repo_name
stringlengths
6
112
path
stringlengths
4
204
copies
stringlengths
1
3
size
stringlengths
4
6
content
stringlengths
714
810k
license
stringclasses
15 values
pydata/xarray
xarray/tests/test_dask.py
1
59200
import operator import pickle import sys from contextlib import suppress from distutils.version import LooseVersion from textwrap import dedent import numpy as np import pandas as pd import pytest import xarray as xr import xarray.ufuncs as xu from xarray import DataArray, Dataset, Variable from xarray.core import duck_array_ops from xarray.testing import assert_chunks_equal from xarray.tests import mock from ..core.duck_array_ops import lazy_array_equiv from . import ( assert_allclose, assert_array_equal, assert_equal, assert_frame_equal, assert_identical, raise_if_dask_computes, requires_pint_0_15, requires_scipy_or_netCDF4, ) from .test_backends import create_tmp_file dask = pytest.importorskip("dask") da = pytest.importorskip("dask.array") dd = pytest.importorskip("dask.dataframe") ON_WINDOWS = sys.platform == "win32" def test_raise_if_dask_computes(): data = da.from_array(np.random.RandomState(0).randn(4, 6), chunks=(2, 2)) with pytest.raises(RuntimeError, match=r"Too many computes"): with raise_if_dask_computes(): data.compute() class DaskTestCase: def assertLazyAnd(self, expected, actual, test): with dask.config.set(scheduler="synchronous"): test(actual, expected) if isinstance(actual, Dataset): for k, v in actual.variables.items(): if k in actual.dims: assert isinstance(v.data, np.ndarray) else: assert isinstance(v.data, da.Array) elif isinstance(actual, DataArray): assert isinstance(actual.data, da.Array) for k, v in actual.coords.items(): if k in actual.dims: assert isinstance(v.data, np.ndarray) else: assert isinstance(v.data, da.Array) elif isinstance(actual, Variable): assert isinstance(actual.data, da.Array) else: assert False class TestVariable(DaskTestCase): def assertLazyAndIdentical(self, expected, actual): self.assertLazyAnd(expected, actual, assert_identical) def assertLazyAndAllClose(self, expected, actual): self.assertLazyAnd(expected, actual, assert_allclose) @pytest.fixture(autouse=True) def setUp(self): self.values = np.random.RandomState(0).randn(4, 6) self.data = da.from_array(self.values, chunks=(2, 2)) self.eager_var = Variable(("x", "y"), self.values) self.lazy_var = Variable(("x", "y"), self.data) def test_basics(self): v = self.lazy_var assert self.data is v.data assert self.data.chunks == v.chunks assert_array_equal(self.values, v) def test_copy(self): self.assertLazyAndIdentical(self.eager_var, self.lazy_var.copy()) self.assertLazyAndIdentical(self.eager_var, self.lazy_var.copy(deep=True)) def test_chunk(self): for chunks, expected in [ ({}, ((2, 2), (2, 2, 2))), (3, ((3, 1), (3, 3))), ({"x": 3, "y": 3}, ((3, 1), (3, 3))), ({"x": 3}, ((3, 1), (2, 2, 2))), ({"x": (3, 1)}, ((3, 1), (2, 2, 2))), ]: rechunked = self.lazy_var.chunk(chunks) assert rechunked.chunks == expected self.assertLazyAndIdentical(self.eager_var, rechunked) def test_indexing(self): u = self.eager_var v = self.lazy_var self.assertLazyAndIdentical(u[0], v[0]) self.assertLazyAndIdentical(u[:1], v[:1]) self.assertLazyAndIdentical(u[[0, 1], [0, 1, 2]], v[[0, 1], [0, 1, 2]]) @pytest.mark.skipif( LooseVersion(dask.__version__) < LooseVersion("2021.04.1"), reason="Requires dask v2021.04.1 or later", ) @pytest.mark.parametrize( "expected_data, index", [ (da.array([99, 2, 3, 4]), 0), (da.array([99, 99, 99, 4]), slice(2, None, -1)), (da.array([99, 99, 3, 99]), [0, -1, 1]), (da.array([99, 99, 99, 4]), np.arange(3)), (da.array([1, 99, 99, 99]), [False, True, True, True]), (da.array([1, 99, 99, 99]), np.arange(4) > 0), (da.array([99, 99, 99, 99]), Variable(("x"), da.array([1, 2, 3, 4])) > 0), ], ) def test_setitem_dask_array(self, expected_data, index): arr = Variable(("x"), da.array([1, 2, 3, 4])) expected = Variable(("x"), expected_data) arr[index] = 99 assert_identical(arr, expected) @pytest.mark.skipif( LooseVersion(dask.__version__) >= LooseVersion("2021.04.1"), reason="Requires dask v2021.04.0 or earlier", ) def test_setitem_dask_array_error(self): with pytest.raises(TypeError, match=r"stored in a dask array"): v = self.lazy_var v[:1] = 0 def test_squeeze(self): u = self.eager_var v = self.lazy_var self.assertLazyAndIdentical(u[0].squeeze(), v[0].squeeze()) def test_equals(self): v = self.lazy_var assert v.equals(v) assert isinstance(v.data, da.Array) assert v.identical(v) assert isinstance(v.data, da.Array) def test_transpose(self): u = self.eager_var v = self.lazy_var self.assertLazyAndIdentical(u.T, v.T) def test_shift(self): u = self.eager_var v = self.lazy_var self.assertLazyAndIdentical(u.shift(x=2), v.shift(x=2)) self.assertLazyAndIdentical(u.shift(x=-2), v.shift(x=-2)) assert v.data.chunks == v.shift(x=1).data.chunks def test_roll(self): u = self.eager_var v = self.lazy_var self.assertLazyAndIdentical(u.roll(x=2), v.roll(x=2)) assert v.data.chunks == v.roll(x=1).data.chunks def test_unary_op(self): u = self.eager_var v = self.lazy_var self.assertLazyAndIdentical(-u, -v) self.assertLazyAndIdentical(abs(u), abs(v)) self.assertLazyAndIdentical(u.round(), v.round()) def test_binary_op(self): u = self.eager_var v = self.lazy_var self.assertLazyAndIdentical(2 * u, 2 * v) self.assertLazyAndIdentical(u + u, v + v) self.assertLazyAndIdentical(u[0] + u, v[0] + v) def test_repr(self): expected = dedent( """\ <xarray.Variable (x: 4, y: 6)> {!r}""".format( self.lazy_var.data ) ) assert expected == repr(self.lazy_var) def test_pickle(self): # Test that pickling/unpickling does not convert the dask # backend to numpy a1 = Variable(["x"], build_dask_array("x")) a1.compute() assert not a1._in_memory assert kernel_call_count == 1 a2 = pickle.loads(pickle.dumps(a1)) assert kernel_call_count == 1 assert_identical(a1, a2) assert not a1._in_memory assert not a2._in_memory def test_reduce(self): u = self.eager_var v = self.lazy_var self.assertLazyAndAllClose(u.mean(), v.mean()) self.assertLazyAndAllClose(u.std(), v.std()) with raise_if_dask_computes(): actual = v.argmax(dim="x") self.assertLazyAndAllClose(u.argmax(dim="x"), actual) with raise_if_dask_computes(): actual = v.argmin(dim="x") self.assertLazyAndAllClose(u.argmin(dim="x"), actual) self.assertLazyAndAllClose((u > 1).any(), (v > 1).any()) self.assertLazyAndAllClose((u < 1).all("x"), (v < 1).all("x")) with pytest.raises(NotImplementedError, match=r"only works along an axis"): v.median() with pytest.raises(NotImplementedError, match=r"only works along an axis"): v.median(v.dims) with raise_if_dask_computes(): v.reduce(duck_array_ops.mean) def test_missing_values(self): values = np.array([0, 1, np.nan, 3]) data = da.from_array(values, chunks=(2,)) eager_var = Variable("x", values) lazy_var = Variable("x", data) self.assertLazyAndIdentical(eager_var, lazy_var.fillna(lazy_var)) self.assertLazyAndIdentical(Variable("x", range(4)), lazy_var.fillna(2)) self.assertLazyAndIdentical(eager_var.count(), lazy_var.count()) def test_concat(self): u = self.eager_var v = self.lazy_var self.assertLazyAndIdentical(u, Variable.concat([v[:2], v[2:]], "x")) self.assertLazyAndIdentical(u[:2], Variable.concat([v[0], v[1]], "x")) self.assertLazyAndIdentical(u[:2], Variable.concat([u[0], v[1]], "x")) self.assertLazyAndIdentical(u[:2], Variable.concat([v[0], u[1]], "x")) self.assertLazyAndIdentical( u[:3], Variable.concat([v[[0, 2]], v[[1]]], "x", positions=[[0, 2], [1]]) ) def test_missing_methods(self): v = self.lazy_var try: v.argsort() except NotImplementedError as err: assert "dask" in str(err) try: v[0].item() except NotImplementedError as err: assert "dask" in str(err) @pytest.mark.filterwarnings("ignore::PendingDeprecationWarning") def test_univariate_ufunc(self): u = self.eager_var v = self.lazy_var self.assertLazyAndAllClose(np.sin(u), xu.sin(v)) @pytest.mark.filterwarnings("ignore::PendingDeprecationWarning") def test_bivariate_ufunc(self): u = self.eager_var v = self.lazy_var self.assertLazyAndAllClose(np.maximum(u, 0), xu.maximum(v, 0)) self.assertLazyAndAllClose(np.maximum(u, 0), xu.maximum(0, v)) def test_compute(self): u = self.eager_var v = self.lazy_var assert dask.is_dask_collection(v) (v2,) = dask.compute(v + 1) assert not dask.is_dask_collection(v2) assert ((u + 1).data == v2.data).all() def test_persist(self): u = self.eager_var v = self.lazy_var + 1 (v2,) = dask.persist(v) assert v is not v2 assert len(v2.__dask_graph__()) < len(v.__dask_graph__()) assert v2.__dask_keys__() == v.__dask_keys__() assert dask.is_dask_collection(v) assert dask.is_dask_collection(v2) self.assertLazyAndAllClose(u + 1, v) self.assertLazyAndAllClose(u + 1, v2) @requires_pint_0_15(reason="Need __dask_tokenize__") def test_tokenize_duck_dask_array(self): import pint unit_registry = pint.UnitRegistry() q = unit_registry.Quantity(self.data, "meter") variable = xr.Variable(("x", "y"), q) token = dask.base.tokenize(variable) post_op = variable + 5 * unit_registry.meter assert dask.base.tokenize(variable) != dask.base.tokenize(post_op) # Immutability check assert dask.base.tokenize(variable) == token class TestDataArrayAndDataset(DaskTestCase): def assertLazyAndIdentical(self, expected, actual): self.assertLazyAnd(expected, actual, assert_identical) def assertLazyAndAllClose(self, expected, actual): self.assertLazyAnd(expected, actual, assert_allclose) def assertLazyAndEqual(self, expected, actual): self.assertLazyAnd(expected, actual, assert_equal) @pytest.fixture(autouse=True) def setUp(self): self.values = np.random.randn(4, 6) self.data = da.from_array(self.values, chunks=(2, 2)) self.eager_array = DataArray( self.values, coords={"x": range(4)}, dims=("x", "y"), name="foo" ) self.lazy_array = DataArray( self.data, coords={"x": range(4)}, dims=("x", "y"), name="foo" ) def test_rechunk(self): chunked = self.eager_array.chunk({"x": 2}).chunk({"y": 2}) assert chunked.chunks == ((2,) * 2, (2,) * 3) self.assertLazyAndIdentical(self.lazy_array, chunked) def test_new_chunk(self): chunked = self.eager_array.chunk() assert chunked.data.name.startswith("xarray-<this-array>") def test_lazy_dataset(self): lazy_ds = Dataset({"foo": (("x", "y"), self.data)}) assert isinstance(lazy_ds.foo.variable.data, da.Array) def test_lazy_array(self): u = self.eager_array v = self.lazy_array self.assertLazyAndAllClose(u, v) self.assertLazyAndAllClose(-u, -v) self.assertLazyAndAllClose(u.T, v.T) self.assertLazyAndAllClose(u.mean(), v.mean()) self.assertLazyAndAllClose(1 + u, 1 + v) actual = xr.concat([v[:2], v[2:]], "x") self.assertLazyAndAllClose(u, actual) def test_compute(self): u = self.eager_array v = self.lazy_array assert dask.is_dask_collection(v) (v2,) = dask.compute(v + 1) assert not dask.is_dask_collection(v2) assert ((u + 1).data == v2.data).all() def test_persist(self): u = self.eager_array v = self.lazy_array + 1 (v2,) = dask.persist(v) assert v is not v2 assert len(v2.__dask_graph__()) < len(v.__dask_graph__()) assert v2.__dask_keys__() == v.__dask_keys__() assert dask.is_dask_collection(v) assert dask.is_dask_collection(v2) self.assertLazyAndAllClose(u + 1, v) self.assertLazyAndAllClose(u + 1, v2) def test_concat_loads_variables(self): # Test that concat() computes not-in-memory variables at most once # and loads them in the output, while leaving the input unaltered. d1 = build_dask_array("d1") c1 = build_dask_array("c1") d2 = build_dask_array("d2") c2 = build_dask_array("c2") d3 = build_dask_array("d3") c3 = build_dask_array("c3") # Note: c is a non-index coord. # Index coords are loaded by IndexVariable.__init__. ds1 = Dataset(data_vars={"d": ("x", d1)}, coords={"c": ("x", c1)}) ds2 = Dataset(data_vars={"d": ("x", d2)}, coords={"c": ("x", c2)}) ds3 = Dataset(data_vars={"d": ("x", d3)}, coords={"c": ("x", c3)}) assert kernel_call_count == 0 out = xr.concat( [ds1, ds2, ds3], dim="n", data_vars="different", coords="different" ) # each kernel is computed exactly once assert kernel_call_count == 6 # variables are loaded in the output assert isinstance(out["d"].data, np.ndarray) assert isinstance(out["c"].data, np.ndarray) out = xr.concat([ds1, ds2, ds3], dim="n", data_vars="all", coords="all") # no extra kernel calls assert kernel_call_count == 6 assert isinstance(out["d"].data, dask.array.Array) assert isinstance(out["c"].data, dask.array.Array) out = xr.concat([ds1, ds2, ds3], dim="n", data_vars=["d"], coords=["c"]) # no extra kernel calls assert kernel_call_count == 6 assert isinstance(out["d"].data, dask.array.Array) assert isinstance(out["c"].data, dask.array.Array) out = xr.concat([ds1, ds2, ds3], dim="n", data_vars=[], coords=[]) # variables are loaded once as we are validing that they're identical assert kernel_call_count == 12 assert isinstance(out["d"].data, np.ndarray) assert isinstance(out["c"].data, np.ndarray) out = xr.concat( [ds1, ds2, ds3], dim="n", data_vars="different", coords="different", compat="identical", ) # compat=identical doesn't do any more kernel calls than compat=equals assert kernel_call_count == 18 assert isinstance(out["d"].data, np.ndarray) assert isinstance(out["c"].data, np.ndarray) # When the test for different turns true halfway through, # stop computing variables as it would not have any benefit ds4 = Dataset(data_vars={"d": ("x", [2.0])}, coords={"c": ("x", [2.0])}) out = xr.concat( [ds1, ds2, ds4, ds3], dim="n", data_vars="different", coords="different" ) # the variables of ds1 and ds2 were computed, but those of ds3 didn't assert kernel_call_count == 22 assert isinstance(out["d"].data, dask.array.Array) assert isinstance(out["c"].data, dask.array.Array) # the data of ds1 and ds2 was loaded into numpy and then # concatenated to the data of ds3. Thus, only ds3 is computed now. out.compute() assert kernel_call_count == 24 # Finally, test that originals are unaltered assert ds1["d"].data is d1 assert ds1["c"].data is c1 assert ds2["d"].data is d2 assert ds2["c"].data is c2 assert ds3["d"].data is d3 assert ds3["c"].data is c3 # now check that concat() is correctly using dask name equality to skip loads out = xr.concat( [ds1, ds1, ds1], dim="n", data_vars="different", coords="different" ) assert kernel_call_count == 24 # variables are not loaded in the output assert isinstance(out["d"].data, dask.array.Array) assert isinstance(out["c"].data, dask.array.Array) out = xr.concat( [ds1, ds1, ds1], dim="n", data_vars=[], coords=[], compat="identical" ) assert kernel_call_count == 24 # variables are not loaded in the output assert isinstance(out["d"].data, dask.array.Array) assert isinstance(out["c"].data, dask.array.Array) out = xr.concat( [ds1, ds2.compute(), ds3], dim="n", data_vars="all", coords="different", compat="identical", ) # c1,c3 must be computed for comparison since c2 is numpy; # d2 is computed too assert kernel_call_count == 28 out = xr.concat( [ds1, ds2.compute(), ds3], dim="n", data_vars="all", coords="all", compat="identical", ) # no extra computes assert kernel_call_count == 30 # Finally, test that originals are unaltered assert ds1["d"].data is d1 assert ds1["c"].data is c1 assert ds2["d"].data is d2 assert ds2["c"].data is c2 assert ds3["d"].data is d3 assert ds3["c"].data is c3 def test_groupby(self): u = self.eager_array v = self.lazy_array expected = u.groupby("x").mean(...) with raise_if_dask_computes(): actual = v.groupby("x").mean(...) self.assertLazyAndAllClose(expected, actual) def test_rolling(self): u = self.eager_array v = self.lazy_array expected = u.rolling(x=2).mean() with raise_if_dask_computes(): actual = v.rolling(x=2).mean() self.assertLazyAndAllClose(expected, actual) def test_groupby_first(self): u = self.eager_array v = self.lazy_array for coords in [u.coords, v.coords]: coords["ab"] = ("x", ["a", "a", "b", "b"]) with pytest.raises(NotImplementedError, match=r"dask"): v.groupby("ab").first() expected = u.groupby("ab").first() with raise_if_dask_computes(): actual = v.groupby("ab").first(skipna=False) self.assertLazyAndAllClose(expected, actual) def test_reindex(self): u = self.eager_array.assign_coords(y=range(6)) v = self.lazy_array.assign_coords(y=range(6)) for kwargs in [ {"x": [2, 3, 4]}, {"x": [1, 100, 2, 101, 3]}, {"x": [2.5, 3, 3.5], "y": [2, 2.5, 3]}, ]: expected = u.reindex(**kwargs) actual = v.reindex(**kwargs) self.assertLazyAndAllClose(expected, actual) def test_to_dataset_roundtrip(self): u = self.eager_array v = self.lazy_array expected = u.assign_coords(x=u["x"]) self.assertLazyAndEqual(expected, v.to_dataset("x").to_array("x")) def test_merge(self): def duplicate_and_merge(array): return xr.merge([array, array.rename("bar")]).to_array() expected = duplicate_and_merge(self.eager_array) actual = duplicate_and_merge(self.lazy_array) self.assertLazyAndEqual(expected, actual) @pytest.mark.filterwarnings("ignore::PendingDeprecationWarning") def test_ufuncs(self): u = self.eager_array v = self.lazy_array self.assertLazyAndAllClose(np.sin(u), xu.sin(v)) def test_where_dispatching(self): a = np.arange(10) b = a > 3 x = da.from_array(a, 5) y = da.from_array(b, 5) expected = DataArray(a).where(b) self.assertLazyAndEqual(expected, DataArray(a).where(y)) self.assertLazyAndEqual(expected, DataArray(x).where(b)) self.assertLazyAndEqual(expected, DataArray(x).where(y)) def test_simultaneous_compute(self): ds = Dataset({"foo": ("x", range(5)), "bar": ("x", range(5))}).chunk() count = [0] def counting_get(*args, **kwargs): count[0] += 1 return dask.get(*args, **kwargs) ds.load(scheduler=counting_get) assert count[0] == 1 def test_stack(self): data = da.random.normal(size=(2, 3, 4), chunks=(1, 3, 4)) arr = DataArray(data, dims=("w", "x", "y")) stacked = arr.stack(z=("x", "y")) z = pd.MultiIndex.from_product([np.arange(3), np.arange(4)], names=["x", "y"]) expected = DataArray(data.reshape(2, -1), {"z": z}, dims=["w", "z"]) assert stacked.data.chunks == expected.data.chunks self.assertLazyAndEqual(expected, stacked) def test_dot(self): eager = self.eager_array.dot(self.eager_array[0]) lazy = self.lazy_array.dot(self.lazy_array[0]) self.assertLazyAndAllClose(eager, lazy) @pytest.mark.skipif(LooseVersion(dask.__version__) >= "2.0", reason="no meta") def test_dataarray_repr_legacy(self): data = build_dask_array("data") nonindex_coord = build_dask_array("coord") a = DataArray(data, dims=["x"], coords={"y": ("x", nonindex_coord)}) expected = dedent( """\ <xarray.DataArray 'data' (x: 1)> {!r} Coordinates: y (x) int64 dask.array<chunksize=(1,), meta=np.ndarray> Dimensions without coordinates: x""".format( data ) ) assert expected == repr(a) assert kernel_call_count == 0 # should not evaluate dask array @pytest.mark.skipif(LooseVersion(dask.__version__) < "2.0", reason="needs meta") def test_dataarray_repr(self): data = build_dask_array("data") nonindex_coord = build_dask_array("coord") a = DataArray(data, dims=["x"], coords={"y": ("x", nonindex_coord)}) expected = dedent( """\ <xarray.DataArray 'data' (x: 1)> {!r} Coordinates: y (x) int64 dask.array<chunksize=(1,), meta=np.ndarray> Dimensions without coordinates: x""".format( data ) ) assert expected == repr(a) assert kernel_call_count == 0 # should not evaluate dask array @pytest.mark.skipif(LooseVersion(dask.__version__) < "2.0", reason="needs meta") def test_dataset_repr(self): data = build_dask_array("data") nonindex_coord = build_dask_array("coord") ds = Dataset(data_vars={"a": ("x", data)}, coords={"y": ("x", nonindex_coord)}) expected = dedent( """\ <xarray.Dataset> Dimensions: (x: 1) Coordinates: y (x) int64 dask.array<chunksize=(1,), meta=np.ndarray> Dimensions without coordinates: x Data variables: a (x) int64 dask.array<chunksize=(1,), meta=np.ndarray>""" ) assert expected == repr(ds) assert kernel_call_count == 0 # should not evaluate dask array def test_dataarray_pickle(self): # Test that pickling/unpickling converts the dask backend # to numpy in neither the data variable nor the non-index coords data = build_dask_array("data") nonindex_coord = build_dask_array("coord") a1 = DataArray(data, dims=["x"], coords={"y": ("x", nonindex_coord)}) a1.compute() assert not a1._in_memory assert not a1.coords["y"]._in_memory assert kernel_call_count == 2 a2 = pickle.loads(pickle.dumps(a1)) assert kernel_call_count == 2 assert_identical(a1, a2) assert not a1._in_memory assert not a2._in_memory assert not a1.coords["y"]._in_memory assert not a2.coords["y"]._in_memory def test_dataset_pickle(self): # Test that pickling/unpickling converts the dask backend # to numpy in neither the data variables nor the non-index coords data = build_dask_array("data") nonindex_coord = build_dask_array("coord") ds1 = Dataset(data_vars={"a": ("x", data)}, coords={"y": ("x", nonindex_coord)}) ds1.compute() assert not ds1["a"]._in_memory assert not ds1["y"]._in_memory assert kernel_call_count == 2 ds2 = pickle.loads(pickle.dumps(ds1)) assert kernel_call_count == 2 assert_identical(ds1, ds2) assert not ds1["a"]._in_memory assert not ds2["a"]._in_memory assert not ds1["y"]._in_memory assert not ds2["y"]._in_memory def test_dataarray_getattr(self): # ipython/jupyter does a long list of getattr() calls to when trying to # represent an object. # Make sure we're not accidentally computing dask variables. data = build_dask_array("data") nonindex_coord = build_dask_array("coord") a = DataArray(data, dims=["x"], coords={"y": ("x", nonindex_coord)}) with suppress(AttributeError): getattr(a, "NOTEXIST") assert kernel_call_count == 0 def test_dataset_getattr(self): # Test that pickling/unpickling converts the dask backend # to numpy in neither the data variables nor the non-index coords data = build_dask_array("data") nonindex_coord = build_dask_array("coord") ds = Dataset(data_vars={"a": ("x", data)}, coords={"y": ("x", nonindex_coord)}) with suppress(AttributeError): getattr(ds, "NOTEXIST") assert kernel_call_count == 0 def test_values(self): # Test that invoking the values property does not convert the dask # backend to numpy a = DataArray([1, 2]).chunk() assert not a._in_memory assert a.values.tolist() == [1, 2] assert not a._in_memory def test_from_dask_variable(self): # Test array creation from Variable with dask backend. # This is used e.g. in broadcast() a = DataArray(self.lazy_array.variable, coords={"x": range(4)}, name="foo") self.assertLazyAndIdentical(self.lazy_array, a) @requires_pint_0_15(reason="Need __dask_tokenize__") def test_tokenize_duck_dask_array(self): import pint unit_registry = pint.UnitRegistry() q = unit_registry.Quantity(self.data, unit_registry.meter) data_array = xr.DataArray( data=q, coords={"x": range(4)}, dims=("x", "y"), name="foo" ) token = dask.base.tokenize(data_array) post_op = data_array + 5 * unit_registry.meter assert dask.base.tokenize(data_array) != dask.base.tokenize(post_op) # Immutability check assert dask.base.tokenize(data_array) == token class TestToDaskDataFrame: def test_to_dask_dataframe(self): # Test conversion of Datasets to dask DataFrames x = np.random.randn(10) y = np.arange(10, dtype="uint8") t = list("abcdefghij") ds = Dataset( {"a": ("t", da.from_array(x, chunks=4)), "b": ("t", y), "t": ("t", t)} ) expected_pd = pd.DataFrame({"a": x, "b": y}, index=pd.Index(t, name="t")) # test if 1-D index is correctly set up expected = dd.from_pandas(expected_pd, chunksize=4) actual = ds.to_dask_dataframe(set_index=True) # test if we have dask dataframes assert isinstance(actual, dd.DataFrame) # use the .equals from pandas to check dataframes are equivalent assert_frame_equal(expected.compute(), actual.compute()) # test if no index is given expected = dd.from_pandas(expected_pd.reset_index(drop=False), chunksize=4) actual = ds.to_dask_dataframe(set_index=False) assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected.compute(), actual.compute()) def test_to_dask_dataframe_2D(self): # Test if 2-D dataset is supplied w = np.random.randn(2, 3) ds = Dataset({"w": (("x", "y"), da.from_array(w, chunks=(1, 2)))}) ds["x"] = ("x", np.array([0, 1], np.int64)) ds["y"] = ("y", list("abc")) # dask dataframes do not (yet) support multiindex, # but when it does, this would be the expected index: exp_index = pd.MultiIndex.from_arrays( [[0, 0, 0, 1, 1, 1], ["a", "b", "c", "a", "b", "c"]], names=["x", "y"] ) expected = pd.DataFrame({"w": w.reshape(-1)}, index=exp_index) # so for now, reset the index expected = expected.reset_index(drop=False) actual = ds.to_dask_dataframe(set_index=False) assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected, actual.compute()) @pytest.mark.xfail(raises=NotImplementedError) def test_to_dask_dataframe_2D_set_index(self): # This will fail until dask implements MultiIndex support w = da.from_array(np.random.randn(2, 3), chunks=(1, 2)) ds = Dataset({"w": (("x", "y"), w)}) ds["x"] = ("x", np.array([0, 1], np.int64)) ds["y"] = ("y", list("abc")) expected = ds.compute().to_dataframe() actual = ds.to_dask_dataframe(set_index=True) assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected, actual.compute()) def test_to_dask_dataframe_coordinates(self): # Test if coordinate is also a dask array x = np.random.randn(10) t = np.arange(10) * 2 ds = Dataset( { "a": ("t", da.from_array(x, chunks=4)), "t": ("t", da.from_array(t, chunks=4)), } ) expected_pd = pd.DataFrame({"a": x}, index=pd.Index(t, name="t")) expected = dd.from_pandas(expected_pd, chunksize=4) actual = ds.to_dask_dataframe(set_index=True) assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected.compute(), actual.compute()) def test_to_dask_dataframe_not_daskarray(self): # Test if DataArray is not a dask array x = np.random.randn(10) y = np.arange(10, dtype="uint8") t = list("abcdefghij") ds = Dataset({"a": ("t", x), "b": ("t", y), "t": ("t", t)}) expected = pd.DataFrame({"a": x, "b": y}, index=pd.Index(t, name="t")) actual = ds.to_dask_dataframe(set_index=True) assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected, actual.compute()) def test_to_dask_dataframe_no_coordinate(self): x = da.from_array(np.random.randn(10), chunks=4) ds = Dataset({"x": ("dim_0", x)}) expected = ds.compute().to_dataframe().reset_index() actual = ds.to_dask_dataframe() assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected, actual.compute()) expected = ds.compute().to_dataframe() actual = ds.to_dask_dataframe(set_index=True) assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected, actual.compute()) def test_to_dask_dataframe_dim_order(self): values = np.array([[1, 2], [3, 4]], dtype=np.int64) ds = Dataset({"w": (("x", "y"), values)}).chunk(1) expected = ds["w"].to_series().reset_index() actual = ds.to_dask_dataframe(dim_order=["x", "y"]) assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected, actual.compute()) expected = ds["w"].T.to_series().reset_index() actual = ds.to_dask_dataframe(dim_order=["y", "x"]) assert isinstance(actual, dd.DataFrame) assert_frame_equal(expected, actual.compute()) with pytest.raises(ValueError, match=r"does not match the set of dimensions"): ds.to_dask_dataframe(dim_order=["x"]) @pytest.mark.parametrize("method", ["load", "compute"]) def test_dask_kwargs_variable(method): x = Variable("y", da.from_array(np.arange(3), chunks=(2,))) # args should be passed on to da.Array.compute() with mock.patch.object( da.Array, "compute", return_value=np.arange(3) ) as mock_compute: getattr(x, method)(foo="bar") mock_compute.assert_called_with(foo="bar") @pytest.mark.parametrize("method", ["load", "compute", "persist"]) def test_dask_kwargs_dataarray(method): data = da.from_array(np.arange(3), chunks=(2,)) x = DataArray(data) if method in ["load", "compute"]: dask_func = "dask.array.compute" else: dask_func = "dask.persist" # args should be passed on to "dask_func" with mock.patch(dask_func) as mock_func: getattr(x, method)(foo="bar") mock_func.assert_called_with(data, foo="bar") @pytest.mark.parametrize("method", ["load", "compute", "persist"]) def test_dask_kwargs_dataset(method): data = da.from_array(np.arange(3), chunks=(2,)) x = Dataset({"x": (("y"), data)}) if method in ["load", "compute"]: dask_func = "dask.array.compute" else: dask_func = "dask.persist" # args should be passed on to "dask_func" with mock.patch(dask_func) as mock_func: getattr(x, method)(foo="bar") mock_func.assert_called_with(data, foo="bar") kernel_call_count = 0 def kernel(name): """Dask kernel to test pickling/unpickling and __repr__. Must be global to make it pickleable. """ global kernel_call_count kernel_call_count += 1 return np.ones(1, dtype=np.int64) def build_dask_array(name): global kernel_call_count kernel_call_count = 0 return dask.array.Array( dask={(name, 0): (kernel, name)}, name=name, chunks=((1,),), dtype=np.int64 ) @pytest.mark.parametrize( "persist", [lambda x: x.persist(), lambda x: dask.persist(x)[0]] ) def test_persist_Dataset(persist): ds = Dataset({"foo": ("x", range(5)), "bar": ("x", range(5))}).chunk() ds = ds + 1 n = len(ds.foo.data.dask) ds2 = persist(ds) assert len(ds2.foo.data.dask) == 1 assert len(ds.foo.data.dask) == n # doesn't mutate in place @pytest.mark.parametrize( "persist", [lambda x: x.persist(), lambda x: dask.persist(x)[0]] ) def test_persist_DataArray(persist): x = da.arange(10, chunks=(5,)) y = DataArray(x) z = y + 1 n = len(z.data.dask) zz = persist(z) assert len(z.data.dask) == n assert len(zz.data.dask) == zz.data.npartitions def test_dataarray_with_dask_coords(): import toolz x = xr.Variable("x", da.arange(8, chunks=(4,))) y = xr.Variable("y", da.arange(8, chunks=(4,)) * 2) data = da.random.random((8, 8), chunks=(4, 4)) + 1 array = xr.DataArray(data, dims=["x", "y"]) array.coords["xx"] = x array.coords["yy"] = y assert dict(array.__dask_graph__()) == toolz.merge( data.__dask_graph__(), x.__dask_graph__(), y.__dask_graph__() ) (array2,) = dask.compute(array) assert not dask.is_dask_collection(array2) assert all(isinstance(v._variable.data, np.ndarray) for v in array2.coords.values()) def test_basic_compute(): ds = Dataset({"foo": ("x", range(5)), "bar": ("x", range(5))}).chunk({"x": 2}) for get in [dask.threaded.get, dask.multiprocessing.get, dask.local.get_sync, None]: with dask.config.set(scheduler=get): ds.compute() ds.foo.compute() ds.foo.variable.compute() def test_dask_layers_and_dependencies(): ds = Dataset({"foo": ("x", range(5)), "bar": ("x", range(5))}).chunk() x = dask.delayed(ds) assert set(x.__dask_graph__().dependencies).issuperset( ds.__dask_graph__().dependencies ) assert set(x.foo.__dask_graph__().dependencies).issuperset( ds.__dask_graph__().dependencies ) def make_da(): da = xr.DataArray( np.ones((10, 20)), dims=["x", "y"], coords={"x": np.arange(10), "y": np.arange(100, 120)}, name="a", ).chunk({"x": 4, "y": 5}) da.x.attrs["long_name"] = "x" da.attrs["test"] = "test" da.coords["c2"] = 0.5 da.coords["ndcoord"] = da.x * 2 da.coords["cxy"] = (da.x * da.y).chunk({"x": 4, "y": 5}) return da def make_ds(): map_ds = xr.Dataset() map_ds["a"] = make_da() map_ds["b"] = map_ds.a + 50 map_ds["c"] = map_ds.x + 20 map_ds = map_ds.chunk({"x": 4, "y": 5}) map_ds["d"] = ("z", [1, 1, 1, 1]) map_ds["z"] = [0, 1, 2, 3] map_ds["e"] = map_ds.x + map_ds.y map_ds.coords["c1"] = 0.5 map_ds.coords["cx"] = ("x", np.arange(len(map_ds.x))) map_ds.coords["cx"].attrs["test2"] = "test2" map_ds.attrs["test"] = "test" map_ds.coords["xx"] = map_ds["a"] * map_ds.y map_ds.x.attrs["long_name"] = "x" map_ds.y.attrs["long_name"] = "y" return map_ds # fixtures cannot be used in parametrize statements # instead use this workaround # https://docs.pytest.org/en/latest/deprecations.html#calling-fixtures-directly @pytest.fixture def map_da(): return make_da() @pytest.fixture def map_ds(): return make_ds() def test_unify_chunks(map_ds): ds_copy = map_ds.copy() ds_copy["cxy"] = ds_copy.cxy.chunk({"y": 10}) with pytest.raises(ValueError, match=r"inconsistent chunks"): ds_copy.chunks expected_chunks = {"x": (4, 4, 2), "y": (5, 5, 5, 5)} with raise_if_dask_computes(): actual_chunks = ds_copy.unify_chunks().chunks assert actual_chunks == expected_chunks assert_identical(map_ds, ds_copy.unify_chunks()) out_a, out_b = xr.unify_chunks(ds_copy.cxy, ds_copy.drop_vars("cxy")) assert out_a.chunks == ((4, 4, 2), (5, 5, 5, 5)) assert out_b.chunks == expected_chunks # Test unordered dims da = ds_copy["cxy"] out_a, out_b = xr.unify_chunks(da.chunk({"x": -1}), da.T.chunk({"y": -1})) assert out_a.chunks == ((4, 4, 2), (5, 5, 5, 5)) assert out_b.chunks == ((5, 5, 5, 5), (4, 4, 2)) # Test mismatch with pytest.raises(ValueError, match=r"Dimension 'x' size mismatch: 10 != 2"): xr.unify_chunks(da, da.isel(x=slice(2))) @pytest.mark.parametrize("obj", [make_ds(), make_da()]) @pytest.mark.parametrize( "transform", [lambda x: x.compute(), lambda x: x.unify_chunks()] ) def test_unify_chunks_shallow_copy(obj, transform): obj = transform(obj) unified = obj.unify_chunks() assert_identical(obj, unified) and obj is not obj.unify_chunks() @pytest.mark.parametrize("obj", [make_da()]) def test_auto_chunk_da(obj): actual = obj.chunk("auto").data expected = obj.data.rechunk("auto") np.testing.assert_array_equal(actual, expected) assert actual.chunks == expected.chunks def test_map_blocks_error(map_da, map_ds): def bad_func(darray): return (darray * darray.x + 5 * darray.y)[:1, :1] with pytest.raises(ValueError, match=r"Received dimension 'x' of length 1"): xr.map_blocks(bad_func, map_da).compute() def returns_numpy(darray): return (darray * darray.x + 5 * darray.y).values with pytest.raises(TypeError, match=r"Function must return an xarray DataArray"): xr.map_blocks(returns_numpy, map_da) with pytest.raises(TypeError, match=r"args must be"): xr.map_blocks(operator.add, map_da, args=10) with pytest.raises(TypeError, match=r"kwargs must be"): xr.map_blocks(operator.add, map_da, args=[10], kwargs=[20]) def really_bad_func(darray): raise ValueError("couldn't do anything.") with pytest.raises(Exception, match=r"Cannot infer"): xr.map_blocks(really_bad_func, map_da) ds_copy = map_ds.copy() ds_copy["cxy"] = ds_copy.cxy.chunk({"y": 10}) with pytest.raises(ValueError, match=r"inconsistent chunks"): xr.map_blocks(bad_func, ds_copy) with pytest.raises(TypeError, match=r"Cannot pass dask collections"): xr.map_blocks(bad_func, map_da, kwargs=dict(a=map_da.chunk())) @pytest.mark.parametrize("obj", [make_da(), make_ds()]) def test_map_blocks(obj): def func(obj): result = obj + obj.x + 5 * obj.y return result with raise_if_dask_computes(): actual = xr.map_blocks(func, obj) expected = func(obj) assert_chunks_equal(expected.chunk(), actual) assert_identical(actual, expected) @pytest.mark.parametrize("obj", [make_da(), make_ds()]) def test_map_blocks_convert_args_to_list(obj): expected = obj + 10 with raise_if_dask_computes(): actual = xr.map_blocks(operator.add, obj, [10]) assert_chunks_equal(expected.chunk(), actual) assert_identical(actual, expected) def test_map_blocks_dask_args(): da1 = xr.DataArray( np.ones((10, 20)), dims=["x", "y"], coords={"x": np.arange(10), "y": np.arange(20)}, ).chunk({"x": 5, "y": 4}) # check that block shapes are the same def sumda(da1, da2): assert da1.shape == da2.shape return da1 + da2 da2 = da1 + 1 with raise_if_dask_computes(): mapped = xr.map_blocks(sumda, da1, args=[da2]) xr.testing.assert_equal(da1 + da2, mapped) # one dimension in common da2 = (da1 + 1).isel(x=1, drop=True) with raise_if_dask_computes(): mapped = xr.map_blocks(operator.add, da1, args=[da2]) xr.testing.assert_equal(da1 + da2, mapped) # test that everything works when dimension names are different da2 = (da1 + 1).isel(x=1, drop=True).rename({"y": "k"}) with raise_if_dask_computes(): mapped = xr.map_blocks(operator.add, da1, args=[da2]) xr.testing.assert_equal(da1 + da2, mapped) with pytest.raises(ValueError, match=r"Chunk sizes along dimension 'x'"): xr.map_blocks(operator.add, da1, args=[da1.chunk({"x": 1})]) with pytest.raises(ValueError, match=r"indexes along dimension 'x' are not equal"): xr.map_blocks(operator.add, da1, args=[da1.reindex(x=np.arange(20))]) # reduction da1 = da1.chunk({"x": -1}) da2 = da1 + 1 with raise_if_dask_computes(): mapped = xr.map_blocks(lambda a, b: (a + b).sum("x"), da1, args=[da2]) xr.testing.assert_equal((da1 + da2).sum("x"), mapped) # reduction with template da1 = da1.chunk({"x": -1}) da2 = da1 + 1 with raise_if_dask_computes(): mapped = xr.map_blocks( lambda a, b: (a + b).sum("x"), da1, args=[da2], template=da1.sum("x") ) xr.testing.assert_equal((da1 + da2).sum("x"), mapped) @pytest.mark.parametrize("obj", [make_da(), make_ds()]) def test_map_blocks_add_attrs(obj): def add_attrs(obj): obj = obj.copy(deep=True) obj.attrs["new"] = "new" obj.cxy.attrs["new2"] = "new2" return obj expected = add_attrs(obj) with raise_if_dask_computes(): actual = xr.map_blocks(add_attrs, obj) assert_identical(actual, expected) # when template is specified, attrs are copied from template, not set by function with raise_if_dask_computes(): actual = xr.map_blocks(add_attrs, obj, template=obj) assert_identical(actual, obj) def test_map_blocks_change_name(map_da): def change_name(obj): obj = obj.copy(deep=True) obj.name = "new" return obj expected = change_name(map_da) with raise_if_dask_computes(): actual = xr.map_blocks(change_name, map_da) assert_identical(actual, expected) @pytest.mark.parametrize("obj", [make_da(), make_ds()]) def test_map_blocks_kwargs(obj): expected = xr.full_like(obj, fill_value=np.nan) with raise_if_dask_computes(): actual = xr.map_blocks(xr.full_like, obj, kwargs=dict(fill_value=np.nan)) assert_chunks_equal(expected.chunk(), actual) assert_identical(actual, expected) def test_map_blocks_to_array(map_ds): with raise_if_dask_computes(): actual = xr.map_blocks(lambda x: x.to_array(), map_ds) # to_array does not preserve name, so cannot use assert_identical assert_equal(actual, map_ds.to_array()) @pytest.mark.parametrize( "func", [ lambda x: x, lambda x: x.to_dataset(), lambda x: x.drop_vars("x"), lambda x: x.expand_dims(k=[1, 2, 3]), lambda x: x.expand_dims(k=3), lambda x: x.assign_coords(new_coord=("y", x.y.data * 2)), lambda x: x.astype(np.int32), lambda x: x.x, ], ) def test_map_blocks_da_transformations(func, map_da): with raise_if_dask_computes(): actual = xr.map_blocks(func, map_da) assert_identical(actual, func(map_da)) @pytest.mark.parametrize( "func", [ lambda x: x, lambda x: x.drop_vars("cxy"), lambda x: x.drop_vars("a"), lambda x: x.drop_vars("x"), lambda x: x.expand_dims(k=[1, 2, 3]), lambda x: x.expand_dims(k=3), lambda x: x.rename({"a": "new1", "b": "new2"}), lambda x: x.x, ], ) def test_map_blocks_ds_transformations(func, map_ds): with raise_if_dask_computes(): actual = xr.map_blocks(func, map_ds) assert_identical(actual, func(map_ds)) @pytest.mark.parametrize("obj", [make_da(), make_ds()]) def test_map_blocks_da_ds_with_template(obj): func = lambda x: x.isel(x=[1]) template = obj.isel(x=[1, 5, 9]) with raise_if_dask_computes(): actual = xr.map_blocks(func, obj, template=template) assert_identical(actual, template) with raise_if_dask_computes(): actual = obj.map_blocks(func, template=template) assert_identical(actual, template) def test_map_blocks_template_convert_object(): da = make_da() func = lambda x: x.to_dataset().isel(x=[1]) template = da.to_dataset().isel(x=[1, 5, 9]) with raise_if_dask_computes(): actual = xr.map_blocks(func, da, template=template) assert_identical(actual, template) ds = da.to_dataset() func = lambda x: x.to_array().isel(x=[1]) template = ds.to_array().isel(x=[1, 5, 9]) with raise_if_dask_computes(): actual = xr.map_blocks(func, ds, template=template) assert_identical(actual, template) @pytest.mark.parametrize("obj", [make_da(), make_ds()]) def test_map_blocks_errors_bad_template(obj): with pytest.raises(ValueError, match=r"unexpected coordinate variables"): xr.map_blocks(lambda x: x.assign_coords(a=10), obj, template=obj).compute() with pytest.raises(ValueError, match=r"does not contain coordinate variables"): xr.map_blocks(lambda x: x.drop_vars("cxy"), obj, template=obj).compute() with pytest.raises(ValueError, match=r"Dimensions {'x'} missing"): xr.map_blocks(lambda x: x.isel(x=1), obj, template=obj).compute() with pytest.raises(ValueError, match=r"Received dimension 'x' of length 1"): xr.map_blocks(lambda x: x.isel(x=[1]), obj, template=obj).compute() with pytest.raises(TypeError, match=r"must be a DataArray"): xr.map_blocks(lambda x: x.isel(x=[1]), obj, template=(obj,)).compute() with pytest.raises(ValueError, match=r"map_blocks requires that one block"): xr.map_blocks( lambda x: x.isel(x=[1]).assign_coords(x=10), obj, template=obj.isel(x=[1]) ).compute() with pytest.raises(ValueError, match=r"Expected index 'x' to be"): xr.map_blocks( lambda a: a.isel(x=[1]).assign_coords(x=[120]), # assign bad index values obj, template=obj.isel(x=[1, 5, 9]), ).compute() def test_map_blocks_errors_bad_template_2(map_ds): with pytest.raises(ValueError, match=r"unexpected data variables {'xyz'}"): xr.map_blocks(lambda x: x.assign(xyz=1), map_ds, template=map_ds).compute() @pytest.mark.parametrize("obj", [make_da(), make_ds()]) def test_map_blocks_object_method(obj): def func(obj): result = obj + obj.x + 5 * obj.y return result with raise_if_dask_computes(): expected = xr.map_blocks(func, obj) actual = obj.map_blocks(func) assert_identical(expected, actual) def test_map_blocks_hlg_layers(): # regression test for #3599 ds = xr.Dataset( { "x": (("a",), dask.array.ones(10, chunks=(5,))), "z": (("b",), dask.array.ones(10, chunks=(5,))), } ) mapped = ds.map_blocks(lambda x: x) xr.testing.assert_equal(mapped, ds) def test_make_meta(map_ds): from ..core.parallel import make_meta meta = make_meta(map_ds) for variable in map_ds._coord_names: assert variable in meta._coord_names assert meta.coords[variable].shape == (0,) * meta.coords[variable].ndim for variable in map_ds.data_vars: assert variable in meta.data_vars assert meta.data_vars[variable].shape == (0,) * meta.data_vars[variable].ndim def test_identical_coords_no_computes(): lons2 = xr.DataArray(da.zeros((10, 10), chunks=2), dims=("y", "x")) a = xr.DataArray( da.zeros((10, 10), chunks=2), dims=("y", "x"), coords={"lons": lons2} ) b = xr.DataArray( da.zeros((10, 10), chunks=2), dims=("y", "x"), coords={"lons": lons2} ) with raise_if_dask_computes(): c = a + b assert_identical(c, a) @pytest.mark.parametrize( "obj", [make_da(), make_da().compute(), make_ds(), make_ds().compute()] ) @pytest.mark.parametrize( "transform", [ lambda x: x.reset_coords(), lambda x: x.reset_coords(drop=True), lambda x: x.isel(x=1), lambda x: x.attrs.update(new_attrs=1), lambda x: x.assign_coords(cxy=1), lambda x: x.rename({"x": "xnew"}), lambda x: x.rename({"cxy": "cxynew"}), ], ) def test_token_changes_on_transform(obj, transform): with raise_if_dask_computes(): assert dask.base.tokenize(obj) != dask.base.tokenize(transform(obj)) @pytest.mark.parametrize( "obj", [make_da(), make_da().compute(), make_ds(), make_ds().compute()] ) def test_token_changes_when_data_changes(obj): with raise_if_dask_computes(): t1 = dask.base.tokenize(obj) # Change data_var if isinstance(obj, DataArray): obj *= 2 else: obj["a"] *= 2 with raise_if_dask_computes(): t2 = dask.base.tokenize(obj) assert t2 != t1 # Change non-index coord obj.coords["ndcoord"] *= 2 with raise_if_dask_computes(): t3 = dask.base.tokenize(obj) assert t3 != t2 # Change IndexVariable obj = obj.assign_coords(x=obj.x * 2) with raise_if_dask_computes(): t4 = dask.base.tokenize(obj) assert t4 != t3 @pytest.mark.parametrize("obj", [make_da().compute(), make_ds().compute()]) def test_token_changes_when_buffer_changes(obj): with raise_if_dask_computes(): t1 = dask.base.tokenize(obj) if isinstance(obj, DataArray): obj[0, 0] = 123 else: obj["a"][0, 0] = 123 with raise_if_dask_computes(): t2 = dask.base.tokenize(obj) assert t2 != t1 obj.coords["ndcoord"][0] = 123 with raise_if_dask_computes(): t3 = dask.base.tokenize(obj) assert t3 != t2 @pytest.mark.parametrize( "transform", [lambda x: x, lambda x: x.copy(deep=False), lambda x: x.copy(deep=True)], ) @pytest.mark.parametrize("obj", [make_da(), make_ds(), make_ds().variables["a"]]) def test_token_identical(obj, transform): with raise_if_dask_computes(): assert dask.base.tokenize(obj) == dask.base.tokenize(transform(obj)) assert dask.base.tokenize(obj.compute()) == dask.base.tokenize( transform(obj.compute()) ) def test_recursive_token(): """Test that tokenization is invoked recursively, and doesn't just rely on the output of str() """ a = np.ones(10000) b = np.ones(10000) b[5000] = 2 assert str(a) == str(b) assert dask.base.tokenize(a) != dask.base.tokenize(b) # Test DataArray and Variable da_a = DataArray(a) da_b = DataArray(b) assert dask.base.tokenize(da_a) != dask.base.tokenize(da_b) # Test Dataset ds_a = da_a.to_dataset(name="x") ds_b = da_b.to_dataset(name="x") assert dask.base.tokenize(ds_a) != dask.base.tokenize(ds_b) # Test IndexVariable da_a = DataArray(a, dims=["x"], coords={"x": a}) da_b = DataArray(a, dims=["x"], coords={"x": b}) assert dask.base.tokenize(da_a) != dask.base.tokenize(da_b) @requires_scipy_or_netCDF4 def test_normalize_token_with_backend(map_ds): with create_tmp_file(allow_cleanup_failure=ON_WINDOWS) as tmp_file: map_ds.to_netcdf(tmp_file) read = xr.open_dataset(tmp_file) assert not dask.base.tokenize(map_ds) == dask.base.tokenize(read) read.close() @pytest.mark.parametrize( "compat", ["broadcast_equals", "equals", "identical", "no_conflicts"] ) def test_lazy_array_equiv_variables(compat): var1 = xr.Variable(("y", "x"), da.zeros((10, 10), chunks=2)) var2 = xr.Variable(("y", "x"), da.zeros((10, 10), chunks=2)) var3 = xr.Variable(("y", "x"), da.zeros((20, 10), chunks=2)) with raise_if_dask_computes(): assert getattr(var1, compat)(var2, equiv=lazy_array_equiv) # values are actually equal, but we don't know that till we compute, return None with raise_if_dask_computes(): assert getattr(var1, compat)(var2 / 2, equiv=lazy_array_equiv) is None # shapes are not equal, return False without computes with raise_if_dask_computes(): assert getattr(var1, compat)(var3, equiv=lazy_array_equiv) is False # if one or both arrays are numpy, return None assert getattr(var1, compat)(var2.compute(), equiv=lazy_array_equiv) is None assert ( getattr(var1.compute(), compat)(var2.compute(), equiv=lazy_array_equiv) is None ) with raise_if_dask_computes(): assert getattr(var1, compat)(var2.transpose("y", "x")) @pytest.mark.parametrize( "compat", ["broadcast_equals", "equals", "identical", "no_conflicts"] ) def test_lazy_array_equiv_merge(compat): da1 = xr.DataArray(da.zeros((10, 10), chunks=2), dims=("y", "x")) da2 = xr.DataArray(da.zeros((10, 10), chunks=2), dims=("y", "x")) da3 = xr.DataArray(da.ones((20, 10), chunks=2), dims=("y", "x")) with raise_if_dask_computes(): xr.merge([da1, da2], compat=compat) # shapes are not equal; no computes necessary with raise_if_dask_computes(max_computes=0): with pytest.raises(ValueError): xr.merge([da1, da3], compat=compat) with raise_if_dask_computes(max_computes=2): xr.merge([da1, da2 / 2], compat=compat) @pytest.mark.filterwarnings("ignore::FutureWarning") # transpose_coords @pytest.mark.parametrize("obj", [make_da(), make_ds()]) @pytest.mark.parametrize( "transform", [ lambda a: a.assign_attrs(new_attr="anew"), lambda a: a.assign_coords(cxy=a.cxy), lambda a: a.copy(), lambda a: a.isel(x=np.arange(a.sizes["x"])), lambda a: a.isel(x=slice(None)), lambda a: a.loc[dict(x=slice(None))], lambda a: a.loc[dict(x=np.arange(a.sizes["x"]))], lambda a: a.loc[dict(x=a.x)], lambda a: a.sel(x=a.x), lambda a: a.sel(x=a.x.values), lambda a: a.transpose(...), lambda a: a.squeeze(), # no dimensions to squeeze lambda a: a.sortby("x"), # "x" is already sorted lambda a: a.reindex(x=a.x), lambda a: a.reindex_like(a), lambda a: a.rename({"cxy": "cnew"}).rename({"cnew": "cxy"}), lambda a: a.pipe(lambda x: x), lambda a: xr.align(a, xr.zeros_like(a))[0], # assign # swap_dims # set_index / reset_index ], ) def test_transforms_pass_lazy_array_equiv(obj, transform): with raise_if_dask_computes(): assert_equal(obj, transform(obj)) def test_more_transforms_pass_lazy_array_equiv(map_da, map_ds): with raise_if_dask_computes(): assert_equal(map_ds.cxy.broadcast_like(map_ds.cxy), map_ds.cxy) assert_equal(xr.broadcast(map_ds.cxy, map_ds.cxy)[0], map_ds.cxy) assert_equal(map_ds.map(lambda x: x), map_ds) assert_equal(map_ds.set_coords("a").reset_coords("a"), map_ds) assert_equal(map_ds.update({"a": map_ds.a}), map_ds) # fails because of index error # assert_equal( # map_ds.rename_dims({"x": "xnew"}).rename_dims({"xnew": "x"}), map_ds # ) assert_equal( map_ds.rename_vars({"cxy": "cnew"}).rename_vars({"cnew": "cxy"}), map_ds ) assert_equal(map_da._from_temp_dataset(map_da._to_temp_dataset()), map_da) assert_equal(map_da.astype(map_da.dtype), map_da) assert_equal(map_da.transpose("y", "x", transpose_coords=False).cxy, map_da.cxy) def test_optimize(): # https://github.com/pydata/xarray/issues/3698 a = dask.array.ones((10, 4), chunks=(5, 2)) arr = xr.DataArray(a).chunk(5) (arr2,) = dask.optimize(arr) arr2.compute() # The graph_manipulation module is in dask since 2021.2 but it became usable with # xarray only since 2021.3 @pytest.mark.skipif(LooseVersion(dask.__version__) <= "2021.02.0", reason="new module") def test_graph_manipulation(): """dask.graph_manipulation passes an optional parameter, "rename", to the rebuilder function returned by __dask_postperist__; also, the dsk passed to the rebuilder is a HighLevelGraph whereas with dask.persist() and dask.optimize() it's a plain dict. """ import dask.graph_manipulation as gm v = Variable(["x"], [1, 2]).chunk(-1).chunk(1) * 2 da = DataArray(v) ds = Dataset({"d1": v[0], "d2": v[1], "d3": ("x", [3, 4])}) v2, da2, ds2 = gm.clone(v, da, ds) assert_equal(v2, v) assert_equal(da2, da) assert_equal(ds2, ds) for a, b in ((v, v2), (da, da2), (ds, ds2)): assert a.__dask_layers__() != b.__dask_layers__() assert len(a.__dask_layers__()) == len(b.__dask_layers__()) assert a.__dask_graph__().keys() != b.__dask_graph__().keys() assert len(a.__dask_graph__()) == len(b.__dask_graph__()) assert a.__dask_graph__().layers.keys() != b.__dask_graph__().layers.keys() assert len(a.__dask_graph__().layers) == len(b.__dask_graph__().layers) # Above we performed a slice operation; adding the two slices back together creates # a diamond-shaped dependency graph, which in turn will trigger a collision in layer # names if we were to use HighLevelGraph.cull() instead of # HighLevelGraph.cull_layers() in Dataset.__dask_postpersist__(). assert_equal(ds2.d1 + ds2.d2, ds.d1 + ds.d2)
apache-2.0
stscieisenhamer/glue
glue/viewers/image/layer_artist.py
1
13979
from __future__ import absolute_import, division, print_function import uuid import weakref import numpy as np from glue.utils import defer_draw from glue.viewers.image.state import ImageLayerState, ImageSubsetLayerState from glue.viewers.matplotlib.layer_artist import MatplotlibLayerArtist from glue.core.exceptions import IncompatibleAttribute from glue.utils import color2rgb from glue.core.link_manager import is_equivalent_cid from glue.core import Data, HubListener from glue.core.message import ComponentsChangedMessage from glue.external.modest_image import imshow class BaseImageLayerArtist(MatplotlibLayerArtist, HubListener): def __init__(self, axes, viewer_state, layer_state=None, layer=None): super(BaseImageLayerArtist, self).__init__(axes, viewer_state, layer_state=layer_state, layer=layer) self.reset_cache() # Watch for changes in the viewer state which would require the # layers to be redrawn self._viewer_state.add_global_callback(self._update_image) self.state.add_global_callback(self._update_image) self.layer.hub.subscribe(self, ComponentsChangedMessage, handler=self._update_compatibility, filter=self._is_data_object) self._update_compatibility() def _is_data_object(self, message): if isinstance(self.layer, Data): return message.sender is self.layer else: return message.sender is self.layer.data def reset_cache(self): self._last_viewer_state = {} self._last_layer_state = {} def _update_image(self, force=False, **kwargs): raise NotImplementedError() @defer_draw def _update_compatibility(self, *args, **kwargs): """ Determine compatibility of data with reference data. For the data to be compatible with the reference data, the number of dimensions has to match and the pixel component IDs have to be equivalent. """ if self._viewer_state.reference_data is None: self._compatible_with_reference_data = False self.disable('No reference data defined') return if self.layer is self._viewer_state.reference_data: self._compatible_with_reference_data = True self.enable() return # Check whether the pixel component IDs of the dataset are equivalent # to that of the reference dataset. In future this is where we could # allow for these to be different and implement reprojection. if self.layer.ndim != self._viewer_state.reference_data.ndim: self._compatible_with_reference_data = False self.disable('Data dimensions do not match reference data') return # Determine whether pixel component IDs are equivalent pids = self.layer.pixel_component_ids pids_ref = self._viewer_state.reference_data.pixel_component_ids if isinstance(self.layer, Data): data = self.layer else: data = self.layer.data for i in range(data.ndim): if not is_equivalent_cid(data, pids[i], pids_ref[i]): self._compatible_with_reference_data = False self.disable('Pixel component IDs do not match. You can try ' 'fixing this by linking the pixel component IDs ' 'of this dataset with those of the reference ' 'dataset.') return self._compatible_with_reference_data = True self.enable() class ImageLayerArtist(BaseImageLayerArtist): _layer_state_cls = ImageLayerState def __init__(self, axes, viewer_state, layer_state=None, layer=None): super(ImageLayerArtist, self).__init__(axes, viewer_state, layer_state=layer_state, layer=layer) # We use a custom object to deal with the compositing of images, and we # store it as a private attribute of the axes to make sure it is # accessible for all layer artists. self.uuid = str(uuid.uuid4()) self.composite = self.axes._composite self.composite.allocate(self.uuid) self.composite.set(self.uuid, array=self.get_image_data, shape=self.get_image_shape) self.composite_image = self.axes._composite_image def get_layer_color(self): if self._viewer_state.color_mode == 'One color per layer': return self.state.color else: return self.state.cmap def enable(self): if hasattr(self, 'composite_image'): self.composite_image.invalidate_cache() super(ImageLayerArtist, self).enable() def remove(self): super(ImageLayerArtist, self).remove() self.composite.deallocate(self.uuid) def get_image_shape(self): if not self._compatible_with_reference_data: return None if self._viewer_state.x_att is None or self._viewer_state.y_att is None: return None x_axis = self._viewer_state.x_att.axis y_axis = self._viewer_state.y_att.axis full_shape = self.layer.shape return full_shape[y_axis], full_shape[x_axis] def get_image_data(self, view=None): if not self._compatible_with_reference_data: return None try: image = self.state.get_sliced_data(view=view) except (IncompatibleAttribute, IndexError): # The following includes a call to self.clear() self.disable_invalid_attributes(self.state.attribute) return None else: self.enable() return image def _update_image_data(self): self.composite_image.invalidate_cache() self.redraw() @defer_draw def _update_visual_attributes(self): if not self.enabled: return if self._viewer_state.color_mode == 'Colormaps': color = self.state.cmap else: color = self.state.color self.composite.set(self.uuid, clim=(self.state.v_min, self.state.v_max), visible=self.state.visible, zorder=self.state.zorder, color=color, contrast=self.state.contrast, bias=self.state.bias, alpha=self.state.alpha, stretch=self.state.stretch) self.composite_image.invalidate_cache() self.redraw() @defer_draw def _update_image(self, force=False, **kwargs): if self.state.attribute is None or self.state.layer is None: return # Figure out which attributes are different from before. Ideally we shouldn't # need this but currently this method is called multiple times if an # attribute is changed due to x_att changing then hist_x_min, hist_x_max, etc. # If we can solve this so that _update_histogram is really only called once # then we could consider simplifying this. Until then, we manually keep track # of which properties have changed. changed = set() if not force: for key, value in self._viewer_state.as_dict().items(): if value != self._last_viewer_state.get(key, None): changed.add(key) for key, value in self.state.as_dict().items(): if value != self._last_layer_state.get(key, None): changed.add(key) self._last_viewer_state.update(self._viewer_state.as_dict()) self._last_layer_state.update(self.state.as_dict()) if 'reference_data' in changed or 'layer' in changed: self._update_compatibility() if force or any(prop in changed for prop in ('layer', 'attribute', 'slices', 'x_att', 'y_att')): self._update_image_data() force = True # make sure scaling and visual attributes are updated if force or any(prop in changed for prop in ('v_min', 'v_max', 'contrast', 'bias', 'alpha', 'color_mode', 'cmap', 'color', 'zorder', 'visible', 'stretch')): self._update_visual_attributes() @defer_draw def update(self): self._update_image(force=True) # Reset the axes stack so that pressing the home button doesn't go back # to a previous irrelevant view. self.axes.figure.canvas.toolbar.update() self.redraw() class ImageSubsetArray(object): def __init__(self, viewer_state, layer_artist): self._viewer_state = weakref.ref(viewer_state) self._layer_artist = weakref.ref(layer_artist) self._layer_state = weakref.ref(layer_artist.state) @property def layer_artist(self): return self._layer_artist() @property def layer_state(self): return self._layer_state() @property def viewer_state(self): return self._viewer_state() @property def shape(self): x_axis = self.viewer_state.x_att.axis y_axis = self.viewer_state.y_att.axis full_shape = self.layer_state.layer.shape return full_shape[y_axis], full_shape[x_axis] @property def nan_array(self): return np.ones(self.shape) * np.nan def __getitem__(self, view=None): if (self.layer_artist is None or self.layer_state is None or self.viewer_state is None): return self.nan_array if not self.layer_artist._compatible_with_reference_data: return self.nan_array try: mask = self.layer_state.get_sliced_data(view=view) except IncompatibleAttribute: self.layer_artist.disable_incompatible_subset() return self.nan_array else: self.layer_artist.enable() r, g, b = color2rgb(self.layer_state.color) mask = np.dstack((r * mask, g * mask, b * mask, mask * .5)) mask = (255 * mask).astype(np.uint8) return mask @property def dtype(self): return np.uint8 @property def ndim(self): return 2 @property def size(self): return np.product(self.shape) class ImageSubsetLayerArtist(BaseImageLayerArtist): _layer_state_cls = ImageSubsetLayerState def __init__(self, axes, viewer_state, layer_state=None, layer=None): super(ImageSubsetLayerArtist, self).__init__(axes, viewer_state, layer_state=layer_state, layer=layer) self.subset_array = ImageSubsetArray(self._viewer_state, self) self.image_artist = imshow(self.axes, self.subset_array, origin='lower', interpolation='nearest', vmin=0, vmax=1, aspect=self._viewer_state.aspect) self.mpl_artists = [self.image_artist] @defer_draw def _update_visual_attributes(self): if not self.enabled: return # TODO: deal with color using a colormap instead of having to change data self.image_artist.set_visible(self.state.visible) self.image_artist.set_zorder(self.state.zorder) self.image_artist.set_alpha(self.state.alpha) self.redraw() def _update_image(self, force=False, **kwargs): if self.state.layer is None: return # Figure out which attributes are different from before. Ideally we shouldn't # need this but currently this method is called multiple times if an # attribute is changed due to x_att changing then hist_x_min, hist_x_max, etc. # If we can solve this so that _update_histogram is really only called once # then we could consider simplifying this. Until then, we manually keep track # of which properties have changed. changed = set() if not force: for key, value in self._viewer_state.as_dict().items(): if value != self._last_viewer_state.get(key, None): changed.add(key) for key, value in self.state.as_dict().items(): if value != self._last_layer_state.get(key, None): changed.add(key) self._last_viewer_state.update(self._viewer_state.as_dict()) self._last_layer_state.update(self.state.as_dict()) if 'reference_data' in changed or 'layer' in changed: self._update_compatibility() if force or any(prop in changed for prop in ('layer', 'attribute', 'color', 'x_att', 'y_att', 'slices')): self.image_artist.invalidate_cache() self.redraw() # forces subset to be recomputed force = True # make sure scaling and visual attributes are updated if force or any(prop in changed for prop in ('zorder', 'visible', 'alpha')): self._update_visual_attributes() def enable(self): super(ImageSubsetLayerArtist, self).enable() # We need to now ensure that image_artist, which may have been marked # as not being visible when the layer was cleared is made visible # again. if hasattr(self, 'image_artist'): self.image_artist.invalidate_cache() self._update_visual_attributes() @defer_draw def update(self): # TODO: determine why this gets called when changing the transparency slider self._update_image(force=True) self.redraw()
bsd-3-clause
Joukahainen/trading-with-python
lib/interactivebrokers.py
77
18140
""" Copyright: Jev Kuznetsov Licence: BSD Interface to interactive brokers together with gui widgets """ import sys # import os from time import sleep from PyQt4.QtCore import (SIGNAL, SLOT) from PyQt4.QtGui import (QApplication, QFileDialog, QDialog, QVBoxLayout, QHBoxLayout, QDialogButtonBox, QTableView, QPushButton, QWidget, QLabel, QLineEdit, QGridLayout, QHeaderView) import ib from ib.ext.Contract import Contract from ib.opt import ibConnection, message from ib.ext.Order import Order import logger as logger from qtpandas import DataFrameModel, TableView from eventSystem import Sender import numpy as np import pandas from pandas import DataFrame, Index from datetime import datetime import os import datetime as dt import time priceTicks = {1: 'bid', 2: 'ask', 4: 'last', 6: 'high', 7: 'low', 9: 'close', 14: 'open'} timeFormat = "%Y%m%d %H:%M:%S" dateFormat = "%Y%m%d" def createContract(symbol, secType='STK', exchange='SMART', currency='USD'): """ contract factory function """ contract = Contract() contract.m_symbol = symbol contract.m_secType = secType contract.m_exchange = exchange contract.m_currency = currency return contract def _str2datetime(s): """ convert string to datetime """ return datetime.strptime(s, '%Y%m%d') def readActivityFlex(fName): """ parse trade log in a csv file produced by IB 'Activity Flex Query' the file should contain these columns: ['Symbol','TradeDate','Quantity','TradePrice','IBCommission'] Returns: A DataFrame with parsed trade data """ import csv rows = [] with open(fName, 'rb') as f: reader = csv.reader(f) for row in reader: rows.append(row) header = ['TradeDate', 'Symbol', 'Quantity', 'TradePrice', 'IBCommission'] types = dict(zip(header, [_str2datetime, str, int, float, float])) idx = dict(zip(header, [rows[0].index(h) for h in header])) data = dict(zip(header, [[] for h in header])) for row in rows[1:]: print row for col in header: val = types[col](row[idx[col]]) data[col].append(val) return DataFrame(data)[header].sort(column='TradeDate') class Subscriptions(DataFrameModel, Sender): """ a data table containing price & subscription data """ def __init__(self, tws=None): super(Subscriptions, self).__init__() self.df = DataFrame() # this property holds the data in a table format self._nextId = 1 self._id2symbol = {} # id-> symbol lookup dict self._header = ['id', 'position', 'bid', 'ask', 'last'] # columns of the _data table # register callbacks if tws is not None: tws.register(self.priceHandler, message.TickPrice) tws.register(self.accountHandler, message.UpdatePortfolio) def add(self, symbol, subId=None): """ Add a subscription to data table return : subscription id """ if subId is None: subId = self._nextId data = dict(zip(self._header, [subId, 0, np.nan, np.nan, np.nan])) row = DataFrame(data, index=Index([symbol])) self.df = self.df.append(row[self._header]) # append data and set correct column order self._nextId = subId + 1 self._rebuildIndex() self.emit(SIGNAL("layoutChanged()")) return subId def priceHandler(self, msg): """ handler function for price updates. register this with ibConnection class """ if priceTicks[msg.field] not in self._header: # do nothing for ticks that are not in _data table return self.df[priceTicks[msg.field]][self._id2symbol[msg.tickerId]] = msg.price #notify viewer col = self._header.index(priceTicks[msg.field]) row = self.df.index.tolist().index(self._id2symbol[msg.tickerId]) idx = self.createIndex(row, col) self.emit(SIGNAL("dataChanged(QModelIndex,QModelIndex)"), idx, idx) def accountHandler(self, msg): if msg.contract.m_symbol in self.df.index.tolist(): self.df['position'][msg.contract.m_symbol] = msg.position def _rebuildIndex(self): """ udate lookup dictionary id-> symbol """ symbols = self.df.index.tolist() ids = self.df['id'].values.tolist() self._id2symbol = dict(zip(ids, symbols)) def __repr__(self): return str(self.df) class Broker(object): """ Broker class acts as a wrapper around ibConnection from ibPy. It tracks current subscriptions and provides data models to viewiers . """ def __init__(self, name='broker'): """ initialize broker class """ self.name = name self.log = logger.getLogger(self.name) self.log.debug('Initializing broker. Pandas version={0}'.format(pandas.__version__)) self.contracts = {} # a dict to keep track of subscribed contracts self.tws = ibConnection() # tws interface self.nextValidOrderId = None self.dataModel = Subscriptions(self.tws) # data container self.tws.registerAll(self.defaultHandler) #self.tws.register(self.debugHandler,message.TickPrice) self.tws.register(self.nextValidIdHandler, 'NextValidId') self.log.debug('Connecting to tws') self.tws.connect() self.tws.reqAccountUpdates(True, '') def subscribeStk(self, symbol, secType='STK', exchange='SMART', currency='USD'): """ subscribe to stock data """ self.log.debug('Subscribing to ' + symbol) # if symbol in self.data.symbols: # print 'Already subscribed to {0}'.format(symbol) # return c = Contract() c.m_symbol = symbol c.m_secType = secType c.m_exchange = exchange c.m_currency = currency subId = self.dataModel.add(symbol) self.tws.reqMktData(subId, c, '', False) self.contracts[symbol] = c return subId @property def data(self): return self.dataModel.df def placeOrder(self, symbol, shares, limit=None, exchange='SMART', transmit=0): """ place an order on already subscribed contract """ if symbol not in self.contracts.keys(): self.log.error("Can't place order, not subscribed to %s" % symbol) return action = {-1: 'SELL', 1: 'BUY'} o = Order() o.m_orderId = self.getOrderId() o.m_action = action[cmp(shares, 0)] o.m_totalQuantity = abs(shares) o.m_transmit = transmit if limit is not None: o.m_orderType = 'LMT' o.m_lmtPrice = limit self.log.debug('Placing %s order for %i %s (id=%i)' % (o.m_action, o.m_totalQuantity, symbol, o.m_orderId)) self.tws.placeOrder(o.m_orderId, self.contracts[symbol], o) def getOrderId(self): self.nextValidOrderId += 1 return self.nextValidOrderId - 1 def unsubscribeStk(self, symbol): self.log.debug('Function not implemented') def disconnect(self): self.tws.disconnect() def __del__(self): """destructor, clean up """ print 'Broker is cleaning up after itself.' self.tws.disconnect() def debugHandler(self, msg): print msg def defaultHandler(self, msg): """ default message handler """ #print msg.typeName if msg.typeName == 'Error': self.log.error(msg) def nextValidIdHandler(self, msg): self.nextValidOrderId = msg.orderId self.log.debug('Next valid order id:{0}'.format(self.nextValidOrderId)) def saveData(self, fname): """ save current dataframe to csv """ self.log.debug("Saving data to {0}".format(fname)) self.dataModel.df.to_csv(fname) # def __getattr__(self, name): # """ x.__getattr__('name') <==> x.name # an easy way to call ibConnection methods # @return named attribute from instance tws # """ # return getattr(self.tws, name) class _HistDataHandler(object): """ handles incoming messages """ def __init__(self, tws): self._log = logger.getLogger('DH') tws.register(self.msgHandler, message.HistoricalData) self.reset() def reset(self): self._log.debug('Resetting data') self.dataReady = False self._timestamp = [] self._data = {'open': [], 'high': [], 'low': [], 'close': [], 'volume': [], 'count': [], 'WAP': []} def msgHandler(self, msg): #print '[msg]', msg if msg.date[:8] == 'finished': self._log.debug('Data recieved') self.dataReady = True return if len(msg.date) > 8: self._timestamp.append(dt.datetime.strptime(msg.date, timeFormat)) else: self._timestamp.append(dt.datetime.strptime(msg.date, dateFormat)) for k in self._data.keys(): self._data[k].append(getattr(msg, k)) @property def data(self): """ return downloaded data as a DataFrame """ df = DataFrame(data=self._data, index=Index(self._timestamp)) return df class Downloader(object): def __init__(self, debug=False): self._log = logger.getLogger('DLD') self._log.debug( 'Initializing data dwonloader. Pandas version={0}, ibpy version:{1}'.format(pandas.__version__, ib.version)) self.tws = ibConnection() self._dataHandler = _HistDataHandler(self.tws) if debug: self.tws.registerAll(self._debugHandler) self.tws.unregister(self._debugHandler, message.HistoricalData) self._log.debug('Connecting to tws') self.tws.connect() self._timeKeeper = TimeKeeper() # keep track of past requests self._reqId = 1 # current request id def _debugHandler(self, msg): print '[debug]', msg def requestData(self, contract, endDateTime, durationStr='1 D', barSizeSetting='30 secs', whatToShow='TRADES', useRTH=1, formatDate=1): self._log.debug('Requesting data for %s end time %s.' % (contract.m_symbol, endDateTime)) while self._timeKeeper.nrRequests(timeSpan=600) > 59: print 'Too many requests done. Waiting... ' time.sleep(10) self._timeKeeper.addRequest() self._dataHandler.reset() self.tws.reqHistoricalData(self._reqId, contract, endDateTime, durationStr, barSizeSetting, whatToShow, useRTH, formatDate) self._reqId += 1 #wait for data startTime = time.time() timeout = 3 while not self._dataHandler.dataReady and (time.time() - startTime < timeout): sleep(2) if not self._dataHandler.dataReady: self._log.error('Data timeout') print self._dataHandler.data return self._dataHandler.data def getIntradayData(self, contract, dateTuple): """ get full day data on 1-s interval date: a tuple of (yyyy,mm,dd) """ openTime = dt.datetime(*dateTuple) + dt.timedelta(hours=16) closeTime = dt.datetime(*dateTuple) + dt.timedelta(hours=22) timeRange = pandas.date_range(openTime, closeTime, freq='30min') datasets = [] for t in timeRange: datasets.append(self.requestData(contract, t.strftime(timeFormat))) return pandas.concat(datasets) def disconnect(self): self.tws.disconnect() class TimeKeeper(object): def __init__(self): self._log = logger.getLogger('TK') dataDir = os.path.expanduser('~') + '/twpData' if not os.path.exists(dataDir): os.mkdir(dataDir) self._timeFormat = "%Y%m%d %H:%M:%S" self.dataFile = os.path.normpath(os.path.join(dataDir, 'requests.txt')) self._log.debug('Data file: {0}'.format(self.dataFile)) def addRequest(self): """ adds a timestamp of current request""" with open(self.dataFile, 'a') as f: f.write(dt.datetime.now().strftime(self._timeFormat) + '\n') def nrRequests(self, timeSpan=600): """ return number of requests in past timespan (s) """ delta = dt.timedelta(seconds=timeSpan) now = dt.datetime.now() requests = 0 with open(self.dataFile, 'r') as f: lines = f.readlines() for line in lines: if now - dt.datetime.strptime(line.strip(), self._timeFormat) < delta: requests += 1 if requests == 0: # erase all contents if no requests are relevant open(self.dataFile, 'w').close() self._log.debug('past requests: {0}'.format(requests)) return requests #---------------test functions----------------- def dummyHandler(msg): print msg def testConnection(): """ a simple test to check working of streaming prices etc """ tws = ibConnection() tws.registerAll(dummyHandler) tws.connect() c = createContract('SPY') tws.reqMktData(1, c, '', False) sleep(3) print 'testConnection done.' def testSubscriptions(): s = Subscriptions() s.add('SPY') #s.add('XLE') print s def testBroker(): b = Broker() sleep(2) b.subscribeStk('SPY') b.subscribeStk('XLE') b.subscribeStk('GOOG') b.placeOrder('ABC', 125, 55.1) sleep(3) return b #---------------------GUI stuff-------------------------------------------- class AddSubscriptionDlg(QDialog): def __init__(self, parent=None): super(AddSubscriptionDlg, self).__init__(parent) symbolLabel = QLabel('Symbol') self.symbolEdit = QLineEdit() secTypeLabel = QLabel('secType') self.secTypeEdit = QLineEdit('STK') exchangeLabel = QLabel('exchange') self.exchangeEdit = QLineEdit('SMART') currencyLabel = QLabel('currency') self.currencyEdit = QLineEdit('USD') buttonBox = QDialogButtonBox(QDialogButtonBox.Ok | QDialogButtonBox.Cancel) lay = QGridLayout() lay.addWidget(symbolLabel, 0, 0) lay.addWidget(self.symbolEdit, 0, 1) lay.addWidget(secTypeLabel, 1, 0) lay.addWidget(self.secTypeEdit, 1, 1) lay.addWidget(exchangeLabel, 2, 0) lay.addWidget(self.exchangeEdit, 2, 1) lay.addWidget(currencyLabel, 3, 0) lay.addWidget(self.currencyEdit, 3, 1) lay.addWidget(buttonBox, 4, 0, 1, 2) self.setLayout(lay) self.connect(buttonBox, SIGNAL("accepted()"), self, SLOT("accept()")) self.connect(buttonBox, SIGNAL("rejected()"), self, SLOT("reject()")) self.setWindowTitle("Add subscription") class BrokerWidget(QWidget): def __init__(self, broker, parent=None): super(BrokerWidget, self).__init__(parent) self.broker = broker self.dataTable = TableView() self.dataTable.setModel(self.broker.dataModel) self.dataTable.horizontalHeader().setResizeMode(QHeaderView.Stretch) #self.dataTable.resizeColumnsToContents() dataLabel = QLabel('Price Data') dataLabel.setBuddy(self.dataTable) dataLayout = QVBoxLayout() dataLayout.addWidget(dataLabel) dataLayout.addWidget(self.dataTable) addButton = QPushButton("&Add Symbol") saveDataButton = QPushButton("&Save Data") #deleteButton = QPushButton("&Delete") buttonLayout = QVBoxLayout() buttonLayout.addWidget(addButton) buttonLayout.addWidget(saveDataButton) buttonLayout.addStretch() layout = QHBoxLayout() layout.addLayout(dataLayout) layout.addLayout(buttonLayout) self.setLayout(layout) self.connect(addButton, SIGNAL('clicked()'), self.addSubscription) self.connect(saveDataButton, SIGNAL('clicked()'), self.saveData) #self.connect(deleteButton,SIGNAL('clicked()'),self.deleteSubscription) def addSubscription(self): dialog = AddSubscriptionDlg(self) if dialog.exec_(): self.broker.subscribeStk(str(dialog.symbolEdit.text()), str(dialog.secTypeEdit.text()), str(dialog.exchangeEdit.text()), str(dialog.currencyEdit.text())) def saveData(self): """ save data to a .csv file """ fname = unicode(QFileDialog.getSaveFileName(self, caption="Save data to csv", filter='*.csv')) if fname: self.broker.saveData(fname) # def deleteSubscription(self): # pass class Form(QDialog): def __init__(self, parent=None): super(Form, self).__init__(parent) self.resize(640, 480) self.setWindowTitle('Broker test') self.broker = Broker() self.broker.subscribeStk('SPY') self.broker.subscribeStk('XLE') self.broker.subscribeStk('GOOG') brokerWidget = BrokerWidget(self.broker, self) lay = QVBoxLayout() lay.addWidget(brokerWidget) self.setLayout(lay) def startGui(): app = QApplication(sys.argv) form = Form() form.show() app.exec_() if __name__ == "__main__": import ib print 'iby version:', ib.version #testConnection() #testBroker() #testSubscriptions() print message.messageTypeNames() startGui() print 'All done'
bsd-3-clause
PlummerLab/2015-05-05-AvrRvi5_candidate_transcript_validation
lib/draw_wrappers.py
1
4173
from gene_shapes import Triangle from gene_shapes import OpenTriangle import matplotlib.patches as patches from matplotlib.path import Path from matplotlib.text import Text def draw_region( seq, start=None, end=None, intron_threshold=1000, exon=Triangle(width=1), intron=OpenTriangle(width=0.5, y_offset=0.5), other_shapes=dict(), names_to_print=dict(), ): """ Keyword arguments: names_to_print -- dict. """ if start is None: start = 0 if end is None: end = len(seq) feature_patches = list() text_patches = list() for feature in seq[start:end].features: if feature.id in names_to_print: if 's' not in names_to_print[feature.id]: names_to_print[feature.id]['s'] = feature.id start = feature.location.start end = feature.location.end names_to_print[feature.id]['x'] = start + 0.5 * (end - start) text_patches.append(names_to_print[feature.id]) if feature.type == 'CDS' and exon is not None: exons = list() introns = list() reverse = feature.strand == -1 parts = sorted(feature.location.parts, key=lambda f: min(f.start, f.end), reverse=reverse) for i in range(len(parts)): strand = parts[i].strand # Draw intron if not the last exon if i > 0 and intron is not None: if strand in {None, 0, 1}: strand = 1 start = parts[i - 1].end distance = (parts[i].start - parts[i - 1].end) else: strand = -1 start = parts[i - 1].start distance = (parts[i].end - parts[i - 1].start) if abs(distance) >= intron_threshold: incl_intron = True verts, codes = intron( start, 0., distance ) introns.append([start, distance]) p = Path(verts, codes) feature_patches.append( patches.PathPatch( p, **intron.properties ) ) else: incl_intron = False # Now draw the exon start = parts[i].start if strand in {None, 0, 1}: strand = 1 start = parts[i].start else: strand = -1 start = parts[i].end distance = (parts[i].end - parts[i].start) * strand if len(exons) == 0 or incl_intron: exons.append([start, distance]) else: # Join two exons exons[-1][1] += distance for e in exons: verts, codes = exon(e[0], 0., e[1]) p = Path(verts, codes) feature_patches.append( patches.PathPatch( p, **exon.properties ) ) elif feature.type in other_shapes: part = feature.location strand = part.strand if strand in {None, 0, 1}: strand = 1 start = part.start else: strand = -1 start = part.end distance = (part.end - part.start) * strand verts, codes = other_shapes[feature.type](start, 0., distance) p = Path(verts, codes) feature_patches.append( patches.PathPatch( p, **other_shapes[feature.type].properties ) ) return feature_patches, text_patches
mit
Fireblend/scikit-learn
examples/ensemble/plot_partial_dependence.py
249
4456
""" ======================== Partial Dependence Plots ======================== Partial dependence plots show the dependence between the target function [1]_ and a set of 'target' features, marginalizing over the values of all other features (the complement features). Due to the limits of human perception the size of the target feature set must be small (usually, one or two) thus the target features are usually chosen among the most important features (see :attr:`~sklearn.ensemble.GradientBoostingRegressor.feature_importances_`). This example shows how to obtain partial dependence plots from a :class:`~sklearn.ensemble.GradientBoostingRegressor` trained on the California housing dataset. The example is taken from [HTF2009]_. The plot shows four one-way and one two-way partial dependence plots. The target variables for the one-way PDP are: median income (`MedInc`), avg. occupants per household (`AvgOccup`), median house age (`HouseAge`), and avg. rooms per household (`AveRooms`). We can clearly see that the median house price shows a linear relationship with the median income (top left) and that the house price drops when the avg. occupants per household increases (top middle). The top right plot shows that the house age in a district does not have a strong influence on the (median) house price; so does the average rooms per household. The tick marks on the x-axis represent the deciles of the feature values in the training data. Partial dependence plots with two target features enable us to visualize interactions among them. The two-way partial dependence plot shows the dependence of median house price on joint values of house age and avg. occupants per household. We can clearly see an interaction between the two features: For an avg. occupancy greater than two, the house price is nearly independent of the house age, whereas for values less than two there is a strong dependence on age. .. [HTF2009] T. Hastie, R. Tibshirani and J. Friedman, "Elements of Statistical Learning Ed. 2", Springer, 2009. .. [1] For classification you can think of it as the regression score before the link function. """ print(__doc__) import numpy as np import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import Axes3D from sklearn.cross_validation import train_test_split from sklearn.ensemble import GradientBoostingRegressor from sklearn.ensemble.partial_dependence import plot_partial_dependence from sklearn.ensemble.partial_dependence import partial_dependence from sklearn.datasets.california_housing import fetch_california_housing # fetch California housing dataset cal_housing = fetch_california_housing() # split 80/20 train-test X_train, X_test, y_train, y_test = train_test_split(cal_housing.data, cal_housing.target, test_size=0.2, random_state=1) names = cal_housing.feature_names print('_' * 80) print("Training GBRT...") clf = GradientBoostingRegressor(n_estimators=100, max_depth=4, learning_rate=0.1, loss='huber', random_state=1) clf.fit(X_train, y_train) print("done.") print('_' * 80) print('Convenience plot with ``partial_dependence_plots``') print features = [0, 5, 1, 2, (5, 1)] fig, axs = plot_partial_dependence(clf, X_train, features, feature_names=names, n_jobs=3, grid_resolution=50) fig.suptitle('Partial dependence of house value on nonlocation features\n' 'for the California housing dataset') plt.subplots_adjust(top=0.9) # tight_layout causes overlap with suptitle print('_' * 80) print('Custom 3d plot via ``partial_dependence``') print fig = plt.figure() target_feature = (1, 5) pdp, (x_axis, y_axis) = partial_dependence(clf, target_feature, X=X_train, grid_resolution=50) XX, YY = np.meshgrid(x_axis, y_axis) Z = pdp.T.reshape(XX.shape).T ax = Axes3D(fig) surf = ax.plot_surface(XX, YY, Z, rstride=1, cstride=1, cmap=plt.cm.BuPu) ax.set_xlabel(names[target_feature[0]]) ax.set_ylabel(names[target_feature[1]]) ax.set_zlabel('Partial dependence') # pretty init view ax.view_init(elev=22, azim=122) plt.colorbar(surf) plt.suptitle('Partial dependence of house value on median age and ' 'average occupancy') plt.subplots_adjust(top=0.9) plt.show()
bsd-3-clause
MatthieuBizien/scikit-learn
examples/svm/plot_svm_scale_c.py
6
5404
""" ============================================== Scaling the regularization parameter for SVCs ============================================== The following example illustrates the effect of scaling the regularization parameter when using :ref:`svm` for :ref:`classification <svm_classification>`. For SVC classification, we are interested in a risk minimization for the equation: .. math:: C \sum_{i=1, n} \mathcal{L} (f(x_i), y_i) + \Omega (w) where - :math:`C` is used to set the amount of regularization - :math:`\mathcal{L}` is a `loss` function of our samples and our model parameters. - :math:`\Omega` is a `penalty` function of our model parameters If we consider the loss function to be the individual error per sample, then the data-fit term, or the sum of the error for each sample, will increase as we add more samples. The penalization term, however, will not increase. When using, for example, :ref:`cross validation <cross_validation>`, to set the amount of regularization with `C`, there will be a different amount of samples between the main problem and the smaller problems within the folds of the cross validation. Since our loss function is dependent on the amount of samples, the latter will influence the selected value of `C`. The question that arises is `How do we optimally adjust C to account for the different amount of training samples?` The figures below are used to illustrate the effect of scaling our `C` to compensate for the change in the number of samples, in the case of using an `l1` penalty, as well as the `l2` penalty. l1-penalty case ----------------- In the `l1` case, theory says that prediction consistency (i.e. that under given hypothesis, the estimator learned predicts as well as a model knowing the true distribution) is not possible because of the bias of the `l1`. It does say, however, that model consistency, in terms of finding the right set of non-zero parameters as well as their signs, can be achieved by scaling `C1`. l2-penalty case ----------------- The theory says that in order to achieve prediction consistency, the penalty parameter should be kept constant as the number of samples grow. Simulations ------------ The two figures below plot the values of `C` on the `x-axis` and the corresponding cross-validation scores on the `y-axis`, for several different fractions of a generated data-set. In the `l1` penalty case, the cross-validation-error correlates best with the test-error, when scaling our `C` with the number of samples, `n`, which can be seen in the first figure. For the `l2` penalty case, the best result comes from the case where `C` is not scaled. .. topic:: Note: Two separate datasets are used for the two different plots. The reason behind this is the `l1` case works better on sparse data, while `l2` is better suited to the non-sparse case. """ print(__doc__) # Author: Andreas Mueller <[email protected]> # Jaques Grobler <[email protected]> # License: BSD 3 clause import numpy as np import matplotlib.pyplot as plt from sklearn.svm import LinearSVC from sklearn.model_selection import ShuffleSplit from sklearn.model_selection import GridSearchCV from sklearn.utils import check_random_state from sklearn import datasets rnd = check_random_state(1) # set up dataset n_samples = 100 n_features = 300 # l1 data (only 5 informative features) X_1, y_1 = datasets.make_classification(n_samples=n_samples, n_features=n_features, n_informative=5, random_state=1) # l2 data: non sparse, but less features y_2 = np.sign(.5 - rnd.rand(n_samples)) X_2 = rnd.randn(n_samples, n_features / 5) + y_2[:, np.newaxis] X_2 += 5 * rnd.randn(n_samples, n_features / 5) clf_sets = [(LinearSVC(penalty='l1', loss='squared_hinge', dual=False, tol=1e-3), np.logspace(-2.3, -1.3, 10), X_1, y_1), (LinearSVC(penalty='l2', loss='squared_hinge', dual=True, tol=1e-4), np.logspace(-4.5, -2, 10), X_2, y_2)] colors = ['navy', 'cyan', 'darkorange'] lw = 2 for fignum, (clf, cs, X, y) in enumerate(clf_sets): # set up the plot for each regressor plt.figure(fignum, figsize=(9, 10)) for k, train_size in enumerate(np.linspace(0.3, 0.7, 3)[::-1]): param_grid = dict(C=cs) # To get nice curve, we need a large number of iterations to # reduce the variance grid = GridSearchCV(clf, refit=False, param_grid=param_grid, cv=ShuffleSplit(train_size=train_size, n_iter=250, random_state=1)) grid.fit(X, y) scores = grid.results_['test_mean_score'] scales = [(1, 'No scaling'), ((n_samples * train_size), '1/n_samples'), ] for subplotnum, (scaler, name) in enumerate(scales): plt.subplot(2, 1, subplotnum + 1) plt.xlabel('C') plt.ylabel('CV Score') grid_cs = cs * float(scaler) # scale the C's plt.semilogx(grid_cs, scores, label="fraction %.2f" % train_size, color=colors[k], lw=lw) plt.title('scaling=%s, penalty=%s, loss=%s' % (name, clf.penalty, clf.loss)) plt.legend(loc="best") plt.show()
bsd-3-clause
ritviksahajpal/LUH2
doc/sphinxext/docscrape_sphinx.py
154
7759
import re, inspect, textwrap, pydoc import sphinx from docscrape import NumpyDocString, FunctionDoc, ClassDoc class SphinxDocString(NumpyDocString): def __init__(self, docstring, config={}): self.use_plots = config.get('use_plots', False) NumpyDocString.__init__(self, docstring, config=config) # string conversion routines def _str_header(self, name, symbol='`'): return ['.. rubric:: ' + name, ''] def _str_field_list(self, name): return [':' + name + ':'] def _str_indent(self, doc, indent=4): out = [] for line in doc: out += [' '*indent + line] return out def _str_signature(self): return [''] if self['Signature']: return ['``%s``' % self['Signature']] + [''] else: return [''] def _str_summary(self): return self['Summary'] + [''] def _str_extended_summary(self): return self['Extended Summary'] + [''] def _str_param_list(self, name): out = [] if self[name]: out += self._str_field_list(name) out += [''] for param,param_type,desc in self[name]: out += self._str_indent(['**%s** : %s' % (param.strip(), param_type)]) out += [''] out += self._str_indent(desc,8) out += [''] return out @property def _obj(self): if hasattr(self, '_cls'): return self._cls elif hasattr(self, '_f'): return self._f return None def _str_member_list(self, name): """ Generate a member listing, autosummary:: table where possible, and a table where not. """ out = [] if self[name]: out += ['.. rubric:: %s' % name, ''] prefix = getattr(self, '_name', '') if prefix: prefix = '~%s.' % prefix autosum = [] others = [] for param, param_type, desc in self[name]: param = param.strip() if not self._obj or hasattr(self._obj, param): autosum += [" %s%s" % (prefix, param)] else: others.append((param, param_type, desc)) if autosum: out += ['.. autosummary::', ' :toctree:', ''] out += autosum if others: maxlen_0 = max([len(x[0]) for x in others]) maxlen_1 = max([len(x[1]) for x in others]) hdr = "="*maxlen_0 + " " + "="*maxlen_1 + " " + "="*10 fmt = '%%%ds %%%ds ' % (maxlen_0, maxlen_1) n_indent = maxlen_0 + maxlen_1 + 4 out += [hdr] for param, param_type, desc in others: out += [fmt % (param.strip(), param_type)] out += self._str_indent(desc, n_indent) out += [hdr] out += [''] return out def _str_section(self, name): out = [] if self[name]: out += self._str_header(name) out += [''] content = textwrap.dedent("\n".join(self[name])).split("\n") out += content out += [''] return out def _str_see_also(self, func_role): out = [] if self['See Also']: see_also = super(SphinxDocString, self)._str_see_also(func_role) out = ['.. seealso::', ''] out += self._str_indent(see_also[2:]) return out def _str_warnings(self): out = [] if self['Warnings']: out = ['.. warning::', ''] out += self._str_indent(self['Warnings']) return out def _str_index(self): idx = self['index'] out = [] if len(idx) == 0: return out out += ['.. index:: %s' % idx.get('default','')] for section, references in idx.iteritems(): if section == 'default': continue elif section == 'refguide': out += [' single: %s' % (', '.join(references))] else: out += [' %s: %s' % (section, ','.join(references))] return out def _str_references(self): out = [] if self['References']: out += self._str_header('References') if isinstance(self['References'], str): self['References'] = [self['References']] out.extend(self['References']) out += [''] # Latex collects all references to a separate bibliography, # so we need to insert links to it if sphinx.__version__ >= "0.6": out += ['.. only:: latex',''] else: out += ['.. latexonly::',''] items = [] for line in self['References']: m = re.match(r'.. \[([a-z0-9._-]+)\]', line, re.I) if m: items.append(m.group(1)) out += [' ' + ", ".join(["[%s]_" % item for item in items]), ''] return out def _str_examples(self): examples_str = "\n".join(self['Examples']) if (self.use_plots and 'import matplotlib' in examples_str and 'plot::' not in examples_str): out = [] out += self._str_header('Examples') out += ['.. plot::', ''] out += self._str_indent(self['Examples']) out += [''] return out else: return self._str_section('Examples') def __str__(self, indent=0, func_role="obj"): out = [] out += self._str_signature() out += self._str_index() + [''] out += self._str_summary() out += self._str_extended_summary() for param_list in ('Parameters', 'Returns', 'Other Parameters', 'Raises', 'Warns'): out += self._str_param_list(param_list) out += self._str_warnings() out += self._str_see_also(func_role) out += self._str_section('Notes') out += self._str_references() out += self._str_examples() for param_list in ('Attributes', 'Methods'): out += self._str_member_list(param_list) out = self._str_indent(out,indent) return '\n'.join(out) class SphinxFunctionDoc(SphinxDocString, FunctionDoc): def __init__(self, obj, doc=None, config={}): self.use_plots = config.get('use_plots', False) FunctionDoc.__init__(self, obj, doc=doc, config=config) class SphinxClassDoc(SphinxDocString, ClassDoc): def __init__(self, obj, doc=None, func_doc=None, config={}): self.use_plots = config.get('use_plots', False) ClassDoc.__init__(self, obj, doc=doc, func_doc=None, config=config) class SphinxObjDoc(SphinxDocString): def __init__(self, obj, doc=None, config={}): self._f = obj SphinxDocString.__init__(self, doc, config=config) def get_doc_object(obj, what=None, doc=None, config={}): if what is None: if inspect.isclass(obj): what = 'class' elif inspect.ismodule(obj): what = 'module' elif callable(obj): what = 'function' else: what = 'object' if what == 'class': return SphinxClassDoc(obj, func_doc=SphinxFunctionDoc, doc=doc, config=config) elif what in ('function', 'method'): return SphinxFunctionDoc(obj, doc=doc, config=config) else: if doc is None: doc = pydoc.getdoc(obj) return SphinxObjDoc(obj, doc, config=config)
mit
wlamond/scikit-learn
sklearn/neighbors/__init__.py
71
1025
""" The :mod:`sklearn.neighbors` module implements the k-nearest neighbors algorithm. """ from .ball_tree import BallTree from .kd_tree import KDTree from .dist_metrics import DistanceMetric from .graph import kneighbors_graph, radius_neighbors_graph from .unsupervised import NearestNeighbors from .classification import KNeighborsClassifier, RadiusNeighborsClassifier from .regression import KNeighborsRegressor, RadiusNeighborsRegressor from .nearest_centroid import NearestCentroid from .kde import KernelDensity from .approximate import LSHForest from .lof import LocalOutlierFactor __all__ = ['BallTree', 'DistanceMetric', 'KDTree', 'KNeighborsClassifier', 'KNeighborsRegressor', 'NearestCentroid', 'NearestNeighbors', 'RadiusNeighborsClassifier', 'RadiusNeighborsRegressor', 'kneighbors_graph', 'radius_neighbors_graph', 'KernelDensity', 'LSHForest', 'LocalOutlierFactor']
bsd-3-clause
ElcoLuijendijk/pyGISlib
classify_raster.py
1
2111
""" read a raster file and a classification table and reclassify the raster reclassification works by assigning a new value based to the existing raster based on the closest value in the classification table to use simply change the filename variable below to point to your input raster and adjust the raster classification values in the file data/raster_classes.csv Elco Luijendijk, 14 march 2016 """ import numpy as np import pandas as pd try: import pyGISlib except ImportError: import lib.pyGISlib as pyGISlib maxDepth = 0.0 Nbands = 3 noDataValue = -99999 filename = 'examples/example_raster.tif' # read raster file print 'loading raster file ', filename raster, dimensions, origin, cellsize, nodata, projection = \ pyGISlib.read_raster_file(filename) Nbands, nx, ny = raster.shape raster_mod = np.ones_like(raster) df = pd.read_csv('examples/raster_classes.csv') # values for color legend in figure raster_values = (df['raster_values_min'] + df['raster_values_max']) / 2.0 Nintervals = len(raster_values) band_values = np.zeros((Nintervals, Nbands)) for i in range(Nbands): band_values[:, i] = df['value_band%i' % (i + 1)].values # determine closeness to band values: diff_raster = np.zeros((Nbands, nx, ny, Nintervals)) for i in xrange(Nbands): for j in xrange(Nintervals): diff_raster[i, :, :, j] = np.abs(raster[i, :, :] - band_values[j, i]) diff_raster_sum = np.zeros((nx, ny, Nintervals)) # sum the differences for each band for j in xrange(Nintervals): diff_raster_sum[:, :, j] = np.sum(diff_raster[:, :, :, j], axis=0) raster_class = np.argmin(diff_raster_sum, axis=2) raster_class_final = np.zeros(raster_class.shape) for i in xrange(Nintervals): ind = np.where(raster_class == i) raster_class_final[ind] = raster_values[i] # save raster outputFilename = 'examples/classified_raster.tif' print 'saving raster file %s' % outputFilename pyGISlib.write_raster_file(outputFilename, raster_class_final, origin, cellsize, nodata, crs=projection) print 'done'
gpl-3.0
rosswhitfield/mantid
qt/python/mantidqt/widgets/waterfallplotfillareadialog/presenter.py
3
3112
# Mantid Repository : https://github.com/mantidproject/mantid # # Copyright &copy; 2019 ISIS Rutherford Appleton Laboratory UKRI, # NScD Oak Ridge National Laboratory, European Spallation Source, # Institut Laue - Langevin & CSNS, Institute of High Energy Physics, CAS # SPDX - License - Identifier: GPL - 3.0 + # This file is part of the mantid workbench. from matplotlib.collections import PolyCollection from mantid.plots import datafunctions from mantidqt.widgets.plotconfigdialog.colorselector import convert_color_to_hex from mantidqt.widgets.waterfallplotfillareadialog.view import WaterfallPlotFillAreaDialogView class WaterfallPlotFillAreaDialogPresenter: def __init__(self, fig, view=None, parent=None): self.fig = fig self.ax = fig.get_axes()[0] if view: self.view = view else: self.view = WaterfallPlotFillAreaDialogView(parent) self.init_view() self.view.show() # Signals self.view.close_push_button.clicked.connect(self.view.close) self.view.enable_fill_group_box.clicked.connect(lambda: self.set_fill_enabled()) self.view.use_line_colour_radio_button.clicked.connect(self.line_colour_fill) self.view.use_solid_colour_radio_button.clicked.connect(self.solid_colour_fill) self.view.colour_selector_widget.line_edit.textChanged.connect(self.solid_colour_fill) def init_view(self): # This function sets the correct values in the menu when it is first opened. if self.ax.waterfall_has_fill(): self.view.enable_fill_group_box.setChecked(True) if datafunctions.waterfall_fill_is_line_colour(self.ax): self.view.use_line_colour_radio_button.setChecked(True) else: self.view.use_solid_colour_radio_button.setChecked(True) poly = next(poly_collection for poly_collection in self.ax.collections if isinstance(poly_collection, PolyCollection)) self.view.colour_selector_widget.set_color(convert_color_to_hex(poly.get_facecolor().tolist()[0])) def set_fill_enabled(self): if self.view.enable_fill_group_box.isChecked(): if self.view.use_line_colour_radio_button.isChecked(): self.line_colour_fill() else: self.solid_colour_fill() else: self.remove_fill() def line_colour_fill(self): datafunctions.line_colour_fill(self.ax) def solid_colour_fill(self): # If the colour selector has been changed then presumably the user wants to set a custom fill colour # so that option is checked if it wasn't already. if not self.view.use_solid_colour_radio_button.isChecked(): self.view.use_solid_colour_radio_button.setChecked(True) colour = self.view.colour_selector_widget.get_color() datafunctions.solid_colour_fill(self.ax, colour) def create_fill(self): self.ax.set_waterfall_fill(True) def remove_fill(self): self.ax.set_waterfall_fill(False)
gpl-3.0
analysiscenter/dataset
batchflow/models/sklearn.py
1
3097
""" Contains models for sci-kit learn estimators """ try: from sklearn.external import joblib as pickle except ImportError: pass try: import dill as pickle except ImportError: pass from .base import BaseModel class SklearnModel(BaseModel): """ Base class for scikit-learn models Attributes ---------- estimator an instance of scikit-learn estimator Notes ----- **Configuration** estimator - an instance of scikit-learn estimator load / path - a path to a pickled estimator Examples -------- .. code-block:: python pipeline .init_model('static', SklearnModel, 'my_model', config={'estimator': sklearn.linear_model.SGDClassifier(loss='huber')}) pipeline .init_model('static', SklearnModel, 'my_model', config={'load/path': '/path/to/estimator.pickle'}) """ def __init__(self, *args, **kwargs): self.estimator = None super().__init__(*args, **kwargs) def build(self, *args, **kwargs): """ Define the model """ _ = args, kwargs self.estimator = self.config.get('estimator') def reset(self): """ Reset the trained model to allow a new training from scratch """ self.build() def load(self, path): """ Load the model. Parameters ---------- path : str a full path to a file from which a model will be loaded """ self.estimator = pickle.load(path) def save(self, path): """ Save the model. Parameters ---------- path : str a full path to a file where a model will be saved to """ if self.estimator is not None: pickle.dump(self.estimator, path) else: raise ValueError("Scikit-learn estimator does not exist. Check your config for 'estimator'.") def train(self, X, y, *args, **kwargs): """ Train the model with the data provided Parameters ---------- X : array-like Subset of the training data, shape (n_samples, n_features) y : numpy array Subset of the target values, shape (n_samples,) Notes ----- For more details and other parameters look at the documentation for the estimator used. """ if hasattr(self.estimator, 'partial_fit'): self.estimator.partial_fit(X, y, *args, **kwargs) else: self.estimator.fit(X, y, *args, **kwargs) def predict(self, X, *args, **kwargs): """ Predict with the data provided Parameters ---------- X : array-like Subset of the training data, shape (n_samples, n_features) Notes ----- For more details and other parameters look at the documentation for the estimator used. Returns ------- array Predicted value per sample, shape (n_samples,) """ return self.estimator.predict(X, *args, **kwargs)
apache-2.0
mbinkowski/opt-mmd
gan/model_mmd_gan.py
1
3138
from __future__ import division, print_function from glob import glob import os import time import numpy as np import scipy.misc from six.moves import xrange import tensorflow as tf import matplotlib.pyplot as plt from PIL import Image import lmdb import io import sys from IPython.display import display from model_mmd2 import MMD_GAN, tf, np import mmd as MMD import load from ops import batch_norm, conv2d, deconv2d, linear, lrelu from utils import save_images, unpickle, read_and_scale, center_and_scale, variable_summaries, conv_sizes, pp import pprint class MMDCE_GAN(MMD_GAN): def set_loss(self, G, images): with tf.variable_scope("discriminator") as scope: G1 = linear(G, 1, 'd_htop_lin') scope.reuse_variables() images1 = linear(images, 1, 'd_htop_lin') # no need to ouput sigmoids, loss function below takes logits self.gan_ce_loss = tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits( logits=G1, labels=tf.zeros_like(G1))) # fake self.gan_ce_loss += tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits( logits=images1, labels=tf.ones_like(images1))) #real super(MMDCE_GAN, self).set_loss(G, images) self.optim_name = 'kernel+cross_entropy_loss' def add_gradient_penalty(self, kernel, fake_data, real_data): alpha = tf.random_uniform(shape=[self.batch_size, 1]) if 'mid' in self.config.suffix: alpha = .4 + .2 * alpha elif 'edges' in self.config.suffix: qq = tf.cast(tf.reshape(tf.multinomial([[.5, .5]], self.batch_size), [self.batch_size, 1]), tf.float32) alpha = .1 * alpha * qq + (1. - .1 * alpha) * (1. - qq) elif 'edge' in self.config.suffix: alpha = .99 + .01 * alpha x_hat = (1. - alpha) * real_data + alpha * fake_data Ekx = lambda yy: tf.reduce_mean(kernel(x_hat, yy, K_XY_only=True), axis=1) witness = Ekx(real_data) - Ekx(fake_data) gradients = tf.gradients(witness, [x_hat])[0] penalty = tf.reduce_mean(tf.square(tf.norm(gradients, axis=1) - 1.0)) print('adding gradient penalty') # We need to: # - minimize MMD wrt generator # - maximize MMD wrt discriminator # - minimize GAN cross-entropy wrt discriminator if self.config.gradient_penalty > 0: self.gp = tf.get_variable('gradient_penalty', dtype=tf.float32, initializer=self.config.gradient_penalty) self.g_loss = self.mmd_loss self.d_loss = -self.mmd_loss + penalty * self.gp + self.gan_ce_loss self.optim_name += ' gp %.1f' % self.config.gradient_penalty else: self.g_loss = self.mmd_loss self.d_loss = -self.mmd_loss + self.gan_ce_loss variable_summaries([(gradients, 'dx_gradients')]) tf.summary.scalar(self.optim_name + ' G', self.g_loss) tf.summary.scalar(self.optim_name + ' D', self.d_loss) tf.summary.scalar('dx_penalty', penalty)
bsd-3-clause
tsurumeso/pysparcl
pysparcl/subfunc.py
1
2830
import numpy as np from scipy.spatial.distance import pdist from scipy.spatial.distance import squareform from sklearn.cluster import KMeans from pysparcl import utils def _get_uw(ds, wbound, niter, uorth=None): n, p = ds.shape u = np.random.randn(p) w = (np.ones(p) / p) * wbound w_old = np.random.standard_normal(p) iter = 0 if uorth is not None: if np.sum(np.abs(uorth - uorth.T)) > 1e-10: return None uorth = squareform(uorth) uorth /= np.sqrt(np.sum(np.square(uorth))) while (iter < niter and np.sum(np.abs(w_old - w) / np.sum(np.abs(w_old))) > 1e-4): if iter == 0: u = ds.dot(w.T) else: u = ds[:, argw >= lam].dot(w[argw >= lam].T) if uorth is not None: u -= uorth.dot(uorth.T.dot(u)) iter += 1 u = u / np.linalg.norm(u) w_old = w.copy() argw = np.maximum(u.dot(ds), 0).T lam = utils._binary_search(argw, wbound) w = utils._soft_thresholding(argw, lam) w /= np.linalg.norm(w) u = ds[:, argw >= lam].dot(w[argw >= lam].T) / np.sum(w) if uorth is not None: u -= uorth.dot(uorth.T.dot(u)) u /= np.linalg.norm(u) w /= np.linalg.norm(w) crit = np.sum(u * (ds.dot(w.T))) u /= np.sqrt(2.) return u, w, crit def _get_wcss(x, cs, ws=None): wcss_perf = np.zeros(x.shape[1]) for i in np.unique(cs): mask = (cs == i) if np.sum(mask) > 1: wcss_perf += np.sum( np.square(x[mask, :] - np.mean(x[mask, :], axis=0)), axis=0) bcss_perf = np.sum(np.square(x - np.mean(x, axis=0)), axis=0) - wcss_perf return wcss_perf, bcss_perf def _update_cs(x, k, ws, cs): x = x[:, ws != 0] z = x * np.sqrt(ws[ws != 0]) nrowz = z.shape[0] mus = None if cs is not None: for i in np.unique(cs): if np.sum(cs == i) > 1: mus = utils._rbind(mus, np.mean(z[cs == i, :], axis=0)) if np.sum(cs == i) == 1: mus = utils._rbind(mus, z[cs == i, :]) if mus is None: km = KMeans(k, init='random', n_init=10).fit(z) else: distmat = squareform(pdist(utils._rbind(z, mus))) distmat = distmat[:nrowz, (nrowz + 1):(nrowz + k)] nearest = distmat.argmin(axis=1) if len(np.unique(nearest)) == k: km = KMeans(k, init=mus, n_init=1).fit(z) else: km = KMeans(k, init='random', n_init=10).fit(z) return km.labels_ def _update_ws(x, cs, wbound): wcss_perf = _get_wcss(x, cs)[0] tss_perf = _get_wcss(x, np.ones(x.shape[0]))[0] lam = utils._binary_search(-wcss_perf + tss_perf, wbound) ws_unscaled = utils._soft_thresholding(-wcss_perf + tss_perf, lam) return ws_unscaled / np.linalg.norm(ws_unscaled)
gpl-2.0
ovgarol/chaPulin9.0
simPulsar/galParameters.py
1
5836
#!/usr/bin/env python """ Calcula y grafica los parametros para un modelo basado en las estadisticas de ATNF. """ import numpy as np #import scipy as sp #import time as tm import matplotlib.pyplot as plt from scipy import optimize, array, stats from matplotlib import rc, rcParams rc('text',usetex=True) rc('font',**{'family':'serif','serif':['Computer Modern']}) ########################################################################################### # MAIN ########################################################################################### if __name__ == "__main__": ########################################################################################### # Getting data from file ########################################################################################### metal = [[-1.,-0.5,0.0,0.5,1.0],\ [7128,7179,7194,6778,6660],\ [689,588,639,726,611],\ [33.18,33.86,33.82,31.32,30.36],\ [6.33,6.41,6.79,6.38,6.26]] f = open('sim_parametros.gal', 'r') # open file to read index = [] Np = [] #C0 = [] #C1 = [] Nc = [] M = [] D = [] # index C0 C1 Np for line in f: # iterate over the lines in the file columns = line.split(' ') # split the line into a list of column values columns = [col.strip() for col in columns] # clean any whitespace off the items index.append(float(columns[0])) #C0.append(np.log(float(columns[1]))) #C1.append(np.log(float(columns[2]))) Np.append((float(columns[3]))) Nc.append((float(columns[4]))) M.append((float(columns[5]))) D.append((float(columns[6]))) f.close() index = array(index) Np = array(Np) #C0 = array(C0) #C1 = array(C0) Nc = array(Nc) M = array(M) D = array(D) logNp = np.log10(Np) logNc = np.log10(Nc) """ plt.hist(C0,10,color='k',linewidth=2,histtype='step', label='C0')#, range=rango) plt.legend(loc='upper left') plt.xlabel('$\log C0$') plt.ylabel('$N$') plt.grid(True) #plt.show() plt.savefig('N_logC0_.pdf') plt.clf() plt.hist(C1,10,color='k',linewidth=2,histtype='step', label='C1')#, range=rango) plt.legend(loc='upper left') plt.xlabel('$\log C1$') plt.ylabel('$N$') plt.grid(True) #plt.show() plt.savefig('N_logC1_.pdf') plt.clf() """ plt.hist(logNp,10,color='k',linewidth=2,histtype='step')#, range=rango) #plt.legend(loc='upper left') plt.xlabel('$\log N_T$ [adim]') plt.ylabel('$N$') plt.grid(True) #plt.show() plt.savefig('N_logNT_.pdf') plt.clf() plt.plot(index,Np,',',color='k',alpha=1.) #plt.legend(loc='best') plt.xlabel(r'$\alpha_3$ [adim]') plt.ylabel('$N_T$ [adim]') #plt.xlim([-2,2]) #plt.ylim([-18,-12]) plt.grid(True) #plt.show() plt.savefig('index_NT.pdf') plt.clf() plt.hist(logNc,10,color='k',linewidth=2,histtype='step')#, range=rango) #plt.legend(loc='upper left') plt.xlabel('$\log N_p$ [adim]') plt.ylabel('$N$') plt.grid(True) #plt.show() plt.savefig('N_logNp_.pdf') plt.clf() "" plt.plot(index,Nc,',',color='k',alpha=1.) #plt.legend(loc='best') plt.xlabel(r'$\alpha_3$ [adim]') plt.ylabel('$N_p$ [adim]') #plt.xlim([-2,2]) #plt.ylim([-18,-12]) plt.grid(True) #plt.show() plt.savefig('index_Np.pdf') plt.clf() plt.plot(M,Np,',',color='k',alpha=1.) plt.errorbar(metal[0],metal[1], yerr = metal[2], fmt='o', ls='--',color='k') #plt.legend(loc='best') plt.xlabel(r'$\Delta$ [Z] [dex]') plt.ylabel('$N_T$ [adim]') plt.xlim([-1.5,1.5]) #plt.ylim([-18,-12]) plt.grid(True) #plt.show() plt.savefig('M_NT.pdf') plt.clf() plt.plot(M,Nc,',',color='k',alpha=1.) plt.errorbar(metal[0],metal[3], yerr=metal[4],fmt='o',color='k',ls='--') #plt.legend(loc='best') plt.xlabel(r'$\Delta$ [Z] [dex]') plt.ylabel('$N_p$ [adim]') plt.xlim([-1.5,1.5]) #plt.ylim([-18,-12]) plt.grid(True) #plt.show() plt.savefig('M_Np.pdf') plt.clf() plt.plot(D,Np,',',color='k',alpha=1.) #plt.legend(loc='best') plt.xlabel(r'$\Delta t$ [yr]') plt.ylabel('$N_T$ [adim]') #plt.xlim([-2,2]) #plt.ylim([-18,-12]) plt.grid(True) #plt.show() plt.savefig('D_NT.pdf') plt.clf() plt.plot(D,Nc,',',color='k',alpha=1.) #plt.legend(loc='best') plt.xlabel(r'$\Delta t$ [yr]') plt.ylabel('$N_p$ [adim]') #plt.xlim([-2,2]) #plt.ylim([-18,-12]) plt.grid(True) #plt.show() plt.savefig('D_Np.pdf') plt.clf() DD = open('sim.gal', 'a') # open file to read print>>DD, 'N_T - ', Np.mean(), '-', Np.std() print>>DD, 'N_p - ', Nc.mean(), '-', Nc.std() DD.close() #plt.plot(age[0],age[1],'o',color='k',alpha=.25) plt.legend(loc='best') plt.xlabel(r'$\Delta Z$ [dex]') plt.ylabel(r'$N_{T}$ [adim]') plt.xlim([-1.5,1.5]) plt.grid(True) #plt.show() plt.savefig('metal_Nt.jpg') plt.clf() #plt.errorbar(index[0],index[1], yerr = index[2], fmt='o', ls='--') plt.legend(loc='best') plt.xlabel(r'$\Delta Z$ [dex]') plt.ylabel(r'$N_{p}$ [adim]') plt.xlim([-1.5,1.5]) plt.grid(True) #plt.show() plt.savefig('metal_Np.jpg') plt.clf() dumi = [] dumd = [] for i in range(len(metal[0])): dumi.append(metal[3][i]/metal[1][i]) dumd.append(metal[4][i]/metal[1][i]) #plt.plot(age[0],age[1],'o',color='k',alpha=.25) plt.errorbar(metal[0],dumi, yerr = dumd, fmt='o', ls='--',color='k') plt.legend(loc='best') plt.xlabel(r'$\Delta Z$ [dex]') plt.ylabel(r'$N_{p}/N_{T}$ [adim]') plt.xlim([-1.5,1.5]) plt.grid(True) #plt.show() plt.savefig('metal_Np-Nt.jpg') plt.clf() del dumi, dumd
agpl-3.0
belltailjp/scikit-learn
sklearn/datasets/samples_generator.py
26
56311
""" Generate samples of synthetic data sets. """ # Authors: B. Thirion, G. Varoquaux, A. Gramfort, V. Michel, O. Grisel, # G. Louppe, J. Nothman # License: BSD 3 clause import numbers import warnings import array import numpy as np from scipy import linalg import scipy.sparse as sp from ..preprocessing import MultiLabelBinarizer from ..utils import check_array, check_random_state from ..utils import shuffle as util_shuffle from ..utils.fixes import astype from ..utils.random import sample_without_replacement from ..externals import six map = six.moves.map zip = six.moves.zip def _generate_hypercube(samples, dimensions, rng): """Returns distinct binary samples of length dimensions """ if dimensions > 30: return np.hstack([_generate_hypercube(samples, dimensions - 30, rng), _generate_hypercube(samples, 30, rng)]) out = astype(sample_without_replacement(2 ** dimensions, samples, random_state=rng), dtype='>u4', copy=False) out = np.unpackbits(out.view('>u1')).reshape((-1, 32))[:, -dimensions:] return out def make_classification(n_samples=100, n_features=20, n_informative=2, n_redundant=2, n_repeated=0, n_classes=2, n_clusters_per_class=2, weights=None, flip_y=0.01, class_sep=1.0, hypercube=True, shift=0.0, scale=1.0, shuffle=True, random_state=None): """Generate a random n-class classification problem. This initially creates clusters of points normally distributed (std=1) about vertices of a `2 * class_sep`-sided hypercube, and assigns an equal number of clusters to each class. It introduces interdependence between these features and adds various types of further noise to the data. Prior to shuffling, `X` stacks a number of these primary "informative" features, "redundant" linear combinations of these, "repeated" duplicates of sampled features, and arbitrary noise for and remaining features. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of samples. n_features : int, optional (default=20) The total number of features. These comprise `n_informative` informative features, `n_redundant` redundant features, `n_repeated` duplicated features and `n_features-n_informative-n_redundant- n_repeated` useless features drawn at random. n_informative : int, optional (default=2) The number of informative features. Each class is composed of a number of gaussian clusters each located around the vertices of a hypercube in a subspace of dimension `n_informative`. For each cluster, informative features are drawn independently from N(0, 1) and then randomly linearly combined within each cluster in order to add covariance. The clusters are then placed on the vertices of the hypercube. n_redundant : int, optional (default=2) The number of redundant features. These features are generated as random linear combinations of the informative features. n_repeated : int, optional (default=0) The number of duplicated features, drawn randomly from the informative and the redundant features. n_classes : int, optional (default=2) The number of classes (or labels) of the classification problem. n_clusters_per_class : int, optional (default=2) The number of clusters per class. weights : list of floats or None (default=None) The proportions of samples assigned to each class. If None, then classes are balanced. Note that if `len(weights) == n_classes - 1`, then the last class weight is automatically inferred. More than `n_samples` samples may be returned if the sum of `weights` exceeds 1. flip_y : float, optional (default=0.01) The fraction of samples whose class are randomly exchanged. class_sep : float, optional (default=1.0) The factor multiplying the hypercube dimension. hypercube : boolean, optional (default=True) If True, the clusters are put on the vertices of a hypercube. If False, the clusters are put on the vertices of a random polytope. shift : float, array of shape [n_features] or None, optional (default=0.0) Shift features by the specified value. If None, then features are shifted by a random value drawn in [-class_sep, class_sep]. scale : float, array of shape [n_features] or None, optional (default=1.0) Multiply features by the specified value. If None, then features are scaled by a random value drawn in [1, 100]. Note that scaling happens after shifting. shuffle : boolean, optional (default=True) Shuffle the samples and the features. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, n_features] The generated samples. y : array of shape [n_samples] The integer labels for class membership of each sample. Notes ----- The algorithm is adapted from Guyon [1] and was designed to generate the "Madelon" dataset. References ---------- .. [1] I. Guyon, "Design of experiments for the NIPS 2003 variable selection benchmark", 2003. See also -------- make_blobs: simplified variant make_multilabel_classification: unrelated generator for multilabel tasks """ generator = check_random_state(random_state) # Count features, clusters and samples if n_informative + n_redundant + n_repeated > n_features: raise ValueError("Number of informative, redundant and repeated " "features must sum to less than the number of total" " features") if 2 ** n_informative < n_classes * n_clusters_per_class: raise ValueError("n_classes * n_clusters_per_class must" " be smaller or equal 2 ** n_informative") if weights and len(weights) not in [n_classes, n_classes - 1]: raise ValueError("Weights specified but incompatible with number " "of classes.") n_useless = n_features - n_informative - n_redundant - n_repeated n_clusters = n_classes * n_clusters_per_class if weights and len(weights) == (n_classes - 1): weights.append(1.0 - sum(weights)) if weights is None: weights = [1.0 / n_classes] * n_classes weights[-1] = 1.0 - sum(weights[:-1]) # Distribute samples among clusters by weight n_samples_per_cluster = [] for k in range(n_clusters): n_samples_per_cluster.append(int(n_samples * weights[k % n_classes] / n_clusters_per_class)) for i in range(n_samples - sum(n_samples_per_cluster)): n_samples_per_cluster[i % n_clusters] += 1 # Intialize X and y X = np.zeros((n_samples, n_features)) y = np.zeros(n_samples, dtype=np.int) # Build the polytope whose vertices become cluster centroids centroids = _generate_hypercube(n_clusters, n_informative, generator).astype(float) centroids *= 2 * class_sep centroids -= class_sep if not hypercube: centroids *= generator.rand(n_clusters, 1) centroids *= generator.rand(1, n_informative) # Initially draw informative features from the standard normal X[:, :n_informative] = generator.randn(n_samples, n_informative) # Create each cluster; a variant of make_blobs stop = 0 for k, centroid in enumerate(centroids): start, stop = stop, stop + n_samples_per_cluster[k] y[start:stop] = k % n_classes # assign labels X_k = X[start:stop, :n_informative] # slice a view of the cluster A = 2 * generator.rand(n_informative, n_informative) - 1 X_k[...] = np.dot(X_k, A) # introduce random covariance X_k += centroid # shift the cluster to a vertex # Create redundant features if n_redundant > 0: B = 2 * generator.rand(n_informative, n_redundant) - 1 X[:, n_informative:n_informative + n_redundant] = \ np.dot(X[:, :n_informative], B) # Repeat some features if n_repeated > 0: n = n_informative + n_redundant indices = ((n - 1) * generator.rand(n_repeated) + 0.5).astype(np.intp) X[:, n:n + n_repeated] = X[:, indices] # Fill useless features if n_useless > 0: X[:, -n_useless:] = generator.randn(n_samples, n_useless) # Randomly replace labels if flip_y >= 0.0: flip_mask = generator.rand(n_samples) < flip_y y[flip_mask] = generator.randint(n_classes, size=flip_mask.sum()) # Randomly shift and scale if shift is None: shift = (2 * generator.rand(n_features) - 1) * class_sep X += shift if scale is None: scale = 1 + 100 * generator.rand(n_features) X *= scale if shuffle: # Randomly permute samples X, y = util_shuffle(X, y, random_state=generator) # Randomly permute features indices = np.arange(n_features) generator.shuffle(indices) X[:, :] = X[:, indices] return X, y def make_multilabel_classification(n_samples=100, n_features=20, n_classes=5, n_labels=2, length=50, allow_unlabeled=True, sparse=False, return_indicator=False, return_distributions=False, random_state=None): """Generate a random multilabel classification problem. For each sample, the generative process is: - pick the number of labels: n ~ Poisson(n_labels) - n times, choose a class c: c ~ Multinomial(theta) - pick the document length: k ~ Poisson(length) - k times, choose a word: w ~ Multinomial(theta_c) In the above process, rejection sampling is used to make sure that n is never zero or more than `n_classes`, and that the document length is never zero. Likewise, we reject classes which have already been chosen. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of samples. n_features : int, optional (default=20) The total number of features. n_classes : int, optional (default=5) The number of classes of the classification problem. n_labels : int, optional (default=2) The average number of labels per instance. More precisely, the number of labels per sample is drawn from a Poisson distribution with ``n_labels`` as its expected value, but samples are bounded (using rejection sampling) by ``n_classes``, and must be nonzero if ``allow_unlabeled`` is False. length : int, optional (default=50) The sum of the features (number of words if documents) is drawn from a Poisson distribution with this expected value. allow_unlabeled : bool, optional (default=True) If ``True``, some instances might not belong to any class. sparse : bool, optional (default=False) If ``True``, return a sparse feature matrix return_indicator : bool, optional (default=False), If ``True``, return ``Y`` in the binary indicator format, else return a tuple of lists of labels. return_distributions : bool, optional (default=False) If ``True``, return the prior class probability and conditional probabilities of features given classes, from which the data was drawn. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array or sparse CSR matrix of shape [n_samples, n_features] The generated samples. Y : tuple of lists or array of shape [n_samples, n_classes] The label sets. p_c : array, shape [n_classes] The probability of each class being drawn. Only returned if ``return_distributions=True``. p_w_c : array, shape [n_features, n_classes] The probability of each feature being drawn given each class. Only returned if ``return_distributions=True``. """ generator = check_random_state(random_state) p_c = generator.rand(n_classes) p_c /= p_c.sum() cumulative_p_c = np.cumsum(p_c) p_w_c = generator.rand(n_features, n_classes) p_w_c /= np.sum(p_w_c, axis=0) def sample_example(): _, n_classes = p_w_c.shape # pick a nonzero number of labels per document by rejection sampling y_size = n_classes + 1 while (not allow_unlabeled and y_size == 0) or y_size > n_classes: y_size = generator.poisson(n_labels) # pick n classes y = set() while len(y) != y_size: # pick a class with probability P(c) c = np.searchsorted(cumulative_p_c, generator.rand(y_size - len(y))) y.update(c) y = list(y) # pick a non-zero document length by rejection sampling n_words = 0 while n_words == 0: n_words = generator.poisson(length) # generate a document of length n_words if len(y) == 0: # if sample does not belong to any class, generate noise word words = generator.randint(n_features, size=n_words) return words, y # sample words with replacement from selected classes cumulative_p_w_sample = p_w_c.take(y, axis=1).sum(axis=1).cumsum() cumulative_p_w_sample /= cumulative_p_w_sample[-1] words = np.searchsorted(cumulative_p_w_sample, generator.rand(n_words)) return words, y X_indices = array.array('i') X_indptr = array.array('i', [0]) Y = [] for i in range(n_samples): words, y = sample_example() X_indices.extend(words) X_indptr.append(len(X_indices)) Y.append(y) X_data = np.ones(len(X_indices), dtype=np.float64) X = sp.csr_matrix((X_data, X_indices, X_indptr), shape=(n_samples, n_features)) X.sum_duplicates() if not sparse: X = X.toarray() if return_indicator: lb = MultiLabelBinarizer() Y = lb.fit([range(n_classes)]).transform(Y) else: warnings.warn('Support for the sequence of sequences multilabel ' 'representation is being deprecated and replaced with ' 'a sparse indicator matrix. ' 'return_indicator will default to True from version ' '0.17.', DeprecationWarning) if return_distributions: return X, Y, p_c, p_w_c return X, Y def make_hastie_10_2(n_samples=12000, random_state=None): """Generates data for binary classification used in Hastie et al. 2009, Example 10.2. The ten features are standard independent Gaussian and the target ``y`` is defined by:: y[i] = 1 if np.sum(X[i] ** 2) > 9.34 else -1 Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=12000) The number of samples. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, 10] The input samples. y : array of shape [n_samples] The output values. References ---------- .. [1] T. Hastie, R. Tibshirani and J. Friedman, "Elements of Statistical Learning Ed. 2", Springer, 2009. See also -------- make_gaussian_quantiles: a generalization of this dataset approach """ rs = check_random_state(random_state) shape = (n_samples, 10) X = rs.normal(size=shape).reshape(shape) y = ((X ** 2.0).sum(axis=1) > 9.34).astype(np.float64) y[y == 0.0] = -1.0 return X, y def make_regression(n_samples=100, n_features=100, n_informative=10, n_targets=1, bias=0.0, effective_rank=None, tail_strength=0.5, noise=0.0, shuffle=True, coef=False, random_state=None): """Generate a random regression problem. The input set can either be well conditioned (by default) or have a low rank-fat tail singular profile. See :func:`make_low_rank_matrix` for more details. The output is generated by applying a (potentially biased) random linear regression model with `n_informative` nonzero regressors to the previously generated input and some gaussian centered noise with some adjustable scale. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of samples. n_features : int, optional (default=100) The number of features. n_informative : int, optional (default=10) The number of informative features, i.e., the number of features used to build the linear model used to generate the output. n_targets : int, optional (default=1) The number of regression targets, i.e., the dimension of the y output vector associated with a sample. By default, the output is a scalar. bias : float, optional (default=0.0) The bias term in the underlying linear model. effective_rank : int or None, optional (default=None) if not None: The approximate number of singular vectors required to explain most of the input data by linear combinations. Using this kind of singular spectrum in the input allows the generator to reproduce the correlations often observed in practice. if None: The input set is well conditioned, centered and gaussian with unit variance. tail_strength : float between 0.0 and 1.0, optional (default=0.5) The relative importance of the fat noisy tail of the singular values profile if `effective_rank` is not None. noise : float, optional (default=0.0) The standard deviation of the gaussian noise applied to the output. shuffle : boolean, optional (default=True) Shuffle the samples and the features. coef : boolean, optional (default=False) If True, the coefficients of the underlying linear model are returned. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, n_features] The input samples. y : array of shape [n_samples] or [n_samples, n_targets] The output values. coef : array of shape [n_features] or [n_features, n_targets], optional The coefficient of the underlying linear model. It is returned only if coef is True. """ n_informative = min(n_features, n_informative) generator = check_random_state(random_state) if effective_rank is None: # Randomly generate a well conditioned input set X = generator.randn(n_samples, n_features) else: # Randomly generate a low rank, fat tail input set X = make_low_rank_matrix(n_samples=n_samples, n_features=n_features, effective_rank=effective_rank, tail_strength=tail_strength, random_state=generator) # Generate a ground truth model with only n_informative features being non # zeros (the other features are not correlated to y and should be ignored # by a sparsifying regularizers such as L1 or elastic net) ground_truth = np.zeros((n_features, n_targets)) ground_truth[:n_informative, :] = 100 * generator.rand(n_informative, n_targets) y = np.dot(X, ground_truth) + bias # Add noise if noise > 0.0: y += generator.normal(scale=noise, size=y.shape) # Randomly permute samples and features if shuffle: X, y = util_shuffle(X, y, random_state=generator) indices = np.arange(n_features) generator.shuffle(indices) X[:, :] = X[:, indices] ground_truth = ground_truth[indices] y = np.squeeze(y) if coef: return X, y, np.squeeze(ground_truth) else: return X, y def make_circles(n_samples=100, shuffle=True, noise=None, random_state=None, factor=.8): """Make a large circle containing a smaller circle in 2d. A simple toy dataset to visualize clustering and classification algorithms. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The total number of points generated. shuffle: bool, optional (default=True) Whether to shuffle the samples. noise : double or None (default=None) Standard deviation of Gaussian noise added to the data. factor : double < 1 (default=.8) Scale factor between inner and outer circle. Returns ------- X : array of shape [n_samples, 2] The generated samples. y : array of shape [n_samples] The integer labels (0 or 1) for class membership of each sample. """ if factor > 1 or factor < 0: raise ValueError("'factor' has to be between 0 and 1.") generator = check_random_state(random_state) # so as not to have the first point = last point, we add one and then # remove it. linspace = np.linspace(0, 2 * np.pi, n_samples // 2 + 1)[:-1] outer_circ_x = np.cos(linspace) outer_circ_y = np.sin(linspace) inner_circ_x = outer_circ_x * factor inner_circ_y = outer_circ_y * factor X = np.vstack((np.append(outer_circ_x, inner_circ_x), np.append(outer_circ_y, inner_circ_y))).T y = np.hstack([np.zeros(n_samples // 2, dtype=np.intp), np.ones(n_samples // 2, dtype=np.intp)]) if shuffle: X, y = util_shuffle(X, y, random_state=generator) if noise is not None: X += generator.normal(scale=noise, size=X.shape) return X, y def make_moons(n_samples=100, shuffle=True, noise=None, random_state=None): """Make two interleaving half circles A simple toy dataset to visualize clustering and classification algorithms. Parameters ---------- n_samples : int, optional (default=100) The total number of points generated. shuffle : bool, optional (default=True) Whether to shuffle the samples. noise : double or None (default=None) Standard deviation of Gaussian noise added to the data. Read more in the :ref:`User Guide <sample_generators>`. Returns ------- X : array of shape [n_samples, 2] The generated samples. y : array of shape [n_samples] The integer labels (0 or 1) for class membership of each sample. """ n_samples_out = n_samples // 2 n_samples_in = n_samples - n_samples_out generator = check_random_state(random_state) outer_circ_x = np.cos(np.linspace(0, np.pi, n_samples_out)) outer_circ_y = np.sin(np.linspace(0, np.pi, n_samples_out)) inner_circ_x = 1 - np.cos(np.linspace(0, np.pi, n_samples_in)) inner_circ_y = 1 - np.sin(np.linspace(0, np.pi, n_samples_in)) - .5 X = np.vstack((np.append(outer_circ_x, inner_circ_x), np.append(outer_circ_y, inner_circ_y))).T y = np.hstack([np.zeros(n_samples_in, dtype=np.intp), np.ones(n_samples_out, dtype=np.intp)]) if shuffle: X, y = util_shuffle(X, y, random_state=generator) if noise is not None: X += generator.normal(scale=noise, size=X.shape) return X, y def make_blobs(n_samples=100, n_features=2, centers=3, cluster_std=1.0, center_box=(-10.0, 10.0), shuffle=True, random_state=None): """Generate isotropic Gaussian blobs for clustering. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The total number of points equally divided among clusters. n_features : int, optional (default=2) The number of features for each sample. centers : int or array of shape [n_centers, n_features], optional (default=3) The number of centers to generate, or the fixed center locations. cluster_std: float or sequence of floats, optional (default=1.0) The standard deviation of the clusters. center_box: pair of floats (min, max), optional (default=(-10.0, 10.0)) The bounding box for each cluster center when centers are generated at random. shuffle : boolean, optional (default=True) Shuffle the samples. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, n_features] The generated samples. y : array of shape [n_samples] The integer labels for cluster membership of each sample. Examples -------- >>> from sklearn.datasets.samples_generator import make_blobs >>> X, y = make_blobs(n_samples=10, centers=3, n_features=2, ... random_state=0) >>> print(X.shape) (10, 2) >>> y array([0, 0, 1, 0, 2, 2, 2, 1, 1, 0]) See also -------- make_classification: a more intricate variant """ generator = check_random_state(random_state) if isinstance(centers, numbers.Integral): centers = generator.uniform(center_box[0], center_box[1], size=(centers, n_features)) else: centers = check_array(centers) n_features = centers.shape[1] X = [] y = [] n_centers = centers.shape[0] n_samples_per_center = [int(n_samples // n_centers)] * n_centers for i in range(n_samples % n_centers): n_samples_per_center[i] += 1 for i, n in enumerate(n_samples_per_center): X.append(centers[i] + generator.normal(scale=cluster_std, size=(n, n_features))) y += [i] * n X = np.concatenate(X) y = np.array(y) if shuffle: indices = np.arange(n_samples) generator.shuffle(indices) X = X[indices] y = y[indices] return X, y def make_friedman1(n_samples=100, n_features=10, noise=0.0, random_state=None): """Generate the "Friedman \#1" regression problem This dataset is described in Friedman [1] and Breiman [2]. Inputs `X` are independent features uniformly distributed on the interval [0, 1]. The output `y` is created according to the formula:: y(X) = 10 * sin(pi * X[:, 0] * X[:, 1]) + 20 * (X[:, 2] - 0.5) ** 2 \ + 10 * X[:, 3] + 5 * X[:, 4] + noise * N(0, 1). Out of the `n_features` features, only 5 are actually used to compute `y`. The remaining features are independent of `y`. The number of features has to be >= 5. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of samples. n_features : int, optional (default=10) The number of features. Should be at least 5. noise : float, optional (default=0.0) The standard deviation of the gaussian noise applied to the output. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, n_features] The input samples. y : array of shape [n_samples] The output values. References ---------- .. [1] J. Friedman, "Multivariate adaptive regression splines", The Annals of Statistics 19 (1), pages 1-67, 1991. .. [2] L. Breiman, "Bagging predictors", Machine Learning 24, pages 123-140, 1996. """ if n_features < 5: raise ValueError("n_features must be at least five.") generator = check_random_state(random_state) X = generator.rand(n_samples, n_features) y = 10 * np.sin(np.pi * X[:, 0] * X[:, 1]) + 20 * (X[:, 2] - 0.5) ** 2 \ + 10 * X[:, 3] + 5 * X[:, 4] + noise * generator.randn(n_samples) return X, y def make_friedman2(n_samples=100, noise=0.0, random_state=None): """Generate the "Friedman \#2" regression problem This dataset is described in Friedman [1] and Breiman [2]. Inputs `X` are 4 independent features uniformly distributed on the intervals:: 0 <= X[:, 0] <= 100, 40 * pi <= X[:, 1] <= 560 * pi, 0 <= X[:, 2] <= 1, 1 <= X[:, 3] <= 11. The output `y` is created according to the formula:: y(X) = (X[:, 0] ** 2 + (X[:, 1] * X[:, 2] \ - 1 / (X[:, 1] * X[:, 3])) ** 2) ** 0.5 + noise * N(0, 1). Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of samples. noise : float, optional (default=0.0) The standard deviation of the gaussian noise applied to the output. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, 4] The input samples. y : array of shape [n_samples] The output values. References ---------- .. [1] J. Friedman, "Multivariate adaptive regression splines", The Annals of Statistics 19 (1), pages 1-67, 1991. .. [2] L. Breiman, "Bagging predictors", Machine Learning 24, pages 123-140, 1996. """ generator = check_random_state(random_state) X = generator.rand(n_samples, 4) X[:, 0] *= 100 X[:, 1] *= 520 * np.pi X[:, 1] += 40 * np.pi X[:, 3] *= 10 X[:, 3] += 1 y = (X[:, 0] ** 2 + (X[:, 1] * X[:, 2] - 1 / (X[:, 1] * X[:, 3])) ** 2) ** 0.5 \ + noise * generator.randn(n_samples) return X, y def make_friedman3(n_samples=100, noise=0.0, random_state=None): """Generate the "Friedman \#3" regression problem This dataset is described in Friedman [1] and Breiman [2]. Inputs `X` are 4 independent features uniformly distributed on the intervals:: 0 <= X[:, 0] <= 100, 40 * pi <= X[:, 1] <= 560 * pi, 0 <= X[:, 2] <= 1, 1 <= X[:, 3] <= 11. The output `y` is created according to the formula:: y(X) = arctan((X[:, 1] * X[:, 2] - 1 / (X[:, 1] * X[:, 3])) \ / X[:, 0]) + noise * N(0, 1). Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of samples. noise : float, optional (default=0.0) The standard deviation of the gaussian noise applied to the output. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, 4] The input samples. y : array of shape [n_samples] The output values. References ---------- .. [1] J. Friedman, "Multivariate adaptive regression splines", The Annals of Statistics 19 (1), pages 1-67, 1991. .. [2] L. Breiman, "Bagging predictors", Machine Learning 24, pages 123-140, 1996. """ generator = check_random_state(random_state) X = generator.rand(n_samples, 4) X[:, 0] *= 100 X[:, 1] *= 520 * np.pi X[:, 1] += 40 * np.pi X[:, 3] *= 10 X[:, 3] += 1 y = np.arctan((X[:, 1] * X[:, 2] - 1 / (X[:, 1] * X[:, 3])) / X[:, 0]) \ + noise * generator.randn(n_samples) return X, y def make_low_rank_matrix(n_samples=100, n_features=100, effective_rank=10, tail_strength=0.5, random_state=None): """Generate a mostly low rank matrix with bell-shaped singular values Most of the variance can be explained by a bell-shaped curve of width effective_rank: the low rank part of the singular values profile is:: (1 - tail_strength) * exp(-1.0 * (i / effective_rank) ** 2) The remaining singular values' tail is fat, decreasing as:: tail_strength * exp(-0.1 * i / effective_rank). The low rank part of the profile can be considered the structured signal part of the data while the tail can be considered the noisy part of the data that cannot be summarized by a low number of linear components (singular vectors). This kind of singular profiles is often seen in practice, for instance: - gray level pictures of faces - TF-IDF vectors of text documents crawled from the web Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of samples. n_features : int, optional (default=100) The number of features. effective_rank : int, optional (default=10) The approximate number of singular vectors required to explain most of the data by linear combinations. tail_strength : float between 0.0 and 1.0, optional (default=0.5) The relative importance of the fat noisy tail of the singular values profile. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, n_features] The matrix. """ generator = check_random_state(random_state) n = min(n_samples, n_features) # Random (ortho normal) vectors u, _ = linalg.qr(generator.randn(n_samples, n), mode='economic') v, _ = linalg.qr(generator.randn(n_features, n), mode='economic') # Index of the singular values singular_ind = np.arange(n, dtype=np.float64) # Build the singular profile by assembling signal and noise components low_rank = ((1 - tail_strength) * np.exp(-1.0 * (singular_ind / effective_rank) ** 2)) tail = tail_strength * np.exp(-0.1 * singular_ind / effective_rank) s = np.identity(n) * (low_rank + tail) return np.dot(np.dot(u, s), v.T) def make_sparse_coded_signal(n_samples, n_components, n_features, n_nonzero_coefs, random_state=None): """Generate a signal as a sparse combination of dictionary elements. Returns a matrix Y = DX, such as D is (n_features, n_components), X is (n_components, n_samples) and each column of X has exactly n_nonzero_coefs non-zero elements. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int number of samples to generate n_components: int, number of components in the dictionary n_features : int number of features of the dataset to generate n_nonzero_coefs : int number of active (non-zero) coefficients in each sample random_state: int or RandomState instance, optional (default=None) seed used by the pseudo random number generator Returns ------- data: array of shape [n_features, n_samples] The encoded signal (Y). dictionary: array of shape [n_features, n_components] The dictionary with normalized components (D). code: array of shape [n_components, n_samples] The sparse code such that each column of this matrix has exactly n_nonzero_coefs non-zero items (X). """ generator = check_random_state(random_state) # generate dictionary D = generator.randn(n_features, n_components) D /= np.sqrt(np.sum((D ** 2), axis=0)) # generate code X = np.zeros((n_components, n_samples)) for i in range(n_samples): idx = np.arange(n_components) generator.shuffle(idx) idx = idx[:n_nonzero_coefs] X[idx, i] = generator.randn(n_nonzero_coefs) # encode signal Y = np.dot(D, X) return map(np.squeeze, (Y, D, X)) def make_sparse_uncorrelated(n_samples=100, n_features=10, random_state=None): """Generate a random regression problem with sparse uncorrelated design This dataset is described in Celeux et al [1]. as:: X ~ N(0, 1) y(X) = X[:, 0] + 2 * X[:, 1] - 2 * X[:, 2] - 1.5 * X[:, 3] Only the first 4 features are informative. The remaining features are useless. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of samples. n_features : int, optional (default=10) The number of features. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, n_features] The input samples. y : array of shape [n_samples] The output values. References ---------- .. [1] G. Celeux, M. El Anbari, J.-M. Marin, C. P. Robert, "Regularization in regression: comparing Bayesian and frequentist methods in a poorly informative situation", 2009. """ generator = check_random_state(random_state) X = generator.normal(loc=0, scale=1, size=(n_samples, n_features)) y = generator.normal(loc=(X[:, 0] + 2 * X[:, 1] - 2 * X[:, 2] - 1.5 * X[:, 3]), scale=np.ones(n_samples)) return X, y def make_spd_matrix(n_dim, random_state=None): """Generate a random symmetric, positive-definite matrix. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_dim : int The matrix dimension. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_dim, n_dim] The random symmetric, positive-definite matrix. See also -------- make_sparse_spd_matrix """ generator = check_random_state(random_state) A = generator.rand(n_dim, n_dim) U, s, V = linalg.svd(np.dot(A.T, A)) X = np.dot(np.dot(U, 1.0 + np.diag(generator.rand(n_dim))), V) return X def make_sparse_spd_matrix(dim=1, alpha=0.95, norm_diag=False, smallest_coef=.1, largest_coef=.9, random_state=None): """Generate a sparse symmetric definite positive matrix. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- dim: integer, optional (default=1) The size of the random matrix to generate. alpha: float between 0 and 1, optional (default=0.95) The probability that a coefficient is non zero (see notes). random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. largest_coef : float between 0 and 1, optional (default=0.9) The value of the largest coefficient. smallest_coef : float between 0 and 1, optional (default=0.1) The value of the smallest coefficient. norm_diag : boolean, optional (default=False) Whether to normalize the output matrix to make the leading diagonal elements all 1 Returns ------- prec : sparse matrix of shape (dim, dim) The generated matrix. Notes ----- The sparsity is actually imposed on the cholesky factor of the matrix. Thus alpha does not translate directly into the filling fraction of the matrix itself. See also -------- make_spd_matrix """ random_state = check_random_state(random_state) chol = -np.eye(dim) aux = random_state.rand(dim, dim) aux[aux < alpha] = 0 aux[aux > alpha] = (smallest_coef + (largest_coef - smallest_coef) * random_state.rand(np.sum(aux > alpha))) aux = np.tril(aux, k=-1) # Permute the lines: we don't want to have asymmetries in the final # SPD matrix permutation = random_state.permutation(dim) aux = aux[permutation].T[permutation] chol += aux prec = np.dot(chol.T, chol) if norm_diag: # Form the diagonal vector into a row matrix d = np.diag(prec).reshape(1, prec.shape[0]) d = 1. / np.sqrt(d) prec *= d prec *= d.T return prec def make_swiss_roll(n_samples=100, noise=0.0, random_state=None): """Generate a swiss roll dataset. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of sample points on the S curve. noise : float, optional (default=0.0) The standard deviation of the gaussian noise. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, 3] The points. t : array of shape [n_samples] The univariate position of the sample according to the main dimension of the points in the manifold. Notes ----- The algorithm is from Marsland [1]. References ---------- .. [1] S. Marsland, "Machine Learning: An Algorithmic Perspective", Chapter 10, 2009. http://www-ist.massey.ac.nz/smarsland/Code/10/lle.py """ generator = check_random_state(random_state) t = 1.5 * np.pi * (1 + 2 * generator.rand(1, n_samples)) x = t * np.cos(t) y = 21 * generator.rand(1, n_samples) z = t * np.sin(t) X = np.concatenate((x, y, z)) X += noise * generator.randn(3, n_samples) X = X.T t = np.squeeze(t) return X, t def make_s_curve(n_samples=100, noise=0.0, random_state=None): """Generate an S curve dataset. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- n_samples : int, optional (default=100) The number of sample points on the S curve. noise : float, optional (default=0.0) The standard deviation of the gaussian noise. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, 3] The points. t : array of shape [n_samples] The univariate position of the sample according to the main dimension of the points in the manifold. """ generator = check_random_state(random_state) t = 3 * np.pi * (generator.rand(1, n_samples) - 0.5) x = np.sin(t) y = 2.0 * generator.rand(1, n_samples) z = np.sign(t) * (np.cos(t) - 1) X = np.concatenate((x, y, z)) X += noise * generator.randn(3, n_samples) X = X.T t = np.squeeze(t) return X, t def make_gaussian_quantiles(mean=None, cov=1., n_samples=100, n_features=2, n_classes=3, shuffle=True, random_state=None): """Generate isotropic Gaussian and label samples by quantile This classification dataset is constructed by taking a multi-dimensional standard normal distribution and defining classes separated by nested concentric multi-dimensional spheres such that roughly equal numbers of samples are in each class (quantiles of the :math:`\chi^2` distribution). Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- mean : array of shape [n_features], optional (default=None) The mean of the multi-dimensional normal distribution. If None then use the origin (0, 0, ...). cov : float, optional (default=1.) The covariance matrix will be this value times the unit matrix. This dataset only produces symmetric normal distributions. n_samples : int, optional (default=100) The total number of points equally divided among classes. n_features : int, optional (default=2) The number of features for each sample. n_classes : int, optional (default=3) The number of classes shuffle : boolean, optional (default=True) Shuffle the samples. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape [n_samples, n_features] The generated samples. y : array of shape [n_samples] The integer labels for quantile membership of each sample. Notes ----- The dataset is from Zhu et al [1]. References ---------- .. [1] J. Zhu, H. Zou, S. Rosset, T. Hastie, "Multi-class AdaBoost", 2009. """ if n_samples < n_classes: raise ValueError("n_samples must be at least n_classes") generator = check_random_state(random_state) if mean is None: mean = np.zeros(n_features) else: mean = np.array(mean) # Build multivariate normal distribution X = generator.multivariate_normal(mean, cov * np.identity(n_features), (n_samples,)) # Sort by distance from origin idx = np.argsort(np.sum((X - mean[np.newaxis, :]) ** 2, axis=1)) X = X[idx, :] # Label by quantile step = n_samples // n_classes y = np.hstack([np.repeat(np.arange(n_classes), step), np.repeat(n_classes - 1, n_samples - step * n_classes)]) if shuffle: X, y = util_shuffle(X, y, random_state=generator) return X, y def _shuffle(data, random_state=None): generator = check_random_state(random_state) n_rows, n_cols = data.shape row_idx = generator.permutation(n_rows) col_idx = generator.permutation(n_cols) result = data[row_idx][:, col_idx] return result, row_idx, col_idx def make_biclusters(shape, n_clusters, noise=0.0, minval=10, maxval=100, shuffle=True, random_state=None): """Generate an array with constant block diagonal structure for biclustering. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- shape : iterable (n_rows, n_cols) The shape of the result. n_clusters : integer The number of biclusters. noise : float, optional (default=0.0) The standard deviation of the gaussian noise. minval : int, optional (default=10) Minimum value of a bicluster. maxval : int, optional (default=100) Maximum value of a bicluster. shuffle : boolean, optional (default=True) Shuffle the samples. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape `shape` The generated array. rows : array of shape (n_clusters, X.shape[0],) The indicators for cluster membership of each row. cols : array of shape (n_clusters, X.shape[1],) The indicators for cluster membership of each column. References ---------- .. [1] Dhillon, I. S. (2001, August). Co-clustering documents and words using bipartite spectral graph partitioning. In Proceedings of the seventh ACM SIGKDD international conference on Knowledge discovery and data mining (pp. 269-274). ACM. See also -------- make_checkerboard """ generator = check_random_state(random_state) n_rows, n_cols = shape consts = generator.uniform(minval, maxval, n_clusters) # row and column clusters of approximately equal sizes row_sizes = generator.multinomial(n_rows, np.repeat(1.0 / n_clusters, n_clusters)) col_sizes = generator.multinomial(n_cols, np.repeat(1.0 / n_clusters, n_clusters)) row_labels = np.hstack(list(np.repeat(val, rep) for val, rep in zip(range(n_clusters), row_sizes))) col_labels = np.hstack(list(np.repeat(val, rep) for val, rep in zip(range(n_clusters), col_sizes))) result = np.zeros(shape, dtype=np.float64) for i in range(n_clusters): selector = np.outer(row_labels == i, col_labels == i) result[selector] += consts[i] if noise > 0: result += generator.normal(scale=noise, size=result.shape) if shuffle: result, row_idx, col_idx = _shuffle(result, random_state) row_labels = row_labels[row_idx] col_labels = col_labels[col_idx] rows = np.vstack(row_labels == c for c in range(n_clusters)) cols = np.vstack(col_labels == c for c in range(n_clusters)) return result, rows, cols def make_checkerboard(shape, n_clusters, noise=0.0, minval=10, maxval=100, shuffle=True, random_state=None): """Generate an array with block checkerboard structure for biclustering. Read more in the :ref:`User Guide <sample_generators>`. Parameters ---------- shape : iterable (n_rows, n_cols) The shape of the result. n_clusters : integer or iterable (n_row_clusters, n_column_clusters) The number of row and column clusters. noise : float, optional (default=0.0) The standard deviation of the gaussian noise. minval : int, optional (default=10) Minimum value of a bicluster. maxval : int, optional (default=100) Maximum value of a bicluster. shuffle : boolean, optional (default=True) Shuffle the samples. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Returns ------- X : array of shape `shape` The generated array. rows : array of shape (n_clusters, X.shape[0],) The indicators for cluster membership of each row. cols : array of shape (n_clusters, X.shape[1],) The indicators for cluster membership of each column. References ---------- .. [1] Kluger, Y., Basri, R., Chang, J. T., & Gerstein, M. (2003). Spectral biclustering of microarray data: coclustering genes and conditions. Genome research, 13(4), 703-716. See also -------- make_biclusters """ generator = check_random_state(random_state) if hasattr(n_clusters, "__len__"): n_row_clusters, n_col_clusters = n_clusters else: n_row_clusters = n_col_clusters = n_clusters # row and column clusters of approximately equal sizes n_rows, n_cols = shape row_sizes = generator.multinomial(n_rows, np.repeat(1.0 / n_row_clusters, n_row_clusters)) col_sizes = generator.multinomial(n_cols, np.repeat(1.0 / n_col_clusters, n_col_clusters)) row_labels = np.hstack(list(np.repeat(val, rep) for val, rep in zip(range(n_row_clusters), row_sizes))) col_labels = np.hstack(list(np.repeat(val, rep) for val, rep in zip(range(n_col_clusters), col_sizes))) result = np.zeros(shape, dtype=np.float64) for i in range(n_row_clusters): for j in range(n_col_clusters): selector = np.outer(row_labels == i, col_labels == j) result[selector] += generator.uniform(minval, maxval) if noise > 0: result += generator.normal(scale=noise, size=result.shape) if shuffle: result, row_idx, col_idx = _shuffle(result, random_state) row_labels = row_labels[row_idx] col_labels = col_labels[col_idx] rows = np.vstack(row_labels == label for label in range(n_row_clusters) for _ in range(n_col_clusters)) cols = np.vstack(col_labels == label for _ in range(n_row_clusters) for label in range(n_col_clusters)) return result, rows, cols
bsd-3-clause
alexeyum/scikit-learn
examples/ensemble/plot_forest_importances_faces.py
403
1519
""" ================================================= Pixel importances with a parallel forest of trees ================================================= This example shows the use of forests of trees to evaluate the importance of the pixels in an image classification task (faces). The hotter the pixel, the more important. The code below also illustrates how the construction and the computation of the predictions can be parallelized within multiple jobs. """ print(__doc__) from time import time import matplotlib.pyplot as plt from sklearn.datasets import fetch_olivetti_faces from sklearn.ensemble import ExtraTreesClassifier # Number of cores to use to perform parallel fitting of the forest model n_jobs = 1 # Load the faces dataset data = fetch_olivetti_faces() X = data.images.reshape((len(data.images), -1)) y = data.target mask = y < 5 # Limit to 5 classes X = X[mask] y = y[mask] # Build a forest and compute the pixel importances print("Fitting ExtraTreesClassifier on faces data with %d cores..." % n_jobs) t0 = time() forest = ExtraTreesClassifier(n_estimators=1000, max_features=128, n_jobs=n_jobs, random_state=0) forest.fit(X, y) print("done in %0.3fs" % (time() - t0)) importances = forest.feature_importances_ importances = importances.reshape(data.images[0].shape) # Plot pixel importances plt.matshow(importances, cmap=plt.cm.hot) plt.title("Pixel importances with forests of trees") plt.show()
bsd-3-clause
lpenguin/pandas-qt
tests/test_DataSearch.py
4
5775
# -*- coding: utf-8 -*- from pandasqt.compat import Qt, QtCore, QtGui import pytest import pytestqt import decimal import numpy import pandas from pandasqt.models.DataFrameModel import DataFrameModel, DATAFRAME_ROLE from pandasqt.models.DataSearch import DataSearch class TestDataSearch(object): @pytest.fixture def dataFrame(self): data = [ [0, 1, 2, 3, 4], [5, 6, 7, 8, 9], [10, 11, 12, 13, 14] ] columns = ['Foo', 'Bar', 'Spam', 'Eggs', 'Baz'] dataFrame = pandas.DataFrame(data, columns=columns) return dataFrame @pytest.fixture def geoDataFrame(self): data = [ [0, 1, 2, 3, 4, 49.1234, 8.123], [5, 6, 7, 8, 9, 52.1234, 13.123], [10, 11, 12, 13, 14, 55.1234, 16.123] ] columns = ['Foo', 'Bar', 'Spam', 'Eggs', 'Baz', 'lat', 'lng'] dataFrame = pandas.DataFrame(data, columns=columns) return dataFrame def test_init(self, dataFrame): filterString = 'Foo < 10' datasearch = DataSearch("Test", filterString) assert datasearch._filterString == filterString assert isinstance(datasearch._dataFrame, pandas.DataFrame) assert datasearch.name == 'Test' datasearch = DataSearch("Test2") assert datasearch._filterString == '' assert isinstance(datasearch._dataFrame, pandas.DataFrame) assert datasearch.name == 'Test2' datasearch = DataSearch("Test3", dataFrame=dataFrame) assert datasearch._filterString == '' assert isinstance(datasearch._dataFrame, pandas.DataFrame) assert datasearch.name == 'Test3' assert len(datasearch._dataFrame.index) == 3 def test_repr(self, dataFrame): datasearch = DataSearch("Test2") assert str(datasearch).startswith('DataSearch(') assert str(datasearch).endswith('Test2 ()') def test_dataFrame(self, dataFrame): datasearch = DataSearch("Test") assert datasearch.dataFrame().empty assert isinstance(datasearch.dataFrame(), pandas.DataFrame) datasearch = DataSearch("Test", dataFrame=dataFrame) assert len(datasearch.dataFrame()) == 3 def test_filterString(self): datasearch = DataSearch("Test") assert datasearch.filterString() == '' datasearch = DataSearch('Test2', filterString='Hello World') assert datasearch.filterString() == 'Hello World' def test_setFilterString(self): datasearch = DataSearch("Test") filterString = 'foo bar' datasearch.setFilterString(filterString) assert datasearch.filterString() == filterString filterString = ' foo bar ' datasearch.setFilterString(filterString) assert datasearch.filterString() != filterString assert datasearch.filterString() == filterString.strip() def test_search(self, dataFrame): datasearch = DataSearch('Test', dataFrame=dataFrame) filterString = 'Foo < 10' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 2 filterString = 'Foo < 10 and Bar' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert not valid filterString = '(Foo < 10) & (Bar > 1)' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 1 filterString = '(Monty < 10) & (Bar > 1)' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert not valid def test_freeSearch(self, dataFrame): datasearch = DataSearch('Test', dataFrame=dataFrame) filterString = 'freeSearch("0")' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 2 filterString = 'freeSearch(1)' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert not valid filterString = 'freeSearch("12")' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 1 def test_extentSearch(self, geoDataFrame, dataFrame): datasearch = DataSearch('Test', dataFrame=geoDataFrame) filterString = 'extentSearch(51, 9, 55, 14)' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 1 datasearch = DataSearch('Test', dataFrame=dataFrame) filterString = 'extentSearch(51, 9, 55, 14)' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 0 def test_indexSearch(self, dataFrame): datasearch = DataSearch('Test', dataFrame=dataFrame) filterString = 'indexSearch([0])' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 1 filterString = 'indexSearch([0, 2])' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 2 filterString = 'indexSearch([0, 1, 2])' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 3 filterString = 'indexSearch([99])' datasearch.setFilterString(filterString) ret, valid = datasearch.search() assert valid assert sum(ret) == 0 if __name__ == '__main__': pytest.main()
mit
scls19fr/blaze
blaze/compute/tests/test_core_compute.py
8
4256
from __future__ import absolute_import, division, print_function import pytest import operator from datashape import discover, dshape from blaze.compute.core import (compute_up, compute, bottom_up_until_type_break, top_then_bottom_then_top_again_etc, swap_resources_into_scope) from blaze.expr import by, symbol, Expr, Symbol from blaze.dispatch import dispatch from blaze.compatibility import raises, reduce from blaze.utils import example import pandas as pd import numpy as np def test_errors(): t = symbol('t', 'var * {foo: int}') with raises(NotImplementedError): compute_up(by(t, count=t.count()), 1) def test_optimize(): class Foo(object): pass s = symbol('s', '5 * {x: int, y: int}') @dispatch(Expr, Foo) def compute_down(expr, foo): return str(expr) assert compute(s.x * 2, Foo()) == "s.x * 2" @dispatch(Expr, Foo) def optimize(expr, foo): return expr + 1 assert compute(s.x * 2, Foo()) == "(s.x * 2) + 1" def test_bottom_up_until_type_break(): s = symbol('s', 'var * {name: string, amount: int}') data = np.array([('Alice', 100), ('Bob', 200), ('Charlie', 300)], dtype=[('name', 'S7'), ('amount', 'i4')]) e = (s.amount + 1).distinct() expr, scope = bottom_up_until_type_break(e, {s: data}) amount = symbol('amount', 'var * int64', token=1) assert expr.isidentical(amount) assert len(scope) == 1 assert amount in scope assert (scope[amount] == np.array([101, 201, 301], dtype='i4')).all() # This computation has a type change midstream, so we stop and get the # unfinished computation. e = s.amount.sum() + 1 expr, scope = bottom_up_until_type_break(e, {s: data}) amount_sum = symbol('amount_sum', 'int64') assert expr.isidentical(amount_sum + 1) assert len(scope) == 1 assert amount_sum in scope assert scope[amount_sum] == 600 # ensure that we work on binops with one child x = symbol('x', 'real') expr, scope = bottom_up_until_type_break(x + x, {x: 1}) assert len(scope) == 1 x2 = list(scope.keys())[0] assert isinstance(x2, Symbol) assert isinstance(expr, Symbol) assert scope[x2] == 2 def test_top_then_bottom_then_top_again_etc(): s = symbol('s', 'var * {name: string, amount: int32}') data = np.array([('Alice', 100), ('Bob', 200), ('Charlie', 300)], dtype=[('name', 'S7'), ('amount', 'i4')]) e = s.amount.sum() + 1 assert top_then_bottom_then_top_again_etc(e, {s: data}) == 601 def test_swap_resources_into_scope(): from blaze import Data t = Data([1, 2, 3], dshape='3 * int', name='t') expr, scope = swap_resources_into_scope(t.head(2), {t: t.data}) assert t._resources() assert not expr._resources() assert t not in scope def test_compute_up_on_dict(): d = {'a': [1, 2, 3], 'b': [4, 5, 6]} assert str(discover(d)) == str(dshape('{a: 3 * int64, b: 3 * int64}')) s = symbol('s', discover(d)) assert compute(s.a, {s: d}) == [1, 2, 3] def test_pre_compute_on_multiple_datasets_is_selective(): from odo import CSV from blaze import Data from blaze.cached import CachedDataset df = pd.DataFrame([[1, 'Alice', 100], [2, 'Bob', -200], [3, 'Charlie', 300], [4, 'Denis', 400], [5, 'Edith', -500]], columns=['id', 'name', 'amount']) iris = CSV(example('iris.csv')) dset = CachedDataset({'df': df, 'iris': iris}) d = Data(dset) assert str(compute(d.df.amount)) == str(df.amount) def test_raises_on_valid_expression_but_no_implementation(): class MyExpr(Expr): __slots__ = '_hash', '_child' @property def dshape(self): return self._child.dshape t = symbol('t', 'var * {amount: real}') expr = MyExpr(t.amount) df = [(1.0,), (2.0,), (3.0,)] with pytest.raises(NotImplementedError): compute(expr, df) @pytest.mark.parametrize('n', range(2, 11)) def test_simple_add(n): x = symbol('x', 'int') expr = reduce(operator.add, [x] * n) assert compute(expr, 1) == n
bsd-3-clause
nipe0324/kaggle-keypoints-detection-keras
load_data.py
1
1888
import os import numpy as np from pandas.io.parsers import read_csv from sklearn.utils import shuffle from utils import reshape2d_by_image_dim_ordering from keras import backend as K FTRAIN = 'data/training.csv' FTEST = 'data/test.csv' def load(test=False, cols=None): """testがTrueの場合はFTESTからデータを読み込み、Falseの場合はFTRAINから読み込みます。 colsにリストが渡された場合にはそのカラムに関するデータのみ返します。 """ fname = FTEST if test else FTRAIN df = read_csv(os.path.expanduser(fname)) # pandasのdataframeを使用 # スペースで句切られているピクセル値をnumpy arrayに変換 df['Image'] = df['Image'].apply(lambda im: np.fromstring(im, sep=' ')) if cols: # カラムに関連するデータのみを抽出 df = df[list(cols) + ['Image']] print(df.count()) # カラム毎に値が存在する行数を出力 df = df.dropna() # データが欠けている行は捨てる X = np.vstack(df['Image'].values) / 255. # 0から1の値に変換 X = X.astype(np.float32) if not test: # ラベルが存在するのはFTRAINのみ y = df[df.columns[:-1]].values y = (y - 48) / 48 # -1から1の値に変換 X, y = shuffle(X, y, random_state=42) # データをシャッフル y = y.astype(np.float32) else: y = None return X, y def load2d(test=False, cols=None): X, y = load(test, cols) # image_dim_orderring に合わせて2D画像のshapeを変える X, _ = reshape2d_by_image_dim_ordering(X) return X, y if __name__ == '__main__': X, y = load() print("X.shape == {}; X.min == {:.3f}; X.max == {:.3f}".format( X.shape, X.min(), X.max())) print("y.shape == {}; y.min == {:.3f}; y.max == {:.3f}".format( y.shape, y.min(), y.max()))
apache-2.0
nomadcube/scikit-learn
sklearn/tree/tests/test_tree.py
72
47440
""" Testing for the tree module (sklearn.tree). """ import pickle from functools import partial from itertools import product import platform import numpy as np from scipy.sparse import csc_matrix from scipy.sparse import csr_matrix from scipy.sparse import coo_matrix from sklearn.random_projection import sparse_random_matrix from sklearn.metrics import accuracy_score from sklearn.metrics import mean_squared_error from sklearn.utils.testing import assert_array_equal from sklearn.utils.testing import assert_array_almost_equal from sklearn.utils.testing import assert_almost_equal from sklearn.utils.testing import assert_equal from sklearn.utils.testing import assert_in from sklearn.utils.testing import assert_raises from sklearn.utils.testing import assert_greater from sklearn.utils.testing import assert_greater_equal from sklearn.utils.testing import assert_less from sklearn.utils.testing import assert_true from sklearn.utils.testing import raises from sklearn.utils.validation import check_random_state from sklearn.utils.validation import NotFittedError from sklearn.tree import DecisionTreeClassifier from sklearn.tree import DecisionTreeRegressor from sklearn.tree import ExtraTreeClassifier from sklearn.tree import ExtraTreeRegressor from sklearn import tree from sklearn.tree.tree import SPARSE_SPLITTERS from sklearn.tree._tree import TREE_LEAF from sklearn import datasets from sklearn.preprocessing._weights import _balance_weights CLF_CRITERIONS = ("gini", "entropy") REG_CRITERIONS = ("mse", ) CLF_TREES = { "DecisionTreeClassifier": DecisionTreeClassifier, "Presort-DecisionTreeClassifier": partial(DecisionTreeClassifier, splitter="presort-best"), "ExtraTreeClassifier": ExtraTreeClassifier, } REG_TREES = { "DecisionTreeRegressor": DecisionTreeRegressor, "Presort-DecisionTreeRegressor": partial(DecisionTreeRegressor, splitter="presort-best"), "ExtraTreeRegressor": ExtraTreeRegressor, } ALL_TREES = dict() ALL_TREES.update(CLF_TREES) ALL_TREES.update(REG_TREES) SPARSE_TREES = [name for name, Tree in ALL_TREES.items() if Tree().splitter in SPARSE_SPLITTERS] X_small = np.array([ [0, 0, 4, 0, 0, 0, 1, -14, 0, -4, 0, 0, 0, 0, ], [0, 0, 5, 3, 0, -4, 0, 0, 1, -5, 0.2, 0, 4, 1, ], [-1, -1, 0, 0, -4.5, 0, 0, 2.1, 1, 0, 0, -4.5, 0, 1, ], [-1, -1, 0, -1.2, 0, 0, 0, 0, 0, 0, 0.2, 0, 0, 1, ], [-1, -1, 0, 0, 0, 0, 0, 3, 0, 0, 0, 0, 0, 1, ], [-1, -2, 0, 4, -3, 10, 4, 0, -3.2, 0, 4, 3, -4, 1, ], [2.11, 0, -6, -0.5, 0, 11, 0, 0, -3.2, 6, 0.5, 0, -3, 1, ], [2.11, 0, -6, -0.5, 0, 11, 0, 0, -3.2, 6, 0, 0, -2, 1, ], [2.11, 8, -6, -0.5, 0, 11, 0, 0, -3.2, 6, 0, 0, -2, 1, ], [2.11, 8, -6, -0.5, 0, 11, 0, 0, -3.2, 6, 0.5, 0, -1, 0, ], [2, 8, 5, 1, 0.5, -4, 10, 0, 1, -5, 3, 0, 2, 0, ], [2, 0, 1, 1, 1, -1, 1, 0, 0, -2, 3, 0, 1, 0, ], [2, 0, 1, 2, 3, -1, 10, 2, 0, -1, 1, 2, 2, 0, ], [1, 1, 0, 2, 2, -1, 1, 2, 0, -5, 1, 2, 3, 0, ], [3, 1, 0, 3, 0, -4, 10, 0, 1, -5, 3, 0, 3, 1, ], [2.11, 8, -6, -0.5, 0, 1, 0, 0, -3.2, 6, 0.5, 0, -3, 1, ], [2.11, 8, -6, -0.5, 0, 1, 0, 0, -3.2, 6, 1.5, 1, -1, -1, ], [2.11, 8, -6, -0.5, 0, 10, 0, 0, -3.2, 6, 0.5, 0, -1, -1, ], [2, 0, 5, 1, 0.5, -2, 10, 0, 1, -5, 3, 1, 0, -1, ], [2, 0, 1, 1, 1, -2, 1, 0, 0, -2, 0, 0, 0, 1, ], [2, 1, 1, 1, 2, -1, 10, 2, 0, -1, 0, 2, 1, 1, ], [1, 1, 0, 0, 1, -3, 1, 2, 0, -5, 1, 2, 1, 1, ], [3, 1, 0, 1, 0, -4, 1, 0, 1, -2, 0, 0, 1, 0, ]]) y_small = [1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0, 1, 0, 0, 0, 0] y_small_reg = [1.0, 2.1, 1.2, 0.05, 10, 2.4, 3.1, 1.01, 0.01, 2.98, 3.1, 1.1, 0.0, 1.2, 2, 11, 0, 0, 4.5, 0.201, 1.06, 0.9, 0] # toy sample X = [[-2, -1], [-1, -1], [-1, -2], [1, 1], [1, 2], [2, 1]] y = [-1, -1, -1, 1, 1, 1] T = [[-1, -1], [2, 2], [3, 2]] true_result = [-1, 1, 1] # also load the iris dataset # and randomly permute it iris = datasets.load_iris() rng = np.random.RandomState(1) perm = rng.permutation(iris.target.size) iris.data = iris.data[perm] iris.target = iris.target[perm] # also load the boston dataset # and randomly permute it boston = datasets.load_boston() perm = rng.permutation(boston.target.size) boston.data = boston.data[perm] boston.target = boston.target[perm] digits = datasets.load_digits() perm = rng.permutation(digits.target.size) digits.data = digits.data[perm] digits.target = digits.target[perm] random_state = check_random_state(0) X_multilabel, y_multilabel = datasets.make_multilabel_classification( random_state=0, return_indicator=True, n_samples=30, n_features=10) X_sparse_pos = random_state.uniform(size=(20, 5)) X_sparse_pos[X_sparse_pos <= 0.8] = 0. y_random = random_state.randint(0, 4, size=(20, )) X_sparse_mix = sparse_random_matrix(20, 10, density=0.25, random_state=0) DATASETS = { "iris": {"X": iris.data, "y": iris.target}, "boston": {"X": boston.data, "y": boston.target}, "digits": {"X": digits.data, "y": digits.target}, "toy": {"X": X, "y": y}, "clf_small": {"X": X_small, "y": y_small}, "reg_small": {"X": X_small, "y": y_small_reg}, "multilabel": {"X": X_multilabel, "y": y_multilabel}, "sparse-pos": {"X": X_sparse_pos, "y": y_random}, "sparse-neg": {"X": - X_sparse_pos, "y": y_random}, "sparse-mix": {"X": X_sparse_mix, "y": y_random}, "zeros": {"X": np.zeros((20, 3)), "y": y_random} } for name in DATASETS: DATASETS[name]["X_sparse"] = csc_matrix(DATASETS[name]["X"]) def assert_tree_equal(d, s, message): assert_equal(s.node_count, d.node_count, "{0}: inequal number of node ({1} != {2})" "".format(message, s.node_count, d.node_count)) assert_array_equal(d.children_right, s.children_right, message + ": inequal children_right") assert_array_equal(d.children_left, s.children_left, message + ": inequal children_left") external = d.children_right == TREE_LEAF internal = np.logical_not(external) assert_array_equal(d.feature[internal], s.feature[internal], message + ": inequal features") assert_array_equal(d.threshold[internal], s.threshold[internal], message + ": inequal threshold") assert_array_equal(d.n_node_samples.sum(), s.n_node_samples.sum(), message + ": inequal sum(n_node_samples)") assert_array_equal(d.n_node_samples, s.n_node_samples, message + ": inequal n_node_samples") assert_almost_equal(d.impurity, s.impurity, err_msg=message + ": inequal impurity") assert_array_almost_equal(d.value[external], s.value[external], err_msg=message + ": inequal value") def test_classification_toy(): # Check classification on a toy dataset. for name, Tree in CLF_TREES.items(): clf = Tree(random_state=0) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result, "Failed with {0}".format(name)) clf = Tree(max_features=1, random_state=1) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result, "Failed with {0}".format(name)) def test_weighted_classification_toy(): # Check classification on a weighted toy dataset. for name, Tree in CLF_TREES.items(): clf = Tree(random_state=0) clf.fit(X, y, sample_weight=np.ones(len(X))) assert_array_equal(clf.predict(T), true_result, "Failed with {0}".format(name)) clf.fit(X, y, sample_weight=np.ones(len(X)) * 0.5) assert_array_equal(clf.predict(T), true_result, "Failed with {0}".format(name)) def test_regression_toy(): # Check regression on a toy dataset. for name, Tree in REG_TREES.items(): reg = Tree(random_state=1) reg.fit(X, y) assert_almost_equal(reg.predict(T), true_result, err_msg="Failed with {0}".format(name)) clf = Tree(max_features=1, random_state=1) clf.fit(X, y) assert_almost_equal(reg.predict(T), true_result, err_msg="Failed with {0}".format(name)) def test_xor(): # Check on a XOR problem y = np.zeros((10, 10)) y[:5, :5] = 1 y[5:, 5:] = 1 gridx, gridy = np.indices(y.shape) X = np.vstack([gridx.ravel(), gridy.ravel()]).T y = y.ravel() for name, Tree in CLF_TREES.items(): clf = Tree(random_state=0) clf.fit(X, y) assert_equal(clf.score(X, y), 1.0, "Failed with {0}".format(name)) clf = Tree(random_state=0, max_features=1) clf.fit(X, y) assert_equal(clf.score(X, y), 1.0, "Failed with {0}".format(name)) def test_iris(): # Check consistency on dataset iris. for (name, Tree), criterion in product(CLF_TREES.items(), CLF_CRITERIONS): clf = Tree(criterion=criterion, random_state=0) clf.fit(iris.data, iris.target) score = accuracy_score(clf.predict(iris.data), iris.target) assert_greater(score, 0.9, "Failed with {0}, criterion = {1} and score = {2}" "".format(name, criterion, score)) clf = Tree(criterion=criterion, max_features=2, random_state=0) clf.fit(iris.data, iris.target) score = accuracy_score(clf.predict(iris.data), iris.target) assert_greater(score, 0.5, "Failed with {0}, criterion = {1} and score = {2}" "".format(name, criterion, score)) def test_boston(): # Check consistency on dataset boston house prices. for (name, Tree), criterion in product(REG_TREES.items(), REG_CRITERIONS): reg = Tree(criterion=criterion, random_state=0) reg.fit(boston.data, boston.target) score = mean_squared_error(boston.target, reg.predict(boston.data)) assert_less(score, 1, "Failed with {0}, criterion = {1} and score = {2}" "".format(name, criterion, score)) # using fewer features reduces the learning ability of this tree, # but reduces training time. reg = Tree(criterion=criterion, max_features=6, random_state=0) reg.fit(boston.data, boston.target) score = mean_squared_error(boston.target, reg.predict(boston.data)) assert_less(score, 2, "Failed with {0}, criterion = {1} and score = {2}" "".format(name, criterion, score)) def test_probability(): # Predict probabilities using DecisionTreeClassifier. for name, Tree in CLF_TREES.items(): clf = Tree(max_depth=1, max_features=1, random_state=42) clf.fit(iris.data, iris.target) prob_predict = clf.predict_proba(iris.data) assert_array_almost_equal(np.sum(prob_predict, 1), np.ones(iris.data.shape[0]), err_msg="Failed with {0}".format(name)) assert_array_equal(np.argmax(prob_predict, 1), clf.predict(iris.data), err_msg="Failed with {0}".format(name)) assert_almost_equal(clf.predict_proba(iris.data), np.exp(clf.predict_log_proba(iris.data)), 8, err_msg="Failed with {0}".format(name)) def test_arrayrepr(): # Check the array representation. # Check resize X = np.arange(10000)[:, np.newaxis] y = np.arange(10000) for name, Tree in REG_TREES.items(): reg = Tree(max_depth=None, random_state=0) reg.fit(X, y) def test_pure_set(): # Check when y is pure. X = [[-2, -1], [-1, -1], [-1, -2], [1, 1], [1, 2], [2, 1]] y = [1, 1, 1, 1, 1, 1] for name, TreeClassifier in CLF_TREES.items(): clf = TreeClassifier(random_state=0) clf.fit(X, y) assert_array_equal(clf.predict(X), y, err_msg="Failed with {0}".format(name)) for name, TreeRegressor in REG_TREES.items(): reg = TreeRegressor(random_state=0) reg.fit(X, y) assert_almost_equal(clf.predict(X), y, err_msg="Failed with {0}".format(name)) def test_numerical_stability(): # Check numerical stability. X = np.array([ [152.08097839, 140.40744019, 129.75102234, 159.90493774], [142.50700378, 135.81935120, 117.82884979, 162.75781250], [127.28772736, 140.40744019, 129.75102234, 159.90493774], [132.37025452, 143.71923828, 138.35694885, 157.84558105], [103.10237122, 143.71928406, 138.35696411, 157.84559631], [127.71276855, 143.71923828, 138.35694885, 157.84558105], [120.91514587, 140.40744019, 129.75102234, 159.90493774]]) y = np.array( [1., 0.70209277, 0.53896582, 0., 0.90914464, 0.48026916, 0.49622521]) with np.errstate(all="raise"): for name, Tree in REG_TREES.items(): reg = Tree(random_state=0) reg.fit(X, y) reg.fit(X, -y) reg.fit(-X, y) reg.fit(-X, -y) def test_importances(): # Check variable importances. X, y = datasets.make_classification(n_samples=2000, n_features=10, n_informative=3, n_redundant=0, n_repeated=0, shuffle=False, random_state=0) for name, Tree in CLF_TREES.items(): clf = Tree(random_state=0) clf.fit(X, y) importances = clf.feature_importances_ n_important = np.sum(importances > 0.1) assert_equal(importances.shape[0], 10, "Failed with {0}".format(name)) assert_equal(n_important, 3, "Failed with {0}".format(name)) X_new = clf.transform(X, threshold="mean") assert_less(0, X_new.shape[1], "Failed with {0}".format(name)) assert_less(X_new.shape[1], X.shape[1], "Failed with {0}".format(name)) # Check on iris that importances are the same for all builders clf = DecisionTreeClassifier(random_state=0) clf.fit(iris.data, iris.target) clf2 = DecisionTreeClassifier(random_state=0, max_leaf_nodes=len(iris.data)) clf2.fit(iris.data, iris.target) assert_array_equal(clf.feature_importances_, clf2.feature_importances_) @raises(ValueError) def test_importances_raises(): # Check if variable importance before fit raises ValueError. clf = DecisionTreeClassifier() clf.feature_importances_ def test_importances_gini_equal_mse(): # Check that gini is equivalent to mse for binary output variable X, y = datasets.make_classification(n_samples=2000, n_features=10, n_informative=3, n_redundant=0, n_repeated=0, shuffle=False, random_state=0) # The gini index and the mean square error (variance) might differ due # to numerical instability. Since those instabilities mainly occurs at # high tree depth, we restrict this maximal depth. clf = DecisionTreeClassifier(criterion="gini", max_depth=5, random_state=0).fit(X, y) reg = DecisionTreeRegressor(criterion="mse", max_depth=5, random_state=0).fit(X, y) assert_almost_equal(clf.feature_importances_, reg.feature_importances_) assert_array_equal(clf.tree_.feature, reg.tree_.feature) assert_array_equal(clf.tree_.children_left, reg.tree_.children_left) assert_array_equal(clf.tree_.children_right, reg.tree_.children_right) assert_array_equal(clf.tree_.n_node_samples, reg.tree_.n_node_samples) def test_max_features(): # Check max_features. for name, TreeRegressor in REG_TREES.items(): reg = TreeRegressor(max_features="auto") reg.fit(boston.data, boston.target) assert_equal(reg.max_features_, boston.data.shape[1]) for name, TreeClassifier in CLF_TREES.items(): clf = TreeClassifier(max_features="auto") clf.fit(iris.data, iris.target) assert_equal(clf.max_features_, 2) for name, TreeEstimator in ALL_TREES.items(): est = TreeEstimator(max_features="sqrt") est.fit(iris.data, iris.target) assert_equal(est.max_features_, int(np.sqrt(iris.data.shape[1]))) est = TreeEstimator(max_features="log2") est.fit(iris.data, iris.target) assert_equal(est.max_features_, int(np.log2(iris.data.shape[1]))) est = TreeEstimator(max_features=1) est.fit(iris.data, iris.target) assert_equal(est.max_features_, 1) est = TreeEstimator(max_features=3) est.fit(iris.data, iris.target) assert_equal(est.max_features_, 3) est = TreeEstimator(max_features=0.01) est.fit(iris.data, iris.target) assert_equal(est.max_features_, 1) est = TreeEstimator(max_features=0.5) est.fit(iris.data, iris.target) assert_equal(est.max_features_, int(0.5 * iris.data.shape[1])) est = TreeEstimator(max_features=1.0) est.fit(iris.data, iris.target) assert_equal(est.max_features_, iris.data.shape[1]) est = TreeEstimator(max_features=None) est.fit(iris.data, iris.target) assert_equal(est.max_features_, iris.data.shape[1]) # use values of max_features that are invalid est = TreeEstimator(max_features=10) assert_raises(ValueError, est.fit, X, y) est = TreeEstimator(max_features=-1) assert_raises(ValueError, est.fit, X, y) est = TreeEstimator(max_features=0.0) assert_raises(ValueError, est.fit, X, y) est = TreeEstimator(max_features=1.5) assert_raises(ValueError, est.fit, X, y) est = TreeEstimator(max_features="foobar") assert_raises(ValueError, est.fit, X, y) def test_error(): # Test that it gives proper exception on deficient input. for name, TreeEstimator in CLF_TREES.items(): # predict before fit est = TreeEstimator() assert_raises(NotFittedError, est.predict_proba, X) est.fit(X, y) X2 = [-2, -1, 1] # wrong feature shape for sample assert_raises(ValueError, est.predict_proba, X2) for name, TreeEstimator in ALL_TREES.items(): # Invalid values for parameters assert_raises(ValueError, TreeEstimator(min_samples_leaf=-1).fit, X, y) assert_raises(ValueError, TreeEstimator(min_weight_fraction_leaf=-1).fit, X, y) assert_raises(ValueError, TreeEstimator(min_weight_fraction_leaf=0.51).fit, X, y) assert_raises(ValueError, TreeEstimator(min_samples_split=-1).fit, X, y) assert_raises(ValueError, TreeEstimator(max_depth=-1).fit, X, y) assert_raises(ValueError, TreeEstimator(max_features=42).fit, X, y) # Wrong dimensions est = TreeEstimator() y2 = y[:-1] assert_raises(ValueError, est.fit, X, y2) # Test with arrays that are non-contiguous. Xf = np.asfortranarray(X) est = TreeEstimator() est.fit(Xf, y) assert_almost_equal(est.predict(T), true_result) # predict before fitting est = TreeEstimator() assert_raises(NotFittedError, est.predict, T) # predict on vector with different dims est.fit(X, y) t = np.asarray(T) assert_raises(ValueError, est.predict, t[:, 1:]) # wrong sample shape Xt = np.array(X).T est = TreeEstimator() est.fit(np.dot(X, Xt), y) assert_raises(ValueError, est.predict, X) assert_raises(ValueError, est.apply, X) clf = TreeEstimator() clf.fit(X, y) assert_raises(ValueError, clf.predict, Xt) assert_raises(ValueError, clf.apply, Xt) # apply before fitting est = TreeEstimator() assert_raises(NotFittedError, est.apply, T) def test_min_samples_leaf(): # Test if leaves contain more than leaf_count training examples X = np.asfortranarray(iris.data.astype(tree._tree.DTYPE)) y = iris.target # test both DepthFirstTreeBuilder and BestFirstTreeBuilder # by setting max_leaf_nodes for max_leaf_nodes in (None, 1000): for name, TreeEstimator in ALL_TREES.items(): est = TreeEstimator(min_samples_leaf=5, max_leaf_nodes=max_leaf_nodes, random_state=0) est.fit(X, y) out = est.tree_.apply(X) node_counts = np.bincount(out) # drop inner nodes leaf_count = node_counts[node_counts != 0] assert_greater(np.min(leaf_count), 4, "Failed with {0}".format(name)) def check_min_weight_fraction_leaf(name, datasets, sparse=False): """Test if leaves contain at least min_weight_fraction_leaf of the training set""" if sparse: X = DATASETS[datasets]["X_sparse"].astype(np.float32) else: X = DATASETS[datasets]["X"].astype(np.float32) y = DATASETS[datasets]["y"] weights = rng.rand(X.shape[0]) total_weight = np.sum(weights) TreeEstimator = ALL_TREES[name] # test both DepthFirstTreeBuilder and BestFirstTreeBuilder # by setting max_leaf_nodes for max_leaf_nodes, frac in product((None, 1000), np.linspace(0, 0.5, 6)): est = TreeEstimator(min_weight_fraction_leaf=frac, max_leaf_nodes=max_leaf_nodes, random_state=0) est.fit(X, y, sample_weight=weights) if sparse: out = est.tree_.apply(X.tocsr()) else: out = est.tree_.apply(X) node_weights = np.bincount(out, weights=weights) # drop inner nodes leaf_weights = node_weights[node_weights != 0] assert_greater_equal( np.min(leaf_weights), total_weight * est.min_weight_fraction_leaf, "Failed with {0} " "min_weight_fraction_leaf={1}".format( name, est.min_weight_fraction_leaf)) def test_min_weight_fraction_leaf(): # Check on dense input for name in ALL_TREES: yield check_min_weight_fraction_leaf, name, "iris" # Check on sparse input for name in SPARSE_TREES: yield check_min_weight_fraction_leaf, name, "multilabel", True def test_pickle(): # Check that tree estimator are pickable for name, TreeClassifier in CLF_TREES.items(): clf = TreeClassifier(random_state=0) clf.fit(iris.data, iris.target) score = clf.score(iris.data, iris.target) serialized_object = pickle.dumps(clf) clf2 = pickle.loads(serialized_object) assert_equal(type(clf2), clf.__class__) score2 = clf2.score(iris.data, iris.target) assert_equal(score, score2, "Failed to generate same score " "after pickling (classification) " "with {0}".format(name)) for name, TreeRegressor in REG_TREES.items(): reg = TreeRegressor(random_state=0) reg.fit(boston.data, boston.target) score = reg.score(boston.data, boston.target) serialized_object = pickle.dumps(reg) reg2 = pickle.loads(serialized_object) assert_equal(type(reg2), reg.__class__) score2 = reg2.score(boston.data, boston.target) assert_equal(score, score2, "Failed to generate same score " "after pickling (regression) " "with {0}".format(name)) def test_multioutput(): # Check estimators on multi-output problems. X = [[-2, -1], [-1, -1], [-1, -2], [1, 1], [1, 2], [2, 1], [-2, 1], [-1, 1], [-1, 2], [2, -1], [1, -1], [1, -2]] y = [[-1, 0], [-1, 0], [-1, 0], [1, 1], [1, 1], [1, 1], [-1, 2], [-1, 2], [-1, 2], [1, 3], [1, 3], [1, 3]] T = [[-1, -1], [1, 1], [-1, 1], [1, -1]] y_true = [[-1, 0], [1, 1], [-1, 2], [1, 3]] # toy classification problem for name, TreeClassifier in CLF_TREES.items(): clf = TreeClassifier(random_state=0) y_hat = clf.fit(X, y).predict(T) assert_array_equal(y_hat, y_true) assert_equal(y_hat.shape, (4, 2)) proba = clf.predict_proba(T) assert_equal(len(proba), 2) assert_equal(proba[0].shape, (4, 2)) assert_equal(proba[1].shape, (4, 4)) log_proba = clf.predict_log_proba(T) assert_equal(len(log_proba), 2) assert_equal(log_proba[0].shape, (4, 2)) assert_equal(log_proba[1].shape, (4, 4)) # toy regression problem for name, TreeRegressor in REG_TREES.items(): reg = TreeRegressor(random_state=0) y_hat = reg.fit(X, y).predict(T) assert_almost_equal(y_hat, y_true) assert_equal(y_hat.shape, (4, 2)) def test_classes_shape(): # Test that n_classes_ and classes_ have proper shape. for name, TreeClassifier in CLF_TREES.items(): # Classification, single output clf = TreeClassifier(random_state=0) clf.fit(X, y) assert_equal(clf.n_classes_, 2) assert_array_equal(clf.classes_, [-1, 1]) # Classification, multi-output _y = np.vstack((y, np.array(y) * 2)).T clf = TreeClassifier(random_state=0) clf.fit(X, _y) assert_equal(len(clf.n_classes_), 2) assert_equal(len(clf.classes_), 2) assert_array_equal(clf.n_classes_, [2, 2]) assert_array_equal(clf.classes_, [[-1, 1], [-2, 2]]) def test_unbalanced_iris(): # Check class rebalancing. unbalanced_X = iris.data[:125] unbalanced_y = iris.target[:125] sample_weight = _balance_weights(unbalanced_y) for name, TreeClassifier in CLF_TREES.items(): clf = TreeClassifier(random_state=0) clf.fit(unbalanced_X, unbalanced_y, sample_weight=sample_weight) assert_almost_equal(clf.predict(unbalanced_X), unbalanced_y) def test_memory_layout(): # Check that it works no matter the memory layout for (name, TreeEstimator), dtype in product(ALL_TREES.items(), [np.float64, np.float32]): est = TreeEstimator(random_state=0) # Nothing X = np.asarray(iris.data, dtype=dtype) y = iris.target assert_array_equal(est.fit(X, y).predict(X), y) # C-order X = np.asarray(iris.data, order="C", dtype=dtype) y = iris.target assert_array_equal(est.fit(X, y).predict(X), y) # F-order X = np.asarray(iris.data, order="F", dtype=dtype) y = iris.target assert_array_equal(est.fit(X, y).predict(X), y) # Contiguous X = np.ascontiguousarray(iris.data, dtype=dtype) y = iris.target assert_array_equal(est.fit(X, y).predict(X), y) if est.splitter in SPARSE_SPLITTERS: # csr matrix X = csr_matrix(iris.data, dtype=dtype) y = iris.target assert_array_equal(est.fit(X, y).predict(X), y) # csc_matrix X = csc_matrix(iris.data, dtype=dtype) y = iris.target assert_array_equal(est.fit(X, y).predict(X), y) # Strided X = np.asarray(iris.data[::3], dtype=dtype) y = iris.target[::3] assert_array_equal(est.fit(X, y).predict(X), y) def test_sample_weight(): # Check sample weighting. # Test that zero-weighted samples are not taken into account X = np.arange(100)[:, np.newaxis] y = np.ones(100) y[:50] = 0.0 sample_weight = np.ones(100) sample_weight[y == 0] = 0.0 clf = DecisionTreeClassifier(random_state=0) clf.fit(X, y, sample_weight=sample_weight) assert_array_equal(clf.predict(X), np.ones(100)) # Test that low weighted samples are not taken into account at low depth X = np.arange(200)[:, np.newaxis] y = np.zeros(200) y[50:100] = 1 y[100:200] = 2 X[100:200, 0] = 200 sample_weight = np.ones(200) sample_weight[y == 2] = .51 # Samples of class '2' are still weightier clf = DecisionTreeClassifier(max_depth=1, random_state=0) clf.fit(X, y, sample_weight=sample_weight) assert_equal(clf.tree_.threshold[0], 149.5) sample_weight[y == 2] = .5 # Samples of class '2' are no longer weightier clf = DecisionTreeClassifier(max_depth=1, random_state=0) clf.fit(X, y, sample_weight=sample_weight) assert_equal(clf.tree_.threshold[0], 49.5) # Threshold should have moved # Test that sample weighting is the same as having duplicates X = iris.data y = iris.target duplicates = rng.randint(0, X.shape[0], 200) clf = DecisionTreeClassifier(random_state=1) clf.fit(X[duplicates], y[duplicates]) sample_weight = np.bincount(duplicates, minlength=X.shape[0]) clf2 = DecisionTreeClassifier(random_state=1) clf2.fit(X, y, sample_weight=sample_weight) internal = clf.tree_.children_left != tree._tree.TREE_LEAF assert_array_almost_equal(clf.tree_.threshold[internal], clf2.tree_.threshold[internal]) def test_sample_weight_invalid(): # Check sample weighting raises errors. X = np.arange(100)[:, np.newaxis] y = np.ones(100) y[:50] = 0.0 clf = DecisionTreeClassifier(random_state=0) sample_weight = np.random.rand(100, 1) assert_raises(ValueError, clf.fit, X, y, sample_weight=sample_weight) sample_weight = np.array(0) assert_raises(ValueError, clf.fit, X, y, sample_weight=sample_weight) sample_weight = np.ones(101) assert_raises(ValueError, clf.fit, X, y, sample_weight=sample_weight) sample_weight = np.ones(99) assert_raises(ValueError, clf.fit, X, y, sample_weight=sample_weight) def check_class_weights(name): """Check class_weights resemble sample_weights behavior.""" TreeClassifier = CLF_TREES[name] # Iris is balanced, so no effect expected for using 'balanced' weights clf1 = TreeClassifier(random_state=0) clf1.fit(iris.data, iris.target) clf2 = TreeClassifier(class_weight='balanced', random_state=0) clf2.fit(iris.data, iris.target) assert_almost_equal(clf1.feature_importances_, clf2.feature_importances_) # Make a multi-output problem with three copies of Iris iris_multi = np.vstack((iris.target, iris.target, iris.target)).T # Create user-defined weights that should balance over the outputs clf3 = TreeClassifier(class_weight=[{0: 2., 1: 2., 2: 1.}, {0: 2., 1: 1., 2: 2.}, {0: 1., 1: 2., 2: 2.}], random_state=0) clf3.fit(iris.data, iris_multi) assert_almost_equal(clf2.feature_importances_, clf3.feature_importances_) # Check against multi-output "auto" which should also have no effect clf4 = TreeClassifier(class_weight='balanced', random_state=0) clf4.fit(iris.data, iris_multi) assert_almost_equal(clf3.feature_importances_, clf4.feature_importances_) # Inflate importance of class 1, check against user-defined weights sample_weight = np.ones(iris.target.shape) sample_weight[iris.target == 1] *= 100 class_weight = {0: 1., 1: 100., 2: 1.} clf1 = TreeClassifier(random_state=0) clf1.fit(iris.data, iris.target, sample_weight) clf2 = TreeClassifier(class_weight=class_weight, random_state=0) clf2.fit(iris.data, iris.target) assert_almost_equal(clf1.feature_importances_, clf2.feature_importances_) # Check that sample_weight and class_weight are multiplicative clf1 = TreeClassifier(random_state=0) clf1.fit(iris.data, iris.target, sample_weight ** 2) clf2 = TreeClassifier(class_weight=class_weight, random_state=0) clf2.fit(iris.data, iris.target, sample_weight) assert_almost_equal(clf1.feature_importances_, clf2.feature_importances_) def test_class_weights(): for name in CLF_TREES: yield check_class_weights, name def check_class_weight_errors(name): # Test if class_weight raises errors and warnings when expected. TreeClassifier = CLF_TREES[name] _y = np.vstack((y, np.array(y) * 2)).T # Invalid preset string clf = TreeClassifier(class_weight='the larch', random_state=0) assert_raises(ValueError, clf.fit, X, y) assert_raises(ValueError, clf.fit, X, _y) # Not a list or preset for multi-output clf = TreeClassifier(class_weight=1, random_state=0) assert_raises(ValueError, clf.fit, X, _y) # Incorrect length list for multi-output clf = TreeClassifier(class_weight=[{-1: 0.5, 1: 1.}], random_state=0) assert_raises(ValueError, clf.fit, X, _y) def test_class_weight_errors(): for name in CLF_TREES: yield check_class_weight_errors, name def test_max_leaf_nodes(): # Test greedy trees with max_depth + 1 leafs. from sklearn.tree._tree import TREE_LEAF X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) k = 4 for name, TreeEstimator in ALL_TREES.items(): est = TreeEstimator(max_depth=None, max_leaf_nodes=k + 1).fit(X, y) tree = est.tree_ assert_equal((tree.children_left == TREE_LEAF).sum(), k + 1) # max_leaf_nodes in (0, 1) should raise ValueError est = TreeEstimator(max_depth=None, max_leaf_nodes=0) assert_raises(ValueError, est.fit, X, y) est = TreeEstimator(max_depth=None, max_leaf_nodes=1) assert_raises(ValueError, est.fit, X, y) est = TreeEstimator(max_depth=None, max_leaf_nodes=0.1) assert_raises(ValueError, est.fit, X, y) def test_max_leaf_nodes_max_depth(): # Test preceedence of max_leaf_nodes over max_depth. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) k = 4 for name, TreeEstimator in ALL_TREES.items(): est = TreeEstimator(max_depth=1, max_leaf_nodes=k).fit(X, y) tree = est.tree_ assert_greater(tree.max_depth, 1) def test_arrays_persist(): # Ensure property arrays' memory stays alive when tree disappears # non-regression for #2726 for attr in ['n_classes', 'value', 'children_left', 'children_right', 'threshold', 'impurity', 'feature', 'n_node_samples']: value = getattr(DecisionTreeClassifier().fit([[0]], [0]).tree_, attr) # if pointing to freed memory, contents may be arbitrary assert_true(-2 <= value.flat[0] < 2, 'Array points to arbitrary memory') def test_only_constant_features(): random_state = check_random_state(0) X = np.zeros((10, 20)) y = random_state.randint(0, 2, (10, )) for name, TreeEstimator in ALL_TREES.items(): est = TreeEstimator(random_state=0) est.fit(X, y) assert_equal(est.tree_.max_depth, 0) def test_with_only_one_non_constant_features(): X = np.hstack([np.array([[1.], [1.], [0.], [0.]]), np.zeros((4, 1000))]) y = np.array([0., 1., 0., 1.0]) for name, TreeEstimator in CLF_TREES.items(): est = TreeEstimator(random_state=0, max_features=1) est.fit(X, y) assert_equal(est.tree_.max_depth, 1) assert_array_equal(est.predict_proba(X), 0.5 * np.ones((4, 2))) for name, TreeEstimator in REG_TREES.items(): est = TreeEstimator(random_state=0, max_features=1) est.fit(X, y) assert_equal(est.tree_.max_depth, 1) assert_array_equal(est.predict(X), 0.5 * np.ones((4, ))) def test_big_input(): # Test if the warning for too large inputs is appropriate. X = np.repeat(10 ** 40., 4).astype(np.float64).reshape(-1, 1) clf = DecisionTreeClassifier() try: clf.fit(X, [0, 1, 0, 1]) except ValueError as e: assert_in("float32", str(e)) def test_realloc(): from sklearn.tree._tree import _realloc_test assert_raises(MemoryError, _realloc_test) def test_huge_allocations(): n_bits = int(platform.architecture()[0].rstrip('bit')) X = np.random.randn(10, 2) y = np.random.randint(0, 2, 10) # Sanity check: we cannot request more memory than the size of the address # space. Currently raises OverflowError. huge = 2 ** (n_bits + 1) clf = DecisionTreeClassifier(splitter='best', max_leaf_nodes=huge) assert_raises(Exception, clf.fit, X, y) # Non-regression test: MemoryError used to be dropped by Cython # because of missing "except *". huge = 2 ** (n_bits - 1) - 1 clf = DecisionTreeClassifier(splitter='best', max_leaf_nodes=huge) assert_raises(MemoryError, clf.fit, X, y) def check_sparse_input(tree, dataset, max_depth=None): TreeEstimator = ALL_TREES[tree] X = DATASETS[dataset]["X"] X_sparse = DATASETS[dataset]["X_sparse"] y = DATASETS[dataset]["y"] # Gain testing time if dataset in ["digits", "boston"]: n_samples = X.shape[0] // 5 X = X[:n_samples] X_sparse = X_sparse[:n_samples] y = y[:n_samples] for sparse_format in (csr_matrix, csc_matrix, coo_matrix): X_sparse = sparse_format(X_sparse) # Check the default (depth first search) d = TreeEstimator(random_state=0, max_depth=max_depth).fit(X, y) s = TreeEstimator(random_state=0, max_depth=max_depth).fit(X_sparse, y) assert_tree_equal(d.tree_, s.tree_, "{0} with dense and sparse format gave different " "trees".format(tree)) y_pred = d.predict(X) if tree in CLF_TREES: y_proba = d.predict_proba(X) y_log_proba = d.predict_log_proba(X) for sparse_matrix in (csr_matrix, csc_matrix, coo_matrix): X_sparse_test = sparse_matrix(X_sparse, dtype=np.float32) assert_array_almost_equal(s.predict(X_sparse_test), y_pred) if tree in CLF_TREES: assert_array_almost_equal(s.predict_proba(X_sparse_test), y_proba) assert_array_almost_equal(s.predict_log_proba(X_sparse_test), y_log_proba) def test_sparse_input(): for tree, dataset in product(SPARSE_TREES, ("clf_small", "toy", "digits", "multilabel", "sparse-pos", "sparse-neg", "sparse-mix", "zeros")): max_depth = 3 if dataset == "digits" else None yield (check_sparse_input, tree, dataset, max_depth) # Due to numerical instability of MSE and too strict test, we limit the # maximal depth for tree, dataset in product(REG_TREES, ["boston", "reg_small"]): if tree in SPARSE_TREES: yield (check_sparse_input, tree, dataset, 2) def check_sparse_parameters(tree, dataset): TreeEstimator = ALL_TREES[tree] X = DATASETS[dataset]["X"] X_sparse = DATASETS[dataset]["X_sparse"] y = DATASETS[dataset]["y"] # Check max_features d = TreeEstimator(random_state=0, max_features=1, max_depth=2).fit(X, y) s = TreeEstimator(random_state=0, max_features=1, max_depth=2).fit(X_sparse, y) assert_tree_equal(d.tree_, s.tree_, "{0} with dense and sparse format gave different " "trees".format(tree)) assert_array_almost_equal(s.predict(X), d.predict(X)) # Check min_samples_split d = TreeEstimator(random_state=0, max_features=1, min_samples_split=10).fit(X, y) s = TreeEstimator(random_state=0, max_features=1, min_samples_split=10).fit(X_sparse, y) assert_tree_equal(d.tree_, s.tree_, "{0} with dense and sparse format gave different " "trees".format(tree)) assert_array_almost_equal(s.predict(X), d.predict(X)) # Check min_samples_leaf d = TreeEstimator(random_state=0, min_samples_leaf=X_sparse.shape[0] // 2).fit(X, y) s = TreeEstimator(random_state=0, min_samples_leaf=X_sparse.shape[0] // 2).fit(X_sparse, y) assert_tree_equal(d.tree_, s.tree_, "{0} with dense and sparse format gave different " "trees".format(tree)) assert_array_almost_equal(s.predict(X), d.predict(X)) # Check best-first search d = TreeEstimator(random_state=0, max_leaf_nodes=3).fit(X, y) s = TreeEstimator(random_state=0, max_leaf_nodes=3).fit(X_sparse, y) assert_tree_equal(d.tree_, s.tree_, "{0} with dense and sparse format gave different " "trees".format(tree)) assert_array_almost_equal(s.predict(X), d.predict(X)) def test_sparse_parameters(): for tree, dataset in product(SPARSE_TREES, ["sparse-pos", "sparse-neg", "sparse-mix", "zeros"]): yield (check_sparse_parameters, tree, dataset) def check_sparse_criterion(tree, dataset): TreeEstimator = ALL_TREES[tree] X = DATASETS[dataset]["X"] X_sparse = DATASETS[dataset]["X_sparse"] y = DATASETS[dataset]["y"] # Check various criterion CRITERIONS = REG_CRITERIONS if tree in REG_TREES else CLF_CRITERIONS for criterion in CRITERIONS: d = TreeEstimator(random_state=0, max_depth=3, criterion=criterion).fit(X, y) s = TreeEstimator(random_state=0, max_depth=3, criterion=criterion).fit(X_sparse, y) assert_tree_equal(d.tree_, s.tree_, "{0} with dense and sparse format gave different " "trees".format(tree)) assert_array_almost_equal(s.predict(X), d.predict(X)) def test_sparse_criterion(): for tree, dataset in product(SPARSE_TREES, ["sparse-pos", "sparse-neg", "sparse-mix", "zeros"]): yield (check_sparse_criterion, tree, dataset) def check_explicit_sparse_zeros(tree, max_depth=3, n_features=10): TreeEstimator = ALL_TREES[tree] # n_samples set n_feature to ease construction of a simultaneous # construction of a csr and csc matrix n_samples = n_features samples = np.arange(n_samples) # Generate X, y random_state = check_random_state(0) indices = [] data = [] offset = 0 indptr = [offset] for i in range(n_features): n_nonzero_i = random_state.binomial(n_samples, 0.5) indices_i = random_state.permutation(samples)[:n_nonzero_i] indices.append(indices_i) data_i = random_state.binomial(3, 0.5, size=(n_nonzero_i, )) - 1 data.append(data_i) offset += n_nonzero_i indptr.append(offset) indices = np.concatenate(indices) data = np.array(np.concatenate(data), dtype=np.float32) X_sparse = csc_matrix((data, indices, indptr), shape=(n_samples, n_features)) X = X_sparse.toarray() X_sparse_test = csr_matrix((data, indices, indptr), shape=(n_samples, n_features)) X_test = X_sparse_test.toarray() y = random_state.randint(0, 3, size=(n_samples, )) # Ensure that X_sparse_test owns its data, indices and indptr array X_sparse_test = X_sparse_test.copy() # Ensure that we have explicit zeros assert_greater((X_sparse.data == 0.).sum(), 0) assert_greater((X_sparse_test.data == 0.).sum(), 0) # Perform the comparison d = TreeEstimator(random_state=0, max_depth=max_depth).fit(X, y) s = TreeEstimator(random_state=0, max_depth=max_depth).fit(X_sparse, y) assert_tree_equal(d.tree_, s.tree_, "{0} with dense and sparse format gave different " "trees".format(tree)) Xs = (X_test, X_sparse_test) for X1, X2 in product(Xs, Xs): assert_array_almost_equal(s.tree_.apply(X1), d.tree_.apply(X2)) assert_array_almost_equal(s.apply(X1), d.apply(X2)) assert_array_almost_equal(s.apply(X1), s.tree_.apply(X1)) assert_array_almost_equal(s.predict(X1), d.predict(X2)) if tree in CLF_TREES: assert_array_almost_equal(s.predict_proba(X1), d.predict_proba(X2)) def test_explicit_sparse_zeros(): for tree in SPARSE_TREES: yield (check_explicit_sparse_zeros, tree) def check_raise_error_on_1d_input(name): TreeEstimator = ALL_TREES[name] X = iris.data[:, 0].ravel() X_2d = iris.data[:, 0].reshape((-1, 1)) y = iris.target assert_raises(ValueError, TreeEstimator(random_state=0).fit, X, y) est = TreeEstimator(random_state=0) est.fit(X_2d, y) assert_raises(ValueError, est.predict, X) def test_1d_input(): for name in ALL_TREES: yield check_raise_error_on_1d_input, name def _check_min_weight_leaf_split_level(TreeEstimator, X, y, sample_weight): # Private function to keep pretty printing in nose yielded tests est = TreeEstimator(random_state=0) est.fit(X, y, sample_weight=sample_weight) assert_equal(est.tree_.max_depth, 1) est = TreeEstimator(random_state=0, min_weight_fraction_leaf=0.4) est.fit(X, y, sample_weight=sample_weight) assert_equal(est.tree_.max_depth, 0) def check_min_weight_leaf_split_level(name): TreeEstimator = ALL_TREES[name] X = np.array([[0], [0], [0], [0], [1]]) y = [0, 0, 0, 0, 1] sample_weight = [0.2, 0.2, 0.2, 0.2, 0.2] _check_min_weight_leaf_split_level(TreeEstimator, X, y, sample_weight) if TreeEstimator().splitter in SPARSE_SPLITTERS: _check_min_weight_leaf_split_level(TreeEstimator, csc_matrix(X), y, sample_weight) def test_min_weight_leaf_split_level(): for name in ALL_TREES: yield check_min_weight_leaf_split_level, name def check_public_apply(name): X_small32 = X_small.astype(tree._tree.DTYPE) est = ALL_TREES[name]() est.fit(X_small, y_small) assert_array_equal(est.apply(X_small), est.tree_.apply(X_small32)) def check_public_apply_sparse(name): X_small32 = csr_matrix(X_small.astype(tree._tree.DTYPE)) est = ALL_TREES[name]() est.fit(X_small, y_small) assert_array_equal(est.apply(X_small), est.tree_.apply(X_small32)) def test_public_apply(): for name in ALL_TREES: yield (check_public_apply, name) for name in SPARSE_TREES: yield (check_public_apply_sparse, name)
bsd-3-clause
shangwuhencc/scikit-learn
examples/svm/plot_rbf_parameters.py
132
8096
''' ================== RBF SVM parameters ================== This example illustrates the effect of the parameters ``gamma`` and ``C`` of the Radial Basis Function (RBF) kernel SVM. Intuitively, the ``gamma`` parameter defines how far the influence of a single training example reaches, with low values meaning 'far' and high values meaning 'close'. The ``gamma`` parameters can be seen as the inverse of the radius of influence of samples selected by the model as support vectors. The ``C`` parameter trades off misclassification of training examples against simplicity of the decision surface. A low ``C`` makes the decision surface smooth, while a high ``C`` aims at classifying all training examples correctly by giving the model freedom to select more samples as support vectors. The first plot is a visualization of the decision function for a variety of parameter values on a simplified classification problem involving only 2 input features and 2 possible target classes (binary classification). Note that this kind of plot is not possible to do for problems with more features or target classes. The second plot is a heatmap of the classifier's cross-validation accuracy as a function of ``C`` and ``gamma``. For this example we explore a relatively large grid for illustration purposes. In practice, a logarithmic grid from :math:`10^{-3}` to :math:`10^3` is usually sufficient. If the best parameters lie on the boundaries of the grid, it can be extended in that direction in a subsequent search. Note that the heat map plot has a special colorbar with a midpoint value close to the score values of the best performing models so as to make it easy to tell them appart in the blink of an eye. The behavior of the model is very sensitive to the ``gamma`` parameter. If ``gamma`` is too large, the radius of the area of influence of the support vectors only includes the support vector itself and no amount of regularization with ``C`` will be able to prevent overfitting. When ``gamma`` is very small, the model is too constrained and cannot capture the complexity or "shape" of the data. The region of influence of any selected support vector would include the whole training set. The resulting model will behave similarly to a linear model with a set of hyperplanes that separate the centers of high density of any pair of two classes. For intermediate values, we can see on the second plot that good models can be found on a diagonal of ``C`` and ``gamma``. Smooth models (lower ``gamma`` values) can be made more complex by selecting a larger number of support vectors (larger ``C`` values) hence the diagonal of good performing models. Finally one can also observe that for some intermediate values of ``gamma`` we get equally performing models when ``C`` becomes very large: it is not necessary to regularize by limiting the number of support vectors. The radius of the RBF kernel alone acts as a good structural regularizer. In practice though it might still be interesting to limit the number of support vectors with a lower value of ``C`` so as to favor models that use less memory and that are faster to predict. We should also note that small differences in scores results from the random splits of the cross-validation procedure. Those spurious variations can be smoothed out by increasing the number of CV iterations ``n_iter`` at the expense of compute time. Increasing the value number of ``C_range`` and ``gamma_range`` steps will increase the resolution of the hyper-parameter heat map. ''' print(__doc__) import numpy as np import matplotlib.pyplot as plt from matplotlib.colors import Normalize from sklearn.svm import SVC from sklearn.preprocessing import StandardScaler from sklearn.datasets import load_iris from sklearn.cross_validation import StratifiedShuffleSplit from sklearn.grid_search import GridSearchCV # Utility function to move the midpoint of a colormap to be around # the values of interest. class MidpointNormalize(Normalize): def __init__(self, vmin=None, vmax=None, midpoint=None, clip=False): self.midpoint = midpoint Normalize.__init__(self, vmin, vmax, clip) def __call__(self, value, clip=None): x, y = [self.vmin, self.midpoint, self.vmax], [0, 0.5, 1] return np.ma.masked_array(np.interp(value, x, y)) ############################################################################## # Load and prepare data set # # dataset for grid search iris = load_iris() X = iris.data y = iris.target # Dataset for decision function visualization: we only keep the first two # features in X and sub-sample the dataset to keep only 2 classes and # make it a binary classification problem. X_2d = X[:, :2] X_2d = X_2d[y > 0] y_2d = y[y > 0] y_2d -= 1 # It is usually a good idea to scale the data for SVM training. # We are cheating a bit in this example in scaling all of the data, # instead of fitting the transformation on the training set and # just applying it on the test set. scaler = StandardScaler() X = scaler.fit_transform(X) X_2d = scaler.fit_transform(X_2d) ############################################################################## # Train classifiers # # For an initial search, a logarithmic grid with basis # 10 is often helpful. Using a basis of 2, a finer # tuning can be achieved but at a much higher cost. C_range = np.logspace(-2, 10, 13) gamma_range = np.logspace(-9, 3, 13) param_grid = dict(gamma=gamma_range, C=C_range) cv = StratifiedShuffleSplit(y, n_iter=5, test_size=0.2, random_state=42) grid = GridSearchCV(SVC(), param_grid=param_grid, cv=cv) grid.fit(X, y) print("The best parameters are %s with a score of %0.2f" % (grid.best_params_, grid.best_score_)) # Now we need to fit a classifier for all parameters in the 2d version # (we use a smaller set of parameters here because it takes a while to train) C_2d_range = [1e-2, 1, 1e2] gamma_2d_range = [1e-1, 1, 1e1] classifiers = [] for C in C_2d_range: for gamma in gamma_2d_range: clf = SVC(C=C, gamma=gamma) clf.fit(X_2d, y_2d) classifiers.append((C, gamma, clf)) ############################################################################## # visualization # # draw visualization of parameter effects plt.figure(figsize=(8, 6)) xx, yy = np.meshgrid(np.linspace(-3, 3, 200), np.linspace(-3, 3, 200)) for (k, (C, gamma, clf)) in enumerate(classifiers): # evaluate decision function in a grid Z = clf.decision_function(np.c_[xx.ravel(), yy.ravel()]) Z = Z.reshape(xx.shape) # visualize decision function for these parameters plt.subplot(len(C_2d_range), len(gamma_2d_range), k + 1) plt.title("gamma=10^%d, C=10^%d" % (np.log10(gamma), np.log10(C)), size='medium') # visualize parameter's effect on decision function plt.pcolormesh(xx, yy, -Z, cmap=plt.cm.RdBu) plt.scatter(X_2d[:, 0], X_2d[:, 1], c=y_2d, cmap=plt.cm.RdBu_r) plt.xticks(()) plt.yticks(()) plt.axis('tight') # plot the scores of the grid # grid_scores_ contains parameter settings and scores # We extract just the scores scores = [x[1] for x in grid.grid_scores_] scores = np.array(scores).reshape(len(C_range), len(gamma_range)) # Draw heatmap of the validation accuracy as a function of gamma and C # # The score are encoded as colors with the hot colormap which varies from dark # red to bright yellow. As the most interesting scores are all located in the # 0.92 to 0.97 range we use a custom normalizer to set the mid-point to 0.92 so # as to make it easier to visualize the small variations of score values in the # interesting range while not brutally collapsing all the low score values to # the same color. plt.figure(figsize=(8, 6)) plt.subplots_adjust(left=.2, right=0.95, bottom=0.15, top=0.95) plt.imshow(scores, interpolation='nearest', cmap=plt.cm.hot, norm=MidpointNormalize(vmin=0.2, midpoint=0.92)) plt.xlabel('gamma') plt.ylabel('C') plt.colorbar() plt.xticks(np.arange(len(gamma_range)), gamma_range, rotation=45) plt.yticks(np.arange(len(C_range)), C_range) plt.title('Validation accuracy') plt.show()
bsd-3-clause
liutairan/pyGCS
dev/GCS.py
1
15660
#!/usr/bin/pythonw # -*- coding: UTF-8 -*- ''' MIT License Copyright (c) 2017 Tairan Liu Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. ''' import os from os import walk import sys from sys import stdout import wx import wx.lib.embeddedimage import wx.dataview import logging import threading from threading import Thread from wx.lib.pubsub import pub import serial import serial.tools.list_ports from pyzbMultiwii import MultiWii from SerialCom import SerialCommunication from DataExchange import DataExchange from TabOne import TabOne from TabTwo import TabTwo from TabThree import TabThree from TabFour import TabFour import math import time import struct import numpy import matplotlib from matplotlib.figure import Figure import matplotlib.pyplot as plt from PIL import Image from Map import Map #from GSMPy import GSMPy import signal from contextlib import contextmanager __author__ = "Tairan Liu" __copyright__ = "Copyright 2017, Tairan Liu" __credits__ = ["Tairan Liu", "Other Supporters"] __license__ = "MIT" __version__ = "0.4-dev" __maintainer__ = "Tairan Liu" __email__ = "[email protected]" __status__ = "Development" class TimeoutException(Exception): pass @contextmanager def time_limit(seconds): def signal_handler(signum, frame): raise TimeoutException, "Timed out!" signal.signal(signal.SIGALRM, signal_handler) signal.setitimer(signal.ITIMER_REAL, seconds) try: yield finally: signal.alarm(0) class MainFrame(wx.Frame): def __init__(self, *args, **kw): super(MainFrame, self).__init__(*args, **kw) # Data exchange handle self.dataExchangeHandle = DataExchange() # Mouse states self.inWindowFlag = 0 self.inMapFlag = 0 self.leftDown = 0 self.rightDown = 0 self.shiftDown = 0 self.currentTab = 0 # Map Info self._width = 640 self._height = 640 self._originLat = 30.408158 #37.7913838 self._originLon = -91.179533 #-79.44398934 self._zoom = 19 self._maptype = 'hybrid' #'roadmap' self._homeLat = self._originLat self._homeLon = self._originLon self._dX = 0 self._dY = 0 self.waypoints = [] self.InitUI() def InitUI(self): self.pnl = wx.Panel(self) self.SetSize((1150,670)) self.SetTitle("GCS") self.SetClientSize((1150,670)) self.Center() # Events self.Bind(wx.EVT_SIZE, self.OnSize) self.Bind(wx.EVT_PAINT, self.OnPaint) self.Bind(wx.EVT_IDLE,self.OnIdle) self.pnl.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) self.pnl.Bind(wx.EVT_KEY_UP, self.OnKeyUp) self.pnl.SetFocus() #pnl.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) #pnl.Bind(wx.EVT_KEY_UP, self.OnKeyUp) #self.Bind(wx.EVT_CONTEXT_MENU, self.OnContext) # Panel Elements # Create Empty Image to preload self.mapHandle = Map(self._originLat, self._originLon, self._zoom, self._width, self._height) self.mapImage = self.mapHandle.retImage self.imageCtrl = wx.StaticBitmap(self, wx.ID_ANY, wx.BitmapFromImage(self.mapImage), pos=(0, 0)) # Bind Mouse Events self.imageCtrl.Bind(wx.EVT_LEFT_DOWN, self.OnMouseLeftDown) self.imageCtrl.Bind(wx.EVT_LEFT_UP, self.OnMouseLeftUp) self.imageCtrl.Bind(wx.EVT_RIGHT_DOWN, self.OnMouseRightDown) self.imageCtrl.Bind(wx.EVT_RIGHT_UP, self.OnMouseRightUp) self.imageCtrl.Bind(wx.EVT_MOTION, self.OnMotion) self.imageCtrl.Bind(wx.EVT_MOUSEWHEEL, self.OnScroll) self.imageCtrl.Bind(wx.EVT_ENTER_WINDOW, self.OnEnterMap) self.imageCtrl.Bind(wx.EVT_LEAVE_WINDOW, self.OnLeaveMap) self.pnl.Bind(wx.EVT_LEFT_DOWN, self.OnMouseLeftDown) self.pnl.Bind(wx.EVT_LEFT_UP, self.OnMouseLeftUp) self.pnl.Bind(wx.EVT_RIGHT_DOWN, self.OnMouseRightDown) self.pnl.Bind(wx.EVT_RIGHT_UP, self.OnMouseRightUp) self.pnl.Bind(wx.EVT_MOTION, self.OnMotion) #self.Bind(wx.EVT_MOUSEWHEEL, self.OnScroll) self.pnl.Bind(wx.EVT_ENTER_WINDOW, self.OnEnterWindow) self.pnl.Bind(wx.EVT_LEAVE_WINDOW, self.OnLeaveWindow) self.imageCtrl.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) self.imageCtrl.Bind(wx.EVT_KEY_UP, self.OnKeyUp) # Tabs self.nb = wx.Notebook(self.pnl, pos = (642,0), size = (510, 635)) self.tab1 = TabOne(self.nb, self.dataExchangeHandle) self.tab2 = TabTwo(self.nb, self.dataExchangeHandle) self.tab3 = TabThree(self.nb, self.dataExchangeHandle) self.tab4 = TabFour(self.nb, self.dataExchangeHandle) # Add the windows to tabs and name them. self.nb.AddPage(self.tab1, "Overview") self.nb.AddPage(self.tab2, "Quad 1") self.nb.AddPage(self.tab3, "Quad 2") self.nb.AddPage(self.tab4, "Quad 3") self.nb.Bind(wx.EVT_NOTEBOOK_PAGE_CHANGED, self.OnPageChanged) self.nb.Bind(wx.EVT_NOTEBOOK_PAGE_CHANGING, self.OnPageChanging) self.nb.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) self.nb.Bind(wx.EVT_KEY_UP, self.OnKeyUp) self.tab1.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) self.tab1.Bind(wx.EVT_KEY_UP, self.OnKeyUp) self.tab2.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) self.tab2.Bind(wx.EVT_KEY_UP, self.OnKeyUp) self.tab3.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) self.tab3.Bind(wx.EVT_KEY_UP, self.OnKeyUp) self.tab4.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) self.tab4.Bind(wx.EVT_KEY_UP, self.OnKeyUp) # #self.imageCtrl.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) #self.imageCtrl.Bind(wx.EVT_KEY_UP, self.OnKeyUp) # Button Events #buttonStaticBox = wx.StaticBox(pnl, -1, 'Buttons', pos = (645,0), size = (300,240)) #flightStaticBox = wx.StaticBox(pnl, -1, 'Flight Data', pos = (645,245), size = (300,240)) # Buttons self.incZoomButton = wx.Button(self.pnl, -1, '+', pos = (2, 642), size = (25,20)) self.Bind(wx.EVT_BUTTON, self.OnIncZoom, self.incZoomButton) self.decZoomButton = wx.Button(self.pnl, -1, '-', pos = (27, 642), size = (25,20)) self.Bind(wx.EVT_BUTTON, self.OnDecZoom, self.decZoomButton) self.autoZoomButton = wx.Button(self.pnl, -1, 'Auto Zoom', pos = (55, 642), size = (85,20)) self.Bind(wx.EVT_BUTTON, self.OnAutoZoom, self.autoZoomButton) self.retHomeButton = wx.Button(self.pnl, -1, 'Return Home', pos = (143, 642), size = (95,20)) self.Bind(wx.EVT_BUTTON, self.OnReturnHome, self.retHomeButton) self.zoomlevelLabel = wx.StaticText(self, -1, 'Zoom Level: '+str(self._zoom), pos = (245,647), size = (40,20)) # Show self.Show(True) def OnQuitApp(self, event): self.Close() def OnPageChanged(self, event): self.currentTab = event.GetSelection() self.dataExchangeHandle.serialMode = self.currentTab event.Skip() def OnPageChanging(self, event): old = event.GetOldSelection() new = event.GetSelection() sel = self.nb.GetSelection() #print 'OnPageChanging, old:%d, new:%d, sel:%d\n' % (old, new, sel) event.Skip() def OnKeyDown(self, event): keyNumber = event.GetKeyCode() print(keyNumber) if keyNumber == wx.WXK_SHIFT: self.shiftDown = 1 def OnKeyUp(self, event): keyNumber = event.GetKeyCode() if keyNumber == 27: self.Close() elif keyNumber == wx.WXK_SHIFT: self.shiftDown = 0 def OnIncZoom(self, event): self._zoom = self._zoom + 1 self.zoomlevelLabel.SetLabel('Zoom Level: '+str(self._zoom)) self.mapHandle.zoom(1) self.Refresh() def OnDecZoom(self, event): self._zoom = self._zoom - 1 self.zoomlevelLabel.SetLabel('Zoom Level: '+str(self._zoom)) self.mapHandle.zoom(-1) self.Refresh() def OnAutoZoom(self, event): # auto select the zoom level so that all the waypoints are shown in the frame # if no gps coordinates or waypoints, then do nothing existGPSs = self.dataExchangeHandle._currentGPS existWPs = self.dataExchangeHandle._waypointLists self._auto_zoom_and_center(existGPSs, existWPs) self.Refresh() def _auto_zoom_and_center(self, gps, wps): tempGPSList = [] latList = [] lonList = [] for dev in range(3): if len(gps[dev]) > 0: tempGPSList.append(gps[dev]) latList.append(gps[dev][0]) lonList.append(gps[dev][1]) tempList = wps[dev] if len(tempList) > 0: for i in range(len(tempList)): tempWP = tempList[i] tempGPSList.append([tempWP['lat'], tempWP['lon']]) latList.append(tempWP['lat']) lonList.append(tempWP['lon']) if len(tempGPSList) >= 2: max_lat = max(latList) min_lat = min(latList) max_lon = max(lonList) min_lon = min(lonList) [_center_lat, _center_lon, _zoomlevel] = self.mapHandle._find_zoomlevel(min_lat, max_lat, min_lon, max_lon) self._zoom = _zoomlevel self.zoomlevelLabel.SetLabel('Zoom Level: '+str(self._zoom)) self.mapHandle._reload(_center_lat, _center_lon, _zoomlevel) self.Refresh() def OnReturnHome(self, event): self.mapHandle.return_origin() self.Refresh() def OnSize(self, event): event.Skip() self.Refresh() def OnPaint(self, event): self.mapImage = self.mapHandle.retImage tempImage = wx.BitmapFromImage(self.mapImage) self.dc = wx.MemoryDC(tempImage) self.dc.SetPen(wx.Pen("BLACK", style = wx.TRANSPARENT)) try: for dev in range(3): self.dc.SetPen(wx.Pen("BLACK", style = wx.TRANSPARENT)) tempList = self.dataExchangeHandle._waypointLists[dev] if len(tempList) > 0: for i in range(len(tempList)): tempWP = tempList[i] x,y = self.mapHandle.GPStoImagePos(tempWP['lat'], tempWP['lon']) if i == 0: self.dc.SetBrush(wx.Brush("BLUE", wx.SOLID)) self.dc.DrawCircle(x, y, 7) self.dc.DrawText(str(dev+1), x, y) else: self.dc.SetBrush(wx.Brush("RED", wx.SOLID)) self.dc.DrawCircle(x, y, 7) for i in range(len(tempList)): if i < len(tempList)-1: tempWP = tempList[i] x,y = self.mapHandle.GPStoImagePos(tempWP['lat'], tempWP['lon']) tempWP_next = tempList[i+1] x_n,y_n = self.mapHandle.GPStoImagePos(tempWP_next['lat'], tempWP_next['lon']) self.dc.SetPen(wx.Pen(wx.Colour(dev*60,255,255-dev*60), 1)) self.dc.DrawLines(((x, y),(x_n, y_n))) else: tempWP = tempList[i] x,y = self.mapHandle.GPStoImagePos(tempWP['lat'], tempWP['lon']) tempWP_next = tempList[0] x_n,y_n = self.mapHandle.GPStoImagePos(tempWP_next['lat'], tempWP_next['lon']) self.dc.SetPen(wx.Pen(wx.RED, 1)) self.dc.DrawLines(((x,y),(x_n, y_n))) else: pass except: pass # draw current GPS if available try: for dev in range(3): self.dc.SetPen(wx.Pen("BLACK", style = wx.TRANSPARENT)) tempGPSs = self.dataExchangeHandle._currentGPS[dev] if len(tempGPSs) > 0: x, y = self.mapHandle.GPStoImagePos(tempGPSs[0], tempGPSs[1]) self.dc.SetBrush(wx.Brush("YELLOW", wx.SOLID)) self.dc.DrawCircle(x, y, 10) self.dc.DrawText(str(dev+1), x-2, y-4) else: pass except: pass self.dc.SelectObject(wx.NullBitmap) self.imageCtrl.SetBitmap(tempImage) def OnIdle(self,event): self.Refresh() def OnEnterWindow(self, event): #print('Enter Window') self.inWindowFlag = 1 def OnEnterMap(self, event): #print('Enter Map') self.pnl.SetFocus() self.inMapFlag = 1 def OnLeaveWindow(self, event): #print('Leave Window') self.inWindowFlag = 0 def OnLeaveMap(self, event): #print('Leave Map') self.inMapFlag = 0 def OnMouseLeftDown(self, event): #print('left down') self.leftDown = 1 self.mouseX, self.mouseY = event.GetPosition() def OnMouseLeftUp(self, event): #print('left up') self.leftDown = 0 def OnMouseRightDown(self, event): #print('right down') self.rightDown = 1 self.mouseX, self.mouseY = event.GetPosition() _point_lat, _point_lon = self.mapHandle.PostoGPS(self.mouseX, self.mouseY) _point_x, _point_y = self.mapHandle.GPStoImagePos(_point_lat, _point_lon) #print(self.currentTab) if self.currentTab == 1: self.tab2.OnAdd(_point_lat, _point_lon) if self.currentTab == 2: self.tab3.OnAdd(_point_lat, _point_lon) if self.currentTab == 3: self.tab4.OnAdd(_point_lat, _point_lon) self.Refresh() def OnMouseRightUp(self, event): #print('right up') self.rightDown = 0 def OnMotion(self, event): x, y = event.GetPosition() #print(x,y) if self.inMapFlag == 1 and self.leftDown == 1: dx = x-self.mouseX dy = y-self.mouseY self.mapHandle.move(dx, dy) self.Refresh() def OnScroll(self, event): dlevel = event.GetWheelRotation() #self.mapHandle.zoom(dlevel/20) # +: Down/Left, -: Up/Right self.Refresh() def InPointArea(self, x, y): if self.currentTab == 1: pass if self.currentTab == 2: pass if self.currentTab == 3: pass def main(): map = wx.App() MainFrame(None) map.MainLoop() if __name__ == "__main__": main()
mit
sharadmv/trees
experiments/benchmark/create_offline_graph.py
1
3888
from cStringIO import StringIO from Bio import Phylo import matplotlib import matplotlib.pyplot as plt import random import logging logger = logging.getLogger() logger.setLevel(logging.INFO) import numpy as np import trees from trees.ddt import DirichletDiffusionTree, Inverse, GaussianLikelihoodModel from trees.mcmc import MetropolisHastingsSampler matplotlib.rcParams.update({'font.size': 48}) from trees.util import plot_tree_2d import seaborn as sns sns.set_style('white') from tqdm import tqdm from sklearn.decomposition import PCA import cPickle as pickle pca = PCA(2) dataset = trees.data.load('zoo') X, y = dataset.X, dataset.y X += np.random.normal(scale=0.01, size=X.shape) pca.fit(X) N, D = X.shape with open('../../scripts/zoo.tree', 'rb') as fp: master_tree = pickle.load(fp) master_constraints = list(master_tree.generate_constraints()) random.seed(0) random.shuffle(master_constraints) train_constraints, test_constraints = master_constraints[:200], master_constraints[200:] test_constraints = test_constraints[:10000] df = Inverse(c=0.9) lm = GaussianLikelihoodModel(sigma=np.eye(D) / 4.0, sigma0=np.eye(D) / 2.0, mu0=X.mean(axis=0)).compile() models = { 'No constraints': DirichletDiffusionTree(df=df, likelihood_model=lm, constraints=[]), # '10 constraints': DirichletDiffusionTree(df=df, likelihood_model=lm, constraints=train_constraints[:10]), '50 constraints': DirichletDiffusionTree(df=df, likelihood_model=lm, constraints=train_constraints[:50]), '100 constraints': DirichletDiffusionTree(df=df, likelihood_model=lm, constraints=train_constraints[:100]), # '150 constraints': DirichletDiffusionTree(df=df, likelihood_model=lm, constraints=train_constraints[:150]), '200 constraints': DirichletDiffusionTree(df=df, likelihood_model=lm, constraints=train_constraints), } samplers = { a : MetropolisHastingsSampler(d, X) for a, d in models.iteritems() } for sampler in samplers.values(): sampler.initialize_assignments() score_every = 1000 def iterate(n_iters): scores = {a: [] for a in samplers} likelihoods = {a: [] for a in samplers} for i in tqdm(xrange(n_iters)): for name, sampler in samplers.items(): sampler.sample() likelihoods[name].append(sampler.tree.marg_log_likelihood()) if i % score_every == 0: scores[name].append(float(sampler.tree.score_constraints(test_constraints)) / len(test_constraints)) for name, sampler in samplers.items(): scores[name].append(float(sampler.tree.score_constraints(test_constraints)) / len(test_constraints)) return scores, likelihoods n_iters = 100000 scores, likelihoods = iterate(n_iters) fontsize = 16 plt.figure() plt.ylim([0, 1]) plt.xlim([0, n_iters]) plt.xlabel("Iterations", fontsize=fontsize) plt.ylabel("Constraint Score", fontsize=fontsize) for name, score in scores.items(): plt.plot(np.arange(0, n_iters + score_every, score_every), score, label=name) plt.legend(loc='best', fontsize=12) plt.savefig('offline-scores.png', bbox_inches='tight') plt.figure() plt.xlim([0, n_iters]) # plt.ylim(ymin=-400) plt.xlabel("Iterations", fontsize=fontsize) plt.ylabel("Data Log Likelihood", fontsize=fontsize) for name, likelihood in likelihoods.items(): plt.plot(likelihood, label=name) plt.legend(loc='best', fontsize=12) plt.savefig('offline-likelihoods.png', bbox_inches='tight') for type, model in models.items(): final_tree = model.copy() plt.figure() plot_tree_2d(final_tree, X, pca) for node in final_tree.dfs(): if node.is_leaf(): node.point = y[node.point] newick = final_tree.to_newick() tree = Phylo.read(StringIO(newick), 'newick') Phylo.draw_graphviz(tree, prog='neato') plt.savefig('tree-%s.png' % type, bbox_inches='tight') plt.show()
mit
steinnp/Big-Data-Final
Classification/bayes_most_informative.py
1
3013
import nltk import csv import matplotlib.pyplot as plt word_features = [] def get_words_in_tweets(tweets): all_words = [] for (words, sentiment) in tweets: all_words.extend(words) return all_words def get_word_features(wordlist): wordlist = nltk.FreqDist(wordlist) word_features = wordlist.keys() return word_features def extract_features(document): document_words = set(document) features = {} global word_features for word in word_features: features[word] = (word in document_words) return features def get_most_informative_features_with_values(clf, n=100): # Determine the most relevant features, and display them. cpdist = clf._feature_probdist to_return = [] print('Most Informative Features') for (fname, fval) in clf.most_informative_features(n): def labelprob(l): return cpdist[l, fname].prob(fval) labels = sorted([l for l in clf._labels if fval in cpdist[l, fname].samples()], key=labelprob) if len(labels) == 1: continue l0 = labels[0] l1 = labels[-1] if cpdist[l0, fname].prob(fval) == 0: ratio = 'INF' else: ratio = float((cpdist[l1, fname].prob(fval) / cpdist[l0, fname].prob(fval))) if l0 == 'pos': ratio = ratio * -1 to_return.append((fname, ratio)) return to_return def plot_most_important_words(tweets, predicts): labels = [] new_tweets = [] for i, la in enumerate(predicts): if la == 0: new_tweets.append(tweets[i]) labels.append('neg') if la == 1: pass if la == 2: new_tweets.append(tweets[i]) labels.append('pos') train = list(zip(new_tweets, labels)) tweets = [] for (words, sentiment) in train: words_filtered = [e.lower() for e in words.split() if len(e) >= 3] tweets.append((words_filtered, sentiment)) global word_features word_features = get_word_features(get_words_in_tweets(tweets)) training_set = nltk.classify.apply_features(extract_features, tweets) # training_set = nltk.classify.apply_features(word_features, tweets) clf = nltk.NaiveBayesClassifier.train(training_set) mostinf = get_most_informative_features_with_values(clf, 20) # mostinf = clf.get_most_informative_features_with_values(20) mostinf = sorted(mostinf, key=lambda x: x[1]) words = [i[0] for i in mostinf] values = [i[1] for i in mostinf] x_range = [i for i in range(len(words))] fig = plt.figure(facecolor='white') ax = fig.add_subplot(1, 1, 1) colors = ['red' if v < 0 else 'green' for v in values] values = sorted([abs(n) for n in values]) ax.barh(x_range, values, align='center', color=colors) ax.set_yticks(x_range) ax.set_yticklabels(words) ax.set_xlabel('Word impact') plt.title("Most informative features") #plt.show()
mit
dinossimpson/pyspeckit
pyspeckit/spectrum/models/radex_modelgrid.py
3
4499
""" Fit a line based on parameters output from a grid of RADEX models """ import numpy as np from pyspeckit.mpfit import mpfit from .. import units from . import fitter,model import matplotlib.cbook as mpcb import copy try: import astropy.io.fits as pyfits except ImportError: import pyfits class radex_model(object): def __init__(self, xarr, grid_vwidth=1.0, grid_vwidth_scale=False, texgrid=None, taugrid=None, hdr=None, path_to_texgrid='', path_to_taugrid='', temperature_gridnumber=3, debug=False, verbose=False, modelfunc=None, **kwargs): """ Use a grid of RADEX-computed models to make a model line spectrum The RADEX models have to be available somewhere. OR they can be passed as arrays. If as arrays, the form should be: texgrid = ((minfreq1,maxfreq1,texgrid1),(minfreq2,maxfreq2,texgrid2)) xarr must be a SpectroscopicAxis instance xoff_v, width are both in km/s. With is 'sigma' grid_vwidth is the velocity assumed when computing the grid in km/s this is important because tau = modeltau / width (see, e.g., Draine 2011 textbook pgs 219-230) grid_vwidth_scale is True or False: False for LVG, True for Sphere A modelfunc must be specified. Model functions should take an xarr and a series of keyword arguments corresponding to the line parameters (Tex, tau, xoff_v, and width (gaussian sigma, not FWHM)) """ self.modelfunc = modelfunc if self.modelfunc is None: raise ValueError("Must specify a spectral model function. See class help for form.") if texgrid is None and taugrid is None: if path_to_texgrid == '' or path_to_taugrid=='': raise IOError("Must specify model grids to use.") else: self.taugrid = [pyfits.getdata(path_to_taugrid)] self.texgrid = [pyfits.getdata(path_to_texgrid)] hdr = pyfits.getheader(path_to_taugrid) self.yinds,self.xinds = np.indices(self.taugrid[0].shape[1:]) self.densityarr = (xinds+hdr['CRPIX1']-1)*hdr['CD1_1']+hdr['CRVAL1'] # log density self.columnarr = (yinds+hdr['CRPIX2']-1)*hdr['CD2_2']+hdr['CRVAL2'] # log column self.minfreq = (4.8,) self.maxfreq = (5.0,) elif len(taugrid)==len(texgrid) and hdr is not None: self.minfreq,self.maxfreq,self.texgrid = zip(*texgrid) self.minfreq,self.maxfreq,self.taugrid = zip(*taugrid) self.yinds,self.xinds = np.indices(self.taugrid[0].shape[1:]) self.densityarr = (xinds+hdr['CRPIX1']-1)*hdr['CD1_1']+hdr['CRVAL1'] # log density self.columnarr = (yinds+hdr['CRPIX2']-1)*hdr['CD2_2']+hdr['CRVAL2'] # log column else: raise Exception # Convert X-units to frequency in GHz self.xarr = copy.copy(xarr) self.xarr.convert_to_unit('Hz', quiet=True) #tau = modelgrid.line_params_2D(gridval1,gridval2,densityarr,columnarr,taugrid[temperature_gridnumber,:,:]) #tex = modelgrid.line_params_2D(gridval1,gridval2,densityarr,columnarr,texgrid[temperature_gridnumber,:,:]) if debug: import pdb; pdb.set_trace() def __call__(self, density=4, column=13, xoff_v=0.0, width=1.0,): self.gridval1 = np.interp(density, self.densityarr[0,:], xinds[0,:]) self.gridval2 = np.interp(column, self.columnarr[:,0], yinds[:,0]) if np.isnan(gridval1) or np.isnan(gridval2): raise ValueError("Invalid column/density") if scipyOK: tau = [scipy.ndimage.map_coordinates(tg[temperature_gridnumber,:,:],np.array([[self.gridval2],[self.gridval1]]),order=1) for tg in self.taugrid] tex = [scipy.ndimage.map_coordinates(tg[temperature_gridnumber,:,:],np.array([[self.gridval2],[self.gridval1]]),order=1) for tg in self.texgrid] else: raise ImportError("Couldn't import scipy, therefore cannot interpolate") if verbose: print "density %20.12g column %20.12g: tau %20.12g tex %20.12g" % (density, column, tau, tex) if debug: import pdb; pdb.set_trace() return self.modelfunc(self.xarr,Tex=self.tex,tau=tau,xoff_v=xoff_v,width=width,**kwargs)
mit
r3kall/AnimeRecommenderSystem
animerecommendersystem/evaluation/training_testing_cf.py
1
7694
import os import time import numpy as np import matplotlib.pyplot as plt from sklearn.neighbors import NearestNeighbors from animerecommendersystem.utils import definitions from animerecommendersystem.data_processing.user_cluster_matrix import read_user_item_json from animerecommendersystem.data_processing.item_cluster_matrix import build_item_feature_matrix def build_user_item_sparse_matrix(filename): user_item = read_user_item_json(filename) item_feature, pos_to_id, id_to_pos = build_item_feature_matrix() N = len(user_item.keys()) M = item_feature.shape[0] user_item_sparse = np.zeros((N, M), dtype=np.uint16) user_mean = np.zeros(N) user_count = 0 # user_count correspond to the i-th key # of the iteration over user_item keys for user in user_item.keys(): sumrank = 0. relevant = 0. for item_id, values in user_item[user]['list'].iteritems(): try: item_index = id_to_pos[int(item_id)] except KeyError: continue rate = values['rate'] user_item_sparse[user_count, item_index] = rate if rate > 0: relevant += 1 sumrank += rate if relevant > 0: user_mean[user_count] = sumrank / relevant else: user_mean[user_count] = 5.5 user_count += 1 return user_item_sparse, user_mean def k_neighbors(sparse_matrix, k): # create the k-neighbors unsupervised model model = NearestNeighbors(n_neighbors=k+1, metric='cosine', algorithm='brute', n_jobs=1) model.fit(sparse_matrix) # train the model # compute k-neighbors, returning the index and distance matrices distances, indices = model.kneighbors(sparse_matrix, return_distance=True) return distances[:, 1:], indices[:, 1:] def evaluate(user_item_sparse, neighbors, distances, mean_rates): relevant_counter = 0 # items with rate != 0 and that exist in the neighbors total_counter = 0 # items with rate != 0 mae_list = [] rmse_list = [] for u in range(user_item_sparse.shape[0]): for it in range(user_item_sparse.shape[1]): if user_item_sparse[u, it] != 0: total_counter += 1 pred_num = 0. pred_dem = 0. for n in range(neighbors.shape[1]): neigh_rate = user_item_sparse[neighbors[u, n], it] if neigh_rate > 0: sim = (1. - distances[u, n]) pred_num += sim * ( neigh_rate - mean_rates[neighbors[u, n]] ) pred_dem += sim if pred_dem == 0: # print "\nNo item in neigh" # prediction = user_item_matrix[user]['mean_rate'] continue else: prediction = mean_rates[u] + (pred_num / pred_dem) # prediction = pred_num / pred_dem relevant_counter += 1 if prediction < 1.: prediction = 1. if prediction > 10.: prediction = 10. mae_list.append(np.abs(prediction - float(user_item_sparse[u, it]))) rmse_list.append((prediction - float(user_item_sparse[u, it])) ** 2) # print "prediction: %f \t true: %d" % (prediction, attributes['rate']) not_found_ratio = 1. - (float(relevant_counter) / float(total_counter)) return np.array(mae_list), np.array(rmse_list), not_found_ratio def cf_k_fold_rmse(k=5): """Perform k-fold cross validation, with k=5""" # these are the same for all iterations # item_feature, pos_to_id, id_to_pos = build_item_feature_matrix() trn_mae_list = [] trn_rmse_list = [] trn_not_found_ratio_list = [] tst_mae_list = [] tst_rmse_list = [] tst_not_found_ratio_list = [] # TODO execute with 5 splits for i in range(2): trn_filename = os.path.join(definitions.FILE_DIR, "user_item_train_"+str(i)+".json") tst_filename = os.path.join(definitions.FILE_DIR, "user_item_test_"+str(i)+".json") trn_user_item_sparse, trn_mean_rates = build_user_item_sparse_matrix(trn_filename) t0 = time.time() distances, indices = k_neighbors(trn_user_item_sparse, k) print "Iteration %d, time to compute neighbors: %f seconds" % (i, time.time() - t0) """ trn_mae, trn_rmse, trn_not_found_ratio = evaluate( trn_user_item_sparse, indices, distances, trn_mean_rates) del trn_user_item_sparse del trn_mean_rates print "First Evaluation done, iteration %d" % i """ tst_user_item_sparse, tst_mean_rates = build_user_item_sparse_matrix(tst_filename) """ tst_mae, tst_rmse, tst_not_found_ratio = evaluate( tst_user_item_sparse, indices, distances, tst_mean_rates) """ # del tst_user_item_sparse # del tst_mean_rates trn_mae_list.append(np.mean([1, 2])) trn_rmse_list.append(np.sqrt(np.mean([1, 2]))) trn_not_found_ratio_list.append(0.1) tst_mae_list.append(np.mean([1, 2])) tst_rmse_list.append(np.sqrt(np.mean([1, 2]))) tst_not_found_ratio_list.append(0.1) return np.mean(trn_mae_list), np.mean(trn_rmse_list), np.mean(trn_not_found_ratio_list), \ np.mean(tst_mae_list), np.mean(tst_rmse_list), np.mean(tst_not_found_ratio_list) def compute_evaluation(): train_mae_list = [] train_rmse_list = [] test_mae_list = [] test_rmse_list = [] parameters = [3, 5, 7, 10, 30, 50, 75, 100] parameters = [1000, 2000, 5000] min_rmse = 1000. target_k = 0 for t in parameters: print "=" * 71 print "K = %d" % t tr_mae, tr_rmse, tr_ratio, ts_mae, ts_rmse, ts_ratio = cf_k_fold_rmse(k=t) """ print "\nTraining Set" print "Not Found Ratio: %f" % tr_ratio print "MAE: %s" % str(tr_mae) print "RMSE: %s" % str(tr_rmse) """ print "\nTest Set" print "Not Found Ratio: %f" % ts_ratio print "MAE: %s" % str(ts_mae) print "RMSE: %s" % str(ts_rmse) print "\nMAE Training/Test difference: %f" % (np.abs(tr_mae - ts_mae)) print "RMSE Training/Test difference: %f" % (np.abs(tr_rmse - ts_rmse)) test_mae_list.append(ts_mae) test_rmse_list.append(ts_rmse) if ts_rmse < min_rmse: min_rmse = ts_rmse target_k = t print "=" * 71 print "Min Test RMSE: %s" % str(min_rmse) print "Target K: %d" % target_k return test_mae_list, test_rmse_list, parameters def draw(): test_mae_list, test_rmse_list, p = compute_evaluation() # plot MAE with fixed clusters plt.figure() plt.plot(p, test_mae_list, 'r', p, test_mae_list, 'rs', lw=2) plt.ylabel("MAE") plt.xlabel("number of neighbors") plt.title("Collaborative Filtering") plt.grid(True) # plot RMSE with fixed clusters plt.figure() plt.plot(p, test_rmse_list, 'k', p, test_rmse_list, 'ks', lw=2) plt.ylabel("RMSE") plt.xlabel("number of neighbors") plt.title("Collaborative Filtering") plt.grid(True) plt.show() if __name__ == '__main__': draw()
gpl-3.0
danforthcenter/plantcv
plantcv/plantcv/morphology/segment_angle.py
2
3251
# Find angles in degrees of skeleton segments import os import cv2 import numpy as np import pandas as pd from plantcv.plantcv import params from plantcv.plantcv import outputs from plantcv.plantcv import plot_image from plantcv.plantcv import print_image from plantcv.plantcv import color_palette def segment_angle(segmented_img, objects, label="default"): """ Calculate angle of segments (in degrees) by fitting a linear regression line to segments. Inputs: segmented_img = Segmented image to plot slope lines and angles on objects = List of contours label = optional label parameter, modifies the variable name of observations recorded Returns: labeled_img = Segmented debugging image with angles labeled :param segmented_img: numpy.ndarray :param objects: list :param label: str :return labeled_img: numpy.ndarray """ label_coord_x = [] label_coord_y = [] segment_angles = [] labeled_img = segmented_img.copy() # Use a previously saved color scale if available rand_color = color_palette(num=len(objects), saved=True) for i, cnt in enumerate(objects): # Find bounds for regression lines to get drawn rect = cv2.minAreaRect(cnt) pts = cv2.boxPoints(rect) df = pd.DataFrame(pts, columns=('x', 'y')) x_max = int(df['x'].max()) x_min = int(df['x'].min()) # Find line fit to each segment [vx, vy, x, y] = cv2.fitLine(objects[i], cv2.DIST_L2, 0, 0.01, 0.01) slope = -vy / vx left_list = int(((x - x_min) * slope) + y) right_list = int(((x - x_max) * slope) + y) if slope > 1000000 or slope < -1000000: print("Slope of contour with ID#", i, "is", slope, "and cannot be plotted.") else: # Draw slope lines cv2.line(labeled_img, (x_max - 1, right_list), (x_min, left_list), rand_color[i], 1) # Store coordinates for labels label_coord_x.append(objects[i][0][0][0]) label_coord_y.append(objects[i][0][0][1]) # Calculate degrees from slopes segment_angles.append(np.arctan(slope[0]) * 180 / np.pi) segment_ids = [] for i, cnt in enumerate(objects): # Label slope lines w = label_coord_x[i] h = label_coord_y[i] text = "{:.2f}".format(segment_angles[i]) cv2.putText(img=labeled_img, text=text, org=(w, h), fontFace=cv2.FONT_HERSHEY_SIMPLEX, fontScale=params.text_size, color=(150, 150, 150), thickness=params.text_thickness) # segment_label = "ID" + str(i) segment_ids.append(i) outputs.add_observation(sample=label, variable='segment_angle', trait='segment angle', method='plantcv.plantcv.morphology.segment_angle', scale='degrees', datatype=list, value=segment_angles, label=segment_ids) # Auto-increment device params.device += 1 if params.debug == 'print': print_image(labeled_img, os.path.join(params.debug_outdir, str(params.device) + '_segmented_angles.png')) elif params.debug == 'plot': plot_image(labeled_img) return labeled_img
mit
saskartt/kandi
plotProfiles.py
1
7136
#!/usr/bin/env python import sys import argparse import numpy as np from scipy.optimize import leastsq import matplotlib as mpl mpl.use('GTKCairo') import matplotlib.pyplot as plt from matplotlib.font_manager import FontProperties from matplotlib import rc from itertools import cycle from settings import * from kandiLib import * ''' Plot time-averaged profiles. ''' #==========================================================# parser = argparse.ArgumentParser( prog='plotProfiles.py', description='''Plot time-averaged profiles.''') parser.add_argument("-f", "--files", type=str, nargs='+',default=None, help="Name of the input netCDF4 files.") parser.add_argument("-d", "--domains", type=str, nargs='+', default=['0'], help="Statistical domains to process. Default: 00") parser.add_argument("-v", "--variable", type=str, default="u", help="Variable to be plotted.") parser.add_argument("-s", "--save", type=str, help="Save resulting figure as.") parser.add_argument("-ft", "--fit", type=int, nargs=2, default=[30,60], help="Range of vertical grid points to fit to.") parser.add_argument("-x", "--xlims", type=float, nargs=2, help="Set x axis limits manually.") parser.add_argument("-y", "--ylims", type=float, nargs=2, help="Set y axis limits manually.") args = parser.parse_args() #==========================================================# mpl.rcParams["mathtext.fontset"] ="cm" # Read all datasets into a list dsList = []; tpList = {}; nameList = {} for fname in args.files: ds = openDataSet(fname) nameList[ds] = fname dsList.append(ds) t_inds, = np.where(np.logical_and(ds.variables['time'][:] >= timespan[0], ds.variables['time'][:] <= timespan[1])) tpList[ds] = t_inds plt.figure(1) plt.grid() axes = plt.gca() if (args.xlims): axes.set_xlim(args.xlims) if (args.ylims): axes.set_ylim(args.ylims) else: axes.set_ylim([0, 128]) plt.ylabel("$z\/\mathrm{(m)}$",fontsize=14) color_cycle = ['b', 'g', 'r', 'c', 'm', 'y', 'fuchsia', 'gold', 'orange', 'lightcoral', 'lightslategrey','tan'] i=0 for ds in dsList: for domain in args.domains: if (args.variable == "u"): datalist=averageProfilesWS(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[0] plt.xlabel("$\mathbf{u}\/\mathrm{(m/s)}$",fontsize=14) elif (args.variable == "v"): datalist=averageProfilesWS(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[1] plt.xlabel("$\mathbf{v}\/\mathrm{(m/s)}$",fontsize=14) elif (args.variable == "w"): datalist=averageProfilesWS(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[2] plt.xlabel("$\mathbf{w}\/\mathrm{(m/s)}$",fontsize=14) elif (args.variable == "U"): datalist=averageProfilesWS(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[3] plt.xlabel("$\mathbf{U}\/\mathrm{(m/s)}$",fontsize=14) elif (args.variable == "u*2"): datalist=averageProfilesVariances(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[0] plt.xlabel("$\sigma^2_{u}\/\mathrm{(m^2/s^2)}$",fontsize=14) elif (args.variable == "v*2"): datalist=averageProfilesVariances(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[1] plt.xlabel("$\sigma^2_{v}\/\mathrm{(m^2/s^2)}$",fontsize=14) elif (args.variable == "w*2"): datalist=averageProfilesVariances(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[2] plt.xlabel("$\sigma^2_{w}\/\mathrm{(m^2/s^2)}$",fontsize=14) elif (args.variable == "wu"): datalist=averageProfilesMomentumFluxes(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[0] plt.xlabel("$\overline{u'w'}\/\mathrm{(m^2/s^2)}$",fontsize=14) elif (args.variable == "wv"): datalist=averageProfilesMomentumFluxes(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[1] plt.xlabel("$\overline{v'w'}\/\mathrm{(m^2/s^2)}$",fontsize=14) elif (args.variable == "flux"): datalist=averageProfilesMomentumFluxes(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[2] plt.xlabel(r"$\overline{u'w'}+ \overline{v'w'} \/\mathrm{(m^2/s^2)}$",fontsize=14) elif (args.variable == "tke"): datalist=averageProfilesTKE(domain, tpList[ds], pr_heights_plot, ds) pr = datalist[0] plt.xlabel("$TKE\/\mathrm{(m^2/s^2)}$",fontsize=14) elif (args.variable == "u*"): datalist=averageProfilesMomentumFluxes(domain, tpList[ds], pr_heights_plot, ds) pr1 = np.power(datalist[0],2.0) pr2 = np.power(datalist[1],2.0) pr = np.power(pr1+pr2,0.25) elif (args.variable == "z0"): flux=averageProfilesMomentumFluxes(domain, tpList[ds], pr_heights_plot, ds)[2] fric_vel= np.sqrt(np.polyfit(pr_heights_plot[20:80]/128.-1,flux[20:80],1)[0]) hwind = datalist=averageProfilesWS(domain, tpList[ds], pr_heights_plot, ds) hwind = hwind[3] disp_height = 30.-((60.-30.)/(np.exp(0.41*((hwind[60]/fric_vel)-(hwind[30]/fric_vel)))-1)) print("Displacement height: {}".format(disp_height)) uu = (hwind/fric_vel) pr = (pr_heights_plot-disp_height)*np.exp(-uu*0.41) pr_heights_plot = pr_heights_plot elif (args.variable == "wplog"): flux1=averageProfilesMomentumFluxes(domain, tpList[ds], pr_heights_plot, ds)[0] flux2=averageProfilesMomentumFluxes(domain, tpList[ds], pr_heights_plot, ds)[1] flux = (flux1**2.0 + flux2**2.0)**0.25 fric_vel= np.mean(flux[args.fit[0]:args.fit[1]]) print(fric_vel) datalist=averageProfilesWS(domain, tpList[ds], pr_heights_plot, ds) hwind = datalist[3] plt.xlabel("$\mathbf{u}/\mathbf{u_*}\/\mathrm{(m/s)}$",fontsize=14) plt.plot(hwind/fric_vel,pr_heights_plot, label=r'Run: {}, simulated'.format(nameList[ds][4], domain),color=color_cycle[i]) z=pr_heights_plot[args.fit[0]:args.fit[1]] u_profile = hwind[args.fit[0]:args.fit[1]] funcLogProfile = lambda val,z : (fric_vel/0.41)*np.log((z-val[1])/val[0]) ErrorFunc = lambda val,z,pr: np.abs(funcLogProfile(val,z)-u_profile) valInitial=(1.0,0.0) valFinal,success = leastsq(ErrorFunc,valInitial[:],args=(z,u_profile)) print("Least squrares fit: {}".format(valFinal)) np.seterr(invalid='ignore') pr=(1./0.41)*np.log((pr_heights_plot-valFinal[1])/valFinal[0]) # plt.plot(pr,pr_heights_plot, label=r'Run: {}, logprofile'.format(nameList[ds][4:], domain)) else: raise NameError("Unknown variable "+args.variable) if (args.ylims): axes.set_ylim([args.ylims[0],args.ylims[1]]) if (args.xlims): axes.set_xlim([args.xlims[0],args.xlims[1]]) plt.plot(pr,pr_heights_plot, label=r'Run: {}, log profile'.format(nameList[ds][4]), linestyle='--', color=color_cycle[i]) i=i+1 #axes.fill_between(np.linspace(0,12.0), 16, 32, facecolor='yellow', alpha=0.3, # label='Roof level < h < 0.3*BLH') leg = plt.legend(loc=0, fontsize=9) for legobj in leg.legendHandles: legobj.set_linewidth(2.0) if (args.save): plt.savefig(args.save) print("Figure {} saved.".format(args.save)) plt.show()
mit
fzalkow/scikit-learn
examples/linear_model/plot_sgd_loss_functions.py
249
1095
""" ========================== SGD: convex loss functions ========================== A plot that compares the various convex loss functions supported by :class:`sklearn.linear_model.SGDClassifier` . """ print(__doc__) import numpy as np import matplotlib.pyplot as plt def modified_huber_loss(y_true, y_pred): z = y_pred * y_true loss = -4 * z loss[z >= -1] = (1 - z[z >= -1]) ** 2 loss[z >= 1.] = 0 return loss xmin, xmax = -4, 4 xx = np.linspace(xmin, xmax, 100) plt.plot([xmin, 0, 0, xmax], [1, 1, 0, 0], 'k-', label="Zero-one loss") plt.plot(xx, np.where(xx < 1, 1 - xx, 0), 'g-', label="Hinge loss") plt.plot(xx, -np.minimum(xx, 0), 'm-', label="Perceptron loss") plt.plot(xx, np.log2(1 + np.exp(-xx)), 'r-', label="Log loss") plt.plot(xx, np.where(xx < 1, 1 - xx, 0) ** 2, 'b-', label="Squared hinge loss") plt.plot(xx, modified_huber_loss(xx, 1), 'y--', label="Modified Huber loss") plt.ylim((0, 8)) plt.legend(loc="upper right") plt.xlabel(r"Decision function $f(x)$") plt.ylabel("$L(y, f(x))$") plt.show()
bsd-3-clause
AsaWilks/diabetes_test
diabetes.py
1
1326
# -*- coding: utf-8 -*- """ Spyder Editor This is a temporary script file. """ me = "asa" twome = me*2 print(twome) x = (1,2,3,4,5) y = (3,4,5,6,7) import matplotlib.pyplot as plt import numpy as np from sklearn import datasets, linear_model # Load the diabetes dataset diabetes = datasets.load_diabetes() # Use only one feature diabetes_X = diabetes.data[:, np.newaxis, 2] # Split the data into training/testing sets diabetes_X_train = diabetes_X[:-20] diabetes_X_test = diabetes_X[-20:] # Split the targets into training/testing sets diabetes_y_train = diabetes.target[:-20] diabetes_y_test = diabetes.target[-20:] # Create linear regression object regr = linear_model.LinearRegression() # Train the model using the training sets regr.fit(diabetes_X_train, diabetes_y_train) # The coefficients print('Coefficients: \n', regr.coef_) # The mean square error print("Residual sum of squares: %.2f" % np.mean((regr.predict(diabetes_X_test) - diabetes_y_test) ** 2)) # Explained variance score: 1 is perfect prediction print('Variance score: %.2f' % regr.score(diabetes_X_test, diabetes_y_test)) # Plot outputs plt.scatter(diabetes_X_test, diabetes_y_test, color='black') plt.plot(diabetes_X_test, regr.predict(diabetes_X_test), color='blue', linewidth=3) plt.xticks(()) plt.yticks(()) plt.show()
mit
nvoron23/scikit-learn
sklearn/ensemble/tests/test_gradient_boosting.py
56
37976
""" Testing for the gradient boosting module (sklearn.ensemble.gradient_boosting). """ import warnings import numpy as np from sklearn import datasets from sklearn.base import clone from sklearn.ensemble import GradientBoostingClassifier from sklearn.ensemble import GradientBoostingRegressor from sklearn.ensemble.gradient_boosting import ZeroEstimator from sklearn.metrics import mean_squared_error from sklearn.utils import check_random_state, tosequence from sklearn.utils.testing import assert_almost_equal from sklearn.utils.testing import assert_array_almost_equal from sklearn.utils.testing import assert_array_equal from sklearn.utils.testing import assert_equal from sklearn.utils.testing import assert_greater from sklearn.utils.testing import assert_less from sklearn.utils.testing import assert_raises from sklearn.utils.testing import assert_true from sklearn.utils.testing import assert_warns from sklearn.utils.validation import DataConversionWarning from sklearn.utils.validation import NotFittedError # toy sample X = [[-2, -1], [-1, -1], [-1, -2], [1, 1], [1, 2], [2, 1]] y = [-1, -1, -1, 1, 1, 1] T = [[-1, -1], [2, 2], [3, 2]] true_result = [-1, 1, 1] rng = np.random.RandomState(0) # also load the boston dataset # and randomly permute it boston = datasets.load_boston() perm = rng.permutation(boston.target.size) boston.data = boston.data[perm] boston.target = boston.target[perm] # also load the iris dataset # and randomly permute it iris = datasets.load_iris() perm = rng.permutation(iris.target.size) iris.data = iris.data[perm] iris.target = iris.target[perm] def test_classification_toy(): # Check classification on a toy dataset. for loss in ('deviance', 'exponential'): clf = GradientBoostingClassifier(loss=loss, n_estimators=10, random_state=1) assert_raises(ValueError, clf.predict, T) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result) assert_equal(10, len(clf.estimators_)) deviance_decrease = (clf.train_score_[:-1] - clf.train_score_[1:]) assert np.any(deviance_decrease >= 0.0), \ "Train deviance does not monotonically decrease." leaves = clf.apply(X) assert_equal(leaves.shape, (6, 10, 1)) def test_parameter_checks(): # Check input parameter validation. assert_raises(ValueError, GradientBoostingClassifier(n_estimators=0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(n_estimators=-1).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(learning_rate=0.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(learning_rate=-1.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(loss='foobar').fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_samples_split=0.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_samples_split=-1.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_samples_leaf=0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_samples_leaf=-1.).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_weight_fraction_leaf=-1.).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_weight_fraction_leaf=0.6).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(subsample=0.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(subsample=1.1).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(subsample=-0.1).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(max_depth=-0.1).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(max_depth=0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(init={}).fit, X, y) # test fit before feature importance assert_raises(ValueError, lambda: GradientBoostingClassifier().feature_importances_) # deviance requires ``n_classes >= 2``. assert_raises(ValueError, lambda X, y: GradientBoostingClassifier( loss='deviance').fit(X, y), X, [0, 0, 0, 0]) def test_loss_function(): assert_raises(ValueError, GradientBoostingClassifier(loss='ls').fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(loss='lad').fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(loss='quantile').fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(loss='huber').fit, X, y) assert_raises(ValueError, GradientBoostingRegressor(loss='deviance').fit, X, y) assert_raises(ValueError, GradientBoostingRegressor(loss='exponential').fit, X, y) def test_classification_synthetic(): # Test GradientBoostingClassifier on synthetic dataset used by # Hastie et al. in ESLII Example 12.7. X, y = datasets.make_hastie_10_2(n_samples=12000, random_state=1) X_train, X_test = X[:2000], X[2000:] y_train, y_test = y[:2000], y[2000:] for loss in ('deviance', 'exponential'): gbrt = GradientBoostingClassifier(n_estimators=100, min_samples_split=1, max_depth=1, loss=loss, learning_rate=1.0, random_state=0) gbrt.fit(X_train, y_train) error_rate = (1.0 - gbrt.score(X_test, y_test)) assert error_rate < 0.09, \ "GB(loss={}) failed with error {}".format(loss, error_rate) gbrt = GradientBoostingClassifier(n_estimators=200, min_samples_split=1, max_depth=1, learning_rate=1.0, subsample=0.5, random_state=0) gbrt.fit(X_train, y_train) error_rate = (1.0 - gbrt.score(X_test, y_test)) assert error_rate < 0.08, ("Stochastic GradientBoostingClassifier(loss={}) " "failed with error {}".format(loss, error_rate)) def test_boston(): # Check consistency on dataset boston house prices with least squares # and least absolute deviation. for loss in ("ls", "lad", "huber"): for subsample in (1.0, 0.5): last_y_pred = None for i, sample_weight in enumerate( (None, np.ones(len(boston.target)), 2 * np.ones(len(boston.target)))): clf = GradientBoostingRegressor(n_estimators=100, loss=loss, max_depth=4, subsample=subsample, min_samples_split=1, random_state=1) assert_raises(ValueError, clf.predict, boston.data) clf.fit(boston.data, boston.target, sample_weight=sample_weight) leaves = clf.apply(boston.data) assert_equal(leaves.shape, (506, 100)) y_pred = clf.predict(boston.data) mse = mean_squared_error(boston.target, y_pred) assert mse < 6.0, "Failed with loss %s and " \ "mse = %.4f" % (loss, mse) if last_y_pred is not None: np.testing.assert_array_almost_equal( last_y_pred, y_pred, err_msg='pred_%d doesnt match last pred_%d for loss %r and subsample %r. ' % (i, i - 1, loss, subsample)) last_y_pred = y_pred def test_iris(): # Check consistency on dataset iris. for subsample in (1.0, 0.5): for sample_weight in (None, np.ones(len(iris.target))): clf = GradientBoostingClassifier(n_estimators=100, loss='deviance', random_state=1, subsample=subsample) clf.fit(iris.data, iris.target, sample_weight=sample_weight) score = clf.score(iris.data, iris.target) assert score > 0.9, "Failed with subsample %.1f " \ "and score = %f" % (subsample, score) leaves = clf.apply(iris.data) assert_equal(leaves.shape, (150, 100, 3)) def test_regression_synthetic(): # Test on synthetic regression datasets used in Leo Breiman, # `Bagging Predictors?. Machine Learning 24(2): 123-140 (1996). random_state = check_random_state(1) regression_params = {'n_estimators': 100, 'max_depth': 4, 'min_samples_split': 1, 'learning_rate': 0.1, 'loss': 'ls'} # Friedman1 X, y = datasets.make_friedman1(n_samples=1200, random_state=random_state, noise=1.0) X_train, y_train = X[:200], y[:200] X_test, y_test = X[200:], y[200:] clf = GradientBoostingRegressor() clf.fit(X_train, y_train) mse = mean_squared_error(y_test, clf.predict(X_test)) assert mse < 5.0, "Failed on Friedman1 with mse = %.4f" % mse # Friedman2 X, y = datasets.make_friedman2(n_samples=1200, random_state=random_state) X_train, y_train = X[:200], y[:200] X_test, y_test = X[200:], y[200:] clf = GradientBoostingRegressor(**regression_params) clf.fit(X_train, y_train) mse = mean_squared_error(y_test, clf.predict(X_test)) assert mse < 1700.0, "Failed on Friedman2 with mse = %.4f" % mse # Friedman3 X, y = datasets.make_friedman3(n_samples=1200, random_state=random_state) X_train, y_train = X[:200], y[:200] X_test, y_test = X[200:], y[200:] clf = GradientBoostingRegressor(**regression_params) clf.fit(X_train, y_train) mse = mean_squared_error(y_test, clf.predict(X_test)) assert mse < 0.015, "Failed on Friedman3 with mse = %.4f" % mse def test_feature_importances(): X = np.array(boston.data, dtype=np.float32) y = np.array(boston.target, dtype=np.float32) clf = GradientBoostingRegressor(n_estimators=100, max_depth=5, min_samples_split=1, random_state=1) clf.fit(X, y) #feature_importances = clf.feature_importances_ assert_true(hasattr(clf, 'feature_importances_')) X_new = clf.transform(X, threshold="mean") assert_less(X_new.shape[1], X.shape[1]) feature_mask = clf.feature_importances_ > clf.feature_importances_.mean() assert_array_almost_equal(X_new, X[:, feature_mask]) # true feature importance ranking # true_ranking = np.array([3, 1, 8, 2, 10, 9, 4, 11, 0, 6, 7, 5, 12]) # assert_array_equal(true_ranking, feature_importances.argsort()) def test_probability_log(): # Predict probabilities. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) assert_raises(ValueError, clf.predict_proba, T) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result) # check if probabilities are in [0, 1]. y_proba = clf.predict_proba(T) assert np.all(y_proba >= 0.0) assert np.all(y_proba <= 1.0) # derive predictions from probabilities y_pred = clf.classes_.take(y_proba.argmax(axis=1), axis=0) assert_array_equal(y_pred, true_result) def test_check_inputs(): # Test input checks (shape and type of X and y). clf = GradientBoostingClassifier(n_estimators=100, random_state=1) assert_raises(ValueError, clf.fit, X, y + [0, 1]) from scipy import sparse X_sparse = sparse.csr_matrix(X) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) assert_raises(TypeError, clf.fit, X_sparse, y) clf = GradientBoostingClassifier().fit(X, y) assert_raises(TypeError, clf.predict, X_sparse) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) assert_raises(ValueError, clf.fit, X, y, sample_weight=([1] * len(y)) + [0, 1]) def test_check_inputs_predict(): # X has wrong shape clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X, y) x = np.array([1.0, 2.0])[:, np.newaxis] assert_raises(ValueError, clf.predict, x) x = np.array([[]]) assert_raises(ValueError, clf.predict, x) x = np.array([1.0, 2.0, 3.0])[:, np.newaxis] assert_raises(ValueError, clf.predict, x) clf = GradientBoostingRegressor(n_estimators=100, random_state=1) clf.fit(X, rng.rand(len(X))) x = np.array([1.0, 2.0])[:, np.newaxis] assert_raises(ValueError, clf.predict, x) x = np.array([[]]) assert_raises(ValueError, clf.predict, x) x = np.array([1.0, 2.0, 3.0])[:, np.newaxis] assert_raises(ValueError, clf.predict, x) def test_check_max_features(): # test if max_features is valid. clf = GradientBoostingRegressor(n_estimators=100, random_state=1, max_features=0) assert_raises(ValueError, clf.fit, X, y) clf = GradientBoostingRegressor(n_estimators=100, random_state=1, max_features=(len(X[0]) + 1)) assert_raises(ValueError, clf.fit, X, y) clf = GradientBoostingRegressor(n_estimators=100, random_state=1, max_features=-0.1) assert_raises(ValueError, clf.fit, X, y) def test_max_feature_regression(): # Test to make sure random state is set properly. X, y = datasets.make_hastie_10_2(n_samples=12000, random_state=1) X_train, X_test = X[:2000], X[2000:] y_train, y_test = y[:2000], y[2000:] gbrt = GradientBoostingClassifier(n_estimators=100, min_samples_split=5, max_depth=2, learning_rate=.1, max_features=2, random_state=1) gbrt.fit(X_train, y_train) deviance = gbrt.loss_(y_test, gbrt.decision_function(X_test)) assert_true(deviance < 0.5, "GB failed with deviance %.4f" % deviance) def test_max_feature_auto(): # Test if max features is set properly for floats and str. X, y = datasets.make_hastie_10_2(n_samples=12000, random_state=1) _, n_features = X.shape X_train = X[:2000] y_train = y[:2000] gbrt = GradientBoostingClassifier(n_estimators=1, max_features='auto') gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, int(np.sqrt(n_features))) gbrt = GradientBoostingRegressor(n_estimators=1, max_features='auto') gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, n_features) gbrt = GradientBoostingRegressor(n_estimators=1, max_features=0.3) gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, int(n_features * 0.3)) gbrt = GradientBoostingRegressor(n_estimators=1, max_features='sqrt') gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, int(np.sqrt(n_features))) gbrt = GradientBoostingRegressor(n_estimators=1, max_features='log2') gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, int(np.log2(n_features))) gbrt = GradientBoostingRegressor(n_estimators=1, max_features=0.01 / X.shape[1]) gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, 1) def test_staged_predict(): # Test whether staged decision function eventually gives # the same prediction. X, y = datasets.make_friedman1(n_samples=1200, random_state=1, noise=1.0) X_train, y_train = X[:200], y[:200] X_test = X[200:] clf = GradientBoostingRegressor() # test raise ValueError if not fitted assert_raises(ValueError, lambda X: np.fromiter( clf.staged_predict(X), dtype=np.float64), X_test) clf.fit(X_train, y_train) y_pred = clf.predict(X_test) # test if prediction for last stage equals ``predict`` for y in clf.staged_predict(X_test): assert_equal(y.shape, y_pred.shape) assert_array_equal(y_pred, y) def test_staged_predict_proba(): # Test whether staged predict proba eventually gives # the same prediction. X, y = datasets.make_hastie_10_2(n_samples=1200, random_state=1) X_train, y_train = X[:200], y[:200] X_test, y_test = X[200:], y[200:] clf = GradientBoostingClassifier(n_estimators=20) # test raise NotFittedError if not fitted assert_raises(NotFittedError, lambda X: np.fromiter( clf.staged_predict_proba(X), dtype=np.float64), X_test) clf.fit(X_train, y_train) # test if prediction for last stage equals ``predict`` for y_pred in clf.staged_predict(X_test): assert_equal(y_test.shape, y_pred.shape) assert_array_equal(clf.predict(X_test), y_pred) # test if prediction for last stage equals ``predict_proba`` for staged_proba in clf.staged_predict_proba(X_test): assert_equal(y_test.shape[0], staged_proba.shape[0]) assert_equal(2, staged_proba.shape[1]) assert_array_equal(clf.predict_proba(X_test), staged_proba) def test_staged_functions_defensive(): # test that staged_functions make defensive copies rng = np.random.RandomState(0) X = rng.uniform(size=(10, 3)) y = (4 * X[:, 0]).astype(np.int) + 1 # don't predict zeros for estimator in [GradientBoostingRegressor(), GradientBoostingClassifier()]: estimator.fit(X, y) for func in ['predict', 'decision_function', 'predict_proba']: staged_func = getattr(estimator, "staged_" + func, None) if staged_func is None: # regressor has no staged_predict_proba continue with warnings.catch_warnings(record=True): staged_result = list(staged_func(X)) staged_result[1][:] = 0 assert_true(np.all(staged_result[0] != 0)) def test_serialization(): # Check model serialization. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) try: import cPickle as pickle except ImportError: import pickle serialized_clf = pickle.dumps(clf, protocol=pickle.HIGHEST_PROTOCOL) clf = None clf = pickle.loads(serialized_clf) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) def test_degenerate_targets(): # Check if we can fit even though all targets are equal. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) # classifier should raise exception assert_raises(ValueError, clf.fit, X, np.ones(len(X))) clf = GradientBoostingRegressor(n_estimators=100, random_state=1) clf.fit(X, np.ones(len(X))) clf.predict([rng.rand(2)]) assert_array_equal(np.ones((1,), dtype=np.float64), clf.predict([rng.rand(2)])) def test_quantile_loss(): # Check if quantile loss with alpha=0.5 equals lad. clf_quantile = GradientBoostingRegressor(n_estimators=100, loss='quantile', max_depth=4, alpha=0.5, random_state=7) clf_quantile.fit(boston.data, boston.target) y_quantile = clf_quantile.predict(boston.data) clf_lad = GradientBoostingRegressor(n_estimators=100, loss='lad', max_depth=4, random_state=7) clf_lad.fit(boston.data, boston.target) y_lad = clf_lad.predict(boston.data) assert_array_almost_equal(y_quantile, y_lad, decimal=4) def test_symbol_labels(): # Test with non-integer class labels. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) symbol_y = tosequence(map(str, y)) clf.fit(X, symbol_y) assert_array_equal(clf.predict(T), tosequence(map(str, true_result))) assert_equal(100, len(clf.estimators_)) def test_float_class_labels(): # Test with float class labels. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) float_y = np.asarray(y, dtype=np.float32) clf.fit(X, float_y) assert_array_equal(clf.predict(T), np.asarray(true_result, dtype=np.float32)) assert_equal(100, len(clf.estimators_)) def test_shape_y(): # Test with float class labels. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) y_ = np.asarray(y, dtype=np.int32) y_ = y_[:, np.newaxis] # This will raise a DataConversionWarning that we want to # "always" raise, elsewhere the warnings gets ignored in the # later tests, and the tests that check for this warning fail assert_warns(DataConversionWarning, clf.fit, X, y_) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) def test_mem_layout(): # Test with different memory layouts of X and y X_ = np.asfortranarray(X) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X_, y) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) X_ = np.ascontiguousarray(X) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X_, y) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) y_ = np.asarray(y, dtype=np.int32) y_ = np.ascontiguousarray(y_) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X, y_) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) y_ = np.asarray(y, dtype=np.int32) y_ = np.asfortranarray(y_) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X, y_) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) def test_oob_improvement(): # Test if oob improvement has correct shape and regression test. clf = GradientBoostingClassifier(n_estimators=100, random_state=1, subsample=0.5) clf.fit(X, y) assert clf.oob_improvement_.shape[0] == 100 # hard-coded regression test - change if modification in OOB computation assert_array_almost_equal(clf.oob_improvement_[:5], np.array([0.19, 0.15, 0.12, -0.12, -0.11]), decimal=2) def test_oob_improvement_raise(): # Test if oob improvement has correct shape. clf = GradientBoostingClassifier(n_estimators=100, random_state=1, subsample=1.0) clf.fit(X, y) assert_raises(AttributeError, lambda: clf.oob_improvement_) def test_oob_multilcass_iris(): # Check OOB improvement on multi-class dataset. clf = GradientBoostingClassifier(n_estimators=100, loss='deviance', random_state=1, subsample=0.5) clf.fit(iris.data, iris.target) score = clf.score(iris.data, iris.target) assert score > 0.9, "Failed with subsample %.1f " \ "and score = %f" % (0.5, score) assert clf.oob_improvement_.shape[0] == clf.n_estimators # hard-coded regression test - change if modification in OOB computation # FIXME: the following snippet does not yield the same results on 32 bits # assert_array_almost_equal(clf.oob_improvement_[:5], # np.array([12.68, 10.45, 8.18, 6.43, 5.13]), # decimal=2) def test_verbose_output(): # Check verbose=1 does not cause error. from sklearn.externals.six.moves import cStringIO as StringIO import sys old_stdout = sys.stdout sys.stdout = StringIO() clf = GradientBoostingClassifier(n_estimators=100, random_state=1, verbose=1, subsample=0.8) clf.fit(X, y) verbose_output = sys.stdout sys.stdout = old_stdout # check output verbose_output.seek(0) header = verbose_output.readline().rstrip() # with OOB true_header = ' '.join(['%10s'] + ['%16s'] * 3) % ( 'Iter', 'Train Loss', 'OOB Improve', 'Remaining Time') assert_equal(true_header, header) n_lines = sum(1 for l in verbose_output.readlines()) # one for 1-10 and then 9 for 20-100 assert_equal(10 + 9, n_lines) def test_more_verbose_output(): # Check verbose=2 does not cause error. from sklearn.externals.six.moves import cStringIO as StringIO import sys old_stdout = sys.stdout sys.stdout = StringIO() clf = GradientBoostingClassifier(n_estimators=100, random_state=1, verbose=2) clf.fit(X, y) verbose_output = sys.stdout sys.stdout = old_stdout # check output verbose_output.seek(0) header = verbose_output.readline().rstrip() # no OOB true_header = ' '.join(['%10s'] + ['%16s'] * 2) % ( 'Iter', 'Train Loss', 'Remaining Time') assert_equal(true_header, header) n_lines = sum(1 for l in verbose_output.readlines()) # 100 lines for n_estimators==100 assert_equal(100, n_lines) def test_warm_start(): # Test if warm start equals fit. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=200, max_depth=1) est.fit(X, y) est_ws = Cls(n_estimators=100, max_depth=1, warm_start=True) est_ws.fit(X, y) est_ws.set_params(n_estimators=200) est_ws.fit(X, y) assert_array_almost_equal(est_ws.predict(X), est.predict(X)) def test_warm_start_n_estimators(): # Test if warm start equals fit - set n_estimators. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=300, max_depth=1) est.fit(X, y) est_ws = Cls(n_estimators=100, max_depth=1, warm_start=True) est_ws.fit(X, y) est_ws.set_params(n_estimators=300) est_ws.fit(X, y) assert_array_almost_equal(est_ws.predict(X), est.predict(X)) def test_warm_start_max_depth(): # Test if possible to fit trees of different depth in ensemble. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1, warm_start=True) est.fit(X, y) est.set_params(n_estimators=110, max_depth=2) est.fit(X, y) # last 10 trees have different depth assert est.estimators_[0, 0].max_depth == 1 for i in range(1, 11): assert est.estimators_[-i, 0].max_depth == 2 def test_warm_start_clear(): # Test if fit clears state. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1) est.fit(X, y) est_2 = Cls(n_estimators=100, max_depth=1, warm_start=True) est_2.fit(X, y) # inits state est_2.set_params(warm_start=False) est_2.fit(X, y) # clears old state and equals est assert_array_almost_equal(est_2.predict(X), est.predict(X)) def test_warm_start_zero_n_estimators(): # Test if warm start with zero n_estimators raises error X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1, warm_start=True) est.fit(X, y) est.set_params(n_estimators=0) assert_raises(ValueError, est.fit, X, y) def test_warm_start_smaller_n_estimators(): # Test if warm start with smaller n_estimators raises error X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1, warm_start=True) est.fit(X, y) est.set_params(n_estimators=99) assert_raises(ValueError, est.fit, X, y) def test_warm_start_equal_n_estimators(): # Test if warm start with equal n_estimators does nothing X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1) est.fit(X, y) est2 = clone(est) est2.set_params(n_estimators=est.n_estimators, warm_start=True) est2.fit(X, y) assert_array_almost_equal(est2.predict(X), est.predict(X)) def test_warm_start_oob_switch(): # Test if oob can be turned on during warm start. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1, warm_start=True) est.fit(X, y) est.set_params(n_estimators=110, subsample=0.5) est.fit(X, y) assert_array_equal(est.oob_improvement_[:100], np.zeros(100)) # the last 10 are not zeros assert_array_equal(est.oob_improvement_[-10:] == 0.0, np.zeros(10, dtype=np.bool)) def test_warm_start_oob(): # Test if warm start OOB equals fit. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=200, max_depth=1, subsample=0.5, random_state=1) est.fit(X, y) est_ws = Cls(n_estimators=100, max_depth=1, subsample=0.5, random_state=1, warm_start=True) est_ws.fit(X, y) est_ws.set_params(n_estimators=200) est_ws.fit(X, y) assert_array_almost_equal(est_ws.oob_improvement_[:100], est.oob_improvement_[:100]) def early_stopping_monitor(i, est, locals): """Returns True on the 10th iteration. """ if i == 9: return True else: return False def test_monitor_early_stopping(): # Test if monitor return value works. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=20, max_depth=1, random_state=1, subsample=0.5) est.fit(X, y, monitor=early_stopping_monitor) assert_equal(est.n_estimators, 20) # this is not altered assert_equal(est.estimators_.shape[0], 10) assert_equal(est.train_score_.shape[0], 10) assert_equal(est.oob_improvement_.shape[0], 10) # try refit est.set_params(n_estimators=30) est.fit(X, y) assert_equal(est.n_estimators, 30) assert_equal(est.estimators_.shape[0], 30) assert_equal(est.train_score_.shape[0], 30) est = Cls(n_estimators=20, max_depth=1, random_state=1, subsample=0.5, warm_start=True) est.fit(X, y, monitor=early_stopping_monitor) assert_equal(est.n_estimators, 20) assert_equal(est.estimators_.shape[0], 10) assert_equal(est.train_score_.shape[0], 10) assert_equal(est.oob_improvement_.shape[0], 10) # try refit est.set_params(n_estimators=30, warm_start=False) est.fit(X, y) assert_equal(est.n_estimators, 30) assert_equal(est.train_score_.shape[0], 30) assert_equal(est.estimators_.shape[0], 30) assert_equal(est.oob_improvement_.shape[0], 30) def test_complete_classification(): # Test greedy trees with max_depth + 1 leafs. from sklearn.tree._tree import TREE_LEAF X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) k = 4 est = GradientBoostingClassifier(n_estimators=20, max_depth=None, random_state=1, max_leaf_nodes=k + 1) est.fit(X, y) tree = est.estimators_[0, 0].tree_ assert_equal(tree.max_depth, k) assert_equal(tree.children_left[tree.children_left == TREE_LEAF].shape[0], k + 1) def test_complete_regression(): # Test greedy trees with max_depth + 1 leafs. from sklearn.tree._tree import TREE_LEAF k = 4 est = GradientBoostingRegressor(n_estimators=20, max_depth=None, random_state=1, max_leaf_nodes=k + 1) est.fit(boston.data, boston.target) tree = est.estimators_[-1, 0].tree_ assert_equal(tree.children_left[tree.children_left == TREE_LEAF].shape[0], k + 1) def test_zero_estimator_reg(): # Test if ZeroEstimator works for regression. est = GradientBoostingRegressor(n_estimators=20, max_depth=1, random_state=1, init=ZeroEstimator()) est.fit(boston.data, boston.target) y_pred = est.predict(boston.data) mse = mean_squared_error(boston.target, y_pred) assert_almost_equal(mse, 33.0, decimal=0) est = GradientBoostingRegressor(n_estimators=20, max_depth=1, random_state=1, init='zero') est.fit(boston.data, boston.target) y_pred = est.predict(boston.data) mse = mean_squared_error(boston.target, y_pred) assert_almost_equal(mse, 33.0, decimal=0) est = GradientBoostingRegressor(n_estimators=20, max_depth=1, random_state=1, init='foobar') assert_raises(ValueError, est.fit, boston.data, boston.target) def test_zero_estimator_clf(): # Test if ZeroEstimator works for classification. X = iris.data y = np.array(iris.target) est = GradientBoostingClassifier(n_estimators=20, max_depth=1, random_state=1, init=ZeroEstimator()) est.fit(X, y) assert est.score(X, y) > 0.96 est = GradientBoostingClassifier(n_estimators=20, max_depth=1, random_state=1, init='zero') est.fit(X, y) assert est.score(X, y) > 0.96 # binary clf mask = y != 0 y[mask] = 1 y[~mask] = 0 est = GradientBoostingClassifier(n_estimators=20, max_depth=1, random_state=1, init='zero') est.fit(X, y) assert est.score(X, y) > 0.96 est = GradientBoostingClassifier(n_estimators=20, max_depth=1, random_state=1, init='foobar') assert_raises(ValueError, est.fit, X, y) def test_max_leaf_nodes_max_depth(): # Test preceedence of max_leaf_nodes over max_depth. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) all_estimators = [GradientBoostingRegressor, GradientBoostingClassifier] k = 4 for GBEstimator in all_estimators: est = GBEstimator(max_depth=1, max_leaf_nodes=k).fit(X, y) tree = est.estimators_[0, 0].tree_ assert_greater(tree.max_depth, 1) est = GBEstimator(max_depth=1).fit(X, y) tree = est.estimators_[0, 0].tree_ assert_equal(tree.max_depth, 1) def test_warm_start_wo_nestimators_change(): # Test if warm_start does nothing if n_estimators is not changed. # Regression test for #3513. clf = GradientBoostingClassifier(n_estimators=10, warm_start=True) clf.fit([[0, 1], [2, 3]], [0, 1]) assert clf.estimators_.shape[0] == 10 clf.fit([[0, 1], [2, 3]], [0, 1]) assert clf.estimators_.shape[0] == 10 def test_probability_exponential(): # Predict probabilities. clf = GradientBoostingClassifier(loss='exponential', n_estimators=100, random_state=1) assert_raises(ValueError, clf.predict_proba, T) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result) # check if probabilities are in [0, 1]. y_proba = clf.predict_proba(T) assert np.all(y_proba >= 0.0) assert np.all(y_proba <= 1.0) score = clf.decision_function(T).ravel() assert_array_almost_equal(y_proba[:, 1], 1.0 / (1.0 + np.exp(-2 * score))) # derive predictions from probabilities y_pred = clf.classes_.take(y_proba.argmax(axis=1), axis=0) assert_array_equal(y_pred, true_result) def test_non_uniform_weights_toy_edge_case_reg(): X = [[1, 0], [1, 0], [1, 0], [0, 1]] y = [0, 0, 1, 0] # ignore the first 2 training samples by setting their weight to 0 sample_weight = [0, 0, 1, 1] for loss in ('huber', 'ls', 'lad', 'quantile'): gb = GradientBoostingRegressor(learning_rate=1.0, n_estimators=2, loss=loss) gb.fit(X, y, sample_weight=sample_weight) assert_greater(gb.predict([[1, 0]])[0], 0.5) def test_non_uniform_weights_toy_min_weight_leaf(): # Regression test for issue #4447 X = [[1, 0], [1, 0], [1, 0], [0, 1], ] y = [0, 0, 1, 0] # ignore the first 2 training samples by setting their weight to 0 sample_weight = [0, 0, 1, 1] gb = GradientBoostingRegressor(n_estimators=5, min_weight_fraction_leaf=0.1) gb.fit(X, y, sample_weight=sample_weight) assert_true(gb.predict([[1, 0]])[0] > 0.5) assert_almost_equal(gb.estimators_[0, 0].splitter.min_weight_leaf, 0.2) def test_non_uniform_weights_toy_edge_case_clf(): X = [[1, 0], [1, 0], [1, 0], [0, 1]] y = [0, 0, 1, 0] # ignore the first 2 training samples by setting their weight to 0 sample_weight = [0, 0, 1, 1] for loss in ('deviance', 'exponential'): gb = GradientBoostingClassifier(n_estimators=5) gb.fit(X, y, sample_weight=sample_weight) assert_array_equal(gb.predict([[1, 0]]), [1])
bsd-3-clause
josesho/bootstrapContrast
bootstrap_contrast/plot_tools.py
2
4118
import matplotlib.pyplot as plt import seaborn as sns import numpy as np from .misc_tools import merge_two_dicts def halfviolin(v, half = 'right', color = 'k'): for b in v['bodies']: mVertical = np.mean(b.get_paths()[0].vertices[:, 0]) mHorizontal = np.mean(b.get_paths()[0].vertices[:, 1]) if half is 'left': b.get_paths()[0].vertices[:, 0] = np.clip(b.get_paths()[0].vertices[:, 0], -np.inf, mVertical) if half is 'right': b.get_paths()[0].vertices[:, 0] = np.clip(b.get_paths()[0].vertices[:, 0], mVertical, np.inf) if half is 'bottom': b.get_paths()[0].vertices[:, 1] = np.clip(b.get_paths()[0].vertices[:, 1], -np.inf, mHorizontal) if half is 'top': b.get_paths()[0].vertices[:, 1] = np.clip(b.get_paths()[0].vertices[:, 1], mHorizontal, np.inf) b.set_color(color) def align_yaxis(ax1, v1, ax2, v2): """adjust ax2 ylimit so that v2 in ax2 is aligned to v1 in ax1""" # Taken from # http://stackoverflow.com/questions/7630778/matplotlib-align-origin-of-right-axis-with-specific-left-axis-value _, y1 = ax1.transData.transform((0, v1)) _, y2 = ax2.transData.transform((0, v2)) inv = ax2.transData.inverted() _, dy = inv.transform((0, 0)) - inv.transform((0, y1-y2)) miny, maxy = ax2.get_ylim() ax2.set_ylim(miny+dy, maxy+dy) def rotate_ticks(axes, angle=45, alignment='right'): for tick in axes.get_xticklabels(): tick.set_rotation(angle) tick.set_horizontalalignment(alignment) def plot_means(data,x,y,ax=None,xwidth=0.5,zorder=1,linestyle_kw=None): """Takes a pandas DataFrame and plots the `y` means of each group in `x` as horizontal lines. Keyword arguments: data: pandas DataFrame. This DataFrame should be in 'wide' format. x,y: string. x and y columns to be plotted. xwidth: float, default 0.5 The horizontal spread of the line. The default is 0.5, which means the mean line will stretch 0.5 (in data coordinates) on both sides of the xtick. zorder: int, default 1 This is the plot order of the means on the axes. See http://matplotlib.org/examples/pylab_examples/zorder_demo.html linestyle_kw: dict, default None Dictionary with kwargs passed to the `meanprops` argument of `plt.boxplot`. """ # Set default linestyle parameters. default_linestyle_kw=dict( linewidth=1.5, color='k', linestyle='-') # If user has specified kwargs for linestyle, merge with default params. if linestyle_kw is None: meanlinestyle_kw=default_linestyle_kw else: meanlinestyle_kw=merge_two_dicts(default_linestyle_kw,linestyle_kw) # Set axes for plotting. if ax is None: ax=plt.gca() # Use sns.boxplot to create the mean lines. sns.boxplot(data=data, x=x,y=y, ax=ax, showmeans=True, meanline=True, showbox=False, showcaps=False, showfliers=False, whis=0, width=xwidth, zorder=int(zorder), meanprops=meanlinestyle_kw, medianprops=dict(linewidth=0) ) def plot_std(data, x, y, offset=0, ax=None, **kwargs): '''Convenience function to plot the standard devations as vertical errorbars.''' if ax is None: ax = plt.gca() keys = kwargs.keys() if 'zorder' not in keys: kwargs['zorder'] = 5 if 'lw' not in keys: kwargs['lw'] = 2.25, if 'color' not in keys: kwargs['color'] = 'k' if 'alpha' not in keys: kwargs['alpha'] = 0.5 num_groups = len(data[x].unique()) ax.errorbar(x=np.array(range(0, num_groups)) + offset, y=data.groupby(x)[y].mean().tolist(), yerr=data.groupby(x)[y].std().tolist(), fmt='none', **kwargs)
gpl-3.0
Sentient07/scikit-learn
sklearn/ensemble/forest.py
8
67993
"""Forest of trees-based ensemble methods Those methods include random forests and extremely randomized trees. The module structure is the following: - The ``BaseForest`` base class implements a common ``fit`` method for all the estimators in the module. The ``fit`` method of the base ``Forest`` class calls the ``fit`` method of each sub-estimator on random samples (with replacement, a.k.a. bootstrap) of the training set. The init of the sub-estimator is further delegated to the ``BaseEnsemble`` constructor. - The ``ForestClassifier`` and ``ForestRegressor`` base classes further implement the prediction logic by computing an average of the predicted outcomes of the sub-estimators. - The ``RandomForestClassifier`` and ``RandomForestRegressor`` derived classes provide the user with concrete implementations of the forest ensemble method using classical, deterministic ``DecisionTreeClassifier`` and ``DecisionTreeRegressor`` as sub-estimator implementations. - The ``ExtraTreesClassifier`` and ``ExtraTreesRegressor`` derived classes provide the user with concrete implementations of the forest ensemble method using the extremely randomized trees ``ExtraTreeClassifier`` and ``ExtraTreeRegressor`` as sub-estimator implementations. Single and multi-output problems are both handled. """ # Authors: Gilles Louppe <[email protected]> # Brian Holt <[email protected]> # Joly Arnaud <[email protected]> # Fares Hedayati <[email protected]> # # License: BSD 3 clause from __future__ import division import warnings from warnings import warn from abc import ABCMeta, abstractmethod import numpy as np from scipy.sparse import issparse from scipy.sparse import hstack as sparse_hstack from ..base import ClassifierMixin, RegressorMixin from ..externals.joblib import Parallel, delayed from ..externals import six from ..metrics import r2_score from ..preprocessing import OneHotEncoder from ..tree import (DecisionTreeClassifier, DecisionTreeRegressor, ExtraTreeClassifier, ExtraTreeRegressor) from ..tree._tree import DTYPE, DOUBLE from ..utils import check_random_state, check_array, compute_sample_weight from ..exceptions import DataConversionWarning, NotFittedError from .base import BaseEnsemble, _partition_estimators from ..utils.fixes import bincount, parallel_helper from ..utils.multiclass import check_classification_targets from ..utils.validation import check_is_fitted __all__ = ["RandomForestClassifier", "RandomForestRegressor", "ExtraTreesClassifier", "ExtraTreesRegressor", "RandomTreesEmbedding"] MAX_INT = np.iinfo(np.int32).max def _generate_sample_indices(random_state, n_samples): """Private function used to _parallel_build_trees function.""" random_instance = check_random_state(random_state) sample_indices = random_instance.randint(0, n_samples, n_samples) return sample_indices def _generate_unsampled_indices(random_state, n_samples): """Private function used to forest._set_oob_score function.""" sample_indices = _generate_sample_indices(random_state, n_samples) sample_counts = bincount(sample_indices, minlength=n_samples) unsampled_mask = sample_counts == 0 indices_range = np.arange(n_samples) unsampled_indices = indices_range[unsampled_mask] return unsampled_indices def _parallel_build_trees(tree, forest, X, y, sample_weight, tree_idx, n_trees, verbose=0, class_weight=None): """Private function used to fit a single tree in parallel.""" if verbose > 1: print("building tree %d of %d" % (tree_idx + 1, n_trees)) if forest.bootstrap: n_samples = X.shape[0] if sample_weight is None: curr_sample_weight = np.ones((n_samples,), dtype=np.float64) else: curr_sample_weight = sample_weight.copy() indices = _generate_sample_indices(tree.random_state, n_samples) sample_counts = bincount(indices, minlength=n_samples) curr_sample_weight *= sample_counts if class_weight == 'subsample': with warnings.catch_warnings(): warnings.simplefilter('ignore', DeprecationWarning) curr_sample_weight *= compute_sample_weight('auto', y, indices) elif class_weight == 'balanced_subsample': curr_sample_weight *= compute_sample_weight('balanced', y, indices) tree.fit(X, y, sample_weight=curr_sample_weight, check_input=False) else: tree.fit(X, y, sample_weight=sample_weight, check_input=False) return tree class BaseForest(six.with_metaclass(ABCMeta, BaseEnsemble)): """Base class for forests of trees. Warning: This class should not be used directly. Use derived classes instead. """ @abstractmethod def __init__(self, base_estimator, n_estimators=10, estimator_params=tuple(), bootstrap=False, oob_score=False, n_jobs=1, random_state=None, verbose=0, warm_start=False, class_weight=None): super(BaseForest, self).__init__( base_estimator=base_estimator, n_estimators=n_estimators, estimator_params=estimator_params) self.bootstrap = bootstrap self.oob_score = oob_score self.n_jobs = n_jobs self.random_state = random_state self.verbose = verbose self.warm_start = warm_start self.class_weight = class_weight def apply(self, X): """Apply trees in the forest to X, return leaf indices. Parameters ---------- X : array-like or sparse matrix, shape = [n_samples, n_features] The input samples. Internally, its dtype will be converted to ``dtype=np.float32``. If a sparse matrix is provided, it will be converted into a sparse ``csr_matrix``. Returns ------- X_leaves : array_like, shape = [n_samples, n_estimators] For each datapoint x in X and for each tree in the forest, return the index of the leaf x ends up in. """ X = self._validate_X_predict(X) results = Parallel(n_jobs=self.n_jobs, verbose=self.verbose, backend="threading")( delayed(parallel_helper)(tree, 'apply', X, check_input=False) for tree in self.estimators_) return np.array(results).T def decision_path(self, X): """Return the decision path in the forest .. versionadded:: 0.18 Parameters ---------- X : array-like or sparse matrix, shape = [n_samples, n_features] The input samples. Internally, its dtype will be converted to ``dtype=np.float32``. If a sparse matrix is provided, it will be converted into a sparse ``csr_matrix``. Returns ------- indicator : sparse csr array, shape = [n_samples, n_nodes] Return a node indicator matrix where non zero elements indicates that the samples goes through the nodes. n_nodes_ptr : array of size (n_estimators + 1, ) The columns from indicator[n_nodes_ptr[i]:n_nodes_ptr[i+1]] gives the indicator value for the i-th estimator. """ X = self._validate_X_predict(X) indicators = Parallel(n_jobs=self.n_jobs, verbose=self.verbose, backend="threading")( delayed(parallel_helper)(tree, 'decision_path', X, check_input=False) for tree in self.estimators_) n_nodes = [0] n_nodes.extend([i.shape[1] for i in indicators]) n_nodes_ptr = np.array(n_nodes).cumsum() return sparse_hstack(indicators).tocsr(), n_nodes_ptr def fit(self, X, y, sample_weight=None): """Build a forest of trees from the training set (X, y). Parameters ---------- X : array-like or sparse matrix of shape = [n_samples, n_features] The training input samples. Internally, its dtype will be converted to ``dtype=np.float32``. If a sparse matrix is provided, it will be converted into a sparse ``csc_matrix``. y : array-like, shape = [n_samples] or [n_samples, n_outputs] The target values (class labels in classification, real numbers in regression). sample_weight : array-like, shape = [n_samples] or None Sample weights. If None, then samples are equally weighted. Splits that would create child nodes with net zero or negative weight are ignored while searching for a split in each node. In the case of classification, splits are also ignored if they would result in any single class carrying a negative weight in either child node. Returns ------- self : object Returns self. """ # Validate or convert input data X = check_array(X, accept_sparse="csc", dtype=DTYPE) y = check_array(y, accept_sparse='csc', ensure_2d=False, dtype=None) if sample_weight is not None: sample_weight = check_array(sample_weight, ensure_2d=False) if issparse(X): # Pre-sort indices to avoid that each individual tree of the # ensemble sorts the indices. X.sort_indices() # Remap output n_samples, self.n_features_ = X.shape y = np.atleast_1d(y) if y.ndim == 2 and y.shape[1] == 1: warn("A column-vector y was passed when a 1d array was" " expected. Please change the shape of y to " "(n_samples,), for example using ravel().", DataConversionWarning, stacklevel=2) if y.ndim == 1: # reshape is necessary to preserve the data contiguity against vs # [:, np.newaxis] that does not. y = np.reshape(y, (-1, 1)) self.n_outputs_ = y.shape[1] y, expanded_class_weight = self._validate_y_class_weight(y) if getattr(y, "dtype", None) != DOUBLE or not y.flags.contiguous: y = np.ascontiguousarray(y, dtype=DOUBLE) if expanded_class_weight is not None: if sample_weight is not None: sample_weight = sample_weight * expanded_class_weight else: sample_weight = expanded_class_weight # Check parameters self._validate_estimator() if not self.bootstrap and self.oob_score: raise ValueError("Out of bag estimation only available" " if bootstrap=True") random_state = check_random_state(self.random_state) if not self.warm_start or not hasattr(self, "estimators_"): # Free allocated memory, if any self.estimators_ = [] n_more_estimators = self.n_estimators - len(self.estimators_) if n_more_estimators < 0: raise ValueError('n_estimators=%d must be larger or equal to ' 'len(estimators_)=%d when warm_start==True' % (self.n_estimators, len(self.estimators_))) elif n_more_estimators == 0: warn("Warm-start fitting without increasing n_estimators does not " "fit new trees.") else: if self.warm_start and len(self.estimators_) > 0: # We draw from the random state to get the random state we # would have got if we hadn't used a warm_start. random_state.randint(MAX_INT, size=len(self.estimators_)) trees = [] for i in range(n_more_estimators): tree = self._make_estimator(append=False, random_state=random_state) trees.append(tree) # Parallel loop: we use the threading backend as the Cython code # for fitting the trees is internally releasing the Python GIL # making threading always more efficient than multiprocessing in # that case. trees = Parallel(n_jobs=self.n_jobs, verbose=self.verbose, backend="threading")( delayed(_parallel_build_trees)( t, self, X, y, sample_weight, i, len(trees), verbose=self.verbose, class_weight=self.class_weight) for i, t in enumerate(trees)) # Collect newly grown trees self.estimators_.extend(trees) if self.oob_score: self._set_oob_score(X, y) # Decapsulate classes_ attributes if hasattr(self, "classes_") and self.n_outputs_ == 1: self.n_classes_ = self.n_classes_[0] self.classes_ = self.classes_[0] return self @abstractmethod def _set_oob_score(self, X, y): """Calculate out of bag predictions and score.""" def _validate_y_class_weight(self, y): # Default implementation return y, None def _validate_X_predict(self, X): """Validate X whenever one tries to predict, apply, predict_proba""" if self.estimators_ is None or len(self.estimators_) == 0: raise NotFittedError("Estimator not fitted, " "call `fit` before exploiting the model.") return self.estimators_[0]._validate_X_predict(X, check_input=True) @property def feature_importances_(self): """Return the feature importances (the higher, the more important the feature). Returns ------- feature_importances_ : array, shape = [n_features] """ check_is_fitted(self, 'estimators_') all_importances = Parallel(n_jobs=self.n_jobs, backend="threading")( delayed(getattr)(tree, 'feature_importances_') for tree in self.estimators_) return sum(all_importances) / len(self.estimators_) class ForestClassifier(six.with_metaclass(ABCMeta, BaseForest, ClassifierMixin)): """Base class for forest of trees-based classifiers. Warning: This class should not be used directly. Use derived classes instead. """ @abstractmethod def __init__(self, base_estimator, n_estimators=10, estimator_params=tuple(), bootstrap=False, oob_score=False, n_jobs=1, random_state=None, verbose=0, warm_start=False, class_weight=None): super(ForestClassifier, self).__init__( base_estimator, n_estimators=n_estimators, estimator_params=estimator_params, bootstrap=bootstrap, oob_score=oob_score, n_jobs=n_jobs, random_state=random_state, verbose=verbose, warm_start=warm_start, class_weight=class_weight) def _set_oob_score(self, X, y): """Compute out-of-bag score""" X = check_array(X, dtype=DTYPE, accept_sparse='csr') n_classes_ = self.n_classes_ n_samples = y.shape[0] oob_decision_function = [] oob_score = 0.0 predictions = [] for k in range(self.n_outputs_): predictions.append(np.zeros((n_samples, n_classes_[k]))) for estimator in self.estimators_: unsampled_indices = _generate_unsampled_indices( estimator.random_state, n_samples) p_estimator = estimator.predict_proba(X[unsampled_indices, :], check_input=False) if self.n_outputs_ == 1: p_estimator = [p_estimator] for k in range(self.n_outputs_): predictions[k][unsampled_indices, :] += p_estimator[k] for k in range(self.n_outputs_): if (predictions[k].sum(axis=1) == 0).any(): warn("Some inputs do not have OOB scores. " "This probably means too few trees were used " "to compute any reliable oob estimates.") decision = (predictions[k] / predictions[k].sum(axis=1)[:, np.newaxis]) oob_decision_function.append(decision) oob_score += np.mean(y[:, k] == np.argmax(predictions[k], axis=1), axis=0) if self.n_outputs_ == 1: self.oob_decision_function_ = oob_decision_function[0] else: self.oob_decision_function_ = oob_decision_function self.oob_score_ = oob_score / self.n_outputs_ def _validate_y_class_weight(self, y): check_classification_targets(y) y = np.copy(y) expanded_class_weight = None if self.class_weight is not None: y_original = np.copy(y) self.classes_ = [] self.n_classes_ = [] y_store_unique_indices = np.zeros(y.shape, dtype=np.int) for k in range(self.n_outputs_): classes_k, y_store_unique_indices[:, k] = np.unique(y[:, k], return_inverse=True) self.classes_.append(classes_k) self.n_classes_.append(classes_k.shape[0]) y = y_store_unique_indices if self.class_weight is not None: valid_presets = ('balanced', 'balanced_subsample') if isinstance(self.class_weight, six.string_types): if self.class_weight not in valid_presets: raise ValueError('Valid presets for class_weight include ' '"balanced" and "balanced_subsample". Given "%s".' % self.class_weight) if self.warm_start: warn('class_weight presets "balanced" or "balanced_subsample" are ' 'not recommended for warm_start if the fitted data ' 'differs from the full dataset. In order to use ' '"balanced" weights, use compute_class_weight("balanced", ' 'classes, y). In place of y you can use a large ' 'enough sample of the full training set target to ' 'properly estimate the class frequency ' 'distributions. Pass the resulting weights as the ' 'class_weight parameter.') if (self.class_weight != 'balanced_subsample' or not self.bootstrap): if self.class_weight == "balanced_subsample": class_weight = "balanced" else: class_weight = self.class_weight expanded_class_weight = compute_sample_weight(class_weight, y_original) return y, expanded_class_weight def predict(self, X): """Predict class for X. The predicted class of an input sample is a vote by the trees in the forest, weighted by their probability estimates. That is, the predicted class is the one with highest mean probability estimate across the trees. Parameters ---------- X : array-like or sparse matrix of shape = [n_samples, n_features] The input samples. Internally, its dtype will be converted to ``dtype=np.float32``. If a sparse matrix is provided, it will be converted into a sparse ``csr_matrix``. Returns ------- y : array of shape = [n_samples] or [n_samples, n_outputs] The predicted classes. """ proba = self.predict_proba(X) if self.n_outputs_ == 1: return self.classes_.take(np.argmax(proba, axis=1), axis=0) else: n_samples = proba[0].shape[0] predictions = np.zeros((n_samples, self.n_outputs_)) for k in range(self.n_outputs_): predictions[:, k] = self.classes_[k].take(np.argmax(proba[k], axis=1), axis=0) return predictions def predict_proba(self, X): """Predict class probabilities for X. The predicted class probabilities of an input sample are computed as the mean predicted class probabilities of the trees in the forest. The class probability of a single tree is the fraction of samples of the same class in a leaf. Parameters ---------- X : array-like or sparse matrix of shape = [n_samples, n_features] The input samples. Internally, its dtype will be converted to ``dtype=np.float32``. If a sparse matrix is provided, it will be converted into a sparse ``csr_matrix``. Returns ------- p : array of shape = [n_samples, n_classes], or a list of n_outputs such arrays if n_outputs > 1. The class probabilities of the input samples. The order of the classes corresponds to that in the attribute `classes_`. """ check_is_fitted(self, 'estimators_') # Check data X = self._validate_X_predict(X) # Assign chunk of trees to jobs n_jobs, _, _ = _partition_estimators(self.n_estimators, self.n_jobs) # Parallel loop all_proba = Parallel(n_jobs=n_jobs, verbose=self.verbose, backend="threading")( delayed(parallel_helper)(e, 'predict_proba', X, check_input=False) for e in self.estimators_) # Reduce proba = all_proba[0] if self.n_outputs_ == 1: for j in range(1, len(all_proba)): proba += all_proba[j] proba /= len(self.estimators_) else: for j in range(1, len(all_proba)): for k in range(self.n_outputs_): proba[k] += all_proba[j][k] for k in range(self.n_outputs_): proba[k] /= self.n_estimators return proba def predict_log_proba(self, X): """Predict class log-probabilities for X. The predicted class log-probabilities of an input sample is computed as the log of the mean predicted class probabilities of the trees in the forest. Parameters ---------- X : array-like or sparse matrix of shape = [n_samples, n_features] The input samples. Internally, its dtype will be converted to ``dtype=np.float32``. If a sparse matrix is provided, it will be converted into a sparse ``csr_matrix``. Returns ------- p : array of shape = [n_samples, n_classes], or a list of n_outputs such arrays if n_outputs > 1. The class probabilities of the input samples. The order of the classes corresponds to that in the attribute `classes_`. """ proba = self.predict_proba(X) if self.n_outputs_ == 1: return np.log(proba) else: for k in range(self.n_outputs_): proba[k] = np.log(proba[k]) return proba class ForestRegressor(six.with_metaclass(ABCMeta, BaseForest, RegressorMixin)): """Base class for forest of trees-based regressors. Warning: This class should not be used directly. Use derived classes instead. """ @abstractmethod def __init__(self, base_estimator, n_estimators=10, estimator_params=tuple(), bootstrap=False, oob_score=False, n_jobs=1, random_state=None, verbose=0, warm_start=False): super(ForestRegressor, self).__init__( base_estimator, n_estimators=n_estimators, estimator_params=estimator_params, bootstrap=bootstrap, oob_score=oob_score, n_jobs=n_jobs, random_state=random_state, verbose=verbose, warm_start=warm_start) def predict(self, X): """Predict regression target for X. The predicted regression target of an input sample is computed as the mean predicted regression targets of the trees in the forest. Parameters ---------- X : array-like or sparse matrix of shape = [n_samples, n_features] The input samples. Internally, its dtype will be converted to ``dtype=np.float32``. If a sparse matrix is provided, it will be converted into a sparse ``csr_matrix``. Returns ------- y : array of shape = [n_samples] or [n_samples, n_outputs] The predicted values. """ check_is_fitted(self, 'estimators_') # Check data X = self._validate_X_predict(X) # Assign chunk of trees to jobs n_jobs, _, _ = _partition_estimators(self.n_estimators, self.n_jobs) # Parallel loop all_y_hat = Parallel(n_jobs=n_jobs, verbose=self.verbose, backend="threading")( delayed(parallel_helper)(e, 'predict', X, check_input=False) for e in self.estimators_) # Reduce y_hat = sum(all_y_hat) / len(self.estimators_) return y_hat def _set_oob_score(self, X, y): """Compute out-of-bag scores""" X = check_array(X, dtype=DTYPE, accept_sparse='csr') n_samples = y.shape[0] predictions = np.zeros((n_samples, self.n_outputs_)) n_predictions = np.zeros((n_samples, self.n_outputs_)) for estimator in self.estimators_: unsampled_indices = _generate_unsampled_indices( estimator.random_state, n_samples) p_estimator = estimator.predict( X[unsampled_indices, :], check_input=False) if self.n_outputs_ == 1: p_estimator = p_estimator[:, np.newaxis] predictions[unsampled_indices, :] += p_estimator n_predictions[unsampled_indices, :] += 1 if (n_predictions == 0).any(): warn("Some inputs do not have OOB scores. " "This probably means too few trees were used " "to compute any reliable oob estimates.") n_predictions[n_predictions == 0] = 1 predictions /= n_predictions self.oob_prediction_ = predictions if self.n_outputs_ == 1: self.oob_prediction_ = \ self.oob_prediction_.reshape((n_samples, )) self.oob_score_ = 0.0 for k in range(self.n_outputs_): self.oob_score_ += r2_score(y[:, k], predictions[:, k]) self.oob_score_ /= self.n_outputs_ class RandomForestClassifier(ForestClassifier): """A random forest classifier. A random forest is a meta estimator that fits a number of decision tree classifiers on various sub-samples of the dataset and use averaging to improve the predictive accuracy and control over-fitting. The sub-sample size is always the same as the original input sample size but the samples are drawn with replacement if `bootstrap=True` (default). Read more in the :ref:`User Guide <forest>`. Parameters ---------- n_estimators : integer, optional (default=10) The number of trees in the forest. criterion : string, optional (default="gini") The function to measure the quality of a split. Supported criteria are "gini" for the Gini impurity and "entropy" for the information gain. Note: this parameter is tree-specific. max_features : int, float, string or None, optional (default="auto") The number of features to consider when looking for the best split: - If int, then consider `max_features` features at each split. - If float, then `max_features` is a percentage and `int(max_features * n_features)` features are considered at each split. - If "auto", then `max_features=sqrt(n_features)`. - If "sqrt", then `max_features=sqrt(n_features)` (same as "auto"). - If "log2", then `max_features=log2(n_features)`. - If None, then `max_features=n_features`. Note: the search for a split does not stop until at least one valid partition of the node samples is found, even if it requires to effectively inspect more than ``max_features`` features. max_depth : integer or None, optional (default=None) The maximum depth of the tree. If None, then nodes are expanded until all leaves are pure or until all leaves contain less than min_samples_split samples. min_samples_split : int, float, optional (default=2) The minimum number of samples required to split an internal node: - If int, then consider `min_samples_split` as the minimum number. - If float, then `min_samples_split` is a percentage and `ceil(min_samples_split * n_samples)` are the minimum number of samples for each split. .. versionchanged:: 0.18 Added float values for percentages. min_samples_leaf : int, float, optional (default=1) The minimum number of samples required to be at a leaf node: - If int, then consider `min_samples_leaf` as the minimum number. - If float, then `min_samples_leaf` is a percentage and `ceil(min_samples_leaf * n_samples)` are the minimum number of samples for each node. .. versionchanged:: 0.18 Added float values for percentages. min_weight_fraction_leaf : float, optional (default=0.) The minimum weighted fraction of the sum total of weights (of all the input samples) required to be at a leaf node. Samples have equal weight when sample_weight is not provided. max_leaf_nodes : int or None, optional (default=None) Grow trees with ``max_leaf_nodes`` in best-first fashion. Best nodes are defined as relative reduction in impurity. If None then unlimited number of leaf nodes. min_impurity_split : float, optional (default=1e-7) Threshold for early stopping in tree growth. A node will split if its impurity is above the threshold, otherwise it is a leaf. .. versionadded:: 0.18 bootstrap : boolean, optional (default=True) Whether bootstrap samples are used when building trees. oob_score : bool (default=False) Whether to use out-of-bag samples to estimate the generalization accuracy. n_jobs : integer, optional (default=1) The number of jobs to run in parallel for both `fit` and `predict`. If -1, then the number of jobs is set to the number of cores. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. verbose : int, optional (default=0) Controls the verbosity of the tree building process. warm_start : bool, optional (default=False) When set to ``True``, reuse the solution of the previous call to fit and add more estimators to the ensemble, otherwise, just fit a whole new forest. class_weight : dict, list of dicts, "balanced", "balanced_subsample" or None, optional (default=None) Weights associated with classes in the form ``{class_label: weight}``. If not given, all classes are supposed to have weight one. For multi-output problems, a list of dicts can be provided in the same order as the columns of y. The "balanced" mode uses the values of y to automatically adjust weights inversely proportional to class frequencies in the input data as ``n_samples / (n_classes * np.bincount(y))`` The "balanced_subsample" mode is the same as "balanced" except that weights are computed based on the bootstrap sample for every tree grown. For multi-output, the weights of each column of y will be multiplied. Note that these weights will be multiplied with sample_weight (passed through the fit method) if sample_weight is specified. Attributes ---------- estimators_ : list of DecisionTreeClassifier The collection of fitted sub-estimators. classes_ : array of shape = [n_classes] or a list of such arrays The classes labels (single output problem), or a list of arrays of class labels (multi-output problem). n_classes_ : int or list The number of classes (single output problem), or a list containing the number of classes for each output (multi-output problem). n_features_ : int The number of features when ``fit`` is performed. n_outputs_ : int The number of outputs when ``fit`` is performed. feature_importances_ : array of shape = [n_features] The feature importances (the higher, the more important the feature). oob_score_ : float Score of the training dataset obtained using an out-of-bag estimate. oob_decision_function_ : array of shape = [n_samples, n_classes] Decision function computed with out-of-bag estimate on the training set. If n_estimators is small it might be possible that a data point was never left out during the bootstrap. In this case, `oob_decision_function_` might contain NaN. Notes ----- The features are always randomly permuted at each split. Therefore, the best found split may vary, even with the same training data, ``max_features=n_features`` and ``bootstrap=False``, if the improvement of the criterion is identical for several splits enumerated during the search of the best split. To obtain a deterministic behaviour during fitting, ``random_state`` has to be fixed. References ---------- .. [1] L. Breiman, "Random Forests", Machine Learning, 45(1), 5-32, 2001. See also -------- DecisionTreeClassifier, ExtraTreesClassifier """ def __init__(self, n_estimators=10, criterion="gini", max_depth=None, min_samples_split=2, min_samples_leaf=1, min_weight_fraction_leaf=0., max_features="auto", max_leaf_nodes=None, min_impurity_split=1e-7, bootstrap=True, oob_score=False, n_jobs=1, random_state=None, verbose=0, warm_start=False, class_weight=None): super(RandomForestClassifier, self).__init__( base_estimator=DecisionTreeClassifier(), n_estimators=n_estimators, estimator_params=("criterion", "max_depth", "min_samples_split", "min_samples_leaf", "min_weight_fraction_leaf", "max_features", "max_leaf_nodes", "min_impurity_split", "random_state"), bootstrap=bootstrap, oob_score=oob_score, n_jobs=n_jobs, random_state=random_state, verbose=verbose, warm_start=warm_start, class_weight=class_weight) self.criterion = criterion self.max_depth = max_depth self.min_samples_split = min_samples_split self.min_samples_leaf = min_samples_leaf self.min_weight_fraction_leaf = min_weight_fraction_leaf self.max_features = max_features self.max_leaf_nodes = max_leaf_nodes self.min_impurity_split = min_impurity_split class RandomForestRegressor(ForestRegressor): """A random forest regressor. A random forest is a meta estimator that fits a number of classifying decision trees on various sub-samples of the dataset and use averaging to improve the predictive accuracy and control over-fitting. The sub-sample size is always the same as the original input sample size but the samples are drawn with replacement if `bootstrap=True` (default). Read more in the :ref:`User Guide <forest>`. Parameters ---------- n_estimators : integer, optional (default=10) The number of trees in the forest. criterion : string, optional (default="mse") The function to measure the quality of a split. Supported criteria are "mse" for the mean squared error, which is equal to variance reduction as feature selection criterion, and "mae" for the mean absolute error. .. versionadded:: 0.18 Mean Absolute Error (MAE) criterion. max_features : int, float, string or None, optional (default="auto") The number of features to consider when looking for the best split: - If int, then consider `max_features` features at each split. - If float, then `max_features` is a percentage and `int(max_features * n_features)` features are considered at each split. - If "auto", then `max_features=n_features`. - If "sqrt", then `max_features=sqrt(n_features)`. - If "log2", then `max_features=log2(n_features)`. - If None, then `max_features=n_features`. Note: the search for a split does not stop until at least one valid partition of the node samples is found, even if it requires to effectively inspect more than ``max_features`` features. max_depth : integer or None, optional (default=None) The maximum depth of the tree. If None, then nodes are expanded until all leaves are pure or until all leaves contain less than min_samples_split samples. min_samples_split : int, float, optional (default=2) The minimum number of samples required to split an internal node: - If int, then consider `min_samples_split` as the minimum number. - If float, then `min_samples_split` is a percentage and `ceil(min_samples_split * n_samples)` are the minimum number of samples for each split. .. versionchanged:: 0.18 Added float values for percentages. min_samples_leaf : int, float, optional (default=1) The minimum number of samples required to be at a leaf node: - If int, then consider `min_samples_leaf` as the minimum number. - If float, then `min_samples_leaf` is a percentage and `ceil(min_samples_leaf * n_samples)` are the minimum number of samples for each node. .. versionchanged:: 0.18 Added float values for percentages. min_weight_fraction_leaf : float, optional (default=0.) The minimum weighted fraction of the sum total of weights (of all the input samples) required to be at a leaf node. Samples have equal weight when sample_weight is not provided. max_leaf_nodes : int or None, optional (default=None) Grow trees with ``max_leaf_nodes`` in best-first fashion. Best nodes are defined as relative reduction in impurity. If None then unlimited number of leaf nodes. min_impurity_split : float, optional (default=1e-7) Threshold for early stopping in tree growth. A node will split if its impurity is above the threshold, otherwise it is a leaf. .. versionadded:: 0.18 bootstrap : boolean, optional (default=True) Whether bootstrap samples are used when building trees. oob_score : bool, optional (default=False) whether to use out-of-bag samples to estimate the R^2 on unseen data. n_jobs : integer, optional (default=1) The number of jobs to run in parallel for both `fit` and `predict`. If -1, then the number of jobs is set to the number of cores. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. verbose : int, optional (default=0) Controls the verbosity of the tree building process. warm_start : bool, optional (default=False) When set to ``True``, reuse the solution of the previous call to fit and add more estimators to the ensemble, otherwise, just fit a whole new forest. Attributes ---------- estimators_ : list of DecisionTreeRegressor The collection of fitted sub-estimators. feature_importances_ : array of shape = [n_features] The feature importances (the higher, the more important the feature). n_features_ : int The number of features when ``fit`` is performed. n_outputs_ : int The number of outputs when ``fit`` is performed. oob_score_ : float Score of the training dataset obtained using an out-of-bag estimate. oob_prediction_ : array of shape = [n_samples] Prediction computed with out-of-bag estimate on the training set. Notes ----- The features are always randomly permuted at each split. Therefore, the best found split may vary, even with the same training data, ``max_features=n_features`` and ``bootstrap=False``, if the improvement of the criterion is identical for several splits enumerated during the search of the best split. To obtain a deterministic behaviour during fitting, ``random_state`` has to be fixed. References ---------- .. [1] L. Breiman, "Random Forests", Machine Learning, 45(1), 5-32, 2001. See also -------- DecisionTreeRegressor, ExtraTreesRegressor """ def __init__(self, n_estimators=10, criterion="mse", max_depth=None, min_samples_split=2, min_samples_leaf=1, min_weight_fraction_leaf=0., max_features="auto", max_leaf_nodes=None, min_impurity_split=1e-7, bootstrap=True, oob_score=False, n_jobs=1, random_state=None, verbose=0, warm_start=False): super(RandomForestRegressor, self).__init__( base_estimator=DecisionTreeRegressor(), n_estimators=n_estimators, estimator_params=("criterion", "max_depth", "min_samples_split", "min_samples_leaf", "min_weight_fraction_leaf", "max_features", "max_leaf_nodes", "min_impurity_split", "random_state"), bootstrap=bootstrap, oob_score=oob_score, n_jobs=n_jobs, random_state=random_state, verbose=verbose, warm_start=warm_start) self.criterion = criterion self.max_depth = max_depth self.min_samples_split = min_samples_split self.min_samples_leaf = min_samples_leaf self.min_weight_fraction_leaf = min_weight_fraction_leaf self.max_features = max_features self.max_leaf_nodes = max_leaf_nodes self.min_impurity_split = min_impurity_split class ExtraTreesClassifier(ForestClassifier): """An extra-trees classifier. This class implements a meta estimator that fits a number of randomized decision trees (a.k.a. extra-trees) on various sub-samples of the dataset and use averaging to improve the predictive accuracy and control over-fitting. Read more in the :ref:`User Guide <forest>`. Parameters ---------- n_estimators : integer, optional (default=10) The number of trees in the forest. criterion : string, optional (default="gini") The function to measure the quality of a split. Supported criteria are "gini" for the Gini impurity and "entropy" for the information gain. max_features : int, float, string or None, optional (default="auto") The number of features to consider when looking for the best split: - If int, then consider `max_features` features at each split. - If float, then `max_features` is a percentage and `int(max_features * n_features)` features are considered at each split. - If "auto", then `max_features=sqrt(n_features)`. - If "sqrt", then `max_features=sqrt(n_features)`. - If "log2", then `max_features=log2(n_features)`. - If None, then `max_features=n_features`. Note: the search for a split does not stop until at least one valid partition of the node samples is found, even if it requires to effectively inspect more than ``max_features`` features. max_depth : integer or None, optional (default=None) The maximum depth of the tree. If None, then nodes are expanded until all leaves are pure or until all leaves contain less than min_samples_split samples. min_samples_split : int, float, optional (default=2) The minimum number of samples required to split an internal node: - If int, then consider `min_samples_split` as the minimum number. - If float, then `min_samples_split` is a percentage and `ceil(min_samples_split * n_samples)` are the minimum number of samples for each split. .. versionchanged:: 0.18 Added float values for percentages. min_samples_leaf : int, float, optional (default=1) The minimum number of samples required to be at a leaf node: - If int, then consider `min_samples_leaf` as the minimum number. - If float, then `min_samples_leaf` is a percentage and `ceil(min_samples_leaf * n_samples)` are the minimum number of samples for each node. .. versionchanged:: 0.18 Added float values for percentages. min_weight_fraction_leaf : float, optional (default=0.) The minimum weighted fraction of the sum total of weights (of all the input samples) required to be at a leaf node. Samples have equal weight when sample_weight is not provided. max_leaf_nodes : int or None, optional (default=None) Grow trees with ``max_leaf_nodes`` in best-first fashion. Best nodes are defined as relative reduction in impurity. If None then unlimited number of leaf nodes. min_impurity_split : float, optional (default=1e-7) Threshold for early stopping in tree growth. A node will split if its impurity is above the threshold, otherwise it is a leaf. .. versionadded:: 0.18 bootstrap : boolean, optional (default=False) Whether bootstrap samples are used when building trees. oob_score : bool, optional (default=False) Whether to use out-of-bag samples to estimate the generalization accuracy. n_jobs : integer, optional (default=1) The number of jobs to run in parallel for both `fit` and `predict`. If -1, then the number of jobs is set to the number of cores. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. verbose : int, optional (default=0) Controls the verbosity of the tree building process. warm_start : bool, optional (default=False) When set to ``True``, reuse the solution of the previous call to fit and add more estimators to the ensemble, otherwise, just fit a whole new forest. class_weight : dict, list of dicts, "balanced", "balanced_subsample" or None, optional (default=None) Weights associated with classes in the form ``{class_label: weight}``. If not given, all classes are supposed to have weight one. For multi-output problems, a list of dicts can be provided in the same order as the columns of y. The "balanced" mode uses the values of y to automatically adjust weights inversely proportional to class frequencies in the input data as ``n_samples / (n_classes * np.bincount(y))`` The "balanced_subsample" mode is the same as "balanced" except that weights are computed based on the bootstrap sample for every tree grown. For multi-output, the weights of each column of y will be multiplied. Note that these weights will be multiplied with sample_weight (passed through the fit method) if sample_weight is specified. Attributes ---------- estimators_ : list of DecisionTreeClassifier The collection of fitted sub-estimators. classes_ : array of shape = [n_classes] or a list of such arrays The classes labels (single output problem), or a list of arrays of class labels (multi-output problem). n_classes_ : int or list The number of classes (single output problem), or a list containing the number of classes for each output (multi-output problem). feature_importances_ : array of shape = [n_features] The feature importances (the higher, the more important the feature). n_features_ : int The number of features when ``fit`` is performed. n_outputs_ : int The number of outputs when ``fit`` is performed. oob_score_ : float Score of the training dataset obtained using an out-of-bag estimate. oob_decision_function_ : array of shape = [n_samples, n_classes] Decision function computed with out-of-bag estimate on the training set. If n_estimators is small it might be possible that a data point was never left out during the bootstrap. In this case, `oob_decision_function_` might contain NaN. References ---------- .. [1] P. Geurts, D. Ernst., and L. Wehenkel, "Extremely randomized trees", Machine Learning, 63(1), 3-42, 2006. See also -------- sklearn.tree.ExtraTreeClassifier : Base classifier for this ensemble. RandomForestClassifier : Ensemble Classifier based on trees with optimal splits. """ def __init__(self, n_estimators=10, criterion="gini", max_depth=None, min_samples_split=2, min_samples_leaf=1, min_weight_fraction_leaf=0., max_features="auto", max_leaf_nodes=None, min_impurity_split=1e-7, bootstrap=False, oob_score=False, n_jobs=1, random_state=None, verbose=0, warm_start=False, class_weight=None): super(ExtraTreesClassifier, self).__init__( base_estimator=ExtraTreeClassifier(), n_estimators=n_estimators, estimator_params=("criterion", "max_depth", "min_samples_split", "min_samples_leaf", "min_weight_fraction_leaf", "max_features", "max_leaf_nodes", "min_impurity_split", "random_state"), bootstrap=bootstrap, oob_score=oob_score, n_jobs=n_jobs, random_state=random_state, verbose=verbose, warm_start=warm_start, class_weight=class_weight) self.criterion = criterion self.max_depth = max_depth self.min_samples_split = min_samples_split self.min_samples_leaf = min_samples_leaf self.min_weight_fraction_leaf = min_weight_fraction_leaf self.max_features = max_features self.max_leaf_nodes = max_leaf_nodes self.min_impurity_split = min_impurity_split class ExtraTreesRegressor(ForestRegressor): """An extra-trees regressor. This class implements a meta estimator that fits a number of randomized decision trees (a.k.a. extra-trees) on various sub-samples of the dataset and use averaging to improve the predictive accuracy and control over-fitting. Read more in the :ref:`User Guide <forest>`. Parameters ---------- n_estimators : integer, optional (default=10) The number of trees in the forest. criterion : string, optional (default="mse") The function to measure the quality of a split. Supported criteria are "mse" for the mean squared error, which is equal to variance reduction as feature selection criterion, and "mae" for the mean absolute error. .. versionadded:: 0.18 Mean Absolute Error (MAE) criterion. max_features : int, float, string or None, optional (default="auto") The number of features to consider when looking for the best split: - If int, then consider `max_features` features at each split. - If float, then `max_features` is a percentage and `int(max_features * n_features)` features are considered at each split. - If "auto", then `max_features=n_features`. - If "sqrt", then `max_features=sqrt(n_features)`. - If "log2", then `max_features=log2(n_features)`. - If None, then `max_features=n_features`. Note: the search for a split does not stop until at least one valid partition of the node samples is found, even if it requires to effectively inspect more than ``max_features`` features. max_depth : integer or None, optional (default=None) The maximum depth of the tree. If None, then nodes are expanded until all leaves are pure or until all leaves contain less than min_samples_split samples. min_samples_split : int, float, optional (default=2) The minimum number of samples required to split an internal node: - If int, then consider `min_samples_split` as the minimum number. - If float, then `min_samples_split` is a percentage and `ceil(min_samples_split * n_samples)` are the minimum number of samples for each split. .. versionchanged:: 0.18 Added float values for percentages. min_samples_leaf : int, float, optional (default=1) The minimum number of samples required to be at a leaf node: - If int, then consider `min_samples_leaf` as the minimum number. - If float, then `min_samples_leaf` is a percentage and `ceil(min_samples_leaf * n_samples)` are the minimum number of samples for each node. .. versionchanged:: 0.18 Added float values for percentages. min_weight_fraction_leaf : float, optional (default=0.) The minimum weighted fraction of the sum total of weights (of all the input samples) required to be at a leaf node. Samples have equal weight when sample_weight is not provided. max_leaf_nodes : int or None, optional (default=None) Grow trees with ``max_leaf_nodes`` in best-first fashion. Best nodes are defined as relative reduction in impurity. If None then unlimited number of leaf nodes. min_impurity_split : float, optional (default=1e-7) Threshold for early stopping in tree growth. A node will split if its impurity is above the threshold, otherwise it is a leaf. .. versionadded:: 0.18 bootstrap : boolean, optional (default=False) Whether bootstrap samples are used when building trees. oob_score : bool, optional (default=False) Whether to use out-of-bag samples to estimate the R^2 on unseen data. n_jobs : integer, optional (default=1) The number of jobs to run in parallel for both `fit` and `predict`. If -1, then the number of jobs is set to the number of cores. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. verbose : int, optional (default=0) Controls the verbosity of the tree building process. warm_start : bool, optional (default=False) When set to ``True``, reuse the solution of the previous call to fit and add more estimators to the ensemble, otherwise, just fit a whole new forest. Attributes ---------- estimators_ : list of DecisionTreeRegressor The collection of fitted sub-estimators. feature_importances_ : array of shape = [n_features] The feature importances (the higher, the more important the feature). n_features_ : int The number of features. n_outputs_ : int The number of outputs. oob_score_ : float Score of the training dataset obtained using an out-of-bag estimate. oob_prediction_ : array of shape = [n_samples] Prediction computed with out-of-bag estimate on the training set. References ---------- .. [1] P. Geurts, D. Ernst., and L. Wehenkel, "Extremely randomized trees", Machine Learning, 63(1), 3-42, 2006. See also -------- sklearn.tree.ExtraTreeRegressor: Base estimator for this ensemble. RandomForestRegressor: Ensemble regressor using trees with optimal splits. """ def __init__(self, n_estimators=10, criterion="mse", max_depth=None, min_samples_split=2, min_samples_leaf=1, min_weight_fraction_leaf=0., max_features="auto", max_leaf_nodes=None, min_impurity_split=1e-7, bootstrap=False, oob_score=False, n_jobs=1, random_state=None, verbose=0, warm_start=False): super(ExtraTreesRegressor, self).__init__( base_estimator=ExtraTreeRegressor(), n_estimators=n_estimators, estimator_params=("criterion", "max_depth", "min_samples_split", "min_samples_leaf", "min_weight_fraction_leaf", "max_features", "max_leaf_nodes", "min_impurity_split", "random_state"), bootstrap=bootstrap, oob_score=oob_score, n_jobs=n_jobs, random_state=random_state, verbose=verbose, warm_start=warm_start) self.criterion = criterion self.max_depth = max_depth self.min_samples_split = min_samples_split self.min_samples_leaf = min_samples_leaf self.min_weight_fraction_leaf = min_weight_fraction_leaf self.max_features = max_features self.max_leaf_nodes = max_leaf_nodes self.min_impurity_split = min_impurity_split class RandomTreesEmbedding(BaseForest): """An ensemble of totally random trees. An unsupervised transformation of a dataset to a high-dimensional sparse representation. A datapoint is coded according to which leaf of each tree it is sorted into. Using a one-hot encoding of the leaves, this leads to a binary coding with as many ones as there are trees in the forest. The dimensionality of the resulting representation is ``n_out <= n_estimators * max_leaf_nodes``. If ``max_leaf_nodes == None``, the number of leaf nodes is at most ``n_estimators * 2 ** max_depth``. Read more in the :ref:`User Guide <random_trees_embedding>`. Parameters ---------- n_estimators : integer, optional (default=10) Number of trees in the forest. max_depth : integer, optional (default=5) The maximum depth of each tree. If None, then nodes are expanded until all leaves are pure or until all leaves contain less than min_samples_split samples. min_samples_split : int, float, optional (default=2) The minimum number of samples required to split an internal node: - If int, then consider `min_samples_split` as the minimum number. - If float, then `min_samples_split` is a percentage and `ceil(min_samples_split * n_samples)` is the minimum number of samples for each split. .. versionchanged:: 0.18 Added float values for percentages. min_samples_leaf : int, float, optional (default=1) The minimum number of samples required to be at a leaf node: - If int, then consider `min_samples_leaf` as the minimum number. - If float, then `min_samples_leaf` is a percentage and `ceil(min_samples_leaf * n_samples)` is the minimum number of samples for each node. .. versionchanged:: 0.18 Added float values for percentages. min_weight_fraction_leaf : float, optional (default=0.) The minimum weighted fraction of the sum total of weights (of all the input samples) required to be at a leaf node. Samples have equal weight when sample_weight is not provided. max_leaf_nodes : int or None, optional (default=None) Grow trees with ``max_leaf_nodes`` in best-first fashion. Best nodes are defined as relative reduction in impurity. If None then unlimited number of leaf nodes. min_impurity_split : float, optional (default=1e-7) Threshold for early stopping in tree growth. A node will split if its impurity is above the threshold, otherwise it is a leaf. .. versionadded:: 0.18 sparse_output : bool, optional (default=True) Whether or not to return a sparse CSR matrix, as default behavior, or to return a dense array compatible with dense pipeline operators. n_jobs : integer, optional (default=1) The number of jobs to run in parallel for both `fit` and `predict`. If -1, then the number of jobs is set to the number of cores. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. verbose : int, optional (default=0) Controls the verbosity of the tree building process. warm_start : bool, optional (default=False) When set to ``True``, reuse the solution of the previous call to fit and add more estimators to the ensemble, otherwise, just fit a whole new forest. Attributes ---------- estimators_ : list of DecisionTreeClassifier The collection of fitted sub-estimators. References ---------- .. [1] P. Geurts, D. Ernst., and L. Wehenkel, "Extremely randomized trees", Machine Learning, 63(1), 3-42, 2006. .. [2] Moosmann, F. and Triggs, B. and Jurie, F. "Fast discriminative visual codebooks using randomized clustering forests" NIPS 2007 """ def __init__(self, n_estimators=10, max_depth=5, min_samples_split=2, min_samples_leaf=1, min_weight_fraction_leaf=0., max_leaf_nodes=None, min_impurity_split=1e-7, sparse_output=True, n_jobs=1, random_state=None, verbose=0, warm_start=False): super(RandomTreesEmbedding, self).__init__( base_estimator=ExtraTreeRegressor(), n_estimators=n_estimators, estimator_params=("criterion", "max_depth", "min_samples_split", "min_samples_leaf", "min_weight_fraction_leaf", "max_features", "max_leaf_nodes", "min_impurity_split", "random_state"), bootstrap=False, oob_score=False, n_jobs=n_jobs, random_state=random_state, verbose=verbose, warm_start=warm_start) self.criterion = 'mse' self.max_depth = max_depth self.min_samples_split = min_samples_split self.min_samples_leaf = min_samples_leaf self.min_weight_fraction_leaf = min_weight_fraction_leaf self.max_features = 1 self.max_leaf_nodes = max_leaf_nodes self.min_impurity_split = min_impurity_split self.sparse_output = sparse_output def _set_oob_score(self, X, y): raise NotImplementedError("OOB score not supported by tree embedding") def fit(self, X, y=None, sample_weight=None): """Fit estimator. Parameters ---------- X : array-like or sparse matrix, shape=(n_samples, n_features) The input samples. Use ``dtype=np.float32`` for maximum efficiency. Sparse matrices are also supported, use sparse ``csc_matrix`` for maximum efficiency. Returns ------- self : object Returns self. """ self.fit_transform(X, y, sample_weight=sample_weight) return self def fit_transform(self, X, y=None, sample_weight=None): """Fit estimator and transform dataset. Parameters ---------- X : array-like or sparse matrix, shape=(n_samples, n_features) Input data used to build forests. Use ``dtype=np.float32`` for maximum efficiency. Returns ------- X_transformed : sparse matrix, shape=(n_samples, n_out) Transformed dataset. """ X = check_array(X, accept_sparse=['csc']) if issparse(X): # Pre-sort indices to avoid that each individual tree of the # ensemble sorts the indices. X.sort_indices() rnd = check_random_state(self.random_state) y = rnd.uniform(size=X.shape[0]) super(RandomTreesEmbedding, self).fit(X, y, sample_weight=sample_weight) self.one_hot_encoder_ = OneHotEncoder(sparse=self.sparse_output) return self.one_hot_encoder_.fit_transform(self.apply(X)) def transform(self, X): """Transform dataset. Parameters ---------- X : array-like or sparse matrix, shape=(n_samples, n_features) Input data to be transformed. Use ``dtype=np.float32`` for maximum efficiency. Sparse matrices are also supported, use sparse ``csr_matrix`` for maximum efficiency. Returns ------- X_transformed : sparse matrix, shape=(n_samples, n_out) Transformed dataset. """ return self.one_hot_encoder_.transform(self.apply(X))
bsd-3-clause
nhuntwalker/astroML
book_figures/chapter4/fig_GMM_1D.py
3
4324
""" 1D Gaussian Mixture Example --------------------------- Figure 4.2. Example of a one-dimensional Gaussian mixture model with three components. The left panel shows a histogram of the data, along with the best-fit model for a mixture with three components. The center panel shows the model selection criteria AIC (see Section 4.3) and BIC (see Section 5.4) as a function of the number of components. Both are minimized for a three-component model. The right panel shows the probability that a given point is drawn from each class as a function of its position. For a given x value, the vertical extent of each region is proportional to that probability. Note that extreme values are most likely to belong to class 1. """ # Author: Jake VanderPlas # License: BSD # The figure produced by this code is published in the textbook # "Statistics, Data Mining, and Machine Learning in Astronomy" (2013) # For more information, see http://astroML.github.com # To report a bug or issue, use the following forum: # https://groups.google.com/forum/#!forum/astroml-general from matplotlib import pyplot as plt import numpy as np from sklearn.mixture import GMM #---------------------------------------------------------------------- # This function adjusts matplotlib settings for a uniform feel in the textbook. # Note that with usetex=True, fonts are rendered with LaTeX. This may # result in an error if LaTeX is not installed on your system. In that case, # you can set usetex to False. from astroML.plotting import setup_text_plots setup_text_plots(fontsize=8, usetex=True) #------------------------------------------------------------ # Set up the dataset. # We'll use scikit-learn's Gaussian Mixture Model to sample # data from a mixture of Gaussians. The usual way of using # this involves fitting the mixture to data: we'll see that # below. Here we'll set the internal means, covariances, # and weights by-hand. np.random.seed(1) gmm = GMM(3, n_iter=1) gmm.means_ = np.array([[-1], [0], [3]]) gmm.covars_ = np.array([[1.5], [1], [0.5]]) ** 2 gmm.weights_ = np.array([0.3, 0.5, 0.2]) X = gmm.sample(1000) #------------------------------------------------------------ # Learn the best-fit GMM models # Here we'll use GMM in the standard way: the fit() method # uses an Expectation-Maximization approach to find the best # mixture of Gaussians for the data # fit models with 1-10 components N = np.arange(1, 11) models = [None for i in range(len(N))] for i in range(len(N)): models[i] = GMM(N[i]).fit(X) # compute the AIC and the BIC AIC = [m.aic(X) for m in models] BIC = [m.bic(X) for m in models] #------------------------------------------------------------ # Plot the results # We'll use three panels: # 1) data + best-fit mixture # 2) AIC and BIC vs number of components # 3) probability that a point came from each component fig = plt.figure(figsize=(5, 1.7)) fig.subplots_adjust(left=0.12, right=0.97, bottom=0.21, top=0.9, wspace=0.5) # plot 1: data + best-fit mixture ax = fig.add_subplot(131) M_best = models[np.argmin(AIC)] x = np.linspace(-6, 6, 1000) logprob, responsibilities = M_best.eval(x) pdf = np.exp(logprob) pdf_individual = responsibilities * pdf[:, np.newaxis] ax.hist(X, 30, normed=True, histtype='stepfilled', alpha=0.4) ax.plot(x, pdf, '-k') ax.plot(x, pdf_individual, '--k') ax.text(0.04, 0.96, "Best-fit Mixture", ha='left', va='top', transform=ax.transAxes) ax.set_xlabel('$x$') ax.set_ylabel('$p(x)$') # plot 2: AIC and BIC ax = fig.add_subplot(132) ax.plot(N, AIC, '-k', label='AIC') ax.plot(N, BIC, '--k', label='BIC') ax.set_xlabel('n. components') ax.set_ylabel('information criterion') ax.legend(loc=2) # plot 3: posterior probabilities for each component ax = fig.add_subplot(133) p = M_best.predict_proba(x) p = p[:, (1, 0, 2)] # rearrange order so the plot looks better p = p.cumsum(1).T ax.fill_between(x, 0, p[0], color='gray', alpha=0.3) ax.fill_between(x, p[0], p[1], color='gray', alpha=0.5) ax.fill_between(x, p[1], 1, color='gray', alpha=0.7) ax.set_xlim(-6, 6) ax.set_ylim(0, 1) ax.set_xlabel('$x$') ax.set_ylabel(r'$p({\rm class}|x)$') ax.text(-5, 0.3, 'class 1', rotation='vertical') ax.text(0, 0.5, 'class 2', rotation='vertical') ax.text(3, 0.3, 'class 3', rotation='vertical') plt.show()
bsd-2-clause
adlyons/AWOT
awot/io/common.py
1
4765
""" awot.io.common ============== Common IO routines. """ from __future__ import print_function import numpy as np from netCDF4 import num2date, date2num ################################# # variable/dictionary methods # ################################# EPOCH_UNITS = 'seconds since 1970-1-1 00:00:00+0:00' def _build_dict(data, units, longname, stdname): newdict = {'data': data, 'units': units, 'long_name': longname, 'standard_name': stdname} return newdict def _ncvar_subset_masked(ncFile, ncvar, Good_Indices): """ Convert a NetCDF variable into a masked variable. Assumes a 1D variable """ d = ncFile.variables[ncvar][Good_Indices] np.ma.masked_invalid(d) return d def _ncvar_subset_to_dict(ncvar, Good_Indices): """ Convert a NetCDF Dataset variable to a dictionary. Appropriated from Py-ART package. Assumes subsetting in first column. """ d = dict((k, getattr(ncvar, k)) for k in ncvar.ncattrs()) d['data'] = ncvar[:] if np.isscalar(d['data']): # netCDF4 1.1.0+ returns a scalar for 0-dim array, we always want # 1-dim+ arrays with a valid shape. d['data'] = np.array(d['data'][Good_Indices, :]) d['data'].shape = (1, ) return d def _ncvar_to_dict(ncvar): """ Convert a NetCDF Dataset variable to a dictionary. Appropriated from PyArt package. """ d = dict((k, getattr(ncvar, k)) for k in ncvar.ncattrs()) d['data'] = ncvar[:] if np.isscalar(d['data']): # netCDF4 1.1.0+ returns a scalar for 0-dim array, we always want # 1-dim+ arrays with a valid shape. d['data'] = np.array(d['data'][:]) d['data'].shape = (1, ) return d def _ncvar_to_dict_masked(ncvar, Good_Indices): """ Convert a NetCDF Dataset variable to a dictionary. Appropriated from PyArt package. """ d = dict((k, getattr(ncvar, k)) for k in ncvar.ncattrs()) d['data'] = ncvar[Good_Indices] if np.isscalar(d['data']): # netCDF4 1.1.0+ returns a scalar for 0-dim array, we always want # 1-dim+ arrays with a valid shape. d['data'] = np.array(d['data'][:]) d['data'].shape = (1, ) return d def _nasa_ames_var_to_dict(var, standard_name, long_name): d = {} d['standard_name'] = standard_name d['long_name'] = long_name d['units'] = " " d['data'] = var return d def _h5var_to_dict(dataset, units=None, long_name=None, standard_name=None): """ Convert an HDF5 Dataset to a dictionary.""" d = {} if dataset.dtype.char == "S": d['data'] = np.array(dataset)[0] else: d['data'] = np.array(dataset) if len(dataset.attrs) > 0: for attrname in list(dataset.attrs): d[attrname] = dataset.attrs.get(attrname) else: d['standard_name'] = standard_name d['long_name'] = long_name d['units'] = units return d def _var_found(var): '''Print variable found message.''' print("Found %s" % var) def _var_not_found(var): '''Print variable not found message.''' print("%s does not exist in file..." % var) ################## # time methods # ################## def _get_epoch_dict(TimeSec, time_units): '''Output Epoch time dictionary.''' # Convert the time array into a datetime instance dtHrs = num2date(TimeSec, time_units) # Now convert this datetime instance into a number of seconds since Epoch TimeEpoch = date2num(dtHrs, EPOCH_UNITS) # Now once again convert this data into a datetime instance Time_unaware = num2date(TimeEpoch, EPOCH_UNITS) Time = {'data': Time_unaware, 'units': EPOCH_UNITS, 'standard_name': 'Time', 'long_name': 'Time (UTC)'} return Time def convert_to_epoch_dict(datetime_dict): '''Output Epoch time dictionary.''' # Now convert this datetime instance into a number array TimeSec = date2num(datetime_dict['data'], EPOCH_UNITS) # Now once again convert data into a datetime instance Time_unaware = num2date(TimeSec, EPOCH_UNITS) Time = {'data': Time_unaware, 'units': EPOCH_UNITS, 'standard_name': 'Time', 'long_name': 'Time (UTC)'} return Time ######################## # image save methods # ######################## def save_figure(self, figName='awot_plot', figType='png', **kwargs): '''Save the current plot Parameters ---------- figName : str Figure name figType : str Figure format, default to .png ''' plt.gca() plt.gcf() plt.savefig(figName+'.'+figType, format=figType) print("Saved figure: %s.%s" % (figName, figType)) # Now close the plot to make sure matplotlib is happy plt.close()
gpl-2.0
johnnyliu27/openmc
openmc/filter_expansion.py
1
16333
from numbers import Integral, Real from xml.etree import ElementTree as ET import numpy as np import pandas as pd import openmc.checkvalue as cv from . import Filter class ExpansionFilter(Filter): """Abstract filter class for functional expansions.""" def __init__(self, order, filter_id=None): self.order = order self.id = filter_id def __eq__(self, other): if type(self) is not type(other): return False else: return hash(self) == hash(other) @property def order(self): return self._order @order.setter def order(self, order): cv.check_type('expansion order', order, Integral) cv.check_greater_than('expansion order', order, 0, equality=True) self._order = order def to_xml_element(self): """Return XML Element representing the filter. Returns ------- element : xml.etree.ElementTree.Element XML element containing Legendre filter data """ element = ET.Element('filter') element.set('id', str(self.id)) element.set('type', self.short_name.lower()) subelement = ET.SubElement(element, 'order') subelement.text = str(self.order) return element class LegendreFilter(ExpansionFilter): r"""Score Legendre expansion moments up to specified order. This filter allows scores to be multiplied by Legendre polynomials of the change in particle angle (:math:`\mu`) up to a user-specified order. Parameters ---------- order : int Maximum Legendre polynomial order filter_id : int or None Unique identifier for the filter Attributes ---------- order : int Maximum Legendre polynomial order id : int Unique identifier for the filter num_bins : int The number of filter bins """ def __hash__(self): string = type(self).__name__ + '\n' string += '{: <16}=\t{}\n'.format('\tOrder', self.order) return hash(string) def __repr__(self): string = type(self).__name__ + '\n' string += '{: <16}=\t{}\n'.format('\tOrder', self.order) string += '{: <16}=\t{}\n'.format('\tID', self.id) return string @ExpansionFilter.order.setter def order(self, order): ExpansionFilter.order.__set__(self, order) self.bins = ['P{}'.format(i) for i in range(order + 1)] @classmethod def from_hdf5(cls, group, **kwargs): if group['type'].value.decode() != cls.short_name.lower(): raise ValueError("Expected HDF5 data for filter type '" + cls.short_name.lower() + "' but got '" + group['type'].value.decode() + " instead") filter_id = int(group.name.split('/')[-1].lstrip('filter ')) out = cls(group['order'].value, filter_id) return out class SpatialLegendreFilter(ExpansionFilter): r"""Score Legendre expansion moments in space up to specified order. This filter allows scores to be multiplied by Legendre polynomials of the the particle's position along a particular axis, normalized to a given range, up to a user-specified order. Parameters ---------- order : int Maximum Legendre polynomial order axis : {'x', 'y', 'z'} Axis along which to take the expansion minimum : float Minimum value along selected axis maximum : float Maximum value along selected axis filter_id : int or None Unique identifier for the filter Attributes ---------- order : int Maximum Legendre polynomial order axis : {'x', 'y', 'z'} Axis along which to take the expansion minimum : float Minimum value along selected axis maximum : float Maximum value along selected axis id : int Unique identifier for the filter num_bins : int The number of filter bins """ def __init__(self, order, axis, minimum, maximum, filter_id=None): super().__init__(order, filter_id) self.axis = axis self.minimum = minimum self.maximum = maximum def __hash__(self): string = type(self).__name__ + '\n' string += '{: <16}=\t{}\n'.format('\tOrder', self.order) string += '{: <16}=\t{}\n'.format('\tAxis', self.axis) string += '{: <16}=\t{}\n'.format('\tMin', self.minimum) string += '{: <16}=\t{}\n'.format('\tMax', self.maximum) return hash(string) def __repr__(self): string = type(self).__name__ + '\n' string += '{: <16}=\t{}\n'.format('\tOrder', self.order) string += '{: <16}=\t{}\n'.format('\tAxis', self.axis) string += '{: <16}=\t{}\n'.format('\tMin', self.minimum) string += '{: <16}=\t{}\n'.format('\tMax', self.maximum) string += '{: <16}=\t{}\n'.format('\tID', self.id) return string @ExpansionFilter.order.setter def order(self, order): ExpansionFilter.order.__set__(self, order) self.bins = ['P{}'.format(i) for i in range(order + 1)] @property def axis(self): return self._axis @axis.setter def axis(self, axis): cv.check_value('axis', axis, ('x', 'y', 'z')) self._axis = axis @property def minimum(self): return self._minimum @minimum.setter def minimum(self, minimum): cv.check_type('minimum', minimum, Real) self._minimum = minimum @property def maximum(self): return self._maximum @maximum.setter def maximum(self, maximum): cv.check_type('maximum', maximum, Real) self._maximum = maximum @classmethod def from_hdf5(cls, group, **kwargs): if group['type'].value.decode() != cls.short_name.lower(): raise ValueError("Expected HDF5 data for filter type '" + cls.short_name.lower() + "' but got '" + group['type'].value.decode() + " instead") filter_id = int(group.name.split('/')[-1].lstrip('filter ')) order = group['order'].value axis = group['axis'].value.decode() min_, max_ = group['min'].value, group['max'].value return cls(order, axis, min_, max_, filter_id) def to_xml_element(self): """Return XML Element representing the filter. Returns ------- element : xml.etree.ElementTree.Element XML element containing Legendre filter data """ element = super().to_xml_element() subelement = ET.SubElement(element, 'axis') subelement.text = self.axis subelement = ET.SubElement(element, 'min') subelement.text = str(self.minimum) subelement = ET.SubElement(element, 'max') subelement.text = str(self.maximum) return element class SphericalHarmonicsFilter(ExpansionFilter): r"""Score spherical harmonic expansion moments up to specified order. This filter allows you to obtain real spherical harmonic moments of either the particle's direction or the cosine of the scattering angle. Specifying a filter with order :math:`\ell` tallies moments for all orders from 0 to :math:`\ell`. Parameters ---------- order : int Maximum spherical harmonics order, :math:`\ell` filter_id : int or None Unique identifier for the filter Attributes ---------- order : int Maximum spherical harmonics order, :math:`\ell` id : int Unique identifier for the filter cosine : {'scatter', 'particle'} How to handle the cosine term. num_bins : int The number of filter bins """ def __init__(self, order, filter_id=None): super().__init__(order, filter_id) self._cosine = 'particle' def __hash__(self): string = type(self).__name__ + '\n' string += '{: <16}=\t{}\n'.format('\tOrder', self.order) string += '{: <16}=\t{}\n'.format('\tCosine', self.cosine) return hash(string) def __repr__(self): string = type(self).__name__ + '\n' string += '{: <16}=\t{}\n'.format('\tOrder', self.order) string += '{: <16}=\t{}\n'.format('\tCosine', self.cosine) string += '{: <16}=\t{}\n'.format('\tID', self.id) return string @ExpansionFilter.order.setter def order(self, order): ExpansionFilter.order.__set__(self, order) self.bins = ['Y{},{}'.format(n, m) for n in range(order + 1) for m in range(-n, n + 1)] @property def cosine(self): return self._cosine @cosine.setter def cosine(self, cosine): cv.check_value('Spherical harmonics cosine treatment', cosine, ('scatter', 'particle')) self._cosine = cosine @classmethod def from_hdf5(cls, group, **kwargs): if group['type'].value.decode() != cls.short_name.lower(): raise ValueError("Expected HDF5 data for filter type '" + cls.short_name.lower() + "' but got '" + group['type'].value.decode() + " instead") filter_id = int(group.name.split('/')[-1].lstrip('filter ')) out = cls(group['order'].value, filter_id) out.cosine = group['cosine'].value.decode() return out def to_xml_element(self): """Return XML Element representing the filter. Returns ------- element : xml.etree.ElementTree.Element XML element containing spherical harmonics filter data """ element = super().to_xml_element() element.set('cosine', self.cosine) return element class ZernikeFilter(ExpansionFilter): r"""Score Zernike expansion moments in space up to specified order. This filter allows scores to be multiplied by Zernike polynomials of the particle's position normalized to a given unit circle, up to a user-specified order. The standard Zernike polynomials follow the definition by Born and Wolf, *Principles of Optics* and are defined as .. math:: Z_n^m(\rho, \theta) = R_n^m(\rho) \cos (m\theta), \quad m > 0 Z_n^{m}(\rho, \theta) = R_n^{m}(\rho) \sin (m\theta), \quad m < 0 Z_n^{m}(\rho, \theta) = R_n^{m}(\rho), \quad m = 0 where the radial polynomials are .. math:: R_n^m(\rho) = \sum\limits_{k=0}^{(n-m)/2} \frac{(-1)^k (n-k)!}{k! ( \frac{n+m}{2} - k)! (\frac{n-m}{2} - k)!} \rho^{n-2k}. With this definition, the integral of :math:`(Z_n^m)^2` over the unit disk is :math:`\frac{\epsilon_m\pi}{2n+2}` for each polynomial where :math:`\epsilon_m` is 2 if :math:`m` equals 0 and 1 otherwise. Specifying a filter with order N tallies moments for all :math:`n` from 0 to N and each value of :math:`m`. The ordering of the Zernike polynomial moments follows the ANSI Z80.28 standard, where the one-dimensional index :math:`j` corresponds to the :math:`n` and :math:`m` by .. math:: j = \frac{n(n + 2) + m}{2}. Parameters ---------- order : int Maximum Zernike polynomial order x : float x-coordinate of center of circle for normalization y : float y-coordinate of center of circle for normalization r : int or None Radius of circle for normalization Attributes ---------- order : int Maximum Zernike polynomial order x : float x-coordinate of center of circle for normalization y : float y-coordinate of center of circle for normalization r : int or None Radius of circle for normalization id : int Unique identifier for the filter num_bins : int The number of filter bins """ def __init__(self, order, x=0.0, y=0.0, r=1.0, filter_id=None): super().__init__(order, filter_id) self.x = x self.y = y self.r = r def __hash__(self): string = type(self).__name__ + '\n' string += '{: <16}=\t{}\n'.format('\tOrder', self.order) string += '{: <16}=\t{}\n'.format('\tX', self.x) string += '{: <16}=\t{}\n'.format('\tY', self.y) string += '{: <16}=\t{}\n'.format('\tR', self.r) return hash(string) def __repr__(self): string = type(self).__name__ + '\n' string += '{: <16}=\t{}\n'.format('\tOrder', self.order) string += '{: <16}=\t{}\n'.format('\tID', self.id) return string @ExpansionFilter.order.setter def order(self, order): ExpansionFilter.order.__set__(self, order) self.bins = ['Z{},{}'.format(n, m) for n in range(order + 1) for m in range(-n, n + 1, 2)] @property def x(self): return self._x @x.setter def x(self, x): cv.check_type('x', x, Real) self._x = x @property def y(self): return self._y @y.setter def y(self, y): cv.check_type('y', y, Real) self._y = y @property def r(self): return self._r @r.setter def r(self, r): cv.check_type('r', r, Real) self._r = r @classmethod def from_hdf5(cls, group, **kwargs): if group['type'].value.decode() != cls.short_name.lower(): raise ValueError("Expected HDF5 data for filter type '" + cls.short_name.lower() + "' but got '" + group['type'].value.decode() + " instead") filter_id = int(group.name.split('/')[-1].lstrip('filter ')) order = group['order'].value x, y, r = group['x'].value, group['y'].value, group['r'].value return cls(order, x, y, r, filter_id) def to_xml_element(self): """Return XML Element representing the filter. Returns ------- element : xml.etree.ElementTree.Element XML element containing Zernike filter data """ element = super().to_xml_element() subelement = ET.SubElement(element, 'x') subelement.text = str(self.x) subelement = ET.SubElement(element, 'y') subelement.text = str(self.y) subelement = ET.SubElement(element, 'r') subelement.text = str(self.r) return element class ZernikeRadialFilter(ZernikeFilter): r"""Score the :math:`m = 0` (radial variation only) Zernike moments up to specified order. The Zernike polynomials are defined the same as in :class:`ZernikeFilter`. .. math:: Z_n^{0}(\rho, \theta) = R_n^{0}(\rho) where the radial polynomials are .. math:: R_n^{0}(\rho) = \sum\limits_{k=0}^{n/2} \frac{(-1)^k (n-k)!}{k! (( \frac{n}{2} - k)!)^{2}} \rho^{n-2k}. With this definition, the integral of :math:`(Z_n^0)^2` over the unit disk is :math:`\frac{\pi}{n+1}`. If there is only radial dependency, the polynomials are integrated over the azimuthal angles. The only terms left are :math:`Z_n^{0}(\rho, \theta) = R_n^{0}(\rho)`. Note that :math:`n` could only be even orders. Therefore, for a radial Zernike polynomials up to order of :math:`n`, there are :math:`\frac{n}{2} + 1` terms in total. The indexing is from the lowest even order (0) to highest even order. Parameters ---------- order : int Maximum radial Zernike polynomial order x : float x-coordinate of center of circle for normalization y : float y-coordinate of center of circle for normalization r : int or None Radius of circle for normalization Attributes ---------- order : int Maximum radial Zernike polynomial order x : float x-coordinate of center of circle for normalization y : float y-coordinate of center of circle for normalization r : int or None Radius of circle for normalization id : int Unique identifier for the filter num_bins : int The number of filter bins """ @ExpansionFilter.order.setter def order(self, order): ExpansionFilter.order.__set__(self, order) self.bins = ['Z{},0'.format(n) for n in range(0, order+1, 2)]
mit
ibis-project/ibis-bigquery
tests/unit/test_compiler.py
1
10157
import datetime import ibis import ibis.expr.datatypes as dt import ibis.expr.operations as ops import packaging.version import pandas as pd import pytest from ibis.expr.types import TableExpr import ibis_bigquery IBIS_VERSION = packaging.version.Version(ibis.__version__) IBIS_1_4_VERSION = packaging.version.Version("1.4.0") @pytest.mark.parametrize( ('case', 'expected', 'dtype'), [ (datetime.date(2017, 1, 1), "DATE '2017-01-01'", dt.date), (pd.Timestamp('2017-01-01'), "DATE '2017-01-01'", dt.date,), ('2017-01-01', "DATE '2017-01-01'", dt.date), ( datetime.datetime(2017, 1, 1, 4, 55, 59), "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, ), ( '2017-01-01 04:55:59', "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, ), ( pd.Timestamp('2017-01-01 04:55:59'), "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, ), ], ) def test_literal_date(case, expected, dtype): expr = ibis.literal(case, type=dtype).year() result = ibis_bigquery.compile(expr) assert result == f"SELECT EXTRACT(year from {expected}) AS `tmp`" @pytest.mark.parametrize( ('case', 'expected', 'dtype', 'strftime_func'), [ ( datetime.date(2017, 1, 1), "DATE '2017-01-01'", dt.date, 'FORMAT_DATE', ), ( pd.Timestamp('2017-01-01'), "DATE '2017-01-01'", dt.date, 'FORMAT_DATE', ), ('2017-01-01', "DATE '2017-01-01'", dt.date, 'FORMAT_DATE',), ( datetime.datetime(2017, 1, 1, 4, 55, 59), "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, 'FORMAT_TIMESTAMP', ), ( '2017-01-01 04:55:59', "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, 'FORMAT_TIMESTAMP', ), ( pd.Timestamp('2017-01-01 04:55:59'), "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, 'FORMAT_TIMESTAMP', ), ], ) def test_day_of_week(case, expected, dtype, strftime_func): date_var = ibis.literal(case, type=dtype) expr_index = date_var.day_of_week.index() result = ibis_bigquery.compile(expr_index) assert ( result == f"SELECT MOD(EXTRACT(DAYOFWEEK FROM {expected}) + 5, 7) AS `tmp`" ) expr_name = date_var.day_of_week.full_name() result = ibis_bigquery.compile(expr_name) if strftime_func == 'FORMAT_TIMESTAMP': assert ( result == f"SELECT {strftime_func}('%A', {expected}, 'UTC') AS `tmp`" ) else: assert result == f"SELECT {strftime_func}('%A', {expected}) AS `tmp`" @pytest.mark.parametrize( ("case", "expected", "dtype"), [ ("test of hash", "'test of hash'", dt.string,), (b"test of hash", "FROM_BASE64('dGVzdCBvZiBoYXNo')", dt.binary,), ], ) def test_hash(case, expected, dtype): if IBIS_VERSION < IBIS_1_4_VERSION: pytest.skip("requires ibis 1.4+") string_var = ibis.literal(case, type=dtype) expr = string_var.hash(how="farm_fingerprint") result = ibis_bigquery.compile(expr) assert result == f"SELECT farm_fingerprint({expected}) AS `tmp`" @pytest.mark.parametrize( ("case", "expected", "how", "dtype"), [ ("test", "md5('test')", "md5", dt.string,), (b"test", "md5(FROM_BASE64('dGVzdA=='))", "md5", dt.binary,), ("test", "sha1('test')", "sha1", dt.string,), (b"test", "sha1(FROM_BASE64('dGVzdA=='))", "sha1", dt.binary,), ("test", "sha256('test')", "sha256", dt.string,), (b"test", "sha256(FROM_BASE64('dGVzdA=='))", "sha256", dt.binary,), ("test", "sha512('test')", "sha512", dt.string,), (b"test", "sha512(FROM_BASE64('dGVzdA=='))", "sha512", dt.binary,), ], ) def test_hashbytes(case, expected, how, dtype): if IBIS_VERSION < IBIS_1_4_VERSION: pytest.skip("requires ibis 1.4+") var = ibis.literal(case, type=dtype) expr = var.hashbytes(how=how) result = ibis_bigquery.compile(expr) assert result == f"SELECT {expected} AS `tmp`" @pytest.mark.parametrize( ('case', 'expected', 'dtype'), [ ( datetime.datetime(2017, 1, 1, 4, 55, 59), "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, ), ( '2017-01-01 04:55:59', "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, ), ( pd.Timestamp('2017-01-01 04:55:59'), "TIMESTAMP '2017-01-01 04:55:59'", dt.timestamp, ), (datetime.time(4, 55, 59), "TIME '04:55:59'", dt.time), ('04:55:59', "TIME '04:55:59'", dt.time), ], ) def test_literal_timestamp_or_time(case, expected, dtype): expr = ibis.literal(case, type=dtype).hour() result = ibis_bigquery.compile(expr) assert result == f"SELECT EXTRACT(hour from {expected}) AS `tmp`" def test_projection_fusion_only_peeks_at_immediate_parent(): if IBIS_VERSION < IBIS_1_4_VERSION: pytest.skip("requires ibis 1.4+") schema = [ ('file_date', 'timestamp'), ('PARTITIONTIME', 'date'), ('val', 'int64'), ] table = ibis.table(schema, name='unbound_table') table = table[table.PARTITIONTIME < ibis.date('2017-01-01')] table = table.mutate(file_date=table.file_date.cast('date')) table = table[table.file_date < ibis.date('2017-01-01')] table = table.mutate(XYZ=table.val * 2) expr = table.join(table.view())[table] result = ibis_bigquery.compile(expr) expected = """\ WITH t0 AS ( SELECT * FROM unbound_table WHERE `PARTITIONTIME` < DATE '2017-01-01' ), t1 AS ( SELECT CAST(`file_date` AS DATE) AS `file_date`, `PARTITIONTIME`, `val` FROM t0 ), t2 AS ( SELECT t1.* FROM t1 WHERE t1.`file_date` < DATE '2017-01-01' ), t3 AS ( SELECT *, `val` * 2 AS `XYZ` FROM t2 ) SELECT t3.* FROM t3 INNER JOIN t3 t4""" assert result == expected @pytest.mark.parametrize( ('unit', 'expected_unit', 'expected_func'), [ ('Y', 'YEAR', 'TIMESTAMP'), ('Q', 'QUARTER', 'TIMESTAMP'), ('M', 'MONTH', 'TIMESTAMP'), ('W', 'WEEK', 'TIMESTAMP'), ('D', 'DAY', 'TIMESTAMP'), ('h', 'HOUR', 'TIMESTAMP'), ('m', 'MINUTE', 'TIMESTAMP'), ('s', 'SECOND', 'TIMESTAMP'), ('ms', 'MILLISECOND', 'TIMESTAMP'), ('us', 'MICROSECOND', 'TIMESTAMP'), ('Y', 'YEAR', 'DATE'), ('Q', 'QUARTER', 'DATE'), ('M', 'MONTH', 'DATE'), ('W', 'WEEK', 'DATE'), ('D', 'DAY', 'DATE'), ('h', 'HOUR', 'TIME'), ('m', 'MINUTE', 'TIME'), ('s', 'SECOND', 'TIME'), ('ms', 'MILLISECOND', 'TIME'), ('us', 'MICROSECOND', 'TIME'), ], ) def test_temporal_truncate(unit, expected_unit, expected_func): t = ibis.table([('a', getattr(dt, expected_func.lower()))], name='t') expr = t.a.truncate(unit) result = ibis_bigquery.compile(expr) expected = f"""\ SELECT {expected_func}_TRUNC(`a`, {expected_unit}) AS `tmp` FROM t""" assert result == expected @pytest.mark.parametrize('kind', ['date', 'time']) def test_extract_temporal_from_timestamp(kind): t = ibis.table([('ts', dt.timestamp)], name='t') expr = getattr(t.ts, kind)() result = ibis_bigquery.compile(expr) expected = f"""\ SELECT {kind.upper()}(`ts`) AS `tmp` FROM t""" assert result == expected def test_now(): expr = ibis.now() result = ibis_bigquery.compile(expr) expected = 'SELECT CURRENT_TIMESTAMP() AS `tmp`' assert result == expected def test_binary(): t = ibis.table([('value', 'double')], name='t') expr = t["value"].cast(dt.binary).name("value_hash") result = ibis_bigquery.compile(expr) expected = """\ SELECT CAST(`value` AS BYTES) AS `tmp` FROM t""" assert result == expected def test_substring(): t = ibis.table([('value', 'string')], name='t') expr = t["value"].substr(3, -1) with pytest.raises(Exception) as exception_info: ibis_bigquery.compile(expr) expected = 'Length parameter should not be a negative value.' assert str(exception_info.value) == expected def test_bucket(): t = ibis.table([('value', 'double')], name='t') buckets = [0, 1, 3] expr = t.value.bucket(buckets).name('foo') result = ibis_bigquery.compile(expr) expected = """\ SELECT CASE WHEN (`value` >= 0) AND (`value` < 1) THEN 0 WHEN (`value` >= 1) AND (`value` <= 3) THEN 1 ELSE CAST(NULL AS INT64) END AS `tmp` FROM t""" assert result == expected @pytest.mark.parametrize( ('kind', 'begin', 'end', 'expected'), [ ('preceding', None, 1, 'UNBOUNDED PRECEDING AND 1 PRECEDING'), ('following', 1, None, '1 FOLLOWING AND UNBOUNDED FOLLOWING'), ], ) def test_window_unbounded(kind, begin, end, expected): t = ibis.table([('a', 'int64')], name='t') kwargs = {kind: (begin, end)} expr = t.a.sum().over(ibis.window(**kwargs)) result = ibis_bigquery.compile(expr) assert ( result == f"""\ SELECT sum(`a`) OVER (ROWS BETWEEN {expected}) AS `tmp` FROM t""" ) def test_large_compile(): """ Tests that compiling a large expression tree finishes within a reasonable amount of time """ num_columns = 20 num_joins = 7 class MockBigQueryClient(ibis_bigquery.BigQueryClient): def __init__(self): pass names = [f"col_{i}" for i in range(num_columns)] schema = ibis.Schema(names, ['string'] * num_columns) ibis_client = MockBigQueryClient() table = TableExpr( ops.SQLQueryResult("select * from t", schema, ibis_client) ) for _ in range(num_joins): table = table.mutate(dummy=ibis.literal("")) table = table.left_join(table, ["dummy"])[[table]] start = datetime.datetime.now() table.compile() delta = datetime.datetime.now() - start assert delta.total_seconds() < 10
apache-2.0
GitYiheng/reinforcement_learning_test
test00_previous_files/mc_pi_dst_fv_es.py
1
2517
# Monte Carlo policy iteration # Deterministic state transition # First-visit # Exploring starts import numpy as np import matplotlib.pyplot as plt from grid_world import standard_grid, negative_grid from dp_ipe_dst_dp import print_values, print_policy SMALL_ENOUGH = 1e-4 GAMMA = 0.9 def play_one_episode(grid, policy): valid_states = list(grid.actions.keys()) start_state_index = np.random.choice(len(valid_states)) s = grid.set_state(valid_states[start_state_index]) a = np.random.choice(list(policy[s])) states_actions_rewards = [(s, a, 0)] visited_states = set() while True: old_s = grid.current_state() r = grid.move(a) s = grid.current_state() if s in visited_states: states_actions_rewards.append((s, None, -100)) break elif grid.game_over(): states_actions_rewards.append((s, None, r)) break else: a = policy[s] states_actions_rewards.append((s, a, r)) visited_states.add(s) G = 0 states_actions_returns = [] first = True for s, a, r in reversed(states_actions_rewards): if first: first = False else: states_actions_returns.append((s, a, G)) G = r + GAMMA * G states_actions_returns.reverse() return states_actions_returns def max_dict(d): max_key = None max_value = float('-inf') for key, value in d.items(): if value > max_value: max_value = value max_key = key return max_key, max_value if __name__ == '__main__': grid = negative_grid(step_cost=-0.1) print("Rewards:") print_values(grid.rewards, grid) policy = {} for s in grid.actions.keys(): policy[s] = np.random.choice(list(grid.actions[s])) Q = {} returns = {} states = grid.all_states() for s in grid.actions.keys(): Q[s] = {} for a in grid.actions[s]: Q[s][a] = 0 returns[(s, a)] = [] deltas = [] for i in range(2000): if i % 100 == 0: print(i) biggest_change = 0 states_actions_returns = play_one_episode(grid, policy) visited_state_action_pairs = set() for s, a, G in states_actions_returns: sa = (s, a) if sa not in visited_state_action_pairs: old_q = Q[s][a] returns[sa].append(G) Q[s][a] = np.mean(returns[sa]) biggest_change = max(biggest_change, np.abs(old_q - Q[s][a])) visited_state_action_pairs.add(sa) deltas.append(biggest_change) for s in policy.keys(): policy[s] = max_dict(Q[s])[0] # plt.plot(deltas) # plt.show() print("Final policy:") print_policy(policy, grid) V = {} for s, Qs in Q.items(): V[s] = max_dict(Q[s])[1] print("Final values:") print_values(V, grid)
mit
kashif/scikit-learn
examples/model_selection/plot_confusion_matrix.py
47
2495
""" ================ Confusion matrix ================ Example of confusion matrix usage to evaluate the quality of the output of a classifier on the iris data set. The diagonal elements represent the number of points for which the predicted label is equal to the true label, while off-diagonal elements are those that are mislabeled by the classifier. The higher the diagonal values of the confusion matrix the better, indicating many correct predictions. The figures show the confusion matrix with and without normalization by class support size (number of elements in each class). This kind of normalization can be interesting in case of class imbalance to have a more visual interpretation of which class is being misclassified. Here the results are not as good as they could be as our choice for the regularization parameter C was not the best. In real life applications this parameter is usually chosen using :ref:`grid_search`. """ print(__doc__) import numpy as np import matplotlib.pyplot as plt from sklearn import svm, datasets from sklearn.model_selection import train_test_split from sklearn.metrics import confusion_matrix # import some data to play with iris = datasets.load_iris() X = iris.data y = iris.target # Split the data into a training set and a test set X_train, X_test, y_train, y_test = train_test_split(X, y, random_state=0) # Run classifier, using a model that is too regularized (C too low) to see # the impact on the results classifier = svm.SVC(kernel='linear', C=0.01) y_pred = classifier.fit(X_train, y_train).predict(X_test) def plot_confusion_matrix(cm, title='Confusion matrix', cmap=plt.cm.Blues): plt.imshow(cm, interpolation='nearest', cmap=cmap) plt.title(title) plt.colorbar() tick_marks = np.arange(len(iris.target_names)) plt.xticks(tick_marks, iris.target_names, rotation=45) plt.yticks(tick_marks, iris.target_names) plt.tight_layout() plt.ylabel('True label') plt.xlabel('Predicted label') # Compute confusion matrix cm = confusion_matrix(y_test, y_pred) np.set_printoptions(precision=2) print('Confusion matrix, without normalization') print(cm) plt.figure() plot_confusion_matrix(cm) # Normalize the confusion matrix by row (i.e by the number of samples # in each class) cm_normalized = cm.astype('float') / cm.sum(axis=1)[:, np.newaxis] print('Normalized confusion matrix') print(cm_normalized) plt.figure() plot_confusion_matrix(cm_normalized, title='Normalized confusion matrix') plt.show()
bsd-3-clause
ssahli/Python-Neural-Network
Demo.py
1
1716
import matplotlib.pyplot as plt import pylab import numpy as np from sklearn import datasets from NeuralNet import NeuralNetwork # Tunable parameters. Go nuts. HIDDEN_NODES = 128 LEARNING_RATE = 0.3 ITERATIONS = 50 VIEW_EXAMPLES = True VIEW_PLOT = True ''' Lets view a few examples from the original dataset. source of code: scikit-learn.org ''' if VIEW_EXAMPLES == True: digits = datasets.load_digits() images_and_labels = list(zip(digits.images, digits.target)) for index, (image, label) in enumerate(images_and_labels[:10]): plt.subplot(4, 3, index + 1) plt.axis('off') plt.imshow(image, cmap=plt.cm.gray_r, interpolation='nearest') plt.title('Training: %i' % label) pylab.show() ''' Load the data. For this demo, we're using sklearn's digits dataset Digits are 8x8 pixel images. Each row is one image, in a linear format, where columns 65-74 correspond to one hot encoded responses representing digits 0 through 9. 1797 rows 74 columns ''' data = np.loadtxt("transformed.csv", delimiter = ',') m = len(data) # Split the data into training set and test set. train_set = data[:(3*m/4),:] test_set = data[m/4:,:] # Instantiate a new neural network. 64 input, 64 hidden, 10 output nodes. NN = NeuralNetwork(64,HIDDEN_NODES,10,LEARNING_RATE,ITERATIONS) # Train on the training set, test on the test set. The test() function # will print out the percent correctness on the test set. errors = NN.train(train_set) NN.test(test_set) # Plot the error curve if VIEW_PLOT == True: plt.plot(errors) plt.title("Average Error Per Iteration On Training Set") plt.xlabel("Iteration") plt.ylabel("Average Error") pylab.show()
gpl-3.0
lin-credible/scikit-learn
examples/bicluster/plot_spectral_biclustering.py
403
2011
""" ============================================= A demo of the Spectral Biclustering algorithm ============================================= This example demonstrates how to generate a checkerboard dataset and bicluster it using the Spectral Biclustering algorithm. The data is generated with the ``make_checkerboard`` function, then shuffled and passed to the Spectral Biclustering algorithm. The rows and columns of the shuffled matrix are rearranged to show the biclusters found by the algorithm. The outer product of the row and column label vectors shows a representation of the checkerboard structure. """ print(__doc__) # Author: Kemal Eren <[email protected]> # License: BSD 3 clause import numpy as np from matplotlib import pyplot as plt from sklearn.datasets import make_checkerboard from sklearn.datasets import samples_generator as sg from sklearn.cluster.bicluster import SpectralBiclustering from sklearn.metrics import consensus_score n_clusters = (4, 3) data, rows, columns = make_checkerboard( shape=(300, 300), n_clusters=n_clusters, noise=10, shuffle=False, random_state=0) plt.matshow(data, cmap=plt.cm.Blues) plt.title("Original dataset") data, row_idx, col_idx = sg._shuffle(data, random_state=0) plt.matshow(data, cmap=plt.cm.Blues) plt.title("Shuffled dataset") model = SpectralBiclustering(n_clusters=n_clusters, method='log', random_state=0) model.fit(data) score = consensus_score(model.biclusters_, (rows[:, row_idx], columns[:, col_idx])) print("consensus score: {:.1f}".format(score)) fit_data = data[np.argsort(model.row_labels_)] fit_data = fit_data[:, np.argsort(model.column_labels_)] plt.matshow(fit_data, cmap=plt.cm.Blues) plt.title("After biclustering; rearranged to show biclusters") plt.matshow(np.outer(np.sort(model.row_labels_) + 1, np.sort(model.column_labels_) + 1), cmap=plt.cm.Blues) plt.title("Checkerboard structure of rearranged data") plt.show()
bsd-3-clause
CompPhysics/MachineLearning
doc/src/SupportVMachines/Programs/xgcancer.py
2
1413
import matplotlib.pyplot as plt import numpy as np from sklearn.model_selection import train_test_split from sklearn.datasets import load_breast_cancer from sklearn.preprocessing import LabelEncoder from sklearn.model_selection import cross_validate import scikitplot as skplt import xgboost as xgb # Load the data cancer = load_breast_cancer() X_train, X_test, y_train, y_test = train_test_split(cancer.data,cancer.target,random_state=0) print(X_train.shape) print(X_test.shape) #now scale the data from sklearn.preprocessing import StandardScaler scaler = StandardScaler() scaler.fit(X_train) X_train_scaled = scaler.transform(X_train) X_test_scaled = scaler.transform(X_test) xg_clf = xgb.XGBClassifier(max_depth = 4, n_estimators = 200) xg_clf.fit(X_train_scaled,y_train) y_test = xg_clf.predict(X_test_scaled) print("Test set accuracy with Random Forests and scaled data: {:.2f}".format(xg_clf.score(X_test_scaled,y_test))) import scikitplot as skplt y_pred = xg_clf.predict(X_test_scaled) skplt.metrics.plot_confusion_matrix(y_test, y_pred, normalize=True) plt.show() y_probas = xg_clf.predict_proba(X_test_scaled) skplt.metrics.plot_roc(y_test, y_probas) plt.show() skplt.metrics.plot_cumulative_gain(y_test, y_probas) plt.show() xgb.plot_tree(xg_clf,num_trees=0) plt.rcParams['figure.figsize'] = [50, 10] plt.show() xgb.plot_importance(xg_clf) plt.rcParams['figure.figsize'] = [5, 5] plt.show()
cc0-1.0
pradyu1993/scikit-learn
examples/linear_model/plot_lasso_and_elasticnet.py
3
1765
""" ======================================== Lasso and Elastic Net for Sparse Signals ======================================== """ print __doc__ import numpy as np import pylab as pl from sklearn.metrics import r2_score ############################################################################### # generate some sparse data to play with np.random.seed(42) n_samples, n_features = 50, 200 X = np.random.randn(n_samples, n_features) coef = 3 * np.random.randn(n_features) inds = np.arange(n_features) np.random.shuffle(inds) coef[inds[10:]] = 0 # sparsify coef y = np.dot(X, coef) # add noise y += 0.01 * np.random.normal((n_samples,)) # Split data in train set and test set n_samples = X.shape[0] X_train, y_train = X[:n_samples / 2], y[:n_samples / 2] X_test, y_test = X[n_samples / 2:], y[n_samples / 2:] ############################################################################### # Lasso from sklearn.linear_model import Lasso alpha = 0.1 lasso = Lasso(alpha=alpha) y_pred_lasso = lasso.fit(X_train, y_train).predict(X_test) r2_score_lasso = r2_score(y_test, y_pred_lasso) print lasso print "r^2 on test data : %f" % r2_score_lasso ############################################################################### # ElasticNet from sklearn.linear_model import ElasticNet enet = ElasticNet(alpha=alpha, rho=0.7) y_pred_enet = enet.fit(X_train, y_train).predict(X_test) r2_score_enet = r2_score(y_test, y_pred_enet) print enet print "r^2 on test data : %f" % r2_score_enet pl.plot(enet.coef_, label='Elastic net coefficients') pl.plot(lasso.coef_, label='Lasso coefficients') pl.plot(coef, '--', label='original coefficients') pl.legend(loc='best') pl.title("Lasso R^2: %f, Elastic Net R^2: %f" % (r2_score_lasso, r2_score_enet)) pl.show()
bsd-3-clause
DGrady/pandas
pandas/io/packers.py
4
27509
""" Msgpack serializer support for reading and writing pandas data structures to disk portions of msgpack_numpy package, by Lev Givon were incorporated into this module (and tests_packers.py) License ======= Copyright (c) 2013, Lev Givon. All rights reserved. Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: * Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. * Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. * Neither the name of Lev Givon nor the names of any contributors may be used to endorse or promote products derived from this software without specific prior written permission. THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. """ from datetime import datetime, date, timedelta from dateutil.parser import parse import os from textwrap import dedent import warnings import numpy as np from pandas import compat from pandas.compat import u, u_safe from pandas.core.dtypes.common import ( is_categorical_dtype, is_object_dtype, needs_i8_conversion, pandas_dtype) from pandas import (Timestamp, Period, Series, DataFrame, # noqa Index, MultiIndex, Float64Index, Int64Index, Panel, RangeIndex, PeriodIndex, DatetimeIndex, NaT, Categorical, CategoricalIndex) from pandas._libs.tslib import NaTType from pandas.core.sparse.api import SparseSeries, SparseDataFrame from pandas.core.sparse.array import BlockIndex, IntIndex from pandas.core.generic import NDFrame from pandas.errors import PerformanceWarning from pandas.io.common import get_filepath_or_buffer, _stringify_path from pandas.core.internals import BlockManager, make_block, _safe_reshape import pandas.core.internals as internals from pandas.io.msgpack import Unpacker as _Unpacker, Packer as _Packer, ExtType from pandas.util._move import ( BadMove as _BadMove, move_into_mutable_buffer as _move_into_mutable_buffer, ) # check whcih compression libs we have installed try: import zlib def _check_zlib(): pass except ImportError: def _check_zlib(): raise ImportError('zlib is not installed') _check_zlib.__doc__ = dedent( """\ Check if zlib is installed. Raises ------ ImportError Raised when zlib is not installed. """, ) try: import blosc def _check_blosc(): pass except ImportError: def _check_blosc(): raise ImportError('blosc is not installed') _check_blosc.__doc__ = dedent( """\ Check if blosc is installed. Raises ------ ImportError Raised when blosc is not installed. """, ) # until we can pass this into our conversion functions, # this is pretty hacky compressor = None def to_msgpack(path_or_buf, *args, **kwargs): """ msgpack (serialize) object to input file path THIS IS AN EXPERIMENTAL LIBRARY and the storage format may not be stable until a future release. Parameters ---------- path_or_buf : string File path, buffer-like, or None if None, return generated string args : an object or objects to serialize encoding: encoding for unicode objects append : boolean whether to append to an existing msgpack (default is False) compress : type of compressor (zlib or blosc), default to None (no compression) """ global compressor compressor = kwargs.pop('compress', None) if compressor: compressor = u(compressor) append = kwargs.pop('append', None) if append: mode = 'a+b' else: mode = 'wb' def writer(fh): for a in args: fh.write(pack(a, **kwargs)) path_or_buf = _stringify_path(path_or_buf) if isinstance(path_or_buf, compat.string_types): with open(path_or_buf, mode) as fh: writer(fh) elif path_or_buf is None: buf = compat.BytesIO() writer(buf) return buf.getvalue() else: writer(path_or_buf) def read_msgpack(path_or_buf, encoding='utf-8', iterator=False, **kwargs): """ Load msgpack pandas object from the specified file path THIS IS AN EXPERIMENTAL LIBRARY and the storage format may not be stable until a future release. Parameters ---------- path_or_buf : string File path, BytesIO like or string encoding: Encoding for decoding msgpack str type iterator : boolean, if True, return an iterator to the unpacker (default is False) Returns ------- obj : type of object stored in file """ path_or_buf, _, _ = get_filepath_or_buffer(path_or_buf) if iterator: return Iterator(path_or_buf) def read(fh): l = list(unpack(fh, encoding=encoding, **kwargs)) if len(l) == 1: return l[0] return l # see if we have an actual file if isinstance(path_or_buf, compat.string_types): try: exists = os.path.exists(path_or_buf) except (TypeError, ValueError): exists = False if exists: with open(path_or_buf, 'rb') as fh: return read(fh) # treat as a binary-like if isinstance(path_or_buf, compat.binary_type): fh = None try: fh = compat.BytesIO(path_or_buf) return read(fh) finally: if fh is not None: fh.close() # a buffer like if hasattr(path_or_buf, 'read') and compat.callable(path_or_buf.read): return read(path_or_buf) raise ValueError('path_or_buf needs to be a string file path or file-like') dtype_dict = {21: np.dtype('M8[ns]'), u('datetime64[ns]'): np.dtype('M8[ns]'), u('datetime64[us]'): np.dtype('M8[us]'), 22: np.dtype('m8[ns]'), u('timedelta64[ns]'): np.dtype('m8[ns]'), u('timedelta64[us]'): np.dtype('m8[us]'), # this is platform int, which we need to remap to np.int64 # for compat on windows platforms 7: np.dtype('int64'), 'category': 'category' } def dtype_for(t): """ return my dtype mapping, whether number or name """ if t in dtype_dict: return dtype_dict[t] return np.typeDict.get(t, t) c2f_dict = {'complex': np.float64, 'complex128': np.float64, 'complex64': np.float32} # numpy 1.6.1 compat if hasattr(np, 'float128'): c2f_dict['complex256'] = np.float128 def c2f(r, i, ctype_name): """ Convert strings to complex number instance with specified numpy type. """ ftype = c2f_dict[ctype_name] return np.typeDict[ctype_name](ftype(r) + 1j * ftype(i)) def convert(values): """ convert the numpy values to a list """ dtype = values.dtype if is_categorical_dtype(values): return values elif is_object_dtype(dtype): return values.ravel().tolist() if needs_i8_conversion(dtype): values = values.view('i8') v = values.ravel() if compressor == 'zlib': _check_zlib() # return string arrays like they are if dtype == np.object_: return v.tolist() # convert to a bytes array v = v.tostring() return ExtType(0, zlib.compress(v)) elif compressor == 'blosc': _check_blosc() # return string arrays like they are if dtype == np.object_: return v.tolist() # convert to a bytes array v = v.tostring() return ExtType(0, blosc.compress(v, typesize=dtype.itemsize)) # ndarray (on original dtype) return ExtType(0, v.tostring()) def unconvert(values, dtype, compress=None): as_is_ext = isinstance(values, ExtType) and values.code == 0 if as_is_ext: values = values.data if is_categorical_dtype(dtype): return values elif is_object_dtype(dtype): return np.array(values, dtype=object) dtype = pandas_dtype(dtype).base if not as_is_ext: values = values.encode('latin1') if compress: if compress == u'zlib': _check_zlib() decompress = zlib.decompress elif compress == u'blosc': _check_blosc() decompress = blosc.decompress else: raise ValueError("compress must be one of 'zlib' or 'blosc'") try: return np.frombuffer( _move_into_mutable_buffer(decompress(values)), dtype=dtype, ) except _BadMove as e: # Pull the decompressed data off of the `_BadMove` exception. # We don't just store this in the locals because we want to # minimize the risk of giving users access to a `bytes` object # whose data is also given to a mutable buffer. values = e.args[0] if len(values) > 1: # The empty string and single characters are memoized in many # string creating functions in the capi. This case should not # warn even though we need to make a copy because we are only # copying at most 1 byte. warnings.warn( 'copying data after decompressing; this may mean that' ' decompress is caching its result', PerformanceWarning, ) # fall through to copying `np.fromstring` # Copy the string into a numpy array. return np.fromstring(values, dtype=dtype) def encode(obj): """ Data encoder """ tobj = type(obj) if isinstance(obj, Index): if isinstance(obj, RangeIndex): return {u'typ': u'range_index', u'klass': u(obj.__class__.__name__), u'name': getattr(obj, 'name', None), u'start': getattr(obj, '_start', None), u'stop': getattr(obj, '_stop', None), u'step': getattr(obj, '_step', None)} elif isinstance(obj, PeriodIndex): return {u'typ': u'period_index', u'klass': u(obj.__class__.__name__), u'name': getattr(obj, 'name', None), u'freq': u_safe(getattr(obj, 'freqstr', None)), u'dtype': u(obj.dtype.name), u'data': convert(obj.asi8), u'compress': compressor} elif isinstance(obj, DatetimeIndex): tz = getattr(obj, 'tz', None) # store tz info and data as UTC if tz is not None: tz = u(tz.zone) obj = obj.tz_convert('UTC') return {u'typ': u'datetime_index', u'klass': u(obj.__class__.__name__), u'name': getattr(obj, 'name', None), u'dtype': u(obj.dtype.name), u'data': convert(obj.asi8), u'freq': u_safe(getattr(obj, 'freqstr', None)), u'tz': tz, u'compress': compressor} elif isinstance(obj, MultiIndex): return {u'typ': u'multi_index', u'klass': u(obj.__class__.__name__), u'names': getattr(obj, 'names', None), u'dtype': u(obj.dtype.name), u'data': convert(obj.values), u'compress': compressor} else: return {u'typ': u'index', u'klass': u(obj.__class__.__name__), u'name': getattr(obj, 'name', None), u'dtype': u(obj.dtype.name), u'data': convert(obj.values), u'compress': compressor} elif isinstance(obj, Categorical): return {u'typ': u'category', u'klass': u(obj.__class__.__name__), u'name': getattr(obj, 'name', None), u'codes': obj.codes, u'categories': obj.categories, u'ordered': obj.ordered, u'compress': compressor} elif isinstance(obj, Series): if isinstance(obj, SparseSeries): raise NotImplementedError( 'msgpack sparse series is not implemented' ) # d = {'typ': 'sparse_series', # 'klass': obj.__class__.__name__, # 'dtype': obj.dtype.name, # 'index': obj.index, # 'sp_index': obj.sp_index, # 'sp_values': convert(obj.sp_values), # 'compress': compressor} # for f in ['name', 'fill_value', 'kind']: # d[f] = getattr(obj, f, None) # return d else: return {u'typ': u'series', u'klass': u(obj.__class__.__name__), u'name': getattr(obj, 'name', None), u'index': obj.index, u'dtype': u(obj.dtype.name), u'data': convert(obj.values), u'compress': compressor} elif issubclass(tobj, NDFrame): if isinstance(obj, SparseDataFrame): raise NotImplementedError( 'msgpack sparse frame is not implemented' ) # d = {'typ': 'sparse_dataframe', # 'klass': obj.__class__.__name__, # 'columns': obj.columns} # for f in ['default_fill_value', 'default_kind']: # d[f] = getattr(obj, f, None) # d['data'] = dict([(name, ss) # for name, ss in compat.iteritems(obj)]) # return d else: data = obj._data if not data.is_consolidated(): data = data.consolidate() # the block manager return {u'typ': u'block_manager', u'klass': u(obj.__class__.__name__), u'axes': data.axes, u'blocks': [{u'locs': b.mgr_locs.as_array, u'values': convert(b.values), u'shape': b.values.shape, u'dtype': u(b.dtype.name), u'klass': u(b.__class__.__name__), u'compress': compressor} for b in data.blocks] } elif isinstance(obj, (datetime, date, np.datetime64, timedelta, np.timedelta64, NaTType)): if isinstance(obj, Timestamp): tz = obj.tzinfo if tz is not None: tz = u(tz.zone) freq = obj.freq if freq is not None: freq = u(freq.freqstr) return {u'typ': u'timestamp', u'value': obj.value, u'freq': freq, u'tz': tz} if isinstance(obj, NaTType): return {u'typ': u'nat'} elif isinstance(obj, np.timedelta64): return {u'typ': u'timedelta64', u'data': obj.view('i8')} elif isinstance(obj, timedelta): return {u'typ': u'timedelta', u'data': (obj.days, obj.seconds, obj.microseconds)} elif isinstance(obj, np.datetime64): return {u'typ': u'datetime64', u'data': u(str(obj))} elif isinstance(obj, datetime): return {u'typ': u'datetime', u'data': u(obj.isoformat())} elif isinstance(obj, date): return {u'typ': u'date', u'data': u(obj.isoformat())} raise Exception("cannot encode this datetimelike object: %s" % obj) elif isinstance(obj, Period): return {u'typ': u'period', u'ordinal': obj.ordinal, u'freq': u(obj.freq)} elif isinstance(obj, BlockIndex): return {u'typ': u'block_index', u'klass': u(obj.__class__.__name__), u'blocs': obj.blocs, u'blengths': obj.blengths, u'length': obj.length} elif isinstance(obj, IntIndex): return {u'typ': u'int_index', u'klass': u(obj.__class__.__name__), u'indices': obj.indices, u'length': obj.length} elif isinstance(obj, np.ndarray): return {u'typ': u'ndarray', u'shape': obj.shape, u'ndim': obj.ndim, u'dtype': u(obj.dtype.name), u'data': convert(obj), u'compress': compressor} elif isinstance(obj, np.number): if np.iscomplexobj(obj): return {u'typ': u'np_scalar', u'sub_typ': u'np_complex', u'dtype': u(obj.dtype.name), u'real': u(obj.real.__repr__()), u'imag': u(obj.imag.__repr__())} else: return {u'typ': u'np_scalar', u'dtype': u(obj.dtype.name), u'data': u(obj.__repr__())} elif isinstance(obj, complex): return {u'typ': u'np_complex', u'real': u(obj.real.__repr__()), u'imag': u(obj.imag.__repr__())} return obj def decode(obj): """ Decoder for deserializing numpy data types. """ typ = obj.get(u'typ') if typ is None: return obj elif typ == u'timestamp': freq = obj[u'freq'] if 'freq' in obj else obj[u'offset'] return Timestamp(obj[u'value'], tz=obj[u'tz'], freq=freq) elif typ == u'nat': return NaT elif typ == u'period': return Period(ordinal=obj[u'ordinal'], freq=obj[u'freq']) elif typ == u'index': dtype = dtype_for(obj[u'dtype']) data = unconvert(obj[u'data'], dtype, obj.get(u'compress')) return globals()[obj[u'klass']](data, dtype=dtype, name=obj[u'name']) elif typ == u'range_index': return globals()[obj[u'klass']](obj[u'start'], obj[u'stop'], obj[u'step'], name=obj[u'name']) elif typ == u'multi_index': dtype = dtype_for(obj[u'dtype']) data = unconvert(obj[u'data'], dtype, obj.get(u'compress')) data = [tuple(x) for x in data] return globals()[obj[u'klass']].from_tuples(data, names=obj[u'names']) elif typ == u'period_index': data = unconvert(obj[u'data'], np.int64, obj.get(u'compress')) d = dict(name=obj[u'name'], freq=obj[u'freq']) return globals()[obj[u'klass']]._from_ordinals(data, **d) elif typ == u'datetime_index': data = unconvert(obj[u'data'], np.int64, obj.get(u'compress')) d = dict(name=obj[u'name'], freq=obj[u'freq'], verify_integrity=False) result = globals()[obj[u'klass']](data, **d) tz = obj[u'tz'] # reverse tz conversion if tz is not None: result = result.tz_localize('UTC').tz_convert(tz) return result elif typ == u'category': from_codes = globals()[obj[u'klass']].from_codes return from_codes(codes=obj[u'codes'], categories=obj[u'categories'], ordered=obj[u'ordered']) elif typ == u'series': dtype = dtype_for(obj[u'dtype']) pd_dtype = pandas_dtype(dtype) index = obj[u'index'] result = globals()[obj[u'klass']](unconvert(obj[u'data'], dtype, obj[u'compress']), index=index, dtype=pd_dtype, name=obj[u'name']) return result elif typ == u'block_manager': axes = obj[u'axes'] def create_block(b): values = _safe_reshape(unconvert( b[u'values'], dtype_for(b[u'dtype']), b[u'compress']), b[u'shape']) # locs handles duplicate column names, and should be used instead # of items; see GH 9618 if u'locs' in b: placement = b[u'locs'] else: placement = axes[0].get_indexer(b[u'items']) return make_block(values=values, klass=getattr(internals, b[u'klass']), placement=placement, dtype=b[u'dtype']) blocks = [create_block(b) for b in obj[u'blocks']] return globals()[obj[u'klass']](BlockManager(blocks, axes)) elif typ == u'datetime': return parse(obj[u'data']) elif typ == u'datetime64': return np.datetime64(parse(obj[u'data'])) elif typ == u'date': return parse(obj[u'data']).date() elif typ == u'timedelta': return timedelta(*obj[u'data']) elif typ == u'timedelta64': return np.timedelta64(int(obj[u'data'])) # elif typ == 'sparse_series': # dtype = dtype_for(obj['dtype']) # return globals()[obj['klass']]( # unconvert(obj['sp_values'], dtype, obj['compress']), # sparse_index=obj['sp_index'], index=obj['index'], # fill_value=obj['fill_value'], kind=obj['kind'], name=obj['name']) # elif typ == 'sparse_dataframe': # return globals()[obj['klass']]( # obj['data'], columns=obj['columns'], # default_fill_value=obj['default_fill_value'], # default_kind=obj['default_kind'] # ) # elif typ == 'sparse_panel': # return globals()[obj['klass']]( # obj['data'], items=obj['items'], # default_fill_value=obj['default_fill_value'], # default_kind=obj['default_kind']) elif typ == u'block_index': return globals()[obj[u'klass']](obj[u'length'], obj[u'blocs'], obj[u'blengths']) elif typ == u'int_index': return globals()[obj[u'klass']](obj[u'length'], obj[u'indices']) elif typ == u'ndarray': return unconvert(obj[u'data'], np.typeDict[obj[u'dtype']], obj.get(u'compress')).reshape(obj[u'shape']) elif typ == u'np_scalar': if obj.get(u'sub_typ') == u'np_complex': return c2f(obj[u'real'], obj[u'imag'], obj[u'dtype']) else: dtype = dtype_for(obj[u'dtype']) try: return dtype(obj[u'data']) except: return dtype.type(obj[u'data']) elif typ == u'np_complex': return complex(obj[u'real'] + u'+' + obj[u'imag'] + u'j') elif isinstance(obj, (dict, list, set)): return obj else: return obj def pack(o, default=encode, encoding='utf-8', unicode_errors='strict', use_single_float=False, autoreset=1, use_bin_type=1): """ Pack an object and return the packed bytes. """ return Packer(default=default, encoding=encoding, unicode_errors=unicode_errors, use_single_float=use_single_float, autoreset=autoreset, use_bin_type=use_bin_type).pack(o) def unpack(packed, object_hook=decode, list_hook=None, use_list=False, encoding='utf-8', unicode_errors='strict', object_pairs_hook=None, max_buffer_size=0, ext_hook=ExtType): """ Unpack a packed object, return an iterator Note: packed lists will be returned as tuples """ return Unpacker(packed, object_hook=object_hook, list_hook=list_hook, use_list=use_list, encoding=encoding, unicode_errors=unicode_errors, object_pairs_hook=object_pairs_hook, max_buffer_size=max_buffer_size, ext_hook=ext_hook) class Packer(_Packer): def __init__(self, default=encode, encoding='utf-8', unicode_errors='strict', use_single_float=False, autoreset=1, use_bin_type=1): super(Packer, self).__init__(default=default, encoding=encoding, unicode_errors=unicode_errors, use_single_float=use_single_float, autoreset=autoreset, use_bin_type=use_bin_type) class Unpacker(_Unpacker): def __init__(self, file_like=None, read_size=0, use_list=False, object_hook=decode, object_pairs_hook=None, list_hook=None, encoding='utf-8', unicode_errors='strict', max_buffer_size=0, ext_hook=ExtType): super(Unpacker, self).__init__(file_like=file_like, read_size=read_size, use_list=use_list, object_hook=object_hook, object_pairs_hook=object_pairs_hook, list_hook=list_hook, encoding=encoding, unicode_errors=unicode_errors, max_buffer_size=max_buffer_size, ext_hook=ext_hook) class Iterator(object): """ manage the unpacking iteration, close the file on completion """ def __init__(self, path, **kwargs): self.path = path self.kwargs = kwargs def __iter__(self): needs_closing = True try: # see if we have an actual file if isinstance(self.path, compat.string_types): try: path_exists = os.path.exists(self.path) except TypeError: path_exists = False if path_exists: fh = open(self.path, 'rb') else: fh = compat.BytesIO(self.path) else: if not hasattr(self.path, 'read'): fh = compat.BytesIO(self.path) else: # a file-like needs_closing = False fh = self.path unpacker = unpack(fh) for o in unpacker: yield o finally: if needs_closing: fh.close()
bsd-3-clause
ajerneck/thatsfordinner
frontend/app/tmp.py
1
2982
import collections import psycopg2 import numpy as np import pandas as pd from sqlalchemy import create_engine engine = create_engine("postgresql+psycopg2://explore:Ln2bOYAVCG6utNUSaSZaIVMH@localhost/explore") #con = psycopg2.connect(host='localhost', dbname='explore', user='explore', password='Ln2bOYAVCG6utNUSaSZaIVMH') ww = pd.read_sql_table('all_word_probs', engine) xx = ww.sort(['label','prob']).groupby('label').tail(20) ## get the 10 most probable within each group. ws = xx[xx['label']==0]['word'].values ## loop over words, filter out those that are in other bigsams wss = [w.split() for w in ws] bs = [] us = [] for w in wss: if len(w) > 1: bs.append(w) else: us.append(w) keep = [] for u in us: hits = [b for b in bs if u[0] in b] if hits == []: keep.append(u) ## this works. keep = [] for w in itertools.chain(*wss): print w if w not in keep: keep.append(w) ## TODO: sum up the probabilities: ## do nlp on words to identify nouns. ## do decorate, sort, undecorate for row in ws.values.tolist(): print row words = row[0].split() prob = row[1] for w in words: ks[w] += prob k = collections.defaultdict(float) for w in itertools(*wss): k[w] += k = dict.fromkeys(itertools.chain(*wss), 0) x = {} import itertools dict.fromkeys(itertools.chain(*wss)) ws = xx[xx['label']==0][['word','prob']] ws['word'].values ws['word'].values wss bs = [w for w in wss if len(w)>1] for w in ws: if use 'low' in 'low chicken' # cur = con.cursor() # cur.execute('select * from all_word_probs order by label') # ww = cur.fetchall() gen_recipes = collections.defaultdict(list) for topic, group in ww.groupby('label'): # print topic # print [(np.random.choice(group['word'], size=5, p=group['prob'])) for _ in range(0,2)] x = [np.random.choice(group['word'], size=5, p=group['prob']).tolist() for i in range(0, 2)] gen_recipes[topic] += [map(lambda i: ', '.join(i), x)] print gen_recipes ## extract most probable words for each topic. cur.execute('SELECT * FROM word_probs order by topic, prob desc;') word_probs = cur.fetchall() word_data = collections.defaultdict(list) for row in word_probs: word_data[row[2]] += [row[3]] for k,v in word_data.items(): word_data[k] = ', '.join(v) ## extract most probable documents for each topic. cur.execute("SELECT doc_prob.topic, ingredient_txt, image, url, clean_recipes.title, prob FROM doc_prob, clean_recipes WHERE doc_prob.recipe_key=clean_recipes.key ORDER BY topic, rank;") doc_probs = cur.fetchall() doc_data = collections.defaultdict(list) for row in doc_probs: doc_data[row[0]] += [{'ingredient': row[1], 'image':row[2], 'url':row[3], 'title':row[4]}] topics = doc_data.keys() ## TODO: # extract max topic assignment for each topic ## cur.execute('SELECT topic, ingredient_txt, image, url, title') ## topic_docs = topic_data = collections.defaultdict(dict)
bsd-3-clause
vortex-ape/scikit-learn
sklearn/kernel_ridge.py
12
7382
"""Module :mod:`sklearn.kernel_ridge` implements kernel ridge regression.""" # Authors: Mathieu Blondel <[email protected]> # Jan Hendrik Metzen <[email protected]> # License: BSD 3 clause import numpy as np from .base import BaseEstimator, RegressorMixin from .metrics.pairwise import pairwise_kernels from .linear_model.ridge import _solve_cholesky_kernel from .utils import check_array, check_X_y from .utils.validation import check_is_fitted class KernelRidge(BaseEstimator, RegressorMixin): """Kernel ridge regression. Kernel ridge regression (KRR) combines ridge regression (linear least squares with l2-norm regularization) with the kernel trick. It thus learns a linear function in the space induced by the respective kernel and the data. For non-linear kernels, this corresponds to a non-linear function in the original space. The form of the model learned by KRR is identical to support vector regression (SVR). However, different loss functions are used: KRR uses squared error loss while support vector regression uses epsilon-insensitive loss, both combined with l2 regularization. In contrast to SVR, fitting a KRR model can be done in closed-form and is typically faster for medium-sized datasets. On the other hand, the learned model is non-sparse and thus slower than SVR, which learns a sparse model for epsilon > 0, at prediction-time. This estimator has built-in support for multi-variate regression (i.e., when y is a 2d-array of shape [n_samples, n_targets]). Read more in the :ref:`User Guide <kernel_ridge>`. Parameters ---------- alpha : {float, array-like}, shape = [n_targets] Small positive values of alpha improve the conditioning of the problem and reduce the variance of the estimates. Alpha corresponds to ``(2*C)^-1`` in other linear models such as LogisticRegression or LinearSVC. If an array is passed, penalties are assumed to be specific to the targets. Hence they must correspond in number. kernel : string or callable, default="linear" Kernel mapping used internally. A callable should accept two arguments and the keyword arguments passed to this object as kernel_params, and should return a floating point number. Set to "precomputed" in order to pass a precomputed kernel matrix to the estimator methods instead of samples. gamma : float, default=None Gamma parameter for the RBF, laplacian, polynomial, exponential chi2 and sigmoid kernels. Interpretation of the default value is left to the kernel; see the documentation for sklearn.metrics.pairwise. Ignored by other kernels. degree : float, default=3 Degree of the polynomial kernel. Ignored by other kernels. coef0 : float, default=1 Zero coefficient for polynomial and sigmoid kernels. Ignored by other kernels. kernel_params : mapping of string to any, optional Additional parameters (keyword arguments) for kernel function passed as callable object. Attributes ---------- dual_coef_ : array, shape = [n_samples] or [n_samples, n_targets] Representation of weight vector(s) in kernel space X_fit_ : {array-like, sparse matrix}, shape = [n_samples, n_features] Training data, which is also required for prediction. If kernel == "precomputed" this is instead the precomputed training matrix, shape = [n_samples, n_samples]. References ---------- * Kevin P. Murphy "Machine Learning: A Probabilistic Perspective", The MIT Press chapter 14.4.3, pp. 492-493 See also -------- sklearn.linear_model.Ridge: Linear ridge regression. sklearn.svm.SVR: Support Vector Regression implemented using libsvm. Examples -------- >>> from sklearn.kernel_ridge import KernelRidge >>> import numpy as np >>> n_samples, n_features = 10, 5 >>> rng = np.random.RandomState(0) >>> y = rng.randn(n_samples) >>> X = rng.randn(n_samples, n_features) >>> clf = KernelRidge(alpha=1.0) >>> clf.fit(X, y) # doctest: +NORMALIZE_WHITESPACE KernelRidge(alpha=1.0, coef0=1, degree=3, gamma=None, kernel='linear', kernel_params=None) """ def __init__(self, alpha=1, kernel="linear", gamma=None, degree=3, coef0=1, kernel_params=None): self.alpha = alpha self.kernel = kernel self.gamma = gamma self.degree = degree self.coef0 = coef0 self.kernel_params = kernel_params def _get_kernel(self, X, Y=None): if callable(self.kernel): params = self.kernel_params or {} else: params = {"gamma": self.gamma, "degree": self.degree, "coef0": self.coef0} return pairwise_kernels(X, Y, metric=self.kernel, filter_params=True, **params) @property def _pairwise(self): return self.kernel == "precomputed" def fit(self, X, y=None, sample_weight=None): """Fit Kernel Ridge regression model Parameters ---------- X : {array-like, sparse matrix}, shape = [n_samples, n_features] Training data. If kernel == "precomputed" this is instead a precomputed kernel matrix, shape = [n_samples, n_samples]. y : array-like, shape = [n_samples] or [n_samples, n_targets] Target values sample_weight : float or array-like of shape [n_samples] Individual weights for each sample, ignored if None is passed. Returns ------- self : returns an instance of self. """ # Convert data X, y = check_X_y(X, y, accept_sparse=("csr", "csc"), multi_output=True, y_numeric=True) if sample_weight is not None and not isinstance(sample_weight, float): sample_weight = check_array(sample_weight, ensure_2d=False) K = self._get_kernel(X) alpha = np.atleast_1d(self.alpha) ravel = False if len(y.shape) == 1: y = y.reshape(-1, 1) ravel = True copy = self.kernel == "precomputed" self.dual_coef_ = _solve_cholesky_kernel(K, y, alpha, sample_weight, copy) if ravel: self.dual_coef_ = self.dual_coef_.ravel() self.X_fit_ = X return self def predict(self, X): """Predict using the kernel ridge model Parameters ---------- X : {array-like, sparse matrix}, shape = [n_samples, n_features] Samples. If kernel == "precomputed" this is instead a precomputed kernel matrix, shape = [n_samples, n_samples_fitted], where n_samples_fitted is the number of samples used in the fitting for this estimator. Returns ------- C : array, shape = [n_samples] or [n_samples, n_targets] Returns predicted values. """ check_is_fitted(self, ["X_fit_", "dual_coef_"]) K = self._get_kernel(X, self.X_fit_) return np.dot(K, self.dual_coef_)
bsd-3-clause
equialgo/scikit-learn
sklearn/setup.py
69
3201
import os from os.path import join import warnings from sklearn._build_utils import maybe_cythonize_extensions def configuration(parent_package='', top_path=None): from numpy.distutils.misc_util import Configuration from numpy.distutils.system_info import get_info, BlasNotFoundError import numpy libraries = [] if os.name == 'posix': libraries.append('m') config = Configuration('sklearn', parent_package, top_path) # submodules with build utilities config.add_subpackage('__check_build') config.add_subpackage('_build_utils') # submodules which do not have their own setup.py # we must manually add sub-submodules & tests config.add_subpackage('covariance') config.add_subpackage('covariance/tests') config.add_subpackage('cross_decomposition') config.add_subpackage('cross_decomposition/tests') config.add_subpackage('feature_selection') config.add_subpackage('feature_selection/tests') config.add_subpackage('gaussian_process') config.add_subpackage('gaussian_process/tests') config.add_subpackage('mixture') config.add_subpackage('mixture/tests') config.add_subpackage('model_selection') config.add_subpackage('model_selection/tests') config.add_subpackage('neural_network') config.add_subpackage('neural_network/tests') config.add_subpackage('preprocessing') config.add_subpackage('preprocessing/tests') config.add_subpackage('semi_supervised') config.add_subpackage('semi_supervised/tests') # submodules which have their own setup.py # leave out "linear_model" and "utils" for now; add them after cblas below config.add_subpackage('cluster') config.add_subpackage('datasets') config.add_subpackage('decomposition') config.add_subpackage('ensemble') config.add_subpackage('externals') config.add_subpackage('feature_extraction') config.add_subpackage('manifold') config.add_subpackage('metrics') config.add_subpackage('metrics/cluster') config.add_subpackage('neighbors') config.add_subpackage('tree') config.add_subpackage('svm') # add cython extension module for isotonic regression config.add_extension('_isotonic', sources=['_isotonic.pyx'], include_dirs=[numpy.get_include()], libraries=libraries, ) # some libs needs cblas, fortran-compiled BLAS will not be sufficient blas_info = get_info('blas_opt', 0) if (not blas_info) or ( ('NO_ATLAS_INFO', 1) in blas_info.get('define_macros', [])): config.add_library('cblas', sources=[join('src', 'cblas', '*.c')]) warnings.warn(BlasNotFoundError.__doc__) # the following packages depend on cblas, so they have to be build # after the above. config.add_subpackage('linear_model') config.add_subpackage('utils') # add the test directory config.add_subpackage('tests') maybe_cythonize_extensions(top_path, config) return config if __name__ == '__main__': from numpy.distutils.core import setup setup(**configuration(top_path='').todict())
bsd-3-clause
Windy-Ground/scikit-learn
examples/linear_model/plot_multi_task_lasso_support.py
249
2211
#!/usr/bin/env python """ ============================================= Joint feature selection with multi-task Lasso ============================================= The multi-task lasso allows to fit multiple regression problems jointly enforcing the selected features to be the same across tasks. This example simulates sequential measurements, each task is a time instant, and the relevant features vary in amplitude over time while being the same. The multi-task lasso imposes that features that are selected at one time point are select for all time point. This makes feature selection by the Lasso more stable. """ print(__doc__) # Author: Alexandre Gramfort <[email protected]> # License: BSD 3 clause import matplotlib.pyplot as plt import numpy as np from sklearn.linear_model import MultiTaskLasso, Lasso rng = np.random.RandomState(42) # Generate some 2D coefficients with sine waves with random frequency and phase n_samples, n_features, n_tasks = 100, 30, 40 n_relevant_features = 5 coef = np.zeros((n_tasks, n_features)) times = np.linspace(0, 2 * np.pi, n_tasks) for k in range(n_relevant_features): coef[:, k] = np.sin((1. + rng.randn(1)) * times + 3 * rng.randn(1)) X = rng.randn(n_samples, n_features) Y = np.dot(X, coef.T) + rng.randn(n_samples, n_tasks) coef_lasso_ = np.array([Lasso(alpha=0.5).fit(X, y).coef_ for y in Y.T]) coef_multi_task_lasso_ = MultiTaskLasso(alpha=1.).fit(X, Y).coef_ ############################################################################### # Plot support and time series fig = plt.figure(figsize=(8, 5)) plt.subplot(1, 2, 1) plt.spy(coef_lasso_) plt.xlabel('Feature') plt.ylabel('Time (or Task)') plt.text(10, 5, 'Lasso') plt.subplot(1, 2, 2) plt.spy(coef_multi_task_lasso_) plt.xlabel('Feature') plt.ylabel('Time (or Task)') plt.text(10, 5, 'MultiTaskLasso') fig.suptitle('Coefficient non-zero location') feature_to_plot = 0 plt.figure() plt.plot(coef[:, feature_to_plot], 'k', label='Ground truth') plt.plot(coef_lasso_[:, feature_to_plot], 'g', label='Lasso') plt.plot(coef_multi_task_lasso_[:, feature_to_plot], 'r', label='MultiTaskLasso') plt.legend(loc='upper center') plt.axis('tight') plt.ylim([-1.1, 1.1]) plt.show()
bsd-3-clause
466152112/scikit-learn
examples/ensemble/plot_adaboost_regression.py
311
1529
""" ====================================== Decision Tree Regression with AdaBoost ====================================== A decision tree is boosted using the AdaBoost.R2 [1] algorithm on a 1D sinusoidal dataset with a small amount of Gaussian noise. 299 boosts (300 decision trees) is compared with a single decision tree regressor. As the number of boosts is increased the regressor can fit more detail. .. [1] H. Drucker, "Improving Regressors using Boosting Techniques", 1997. """ print(__doc__) # Author: Noel Dawe <[email protected]> # # License: BSD 3 clause # importing necessary libraries import numpy as np import matplotlib.pyplot as plt from sklearn.tree import DecisionTreeRegressor from sklearn.ensemble import AdaBoostRegressor # Create the dataset rng = np.random.RandomState(1) X = np.linspace(0, 6, 100)[:, np.newaxis] y = np.sin(X).ravel() + np.sin(6 * X).ravel() + rng.normal(0, 0.1, X.shape[0]) # Fit regression model regr_1 = DecisionTreeRegressor(max_depth=4) regr_2 = AdaBoostRegressor(DecisionTreeRegressor(max_depth=4), n_estimators=300, random_state=rng) regr_1.fit(X, y) regr_2.fit(X, y) # Predict y_1 = regr_1.predict(X) y_2 = regr_2.predict(X) # Plot the results plt.figure() plt.scatter(X, y, c="k", label="training samples") plt.plot(X, y_1, c="g", label="n_estimators=1", linewidth=2) plt.plot(X, y_2, c="r", label="n_estimators=300", linewidth=2) plt.xlabel("data") plt.ylabel("target") plt.title("Boosted Decision Tree Regression") plt.legend() plt.show()
bsd-3-clause
alperyeg/elephant
elephant/current_source_density_src/icsd.py
9
35175
# -*- coding: utf-8 -*- ''' py-iCSD toolbox! Translation of the core functionality of the CSDplotter MATLAB package to python. The methods were originally developed by Klas H. Pettersen, as described in: Klas H. Pettersen, Anna Devor, Istvan Ulbert, Anders M. Dale, Gaute T. Einevoll, Current-source density estimation based on inversion of electrostatic forward solution: Effects of finite extent of neuronal activity and conductivity discontinuities, Journal of Neuroscience Methods, Volume 154, Issues 1-2, 30 June 2006, Pages 116-133, ISSN 0165-0270, http://dx.doi.org/10.1016/j.jneumeth.2005.12.005. (http://www.sciencedirect.com/science/article/pii/S0165027005004541) The method themselves are implemented as callable subclasses of the base CSD class object, which sets some common attributes, and a basic function for calculating the iCSD, and a generic spatial filter implementation. The raw- and filtered CSD estimates are returned as Quantity arrays. Requires pylab environment to work, i.e numpy+scipy+matplotlib, with the addition of quantities (http://pythonhosted.org/quantities) and neo (https://pythonhosted.org/neo)- Original implementation from CSDplotter-0.1.1 (http://software.incf.org/software/csdplotter) by Klas. H. Pettersen 2005. Written by: - [email protected], 2010, - [email protected], 2015-2016 ''' import numpy as np import scipy.integrate as si import scipy.signal as ss import quantities as pq class CSD(object): '''Base iCSD class''' def __init__(self, lfp, f_type='gaussian', f_order=(3, 1)): '''Initialize parent class iCSD Parameters ---------- lfp : np.ndarray * quantity.Quantity LFP signal of shape (# channels, # time steps) f_type : str type of spatial filter, must be a scipy.signal filter design method f_order : list settings for spatial filter, arg passed to filter design function ''' self.name = 'CSD estimate parent class' self.lfp = lfp self.f_matrix = np.eye(lfp.shape[0]) * pq.m**3 / pq.S self.f_type = f_type self.f_order = f_order def get_csd(self, ): ''' Perform the CSD estimate from the LFP and forward matrix F, i.e as CSD=F**-1*LFP Arguments --------- Returns ------- csd : np.ndarray * quantity.Quantity Array with the csd estimate ''' csd = np.linalg.solve(self.f_matrix, self.lfp) return csd * (self.f_matrix.units**-1 * self.lfp.units).simplified def filter_csd(self, csd, filterfunction='convolve'): ''' Spatial filtering of the CSD estimate, using an N-point filter Arguments --------- csd : np.ndarrray * quantity.Quantity Array with the csd estimate filterfunction : str 'filtfilt' or 'convolve'. Apply spatial filter using scipy.signal.filtfilt or scipy.signal.convolve. ''' if self.f_type == 'gaussian': try: assert(len(self.f_order) == 2) except AssertionError as ae: raise ae('filter order f_order must be a tuple of length 2') else: try: assert(self.f_order > 0 and isinstance(self.f_order, int)) except AssertionError as ae: raise ae('Filter order must be int > 0!') try: assert(filterfunction in ['filtfilt', 'convolve']) except AssertionError as ae: raise ae("{} not equal to 'filtfilt' or \ 'convolve'".format(filterfunction)) if self.f_type == 'boxcar': num = ss.boxcar(self.f_order) denom = np.array([num.sum()]) elif self.f_type == 'hamming': num = ss.hamming(self.f_order) denom = np.array([num.sum()]) elif self.f_type == 'triangular': num = ss.triang(self.f_order) denom = np.array([num.sum()]) elif self.f_type == 'gaussian': num = ss.gaussian(self.f_order[0], self.f_order[1]) denom = np.array([num.sum()]) elif self.f_type == 'identity': num = np.array([1.]) denom = np.array([1.]) else: print('%s Wrong filter type!' % self.f_type) raise num_string = '[ ' for i in num: num_string = num_string + '%.3f ' % i num_string = num_string + ']' denom_string = '[ ' for i in denom: denom_string = denom_string + '%.3f ' % i denom_string = denom_string + ']' print(('discrete filter coefficients: \nb = {}, \ \na = {}'.format(num_string, denom_string))) if filterfunction == 'filtfilt': return ss.filtfilt(num, denom, csd, axis=0) * csd.units elif filterfunction == 'convolve': csdf = csd / csd.units for i in range(csdf.shape[1]): csdf[:, i] = ss.convolve(csdf[:, i], num / denom.sum(), 'same') return csdf * csd.units class StandardCSD(CSD): ''' Standard CSD method with and without Vaknin electrodes ''' def __init__(self, lfp, coord_electrode, **kwargs): ''' Initialize standard CSD method class with & without Vaknin electrodes. Parameters ---------- lfp : np.ndarray * quantity.Quantity LFP signal of shape (# channels, # time steps) in units of V coord_electrode : np.ndarray * quantity.Quantity depth of evenly spaced electrode contact points of shape (# contacts, ) in units of m, must be monotonously increasing sigma : float * quantity.Quantity conductivity of tissue in units of S/m or 1/(ohm*m) Defaults to 0.3 S/m vaknin_el : bool flag for using method of Vaknin to endpoint electrodes Defaults to True f_type : str type of spatial filter, must be a scipy.signal filter design method Defaults to 'gaussian' f_order : list settings for spatial filter, arg passed to filter design function Defaults to (3,1) for the gaussian ''' self.parameters(**kwargs) CSD.__init__(self, lfp, self.f_type, self.f_order) diff_diff_coord = np.diff(np.diff(coord_electrode)).magnitude zeros_ddc = np.zeros_like(diff_diff_coord) try: assert(np.all(np.isclose(diff_diff_coord, zeros_ddc, atol=1e-12))) except AssertionError as ae: print('coord_electrode not monotonously varying') raise ae if self.vaknin_el: # extend lfps array by duplicating potential at endpoint contacts if lfp.ndim == 1: self.lfp = np.empty((lfp.shape[0] + 2, )) * lfp.units else: self.lfp = np.empty((lfp.shape[0] + 2, lfp.shape[1])) * lfp.units self.lfp[0, ] = lfp[0, ] self.lfp[1:-1, ] = lfp self.lfp[-1, ] = lfp[-1, ] else: self.lfp = lfp self.name = 'Standard CSD method' self.coord_electrode = coord_electrode self.f_inv_matrix = self.get_f_inv_matrix() def parameters(self, **kwargs): '''Defining the default values of the method passed as kwargs Parameters ---------- **kwargs Same as those passed to initialize the Class ''' self.sigma = kwargs.pop('sigma', 0.3 * pq.S / pq.m) self.vaknin_el = kwargs.pop('vaknin_el', True) self.f_type = kwargs.pop('f_type', 'gaussian') self.f_order = kwargs.pop('f_order', (3, 1)) if kwargs: raise TypeError('Invalid keyword arguments:', kwargs.keys()) def get_f_inv_matrix(self): '''Calculate the inverse F-matrix for the standard CSD method''' h_val = abs(np.diff(self.coord_electrode)[0]) f_inv = -np.eye(self.lfp.shape[0]) # Inner matrix elements is just the discrete laplacian coefficients for j in range(1, f_inv.shape[0] - 1): f_inv[j, j - 1: j + 2] = np.array([1., -2., 1.]) return f_inv * -self.sigma / h_val def get_csd(self): ''' Perform the iCSD calculation, i.e: iCSD=F_inv*LFP Returns ------- csd : np.ndarray * quantity.Quantity Array with the csd estimate ''' csd = np.dot(self.f_inv_matrix, self.lfp)[1:-1, ] # `np.dot()` does not return correct units, so the units of `csd` must # be assigned manually csd_units = (self.f_inv_matrix.units * self.lfp.units).simplified csd = csd.magnitude * csd_units return csd class DeltaiCSD(CSD): ''' delta-iCSD method ''' def __init__(self, lfp, coord_electrode, **kwargs): ''' Initialize the delta-iCSD method class object Parameters ---------- lfp : np.ndarray * quantity.Quantity LFP signal of shape (# channels, # time steps) in units of V coord_electrode : np.ndarray * quantity.Quantity depth of evenly spaced electrode contact points of shape (# contacts, ) in units of m diam : float * quantity.Quantity diamater of the assumed circular planar current sources centered at each contact Defaults to 500E-6 meters sigma : float * quantity.Quantity conductivity of tissue in units of S/m or 1/(ohm*m) Defaults to 0.3 S / m sigma_top : float * quantity.Quantity conductivity on top of tissue in units of S/m or 1/(ohm*m) Defaults to 0.3 S / m f_type : str type of spatial filter, must be a scipy.signal filter design method Defaults to 'gaussian' f_order : list settings for spatial filter, arg passed to filter design function Defaults to (3,1) for gaussian ''' self.parameters(**kwargs) CSD.__init__(self, lfp, self.f_type, self.f_order) try: # Should the class not take care of this?! assert(self.diam.units == coord_electrode.units) except AssertionError as ae: print('units of coord_electrode ({}) and diam ({}) differ' .format(coord_electrode.units, self.diam.units)) raise ae try: assert(np.all(np.diff(coord_electrode) > 0)) except AssertionError as ae: print('values of coord_electrode not continously increasing') raise ae try: assert(self.diam.size == 1 or self.diam.size == coord_electrode.size) if self.diam.size == coord_electrode.size: assert(np.all(self.diam > 0 * self.diam.units)) else: assert(self.diam > 0 * self.diam.units) except AssertionError as ae: print('diam must be positive scalar or of same shape \ as coord_electrode') raise ae if self.diam.size == 1: self.diam = np.ones(coord_electrode.size) * self.diam self.name = 'delta-iCSD method' self.coord_electrode = coord_electrode # initialize F- and iCSD-matrices self.f_matrix = np.empty((self.coord_electrode.size, self.coord_electrode.size)) self.f_matrix = self.get_f_matrix() def parameters(self, **kwargs): '''Defining the default values of the method passed as kwargs Parameters ---------- **kwargs Same as those passed to initialize the Class ''' self.diam = kwargs.pop('diam', 500E-6 * pq.m) self.sigma = kwargs.pop('sigma', 0.3 * pq.S / pq.m) self.sigma_top = kwargs.pop('sigma_top', 0.3 * pq.S / pq.m) self.f_type = kwargs.pop('f_type', 'gaussian') self.f_order = kwargs.pop('f_order', (3, 1)) if kwargs: raise TypeError('Invalid keyword arguments:', kwargs.keys()) def get_f_matrix(self): '''Calculate the F-matrix''' f_matrix = np.empty((self.coord_electrode.size, self.coord_electrode.size)) * self.coord_electrode.units for j in range(self.coord_electrode.size): for i in range(self.coord_electrode.size): f_matrix[j, i] = ((np.sqrt((self.coord_electrode[j] - self.coord_electrode[i])**2 + (self.diam[j] / 2)**2) - abs(self.coord_electrode[j] - self.coord_electrode[i])) + (self.sigma - self.sigma_top) / (self.sigma + self.sigma_top) * (np.sqrt((self.coord_electrode[j] + self.coord_electrode[i])**2 + (self.diam[j] / 2)**2)- abs(self.coord_electrode[j] + self.coord_electrode[i]))) f_matrix /= (2 * self.sigma) return f_matrix class StepiCSD(CSD): '''step-iCSD method''' def __init__(self, lfp, coord_electrode, **kwargs): ''' Initializing step-iCSD method class object Parameters ---------- lfp : np.ndarray * quantity.Quantity LFP signal of shape (# channels, # time steps) in units of V coord_electrode : np.ndarray * quantity.Quantity depth of evenly spaced electrode contact points of shape (# contacts, ) in units of m diam : float or np.ndarray * quantity.Quantity diameter(s) of the assumed circular planar current sources centered at each contact Defaults to 500E-6 meters h : float or np.ndarray * quantity.Quantity assumed thickness of the source cylinders at all or each contact Defaults to np.ones(15) * 100E-6 * pq.m sigma : float * quantity.Quantity conductivity of tissue in units of S/m or 1/(ohm*m) Defaults to 0.3 S / m sigma_top : float * quantity.Quantity conductivity on top of tissue in units of S/m or 1/(ohm*m) Defaults to 0.3 S / m tol : float tolerance of numerical integration Defaults 1e-6 f_type : str type of spatial filter, must be a scipy.signal filter design method Defaults to 'gaussian' f_order : list settings for spatial filter, arg passed to filter design function Defaults to (3,1) for the gaussian ''' self.parameters(**kwargs) CSD.__init__(self, lfp, self.f_type, self.f_order) try: # Should the class not take care of this? assert(self.diam.units == coord_electrode.units) except AssertionError as ae: print('units of coord_electrode ({}) and diam ({}) differ' .format(coord_electrode.units, self.diam.units)) raise ae try: assert(np.all(np.diff(coord_electrode) > 0)) except AssertionError as ae: print('values of coord_electrode not continously increasing') raise ae try: assert(self.diam.size == 1 or self.diam.size == coord_electrode.size) if self.diam.size == coord_electrode.size: assert(np.all(self.diam > 0 * self.diam.units)) else: assert(self.diam > 0 * self.diam.units) except AssertionError as ae: print('diam must be positive scalar or of same shape \ as coord_electrode') raise ae if self.diam.size == 1: self.diam = np.ones(coord_electrode.size) * self.diam try: assert(self.h.size == 1 or self.h.size == coord_electrode.size) if self.h.size == coord_electrode.size: assert(np.all(self.h > 0 * self.h.units)) except AssertionError as ae: print('h must be scalar or of same shape as coord_electrode') raise ae if self.h.size == 1: self.h = np.ones(coord_electrode.size) * self.h self.name = 'step-iCSD method' self.coord_electrode = coord_electrode # compute forward-solution matrix self.f_matrix = self.get_f_matrix() def parameters(self, **kwargs): '''Defining the default values of the method passed as kwargs Parameters ---------- **kwargs Same as those passed to initialize the Class ''' self.diam = kwargs.pop('diam', 500E-6 * pq.m) self.h = kwargs.pop('h', np.ones(23) * 100E-6 * pq.m) self.sigma = kwargs.pop('sigma', 0.3 * pq.S / pq.m) self.sigma_top = kwargs.pop('sigma_top', 0.3 * pq.S / pq.m) self.tol = kwargs.pop('tol', 1e-6) self.f_type = kwargs.pop('f_type', 'gaussian') self.f_order = kwargs.pop('f_order', (3, 1)) if kwargs: raise TypeError('Invalid keyword arguments:', kwargs.keys()) def get_f_matrix(self): '''Calculate F-matrix for step iCSD method''' el_len = self.coord_electrode.size f_matrix = np.zeros((el_len, el_len)) for j in range(el_len): for i in range(el_len): lower_int = self.coord_electrode[i] - self.h[j] / 2 if lower_int < 0: lower_int = self.h[j].units upper_int = self.coord_electrode[i] + self.h[j] / 2 # components of f_matrix object f_cyl0 = si.quad(self._f_cylinder, a=lower_int, b=upper_int, args=(float(self.coord_electrode[j]), float(self.diam[j]), float(self.sigma)), epsabs=self.tol)[0] f_cyl1 = si.quad(self._f_cylinder, a=lower_int, b=upper_int, args=(-float(self.coord_electrode[j]), float(self.diam[j]), float(self.sigma)), epsabs=self.tol)[0] # method of images coefficient mom = (self.sigma - self.sigma_top) / (self.sigma + self.sigma_top) f_matrix[j, i] = f_cyl0 + mom * f_cyl1 # assume si.quad trash the units return f_matrix * self.h.units**2 / self.sigma.units def _f_cylinder(self, zeta, z_val, diam, sigma): '''function used by class method''' f_cyl = 1. / (2. * sigma) * \ (np.sqrt((diam / 2)**2 + ((z_val - zeta))**2) - abs(z_val - zeta)) return f_cyl class SplineiCSD(CSD): '''spline iCSD method''' def __init__(self, lfp, coord_electrode, **kwargs): ''' Initializing spline-iCSD method class object Parameters ---------- lfp : np.ndarray * quantity.Quantity LFP signal of shape (# channels, # time steps) in units of V coord_electrode : np.ndarray * quantity.Quantity depth of evenly spaced electrode contact points of shape (# contacts, ) in units of m diam : float * quantity.Quantity diamater of the assumed circular planar current sources centered at each contact Defaults to 500E-6 meters sigma : float * quantity.Quantity conductivity of tissue in units of S/m or 1/(ohm*m) Defaults to 0.3 S / m sigma_top : float * quantity.Quantity conductivity on top of tissue in units of S/m or 1/(ohm*m) Defaults to 0.3 S / m tol : float tolerance of numerical integration Defaults 1e-6 f_type : str type of spatial filter, must be a scipy.signal filter design method Defaults to 'gaussian' f_order : list settings for spatial filter, arg passed to filter design function Defaults to (3,1) for the gaussian num_steps : int number of data points for the spatially upsampled LFP/CSD data Defaults to 200 ''' self.parameters(**kwargs) CSD.__init__(self, lfp, self.f_type, self.f_order) try: # Should the class not take care of this?! assert(self.diam.units == coord_electrode.units) except AssertionError as ae: print('units of coord_electrode ({}) and diam ({}) differ' .format(coord_electrode.units, self.diam.units)) raise try: assert(np.all(np.diff(coord_electrode) > 0)) except AssertionError as ae: print('values of coord_electrode not continously increasing') raise ae try: assert(self.diam.size == 1 or self.diam.size == coord_electrode.size) if self.diam.size == coord_electrode.size: assert(np.all(self.diam > 0 * self.diam.units)) except AssertionError as ae: print('diam must be scalar or of same shape as coord_electrode') raise ae if self.diam.size == 1: self.diam = np.ones(coord_electrode.size) * self.diam self.name = 'spline-iCSD method' self.coord_electrode = coord_electrode # compute stuff self.f_matrix = self.get_f_matrix() def parameters(self, **kwargs): '''Defining the default values of the method passed as kwargs Parameters ---------- **kwargs Same as those passed to initialize the Class ''' self.diam = kwargs.pop('diam', 500E-6 * pq.m) self.sigma = kwargs.pop('sigma', 0.3 * pq.S / pq.m) self.sigma_top = kwargs.pop('sigma_top', 0.3 * pq.S / pq.m) self.tol = kwargs.pop('tol', 1e-6) self.num_steps = kwargs.pop('num_steps', 200) self.f_type = kwargs.pop('f_type', 'gaussian') self.f_order = kwargs.pop('f_order', (3, 1)) if kwargs: raise TypeError('Invalid keyword arguments:', kwargs.keys()) def get_f_matrix(self): '''Calculate the F-matrix for cubic spline iCSD method''' el_len = self.coord_electrode.size z_js = np.zeros(el_len + 1) z_js[:-1] = np.array(self.coord_electrode) z_js[-1] = z_js[-2] + float(np.diff(self.coord_electrode).mean()) # Define integration matrixes f_mat0 = np.zeros((el_len, el_len + 1)) f_mat1 = np.zeros((el_len, el_len + 1)) f_mat2 = np.zeros((el_len, el_len + 1)) f_mat3 = np.zeros((el_len, el_len + 1)) # Calc. elements for j in range(el_len): for i in range(el_len): f_mat0[j, i] = si.quad(self._f_mat0, a=z_js[i], b=z_js[i + 1], args=(z_js[j + 1], float(self.sigma), float(self.diam[j])), epsabs=self.tol)[0] f_mat1[j, i] = si.quad(self._f_mat1, a=z_js[i], b=z_js[i + 1], args=(z_js[j + 1], z_js[i], float(self.sigma), float(self.diam[j])), epsabs=self.tol)[0] f_mat2[j, i] = si.quad(self._f_mat2, a=z_js[i], b=z_js[i + 1], args=(z_js[j + 1], z_js[i], float(self.sigma), float(self.diam[j])), epsabs=self.tol)[0] f_mat3[j, i] = si.quad(self._f_mat3, a=z_js[i], b=z_js[i + 1], args=(z_js[j + 1], z_js[i], float(self.sigma), float(self.diam[j])), epsabs=self.tol)[0] # image technique if conductivity not constant: if self.sigma != self.sigma_top: f_mat0[j, i] = f_mat0[j, i] + (self.sigma-self.sigma_top) / \ (self.sigma + self.sigma_top) * \ si.quad(self._f_mat0, a=z_js[i], b=z_js[i+1], \ args=(-z_js[j+1], float(self.sigma), float(self.diam[j])), \ epsabs=self.tol)[0] f_mat1[j, i] = f_mat1[j, i] + (self.sigma-self.sigma_top) / \ (self.sigma + self.sigma_top) * \ si.quad(self._f_mat1, a=z_js[i], b=z_js[i+1], \ args=(-z_js[j+1], z_js[i], float(self.sigma), float(self.diam[j])), epsabs=self.tol)[0] f_mat2[j, i] = f_mat2[j, i] + (self.sigma-self.sigma_top) / \ (self.sigma + self.sigma_top) * \ si.quad(self._f_mat2, a=z_js[i], b=z_js[i+1], \ args=(-z_js[j+1], z_js[i], float(self.sigma), float(self.diam[j])), epsabs=self.tol)[0] f_mat3[j, i] = f_mat3[j, i] + (self.sigma-self.sigma_top) / \ (self.sigma + self.sigma_top) * \ si.quad(self._f_mat3, a=z_js[i], b=z_js[i+1], \ args=(-z_js[j+1], z_js[i], float(self.sigma), float(self.diam[j])), epsabs=self.tol)[0] e_mat0, e_mat1, e_mat2, e_mat3 = self._calc_e_matrices() # Calculate the F-matrix f_matrix = np.eye(el_len + 2) f_matrix[1:-1, :] = np.dot(f_mat0, e_mat0) + \ np.dot(f_mat1, e_mat1) + \ np.dot(f_mat2, e_mat2) + \ np.dot(f_mat3, e_mat3) return f_matrix * self.coord_electrode.units**2 / self.sigma.units def get_csd(self): ''' Calculate the iCSD using the spline iCSD method Returns ------- csd : np.ndarray * quantity.Quantity Array with csd estimate ''' e_mat = self._calc_e_matrices() el_len = self.coord_electrode.size # padding the lfp with zeros on top/bottom if self.lfp.ndim == 1: cs_lfp = np.r_[[0], np.asarray(self.lfp), [0]].reshape(1, -1).T csd = np.zeros(self.num_steps) else: cs_lfp = np.vstack((np.zeros(self.lfp.shape[1]), np.asarray(self.lfp), np.zeros(self.lfp.shape[1]))) csd = np.zeros((self.num_steps, self.lfp.shape[1])) cs_lfp *= self.lfp.units # CSD coefficients csd_coeff = np.linalg.solve(self.f_matrix, cs_lfp) # The cubic spline polynomial coefficients a_mat0 = np.dot(e_mat[0], csd_coeff) a_mat1 = np.dot(e_mat[1], csd_coeff) a_mat2 = np.dot(e_mat[2], csd_coeff) a_mat3 = np.dot(e_mat[3], csd_coeff) # Extend electrode coordinates in both end by min contact interdistance h = np.diff(self.coord_electrode).min() z_js = np.zeros(el_len + 2) z_js[0] = self.coord_electrode[0] - h z_js[1: -1] = self.coord_electrode z_js[-1] = self.coord_electrode[-1] + h # create high res spatial grid out_zs = np.linspace(z_js[1], z_js[-2], self.num_steps) # Calculate iCSD estimate on grid from polynomial coefficients. i = 0 for j in range(self.num_steps): if out_zs[j] >= z_js[i + 1]: i += 1 csd[j, ] = a_mat0[i, :] + a_mat1[i, :] * \ (out_zs[j] - z_js[i]) + \ a_mat2[i, :] * (out_zs[j] - z_js[i])**2 + \ a_mat3[i, :] * (out_zs[j] - z_js[i])**3 csd_unit = (self.f_matrix.units**-1 * self.lfp.units).simplified return csd * csd_unit def _f_mat0(self, zeta, z_val, sigma, diam): '''0'th order potential function''' return 1. / (2. * sigma) * \ (np.sqrt((diam / 2)**2 + ((z_val - zeta))**2) - abs(z_val - zeta)) def _f_mat1(self, zeta, z_val, zi_val, sigma, diam): '''1'th order potential function''' return (zeta - zi_val) * self._f_mat0(zeta, z_val, sigma, diam) def _f_mat2(self, zeta, z_val, zi_val, sigma, diam): '''2'nd order potential function''' return (zeta - zi_val)**2 * self._f_mat0(zeta, z_val, sigma, diam) def _f_mat3(self, zeta, z_val, zi_val, sigma, diam): '''3'rd order potential function''' return (zeta - zi_val)**3 * self._f_mat0(zeta, z_val, sigma, diam) def _calc_k_matrix(self): '''Calculate the K-matrix used by to calculate E-matrices''' el_len = self.coord_electrode.size h = float(np.diff(self.coord_electrode).min()) c_jm1 = np.eye(el_len + 2, k=0) / h c_jm1[0, 0] = 0 c_j0 = np.eye(el_len + 2) / h c_j0[-1, -1] = 0 c_jall = c_j0 c_jall[0, 0] = 1 c_jall[-1, -1] = 1 tjp1 = np.eye(el_len + 2, k=1) tjm1 = np.eye(el_len + 2, k=-1) tj0 = np.eye(el_len + 2) tj0[0, 0] = 0 tj0[-1, -1] = 0 # Defining K-matrix used to calculate e_mat1-3 return np.dot(np.linalg.inv(np.dot(c_jm1, tjm1) + 2 * np.dot(c_jm1, tj0) + 2 * c_jall + np.dot(c_j0, tjp1)), 3 * (np.dot(np.dot(c_jm1, c_jm1), tj0) - np.dot(np.dot(c_jm1, c_jm1), tjm1) + np.dot(np.dot(c_j0, c_j0), tjp1) - np.dot(np.dot(c_j0, c_j0), tj0))) def _calc_e_matrices(self): '''Calculate the E-matrices used by cubic spline iCSD method''' el_len = self.coord_electrode.size # expanding electrode grid h = float(np.diff(self.coord_electrode).min()) # Define transformation matrices c_mat3 = np.eye(el_len + 1) / h # Get K-matrix k_matrix = self._calc_k_matrix() # Define matrixes for C to A transformation: tja = np.eye(el_len + 2)[:-1, ] tjp1a = np.eye(el_len + 2, k=1)[:-1, ] # Define spline coefficients e_mat0 = tja e_mat1 = np.dot(tja, k_matrix) e_mat2 = 3 * np.dot(c_mat3**2, (tjp1a - tja)) - \ np.dot(np.dot(c_mat3, (tjp1a + 2 * tja)), k_matrix) e_mat3 = 2 * np.dot(c_mat3**3, (tja - tjp1a)) + \ np.dot(np.dot(c_mat3**2, (tjp1a + tja)), k_matrix) return e_mat0, e_mat1, e_mat2, e_mat3 if __name__ == '__main__': from scipy.io import loadmat import matplotlib.pyplot as plt #loading test data test_data = loadmat('test_data.mat') #prepare lfp data for use, by changing the units to SI and append quantities, #along with electrode geometry, conductivities and assumed source geometry lfp_data = test_data['pot1'] * 1E-6 * pq.V # [uV] -> [V] z_data = np.linspace(100E-6, 2300E-6, 23) * pq.m # [m] diam = 500E-6 * pq.m # [m] h = 100E-6 * pq.m # [m] sigma = 0.3 * pq.S / pq.m # [S/m] or [1/(ohm*m)] sigma_top = 0.3 * pq.S / pq.m # [S/m] or [1/(ohm*m)] # Input dictionaries for each method delta_input = { 'lfp' : lfp_data, 'coord_electrode' : z_data, 'diam' : diam, # source diameter 'sigma' : sigma, # extracellular conductivity 'sigma_top' : sigma, # conductivity on top of cortex 'f_type' : 'gaussian', # gaussian filter 'f_order' : (3, 1), # 3-point filter, sigma = 1. } step_input = { 'lfp' : lfp_data, 'coord_electrode' : z_data, 'diam' : diam, 'h' : h, # source thickness 'sigma' : sigma, 'sigma_top' : sigma, 'tol' : 1E-12, # Tolerance in numerical integration 'f_type' : 'gaussian', 'f_order' : (3, 1), } spline_input = { 'lfp' : lfp_data, 'coord_electrode' : z_data, 'diam' : diam, 'sigma' : sigma, 'sigma_top' : sigma, 'num_steps' : 201, # Spatial CSD upsampling to N steps 'tol' : 1E-12, 'f_type' : 'gaussian', 'f_order' : (20, 5), } std_input = { 'lfp' : lfp_data, 'coord_electrode' : z_data, 'sigma' : sigma, 'f_type' : 'gaussian', 'f_order' : (3, 1), } #Create the different CSD-method class instances. We use the class methods #get_csd() and filter_csd() below to get the raw and spatially filtered #versions of the current-source density estimates. csd_dict = dict( delta_icsd = DeltaiCSD(**delta_input), step_icsd = StepiCSD(**step_input), spline_icsd = SplineiCSD(**spline_input), std_csd = StandardCSD(**std_input), ) #plot for method, csd_obj in list(csd_dict.items()): fig, axes = plt.subplots(3,1, figsize=(8,8)) #plot LFP signal ax = axes[0] im = ax.imshow(np.array(lfp_data), origin='upper', vmin=-abs(lfp_data).max(), \ vmax=abs(lfp_data).max(), cmap='jet_r', interpolation='nearest') ax.axis(ax.axis('tight')) cb = plt.colorbar(im, ax=ax) cb.set_label('LFP (%s)' % lfp_data.dimensionality.string) ax.set_xticklabels([]) ax.set_title('LFP') ax.set_ylabel('ch #') #plot raw csd estimate csd = csd_obj.get_csd() ax = axes[1] im = ax.imshow(np.array(csd), origin='upper', vmin=-abs(csd).max(), \ vmax=abs(csd).max(), cmap='jet_r', interpolation='nearest') ax.axis(ax.axis('tight')) ax.set_title(csd_obj.name) cb = plt.colorbar(im, ax=ax) cb.set_label('CSD (%s)' % csd.dimensionality.string) ax.set_xticklabels([]) ax.set_ylabel('ch #') #plot spatially filtered csd estimate ax = axes[2] csd = csd_obj.filter_csd(csd) im = ax.imshow(np.array(csd), origin='upper', vmin=-abs(csd).max(), \ vmax=abs(csd).max(), cmap='jet_r', interpolation='nearest') ax.axis(ax.axis('tight')) ax.set_title(csd_obj.name + ', filtered') cb = plt.colorbar(im, ax=ax) cb.set_label('CSD (%s)' % csd.dimensionality.string) ax.set_ylabel('ch #') ax.set_xlabel('timestep') plt.show()
bsd-3-clause
mgahsan/QuantEcon.py
quantecon/models/solow/model.py
7
38654
r""" ====================== The Solow Growth Model ====================== The following summary of the [solow1956] model of economic growth largely follows [romer2011]. Assumptions =========== The production function ---------------------------------------------- The [solow1956] model of economic growth focuses on the behavior of four variables: output, `Y`, capital, `K`, labor, `L`, and knowledge (or technology or the ``effectiveness of labor''), `A`. At each point in time the economy has some amounts of capital, labor, and knowledge that can be combined to produce output according to some production function, `F`. .. math:: Y(t) = F(K(t), A(t)L(t)) where `t` denotes time. The evolution of the inputs to production ----------------------------------------- The initial levels of capital, :math:`K_0`, labor, :math:`L_0`, and technology, :math:`A_0`, are taken as given. Labor and technology are assumed to grow at constant rates: .. math:: \dot{A}(t) = gA(t) \dot{L}(t) = nL(t) where the rate of technological progrss, `g`, and the population growth rate, `n`, are exogenous parameters. Output is divided between consumption and investment. The fraction of output devoted to investment, :math:`0 < s < 1`, is exogenous and constant. One unit of output devoted to investment yields one unit of new capital. Capital is assumed to decpreciate at a rate :math:`0\le \delta`. Thus aggregate capital stock evolves according to .. math:: \dot{K}(t) = sY(t) - \delta K(t). Although no restrictions are placed on the rates of technological progress and population growth, the sum of `g`, `n`, and :math:`delta` is assumed to be positive. The dynamics of the model ========================= Because the economy is growing over time (due to exogenous technological progress and population growth) it is useful to focus on the behavior of capital stock per unit of effective labor, :math:`k\equiv K/AL`. Applying the chain rule to the equation of motion for capital stock yields (after a bit of algebra!) an equation of motion for capital stock per unit of effective labor. .. math:: \dot{k}(t) = s f(k) - (g + n + \delta)k(t) References ========== .. [romer2011] D. Romer. *Advanced Macroeconomics, 4th edition*, MacGraw Hill, 2011. .. [solow1956] R. Solow. *A contribution to the theory of economic growth*, Quarterly Journal of Economics, 70(1):64-95, 1956. @author : David R. Pugh @date : 2014-11-27 """ from __future__ import division import collections from textwrap import dedent import matplotlib.pyplot as plt import numpy as np from scipy import optimize import sympy as sym from ... import ivp from . import impulse_response # declare key variables for the model t, X = sym.symbols('t'), sym.DeferredVector('X') A, k, K, L, Y = sym.symbols('A, k, K, L, Y') # declare required model parameters g, n, s, delta = sym.symbols('g, n, s, delta') class Model(object): __intensive_output = None __mpk = None __numeric_jacobian = None __numeric_solow_residual = None __numeric_system = None _modules = [{'ImmutableMatrix': np.array}, "numpy"] _required_params = ['g', 'n', 's', 'delta', 'A0', 'L0'] def __init__(self, output, params): """ Create an instance of the Solow growth model. Parameters ---------- output : sym.Basic Symbolic expression defining the aggregate production function. params : dict Dictionary of model parameters. """ self.irf = impulse_response.ImpulseResponse(self) self.output = output self.params = params def __repr__(self): """Machine readable summary of a Model instance.""" return self.__str__() def __str__(self): """Human readable summary of a Model instance.""" m = """ Solow (1956) model of economic growth: - Output : {Y} - A0 (initial level of technology) : {A0:g} - L0 (initial amount of available labor) : {L0:g} - g (growth rate of technology) : {g:g} - n (growth rate of the labor force) : {n:g} - s (savings rate) : {s:g} - delta (depreciation rate of physical capital) : {delta:g} """ formatted_str = dedent(m.format(Y=self.output, A0=self.params['A0'], L0=self.params['L0'], g=self.params['g'], n=self.params['n'], s=self.params['s'], delta=self.params['delta'])) return formatted_str @property def _intensive_output(self): """ :getter: Return vectorized symbolic intensive aggregate production. :type: function """ if self.__intensive_output is None: args = [k] + sym.symbols(list(self.params.keys())) self.__intensive_output = sym.lambdify(args, self.intensive_output, self._modules) return self.__intensive_output @property def _mpk(self): """ :getter: Return vectorized symbolic marginal product capital. :type: function """ if self.__mpk is None: args = [k] + sym.symbols(list(self.params.keys())) self.__mpk = sym.lambdify(args, self.marginal_product_capital, self._modules) return self.__mpk @property def _numeric_jacobian(self): """ Vectorized, numpy-aware function defining the Jacobian matrix of partial derivatives. :getter: Return vectorized Jacobian matrix of partial derivatives. :type: function """ if self.__numeric_jacobian is None: self.__numeric_jacobian = sym.lambdify(self._symbolic_args, self._symbolic_jacobian, self._modules) return self.__numeric_jacobian @property def _numeric_solow_residual(self): """ Vectorized, numpy-aware function defining the Solow residual. :getter: Return vectorized symbolic Solow residual. :type: function """ if self.__numeric_solow_residual is None: tmp_args = [Y, K, L] + sym.symbols(list(self.params.keys())) self.__numeric_solow_residual = sym.lambdify(tmp_args, self.solow_residual, self._modules) return self.__numeric_solow_residual @property def _numeric_system(self): """ Vectorized, numpy-aware function defining the system of ODEs. :getter: Return vectorized symbolic system of ODEs. :type: function """ if self.__numeric_system is None: self.__numeric_system = sym.lambdify(self._symbolic_args, self._symbolic_system, self._modules) return self.__numeric_system @property def _symbolic_args(self): """ List of symbolic arguments used in constructing vectorized versions of _symbolic_system and _symbolic_jacobian. :getter: Return list of symbolic arguments. :type: list """ args = [t, X] + sym.symbols(list(self.params.keys())) return args @property def _symbolic_jacobian(self): """ Symbolic Jacobian matrix for the system of ODEs. :getter: Return the symbolic Jacobian matrix. :type: sym.MutableDenseMatrix """ N = self._symbolic_system.shape[0] return self._symbolic_system.jacobian([X[i] for i in range(N)]) @property def _symbolic_system(self): """ Symbolic matrix defining the system of ODEs. :getter: Return the matrix defining the system of ODEs. :type: sym.MutableDenseMatrix """ change_of_vars = {k: X[0]} return sym.Matrix([self.k_dot]).subs(change_of_vars) @property def effective_depreciation_rate(self): """ Effective depreciation rate for capital stock (per unit effective labor). :getter: Return the current effective depreciation rate. :type: float Notes ----- The effective depreciation rate of physical capital takes into account both technological progress and population growth, as well as physical depreciation. """ return sum(self.params[key] for key in ['g', 'n', 'delta']) @property def intensive_output(self): r""" Symbolic expression for the intensive form of aggregate production. :getter: Return the current intensive production function. :type: sym.Basic Notes ----- The assumption of constant returns to scale allows us to work the the intensive form of the aggregate production function, `F`. Defining :math:`c=1/AL` one can write ..math:: F\bigg(\frac{K}{AL}, 1\bigg) = \frac{1}{AL}F(A, K, L) Defining :math:`k=K/AL` and :math:`y=Y/AL` to be capital per unit effective labor and output per unit effective labor, respectively, the intensive form of the production function can be written as .. math:: y = f(k). Additional assumptions are that `f` satisfies :math:`f(0)=0`, is concave (i.e., :math:`f'(k) > 0, f''(k) < 0`), and satisfies the Inada conditions: .. math:: :type: eqnarray \lim_{k \rightarrow 0} &=& \infty \\ \lim_{k \rightarrow \infty} &=& 0 The [inada1964]_ conditions are sufficient (but not necessary!) to ensure that the time path of capital per effective worker does not explode. .. [inada1964] K. Inda. *Some structural characteristics of Turnpike Theorems*, Review of Economic Studies, 31(1):43-58, 1964. """ return self.output.subs({'A': 1.0, 'K': k, 'L': 1.0}) @property def ivp(self): r""" Initial value problem :getter: Return an instance of the ivp.IVP class representing the Solow model. :type: ivp.IVP Notes ----- The Solow model with can be formulated as an initial value problem (IVP) as follows. .. math:: \dot{k}(t) = sf(k(t)) - (g + n + \delta)k(t),\ t\ge t_0,\ k(t_0) = k_0 The solution to this IVP is a function :math:`k(t)` describing the time path of capital stock (per unit effective labor). """ tmp_ivp = ivp.IVP(self._numeric_system, self._numeric_jacobian) tmp_ivp.f_params = tuple(self.params.values()) tmp_ivp.jac_params = tuple(self.params.values()) return tmp_ivp @property def k_dot(self): r""" Symbolic expression for the equation of motion for capital (per unit effective labor). :getter: Return the current equation of motion for capital (per unit effective labor). :type: sym.Basic Notes ----- Because the economy is growing over time due to technological progress, `g`, and population growth, `n`, it makes sense to focus on the capital stock per unit effective labor, `k`, rather than aggregate physical capital, `K`. Since, by definition, :math:`k=K/AL`, we can apply the chain rule to the time derative of `k`. .. math:: :type: eqnarray \dot{k}(t) =& \frac{\dot{K}(t)}{A(t)L(t)} - \frac{K(t)}{[A(t)L(t)]^2}\bigg[\dot{A}(t)L(t) + \dot{L}(t)A(t)\bigg] \\ =& \frac{\dot{K}(t)}{A(t)L(t)} - \bigg(\frac{\dot{A}(t)}{A(t)} + \frac{\dot{L}(t)}{L(t)}\bigg)\frac{K(t)}{A(t)L(t)} By definition, math:`k=K/AL`, and by assumption :math:`\dot{A}/A` and :math:`\dot{L}/L` are `g` and `n` respectively. Aggregate capital stock evolves according to .. math:: \dot{K}(t) = sF(K(t), A(t)L(t)) - \delta K(t). Substituting these facts into the above equation yields the equation of motion for capital stock (per unit effective labor). .. math:: :type: eqnarray \dot{k}(t) =& \frac{sF(K(t), A(t)L(t)) - \delta K(t)}{A(t)L(t)} - (g + n)k(t) \\ =& \frac{sY(t)}{A(t)L(t)} - (g + n + \delta)k(t) \\ =& sf(k(t)) - (g + n + \delta)k(t) """ return s * self.intensive_output - (g + n + delta) * k @property def marginal_product_capital(self): r""" Symbolic expression for the marginal product of capital (per unit effective labor). :getter: Return the current marginal product of capital (per unit effective labor). :type: sym.Basic Notes ----- The marginal product of capital is defined as follows: .. math:: \frac{\partial F(K, AL)}{\partial K} \equiv f'(k) where :math:`k=K/AL` is capital stock (per unit effective labor) """ return sym.diff(self.intensive_output, k) @property def output(self): r""" Symbolic expression for the aggregate production function. :getter: Return the current aggregate production function. :setter: Set a new aggregate production function :type: sym.Basic Notes ----- At each point in time the economy has some amounts of capital, `K`, labor, `L`, and knowledge (or technology), `A`, that can be combined to produce output, `Y`, according to some function, `F`. .. math:: Y(t) = F(K(t), A(t)L(t)) where `t` denotes time. Note that `A` and `L` are assumed to enter multiplicatively. Typically `A(t)L(t)` denotes "effective labor", and technology that enters in this fashion is known as labor-augmenting or "Harrod neutral." A key assumption of the model is that the function `F` exhibits constant returns to scale in capital and labor inputs. Specifically, .. math:: F(cK(t), cA(t)L(t)) = cF(K(t), A(t)L(t)) = cY(t) for any :math:`c \ge 0`. """ return self._output @property def params(self): """ Dictionary of model parameters. :getter: Return the current dictionary of model parameters. :setter: Set a new dictionary of model parameters. :type: dict Notes ----- The following parameters are required: A0: float Initial level of technology. Must satisfy :math:`A_0 > 0 `. L0: float Initial amount of available labor. Must satisfy :math:`L_0 > 0 `. g : float Growth rate of technology. n : float Growth rate of the labor force. s : float Savings rate. Must satisfy `0 < s < 1`. delta : float Depreciation rate of physical capital. Must satisfy :math:`0 < \delta`. Although no restrictions are placed on the rates of technological progress and population growth, the sum of `g`, `n`, and :math:`delta` is assumed to be positive. The user mus also specify any additional model parameters specific to the chosen aggregate production function. """ return self._params @property def solow_residual(self): """ Symbolic expression for the Solow residual which is used as a measure of technology. :getter: Return the symbolic expression. :type: sym.Basic """ return sym.solve(Y - self.output, A)[0] @property def speed_of_convergence(self): r""" The speed of convergence for the Solow model. :getter: Return the current speed of convergence. :type: float Notes ----- The following is a derivation for the speed of convergence :math:`\lambda`: .. :math:: :type: eqnarray \lambda \equiv -\frac{\partial \dot{k}(k(t))}{\partial k(t)}\bigg|_{k(t)=k^*} =& -[sf'(k^*) - (g + n+ \delta)] \\ =& (g + n+ \delta) - sf'(k^*) \\ =& (g + n + \delta) - (g + n + \delta)\frac{k^*f'(k^*)}{f(k^*)} \\ =& (1 - \alpha_K(k^*))(g + n + \delta) where the elasticity of output with respect to capital, $\alpha_K(k)$, is defined as .. :math:: \alpha_K(k) = \frac{k'(k)}{f(k)}. """ alpha_K = self.evaluate_output_elasticity(self.steady_state) return (1 - alpha_K) * self.effective_depreciation_rate @property def steady_state(self): r""" Steady state value of capital stock (per unit effective labor). :getter: Return the current steady state value. :type: float Notes ----- The steady state value of capital stock (per unit effective labor), `k`, is defined as the value of `k` that solves .. math:: 0 = sf(k) - (g + n + \delta)k where `s` is the savings rate, `f(k)` is intensive output, and :math:`g + n + \delta` is the effective depreciation rate. """ lower, upper = 1e-12, 1e12 return self.find_steady_state(lower, upper) @output.setter def output(self, value): """Set a new production function.""" self._output = self._validate_output(value) self._clear_cache() @params.setter def params(self, value): """Set a new parameter dictionary.""" valid_params = self._validate_params(value) self._params = self._order_params(valid_params) def _clear_cache(self): """Clear cached values.""" self.__intensive_output = None self.__mpk = None self.__numeric_jacobian = None self.__numeric_solow_residual = None self.__numeric_system = None @staticmethod def _order_params(params): """Cast a dictionary to an order dictionary.""" return collections.OrderedDict(sorted(params.items())) def _validate_output(self, output): """Validate the production function.""" if not isinstance(output, sym.Basic): mesg = ("Output must be an instance of {}.".format(sym.Basic)) raise AttributeError(mesg) elif not ({A, K, L} < output.atoms()): mesg = ("Output must be an expression of technology, 'A', " + "capital, 'K', and labor, 'L'.") raise AttributeError(mesg) else: return output def _validate_params(self, params): """Validate the model parameters.""" if not isinstance(params, dict): mesg = "SolowModel.params must be a dict, not a {}." raise AttributeError(mesg.format(params.__class__)) elif not set(self._required_params) <= set(params.keys()): mesg = "One of the required params in {} has not been specified." raise AttributeError(mesg.format(self._required_params)) elif params['s'] <= 0.0 or params['s'] >= 1.0: raise AttributeError('Savings rate must be in (0, 1).') elif params['delta'] <= 0.0 or params['delta'] >= 1.0: raise AttributeError('Depreciation rate must be in (0, 1).') elif params['g'] + params['n'] + params['delta'] <= 0.0: raise AttributeError("Sum of g, n, and delta must be positive.") elif params['A0'] <= 0.0: mesg = "Initial value for technology must be strictly positive." raise AttributeError(mesg) elif params['L0'] <= 0.0: mesg = "Initial value for labor supply must be strictly positive." raise AttributeError(mesg) else: return params def evaluate_actual_investment(self, k): """ Return the amount of output (per unit of effective labor) invested in the production of new capital. Parameters ---------- k : array_like (float) Capital stock (per unit of effective labor) Returns ------- actual_inv : array_like (float) Investment (per unit of effective labor) """ actual_inv = self.params['s'] * self.evaluate_intensive_output(k) return actual_inv def evaluate_consumption(self, k): """ Return the amount of consumption (per unit of effective labor). Parameters ---------- k : ndarray (float) Capital stock (per unit of effective labor) Returns ------- c : ndarray (float) Consumption (per unit of effective labor) """ c = (self.evaluate_intensive_output(k) - self.evaluate_actual_investment(k)) return c def evaluate_effective_depreciation(self, k): """ Return amount of Capital stock (per unit of effective labor) that depreciaties due to technological progress, population growth, and physical depreciation. Parameters ---------- k : array_like (float) Capital stock (per unit of effective labor) Returns ------- effective_depreciation : array_like (float) Amount of depreciated Capital stock (per unit of effective labor) """ effective_depreciation = self.effective_depreciation_rate * k return effective_depreciation def evaluate_intensive_output(self, k): """ Return the amount of output (per unit of effective labor). Parameters ---------- k : ndarray (float) Capital stock (per unit of effective labor) Returns ------- y : ndarray (float) Output (per unit of effective labor) """ y = self._intensive_output(k, *self.params.values()) return y def evaluate_k_dot(self, k): """ Return time derivative of capital stock (per unit of effective labor). Parameters ---------- k : ndarray (float) Capital stock (per unit of effective labor) Returns ------- k_dot : ndarray (float) Time derivative of capital stock (per unit of effective labor). """ k_dot = (self.evaluate_actual_investment(k) - self.evaluate_effective_depreciation(k)) return k_dot def evaluate_mpk(self, k): """ Return marginal product of capital stock (per unit of effective labor). Parameters ---------- k : ndarray (float) Capital stock (per unit of effective labor) Returns ------- mpk : ndarray (float) Marginal product of capital stock (per unit of effective labor). """ mpk = self._mpk(k, *self.params.values()) return mpk def evaluate_output_elasticity(self, k): """ Return elasticity of output with respect to capital stock (per unit effective labor). Parameters ---------- k : array_like (float) Capital stock (per unit of effective labor) Returns ------- alpha_k : array_like (float) Elasticity of output with respect to capital stock (per unit effective labor). Notes ----- Under the additional assumption that markets are perfectly competitive, the elasticity of output with respect to capital stock is equivalent to capital's share of income. Since, under perfect competition, firms earn zero profits it must be true capital's share and labor's share must sum to one. """ alpha_k = (k*self.evaluate_mpk(k)) / self.evaluate_intensive_output(k) return alpha_k def evaluate_solow_residual(self, Y, K, L): """ Return Solow residual. Parameters ---------- k : array_like (float) Capital stock (per unit of effective labor) Returns ------- residual : array_like (float) Solow residual """ residual = self._numeric_solow_residual(Y, K, L, *self.params.values()) assert residual.all() > 0, "Solow residual show always be positive!" return residual def find_steady_state(self, a, b, method='brentq', **kwargs): """ Compute the equilibrium value of capital stock (per unit effective labor). Parameters ---------- a : float One end of the bracketing interval [a,b]. b : float The other end of the bracketing interval [a,b] method : str (default=`brentq`) Method to use when computing the steady state. Supported methods are `bisect`, `brenth`, `brentq`, `ridder`. See `scipy.optimize` for more details (including references). kwargs : optional Additional keyword arguments. Keyword arguments are method specific see `scipy.optimize` for details. Returns ------- x0 : float Zero of `f` between `a` and `b`. r : RootResults (present if ``full_output = True``) Object containing information about the convergence. In particular, ``r.converged`` is True if the routine converged. """ if method == 'bisect': result = optimize.bisect(self.evaluate_k_dot, a, b, **kwargs) elif method == 'brenth': result = optimize.brenth(self.evaluate_k_dot, a, b, **kwargs) elif method == 'brentq': result = optimize.brentq(self.evaluate_k_dot, a, b, **kwargs) elif method == 'ridder': result = optimize.ridder(self.evaluate_k_dot, a, b, **kwargs) else: mesg = ("Method must be one of : 'bisect', 'brenth', 'brentq', " + "or 'ridder'.") raise ValueError(mesg) return result def linearized_solution(self, t, k0): """ Compute the linearized solution for the Solow model. Parameters ---------- t : ndarray (shape=(T,)) Array of points at which the solution is desired. k0 : (float) Initial condition for capital stock (per unit of effective labor) Returns ------- linearized_traj : ndarray (shape=t.size, 2) Array representing the linearized solution trajectory. """ kt = (self.steady_state + np.exp(-self.speed_of_convergence * t) * (k0 - self.steady_state)) linearized_traj = np.hstack((t[:, np.newaxis], kt[:, np.newaxis])) return linearized_traj def plot_factor_shares(self, ax, Nk=1e3, **new_params): """ Plot income/output shares of capital and labor inputs to production. Parameters ---------- ax : `matplotlib.axes.AxesSubplot` An instance of `matplotlib.axes.AxesSubplot`. Nk : float (default=1e3) Number of capital stock (per unit of effective labor) grid points. new_params : dict (optional) Optional dictionary of parameter values to change. Returns ------- A list containing... capitals_share_line : maplotlib.lines.Line2D A Line2D object representing the time path for capital's share of income. labors_share_line : maplotlib.lines.Line2D A Line2D object representing the time path for labor's share of income. """ # create tmp_params dict to force check for valid params tmp_params = self.params.copy() tmp_params.update(new_params) self.params = tmp_params # forces check for valid params! # create the plot k_grid = np.linspace(0, 2 * self.steady_state, Nk) capitals_share = self.evaluate_output_elasticity(k_grid) labors_share = 1 - capitals_share capitals_share_line, = ax.plot(k_grid, capitals_share, 'r-', label=r'$\alpha_K(k(t))$') labors_share_line, = ax.plot(k_grid, labors_share, 'b-', label=r'$1 - \alpha_K(k(t))$') ax.set_xlabel('Capital (per unit effective labor), $k(t)$', family='serif', fontsize=15) ax.set_title('Factor shares', family='serif', fontsize=20) ax.grid(True) ax.legend(loc=0, frameon=False, prop={'family': 'serif'}, bbox_to_anchor=(1.0, 1.0)) return [capitals_share_line, labors_share_line] def plot_intensive_output(self, ax, Nk=1e3, **new_params): """ Plot intensive form of the aggregate production function. Parameters ---------- ax : `matplotlib.axes.AxesSubplot` An instance of `matplotlib.axes.AxesSubplot`. Nk : float (default=1e3) Number of capital stock (per unit of effective labor) grid points. new_params : dict (optional) Optional dictionary of parameter values to change. Returns ------- A list containing... intensive_output : maplotlib.lines.Line2D A Line2D object representing intensive output as a function of capital stock (per unit effective labor). """ # create tmp_params dict to force check for valid params tmp_params = self.params.copy() tmp_params.update(new_params) self.params = tmp_params # forces check for valid params! # create the plot k_grid = np.linspace(0, 2 * self.steady_state, Nk) y_grid = self.evaluate_intensive_output(k_grid) intensive_output_line, = ax.plot(k_grid, y_grid, 'r-') ax.set_xlabel('Capital (per unit effective labor), $k(t)$', family='serif', fontsize=15) ax.set_ylabel('$f(k(t))$', family='serif', fontsize=20, rotation='horizontal') ax.yaxis.set_label_coords(-0.1, 0.5) ax.set_title('Output (per unit effective labor)', family='serif', fontsize=20) ax.grid(True) return [intensive_output_line] def plot_intensive_investment(self, ax, Nk=1e3, **new_params): """ Plot actual investment (per unit effective labor) and effective depreciation. The steady state value of capital stock (per unit effective labor) balance acual investment and effective depreciation. Parameters ---------- ax : `matplotlib.axes.AxesSubplot` An instance of `matplotlib.axes.AxesSubplot`. Nk : float (default=1e3) Number of capital stock (per unit of effective labor) grid points. new_params : dict (optional) Optional dictionary of parameter values to change. Returns ------- A list containing... actual_investment_line : maplotlib.lines.Line2D A Line2D object representing the level of actual investment as a function of capital stock (per unit effective labor). breakeven_investment_line : maplotlib.lines.Line2D A Line2D object representing the "break-even" level of investment as a function of capital stock (per unit effective labor). ss_line : maplotlib.lines.Line2D A Line2D object representing the steady state level of investment. """ # create tmp_params dict to force check for valid params tmp_params = self.params.copy() tmp_params.update(new_params) self.params = tmp_params # forces check for valid params! # create the plot k_grid = np.linspace(0, 2 * self.steady_state, Nk) actual_investment_grid = self.evaluate_actual_investment(k_grid) breakeven_investment_grid = self.evaluate_effective_depreciation(k_grid) ss_investment = self.evaluate_actual_investment(self.steady_state) actual_investment_line, = ax.plot(k_grid, actual_investment_grid, 'g-', label='$sf(k(t))$') breakeven_investment_line, = ax.plot(k_grid, breakeven_investment_grid, 'b-', label='$(g + n + \delta)k(t)$') ss_line, = ax.plot(self.steady_state, ss_investment, 'ko', label='$k^*={0:.4f}$'.format(self.steady_state)) ax.set_xlabel('Capital (per unit effective labor), $k(t)$', family='serif', fontsize=15) ax.set_ylabel('Investment (per unit effective labor)', family='serif', fontsize=15) ax.set_title('Output (per unit effective labor)', family='serif', fontsize=20) ax.grid(True) ax.legend(loc=0, frameon=False, prop={'family': 'serif'}, bbox_to_anchor=(1.0, 1.0)) return [actual_investment_line, breakeven_investment_line, ss_line] def plot_phase_diagram(self, ax, Nk=1e3, **new_params): """ Plot the model's phase diagram. Parameters ---------- ax : `matplotlib.axes.AxesSubplot` An instance of `matplotlib.axes.AxesSubplot`. Nk : float (default=1e3) Number of capital stock (per unit of effective labor) grid points. new_params : dict (optional) Optional dictionary of parameter values to change. Returns ------- A list containing... k_dot_line : maplotlib.lines.Line2D A Line2D object representing the rate of change of capital stock (per unit effective labor) as a function of its level. origin_line : maplotlib.lines.Line2D A Line2D object representing the origin (i.e., locus of points where k_dot is zero). ss_line : maplotlib.lines.Line2D A Line2D object representing the steady state level of capital stock (per unit effective labor). """ # create tmp_params dict to force check for valid params tmp_params = self.params.copy() tmp_params.update(new_params) self.params = tmp_params # forces check for valid params! # create the plot k_grid = np.linspace(0, 2 * self.steady_state, Nk) k_dot_line, = ax.plot(k_grid, self.evaluate_k_dot(k_grid), color='orange') origin_line = ax.axhline(0, color='k') ss_line, = ax.plot(self.steady_state, 0.0, 'ko', label='$k^*={0:.4f}$'.format(self.steady_state)) ax.set_xlabel('Capital (per unit effective labor), $k(t)$', family='serif', fontsize=15) ax.set_ylabel('$\dot{k}(t)$', family='serif', fontsize=25, rotation='horizontal') ax.yaxis.set_label_coords(-0.1, 0.5) ax.set_title('Phase diagram', family='serif', fontsize=20) ax.grid(True) return [k_dot_line, origin_line, ss_line] def plot_solow_diagram(self, ax, Nk=1e3, **new_params): """ Plot the classic Solow diagram. Parameters ---------- ax : `matplotlib.axes.AxesSubplot` An instance of `matplotlib.axes.AxesSubplot`. Nk : float (default=1e3) Number of capital stock (per unit of effective labor) grid points. new_params : dict (optional) Optional dictionary of parameter values to change. Returns ------- A list containing... actual_investment_line : maplotlib.lines.Line2D A Line2D object representing the level of actual investment as a function of capital stock (per unit effective labor). breakeven_investment_line : maplotlib.lines.Line2D A Line2D object representing the "break-even" level of investment as a function of capital stock (per unit effective labor). ss_line : maplotlib.lines.Line2D A Line2D object representing the steady state level of investment. """ # create tmp_params dict to force check for valid params tmp_params = self.params.copy() tmp_params.update(new_params) self.params = tmp_params # forces check for valid params! # create the plot k_grid = np.linspace(0, 2 * self.steady_state, Nk) intensive_output_grid = self.evaluate_intensive_output(k_grid) actual_investment_grid = self.evaluate_actual_investment(k_grid) breakeven_investment_grid = self.evaluate_effective_depreciation(k_grid) ss_investment = self.evaluate_actual_investment(self.steady_state) intensive_output_line, = ax.plot(k_grid, intensive_output_grid, 'r-', label='$f(k(t)$') actual_investment_line, = ax.plot(k_grid, actual_investment_grid, 'g-', label='$sf(k(t))$') breakeven_investment_line, = ax.plot(k_grid, breakeven_investment_grid, 'b-', label='$(g + n + \delta)k(t)$') ss_line, = ax.plot(self.steady_state, ss_investment, 'ko', label='$k^*={0:.4f}$'.format(self.steady_state)) ax.set_xlabel('Capital (per unit effective labor), $k(t)$', family='serif', fontsize=15) ax.set_title('Solow diagram', family='serif', fontsize=20) ax.grid(True) ax.legend(loc=0, frameon=False, prop={'family': 'serif'}, bbox_to_anchor=(1, 1)) lines = [intensive_output_line, actual_investment_line, breakeven_investment_line, ss_line] return lines
bsd-3-clause
adamgreenhall/scikit-learn
sklearn/utils/tests/test_testing.py
144
4121
import warnings import unittest import sys from nose.tools import assert_raises from sklearn.utils.testing import ( _assert_less, _assert_greater, assert_less_equal, assert_greater_equal, assert_warns, assert_no_warnings, assert_equal, set_random_state, assert_raise_message) from sklearn.tree import DecisionTreeClassifier from sklearn.lda import LDA try: from nose.tools import assert_less def test_assert_less(): # Check that the nose implementation of assert_less gives the # same thing as the scikit's assert_less(0, 1) _assert_less(0, 1) assert_raises(AssertionError, assert_less, 1, 0) assert_raises(AssertionError, _assert_less, 1, 0) except ImportError: pass try: from nose.tools import assert_greater def test_assert_greater(): # Check that the nose implementation of assert_less gives the # same thing as the scikit's assert_greater(1, 0) _assert_greater(1, 0) assert_raises(AssertionError, assert_greater, 0, 1) assert_raises(AssertionError, _assert_greater, 0, 1) except ImportError: pass def test_assert_less_equal(): assert_less_equal(0, 1) assert_less_equal(1, 1) assert_raises(AssertionError, assert_less_equal, 1, 0) def test_assert_greater_equal(): assert_greater_equal(1, 0) assert_greater_equal(1, 1) assert_raises(AssertionError, assert_greater_equal, 0, 1) def test_set_random_state(): lda = LDA() tree = DecisionTreeClassifier() # LDA doesn't have random state: smoke test set_random_state(lda, 3) set_random_state(tree, 3) assert_equal(tree.random_state, 3) def test_assert_raise_message(): def _raise_ValueError(message): raise ValueError(message) def _no_raise(): pass assert_raise_message(ValueError, "test", _raise_ValueError, "test") assert_raises(AssertionError, assert_raise_message, ValueError, "something else", _raise_ValueError, "test") assert_raises(ValueError, assert_raise_message, TypeError, "something else", _raise_ValueError, "test") assert_raises(AssertionError, assert_raise_message, ValueError, "test", _no_raise) # multiple exceptions in a tuple assert_raises(AssertionError, assert_raise_message, (ValueError, AttributeError), "test", _no_raise) # This class is inspired from numpy 1.7 with an alteration to check # the reset warning filters after calls to assert_warns. # This assert_warns behavior is specific to scikit-learn because #`clean_warning_registry()` is called internally by assert_warns # and clears all previous filters. class TestWarns(unittest.TestCase): def test_warn(self): def f(): warnings.warn("yo") return 3 # Test that assert_warns is not impacted by externally set # filters and is reset internally. # This is because `clean_warning_registry()` is called internally by # assert_warns and clears all previous filters. warnings.simplefilter("ignore", UserWarning) assert_equal(assert_warns(UserWarning, f), 3) # Test that the warning registry is empty after assert_warns assert_equal(sys.modules['warnings'].filters, []) assert_raises(AssertionError, assert_no_warnings, f) assert_equal(assert_no_warnings(lambda x: x, 1), 1) def test_warn_wrong_warning(self): def f(): warnings.warn("yo", DeprecationWarning) failed = False filters = sys.modules['warnings'].filters[:] try: try: # Should raise an AssertionError assert_warns(UserWarning, f) failed = True except AssertionError: pass finally: sys.modules['warnings'].filters = filters if failed: raise AssertionError("wrong warning caught by assert_warn")
bsd-3-clause
aerler/GeoPy
src/plotting/archive/lineplots.py
1
9662
''' Created on 2014-03-16 some useful plotting functions that take advantage of variable meta data @author: Andre R. Erler, GPL v3 ''' # external imports from types import NoneType from warnings import warn import numpy as np import matplotlib as mpl # import matplotlib.pylab as pyl # #from mpl_toolkits.axes_grid1 import ImageGrid # linewidth = .75 # mpl.rc('lines', linewidth=linewidth) # if linewidth == 1.5: mpl.rc('font', size=12) # elif linewidth == .75: mpl.rc('font', size=8) # else: mpl.rc('font', size=10) # # prevent figures from closing: don't run in interactive mode, or plt.show() will not block # pyl.ioff() # internal imports from utils.signalsmooth import smooth from plotting.misc import getPlotValues, getFigAx, updateSubplots from geodata.base import Variable from geodata.misc import AxisError, ListError #import pdb #pdb.set_trace() def linePlot(varlist, ax=None, fig=None, linestyles=None, varatts=None, legend=None, xline=None, yline=None, title=None, flipxy=None, xlabel=None, ylabel=None, xlim=None, ylim=None, lsmooth=False, lprint=False, **kwargs): ''' A function to draw a list of 1D variables into an axes, and annotate the plot based on variable properties. ''' warn('Deprecated function: use Figure or Axes class methods.') # create axes, if necessary if ax is None: if fig is None: fig,ax = getFigAx(1) # single panel else: ax = fig.axes[0] # varlist is the list of variable objects that are to be plotted #print varlist if isinstance(varlist,Variable): varlist = [varlist] elif not isinstance(varlist,(tuple,list)) or not all([isinstance(var,Variable) for var in varlist]): raise TypeError for var in varlist: var.squeeze() # remove singleton dimensions # linestyles is just a list of line styles for each plot if isinstance(linestyles,(str,NoneType)): linestyles = [linestyles]*len(varlist) elif not isinstance(linestyles,(tuple,list)): if not all([isinstance(linestyles,str) for var in varlist]): raise TypeError if len(varlist) != len(linestyles): raise ListError("Failed to match linestyles to varlist!") # varatts are variable-specific attributes that are parsed for special keywords and then passed on to the if varatts is None: varatts = [dict()]*len(varlist) elif isinstance(varatts,dict): tmp = [varatts[var.name] if var.name in varatts else dict() for var in varlist] if any(tmp): varatts = tmp # if any variable names were found else: varatts = [varatts]*len(varlist) # assume it is one varatts dict, which will be used for all variables elif not isinstance(varatts,(tuple,list)): raise TypeError if not all([isinstance(atts,dict) for atts in varatts]): raise TypeError # check axis: they need to have only one axes, which has to be the same for all! if len(varatts) != len(varlist): raise ListError("Failed to match varatts to varlist!") for var in varlist: if var.ndim > 1: raise AxisError("Variable '{}' has more than one dimension; consider squeezing.".format(var.name)) elif var.ndim == 0: raise AxisError("Variable '{}' is a scalar; consider display as a line.".format(var.name)) # loop over variables plts = []; varname = None; varunits = None; axname = None; axunits = None # list of plot handles for var,linestyle,varatt in zip(varlist,linestyles,varatts): varax = var.axes[0] # scale axis and variable values axe, axunits, axname = getPlotValues(varax, checkunits=axunits, checkname=None) val, varunits, varname = getPlotValues(var, checkunits=varunits, checkname=None) # variable and axis scaling is not always independent... if var.plot is not None and varax.plot is not None: if 'preserve' in var.plot and 'scalefactor' in varax.plot: if varax.units != axunits and var.plot.preserve == 'area': val /= varax.plot.scalefactor # figure out keyword options kwatts = kwargs.copy(); kwatts.update(varatt) # join individual and common attributes if 'label' not in kwatts: kwatts['label'] = var.name # default label: variable name # N.B.: other scaling behavior could be added here if lprint: print(varname, varunits, val.mean()) if lsmooth: val = smooth(val) # figure out orientation if flipxy: xx,yy = val, axe else: xx,yy = axe, val # call plot function if linestyle is None: plts.append(ax.plot(xx, yy, **kwatts)[0]) else: plts.append(ax.plot(xx, yy, linestyle, **kwatts)[0]) # set axes limits if isinstance(xlim,(list,tuple)) and len(xlim)==2: ax.set_xlim(*xlim) elif xlim is not None: raise TypeError if isinstance(ylim,(list,tuple)) and len(ylim)==2: ax.set_ylim(*ylim) elif ylim is not None: raise TypeError # set title if title is not None: ax.set_title(title, dict(fontsize='medium')) pos = ax.get_position() pos = pos.from_bounds(x0=pos.x0, y0=pos.y0, width=pos.width, height=pos.height-0.03) ax.set_position(pos) # set axes labels if flipxy: xname,xunits,yname,yunits = varname,varunits,axname,axunits else: xname,xunits,yname,yunits = axname,axunits,varname,varunits if not xlabel: xlabel = '{0:s} [{1:s}]'.format(xname,xunits) if xunits else '{0:s}'.format(xname) else: xlabel = xlabel.format(xname,xunits) if not ylabel: ylabel = '{0:s} [{1:s}]'.format(yname,yunits) if yunits else '{0:s}'.format(yname) else: ylabel = ylabel.format(yname,yunits) # a typical custom label that makes use of the units would look like this: 'custom label [{1:s}]', # where {} will be replaced by the appropriate default units (which have to be the same anyway) xpad = 2; xticks = ax.get_xaxis().get_ticklabels() ypad = -2; yticks = ax.get_yaxis().get_ticklabels() # len(xticks) > 0 is necessary to avoid errors with AxesGrid, which removes invisible tick labels if len(xticks) > 0 and xticks[-1].get_visible(): ax.set_xlabel(xlabel, labelpad=xpad) elif len(yticks) > 0 and not title: yticks[0].set_visible(False) # avoid overlap if len(yticks) > 0 and yticks[-1].get_visible(): ax.set_ylabel(ylabel, labelpad=ypad) elif len(xticks) > 0: xticks[0].set_visible(False) # avoid overlap # make monthly ticks if axname == 'time' and axunits == 'month': ax.xaxis.set_minor_locator(mpl.ticker.AutoMinorLocator(2)) # ax.minorticks_on() # add legend if legend: legatts = dict() if ax.get_yaxis().get_label(): legatts['fontsize'] = ax.get_yaxis().get_label().get_fontsize() if isinstance(legend,dict): legatts.update(legend) elif isinstance(legend,(int,np.integer,float,np.inexact)): legatts['loc'] = legend ax.legend(**legatts) # add orientation lines if isinstance(xline,(int,np.integer,float,np.inexact)): ax.axhline(y=xline, color='black') elif isinstance(xline,dict): ax.axhline(**xline) if isinstance(yline,(int,np.integer,float,np.inexact)): ax.axvline(x=yline, color='black') elif isinstance(xline,dict): ax.axvline(**yline) # return handle return plts # add common/shared legend to a multi-panel plot def addSharedLegend(fig, plts=None, legs=None, fontsize=None, **kwargs): ''' add a common/shared legend to a multi-panel plot ''' # complete input warn('Deprecated function: use Figure or Axes class methods.') if legs is None: legs = [plt.get_label() for plt in plts] elif not isinstance(legs, (list,tuple)): raise TypeError if not isinstance(plts, (list,tuple,NoneType)): raise TypeError # figure out fontsize and row numbers fontsize = fontsize or fig.axes[0].get_yaxis().get_label().get_fontsize() # or fig._suptitle.get_fontsize() nlen = len(plts) if plts else len(legs) if fontsize > 11: ncols = 2 if nlen == 4 else 3 else: ncols = 3 if nlen == 6 else 4 # make room for legend leghgt = np.ceil(nlen/ncols) * fontsize + 0.055 ax = fig.add_axes([0, 0, 1,leghgt]) # new axes to hold legend, with some attributes ax.set_frame_on(False); ax.axes.get_yaxis().set_visible(False); ax.axes.get_xaxis().set_visible(False) fig = updateSubplots(fig, mode='shift', bottom=leghgt) # shift bottom upwards # define legend parameters legargs = dict(loc=10, ncol=ncols, borderaxespad=0., fontsize=fontsize, frameon=True, labelspacing=0.1, handlelength=1.3, handletextpad=0.3, fancybox=True) legargs.update(kwargs) # create legend and return handle if plts: legend = ax.legend(plts, legs, **legargs) else: legend = ax.legend(legs, **legargs) return legend # plots with error shading def addErrorPatch(ax, var, err, color=None, axis=None, xerr=True, alpha=0.25, check=False, cap=-1): from numpy import append, where, isnan from matplotlib.patches import Polygon warn('Deprecated function: use Figure or Axes class methods.') if isinstance(var,Variable): if axis is None and var.ndim > 1: raise AxisError x = var.getAxis(axis).getArray() y = var.getArray(); if isinstance(err,Variable): e = err.getArray() else: e = err else: if axis is None: raise ValueError y = axis; x = var; e = err if check: e = where(isnan(e),0,e) if cap > 0: e = where(e>cap,0,e) if xerr: ix = append(x-e,(x+e)[::-1]) iy = append(y,y[::-1]) else: ix = append(y,y[::-1]) iy = append(x-e,(x+e)[::-1]) if color is None: raise NotImplementedError # should take color from plot line (variable) patch = Polygon(list(zip(ix,iy)), alpha=alpha, facecolor=color, edgecolor=color) ax.add_patch(patch) return patch if __name__ == '__main__': pass
gpl-3.0
joshfuchs/ZZCeti_fitting
finegrid.py
1
3310
""" Written March 2015 @author: Josh T Fuchs """ import numpy as np import matplotlib.pyplot as plt import os import sys from intmodels import models #This interpolates the models to a small grid ''' :DESCRIPTION: Takes the best Teff and log(g) from the fitting to the coarse grid. Sets up ranges and values to interpolate the grid to smaller Teff and log(g) spacing. Calls intmodels.py that does the actual interpolation. :INPUTS: bestT: integer, best-fitting Teff from the coarse grid bestg: integer, best-fitting log(g) from the coarse grid. In format: log(g) = 8.0 as bestg = 800 ''' script, midt, midg = sys.argv midt = int(midt)#12500 midg = int(midg)#800 #Choose coarse models to import for interpolation. This is for getting finer log(g) #For model spacings of 250 K and .25 logg #testt = [midt-500,midt-250,midt,midt+250,midt+500] #testg = [midg-50,midg-25,midg,midg+25,midg+50] #Define coarse model spacings of 100 K and .1 logg testt, testg = [], [] for n in range(51): testt.append(midt-2500+100*n) for m in range(11): testg.append(midg-50+10*m) #print testt #print testg #exit() #Set up finer grid for log(g) #Set final number of models you want numberg = range(21) gridg = np.empty(len(numberg)) for n in numberg: gridg[n] = (midg/100.-0.50 + 0.05*n) #############(midg/100.-0.5 + 0.005*n) (midg/100.-0.25+0.05*n) #Begin iterating over different Teffs to get finer log(g)'s for i in testt: print '' print 'Now starting with Teffs of ',i filenames = ['da' + str(i) + '_' + str(x) + '.dk' for x in testg] grid = gridg case = 0 # Use 0 for log(g) interp. and 1 for Teff interp. Just a binary switch. models(filenames,grid,case,midt,midg) print 'Made it back!' print 'Done with all Teffs.' #Now we want to create our finer grid of Teff. We need to read in our interpolated models in logg #gridg is our set of logg's #Set up new grid for new Teffs numbert = range(501) gridt = np.empty(len(numbert)) for n in numbert: gridt[n] = midt-2500.+10.*n #########midt-250.+10*n #Begin iterating over different logg's to get finer Teffs for i in gridg: print '' print 'Now starting with log(g) of ',i intlogg = str(i * 1000.) intlogg = intlogg[:-2] #filenames = ['da' + str(testt[0]) + '_' + intlogg + '.jf','da' + str(testt[1]) + '_' + intlogg + '.jf','da' + str(testt[2]) + '_' + intlogg + '.jf','da' + str(testt[3]) + '_' + intlogg + '.jf','da' + str(testt[4]) + '_' + intlogg + '.jf'] filenames = ['da' + str(x) + '_' + intlogg + '.jf' for x in testt] grid = gridt case = 1 # Use 0 for log(g) interp. and 1 for Teff interp. Just a binary switch. models(filenames,grid,case,midt,midg) print 'Made it back!' print 'Done with all the log(g)s.' ''' #Save file names to interpolated_names.txt print 'Saving file names to interpolated_names.txt.' lowt = midt - 1500 lowg = midg*10 - 250 ranget = 10*np.arange(301)#steps of 5 in Teff rangeg = 50*np.arange(11)#steps of 0.005 in log(g) f = open('interpolated_names.txt','a') for y in ranget: teffwrite = lowt + y for x in rangeg: loggwrite = lowg + x file = 'da' + str(teffwrite) + '_' + str(loggwrite) + '.jf' f.write(file + '\n') f.close() ''' print 'File saved.' print 'The finer grid is complete!'
mit
jseabold/scikit-learn
examples/cluster/plot_agglomerative_clustering.py
343
2931
""" Agglomerative clustering with and without structure =================================================== This example shows the effect of imposing a connectivity graph to capture local structure in the data. The graph is simply the graph of 20 nearest neighbors. Two consequences of imposing a connectivity can be seen. First clustering with a connectivity matrix is much faster. Second, when using a connectivity matrix, average and complete linkage are unstable and tend to create a few clusters that grow very quickly. Indeed, average and complete linkage fight this percolation behavior by considering all the distances between two clusters when merging them. The connectivity graph breaks this mechanism. This effect is more pronounced for very sparse graphs (try decreasing the number of neighbors in kneighbors_graph) and with complete linkage. In particular, having a very small number of neighbors in the graph, imposes a geometry that is close to that of single linkage, which is well known to have this percolation instability. """ # Authors: Gael Varoquaux, Nelle Varoquaux # License: BSD 3 clause import time import matplotlib.pyplot as plt import numpy as np from sklearn.cluster import AgglomerativeClustering from sklearn.neighbors import kneighbors_graph # Generate sample data n_samples = 1500 np.random.seed(0) t = 1.5 * np.pi * (1 + 3 * np.random.rand(1, n_samples)) x = t * np.cos(t) y = t * np.sin(t) X = np.concatenate((x, y)) X += .7 * np.random.randn(2, n_samples) X = X.T # Create a graph capturing local connectivity. Larger number of neighbors # will give more homogeneous clusters to the cost of computation # time. A very large number of neighbors gives more evenly distributed # cluster sizes, but may not impose the local manifold structure of # the data knn_graph = kneighbors_graph(X, 30, include_self=False) for connectivity in (None, knn_graph): for n_clusters in (30, 3): plt.figure(figsize=(10, 4)) for index, linkage in enumerate(('average', 'complete', 'ward')): plt.subplot(1, 3, index + 1) model = AgglomerativeClustering(linkage=linkage, connectivity=connectivity, n_clusters=n_clusters) t0 = time.time() model.fit(X) elapsed_time = time.time() - t0 plt.scatter(X[:, 0], X[:, 1], c=model.labels_, cmap=plt.cm.spectral) plt.title('linkage=%s (time %.2fs)' % (linkage, elapsed_time), fontdict=dict(verticalalignment='top')) plt.axis('equal') plt.axis('off') plt.subplots_adjust(bottom=0, top=.89, wspace=0, left=0, right=1) plt.suptitle('n_cluster=%i, connectivity=%r' % (n_clusters, connectivity is not None), size=17) plt.show()
bsd-3-clause
jaeilepp/mne-python
mne/tests/test_cov.py
1
24821
# Author: Alexandre Gramfort <[email protected]> # Denis Engemann <[email protected]> # # License: BSD (3-clause) import os.path as op from nose.tools import assert_true from numpy.testing import (assert_array_almost_equal, assert_array_equal, assert_equal, assert_allclose) from nose.tools import assert_raises import numpy as np from scipy import linalg import warnings import itertools as itt from mne.cov import (regularize, whiten_evoked, _estimate_rank_meeg_cov, _auto_low_rank_model, _apply_scaling_cov, _undo_scaling_cov, prepare_noise_cov, compute_whitener, _apply_scaling_array, _undo_scaling_array) from mne import (read_cov, write_cov, Epochs, merge_events, find_events, compute_raw_covariance, compute_covariance, read_evokeds, compute_proj_raw, pick_channels_cov, pick_types, pick_info, make_ad_hoc_cov) from mne.io import read_raw_fif, RawArray, read_info from mne.tests.common import assert_naming, assert_snr from mne.utils import (_TempDir, slow_test, requires_sklearn_0_15, run_tests_if_main) from mne.io.proc_history import _get_sss_rank from mne.io.pick import channel_type, _picks_by_type warnings.simplefilter('always') # enable b/c these tests throw warnings base_dir = op.join(op.dirname(__file__), '..', 'io', 'tests', 'data') cov_fname = op.join(base_dir, 'test-cov.fif') cov_gz_fname = op.join(base_dir, 'test-cov.fif.gz') cov_km_fname = op.join(base_dir, 'test-km-cov.fif') raw_fname = op.join(base_dir, 'test_raw.fif') ave_fname = op.join(base_dir, 'test-ave.fif') erm_cov_fname = op.join(base_dir, 'test_erm-cov.fif') hp_fif_fname = op.join(base_dir, 'test_chpi_raw_sss.fif') def test_cov_mismatch(): """Test estimation with MEG<->Head mismatch.""" raw = read_raw_fif(raw_fname).crop(0, 5).load_data() events = find_events(raw, stim_channel='STI 014') raw.pick_channels(raw.ch_names[:5]) raw.add_proj([], remove_existing=True) epochs = Epochs(raw, events, None, tmin=-0.2, tmax=0., preload=True) for kind in ('shift', 'None'): epochs_2 = epochs.copy() # This should be fine with warnings.catch_warnings(record=True) as w: compute_covariance([epochs, epochs_2]) assert_equal(len(w), 0) if kind == 'shift': epochs_2.info['dev_head_t']['trans'][:3, 3] += 0.001 else: # None epochs_2.info['dev_head_t'] = None assert_raises(ValueError, compute_covariance, [epochs, epochs_2]) assert_equal(len(w), 0) compute_covariance([epochs, epochs_2], on_mismatch='ignore') assert_equal(len(w), 0) compute_covariance([epochs, epochs_2], on_mismatch='warn') assert_raises(ValueError, compute_covariance, epochs, on_mismatch='x') assert_true(any('transform mismatch' in str(ww.message) for ww in w)) # This should work epochs.info['dev_head_t'] = None epochs_2.info['dev_head_t'] = None compute_covariance([epochs, epochs_2], method=None) def test_cov_order(): """Test covariance ordering.""" info = read_info(raw_fname) # add MEG channel with low enough index number to affect EEG if # order is incorrect info['bads'] += ['MEG 0113'] ch_names = [info['ch_names'][pick] for pick in pick_types(info, meg=False, eeg=True)] cov = read_cov(cov_fname) # no avg ref present warning prepare_noise_cov(cov, info, ch_names, verbose='error') # big reordering cov_reorder = cov.copy() order = np.random.RandomState(0).permutation(np.arange(len(cov.ch_names))) cov_reorder['names'] = [cov['names'][ii] for ii in order] cov_reorder['data'] = cov['data'][order][:, order] # Make sure we did this properly _assert_reorder(cov_reorder, cov, order) # Now check some functions that should get the same result for both # regularize cov_reg = regularize(cov, info) cov_reg_reorder = regularize(cov_reorder, info) _assert_reorder(cov_reg_reorder, cov_reg, order) # prepare_noise_cov cov_prep = prepare_noise_cov(cov, info, ch_names) cov_prep_reorder = prepare_noise_cov(cov, info, ch_names) _assert_reorder(cov_prep, cov_prep_reorder, order=np.arange(len(cov_prep['names']))) # compute_whitener whitener, w_ch_names = compute_whitener(cov, info) whitener_2, w_ch_names_2 = compute_whitener(cov_reorder, info) assert_array_equal(w_ch_names_2, w_ch_names) assert_allclose(whitener_2, whitener) # whiten_evoked evoked = read_evokeds(ave_fname)[0] evoked_white = whiten_evoked(evoked, cov) evoked_white_2 = whiten_evoked(evoked, cov_reorder) assert_allclose(evoked_white_2.data, evoked_white.data) def _assert_reorder(cov_new, cov_orig, order): """Check that we get the same result under reordering.""" inv_order = np.argsort(order) assert_array_equal([cov_new['names'][ii] for ii in inv_order], cov_orig['names']) assert_allclose(cov_new['data'][inv_order][:, inv_order], cov_orig['data'], atol=1e-20) def test_ad_hoc_cov(): """Test ad hoc cov creation and I/O.""" tempdir = _TempDir() out_fname = op.join(tempdir, 'test-cov.fif') evoked = read_evokeds(ave_fname)[0] cov = make_ad_hoc_cov(evoked.info) cov.save(out_fname) assert_true('Covariance' in repr(cov)) cov2 = read_cov(out_fname) assert_array_almost_equal(cov['data'], cov2['data']) def test_io_cov(): """Test IO for noise covariance matrices.""" tempdir = _TempDir() cov = read_cov(cov_fname) cov['method'] = 'empirical' cov['loglik'] = -np.inf cov.save(op.join(tempdir, 'test-cov.fif')) cov2 = read_cov(op.join(tempdir, 'test-cov.fif')) assert_array_almost_equal(cov.data, cov2.data) assert_equal(cov['method'], cov2['method']) assert_equal(cov['loglik'], cov2['loglik']) assert_true('Covariance' in repr(cov)) cov2 = read_cov(cov_gz_fname) assert_array_almost_equal(cov.data, cov2.data) cov2.save(op.join(tempdir, 'test-cov.fif.gz')) cov2 = read_cov(op.join(tempdir, 'test-cov.fif.gz')) assert_array_almost_equal(cov.data, cov2.data) cov['bads'] = ['EEG 039'] cov_sel = pick_channels_cov(cov, exclude=cov['bads']) assert_true(cov_sel['dim'] == (len(cov['data']) - len(cov['bads']))) assert_true(cov_sel['data'].shape == (cov_sel['dim'], cov_sel['dim'])) cov_sel.save(op.join(tempdir, 'test-cov.fif')) cov2 = read_cov(cov_gz_fname) assert_array_almost_equal(cov.data, cov2.data) cov2.save(op.join(tempdir, 'test-cov.fif.gz')) cov2 = read_cov(op.join(tempdir, 'test-cov.fif.gz')) assert_array_almost_equal(cov.data, cov2.data) # test warnings on bad filenames with warnings.catch_warnings(record=True) as w: warnings.simplefilter('always') cov_badname = op.join(tempdir, 'test-bad-name.fif.gz') write_cov(cov_badname, cov) read_cov(cov_badname) assert_naming(w, 'test_cov.py', 2) def test_cov_estimation_on_raw(): """Test estimation from raw (typically empty room).""" tempdir = _TempDir() raw = read_raw_fif(raw_fname, preload=True) cov_mne = read_cov(erm_cov_fname) # The pure-string uses the more efficient numpy-based method, the # the list gets triaged to compute_covariance (should be equivalent # but use more memory) for method in (None, ['empirical']): # None is cast to 'empirical' cov = compute_raw_covariance(raw, tstep=None, method=method) assert_equal(cov.ch_names, cov_mne.ch_names) assert_equal(cov.nfree, cov_mne.nfree) assert_snr(cov.data, cov_mne.data, 1e4) cov = compute_raw_covariance(raw, method=method) # tstep=0.2 (default) assert_equal(cov.nfree, cov_mne.nfree - 119) # cutoff some samples assert_snr(cov.data, cov_mne.data, 1e2) # test IO when computation done in Python cov.save(op.join(tempdir, 'test-cov.fif')) # test saving cov_read = read_cov(op.join(tempdir, 'test-cov.fif')) assert_true(cov_read.ch_names == cov.ch_names) assert_true(cov_read.nfree == cov.nfree) assert_array_almost_equal(cov.data, cov_read.data) # test with a subset of channels raw_pick = raw.copy().pick_channels(raw.ch_names[:5]) raw_pick.info.normalize_proj() cov = compute_raw_covariance(raw_pick, tstep=None, method=method) assert_true(cov_mne.ch_names[:5] == cov.ch_names) assert_snr(cov.data, cov_mne.data[:5, :5], 1e4) cov = compute_raw_covariance(raw_pick, method=method) assert_snr(cov.data, cov_mne.data[:5, :5], 90) # cutoff samps # make sure we get a warning with too short a segment raw_2 = read_raw_fif(raw_fname).crop(0, 1) with warnings.catch_warnings(record=True) as w: warnings.simplefilter('always') cov = compute_raw_covariance(raw_2, method=method) assert_true(any('Too few samples' in str(ww.message) for ww in w)) # no epochs found due to rejection assert_raises(ValueError, compute_raw_covariance, raw, tstep=None, method='empirical', reject=dict(eog=200e-6)) # but this should work cov = compute_raw_covariance(raw.copy().crop(0, 10.), tstep=None, method=method, reject=dict(eog=1000e-6)) @slow_test @requires_sklearn_0_15 def test_cov_estimation_on_raw_reg(): """Test estimation from raw with regularization.""" raw = read_raw_fif(raw_fname, preload=True) raw.info['sfreq'] /= 10. raw = RawArray(raw._data[:, ::10].copy(), raw.info) # decimate for speed cov_mne = read_cov(erm_cov_fname) with warnings.catch_warnings(record=True): # too few samples warnings.simplefilter('always') # XXX don't use "shrunk" here, for some reason it makes Travis 2.7 # hang... "diagonal_fixed" is much faster. Use long epochs for speed. cov = compute_raw_covariance(raw, tstep=5., method='diagonal_fixed') assert_snr(cov.data, cov_mne.data, 5) def _assert_cov(cov, cov_desired, tol=0.005, nfree=True): assert_equal(cov.ch_names, cov_desired.ch_names) err = (linalg.norm(cov.data - cov_desired.data, ord='fro') / linalg.norm(cov.data, ord='fro')) assert_true(err < tol, msg='%s >= %s' % (err, tol)) if nfree: assert_equal(cov.nfree, cov_desired.nfree) @slow_test def test_cov_estimation_with_triggers(): """Test estimation from raw with triggers.""" tempdir = _TempDir() raw = read_raw_fif(raw_fname) raw.set_eeg_reference(projection=True).load_data() events = find_events(raw, stim_channel='STI 014') event_ids = [1, 2, 3, 4] reject = dict(grad=10000e-13, mag=4e-12, eeg=80e-6, eog=150e-6) # cov with merged events and keep_sample_mean=True events_merged = merge_events(events, event_ids, 1234) epochs = Epochs(raw, events_merged, 1234, tmin=-0.2, tmax=0, baseline=(-0.2, -0.1), proj=True, reject=reject, preload=True) cov = compute_covariance(epochs, keep_sample_mean=True) _assert_cov(cov, read_cov(cov_km_fname)) # Test with tmin and tmax (different but not too much) cov_tmin_tmax = compute_covariance(epochs, tmin=-0.19, tmax=-0.01) assert_true(np.all(cov.data != cov_tmin_tmax.data)) err = (linalg.norm(cov.data - cov_tmin_tmax.data, ord='fro') / linalg.norm(cov_tmin_tmax.data, ord='fro')) assert_true(err < 0.05, msg=err) # cov using a list of epochs and keep_sample_mean=True epochs = [Epochs(raw, events, ev_id, tmin=-0.2, tmax=0, baseline=(-0.2, -0.1), proj=True, reject=reject) for ev_id in event_ids] cov2 = compute_covariance(epochs, keep_sample_mean=True) assert_array_almost_equal(cov.data, cov2.data) assert_true(cov.ch_names == cov2.ch_names) # cov with keep_sample_mean=False using a list of epochs cov = compute_covariance(epochs, keep_sample_mean=False) _assert_cov(cov, read_cov(cov_fname), nfree=False) method_params = {'empirical': {'assume_centered': False}} assert_raises(ValueError, compute_covariance, epochs, keep_sample_mean=False, method_params=method_params) assert_raises(ValueError, compute_covariance, epochs, keep_sample_mean=False, method='factor_analysis') # test IO when computation done in Python cov.save(op.join(tempdir, 'test-cov.fif')) # test saving cov_read = read_cov(op.join(tempdir, 'test-cov.fif')) _assert_cov(cov, cov_read, 1e-5) # cov with list of epochs with different projectors epochs = [Epochs(raw, events[:1], None, tmin=-0.2, tmax=0, baseline=(-0.2, -0.1), proj=True), Epochs(raw, events[:1], None, tmin=-0.2, tmax=0, baseline=(-0.2, -0.1), proj=False)] # these should fail assert_raises(ValueError, compute_covariance, epochs) assert_raises(ValueError, compute_covariance, epochs, projs=None) # these should work, but won't be equal to above with warnings.catch_warnings(record=True) as w: # too few samples warning warnings.simplefilter('always') cov = compute_covariance(epochs, projs=epochs[0].info['projs']) cov = compute_covariance(epochs, projs=[]) assert_equal(len(w), 2) # test new dict support epochs = Epochs(raw, events, dict(a=1, b=2, c=3, d=4), tmin=-0.01, tmax=0, proj=True, reject=reject, preload=True) with warnings.catch_warnings(record=True): # samples compute_covariance(epochs) # projs checking compute_covariance(epochs, projs=[]) assert_raises(TypeError, compute_covariance, epochs, projs='foo') assert_raises(TypeError, compute_covariance, epochs, projs=['foo']) def test_arithmetic_cov(): """Test arithmetic with noise covariance matrices.""" cov = read_cov(cov_fname) cov_sum = cov + cov assert_array_almost_equal(2 * cov.nfree, cov_sum.nfree) assert_array_almost_equal(2 * cov.data, cov_sum.data) assert_true(cov.ch_names == cov_sum.ch_names) cov += cov assert_array_almost_equal(cov_sum.nfree, cov.nfree) assert_array_almost_equal(cov_sum.data, cov.data) assert_true(cov_sum.ch_names == cov.ch_names) def test_regularize_cov(): """Test cov regularization.""" raw = read_raw_fif(raw_fname) raw.info['bads'].append(raw.ch_names[0]) # test with bad channels noise_cov = read_cov(cov_fname) # Regularize noise cov reg_noise_cov = regularize(noise_cov, raw.info, mag=0.1, grad=0.1, eeg=0.1, proj=True, exclude='bads') assert_true(noise_cov['dim'] == reg_noise_cov['dim']) assert_true(noise_cov['data'].shape == reg_noise_cov['data'].shape) assert_true(np.mean(noise_cov['data'] < reg_noise_cov['data']) < 0.08) def test_whiten_evoked(): """Test whitening of evoked data.""" evoked = read_evokeds(ave_fname, condition=0, baseline=(None, 0), proj=True) cov = read_cov(cov_fname) ########################################################################### # Show result picks = pick_types(evoked.info, meg=True, eeg=True, ref_meg=False, exclude='bads') noise_cov = regularize(cov, evoked.info, grad=0.1, mag=0.1, eeg=0.1, exclude='bads') evoked_white = whiten_evoked(evoked, noise_cov, picks, diag=True) whiten_baseline_data = evoked_white.data[picks][:, evoked.times < 0] mean_baseline = np.mean(np.abs(whiten_baseline_data), axis=1) assert_true(np.all(mean_baseline < 1.)) assert_true(np.all(mean_baseline > 0.2)) # degenerate cov_bad = pick_channels_cov(cov, include=evoked.ch_names[:10]) assert_raises(RuntimeError, whiten_evoked, evoked, cov_bad, picks) @slow_test def test_rank(): """Test cov rank estimation.""" # Test that our rank estimation works properly on a simple case evoked = read_evokeds(ave_fname, condition=0, baseline=(None, 0), proj=False) cov = read_cov(cov_fname) ch_names = [ch for ch in evoked.info['ch_names'] if '053' not in ch and ch.startswith('EEG')] cov = prepare_noise_cov(cov, evoked.info, ch_names, None) assert_equal(cov['eig'][0], 0.) # avg projector should set this to zero assert_true((cov['eig'][1:] > 0).all()) # all else should be > 0 # Now do some more comprehensive tests raw_sample = read_raw_fif(raw_fname) raw_sss = read_raw_fif(hp_fif_fname) raw_sss.add_proj(compute_proj_raw(raw_sss)) cov_sample = compute_raw_covariance(raw_sample) cov_sample_proj = compute_raw_covariance( raw_sample.copy().apply_proj()) cov_sss = compute_raw_covariance(raw_sss) cov_sss_proj = compute_raw_covariance( raw_sss.copy().apply_proj()) picks_all_sample = pick_types(raw_sample.info, meg=True, eeg=True) picks_all_sss = pick_types(raw_sss.info, meg=True, eeg=True) info_sample = pick_info(raw_sample.info, picks_all_sample) picks_stack_sample = [('eeg', pick_types(info_sample, meg=False, eeg=True))] picks_stack_sample += [('meg', pick_types(info_sample, meg=True))] picks_stack_sample += [('all', pick_types(info_sample, meg=True, eeg=True))] info_sss = pick_info(raw_sss.info, picks_all_sss) picks_stack_somato = [('eeg', pick_types(info_sss, meg=False, eeg=True))] picks_stack_somato += [('meg', pick_types(info_sss, meg=True))] picks_stack_somato += [('all', pick_types(info_sss, meg=True, eeg=True))] iter_tests = list(itt.product( [(cov_sample, picks_stack_sample, info_sample), (cov_sample_proj, picks_stack_sample, info_sample), (cov_sss, picks_stack_somato, info_sss), (cov_sss_proj, picks_stack_somato, info_sss)], # sss [dict(mag=1e15, grad=1e13, eeg=1e6)] )) for (cov, picks_list, this_info), scalings in iter_tests: for ch_type, picks in picks_list: this_very_info = pick_info(this_info, picks) # compute subset of projs this_projs = [c['active'] and len(set(c['data']['col_names']) .intersection(set(this_very_info['ch_names']))) > 0 for c in cov['projs']] n_projs = sum(this_projs) # count channel types ch_types = [channel_type(this_very_info, idx) for idx in range(len(picks))] n_eeg, n_mag, n_grad = [ch_types.count(k) for k in ['eeg', 'mag', 'grad']] n_meg = n_mag + n_grad if ch_type in ('all', 'eeg'): n_projs_eeg = 1 else: n_projs_eeg = 0 # check sss if len(this_very_info['proc_history']) > 0: mf = this_very_info['proc_history'][0]['max_info'] n_free = _get_sss_rank(mf) if 'mag' not in ch_types and 'grad' not in ch_types: n_free = 0 # - n_projs XXX clarify expected_rank = n_free + n_eeg if n_projs > 0 and ch_type in ('all', 'eeg'): expected_rank -= n_projs_eeg else: expected_rank = n_meg + n_eeg - n_projs C = cov['data'][np.ix_(picks, picks)] est_rank = _estimate_rank_meeg_cov(C, this_very_info, scalings=scalings) assert_equal(expected_rank, est_rank) def test_cov_scaling(): """Test rescaling covs""" evoked = read_evokeds(ave_fname, condition=0, baseline=(None, 0), proj=True) cov = read_cov(cov_fname)['data'] cov2 = read_cov(cov_fname)['data'] assert_array_equal(cov, cov2) evoked.pick_channels([evoked.ch_names[k] for k in pick_types( evoked.info, meg=True, eeg=True )]) picks_list = _picks_by_type(evoked.info) scalings = dict(mag=1e15, grad=1e13, eeg=1e6) _apply_scaling_cov(cov2, picks_list, scalings=scalings) _apply_scaling_cov(cov, picks_list, scalings=scalings) assert_array_equal(cov, cov2) assert_true(cov.max() > 1) _undo_scaling_cov(cov2, picks_list, scalings=scalings) _undo_scaling_cov(cov, picks_list, scalings=scalings) assert_array_equal(cov, cov2) assert_true(cov.max() < 1) data = evoked.data.copy() _apply_scaling_array(data, picks_list, scalings=scalings) _undo_scaling_array(data, picks_list, scalings=scalings) assert_allclose(data, evoked.data, atol=1e-20) @requires_sklearn_0_15 def test_auto_low_rank(): """Test probabilistic low rank estimators.""" n_samples, n_features, rank = 400, 10, 5 sigma = 0.1 def get_data(n_samples, n_features, rank, sigma): rng = np.random.RandomState(42) W = rng.randn(n_features, n_features) X = rng.randn(n_samples, rank) U, _, _ = linalg.svd(W.copy()) X = np.dot(X, U[:, :rank].T) sigmas = sigma * rng.rand(n_features) + sigma / 2. X += rng.randn(n_samples, n_features) * sigmas return X X = get_data(n_samples=n_samples, n_features=n_features, rank=rank, sigma=sigma) method_params = {'iter_n_components': [4, 5, 6]} cv = 3 n_jobs = 1 mode = 'factor_analysis' rescale = 1e8 X *= rescale est, info = _auto_low_rank_model(X, mode=mode, n_jobs=n_jobs, method_params=method_params, cv=cv) assert_equal(info['best'], rank) X = get_data(n_samples=n_samples, n_features=n_features, rank=rank, sigma=sigma) method_params = {'iter_n_components': [n_features + 5]} msg = ('You are trying to estimate %i components on matrix ' 'with %i features.') with warnings.catch_warnings(record=True) as w: warnings.simplefilter('always') _auto_low_rank_model(X, mode=mode, n_jobs=n_jobs, method_params=method_params, cv=cv) assert_equal(len(w), 1) assert_equal(msg % (n_features + 5, n_features), '%s' % w[0].message) method_params = {'iter_n_components': [n_features + 5]} assert_raises(ValueError, _auto_low_rank_model, X, mode='foo', n_jobs=n_jobs, method_params=method_params, cv=cv) @slow_test @requires_sklearn_0_15 def test_compute_covariance_auto_reg(): """Test automated regularization.""" raw = read_raw_fif(raw_fname, preload=True) raw.resample(100, npad='auto') # much faster estimation events = find_events(raw, stim_channel='STI 014') event_ids = [1, 2, 3, 4] reject = dict(mag=4e-12) # cov with merged events and keep_sample_mean=True events_merged = merge_events(events, event_ids, 1234) # we need a few channels for numerical reasons in PCA/FA picks = pick_types(raw.info, meg='mag', eeg=False)[:10] raw.pick_channels([raw.ch_names[pick] for pick in picks]) raw.info.normalize_proj() epochs = Epochs( raw, events_merged, 1234, tmin=-0.2, tmax=0, baseline=(-0.2, -0.1), proj=True, reject=reject, preload=True) epochs = epochs.crop(None, 0)[:10] method_params = dict(factor_analysis=dict(iter_n_components=[3]), pca=dict(iter_n_components=[3])) covs = compute_covariance(epochs, method='auto', method_params=method_params, return_estimators=True) logliks = [c['loglik'] for c in covs] assert_true(np.diff(logliks).max() <= 0) # descending order methods = ['empirical', 'factor_analysis', 'ledoit_wolf', 'pca'] cov3 = compute_covariance(epochs, method=methods, method_params=method_params, projs=None, return_estimators=True) assert_equal(set([c['method'] for c in cov3]), set(methods)) # invalid prespecified method assert_raises(ValueError, compute_covariance, epochs, method='pizza') # invalid scalings assert_raises(ValueError, compute_covariance, epochs, method='shrunk', scalings=dict(misc=123)) run_tests_if_main()
bsd-3-clause
RPGOne/scikit-learn
sklearn/tests/test_kernel_approximation.py
78
7586
import numpy as np from scipy.sparse import csr_matrix from sklearn.utils.testing import assert_array_equal, assert_equal, assert_true from sklearn.utils.testing import assert_not_equal from sklearn.utils.testing import assert_array_almost_equal, assert_raises from sklearn.utils.testing import assert_less_equal from sklearn.metrics.pairwise import kernel_metrics from sklearn.kernel_approximation import RBFSampler from sklearn.kernel_approximation import AdditiveChi2Sampler from sklearn.kernel_approximation import SkewedChi2Sampler from sklearn.kernel_approximation import Nystroem from sklearn.metrics.pairwise import polynomial_kernel, rbf_kernel # generate data rng = np.random.RandomState(0) X = rng.random_sample(size=(300, 50)) Y = rng.random_sample(size=(300, 50)) X /= X.sum(axis=1)[:, np.newaxis] Y /= Y.sum(axis=1)[:, np.newaxis] def test_additive_chi2_sampler(): # test that AdditiveChi2Sampler approximates kernel on random data # compute exact kernel # abbreviations for easier formula X_ = X[:, np.newaxis, :] Y_ = Y[np.newaxis, :, :] large_kernel = 2 * X_ * Y_ / (X_ + Y_) # reduce to n_samples_x x n_samples_y by summing over features kernel = (large_kernel.sum(axis=2)) # approximate kernel mapping transform = AdditiveChi2Sampler(sample_steps=3) X_trans = transform.fit_transform(X) Y_trans = transform.transform(Y) kernel_approx = np.dot(X_trans, Y_trans.T) assert_array_almost_equal(kernel, kernel_approx, 1) X_sp_trans = transform.fit_transform(csr_matrix(X)) Y_sp_trans = transform.transform(csr_matrix(Y)) assert_array_equal(X_trans, X_sp_trans.A) assert_array_equal(Y_trans, Y_sp_trans.A) # test error is raised on negative input Y_neg = Y.copy() Y_neg[0, 0] = -1 assert_raises(ValueError, transform.transform, Y_neg) # test error on invalid sample_steps transform = AdditiveChi2Sampler(sample_steps=4) assert_raises(ValueError, transform.fit, X) # test that the sample interval is set correctly sample_steps_available = [1, 2, 3] for sample_steps in sample_steps_available: # test that the sample_interval is initialized correctly transform = AdditiveChi2Sampler(sample_steps=sample_steps) assert_equal(transform.sample_interval, None) # test that the sample_interval is changed in the fit method transform.fit(X) assert_not_equal(transform.sample_interval_, None) # test that the sample_interval is set correctly sample_interval = 0.3 transform = AdditiveChi2Sampler(sample_steps=4, sample_interval=sample_interval) assert_equal(transform.sample_interval, sample_interval) transform.fit(X) assert_equal(transform.sample_interval_, sample_interval) def test_skewed_chi2_sampler(): # test that RBFSampler approximates kernel on random data # compute exact kernel c = 0.03 # abbreviations for easier formula X_c = (X + c)[:, np.newaxis, :] Y_c = (Y + c)[np.newaxis, :, :] # we do it in log-space in the hope that it's more stable # this array is n_samples_x x n_samples_y big x n_features log_kernel = ((np.log(X_c) / 2.) + (np.log(Y_c) / 2.) + np.log(2.) - np.log(X_c + Y_c)) # reduce to n_samples_x x n_samples_y by summing over features in log-space kernel = np.exp(log_kernel.sum(axis=2)) # approximate kernel mapping transform = SkewedChi2Sampler(skewedness=c, n_components=1000, random_state=42) X_trans = transform.fit_transform(X) Y_trans = transform.transform(Y) kernel_approx = np.dot(X_trans, Y_trans.T) assert_array_almost_equal(kernel, kernel_approx, 1) # test error is raised on negative input Y_neg = Y.copy() Y_neg[0, 0] = -1 assert_raises(ValueError, transform.transform, Y_neg) def test_rbf_sampler(): # test that RBFSampler approximates kernel on random data # compute exact kernel gamma = 10. kernel = rbf_kernel(X, Y, gamma=gamma) # approximate kernel mapping rbf_transform = RBFSampler(gamma=gamma, n_components=1000, random_state=42) X_trans = rbf_transform.fit_transform(X) Y_trans = rbf_transform.transform(Y) kernel_approx = np.dot(X_trans, Y_trans.T) error = kernel - kernel_approx assert_less_equal(np.abs(np.mean(error)), 0.01) # close to unbiased np.abs(error, out=error) assert_less_equal(np.max(error), 0.1) # nothing too far off assert_less_equal(np.mean(error), 0.05) # mean is fairly close def test_input_validation(): # Regression test: kernel approx. transformers should work on lists # No assertions; the old versions would simply crash X = [[1, 2], [3, 4], [5, 6]] AdditiveChi2Sampler().fit(X).transform(X) SkewedChi2Sampler().fit(X).transform(X) RBFSampler().fit(X).transform(X) X = csr_matrix(X) RBFSampler().fit(X).transform(X) def test_nystroem_approximation(): # some basic tests rnd = np.random.RandomState(0) X = rnd.uniform(size=(10, 4)) # With n_components = n_samples this is exact X_transformed = Nystroem(n_components=X.shape[0]).fit_transform(X) K = rbf_kernel(X) assert_array_almost_equal(np.dot(X_transformed, X_transformed.T), K) trans = Nystroem(n_components=2, random_state=rnd) X_transformed = trans.fit(X).transform(X) assert_equal(X_transformed.shape, (X.shape[0], 2)) # test callable kernel linear_kernel = lambda X, Y: np.dot(X, Y.T) trans = Nystroem(n_components=2, kernel=linear_kernel, random_state=rnd) X_transformed = trans.fit(X).transform(X) assert_equal(X_transformed.shape, (X.shape[0], 2)) # test that available kernels fit and transform kernels_available = kernel_metrics() for kern in kernels_available: trans = Nystroem(n_components=2, kernel=kern, random_state=rnd) X_transformed = trans.fit(X).transform(X) assert_equal(X_transformed.shape, (X.shape[0], 2)) def test_nystroem_singular_kernel(): # test that nystroem works with singular kernel matrix rng = np.random.RandomState(0) X = rng.rand(10, 20) X = np.vstack([X] * 2) # duplicate samples gamma = 100 N = Nystroem(gamma=gamma, n_components=X.shape[0]).fit(X) X_transformed = N.transform(X) K = rbf_kernel(X, gamma=gamma) assert_array_almost_equal(K, np.dot(X_transformed, X_transformed.T)) assert_true(np.all(np.isfinite(Y))) def test_nystroem_poly_kernel_params(): # Non-regression: Nystroem should pass other parameters beside gamma. rnd = np.random.RandomState(37) X = rnd.uniform(size=(10, 4)) K = polynomial_kernel(X, degree=3.1, coef0=.1) nystroem = Nystroem(kernel="polynomial", n_components=X.shape[0], degree=3.1, coef0=.1) X_transformed = nystroem.fit_transform(X) assert_array_almost_equal(np.dot(X_transformed, X_transformed.T), K) def test_nystroem_callable(): # Test Nystroem on a callable. rnd = np.random.RandomState(42) n_samples = 10 X = rnd.uniform(size=(n_samples, 4)) def logging_histogram_kernel(x, y, log): """Histogram kernel that writes to a log.""" log.append(1) return np.minimum(x, y).sum() kernel_log = [] X = list(X) # test input validation Nystroem(kernel=logging_histogram_kernel, n_components=(n_samples - 1), kernel_params={'log': kernel_log}).fit(X) assert_equal(len(kernel_log), n_samples * (n_samples - 1) / 2)
bsd-3-clause
zangsir/sms-tools
lectures/06-Harmonic-model/plots-code/monophonic-polyphonic.py
3
2250
import numpy as np import matplotlib.pyplot as plt from scipy.signal import hamming, triang, blackmanharris import sys, os, functools, time sys.path.append(os.path.join(os.path.dirname(os.path.realpath(__file__)), '../../../software/models/')) import sineModel as SM import stft as STFT import utilFunctions as UF plt.figure(1, figsize=(9, 6)) plt.subplot(211) (fs, x) = UF.wavread(os.path.join(os.path.dirname(os.path.realpath(__file__)), '../../../sounds/carnatic.wav')) x1 = x[4.35*fs:] w = np.blackman(1301) N = 2048 H = 250 t = -70 minSineDur = .02 maxnSines = 150 freqDevOffset = 20 freqDevSlope = 0.02 mX, pX = STFT.stftAnal(x, w, N, H) tfreq, tmag, tphase = SM.sineModelAnal(x, fs, w, N, H, t, maxnSines, minSineDur, freqDevOffset, freqDevSlope) maxplotfreq = 3000.0 maxplotbin = int(N*maxplotfreq/fs) numFrames = int(mX[:,0].size) frmTime = H*np.arange(numFrames)/float(fs) binFreq = np.arange(maxplotbin+1)*float(fs)/N plt.pcolormesh(frmTime, binFreq, np.transpose(mX[:,:maxplotbin+1])) plt.autoscale(tight=True) tracks = tfreq*np.less(tfreq, maxplotfreq) tracks[tracks<=0] = np.nan plt.plot(frmTime, tracks, color='k', lw=1.5) plt.autoscale(tight=True) plt.title('mX + sine frequencies (carnatic.wav)') plt.subplot(212) (fs, x) = UF.wavread(os.path.join(os.path.dirname(os.path.realpath(__file__)), '../../../sounds/vignesh.wav')) w = np.blackman(1101) N = 2048 H = 250 t = -90 minSineDur = .1 maxnSines = 200 freqDevOffset = 20 freqDevSlope = 0.02 mX, pX = STFT.stftAnal(x, w, N, H) tfreq, tmag, tphase = SM.sineModelAnal(x, fs, w, N, H, t, maxnSines, minSineDur, freqDevOffset, freqDevSlope) maxplotfreq = 3000.0 maxplotbin = int(N*maxplotfreq/fs) numFrames = int(mX[:,0].size) frmTime = H*np.arange(numFrames)/float(fs) binFreq = np.arange(maxplotbin+1)*float(fs)/N plt.pcolormesh(frmTime, binFreq, np.transpose(mX[:,:maxplotbin+1])) plt.autoscale(tight=True) tracks = tfreq*np.less(tfreq, maxplotfreq) tracks[tracks<=0] = np.nan plt.plot(frmTime, tracks, color='k', lw=1.5) plt.autoscale(tight=True) plt.title('mX + sine frequencies (vignesh.wav)') plt.tight_layout() plt.savefig('monophonic-polyphonic.png') plt.show()
agpl-3.0
mraspaud/dask
dask/array/percentile.py
2
6272
from __future__ import absolute_import, division, print_function from functools import wraps from collections import Iterator import numpy as np from toolz import merge, merge_sorted from .core import Array from ..base import tokenize from .. import sharedict @wraps(np.percentile) def _percentile(a, q, interpolation='linear'): if not len(a): return None if isinstance(q, Iterator): q = list(q) if str(a.dtype) == 'category': result = np.percentile(a.codes, q, interpolation=interpolation) import pandas as pd return pd.Categorical.from_codes(result, a.categories, a.ordered) if np.issubdtype(a.dtype, np.datetime64): a2 = a.astype('i8') result = np.percentile(a2, q, interpolation=interpolation) return result.astype(a.dtype) if not np.issubdtype(a.dtype, np.number): interpolation = 'nearest' return np.percentile(a, q, interpolation=interpolation) def percentile(a, q, interpolation='linear'): """ Approximate percentile of 1-D array See numpy.percentile for more information """ if not a.ndim == 1: raise NotImplementedError( "Percentiles only implemented for 1-d arrays") q = np.array(q) token = tokenize(a, list(q), interpolation) name = 'percentile_chunk-' + token dsk = dict(((name, i), (_percentile, (key), q, interpolation)) for i, key in enumerate(a._keys())) name2 = 'percentile-' + token dsk2 = {(name2, 0): (merge_percentiles, q, [q] * len(a.chunks[0]), sorted(dsk), a.chunks[0], interpolation)} dtype = a.dtype if np.issubdtype(dtype, np.integer): dtype = (np.array([], dtype=dtype) / 0.5).dtype dsk = merge(dsk, dsk2) dsk = sharedict.merge(a.dask, (name2, dsk)) return Array(dsk, name2, chunks=((len(q),),), dtype=dtype) def merge_percentiles(finalq, qs, vals, Ns, interpolation='lower'): """ Combine several percentile calculations of different data. Parameters ---------- finalq : numpy.array Percentiles to compute (must use same scale as ``qs``). qs : sequence of numpy.arrays Percentiles calculated on different sets of data. vals : sequence of numpy.arrays Resulting values associated with percentiles ``qs``. Ns : sequence of integers The number of data elements associated with each data set. interpolation : {'linear', 'lower', 'higher', 'midpoint', 'nearest'} Specify the type of interpolation to use to calculate final percentiles. For more information, see numpy.percentile. Examples -------- >>> finalq = [10, 20, 30, 40, 50, 60, 70, 80] >>> qs = [[20, 40, 60, 80], [20, 40, 60, 80]] >>> vals = [np.array([1, 2, 3, 4]), np.array([10, 11, 12, 13])] >>> Ns = [100, 100] # Both original arrays had 100 elements >>> merge_percentiles(finalq, qs, vals, Ns) array([ 1, 2, 3, 4, 10, 11, 12, 13]) """ if isinstance(finalq, Iterator): finalq = list(finalq) finalq = np.array(finalq) qs = list(map(list, qs)) vals = list(vals) Ns = list(Ns) L = list(zip(*[(q, val, N) for q, val, N in zip(qs, vals, Ns) if N])) if not L: raise ValueError("No non-trivial arrays found") qs, vals, Ns = L # TODO: Perform this check above in percentile once dtype checking is easy # Here we silently change meaning if str(vals[0].dtype) == 'category': result = merge_percentiles(finalq, qs, [v.codes for v in vals], Ns, interpolation) import pandas as pd return pd.Categorical.from_codes(result, vals[0].categories, vals[0].ordered) if not np.issubdtype(vals[0].dtype, np.number): interpolation = 'nearest' if len(vals) != len(qs) or len(Ns) != len(qs): raise ValueError('qs, vals, and Ns parameters must be the same length') # transform qs and Ns into number of observations between percentiles counts = [] for q, N in zip(qs, Ns): count = np.empty(len(q)) count[1:] = np.diff(q) count[0] = q[0] count *= N counts.append(count) # Sort by calculated percentile values, then number of observations. # >95% of the time in this function is spent in `merge_sorted` below. # An alternative that uses numpy sort is shown. It is sometimes # comparable to, but typically slower than, `merge_sorted`. # # >>> A = np.concatenate(map(np.array, map(zip, vals, counts))) # >>> A.sort(0, kind='mergesort') combined_vals_counts = merge_sorted(*map(zip, vals, counts)) combined_vals, combined_counts = zip(*combined_vals_counts) combined_vals = np.array(combined_vals) combined_counts = np.array(combined_counts) # percentile-like, but scaled by total number of observations combined_q = np.cumsum(combined_counts) # rescale finalq percentiles to match combined_q desired_q = finalq * sum(Ns) # the behavior of different interpolation methods should be # investigated further. if interpolation == 'linear': rv = np.interp(desired_q, combined_q, combined_vals) else: left = np.searchsorted(combined_q, desired_q, side='left') right = np.searchsorted(combined_q, desired_q, side='right') - 1 np.minimum(left, len(combined_vals) - 1, left) # don't exceed max index lower = np.minimum(left, right) upper = np.maximum(left, right) if interpolation == 'lower': rv = combined_vals[lower] elif interpolation == 'higher': rv = combined_vals[upper] elif interpolation == 'midpoint': rv = 0.5 * (combined_vals[lower] + combined_vals[upper]) elif interpolation == 'nearest': lower_residual = np.abs(combined_q[lower] - desired_q) upper_residual = np.abs(combined_q[upper] - desired_q) mask = lower_residual > upper_residual index = lower # alias; we no longer need lower index[mask] = upper[mask] rv = combined_vals[index] else: raise ValueError("interpolation can only be 'linear', 'lower', " "'higher', 'midpoint', or 'nearest'") return rv
bsd-3-clause
Vimos/scikit-learn
sklearn/manifold/tests/test_spectral_embedding.py
42
11137
from scipy.sparse import csr_matrix from scipy.sparse import csc_matrix from scipy.sparse import coo_matrix from scipy.linalg import eigh import numpy as np from numpy.testing import assert_array_almost_equal from numpy.testing import assert_array_equal from sklearn.manifold.spectral_embedding_ import SpectralEmbedding from sklearn.manifold.spectral_embedding_ import _graph_is_connected from sklearn.manifold.spectral_embedding_ import _graph_connected_component from sklearn.manifold import spectral_embedding from sklearn.metrics.pairwise import rbf_kernel from sklearn.metrics import normalized_mutual_info_score from sklearn.cluster import KMeans from sklearn.datasets.samples_generator import make_blobs from sklearn.utils.graph import graph_laplacian from sklearn.utils.extmath import _deterministic_vector_sign_flip from sklearn.utils.testing import assert_true, assert_equal, assert_raises from sklearn.utils.testing import SkipTest # non centered, sparse centers to check the centers = np.array([ [0.0, 5.0, 0.0, 0.0, 0.0], [0.0, 0.0, 4.0, 0.0, 0.0], [1.0, 0.0, 0.0, 5.0, 1.0], ]) n_samples = 1000 n_clusters, n_features = centers.shape S, true_labels = make_blobs(n_samples=n_samples, centers=centers, cluster_std=1., random_state=42) def _check_with_col_sign_flipping(A, B, tol=0.0): """ Check array A and B are equal with possible sign flipping on each columns""" sign = True for column_idx in range(A.shape[1]): sign = sign and ((((A[:, column_idx] - B[:, column_idx]) ** 2).mean() <= tol ** 2) or (((A[:, column_idx] + B[:, column_idx]) ** 2).mean() <= tol ** 2)) if not sign: return False return True def test_sparse_graph_connected_component(): rng = np.random.RandomState(42) n_samples = 300 boundaries = [0, 42, 121, 200, n_samples] p = rng.permutation(n_samples) connections = [] for start, stop in zip(boundaries[:-1], boundaries[1:]): group = p[start:stop] # Connect all elements within the group at least once via an # arbitrary path that spans the group. for i in range(len(group) - 1): connections.append((group[i], group[i + 1])) # Add some more random connections within the group min_idx, max_idx = 0, len(group) - 1 n_random_connections = 1000 source = rng.randint(min_idx, max_idx, size=n_random_connections) target = rng.randint(min_idx, max_idx, size=n_random_connections) connections.extend(zip(group[source], group[target])) # Build a symmetric affinity matrix row_idx, column_idx = tuple(np.array(connections).T) data = rng.uniform(.1, 42, size=len(connections)) affinity = coo_matrix((data, (row_idx, column_idx))) affinity = 0.5 * (affinity + affinity.T) for start, stop in zip(boundaries[:-1], boundaries[1:]): component_1 = _graph_connected_component(affinity, p[start]) component_size = stop - start assert_equal(component_1.sum(), component_size) # We should retrieve the same component mask by starting by both ends # of the group component_2 = _graph_connected_component(affinity, p[stop - 1]) assert_equal(component_2.sum(), component_size) assert_array_equal(component_1, component_2) def test_spectral_embedding_two_components(seed=36): # Test spectral embedding with two components random_state = np.random.RandomState(seed) n_sample = 100 affinity = np.zeros(shape=[n_sample * 2, n_sample * 2]) # first component affinity[0:n_sample, 0:n_sample] = np.abs(random_state.randn(n_sample, n_sample)) + 2 # second component affinity[n_sample::, n_sample::] = np.abs(random_state.randn(n_sample, n_sample)) + 2 # Test of internal _graph_connected_component before connection component = _graph_connected_component(affinity, 0) assert_true(component[:n_sample].all()) assert_true(not component[n_sample:].any()) component = _graph_connected_component(affinity, -1) assert_true(not component[:n_sample].any()) assert_true(component[n_sample:].all()) # connection affinity[0, n_sample + 1] = 1 affinity[n_sample + 1, 0] = 1 affinity.flat[::2 * n_sample + 1] = 0 affinity = 0.5 * (affinity + affinity.T) true_label = np.zeros(shape=2 * n_sample) true_label[0:n_sample] = 1 se_precomp = SpectralEmbedding(n_components=1, affinity="precomputed", random_state=np.random.RandomState(seed)) embedded_coordinate = se_precomp.fit_transform(affinity) # Some numpy versions are touchy with types embedded_coordinate = \ se_precomp.fit_transform(affinity.astype(np.float32)) # thresholding on the first components using 0. label_ = np.array(embedded_coordinate.ravel() < 0, dtype="float") assert_equal(normalized_mutual_info_score(true_label, label_), 1.0) def test_spectral_embedding_precomputed_affinity(seed=36): # Test spectral embedding with precomputed kernel gamma = 1.0 se_precomp = SpectralEmbedding(n_components=2, affinity="precomputed", random_state=np.random.RandomState(seed)) se_rbf = SpectralEmbedding(n_components=2, affinity="rbf", gamma=gamma, random_state=np.random.RandomState(seed)) embed_precomp = se_precomp.fit_transform(rbf_kernel(S, gamma=gamma)) embed_rbf = se_rbf.fit_transform(S) assert_array_almost_equal( se_precomp.affinity_matrix_, se_rbf.affinity_matrix_) assert_true(_check_with_col_sign_flipping(embed_precomp, embed_rbf, 0.05)) def test_spectral_embedding_callable_affinity(seed=36): # Test spectral embedding with callable affinity gamma = 0.9 kern = rbf_kernel(S, gamma=gamma) se_callable = SpectralEmbedding(n_components=2, affinity=( lambda x: rbf_kernel(x, gamma=gamma)), gamma=gamma, random_state=np.random.RandomState(seed)) se_rbf = SpectralEmbedding(n_components=2, affinity="rbf", gamma=gamma, random_state=np.random.RandomState(seed)) embed_rbf = se_rbf.fit_transform(S) embed_callable = se_callable.fit_transform(S) assert_array_almost_equal( se_callable.affinity_matrix_, se_rbf.affinity_matrix_) assert_array_almost_equal(kern, se_rbf.affinity_matrix_) assert_true( _check_with_col_sign_flipping(embed_rbf, embed_callable, 0.05)) def test_spectral_embedding_amg_solver(seed=36): # Test spectral embedding with amg solver try: from pyamg import smoothed_aggregation_solver except ImportError: raise SkipTest("pyamg not available.") se_amg = SpectralEmbedding(n_components=2, affinity="nearest_neighbors", eigen_solver="amg", n_neighbors=5, random_state=np.random.RandomState(seed)) se_arpack = SpectralEmbedding(n_components=2, affinity="nearest_neighbors", eigen_solver="arpack", n_neighbors=5, random_state=np.random.RandomState(seed)) embed_amg = se_amg.fit_transform(S) embed_arpack = se_arpack.fit_transform(S) assert_true(_check_with_col_sign_flipping(embed_amg, embed_arpack, 0.05)) def test_pipeline_spectral_clustering(seed=36): # Test using pipeline to do spectral clustering random_state = np.random.RandomState(seed) se_rbf = SpectralEmbedding(n_components=n_clusters, affinity="rbf", random_state=random_state) se_knn = SpectralEmbedding(n_components=n_clusters, affinity="nearest_neighbors", n_neighbors=5, random_state=random_state) for se in [se_rbf, se_knn]: km = KMeans(n_clusters=n_clusters, random_state=random_state) km.fit(se.fit_transform(S)) assert_array_almost_equal( normalized_mutual_info_score( km.labels_, true_labels), 1.0, 2) def test_spectral_embedding_unknown_eigensolver(seed=36): # Test that SpectralClustering fails with an unknown eigensolver se = SpectralEmbedding(n_components=1, affinity="precomputed", random_state=np.random.RandomState(seed), eigen_solver="<unknown>") assert_raises(ValueError, se.fit, S) def test_spectral_embedding_unknown_affinity(seed=36): # Test that SpectralClustering fails with an unknown affinity type se = SpectralEmbedding(n_components=1, affinity="<unknown>", random_state=np.random.RandomState(seed)) assert_raises(ValueError, se.fit, S) def test_connectivity(seed=36): # Test that graph connectivity test works as expected graph = np.array([[1, 0, 0, 0, 0], [0, 1, 1, 0, 0], [0, 1, 1, 1, 0], [0, 0, 1, 1, 1], [0, 0, 0, 1, 1]]) assert_equal(_graph_is_connected(graph), False) assert_equal(_graph_is_connected(csr_matrix(graph)), False) assert_equal(_graph_is_connected(csc_matrix(graph)), False) graph = np.array([[1, 1, 0, 0, 0], [1, 1, 1, 0, 0], [0, 1, 1, 1, 0], [0, 0, 1, 1, 1], [0, 0, 0, 1, 1]]) assert_equal(_graph_is_connected(graph), True) assert_equal(_graph_is_connected(csr_matrix(graph)), True) assert_equal(_graph_is_connected(csc_matrix(graph)), True) def test_spectral_embedding_deterministic(): # Test that Spectral Embedding is deterministic random_state = np.random.RandomState(36) data = random_state.randn(10, 30) sims = rbf_kernel(data) embedding_1 = spectral_embedding(sims) embedding_2 = spectral_embedding(sims) assert_array_almost_equal(embedding_1, embedding_2) def test_spectral_embedding_unnormalized(): # Test that spectral_embedding is also processing unnormalized laplacian # correctly random_state = np.random.RandomState(36) data = random_state.randn(10, 30) sims = rbf_kernel(data) n_components = 8 embedding_1 = spectral_embedding(sims, norm_laplacian=False, n_components=n_components, drop_first=False) # Verify using manual computation with dense eigh laplacian, dd = graph_laplacian(sims, normed=False, return_diag=True) _, diffusion_map = eigh(laplacian) embedding_2 = diffusion_map.T[:n_components] * dd embedding_2 = _deterministic_vector_sign_flip(embedding_2).T assert_array_almost_equal(embedding_1, embedding_2)
bsd-3-clause
pysb/pysb
pysb/simulator/base.py
5
57380
from abc import ABCMeta, abstractmethod import numpy as np import itertools import sympy import collections from collections.abc import Mapping, Sequence import numbers from pysb.core import MonomerPattern, ComplexPattern, as_complex_pattern, \ Parameter, Expression, Model, ComponentSet from pysb.logging import get_logger, EXTENDED_DEBUG import pickle from pysb.export.json import JsonExporter from pysb.importers.json import model_from_json from pysb import __version__ as PYSB_VERSION from datetime import datetime import dateutil.parser import copy from warnings import warn from pysb.pattern import SpeciesPatternMatcher from contextlib import contextmanager import weakref try: import pandas as pd except ImportError: pd = None try: import h5py except ImportError: h5py = None class SimulatorException(Exception): pass class InconsistentParameterError(SimulatorException, ValueError): def __init__(self, parameter_name, value, reason): super(InconsistentParameterError, self).__init__( f'Value {value} that was passed for parameter {parameter_name} ' f'was inconsistent with that parameters assumption: {reason}' ) class Simulator(object): """An abstract base class for numerical simulation of models. .. warning:: The interface for this class is considered experimental and may change without warning as PySB is updated. Parameters ---------- model : pysb.Model Model to simulate. tspan : vector-like, optional Time values over which to simulate. The first and last values define the time range. Returned trajectories are sampled at every value unless the simulation is interrupted for some reason, e.g., due to satisfaction of a logical stopping criterion (see 'tout' below). initials : vector-like or dict, optional Values to use for the initial condition of all species. Ordering is determined by the order of model.species. If not specified, initial conditions will be taken from model.initials (with initial condition parameter values taken from `param_values` if specified). param_values : vector-like or dict, optional Values to use for every parameter in the model. Ordering is determined by the order of model.parameters. If passed as a dictionary, keys must be parameter names. If not specified, parameter values will be taken directly from model.parameters. verbose : bool or int, optional (default: False) Sets the verbosity level of the logger. See the logging levels and constants from Python's logging module for interpretation of integer values. False is equal to the PySB default level (currently WARNING), True is equal to DEBUG. Attributes ---------- verbose: bool Verbosity flag passed to the constructor. model : pysb.Model Model passed to the constructor. tspan : vector-like Time values passed to the constructor. Notes ----- If ``tspan`` is not defined, it may be defined in the call to the ``run`` method. The dimensionality of ``tout`` depends on whether a single simulation or multiple simulations are run. The dimensionalities of ``y``, ``yobs``, ``yobs_view``, ``yexpr``, and ``yexpr_view`` depend on the number of simulations being run as well as on the type of simulation, i.e., spatial vs. non-spatial. """ __metaclass__ = ABCMeta _supports = { 'multi_initials' : False, 'multi_param_values' : False } @abstractmethod def __init__(self, model, tspan=None, initials=None, param_values=None, verbose=False, **kwargs): # Get or create base a PySB logger for this module and model self._logger = get_logger(self.__module__, model=model, log_level=verbose) self._logger.debug('Simulator created') self._model = model self.verbose = verbose self.tout = None # Per-run initial conditions/parameter/tspan override self._tspan = tspan # Per-run tspan, initials and param_values self._run_tspan = None self._run_initials = None self._run_params = None # Base initials and param values self._params = None self.param_values = param_values self._initials = None self.initials = initials # Store init kwargs and run kwargs if needed for saving results self._init_kwargs = kwargs self._run_kwargs = None @property def model(self): return self._model @property def tspan(self): return self._run_tspan if self._run_tspan is not None else self._tspan @tspan.setter def tspan(self, new_tspan): self._tspan = new_tspan @staticmethod def _num_sims_calc(initials_or_params): """ Calculate number of simulations implied by initials or param values """ if initials_or_params is None: return None if isinstance(initials_or_params, np.ndarray): return len(initials_or_params) first_entry = next(iter(initials_or_params.values())) try: return len(first_entry) # First entry is iterable except TypeError: return 1 # First entry is non-iterable, e.g. int, float @property def initials_length(self): try: return len(self.initials) except SimulatorException: # Network free simulators if self._initials: return len(list(self._initials.values())[0]) elif self._run_initials: return len(list(self._run_initials.values())[0]) else: return len(self.param_values) def _update_initials_dict(self, initials_dict, initials_source, subs=None): if isinstance(initials_source, Mapping): # Can't just use .update() as we need to test # equality with .is_equivalent_to() for cp, value_obj in initials_source.items(): cp = as_complex_pattern(cp) if any(existing_cp.is_equivalent_to(cp) for existing_cp in initials_dict): continue if isinstance(value_obj, (Sequence, np.ndarray))\ and all(isinstance(v, numbers.Number) for v in value_obj): value = value_obj elif isinstance(value_obj, Expression): value = [value_obj.expand_expr().xreplace(subs[sim]) for sim in range(len(subs))] elif isinstance(value_obj, Parameter): # Set parameter using param_values pi = self._model.parameters.index(value_obj) value = [self.param_values[sim][pi] for sim in range(len(self.param_values))] else: raise TypeError("Unexpected initial condition " "value type: %s" % type(value_obj)) initials_dict[cp] = value elif initials_source is not None: # Update from array-like structure, which we can only do if we # have the species available (e.g. not in network-free simulations) if not self.model.species: raise ValueError( 'Cannot update initials from an array-like source without ' 'model species.') for cp_idx, cp in enumerate(self.model.species): if any(existing_cp.is_equivalent_to(cp) for existing_cp in initials_dict): continue initials_dict[cp] = [initials_source[n][cp_idx] for n in range(len(initials_source))] return initials_dict @property def initials_dict(self): n_sims = self._check_run_initials_vs_base_initials_length() if n_sims == 1: n_sims = len(self.param_values) # Apply any per-run initial overrides initials_dict = self._update_initials_dict({}, self._run_initials) # Apply any base initial overrides initials_dict = self._update_initials_dict(initials_dict, self._initials) model_initials = {ic.pattern: ic.value for ic in self.model.initials} # Otherwise, populate initials from the model n_sims_params = len(self.param_values) n_sims_actual = max(n_sims_params, n_sims) # Get remaining initials from the model itself and # self.param_values, if necessary subs = None if any(isinstance(v, Expression) for v in model_initials.values()): # Only need parameter substitutions if model initials include # expressions subs = [ dict((p, pv[i]) for i, p in enumerate(self._model.parameters)) for pv in self.param_values] if len(subs) == 1 and n_sims_actual > 1: subs = list(itertools.repeat(subs[0], n_sims_actual)) initials_dict = self._update_initials_dict( initials_dict, model_initials, subs=subs ) return initials_dict def _check_run_initials_vs_base_initials_length(self): # Otherwise, build the list from the model, and any overrides # specified in self._initials and self._run_initials n_sims_initials = self._num_sims_calc(self._initials) n_sims_run = self._num_sims_calc(self._run_initials) if n_sims_initials is not None and n_sims_run is not None \ and n_sims_run != n_sims_initials: raise ValueError( "The base initials set with self.initials imply {} " "simulations, but the run() initials imply {} simulations." " Either set self.initials=None, or change the number of " "simulations in the run() initials".format( n_sims_initials, n_sims_run)) if n_sims_initials is not None: return n_sims_initials elif n_sims_run is not None: return n_sims_run else: return 1 @property def initials(self): if not self.model.species: raise SimulatorException('No model species list - either ' 'generate the model equations or use ' 'initials_dict() for network-free ' 'simulations') # Check potential quick return options if self._run_initials is not None: if not isinstance(self._run_initials, Mapping) and \ self._initials is None: return self._run_initials elif not isinstance(self._initials, Mapping) and \ self._initials is not None: return self._initials # At this point (after dimensionality check), we can return # self._run_initials if it's not a dictionary and not None if self._run_initials is not None and not isinstance( self._run_initials, Mapping): return self._run_initials n_sims_initials = self._check_run_initials_vs_base_initials_length() n_sims_params = len(self.param_values) n_sims_actual = max(n_sims_params, n_sims_initials) y0 = np.full((n_sims_actual, len(self.model.species)), 0.0) for species, vals in self.initials_dict.items(): species_index = self._model.get_species_index(species) y0[:, species_index] = vals return y0 @initials.setter def initials(self, new_initials): self._initials = self._process_incoming_initials(new_initials) def _process_incoming_initials(self, new_initials): if new_initials is None: return None # If new_initials is a pandas dataframe, convert to a dict if pd and isinstance(new_initials, pd.DataFrame): new_initials = new_initials.to_dict(orient='list') # If new_initials is a list, convert to numpy array if isinstance(new_initials, list): new_initials = np.array(new_initials, copy=False) # Check if new_initials is a dict, and if so validate the keys # (ComplexPatterns) if isinstance(new_initials, dict): n_sims = 1 if len(new_initials) > 0: n_sims = self._num_sims_calc(new_initials) for cplx_pat, val in new_initials.items(): if not isinstance(cplx_pat, (MonomerPattern, ComplexPattern)): raise ValueError('Dictionary key %s is not a ' 'MonomerPattern or ComplexPattern' % repr(cplx_pat)) # if val is a number, convert it to a single-element array if not isinstance(val, (Sequence, np.ndarray)): val = [val] new_initials[cplx_pat] = np.array(val) # otherwise, check whether simulator supports multiple # initial values : if len(val) != n_sims: raise ValueError("all arrays in new_initials dictionary " "must be equal length") if not np.isfinite(val).all(): raise ValueError('Please check initial {} for non-finite ' 'values'.format(cplx_pat)) elif isinstance(new_initials, np.ndarray): # if new_initials is a 1D array, convert to a 2D array of length 1 if len(new_initials.shape) == 1: new_initials = np.resize(new_initials, (1, len(new_initials))) n_sims = new_initials.shape[0] # make sure number of initials values equals len(model.species) if new_initials.shape[1] != len(self._model.species): raise ValueError("new_initials must be the same length as " "model.species") if not np.isfinite(new_initials).all(): raise ValueError('Please check initials array ' 'for non-finite values') else: raise ValueError( 'Implicit conversion of data type "{}" is not ' 'supported. Please supply initials as a numpy array, list, ' 'or a pandas DataFrame.'.format(type(new_initials))) if n_sims > 1: if not self._supports['multi_initials']: raise ValueError( self.__class__.__name__ + " does not support multiple initial values at this time.") if 1 < len(self.param_values) != n_sims: raise ValueError( 'Cannot set initials for {} simulations ' 'when param_values has been set for {} ' 'simulations'.format( n_sims, len(self.param_values))) return new_initials @property def param_values(self): if not self.model._derived_parameters: if self._params is not None and \ not isinstance(self._params, dict) and \ self._run_params is None: return self._params elif self._run_params is not None and \ not isinstance(self._run_params, dict) and \ self._params is None: return self._run_params # create parameter vector from the values in the model param_values_dict = {} n_sims = self._num_sims_calc(self._params) if isinstance(self._params, dict): param_values_dict.update(self._params) elif isinstance(self._params, np.ndarray): param_values_dict = dict(zip( [p.name for p in self._model.parameters], self._params.T)) n_sims_run = self._num_sims_calc(self._run_params) if n_sims is None: n_sims = n_sims_run elif n_sims_run is not None and n_sims_run != n_sims: raise ValueError( "The base parameters set with self.param_values imply " "{} simulations, but the run() params imply {} " "simulations. Either set self.param_values=None, or " "change the number of simulations in the run() params" .format(n_sims, n_sims_run)) # At this point (after dimensionality check) we can return the # _run_params, if it's not a dict if self._run_params is not None: if not isinstance(self._run_params, dict): if not self._model._derived_parameters: return self._run_params else: param_values_dict.update(dict(zip( self.model.parameters.keys(), self._run_params ))) else: param_values_dict.update(self._run_params) if n_sims is None: n_sims = 1 # Get the base parameters from the model param_values = np.array( [p.value for p in self._model.parameters] + [p.value for p in self._model._derived_parameters] ) param_values = np.repeat([param_values], n_sims, axis=0) # Process overrides for key in param_values_dict.keys(): try: pi = self._model.parameters.index( self._model.parameters[key]) except KeyError: raise IndexError("new_params dictionary has unknown " "parameter name (%s)" % key) # loop over n_sims for n in range(n_sims): param_values[n][pi] = param_values_dict[key][n] return param_values @param_values.setter def param_values(self, new_params): self._params = self._process_incoming_params(new_params) def _process_incoming_params(self, new_params): if new_params is None: return None # Convert pandas dataframe to dictionary if pd and isinstance(new_params, pd.DataFrame): new_params = new_params.to_dict(orient='list') # If new_params is a list, convert to numpy array if isinstance(new_params, list): new_params = np.array(new_params) if isinstance(new_params, dict): n_sims = 1 if len(new_params) > 0: n_sims = self._num_sims_calc(new_params) for key, val in new_params.items(): if key not in self._model.parameters.keys(): raise IndexError("new_params dictionary has unknown " "parameter name (%s)" % key) # if val is a number, convert it to a single-element array if not isinstance(val, Sequence): val = [val] new_params[key] = np.array(val) # Check all elements are the same length if len(val) != n_sims: raise ValueError("all arrays in params dictionary " "must be equal length") for value in val: try: self._model.parameters[key].check_value(value) except ValueError as e: raise InconsistentParameterError( key, value, str(e) ) elif isinstance(new_params, np.ndarray): # if new_params is a 1D array, convert to a 2D array of length 1 if len(new_params.shape) == 1: new_params = np.resize(new_params, (1, len(new_params))) n_sims = new_params.shape[0] # make sure number of param values equals len(model.parameters) if new_params.shape[1] != len(self._model.parameters): raise ValueError("new_params must be the same length as " "model.parameters") for isim in range(n_sims): for param, value in zip(self._model.parameters, new_params[isim, :]): try: param.check_value(value) except ValueError as e: raise InconsistentParameterError( param.name, value, str(e) ) else: raise ValueError( 'Implicit conversion of data type "{}" is not ' 'supported. Please supply parameters as a numpy array, list, ' 'or a pandas DataFrame.'.format(type(new_params))) # Check whether simulator supports multiple param_values if n_sims > 1 and not self._supports['multi_param_values']: raise ValueError( self.__class__.__name__ + " does not support multiple parameter values at this time.") return new_params def _reset_run_overrides(self): """ Reset any single-run tspan, initials, param_values When calling run(), the user can specify tspan, initials and param_values, which are only used for a single run. This method resets those overrides after the run is complete (called from :func:`SimulationResult.__init__`). """ self._run_tspan = None self._run_initials = None self._run_params = None @abstractmethod def run(self, tspan=None, initials=None, param_values=None, _run_kwargs=None): """Run a simulation. Notes for developers implementing Simulator subclasses: Implementations should return a :class:`.SimulationResult` object. Subclasses should pass any additional arguments run as a dictonary to the `_run_kwargs` argument when calling the superclass's run method. If the run method has variable keyword arguments, this can be achieved by passing `_run_kwargs=locals()` to the superclass's run method. The run kwargs are used for reference when saving and loading SimulationResults to disk. They aren't compulsory, but not including them will generate a warning. To suppress (e.g. if there are no additional arguments), set `_run_kwargs=[]`. """ self._logger.info('Simulation(s) started') if _run_kwargs: # Don't store these arguments twice _run_kwargs.pop('self') _run_kwargs.pop('initials', None) _run_kwargs.pop('param_values', None) _run_kwargs.pop('tspan', None) self._run_kwargs = _run_kwargs elif _run_kwargs is None: self._logger.warning( '{} has not passed any additional run arguments to ' '_run_kwargs. Instructions are included in the Simulation ' 'base class run method docstring.'.format( self.__class__.__name__)) self._run_tspan = tspan if self.tspan is None: raise ValueError("tspan must be defined before " "simulation can run") self._run_params = self._process_incoming_params(param_values) self._run_initials = self._process_incoming_initials(initials) # If only one set of param_values, run all simulations # with the same parameters if len(self.param_values) == 1 and self.initials_length > 1: new_params = np.repeat(self.param_values, self.initials_length, axis=0) self._run_params = new_params # Error checks on 'param_values' and 'initials' if len(self.param_values) != self.initials_length: raise ValueError( "'param_values' and 'initials' must be equal lengths.\n" "len(param_values): %d\n" "len(initials): %d" % (len(self.param_values), self.initials_length)) elif len(self.param_values.shape) != 2 or \ self.param_values.shape[1] != ( len(self._model.parameters) + len(self._model._derived_parameters)): raise ValueError( "'param_values' must be a 2D array of dimension N_SIMS x " "len(model.parameters).\n" "param_values.shape: " + str(self.param_values.shape) + "\nlen(model.parameters): %d" % len(self._model.parameters)) if self.model.species and (len(self.initials.shape) != 2 or self.initials.shape[1] != len(self._model.species)): raise ValueError( "'initials' must be a 2D array of dimension N_SIMS x " "len(model.species).\n" "initials.shape: " + str(self.initials.shape) + "\nlen(model.species): %d" % len(self._model.species)) return None class SimulationResult(object): """ Results of a simulation with properties and methods to access them. .. warning:: Please note that the interface for this class is considered experimental and may change without warning as PySB is updated. Notes ----- In the attribute descriptions, a "trajectory set" is a 2D numpy array, species on first axis and time on second axis, with each element containing the concentration or count of the species at the specified time. A list of trajectory sets contains a trajectory set for each simulation. Parameters ---------- simulator : Simulator The simulator object that generated the trajectories tout: list-like Time points returned by the simulator (may be different from ``tspan`` if simulation is interrupted for some reason). trajectories : list or numpy.ndarray A set of species trajectories from a simulation. Should either be a list of 2D numpy arrays or a single 3D numpy array. squeeze : bool, optional (default: True) Return trajectories as a 2D array, rather than a 3d array, if only a single simulation was performed. simulations_per_param_set : int Number of trajectories per parameter set. Typically always 1 for deterministic simulators (e.g. ODE), but with stochastic simulators multiple trajectories per parameter/initial condition set are often desired. model: pysb.Model initials: numpy.ndarray param_values: numpy.ndarray model, initials, param_values are an alternative constructor mechanism used when loading SimulationResults from files (see :func:`SimulationResult.load`). Setting just the simulator argument instead of these arguments is recommended. Examples -------- The following examples use a simple model with three observables and one expression, with a single simulation. >>> from pysb.examples.expression_observables import model >>> from pysb.simulator import ScipyOdeSimulator >>> import numpy as np >>> np.set_printoptions(precision=4) >>> sim = ScipyOdeSimulator(model, tspan=np.linspace(0, 40, 10), \ integrator_options={'atol': 1e-20}) >>> simulation_result = sim.run() ``simulation_result`` is a :class:`SimulationResult` object. An observable can be accessed like so: >>> print(simulation_result.observables['Bax_c0']) \ #doctest: +NORMALIZE_WHITESPACE [1.0000e+00 1.1744e-02 1.3791e-04 1.6196e-06 1.9020e-08 2.2337e-10 2.6232e-12 3.0806e-14 3.6178e-16 4.2492e-18] It is also possible to retrieve the value of all observables at a particular time point, e.g. the final concentrations: >>> print(simulation_result.observables[-1]) \ #doctest: +SKIP (4.2492e-18, 1.6996e-16, 1.) Expressions are read in the same way as observables: >>> print(simulation_result.expressions['NBD_signal']) \ #doctest: +NORMALIZE_WHITESPACE [0. 4.7847 4.9956 4.9999 5. 5. 5. 5. 5. 5. ] The species trajectories can be accessed as a numpy ndarray: >>> print(simulation_result.species) #doctest: +NORMALIZE_WHITESPACE [[1.0000e+00 0.0000e+00 0.0000e+00] [1.1744e-02 5.2194e-02 9.3606e-01] [1.3791e-04 1.2259e-03 9.9864e-01] [1.6196e-06 2.1595e-05 9.9998e-01] [1.9020e-08 3.3814e-07 1.0000e+00] [2.2337e-10 4.9637e-09 1.0000e+00] [2.6232e-12 6.9951e-11 1.0000e+00] [3.0806e-14 9.5840e-13 1.0000e+00] [3.6178e-16 1.2863e-14 1.0000e+00] [4.2492e-18 1.6996e-16 1.0000e+00]] Species, observables and expressions can be combined into a single numpy ndarray and accessed similarly. Here, the initial concentrations of all these entities are examined: >>> print(simulation_result.all[0]) #doctest: +SKIP ( 1., 0., 0., 1., 0., 0., 0.) The ``all`` array can be accessed as a pandas DataFrame object, which allows for more convenient indexing and access to pandas advanced functionality, such as indexing and slicing. Here, the concentrations of the observable ``Bax_c0`` and the expression ``NBD_signal`` are read at time points between 5 and 15 seconds: >>> df = simulation_result.dataframe >>> print(df.loc[5:15, ['Bax_c0', 'NBD_signal']]) \ #doctest: +NORMALIZE_WHITESPACE Bax_c0 NBD_signal time 8.888889 0.000138 4.995633 13.333333 0.000002 4.999927 """ CUSTOM_ATTR_PREFIX = 'usrattr_' def __init__(self, simulator, tout, trajectories=None, observables_and_expressions=None, squeeze=True, simulations_per_param_set=1, model=None, initials=None, param_values=None): if simulator: simulator._logger.debug('SimulationResult constructor started') self._param_values = simulator.param_values.copy() try: self._initials = simulator.initials.copy() except SimulatorException: # Network free simulations don't have initials list, only dict self._initials = simulator.initials_dict.copy() self._model = copy.deepcopy(simulator._model) self.simulator_class = simulator.__class__ self.init_kwargs = copy.deepcopy(simulator._init_kwargs) self.run_kwargs = copy.deepcopy(simulator._run_kwargs) else: self._param_values = param_values self._initials = initials self._model = model self.simulator_class = None self.init_kwargs = {} self.run_kwargs = {} self.squeeze = squeeze self.tout = np.asarray(tout) self._yfull = None self.n_sims_per_parameter_set = simulations_per_param_set self.pysb_version = PYSB_VERSION self.timestamp = datetime.now() self.custom_attrs = {} if trajectories is None and observables_and_expressions is None: raise ValueError('Need to supply at least one of species ' 'trajectories or observables_and_expressions') if trajectories is not None and len(trajectories) > 0: # Validate incoming trajectories if getattr(trajectories, 'ndim', None) == 3: # trajectories is a 3D array, create a list of 2D arrays # This is just a view and doesn't copy the data self._y = [tr for tr in trajectories] else: # Not a 3D array, check for a list of 2D arrays try: if any(tr.ndim != 2 for tr in trajectories): raise AttributeError except (AttributeError, TypeError): raise ValueError("trajectories should be a 3D array or a " "list of 2D arrays") self._y = trajectories self._nsims = len(self._y) if len(self.tout) != self.nsims: raise ValueError("Simulator tout should be the same length as " "trajectories") for i in range(self.nsims): if len(self.tout[i]) != self._y[i].shape[0]: raise ValueError("The number of time points in tout[{0}] " "should match the trajectories array for " "simulation {0}".format(i)) if self._y[i].shape[1] != len(self._model.species): raise ValueError("The number of species in trajectory {0} " "should match length of " "model.species".format(i)) else: self._y = None # Calculate ``yobs`` and ``yexpr`` based on values of ``y`` exprs = self._model.expressions_dynamic(include_local=False) expr_names = [expr.name for expr in exprs] model_obs = self._model.observables obs_names = list(model_obs.keys()) param_names = list(p.name for p in self._model.parameters) if not _allow_unicode_recarray(): for name_list, name_type in zip( (expr_names, obs_names, param_names), ('Expression', 'Observable', 'Parameter')): for i, name in enumerate(name_list): try: name_list[i] = name.encode('ascii') except UnicodeEncodeError: error_msg = 'Non-ASCII compatible ' + \ '%s names not allowed' % name_type raise ValueError(error_msg) yobs_dtype = (list(zip(obs_names, itertools.repeat(float))) if obs_names else float) yexpr_dtype = (list(zip(expr_names, itertools.repeat(float))) if expr_names else float) if observables_and_expressions: # Observables and expression values are used as supplied self._nsims = len(observables_and_expressions) self._yobs_view = [observables_and_expressions[n][:, 0:(len( self._model.observables))] for n in range(self.nsims)] self._yexpr_view = [observables_and_expressions[n][:, (len( self._model.observables)):] for n in range(self.nsims)] self._yobs = [self._yobs_view[n].reshape( len(tout[n]) * len(obs_names)).view(dtype=yobs_dtype) for n in range(self.nsims)] self._yexpr = [self._yexpr_view[n].reshape( len(tout[n]) * len(expr_names)).view(dtype=yexpr_dtype) for n in range(self.nsims)] else: self._yobs = [np.ndarray((len(self.tout[n]),), dtype=yobs_dtype) if obs_names else np.ndarray((len(self.tout[n]), 0), dtype=yobs_dtype) for n in range(self.nsims)] self._yobs_view = [self._yobs[n].view(float). reshape(len(self._yobs[n]), -1) for n in range( self.nsims)] self._yexpr = [np.ndarray((len(self.tout[n]),), dtype=yexpr_dtype) if expr_names else np.ndarray((len(self.tout[n]), 0), dtype=yexpr_dtype) for n in range(self.nsims)] self._yexpr_view = [self._yexpr[n].view(float).reshape(len( self._yexpr[n]), -1) for n in range(self.nsims)] # loop over simulations sym_names = obs_names + param_names expanded_exprs = [sympy.lambdify(sym_names, expr.expand_expr(), "numpy") for expr in exprs] for n in range(self.nsims): if simulator: simulator._logger.log(EXTENDED_DEBUG, 'Evaluating exprs/obs %d/%d' % (n + 1, self.nsims)) # observables for i, obs in enumerate(model_obs): self._yobs_view[n][:, i] = ( self._y[n][:, obs.species] * obs.coefficients).sum(axis=1) # expressions sym_dict = dict((k, self._yobs[n][k]) for k in obs_names) sym_dict.update(dict((p.name, self.param_values[ n // self.n_sims_per_parameter_set][i]) for i, p in enumerate(self._model.parameters))) for i, expr in enumerate(exprs): self._yexpr_view[n][:, i] = expanded_exprs[i](**sym_dict) if simulator: simulator._reset_run_overrides() simulator._logger.debug('SimulationResult constructor finished') def _squeeze_output(self, trajectories): """ Reduces trajectories to a 2D matrix if only one simulation present Can be disabled by setting self.squeeze to False """ if self.nsims == 1 and self.squeeze: return trajectories[0] else: return trajectories @property def nsims(self): """ The number of simulations in this SimulationResult """ return self._nsims @property def all(self): """ Aggregate species, observables, and expressions trajectories into a numpy.ndarray with record-style data-type for return to the user. """ if self._yfull is None: if self._y is None: yfull_dtype = [] else: sp_names = ['__s%d' % i for i in range(len(self._model.species))] yfull_dtype = list(zip(sp_names, itertools.repeat(float))) if len(self._model.observables): yfull_dtype += self._yobs[0].dtype.descr if len(self._model.expressions_dynamic()): yfull_dtype += self._yexpr[0].dtype.descr yfull = [] # loop over simulations for n in range(self.nsims): yfull.append(np.ndarray(len(self.tout[n]), yfull_dtype)) yfull_view = yfull[n].view(float).reshape((len(yfull[n]), -1)) n_sp = self._y[n].shape[1] if self._y else 0 n_ob = self._yobs_view[n].shape[1] n_ex = self._yexpr_view[n].shape[1] if self._y: yfull_view[:, :n_sp] = self._y[n] yfull_view[:, n_sp:n_sp + n_ob] = self._yobs_view[n] yfull_view[:, n_sp + n_ob:n_sp + n_ob + n_ex] = \ self._yexpr_view[n] self._yfull = yfull return self._squeeze_output(self._yfull) @property def dataframe(self): """ A conversion of the trajectory sets (species, observables and expressions for all simulations) into a single :py:class:`pandas.DataFrame`. """ if pd is None: raise Exception('Please "pip install pandas" for this feature') sim_ids = (np.repeat(range(self.nsims), [len(t) for t in self.tout])) times = np.concatenate(self.tout) if self.nsims == 1 and self.squeeze: idx = pd.Index(times, name='time') else: idx = pd.MultiIndex.from_tuples(list(zip(sim_ids, times)), names=['simulation', 'time']) simdata = self.all if not isinstance(simdata, np.ndarray): simdata = np.concatenate(simdata) return pd.DataFrame(simdata, index=idx) @property def species(self): """ List of trajectory sets. The first dimension contains species. """ if self._y is None: raise ValueError('No trajectories are available for network-free ' 'simulations') return self._squeeze_output(self._y) @property def observables(self): """ List of trajectory sets. The first dimension contains observables. """ if not self._model.observables: raise ValueError('Model has no observables') return self._squeeze_output(self._yobs) def observable(self, pattern): """ Calculate a pattern's trajectories without adding to model This method calculates an observable "on demand" using any supplied MonomerPattern or ComplexPattern against the simulation result, without re-running the simulation. Note that the monomers within the supplied pattern are reconciled with the SimulationResult's internal copy of the model by name. This method only works on simulations which calculate species trajectories (i.e. it will not work on network-free simulations). Raises a ValueError if the pattern does not match at least one species. Parameters ---------- pattern: pysb.MonomerPattern or pysb.ComplexPattern An observable pattern to match Returns ------- pandas.Series Series containing the simulation trajectories for the specified observable Examples -------- >>> from pysb import ANY >>> from pysb.examples import earm_1_0 >>> from pysb.simulator import ScipyOdeSimulator >>> simres = ScipyOdeSimulator(earm_1_0.model, tspan=range(5)).run() >>> m = earm_1_0.model.monomers Observable of bound Bid: >>> simres.observable(m.Bid(b=ANY)) time 0 0.000000e+00 1 1.190933e-12 2 2.768582e-11 3 1.609716e-10 4 5.320530e-10 dtype: float64 Observable of AMito bound to mCytoC: >>> simres.observable(m.AMito(b=1) % m.mCytoC(b=1)) time 0 0.000000e+00 1 1.477319e-77 2 1.669917e-71 3 5.076939e-69 4 1.157400e-66 dtype: float64 """ # Adjust the supplied pattern's monomer objects to match the # simulationresult's internal model if isinstance(pattern, MonomerPattern): self._update_monomer_pattern(pattern) elif isinstance(pattern, ComplexPattern): for mp in pattern.monomer_patterns: self._update_monomer_pattern(mp) else: raise ValueError('The pattern must be a MonomerPattern or ' 'ComplexPattern') if self._y is None: raise ValueError('On demand observables can only be calculated ' 'on simulations with species trajectories') obs_matches = SpeciesPatternMatcher(self._model).match( pattern, index=True, counts=True) if not obs_matches: raise ValueError('No species match the supplied observable ' 'pattern') return self.dataframe.iloc[:, list(obs_matches.keys())].multiply( list(obs_matches.values())).sum(axis=1) def _update_monomer_pattern(self, pattern): """ Update a pattern's monomer objects to use internal model Internal function for in-place update of a pattern to replace its monomers with those from SimulationResult's model, matching by name. Raises ValueError if no monomer with the specified name is in the model. """ mon_name = pattern.monomer.name try: new_mon = self._model.monomers[mon_name] except KeyError: raise ValueError('There was no monomer called "{}" in the model ' '"{}" at the time of simulation'.format( mon_name, self._model.name)) pattern.monomer = new_mon @property def expressions(self): """ List of trajectory sets. The first dimension contains expressions. """ if not self._model.expressions_dynamic(): raise ValueError('Model has no dynamic expressions') return self._squeeze_output(self._yexpr) @property def initials(self): return self._initials @property def param_values(self): return self._param_values def save(self, filename, dataset_name=None, group_name=None, append=False, include_obs_exprs=False): """ Save a SimulationResult to a file (HDF5 format) HDF5 is a hierarchical, binary storage format well suited to storing matrix-like data. Our implementation requires the h5py package. Each SimulationResult is treated as an HDF5 dataset, stored within a group which is specific to a model. In this way, it is possible to save multiple SimulationResults for a specific model. A group is first created in the HDF file root (see group_name argument). Within that group, a dataset "_model" has a JSON version of the PySB model. SimulationResult are stored as groups within the model group. The file hierarchy under group_name/dataset_name/ then consists of the following HDF5 gzip compressed HDF5 datasets: trajectories, param_values, initials, tout, observables (optional) and expressions (optional); and the following attributes: simulator_class (pickled Class), simulator_kwargs (pickled dict), squeeze (bool), simulations_per_param_set (int), pysb_version (str), timestamp (ISO 8601 format). Custom attributes can be stored in the SimulationResult's `custom_attrs` dictionary. Keys should be strings, values can be any picklable object. When saved to HDF5, these custom attributes will be prefixed with ``usrattr_``. Parameters ---------- filename: str Filename to which the data will be saved dataset_name: str or None Dataset name. If None, it will default to 'result'. If the dataset_name already exists within the group, a ValueError is raised. group_name: str or None Group name. If None, will default to the name of the model. append: bool If False, raise IOError if the specified file already exists. If True, append to existing file (or create if it doesn't exist). include_obs_exprs: bool Whether to save observables and expressions in the file or not. If they are not included, they can be recreated from the model and species trajectories when loaded back into PySB, but you may wish to include them for use with external software, or if you have complex expressions which take a long time to compute. """ if h5py is None: raise Exception('Please install the h5py package for this feature') if self._y is None and not include_obs_exprs: warn('This SimulationResult has no trajectories - ' 'you will need to set include_obs_exprs=True if ' 'you wish to save observables and expressions') if group_name is None: group_name = self._model.name if dataset_name is None: dataset_name = 'result' # np.void maps to bytes in HDF5. enpickle = lambda obj: np.void(pickle.dumps(obj, -1)) model_json = JsonExporter(self._model).export(include_netgen=True) with h5py.File(filename, 'a' if append else 'w-') as hdf: # Get or create the group try: grp = hdf.create_group(group_name) grp.create_dataset('_model_json', data=model_json) if '_model' in grp: raise ValueError() except ValueError: grp = hdf[group_name] if '_model_json' in grp: model = model_from_json(grp['_model_json'][()]) else: with _patch_model_setstate(): model = pickle.loads(grp['_model'][()]) if model.name != self._model.name: raise ValueError('SimulationResult model has name "{}", ' 'but the model in HDF5 file group "{}" ' 'has name "{}"'.format(self._model.name, group_name, model.name)) # Create the result dataset, which is actually a nested HDF group dset = grp.create_group(dataset_name) if self._y is not None: dset.create_dataset('trajectories', data=self._y, compression='gzip', shuffle=True) if include_obs_exprs: dset.create_dataset('observables', data=self._yobs_view, compression='gzip', shuffle=True) dset.create_dataset('expressions', data=self._yexpr_view, compression='gzip', shuffle=True) dset.create_dataset('param_values', data=self.param_values, compression='gzip', shuffle=True) if isinstance(self.initials, np.ndarray): dset.create_dataset('initials', data=self.initials, compression='gzip', shuffle=True) else: dset.create_dataset('initials_dict', data=enpickle( self.initials)) dset.create_dataset('tout', data=self.tout, compression='gzip') dset.attrs['simulator_class'] = enpickle(self.simulator_class) dset.attrs['init_kwargs'] = enpickle(self.init_kwargs) dset.attrs['run_kwargs'] = enpickle(self.run_kwargs) dset.attrs['squeeze'] = self.squeeze dset.attrs['simulations_per_param_set'] = \ self.n_sims_per_parameter_set dset.attrs['pysb_version'] = self.pysb_version dset.attrs['timestamp'] = datetime.isoformat( self.timestamp) # This is the range of ints that can be natively encoded in HDF5. int_min = np.iinfo(np.int64).min int_max = np.iinfo(np.uint64).max for attr_name, attr_val in self.custom_attrs.items(): # Pass HDF5-native values straight through, pickling others. if (not (isinstance(attr_val, (str, bytes, float, complex)) or (isinstance(attr_val, numbers.Integral) and int_min <= attr_val <= int_max))): attr_val = enpickle(attr_val) dset.attrs[self.CUSTOM_ATTR_PREFIX + attr_name] = attr_val @classmethod def load(cls, filename, dataset_name=None, group_name=None): """ Load a SimulationResult from a file (HDF5 format) For a description of the file format see :func:`save` Parameters ---------- filename: str Filename from which to load data dataset_name: str or None Dataset name. Can be left as None when the group specified only contains one dataset, which will then be selected. If None and more than one dataset is in the group, a ValueError is raised. group_name: str or None Group name. This is typically the name of the model. Can be left as None when the file only contains one group, which will then be selected. If None and more than group is in the file a ValueError is raised. Returns ------- SimulationResult Set of trajectories and associated metadata loaded from the file """ if h5py is None: raise Exception('Please "pip install h5py" for this feature') with h5py.File(filename, 'r') as hdf: if group_name is None: groups = hdf.keys() if len(groups) > 1: raise ValueError("group_name must be specified when file " "contains more than one group. Options " "are: {}".format(str(groups))) group_name = next(iter(hdf)) grp = hdf[group_name] if dataset_name is None: datasets = [k for k in grp.keys() if k not in ('_model', '_model_json')] if len(datasets) > 1: raise ValueError("dataset_name must be specified when " "group contains more than one dataset. " "Options are: {}".format(str(datasets))) dataset_name = datasets[0] dset = grp[dataset_name] obs_and_exprs = None if 'observables' in dset.keys(): obs_and_exprs = list(dset['observables'][:]) if 'expressions' in dset.keys(): exprs = dset['expressions'][:] if obs_and_exprs is None: obs_and_exprs = list(exprs) else: for i in range(len(obs_and_exprs)): obs_and_exprs[i] = np.concatenate( [obs_and_exprs[i], exprs[i]], axis=1 ) trajectories = None try: trajectories = dset['trajectories'][:] except KeyError: pass try: initials = dset['initials'][:] except KeyError: initials = pickle.loads(dset['initials_dict'][()]) if '_model_json' in grp: model = model_from_json(grp['_model_json'][()]) else: warn('The SimulationResult file uses an old model ' 'format (pickled). It\'s recommended you re-save ' 'the SimulationResult to use the new format (JSON).') with _patch_model_setstate(): model = pickle.loads(grp['_model'][()]) simres = cls( simulator=None, model=model, initials=initials, param_values=dset['param_values'][:], tout=dset['tout'][:], trajectories=trajectories, observables_and_expressions=obs_and_exprs, squeeze=dset.attrs['squeeze'], simulations_per_param_set=dset.attrs[ 'simulations_per_param_set'] ) simres.pysb_version = dset.attrs['pysb_version'] simres.timestamp = dateutil.parser.parse( dset.attrs['timestamp']) simres.simulator_class = pickle.loads( dset.attrs['simulator_class']) simres.init_kwargs = pickle.loads(dset.attrs['init_kwargs']) simres.run_kwargs = pickle.loads(dset.attrs['run_kwargs']) for attr_name in dset.attrs.keys(): if attr_name.startswith(cls.CUSTOM_ATTR_PREFIX): orig_name = attr_name[len(cls.CUSTOM_ATTR_PREFIX):] attr_val = dset.attrs[attr_name] # Restore objects that were pickled for storage. if isinstance(attr_val, np.void): attr_val = pickle.loads(attr_val) simres.custom_attrs[orig_name] = attr_val return simres def _allow_unicode_recarray(): """Return True if numpy recarray can take unicode data type. In python 2, numpy doesn't allow unicode strings as names in arrays even if they are ascii encodeable. This function tests this directly. """ try: np.ndarray((1,), dtype=[(u'X', float)]) except TypeError: return False return True def _model_setstate_monkey_patch(self, state): """Monkey patch for Model.__setstate__ for restoring from older pickles""" # restore the 'model' weakrefs on all components self.__dict__.update(state) # Set "tags" attribute for older, pickled models self.__dict__.setdefault('tags', ComponentSet()) for c in self.all_components(): c.model = weakref.ref(self) @contextmanager def _patch_model_setstate(): old_setstate = Model.__setstate__ Model.__setstate__ = _model_setstate_monkey_patch try: yield finally: Model.__setstate__ = old_setstate
bsd-2-clause
pizzathief/scipy
scipy/spatial/_spherical_voronoi.py
7
13695
""" Spherical Voronoi Code .. versionadded:: 0.18.0 """ # # Copyright (C) Tyler Reddy, Ross Hemsley, Edd Edmondson, # Nikolai Nowaczyk, Joe Pitt-Francis, 2015. # # Distributed under the same BSD license as SciPy. # import warnings import numpy as np import scipy from . import _voronoi from scipy.spatial import cKDTree __all__ = ['SphericalVoronoi'] def calculate_solid_angles(R): """Calculates the solid angles of plane triangles. Implements the method of Van Oosterom and Strackee [VanOosterom]_ with some modifications. Assumes that input points have unit norm.""" # Original method uses a triple product `R1 . (R2 x R3)` for the numerator. # This is equal to the determinant of the matrix [R1 R2 R3], which can be # computed with better stability. numerator = np.linalg.det(R) denominator = 1 + (np.einsum('ij,ij->i', R[:, 0], R[:, 1]) + np.einsum('ij,ij->i', R[:, 1], R[:, 2]) + np.einsum('ij,ij->i', R[:, 2], R[:, 0])) return np.abs(2 * np.arctan2(numerator, denominator)) class SphericalVoronoi: """ Voronoi diagrams on the surface of a sphere. .. versionadded:: 0.18.0 Parameters ---------- points : ndarray of floats, shape (npoints, ndim) Coordinates of points from which to construct a spherical Voronoi diagram. radius : float, optional Radius of the sphere (Default: 1) center : ndarray of floats, shape (ndim,) Center of sphere (Default: origin) threshold : float Threshold for detecting duplicate points and mismatches between points and sphere parameters. (Default: 1e-06) Attributes ---------- points : double array of shape (npoints, ndim) the points in `ndim` dimensions to generate the Voronoi diagram from radius : double radius of the sphere center : double array of shape (ndim,) center of the sphere vertices : double array of shape (nvertices, ndim) Voronoi vertices corresponding to points regions : list of list of integers of shape (npoints, _ ) the n-th entry is a list consisting of the indices of the vertices belonging to the n-th point in points Methods ---------- calculate_areas Calculates the areas of the Voronoi regions. For 2D point sets, the regions are circular arcs. The sum of the areas is `2 * pi * radius`. For 3D point sets, the regions are spherical polygons. The sum of the areas is `4 * pi * radius**2`. Raises ------ ValueError If there are duplicates in `points`. If the provided `radius` is not consistent with `points`. Notes ----- The spherical Voronoi diagram algorithm proceeds as follows. The Convex Hull of the input points (generators) is calculated, and is equivalent to their Delaunay triangulation on the surface of the sphere [Caroli]_. The Convex Hull neighbour information is then used to order the Voronoi region vertices around each generator. The latter approach is substantially less sensitive to floating point issues than angle-based methods of Voronoi region vertex sorting. Empirical assessment of spherical Voronoi algorithm performance suggests quadratic time complexity (loglinear is optimal, but algorithms are more challenging to implement). References ---------- .. [Caroli] Caroli et al. Robust and Efficient Delaunay triangulations of points on or close to a sphere. Research Report RR-7004, 2009. .. [VanOosterom] Van Oosterom and Strackee. The solid angle of a plane triangle. IEEE Transactions on Biomedical Engineering, 2, 1983, pp 125--126. See Also -------- Voronoi : Conventional Voronoi diagrams in N dimensions. Examples -------- Do some imports and take some points on a cube: >>> import matplotlib.pyplot as plt >>> from scipy.spatial import SphericalVoronoi, geometric_slerp >>> from mpl_toolkits.mplot3d import proj3d >>> # set input data >>> points = np.array([[0, 0, 1], [0, 0, -1], [1, 0, 0], ... [0, 1, 0], [0, -1, 0], [-1, 0, 0], ]) Calculate the spherical Voronoi diagram: >>> radius = 1 >>> center = np.array([0, 0, 0]) >>> sv = SphericalVoronoi(points, radius, center) Generate plot: >>> # sort vertices (optional, helpful for plotting) >>> sv.sort_vertices_of_regions() >>> t_vals = np.linspace(0, 1, 2000) >>> fig = plt.figure() >>> ax = fig.add_subplot(111, projection='3d') >>> # plot the unit sphere for reference (optional) >>> u = np.linspace(0, 2 * np.pi, 100) >>> v = np.linspace(0, np.pi, 100) >>> x = np.outer(np.cos(u), np.sin(v)) >>> y = np.outer(np.sin(u), np.sin(v)) >>> z = np.outer(np.ones(np.size(u)), np.cos(v)) >>> ax.plot_surface(x, y, z, color='y', alpha=0.1) >>> # plot generator points >>> ax.scatter(points[:, 0], points[:, 1], points[:, 2], c='b') >>> # plot Voronoi vertices >>> ax.scatter(sv.vertices[:, 0], sv.vertices[:, 1], sv.vertices[:, 2], ... c='g') >>> # indicate Voronoi regions (as Euclidean polygons) >>> for region in sv.regions: ... n = len(region) ... for i in range(n): ... start = sv.vertices[region][i] ... end = sv.vertices[region][(i + 1) % n] ... result = geometric_slerp(start, end, t_vals) ... ax.plot(result[..., 0], ... result[..., 1], ... result[..., 2], ... c='k') >>> ax.azim = 10 >>> ax.elev = 40 >>> _ = ax.set_xticks([]) >>> _ = ax.set_yticks([]) >>> _ = ax.set_zticks([]) >>> fig.set_size_inches(4, 4) >>> plt.show() """ def __init__(self, points, radius=1, center=None, threshold=1e-06): if radius is None: radius = 1. warnings.warn('`radius` is `None`. ' 'This will raise an error in a future version. ' 'Please provide a floating point number ' '(i.e. `radius=1`).', DeprecationWarning) self.radius = float(radius) self.points = np.array(points).astype(np.double) self._dim = len(points[0]) if center is None: self.center = np.zeros(self._dim) else: self.center = np.array(center, dtype=float) # test degenerate input self._rank = np.linalg.matrix_rank(self.points - self.points[0], tol=threshold * self.radius) if self._rank < self._dim: raise ValueError("Rank of input points must be at least {0}".format(self._dim)) if cKDTree(self.points).query_pairs(threshold * self.radius): raise ValueError("Duplicate generators present.") radii = np.linalg.norm(self.points - self.center, axis=1) max_discrepancy = np.abs(radii - self.radius).max() if max_discrepancy >= threshold * self.radius: raise ValueError("Radius inconsistent with generators.") self._calc_vertices_regions() def _calc_vertices_regions(self): """ Calculates the Voronoi vertices and regions of the generators stored in self.points. The vertices will be stored in self.vertices and the regions in self.regions. This algorithm was discussed at PyData London 2015 by Tyler Reddy, Ross Hemsley and Nikolai Nowaczyk """ # get Convex Hull conv = scipy.spatial.ConvexHull(self.points) # get circumcenters of Convex Hull triangles from facet equations # for 3D input circumcenters will have shape: (2N-4, 3) self.vertices = self.radius * conv.equations[:, :-1] + self.center self._simplices = conv.simplices # calculate regions from triangulation # for 3D input simplex_indices will have shape: (2N-4,) simplex_indices = np.arange(len(self._simplices)) # for 3D input tri_indices will have shape: (6N-12,) tri_indices = np.column_stack([simplex_indices] * self._dim).ravel() # for 3D input point_indices will have shape: (6N-12,) point_indices = self._simplices.ravel() # for 3D input indices will have shape: (6N-12,) indices = np.argsort(point_indices, kind='mergesort') # for 3D input flattened_groups will have shape: (6N-12,) flattened_groups = tri_indices[indices].astype(np.intp) # intervals will have shape: (N+1,) intervals = np.cumsum(np.bincount(point_indices + 1)) # split flattened groups to get nested list of unsorted regions groups = [list(flattened_groups[intervals[i]:intervals[i + 1]]) for i in range(len(intervals) - 1)] self.regions = groups def sort_vertices_of_regions(self): """Sort indices of the vertices to be (counter-)clockwise ordered. Raises ------ TypeError If the points are not three-dimensional. Notes ----- For each region in regions, it sorts the indices of the Voronoi vertices such that the resulting points are in a clockwise or counterclockwise order around the generator point. This is done as follows: Recall that the n-th region in regions surrounds the n-th generator in points and that the k-th Voronoi vertex in vertices is the circumcenter of the k-th triangle in self._simplices. For each region n, we choose the first triangle (=Voronoi vertex) in self._simplices and a vertex of that triangle not equal to the center n. These determine a unique neighbor of that triangle, which is then chosen as the second triangle. The second triangle will have a unique vertex not equal to the current vertex or the center. This determines a unique neighbor of the second triangle, which is then chosen as the third triangle and so forth. We proceed through all the triangles (=Voronoi vertices) belonging to the generator in points and obtain a sorted version of the vertices of its surrounding region. """ if self._dim != 3: raise TypeError("Only supported for three-dimensional point sets") _voronoi.sort_vertices_of_regions(self._simplices, self.regions) def _calculate_areas_3d(self): self.sort_vertices_of_regions() sizes = [len(region) for region in self.regions] csizes = np.cumsum(sizes) num_regions = csizes[-1] # We create a set of triangles consisting of one point and two Voronoi # vertices. The vertices of each triangle are adjacent in the sorted # regions list. point_indices = [i for i, size in enumerate(sizes) for j in range(size)] nbrs1 = np.array([r for region in self.regions for r in region]) # The calculation of nbrs2 is a vectorized version of: # np.array([r for region in self.regions for r in np.roll(region, 1)]) nbrs2 = np.roll(nbrs1, 1) indices = np.roll(csizes, 1) indices[0] = 0 nbrs2[indices] = nbrs1[csizes - 1] # Normalize points and vertices. pnormalized = (self.points - self.center) / self.radius vnormalized = (self.vertices - self.center) / self.radius # Create the complete set of triangles and calculate their solid angles triangles = np.hstack([pnormalized[point_indices], vnormalized[nbrs1], vnormalized[nbrs2] ]).reshape((num_regions, 3, 3)) triangle_solid_angles = calculate_solid_angles(triangles) # Sum the solid angles of the triangles in each region solid_angles = np.cumsum(triangle_solid_angles)[csizes - 1] solid_angles[1:] -= solid_angles[:-1] # Get polygon areas using A = omega * r**2 return solid_angles * self.radius**2 def _calculate_areas_2d(self): # Find start and end points of arcs arcs = self.points[self._simplices] - self.center # Calculate the angle subtended by arcs cosine = np.einsum('ij,ij->i', arcs[:, 0], arcs[:, 1]) sine = np.abs(np.linalg.det(arcs)) theta = np.arctan2(sine, cosine) # Get areas using A = r * theta areas = self.radius * theta # Correct arcs which go the wrong way (single-hemisphere inputs) signs = np.sign(np.einsum('ij,ij->i', arcs[:, 0], self.vertices - self.center)) indices = np.where(signs < 0) areas[indices] = 2 * np.pi * self.radius - areas[indices] return areas def calculate_areas(self): """Calculates the areas of the Voronoi regions. For 2D point sets, the regions are circular arcs. The sum of the areas is `2 * pi * radius`. For 3D point sets, the regions are spherical polygons. The sum of the areas is `4 * pi * radius**2`. .. versionadded:: 1.5.0 Returns ------- areas : double array of shape (npoints,) The areas of the Voronoi regions. """ if self._dim == 2: return self._calculate_areas_2d() elif self._dim == 3: return self._calculate_areas_3d() else: raise TypeError("Only supported for 2D and 3D point sets")
bsd-3-clause
kclauw/Dueling_Network_Architectures
results/plot.py
4
1501
import glob, os,csv import sys import numpy as np import matplotlib.pyplot as plt def read_files(folder): runs = [] os.chdir(folder) for file in glob.glob("*.csv"): with open(file) as csvfile: readCSV = csv.reader(csvfile, delimiter=',') steps = [] values = [] row1 = next(readCSV) # First line is header for i,row in enumerate(readCSV): step = row[1] value = row[2] #steps.append(step) if i < 100: steps.append(step) values.append(float(value)) runs.append(values) return [runs,steps] def set_plot(values,label,xlabel,ylabel): plt.plot(values,label=label) plt.xlabel(xlabel, fontsize=18) plt.ylabel(ylabel, fontsize=18) leg = plt.legend(loc=4,prop={'size':10},fontsize=30,shadow=True,markerscale=100) # set the linewidth of each legend object for legobj in leg.legendHandles: legobj.set_linewidth(10.0) def main(): y_label = sys.argv[2] #averages = [float(sum(col))/len(col) for col in zip(*read_files(sys.argv[1]))] runs = read_files(sys.argv[1]) average_runs = [float(sum(col))/len(col) for col in zip(*runs[0])] print(average_runs) plt.figure() plt.plot(average_runs) plt.xlabel("Steps", fontsize=18) plt.ylabel(y_label, fontsize=18) plt.show() plt.savefig('plot1.png') if __name__ == "__main__": main()
mit
dwweiss/pmLib
src/Neural.py
1
27362
""" Copyright (c) 2016- by Dietmar W Weiss This is free software; you can redistribute it and/or modify it under the terms of the GNU Lesser General Public License as published by the Free Software Foundation; either version 3.0 of the License, or (at your option) any later version. This software is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more details. You should have received a copy of the GNU Lesser General Public License along with this software; if not, write to the Free Software Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA, or see the FSF site: http://www.fsf.org. Version: 2018-02-08 DWW """ import numpy as np from pandas import DataFrame import matplotlib.pyplot as plt try: import neurolab as nl _hasNeurolab = True except ImportError: _hasNeurolab = False print("??? Import from 'neurolab' failed") try: import genetic_algorithm as gea _hasGenetic = True except ImportError: _hasGenetic = False print('??? Gea not imported') class NeurGen(object): """ Trains feed-forward network with genetic algorithm """ def __init__(self, minmax, size): self.trainf = None self.errorf = None def init(self): pass def train(self, X, Y, **kwargs): """ Trains feed-forward network with genetic algorithm Args: X (2D array_like of float): training input Y (2D array_like of float): training target kwargs (dict, optional): keywork arguments: epochs (int): max number of iterations of single trial, default is 1000 errorf (function) error function: { nl.error.MSE() | nl.error.SSE() }, default is MSE f (method): method f(x) from Hybrid trough Empirical, default is None (f(x) = x) goal (float): limit of 'errorf' for stop of training (0 < goal < 1), default is 1e-5 hidden (int or array_like of int): array of number of neurons in hidden layers, default is max(1, round(nPoint / (alpha * (nInp + nOut)))) outputf (function): activation function of output layer, default is TanSig() plot (int): control of plots showing training progress, default is 0 (no plot) regularization (float): control of regularization (sum of all weights is added to cost function of training, 0. <= regularization <= 1, default is 0 (no effect of sum of all weights) show (int): control of information about training, if show=0: no print, default is epochs // 10 silent (bool): if True, no information is sent to console, default is False smartTrials (bool): if False, perform all trials even if goal has been reached, default is True trainers (string or list of string): space separated string if 'all' or None, all training algorithms will be applied, default is 'bfgs' transf (function): activation function of hidden layers, default is TanSig() trials (int): maximum number of training trials, default is 3 Returns: errorHistory (array of float): error from 'errorf' for each epoch """ # the only non-NeuroLab argument: f = kwargs.get('f', None) assert f is not None self.f = f.__get__(self, self.__class__) epochs = kwargs.get('epochs', 1000) errorf = kwargs.get('errorf', nl.error.MSE()) goal = kwargs.get('goal', 1.0001e-5) hidden = kwargs.get('hidden', None) outputf = kwargs.get('outputf', None) regularization = kwargs.get('rr', 1.0) show = kwargs.get('show', None) transf = kwargs.get('transf', None) errorHistory = None return errorHistory def sim(self, x): y = None return y class Neural(object): """ a) Wraps different neural network implementations from 1) Neurolab: trains exclusively with backpropagation 2) gea: trains exclusively with genetic algorithm b) Compares different training algorithms and different regularisation settings c) Presents graphically history of norms for each trial References: - Recommended training algorithms: 'bfgs': Broyden–Fletcher–Goldfarb–Shanno algorithm, see: scipy.optimize.fmin_bfgs() ref: wikipedia: Broyden-Fletcher-Goldfarb-Shanno_algorithm 'rprop': resilient backpropagation (NO REGULARIZATION) ref: wikipedia: Rprop - http://neupy.com/docs/tutorials.html#tutorials Proposal for number of hidden neurons: nHidden = nPoint / ([2..10] * (nInp + nOut)) 2 -> lowest risk of over-fitting Installation of neurolab: 1) Fetch neurolab.0.3.5.tar.gz file (or newer) 2) Change to download directory 3) python -m pip install .\neurolab.0.3.5.tar.gz """ def __init__(self): self._X = None # input self._Y = None # target self._net = None # network self._norm_y = None # data from normalization of target self._xKeys = None # xKeys for import from data frame self._yKeys = None # yKeys for import from data frame self._trainers = '' # list of training algorithms self._bestTrainer = '' # best train algorithm self._finalErrors = [] # final errors of best trial for # each trainer in 'self._trainers' self._finalL2norms = [] # final L2-norm of best trial for each trainer self._bestEpochs = [] # epochs of best trial for each trainer plt.rcParams.update({'font.size': 14}) plt.rcParams['legend.fontsize'] = 14 @property def bestTrainer(self): return self._bestTrainer def importDataFrame(self, df, xKeys, yKeys): """ Args: df (DataFrame): data object xKeys (list of string): input keys for data selection yKeys (list of string): output keys for data selection """ self._xKeys = list(xKeys) self._yKeys = list(yKeys) assert all(k in df for k in xKeys), 'unknown x-keys: ' + str(xKeys) + \ 'valid keys: ' + df.columns assert all(k in df for k in yKeys), 'unknown y-keys: ' + str(yKeys) + \ ' , valid keys: ' + df.columns self._X = np.asfarray(df.loc[:, xKeys]) self._Y = np.asfarray(df.loc[:, yKeys]) self._norm_y = nl.tool.Norm(self._Y) self._Y = self._norm_y(self._Y) def importArrays(self, X, Y, xKeys=None, yKeys=None): """ Args: X (1D or 2D array_like of float): X will be converted to 2D-array (first index is data point index) Y (1D or 2D array_like of float): Y will be converted to 2D-array (first index is data point index) xKeys (1D array_like of string): list of column keys for data selection use self._xKeys keys if xKeys is None, default: ['x0', 'x1', ... ] yKeys (1D array_like of string): list of column keys for data selection use self._yKeys keys if yKeys is None, default: ['y0', 'y1', ... ] """ #print('nn X.shape:', X.shape, 'Y.shape:', Y.shape) self._X = np.atleast_2d(X) self._Y = np.atleast_2d(Y) #print('nn self.X.shape:',self._X.shape,'self.Y.shape:',self._Y.shape) if self._X.shape[0] < self._X.shape[1]: self._X = self._X.transpose() if self._Y.shape[0] < self._Y.shape[1]: self._Y = self._Y.transpose() assert self._X.shape[0] == self._Y.shape[0], \ 'input arrays incompatible [' + str(self._X.shape[0]) + \ '] vs. [' + str(self._Y.shape[0]) + ']\n' + \ 'self._X: ' + str(self._X) + '\nself._Y: ' + str(self._Y) if xKeys is None: self._xKeys = ['x' + str(i) for i in range(self._X.shape[1])] else: self._xKeys = xKeys if yKeys is None: self._yKeys = ['y' + str(i) for i in range(self._Y.shape[1])] else: self._yKeys = yKeys self._norm_y = nl.tool.Norm(self._Y) self._Y = self._norm_y(self._Y) def train(self, **kwargs): """ Args: kwargs (dict, optional): keywork arguments: epochs (int): max number of iterations of single trial, default is 1000 errorf (function) error function: { nl.error.MSE() | nl.error.SSE() }, default is MSE f (method): method f(x) from Hybrid trough Empirical, default is None (f(x) = x) goal (float): limit of 'errorf' for stop of training (0 < goal < 1), default is 1e-5 hidden (int or array_like of int): array of number of neurons in hidden layers, default is max(1, round(nPoint / (alpha * (nInp + nOut)))) outputf (function): activation function of output layer, default is TanSig() plot (int): control of plots showing training progress, default is 0 (no plot) regularization (float): control of regularization (sum of all weights is added to cost function of training, 0. <= regularization <= 1, default is 0 (no effect of sum of all weights) show (int): control of information about training, if show=0: no print, default is epochs // 10 silent (bool): if True, no information is sent to console, default is False smartTrials (bool): if False, perform all trials even if goal has been reached, default is True trainers (string or list of string): space separated string if 'all' or None, all training algorithms will be applied, default is 'bfgs' transf (function): activation function of hidden layers, default is TanSig() trials (int): maximum number of training trials, default is 3 Returns: (error, trainer, epochs) for best training trial Note: The best network has been assigned to 'self._net' before return """ assert not(self._X is None or self._Y is None), 'call import*() first' epochs = kwargs.get('epochs', 1000) errorf = kwargs.get('errorf', nl.error.MSE()) f = kwargs.get('f', None) goal = kwargs.get('goal', 1e-5) hidden = kwargs.get('hidden', None) outputf = kwargs.get('outputf', None) plot = kwargs.get('plot', 1) regularization = kwargs.get('regularization', 0.0) show = kwargs.get('show', None) silent = kwargs.get('silent', False) smartTrials = kwargs.get('smartTrials', True) trainers = kwargs.get('trainers', 'bfgs') transf = kwargs.get('transf', None) trials = kwargs.get('trials', 3) if not trainers: trainers == 'all' if isinstance(trainers, str): if trainers == 'all': trainers = 'cg gd gdx gdm gda rprop bfgs genetic' trainers = trainers.split() if f is not None: trainers = 'genetic' self._trainers = list(set(trainers)) # remove redundancy if not self._trainers: self._trainers = ['rprop bfgs'] if errorf is None: errorf = nl.error.MSE() if show is None: show = epochs // 10 if silent: plot = False if isinstance(hidden, (int, float)): hidden = list([int(hidden)]) if hidden is None or len(hidden) == 0: alpha = 2 # 2..10, 2 supresses usually over-fitting nPoint = self._X.shape[0] nInp, nOut = self._X.shape[1], self._Y.shape[1] nHidden = max(1, round(nPoint / (alpha * (nInp + nOut)))) print("+++ auto def of 'nHidden': " + str(nHidden)) hidden = [nHidden] if not isinstance(hidden, list): hidden = list(hidden) size = hidden.copy() size.append(self._Y.shape[1]) assert size[-1] == self._Y.shape[1] trainfDict = {'genetic': None, 'bfgs': nl.train.train_bfgs, 'cg': nl.train.train_cg, 'gd': nl.train.train_gd, 'gda': nl.train.train_gda, 'gdm': nl.train.train_gdm, 'gdx': nl.train.train_gdx, 'rprop': nl.train.train_rprop } assert all([x in trainfDict for x in self._trainers]) if not silent: print('+++ trainers:', self._trainers) sequenceError = float('inf') self._bestTrainer = self._trainers[0] self._finalErrors = [] self._finalL2norms = [] self._bestEpochs = [] for trainer in self._trainers: trainf = trainfDict[trainer] trainerErr = float('inf') trainerEpochs = None trainerL2norm = None if trainer == 'genetic': net = NeurGen(nl.tool.minmax(self._X), size, f=f) else: net = nl.net.newff(nl.tool.minmax(self._X), size) net.trainf = trainf net.errorf = errorf for jTrial in range(trials): net.init() if trainer == 'rprop': trialErrors = net.train(self._X, self._Y, epochs=epochs, show=show, goal=goal) else: trialErrors = net.train(self._X, self._Y, epochs=epochs, show=show, goal=goal, rr=regularization) if sequenceError > trialErrors[-1]: sequenceError = trialErrors[-1] del self._net self._net = net.copy() if (trainerErr < goal and trainerEpochs > len(trialErrors)) or\ (trainerErr >= goal and trainerErr > trialErrors[-1]): trainerErr = trialErrors[-1] trainerEpochs = len(trialErrors) trainerL2norm = np.sqrt(np.mean(np.square( self.__call__(self._X) - self._norm_y.renorm(self._Y)))) if plot: plt.plot(range(len(trialErrors)), trialErrors, label='trial: ' + str(jTrial)) if smartTrials: if trialErrors[-1] < goal: break self._finalErrors.append(trainerErr) self._finalL2norms.append(trainerL2norm) self._bestEpochs.append(trainerEpochs) iBest = self._trainers.index(self._bestTrainer) if trainerErr < self._finalErrors[iBest]: self._bestTrainer = trainer if plot: plt.title("'" + trainer + "' mse:" + str(round(trainerErr*1e3, 2)) + 'e-3 L2:' + str(round(trainerL2norm, 3)) + ' [' + str(trainerEpochs) + ']') plt.xlabel('epochs') plt.ylabel('error') plt.yscale('log', nonposy='clip') plt.legend(bbox_to_anchor=(1.1, 1), loc='upper left') plt.grid() plt.show() if not silent: print(' ' + trainer + ':' + str(round(trainerErr, 5)) + '[' + str(trainerEpochs) + '], ') if plot: self.plotTestWithTrainData() iBest = self._trainers.index(self._bestTrainer) if not silent: if len(self._trainers) > 1: print(" best trainer: '" + self._trainers[iBest] + "' out of: [" + ' '.join(self._trainers) + '], error:', round(self._finalErrors[iBest], 5)) if len(self._finalErrors) > 1: print(" (trainer:err): [", end='') s = '' for trainer, err in zip(self._trainers, self._finalErrors): s += trainer + ':' + str(round(err, 5)) + ' ' print(s[:-2] + ']') return self._finalErrors[iBest], self._trainers[iBest], \ self._bestEpochs[iBest] def __call__(self, x=None, **kwargs): return self.predict(x=x) def predict(self, **kwargs): x = kwargs.get('x', None) if x is None: x = self._X assert x is not None, 'x is None' assert self._net is not None, 'net is not trained' x = np.asfarray(x) if x.ndim == 1: x = x.reshape(x.size, 1) if x.shape[1] != self._net.ci: x = np.transpose(x) y = self._net.sim(x) return self._norm_y.renorm(y) def plotTestWithTrainData(self): for trainer, error, epochs in zip(self._trainers, self._finalErrors, self._bestEpochs): y = self.__call__(self._X) # prediction Y = self._norm_y.renorm(self._Y) # target title = 'Train (' + trainer + ') mse: ' + \ str(round(error * 1e3, 2)) + 'e-3 [' + str(epochs) + ']' plt.title(title) for j, yTrainSub in enumerate(Y.T): dy = np.subtract(y.T[j], yTrainSub) for i, xTrainSub in enumerate(self._X.T): label = self._xKeys[i] + ' & ' + self._yKeys[j] plt.plot(xTrainSub, dy, label=label) plt.xlabel('$x$') plt.ylabel('$y_{pred} - y_{train}$') plt.legend(bbox_to_anchor=(1.1, 1), loc='upper left') plt.show() plt.title(title) for j, yTrainSub in enumerate(Y.T): for i, xTrainSub in enumerate(self._X.T): label = self._xKeys[i] + ' & ' + self._yKeys[j] plt.plot(xTrainSub, y.T[j], label=label) plt.plot(xTrainSub, yTrainSub, label=label + ' (target)', linestyle='', marker='*') plt.xlabel('$x$') plt.ylabel('$y$') plt.legend(bbox_to_anchor=(1.1, 1), loc='upper left') plt.show() x = range(len(self._finalErrors)) y = self._finalErrors y2 = np.asfarray(self._bestEpochs) * 1e-5 f = plt.figure() ax = f.add_axes([.1, .1, .8, .8]) ax.plot(np.asfarray(x)+0.01, y2, color='b', label='epochs*1e-5') ax.bar(x, y, align='center', color='r', label='MSE') ax.set_xticks(x) ax.set_xticklabels(self._trainers) ax.set_yticks(np.add(y, y2)) plt.title('Final training errors') plt.xlabel('trainer') plt.ylabel('error') plt.yscale('log', nonposy='clip') plt.grid() plt.legend(bbox_to_anchor=(1.1, 1), loc='upper left') plt.show() # Examples #################################################################### if __name__ == '__main__': ALL = 1 if 0 or ALL: s = 'Example 1' print('-' * len(s) + '\n' + s + '\n' + '-' * len(s)) X = np.linspace(-1.75 * np.pi, 1.75 * np.pi, 50) Y = np.sin(X) * 10 + 0 net = Neural() net.importArrays(X, Y) # trainers: 'cg gd gdx gdm gda rprop bfgs' net.train(hidden=[6], plot=1, epochs=500, goal=1e-5, trials=5, trainers='cg gdx rprop bfgs', regularization=0.0, show=None) dx = 0.5 * (X.max() - X.min()) x = np.linspace(X.min() - dx, X.max() + dx) y = net(x) L2_norm = np.sqrt(np.mean(np.square(y - Y))) plt.title('Test (' + net._bestTrainer + ') L2: ' + str(round(L2_norm, 2))) plt.plot(x, y, '-', X, Y, '.') plt.legend(['pred', 'targ', ]) plt.xlabel('x') plt.ylabel('y(x)') plt.show() if 0 or ALL: s = 'Example 2' print('-' * len(s) + '\n' + s + '\n' + '-' * len(s)) df = DataFrame({'p0': [10, 20, 30, 40], 'p1': [11, 21, 31, 41], 'p2': [12, 22, 32, 42], 'r0': [31, 41, 51, 52], 'r1': [32, 42, 52, 55]}) xKeys = ['p0', 'p2'] yKeys = ['r0', 'r1'] net = Neural() net.importDataFrame(df, xKeys, yKeys) err = net.train(goal=1e-6, hidden=[10, 3], plot=1, epochs=2000, trainers='cg gdx rprop bfgs', trials=10, regularization=0.01, smartTrials=False) if 0 or ALL: s = 'Example 3' print('-' * len(s) + '\n' + s + '\n' + '-' * len(s)) try: from plotArrays import plotSurface, plotIsolines, plotIsoMap, \ plotWireframe except ImportError: print("??? import from 'plotArrays' failed") X = [[10, 11], [11, 33], [33, 14], [37, 39], [20, 20]] Y = [[10, 11], [12, 13], [35, 40], [58, 68], [22, 28]] net = Neural() net.importArrays(X, Y) err = net.train(hidden=6, plot=1, epochs=1000, goal=1e-6, trainers='cg gdx rprop bfgs', trials=5) y = net(X)[:, 0] X = np.asfarray(X) Y = np.asfarray(Y)[:, 0] dy = np.subtract(y, Y) if X.shape[1] == 2: plotWireframe(X[:, 0], X[:, 1], y, title='$y_{prd}$', labels=['x', 'y', r'$Y_{targ}$']) plotWireframe(X[:, 0], X[:, 1], Y, title='$Y_{trg}$', labels=['x', 'y', r'$Y_{targ}$']) plotWireframe(X[:, 0], X[:, 1], dy, title=r'$\Delta y$', labels=['x', 'y', r'$\Delta y$']) plotIsolines(X[:, 0], X[:, 1], y, title='$y_{prd}$') plotIsoMap(X[:, 0], X[:, 1], y, title='$y_{prd}$') plotIsoMap(X[:, 0], X[:, 1], Y, title='$Y_{trg}$') plotIsolines(X[:, 0], X[:, 1], Y, title='$Y_{trg}$') plotIsoMap(X[:, 0], X[:, 1], dy, title=r'$\Delta y$') plotSurface(X[:, 0], X[:, 1], dy, title=r'$\Delta y$') plotSurface(X[:, 0], X[:, 1], y, title='$y_{prd}$') if 0 or ALL: s = 'Example 4: newff and train without class Neural' print('-' * len(s) + '\n' + s + '\n' + '-' * len(s)) X = np.atleast_2d(np.linspace(-7, 7, 20)).T Y = np.sin(X) * 10 norm_y = nl.tool.Norm(Y) YY = norm_y(Y) net = nl.net.newff(nl.tool.minmax(X), [5, YY.shape[1]]) # net.trainf = nl.train.train_rprop # or: net.trainf = nl.train.train_bfgs error = net.train(X, YY, epochs=10000, show=100, goal=1e-6) yTrain = norm_y.renorm(net.sim(X)) print(error[-1]) plt.subplot(211) plt.plot(error) plt.legend(['L2 error']) plt.xlabel('Epoch number') plt.ylabel('error (default SSE)') xTest = np.atleast_2d(np.linspace(-5, 8, 150)).T yTest = norm_y.renorm(net.sim(xTest)).ravel() plt.subplot(212) plt.plot(xTest, yTest, '-', X, Y, '.') plt.legend(['pred', 'targ']) plt.xlabel('x') plt.ylabel('y(x)') plt.show() if 0 or ALL: s = 'Example 5' print('-' * len(s) + '\n' + s + '\n' + '-' * len(s)) try: from plotArrays import plotSurface, plotIsolines, plotIsoMap except ImportError: print("??? import of 'plotArrays' failed") X = np.atleast_2d(np.linspace(-2 * np.pi, 2 * np.pi, 50)).T Y = np.sin(X) * 5 net = Neural() net.importArrays(X, Y) # trainers: 'cg gd gdx gdm gda rprop bfgs' err = net.train(hidden=[8, 2], plot=1, epochs=2000, goal=1e-5, trainers='rprop bfgs', trials=8) y = net(X) if X.shape[1] == 1: plt.plot(X, y, label='pred') plt.plot(X, Y, label='targ') plt.legend() plt.show() elif X.shape[1] == 2: plotSurface(X[:, 0], X[:, 1], y[:, 0], title='$y_{prd}$') plotIsolines(X[:, 0], X[:, 1], y[:, 0], title='$y_{prd}$') plotIsolines(X[:, 0], X[:, 1], Y[:, 0], title='$y_{trg}$') dy = y - Y if X.shape[1] == 2: plotIsoMap(X[:, 0], X[:, 1], dy[:, 0], title='$y_{prd} - y_{trg}$')
lgpl-3.0
HolgerPeters/scikit-learn
benchmarks/bench_plot_lasso_path.py
84
4005
"""Benchmarks of Lasso regularization path computation using Lars and CD The input data is mostly low rank but is a fat infinite tail. """ from __future__ import print_function from collections import defaultdict import gc import sys from time import time import numpy as np from sklearn.linear_model import lars_path from sklearn.linear_model import lasso_path from sklearn.datasets.samples_generator import make_regression def compute_bench(samples_range, features_range): it = 0 results = defaultdict(lambda: []) max_it = len(samples_range) * len(features_range) for n_samples in samples_range: for n_features in features_range: it += 1 print('====================') print('Iteration %03d of %03d' % (it, max_it)) print('====================') dataset_kwargs = { 'n_samples': n_samples, 'n_features': n_features, 'n_informative': n_features / 10, 'effective_rank': min(n_samples, n_features) / 10, #'effective_rank': None, 'bias': 0.0, } print("n_samples: %d" % n_samples) print("n_features: %d" % n_features) X, y = make_regression(**dataset_kwargs) gc.collect() print("benchmarking lars_path (with Gram):", end='') sys.stdout.flush() tstart = time() G = np.dot(X.T, X) # precomputed Gram matrix Xy = np.dot(X.T, y) lars_path(X, y, Xy=Xy, Gram=G, method='lasso') delta = time() - tstart print("%0.3fs" % delta) results['lars_path (with Gram)'].append(delta) gc.collect() print("benchmarking lars_path (without Gram):", end='') sys.stdout.flush() tstart = time() lars_path(X, y, method='lasso') delta = time() - tstart print("%0.3fs" % delta) results['lars_path (without Gram)'].append(delta) gc.collect() print("benchmarking lasso_path (with Gram):", end='') sys.stdout.flush() tstart = time() lasso_path(X, y, precompute=True) delta = time() - tstart print("%0.3fs" % delta) results['lasso_path (with Gram)'].append(delta) gc.collect() print("benchmarking lasso_path (without Gram):", end='') sys.stdout.flush() tstart = time() lasso_path(X, y, precompute=False) delta = time() - tstart print("%0.3fs" % delta) results['lasso_path (without Gram)'].append(delta) return results if __name__ == '__main__': from mpl_toolkits.mplot3d import axes3d # register the 3d projection import matplotlib.pyplot as plt samples_range = np.linspace(10, 2000, 5).astype(np.int) features_range = np.linspace(10, 2000, 5).astype(np.int) results = compute_bench(samples_range, features_range) max_time = max(max(t) for t in results.values()) fig = plt.figure('scikit-learn Lasso path benchmark results') i = 1 for c, (label, timings) in zip('bcry', sorted(results.items())): ax = fig.add_subplot(2, 2, i, projection='3d') X, Y = np.meshgrid(samples_range, features_range) Z = np.asarray(timings).reshape(samples_range.shape[0], features_range.shape[0]) # plot the actual surface ax.plot_surface(X, Y, Z.T, cstride=1, rstride=1, color=c, alpha=0.8) # dummy point plot to stick the legend to since surface plot do not # support legends (yet?) # ax.plot([1], [1], [1], color=c, label=label) ax.set_xlabel('n_samples') ax.set_ylabel('n_features') ax.set_zlabel('Time (s)') ax.set_zlim3d(0.0, max_time * 1.1) ax.set_title(label) # ax.legend() i += 1 plt.show()
bsd-3-clause
yyjiang/scikit-learn
sklearn/ensemble/tests/test_gradient_boosting.py
127
37672
""" Testing for the gradient boosting module (sklearn.ensemble.gradient_boosting). """ import warnings import numpy as np from sklearn import datasets from sklearn.base import clone from sklearn.ensemble import GradientBoostingClassifier from sklearn.ensemble import GradientBoostingRegressor from sklearn.ensemble.gradient_boosting import ZeroEstimator from sklearn.metrics import mean_squared_error from sklearn.utils import check_random_state, tosequence from sklearn.utils.testing import assert_almost_equal from sklearn.utils.testing import assert_array_almost_equal from sklearn.utils.testing import assert_array_equal from sklearn.utils.testing import assert_equal from sklearn.utils.testing import assert_greater from sklearn.utils.testing import assert_less from sklearn.utils.testing import assert_raises from sklearn.utils.testing import assert_true from sklearn.utils.testing import assert_warns from sklearn.utils.validation import DataConversionWarning from sklearn.utils.validation import NotFittedError # toy sample X = [[-2, -1], [-1, -1], [-1, -2], [1, 1], [1, 2], [2, 1]] y = [-1, -1, -1, 1, 1, 1] T = [[-1, -1], [2, 2], [3, 2]] true_result = [-1, 1, 1] rng = np.random.RandomState(0) # also load the boston dataset # and randomly permute it boston = datasets.load_boston() perm = rng.permutation(boston.target.size) boston.data = boston.data[perm] boston.target = boston.target[perm] # also load the iris dataset # and randomly permute it iris = datasets.load_iris() perm = rng.permutation(iris.target.size) iris.data = iris.data[perm] iris.target = iris.target[perm] def test_classification_toy(): # Check classification on a toy dataset. for loss in ('deviance', 'exponential'): clf = GradientBoostingClassifier(loss=loss, n_estimators=10, random_state=1) assert_raises(ValueError, clf.predict, T) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result) assert_equal(10, len(clf.estimators_)) deviance_decrease = (clf.train_score_[:-1] - clf.train_score_[1:]) assert np.any(deviance_decrease >= 0.0), \ "Train deviance does not monotonically decrease." def test_parameter_checks(): # Check input parameter validation. assert_raises(ValueError, GradientBoostingClassifier(n_estimators=0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(n_estimators=-1).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(learning_rate=0.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(learning_rate=-1.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(loss='foobar').fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_samples_split=0.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_samples_split=-1.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_samples_leaf=0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_samples_leaf=-1.).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_weight_fraction_leaf=-1.).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(min_weight_fraction_leaf=0.6).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(subsample=0.0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(subsample=1.1).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(subsample=-0.1).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(max_depth=-0.1).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(max_depth=0).fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(init={}).fit, X, y) # test fit before feature importance assert_raises(ValueError, lambda: GradientBoostingClassifier().feature_importances_) # deviance requires ``n_classes >= 2``. assert_raises(ValueError, lambda X, y: GradientBoostingClassifier( loss='deviance').fit(X, y), X, [0, 0, 0, 0]) def test_loss_function(): assert_raises(ValueError, GradientBoostingClassifier(loss='ls').fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(loss='lad').fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(loss='quantile').fit, X, y) assert_raises(ValueError, GradientBoostingClassifier(loss='huber').fit, X, y) assert_raises(ValueError, GradientBoostingRegressor(loss='deviance').fit, X, y) assert_raises(ValueError, GradientBoostingRegressor(loss='exponential').fit, X, y) def test_classification_synthetic(): # Test GradientBoostingClassifier on synthetic dataset used by # Hastie et al. in ESLII Example 12.7. X, y = datasets.make_hastie_10_2(n_samples=12000, random_state=1) X_train, X_test = X[:2000], X[2000:] y_train, y_test = y[:2000], y[2000:] for loss in ('deviance', 'exponential'): gbrt = GradientBoostingClassifier(n_estimators=100, min_samples_split=1, max_depth=1, loss=loss, learning_rate=1.0, random_state=0) gbrt.fit(X_train, y_train) error_rate = (1.0 - gbrt.score(X_test, y_test)) assert error_rate < 0.09, \ "GB(loss={}) failed with error {}".format(loss, error_rate) gbrt = GradientBoostingClassifier(n_estimators=200, min_samples_split=1, max_depth=1, learning_rate=1.0, subsample=0.5, random_state=0) gbrt.fit(X_train, y_train) error_rate = (1.0 - gbrt.score(X_test, y_test)) assert error_rate < 0.08, ("Stochastic GradientBoostingClassifier(loss={}) " "failed with error {}".format(loss, error_rate)) def test_boston(): # Check consistency on dataset boston house prices with least squares # and least absolute deviation. for loss in ("ls", "lad", "huber"): for subsample in (1.0, 0.5): last_y_pred = None for i, sample_weight in enumerate( (None, np.ones(len(boston.target)), 2 * np.ones(len(boston.target)))): clf = GradientBoostingRegressor(n_estimators=100, loss=loss, max_depth=4, subsample=subsample, min_samples_split=1, random_state=1) assert_raises(ValueError, clf.predict, boston.data) clf.fit(boston.data, boston.target, sample_weight=sample_weight) y_pred = clf.predict(boston.data) mse = mean_squared_error(boston.target, y_pred) assert mse < 6.0, "Failed with loss %s and " \ "mse = %.4f" % (loss, mse) if last_y_pred is not None: np.testing.assert_array_almost_equal( last_y_pred, y_pred, err_msg='pred_%d doesnt match last pred_%d for loss %r and subsample %r. ' % (i, i - 1, loss, subsample)) last_y_pred = y_pred def test_iris(): # Check consistency on dataset iris. for subsample in (1.0, 0.5): for sample_weight in (None, np.ones(len(iris.target))): clf = GradientBoostingClassifier(n_estimators=100, loss='deviance', random_state=1, subsample=subsample) clf.fit(iris.data, iris.target, sample_weight=sample_weight) score = clf.score(iris.data, iris.target) assert score > 0.9, "Failed with subsample %.1f " \ "and score = %f" % (subsample, score) def test_regression_synthetic(): # Test on synthetic regression datasets used in Leo Breiman, # `Bagging Predictors?. Machine Learning 24(2): 123-140 (1996). random_state = check_random_state(1) regression_params = {'n_estimators': 100, 'max_depth': 4, 'min_samples_split': 1, 'learning_rate': 0.1, 'loss': 'ls'} # Friedman1 X, y = datasets.make_friedman1(n_samples=1200, random_state=random_state, noise=1.0) X_train, y_train = X[:200], y[:200] X_test, y_test = X[200:], y[200:] clf = GradientBoostingRegressor() clf.fit(X_train, y_train) mse = mean_squared_error(y_test, clf.predict(X_test)) assert mse < 5.0, "Failed on Friedman1 with mse = %.4f" % mse # Friedman2 X, y = datasets.make_friedman2(n_samples=1200, random_state=random_state) X_train, y_train = X[:200], y[:200] X_test, y_test = X[200:], y[200:] clf = GradientBoostingRegressor(**regression_params) clf.fit(X_train, y_train) mse = mean_squared_error(y_test, clf.predict(X_test)) assert mse < 1700.0, "Failed on Friedman2 with mse = %.4f" % mse # Friedman3 X, y = datasets.make_friedman3(n_samples=1200, random_state=random_state) X_train, y_train = X[:200], y[:200] X_test, y_test = X[200:], y[200:] clf = GradientBoostingRegressor(**regression_params) clf.fit(X_train, y_train) mse = mean_squared_error(y_test, clf.predict(X_test)) assert mse < 0.015, "Failed on Friedman3 with mse = %.4f" % mse def test_feature_importances(): X = np.array(boston.data, dtype=np.float32) y = np.array(boston.target, dtype=np.float32) clf = GradientBoostingRegressor(n_estimators=100, max_depth=5, min_samples_split=1, random_state=1) clf.fit(X, y) #feature_importances = clf.feature_importances_ assert_true(hasattr(clf, 'feature_importances_')) X_new = clf.transform(X, threshold="mean") assert_less(X_new.shape[1], X.shape[1]) feature_mask = clf.feature_importances_ > clf.feature_importances_.mean() assert_array_almost_equal(X_new, X[:, feature_mask]) # true feature importance ranking # true_ranking = np.array([3, 1, 8, 2, 10, 9, 4, 11, 0, 6, 7, 5, 12]) # assert_array_equal(true_ranking, feature_importances.argsort()) def test_probability_log(): # Predict probabilities. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) assert_raises(ValueError, clf.predict_proba, T) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result) # check if probabilities are in [0, 1]. y_proba = clf.predict_proba(T) assert np.all(y_proba >= 0.0) assert np.all(y_proba <= 1.0) # derive predictions from probabilities y_pred = clf.classes_.take(y_proba.argmax(axis=1), axis=0) assert_array_equal(y_pred, true_result) def test_check_inputs(): # Test input checks (shape and type of X and y). clf = GradientBoostingClassifier(n_estimators=100, random_state=1) assert_raises(ValueError, clf.fit, X, y + [0, 1]) from scipy import sparse X_sparse = sparse.csr_matrix(X) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) assert_raises(TypeError, clf.fit, X_sparse, y) clf = GradientBoostingClassifier().fit(X, y) assert_raises(TypeError, clf.predict, X_sparse) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) assert_raises(ValueError, clf.fit, X, y, sample_weight=([1] * len(y)) + [0, 1]) def test_check_inputs_predict(): # X has wrong shape clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X, y) x = np.array([1.0, 2.0])[:, np.newaxis] assert_raises(ValueError, clf.predict, x) x = np.array([]) assert_raises(ValueError, clf.predict, x) x = np.array([1.0, 2.0, 3.0])[:, np.newaxis] assert_raises(ValueError, clf.predict, x) clf = GradientBoostingRegressor(n_estimators=100, random_state=1) clf.fit(X, rng.rand(len(X))) x = np.array([1.0, 2.0])[:, np.newaxis] assert_raises(ValueError, clf.predict, x) x = np.array([]) assert_raises(ValueError, clf.predict, x) x = np.array([1.0, 2.0, 3.0])[:, np.newaxis] assert_raises(ValueError, clf.predict, x) def test_check_max_features(): # test if max_features is valid. clf = GradientBoostingRegressor(n_estimators=100, random_state=1, max_features=0) assert_raises(ValueError, clf.fit, X, y) clf = GradientBoostingRegressor(n_estimators=100, random_state=1, max_features=(len(X[0]) + 1)) assert_raises(ValueError, clf.fit, X, y) clf = GradientBoostingRegressor(n_estimators=100, random_state=1, max_features=-0.1) assert_raises(ValueError, clf.fit, X, y) def test_max_feature_regression(): # Test to make sure random state is set properly. X, y = datasets.make_hastie_10_2(n_samples=12000, random_state=1) X_train, X_test = X[:2000], X[2000:] y_train, y_test = y[:2000], y[2000:] gbrt = GradientBoostingClassifier(n_estimators=100, min_samples_split=5, max_depth=2, learning_rate=.1, max_features=2, random_state=1) gbrt.fit(X_train, y_train) deviance = gbrt.loss_(y_test, gbrt.decision_function(X_test)) assert_true(deviance < 0.5, "GB failed with deviance %.4f" % deviance) def test_max_feature_auto(): # Test if max features is set properly for floats and str. X, y = datasets.make_hastie_10_2(n_samples=12000, random_state=1) _, n_features = X.shape X_train = X[:2000] y_train = y[:2000] gbrt = GradientBoostingClassifier(n_estimators=1, max_features='auto') gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, int(np.sqrt(n_features))) gbrt = GradientBoostingRegressor(n_estimators=1, max_features='auto') gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, n_features) gbrt = GradientBoostingRegressor(n_estimators=1, max_features=0.3) gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, int(n_features * 0.3)) gbrt = GradientBoostingRegressor(n_estimators=1, max_features='sqrt') gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, int(np.sqrt(n_features))) gbrt = GradientBoostingRegressor(n_estimators=1, max_features='log2') gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, int(np.log2(n_features))) gbrt = GradientBoostingRegressor(n_estimators=1, max_features=0.01 / X.shape[1]) gbrt.fit(X_train, y_train) assert_equal(gbrt.max_features_, 1) def test_staged_predict(): # Test whether staged decision function eventually gives # the same prediction. X, y = datasets.make_friedman1(n_samples=1200, random_state=1, noise=1.0) X_train, y_train = X[:200], y[:200] X_test = X[200:] clf = GradientBoostingRegressor() # test raise ValueError if not fitted assert_raises(ValueError, lambda X: np.fromiter( clf.staged_predict(X), dtype=np.float64), X_test) clf.fit(X_train, y_train) y_pred = clf.predict(X_test) # test if prediction for last stage equals ``predict`` for y in clf.staged_predict(X_test): assert_equal(y.shape, y_pred.shape) assert_array_equal(y_pred, y) def test_staged_predict_proba(): # Test whether staged predict proba eventually gives # the same prediction. X, y = datasets.make_hastie_10_2(n_samples=1200, random_state=1) X_train, y_train = X[:200], y[:200] X_test, y_test = X[200:], y[200:] clf = GradientBoostingClassifier(n_estimators=20) # test raise NotFittedError if not fitted assert_raises(NotFittedError, lambda X: np.fromiter( clf.staged_predict_proba(X), dtype=np.float64), X_test) clf.fit(X_train, y_train) # test if prediction for last stage equals ``predict`` for y_pred in clf.staged_predict(X_test): assert_equal(y_test.shape, y_pred.shape) assert_array_equal(clf.predict(X_test), y_pred) # test if prediction for last stage equals ``predict_proba`` for staged_proba in clf.staged_predict_proba(X_test): assert_equal(y_test.shape[0], staged_proba.shape[0]) assert_equal(2, staged_proba.shape[1]) assert_array_equal(clf.predict_proba(X_test), staged_proba) def test_staged_functions_defensive(): # test that staged_functions make defensive copies rng = np.random.RandomState(0) X = rng.uniform(size=(10, 3)) y = (4 * X[:, 0]).astype(np.int) + 1 # don't predict zeros for estimator in [GradientBoostingRegressor(), GradientBoostingClassifier()]: estimator.fit(X, y) for func in ['predict', 'decision_function', 'predict_proba']: staged_func = getattr(estimator, "staged_" + func, None) if staged_func is None: # regressor has no staged_predict_proba continue with warnings.catch_warnings(record=True): staged_result = list(staged_func(X)) staged_result[1][:] = 0 assert_true(np.all(staged_result[0] != 0)) def test_serialization(): # Check model serialization. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) try: import cPickle as pickle except ImportError: import pickle serialized_clf = pickle.dumps(clf, protocol=pickle.HIGHEST_PROTOCOL) clf = None clf = pickle.loads(serialized_clf) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) def test_degenerate_targets(): # Check if we can fit even though all targets are equal. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) # classifier should raise exception assert_raises(ValueError, clf.fit, X, np.ones(len(X))) clf = GradientBoostingRegressor(n_estimators=100, random_state=1) clf.fit(X, np.ones(len(X))) clf.predict(rng.rand(2)) assert_array_equal(np.ones((1,), dtype=np.float64), clf.predict(rng.rand(2))) def test_quantile_loss(): # Check if quantile loss with alpha=0.5 equals lad. clf_quantile = GradientBoostingRegressor(n_estimators=100, loss='quantile', max_depth=4, alpha=0.5, random_state=7) clf_quantile.fit(boston.data, boston.target) y_quantile = clf_quantile.predict(boston.data) clf_lad = GradientBoostingRegressor(n_estimators=100, loss='lad', max_depth=4, random_state=7) clf_lad.fit(boston.data, boston.target) y_lad = clf_lad.predict(boston.data) assert_array_almost_equal(y_quantile, y_lad, decimal=4) def test_symbol_labels(): # Test with non-integer class labels. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) symbol_y = tosequence(map(str, y)) clf.fit(X, symbol_y) assert_array_equal(clf.predict(T), tosequence(map(str, true_result))) assert_equal(100, len(clf.estimators_)) def test_float_class_labels(): # Test with float class labels. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) float_y = np.asarray(y, dtype=np.float32) clf.fit(X, float_y) assert_array_equal(clf.predict(T), np.asarray(true_result, dtype=np.float32)) assert_equal(100, len(clf.estimators_)) def test_shape_y(): # Test with float class labels. clf = GradientBoostingClassifier(n_estimators=100, random_state=1) y_ = np.asarray(y, dtype=np.int32) y_ = y_[:, np.newaxis] # This will raise a DataConversionWarning that we want to # "always" raise, elsewhere the warnings gets ignored in the # later tests, and the tests that check for this warning fail assert_warns(DataConversionWarning, clf.fit, X, y_) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) def test_mem_layout(): # Test with different memory layouts of X and y X_ = np.asfortranarray(X) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X_, y) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) X_ = np.ascontiguousarray(X) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X_, y) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) y_ = np.asarray(y, dtype=np.int32) y_ = np.ascontiguousarray(y_) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X, y_) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) y_ = np.asarray(y, dtype=np.int32) y_ = np.asfortranarray(y_) clf = GradientBoostingClassifier(n_estimators=100, random_state=1) clf.fit(X, y_) assert_array_equal(clf.predict(T), true_result) assert_equal(100, len(clf.estimators_)) def test_oob_improvement(): # Test if oob improvement has correct shape and regression test. clf = GradientBoostingClassifier(n_estimators=100, random_state=1, subsample=0.5) clf.fit(X, y) assert clf.oob_improvement_.shape[0] == 100 # hard-coded regression test - change if modification in OOB computation assert_array_almost_equal(clf.oob_improvement_[:5], np.array([0.19, 0.15, 0.12, -0.12, -0.11]), decimal=2) def test_oob_improvement_raise(): # Test if oob improvement has correct shape. clf = GradientBoostingClassifier(n_estimators=100, random_state=1, subsample=1.0) clf.fit(X, y) assert_raises(AttributeError, lambda: clf.oob_improvement_) def test_oob_multilcass_iris(): # Check OOB improvement on multi-class dataset. clf = GradientBoostingClassifier(n_estimators=100, loss='deviance', random_state=1, subsample=0.5) clf.fit(iris.data, iris.target) score = clf.score(iris.data, iris.target) assert score > 0.9, "Failed with subsample %.1f " \ "and score = %f" % (0.5, score) assert clf.oob_improvement_.shape[0] == clf.n_estimators # hard-coded regression test - change if modification in OOB computation # FIXME: the following snippet does not yield the same results on 32 bits # assert_array_almost_equal(clf.oob_improvement_[:5], # np.array([12.68, 10.45, 8.18, 6.43, 5.13]), # decimal=2) def test_verbose_output(): # Check verbose=1 does not cause error. from sklearn.externals.six.moves import cStringIO as StringIO import sys old_stdout = sys.stdout sys.stdout = StringIO() clf = GradientBoostingClassifier(n_estimators=100, random_state=1, verbose=1, subsample=0.8) clf.fit(X, y) verbose_output = sys.stdout sys.stdout = old_stdout # check output verbose_output.seek(0) header = verbose_output.readline().rstrip() # with OOB true_header = ' '.join(['%10s'] + ['%16s'] * 3) % ( 'Iter', 'Train Loss', 'OOB Improve', 'Remaining Time') assert_equal(true_header, header) n_lines = sum(1 for l in verbose_output.readlines()) # one for 1-10 and then 9 for 20-100 assert_equal(10 + 9, n_lines) def test_more_verbose_output(): # Check verbose=2 does not cause error. from sklearn.externals.six.moves import cStringIO as StringIO import sys old_stdout = sys.stdout sys.stdout = StringIO() clf = GradientBoostingClassifier(n_estimators=100, random_state=1, verbose=2) clf.fit(X, y) verbose_output = sys.stdout sys.stdout = old_stdout # check output verbose_output.seek(0) header = verbose_output.readline().rstrip() # no OOB true_header = ' '.join(['%10s'] + ['%16s'] * 2) % ( 'Iter', 'Train Loss', 'Remaining Time') assert_equal(true_header, header) n_lines = sum(1 for l in verbose_output.readlines()) # 100 lines for n_estimators==100 assert_equal(100, n_lines) def test_warm_start(): # Test if warm start equals fit. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=200, max_depth=1) est.fit(X, y) est_ws = Cls(n_estimators=100, max_depth=1, warm_start=True) est_ws.fit(X, y) est_ws.set_params(n_estimators=200) est_ws.fit(X, y) assert_array_almost_equal(est_ws.predict(X), est.predict(X)) def test_warm_start_n_estimators(): # Test if warm start equals fit - set n_estimators. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=300, max_depth=1) est.fit(X, y) est_ws = Cls(n_estimators=100, max_depth=1, warm_start=True) est_ws.fit(X, y) est_ws.set_params(n_estimators=300) est_ws.fit(X, y) assert_array_almost_equal(est_ws.predict(X), est.predict(X)) def test_warm_start_max_depth(): # Test if possible to fit trees of different depth in ensemble. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1, warm_start=True) est.fit(X, y) est.set_params(n_estimators=110, max_depth=2) est.fit(X, y) # last 10 trees have different depth assert est.estimators_[0, 0].max_depth == 1 for i in range(1, 11): assert est.estimators_[-i, 0].max_depth == 2 def test_warm_start_clear(): # Test if fit clears state. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1) est.fit(X, y) est_2 = Cls(n_estimators=100, max_depth=1, warm_start=True) est_2.fit(X, y) # inits state est_2.set_params(warm_start=False) est_2.fit(X, y) # clears old state and equals est assert_array_almost_equal(est_2.predict(X), est.predict(X)) def test_warm_start_zero_n_estimators(): # Test if warm start with zero n_estimators raises error X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1, warm_start=True) est.fit(X, y) est.set_params(n_estimators=0) assert_raises(ValueError, est.fit, X, y) def test_warm_start_smaller_n_estimators(): # Test if warm start with smaller n_estimators raises error X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1, warm_start=True) est.fit(X, y) est.set_params(n_estimators=99) assert_raises(ValueError, est.fit, X, y) def test_warm_start_equal_n_estimators(): # Test if warm start with equal n_estimators does nothing X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1) est.fit(X, y) est2 = clone(est) est2.set_params(n_estimators=est.n_estimators, warm_start=True) est2.fit(X, y) assert_array_almost_equal(est2.predict(X), est.predict(X)) def test_warm_start_oob_switch(): # Test if oob can be turned on during warm start. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=100, max_depth=1, warm_start=True) est.fit(X, y) est.set_params(n_estimators=110, subsample=0.5) est.fit(X, y) assert_array_equal(est.oob_improvement_[:100], np.zeros(100)) # the last 10 are not zeros assert_array_equal(est.oob_improvement_[-10:] == 0.0, np.zeros(10, dtype=np.bool)) def test_warm_start_oob(): # Test if warm start OOB equals fit. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=200, max_depth=1, subsample=0.5, random_state=1) est.fit(X, y) est_ws = Cls(n_estimators=100, max_depth=1, subsample=0.5, random_state=1, warm_start=True) est_ws.fit(X, y) est_ws.set_params(n_estimators=200) est_ws.fit(X, y) assert_array_almost_equal(est_ws.oob_improvement_[:100], est.oob_improvement_[:100]) def early_stopping_monitor(i, est, locals): """Returns True on the 10th iteration. """ if i == 9: return True else: return False def test_monitor_early_stopping(): # Test if monitor return value works. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) for Cls in [GradientBoostingRegressor, GradientBoostingClassifier]: est = Cls(n_estimators=20, max_depth=1, random_state=1, subsample=0.5) est.fit(X, y, monitor=early_stopping_monitor) assert_equal(est.n_estimators, 20) # this is not altered assert_equal(est.estimators_.shape[0], 10) assert_equal(est.train_score_.shape[0], 10) assert_equal(est.oob_improvement_.shape[0], 10) # try refit est.set_params(n_estimators=30) est.fit(X, y) assert_equal(est.n_estimators, 30) assert_equal(est.estimators_.shape[0], 30) assert_equal(est.train_score_.shape[0], 30) est = Cls(n_estimators=20, max_depth=1, random_state=1, subsample=0.5, warm_start=True) est.fit(X, y, monitor=early_stopping_monitor) assert_equal(est.n_estimators, 20) assert_equal(est.estimators_.shape[0], 10) assert_equal(est.train_score_.shape[0], 10) assert_equal(est.oob_improvement_.shape[0], 10) # try refit est.set_params(n_estimators=30, warm_start=False) est.fit(X, y) assert_equal(est.n_estimators, 30) assert_equal(est.train_score_.shape[0], 30) assert_equal(est.estimators_.shape[0], 30) assert_equal(est.oob_improvement_.shape[0], 30) def test_complete_classification(): # Test greedy trees with max_depth + 1 leafs. from sklearn.tree._tree import TREE_LEAF X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) k = 4 est = GradientBoostingClassifier(n_estimators=20, max_depth=None, random_state=1, max_leaf_nodes=k + 1) est.fit(X, y) tree = est.estimators_[0, 0].tree_ assert_equal(tree.max_depth, k) assert_equal(tree.children_left[tree.children_left == TREE_LEAF].shape[0], k + 1) def test_complete_regression(): # Test greedy trees with max_depth + 1 leafs. from sklearn.tree._tree import TREE_LEAF k = 4 est = GradientBoostingRegressor(n_estimators=20, max_depth=None, random_state=1, max_leaf_nodes=k + 1) est.fit(boston.data, boston.target) tree = est.estimators_[-1, 0].tree_ assert_equal(tree.children_left[tree.children_left == TREE_LEAF].shape[0], k + 1) def test_zero_estimator_reg(): # Test if ZeroEstimator works for regression. est = GradientBoostingRegressor(n_estimators=20, max_depth=1, random_state=1, init=ZeroEstimator()) est.fit(boston.data, boston.target) y_pred = est.predict(boston.data) mse = mean_squared_error(boston.target, y_pred) assert_almost_equal(mse, 33.0, decimal=0) est = GradientBoostingRegressor(n_estimators=20, max_depth=1, random_state=1, init='zero') est.fit(boston.data, boston.target) y_pred = est.predict(boston.data) mse = mean_squared_error(boston.target, y_pred) assert_almost_equal(mse, 33.0, decimal=0) est = GradientBoostingRegressor(n_estimators=20, max_depth=1, random_state=1, init='foobar') assert_raises(ValueError, est.fit, boston.data, boston.target) def test_zero_estimator_clf(): # Test if ZeroEstimator works for classification. X = iris.data y = np.array(iris.target) est = GradientBoostingClassifier(n_estimators=20, max_depth=1, random_state=1, init=ZeroEstimator()) est.fit(X, y) assert est.score(X, y) > 0.96 est = GradientBoostingClassifier(n_estimators=20, max_depth=1, random_state=1, init='zero') est.fit(X, y) assert est.score(X, y) > 0.96 # binary clf mask = y != 0 y[mask] = 1 y[~mask] = 0 est = GradientBoostingClassifier(n_estimators=20, max_depth=1, random_state=1, init='zero') est.fit(X, y) assert est.score(X, y) > 0.96 est = GradientBoostingClassifier(n_estimators=20, max_depth=1, random_state=1, init='foobar') assert_raises(ValueError, est.fit, X, y) def test_max_leaf_nodes_max_depth(): # Test preceedence of max_leaf_nodes over max_depth. X, y = datasets.make_hastie_10_2(n_samples=100, random_state=1) all_estimators = [GradientBoostingRegressor, GradientBoostingClassifier] k = 4 for GBEstimator in all_estimators: est = GBEstimator(max_depth=1, max_leaf_nodes=k).fit(X, y) tree = est.estimators_[0, 0].tree_ assert_greater(tree.max_depth, 1) est = GBEstimator(max_depth=1).fit(X, y) tree = est.estimators_[0, 0].tree_ assert_equal(tree.max_depth, 1) def test_warm_start_wo_nestimators_change(): # Test if warm_start does nothing if n_estimators is not changed. # Regression test for #3513. clf = GradientBoostingClassifier(n_estimators=10, warm_start=True) clf.fit([[0, 1], [2, 3]], [0, 1]) assert clf.estimators_.shape[0] == 10 clf.fit([[0, 1], [2, 3]], [0, 1]) assert clf.estimators_.shape[0] == 10 def test_probability_exponential(): # Predict probabilities. clf = GradientBoostingClassifier(loss='exponential', n_estimators=100, random_state=1) assert_raises(ValueError, clf.predict_proba, T) clf.fit(X, y) assert_array_equal(clf.predict(T), true_result) # check if probabilities are in [0, 1]. y_proba = clf.predict_proba(T) assert np.all(y_proba >= 0.0) assert np.all(y_proba <= 1.0) score = clf.decision_function(T).ravel() assert_array_almost_equal(y_proba[:, 1], 1.0 / (1.0 + np.exp(-2 * score))) # derive predictions from probabilities y_pred = clf.classes_.take(y_proba.argmax(axis=1), axis=0) assert_array_equal(y_pred, true_result) def test_non_uniform_weights_toy_edge_case_reg(): X = [[1, 0], [1, 0], [1, 0], [0, 1]] y = [0, 0, 1, 0] # ignore the first 2 training samples by setting their weight to 0 sample_weight = [0, 0, 1, 1] for loss in ('huber', 'ls', 'lad', 'quantile'): gb = GradientBoostingRegressor(learning_rate=1.0, n_estimators=2, loss=loss) gb.fit(X, y, sample_weight=sample_weight) assert_greater(gb.predict([[1, 0]])[0], 0.5) def test_non_uniform_weights_toy_min_weight_leaf(): # Regression test for issue #4447 X = [[1, 0], [1, 0], [1, 0], [0, 1], ] y = [0, 0, 1, 0] # ignore the first 2 training samples by setting their weight to 0 sample_weight = [0, 0, 1, 1] gb = GradientBoostingRegressor(n_estimators=5, min_weight_fraction_leaf=0.1) gb.fit(X, y, sample_weight=sample_weight) assert_true(gb.predict([[1, 0]])[0] > 0.5) assert_almost_equal(gb.estimators_[0, 0].splitter.min_weight_leaf, 0.2) def test_non_uniform_weights_toy_edge_case_clf(): X = [[1, 0], [1, 0], [1, 0], [0, 1]] y = [0, 0, 1, 0] # ignore the first 2 training samples by setting their weight to 0 sample_weight = [0, 0, 1, 1] for loss in ('deviance', 'exponential'): gb = GradientBoostingClassifier(n_estimators=5) gb.fit(X, y, sample_weight=sample_weight) assert_array_equal(gb.predict([[1, 0]]), [1])
bsd-3-clause
wwf5067/statsmodels
statsmodels/examples/example_enhanced_boxplots.py
33
3179
from __future__ import print_function import numpy as np import matplotlib.pyplot as plt import statsmodels.api as sm # Necessary to make horizontal axis labels fit plt.rcParams['figure.subplot.bottom'] = 0.23 data = sm.datasets.anes96.load_pandas() party_ID = np.arange(7) labels = ["Strong Democrat", "Weak Democrat", "Independent-Democrat", "Independent-Independent", "Independent-Republican", "Weak Republican", "Strong Republican"] # Group age by party ID. age = [data.exog['age'][data.endog == id] for id in party_ID] # Create a violin plot. fig = plt.figure() ax = fig.add_subplot(111) sm.graphics.violinplot(age, ax=ax, labels=labels, plot_opts={'cutoff_val':5, 'cutoff_type':'abs', 'label_fontsize':'small', 'label_rotation':30}) ax.set_xlabel("Party identification of respondent.") ax.set_ylabel("Age") ax.set_title("US national election '96 - Age & Party Identification") # Create a bean plot. fig2 = plt.figure() ax = fig2.add_subplot(111) sm.graphics.beanplot(age, ax=ax, labels=labels, plot_opts={'cutoff_val':5, 'cutoff_type':'abs', 'label_fontsize':'small', 'label_rotation':30}) ax.set_xlabel("Party identification of respondent.") ax.set_ylabel("Age") ax.set_title("US national election '96 - Age & Party Identification") # Create a jitter plot. fig3 = plt.figure() ax = fig3.add_subplot(111) plot_opts={'cutoff_val':5, 'cutoff_type':'abs', 'label_fontsize':'small', 'label_rotation':30, 'violin_fc':(0.8, 0.8, 0.8), 'jitter_marker':'.', 'jitter_marker_size':3, 'bean_color':'#FF6F00', 'bean_mean_color':'#009D91'} sm.graphics.beanplot(age, ax=ax, labels=labels, jitter=True, plot_opts=plot_opts) ax.set_xlabel("Party identification of respondent.") ax.set_ylabel("Age") ax.set_title("US national election '96 - Age & Party Identification") # Create an asymmetrical jitter plot. ix = data.exog['income'] < 16 # incomes < $30k age = data.exog['age'][ix] endog = data.endog[ix] age_lower_income = [age[endog == id] for id in party_ID] ix = data.exog['income'] >= 20 # incomes > $50k age = data.exog['age'][ix] endog = data.endog[ix] age_higher_income = [age[endog == id] for id in party_ID] fig = plt.figure() ax = fig.add_subplot(111) plot_opts['violin_fc'] = (0.5, 0.5, 0.5) plot_opts['bean_show_mean'] = False plot_opts['bean_show_median'] = False plot_opts['bean_legend_text'] = 'Income < \$30k' plot_opts['cutoff_val'] = 10 sm.graphics.beanplot(age_lower_income, ax=ax, labels=labels, side='left', jitter=True, plot_opts=plot_opts) plot_opts['violin_fc'] = (0.7, 0.7, 0.7) plot_opts['bean_color'] = '#009D91' plot_opts['bean_legend_text'] = 'Income > \$50k' sm.graphics.beanplot(age_higher_income, ax=ax, labels=labels, side='right', jitter=True, plot_opts=plot_opts) ax.set_xlabel("Party identification of respondent.") ax.set_ylabel("Age") ax.set_title("US national election '96 - Age & Party Identification") # Show all plots. plt.show()
bsd-3-clause
davidgardenier/frbpoppy
tests/distance/repeaters_dm.py
1
3376
"""Plot DM/SNR distributions of repeater populations.""" import numpy as np import matplotlib.pyplot as plt from scipy.stats import ks_2samp from frbpoppy import CosmicPopulation, Survey, SurveyPopulation, plot from frbpoppy import split_pop, pprint, hist from tests.convenience import plot_aa_style, rel_path DAYS = 4 INTERACTIVE_PLOT = False PLOTTING_LIMIT_N_SRCS = 0 SNR = False r = CosmicPopulation.simple(n_srcs=int(1e5), n_days=DAYS, repeaters=True) r.set_dist(z_max=0.01) r.set_lum(model='powerlaw', low=1e35, high=1e45, power=-1.5, per_source='different') r.set_time(model='poisson', rate=3) r.set_dm_igm(model='ioka', slope=1000, std=0) r.set_dm(mw=False, igm=True, host=False) r.set_w('constant', value=1) r.generate() # Set up survey survey = Survey('perfect', n_days=DAYS) survey.set_beam(model='perfect') survey.snr_limit = 1e6 surv_pop = SurveyPopulation(r, survey) pprint(f'{r.n_bursts()}:{surv_pop.n_bursts()}') pprint(f'{surv_pop.n_sources()} sources detected') if r.n_bursts() < PLOTTING_LIMIT_N_SRCS: pprint('Not sufficient FRB sources for plotting') exit() # Split population into seamingly one-off and repeater populations mask = ((~np.isnan(surv_pop.frbs.time)).sum(1) > 1) pop_rep, pop_one = split_pop(surv_pop, mask) pop_rep.name += ' (> 1 burst)' pop_one.name += ' (1 burst)' if INTERACTIVE_PLOT: plot(r, pop_rep, pop_one, tns=False, mute=False) # Plot dm distribution if SNR: plot_aa_style(cols=2) f, (ax1, ax2) = plt.subplots(1, 2) else: plot_aa_style(cols=1) f, ax1 = plt.subplots(1, 1) prop_cycle = plt.rcParams['axes.prop_cycle'] colors = prop_cycle.by_key()['color'] pops = (r, pop_rep, pop_one) for i, pop in enumerate(pops): # Distinguish populations if pop.name.endswith('(1 burst)'): label = '1 burst' linestyle = 'solid' elif pop.name.endswith('(> 1 burst)'): label = '$>$1 burst' linestyle = 'dashed' else: label = 'cosmic' linestyle = 'dashdot' pprint(f'Number of bursts in {label}: {pop.n_bursts()}') # Do stuff with data dm = pop.frbs.dm x, y = hist(dm) x *= 200 # Normalise x-axis z=0.01, z=2 # Plot DM distributions ax1.step(x, y, where='mid', linestyle=linestyle, label=label, color=colors[i]) # Plot fluence distributions snr = pop.frbs.snr if snr is None: continue if not SNR: continue try: ax2.step(*hist(snr, bin_type='log'), where='mid', linestyle=linestyle, color=colors[i]) except ValueError: pprint('Zero sources available to plot') continue ax1.set_xlabel(r'DM$_{\textrm{ex}}$ ($\textrm{pc}\ \textrm{cm}^{-3}$)') ax1.set_ylabel('Fraction') if SNR: ax2.set_xlabel(r'SNR') ax2.set_xscale('log') ax2.set_yscale('log') ax2.yaxis.tick_right() plt.figlegend(loc='upper center', ncol=len(pops), framealpha=1) else: plt.figlegend(loc='upper center', ncol=3, framealpha=1, prop={'size': 8}, bbox_to_anchor=(0.5, 1.07), bbox_transform=ax1.transAxes) # Test the difference between the distributions rep = pops[1].frbs.dm[:20] # First 20 repeaters one = pops[2].frbs.dm[:min([200, len(pops[2].frbs.dm)])] # First x one-offs print(f'KS test: {ks_2samp(rep, one)}') plt.tight_layout() plt.savefig(rel_path('plots/rep_dm_dist.pdf')) plt.clf()
mit
feiyanzhandui/tware
examples/mimic2/logreg.py
2
7417
import numpy as np import sys from sets import Set #classifiers from sklearn.ensemble import RandomForestClassifier from sklearn.linear_model import LogisticRegression #preprocess from sklearn.preprocessing import MinMaxScaler from sklearn.preprocessing import StandardScaler #eval from sklearn.cross_validation import train_test_split from sklearn.metrics import classification_report from sklearn.metrics import confusion_matrix #viz from sklearn.metrics import roc_curve import pylab as pl from sklearn.metrics import confusion_matrix def main(): diseases = [('infectious',1,140), ('metabolic',240,280), ('blood',280,290), ('neurologic',320,390), ('heart_hypertensive',401,406), ('heart_ischemic',410,415), ('heart_failure',428,429), ('pulmonary',460,520), ('digestive',520,580), ('renal_insufficiency',580,630)] B = {d[0]: LogisticRegression(class_weight='auto', random_state=0) for d in diseases} #B = {d[0]: RandomForestClassifier(n_estimators=100, max_features=None, n_jobs=-1, random_state=0) for d in diseases} #classifiers = {d[0]: #[#KNeighborsClassifier(3), #SVC(kernel="linear", C=0.025), #SVC(gamma=2, C=1), #DecisionTreeClassifier(criterion='entropy',max_depth=4,min_samples_split=10,random_state=0)] for d in diseases}#, #RandomForestClassifier(max_depth=10, n_estimators=100, max_features=1)] for d in diseases}#, #AdaBoostClassifier()] for d in diseases}#, #GaussianNB(), #LDA(), #QDA()]for d in diseases} #RandomForestClassifier(n_estimators=200, max_features=None, n_jobs=-1, random_state=0)] for d in diseases} #GradientBoostingClassifier(n_estimators=1000, max_depth=None, max_features=None)] for d in diseases} #Pipeline([('feature_selection', LinearSVC(penalty='l1', dual=False)), # ('classification', GaussianNB())])] for d in diseases} pts = {} for line in open(sys.argv[1]): raw = line.split(",") try: icd9 = float(raw[1]) pt = raw[0] age = float(raw[3]) if age >= 18: if pt not in pts: x = [float(a) for a in raw[2:]] pts[pt] = (x, set()) for d in diseases: if icd9 >= d[1] and icd9 < d[2]: pts[pt][1].add(d[0]) break except: pass X = [] Y = {d[0]: [] for d in diseases} for pt,(feat,codes) in sorted(pts.items()): X.append(feat) for d in diseases: if d[0] in codes: Y[d[0]].append(1) else: Y[d[0]].append(0) #scale #X = MinMaxScaler().fit_transform(X) #X = StandardScaler().fit_transform(X) #i = 0 #while (True): #Y_pred = {} for disease,y in Y.items(): print '********* DISEASE: ' + disease X_train,X_test,Y_train,Y_test = train_test_split(X, y, test_size=0.3, random_state=0) b = B[disease] b.fit(X_train, Y_train) y_pred = b.predict(X_test) #Y_pred[disease] = y_pred print classification_report(Y_test, y_pred) #for d1,y_h1 in Y_pred.items(): # for d2,y_h2 in Y_pred.items(): # print d1, d2, np.corrcoef(y_h1, y_h2)[0][1] #print confusion_matrix(Y_test, y_pred) #Y_prob = b.predict_proba(X_test) #print Y_prob #Y_pred = [1 if y_prob[1] > 0.4 else 0 for y_prob in Y_prob] #fpr,tpr,thresh = roc_curve(Y_test, Y_prob[:,1]) #pl.plot(fpr, tpr, lw=1, label='roc') #pl.plot([0, 1], [0, 1], 'k--') #pl.xlim([0.0, 1.0]) #pl.ylim([0.0, 1.0]) #pl.xlabel('FPR') #pl.ylabel('TPR') #pl.savefig('prefilter.pdf', format='pdf') #cc = {} #for d1,y_h1 in Y_h.items(): # for d2,y_h2 in Y_h.items(): # if d1 != d2: # cc[(d1,d2)] = np.corrcoef(y_h1, y_h2)[0][1] #maxcc = sorted(cc.items(), key=lambda x: x[1], reverse=True)[0] #print '********** MAXCC= ', maxcc #d1 = maxcc[0][0] #d2 = maxcc[0][1] #d = d1 + ',' + d2 #y1 = Y[d1] #y2 = Y[d2] #y = [y1[i] or y2[i] for i in range(len(y1))] #del Y[d1] #del Y[d2] #Y[d] = y #del B[d1] #del B[d2] #B[d] = RandomForestClassifier(n_estimators=100, max_features=None, n_jobs=100, random_state=0) #i += 1 #if i > 3: # break #with open(k + '.dot', 'w') as f: # f = tree.export_graphviz(B, out_file=f) #cm = confusion_matrix(Y_test, B.predict(X_test)) #print cm #visualize(cm, 'lr', k) #visualize(confusion_matrix(Y, K_lr), "lr") #X10 = SelectPercentile(chi2, percentile=10).fit_transform(X, Y) #tree #print 'Computing tree...' #B_tree = {k: DecisionTreeClassifier() for k in categories} #for k,v in B_tree.items(): # for train,test in StratifiedKFold(Y[k], 3): # X_train = [X[i] for i in train] # Y_train = [Y[k][i] for i in train] # X_test = [X[i] for i in test] # Y_test = [Y[k][i] for i in test] # v.fit(X_train, Y_train) # cm = confusion_matrix(Y_test, v.predict(X_test)) # print k + ':' # print cm #print "Computing tree..." #B_tree = {k: DecisionTreeClassifier() for k in categories} #for k,v in B_tree.items(): # v.fit(X, Y[k]) # print confusion_matrix(Y[k], v.predict(X)) #B_tree = DecisionTreeClassifier() #B_tree.fit(X, Y) #K_tree = B_tree.predict(X) #visualize(confusion_matrix(Y, K_tree), "tree") #with open(d + '.dot', 'w') as f: # f = tree.export_graphviz(b, out_file=f) # cc = {} # for d1,y_h1 in Y_h.items(): # for d2,y_h2 in Y_h.items(): # if d1 != d2: # cc[(d1,d2)] = np.corrcoef(y_h1, y_h2)[0][1] # maxcc = sorted(cc.items(), key=lambda x: x[1], reverse=True)[0] # print '********** MAXCC= ', maxcc # d1 = maxcc[0][0] # d2 = maxcc[0][1] # d = d1 + ',' + d2 # y1 = Y[d1] # y2 = Y[d2] # y = [y1[i] or y2[i] for i in range(len(y1))] # del Y[d1] # del Y[d2] # Y[d] = y # del B[d1] # del B[d2] # B[d] = LogisticRegression(random_state=0) #i += 1 #if i > 3: # break #with open(k + '.dot', 'w') as f: # f = tree.export_graphviz(B, out_file=f) #cm = confusion_matrix(Y_test, B.predict(X_test)) #print cm #visualize(cm, 'lr', k) #visualize(confusion_matrix(Y, K_lr), "lr") #X10 = SelectPercentile(chi2, percentile=10).fit_transform(X, Y) #B_tree = {k: DecisionTreeClassifier() for k in categories} #for k,v in B_tree.items(): # v.fit(X, Y[k]) # print confusion_matrix(Y[k], v.predict(X)) #B_tree = DecisionTreeClassifier() #B_tree.fit(X, Y) #K_tree = B_tree.predict(X) #visualize(confusion_matrix(Y, K_tree), "tree") if __name__ == "__main__": main()
apache-2.0
rexshihaoren/scikit-learn
sklearn/ensemble/gradient_boosting.py
126
65552
"""Gradient Boosted Regression Trees This module contains methods for fitting gradient boosted regression trees for both classification and regression. The module structure is the following: - The ``BaseGradientBoosting`` base class implements a common ``fit`` method for all the estimators in the module. Regression and classification only differ in the concrete ``LossFunction`` used. - ``GradientBoostingClassifier`` implements gradient boosting for classification problems. - ``GradientBoostingRegressor`` implements gradient boosting for regression problems. """ # Authors: Peter Prettenhofer, Scott White, Gilles Louppe, Emanuele Olivetti, # Arnaud Joly # License: BSD 3 clause from __future__ import print_function from __future__ import division from abc import ABCMeta, abstractmethod from time import time import numbers import numpy as np from scipy import stats from .base import BaseEnsemble from ..base import BaseEstimator from ..base import ClassifierMixin from ..base import RegressorMixin from ..utils import check_random_state, check_array, check_X_y, column_or_1d from ..utils import check_consistent_length, deprecated from ..utils.extmath import logsumexp from ..utils.fixes import expit, bincount from ..utils.stats import _weighted_percentile from ..utils.validation import check_is_fitted, NotFittedError from ..externals import six from ..feature_selection.from_model import _LearntSelectorMixin from ..tree.tree import DecisionTreeRegressor from ..tree._tree import DTYPE, TREE_LEAF from ..tree._tree import PresortBestSplitter from ..tree._tree import FriedmanMSE from ._gradient_boosting import predict_stages from ._gradient_boosting import predict_stage from ._gradient_boosting import _random_sample_mask class QuantileEstimator(BaseEstimator): """An estimator predicting the alpha-quantile of the training targets.""" def __init__(self, alpha=0.9): if not 0 < alpha < 1.0: raise ValueError("`alpha` must be in (0, 1.0) but was %r" % alpha) self.alpha = alpha def fit(self, X, y, sample_weight=None): if sample_weight is None: self.quantile = stats.scoreatpercentile(y, self.alpha * 100.0) else: self.quantile = _weighted_percentile(y, sample_weight, self.alpha * 100.0) def predict(self, X): check_is_fitted(self, 'quantile') y = np.empty((X.shape[0], 1), dtype=np.float64) y.fill(self.quantile) return y class MeanEstimator(BaseEstimator): """An estimator predicting the mean of the training targets.""" def fit(self, X, y, sample_weight=None): if sample_weight is None: self.mean = np.mean(y) else: self.mean = np.average(y, weights=sample_weight) def predict(self, X): check_is_fitted(self, 'mean') y = np.empty((X.shape[0], 1), dtype=np.float64) y.fill(self.mean) return y class LogOddsEstimator(BaseEstimator): """An estimator predicting the log odds ratio.""" scale = 1.0 def fit(self, X, y, sample_weight=None): # pre-cond: pos, neg are encoded as 1, 0 if sample_weight is None: pos = np.sum(y) neg = y.shape[0] - pos else: pos = np.sum(sample_weight * y) neg = np.sum(sample_weight * (1 - y)) if neg == 0 or pos == 0: raise ValueError('y contains non binary labels.') self.prior = self.scale * np.log(pos / neg) def predict(self, X): check_is_fitted(self, 'prior') y = np.empty((X.shape[0], 1), dtype=np.float64) y.fill(self.prior) return y class ScaledLogOddsEstimator(LogOddsEstimator): """Log odds ratio scaled by 0.5 -- for exponential loss. """ scale = 0.5 class PriorProbabilityEstimator(BaseEstimator): """An estimator predicting the probability of each class in the training data. """ def fit(self, X, y, sample_weight=None): if sample_weight is None: sample_weight = np.ones_like(y, dtype=np.float64) class_counts = bincount(y, weights=sample_weight) self.priors = class_counts / class_counts.sum() def predict(self, X): check_is_fitted(self, 'priors') y = np.empty((X.shape[0], self.priors.shape[0]), dtype=np.float64) y[:] = self.priors return y class ZeroEstimator(BaseEstimator): """An estimator that simply predicts zero. """ def fit(self, X, y, sample_weight=None): if np.issubdtype(y.dtype, int): # classification self.n_classes = np.unique(y).shape[0] if self.n_classes == 2: self.n_classes = 1 else: # regression self.n_classes = 1 def predict(self, X): check_is_fitted(self, 'n_classes') y = np.empty((X.shape[0], self.n_classes), dtype=np.float64) y.fill(0.0) return y class LossFunction(six.with_metaclass(ABCMeta, object)): """Abstract base class for various loss functions. Attributes ---------- K : int The number of regression trees to be induced; 1 for regression and binary classification; ``n_classes`` for multi-class classification. """ is_multi_class = False def __init__(self, n_classes): self.K = n_classes def init_estimator(self): """Default ``init`` estimator for loss function. """ raise NotImplementedError() @abstractmethod def __call__(self, y, pred, sample_weight=None): """Compute the loss of prediction ``pred`` and ``y``. """ @abstractmethod def negative_gradient(self, y, y_pred, **kargs): """Compute the negative gradient. Parameters --------- y : np.ndarray, shape=(n,) The target labels. y_pred : np.ndarray, shape=(n,): The predictions. """ def update_terminal_regions(self, tree, X, y, residual, y_pred, sample_weight, sample_mask, learning_rate=1.0, k=0): """Update the terminal regions (=leaves) of the given tree and updates the current predictions of the model. Traverses tree and invokes template method `_update_terminal_region`. Parameters ---------- tree : tree.Tree The tree object. X : ndarray, shape=(n, m) The data array. y : ndarray, shape=(n,) The target labels. residual : ndarray, shape=(n,) The residuals (usually the negative gradient). y_pred : ndarray, shape=(n,) The predictions. sample_weight : ndarray, shape=(n,) The weight of each sample. sample_mask : ndarray, shape=(n,) The sample mask to be used. learning_rate : float, default=0.1 learning rate shrinks the contribution of each tree by ``learning_rate``. k : int, default 0 The index of the estimator being updated. """ # compute leaf for each sample in ``X``. terminal_regions = tree.apply(X) # mask all which are not in sample mask. masked_terminal_regions = terminal_regions.copy() masked_terminal_regions[~sample_mask] = -1 # update each leaf (= perform line search) for leaf in np.where(tree.children_left == TREE_LEAF)[0]: self._update_terminal_region(tree, masked_terminal_regions, leaf, X, y, residual, y_pred[:, k], sample_weight) # update predictions (both in-bag and out-of-bag) y_pred[:, k] += (learning_rate * tree.value[:, 0, 0].take(terminal_regions, axis=0)) @abstractmethod def _update_terminal_region(self, tree, terminal_regions, leaf, X, y, residual, pred, sample_weight): """Template method for updating terminal regions (=leaves). """ class RegressionLossFunction(six.with_metaclass(ABCMeta, LossFunction)): """Base class for regression loss functions. """ def __init__(self, n_classes): if n_classes != 1: raise ValueError("``n_classes`` must be 1 for regression but " "was %r" % n_classes) super(RegressionLossFunction, self).__init__(n_classes) class LeastSquaresError(RegressionLossFunction): """Loss function for least squares (LS) estimation. Terminal regions need not to be updated for least squares. """ def init_estimator(self): return MeanEstimator() def __call__(self, y, pred, sample_weight=None): if sample_weight is None: return np.mean((y - pred.ravel()) ** 2.0) else: return (1.0 / sample_weight.sum() * np.sum(sample_weight * ((y - pred.ravel()) ** 2.0))) def negative_gradient(self, y, pred, **kargs): return y - pred.ravel() def update_terminal_regions(self, tree, X, y, residual, y_pred, sample_weight, sample_mask, learning_rate=1.0, k=0): """Least squares does not need to update terminal regions. But it has to update the predictions. """ # update predictions y_pred[:, k] += learning_rate * tree.predict(X).ravel() def _update_terminal_region(self, tree, terminal_regions, leaf, X, y, residual, pred, sample_weight): pass class LeastAbsoluteError(RegressionLossFunction): """Loss function for least absolute deviation (LAD) regression. """ def init_estimator(self): return QuantileEstimator(alpha=0.5) def __call__(self, y, pred, sample_weight=None): if sample_weight is None: return np.abs(y - pred.ravel()).mean() else: return (1.0 / sample_weight.sum() * np.sum(sample_weight * np.abs(y - pred.ravel()))) def negative_gradient(self, y, pred, **kargs): """1.0 if y - pred > 0.0 else -1.0""" pred = pred.ravel() return 2.0 * (y - pred > 0.0) - 1.0 def _update_terminal_region(self, tree, terminal_regions, leaf, X, y, residual, pred, sample_weight): """LAD updates terminal regions to median estimates. """ terminal_region = np.where(terminal_regions == leaf)[0] sample_weight = sample_weight.take(terminal_region, axis=0) diff = y.take(terminal_region, axis=0) - pred.take(terminal_region, axis=0) tree.value[leaf, 0, 0] = _weighted_percentile(diff, sample_weight, percentile=50) class HuberLossFunction(RegressionLossFunction): """Huber loss function for robust regression. M-Regression proposed in Friedman 2001. References ---------- J. Friedman, Greedy Function Approximation: A Gradient Boosting Machine, The Annals of Statistics, Vol. 29, No. 5, 2001. """ def __init__(self, n_classes, alpha=0.9): super(HuberLossFunction, self).__init__(n_classes) self.alpha = alpha self.gamma = None def init_estimator(self): return QuantileEstimator(alpha=0.5) def __call__(self, y, pred, sample_weight=None): pred = pred.ravel() diff = y - pred gamma = self.gamma if gamma is None: if sample_weight is None: gamma = stats.scoreatpercentile(np.abs(diff), self.alpha * 100) else: gamma = _weighted_percentile(np.abs(diff), sample_weight, self.alpha * 100) gamma_mask = np.abs(diff) <= gamma if sample_weight is None: sq_loss = np.sum(0.5 * diff[gamma_mask] ** 2.0) lin_loss = np.sum(gamma * (np.abs(diff[~gamma_mask]) - gamma / 2.0)) loss = (sq_loss + lin_loss) / y.shape[0] else: sq_loss = np.sum(0.5 * sample_weight[gamma_mask] * diff[gamma_mask] ** 2.0) lin_loss = np.sum(gamma * sample_weight[~gamma_mask] * (np.abs(diff[~gamma_mask]) - gamma / 2.0)) loss = (sq_loss + lin_loss) / sample_weight.sum() return loss def negative_gradient(self, y, pred, sample_weight=None, **kargs): pred = pred.ravel() diff = y - pred if sample_weight is None: gamma = stats.scoreatpercentile(np.abs(diff), self.alpha * 100) else: gamma = _weighted_percentile(np.abs(diff), sample_weight, self.alpha * 100) gamma_mask = np.abs(diff) <= gamma residual = np.zeros((y.shape[0],), dtype=np.float64) residual[gamma_mask] = diff[gamma_mask] residual[~gamma_mask] = gamma * np.sign(diff[~gamma_mask]) self.gamma = gamma return residual def _update_terminal_region(self, tree, terminal_regions, leaf, X, y, residual, pred, sample_weight): terminal_region = np.where(terminal_regions == leaf)[0] sample_weight = sample_weight.take(terminal_region, axis=0) gamma = self.gamma diff = (y.take(terminal_region, axis=0) - pred.take(terminal_region, axis=0)) median = _weighted_percentile(diff, sample_weight, percentile=50) diff_minus_median = diff - median tree.value[leaf, 0] = median + np.mean( np.sign(diff_minus_median) * np.minimum(np.abs(diff_minus_median), gamma)) class QuantileLossFunction(RegressionLossFunction): """Loss function for quantile regression. Quantile regression allows to estimate the percentiles of the conditional distribution of the target. """ def __init__(self, n_classes, alpha=0.9): super(QuantileLossFunction, self).__init__(n_classes) assert 0 < alpha < 1.0 self.alpha = alpha self.percentile = alpha * 100.0 def init_estimator(self): return QuantileEstimator(self.alpha) def __call__(self, y, pred, sample_weight=None): pred = pred.ravel() diff = y - pred alpha = self.alpha mask = y > pred if sample_weight is None: loss = (alpha * diff[mask].sum() + (1.0 - alpha) * diff[~mask].sum()) / y.shape[0] else: loss = ((alpha * np.sum(sample_weight[mask] * diff[mask]) + (1.0 - alpha) * np.sum(sample_weight[~mask] * diff[~mask])) / sample_weight.sum()) return loss def negative_gradient(self, y, pred, **kargs): alpha = self.alpha pred = pred.ravel() mask = y > pred return (alpha * mask) - ((1.0 - alpha) * ~mask) def _update_terminal_region(self, tree, terminal_regions, leaf, X, y, residual, pred, sample_weight): terminal_region = np.where(terminal_regions == leaf)[0] diff = (y.take(terminal_region, axis=0) - pred.take(terminal_region, axis=0)) sample_weight = sample_weight.take(terminal_region, axis=0) val = _weighted_percentile(diff, sample_weight, self.percentile) tree.value[leaf, 0] = val class ClassificationLossFunction(six.with_metaclass(ABCMeta, LossFunction)): """Base class for classification loss functions. """ def _score_to_proba(self, score): """Template method to convert scores to probabilities. the does not support probabilites raises AttributeError. """ raise TypeError('%s does not support predict_proba' % type(self).__name__) @abstractmethod def _score_to_decision(self, score): """Template method to convert scores to decisions. Returns int arrays. """ class BinomialDeviance(ClassificationLossFunction): """Binomial deviance loss function for binary classification. Binary classification is a special case; here, we only need to fit one tree instead of ``n_classes`` trees. """ def __init__(self, n_classes): if n_classes != 2: raise ValueError("{0:s} requires 2 classes.".format( self.__class__.__name__)) # we only need to fit one tree for binary clf. super(BinomialDeviance, self).__init__(1) def init_estimator(self): return LogOddsEstimator() def __call__(self, y, pred, sample_weight=None): """Compute the deviance (= 2 * negative log-likelihood). """ # logaddexp(0, v) == log(1.0 + exp(v)) pred = pred.ravel() if sample_weight is None: return -2.0 * np.mean((y * pred) - np.logaddexp(0.0, pred)) else: return (-2.0 / sample_weight.sum() * np.sum(sample_weight * ((y * pred) - np.logaddexp(0.0, pred)))) def negative_gradient(self, y, pred, **kargs): """Compute the residual (= negative gradient). """ return y - expit(pred.ravel()) def _update_terminal_region(self, tree, terminal_regions, leaf, X, y, residual, pred, sample_weight): """Make a single Newton-Raphson step. our node estimate is given by: sum(w * (y - prob)) / sum(w * prob * (1 - prob)) we take advantage that: y - prob = residual """ terminal_region = np.where(terminal_regions == leaf)[0] residual = residual.take(terminal_region, axis=0) y = y.take(terminal_region, axis=0) sample_weight = sample_weight.take(terminal_region, axis=0) numerator = np.sum(sample_weight * residual) denominator = np.sum(sample_weight * (y - residual) * (1 - y + residual)) if denominator == 0.0: tree.value[leaf, 0, 0] = 0.0 else: tree.value[leaf, 0, 0] = numerator / denominator def _score_to_proba(self, score): proba = np.ones((score.shape[0], 2), dtype=np.float64) proba[:, 1] = expit(score.ravel()) proba[:, 0] -= proba[:, 1] return proba def _score_to_decision(self, score): proba = self._score_to_proba(score) return np.argmax(proba, axis=1) class MultinomialDeviance(ClassificationLossFunction): """Multinomial deviance loss function for multi-class classification. For multi-class classification we need to fit ``n_classes`` trees at each stage. """ is_multi_class = True def __init__(self, n_classes): if n_classes < 3: raise ValueError("{0:s} requires more than 2 classes.".format( self.__class__.__name__)) super(MultinomialDeviance, self).__init__(n_classes) def init_estimator(self): return PriorProbabilityEstimator() def __call__(self, y, pred, sample_weight=None): # create one-hot label encoding Y = np.zeros((y.shape[0], self.K), dtype=np.float64) for k in range(self.K): Y[:, k] = y == k if sample_weight is None: return np.sum(-1 * (Y * pred).sum(axis=1) + logsumexp(pred, axis=1)) else: return np.sum(-1 * sample_weight * (Y * pred).sum(axis=1) + logsumexp(pred, axis=1)) def negative_gradient(self, y, pred, k=0, **kwargs): """Compute negative gradient for the ``k``-th class. """ return y - np.nan_to_num(np.exp(pred[:, k] - logsumexp(pred, axis=1))) def _update_terminal_region(self, tree, terminal_regions, leaf, X, y, residual, pred, sample_weight): """Make a single Newton-Raphson step. """ terminal_region = np.where(terminal_regions == leaf)[0] residual = residual.take(terminal_region, axis=0) y = y.take(terminal_region, axis=0) sample_weight = sample_weight.take(terminal_region, axis=0) numerator = np.sum(sample_weight * residual) numerator *= (self.K - 1) / self.K denominator = np.sum(sample_weight * (y - residual) * (1.0 - y + residual)) if denominator == 0.0: tree.value[leaf, 0, 0] = 0.0 else: tree.value[leaf, 0, 0] = numerator / denominator def _score_to_proba(self, score): return np.nan_to_num( np.exp(score - (logsumexp(score, axis=1)[:, np.newaxis]))) def _score_to_decision(self, score): proba = self._score_to_proba(score) return np.argmax(proba, axis=1) class ExponentialLoss(ClassificationLossFunction): """Exponential loss function for binary classification. Same loss as AdaBoost. References ---------- Greg Ridgeway, Generalized Boosted Models: A guide to the gbm package, 2007 """ def __init__(self, n_classes): if n_classes != 2: raise ValueError("{0:s} requires 2 classes.".format( self.__class__.__name__)) # we only need to fit one tree for binary clf. super(ExponentialLoss, self).__init__(1) def init_estimator(self): return ScaledLogOddsEstimator() def __call__(self, y, pred, sample_weight=None): pred = pred.ravel() if sample_weight is None: return np.mean(np.exp(-(2. * y - 1.) * pred)) else: return (1.0 / sample_weight.sum() * np.sum(sample_weight * np.exp(-(2 * y - 1) * pred))) def negative_gradient(self, y, pred, **kargs): y_ = -(2. * y - 1.) return y_ * np.exp(y_ * pred.ravel()) def _update_terminal_region(self, tree, terminal_regions, leaf, X, y, residual, pred, sample_weight): terminal_region = np.where(terminal_regions == leaf)[0] pred = pred.take(terminal_region, axis=0) y = y.take(terminal_region, axis=0) sample_weight = sample_weight.take(terminal_region, axis=0) y_ = 2. * y - 1. numerator = np.sum(y_ * sample_weight * np.exp(-y_ * pred)) denominator = np.sum(sample_weight * np.exp(-y_ * pred)) if denominator == 0.0: tree.value[leaf, 0, 0] = 0.0 else: tree.value[leaf, 0, 0] = numerator / denominator def _score_to_proba(self, score): proba = np.ones((score.shape[0], 2), dtype=np.float64) proba[:, 1] = expit(2.0 * score.ravel()) proba[:, 0] -= proba[:, 1] return proba def _score_to_decision(self, score): return (score.ravel() >= 0.0).astype(np.int) LOSS_FUNCTIONS = {'ls': LeastSquaresError, 'lad': LeastAbsoluteError, 'huber': HuberLossFunction, 'quantile': QuantileLossFunction, 'deviance': None, # for both, multinomial and binomial 'exponential': ExponentialLoss, } INIT_ESTIMATORS = {'zero': ZeroEstimator} class VerboseReporter(object): """Reports verbose output to stdout. If ``verbose==1`` output is printed once in a while (when iteration mod verbose_mod is zero).; if larger than 1 then output is printed for each update. """ def __init__(self, verbose): self.verbose = verbose def init(self, est, begin_at_stage=0): # header fields and line format str header_fields = ['Iter', 'Train Loss'] verbose_fmt = ['{iter:>10d}', '{train_score:>16.4f}'] # do oob? if est.subsample < 1: header_fields.append('OOB Improve') verbose_fmt.append('{oob_impr:>16.4f}') header_fields.append('Remaining Time') verbose_fmt.append('{remaining_time:>16s}') # print the header line print(('%10s ' + '%16s ' * (len(header_fields) - 1)) % tuple(header_fields)) self.verbose_fmt = ' '.join(verbose_fmt) # plot verbose info each time i % verbose_mod == 0 self.verbose_mod = 1 self.start_time = time() self.begin_at_stage = begin_at_stage def update(self, j, est): """Update reporter with new iteration. """ do_oob = est.subsample < 1 # we need to take into account if we fit additional estimators. i = j - self.begin_at_stage # iteration relative to the start iter if (i + 1) % self.verbose_mod == 0: oob_impr = est.oob_improvement_[j] if do_oob else 0 remaining_time = ((est.n_estimators - (j + 1)) * (time() - self.start_time) / float(i + 1)) if remaining_time > 60: remaining_time = '{0:.2f}m'.format(remaining_time / 60.0) else: remaining_time = '{0:.2f}s'.format(remaining_time) print(self.verbose_fmt.format(iter=j + 1, train_score=est.train_score_[j], oob_impr=oob_impr, remaining_time=remaining_time)) if self.verbose == 1 and ((i + 1) // (self.verbose_mod * 10) > 0): # adjust verbose frequency (powers of 10) self.verbose_mod *= 10 class BaseGradientBoosting(six.with_metaclass(ABCMeta, BaseEnsemble, _LearntSelectorMixin)): """Abstract base class for Gradient Boosting. """ @abstractmethod def __init__(self, loss, learning_rate, n_estimators, min_samples_split, min_samples_leaf, min_weight_fraction_leaf, max_depth, init, subsample, max_features, random_state, alpha=0.9, verbose=0, max_leaf_nodes=None, warm_start=False): self.n_estimators = n_estimators self.learning_rate = learning_rate self.loss = loss self.min_samples_split = min_samples_split self.min_samples_leaf = min_samples_leaf self.min_weight_fraction_leaf = min_weight_fraction_leaf self.subsample = subsample self.max_features = max_features self.max_depth = max_depth self.init = init self.random_state = random_state self.alpha = alpha self.verbose = verbose self.max_leaf_nodes = max_leaf_nodes self.warm_start = warm_start self.estimators_ = np.empty((0, 0), dtype=np.object) def _fit_stage(self, i, X, y, y_pred, sample_weight, sample_mask, criterion, splitter, random_state): """Fit another stage of ``n_classes_`` trees to the boosting model. """ assert sample_mask.dtype == np.bool loss = self.loss_ original_y = y for k in range(loss.K): if loss.is_multi_class: y = np.array(original_y == k, dtype=np.float64) residual = loss.negative_gradient(y, y_pred, k=k, sample_weight=sample_weight) # induce regression tree on residuals tree = DecisionTreeRegressor( criterion=criterion, splitter=splitter, max_depth=self.max_depth, min_samples_split=self.min_samples_split, min_samples_leaf=self.min_samples_leaf, min_weight_fraction_leaf=self.min_weight_fraction_leaf, max_features=self.max_features, max_leaf_nodes=self.max_leaf_nodes, random_state=random_state) if self.subsample < 1.0: # no inplace multiplication! sample_weight = sample_weight * sample_mask.astype(np.float64) tree.fit(X, residual, sample_weight=sample_weight, check_input=False) # update tree leaves loss.update_terminal_regions(tree.tree_, X, y, residual, y_pred, sample_weight, sample_mask, self.learning_rate, k=k) # add tree to ensemble self.estimators_[i, k] = tree return y_pred def _check_params(self): """Check validity of parameters and raise ValueError if not valid. """ if self.n_estimators <= 0: raise ValueError("n_estimators must be greater than 0 but " "was %r" % self.n_estimators) if self.learning_rate <= 0.0: raise ValueError("learning_rate must be greater than 0 but " "was %r" % self.learning_rate) if (self.loss not in self._SUPPORTED_LOSS or self.loss not in LOSS_FUNCTIONS): raise ValueError("Loss '{0:s}' not supported. ".format(self.loss)) if self.loss == 'deviance': loss_class = (MultinomialDeviance if len(self.classes_) > 2 else BinomialDeviance) else: loss_class = LOSS_FUNCTIONS[self.loss] if self.loss in ('huber', 'quantile'): self.loss_ = loss_class(self.n_classes_, self.alpha) else: self.loss_ = loss_class(self.n_classes_) if not (0.0 < self.subsample <= 1.0): raise ValueError("subsample must be in (0,1] but " "was %r" % self.subsample) if self.init is not None: if isinstance(self.init, six.string_types): if self.init not in INIT_ESTIMATORS: raise ValueError('init="%s" is not supported' % self.init) else: if (not hasattr(self.init, 'fit') or not hasattr(self.init, 'predict')): raise ValueError("init=%r must be valid BaseEstimator " "and support both fit and " "predict" % self.init) if not (0.0 < self.alpha < 1.0): raise ValueError("alpha must be in (0.0, 1.0) but " "was %r" % self.alpha) if isinstance(self.max_features, six.string_types): if self.max_features == "auto": # if is_classification if self.n_classes_ > 1: max_features = max(1, int(np.sqrt(self.n_features))) else: # is regression max_features = self.n_features elif self.max_features == "sqrt": max_features = max(1, int(np.sqrt(self.n_features))) elif self.max_features == "log2": max_features = max(1, int(np.log2(self.n_features))) else: raise ValueError("Invalid value for max_features: %r. " "Allowed string values are 'auto', 'sqrt' " "or 'log2'." % self.max_features) elif self.max_features is None: max_features = self.n_features elif isinstance(self.max_features, (numbers.Integral, np.integer)): max_features = self.max_features else: # float if 0. < self.max_features <= 1.: max_features = max(int(self.max_features * self.n_features), 1) else: raise ValueError("max_features must be in (0, n_features]") self.max_features_ = max_features def _init_state(self): """Initialize model state and allocate model state data structures. """ if self.init is None: self.init_ = self.loss_.init_estimator() elif isinstance(self.init, six.string_types): self.init_ = INIT_ESTIMATORS[self.init]() else: self.init_ = self.init self.estimators_ = np.empty((self.n_estimators, self.loss_.K), dtype=np.object) self.train_score_ = np.zeros((self.n_estimators,), dtype=np.float64) # do oob? if self.subsample < 1.0: self.oob_improvement_ = np.zeros((self.n_estimators), dtype=np.float64) def _clear_state(self): """Clear the state of the gradient boosting model. """ if hasattr(self, 'estimators_'): self.estimators_ = np.empty((0, 0), dtype=np.object) if hasattr(self, 'train_score_'): del self.train_score_ if hasattr(self, 'oob_improvement_'): del self.oob_improvement_ if hasattr(self, 'init_'): del self.init_ def _resize_state(self): """Add additional ``n_estimators`` entries to all attributes. """ # self.n_estimators is the number of additional est to fit total_n_estimators = self.n_estimators if total_n_estimators < self.estimators_.shape[0]: raise ValueError('resize with smaller n_estimators %d < %d' % (total_n_estimators, self.estimators_[0])) self.estimators_.resize((total_n_estimators, self.loss_.K)) self.train_score_.resize(total_n_estimators) if (self.subsample < 1 or hasattr(self, 'oob_improvement_')): # if do oob resize arrays or create new if not available if hasattr(self, 'oob_improvement_'): self.oob_improvement_.resize(total_n_estimators) else: self.oob_improvement_ = np.zeros((total_n_estimators,), dtype=np.float64) def _is_initialized(self): return len(getattr(self, 'estimators_', [])) > 0 def fit(self, X, y, sample_weight=None, monitor=None): """Fit the gradient boosting model. Parameters ---------- X : array-like, shape = [n_samples, n_features] Training vectors, where n_samples is the number of samples and n_features is the number of features. y : array-like, shape = [n_samples] Target values (integers in classification, real numbers in regression) For classification, labels must correspond to classes. sample_weight : array-like, shape = [n_samples] or None Sample weights. If None, then samples are equally weighted. Splits that would create child nodes with net zero or negative weight are ignored while searching for a split in each node. In the case of classification, splits are also ignored if they would result in any single class carrying a negative weight in either child node. monitor : callable, optional The monitor is called after each iteration with the current iteration, a reference to the estimator and the local variables of ``_fit_stages`` as keyword arguments ``callable(i, self, locals())``. If the callable returns ``True`` the fitting procedure is stopped. The monitor can be used for various things such as computing held-out estimates, early stopping, model introspect, and snapshoting. Returns ------- self : object Returns self. """ # if not warmstart - clear the estimator state if not self.warm_start: self._clear_state() # Check input X, y = check_X_y(X, y, dtype=DTYPE) n_samples, self.n_features = X.shape if sample_weight is None: sample_weight = np.ones(n_samples, dtype=np.float32) else: sample_weight = column_or_1d(sample_weight, warn=True) check_consistent_length(X, y, sample_weight) y = self._validate_y(y) random_state = check_random_state(self.random_state) self._check_params() if not self._is_initialized(): # init state self._init_state() # fit initial model - FIXME make sample_weight optional self.init_.fit(X, y, sample_weight) # init predictions y_pred = self.init_.predict(X) begin_at_stage = 0 else: # add more estimators to fitted model # invariant: warm_start = True if self.n_estimators < self.estimators_.shape[0]: raise ValueError('n_estimators=%d must be larger or equal to ' 'estimators_.shape[0]=%d when ' 'warm_start==True' % (self.n_estimators, self.estimators_.shape[0])) begin_at_stage = self.estimators_.shape[0] y_pred = self._decision_function(X) self._resize_state() # fit the boosting stages n_stages = self._fit_stages(X, y, y_pred, sample_weight, random_state, begin_at_stage, monitor) # change shape of arrays after fit (early-stopping or additional ests) if n_stages != self.estimators_.shape[0]: self.estimators_ = self.estimators_[:n_stages] self.train_score_ = self.train_score_[:n_stages] if hasattr(self, 'oob_improvement_'): self.oob_improvement_ = self.oob_improvement_[:n_stages] return self def _fit_stages(self, X, y, y_pred, sample_weight, random_state, begin_at_stage=0, monitor=None): """Iteratively fits the stages. For each stage it computes the progress (OOB, train score) and delegates to ``_fit_stage``. Returns the number of stages fit; might differ from ``n_estimators`` due to early stopping. """ n_samples = X.shape[0] do_oob = self.subsample < 1.0 sample_mask = np.ones((n_samples, ), dtype=np.bool) n_inbag = max(1, int(self.subsample * n_samples)) loss_ = self.loss_ # Set min_weight_leaf from min_weight_fraction_leaf if self.min_weight_fraction_leaf != 0. and sample_weight is not None: min_weight_leaf = (self.min_weight_fraction_leaf * np.sum(sample_weight)) else: min_weight_leaf = 0. # init criterion and splitter criterion = FriedmanMSE(1) splitter = PresortBestSplitter(criterion, self.max_features_, self.min_samples_leaf, min_weight_leaf, random_state) if self.verbose: verbose_reporter = VerboseReporter(self.verbose) verbose_reporter.init(self, begin_at_stage) # perform boosting iterations i = begin_at_stage for i in range(begin_at_stage, self.n_estimators): # subsampling if do_oob: sample_mask = _random_sample_mask(n_samples, n_inbag, random_state) # OOB score before adding this stage old_oob_score = loss_(y[~sample_mask], y_pred[~sample_mask], sample_weight[~sample_mask]) # fit next stage of trees y_pred = self._fit_stage(i, X, y, y_pred, sample_weight, sample_mask, criterion, splitter, random_state) # track deviance (= loss) if do_oob: self.train_score_[i] = loss_(y[sample_mask], y_pred[sample_mask], sample_weight[sample_mask]) self.oob_improvement_[i] = ( old_oob_score - loss_(y[~sample_mask], y_pred[~sample_mask], sample_weight[~sample_mask])) else: # no need to fancy index w/ no subsampling self.train_score_[i] = loss_(y, y_pred, sample_weight) if self.verbose > 0: verbose_reporter.update(i, self) if monitor is not None: early_stopping = monitor(i, self, locals()) if early_stopping: break return i + 1 def _make_estimator(self, append=True): # we don't need _make_estimator raise NotImplementedError() def _init_decision_function(self, X): """Check input and compute prediction of ``init``. """ if self.estimators_ is None or len(self.estimators_) == 0: raise NotFittedError("Estimator not fitted, call `fit`" " before making predictions`.") if X.shape[1] != self.n_features: raise ValueError("X.shape[1] should be {0:d}, not {1:d}.".format( self.n_features, X.shape[1])) score = self.init_.predict(X).astype(np.float64) return score def _decision_function(self, X): # for use in inner loop, not raveling the output in single-class case, # not doing input validation. score = self._init_decision_function(X) predict_stages(self.estimators_, X, self.learning_rate, score) return score @deprecated(" and will be removed in 0.19") def decision_function(self, X): """Compute the decision function of ``X``. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- score : array, shape = [n_samples, n_classes] or [n_samples] The decision function of the input samples. The order of the classes corresponds to that in the attribute `classes_`. Regression and binary classification produce an array of shape [n_samples]. """ X = check_array(X, dtype=DTYPE, order="C") score = self._decision_function(X) if score.shape[1] == 1: return score.ravel() return score def _staged_decision_function(self, X): """Compute decision function of ``X`` for each iteration. This method allows monitoring (i.e. determine error on testing set) after each stage. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- score : generator of array, shape = [n_samples, k] The decision function of the input samples. The order of the classes corresponds to that in the attribute `classes_`. Regression and binary classification are special cases with ``k == 1``, otherwise ``k==n_classes``. """ X = check_array(X, dtype=DTYPE, order="C") score = self._init_decision_function(X) for i in range(self.estimators_.shape[0]): predict_stage(self.estimators_, i, X, self.learning_rate, score) yield score.copy() @deprecated(" and will be removed in 0.19") def staged_decision_function(self, X): """Compute decision function of ``X`` for each iteration. This method allows monitoring (i.e. determine error on testing set) after each stage. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- score : generator of array, shape = [n_samples, k] The decision function of the input samples. The order of the classes corresponds to that in the attribute `classes_`. Regression and binary classification are special cases with ``k == 1``, otherwise ``k==n_classes``. """ for dec in self._staged_decision_function(X): # no yield from in Python2.X yield dec @property def feature_importances_(self): """Return the feature importances (the higher, the more important the feature). Returns ------- feature_importances_ : array, shape = [n_features] """ if self.estimators_ is None or len(self.estimators_) == 0: raise NotFittedError("Estimator not fitted, call `fit` before" " `feature_importances_`.") total_sum = np.zeros((self.n_features, ), dtype=np.float64) for stage in self.estimators_: stage_sum = sum(tree.feature_importances_ for tree in stage) / len(stage) total_sum += stage_sum importances = total_sum / len(self.estimators_) return importances def _validate_y(self, y): self.n_classes_ = 1 if y.dtype.kind == 'O': y = y.astype(np.float64) # Default implementation return y class GradientBoostingClassifier(BaseGradientBoosting, ClassifierMixin): """Gradient Boosting for classification. GB builds an additive model in a forward stage-wise fashion; it allows for the optimization of arbitrary differentiable loss functions. In each stage ``n_classes_`` regression trees are fit on the negative gradient of the binomial or multinomial deviance loss function. Binary classification is a special case where only a single regression tree is induced. Read more in the :ref:`User Guide <gradient_boosting>`. Parameters ---------- loss : {'deviance', 'exponential'}, optional (default='deviance') loss function to be optimized. 'deviance' refers to deviance (= logistic regression) for classification with probabilistic outputs. For loss 'exponential' gradient boosting recovers the AdaBoost algorithm. learning_rate : float, optional (default=0.1) learning rate shrinks the contribution of each tree by `learning_rate`. There is a trade-off between learning_rate and n_estimators. n_estimators : int (default=100) The number of boosting stages to perform. Gradient boosting is fairly robust to over-fitting so a large number usually results in better performance. max_depth : integer, optional (default=3) maximum depth of the individual regression estimators. The maximum depth limits the number of nodes in the tree. Tune this parameter for best performance; the best value depends on the interaction of the input variables. Ignored if ``max_leaf_nodes`` is not None. min_samples_split : integer, optional (default=2) The minimum number of samples required to split an internal node. min_samples_leaf : integer, optional (default=1) The minimum number of samples required to be at a leaf node. min_weight_fraction_leaf : float, optional (default=0.) The minimum weighted fraction of the input samples required to be at a leaf node. subsample : float, optional (default=1.0) The fraction of samples to be used for fitting the individual base learners. If smaller than 1.0 this results in Stochastic Gradient Boosting. `subsample` interacts with the parameter `n_estimators`. Choosing `subsample < 1.0` leads to a reduction of variance and an increase in bias. max_features : int, float, string or None, optional (default=None) The number of features to consider when looking for the best split: - If int, then consider `max_features` features at each split. - If float, then `max_features` is a percentage and `int(max_features * n_features)` features are considered at each split. - If "auto", then `max_features=sqrt(n_features)`. - If "sqrt", then `max_features=sqrt(n_features)`. - If "log2", then `max_features=log2(n_features)`. - If None, then `max_features=n_features`. Choosing `max_features < n_features` leads to a reduction of variance and an increase in bias. Note: the search for a split does not stop until at least one valid partition of the node samples is found, even if it requires to effectively inspect more than ``max_features`` features. max_leaf_nodes : int or None, optional (default=None) Grow trees with ``max_leaf_nodes`` in best-first fashion. Best nodes are defined as relative reduction in impurity. If None then unlimited number of leaf nodes. If not None then ``max_depth`` will be ignored. init : BaseEstimator, None, optional (default=None) An estimator object that is used to compute the initial predictions. ``init`` has to provide ``fit`` and ``predict``. If None it uses ``loss.init_estimator``. verbose : int, default: 0 Enable verbose output. If 1 then it prints progress and performance once in a while (the more trees the lower the frequency). If greater than 1 then it prints progress and performance for every tree. warm_start : bool, default: False When set to ``True``, reuse the solution of the previous call to fit and add more estimators to the ensemble, otherwise, just erase the previous solution. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Attributes ---------- feature_importances_ : array, shape = [n_features] The feature importances (the higher, the more important the feature). oob_improvement_ : array, shape = [n_estimators] The improvement in loss (= deviance) on the out-of-bag samples relative to the previous iteration. ``oob_improvement_[0]`` is the improvement in loss of the first stage over the ``init`` estimator. train_score_ : array, shape = [n_estimators] The i-th score ``train_score_[i]`` is the deviance (= loss) of the model at iteration ``i`` on the in-bag sample. If ``subsample == 1`` this is the deviance on the training data. loss_ : LossFunction The concrete ``LossFunction`` object. init : BaseEstimator The estimator that provides the initial predictions. Set via the ``init`` argument or ``loss.init_estimator``. estimators_ : ndarray of DecisionTreeRegressor, shape = [n_estimators, loss_.K] The collection of fitted sub-estimators. ``loss_.K`` is 1 for binary classification, otherwise n_classes. See also -------- sklearn.tree.DecisionTreeClassifier, RandomForestClassifier AdaBoostClassifier References ---------- J. Friedman, Greedy Function Approximation: A Gradient Boosting Machine, The Annals of Statistics, Vol. 29, No. 5, 2001. J. Friedman, Stochastic Gradient Boosting, 1999 T. Hastie, R. Tibshirani and J. Friedman. Elements of Statistical Learning Ed. 2, Springer, 2009. """ _SUPPORTED_LOSS = ('deviance', 'exponential') def __init__(self, loss='deviance', learning_rate=0.1, n_estimators=100, subsample=1.0, min_samples_split=2, min_samples_leaf=1, min_weight_fraction_leaf=0., max_depth=3, init=None, random_state=None, max_features=None, verbose=0, max_leaf_nodes=None, warm_start=False): super(GradientBoostingClassifier, self).__init__( loss=loss, learning_rate=learning_rate, n_estimators=n_estimators, min_samples_split=min_samples_split, min_samples_leaf=min_samples_leaf, min_weight_fraction_leaf=min_weight_fraction_leaf, max_depth=max_depth, init=init, subsample=subsample, max_features=max_features, random_state=random_state, verbose=verbose, max_leaf_nodes=max_leaf_nodes, warm_start=warm_start) def _validate_y(self, y): self.classes_, y = np.unique(y, return_inverse=True) self.n_classes_ = len(self.classes_) return y def decision_function(self, X): """Compute the decision function of ``X``. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- score : array, shape = [n_samples, n_classes] or [n_samples] The decision function of the input samples. The order of the classes corresponds to that in the attribute `classes_`. Regression and binary classification produce an array of shape [n_samples]. """ X = check_array(X, dtype=DTYPE, order="C") score = self._decision_function(X) if score.shape[1] == 1: return score.ravel() return score def staged_decision_function(self, X): """Compute decision function of ``X`` for each iteration. This method allows monitoring (i.e. determine error on testing set) after each stage. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- score : generator of array, shape = [n_samples, k] The decision function of the input samples. The order of the classes corresponds to that in the attribute `classes_`. Regression and binary classification are special cases with ``k == 1``, otherwise ``k==n_classes``. """ for dec in self._staged_decision_function(X): # no yield from in Python2.X yield dec def predict(self, X): """Predict class for X. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- y: array of shape = ["n_samples] The predicted values. """ score = self.decision_function(X) decisions = self.loss_._score_to_decision(score) return self.classes_.take(decisions, axis=0) def staged_predict(self, X): """Predict class at each stage for X. This method allows monitoring (i.e. determine error on testing set) after each stage. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- y : generator of array of shape = [n_samples] The predicted value of the input samples. """ for score in self._staged_decision_function(X): decisions = self.loss_._score_to_decision(score) yield self.classes_.take(decisions, axis=0) def predict_proba(self, X): """Predict class probabilities for X. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Raises ------ AttributeError If the ``loss`` does not support probabilities. Returns ------- p : array of shape = [n_samples] The class probabilities of the input samples. The order of the classes corresponds to that in the attribute `classes_`. """ score = self.decision_function(X) try: return self.loss_._score_to_proba(score) except NotFittedError: raise except AttributeError: raise AttributeError('loss=%r does not support predict_proba' % self.loss) def predict_log_proba(self, X): """Predict class log-probabilities for X. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Raises ------ AttributeError If the ``loss`` does not support probabilities. Returns ------- p : array of shape = [n_samples] The class log-probabilities of the input samples. The order of the classes corresponds to that in the attribute `classes_`. """ proba = self.predict_proba(X) return np.log(proba) def staged_predict_proba(self, X): """Predict class probabilities at each stage for X. This method allows monitoring (i.e. determine error on testing set) after each stage. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- y : generator of array of shape = [n_samples] The predicted value of the input samples. """ try: for score in self._staged_decision_function(X): yield self.loss_._score_to_proba(score) except NotFittedError: raise except AttributeError: raise AttributeError('loss=%r does not support predict_proba' % self.loss) class GradientBoostingRegressor(BaseGradientBoosting, RegressorMixin): """Gradient Boosting for regression. GB builds an additive model in a forward stage-wise fashion; it allows for the optimization of arbitrary differentiable loss functions. In each stage a regression tree is fit on the negative gradient of the given loss function. Read more in the :ref:`User Guide <gradient_boosting>`. Parameters ---------- loss : {'ls', 'lad', 'huber', 'quantile'}, optional (default='ls') loss function to be optimized. 'ls' refers to least squares regression. 'lad' (least absolute deviation) is a highly robust loss function solely based on order information of the input variables. 'huber' is a combination of the two. 'quantile' allows quantile regression (use `alpha` to specify the quantile). learning_rate : float, optional (default=0.1) learning rate shrinks the contribution of each tree by `learning_rate`. There is a trade-off between learning_rate and n_estimators. n_estimators : int (default=100) The number of boosting stages to perform. Gradient boosting is fairly robust to over-fitting so a large number usually results in better performance. max_depth : integer, optional (default=3) maximum depth of the individual regression estimators. The maximum depth limits the number of nodes in the tree. Tune this parameter for best performance; the best value depends on the interaction of the input variables. Ignored if ``max_leaf_nodes`` is not None. min_samples_split : integer, optional (default=2) The minimum number of samples required to split an internal node. min_samples_leaf : integer, optional (default=1) The minimum number of samples required to be at a leaf node. min_weight_fraction_leaf : float, optional (default=0.) The minimum weighted fraction of the input samples required to be at a leaf node. subsample : float, optional (default=1.0) The fraction of samples to be used for fitting the individual base learners. If smaller than 1.0 this results in Stochastic Gradient Boosting. `subsample` interacts with the parameter `n_estimators`. Choosing `subsample < 1.0` leads to a reduction of variance and an increase in bias. max_features : int, float, string or None, optional (default=None) The number of features to consider when looking for the best split: - If int, then consider `max_features` features at each split. - If float, then `max_features` is a percentage and `int(max_features * n_features)` features are considered at each split. - If "auto", then `max_features=n_features`. - If "sqrt", then `max_features=sqrt(n_features)`. - If "log2", then `max_features=log2(n_features)`. - If None, then `max_features=n_features`. Choosing `max_features < n_features` leads to a reduction of variance and an increase in bias. Note: the search for a split does not stop until at least one valid partition of the node samples is found, even if it requires to effectively inspect more than ``max_features`` features. max_leaf_nodes : int or None, optional (default=None) Grow trees with ``max_leaf_nodes`` in best-first fashion. Best nodes are defined as relative reduction in impurity. If None then unlimited number of leaf nodes. alpha : float (default=0.9) The alpha-quantile of the huber loss function and the quantile loss function. Only if ``loss='huber'`` or ``loss='quantile'``. init : BaseEstimator, None, optional (default=None) An estimator object that is used to compute the initial predictions. ``init`` has to provide ``fit`` and ``predict``. If None it uses ``loss.init_estimator``. verbose : int, default: 0 Enable verbose output. If 1 then it prints progress and performance once in a while (the more trees the lower the frequency). If greater than 1 then it prints progress and performance for every tree. warm_start : bool, default: False When set to ``True``, reuse the solution of the previous call to fit and add more estimators to the ensemble, otherwise, just erase the previous solution. random_state : int, RandomState instance or None, optional (default=None) If int, random_state is the seed used by the random number generator; If RandomState instance, random_state is the random number generator; If None, the random number generator is the RandomState instance used by `np.random`. Attributes ---------- feature_importances_ : array, shape = [n_features] The feature importances (the higher, the more important the feature). oob_improvement_ : array, shape = [n_estimators] The improvement in loss (= deviance) on the out-of-bag samples relative to the previous iteration. ``oob_improvement_[0]`` is the improvement in loss of the first stage over the ``init`` estimator. train_score_ : array, shape = [n_estimators] The i-th score ``train_score_[i]`` is the deviance (= loss) of the model at iteration ``i`` on the in-bag sample. If ``subsample == 1`` this is the deviance on the training data. loss_ : LossFunction The concrete ``LossFunction`` object. `init` : BaseEstimator The estimator that provides the initial predictions. Set via the ``init`` argument or ``loss.init_estimator``. estimators_ : ndarray of DecisionTreeRegressor, shape = [n_estimators, 1] The collection of fitted sub-estimators. See also -------- DecisionTreeRegressor, RandomForestRegressor References ---------- J. Friedman, Greedy Function Approximation: A Gradient Boosting Machine, The Annals of Statistics, Vol. 29, No. 5, 2001. J. Friedman, Stochastic Gradient Boosting, 1999 T. Hastie, R. Tibshirani and J. Friedman. Elements of Statistical Learning Ed. 2, Springer, 2009. """ _SUPPORTED_LOSS = ('ls', 'lad', 'huber', 'quantile') def __init__(self, loss='ls', learning_rate=0.1, n_estimators=100, subsample=1.0, min_samples_split=2, min_samples_leaf=1, min_weight_fraction_leaf=0., max_depth=3, init=None, random_state=None, max_features=None, alpha=0.9, verbose=0, max_leaf_nodes=None, warm_start=False): super(GradientBoostingRegressor, self).__init__( loss=loss, learning_rate=learning_rate, n_estimators=n_estimators, min_samples_split=min_samples_split, min_samples_leaf=min_samples_leaf, min_weight_fraction_leaf=min_weight_fraction_leaf, max_depth=max_depth, init=init, subsample=subsample, max_features=max_features, random_state=random_state, alpha=alpha, verbose=verbose, max_leaf_nodes=max_leaf_nodes, warm_start=warm_start) def predict(self, X): """Predict regression target for X. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- y : array of shape = [n_samples] The predicted values. """ X = check_array(X, dtype=DTYPE, order="C") return self._decision_function(X).ravel() def staged_predict(self, X): """Predict regression target at each stage for X. This method allows monitoring (i.e. determine error on testing set) after each stage. Parameters ---------- X : array-like of shape = [n_samples, n_features] The input samples. Returns ------- y : generator of array of shape = [n_samples] The predicted value of the input samples. """ for y in self._staged_decision_function(X): yield y.ravel()
bsd-3-clause
jettisonjoe/openhtf
openhtf/core/measurements.py
1
24982
# Copyright 2014 Google Inc. All Rights Reserved. # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Measurements for OpenHTF. Measurements in OpenHTF are used to represent values collected during a Test. They can be numeric or string values, and can be configured such that the OpenHTF framework will automatically check them against Pass/Fail criteria. Measurements should not be used for large binary blobs, which are instead best stored as Attachments (see attachments.py). Measurements are described by the measurements.Measurement class. Essentially, the Measurement class is used by test authors to declare measurements by name, and to optionally provide unit, type, and validation information. Measurements are attached to Test Phases using the @measurements.measures() decorator. When measurements are output by the OpenHTF framework, the Measurement objects are serialized into the 'measurements' field on the PhaseRecord, which contain both descriptor fields, outcome (PASS/FAIL/UNSET), and the values themselves. Validation of undimensioned measurements happens when they are set, so that users of the HTTP API can see PASS/FAIL outcome on those measurements immediately after they are set. Multidimensional measurements, however, don't usually make sense to validate until all data is available, so they instead enter a PARTIALLY_SET outcome state until the end of the test phase, at which point they are validated and become with PASS or FAIL. Note that validators of dimensioned measurements are only called at the end of the phase if at least one value was set in the multidimensional measurement, otherwise it remains UNSET, so that outcome fields for all measurements may be PASS, FAIL, or UNSET. # TODO(madsci): Make validators.py example. See examples/validators.py for some examples on how to define and use custom measurement validators. Examples: @measurements.measures( measurements.Measurement( 'number_widgets').in_range(5, 10).doc( '''This phase parameter tracks the number of widgets.''')) @measurements.measures( *(measurements.Measurement('level_%s' % lvl) for lvl in ('none', 'some', 'all'))) def WidgetTestPhase(test): test.measurements.number_widgets = 5 test.measurements.level_none = 10 """ import collections import logging from enum import Enum import mutablerecords from openhtf import util from openhtf.core import phase_descriptor from openhtf.util import data from openhtf.util import validators from openhtf.util import units import six try: import pandas except ImportError: pandas = None _LOG = logging.getLogger(__name__) class InvalidDimensionsError(Exception): """Raised when there is a problem with measurement dimensions.""" class InvalidMeasurementType(Exception): """Raised when an unexpected measurement type is given.""" class MeasurementNotSetError(Exception): """Raised when a measurement is accessed that hasn't been set.""" class NotAMeasurementError(Exception): """Raised if an invalid measurement name is accessed.""" class DuplicateNameError(Exception): """An exception which occurs when a measurement name collision occurs.""" # Only multidimensional measurements can be 'PARTIALLY_SET', and can never be in # that state after their respective phase has completed (they must transition to # either PASS or FAIL at that point). Outcome = Enum('Outcome', ['PASS', 'FAIL', 'UNSET', 'PARTIALLY_SET']) class Measurement( # pylint: disable=no-init mutablerecords.Record( 'Measurement', ['name'], {'units': None, 'dimensions': None, 'docstring': None, '_notification_cb': None, 'validators': list, 'outcome': Outcome.UNSET, 'measured_value': None, '_cached': None})): """Record encapsulating descriptive data for a measurement. This record includes an _asdict() method so it can be easily output. Output is as you would expect, a dict mapping non-None fields to their values (validators are stringified with str()). Attributes: name: Name of the measurement. docstring: Optional string describing this measurement. units: UOM code of the units for the measurement being taken. dimensions: Tuple of UOM codes for units of dimensions. validators: List of callable validator objects to perform pass/fail checks. outcome: One of the Outcome() enumeration values, starting at UNSET. measured_value: An instance of MeasuredValue or DimensionedMeasuredValue containing the value(s) of this Measurement that have been set, if any. _cached: A cached dict representation of this measurement created initially during as_base_types and updated in place to save allocation time. """ def __init__(self, name, **kwargs): super(Measurement, self).__init__(name, **kwargs) if 'measured_value' not in kwargs: self._initialize_value() def _initialize_value(self): if self.measured_value and self.measured_value.is_value_set: raise ValueError('Cannot update a Measurement once a value is set.') if self.dimensions: self.measured_value = DimensionedMeasuredValue( self.name, len(self.dimensions)) else: self.measured_value = MeasuredValue(self.name) def __setattr__(self, attr, value): super(Measurement, self).__setattr__(attr, value) # When dimensions changes, we may need to update our measured_value type. if attr == 'dimensions': self._initialize_value() def __setstate__(self, state): """Set this record's state during unpickling. This override is necessary to ensure that the the _initialize_value check is skipped during unpickling. """ dimensions = state.pop('dimensions') super(Measurement, self).__setstate__(state) object.__setattr__(self, 'dimensions', dimensions) def set_notification_callback(self, notification_cb): """Set the notifier we'll call when measurements are set.""" self._notification_cb = notification_cb if not notification_cb and self.dimensions: self.measured_value.notify_value_set = None return self def notify_value_set(self): if self.dimensions: self.outcome = Outcome.PARTIALLY_SET else: self.validate() if self._notification_cb: self._notification_cb() def doc(self, docstring): """Set this Measurement's docstring, returns self for chaining.""" self.docstring = docstring return self def _maybe_make_unit_desc(self, unit_desc): """Return the UnitDescriptor or convert a string to one.""" if isinstance(unit_desc, str) or unit_desc is None: unit_desc = units.Unit(unit_desc) if not isinstance(unit_desc, units.UnitDescriptor): raise TypeError('Invalid units for measurement %s: %s' % (self.name, unit_desc)) return unit_desc def _maybe_make_dimension(self, dimension): """Return a `measurements.Dimension` instance.""" # For backwards compatibility the argument can be either a Dimension, a # string or a `units.UnitDescriptor`. if isinstance(dimension, Dimension): return dimension if isinstance(dimension, units.UnitDescriptor): return Dimension.from_unit_descriptor(dimension) if isinstance(dimension, str): return Dimension.from_string(dimension) raise TypeError('Cannot convert %s to a dimension', dimension) def with_units(self, unit_desc): """Declare the units for this Measurement, returns self for chaining.""" self.units = self._maybe_make_unit_desc(unit_desc) return self def with_dimensions(self, *dimensions): """Declare dimensions for this Measurement, returns self for chaining.""" self.dimensions = tuple( self._maybe_make_dimension(dim) for dim in dimensions) self._cached = None return self def with_validator(self, validator): """Add a validator callback to this Measurement, chainable.""" if not callable(validator): raise ValueError('Validator must be callable', validator) self.validators.append(validator) self._cached = None return self def with_args(self, **kwargs): """String substitution for names and docstrings.""" validators = [ validator.with_args(**kwargs) if hasattr(validator, 'with_args') else validator for validator in self.validators ] return mutablerecords.CopyRecord( self, name=util.format_string(self.name, kwargs), docstring=util.format_string(self.docstring, kwargs), validators=validators, _cached=None, ) def __getattr__(self, attr): # pylint: disable=invalid-name """Support our default set of validators as direct attributes.""" # Don't provide a back door to validators.py private stuff accidentally. if attr.startswith('_') or not validators.has_validator(attr): raise AttributeError("'%s' object has no attribute '%s'" % ( type(self).__name__, attr)) # Create a wrapper to invoke the attribute from within validators. def _with_validator(*args, **kwargs): # pylint: disable=invalid-name return self.with_validator( validators.create_validator(attr, *args, **kwargs)) return _with_validator def validate(self): """Validate this measurement and update its 'outcome' field.""" # PASS if all our validators return True, otherwise FAIL. try: if all(v(self.measured_value.value) for v in self.validators): self.outcome = Outcome.PASS else: self.outcome = Outcome.FAIL return self except Exception as e: # pylint: disable=bare-except _LOG.error('Validation for measurement %s raised an exception %s.', self.name, e) self.outcome = Outcome.FAIL raise finally: if self._cached: self._cached['outcome'] = self.outcome.name def as_base_types(self): """Convert this measurement to a dict of basic types.""" if not self._cached: # Create the single cache file the first time this is called. self._cached = { 'name': self.name, 'outcome': self.outcome.name, } if self.validators: self._cached['validators'] = data.convert_to_base_types( tuple(str(v) for v in self.validators)) if self.dimensions: self._cached['dimensions'] = data.convert_to_base_types(self.dimensions) if self.units: self._cached['units'] = data.convert_to_base_types(self.units) if self.docstring: self._cached['docstring'] = self.docstring if self.measured_value.is_value_set: self._cached['measured_value'] = self.measured_value.basetype_value() return self._cached def to_dataframe(self, columns=None): """Convert a multi-dim to a pandas dataframe.""" if not isinstance(self.measured_value, DimensionedMeasuredValue): raise TypeError( 'Only a dimensioned measurement can be converted to a DataFrame') if columns is None: columns = [d.name for d in self.dimensions] columns += [self.units.name if self.units else 'value'] dataframe = self.measured_value.to_dataframe(columns) return dataframe class MeasuredValue( mutablerecords.Record('MeasuredValue', ['name'], {'stored_value': None, 'is_value_set': False, '_cached_value': None})): """Class encapsulating actual values measured. Note that this is really just a value wrapper with some sanity checks. See Declaration for the class that handles the descriptive aspect of the measurement. This class is the type that Collection actually stores in its _values attribute. This class stores values for un-dimensioned (single-value) measurements, for dimensioned values, see the DimensionedMeasuredValue. The interfaces are very similar, but differ slightly; the important part is the get_value() interface on both of them. The _cached_value is the base type represention of the stored_value when that is set. """ def __str__(self): return str(self.value) if self.is_value_set else 'UNSET' def __eq__(self, other): return (type(self) == type(other) and self.name == other.name and self.is_value_set == other.is_value_set and self.stored_value == other.stored_value) def __ne__(self, other): return not self.__eq__(other) @property def value(self): if not self.is_value_set: raise MeasurementNotSetError('Measurement not yet set', self.name) return self.stored_value def basetype_value(self): return self._cached_value def set(self, value): """Set the value for this measurement, with some sanity checks.""" if self.is_value_set: # While we want to *allow* re-setting previously set measurements, we'd # rather promote the use of multidimensional measurements instead of # discarding data, so we make this somewhat chatty. _LOG.warning( 'Overriding previous measurement %s value of %s with %s, the old ' 'value will be lost. Use a dimensioned measurement if you need to ' 'save multiple values.', self.name, self.stored_value, value) if value is None: _LOG.warning('Measurement %s is set to None', self.name) self.stored_value = value self._cached_value = data.convert_to_base_types(value) self.is_value_set = True class Dimension(object): """Dimension for multi-dim Measurements. Dimensions optionally include a unit and a description. This is intended as a drop-in replacement for UnitDescriptor for backwards compatibility. """ __slots__ = ['_description', '_unit', '_cached_dict'] def __init__(self, description='', unit=units.NO_DIMENSION): self._description = description self._unit = unit self._cached_dict = data.convert_to_base_types({ 'code': self.code, 'description': self.description, 'name': self.name, 'suffix': self.suffix, }) def __eq__(self, other): return (self.description == other.description and self.unit == other.unit) def __ne__(self, other): return not self == other def __repr__(self): return '<%s: %s>' % (type(self).__name__, self._asdict()) @classmethod def from_unit_descriptor(cls, unit_desc): return cls(unit=unit_desc) @classmethod def from_string(cls, string): """Convert a string into a Dimension""" # Note: There is some ambiguity as to whether the string passed is intended # to become a unit looked up by name or suffix, or a Dimension descriptor. if string in units.UNITS_BY_ALL: return cls(description=string, unit=units.Unit(string)) else: return cls(description=string) @property def description(self): return self._description @property def unit(self): return self._unit @property def code(self): """Provides backwards compatibility to `units.UnitDescriptor` api.""" return self._unit.code @property def suffix(self): """Provides backwards compatibility to `units.UnitDescriptor` api.""" return self._unit.suffix @property def name(self): """Provides backwards compatibility to `units.UnitDescriptor` api.""" return self._description or self._unit.name def _asdict(self): return self._cached_dict class DimensionedMeasuredValue(mutablerecords.Record( 'DimensionedMeasuredValue', ['name', 'num_dimensions'], {'notify_value_set': None, 'value_dict': collections.OrderedDict, '_cached_basetype_values': list})): """Class encapsulating actual values measured. See the MeasuredValue class docstring for more info. This class provides a dict-like interface for indexing into dimensioned measurements. The _cached_basetype_values is a cached list of the dimensioned entries in order of being set. Each list entry is a tuple that is composed of the key, then the value. This is set to None if a previous measurement is overridden; in such a case, the list is fully reconstructed on the next call to basetype_value. """ def __str__(self): return str(self.value) if self.is_value_set else 'UNSET' def with_notify(self, notify_value_set): self.notify_value_set = notify_value_set return self @property def is_value_set(self): return len(self.value_dict) > 0 def __iter__(self): # pylint: disable=invalid-name """Iterate over items, allows easy conversion to a dict.""" return iter(six.iteritems(self.value_dict)) def __setitem__(self, coordinates, value): # pylint: disable=invalid-name coordinates_len = len(coordinates) if hasattr(coordinates, '__len__') else 1 if coordinates_len != self.num_dimensions: raise InvalidDimensionsError( 'Expected %s-dimensional coordinates, got %s' % (self.num_dimensions, coordinates_len)) # Wrap single dimensions in a tuple so we can assume value_dict keys are # always tuples later. if self.num_dimensions == 1: coordinates = (coordinates,) if coordinates in self.value_dict: _LOG.warning( 'Overriding previous measurement %s[%s] value of %s with %s', self.name, coordinates, self.value_dict[coordinates], value) self._cached_basetype_values = None elif self._cached_basetype_values is not None: self._cached_basetype_values.append(data.convert_to_base_types( coordinates + (value,))) self.value_dict[coordinates] = value if self.notify_value_set: self.notify_value_set() def __getitem__(self, coordinates): # pylint: disable=invalid-name # Wrap single dimensions in a tuple so we can assume value_dict keys are # always tuples later. if self.num_dimensions == 1: coordinates = (coordinates,) return self.value_dict[coordinates] @property def value(self): """The values stored in this record. Returns: A list of tuples; the last element of each tuple will be the measured value, the other elements will be the associated coordinates. The tuples are output in the order in which they were set. """ if not self.is_value_set: raise MeasurementNotSetError('Measurement not yet set', self.name) return [dimensions + (value,) for dimensions, value in six.iteritems(self.value_dict)] def basetype_value(self): if self._cached_basetype_values is None: self._cached_basetype_values = list( data.convert_to_base_types(coordinates + (value,)) for coordinates, value in six.iteritems(self.value_dict)) return self._cached_basetype_values def to_dataframe(self, columns=None): """Converts to a `pandas.DataFrame`""" if not self.is_value_set: raise ValueError('Value must be set before converting to a DataFrame.') if not pandas: raise RuntimeError('Install pandas to convert to pandas.DataFrame') return pandas.DataFrame.from_records(self.value, columns=columns) class Collection(mutablerecords.Record('Collection', ['_measurements'])): """Encapsulates a collection of measurements. This collection can have measurement values retrieved and set via getters and setters that provide attribute and dict-like interfaces. A Collection is created with a list of Measurement objects (defined above). Measurements can't be added after initialization, only accessed and set. MeasuredValue values can be set as attributes (see below). They can also be read as attributes, but you get a DimensionedMeasuredValue object back if the measurement accessed is dimensioned (this is how setting of dimensioned measurements works, and so is unavoidable). Iterating over a Collection results in (key, value) tuples of only set measurements and their values. As such, a Collection can be converted to a dict if you want to see all of a dimensioned measurement's values. Alternatively, DimensionedMeasuredValue objects can also be converted directly to dicts with dict(), as they also support an __iter__() interface. This class is intended for use only internally within the OpenHTF framework. Example: from openhtf.util import measurements from openhtf.util.units import UOM self.measurements = measurements.Collection([ measurements.Measurement('widget_height'), measurements.Measurement('widget_freq_response').with_dimensions( UOM['HERTZ'])]) self.measurements.widget_height = 3 print self.measurements.widget_height # 3 self.measurements.widget_freq_response[5] = 10 print self.measurements.widget_freq_response[5] # 10 self.measurements.widget_freq_response[6] = 11 print dict(self.measurements.widget_freq_response) # {5: 10, 6: 11} # Not recommended, but you can also do this. This is intended only for # framework internal use when generating the output test record. print dict(self.measurements)['widget_freq_response'] # [(5, 10), (6, 11)] """ def _assert_valid_key(self, name): """Raises if name is not a valid measurement.""" if name not in self._measurements: raise NotAMeasurementError('Not a measurement', name, self._measurements) def __iter__(self): # pylint: disable=invalid-name """Extract each MeasurementValue's value.""" return ((key, meas.measured_value.value) for key, meas in six.iteritems(self._measurements)) def __setattr__(self, name, value): # pylint: disable=invalid-name self[name] = value def __getattr__(self, name): # pylint: disable=invalid-name return self[name] def __setitem__(self, name, value): # pylint: disable=invalid-name self._assert_valid_key(name) if self._measurements[name].dimensions: raise InvalidDimensionsError( 'Cannot set dimensioned measurement without indices') self._measurements[name].measured_value.set(value) self._measurements[name].notify_value_set() def __getitem__(self, name): # pylint: disable=invalid-name self._assert_valid_key(name) if self._measurements[name].dimensions: return self._measurements[name].measured_value.with_notify( self._measurements[name].notify_value_set) # Return the MeasuredValue's value, MeasuredValue will raise if not set. return self._measurements[name].measured_value.value def measures(*measurements, **kwargs): """Decorator-maker used to declare measurements for phases. See the measurements module docstring for examples of usage. Args: measurements: Measurement objects to declare, or a string name from which to create a Measurement. kwargs: Keyword arguments to pass to Measurement constructor if we're constructing one. Note that if kwargs are provided, the length of measurements must be 1, and that value must be a string containing the measurement name. For valid kwargs, see the definition of the Measurement class. Returns: A decorator that declares the measurement(s) for the decorated phase. """ def _maybe_make(meas): """Turn strings into Measurement objects if necessary.""" if isinstance(meas, Measurement): return meas elif isinstance(meas, six.string_types): return Measurement(meas, **kwargs) raise InvalidMeasurementType('Expected Measurement or string', meas) # In case we're declaring a measurement inline, we can only declare one. if kwargs and len(measurements) != 1: raise InvalidMeasurementType( 'If @measures kwargs are provided, a single measurement name must be ' 'provided as a positional arg first.') # Unlikely, but let's make sure we don't allow overriding initial outcome. if 'outcome' in kwargs: raise ValueError('Cannot specify outcome in measurement declaration!') measurements = [_maybe_make(meas) for meas in measurements] # 'measurements' is guaranteed to be a list of Measurement objects here. def decorate(wrapped_phase): """Phase decorator to be returned.""" phase = phase_descriptor.PhaseDescriptor.wrap_or_copy(wrapped_phase) duplicate_names = (set(m.name for m in measurements) & set(m.name for m in phase.measurements)) if duplicate_names: raise DuplicateNameError('Measurement names duplicated', duplicate_names) phase.measurements.extend(measurements) return phase return decorate
apache-2.0
flightgong/scikit-learn
examples/covariance/plot_mahalanobis_distances.py
348
6232
r""" ================================================================ Robust covariance estimation and Mahalanobis distances relevance ================================================================ An example to show covariance estimation with the Mahalanobis distances on Gaussian distributed data. For Gaussian distributed data, the distance of an observation :math:`x_i` to the mode of the distribution can be computed using its Mahalanobis distance: :math:`d_{(\mu,\Sigma)}(x_i)^2 = (x_i - \mu)'\Sigma^{-1}(x_i - \mu)` where :math:`\mu` and :math:`\Sigma` are the location and the covariance of the underlying Gaussian distribution. In practice, :math:`\mu` and :math:`\Sigma` are replaced by some estimates. The usual covariance maximum likelihood estimate is very sensitive to the presence of outliers in the data set and therefor, the corresponding Mahalanobis distances are. One would better have to use a robust estimator of covariance to guarantee that the estimation is resistant to "erroneous" observations in the data set and that the associated Mahalanobis distances accurately reflect the true organisation of the observations. The Minimum Covariance Determinant estimator is a robust, high-breakdown point (i.e. it can be used to estimate the covariance matrix of highly contaminated datasets, up to :math:`\frac{n_\text{samples}-n_\text{features}-1}{2}` outliers) estimator of covariance. The idea is to find :math:`\frac{n_\text{samples}+n_\text{features}+1}{2}` observations whose empirical covariance has the smallest determinant, yielding a "pure" subset of observations from which to compute standards estimates of location and covariance. The Minimum Covariance Determinant estimator (MCD) has been introduced by P.J.Rousseuw in [1]. This example illustrates how the Mahalanobis distances are affected by outlying data: observations drawn from a contaminating distribution are not distinguishable from the observations coming from the real, Gaussian distribution that one may want to work with. Using MCD-based Mahalanobis distances, the two populations become distinguishable. Associated applications are outliers detection, observations ranking, clustering, ... For visualization purpose, the cubic root of the Mahalanobis distances are represented in the boxplot, as Wilson and Hilferty suggest [2] [1] P. J. Rousseeuw. Least median of squares regression. J. Am Stat Ass, 79:871, 1984. [2] Wilson, E. B., & Hilferty, M. M. (1931). The distribution of chi-square. Proceedings of the National Academy of Sciences of the United States of America, 17, 684-688. """ print(__doc__) import numpy as np import matplotlib.pyplot as plt from sklearn.covariance import EmpiricalCovariance, MinCovDet n_samples = 125 n_outliers = 25 n_features = 2 # generate data gen_cov = np.eye(n_features) gen_cov[0, 0] = 2. X = np.dot(np.random.randn(n_samples, n_features), gen_cov) # add some outliers outliers_cov = np.eye(n_features) outliers_cov[np.arange(1, n_features), np.arange(1, n_features)] = 7. X[-n_outliers:] = np.dot(np.random.randn(n_outliers, n_features), outliers_cov) # fit a Minimum Covariance Determinant (MCD) robust estimator to data robust_cov = MinCovDet().fit(X) # compare estimators learnt from the full data set with true parameters emp_cov = EmpiricalCovariance().fit(X) ############################################################################### # Display results fig = plt.figure() plt.subplots_adjust(hspace=-.1, wspace=.4, top=.95, bottom=.05) # Show data set subfig1 = plt.subplot(3, 1, 1) inlier_plot = subfig1.scatter(X[:, 0], X[:, 1], color='black', label='inliers') outlier_plot = subfig1.scatter(X[:, 0][-n_outliers:], X[:, 1][-n_outliers:], color='red', label='outliers') subfig1.set_xlim(subfig1.get_xlim()[0], 11.) subfig1.set_title("Mahalanobis distances of a contaminated data set:") # Show contours of the distance functions xx, yy = np.meshgrid(np.linspace(plt.xlim()[0], plt.xlim()[1], 100), np.linspace(plt.ylim()[0], plt.ylim()[1], 100)) zz = np.c_[xx.ravel(), yy.ravel()] mahal_emp_cov = emp_cov.mahalanobis(zz) mahal_emp_cov = mahal_emp_cov.reshape(xx.shape) emp_cov_contour = subfig1.contour(xx, yy, np.sqrt(mahal_emp_cov), cmap=plt.cm.PuBu_r, linestyles='dashed') mahal_robust_cov = robust_cov.mahalanobis(zz) mahal_robust_cov = mahal_robust_cov.reshape(xx.shape) robust_contour = subfig1.contour(xx, yy, np.sqrt(mahal_robust_cov), cmap=plt.cm.YlOrBr_r, linestyles='dotted') subfig1.legend([emp_cov_contour.collections[1], robust_contour.collections[1], inlier_plot, outlier_plot], ['MLE dist', 'robust dist', 'inliers', 'outliers'], loc="upper right", borderaxespad=0) plt.xticks(()) plt.yticks(()) # Plot the scores for each point emp_mahal = emp_cov.mahalanobis(X - np.mean(X, 0)) ** (0.33) subfig2 = plt.subplot(2, 2, 3) subfig2.boxplot([emp_mahal[:-n_outliers], emp_mahal[-n_outliers:]], widths=.25) subfig2.plot(1.26 * np.ones(n_samples - n_outliers), emp_mahal[:-n_outliers], '+k', markeredgewidth=1) subfig2.plot(2.26 * np.ones(n_outliers), emp_mahal[-n_outliers:], '+k', markeredgewidth=1) subfig2.axes.set_xticklabels(('inliers', 'outliers'), size=15) subfig2.set_ylabel(r"$\sqrt[3]{\rm{(Mahal. dist.)}}$", size=16) subfig2.set_title("1. from non-robust estimates\n(Maximum Likelihood)") plt.yticks(()) robust_mahal = robust_cov.mahalanobis(X - robust_cov.location_) ** (0.33) subfig3 = plt.subplot(2, 2, 4) subfig3.boxplot([robust_mahal[:-n_outliers], robust_mahal[-n_outliers:]], widths=.25) subfig3.plot(1.26 * np.ones(n_samples - n_outliers), robust_mahal[:-n_outliers], '+k', markeredgewidth=1) subfig3.plot(2.26 * np.ones(n_outliers), robust_mahal[-n_outliers:], '+k', markeredgewidth=1) subfig3.axes.set_xticklabels(('inliers', 'outliers'), size=15) subfig3.set_ylabel(r"$\sqrt[3]{\rm{(Mahal. dist.)}}$", size=16) subfig3.set_title("2. from robust estimates\n(Minimum Covariance Determinant)") plt.yticks(()) plt.show()
bsd-3-clause
DiCarloLab-Delft/PycQED_py3
pycqed/analysis/tools/plotting.py
1
25541
''' Contain the plotting tools portion of the analysis toolbox Note: There is an equivalent file for analysis v2, include your new code there, unless it is only inteded for analysis v1 ''' import lmfit import matplotlib.pyplot as plt import matplotlib from matplotlib import cm import numpy as np import matplotlib.colors as col import hsluv from scipy.interpolate import interp1d from matplotlib.patches import Rectangle, ConnectionPatch golden_mean = (np.sqrt(5)-1.0)/2.0 # Aesthetic ratio single_col_figsize = (3.39, golden_mean*3.39) double_col_figsize = (6.9, golden_mean*6.9) thesis_col_figsize = (12.2/2.54, golden_mean*12.2/2.54) def set_xlabel(axis, label, unit=None, latexify_ticks=False, **kw): """ Add a unit aware x-label to an axis object. Args: axis: matplotlib axis object to set label on label: the desired label unit: the unit **kw : keyword argument to be passed to matplotlib.set_xlabel """ if unit is not None and unit != '': xticks = axis.get_xticks() scale_factor, unit = SI_prefix_and_scale_factor( val=max(abs(xticks)), unit=unit) tick_str = '{:.4g}' if not latexify_ticks else r'${:.4g}$' formatter = matplotlib.ticker.FuncFormatter( lambda x, pos: tick_str.format(x * scale_factor)) axis.xaxis.set_major_formatter(formatter) axis.set_xlabel(label + ' ({})'.format(unit), **kw) else: axis.set_xlabel(label, **kw) return axis def set_ylabel(axis, label, unit=None, latexify_ticks=False, **kw): """ Add a unit aware y-label to an axis object. Args: axis: matplotlib axis object to set label on label: the desired label unit: the unit **kw : keyword argument to be passed to matplotlib.set_ylabel """ if unit is not None and unit != '': yticks = axis.get_yticks() scale_factor, unit = SI_prefix_and_scale_factor( val=max(abs(yticks)), unit=unit) tick_str = '{:.6g}' if not latexify_ticks else r'${:.6g}$' formatter = matplotlib.ticker.FuncFormatter( lambda x, pos: tick_str.format(x * scale_factor)) axis.yaxis.set_major_formatter(formatter) axis.set_ylabel(label + ' ({})'.format(unit), **kw) else: axis.set_ylabel(label, **kw) return axis def set_cbarlabel(cbar, label, unit=None, **kw): """ Add a unit aware z-label to a colorbar object Args: cbar: colorbar object to set label on label: the desired label unit: the unit **kw : keyword argument to be passed to cbar.set_label """ if unit is not None and unit != '': zticks = cbar.get_ticks() scale_factor, unit = SI_prefix_and_scale_factor( val=max(abs(zticks)), unit=unit) cbar.set_ticks(zticks) cbar.set_ticklabels(zticks*scale_factor) cbar.set_label(label + ' ({})'.format(unit)) else: cbar.set_label(label, **kw) return cbar SI_PREFIXES = dict(zip(range(-24, 25, 3), 'yzafpnμm kMGTPEZY')) SI_PREFIXES[0] = "" # N.B. not all of these are SI units, however, all of these support SI prefixes SI_UNITS = 'm,s,g,W,J,V,A,F,T,Hz,Ohm,S,N,C,px,b,B,K,Bar,Vpeak,Vpp,Vp,Vrms,$\Phi_0$,A/s'.split( ',') def SI_prefix_and_scale_factor(val, unit=None): """ Takes in a value and unit and if applicable returns the proper scale factor and SI prefix. Args: val (float) : the value unit (str) : the unit of the value returns: scale_factor (float) : scale_factor needed to convert value unit (str) : unit including the prefix """ if unit in SI_UNITS: try: with np.errstate(all="ignore"): prefix_power = np.log10(abs(val))//3 * 3 prefix = SI_PREFIXES[prefix_power] # Greek symbols not supported in tex if plt.rcParams['text.usetex'] and prefix == 'μ': prefix = r'$\mu$' return 10 ** -prefix_power, prefix + unit except (KeyError, TypeError): pass return 1, unit if unit is not None else "" def SI_val_to_msg_str(val: float, unit: str=None, return_type=str): """ Takes in a value with optional unit and returns a string tuple consisting of (value_str, unit) where the value and unit are rescaled according to SI prefixes, IF the unit is an SI unit (according to the comprehensive list of SI units in this file ;). the value_str is of the type specified in return_type (str) by default. """ sc, new_unit = SI_prefix_and_scale_factor(val, unit) try: new_val = sc*val except TypeError: return return_type(val), unit return return_type(new_val), new_unit def format_lmfit_par(par_name: str, lmfit_par, end_char=''): """Format an lmfit par to a string of value with uncertainty.""" val_string = par_name val_string += ': {:.4f}'.format(lmfit_par.value) if lmfit_par.stderr is not None: val_string += r'$\pm$' + '{:.4f}'.format(lmfit_par.stderr) else: val_string += r'$\pm$' + 'NaN' val_string += end_char return val_string def data_to_table_png(data: list, filename: str, title: str='', close_fig: bool=True): """ Takes in a list of list containing the data to be put in a table and saves this as a png. """ # Determine the shape of the table nrows, ncols = np.shape(data) hcell, wcell = 0.3, 2. hpad, wpad = 0.5, 0 fig = plt.figure(figsize=(ncols*wcell+wpad, nrows*hcell+hpad)) ax = fig.add_subplot(111) ax.axis('off') # make the table table = ax.table(cellText=data, loc='center') # rescale to make it more readable table.scale(1, 1.5) ax.set_title(title) fig.tight_layout() plt.savefig(filename, dpi=450) if close_fig: plt.close(fig) def annotate_point_pair(ax, text, xy_start, xy_end, xycoords='data', text_offset=(-10, -5), arrowprops=None, **kw): ''' Annotates two points by connecting them with an arrow. The annotation text is placed near the center of the arrow. Function copied from "http://stackoverflow.com/questions/14612637/ plotting-distance-arrows-in-technical-drawing/32522399#32522399" Modified by Adriaan to allows specifying offset of text in two directions. ''' if arrowprops is None: arrowprops = dict(arrowstyle='<->') assert isinstance(text, str) xy_text = ((xy_start[0] + xy_end[0])/2., (xy_start[1] + xy_end[1])/2.) arrow_vector = xy_end[0]-xy_start[0] + (xy_end[1] - xy_start[1]) * 1j arrow_angle = np.angle(arrow_vector) text_angle = arrow_angle - 0.5*np.pi ax.annotate( '', xy=xy_end, xycoords=xycoords, xytext=xy_start, textcoords=xycoords, arrowprops=arrowprops, **kw) label = ax.annotate( text, xy=xy_text, xycoords=xycoords, xytext=(text_offset[0] * np.cos(text_angle) + text_offset[1] * np.sin(text_angle), text_offset[0] * np.sin(text_angle) + text_offset[1] * np.cos(text_angle)), textcoords='offset points', **kw) return label def get_color_order(i, max_num, cmap='viridis'): # take a blue to red scale from 0 to max_num # uses HSV system, H_red = 0, H_green = 1/3 H_blue=2/3 # return colors.hsv_to_rgb(2.*float(i)/(float(max_num)*3.), 1., 1.) print('It is recommended to use the updated function "get_color_cycle".') if isinstance(cmap, str): cmap = cm.get_cmap(cmap) return cmap((i/max_num) % 1) def get_color_from_cmap(i, max_num): pass def plot_lmfit_res(fit_res, ax, plot_init: bool=False, plot_numpoints: int=1000, plot_kw: dict ={}, plot_init_kw: dict = {}, **kw): """ Plot the result of an lmfit optimization. Args: fit_res: lmfit result object. ax: matplotlib axis object to plot on. plot_init: if True plots the initial guess of the fit. plot_numpoints: number of points to use for interpolating the fit. plot_kw: dictionary of options to pass to the plot of the fit. plot_init_kw dictionary of options to pass to the plot of the initial guess. **kw **kwargs, unused only here to match call signature. Return: axis : Returns matplotlib axis object on which the plot was performed. """ if hasattr(fit_res, 'model'): model = fit_res.model # Testing input if not (isinstance(model, lmfit.model.Model) or isinstance(model, lmfit.model.ModelResult)): raise TypeError( 'The passed item in "fit_res" needs to be' ' a fitting model, but is {}'.format(type(model))) if len(model.independent_vars) == 1: independent_var = model.independent_vars[0] else: raise ValueError('Fit can only be plotted if the model function' ' has one independent variable.') x_arr = fit_res.userkws[independent_var] xvals = np.linspace(np.min(x_arr), np.max(x_arr), plot_numpoints) yvals = model.eval(fit_res.params, **{independent_var: xvals}) if plot_init: yvals_init = model.eval(fit_res.init_params, **{independent_var: xvals}) else: # case for the minimizer fit # testing input fit_xvals = fit_res.userkws if len(fit_xvals.keys()) == 1: independent_var = list(fit_xvals.keys())[0] else: raise ValueError('Fit can only be plotted if the model function' ' has one independent variable.') x_arr = fit_res.userkws[independent_var] xvals = np.linspace(np.min(x_arr), np.max(x_arr), plot_numpoints) fit_fn = fit_res.fit_fn yvals = fit_fn(**fit_res.params, **{independent_var: xvals}) if plot_init: yvals_init = fit_fn(**fit_res.init_params, **{independent_var: xvals}) # acutal plotting ax.plot(xvals, yvals, **plot_kw) if plot_init: ax.plot(xvals, yvals_init, **plot_init_kw) return ax def flex_color_plot_vs_x(xvals, yvals, zvals, ax=None, xwidth=None, normalize=False, log=False, save_name=None, cmap='viridis', clim=[None, None], alpha=1, **kw): """ Display a color figure for something like a tracked DAC sweep. xvals should be a single vector with values for the primary sweep. yvals and zvals should be a list of arrays with the sweep points and measured values. """ # create a figure and set of axes if ax is None: fig = plt.figure(figsize=(12, 7)) ax = fig.add_subplot(111) # calculate coordinates for corners of color blocks # x coordinates if xwidth is None: xvals = np.array(xvals) xvertices = np.zeros(np.array(xvals.shape)+1) dx = abs(np.max(xvals)-np.min(xvals))/len(xvals) xvertices[1:-1] = (xvals[:-1]+xvals[1:])/2. xvertices[0] = xvals[0] - dx/2 xvertices[-1] = xvals[-1] + dx/2 else: xvertices = [] for xval in xvals: xvertices.append(xval+np.array([-0.5, 0.5])*xwidth) # y coordinates yvertices = [] for xx in range(len(xvals)): # Important to sort arguments in case unsorted (e.g., FFT freqs) sorted_yarguments = yvals[xx].argsort() yvals[xx] = yvals[xx][sorted_yarguments] zvals[xx] = zvals[xx][sorted_yarguments] yvertices.append(np.zeros(np.array(yvals[xx].shape)+1)) yvertices[xx][1:-1] = (yvals[xx][:-1]+yvals[xx][1:])/2. yvertices[xx][0] = yvals[xx][0] - (yvals[xx][1]-yvals[xx][0])/2 yvertices[xx][-1] = yvals[xx][-1] + (yvals[xx][-1]-yvals[xx][-2])/2 # normalized plot if normalize: zvals[xx] /= np.mean(zvals[xx]) # logarithmic plot if log: zvals[xx] = np.log(zvals[xx])/np.log(10) # add blocks to plot colormaps = [] for xx in range(len(xvals)): tempzvals = np.array( [np.append(zvals[xx], np.array(0)), np.append(zvals[xx], np.array(0))]).transpose() if xwidth is None: colormaps.append(ax.pcolor(xvertices[xx:xx+2], yvertices[xx], tempzvals, cmap=cmap, vmin=clim[0], vmax=clim[1], alpha=alpha)) else: colormaps.append( ax.pcolor(xvertices[xx], yvertices[xx], tempzvals, cmap=cmap, alpha=alpha)) return {'fig': ax.figure, 'ax': ax, 'cmap': colormaps[0], 'cmaps': colormaps} def flex_colormesh_plot_vs_xy(xvals, yvals, zvals, ax=None, normalize=False, log=False, save_name=None, **kw): """ Add a rectangular block to a color plot using pcolormesh. xvals and yvals should be single vectors with values for the two sweep points. zvals should be a list of arrays with the measured values with shape (len(yvals), len(xvals)). **grid-orientation** The grid orientation for the zvals is the same as is used in ax.pcolormesh. Note that the column index corresponds to the x-coordinate, and the row index corresponds to y. This can be counterintuitive: zvals(y_idx, x_idx) and can be inconsistent with some arrays of zvals (such as a 2D histogram from numpy). """ xvals = np.array(xvals) yvals = np.array(yvals) # First, we need to sort the data as otherwise we get odd plotting # artefacts. An example is e.g., plotting a fourier transform sorted_x_arguments = xvals.argsort() xvals = xvals[sorted_x_arguments] sorted_y_arguments = yvals.argsort() yvals = yvals[sorted_y_arguments] zvals = zvals[:, sorted_x_arguments] zvals = zvals[sorted_y_arguments, :] # create a figure and set of axes if ax is None: fig = plt.figure(figsize=(12, 7)) ax = fig.add_subplot(111) # convert xvals and yvals to single dimension arrays xvals = np.squeeze(np.array(xvals)) yvals = np.squeeze(np.array(yvals)) # calculate coordinates for corners of color blocks # x coordinates xvertices = np.zeros(np.array(xvals.shape)+1) xvertices[1:-1] = (xvals[:-1]+xvals[1:])/2. xvertices[0] = xvals[0] - (xvals[1]-xvals[0])/2 xvertices[-1] = xvals[-1] + (xvals[-1]-xvals[-2])/2 # y coordinates yvertices = np.zeros(np.array(yvals.shape)+1) yvertices[1:-1] = (yvals[:-1]+yvals[1:])/2. yvertices[0] = yvals[0] - (yvals[1]-yvals[0])/2 yvertices[-1] = yvals[-1] + (yvals[-1]-yvals[-2])/2 xgrid, ygrid = np.meshgrid(xvertices, yvertices) # various plot options # define colormap cmap = plt.get_cmap(kw.pop('cmap', 'viridis')) clim = kw.pop('clim', [None, None]) # normalized plot if normalize: zvals /= np.mean(zvals, axis=0) # logarithmic plot if log: for xx in range(len(xvals)): zvals[xx] = np.log(zvals[xx])/np.log(10) # add blocks to plot do_transpose = kw.pop('transpose', False) if do_transpose: colormap = ax.pcolormesh(ygrid.transpose(), xgrid.transpose(), zvals.transpose(), cmap=cmap, vmin=clim[0], vmax=clim[1]) else: colormap = ax.pcolormesh(xgrid, ygrid, zvals, cmap=cmap, vmin=clim[0], vmax=clim[1]) return {'fig': ax.figure, 'ax': ax, 'cmap': colormap} def autolabel_barplot(ax, rects, rotation=90): """ Attach a text label above each bar displaying its height """ for rect in rects: height = rect.get_height() ax.text(rect.get_x() + rect.get_width()/2., 0.5*height, '%.2f' % (height), ha='center', va='bottom', rotation=rotation) def set_axeslabel_color(ax, color): ''' Ad hoc function to set the labels, ticks, ticklabels and title to a color. This is useful when e.g., making a presentation on a dark background ''' ax.tick_params(color=color, which='both') # both major and minor ticks plt.setp(ax.get_xticklabels(), color=color) plt.setp(ax.get_yticklabels(), color=color) plt.setp(ax.yaxis.get_label(), color=color) plt.setp(ax.xaxis.get_label(), color=color) plt.setp(ax.title, color=color) # generate custom colormaps # Inpired from # https://stackoverflow.com/questions/23712207/cyclic-colormap-without-visual-distortions-for-use-in-phase-angle-plots def make_segmented_cmap(): white = '#ffffff' black = '#000000' red = '#ff0000' blue = '#0000ff' anglemap = col.LinearSegmentedColormap.from_list( 'anglemap', [black, red, white, blue, black], N=256, gamma=1) return anglemap def make_anglemap_colorlist(N=256, use_hpl=True): hue = np.ones(N) # hue hue[:N // 2] = 11.6 # red hue[N // 2:] = 258.6 # blue s = 100 # saturation lum = np.linspace(0, 100, N // 2) # luminosity lum = np.hstack((lum, lum[::-1])) colorlist = np.zeros((N, 3)) for ii in range(N): if use_hpl: colorlist[ii, :] = hsluv.hpluv_to_rgb((hue[ii], s, lum[ii])) else: colorlist[ii, :] = hsluv.hsluv_to_rgb((hue[ii], s, lum[ii])) colorlist[colorlist > 1] = 1 # correct numeric errors colorlist[colorlist < 0] = 0 return colorlist def make_anglemap(N=256, use_hpl=True): colorlist = make_anglemap_colorlist(N=N, use_hpl=use_hpl) return col.ListedColormap(colorlist) hsluv_anglemap = make_anglemap(use_hpl=False) def circ_interp(x, y_deg, kind='linear'): phases = np.deg2rad(y_deg) newdata_cos = np.cos(phases) newdata_sin = np.sin(phases) ip_cos = interp1d(x, newdata_cos, kind=kind) ip_sin = interp1d(x, newdata_sin, kind=kind) return lambda interp_at: np.rad2deg(np.arctan2(ip_sin(interp_at), ip_cos(interp_at))) % 360 def make_anglemap45_colorlist(N=256, use_hpl=True): col_space = 'hpluv' if use_hpl else 'hsluv' colspace_to_rgb = getattr(hsluv, col_space + '_to_rgb') rgb_to_colspace = getattr(hsluv, 'rgb_to_' + col_space) black = [0., 0., 0.] blue = [0.34, 0.86, 0.70] violet = [0.34, 0.34, 0.86] magenta = [0.86, 0.34, 0.86] pink = [1.00, 0.90, 0.92] red = [0.86, 0.34, 0.34] yellow = [0.86, 0.86, 0.34] green = [0.34, 0.86, 0.34] rgb_list = [ black, blue, violet, magenta, pink, red, yellow, green, black ] col_pos = np.linspace(0, 1, 9) [hsl_hue, hsl_sat, hsl_lum] = np.array([rgb_to_colspace(np.array(rgb_col)) for rgb_col in rgb_list]).T f_circ_interp = circ_interp(col_pos, hsl_hue) f_hsl_sat = interp1d(col_pos, hsl_sat, kind='linear') f_hsl_lum = interp1d(col_pos, hsl_lum, kind='linear') pnts = np.linspace(0, 1, N) new_col = [ f_circ_interp(pnts), np.clip(f_hsl_sat(pnts), a_min=0, a_max=100), np.clip(f_hsl_lum(pnts), a_min=0, a_max=100) ] new_col = np.array([colspace_to_rgb(np.array(rgb_col)) for rgb_col in np.array(new_col).T]) new_col[new_col < 0] = 0 new_col[new_col > 1] = 1 return new_col def make_anglemap45(N=256, use_hpl=True): colorlist = make_anglemap45_colorlist(N=N, use_hpl=use_hpl) return col.ListedColormap(colorlist) hsluv_anglemap45 = make_anglemap45(use_hpl=False) def plot_fit(xvals, fit_res, ax, **plot_kws): """ Evaluates a fit result at specified values to plot the fit. """ model = fit_res.model independent_var = model.independent_vars[0] yvals = model.eval(fit_res.params, **{independent_var: xvals}) ax.plot(xvals, yvals, **plot_kws) def cmap_to_alpha(cmap): """ Takes a cmap and makes the transparency of the cmap changes with each element. """ my_cmap = cmap(np.arange(cmap.N)) # Set alpha my_cmap[:, -1] = np.linspace(0, 1, cmap.N) # Create new colormap my_cmap = col.ListedColormap(my_cmap) return my_cmap def cmap_first_to_alpha(cmap): """ Makes the first element of a cmap transparant. """ my_cmap = cmap(np.arange(cmap.N)) # Set alpha my_cmap[0, -1] = 0 my_cmap[1:, -1] = 1 # Create new colormap my_cmap = col.ListedColormap(my_cmap) return my_cmap def latexify(fig_width=None, fig_height=None, columns=1): """Set up matplotlib's RC params for LaTeX plotting. Call this before plotting a figure. Parameters ---------- fig_width : float, optional, inches fig_height : float, optional, inches columns : {1, 2} """ # code adapted from http://www.scipy.org/Cookbook/Matplotlib/LaTeX_Examples # Width and max height in inches for IEEE journals taken from # computer.org/cms/Computer.org/Journal%20templates/transactions_art_guide.pdf assert(columns in [1, 2]) if fig_width is None: fig_width = 3.39 if columns == 1 else 6.9 # width in inches if fig_height is None: fig_height = fig_width*golden_mean # height in inches MAX_HEIGHT_INCHES = 8.0 if fig_height > MAX_HEIGHT_INCHES: print("WARNING: fig_height too large:" + fig_height + "so will reduce to" + MAX_HEIGHT_INCHES + "inches.") fig_height = MAX_HEIGHT_INCHES params = {'backend': 'ps', 'text.latex.preamble': [r'\usepackage{gensymb}'], 'axes.labelsize': 8, # fontsize for x and y labels (was 10) 'axes.titlesize': 8, # 'text.fontsize': 8, # was 10 'legend.fontsize': 8, # was 10 'xtick.labelsize': 8, 'ytick.labelsize': 8, 'text.usetex': True, 'figure.figsize': [fig_width, fig_height], 'font.family': 'serif' } matplotlib.rcParams.update(params) def lighten_color(color, amount=0.5): """ Lightens the given color by multiplying (1-luminosity) by the given amount. Input can be matplotlib color string, hex string, or RGB tuple. Examples: >> lighten_color('g', 0.3) >> lighten_color('#F034A3', 0.6) >> lighten_color((.3,.55,.1), 0.5) """ import matplotlib.colors as mc import colorsys try: c = mc.cnames[color] except: c = color c = colorsys.rgb_to_hls(*mc.to_rgb(c)) return colorsys.hls_to_rgb(c[0], 1 - amount * (1 - c[1]), c[2]) def connected_zoombox(ax0, ins_ax, corner_a=(1, 1), corner_b=(2, 2), square_kws={}, line_kws={}): """ Create a rectangle in ax0 corresponding to the ins_ax and connect corners. Parameters ---------- ax0 : matplotlib axis The parent axis on which to draw the square and connecting lines. ins_ax : matplotlib axis The inset axis. The limits of this axis are taken to determine the location of the square. corner_a : tuple of ints Tuple of location codes used to determine what corners to connect. 'upper right' 1 'upper left' 2 'lower left' 3 'lower right' 4 """ x_ins = ins_ax.get_xlim() y_ins = ins_ax.get_ylim() # xy coordinates corresponding to counterclockwise locations. # this order is chosen to be consistent with ax.legend() xy1 = (x_ins[1], y_ins[1]) # upper right xy2 = (x_ins[0], y_ins[1]) # upper left xy3 = (x_ins[0], y_ins[0]) # lower left xy4 = (x_ins[1], y_ins[0]) # lower right xy_corners = [xy1, xy2, xy3, xy4] # ensures we have sensible defaults that can be overwritten def_line_kws = dict( color='grey', arrowstyle='-', zorder=0, lw=1.5, ls=':') def_line_kws.update(line_kws) conA = ConnectionPatch(xy_corners[corner_a[0]-1], xy_corners[corner_a[1]-1], 'data', 'data', axesA=ins_ax, axesB=ax0, **def_line_kws) ins_ax.add_artist(conA) conB = ConnectionPatch(xy_corners[corner_b[0]-1], xy_corners[corner_b[1]-1], 'data', 'data', axesA=ins_ax, axesB=ax0, **def_line_kws) ins_ax.add_artist(conB) def_sq_kws = dict(ec='k', lw=0.5, fill=0, zorder=4) def_sq_kws.update(square_kws) rect = Rectangle((x_ins[0], y_ins[0]), x_ins[1]-x_ins[0], y_ins[1]-y_ins[0], **def_sq_kws) ax0.add_patch(rect) def restore_default_plot_params(): """ Restore the matplotlib rcParams to their default values """ matplotlib.rcParams.update(matplotlib.rcParamsDefault)
mit
pbreach/pysd
tests/test_utils.py
2
2986
""" Utilities for aiding in testing. Not tests of utilities... That could be confusing.""" import pysd import numpy as np import pandas as pd import os.path def runner(model_file): directory = os.path.dirname(model_file) # load model if model_file.endswith('.mdl'): model = pysd.read_vensim(model_file) elif model_file.endswith(".xmile"): model = pysd.read_xmile(model_file) else: raise AttributeError('Modelfile should be *.mdl or *.xmile') # load canonical output try: canon = pd.read_csv(directory + '/output.csv', index_col='Time') except IOError: try: canon = pd.read_table(directory + '/output.tab', index_col='Time') except IOError: raise IOError('Canonical output file not found') # run model output = model.run(return_columns=canon.columns) return output, canon def assert_frames_close(actual, expected, **kwargs): """ Compare DataFrame items by column and raise AssertionError if any column is not equal. Ordering of columns is unimportant, items are compared only by label. NaN and infinite values are supported. Parameters ---------- actual: pandas.DataFrame expected: pandas.DataFrame kwargs: Examples -------- >>> assert_frames_close(pd.DataFrame(100, index=range(5), columns=range(3)), ... pd.DataFrame(100, index=range(5), columns=range(3))) >>> assert_frames_close(pd.DataFrame(100, index=range(5), columns=range(3)), ... pd.DataFrame(110, index=range(5), columns=range(3)), ... rtol=.2) >>> assert_frames_close(pd.DataFrame(100, index=range(5), columns=range(3)), ... pd.DataFrame(150, index=range(5), columns=range(3)), ... rtol=.2) # doctest: +IGNORE_EXCEPTION_DETAIL Traceback (most recent call last): ... AssertionError: ... References ---------- Derived from: http://nbviewer.jupyter.org/gist/jiffyclub/ac2e7506428d5e1d587b """ assert (isinstance(actual, pd.DataFrame) and isinstance(expected, pd.DataFrame)), \ 'Inputs must both be pandas DataFrames.' assert set(expected.columns) == set(actual.columns), \ 'test set columns must be equal to those in actual/observed set.' assert (expected.index.values == actual.index.values).all(), \ 'test set and actual set must share a common index'\ 'instead found' + expected.index.values + 'vs' + actual.index.values for col in expected.columns: try: assert_allclose(expected[col].values, actual[col].values, **kwargs) except AssertionError as e: raise AssertionError('Column: ' + str(col) + ' is not close.') def assert_allclose(x, y, rtol=1.e-5, atol=1.e-5): assert np.all(np.less_equal(abs(x-y), atol + rtol * abs(y)))
mit
eggplantbren/DNest4
code/Templates/Builder/nzunemployment.py
1
2737
import numpy as np import pandas as pd import matplotlib.pyplot as plt # Import DNest4's builder import dnest4.builder as bd # Load the data and make a dictionary out of it nzunemployment = pd.read_csv("nzunemployment.csv") data = {} data["N"] = nzunemployment.shape[0] data["t"] = np.array(nzunemployment["q"]) data["adult"] = np.array(nzunemployment["adult"]) data["youth"] = np.array(nzunemployment["youth"]) # Convert to logits of unemployment rates data["adult"] *= 0.01 data["adult"] = np.log(data["adult"]/(1.0 - data["adult"])) data["youth"] *= 0.01 data["youth"] = np.log(data["youth"]/(1.0 - data["youth"])) # Plot the data plt.plot(data["t"], data["adult"], "ko-", label="Adult") plt.plot(data["t"], data["youth"], "go-", label="Youth") plt.xlabel("Time (quarters)") plt.ylabel("Unemployment rate (logit)") plt.legend() plt.xlim([data["t"].min() - 0.5, data["t"].max() + 0.5]) plt.ylim([-4.0, 0.0]) plt.show() # A model (of the prior information!) model = bd.Model() # AR(1) parameters for adult unemployment rate model.add_node(bd.Node("mu1", bd.Uniform(-10.0, 0.0))) model.add_node(bd.Node("L1", bd.LogUniform(1.0, 1E4))) model.add_node(bd.Node("beta1", bd.LogUniform(1E-3, 1E3))) model.add_node(bd.Node("alpha1", bd.Delta("exp(-1.0/L1)"))) model.add_node(bd.Node("sigma1", bd.Delta("beta1/sqrt(1.0 - alpha1*alpha1)"))) # Sampling distribution for adult data model.add_node(bd.Node("adult0",\ bd.Normal("mu1", "sigma1"), observed=True)) for i in range(1, data["N"]): name = "adult{i}".format(i=i) dist = bd.Normal("mu1 + alpha1*(adult{k} - mu1)".format(k=(i-1)), "beta1") model.add_node(bd.Node(name, dist, observed=True)) # Parameters relating to youth data model.add_node(bd.Node("offset", bd.Normal(0.0, 1.0))) model.add_node(bd.Node("policy_effect", bd.Cauchy(0.0, 0.1))) model.add_node(bd.Node("L2", bd.LogUniform(1E-2, 1E2))) model.add_node(bd.Node("beta2", bd.LogUniform(1E-3, 1E3))) model.add_node(bd.Node("alpha2", bd.Delta("exp(-1.0/L2)"))) model.add_node(bd.Node("sigma2", bd.Delta("beta2/sqrt(1.0 - alpha2*alpha2)"))) for i in range(0, data["N"]): name = "youth{i}".format(i=i) mean = "adult{i} + offset + ((t{i} >= 90.0)?(policy_effect):(0.0))"\ .format(i=i) sd = "sigma2" if i > 0: ar1_mean = "{mean} + alpha2*(youth{k} - ({mean}))".format(mean=mean,\ k=(i-1)) mean = ar1_mean sd = "beta2" dist = bd.Normal(mean, sd) model.add_node(bd.Node(name, dist, observed=True)) # Create the C++ code bd.generate_h(model, data) bd.generate_cpp(model, data) # Compile the C++ code so it's ready to go import os os.system("make")
mit
enclose-io/compiler
current/deps/v8/tools/ignition/bytecode_dispatches_report.py
14
9248
#! /usr/bin/python # # Copyright 2016 the V8 project authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. # # for py2/py3 compatibility from __future__ import print_function import argparse import heapq import json from matplotlib import colors from matplotlib import pyplot import numpy import struct import sys __DESCRIPTION = """ Process v8.ignition_dispatches_counters.json and list top counters, or plot a dispatch heatmap. Please note that those handlers that may not or will never dispatch (e.g. Return or Throw) do not show up in the results. """ __HELP_EPILOGUE = """ examples: # Print the hottest bytecodes in descending order, reading from # default filename v8.ignition_dispatches_counters.json (default mode) $ tools/ignition/bytecode_dispatches_report.py # Print the hottest 15 bytecode dispatch pairs reading from data.json $ tools/ignition/bytecode_dispatches_report.py -t -n 15 data.json # Save heatmap to default filename v8.ignition_dispatches_counters.svg $ tools/ignition/bytecode_dispatches_report.py -p # Save heatmap to filename data.svg $ tools/ignition/bytecode_dispatches_report.py -p -o data.svg # Open the heatmap in an interactive viewer $ tools/ignition/bytecode_dispatches_report.py -p -i # Display the top 5 sources and destinations of dispatches to/from LdaZero $ tools/ignition/bytecode_dispatches_report.py -f LdaZero -n 5 """ __COUNTER_BITS = struct.calcsize("P") * 8 # Size in bits of a pointer __COUNTER_MAX = 2**__COUNTER_BITS - 1 def warn_if_counter_may_have_saturated(dispatches_table): for source, counters_from_source in iteritems(dispatches_table): for destination, counter in iteritems(counters_from_source): if counter == __COUNTER_MAX: print("WARNING: {} -> {} may have saturated.".format(source, destination)) def find_top_bytecode_dispatch_pairs(dispatches_table, top_count): def flattened_counters_generator(): for source, counters_from_source in iteritems(dispatches_table): for destination, counter in iteritems(counters_from_source): yield source, destination, counter return heapq.nlargest(top_count, flattened_counters_generator(), key=lambda x: x[2]) def print_top_bytecode_dispatch_pairs(dispatches_table, top_count): top_bytecode_dispatch_pairs = ( find_top_bytecode_dispatch_pairs(dispatches_table, top_count)) print("Top {} bytecode dispatch pairs:".format(top_count)) for source, destination, counter in top_bytecode_dispatch_pairs: print("{:>12d}\t{} -> {}".format(counter, source, destination)) def find_top_bytecodes(dispatches_table): top_bytecodes = [] for bytecode, counters_from_bytecode in iteritems(dispatches_table): top_bytecodes.append((bytecode, sum(itervalues(counters_from_bytecode)))) top_bytecodes.sort(key=lambda x: x[1], reverse=True) return top_bytecodes def print_top_bytecodes(dispatches_table): top_bytecodes = find_top_bytecodes(dispatches_table) print("Top bytecodes:") for bytecode, counter in top_bytecodes: print("{:>12d}\t{}".format(counter, bytecode)) def find_top_dispatch_sources_and_destinations( dispatches_table, bytecode, top_count, sort_source_relative): sources = [] for source, destinations in iteritems(dispatches_table): total = float(sum(itervalues(destinations))) if bytecode in destinations: count = destinations[bytecode] sources.append((source, count, count / total)) destinations = [] bytecode_destinations = dispatches_table[bytecode] bytecode_total = float(sum(itervalues(bytecode_destinations))) for destination, count in iteritems(bytecode_destinations): destinations.append((destination, count, count / bytecode_total)) return (heapq.nlargest(top_count, sources, key=lambda x: x[2 if sort_source_relative else 1]), heapq.nlargest(top_count, destinations, key=lambda x: x[1])) def print_top_dispatch_sources_and_destinations(dispatches_table, bytecode, top_count, sort_relative): top_sources, top_destinations = find_top_dispatch_sources_and_destinations( dispatches_table, bytecode, top_count, sort_relative) print("Top sources of dispatches to {}:".format(bytecode)) for source_name, counter, ratio in top_sources: print("{:>12d}\t{:>5.1f}%\t{}".format(counter, ratio * 100, source_name)) print("\nTop destinations of dispatches from {}:".format(bytecode)) for destination_name, counter, ratio in top_destinations: print("{:>12d}\t{:>5.1f}%\t{}".format(counter, ratio * 100, destination_name)) def build_counters_matrix(dispatches_table): labels = sorted(dispatches_table.keys()) counters_matrix = numpy.empty([len(labels), len(labels)], dtype=int) for from_index, from_name in enumerate(labels): current_row = dispatches_table[from_name]; for to_index, to_name in enumerate(labels): counters_matrix[from_index, to_index] = current_row.get(to_name, 0) # Reverse y axis for a nicer appearance xlabels = labels ylabels = list(reversed(xlabels)) counters_matrix = numpy.flipud(counters_matrix) return counters_matrix, xlabels, ylabels def plot_dispatches_table(dispatches_table, figure, axis): counters_matrix, xlabels, ylabels = build_counters_matrix(dispatches_table) image = axis.pcolor( counters_matrix, cmap="jet", norm=colors.LogNorm(), edgecolor="grey", linestyle="dotted", linewidth=0.5 ) axis.xaxis.set( ticks=numpy.arange(0.5, len(xlabels)), label="From bytecode handler" ) axis.xaxis.tick_top() axis.set_xlim(0, len(xlabels)) axis.set_xticklabels(xlabels, rotation="vertical") axis.yaxis.set( ticks=numpy.arange(0.5, len(ylabels)), label="To bytecode handler", ticklabels=ylabels ) axis.set_ylim(0, len(ylabels)) figure.colorbar( image, ax=axis, fraction=0.01, pad=0.01 ) def parse_command_line(): command_line_parser = argparse.ArgumentParser( formatter_class=argparse.RawDescriptionHelpFormatter, description=__DESCRIPTION, epilog=__HELP_EPILOGUE ) command_line_parser.add_argument( "--plot-size", "-s", metavar="N", default=30, help="shorter side in inches of the output plot (default 30)" ) command_line_parser.add_argument( "--plot", "-p", action="store_true", help="plot dispatch pairs heatmap" ) command_line_parser.add_argument( "--interactive", "-i", action="store_true", help="open the heatmap in an interactive viewer, instead of writing to file" ) command_line_parser.add_argument( "--top-bytecode-dispatch-pairs", "-t", action="store_true", help="print the top bytecode dispatch pairs" ) command_line_parser.add_argument( "--top-entries-count", "-n", metavar="N", type=int, default=10, help="print N top entries when running with -t or -f (default 10)" ) command_line_parser.add_argument( "--top-dispatches-for-bytecode", "-f", metavar="<bytecode name>", help="print top dispatch sources and destinations to the specified bytecode" ) command_line_parser.add_argument( "--output-filename", "-o", metavar="<output filename>", default="v8.ignition_dispatches_table.svg", help=("file to save the plot file to. File type is deduced from the " "extension. PDF, SVG, PNG supported") ) command_line_parser.add_argument( "--sort-sources-relative", "-r", action="store_true", help=("print top sources in order to how often they dispatch to the " "specified bytecode, only applied when using -f") ) command_line_parser.add_argument( "input_filename", metavar="<input filename>", default="v8.ignition_dispatches_table.json", nargs='?', help="Ignition counters JSON file" ) return command_line_parser.parse_args() def itervalues(d): return d.values() if sys.version_info[0] > 2 else d.itervalues() def iteritems(d): return d.items() if sys.version_info[0] > 2 else d.iteritems() def main(): program_options = parse_command_line() with open(program_options.input_filename) as stream: dispatches_table = json.load(stream) warn_if_counter_may_have_saturated(dispatches_table) if program_options.plot: figure, axis = pyplot.subplots() plot_dispatches_table(dispatches_table, figure, axis) if program_options.interactive: pyplot.show() else: figure.set_size_inches(program_options.plot_size, program_options.plot_size) pyplot.savefig(program_options.output_filename) elif program_options.top_bytecode_dispatch_pairs: print_top_bytecode_dispatch_pairs( dispatches_table, program_options.top_entries_count) elif program_options.top_dispatches_for_bytecode: print_top_dispatch_sources_and_destinations( dispatches_table, program_options.top_dispatches_for_bytecode, program_options.top_entries_count, program_options.sort_sources_relative) else: print_top_bytecodes(dispatches_table) if __name__ == "__main__": main()
mit
griffint/SoftwareSystems
hw04/wave3/generate_sine.py
23
2124
"""This file contains code used in "Think DSP", by Allen B. Downey, available from greenteapress.com Copyright 2013 Allen B. Downey License: GNU GPLv3 http://www.gnu.org/licenses/gpl.html """ import thinkdsp import thinkplot import matplotlib.pyplot as pyplot def print_reverse_tables(): print 'int reverse1[] = {' for i in range(64): s = bin(i)[2:].zfill(6) print '%d,' % int(s[::-1], 2), print '};' print 'int reverse2[] = {' for i in [0, 2, 1, 3]: print '%d,' % (i * 64), print '};' def print_c_wave(wave, name='wave1'): print 'int %s[] = {' % name ys = 0.7 + (4.3) * (wave.ys + 1) / 2 zs = [int(y * 256 / 5) for y in ys] t = [str(z) for z in zs] print ','.join(t) print '};' def make_sine(): framerate = 8000 signal = thinkdsp.SinSignal(440, amp=1.0, offset=0) duration = signal.period wave = signal.make_wave(duration=duration, start=0, framerate=framerate) print 'Number of samples', len(wave.ys) print 'Timestep in ms', 1.0 / framerate * 1000 # plot the segment #wave.plot() #thinkplot.Show( # xlabel='time (s)', # axis=[0, duration, -1.05, 1.05]) print_c_wave(wave) def file_example(start=0.1, duration=0.6): """Demonstrates methods in the thinkdsp module. """ # read the file recording wave = thinkdsp.read_wave('51743__erkanozan__applause.wav') # extract a segment segment = wave.segment(start, duration) # make the spectrum spectrum = segment.make_spectrum() # apply a filter spectrum.low_pass(600) # invert the spectrum filtered = spectrum.make_wave() # prepare the original and filtered segments filtered.normalize() filtered.apodize() segment.apodize() # write the original and filtered segments to a file filename = 'filtered.wav' wfile = thinkdsp.WavFileWriter(filename, segment.framerate) wfile.write(segment) wfile.write(filtered) wfile.close() thinkdsp.play_wave(filename) def main(): make_sine() # file_example() if __name__ == '__main__': main()
gpl-3.0
petosegan/scikit-learn
sklearn/neighbors/tests/test_kde.py
208
5556
import numpy as np from sklearn.utils.testing import (assert_allclose, assert_raises, assert_equal) from sklearn.neighbors import KernelDensity, KDTree, NearestNeighbors from sklearn.neighbors.ball_tree import kernel_norm from sklearn.pipeline import make_pipeline from sklearn.datasets import make_blobs from sklearn.grid_search import GridSearchCV from sklearn.preprocessing import StandardScaler def compute_kernel_slow(Y, X, kernel, h): d = np.sqrt(((Y[:, None, :] - X) ** 2).sum(-1)) norm = kernel_norm(h, X.shape[1], kernel) / X.shape[0] if kernel == 'gaussian': return norm * np.exp(-0.5 * (d * d) / (h * h)).sum(-1) elif kernel == 'tophat': return norm * (d < h).sum(-1) elif kernel == 'epanechnikov': return norm * ((1.0 - (d * d) / (h * h)) * (d < h)).sum(-1) elif kernel == 'exponential': return norm * (np.exp(-d / h)).sum(-1) elif kernel == 'linear': return norm * ((1 - d / h) * (d < h)).sum(-1) elif kernel == 'cosine': return norm * (np.cos(0.5 * np.pi * d / h) * (d < h)).sum(-1) else: raise ValueError('kernel not recognized') def test_kernel_density(n_samples=100, n_features=3): rng = np.random.RandomState(0) X = rng.randn(n_samples, n_features) Y = rng.randn(n_samples, n_features) for kernel in ['gaussian', 'tophat', 'epanechnikov', 'exponential', 'linear', 'cosine']: for bandwidth in [0.01, 0.1, 1]: dens_true = compute_kernel_slow(Y, X, kernel, bandwidth) def check_results(kernel, bandwidth, atol, rtol): kde = KernelDensity(kernel=kernel, bandwidth=bandwidth, atol=atol, rtol=rtol) log_dens = kde.fit(X).score_samples(Y) assert_allclose(np.exp(log_dens), dens_true, atol=atol, rtol=max(1E-7, rtol)) assert_allclose(np.exp(kde.score(Y)), np.prod(dens_true), atol=atol, rtol=max(1E-7, rtol)) for rtol in [0, 1E-5]: for atol in [1E-6, 1E-2]: for breadth_first in (True, False): yield (check_results, kernel, bandwidth, atol, rtol) def test_kernel_density_sampling(n_samples=100, n_features=3): rng = np.random.RandomState(0) X = rng.randn(n_samples, n_features) bandwidth = 0.2 for kernel in ['gaussian', 'tophat']: # draw a tophat sample kde = KernelDensity(bandwidth, kernel=kernel).fit(X) samp = kde.sample(100) assert_equal(X.shape, samp.shape) # check that samples are in the right range nbrs = NearestNeighbors(n_neighbors=1).fit(X) dist, ind = nbrs.kneighbors(X, return_distance=True) if kernel == 'tophat': assert np.all(dist < bandwidth) elif kernel == 'gaussian': # 5 standard deviations is safe for 100 samples, but there's a # very small chance this test could fail. assert np.all(dist < 5 * bandwidth) # check unsupported kernels for kernel in ['epanechnikov', 'exponential', 'linear', 'cosine']: kde = KernelDensity(bandwidth, kernel=kernel).fit(X) assert_raises(NotImplementedError, kde.sample, 100) # non-regression test: used to return a scalar X = rng.randn(4, 1) kde = KernelDensity(kernel="gaussian").fit(X) assert_equal(kde.sample().shape, (1, 1)) def test_kde_algorithm_metric_choice(): # Smoke test for various metrics and algorithms rng = np.random.RandomState(0) X = rng.randn(10, 2) # 2 features required for haversine dist. Y = rng.randn(10, 2) for algorithm in ['auto', 'ball_tree', 'kd_tree']: for metric in ['euclidean', 'minkowski', 'manhattan', 'chebyshev', 'haversine']: if algorithm == 'kd_tree' and metric not in KDTree.valid_metrics: assert_raises(ValueError, KernelDensity, algorithm=algorithm, metric=metric) else: kde = KernelDensity(algorithm=algorithm, metric=metric) kde.fit(X) y_dens = kde.score_samples(Y) assert_equal(y_dens.shape, Y.shape[:1]) def test_kde_score(n_samples=100, n_features=3): pass #FIXME #np.random.seed(0) #X = np.random.random((n_samples, n_features)) #Y = np.random.random((n_samples, n_features)) def test_kde_badargs(): assert_raises(ValueError, KernelDensity, algorithm='blah') assert_raises(ValueError, KernelDensity, bandwidth=0) assert_raises(ValueError, KernelDensity, kernel='blah') assert_raises(ValueError, KernelDensity, metric='blah') assert_raises(ValueError, KernelDensity, algorithm='kd_tree', metric='blah') def test_kde_pipeline_gridsearch(): # test that kde plays nice in pipelines and grid-searches X, _ = make_blobs(cluster_std=.1, random_state=1, centers=[[0, 1], [1, 0], [0, 0]]) pipe1 = make_pipeline(StandardScaler(with_mean=False, with_std=False), KernelDensity(kernel="gaussian")) params = dict(kerneldensity__bandwidth=[0.001, 0.01, 0.1, 1, 10]) search = GridSearchCV(pipe1, param_grid=params, cv=5) search.fit(X) assert_equal(search.best_params_['kerneldensity__bandwidth'], .1)
bsd-3-clause
cbertinato/pandas
pandas/tests/plotting/test_converter.py
1
12404
from datetime import date, datetime import subprocess import sys import numpy as np import pytest import pandas._config.config as cf from pandas.compat.numpy import np_datetime64_compat from pandas import Index, Period, Series, Timestamp, date_range import pandas.util.testing as tm from pandas.plotting import ( deregister_matplotlib_converters, register_matplotlib_converters) from pandas.tseries.offsets import Day, Micro, Milli, Second try: from pandas.plotting._matplotlib import converter except ImportError: # try / except, rather than skip, to avoid internal refactoring # causing an improprer skip pass pytest.importorskip('matplotlib.pyplot') def test_initial_warning(): code = ( "import pandas as pd; import matplotlib.pyplot as plt; " "s = pd.Series(1, pd.date_range('2000', periods=12)); " "fig, ax = plt.subplots(); " "ax.plot(s.index, s.values)" ) call = [sys.executable, '-c', code] out = subprocess.check_output(call, stderr=subprocess.STDOUT).decode() assert 'Using an implicitly' in out def test_timtetonum_accepts_unicode(): assert (converter.time2num("00:01") == converter.time2num("00:01")) class TestRegistration: def test_register_by_default(self): # Run in subprocess to ensure a clean state code = ("'import matplotlib.units; " "import pandas as pd; " "units = dict(matplotlib.units.registry); " "assert pd.Timestamp in units)'") call = [sys.executable, '-c', code] assert subprocess.check_call(call) == 0 def test_warns(self): plt = pytest.importorskip("matplotlib.pyplot") s = Series(range(12), index=date_range('2017', periods=12)) _, ax = plt.subplots() # Set to the "warning" state, in case this isn't the first test run converter._WARN = True with tm.assert_produces_warning(FutureWarning, check_stacklevel=False) as w: ax.plot(s.index, s.values) plt.close() assert len(w) == 1 assert "Using an implicitly registered datetime converter" in str(w[0]) def test_registering_no_warning(self): plt = pytest.importorskip("matplotlib.pyplot") s = Series(range(12), index=date_range('2017', periods=12)) _, ax = plt.subplots() # Set to the "warn" state, in case this isn't the first test run converter._WARN = True register_matplotlib_converters() with tm.assert_produces_warning(None) as w: ax.plot(s.index, s.values) assert len(w) == 0 def test_pandas_plots_register(self): pytest.importorskip("matplotlib.pyplot") s = Series(range(12), index=date_range('2017', periods=12)) # Set to the "warn" state, in case this isn't the first test run converter._WARN = True with tm.assert_produces_warning(None) as w: s.plot() assert len(w) == 0 def test_matplotlib_formatters(self): units = pytest.importorskip("matplotlib.units") assert Timestamp in units.registry ctx = cf.option_context("plotting.matplotlib.register_converters", False) with ctx: assert Timestamp not in units.registry assert Timestamp in units.registry def test_option_no_warning(self): pytest.importorskip("matplotlib.pyplot") ctx = cf.option_context("plotting.matplotlib.register_converters", False) plt = pytest.importorskip("matplotlib.pyplot") s = Series(range(12), index=date_range('2017', periods=12)) _, ax = plt.subplots() converter._WARN = True # Test without registering first, no warning with ctx: with tm.assert_produces_warning(None) as w: ax.plot(s.index, s.values) assert len(w) == 0 # Now test with registering converter._WARN = True register_matplotlib_converters() with ctx: with tm.assert_produces_warning(None) as w: ax.plot(s.index, s.values) assert len(w) == 0 def test_registry_resets(self): units = pytest.importorskip("matplotlib.units") dates = pytest.importorskip("matplotlib.dates") # make a copy, to reset to original = dict(units.registry) try: # get to a known state units.registry.clear() date_converter = dates.DateConverter() units.registry[datetime] = date_converter units.registry[date] = date_converter register_matplotlib_converters() assert units.registry[date] is not date_converter deregister_matplotlib_converters() assert units.registry[date] is date_converter finally: # restore original stater units.registry.clear() for k, v in original.items(): units.registry[k] = v def test_old_import_warns(self): with tm.assert_produces_warning(FutureWarning) as w: from pandas.tseries import converter converter.register() assert len(w) assert ('pandas.plotting.register_matplotlib_converters' in str(w[0].message)) class TestDateTimeConverter: def setup_method(self, method): self.dtc = converter.DatetimeConverter() self.tc = converter.TimeFormatter(None) def test_convert_accepts_unicode(self): r1 = self.dtc.convert("12:22", None, None) r2 = self.dtc.convert("12:22", None, None) assert (r1 == r2), "DatetimeConverter.convert should accept unicode" def test_conversion(self): rs = self.dtc.convert(['2012-1-1'], None, None)[0] xp = datetime(2012, 1, 1).toordinal() assert rs == xp rs = self.dtc.convert('2012-1-1', None, None) assert rs == xp rs = self.dtc.convert(date(2012, 1, 1), None, None) assert rs == xp rs = self.dtc.convert(datetime(2012, 1, 1).toordinal(), None, None) assert rs == xp rs = self.dtc.convert('2012-1-1', None, None) assert rs == xp rs = self.dtc.convert(Timestamp('2012-1-1'), None, None) assert rs == xp # also testing datetime64 dtype (GH8614) rs = self.dtc.convert(np_datetime64_compat('2012-01-01'), None, None) assert rs == xp rs = self.dtc.convert(np_datetime64_compat( '2012-01-01 00:00:00+0000'), None, None) assert rs == xp rs = self.dtc.convert(np.array([ np_datetime64_compat('2012-01-01 00:00:00+0000'), np_datetime64_compat('2012-01-02 00:00:00+0000')]), None, None) assert rs[0] == xp # we have a tz-aware date (constructed to that when we turn to utc it # is the same as our sample) ts = (Timestamp('2012-01-01') .tz_localize('UTC') .tz_convert('US/Eastern') ) rs = self.dtc.convert(ts, None, None) assert rs == xp rs = self.dtc.convert(ts.to_pydatetime(), None, None) assert rs == xp rs = self.dtc.convert(Index([ts - Day(1), ts]), None, None) assert rs[1] == xp rs = self.dtc.convert(Index([ts - Day(1), ts]).to_pydatetime(), None, None) assert rs[1] == xp def test_conversion_float(self): decimals = 9 rs = self.dtc.convert( Timestamp('2012-1-1 01:02:03', tz='UTC'), None, None) xp = converter.dates.date2num(Timestamp('2012-1-1 01:02:03', tz='UTC')) tm.assert_almost_equal(rs, xp, decimals) rs = self.dtc.convert( Timestamp('2012-1-1 09:02:03', tz='Asia/Hong_Kong'), None, None) tm.assert_almost_equal(rs, xp, decimals) rs = self.dtc.convert(datetime(2012, 1, 1, 1, 2, 3), None, None) tm.assert_almost_equal(rs, xp, decimals) def test_conversion_outofbounds_datetime(self): # 2579 values = [date(1677, 1, 1), date(1677, 1, 2)] rs = self.dtc.convert(values, None, None) xp = converter.dates.date2num(values) tm.assert_numpy_array_equal(rs, xp) rs = self.dtc.convert(values[0], None, None) xp = converter.dates.date2num(values[0]) assert rs == xp values = [datetime(1677, 1, 1, 12), datetime(1677, 1, 2, 12)] rs = self.dtc.convert(values, None, None) xp = converter.dates.date2num(values) tm.assert_numpy_array_equal(rs, xp) rs = self.dtc.convert(values[0], None, None) xp = converter.dates.date2num(values[0]) assert rs == xp @pytest.mark.parametrize('time,format_expected', [ (0, '00:00'), # time2num(datetime.time.min) (86399.999999, '23:59:59.999999'), # time2num(datetime.time.max) (90000, '01:00'), (3723, '01:02:03'), (39723.2, '11:02:03.200') ]) def test_time_formatter(self, time, format_expected): # issue 18478 result = self.tc(time) assert result == format_expected def test_dateindex_conversion(self): decimals = 9 for freq in ('B', 'L', 'S'): dateindex = tm.makeDateIndex(k=10, freq=freq) rs = self.dtc.convert(dateindex, None, None) xp = converter.dates.date2num(dateindex._mpl_repr()) tm.assert_almost_equal(rs, xp, decimals) def test_resolution(self): def _assert_less(ts1, ts2): val1 = self.dtc.convert(ts1, None, None) val2 = self.dtc.convert(ts2, None, None) if not val1 < val2: raise AssertionError('{0} is not less than {1}.'.format(val1, val2)) # Matplotlib's time representation using floats cannot distinguish # intervals smaller than ~10 microsecond in the common range of years. ts = Timestamp('2012-1-1') _assert_less(ts, ts + Second()) _assert_less(ts, ts + Milli()) _assert_less(ts, ts + Micro(50)) def test_convert_nested(self): inner = [Timestamp('2017-01-01'), Timestamp('2017-01-02')] data = [inner, inner] result = self.dtc.convert(data, None, None) expected = [self.dtc.convert(x, None, None) for x in data] assert (np.array(result) == expected).all() class TestPeriodConverter: def setup_method(self, method): self.pc = converter.PeriodConverter() class Axis: pass self.axis = Axis() self.axis.freq = 'D' def test_convert_accepts_unicode(self): r1 = self.pc.convert("2012-1-1", None, self.axis) r2 = self.pc.convert("2012-1-1", None, self.axis) assert r1 == r2 def test_conversion(self): rs = self.pc.convert(['2012-1-1'], None, self.axis)[0] xp = Period('2012-1-1').ordinal assert rs == xp rs = self.pc.convert('2012-1-1', None, self.axis) assert rs == xp rs = self.pc.convert([date(2012, 1, 1)], None, self.axis)[0] assert rs == xp rs = self.pc.convert(date(2012, 1, 1), None, self.axis) assert rs == xp rs = self.pc.convert([Timestamp('2012-1-1')], None, self.axis)[0] assert rs == xp rs = self.pc.convert(Timestamp('2012-1-1'), None, self.axis) assert rs == xp rs = self.pc.convert( np_datetime64_compat('2012-01-01'), None, self.axis) assert rs == xp rs = self.pc.convert( np_datetime64_compat('2012-01-01 00:00:00+0000'), None, self.axis) assert rs == xp rs = self.pc.convert(np.array([ np_datetime64_compat('2012-01-01 00:00:00+0000'), np_datetime64_compat('2012-01-02 00:00:00+0000')]), None, self.axis) assert rs[0] == xp def test_integer_passthrough(self): # GH9012 rs = self.pc.convert([0, 1], None, self.axis) xp = [0, 1] assert rs == xp def test_convert_nested(self): data = ['2012-1-1', '2012-1-2'] r1 = self.pc.convert([data, data], None, self.axis) r2 = [self.pc.convert(data, None, self.axis) for _ in range(2)] assert r1 == r2
bsd-3-clause
xzh86/scikit-learn
examples/exercises/plot_cv_diabetes.py
231
2527
""" =============================================== Cross-validation on diabetes Dataset Exercise =============================================== A tutorial exercise which uses cross-validation with linear models. This exercise is used in the :ref:`cv_estimators_tut` part of the :ref:`model_selection_tut` section of the :ref:`stat_learn_tut_index`. """ from __future__ import print_function print(__doc__) import numpy as np import matplotlib.pyplot as plt from sklearn import cross_validation, datasets, linear_model diabetes = datasets.load_diabetes() X = diabetes.data[:150] y = diabetes.target[:150] lasso = linear_model.Lasso() alphas = np.logspace(-4, -.5, 30) scores = list() scores_std = list() for alpha in alphas: lasso.alpha = alpha this_scores = cross_validation.cross_val_score(lasso, X, y, n_jobs=1) scores.append(np.mean(this_scores)) scores_std.append(np.std(this_scores)) plt.figure(figsize=(4, 3)) plt.semilogx(alphas, scores) # plot error lines showing +/- std. errors of the scores plt.semilogx(alphas, np.array(scores) + np.array(scores_std) / np.sqrt(len(X)), 'b--') plt.semilogx(alphas, np.array(scores) - np.array(scores_std) / np.sqrt(len(X)), 'b--') plt.ylabel('CV score') plt.xlabel('alpha') plt.axhline(np.max(scores), linestyle='--', color='.5') ############################################################################## # Bonus: how much can you trust the selection of alpha? # To answer this question we use the LassoCV object that sets its alpha # parameter automatically from the data by internal cross-validation (i.e. it # performs cross-validation on the training data it receives). # We use external cross-validation to see how much the automatically obtained # alphas differ across different cross-validation folds. lasso_cv = linear_model.LassoCV(alphas=alphas) k_fold = cross_validation.KFold(len(X), 3) print("Answer to the bonus question:", "how much can you trust the selection of alpha?") print() print("Alpha parameters maximising the generalization score on different") print("subsets of the data:") for k, (train, test) in enumerate(k_fold): lasso_cv.fit(X[train], y[train]) print("[fold {0}] alpha: {1:.5f}, score: {2:.5f}". format(k, lasso_cv.alpha_, lasso_cv.score(X[test], y[test]))) print() print("Answer: Not very much since we obtained different alphas for different") print("subsets of the data and moreover, the scores for these alphas differ") print("quite substantially.") plt.show()
bsd-3-clause
profxj/old_xastropy
xastropy/xguis/img_widgets.py
5
58283
""" #;+ #; NAME: #; spec_widgets #; Version 1.0 #; #; PURPOSE: #; Module for IMG widgets with QT #; 12-Dec-2014 by JXP #;- #;------------------------------------------------------------------------------ """ from __future__ import print_function, absolute_import, division, unicode_literals # Import libraries import numpy as np import os, sys, imp import matplotlib.pyplot as plt from PyQt4 import QtGui from PyQt4 import QtCore from matplotlib.backends.backend_qt4agg import FigureCanvasQTAgg as FigureCanvas from matplotlib.backends.backend_qt4agg import NavigationToolbar2QT as NavigationToolbar # Matplotlib Figure object from matplotlib.figure import Figure # astropy from astropy.table.table import Table from astropy import constants as const from astropy import units as u # xastropy from xastropy.xutils import xdebug as xdb from xastropy.plotting import utils as xputils from xastropy.xguis import utils as xguiu xa_path = imp.find_module('xastropy')[1] # class ExamineSpecWidget # class PlotLinesWidget class ExamineImgWidget(QtGui.QWidget): ''' Widget to show an image and fiddle about 12-Apr-2015 by JXP ''' import xastropy.xutils as xxu from xastropy import stats as xstats def __init__(self, ispec, parent=None, status=None, llist=None, abs_sys=None, norm=True, second_file=None, zsys=None): ''' img = np.array (2D) ''' super(ExamineImgWidget, self).__init__(parent) # Image spec, spec_fil = read_spec(ispec, second_file=second_file) self.orig_spec = spec # For smoothing self.spec = self.orig_spec # Abs Systems if abs_sys is None: self.abs_sys = [] else: self.abs_sys = abs_sys self.norm = norm self.psdict = {} # Dict for spectra plotting self.adict = {} # Dict for analysis self.init_spec() self.xval = None # Used with velplt # Status Bar? if not status is None: self.statusBar = status # Line List? if llist is None: self.llist = {'Plot': False, 'List': 'None', 'z': 0.} else: self.llist = llist # zsys if not zsys is None: self.llist['z'] = zsys # Create the mpl Figure and FigCanvas objects. # 5x4 inches, 100 dots-per-inch # self.dpi = 150 # 150 self.fig = Figure((8.0, 4.0), dpi=self.dpi) self.canvas = FigureCanvas(self.fig) self.canvas.setParent(self) self.canvas.setFocusPolicy( QtCore.Qt.ClickFocus ) self.canvas.setFocus() self.canvas.mpl_connect('key_press_event', self.on_key) self.canvas.mpl_connect('button_press_event', self.on_click) # Make two plots self.ax = self.fig.add_subplot(1,1,1) self.fig.subplots_adjust(hspace=0.1, wspace=0.1) vbox = QtGui.QVBoxLayout() vbox.addWidget(self.canvas) self.setLayout(vbox) # # Draw on init self.on_draw() # Setup the spectrum plotting info def init_spec(self): #xy min/max xmin = np.min(self.spec.dispersion).value xmax = np.max(self.spec.dispersion).value ymed = np.median(self.spec.flux).value ymin = 0. - 0.1*ymed ymax = ymed * 1.5 # #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() self.psdict['xmnx'] = np.array([xmin,xmax]) self.psdict['ymnx'] = [ymin,ymax] self.psdict['sv_xy'] = [ [xmin,xmax], [ymin,ymax] ] self.psdict['nav'] = navigate(0,0,init=True) # Analysis dict self.adict['flg'] = 0 # Column density flag # Main Driver def on_key(self,event): flg = -1 ## NAVIGATING if event.key in self.psdict['nav']: flg = navigate(self.psdict,event) ## DOUBLETS if event.key in ['C','M','O','8','B']: # Set left wave = set_doublet(self, event) #print('wave = {:g},{:g}'.format(wave[0], wave[1])) self.ax.plot( [wave[0],wave[0]], self.psdict['ymnx'], '--', color='red') self.ax.plot( [wave[1],wave[1]], self.psdict['ymnx'], '--', color='red') flg = 2 # Layer ## SMOOTH if event.key == 'S': self.spec = self.spec.box_smooth(2) flg = 1 if event.key == 'U': self.spec = self.orig_spec flg = 1 ## ANALYSIS: EW, AODM column density if event.key in ['N', 'E', '$']: # If column check for line list #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() if (event.key in ['N','E']) & (self.llist['List'] == 'None'): print('xspec: Choose a Line list first!') try: self.statusBar().showMessage('Choose a Line list first!') except AttributeError: pass self.adict['flg'] = 0 return flg = 1 if self.adict['flg'] == 0: self.adict['wv_1'] = event.xdata # wavelength self.adict['C_1'] = event.ydata # continuum self.adict['flg'] = 1 else: self.adict['wv_2'] = event.xdata # wavelength self.adict['C_2'] = event.ydata # continuum self.adict['flg'] = 2 # Ready to plot + print # Sort em + make arrays #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() iwv = np.array(sorted([self.adict['wv_1'], self.adict['wv_2']])) * self.spec.wcs.unit ic = np.array(sorted([self.adict['C_1'], self.adict['C_2']])) # Calculate the continuum (linear fit) param = np.polyfit(iwv, ic, 1) cfunc = np.poly1d(param) conti = cfunc(self.spec.dispersion) if event.key == '$': # Simple stats pix = self.spec.pix_minmax(iwv)[0] mean = np.mean(self.spec.flux[pix]) median = np.median(self.spec.flux[pix]) stdv = np.std(self.spec.flux[pix]-conti[pix]) S2N = median / stdv mssg = 'Mean={:g}, Median={:g}, S/N={:g}'.format(mean,median,S2N) else: # Find the spectral line (or request it!) rng_wrest = iwv / (self.llist['z']+1) gdl = np.where( (self.llist[self.llist['List']]['wrest']-rng_wrest[0]) * (self.llist[self.llist['List']]['wrest']-rng_wrest[1]) < 0.)[0] if len(gdl) == 1: wrest = self.llist[self.llist['List']]['wrest'][gdl[0]] else: if len(gdl) == 0: # Search through them all gdl = np.arange(len(self.llist[self.llist['List']])) sel_widg = SelectLineWidget(self.llist[self.llist['List']][gdl]) sel_widg.exec_() line = sel_widg.line wrest = float(line.split('::')[1].lstrip()) # Generate the Spectral Line from xastropy.spec.lines_utils import AbsLine aline = AbsLine(wrest) aline.analy['z'] = self.llist['z'] aline.spec = self.spec # AODM if event.key == 'N': # Calculate the velocity limits and load-up aline.analy['VLIM'] = const.c.to('km/s') * ( ( iwv/(1+self.llist['z']) - wrest) / wrest ) # AODM aline.aodm(conti=conti) mssg = 'Using '+ aline.__repr__() mssg = mssg + ' :: logN = {:g} +/- {:g}'.format(aline.attrib['logN'], aline.attrib['sig_logN']) elif event.key == 'E': #EW aline.analy['WVMNX'] = iwv aline.restew(conti=conti) mssg = 'Using '+ aline.__repr__() mssg = mssg + ' :: EW = {:g} +/- {:g}'.format(aline.attrib['EW'].to('mAA'), aline.attrib['sigEW'].to('mAA')) # Display values try: self.statusBar().showMessage(mssg) except AttributeError: pass print(mssg) #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() ## Velocity plot if event.key == 'v': flg = 0 from xastropy.xguis import spec_guis as xsgui z=self.llist['z'] # Check for a match in existing list and use it if so if len(self.abs_sys) > 0: zabs = np.array([abs_sys.zabs for abs_sys in self.abs_sys]) mt = np.where( np.abs(zabs-z) < 1e-4)[0] else: mt = [] if len(mt) == 1: ini_abs_sys = self.abs_sys[mt[0]] outfil = ini_abs_sys.absid_file self.vplt_flg = 0 # Old one print('Using existing ID file {:s}'.format(outfil)) else: ini_abs_sys = None outfil = None self.vplt_flg = 1 # New one # Outfil if outfil is None: i0 = self.spec.filename.rfind('/') i1 = self.spec.filename.rfind('.') if i0 < 0: path = './ID_LINES/' else: path = self.spec.filename[0:i0]+'/ID_LINES/' outfil = path + self.spec.filename[i0+1:i1]+'_z'+'{:.4f}'.format(z)+'_id.fits' xxu.files.ensure_dir(outfil) self.outfil = outfil #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() # Launch gui = xsgui.XVelPltGui(self.spec, z=z, outfil=outfil, llist=self.llist, abs_sys=ini_abs_sys, norm=self.norm, sel_wv=self.xval) gui.exec_() if gui.flg_quit == 0: # Quit without saving (i.e. discarded) self.vplt_flg = 0 else: # Push to Abs_Sys if len(mt) == 1: self.abs_sys[mt[0]] = gui.abs_sys else: self.abs_sys.append(gui.abs_sys) print('Adding new abs system') # Redraw flg=1 # Dummy keys if event.key in ['shift', 'control']: flg = 0 # Draw if flg==1: # Default is not to redraw self.on_draw() elif flg==2: # Layer (no clear) self.on_draw(replot=False) elif flg==-1: # Layer (no clear) try: self.statusBar().showMessage('Not a valid key! {:s}'.format(event.key)) except AttributeError: pass # Click of main mouse button def on_click(self,event): try: print('button={:d}, x={:f}, y={:f}, xdata={:f}, ydata={:f}'.format( event.button, event.x, event.y, event.xdata, event.ydata)) except ValueError: print('Out of bounds') return if event.button == 1: # Draw line self.xval = event.xdata self.ax.plot( [event.xdata,event.xdata], self.psdict['ymnx'], ':', color='green') self.on_draw(replot=False) # Print values try: self.statusBar().showMessage('x,y = {:f}, {:f}'.format(event.xdata,event.ydata)) except AttributeError: return # ###### def on_draw(self, replot=True): """ Redraws the spectrum """ # if replot is True: self.ax.clear() self.ax.plot(self.spec.dispersion, self.spec.flux, 'k-',drawstyle='steps-mid') self.ax.plot(self.spec.dispersion, self.spec.sig, 'r:') #self.ax.plot(self.spec.dispersion, self.spec.flux, 'k-',drawstyle='steps-mid') #self.ax.plot(self.spec.dispersion, self.spec.sig, 'r:') self.ax.set_xlabel('Wavelength') self.ax.set_ylabel('Flux') # Spectral lines? if self.llist['Plot'] is True: ylbl = self.psdict['ymnx'][1]-0.2*(self.psdict['ymnx'][1]-self.psdict['ymnx'][0]) z = self.llist['z'] wvobs = np.array((1+z) * self.llist[self.llist['List']]['wrest']) gdwv = np.where( (wvobs > self.psdict['xmnx'][0]) & (wvobs < self.psdict['xmnx'][1]))[0] for kk in range(len(gdwv)): jj = gdwv[kk] wrest = self.llist[self.llist['List']]['wrest'][jj] lbl = self.llist[self.llist['List']]['name'][jj] # Plot self.ax.plot(wrest*np.array([z+1,z+1]), self.psdict['ymnx'], 'b--') # Label self.ax.text(wrest*(z+1), ylbl, lbl, color='blue', rotation=90., size='small') # Abs Sys? if not self.abs_sys is None: ylbl = self.psdict['ymnx'][0]+0.2*(self.psdict['ymnx'][1]-self.psdict['ymnx'][0]) clrs = ['red', 'green', 'cyan', 'orange', 'gray', 'purple']*10 for abs_sys in self.abs_sys: ii = self.abs_sys.index(abs_sys) wrest = np.array(abs_sys.lines.keys()) wvobs = wrest * (abs_sys.zabs+1) gdwv = np.where( ((wvobs+5) > self.psdict['xmnx'][0]) & # Buffer for region ((wvobs-5) < self.psdict['xmnx'][1]))[0] for kk in range(len(gdwv)): jj = gdwv[kk] if abs_sys.lines[wrest[jj]].analy['FLG_ANLY'] == 0: continue #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() # Paint spectrum red wvlim = wvobs[jj]*(1 + abs_sys.lines[wrest[jj]].analy['VLIM']/3e5) pix = np.where( (self.spec.dispersion > wvlim[0]) & (self.spec.dispersion < wvlim[1]))[0] self.ax.plot(self.spec.dispersion[pix], self.spec.flux[pix], '-',drawstyle='steps-mid', color=clrs[ii]) # Label lbl = abs_sys.lines[wrest[jj]].analy['IONNM']+' z={:g}'.format(abs_sys.zabs) self.ax.text(wvobs[jj], ylbl, lbl, color=clrs[ii], rotation=90., size='x-small') # Analysis? EW, Column if self.adict['flg'] == 1: self.ax.plot(self.adict['wv_1'], self.adict['C_1'], 'go') elif self.adict['flg'] == 2: self.ax.plot([self.adict['wv_1'], self.adict['wv_2']], [self.adict['C_1'], self.adict['C_2']], 'g--', marker='o') self.adict['flg'] = 0 # Reset window limits self.ax.set_xlim(self.psdict['xmnx']) self.ax.set_ylim(self.psdict['ymnx']) # Draw self.canvas.draw() # Notes on usage def help_notes(): doublets = [ 'Doublets --------', 'C: CIV', 'M: MgII', 'O: OVI', '8: NeVIII', 'B: Lyb/Lya' ] analysis = [ 'Analysis --------', 'N/N: Column density (AODM)', 'E/E: EW (boxcar)', '$/$: stats on spectrum' ] # ##### class PlotLinesWidget(QtGui.QWidget): ''' Widget to set up spectral lines for plotting 13-Dec-2014 by JXP ''' def __init__(self, parent=None, status=None, init_llist=None, init_z=None): ''' ''' super(PlotLinesWidget, self).__init__(parent) # Initialize if not status is None: self.statusBar = status if init_z is None: init_z = 0. # Create a dialog window for redshift z_label = QtGui.QLabel('z=') self.zbox = QtGui.QLineEdit() self.zbox.z_frmt = '{:.7f}' self.zbox.setText(self.zbox.z_frmt.format(init_z)) self.zbox.setMinimumWidth(50) self.connect(self.zbox, QtCore.SIGNAL('editingFinished ()'), self.setz) # Create the line list self.lists = ['None', 'grb.lst', 'dla.lst', 'lls.lst', 'lyman.lst', 'gal_vac.lst', 'ne8.lst', 'lowz_ovi.lst', 'casbah.lst'] list_label = QtGui.QLabel('Line Lists:') self.llist_widget = QtGui.QListWidget(self) for ilist in self.lists: self.llist_widget.addItem(ilist) self.llist_widget.setCurrentRow(0) self.llist_widget.currentItemChanged.connect(self.on_list_change) self.llist_widget.setMaximumHeight(100) # Input line list? if init_llist is None: self.llist = {} # Dict for the line lists self.llist['Plot'] = False self.llist['z'] = 0. self.llist['List'] = 'None' else: # Fill it all up and select self.llist = init_llist if not init_llist['List'] in self.lists: self.lists.append(init_llist['List']) self.llist_widget.addItem(init_llist['List']) self.llist_widget.setCurrentRow(len(self.lists)-1) else: idx = self.lists.index(init_llist['List']) self.llist_widget.setCurrentRow(idx) try: self.zbox.setText(self.zbox.z_frmt.format(init_llist['z'])) except KeyError: pass # Layout vbox = QtGui.QVBoxLayout() vbox.addWidget(z_label) vbox.addWidget(self.zbox) vbox.addWidget(list_label) vbox.addWidget(self.llist_widget) self.setLayout(vbox) self.setMaximumHeight(200) def on_list_change(self,curr,prev): llist = str(curr.text()) # Print try: self.statusBar().showMessage('You chose: {:s}'.format(llist)) except AttributeError: print('You chose: {:s}'.format(curr.text())) #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() self.llist = set_llist(llist,in_dict=self.llist) # Try to draw if self.llist['Plot'] is True: try: self.spec_widg.on_draw() except AttributeError: return def setz(self): sstr = unicode(self.zbox.text()) try: self.llist['z'] = float(sstr) except ValueError: try: self.statusBar().showMessage('ERROR: z Input must be a float! Try again..') except AttributeError: print('ERROR: z Input must be a float! Try again..') self.zbox.setText(self.zbox.z_frmt.format(self.llist['z'])) return # Report try: self.statusBar().showMessage('z = {:g}'.format(self.llist['z'])) except AttributeError: print('z = {:g}'.format(self.llist['z'])) # Try to draw try: self.spec_widg.on_draw() except AttributeError: return # ##### class SelectLineWidget(QtGui.QDialog): ''' Widget to select a spectral line inp: string or dict or Table Input line list 15-Dec-2014 by JXP ''' def __init__(self, inp, parent=None): ''' ''' super(SelectLineWidget, self).__init__(parent) # Line list Table if isinstance(inp,Table): lines = inp else: raise ValueError('SelectLineWidget: Wrong type of input') self.resize(250, 800) # Create the line list line_label = QtGui.QLabel('Lines:') self.lines_widget = QtGui.QListWidget(self) self.lines_widget.addItem('None') self.lines_widget.setCurrentRow(0) #xdb.set_trace() # Loop on lines (could put a preferred list first) nlin = len(lines['wrest']) for ii in range(nlin): self.lines_widget.addItem('{:s} :: {:.4f}'.format(lines['name'][ii], lines['wrest'][ii])) self.lines_widget.currentItemChanged.connect(self.on_list_change) #self.scrollArea = QtGui.QScrollArea() # Quit qbtn = QtGui.QPushButton('Quit', self) qbtn.clicked.connect(self.close) # Layout vbox = QtGui.QVBoxLayout() vbox.addWidget(line_label) vbox.addWidget(self.lines_widget) vbox.addWidget(qbtn) self.setLayout(vbox) def on_list_change(self,curr,prev): self.line = str(curr.text()) # Print print('You chose: {:s}'.format(curr.text())) # ##### class SelectedLinesWidget(QtGui.QWidget): ''' Widget to show and enable lines to be selected inp: Table or (future: string or dict) Input line list 24-Dec-2014 by JXP ''' def __init__(self, inp, parent=None, init_select=None, plot_widget=None): ''' ''' super(SelectedLinesWidget, self).__init__(parent) # Line list Table if isinstance(inp,Table): self.lines = inp else: raise ValueError('SelectLineWidget: Wrong type of input') self.plot_widget = plot_widget # Create the line list line_label = QtGui.QLabel('Lines:') self.lines_widget = QtGui.QListWidget(self) self.lines_widget.setSelectionMode(QtGui.QAbstractItemView.MultiSelection) # Initialize list self.item_flg = 0 self.init_list() # Initial selection if init_select is None: self.selected = [0] else: self.selected = init_select for iselect in self.selected: self.lines_widget.item(iselect).setSelected(True) self.lines_widget.scrollToItem( self.lines_widget.item( self.selected[0] ) ) # Events #self.lines_widget.itemClicked.connect(self.on_list_change) self.lines_widget.itemSelectionChanged.connect(self.on_item_change) # Layout vbox = QtGui.QVBoxLayout() vbox.addWidget(line_label) vbox.addWidget(self.lines_widget) self.setLayout(vbox) def init_list(self): nlin = len(self.lines['wrest']) for ii in range(nlin): self.lines_widget.addItem('{:s} :: {:.3f}'.format(self.lines['name'][ii], self.lines['wrest'][ii])) def on_item_change(self): #,item): # For big changes if self.item_flg == 1: return all_items = [self.lines_widget.item(ii) for ii in range(self.lines_widget.count())] sel_items = self.lines_widget.selectedItems() self.selected = [all_items.index(isel) for isel in sel_items] self.selected.sort() #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() # Update llist try: self.plot_widget.llist['show_line'] = self.selected except AttributeError: return else: self.plot_widget.on_draw() def on_list_change(self,lines): # Clear self.item_flg = 1 self.lines_widget.clear() # Initialize self.lines = lines self.init_list() #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() # Set selected for iselect in self.selected: self.lines_widget.item(iselect).setSelected(True) self.lines_widget.scrollToItem( self.lines_widget.item( self.selected[0] ) ) self.item_flg = 0 # ##### class AbsSysWidget(QtGui.QWidget): ''' Widget to organize AbsSys along a given sightline Parameters: ----------- abssys_list: List String list of abssys files 16-Dec-2014 by JXP ''' def __init__(self, abssys_list, parent=None): ''' ''' super(AbsSysWidget, self).__init__(parent) #if not status is None: # self.statusBar = status self.abssys_list = abssys_list # Create the line list list_label = QtGui.QLabel('Abs Systems:') self.abslist_widget = QtGui.QListWidget(self) self.abslist_widget.setSelectionMode(QtGui.QAbstractItemView.ExtendedSelection) self.abslist_widget.addItem('None') #self.abslist_widget.addItem('Test') # Lists self.abs_sys = [] self.items = [] self.all_items = [] self.all_abssys = [] for abssys_fil in self.abssys_list: self.all_abssys.append(LLS_System.from_absid_fil(abssys_fil)) self.add_item(abssys_fil) self.abslist_widget.setCurrentRow(0) self.abslist_widget.itemSelectionChanged.connect(self.on_list_change) # Layout vbox = QtGui.QVBoxLayout() vbox.addWidget(list_label) # Buttons buttons = QtGui.QWidget() self.refine_button = QtGui.QPushButton('Refine', self) #self.refine_button.clicked.connect(self.refine) # CONNECTS TO A PARENT reload_btn = QtGui.QPushButton('Reload', self) reload_btn.clicked.connect(self.reload) hbox1 = QtGui.QHBoxLayout() hbox1.addWidget(self.refine_button) hbox1.addWidget(reload_btn) buttons.setLayout(hbox1) vbox.addWidget(buttons) vbox.addWidget(self.abslist_widget) self.setLayout(vbox) # ## def on_list_change(self): items = self.abslist_widget.selectedItems() # Empty the list #self.abs_sys = [] if len(self.abs_sys) > 0: for ii in range(len(self.abs_sys)-1,-1,-1): self.abs_sys.pop(ii) # Load up abs_sys (as need be) new_items = [] for item in items: txt = item.text() # Dummy if txt == 'None': continue print('Including {:s} in the list'.format(txt)) # Using LLS for now. Might change to generic new_items.append(txt) ii = self.all_items.index(txt) self.abs_sys.append(self.all_abssys[ii]) # Pass back self.items = new_items #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() def add_fil(self,abssys_fil): self.abssys_list.append( abssys_fil ) self.add_item(abssys_fil) def add_item(self,abssys_fil): ipos0 = abssys_fil.rfind('/') + 1 ipos1 = abssys_fil.rfind('.fits') self.all_items.append( abssys_fil[ipos0:ipos1] ) self.abslist_widget.addItem(abssys_fil[ipos0:ipos1] ) def reload(self): print('AbsSysWidget: Reloading systems..') self.all_abssys = [] for abssys_fil in self.abssys_list: self.all_abssys.append(LLS_System.from_absid_fil(abssys_fil)) #self.add_item(abssys_fil) self.on_list_change() # ###################### class VelPlotWidget(QtGui.QWidget): ''' Widget for a velocity plot with interaction. 19-Dec-2014 by JXP ''' def __init__(self, ispec, z=None, parent=None, llist=None, norm=True, vmnx=[-300., 300.], abs_sys=None): ''' spec = Spectrum1D Norm: Bool (False) Normalized spectrum? abs_sys: AbsSystem Absorption system class ''' #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() super(VelPlotWidget, self).__init__(parent) # Initialize spec, spec_fil = read_spec(ispec) self.spec = spec self.spec_fil = spec_fil self.z = z self.vmnx = vmnx self.norm = norm # Abs_System self.abs_sys = abs_sys if self.abs_sys is None: self.abs_sys = xiaa.Generic_System(None) self.abs_sys.zabs = self.z else: self.z = self.abs_sys.zabs # Line list if llist is None: try: lwrest = self.abs_sys.lines.keys() except AttributeError: lwrest = None if not lwrest is None: llist = set_llist(lwrest) self.psdict = {} # Dict for spectra plotting self.psdict['xmnx'] = self.vmnx self.psdict['ymnx'] = [-0.1, 1.1] self.psdict['nav'] = navigate(0,0,init=True) # Status Bar? #if not status is None: # self.statusBar = status # Line List if llist is None: self.llist = set_llist('lls.lst') else: self.llist = llist self.llist['z'] = self.z # Indexing for line plotting self.idx_line = 0 self.init_lines() # Create the mpl Figure and FigCanvas objects. # self.dpi = 150 self.fig = Figure((8.0, 4.0), dpi=self.dpi) self.canvas = FigureCanvas(self.fig) self.canvas.setParent(self) self.canvas.setFocusPolicy( QtCore.Qt.ClickFocus ) self.canvas.setFocus() self.canvas.mpl_connect('key_press_event', self.on_key) self.canvas.mpl_connect('button_press_event', self.on_click) # Sub_plots self.sub_xy = [3,4] self.fig.subplots_adjust(hspace=0.0, wspace=0.1) vbox = QtGui.QVBoxLayout() vbox.addWidget(self.canvas) self.setLayout(vbox) # Draw on init self.on_draw() # Load them up for display def init_lines(self): wvmin = np.min(self.spec.dispersion) wvmax = np.max(self.spec.dispersion) # wrest = u.Quantity(self.llist[self.llist['List']]['wrest']) wvobs = (1+self.z) * wrest gdlin = np.where( (wvobs > wvmin) & (wvobs < wvmax) )[0] self.llist['show_line'] = gdlin existing_lines = self.abs_sys.lines.keys() # Update/generate lines for idx in gdlin: # Generate? kwrest = wrest[idx].value if not kwrest in existing_lines: self.abs_sys.lines[kwrest] = xspec.analysis.Spectral_Line(kwrest) print('VelPlot: Generating line {:g}'.format(kwrest)) self.abs_sys.lines[kwrest].analy['VLIM'] = np.array([self.vmnx[0]/2., self.vmnx[1]/2.]) self.abs_sys.lines[kwrest].analy['FLG_ANLY'] = 2 # Init to ok # Spec file if not self.spec_fil is None: self.abs_sys.lines[kwrest].analy['DATFIL'] = self.spec_fil # Key stroke def on_key(self,event): # Init rescale = True fig_clear = False wrest = None flg = 0 sv_idx = self.idx_line ## Change rows/columns if event.key == 'k': self.sub_xy[0] = max(0, self.sub_xy[0]-1) if event.key == 'K': self.sub_xy[0] = self.sub_xy[0]+1 if event.key == 'c': self.sub_xy[1] = max(0, self.sub_xy[1]-1) if event.key == 'C': self.sub_xy[1] = max(0, self.sub_xy[1]+1) ## NAVIGATING if event.key in self.psdict['nav']: flg = navigate(self.psdict,event) if event.key == '-': self.idx_line = max(0, self.idx_line-self.sub_xy[0]*self.sub_xy[1]) # Min=0 if self.idx_line == sv_idx: print('Edge of list') if event.key == '=': self.idx_line = min(len(self.llist['show_line'])-self.sub_xy[0]*self.sub_xy[1], self.idx_line + self.sub_xy[0]*self.sub_xy[1]) if self.idx_line == sv_idx: print('Edge of list') ## Reset z if event.key == 'z': from astropy.relativity import velocities newz = velocities.z_from_v(self.z, event.xdata) self.z = newz self.abs_sys.zabs = newz # Drawing self.psdict['xmnx'] = self.vmnx # Single line command if event.key in ['1','2','B','U','L','N','V','A', 'x', 'X']: try: wrest = event.inaxes.get_gid() except AttributeError: return else: kwrest = wrest.value ## Velocity limits if event.key == '1': self.abs_sys.lines[kwrest].analy['VLIM'][0] = event.xdata if event.key == '2': self.abs_sys.lines[kwrest].analy['VLIM'][1] = event.xdata if event.key == '!': for key in self.abs_sys.lines.keys(): try: self.abs_sys.lines[key].analy['VLIM'][0] = event.xdata except KeyError: print('Not setting VLIM for {:g}'.format(key)) if event.key == '@': for key in self.abs_sys.lines.keys(): try: self.abs_sys.lines[key].analy['VLIM'][1] = event.xdata except KeyError: print('Not setting VLIM for {:g}'.format(key)) ## Line type if event.key == 'A': # Add to lines if not kwrest in self.abs_sys.lines.keys(): self.abs_sys.lines[kwrest] = xspec.analysis.Spectral_Line(wrest) print('VelPlot: Generating line {:g}'.format(kwrest)) self.abs_sys.lines[kwrest].analy['VLIM'] = np.array([self.vmnx[0]/2., self.vmnx[1]/2.]) self.abs_sys.lines[kwrest].analy['FLG_ANLY'] = 2 # Init to ok self.abs_sys.lines[kwrest].analy['DATFIL'] = self.spec_fil if event.key == 'x': # Remove line if kwrest in self.abs_sys.lines.keys(): self.abs_sys.lines.pop(kwrest) print('VelPlot: Removed line {:g}'.format(wrest)) if event.key == 'X': # Remove all lines (might add warning widget) # Double check gui = xguiu.WarningWidg('About to remove all lines. \n Continue??') gui.exec_() if gui.ans is False: return # for kwrest in self.abs_sys.lines.keys(): self.abs_sys.lines.pop(wrest) print('VelPlot: Removed line {:g}'.format(wrest)) if event.key == 'B': # Toggle blend try: feye = self.abs_sys.lines[kwrest].analy['FLG_EYE'] except KeyError: feye = 0 feye = (feye + 1) % 2 self.abs_sys.lines[kwrest].analy['FLG_EYE'] = feye if event.key == 'N': # Toggle NG try: fanly = self.abs_sys.lines[kwrest].analy['FLG_ANLY'] except KeyError: fanly = 2 if fanly == 0: fanly = 2 # Not using 1 anymore.. else: fanly = 0 self.abs_sys.lines[kwrest].analy['FLG_ANLY'] = fanly if event.key == 'V': # Normal self.abs_sys.lines[kwrest].analy['FLG_LIMIT'] = 1 if event.key == 'L': # Lower limit self.abs_sys.lines[kwrest].analy['FLG_LIMIT'] = 2 if event.key == 'U': # Upper limit self.abs_sys.lines[kwrest].analy['FLG_LIMIT'] = 3 # AODM plot if event.key == ':': # # Grab good lines from xastropy.xguis import spec_guis as xsgui gdl = [] for iwr in self.abs_sys.lines.keys(): if self.abs_sys.lines[iwr].analy['FLG_ANLY'] > 0: gdl.append(iwr) # Launch AODM gui = xsgui.XAODMGui(self.spec, self.z, gdl, vmnx=self.vmnx, norm=self.norm) gui.exec_() #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() if not wrest is None: # Single window flg = 3 if event.key in ['c','C','k','K','W','!', '@', '=', '-', 'X', 'z','R']: # Redraw all flg = 1 if event.key in ['Y']: rescale = False if event.key in ['k','c','C','K', 'R']: fig_clear = True if flg==1: # Default is not to redraw self.on_draw(rescale=rescale, fig_clear=fig_clear) elif flg==2: # Layer (no clear) self.on_draw(replot=False, rescale=rescale) elif flg==3: # Layer (no clear) self.on_draw(in_wrest=wrest, rescale=rescale) # Click of main mouse button def on_click(self,event): try: print('button={:d}, x={:f}, y={:f}, xdata={:f}, ydata={:f}'.format( event.button, event.x, event.y, event.xdata, event.ydata)) except ValueError: return if event.button == 1: # Draw line self.ax.plot( [event.xdata,event.xdata], self.psdict['ymnx'], ':', color='green') self.on_draw(replot=False) # Print values try: self.statusBar().showMessage('x,y = {:f}, {:f}'.format(event.xdata,event.ydata)) except AttributeError: return def on_draw(self, replot=True, in_wrest=None, rescale=True, fig_clear=False): """ Redraws the figure """ # if replot is True: if fig_clear: self.fig.clf() # Loop on windows all_idx = self.llist['show_line'] nplt = self.sub_xy[0]*self.sub_xy[1] if len(all_idx) <= nplt: self.idx_line = 0 subp = np.arange(nplt) + 1 subp_idx = np.hstack(subp.reshape(self.sub_xy[0],self.sub_xy[1]).T) for jj in range(min(nplt, len(all_idx))): try: idx = all_idx[jj+self.idx_line] except IndexError: continue # Likely too few lines # Grab line #wvobs = np.array((1+self.z) * self.llist[self.llist['List']]['wrest'][idx]) wrest = (self.llist[self.llist['List']]['wrest'][idx] * self.llist[self.llist['List']]['wrest'].unit) kwrest = wrest.value # For the Dict #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() # Single window? if not in_wrest is None: if np.abs(wrest-in_wrest) > (1e-3*u.AA): continue # Generate plot self.ax = self.fig.add_subplot(self.sub_xy[0],self.sub_xy[1], subp_idx[jj]) self.ax.clear() #print('Plotting {:g}, {:d}'.format(wrest,subp_idx[jj])) # Zero line self.ax.plot( [0., 0.], [-1e9, 1e9], ':', color='gray') # Velocity wvobs = (1+self.z) * wrest velo = (self.spec.dispersion/wvobs - 1.)*const.c.to('km/s').value # Plot self.ax.plot(velo, self.spec.flux, 'k-',drawstyle='steps-mid') # GID for referencing self.ax.set_gid(wrest) # Labels #if jj >= (self.sub_xy[0]-1)*(self.sub_xy[1]): if ((jj+1) % self.sub_xy[0]) == 0: self.ax.set_xlabel('Relative Velocity (km/s)') else: self.ax.get_xaxis().set_ticks([]) #if ((jj+1) // 2 == 0) & (jj < self.sub_xy[0]): # self.ax.set_ylabel('Relative Flux') #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() lbl = self.llist[self.llist['List']]['name'][idx] self.ax.text(0.1, 0.05, lbl, color='blue', transform=self.ax.transAxes, size='x-small', ha='left') # Reset window limits self.ax.set_xlim(self.psdict['xmnx']) # Rescale? if (rescale is True) & (self.norm is False): gdp = np.where( (velo > self.psdict['xmnx'][0]) & (velo < self.psdict['xmnx'][1]))[0] if len(gdp) > 5: per = xstats.basic.perc(self.spec.flux[gdp]) self.ax.set_ylim((0., 1.1*per[1])) else: self.ax.set_ylim(self.psdict['ymnx']) else: self.ax.set_ylim(self.psdict['ymnx']) # Fonts xputils.set_fontsize(self.ax,6.) # Abs_Sys: Color the lines if not self.abs_sys is None: #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() try: vlim = self.abs_sys.lines[kwrest].analy['VLIM'] except KeyError: continue # Color coding clr = 'black' try: # .clm style flag = self.abs_sys.lines[kwrest].analy['FLAGS'][0] except KeyError: flag = None else: if flag <= 1: # Standard detection clr = 'green' elif flag in [2,3]: clr = 'blue' elif flag in [4,5]: clr = 'purple' # ABS ID try: # NG? flagA = self.abs_sys.lines[kwrest].analy['FLG_ANLY'] except KeyError: flagA = None else: if (flagA>0) & (clr == 'black'): clr = 'green' try: # Limit? flagL = self.abs_sys.lines[kwrest].analy['FLG_LIMIT'] except KeyError: flagL = None else: if flagL == 2: clr = 'blue' if flagL == 3: clr = 'purple' try: # Blends? flagE = self.abs_sys.lines[kwrest].analy['FLG_EYE'] except KeyError: flagE = None else: if flagE == 1: clr = 'orange' if flagA == 0: clr = 'red' pix = np.where( (velo > vlim[0]) & (velo < vlim[1]))[0] self.ax.plot(velo[pix], self.spec.flux[pix], '-', drawstyle='steps-mid', color=clr) # Draw self.canvas.draw() # ###################### class AODMWidget(QtGui.QWidget): ''' Widget for comparing tau_AODM profiles 19-Dec-2014 by JXP ''' def __init__(self, spec, z, wrest, parent=None, vmnx=[-300., 300.], norm=True): ''' spec = Spectrum1D ''' super(AODMWidget, self).__init__(parent) # Initialize self.spec = spec self.norm = norm self.z = z self.vmnx = vmnx self.wrest = wrest self.lines = [] for iwrest in self.wrest: self.lines.append(xspec.analysis.Spectral_Line(iwrest)) self.psdict = {} # Dict for spectra plotting self.psdict['xmnx'] = self.vmnx self.psdict['ymnx'] = [-0.1, 1.1] self.psdict['nav'] = navigate(0,0,init=True) # Create the mpl Figure and FigCanvas objects. # self.dpi = 150 self.fig = Figure((8.0, 4.0), dpi=self.dpi) self.canvas = FigureCanvas(self.fig) self.canvas.setParent(self) self.canvas.setFocusPolicy( QtCore.Qt.ClickFocus ) self.canvas.setFocus() self.canvas.mpl_connect('key_press_event', self.on_key) self.canvas.mpl_connect('button_press_event', self.on_click) vbox = QtGui.QVBoxLayout() vbox.addWidget(self.canvas) self.setLayout(vbox) # Draw on init self.on_draw() # Key stroke def on_key(self,event): # Init rescale = True flg = 0 ## NAVIGATING if event.key in self.psdict['nav']: flg = navigate(self.psdict,event) if event.key in ['b','t','W','Z','Y','l','r']: rescale = False self.on_draw(rescale=rescale) # Click of main mouse button def on_click(self,event): return # DO NOTHING FOR NOW try: print('button={:d}, x={:f}, y={:f}, xdata={:f}, ydata={:f}'.format( event.button, event.x, event.y, event.xdata, event.ydata)) except ValueError: return if event.button == 1: # Draw line self.ax.plot( [event.xdata,event.xdata], self.psdict['ymnx'], ':', color='green') self.on_draw() # Print values try: self.statusBar().showMessage('x,y = {:f}, {:f}'.format(event.xdata,event.ydata)) except AttributeError: return def on_draw(self, rescale=True): """ Redraws the figure """ # self.ax = self.fig.add_subplot(1,1,1) self.ax.clear() ymx = 0. for ii,iwrest in enumerate(self.wrest): # Velocity wvobs = (1+self.z) * iwrest velo = (self.spec.dispersion/wvobs - 1.)*const.c.to('km/s').value gdp = np.where((velo > self.psdict['xmnx'][0]) & (velo < self.psdict['xmnx'][1]))[0] # Normalize? if self.norm is False: per = xstats.basic.perc(self.spec.flux[gdp]) fsplice = per[1] / self.spec.flux[gdp] else: fsplice = 1./ self.spec.flux[gdp] # AODM cst = (10.**14.5761)/(self.lines[ii].atomic['fval']*iwrest.value) Naodm = np.log(fsplice)*cst ymx = max(ymx,np.max(Naodm)) # Plot line, = self.ax.plot(velo[gdp], Naodm, '-', drawstyle='steps-mid') # Labels lbl = '{:g}'.format(iwrest) clr = plt.getp(line, 'color') self.ax.text(0.1, 1.-(0.05+0.05*ii), lbl, color=clr, transform=self.ax.transAxes, size='small', ha='left') self.ax.set_xlabel('Relative Velocity (km/s)') self.ax.set_ylabel('N(AODM)') # Zero line self.ax.plot( [0., 0.], [-1e29, 1e29], ':', color='gray') # Reset window limits self.ax.set_xlim(self.psdict['xmnx']) if rescale: self.psdict['ymnx'] = [0.05*ymx, ymx*1.1] #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() self.ax.set_ylim(self.psdict['ymnx']) # Fonts #xputils.set_fontsize(self.ax,6.) # Draw self.canvas.draw() # ###### # Plot Doublet def set_doublet(iself,event): ''' Set z and plot doublet ''' wv_dict = {'C': (1548.195, 1550.770, 'CIV'), 'M': (2796.352, 2803.531, 'MgII'), 'O': (1031.9261, 1037.6167, 'OVI'), '8': (770.409, 780.324, 'NeVIII'), 'B': (1025.4433, 1215.6701, 'Lyba')} wrest = wv_dict[event.key] # Set z iself.zabs = event.xdata/wrest[0] - 1. try: iself.statusBar().showMessage('z = {:g} for {:s}'.format(iself.zabs, wrest[2])) except AttributeError: print('z = {:g} for {:s}'.format(iself.zabs, wrest[2])) return np.array(wrest[0:2])*(1.+iself.zabs) # ###### # Navigate def navigate(psdict,event,init=False): ''' Method to Navigate spectrum init: (False) Initialize Just pass back valid key strokes ''' # Initalize if init is True: return ['l','r','b','t','i','I', 'o','O', '[',']','W','Z', 'Y', '{', '}'] # if (not isinstance(event.xdata,float)) or (not isinstance(event.ydata,float)): print('Navigate: You entered the {:s} key out of bounds'.format(event.key)) return 0 if event.key == 'l': # Set left psdict['xmnx'][0] = event.xdata elif event.key == 'r': # Set Right psdict['xmnx'][1] = event.xdata elif event.key == 'b': # Set Bottom psdict['ymnx'][0] = event.ydata elif event.key == 't': # Set Top psdict['ymnx'][1] = event.ydata elif event.key == 'i': # Zoom in (and center) deltx = (psdict['xmnx'][1]-psdict['xmnx'][0])/4. psdict['xmnx'] = [event.xdata-deltx, event.xdata+deltx] elif event.key == 'I': # Zoom in (and center) deltx = (psdict['xmnx'][1]-psdict['xmnx'][0])/16. psdict['xmnx'] = [event.xdata-deltx, event.xdata+deltx] elif event.key == 'o': # Zoom in (and center) deltx = psdict['xmnx'][1]-psdict['xmnx'][0] psdict['xmnx'] = [event.xdata-deltx, event.xdata+deltx] elif event.key == 'O': # Zoom in (and center) deltx = psdict['xmnx'][1]-psdict['xmnx'][0] psdict['xmnx'] = [event.xdata-2*deltx, event.xdata+2*deltx] elif event.key == 'Y': # Zoom in (and center) delty = psdict['ymnx'][1]-psdict['ymnx'][0] psdict['ymnx'] = [event.ydata-delty, event.ydata+delty] elif event.key in ['[',']','{','}']: # Pan center = (psdict['xmnx'][1]+psdict['xmnx'][0])/2. deltx = (psdict['xmnx'][1]-psdict['xmnx'][0])/2. if event.key == '[': new_center = center - deltx elif event.key == ']': new_center = center + deltx elif event.key == '{': new_center = center - 4*deltx elif event.key == '}': new_center = center + 4*deltx psdict['xmnx'] = [new_center-deltx, new_center+deltx] elif event.key == 'W': # Reset the Window psdict['xmnx'] = psdict['sv_xy'][0] psdict['ymnx'] = psdict['sv_xy'][1] elif event.key == 'Z': # Zero psdict['ymnx'][0] = 0. else: if not (event.key in ['shift']): rstr = 'Key {:s} not supported.'.format(event.key) print(rstr) return 0 return 1 # ###### # def set_llist(llist,in_dict=None): ''' Method to set a line list dict for the Widgets ''' if in_dict is None: in_dict = {} if isinstance(llist,str) or isinstance(llist,unicode): # Set line list from a file in_dict['List'] = llist if llist == 'None': in_dict['Plot'] = False else: in_dict['Plot'] = True # Load? if not (llist in in_dict): #line_file = xa_path+'/data/spec_lines/'+llist llist_cls = xspec.abs_line.Abs_Line_List(llist) in_dict[llist] = llist_cls.data elif isinstance(llist,list): # Set from a list of wrest from astropy.table import Column in_dict['List'] = 'input.lst' in_dict['Plot'] = True # Fill llist.sort() tmp_dict = {} # Parse from grb.lst line_file = xa_path+'/data/spec_lines/grb.lst' llist_cls = xspec.abs_line.Abs_Line_List(line_file) adict = llist_cls.data # Fill names = [] fval = [] for wrest in llist: mt = np.where(np.abs(wrest-adict['wrest']) < 1e-3)[0] if len(mt) != 1: raise ValueError('Problem!') names.append(adict['name'][mt][0]) fval.append(adict['fval'][mt][0]) # Set #QtCore.pyqtRemoveInputHook() #xdb.set_trace() #QtCore.pyqtRestoreInputHook() # Generate a Table col0 = Column(np.array(llist), name='wrest', unit=u.AA) # Assumed Angstroms col1 = Column(np.array(names), name='name') col2 = Column(np.array(fval), name='fval') in_dict['input.lst'] = Table( (col0,col1,col2) ) # Return return in_dict # Read spectrum, pass back it and spec_file name def read_spec(ispec, second_file=None): # if isinstance(ispec,str) or isinstance(ispec,unicode): spec_fil = ispec spec = xspec.readwrite.readspec(spec_fil) # Second file? if not second_file is None: spec2 = xspec.readwrite.readspec(second_file) # Scale for convenience of plotting xper1 = xstats.basic.perc(spec.flux, per=0.9) xper2 = xstats.basic.perc(spec2.flux, per=0.9) scl = xper1[1]/xper2[1] # Stitch together wave3 = np.append(spec.dispersion, spec2.dispersion) flux3 = np.append(spec.flux, spec2.flux*scl) sig3 = np.append(spec.sig, spec2.sig*scl) #xdb.set_trace() spec3 = Spectrum1D.from_array(wave3, flux3, uncertainty=StdDevUncertainty(sig3)) # Overwrite spec = spec3 spec.filename = spec_fil else: spec = ispec # Assuming Spectrum1D spec_fil = spec.filename # Grab from Spectrum1D # Return return spec, spec_fil # ################ # TESTING if __name__ == "__main__": from xastropy import spec as xspec flg_fig = 0 flg_fig += 2**0 # ExamineSpecWidget #flg_fig += 2**1 # PlotLinesWidget #flg_fig += 2**2 # SelectLineWidget #flg_fig += 2**3 # AbsSysWidget #flg_fig += 2**4 # VelPltWidget #flg_fig += 2**5 # SelectedLinesWidget #flg_fig += 2**6 # AODMWidget # ExamineSpec if (flg_fig % 2) == 1: app = QtGui.QApplication(sys.argv) spec_fil = '/u/xavier/Keck/HIRES/RedData/PH957/PH957_f.fits' spec = xspec.readwrite.readspec(spec_fil) app.setApplicationName('XSpec') main = ExamineSpecWidget(spec) main.show() sys.exit(app.exec_()) # PltLineWidget if (flg_fig % 2**2) >= 2**1: app = QtGui.QApplication(sys.argv) app.setApplicationName('PltLine') main = PlotLinesWidget() main.show() sys.exit(app.exec_()) # SelectLineWidget if (flg_fig % 2**3) >= 2**2: line_file = xa_path+'/data/spec_lines/grb.lst' llist_cls = xspec.abs_line.Abs_Line_List(line_file) app = QtGui.QApplication(sys.argv) app.setApplicationName('SelectLine') main = SelectLineWidget(llist_cls.data) main.show() app.exec_() print(main.line) sys.exit() # AbsSys Widget if (flg_fig % 2**4) >= 2**3: abs_fil = '/Users/xavier/paper/LLS/Optical/Data/Analysis/MAGE/SDSSJ1004+0018_z2.746_id.fits' abs_fil2 = '/Users/xavier/paper/LLS/Optical/Data/Analysis/MAGE/SDSSJ2319-1040_z2.675_id.fits' app = QtGui.QApplication(sys.argv) app.setApplicationName('AbsSys') main = AbsSysWidget([abs_fil,abs_fil2]) main.show() sys.exit(app.exec_()) # VelPlt Widget if (flg_fig % 2**5) >= 2**4: specf = 1 if specf == 0: # PH957 DLA # Spectrum spec_fil = '/u/xavier/Keck/HIRES/RedData/PH957/PH957_f.fits' spec = xspec.readwrite.readspec(spec_fil) # Abs_sys abs_sys = xiaa.Generic_System(None) abs_sys.clm_fil = '/Users/xavier/DLA/Abund/PH957.z2309.clm' abs_sys.get_ions(skip_ions=True, fill_lines=True) abs_sys.zabs = abs_sys.clm_analy.zsys elif specf == 1: # UM184 LLS # Spectrum spec_fil = '/Users/xavier/PROGETTI/LLSZ3/data/normalize/UM184_nF.fits' spec = xspec.readwrite.readspec(spec_fil) # Abs_sys abs_fil = '/Users/xavier/paper/LLS/Optical/Data/Analysis/MAGE/UM184_z2.930_id.fits' abs_sys = xiaa.Generic_System(None) abs_sys.parse_absid_file(abs_fil) # Launch app = QtGui.QApplication(sys.argv) app.setApplicationName('VelPlot') main = VelPlotWidget(spec, abs_sys=abs_sys) main.show() sys.exit(app.exec_()) # SelectedLines Widget if (flg_fig % 2**6) >= 2**5: llist = set_llist('grb.lst') # Launch app = QtGui.QApplication(sys.argv) app.setApplicationName('SelectedLines') main = SelectedLinesWidget(llist['grb.lst']) main.show() sys.exit(app.exec_()) # AODM Widget if (flg_fig % 2**7) >= 2**6: spec_fil = '/Users/xavier/PROGETTI/LLSZ3/data/normalize/UM184_nF.fits' spec = xspec.readwrite.readspec(spec_fil) z=2.96916 lines = np.array([1548.195, 1550.770]) * u.AA # Launch app = QtGui.QApplication(sys.argv) app.setApplicationName('AODM') main = AODMWidget(spec, z, lines) main.show() sys.exit(app.exec_())
bsd-3-clause
equialgo/scikit-learn
examples/linear_model/plot_ols_ridge_variance.py
387
2060
#!/usr/bin/python # -*- coding: utf-8 -*- """ ========================================================= Ordinary Least Squares and Ridge Regression Variance ========================================================= Due to the few points in each dimension and the straight line that linear regression uses to follow these points as well as it can, noise on the observations will cause great variance as shown in the first plot. Every line's slope can vary quite a bit for each prediction due to the noise induced in the observations. Ridge regression is basically minimizing a penalised version of the least-squared function. The penalising `shrinks` the value of the regression coefficients. Despite the few data points in each dimension, the slope of the prediction is much more stable and the variance in the line itself is greatly reduced, in comparison to that of the standard linear regression """ print(__doc__) # Code source: Gaël Varoquaux # Modified for documentation by Jaques Grobler # License: BSD 3 clause import numpy as np import matplotlib.pyplot as plt from sklearn import linear_model X_train = np.c_[.5, 1].T y_train = [.5, 1] X_test = np.c_[0, 2].T np.random.seed(0) classifiers = dict(ols=linear_model.LinearRegression(), ridge=linear_model.Ridge(alpha=.1)) fignum = 1 for name, clf in classifiers.items(): fig = plt.figure(fignum, figsize=(4, 3)) plt.clf() plt.title(name) ax = plt.axes([.12, .12, .8, .8]) for _ in range(6): this_X = .1 * np.random.normal(size=(2, 1)) + X_train clf.fit(this_X, y_train) ax.plot(X_test, clf.predict(X_test), color='.5') ax.scatter(this_X, y_train, s=3, c='.5', marker='o', zorder=10) clf.fit(X_train, y_train) ax.plot(X_test, clf.predict(X_test), linewidth=2, color='blue') ax.scatter(X_train, y_train, s=30, c='r', marker='+', zorder=10) ax.set_xticks(()) ax.set_yticks(()) ax.set_ylim((0, 1.6)) ax.set_xlabel('X') ax.set_ylabel('y') ax.set_xlim(0, 2) fignum += 1 plt.show()
bsd-3-clause
mfouesneau/faststats
faststats/figrc.py
1
24585
# -*- coding: utf-8 -*- import os import sys sys.path.append(os.getenv('HOME') + '/bin/python/libs') # just in case notebook was not launched with the option #%pylab inline import pylab as plt import numpy as np from scipy import sparse from matplotlib.mlab import griddata from matplotlib.ticker import MaxNLocator from matplotlib.patches import Ellipse try: import faststats except ImportError: faststats = None #=============================================================================== #============== FIGURE SETUP FUNCTIONS ========================================= #=============================================================================== def theme(ax=None, minorticks=False): """ update plot to make it nice and uniform """ from matplotlib.ticker import AutoMinorLocator from pylab import rcParams, gca, tick_params if minorticks: if ax is None: ax = gca() ax.yaxis.set_minor_locator(AutoMinorLocator()) ax.xaxis.set_minor_locator(AutoMinorLocator()) tick_params(which='both', width=rcParams['lines.linewidth']) def steppify(x, y): """ Steppify a curve (x,y). Useful for manually filling histograms """ dx = 0.5 * (x[1:] + x[:-1]) xx = np.zeros( 2 * len(dx), dtype=float) yy = np.zeros( 2 * len(y), dtype=float) xx[0::2], xx[1::2] = dx, dx yy[0::2], yy[1::2] = y, y xx = np.concatenate(([x[0] - (dx[0] - x[0])], xx, [x[-1] + (x[-1] - dx[-1])])) return xx, yy def colorify(data, vmin=None, vmax=None, cmap=plt.cm.Spectral): """ Associate a color map to a quantity vector """ import matplotlib.colors as colors _vmin = vmin or min(data) _vmax = vmax or max(data) cNorm = colors.normalize(vmin=_vmin, vmax=_vmax) scalarMap = plt.cm.ScalarMappable(norm=cNorm, cmap=cmap) colors = map(scalarMap.to_rgba, data) return colors, scalarMap def hist_with_err(x, xerr, bins=None, normed=False, step=False, *kwargs): from scipy import integrate #check inputs assert( len(x) == len(xerr) ), 'data size mismatch' _x = np.asarray(x).astype(float) _xerr = np.asarray(xerr).astype(float) #def the evaluation points if (bins is None) | (not hasattr(bins, '__iter__')): m = (_x - _xerr).min() M = (_x + _xerr).max() dx = M - m m -= 0.2 * dx M += 0.2 * dx if bins is not None: N = int(bins) else: N = 10 _xp = np.linspace(m, M, N) else: _xp = 0.5 * (bins[1:] + bins[:-1]) def normal(v, mu, sig): norm_pdf = 1. / (np.sqrt(2. * np.pi) * sig ) * np.exp( - ( (v - mu ) / (2. * sig) ) ** 2 ) return norm_pdf / integrate.simps(norm_pdf, v) _yp = np.array([normal(_xp, xk, xerrk) for xk, xerrk in zip(_x, _xerr) ]).sum(axis=0) if normed: _yp /= integrate.simps(_yp, _xp) if step: return steppify(_xp, _yp) else: return _xp, _yp def hist_with_err_bootstrap(x, xerr, bins=None, normed=False, nsample=50, step=False, **kwargs): x0, y0 = hist_with_err(x, xerr, bins=bins, normed=normed, step=step, **kwargs) yn = np.empty( (nsample, len(y0)), dtype=float) yn[0, :] = y0 for k in range(nsample - 1): idx = np.random.randint(0, len(x), len(x)) yn[k, :] = hist_with_err(x[idx], xerr[idx], bins=bins, normed=normed, step=step, **kwargs)[1] return x0, yn def __get_hesse_bins__(_x, _xerr=0., bins=None, margin=0.2): if (bins is None) | (not hasattr(bins, '__iter__')): m = (_x - _xerr).min() M = (_x + _xerr).max() dx = M - m m -= margin * dx M += margin * dx if bins is not None: N = int(bins) else: N = 10 _xp = np.linspace(m, M, N) else: _xp = 0.5 * (bins[1:] + bins[:-1]) return _xp def scatter_contour(x, y, levels=10, bins=40, threshold=50, log_counts=False, histogram2d_args={}, plot_args={}, contour_args={}, ax=None): """Scatter plot with contour over dense regions Parameters ---------- x, y : arrays x and y data for the contour plot levels : integer or array (optional, default=10) number of contour levels, or array of contour levels threshold : float (default=100) number of points per 2D bin at which to begin drawing contours log_counts :boolean (optional) if True, contour levels are the base-10 logarithm of bin counts. histogram2d_args : dict keyword arguments passed to numpy.histogram2d see doc string of numpy.histogram2d for more information plot_args : dict keyword arguments passed to pylab.scatter see doc string of pylab.scatter for more information contourf_args : dict keyword arguments passed to pylab.contourf see doc string of pylab.contourf for more information ax : pylab.Axes instance the axes on which to plot. If not specified, the current axes will be used """ if ax is None: ax = plt.gca() H, xbins, ybins = np.histogram2d(x, y, **histogram2d_args) if log_counts: H = np.log10(1 + H) threshold = np.log10(1 + threshold) levels = np.asarray(levels) if levels.size == 1: levels = np.linspace(threshold, H.max(), levels) extent = [xbins[0], xbins[-1], ybins[0], ybins[-1]] i_min = np.argmin(levels) # draw a zero-width line: this gives us the outer polygon to # reduce the number of points we draw # somewhat hackish... we could probably get the same info from # the filled contour below. outline = ax.contour(H.T, levels[i_min:i_min + 1], linewidths=0, extent=extent) try: outer_poly = outline.allsegs[0][0] ax.contourf(H.T, levels, extent=extent, **contour_args) X = np.hstack([x[:, None], y[:, None]]) try: # this works in newer matplotlib versions from matplotlib.path import Path points_inside = Path(outer_poly).contains_points(X) except: # this works in older matplotlib versions import matplotlib.nxutils as nx points_inside = nx.points_inside_poly(X, outer_poly) Xplot = X[~points_inside] ax.plot(Xplot[:, 0], Xplot[:, 1], zorder=1, **plot_args) except IndexError: ax.plot(x, y, zorder=1, **plot_args) def latex_float(f, precision=0.2, delimiter=r'\times'): float_str = ("{0:" + str(precision) + "g}").format(f) if "e" in float_str: base, exponent = float_str.split("e") return (r"{0}" + delimiter + "10^{{{1}}}").format(base, int(exponent)) else: return float_str #=============================================================================== #=============================================================================== #=============================================================================== def ezrc(fontSize=22., lineWidth=2., labelSize=None, tickmajorsize=10, tickminorsize=5): """ slides - Define params to make pretty fig for slides """ from pylab import rc, rcParams if labelSize is None: labelSize = fontSize + 5 rc('figure', figsize=(8, 6)) rc('lines', linewidth=lineWidth) rcParams['grid.linewidth'] = lineWidth rc('font', size=fontSize, family='serif', weight='normal') rc('axes', linewidth=lineWidth, labelsize=labelSize) #rc('xtick', width=2.) #rc('ytick', width=2.) #rc('legend', fontsize='x-small', borderpad=0.1, markerscale=1., rc('legend', borderpad=0.1, markerscale=1., fancybox=False) rc('text', usetex=True) rc('image', aspect='auto') rc('ps', useafm=True, fonttype=3) rcParams['xtick.major.size'] = tickmajorsize rcParams['xtick.minor.size'] = tickminorsize rcParams['ytick.major.size'] = tickmajorsize rcParams['ytick.minor.size'] = tickminorsize rcParams['font.sans-serif'] = 'Helvetica' rcParams['font.serif'] = 'Helvetica' #rcParams['text.latex.preamble'] = '\usepackage{pslatex}' def hide_axis(where, ax=None): ax = ax or plt.gca() if type(where) == str: _w = [where] else: _w = where [sk.set_color('None') for k, sk in ax.spines.items() if k in _w ] if 'top' in _w and 'bottom' in _w: ax.xaxis.set_ticks_position('none') elif 'top' in _w: ax.xaxis.set_ticks_position('bottom') elif 'bottom' in _w: ax.xaxis.set_ticks_position('top') if 'left' in _w and 'right' in _w: ax.yaxis.set_ticks_position('none') elif 'left' in _w: ax.yaxis.set_ticks_position('right') elif 'right' in _w: ax.yaxis.set_ticks_position('left') plt.draw_if_interactive() def despine(fig=None, ax=None, top=True, right=True, left=False, bottom=False): """Remove the top and right spines from plot(s). fig : matplotlib figure figure to despine all axes of, default uses current figure ax : matplotlib axes specific axes object to despine top, right, left, bottom : boolean if True, remove that spine """ if fig is None and ax is None: axes = plt.gcf().axes elif fig is not None: axes = fig.axes elif ax is not None: axes = [ax] for ax_i in axes: for side in ["top", "right", "left", "bottom"]: ax_i.spines[side].set_visible(not locals()[side]) def shift_axis(which, delta, where='outward', ax=None): ax = ax or plt.gca() if type(which) == str: _w = [which] else: _w = which scales = (ax.xaxis.get_scale(), ax.yaxis.get_scale()) lbls = (ax.xaxis.get_label(), ax.yaxis.get_label()) for wk in _w: ax.spines[wk].set_position((where, delta)) ax.xaxis.set_scale(scales[0]) ax.yaxis.set_scale(scales[1]) ax.xaxis.set_label(lbls[0]) ax.yaxis.set_label(lbls[1]) plt.draw_if_interactive() class AutoLocator(MaxNLocator): def __init__(self, nbins=9, steps=[1, 2, 5, 10], **kwargs): MaxNLocator.__init__(self, nbins=nbins, steps=steps, **kwargs ) def setMargins(left=None, bottom=None, right=None, top=None, wspace=None, hspace=None): """ Tune the subplot layout via the meanings (and suggested defaults) are:: left = 0.125 # the left side of the subplots of the figure right = 0.9 # the right side of the subplots of the figure bottom = 0.1 # the bottom of the subplots of the figure top = 0.9 # the top of the subplots of the figure wspace = 0.2 # the amount of width reserved for blank space between subplots hspace = 0.2 # the amount of height reserved for white space between subplots The actual defaults are controlled by the rc file """ plt.subplots_adjust(left, bottom, right, top, wspace, hspace) plt.draw_if_interactive() def setNmajors(xval=None, yval=None, ax=None, mode='auto', **kwargs): """ setNmajors - set major tick number see figure.MaxNLocator for kwargs """ if ax is None: ax = plt.gca() if (mode == 'fixed'): if xval is not None: ax.xaxis.set_major_locator(MaxNLocator(xval, **kwargs)) if yval is not None: ax.yaxis.set_major_locator(MaxNLocator(yval, **kwargs)) elif (mode == 'auto'): if xval is not None: ax.xaxis.set_major_locator(AutoLocator(xval, **kwargs)) if yval is not None: ax.yaxis.set_major_locator(AutoLocator(yval, **kwargs)) plt.draw_if_interactive() def crazy_histogram2d(x, y, bins=10, weights=None, reduce_w=None, NULL=None, reinterp=None): """ Compute the sparse bi-dimensional histogram of two data samples where *x*, and *y* are 1-D sequences of the same length. If *weights* is None (default), this is a histogram of the number of occurences of the observations at (x[i], y[i]). If *weights* is specified, it specifies values at the coordinate (x[i], y[i]). These values are accumulated for each bin and then reduced according to *reduce_w* function, which defaults to numpy's sum function (np.sum). (If *weights* is specified, it must also be a 1-D sequence of the same length as *x* and *y*.) INPUTS: x ndarray[ndim=1] first data sample coordinates y ndarray[ndim=1] second data sample coordinates KEYWORDS: bins the bin specification int the number of bins for the two dimensions (nx=ny=bins) or [int, int] the number of bins in each dimension (nx, ny = bins) weights ndarray[ndim=1] values *w_i* weighing each sample *(x_i, y_i)* accumulated and reduced (using reduced_w) per bin reduce_w callable function that will reduce the *weights* values accumulated per bin defaults to numpy's sum function (np.sum) NULL value type filling missing data value reinterp str values are [None, 'nn', linear'] if set, reinterpolation is made using mlab.griddata to fill missing data within the convex polygone that encloses the data OUTPUTS: B ndarray[ndim=2] bi-dimensional histogram extent tuple(4) (xmin, xmax, ymin, ymax) entension of the histogram steps tuple(2) (dx, dy) bin size in x and y direction """ # define the bins (do anything you want here but needs edges and sizes of the 2d bins) try: nx, ny = bins except TypeError: nx = ny = bins #values you want to be reported if weights is None: weights = np.ones(x.size) if reduce_w is None: reduce_w = np.sum else: if not hasattr(reduce_w, '__call__'): raise TypeError('reduce function is not callable') # culling nans finite_inds = (np.isfinite(x) & np.isfinite(y) & np.isfinite(weights)) _x = np.asarray(x)[finite_inds] _y = np.asarray(y)[finite_inds] _w = np.asarray(weights)[finite_inds] if not (len(_x) == len(_y)) & (len(_y) == len(_w)): raise ValueError('Shape mismatch between x, y, and weights: {}, {}, {}'.format(_x.shape, _y.shape, _w.shape)) xmin, xmax = _x.min(), _x.max() ymin, ymax = _y.min(), _y.max() dx = (xmax - xmin) / (nx - 1.0) dy = (ymax - ymin) / (ny - 1.0) # Basically, this is just doing what np.digitize does with one less copy xyi = np.vstack((_x, _y)).T xyi -= [xmin, ymin] xyi /= [dx, dy] xyi = np.floor(xyi, xyi).T #xyi contains the bins of each point as a 2d array [(xi,yi)] d = {} for e, k in enumerate(xyi.T): key = (k[0], k[1]) if key in d: d[key].append(_w[e]) else: d[key] = [_w[e]] _xyi = np.array(d.keys()).T _w = np.array([ reduce_w(v) for v in d.values() ]) # exploit a sparse coo_matrix to build the 2D histogram... _grid = sparse.coo_matrix((_w, _xyi), shape=(nx, ny)) if reinterp is None: #convert sparse to array with filled value ## grid.toarray() does not account for filled value ## sparse.coo.coo_todense() does actually add the values to the existing ones, i.e. not what we want -> brute force if NULL is None: B = _grid.toarray() else: # Brute force only went needed B = np.zeros(_grid.shape, dtype=_grid.dtype) B.fill(NULL) for (x, y, v) in zip(_grid.col, _grid.row, _grid.data): B[y, x] = v else: # reinterp xi = np.arange(nx, dtype=float) yi = np.arange(ny, dtype=float) B = griddata(_grid.col.astype(float), _grid.row.astype(float), _grid.data, xi, yi, interp=reinterp) return B, (xmin, xmax, ymin, ymax), (dx, dy) def histplot(data, bins=10, range=None, normed=False, weights=None, density=None, ax=None, **kwargs): """ plot an histogram of data `a la R`: only bottom and left axis, with dots at the bottom to represent the sample Example ------- import numpy as np x = np.random.normal(0, 1, 1e3) histplot(x, bins=50, density=True, ls='steps-mid') """ h, b = np.histogram(data, bins, range, normed, weights, density) if ax is None: ax = plt.gca() x = 0.5 * (b[:-1] + b[1:]) l = ax.plot(x, h, **kwargs) ax.xaxis.set_ticks_position('bottom') ax.yaxis.set_ticks_position('left') _w = ['top', 'right'] [ ax.spines[side].set_visible(False) for side in _w ] for wk in ['bottom', 'left']: ax.spines[wk].set_position(('outward', 10)) ylim = ax.get_ylim() ax.plot(data, -0.02 * max(ylim) * np.ones(len(data)), '|', color=l[0].get_color()) ax.set_ylim(-0.02 * max(ylim), max(ylim)) def scatter_plot(x, y, ellipse=False, levels=[0.99, 0.95, 0.68], color='w', ax=None, **kwargs): if ax is None: ax = plt.gca() if faststats is not None: im, e = faststats.fastkde.fastkde(x, y, (50, 50), adjust=2.) V = im.max() * np.asarray(levels) plt.contour(im.T, levels=V, origin='lower', extent=e, linewidths=[1, 2, 3], colors=color) ax.plot(x, y, 'b,', alpha=0.3, zorder=-1, rasterized=True) if ellipse is True: data = np.vstack([x, y]) mu = np.mean(data, axis=1) cov = np.cov(data) error_ellipse(mu, cov, ax=plt.gca(), edgecolor="g", ls="dashed", lw=4, zorder=2) def error_ellipse(mu, cov, ax=None, factor=1.0, **kwargs): """ Plot the error ellipse at a point given its covariance matrix. """ # some sane defaults facecolor = kwargs.pop('facecolor', 'none') edgecolor = kwargs.pop('edgecolor', 'k') x, y = mu U, S, V = np.linalg.svd(cov) theta = np.degrees(np.arctan2(U[1, 0], U[0, 0])) ellipsePlot = Ellipse(xy=[x, y], width=2 * np.sqrt(S[0]) * factor, height=2 * np.sqrt(S[1]) * factor, angle=theta, facecolor=facecolor, edgecolor=edgecolor, **kwargs) if ax is None: ax = plt.gca() ax.add_patch(ellipsePlot) return ellipsePlot def plotCorr(l, pars, plotfunc=None, lbls=None, triangle='lower', *args, **kwargs): """ Plot correlation matrix between variables inputs ------- l: dict dictionary of variables (could be a Table) pars: sequence of str parameters to use plotfunc: callable function to be called when doing the scatter plots lbls: sequence of str sequence of string to use instead of dictionary keys triangle: str in ['upper', 'lower'] Which side of the triangle to use. *args, **kwargs are forwarded to the plot function Example ------- import numpy as np figrc.ezrc(16, 1, 16, 5) d = {} for k in range(4): d[k] = np.random.normal(0, k+1, 1e4) plt.figure(figsize=(8 * 1.5, 7 * 1.5)) plotCorr(d, d.keys(), plotfunc=figrc.scatter_plot) #plotCorr(d, d.keys(), alpha=0.2) """ if lbls is None: lbls = pars fontmap = {1: 10, 2: 8, 3: 6, 4: 5, 5: 4} if not len(pars) - 1 in fontmap: fontmap[len(pars) - 1] = 3 k = 1 axes = np.empty((len(pars) + 1, len(pars)), dtype=object) for j in range(len(pars)): for i in range(len(pars)): if j > i: sharex = axes[j - 1, i] else: sharex = None if i == j: # Plot the histograms. ax = plt.subplot(len(pars), len(pars), k) axes[j, i] = ax n, b, p = ax.hist(l[pars[i]], bins=50, histtype="step", color=kwargs.get("color", "b")) if triangle == 'upper': ax.set_xlabel(lbls[i]) ax.set_ylabel(lbls[i]) ax.xaxis.set_ticks_position('bottom') ax.yaxis.set_ticks_position('left') else: ax.yaxis.set_ticks_position('right') ax.xaxis.set_ticks_position('bottom') if triangle == 'upper': if i > j: if i > j + 1: sharey = axes[j, i - 1] else: sharey = None ax = plt.subplot(len(pars), len(pars), k, sharey=sharey, sharex=sharex) axes[j, i] = ax if plotfunc is None: plt.plot(l[pars[i]], l[pars[j]], ',', **kwargs) else: plotfunc(l[pars[i]], l[pars[j]], ax=ax, *args, **kwargs) plt.setp(ax.get_xticklabels() + ax.get_yticklabels(), visible=False) if triangle == 'lower': if i < j: if i < j: sharey = axes[j, i - 1] else: sharey = None ax = plt.subplot(len(pars), len(pars), k, sharey=sharey, sharex=sharex) axes[j, i] = ax if plotfunc is None: plt.plot(l[pars[i]], l[pars[j]], ',', **kwargs) else: plotfunc(l[pars[i]], l[pars[j]], ax=ax, *args, **kwargs) plt.setp(ax.get_xticklabels() + ax.get_yticklabels(), visible=False) if i == 0: ax.set_ylabel(lbls[j]) plt.setp(ax.get_yticklabels(), visible=True) if j == len(pars) - 1: ax.set_xlabel(lbls[i]) plt.setp(ax.get_xticklabels(), visible=True) N = int(0.5 * fontmap[len(pars) - 1]) if N <= 4: N = 5 setNmajors(N, N, ax=ax, prune='both') k += 1 setMargins(hspace=0.0, wspace=0.0) def hinton(W, bg='grey', facecolors=('w', 'k')): """Draw a hinton diagram of the matrix W on the current pylab axis Hinton diagrams are a way of visualizing numerical values in a matrix/vector, popular in the neural networks and machine learning literature. The area occupied by a square is proportional to a value's magnitude, and the colour indicates its sign (positive/negative). Example usage: R = np.random.normal(0, 1, (2,1000)) h, ex, ey = np.histogram2d(R[0], R[1], bins=15) hh = h - h.T hinton.hinton(hh) """ M, N = W.shape square_x = np.array([-.5, .5, .5, -.5]) square_y = np.array([-.5, -.5, .5, .5]) ioff = False if plt.isinteractive(): plt.ioff() ioff = True plt.fill([-.5, N - .5, N - .5, - .5], [-.5, -.5, M - .5, M - .5], bg) Wmax = np.abs(W).max() for m, Wrow in enumerate(W): for n, w in enumerate(Wrow): c = plt.signbit(w) and facecolors[1] or facecolors[0] plt.fill(square_x * w / Wmax + n, square_y * w / Wmax + m, c, edgecolor=c) plt.ylim(-0.5, M - 0.5) plt.xlim(-0.5, M - 0.5) if ioff is True: plt.ion() plt.draw_if_interactive()
mit
jljones/Probabilistic-Programming-and-Bayesian-Methods-for-Hackers
Chapter2_MorePyMC/separation_plot.py
86
1494
# separation plot # Author: Cameron Davidson-Pilon,2013 # see http://mdwardlab.com/sites/default/files/GreenhillWardSacks.pdf import matplotlib.pyplot as plt import numpy as np def separation_plot( p, y, **kwargs ): """ This function creates a separation plot for logistic and probit classification. See http://mdwardlab.com/sites/default/files/GreenhillWardSacks.pdf p: The proportions/probabilities, can be a nxM matrix which represents M models. y: the 0-1 response variables. """ assert p.shape[0] == y.shape[0], "p.shape[0] != y.shape[0]" n = p.shape[0] try: M = p.shape[1] except: p = p.reshape( n, 1 ) M = p.shape[1] #colors = np.array( ["#fdf2db", "#e44a32"] ) colors_bmh = np.array( ["#eeeeee", "#348ABD"] ) fig = plt.figure( )#figsize = (8, 1.3*M) ) for i in range(M): ax = fig.add_subplot(M, 1, i+1) ix = np.argsort( p[:,i] ) #plot the different bars bars = ax.bar( np.arange(n), np.ones(n), width=1., color = colors_bmh[ y[ix].astype(int) ], edgecolor = 'none') ax.plot( np.arange(n+1), np.append(p[ix,i], p[ix,i][-1]), "k", linewidth = 1.,drawstyle="steps-post" ) #create expected value bar. ax.vlines( [(1-p[ix,i]).sum()], [0], [1] ) #ax.grid(False) #ax.axis('off') plt.xlim( 0, n) plt.tight_layout() return
mit
hdmetor/scikit-learn
benchmarks/bench_plot_parallel_pairwise.py
297
1247
# Author: Mathieu Blondel <[email protected]> # License: BSD 3 clause import time import pylab as pl from sklearn.utils import check_random_state from sklearn.metrics.pairwise import pairwise_distances from sklearn.metrics.pairwise import pairwise_kernels def plot(func): random_state = check_random_state(0) one_core = [] multi_core = [] sample_sizes = range(1000, 6000, 1000) for n_samples in sample_sizes: X = random_state.rand(n_samples, 300) start = time.time() func(X, n_jobs=1) one_core.append(time.time() - start) start = time.time() func(X, n_jobs=-1) multi_core.append(time.time() - start) pl.figure('scikit-learn parallel %s benchmark results' % func.__name__) pl.plot(sample_sizes, one_core, label="one core") pl.plot(sample_sizes, multi_core, label="multi core") pl.xlabel('n_samples') pl.ylabel('Time (s)') pl.title('Parallel %s' % func.__name__) pl.legend() def euclidean_distances(X, n_jobs): return pairwise_distances(X, metric="euclidean", n_jobs=n_jobs) def rbf_kernels(X, n_jobs): return pairwise_kernels(X, metric="rbf", n_jobs=n_jobs, gamma=0.1) plot(euclidean_distances) plot(rbf_kernels) pl.show()
bsd-3-clause
ste616/atca
atsenscalc/code/atsenscalc_routines.py
1
41093
###################################################################### # The ATCA Sensitivity Calculator # Calculation subroutines. # Copyright 2015 Jamie Stevens, CSIRO # # This file is part of the ATCA Sensitivity Calculator. # # The ATCA Sensitivity Calculator is free software: you can # redistribute it and/or modify it under the terms of the GNU # General Public License as published by the Free Software # Foundation, either version 3 of the License, or (at your # option) any later version. # # The ATCA Sensitivity Calculator is distributed in the hope # that it will be useful, but WITHOUT ANY WARRANTY; without # even the implied warranty of MERCHANTABILITY or FITNESS # FOR A PARTICULAR PURPOSE. See the GNU General Public License # for more details. # # You should have received a copy of the GNU General Public License # along with the ATCA Sensitivity Calculator. # If not, see <http://www.gnu.org/licenses/>. import os import math import sys import numpy as np import matplotlib import matplotlib.pyplot as plt import refract as refract # Define some global parameters. frequencyBands = { # Low and high frequencies for each of the ATCA receivers, and the file to # read to get Tsys information. '16cm': { 'low': 1730, 'high': 2999, 'tsys': "systemps/ca02_21cm_x_polarisation.avg" }, '4cm': { 'low': 4928, 'high': 10928, 'tsys': "systemps/ca02_4cm_y_polarisation.avg" }, '15mm': { 'low': 16000, 'high': 25000, 'tsys': "systemps/12mm_recvtemps.avg" }, '7mm': { 'low': 30000, 'high': 50000, 'tsys': "systemps/ca02_7mm.avg" }, '3mm': { 'low': 83857, 'high': 104785, 'tsys': "systemps/nominal_3mm.avg" } } sideBands = { # Which sideband is used per frequency range. 'USB': [ [ 4928, 10928 ], [ 41000, 50000 ], [ 97800, 104785 ] ], 'LSB': [ [ 1730, 2999 ], [ 16000, 25000 ], [ 30000, 40999 ], [ 83857, 97799 ] ] } continuumBandwidth = 2049.0 # MHz bandwidth of the continuum bands. nZoomChannels = 2048 # the number of channels each zoom has antennaDiameter = 22.0 # metres speedoflight = 299792458.0 # Speed of light, m/s boltzmann = 1.3806488e-23 # J / K latitudeATCA = -30.31288472 # degrees, latitude of the ATCA. longitudeATCA = 149.5501388 # degrees, longitude of the ATCA. eastAngle = longitudeATCA - 90.0 cangle = math.radians(eastAngle) cosl = math.cos(math.radians(latitudeATCA)) sinl = math.sin(math.radians(latitudeATCA)) channelFlagging = { # The channels always flagged in the continuum band. 'continuum': { 'CFB1M': [ 513, 1025, 1537 ], 'CFB64M': [ 9, 17, 25 ] }, # The sampling clock birdies. 'birdies': { 'CFB1M': [ 129, 157, 257, 641, 769, 1153, 1177, 1281, 1409, 1793, 1921 ] } } frequencyFlagging = { # Known RFI ranges. 'rfi': [ [ 1059.0, 1075.0 ], [ 1103.0, 1117.0 ], [ 1145.0, 1159.0 ], [ 1165.0, 1191.0 ], [ 1217.0, 1239.0 ], [ 1240.0, 1252.0 ], [ 1380.0, 1382.0 ], [ 1428.0, 1432.0 ], [ 1436.0, 1450.0 ], [ 1456.0, 1460.0 ], [ 1493.0, 1495.0 ], [ 1499.0, 1511.0 ], [ 1525.0, 1628.0 ], [ 2489.0, 2496.0 ], [ 2879.0, 2881.0 ], [ 5622.0, 5628.0 ], [ 5930.0, 5960.0 ], [ 6440.0, 6480.0 ], [ 7747.0, 7777.0 ], [ 7866.0, 7896.0 ], [ 8058.0, 8088.0 ], [ 8177.0, 8207.0 ] ] } # Some conversion factors. mhzToHz = 1.0e6 # Convert MHz to Hz degreesToArcmin = 60.0 # Convert degrees to arcminutes degreesToArcsec = 3600.0 # Convert degrees to arcseconds jyToSI = 1e-26 # Convert Jy to W.m^-2.s^-1 mToKm = 1e-3 # Convert m to km # Our error handling class. class CalcError(Exception): def __init__(self, value): self.value = value def __str__(self): return repr(self.value) def frequencyOverlap(inf1, inf2, ing1, ing2): # Given two frequency ranges f1 - f2, g1 - g2, returns the amount # of frequency overlap. overlap = 0.0 # Check for correct frequency order. f1 = inf1 f2 = inf2 g1 = ing1 g2 = ing2 if (f2 < f1): f1 = inf2 f2 = inf1 if (g2 < g1): g1 = ing2 g2 = ing1 # Assess overlap. if ((g1 >= f1) and (g1 <= f2)): a1 = g2 - g1 a2 = f2 - g1 overlap += min(a1, a2) elif ((g2 >= f1) and (g2 <= f2)): a1 = g2 - g1 a2 = g2 - f1 overlap += min(a1, a2) elif ((f1 >= g1) and (f1 <= g2)): a1 = f2 - f1 a2 = g2 - f1 overlap += min(a1, a2) elif ((f2 >= g1) and (f2 <= g2)): a1 = f2 - f1 a2 = f2 - g1 overlap += min(a1, a2) return overlap def frequencyBand(freq): # Which band does the frequency belong to? for b in frequencyBands: if (freq >= frequencyBands[b]['low'] and freq <= frequencyBands[b]['high']): return b return None def channelResolution(corrMode): # Return the width of each type of channel for a given correlator mode. if (corrMode == 'CFB1M'): return { 'continuum': 1.0, 'zoom': (1.0 / 2048.0) } elif (corrMode == 'CFB64M'): return { 'continuum': 64.0, 'zoom': (64.0 / 2048.0) } else: return None def makeTemplate(centreFreq, bandwidth, channelWidth): # Make a blank spectrum that covers the specified frequency range with # the correct channel resolution. c = [] v = [] f = [] n = [] x = [] p = [] if (type(bandwidth) is float): lowFreq = centreFreq - (bandwidth - channelWidth) / 2 highFreq = centreFreq + (bandwidth - channelWidth) / 2 elif (type(bandwidth) is list): lowFreq = centreFreq - bandwidth[0] highFreq = centreFreq + bandwidth[1] cFreq = lowFreq chanNum = 1 while (cFreq <= highFreq): c.append(cFreq) v.append(0.0) n.append(0) f.append(False) p.append(0.0) x.append(chanNum) cFreq += channelWidth chanNum += 1 nx = np.array(x) for i in xrange(0, len(sideBands['LSB'])): if ((centreFreq >= sideBands['LSB'][i][0]) and (centreFreq <= sideBands['LSB'][i][1])): # This band is LSB, so we flip the channel numbers. nx = nx[::-1] break return { 'centreFrequency': np.array(c), 'value': np.array(v), 'count': np.array(n), 'flags': f, 'flaggedBandwidth': p, 'channelWidth': channelWidth, 'channelNumber': nx } def averageTemplate(template): # Return the average unflagged value of a template. varr = np.array([]) for i in xrange(0, len(template['value'])): if (template['flags'][i] == False): varr = np.append(varr, template['value'][i]) return np.mean(varr) def getFreq(item): return item[0] def frequencyToWavelength(freq): # Convert a frequency in MHz to a wavelength in metres. wl = speedoflight / (freq * mhzToHz) return (wl) def baselineToLambda(freq, baselineLength): # Convert a basline length in metre to lambda for a specified frequency. wl = frequencyToWavelength(freq) bl = baselineLength / wl return (bl) def primaryBeamSize(freq, diam): # Calculate the size of the primary beam for an antenna with a specified diameter (m), # at the specified frequency (MHz), in arcmin. pbfwhm = math.degrees((speedoflight / diam) / (freq * mhzToHz)) * degreesToArcmin tpbfwhm = "%.1f" % pbfwhm return (float(tpbfwhm)) def synthesisedBeamSize(freq, baselineLength, dec, minHa, maxHa, weightFactor): # Calculate the synthesised beam size given a frequency, baseline length, # declination and the minimum and maximum hour angles observed. # Returns an array where minor axis is the first element, and major # FWHM is the second. blX = baselineToLambda(freq, baselineLength['dX']) blY = baselineToLambda(freq, baselineLength['dY']) blZ = baselineToLambda(freq, baselineLength['dZ']) # We need the hour angles in radians. minHaRad = math.radians(minHa * 15.0) maxHaRad = math.radians(maxHa * 15.0) # We use the full TMS equation 4.1 here. # Find the hour angle for maximum u. umaxHa = math.degrees(math.atan2(blX, blY)) / 15.0 if (umaxHa < minHa): umaxHa = minHa if (umaxHa > maxHa): umaxHa = maxHa umaxHaRad = math.radians(umaxHa * 15.0) umax = abs(math.sin(umaxHaRad) * blX + math.cos(umaxHaRad) * blY) # Find the hour angle for maximum v. vmaxHa = math.degrees(math.atan2(-1 * blY, blX)) / 15.0 if (vmaxHa < minHa): vmaxHa = minHa if (vmaxHa > maxHa): vmaxHa = maxHa vmaxHaRad = math.radians(vmaxHa * 15.0) vmax = abs(-1 * math.sin(math.radians(dec)) * math.cos(vmaxHaRad) * blX + math.sin(math.radians(dec)) * math.sin(vmaxHaRad) * blY + math.cos(math.radians(dec)) * blZ) # The resolution is simply the inverse of umax or vmax, but we also # convert to arcseconds and multiply by the image weighting factor. ures = math.degrees(1.0 / umax) * degreesToArcsec * weightFactor # This next line will trigger a ZeroDivisionError if the source is # on the celestial equator and we're in an EW array. vres = math.degrees(1.0 / vmax) * degreesToArcsec * weightFactor # We now take care of significant figures. utmp = "%.2f" % ures vtmp = "%.2f" % vres ures = float(utmp) vres = float(vtmp) # Make the output with the minor axis first. res = [ ures, vres ] if (ures > vres): res = [ vres, ures ] return (res) def ellipseArea(minor, major): # Returns the area of an ellipse with specified minor and major # axis lengths (in arcseconds), in sr. mn = (minor / 2.0) / degreesToArcsec mj = (major / 2.0) / degreesToArcsec a = math.pi * mn * mj # in square degrees asr = a / (180.0 / math.pi)**2 # in steradians return (asr) def brightnessTemperatureSensitivity(rms, synthBeam, freq): # Calculate the brightness temperature sensitivity (K) of an observation # with an RMS noise level (mJy/beam), a synthesised beam size (arcsec), # and a frequency in MHz. This comes from TMS equation 1.2. A = ellipseArea(synthBeam[0], synthBeam[1]) I = (rms / 1000.0) * jyToSI / A wl = frequencyToWavelength(freq) bt = wl * wl * I / (2.0 * boltzmann) return (bt) def readTsys(filename, lf, hf): # Open the filename. if (os.path.isfile(filename)): # Read it. d = np.loadtxt(filename) # Sort it. ds = sorted(d, key=getFreq) # Split it. startIndex = 0 endIndex = len(ds) - 1 llf = lf / 1000.0 hhf = hf / 1000.0 while ((ds[startIndex][0] < llf) and (startIndex < (len(ds) - 1)) and (ds[startIndex + 1][0] < llf)): startIndex += 1 while ((ds[endIndex][0] > hhf) and (endIndex > 0) and (ds[endIndex - 1][0] > hhf)): endIndex -= 1 if (startIndex == endIndex): if (startIndex > 0): startIndex -= 1 if (endIndex < (len(ds) - 1)): endIndex += 1 dds = ds[startIndex:(endIndex + 1)] c = [np.around(row[0] * 1000.0) for row in dds] v = [(10 ** row[1]) for row in dds] n = [] f = [] for i in xrange(0, len(v)): n.append(1) f.append(False) return { 'centreFrequency': c, 'value': v, 'count': np.array(n), 'flags': f, 'channelWidth': 1.0 } else: raise CalcError("Can't find Tsys file %s." % filename) def lowHigh(c, w): return { 'low': c - (w / 2.0), 'high': c + (w / 2.0) } def overlaps(a, b): if (b['low'] >= a['high']): return False if (b['high'] <= a['low']): return False return True def templateAverage(t): # Divide the values by the counts. for i in xrange(0, len(t['centreFrequency'])): if (t['count'][i] > 0): t['value'][i] /= float(t['count'][i]) if (isinstance(t['flags'][i], list) == True): # Multiple input flags, we choose the most common. ft = 0 ff = 0 for j in xrange(0, len(t['flags'][i])): if (t['flags'][i][j]): ft += 1 else: ff += 1 if (ft > ff): t['flags'][i] = True else: t['flags'][i] = False def linearInterpolate(p1, p2, pi): # Using information from p1 and p2, determine the value at pi. run = p2['frequency'] - p1['frequency'] if (run != 0): slope = (p2['value'] - p1['value']) / run else: slope = 0 nrun = pi['frequency'] - p1['frequency'] return p1['value'] + nrun * slope def templateInterpolate(t): # Interpolate values for channels with no counts. # Get the array for where counts is 0 and not. zeroes = np.where(t['count'] == 0) good = np.where(t['count'] > 0) # Get the arrays without zero counts. cf = t['centreFrequency'][good] vs = t['value'][good] # And the values we need to interpolate for. rf = t['centreFrequency'][zeroes] # And then interpolate. iv = np.interp(rf, cf, vs) t['value'][zeroes] = iv def templateFill(srcTemplate, destTemplate): # Fill in a template spectrum with values from another template, and do it with # a single pass of each array (no looping). i = 0 # The index of the destination template bin j = 0 # The index of the source template bin sfs = lowHigh(srcTemplate['centreFrequency'][j], srcTemplate['channelWidth']) dfs = lowHigh(destTemplate['centreFrequency'][i], destTemplate['channelWidth']) while (i < len(destTemplate['centreFrequency']) and j < len(srcTemplate['centreFrequency'])): if (overlaps(dfs, sfs)): destTemplate['value'][i] += srcTemplate['value'][j] destTemplate['count'][i] += 1 if (destTemplate['count'][i] > 1): if (destTemplate['count'][i] == 2): t = [ destTemplate['flags'][i], srcTemplate['flags'][j] ] destTemplate['flags'][i] = t else: destTemplate['flags'][i].append(srcTemplate['flags'][j]) else: destTemplate['flags'][i] = srcTemplate['flags'][j] j += 1 if (j < len(srcTemplate['centreFrequency'])): sfs = lowHigh(srcTemplate['centreFrequency'][j], srcTemplate['channelWidth']) elif (srcTemplate['centreFrequency'][j] < destTemplate['centreFrequency'][i]): j += 1 if (j < len(srcTemplate['centreFrequency'])): sfs = lowHigh(srcTemplate['centreFrequency'][j], srcTemplate['channelWidth']) else: i += 1 if (i < len(destTemplate['centreFrequency'])): dfs = lowHigh(destTemplate['centreFrequency'][i], destTemplate['channelWidth']) templateAverage(destTemplate) # Check that the edges aren't empty # Bottom edge. if (destTemplate['count'][0] == 0): # Have to interpolate from the source template. dfs = lowHigh(destTemplate['centreFrequency'][0], destTemplate['channelWidth']) j = 0 sfs = lowHigh(srcTemplate['centreFrequency'][j], srcTemplate['channelWidth']) while (sfs['high'] < dfs['low']): j += 1 sfs = lowHigh(srcTemplate['centreFrequency'][j], srcTemplate['channelWidth']) j -= 1 # Because the breaking point is when the frequency goes too high. i = 1 while (i < (len(destTemplate['count']) - 1) and destTemplate['count'][i] == 0): i += 1 destTemplate['value'][0] = linearInterpolate({ 'value': srcTemplate['value'][j], 'frequency': srcTemplate['centreFrequency'][j] }, { 'value': destTemplate['value'][i], 'frequency': destTemplate['centreFrequency'][i] }, { 'frequency': destTemplate['centreFrequency'][0] } ) destTemplate['count'][0] = 1 # Top edge. if (destTemplate['count'][-1] == 0): dfs = lowHigh(destTemplate['centreFrequency'][-1], destTemplate['channelWidth']) j = 0 sfs = lowHigh(srcTemplate['centreFrequency'][j], srcTemplate['channelWidth']) while (sfs['high'] <= dfs['low']): j += 1 if (j < len(srcTemplate['centreFrequency'])): sfs = lowHigh(srcTemplate['centreFrequency'][j], srcTemplate['channelWidth']) else: j -= 1 break # Break point is fine this time. i = -2 while (destTemplate['count'][i] == 0 and (abs(i) < (len(destTemplate['centreFrequency'])))): i -= 1 destTemplate['value'][-1] = linearInterpolate({ 'value': srcTemplate['value'][j], 'frequency': srcTemplate['centreFrequency'][j] }, { 'value': destTemplate['value'][i], 'frequency': destTemplate['centreFrequency'][i] }, { 'frequency': destTemplate['centreFrequency'][-1] } ) destTemplate['count'][-1] = 1 templateInterpolate(destTemplate) def templateEfficiency(): # The template returned by this routine contains all the efficiencies for # all the bands. c = [ 900.0, 1200.0, 1500.0, 1800.0, 2100.0, 2300.0, 2500.0, 4400.0, 5900.0, 7400.0, 8800.0, 10600.0, 16000.0, 16500.0, 17000.0, 17500.0, 18000.0, 18500.0, 19000.0, 19500.0, 20000.0, 20500.0, 21000.0, 21500.0, 22000.0, 22500.0, 23000.0, 23500.0, 24000.0, 24500.0, 25000.0, 25400.0, 30000.0, 31000.0, 32000.0, 33000.0, 34000.0, 35000.0, 36000.0, 37000.0, 38000.0, 39000.0, 40000.0, 41000.0, 42000.0, 43000.0, 44000.0, 45000.0, 46000.0, 47000.0, 48000.0, 49000.0, 50000.0, 83781.1, 85556.2, 86834.3, 88680.5, 90526.6, 91946.7, 94005.9, 95852.1, 97272.2, 98976.3, 100254.4, 102200.0, 102300.0, 106432.0 ] v = [ 0.57, 0.57, 0.60, 0.53, 0.43, 0.42, 0.44, 0.65, 0.72, 0.65, 0.64, 0.65, 0.58, 0.62, 0.63, 0.65, 0.67, 0.70, 0.68, 0.64, 0.64, 0.60, 0.53, 0.55, 0.54, 0.51, 0.51, 0.53, 0.49, 0.49, 0.46, 0.47, 0.60, 0.60, 0.60, 0.60, 0.60, 0.60, 0.60, 0.60, 0.60, 0.60, 0.60, 0.59, 0.58, 0.57, 0.56, 0.55, 0.54, 0.53, 0.52, 0.51, 0.50, 0.3297, 0.3065, 0.3020, 0.2856, 0.2689, 0.2670, 0.2734, 0.2727, 0.2521, 0.2403, 0.2336, 0.2322, 0.14, 0.14 ] f = [] n = [] for i in xrange(0, len(c)): n.append(1) f.append(False) return { 'centreFrequency': np.array(c), 'value': np.array(v), 'count': np.array(n), 'flags': f, 'channelWidth': 1.0 } def fillAtmosphereTemplate(templateOpacity, templateTemperature, t, p, h): # Calculate the opacity and atmospheric temperature at the zenith for each frequency # in the template. atmos = refract.calcOpacity(templateOpacity['centreFrequency'] * 1e6, math.radians(90.0), t, p, h) templateOpacity['value'] = np.array(atmos['tau']) templateTemperature['value'] = np.array(atmos['Tb']) def plotTemplate(t, e, outname): plt.clf() plt.plot(t['centreFrequency'], t['value']) plt.plot(e['centreFrequency'], (e['value']), "green") plt.savefig(outname) def plotSpectrum(template, conditions, outname): # Plot the template spectrum we are passed with frequency on the x-axis. # Initialise the plot. plt.clf() fig = plt.figure() ax = fig.add_subplot(111) # These are the colours we can use for the different lines. colours = [ "blue", "green", "red", "black", "yellow" ] # Go through the conditions (usually weather conditions) and plot a line for each. for i, c in enumerate(conditions): ax.plot(template[c]['centreFrequency'], template[c]['value'], colours[i], label=c) # Set the x-axis limits to be tight on the actual frequency range. plt.xlim(template[c]['centreFrequency'][0], template[c]['centreFrequency'][-1]) plt.xlabel("Frequency [MHz]") plt.ylabel("RMS noise level [mJy/beam]") # Ensure that the x- and y-axes don't have an offset value. ax.get_yaxis().get_major_formatter().set_useOffset(False) ax.get_xaxis().get_major_formatter().set_useOffset(False) # Put the legend with the condition names at the top of the plot outside the border. plt.legend(bbox_to_anchor=(0., 1.02, 1., .102), loc=3, ncol=len(c), mode="expand", borderaxespad=0.) # Highlight the regions that are flagged in the template. for i in xrange(0, len(template[conditions[0]]['flags'])): if (template[conditions[0]]['flags'][i] == True): x1 = template[conditions[0]]['centreFrequency'][i] - template[c]['channelWidth'] / 2.0 x2 = template[conditions[0]]['centreFrequency'][i] + template[c]['channelWidth'] / 2.0 plt.axvspan(x1, x2, alpha=0.2, edgecolor='none', facecolor='red') plt.savefig(outname) def flagTemplate(t, flagType, corrMode, edgeChan): # Set the flags in the template. if ((flagType == "continuum") or (flagType == "birdies")): # This is channel based flagging. flagSrc = channelFlagging[flagType] if (corrMode in flagSrc): flagSrc = flagSrc[corrMode] for c in xrange(0, len(flagSrc)): for i in xrange(0, len(t['flags'])): if (t['channelNumber'][i] == flagSrc[c]): t['flags'][i] = True break elif (flagType == "rfi"): # This is frequency based flagging. oldi = 0 flagSrc = frequencyFlagging[flagType] for r in xrange(0, len(flagSrc)): for i in xrange(oldi, len(t['flags'])): f1 = t['centreFrequency'][i] - t['channelWidth'] / 2.0 f2 = t['centreFrequency'][i] + t['channelWidth'] / 2.0 if (f1 > flagSrc[r][1]): break t['flaggedBandwidth'][i] += frequencyOverlap(f1, f2, flagSrc[r][0], flagSrc[r][1]) oldi = i # Check for which channels are above the percentage flagged cut. for i in xrange(0, len(t['flags'])): p = t['flaggedBandwidth'][i] / t['channelWidth'] if (p > 0.5): t['flags'][i] = True elif (flagType == "edge"): # Flag edge channels. for i in xrange(0, len(t['channelNumber'])): cn = i + 1 rcn = len(t['channelNumber']) - i if ((cn <= edgeChan) or (rcn <= edgeChan)): t['flags'][i] = True def calculateSensitivity(rmsTemplate, nAnts): # Given a template filled with the RMS noise in each channel in the continuum # band, return the average sensitivity of the continuum band channels (the spectral # RMS), and the spectral RMS divided by the bandwidth (the continuum RMS). This # routine does this while respecting any flagging present in the template. rmsTotal = 0.0 rmsZoomTotal = 0.0 rmsN = 0 rmsZoomN = 0 for i in xrange(0, len(rmsTemplate['value'])): # We count flagged continuum channels in the zoom RMS calculation. rmsZoomTotal += rmsTemplate['value'][i] rmsZoomN += 1 if (rmsTemplate['flags'][i] == False): rmsTotal += rmsTemplate['value'][i] rmsN += 1 if (rmsN > 0): rmsSpectral = rmsTotal / rmsN totalBandwidth = rmsN * rmsTemplate['channelWidth'] rmsContinuum = rmsSpectral / math.sqrt(float(rmsN)) rmsZoom = rmsSpectral * math.sqrt(float(nZoomChannels)) else: rmsSpectral = None totalBandwidth = None rmsContinuum = None rmsZoom = None # Calculate the SEFDs for each antenna and the array as a whole. # We use TMS equation 1.6 for this and convert to Jy. Aone = surfaceArea(antennaDiameter) Aall = nAnts * Aone sefdOne = 2.0 * boltzmann * rmsTemplate['systemp'] / (Aone * 1e-26) sefdAll = 2.0 * boltzmann * rmsTemplate['systemp'] / (Aall * 1e-26) return { 'rms': { 'spectral': rmsSpectral, 'continuum': rmsContinuum, 'zoom': rmsZoom }, 'bandwidth': { 'unflagged': totalBandwidth }, 'sefd': { 'antenna': sefdOne, 'array': sefdAll } } def calculateRms(tsys, efficiency, opacity, temperature, minHa, maxHa, perHa, nAntenna, totalTime, weighting, sind, cosd): # Given the tsys and efficiency templates, the number of antennas involved in the # imaging, the total integration time and the image weighting scheme, this routine # will return another template with each channel being the RMS noise expected in # that channel. This comes from eqn 6.62 of TMS, where eta_Q is 1 (for CABB's # digitisation) but A is multiplied by our efficiency factor. That equation is # for only a single polarisation though, so for an unpolarised source, the noise # level is sqrt(2) lower, which is where the sqrt(2) factor in the numerator comes from # instead of the 2. # The variables for our output template. c = [] v = [] n = [] f = [] # Figure out how much time is spent in each integration period. haRange = maxHa - minHa nIntegrations = math.ceil(haRange * perHa) intTime = totalTime / nIntegrations Texcess = [] systemTemperature = [] for j in xrange(0, int(nIntegrations + 1)): # The hour angle at this integration. jHa = minHa + float(j) / perHa # The elevation at this hour angle. cosha = math.cos(math.radians(jHa * 15.0)) sinel = sinl * sind + cosl * cosd * cosha # Calculate the excess temperature due to the atmosphere # and CMB. elFactor = np.exp(-1.0 * opacity['value'] / sinel) cbFactor = 2.7 * elFactor ivFactor = 1.0 - elFactor atFactor = temperature['value'] * ivFactor Texcess.append(atFactor + cbFactor) for i in xrange(0, len(tsys['centreFrequency'])): # Check that the frequencies are the same in both templates. if (tsys['centreFrequency'][i] == efficiency['centreFrequency'][i]): # All's good. c.append(tsys['centreFrequency'][i]) # Get the average excess temperature now. exTemp = [ row[i] for row in Texcess ] excessTemp = np.sum(exTemp) / float(len(exTemp)) Tmeas = tsys['value'][i] + excessTemp TmeasEff = Tmeas / efficiency['value'][i] # The units of this is actually mJy since we keep the frequency # in MHz rather than converting to Hz (convenient isn't it!). v.append((math.sqrt(2.0) * boltzmann * Tmeas * weighting['avg']) / (1e-26 * surfaceArea(antennaDiameter) * efficiency['value'][i] * math.sqrt(float(nAntenna) * float(nAntenna - 1) * tsys['channelWidth'] * (totalTime * 60.0)))) n.append(1) if (tsys['flags'][i] or efficiency['flags'][i]): f.append(True) else: f.append(False) systemTemperature.append(TmeasEff) return { 'centreFrequency': np.array(c), 'value': np.array(v), 'count': np.array(n), 'flags': f, 'channelWidth': tsys['channelWidth'], 'channelNumber': tsys['channelNumber'], 'systemp': np.mean(systemTemperature), 'systemTemperature': float("%.1f" % np.mean(systemTemperature))} def surfaceArea(d): # Given the diameter of a dish (m), return its surface area (m^2). return (math.pi * ((d / 2.0) ** 2)) def weightingFactor(weighting, array, ant6): # Return the w_rms / w_mean weighting factors given the weighting scheme, # the array configuration and whether antenna 6 is included in the imaging. # The weighting factors we determined from simulations. factors = [ { 'array': [ '6000', '6km', '3000', '3km' ], 'factors': [ { 'ca06': True, 'R2': { 'avg': 1.039, 'min': 1.000, 'max': 1.079, 'beam': 1.32 }, 'R1': { 'avg': 1.040, 'min': 1.000, 'max': 1.080, 'beam': 1.32 }, 'R0': { 'avg': 1.871, 'min': 1.350, 'max': 2.781, 'beam': 0.84 }, 'R-1': { 'avg': 5.791, 'min': 3.685, 'max': 10.987, 'beam': 0.80 }, 'R-2': { 'avg': 5.847, 'min': 3.688, 'max': 11.240, 'beam': 0.80 } }, { 'ca06': False, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 0.97 }, 'R1': { 'avg': 1.002, 'min': 1.001, 'max': 1.004, 'beam': 0.89 }, 'R0': { 'avg': 1.882, 'min': 1.703, 'max': 1.943, 'beam': 0.66 }, 'R-1': { 'avg': 3.875, 'min': 2.543, 'max': 7.102, 'beam': 0.64 }, 'R-2': { 'avg': 3.908, 'min': 2.562, 'max': 7.222, 'beam': 0.64 } } ] }, { 'array': [ '1500', '1.5km' ], 'factors': [ { 'ca06': True, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 1.32 }, 'R1': { 'avg': 1.000, 'min': 1.000, 'max': 1.001, 'beam': 1.32 }, 'R0': { 'avg': 1.507, 'min': 1.181, 'max': 1.846, 'beam': 0.84 }, 'R-1': { 'avg': 7.925, 'min': 5.200, 'max': 16.732, 'beam': 0.80 }, 'R-2': { 'avg': 8.151, 'min': 5.163, 'max': 19.304, 'beam': 0.80 } }, { 'ca06': False, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 0.96 }, 'R1': { 'avg': 1.001, 'min': 1.000, 'max': 1.003, 'beam': 0.88 }, 'R0': { 'avg': 1.854, 'min': 1.576, 'max': 1.953, 'beam': 0.64 }, 'R-1': { 'avg': 3.900, 'min': 2.524, 'max': 8.218, 'beam': 0.62 }, 'R-2': { 'avg': 3.923, 'min': 2.506, 'max': 8.707, 'beam': 0.62 } } ] }, { 'array': [ '750', '750m' ], 'factors': [ { 'ca06': True, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 1.32 }, 'R1': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 1.32 }, 'R0': { 'avg': 1.299, 'min': 1.143, 'max': 1.621, 'beam': 0.84 }, 'R-1': { 'avg': 12.893, 'min': 8.581, 'max': 17.674, 'beam': 0.80 }, 'R-2': { 'avg': 14.027, 'min': 8.882, 'max': 22.273, 'beam': 0.80 } }, { 'ca06': False, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 0.96 }, 'R1': { 'avg': 1.001, 'min': 1.000, 'max': 1.002, 'beam': 0.88 }, 'R0': { 'avg': 1.925, 'min': 1.850, 'max': 1.971, 'beam': 0.62 }, 'R-1': { 'avg': 3.557, 'min': 2.578, 'max': 5.255, 'beam': 0.59 }, 'R-2': { 'avg': 3.582, 'min': 2.583, 'max': 5.369, 'beam': 0.59 } } ] }, { 'array': [ '367', 'EW352', 'EW367', 'EW352/367' ], 'factors': [ { 'ca06': True, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 1.32 }, 'R1': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 1.32 }, 'R0': { 'avg': 1.077, 'min': 1.029, 'max': 1.157, 'beam': 0.84 }, 'R-1': { 'avg': 18.304, 'min': 16.432, 'max': 17.498, 'beam': 0.80 }, 'R-2': { 'avg': 31.295, 'min': 20.574, 'max': 52.204, 'beam': 0.80 } }, { 'ca06': False, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 1.09 }, 'R1': { 'avg': 1.001, 'min': 1.000, 'max': 1.001, 'beam': 1.00 }, 'R0': { 'avg': 1.917, 'min': 1.838, 'max': 1.965, 'beam': 0.68 }, 'R-1': { 'avg': 3.271, 'min': 2.537, 'max': 4.639, 'beam': 0.64 }, 'R-2': { 'avg': 3.298, 'min': 2.550, 'max': 4.718, 'beam': 0.64 } } ] }, { 'array': [ 'h214', 'H214', 'h168', 'H168', 'h75', 'H75' ], 'factors': [ { 'ca06': True, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 1.32}, 'R1': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 1.32}, 'R0': { 'avg': 1.106, 'min': 1.023, 'max': 1.186, 'beam': 0.84}, 'R-1': { 'avg': 16.865, 'min': 15.629, 'max': 18.294, 'beam': 0.80 }, 'R-2': { 'avg': 26.926, 'min': 18.717, 'max': 58.094, 'beam': 0.80 } }, { 'ca06': False, 'R2': { 'avg': 1.000, 'min': 1.000, 'max': 1.000, 'beam': 0.75 }, 'R1': { 'avg': 1.001, 'min': 1.001, 'max': 1.002, 'beam': 0.74 }, 'R0': { 'avg': 1.641, 'min': 1.529, 'max': 1.760, 'beam': 0.61 }, 'R-1': { 'avg': 1.984, 'min': 1.753, 'max': 2.281, 'beam': 0.59 }, 'R-2': { 'avg': 1.988, 'min': 1.755, 'max': 2.288, 'beam': 0.59 } } ] } ] # Search through the array. for f in xrange(0, len(factors)): arrayFound = False for i in xrange(0, len(factors[f]['array'])): if (array == factors[f]['array'][i]): arrayFound = True break if (arrayFound): g = 1 if (ant6): g = 0 if (weighting in factors[f]['factors'][g]): return (factors[f]['factors'][g][weighting]) # We couldn't find the appropriate weighting factors. raise CalcError("Weighting factors are not available.") def maximumBaseline(array): # Return the maximum baseline length for a named array, both on the track # only, and including CA06. stationLocations = { 'W0': [ -4752438.459, 2790321.299, -3200483.747 ], 'W2': [ -4752422.922, 2790347.675, -3200483.747 ], 'W4': [ -4752407.385, 2790374.052, -3200483.747 ], 'W6': [ -4752391.848, 2790400.428, -3200483.747 ], 'W8': [ -4752376.311, 2790426.804, -3200483.747 ], 'W10': [ -4752360.774, 2790453.181, -3200483.747 ], 'W12': [ -4752345.237, 2790479.557, -3200483.747 ], 'W14': [ -4752329.700, 2790505.934, -3200483.747 ], 'W16': [ -4752314.163, 2790532.310, -3200483.747 ], 'W32': [ -4752189.868, 2790743.321, -3200483.747 ], 'W45': [ -4752088.877, 2790914.767, -3200483.747 ], 'W64': [ -4751941.276, 2791165.342, -3200483.747 ], 'W84': [ -4751785.907, 2791429.106, -3200483.747 ], 'W98': [ -4751677.148, 2791613.741, -3200483.747 ], 'W100': [ -4751661.611, 2791640.117, -3200483.747 ], 'W102': [ -4751646.074, 2791666.493, -3200483.747 ], 'W104': [ -4751630.537, 2791692.870, -3200483.747 ], 'W106': [ -4751615.000, 2791719.246, -3200483.747 ], 'W109': [ -4751591.695, 2791758.810, -3200483.747 ], 'W110': [ -4751583.926, 2791771.999, -3200483.747 ], 'W111': [ -4751576.158, 2791785.187, -3200483.747 ], 'W112': [ -4751568.389, 2791798.375, -3200483.747 ], 'W113': [ -4751560.621, 2791811.563, -3200483.747 ], 'W124': [ -4751475.168, 2791956.633, -3200483.747 ], 'W125': [ -4751467.399, 2791969.821, -3200483.747 ], 'W128': [ -4751444.094, 2792009.386, -3200483.747 ], 'W129': [ -4751436.325, 2792022.574, -3200483.747 ], 'W140': [ -4751350.872, 2792167.644, -3200483.747 ], 'W147': [ -4751296.492, 2792259.961, -3200483.747 ], 'W148': [ -4751288.724, 2792273.149, -3200483.747 ], 'W163': [ -4751172.197, 2792470.972, -3200483.747 ], 'W168': [ -4751133.354, 2792536.913, -3200483.747 ], 'W172': [ -4751102.281, 2792589.666, -3200483.747 ], 'W173': [ -4751094.512, 2792602.854, -3200483.747 ], 'W182': [ -4751024.596, 2792721.547, -3200483.747 ], 'W189': [ -4750970.216, 2792813.865, -3200483.747 ], 'W190': [ -4750962.448, 2792827.053, -3200483.747 ], 'W195': [ -4750923.605, 2792892.994, -3200483.747 ], 'W196': [ -4750915.837, 2792906.182, -3200483.747 ], 'W392': [ -4749393.198, 2795491.050, -3200483.694 ], 'N2': [ -4751628.291, 2791727.075, -3200457.305 ], 'N5': [ -4751648.226, 2791738.818, -3200417.642 ], 'N7': [ -4751661.517, 2791746.647, -3200391.200 ], 'N11': [ -4751688.098, 2791762.304, -3200338.316 ], 'N14': [ -4751708.034, 2791774.047, -3200298.653 ] } endStations = [ { 'array': [ '6000', '6km', '3000', '3km' ], 'stations': [ 'W2', 'W196' ] }, { 'array': [ '1500', '1.5km' ], 'stations': [ 'W98', 'W195' ] }, { 'array': [ '750', '750m' ], 'stations': [ 'W98', 'W148' ] }, { 'array': [ '367', 'EW367', 'EW352/367' ], 'stations': [ 'W104', 'W128' ] }, { 'array': [ 'EW352' ], 'stations': [ 'W102', 'W125' ] }, { 'array': [ 'h214', 'H214' ], 'stations': [ 'W98', 'W113', 'W104', 'N14' ] }, { 'array': [ 'h168', 'H168' ], 'stations': [ 'W100', 'W111', 'W104', 'N11' ] }, { 'array': [ 'h75', 'H75' ], 'stations': [ 'W104', 'W109', 'W104', 'N5' ] } ] # Search through the array. for s in xrange(0, len(endStations)): if (array in endStations[s]['array']): # Calculate the maximum dX, dY, dZ. mdX = 0 mdY = 0 mdZ = 0 for i in xrange(0, len(endStations[s]['stations']) - 1): for j in xrange(i + 1, len(endStations[s]['stations'])): dYp = abs(stationLocations[endStations[s]['stations'][i]][0] - stationLocations[endStations[s]['stations'][j]][0]) dXp = abs(stationLocations[endStations[s]['stations'][i]][1] - stationLocations[endStations[s]['stations'][j]][1]) dX = dXp * math.cos(cangle) - dYp * math.sin(cangle) dY = dXp * math.sin(cangle) + dYp * math.cos(cangle) if (dX > mdX): mdX = dX if (dY > mdY): mdY = dY dZ = abs(stationLocations[endStations[s]['stations'][i]][2] - stationLocations[endStations[s]['stations'][j]][2]) if (dZ > mdZ): mdZ = dZ mdX6 = 0 mdY6 = 0 mdZ6 = 0 for i in xrange(0, len(endStations[s]['stations'])): dYp = abs(stationLocations[endStations[s]['stations'][i]][0] - stationLocations['W392'][0]) dXp = abs(stationLocations[endStations[s]['stations'][i]][1] - stationLocations['W392'][1]) dX = dXp * math.cos(cangle) - dYp * math.sin(cangle) dY = dXp * math.sin(cangle) + dYp * math.cos(cangle) if (dX > mdX6): mdX6 = dX if (dY > mdY6): mdY6 = dY dZ = abs(stationLocations[endStations[s]['stations'][i]][2] - stationLocations['W392'][2]) if (dZ > mdZ6): mdZ6 = dZ return ( { 'track': { 'dX': mdX, 'dY': mdY, 'dZ': mdZ }, 'ca06': { 'dX': mdX6, 'dY': mdY6, 'dZ': mdZ6 } } ) # We couldn't find the appropriate maximum baseline lengths. raise CalcError("Baseline lengths are not available.") def addToOutput(output, item, name, value, description, units): # Add some information to the JSON output object. if (isinstance(name, list) == False): output[item][name] = value output['description'][name] = description if (units is not None): output['units'][name] = units else: if (name[0] not in output[item]): output[item][name[0]] = {} output['description'][name[0]] = description if (units is not None): output['units'][name[0]] = units output[item][name[0]][name[1]] = value def bandwidthToVelocity(lfreq, bw, restfreq): # Given a rest frequency in MHz, calculate the velocity span represented # by the specified bandwidth (MHz) starting at some low frequency (MHz). vr = bw * restfreq * speedoflight * mToKm / (lfreq * (lfreq + bw)) vro = float("%.3f" % vr) return (vro)
gpl-3.0
troycomi/microMS
GUICanvases/microMSModel.py
1
34074
from PIL import ImageDraw, ImageFont import matplotlib as mpl from matplotlib.path import Path from matplotlib.collections import PatchCollection import matplotlib.pyplot as plt import os import random from scipy.spatial.distance import pdist import numpy as np from copy import deepcopy, copy from GUICanvases import GUIConstants from ImageUtilities import slideWrapper from ImageUtilities import blobFinder from ImageUtilities import blob from ImageUtilities import TSPutil from ImageUtilities.enumModule import Direction, StepSize from ImageUtilities import blobList from CoordinateMappers import supportedCoordSystems class MicroMSModel(object): ''' The model of a microMS experiment consisting of a slide, blob finder, and blobs Performs several vital functions for interacting with each object and maintains a list of blobs ''' def __init__(self, GUI): ''' Initialize a new model setup. Slide starts as None. The coordinateMapper is set as the first mapper of the supported mappers. Also calls self.resetVariables to clear other instance variables. GUI: the supporting GUI ''' self.slide = None self.coordinateMapper = supportedCoordSystems.supportedMappers[0] self.GUI = GUI self.resetVariables() def setupMicroMS(self, filename): ''' Loads an image and sets up a new session filename: the image to load ''' self.slide = slideWrapper.SlideWrapper(filename) self.resetVariables() def resetVariables(self): ''' Clears and initializes all instance variables ''' self.blobCollection = [blobList.blobList(self.slide) for i in range(10)] self.setCurrentBlobs(0) self.tempBlobs = None self.histogramBlobs = None self.histColors = None self.coordinateMapper.clearPoints() self.mirrorImage = False self.showPatches = True self.drawAllBlobs = False self.showPrediction = False self.showThreshold = False def setCoordinateMapper(self, newMapper): ''' Sets a new coordinate mapper and clears its points newMapper: the new instance of coordinateMapper to use ''' self.coordinateMapper = newMapper self.coordinateMapper.clearPoints() def saveEntirePlot(self, fileName, ROI = None): ''' saves the entire slide image at the current zoom level fileName: the file to write to *NOTE: this can take a while to run and generate large files at max zoom ''' #save the current size and position size, pos = self.slide.size, self.slide.pos if ROI is None: #match size to whole slide, position at center self.slide.size, self.slide.pos = \ (self.slide.dimensions[0]//2**self.slide.lvl, self.slide.dimensions[1]//2**self.slide.lvl), \ (self.slide.dimensions[0]//2, self.slide.dimensions[1]//2) else: #limit to just the ROI bounds minx = maxx = ROI[0][0] miny = maxy = ROI[0][1] for r in ROI: minx = minx if minx < r[0] else r[0] maxx = maxx if maxx > r[0] else r[0] miny = miny if miny < r[1] else r[1] maxy = maxy if maxy > r[1] else r[1] self.slide.size = ((maxx-minx) // 2 **self.slide.lvl, (maxy-miny) //2**self.slide.lvl) self.slide.pos = ((maxx-minx) // 2 + minx, (maxy-miny) //2 + miny) self.slide.size = [int(i) for i in self.slide.size] self.slide.pos = [int(i) for i in self.slide.pos] #get whole image wholeImg = self.slide.getImg() draw = ImageDraw.Draw(wholeImg) #markup image linWid = 1 if 6-self.slide.lvl < 1 else 6-self.slide.lvl tfont = ImageFont.truetype("arial.ttf",linWid+6) #for each blob list for ii in range(len(self.blobCollection)): if self.blobCollection[ii].length() > 0: drawnlbls = set() drawlbl = self.blobCollection[ii].blobs[0].group is not None #for each blob for i,gb in enumerate(self.blobCollection[ii].blobs): p = self.slide.getLocalPoint((gb.X,gb.Y)) rad = gb.radius/2**self.slide.lvl #draw blob outline draw.ellipse((p[0]-rad, p[1]-rad, p[0]+rad, p[1]+rad), outline=GUIConstants.MULTI_BLOB[ii]) #draw label if group exists if drawlbl and gb.group not in drawnlbls: draw.text((p[0]+10/2**self.slide.lvl,p[1]-10/2**self.slide.lvl), str(gb.group), font=tfont, fill=GUIConstants.EXPANDED_TEXT) drawnlbls.add(gb.group) #roi if ROI is not None: ROI = [self.slide.getLocalPoint(r) for r in ROI] ROI.append(ROI[0]) draw.line([(x[0], x[1]) for x in ROI], fill = GUIConstants.ROI) #save image wholeImg.save(fileName) #restore size and position self.slide.size, self.slide.pos = size, pos def saveCurrentBlobFinding(self, filename): ''' Save the current blob finder and currently selected blob list filename: file to save to ''' #slide not set up if self.slide is None: return "No slide loaded" #current list is empty if self.blobCollection[self.currentBlobs].length() == 0: return "List {} contains no blobs!".format(self.currentBlobs +1) #plus one for GUI display #save blobs self.blobCollection[self.currentBlobs].saveBlobs(filename) return "Saved blob information of list {}".format(self.currentBlobs+1) def saveHistogramBlobs(self, filename): ''' Save up to 3 files for different histogram filters filename: the filename to save ''' #slide not set up if self.slide is None: return "No slide loaded" #no histogram blobs to save if self.histogramBlobs is None or len(self.histogramBlobs) == 0: return "No histogram divisions provided" #save different divisions f, ex = os.path.splitext(filename) for blbs in self.histogramBlobs: if blbs.length() > 0: blbs.saveBlobs('{}_{}_{}{}'.format(f, blbs.description, blbs.threshCutoff, ex)) return "Saved histogram divisions with base name {}".format(os.path.split(f)[1]) def saveAllBlobs(self, filename): ''' Save each list of blobs in it's own list filename: a full filename with extension. The list number will be added as such: dir/test.txt -> dir/test_1.txt ''' #slide not set up if self.slide is None: return "No slide loaded" f, ex = os.path.splitext(filename) #save each blob list for i, blbs in enumerate(self.blobCollection): if blbs.length() > 0: blbs.saveBlobs('{}_{}{}'.format(f, i, ex)) return "Saved blobs with base name '{}'".format(os.path.split(f)[1]) def saveCoordinateMapper(self, filename): ''' Save the current coordinate mapper filename: file to save to ''' #no fiducials trained if len(self.coordinateMapper.pixelPoints) < 1: return "No coordinates to save" self.coordinateMapper.saveRegistration(filename) return "Saved coordinate mapper" def saveInstrumentPositions(self, filename, tspOpt, maxPoints = None): ''' save positions of blobs in instrument coordinate system fileName: file to save to tspOpt: bool indicating whether or not to perform traveling salesman optimization maxPoints: maximum number of blobs to save. Default (None) saves all ''' #check if the file can be saved if len(self.coordinateMapper.physPoints) < 2: return "Not enough training points to save instrument file" if self.blobCollection[self.currentBlobs].length() == 0: return "No blobs to save" #get current blob list blobs = self.blobCollection[self.currentBlobs].blobs #if maxPoints is valid if maxPoints is not None and maxPoints > 0 and maxPoints < self.currentBlobLength(): #obtain a random sample of blobs blobs = random.sample(blobs,maxPoints) #if tspOpt is requested if tspOpt == True: #reorder visit order soln = TSPutil.TSPRoute(blob.blob.getXYList(blobs)) blobs = [blobs[i] for i in soln] #save list of blobs self.coordinateMapper.saveInstrumentFile(filename, blobs) return "Saved instrument file of list {}".format(self.currentBlobs +1 ) def saveInstrumentRegistrationPositions(self, filename): ''' Save fiducial locations in the instrument coordinate system ''' if len(self.coordinateMapper.physPoints) < 2: return "Not enough training points to save fiducial locations" self.coordinateMapper.saveInstrumentRegFile(filename) return "Saved instrument registration positions" def loadCoordinateMapper(self,filename): ''' load a prior registration file changes the current mapper to the one specified in the file filename: file to load returns a status string to display, and the index of the new mapper ''' #get old index old = supportedCoordSystems.supportedMappers.index(self.coordinateMapper) #get first line in file reader = open(filename,'r') line = reader.readline().strip() reader.close() #see if that is a name of a coordinatemapper try: i = supportedCoordSystems.supportedNames.index(line) except: return 'Unsupported instrument: {}'.format(line), old #See if mapper has changed to warn the user result = 'Loaded {} registration'.format(line) if i != old: result = 'Warning, changing instrument to {}'.format(line) self.coordinateMapper = supportedCoordSystems.supportedMappers[i] self.coordinateMapper.loadRegistration(filename) return result, i def loadBlobFinding(self, filename): ''' Loads the blobs in the provided filename to the current list of blobs and sets the blobfinder to the previous values filename: file to load ''' self.blobCollection[self.currentBlobs].loadBlobs(filename) return "Finished loading blob positions into list {}".format(self.currentBlobs+1) def loadInstrumentPositions(self, filename): ''' Load a instrument position file to the current blob list. Will not have proper radius, but should retain the groups. filename: file to load ''' self.blobCollection[self.currentBlobs].blobs = \ self.coordinateMapper.loadInstrumentFile(filename) self.blobCollection[self.currentBlobs].generateGroupLabels() return "Finished loading instrument file into list {}".format(self.currentBlobs+1) def currentBlobLength(self): ''' Gets the length of the current blob list ''' return self.blobCollection[self.currentBlobs].length() def currentInstrumentExtension(self): ''' Gets the instrument extension of the current coordinate mapper ''' return self.coordinateMapper.instrumentExtension def runGlobalBlobFind(self): ''' Performs global blob finding on the current slide and sets to current blob list ''' if self.slide is None: return "No slide was open" return self.blobCollection[self.currentBlobs].blobSlide() + " in list {}".format(self.currentBlobs+1) def updateCurrentBlobs(self, newBlobs): if not isinstance(newBlobs, blobList.blobList): raise ValueError('New blobs must be a blobList') #find first unused blob index for i in range(len(self.blobCollection)): if self.blobCollection[i].length() == 0: #add new blobs self.blobCollection[i] = newBlobs self.setCurrentBlobs(i) return def distanceFilter(self, distance): ''' filters the global blob list to remove blobs which are closer than 'distance' pixels the prior list is stored in previous current index distance: distance threshold ''' if self.currentBlobLength() == 0: return "No blobs to filter" self.updateCurrentBlobs(self.blobCollection[self.currentBlobs].distanceFilter(distance, verbose = True)) return "Finished distance filter in list {}".format(self.currentBlobs+1) def roiFilter(self): if self.currentBlobLength() == 0: return "No blobs to filter" if len(self.blobCollection[self.currentBlobs].ROI) < 3: return "No ROI selected" startLen = self.currentBlobLength() self.updateCurrentBlobs(self.blobCollection[self.currentBlobs].roiFilter()) endLen = self.currentBlobLength() return "{} blobs removed, {} remain in list {}".format(startLen - endLen, endLen, self.currentBlobs+1) def roiFilterInverse(self): if self.currentBlobLength() == 0: return "No blobs to filter" if len(self.blobCollection[self.currentBlobs].ROI) < 3: return "No ROI selected" startLen = self.currentBlobLength() self.updateCurrentBlobs(self.blobCollection[self.currentBlobs].roiFilterInverse()) endLen = self.currentBlobLength() return "{} blobs removed, {} remain in list {}".format(startLen - endLen, endLen, self.currentBlobs+1) def hexPackBlobs(self, separation, layers, dynamicLayering = False): ''' expands each blob into hexagonally closest packed positions sep: minimum separation between points layers: number of layers to generate dynamicLayering: adjust the number of layers with the blob radius ''' self.updateCurrentBlobs(self.blobCollection[self.currentBlobs]\ .hexagonallyClosePackPoints(separation, layers, dynamicLayering = dynamicLayering)) def rectPackBlobs(self, separation, layers, dynamicLayering = False): ''' expands each blob into rectangularly packed positions sep: minimum separation between points layers: number of layers to generate dynamicLayering: adjust the number of layers with the blob radius ''' self.updateCurrentBlobs(self.blobCollection[self.currentBlobs]\ .rectangularlyPackPoints(separation, layers, dynamicLayering = dynamicLayering)) def circularPackBlobs(self, separation, maxShots, offset): ''' expands each blob into circularly packed positions around the blob sep: minimum separation between spots shots: maximum number of spots to place around each blob offset: offset from the current circumference, offset > 0 places spots outside the current blob ''' self.updateCurrentBlobs(self.blobCollection[self.currentBlobs]\ .circularPackPoints(separation, maxShots, offset, minSpots = 4)) def analyzeAll(self): ''' if the current mapper is connected to an instrument, triggers analysis of all blobs currently found ''' #get all pixel points and translate to motor coords if self.currentBlobLength() == 0: return "No targets currently selected" if len(self.coordinateMapper.physPoints) <= 2: return "Not enough training points" if self.coordinateMapper.connectedInstrument is None or \ self.coordinateMapper.connectedInstrument.connected == False: return "No connected instrument" targets = list(map(lambda b: self.coordinateMapper.translate((b.X, b.Y)), self.blobCollection[self.currentBlobs].blobs)) #send to connected instrument self.coordinateMapper.connectedInstrument.collectAll(targets) return "Finished collection" def setBlobSubset(self, blobSubset): ''' Sets the histogram blobs supplied by a histcanvas blobSubset: an odd object, tuple of lists, first is a blobList, second a list of colors ''' self.histogramBlobs = blobSubset[0] self.histColors = blobSubset[1] def reportSlideStep(self, direction, stepSize): ''' Moves the slide in the specified direction, taking into account mirroring direction: a slideWrapper.direction in the observed direction stepSize: enum dictating if the step size ''' if self.slide is not None: if self.mirrorImage: if direction == Direction.left: self.slide.step(Direction.right, stepSize) elif direction == Direction.right: self.slide.step(Direction.left, stepSize) else: self.slide.step(direction, stepSize) self.slide.step(direction, stepSize) def testBlobFind(self): ''' Performs a test blob find on the current position Sets the zoom level to the maximum value to match test blob finding ''' self.slide.lvl = 0 if self.slide is not None: self.tempBlobs = self.blobCollection[self.currentBlobs].blobFinder.blobImg() def setCurrentBlobs(self, ind): ''' Sets the current blob index to the specified value ind: integer value of list to show ''' self.currentBlobs = ind if self.GUI is not None: self.GUI.setTitle(self.currentBlobs) def reportSize(self, newSize): ''' Sets the size of the slidewrapper to the specified value. Sets the max number of pixels to 600 but keeps the aspect ratio newSize = (width, height) ''' w,h = newSize factor = 600/max(w,h) w, h = int(w*factor), int(h*factor) self.slide.size = [w, h] def getCurrentImage(self): ''' gets the image to display, accounting for showing thresholds ''' #show the threshold image produced by blobfinder helper method if self.showThreshold: im, num = blobFinder.blobFinder._blbThresh(self.slide.getImg(), self.blobCollection[self.currentBlobs].blobFinder.colorChannel, self.blobCollection[self.currentBlobs].blobFinder.threshold) return im #else, use current image view else: return self.slide.getImg() def getPatches(self, limitDraw): ''' Gets the patches of all blobs, registration marks and predicted points. limitDraw: boolean toggle to limit the number of blobs to draw ''' ptches = [] #nothing requested or nothing to show if self.showPatches == False or self.slide is None: return PatchCollection(ptches) #temp blobs from blob finding test. Only drawn once and the only displayed thing if self.tempBlobs is not None: ptches = [plt.Circle((blb.X, blb.Y), blb.radius, color = GUIConstants.TEMP_BLOB_FIND, linewidth = 1, fill = False) for blb in self.tempBlobs] #reset temp blobs self.tempBlobs = None #return patches, if none to show match_original needs to be false return PatchCollection(ptches, match_original=(len(ptches) != 0)) #draw predicted points from coordinate mapper lineWid = 1 if 6-self.slide.lvl < 1 else 6-self.slide.lvl if self.showPrediction and len(self.coordinateMapper.physPoints) >= 2: points, inds = self.slide.getPointsInBounds(self.coordinateMapper.predictedPoints()) ptches.extend( [plt.Circle(p, GUIConstants.FIDUCIAL_RADIUS/2**self.slide.lvl, color = GUIConstants.PREDICTED_POINTS, linewidth = lineWid, fill = False) for p in points] ) #draw fiducial labels, color blended by deviation if len(self.coordinateMapper.physPoints) > 2: deviations = self.coordinateMapper.squareErrors() #scale between 0 and 1 mind = min(deviations) maxd = max(deviations) deviations = [ (x - mind) / (maxd - mind) for x in deviations] else: deviations = [ 0, 0 ] good = mpl.colors.colorConverter.to_rgb(GUIConstants.FIDUCIAL) bad = mpl.colors.colorConverter.to_rgb(GUIConstants.FIDUCIAL_WORST) points, inds = self.slide.getPointsInBounds(self.coordinateMapper.pixelPoints) for i,p in enumerate(points): #blend color based on deviation d = deviations[inds[i]] col = tuple(d * x + (1-d) * y for x,y in zip(bad, good)) ptches.append( plt.Circle(p, GUIConstants.FIDUCIAL_RADIUS/2**self.slide.lvl, color = col, linewidth = lineWid, fill=False) ) #draw region of interest ptches.extend(self.getROIPatches()) #draw histogram blobs if self.histogramBlobs is not None and len(self.histogramBlobs) != 0: for i, blbs in enumerate(self.histogramBlobs): ptches.extend(blbs.getPatches(limitDraw, self.slide, self.histColors[i])) #draw blobs else: #draw all blob lists with their own color if self.drawAllBlobs == True: for j, blobs in enumerate(self.blobCollection): ptches.extend(blobs.getPatches(limitDraw, self.slide, GUIConstants.MULTI_BLOB[j])) #show only the current blob list else: ptches.extend(self.blobCollection[self.currentBlobs].getPatches(limitDraw, self.slide, GUIConstants.MULTI_BLOB[self.currentBlobs])) #return list of patches as a patch collection, if none match_original must be false return PatchCollection(ptches, match_original=(len(ptches) != 0)) def getROIPatches(self, newPoint = None, append = False): ptches = [] tROI = self.blobCollection[self.currentBlobs].getROI(newPoint, GUIConstants.ROI_DIST *2**self.slide.lvl, append) if len(tROI) > 1: verts = [] for roi in tROI: verts.append(self.slide.getLocalPoint(roi)) verts.append(self.slide.getLocalPoint(tROI[0])) ptches.append(mpl.patches.PathPatch(Path(verts, None), color = GUIConstants.ROI, fill = False)) return ptches def reportROI(self, point, append = False): ''' Handles ROI additions and removals based on position point: the point in global coordinates ''' self.blobCollection[self.currentBlobs].ROI = \ self.blobCollection[self.currentBlobs].getROI(point, GUIConstants.ROI_DIST *2**self.slide.lvl, append) def drawLabels(self, axes): ''' draw text labels on the supplied axis. Assume the axis is displaying the slide image and blobs of the current state of everything. ''' if self.slide is None or self.showPatches == False: return #fiducial labels lineWid = 1 if 6-self.slide.lvl < 1 else 6-self.slide.lvl #draw fiducial labels, color blended by deviation if len(self.coordinateMapper.physPoints) > 2: deviations = self.coordinateMapper.squareErrors() #scale between 0 and 1 mind = min(deviations) maxd = max(deviations) deviations = [ (x - mind) / (maxd - mind) for x in deviations] else: deviations = [ 0, 0 ] good = mpl.colors.colorConverter.to_rgb(GUIConstants.FIDUCIAL) bad = mpl.colors.colorConverter.to_rgb(GUIConstants.FIDUCIAL_WORST) points, inds = self.slide.getPointsInBounds(self.coordinateMapper.pixelPoints) for i,p in enumerate(points): #blend color based on deviation d = deviations[inds[i]] col = tuple(d * x + (1-d) * y for x,y in zip(bad, good)) axes.text(p[0] + GUIConstants.FIDUCIAL_RADIUS/2**self.slide.lvl, p[1] - GUIConstants.FIDUCIAL_RADIUS/2**self.slide.lvl, self.coordinateMapper.predictLabel(self.coordinateMapper.physPoints[inds[i]]), fontsize = lineWid + 6, fontweight='bold', color = col, bbox=dict(facecolor=GUIConstants.FIDUCIAL_LABEL_BKGRD)) #show group labels #hist blobs have no text if self.histogramBlobs is not None and len(self.histogramBlobs) != 0: pass #normal blobs can have group labels else: pass #show group names of all lists if self.drawAllBlobs == True: for blobs in self.blobCollection: self._drawBlobLabels(axes, blobs, lineWid) #show only the current list else: self._drawBlobLabels(axes, self.blobCollection[self.currentBlobs], lineWid) def _drawBlobLabels(self, axes, blobs, lineWid): ''' Helper method to draw blob labels onto the provided axis axes: matplotlib axes to draw text to blobs: blobList with labels to draw lineWid: the linewidth to use for drawing ''' #get grouplabels from blobs labels = list(blobs.groupLabels.keys()) pos = list(blobs.groupLabels.values()) if len(labels) != 0: points, inds = self.slide.getPointsInBounds(pos) for i,p in enumerate(points): #add offset from normal position axes.text(p[0]+GUIConstants.DEFAULT_RADIUS/2**self.slide.lvl, p[1]-GUIConstants.DEFAULT_RADIUS/2**self.slide.lvl, labels[inds[i]], fontsize=lineWid+6, color=GUIConstants.EXPANDED_TEXT) def reportInfoRequest(self, localPoint): ''' Handles a request for image/blob information at the supplied local point localPoint: (x,y) tuple of the query point in the local coordinate space of the slide image returns a string description of the point ''' #nothing to query against if self.slide is None: return "No slide loaded" point = self.slide.getGlobalPoint(localPoint) #if the histogram canvas is shown, highlight that blob's location if self.GUI is not None and self.GUI.showHist: #find blob if user clicked in bounds if self.blobCollection[self.currentBlobs] is not None and \ self.blobCollection[self.currentBlobs].length() > 0: points, inds = self.slide.getPointsInBounds(blob.blob.getXYList(self.blobCollection[self.currentBlobs].blobs)) found = False for i,p in enumerate(points): #see if click point is within radius if (localPoint[0]-p[0])**2 + (localPoint[1] - p[1])**2 <= \ (self.blobCollection[self.currentBlobs].blobs[inds[i]].radius/2**self.slide.lvl)**2: self.GUI.histCanvas.singleBlob = inds[i] found = True break #if not found, set to None if not found: self.GUI.histCanvas.singleBlob = None #get pixel color and alpha (discarded) try: r,g,b,a = self.slide.getImg().getpixel(localPoint) except IndexError: r,g,b = 0,0,0 #get the size and circ of an area > thresh if on blb view if self.showThreshold: area,circ = self.blobCollection[self.currentBlobs].blobFinder.getBlobCharacteristics(localPoint) return "x = %d, y = %d r,g,b = %d,%d,%d\tArea = %d\tCirc = %.2f"%(point[0], point[1], r, g, b, area, circ) #get fiducial localization error if in a fiducial fle = self.coordinateMapper.getFLE(point, GUIConstants.FIDUCIAL_RADIUS) if fle is not None: return "x = %d, y = %d r,g,b = %d,%d,%d FLE: %d"%(point[0], point[1], r, g, b, fle) #show rgb and x,y location return "x = %d, y = %d r,g,b = %d,%d,%d"%(point[0], point[1], r, g, b) def reportFiducialRequest(self, localPoint, removePoint, extras = None): ''' handles a fiducial request. localpoint: (x,y) tuple in the image coordinate system removePoint: boolean toggle. If true, the closest fiducial is removed extras: a debugging object to bypass GUI display. Must define text and ok ''' #no slide to register against if self.slide is None: return "No slide loaded" globalPos = self.slide.getGlobalPoint(localPoint) #shift RMB to remove closest fiducial if removePoint: if len(self.coordinateMapper.physPoints) == 0: return "No points to remove" self.coordinateMapper.removeClosest(globalPos) return "Removed fiducial" #get physical location from user else: #mapper returns predicted location predicted = self.coordinateMapper.predictName(globalPos) #prompt user if self.GUI is None and extras is None: return "No input provided" if extras is not None:#make this check first for debugging text = extras.text ok = extras.ok elif self.GUI is not None: text, ok = self.GUI.requestFiducialInput(predicted) if ok: #validate entry if self.coordinateMapper.isValidEntry(text): #add position to mapper dev = self.coordinateMapper.addPoints(globalPos, self.coordinateMapper.extractPoint(text)) if dev is None: return "%s added at %d,%d" % (text, globalPos[0], globalPos[1]) else: return "%s added at %d,%d (FLE: %d)" % (text, globalPos[0], globalPos[1], dev) else: return "Invalid entry: {}".format(text) def reportBlobRequest(self, localPoint, radius): ''' Tries to add the blob to the current blob list. If overlap with current blob, remove that point localPoint: (x,y) tuple in the image coordinate space radius: the radius of the new blob to be added ''' #no slide to add blobs onto if self.slide is None: return "No slide loaded" globalPnt = self.slide.getGlobalPoint(localPoint) added, removeInd = self.blobCollection[self.currentBlobs].blobRequest(globalPnt, radius) if added == True: if self.GUI is not None and self.GUI.showHist: self.GUI.toggleHistWindow() return "Adding blob at {}, {}".format(globalPnt[0], globalPnt[1]) else: if self.GUI is not None and self.GUI.showHist: self.GUI.histCanvas.removeBlob(removeInd) return "Removed blob at {}, {}".format(globalPnt[0], globalPnt[1]) def requestInstrumentMove(self, localPoint): ''' Handles requests for moving the connected instrument localPoint: (x,y) tuple in the current image coordinate system returns a string summarizing the effect of the action ''' #no slide is set up if self.slide is None: return "No slide loaded" #the connected instrument isn't initialized or present if self.coordinateMapper.connectedInstrument is None or \ not self.coordinateMapper.connectedInstrument.connected: return "Instrument not connected" #perform actual movement pixelPnt = self.slide.getGlobalPoint(localPoint) if len(self.coordinateMapper.physPoints) >= 2: motorPnt = self.coordinateMapper.translate(pixelPnt) self.coordinateMapper.connectedInstrument.moveToPositionXY(motorPnt) return "Moving to {:.0f}, {:.0f}".format(motorPnt[0], motorPnt[1]) #not enough registration points else: return "Not enough training points"
mit
llondon6/kerr_public
kerr/mapqnms.py
1
35883
# %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% # '''Class for boxes in complex frequency space''' # The routines of this class assist in the solving and classification of # QNM solutions # %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% # class cwbox: # ************************************************************* # # This is a class to fascilitate the solving of leaver's equations varying # the real and comlex frequency components, and optimizing over the separation constants. # ************************************************************* # def __init__(this, l,m, # QNM indeces cwr, # Center coordinate of real part cwc, # Center coordinate of imag part wid, # box width hig, # box height res = 50, # Number of gridpoints in each dimension parent = None, # Parent of current object sc = None, # optiional holder for separatino constant verbose = False, # be verbose maxn = None, # Overtones with n>maxn will be actively ignored. NOTE that by convention n>=0. smallboxes = True, # Toggle for using small boxes for new solutions **kwargs ): # from numpy import array,complex128,meshgrid,float128 # this.verbose,this.res = verbose,res # Store QNM ideces this.l,this.m = l,m # Set box params this.width,this.height = None,None this.setboxprops(cwr,cwc,wid,hig,res,sc=sc) # Initial a list of children: if a box contains multiple solutions, then it is split according to each solutions location this.children = [this] # Point the object to its parent this.parent = parent # this.__jf__ = [] # temp grid of separation constants this.__scgrid__ = [] # current value of scalarized work-function this.__lvrfmin__ = None # Dictionary for high-level data: the data of all of this object's children is collected here this.data = {} this.dataformat = '{ ... (l,m,n,tail_flag) : { "jf":[...],"cw":[...],"sc":[...],"lvrfmin":[...] } ... }' # Dictionary for low-level data: If this object is fundamental, then its data will be stored here in the same format as above this.__data__ = {} # QNM label: (l,m,n,t), NOTE that "t" is 0 if the QNM is not a power-law tail and 1 otherwise this.__label__ = () # Counter for the number of times map hass benn called on this object this.mapcount = 0 # Default value for temporary separation constant this.__sc__ = 4.0 # Maximum overtone label allowed. NOTE that by convention n>=0. this.__maxn__ = maxn # this.__removeme__ = False # this.__smallboxes__ = smallboxes ################################################################# '''************************************************************ # Set box params & separation constant center # ************************************************************''' ################################################################# def setboxprops(this,cwr,cwc,wid,hig,res,sc=None,data=None,pec=None): # import maths and other from numpy import complex128,float128,array,linspace import matplotlib.patches as patches # set props for box geometry this.center = array([cwr,cwc]) this.__cw__ = cwr + 1j*cwc # Store cw for convinience # Boxes may only shrink. NOTE that this is usefull as some poetntial solutions, or unwanted solutions may be reomved, and we want to avoid finding them again. NOTE that this would be nice to implement, but it currently brakes the root finding. this.width,this.height = float128( abs(wid) ),float128( abs(hig) ) # if (this.width is None) or (this.height is None): # this.width,this.height = float128( abs(wid) ),float128( abs(hig) ) # else: # this.width,this.height = min(float128( abs(wid) ),this.width),min(this.height,float128( abs(hig) )) this.limit = array([this.center[0]-this.width/2.0, # real min this.center[0]+this.width/2.0, # real max this.center[1]-this.height/2.0, # imag min this.center[1]+this.height/2.0]) # imag max this.wr_range = linspace( this.limit[0], this.limit[1], res ) this.wc_range = linspace( this.limit[2], this.limit[3], res ) # Set patch object for plotting. NOTE the negative sign exists here per convention if None is pec: pec = 'k' this.patch = patches.Rectangle( (min(this.limit[0:2]), min(-this.limit[2:4]) ), this.width, this.height, fill=False, edgecolor=pec, alpha=0.4, linestyle='dotted' ) # set holder for separation constant value if sc is not None: this.__sc__ = sc # Initiate the data holder for this box. The data holder will contain lists of spin, official cw and sc values if data is not None: this.data=data ################################################################# '''************************************************************ # Map the potential solutions in this box # ************************************************************''' ################################################################# def map(this,jf): # Import useful things from kerr import localmins # finds local minima of a 2D array from kerr.basics import alert,green,yellow,cyan,bold,magenta,blue from numpy import array,delete,ones #%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%# # Add the input jf to the list of jf values. NOTE that this is not the primary recommended list for referencing jf. Please use the "data" field instead. this.__jf__.append(jf) #%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%#%%# # if this.verbose: if this.parent is None: alert('\n\n# '+'--'*40+' #\n'+blue(bold('Attempting to map qnm solutions for: jf = %1.8f'%(jf)))+'\n# '+'--'*40+' #\n','map') else: print '\n# '+'..'*40+' #\n'+blue('jf = %1.8f, label = %s'%(jf,this.__label__))+'\n# '+'..'*40+' #' # Map solutions using discrete grid if this.isfundamental(): # Brute-force calculate solutions to leaver's equations if this.verbose: alert('Solvinq Leaver''s Eqns over grid','map') this.__x__,this.__scgrid__ = this.lvrgridsolve(jf) # Use a local-min finder to estimate the qnm locations for the grid of work function values, x if this.verbose: alert('Searching for local minima. Ignoring mins on boundaries.','map') this.__localmin__ = localmins(this.__x__,edge_ignore=True) if this.verbose: alert('Number of local minima found: %s.'%magenta('%i'%(len(array(this.__localmin__)[0]))),'map') # If needed, split the box into sub-boxes: Give the current box children! this.splitcenter() # NOTE that if there is only one lcal min, then no split takes place # So far QNM solutions have been estimates mthat have discretization error. Now, we wish to refine the # solutions using optimization. if this.verbose: alert('Refining QNM solution locations using a hybrid strategy.','map') this.refine(jf) else: # Map solutions for all children for child in [ k for k in this.children if this is not k ]: child.map(jf) # Collect QNM solution data for this BH spin. NOTE that only non-fundamental objects are curated if this.verbose: alert('Collecting final QNM solution information ...','map') this.curate(jf) # Remove duplicate solutions this.validatechildren() # if this.verbose: alert('Mapping of Kerr QNM with (l,m)=(%i,%i) within box now complete for this box.' % (this.l,this.m ) ,'map') # Some book-keeping on the number of times this object has been mapped this.mapcount += 1 # For the given bh spin, collect all QNM frequencies and separation constants within the current box # NOTE that the outputs are coincident lists def curate(this,jf): # from numpy import arange,array,sign # children = this.collectchildren() cwlist,sclist = [ child.__cw__ for child in children ],[ child.__sc__ for child in children ] if this.isfundamental(): cwlist.append( this.__cw__ ) sclist.append( this.__sc__ ) # sort the output lists by the imaginary part of the cw values sbn = lambda k: abs( cwlist[k].imag ) # Sort By Overtone(N) space = arange( len(cwlist) ) map_ = sorted( space, key=sbn ) std_cwlist = array( [ cwlist[k] for k in map_ ] ) std_sclist = array( [ sclist[k] for k in map_ ] ) # ---------------------------------------------------------- # # Separate positive, zero and negative frequency solutions # ---------------------------------------------------------- # # Solutions with frequencies less than this value will be considered to be power-laws pltol = 0.01 # Frequencies sorted_cw_pos = list( std_cwlist[ (sign(std_cwlist.real) == sign(this.m)) * (abs(std_cwlist.real)>pltol) ] ) sorted_cw_neg = list( std_cwlist[ (sign(std_cwlist.real) ==-sign(this.m)) * (abs(std_cwlist.real)>pltol) ] ) sorted_cw_zro = list( std_cwlist[ abs(std_cwlist.real)<=pltol ] ) # Create a dictionary between (cw,sc) and child objects A,B = {},{} for child in children: A[child] = ( child.__cw__, child.__sc__ ) B[ A[child] ] = child # def inferlabel( cwsc ): cw,sc = cwsc[0],cwsc[1] ll = this.l if abs(cw.real)<pltol : # power-law decay tt = 1 nn = sorted_cw_zro.index( cw ) mm = this.m else: tt = 0 if sign(this.m)==sign(cw.real): # prograde mm = this.m nn = sorted_cw_pos.index( cw ) else: # retrograde mm = -1 * this.m nn = sorted_cw_neg.index( cw ) # return (ll,mm,nn,tt) # ---------------------------------------------------------- # # Create a dictionary to keep track of potential solutions # ---------------------------------------------------------- # label = {} for child in children: cwsc = ( child.__cw__, child.__sc__ ) label[child] = inferlabel( cwsc ) child.__label__ = label[child] # this.label = label ''' IMPORTANT: Here it is assumed that the solutions will change in a continuous manner, and that after the first mapping, no new solutions are of interest, unless a box-split occurs. ''' # Store the high-level data product for child in children: L = this.label[child] if not L in this.data: this.data[ L ] = {} this.data[ L ][ 'jf' ] = [jf] this.data[ L ][ 'cw' ] = [ child.__cw__ ] this.data[ L ][ 'sc' ] = [ child.__sc__ ] this.data[ L ][ 'lvrfmin' ] = [ child.__lvrfmin__ ] else: this.data[ L ][ 'jf' ].append(jf) this.data[ L ][ 'cw' ].append(child.__cw__) this.data[ L ][ 'sc' ].append(child.__sc__) this.data[ L ][ 'lvrfmin' ].append(child.__lvrfmin__) # Store the information to this child also child.__data__['jf'] = this.data[ L ][ 'jf' ] child.__data__['cw'] = this.data[ L ][ 'cw' ] child.__data__['sc'] = this.data[ L ][ 'sc' ] child.__data__['lvrfmin'] = this.data[ L ][ 'lvrfmin' ] # Refine the box center using fminsearch def refine(this,jf): # Import useful things from numpy import complex128,array,linalg,log,exp,abs from scipy.optimize import fmin,root,fmin_tnc,fmin_slsqp from kerr.pttools import leaver_workfunction,scberti from kerr.basics import alert,say,magenta,bold,green,cyan,yellow from kerr import localmins # finds local minima of a 2D array # if this.isfundamental(): # use the box center for refined minimization CW = complex128( this.center[0] + 1j*this.center[1] ) # SC = this.__sc__ SC = scberti( CW*jf, this.l, this.m ) state = [ CW.real,CW.imag, SC.real,SC.imag ] # retrycount,maxretrycount,done = -1,1,False while done is False: # retrycount += 1 # if retrycount==0: alert(cyan('* Constructing guess using scberti-grid or extrap.'),'refine') state = this.guess(jf,gridguess=state) else: alert(cyan('* Constructing guess using 4D-grid or extrap.'),'refine') state = this.guess(jf) # Solve leaver's equations using a hybrid strategy cw,sc,this.__lvrfmin__,retry = this.lvrsolve(jf,state) # If the root finder had some trouble, then mark this box with a warning (for plotting) done = (not retry) or (retrycount>=maxretrycount) # if retry: newres = 2*this.res if this.verbose: msg = yellow( 'The current function value is %s. Retrying root finding for %ind time with higher resolution pre-grid, and brute-force 4D.'%(this.__lvrfmin__, retrycount+2) ) alert(msg,'refine') # say('Retrying.','refine') # Increase the resolution of the box this.setboxprops(this.__cw__.real,this.__cw__.imag,this.width,this.height,newres,sc=this.__sc__) # NOTE that the commented out code below is depreciated by the use of guess() above. # # Brute force solve again # this.__x__,this.__scgrid__ = this.lvrgridsolve(jf,fullopt=True) # # Use the first local min as a guess # this.__localmin__ = localmins(this.__x__,edge_ignore=True) # state = this.grids2states()[0] # if this.verbose: print X.message+' The final function value is %s'%(this.__lvrfmin__) if this.verbose: print 'The final function value is '+green(bold('%s'%(this.__lvrfmin__))) if this.verbose: print '\n\t Geuss cw: %s' % CW print '\t Optimal cw: %s' % cw print '\t Approx sc: %s' % scberti( CW*jf, this.l, this.m ) print '\t Geuss sc: %s' % (state[2]+1j*state[3]) print '\t Optimal sc: %s\n' % sc # Set the core properties of the new box this.setboxprops( cw.real, cw.imag, this.width,this.height,this.res,sc=sc ) # Rescale this object's boxes based on new centers this.parent.sensescale() else: # for child in [ k for k in this.children if this is not k ]: child.refine(jf) # Determine if the current object has more than itself as a child def isfundamental(this): return len(this.children) is 1 # ************************************************************* # # Determin whether to split this box into sub-boxes (i.e. children) # and if needed, split # ************************************************************* # def splitcenter(this): from numpy import array,zeros,linalg,inf,mean,amax,amin,sqrt from kerr.basics import magenta,bold,alert,error,red,warning,yellow mins = this.__localmin__ num_solutions = len(array(mins)[0]) if num_solutions > 1: # Split the box # for each min for k in range(len(mins[0])): # construct the center location kr = mins[1][k]; wr = this.wr_range[ kr ] kc = mins[0][k]; wc = this.wc_range[ kc ] sc = this.__scgrid__[kr,kc] # Determine the resolution of the new box res = int( max( 20, 1.5*float(this.res)/num_solutions ) ) # Create the new child. NOTE that the child's dimensions will be set below using a standard method. child = cwbox( this.l,this.m,wr,wc,0,0, res, parent=this, sc=sc, verbose=this.verbose ) # Add the new box to the current box's child list this.children.append( child ) # NOTE that here we set the box dimensions of all children using the relative distances between them this.sensescale() # Now redefine the box size to contain all children # NOTE that this step exists only to ensure that the box always contains all of its children's centers children = this.collectchildren() wr = array( [ child.center[0] for child in children ] ) wc = array( [ child.center[1] for child in children ] ) width = amax(wr)-amin(wr) height = amax(wc)-amin(wc) cwr = mean(wr) cwc = mean(wc) this.setboxprops( cwr,cwc,width,height,this.res,sc=sc ) elif num_solutions == 1: # construcut the center location k = 0 # there should be only one local min kr = mins[1][k] kc = mins[0][k] wr = this.wr_range[ kr ] wc = this.wc_range[ kc ] # retrieve associated separation constant sc = this.__scgrid__[kr,kc] # Recenter the box on the current min this.setboxprops(wr,wc,this.width,this.height,this.res,sc=sc) else: # if len(this.__jf__)>3: alert('Invalid number of local minima found: %s.'% (magenta(bold('%s'%num_solutions))), 'splitcenter' ) # Use the extrapolated values as a guess? alert(yellow('Now trying to use extrapolation, wrather than grid guess, to center the current box.'),'splitcenter') # guess = this.guess(this.__jf__[-1],gridguess=[1.0,1.0,4.0,1.0]) wr,wc,cr,cc = guess[0],guess[1],guess[2],guess[3] sc = cr+1j*cc # Recenter the box on the current min this.setboxprops(wr,wc,this.width,this.height,this.res,sc=sc) else: warning('Invalid number of local minima found: %s. This box will be removed. NOTE that this may not be what you want, and further inspection may be warranted.'% (magenta(bold('%s'%num_solutions))), 'splitcenter' ) this.__removeme__ = True # Validate children: Remove duplicates def validatechildren(this): # from numpy import linalg,array from kerr import alert,yellow,cyan,blue,magenta tol = 1e-5 # if not this.isfundamental(): # children = this.collectchildren() initial_count = len(children) # Remove identical twins for a,tom in enumerate( children ): for b,tim in enumerate( children ): if b>a: if linalg.norm(array(tom.center)-array(tim.center)) < tol: tim.parent.children.remove(tim) del tim break # Remove overtones over the max label if this.__maxn__ is not None: for k,child in enumerate(this.collectchildren()): if child.__label__[2] > this.__maxn__: if this.verbose: msg = 'Removing overtone '+yellow('%s'%list(child.__label__))+' becuase its label is higher than the allowed value specified.' alert(msg,'validatechildren') this.label.pop( child.__label__ , None) child.parent.children.remove(child) del child # Remove all boxes marked for deletion for child in this.collectchildren(): if child.__removeme__: this.label.pop( child.__label__, None ) child.parent.children.remove( child ) del child # final_count = len( this.collectchildren() ) # if this.verbose: if final_count != initial_count: alert( yellow('%i children have been removed, and %i remain.') % (-final_count+initial_count,final_count) ,'validatechildren') else: alert( 'All children have been deemed valid.', 'validatechildren' ) # Method for collecting all fundamental children def collectchildren(this,children=None): # if children is None: children = [] # if this.isfundamental(): children.append(this) else: for child in [ k for k in this.children if k is not this ]: children += child.collectchildren() # return children # Method to plot solutions def plot(this,fig=None,show=False,showlabel=False): # from numpy import array,amin,amax,sign from matplotlib.pyplot import plot,xlim,ylim,xlabel,ylabel,title,figure,gca,text from matplotlib.pyplot import show as show_ # children = this.collectchildren() wr = array( [ child.center[0] for child in children ] ) wc =-array( [ child.center[1] for child in children ] ) wr_min,wr_max = amin(wr),amax(wr) wc_min,wc_max = amin(wc),amax(wc) padscale = 0.15 padr,padc = 1.5*padscale*(wr_max-wr_min), padscale*(wc_max-wc_min) wr_min -= padr; wr_max += padr wc_min -= padc; wc_max += padc # if fig is None: # fig = figure( figsize=12*array((wr_max-wr_min, wc_max-wc_min))/(wr_max-wr_min), dpi=200, facecolor='w', edgecolor='k' ) fig = figure( figsize=12.0*array((4.5, 3))/4.0, dpi=200, facecolor='w', edgecolor='k' ) # xlim( [wr_min,wr_max] ) ylim( [wc_min,wc_max] ) ax = gca() # for child in children: plot( child.center[0],-child.center[1], '+k', ms=10 ) ax.add_patch( child.patch ) if showlabel: text( child.center[0]+sign(child.center[0])*child.width/2,-(child.center[1]+child.height/2), '$(%i,%i,%i,%i)$'%(this.label[child]), ha=('right' if sign(child.center[0])<0 else 'left' ), fontsize=10, alpha=0.9 ) # xlabel(r'$\mathrm{re}\;\tilde\omega_{%i%i}$'%(this.l,this.m)) ylabel(r'-$\mathrm{im}\;\tilde\omega_{%i%i}$'%(this.l,this.m)) title(r'$j_f = %1.6f$'%this.__jf__[-1],fontsize=18) # if show: show_() # ************************************************************* # # Solve leaver's equations in a given box=[wr_range,wc_range] # NOTE that the box is a list, not an array # ************************************************************* # def lvrgridsolve(this,jf=0,fullopt=False): # Import maths from numpy import linalg,complex128,ones,array from kerr.pttools import scberti from kerr.pttools import leaver_workfunction from scipy.optimize import fmin,root import sys # Pre-allocate an array that will hold work function values x = ones( ( this.wc_range.size,this.wr_range.size ) ) # Pre-allocate an array that will hold sep const vals scgrid = ones( ( this.wc_range.size,this.wc_range.size ), dtype=complex128 ) # Solve over the grid for i,wr in enumerate( this.wr_range ): for j,wc in enumerate( this.wc_range ): # Costruct the complex frequency for this i and j cw = complex128( wr+1j*wc ) # # Define the intermediate work function to be used for this iteration # fun = lambda SC: linalg.norm( array(leaver_workfunction( jf,this.l,this.m, [cw.real,cw.imag,SC[0],SC[1]] )) ) # # For this complex frequency, optimize over separation constant using initial guess # SC0_= scberti( cw*jf, this.l, this.m ) # Use Berti's analytic prediction as a guess # SC0 = [SC0_.real,SC0_.imag] # X = fmin( fun, SC0, disp=False, full_output=True, maxiter=1 ) # # Store work function value # x[j][i] = X[1] # # Store sep const vals # scgrid[j][i] = X[0][0] + 1j*X[0][1] if fullopt is False: # Define the intermediate work function to be used for this iteration fun = lambda SC: linalg.norm( array(leaver_workfunction( jf,this.l,this.m, [cw.real,cw.imag,SC[0],SC[1]] )) ) # For this complex frequency, optimize over separation constant using initial guess SC0_= scberti( cw*jf, this.l, this.m ) # Use Berti's analytic prediction as a guess SC0 = [SC0_.real,SC0_.imag] # Store work function value x[j][i] = fun(SC0) # Store sep const vals scgrid[j][i] = SC0_ else: SC0_= scberti( cw*jf, this.l, this.m ) # Use Berti's analytic prediction as a guess SC0 = [SC0_.real,SC0_.imag,0,0] #cfun = lambda Y: [ Y[0]+abs(Y[3]), Y[1]+abs(Y[2]) ] fun = lambda SC:leaver_workfunction( jf,this.l,this.m, [cw.real,cw.imag,SC[0],SC[1]] ) X = root( fun, SC0 ) scgrid[j][i] = X.x[0]+1j*X.x[1] x[j][i] = linalg.norm( array(X.fun) ) if this.verbose: sys.stdout.flush() print '.', if this.verbose: print 'Done.' # return work function values AND the optimal separation constants return x,scgrid # Convert output of localmin to a state vector for minimization def grids2states(this): # from numpy import complex128 state = [] # for k in range( len(this.__localmin__[0]) ): # kr,kc = this.__localmin__[1][k], this.__localmin__[0][k] cw = complex128( this.wr_range[kr] + 1j*this.wc_range[kc] ) sc = complex128( this.__scgrid__[kr,kc] ) # state.append( [cw.real,cw.imag,sc.real,sc.imag] ) # return state # Get guess either from local min, or from extrapolation of past data def guess(this,jf,gridguess=None): # from kerr.pttools import leaver_workfunction from kerr.basics import alert,magenta,apolyfit from kerr import localmins from numpy import array,linalg,arange,complex128,allclose,nan from scipy.interpolate import InterpolatedUnivariateSpline as spline # Get a guess from the localmin if gridguess is None: this.__x__,this.__scgrid__ = this.lvrgridsolve(jf,fullopt=True) this.__localmin__ = localmins(this.__x__,edge_ignore=True) guess1 = this.grids2states()[0] else: guess1 = gridguess # Get a guess from extrapolation ( performed in curate() ) guess2 = [ v for v in guess1 ] if this.mapcount > 3: # if there are three map points, try to use polynomial fitting to determine the state at the current jf value nn = len(this.__data__['jf']) order = min(2,nn) # xx = array(this.__data__['jf'])[-4:] # yy = array(this.__data__['cw'])[-4:] yr = apolyfit( xx, yy.real, order )(jf) yc = apolyfit( yy.real, yy.imag, order )(yr) cw = complex128( yr + 1j*yc ) # zz = array(this.__data__['sc'])[-4:] zr = apolyfit( xx, zz.real, order )(jf) zc = apolyfit( zz.real, zz.imag, order )(zr) sc = complex128( zr + 1j*zc ) # guess2 = [ cw.real, cw.imag, sc.real, sc.imag ] # Determine the best guess if not ( allclose(guess1,guess2) ): x1 = linalg.norm( leaver_workfunction( jf,this.l,this.m, guess1 ) ) x2 = linalg.norm( leaver_workfunction( jf,this.l,this.m, guess2 ) ) alert(magenta('The function value at guess from grid is: %s'%x1),'guess') alert(magenta('The function value at guess from extrap is: %s'%x2),'guess') if x2 is nan: x2 = 100.0*x1 if x1<x2: guess = guess1 alert(magenta('Using the guess from the grid.'),'guess') else: guess = guess2 alert(magenta('Using the guess from extrapolation.'),'guess') else: x1 = linalg.norm( leaver_workfunction( jf,this.l,this.m, guess1 ) ) guess = guess1 alert(magenta('The function value at guess from grid is %s'%x1),'guess') # Return the guess solution return guess # Determine whether the current box contains a complex frequency given an iterable whose first two entries are the real and imag part of the complex frequency def contains(this,guess): # cwrmin = min( this.limit[:2] ) cwrmax = max( this.limit[:2] ) cwcmin = min( this.limit[2:] ) cwcmax = max( this.limit[2:] ) # isin = True isin = isin and ( guess[0]<cwrmax ) isin = isin and ( guess[0]>cwrmin ) isin = isin and ( guess[1]<cwcmax ) isin = isin and ( guess[1]>cwcmin ) # return isin # Try solving the 4D equation near a single guess value [ cw.real cw.imag sc.real sc.imag ] def lvrsolve(this,jf,guess,tol=1e-8): # Import Maths from numpy import log,exp,linalg,array from scipy.optimize import root,fmin,minimize from kerr.pttools import leaver_workfunction from kerr import alert,red # Try using root # Define the intermediate work function to be used for this iteration fun = lambda STATE: log( 1.0 + abs(array(leaver_workfunction( jf,this.l,this.m, STATE ))) ) X = root( fun, guess, tol=tol ) cw1,sc1 = X.x[0]+1j*X.x[1], X.x[2]+1j*X.x[3] __lvrfmin1__ = linalg.norm(array( exp(X.fun)-1.0 )) retry1 = ( 'not making good progress' in X.message.lower() ) or ( 'error' in X.message.lower() ) # Try using fmin # Define the intermediate work function to be used for this iteration fun = lambda STATE: log(linalg.norm( leaver_workfunction( jf,this.l,this.m, STATE ) )) X = fmin( fun, guess, disp=False, full_output=True, ftol=tol ) cw2,sc2 = X[0][0]+1j*X[0][1], X[0][2]+1j*X[0][3] __lvrfmin2__ = exp(X[1]) retry2 = this.__lvrfmin__ > 1e-3 # Use the solution that converged the fastest to avoid solutions that have wandered significantly from the initial guess OR use the solution with the smallest fmin if __lvrfmin1__ < __lvrfmin2__ : # use the fmin value for convenience cw,sc,retry = cw1,sc1,retry1 __lvrfmin__ = __lvrfmin1__ else: cw,sc,retry = cw2,sc2,retry2 __lvrfmin__ = __lvrfmin2__ if not this.contains( [cw.real,cw.imag] ): alert(red('Trial solution found to be outside of box. I will now try to use a bounded solver, but the performance may be suboptimal.'),'lvrsolve') s = 2.0 cwrmin = min( this.center[0]-this.width/s, this.center[0]+this.width/s ) cwrmax = max( this.center[0]-this.width/s, this.center[0]+this.width/s ) cwcmin = min( this.center[1]-this.height/s, this.center[1]+this.height/s ) cwcmax = max( this.center[1]-this.height/s, this.center[1]+this.height/s ) scrmin = min( this.__sc__.real-this.width/s, this.__sc__.real+this.width/s ) scrmax = max( this.__sc__.real-this.width/s, this.__sc__.real+this.width/s ) sccmin = min( this.__sc__.imag-this.height/s, this.__sc__.imag+this.height/s ) sccmax = max( this.__sc__.imag-this.height/s, this.__sc__.imag+this.height/s ) bounds = [ (cwrmin,cwrmax), (cwcmin,cwcmax), (scrmin,scrmax), (sccmin,sccmax) ] # Try using minimize # Define the intermediate work function to be used for this iteration fun = lambda STATE: log(linalg.norm( leaver_workfunction( jf,this.l,this.m, STATE ) )) X = minimize( fun, guess, options={'disp':False}, tol=tol, bounds=bounds ) cw,sc = X.x[0]+1j*X.x[1], X.x[2]+1j*X.x[3] __lvrfmin__ = exp(X.fun) # Always retry if the solution is outside of the box if not this.contains( [cw.real,cw.imag] ): retry = True alert(red('Retrying because the trial solution is outside of the box.'),'lvrsolve') # Don't retry if fval is small if __lvrfmin__ > 1e-3: retry = True alert(red('Retrying because the trial fmin value is greater than 1e-3.'),'lvrsolve') # Don't retry if fval is small if retry and (__lvrfmin__ < 1e-4): retry = False alert(red('Not retrying becuase the fmin value is low.'),'lvrsolve') # Return the solution return cw,sc,__lvrfmin__,retry # Given a box's children, resize the boxes relative to child locations: no boxes overlap def sensescale(this): # from numpy import array,inf,linalg,sqrt from kerr import alert # children = this.collectchildren() # Let my people know. if this.verbose: alert('Sensing the scale of the current object\'s sub-boxes.','sensescale') # Determine the distance between this min, and its closest neighbor scalar = sqrt(2) if (not this.__smallboxes__) else 2.0*sqrt(2.0) for tom in children: d = inf for jerry in [ kid for kid in children if kid is not tom ]: r = array(tom.center) r_= array(jerry.center) d_= linalg.norm(r_-r) if d_ < d: d = d_ # Use the smallest distance found to determine a box size s = d/scalar width = s; height = s; res = int( max( 20, 1.5*float(this.res)/len(children) ) ) if (len(children)>1) else this.res # Define the new box size for this child tom.setboxprops( tom.center[0], tom.center[1], width, height, res )
mit
jagill/treeano
examples/sparsity_penalty/mnist_mlp.py
3
3782
from __future__ import division, absolute_import from __future__ import print_function, unicode_literals import itertools import numpy as np import sklearn.datasets import sklearn.cross_validation import sklearn.metrics import theano import theano.tensor as T import treeano import treeano.nodes as tn import canopy from treeano.sandbox.nodes import kl_sparsity_penalty as sp fX = theano.config.floatX # ############################### prepare data ############################### mnist = sklearn.datasets.fetch_mldata('MNIST original') # theano has a constant float type that it uses (float32 for GPU) # also rescaling to [0, 1] instead of [0, 255] X = mnist['data'].astype(fX) / 255.0 y = mnist['target'].astype("int32") X_train, X_valid, y_train, y_valid = sklearn.cross_validation.train_test_split( X, y, random_state=42) in_train = {"x": X_train, "y": y_train} in_valid = {"x": X_valid, "y": y_valid} # ############################## prepare model ############################## model = tn.HyperparameterNode( "model", tn.SequentialNode( "seq", [tn.InputNode("x", shape=(None, 28 * 28)), tn.DenseNode("fc1"), tn.SigmoidNode("sigmoid1"), sp.AuxiliaryKLSparsityPenaltyNode("sp1", cost_weight=1e1), tn.DropoutNode("do1"), tn.DenseNode("fc2"), tn.SigmoidNode("sigmoid2"), sp.AuxiliaryKLSparsityPenaltyNode("sp2", cost_weight=1e1), tn.DropoutNode("do2"), tn.DenseNode("fc3", num_units=10), tn.SoftmaxNode("pred"), tn.TotalCostNode( "cost", {"pred": tn.IdentityNode("pred_id"), "target": tn.InputNode("y", shape=(None,), dtype="int32")}, cost_function=treeano.utils.categorical_crossentropy_i32), tn.InputElementwiseSumNode("total_cost")]), num_units=512, sparsity=0.1, cost_reference="total_cost", dropout_probability=0.5, inits=[treeano.inits.XavierNormalInit()], ) with_updates = tn.HyperparameterNode( "with_updates", tn.AdamNode( "adam", {"subtree": model, "cost": tn.ReferenceNode("cost_ref", reference="total_cost")}), ) network = with_updates.network() network.build() # build eagerly to share weights BATCH_SIZE = 500 valid_fn = canopy.handled_fn( network, [canopy.handlers.time_call(key="valid_time"), canopy.handlers.override_hyperparameters(dropout_probability=0), canopy.handlers.chunk_variables(batch_size=BATCH_SIZE, variables=["x", "y"])], {"x": "x", "y": "y"}, {"total_cost": "total_cost", "pred": "pred"}) def validate(in_dict, results_dict): valid_out = valid_fn(in_valid) probabilities = valid_out["pred"] predicted_classes = np.argmax(probabilities, axis=1) results_dict["valid_cost"] = valid_out["total_cost"] results_dict["valid_time"] = valid_out["valid_time"] results_dict["valid_accuracy"] = sklearn.metrics.accuracy_score( y_valid, predicted_classes) train_fn = canopy.handled_fn( network, [canopy.handlers.time_call(key="total_time"), canopy.handlers.call_after_every(1, validate), canopy.handlers.time_call(key="train_time"), canopy.handlers.chunk_variables(batch_size=BATCH_SIZE, variables=["x", "y"])], {"x": "x", "y": "y"}, {"train_cost": "total_cost", "train_sp_cost1": "sp1_sendto", "train_sp_cost2": "sp2_sendto", "train_classification_cost": "cost"}, include_updates=True) # ################################# training ################################# print("Starting training...") canopy.evaluate_until(fn=train_fn, gen=itertools.repeat(in_train), max_iters=25)
apache-2.0
matbra/bokeh
bokeh/compat/mplexporter/renderers/base.py
44
14355
import warnings import itertools from contextlib import contextmanager import numpy as np from matplotlib import transforms from .. import utils from .. import _py3k_compat as py3k class Renderer(object): @staticmethod def ax_zoomable(ax): return bool(ax and ax.get_navigate()) @staticmethod def ax_has_xgrid(ax): return bool(ax and ax.xaxis._gridOnMajor and ax.yaxis.get_gridlines()) @staticmethod def ax_has_ygrid(ax): return bool(ax and ax.yaxis._gridOnMajor and ax.yaxis.get_gridlines()) @property def current_ax_zoomable(self): return self.ax_zoomable(self._current_ax) @property def current_ax_has_xgrid(self): return self.ax_has_xgrid(self._current_ax) @property def current_ax_has_ygrid(self): return self.ax_has_ygrid(self._current_ax) @contextmanager def draw_figure(self, fig, props): if hasattr(self, "_current_fig") and self._current_fig is not None: warnings.warn("figure embedded in figure: something is wrong") self._current_fig = fig self._fig_props = props self.open_figure(fig=fig, props=props) yield self.close_figure(fig=fig) self._current_fig = None self._fig_props = {} @contextmanager def draw_axes(self, ax, props): if hasattr(self, "_current_ax") and self._current_ax is not None: warnings.warn("axes embedded in axes: something is wrong") self._current_ax = ax self._ax_props = props self.open_axes(ax=ax, props=props) yield self.close_axes(ax=ax) self._current_ax = None self._ax_props = {} @contextmanager def draw_legend(self, legend, props): self._current_legend = legend self._legend_props = props self.open_legend(legend=legend, props=props) yield self.close_legend(legend=legend) self._current_legend = None self._legend_props = {} # Following are the functions which should be overloaded in subclasses def open_figure(self, fig, props): """ Begin commands for a particular figure. Parameters ---------- fig : matplotlib.Figure The Figure which will contain the ensuing axes and elements props : dictionary The dictionary of figure properties """ pass def close_figure(self, fig): """ Finish commands for a particular figure. Parameters ---------- fig : matplotlib.Figure The figure which is finished being drawn. """ pass def open_axes(self, ax, props): """ Begin commands for a particular axes. Parameters ---------- ax : matplotlib.Axes The Axes which will contain the ensuing axes and elements props : dictionary The dictionary of axes properties """ pass def close_axes(self, ax): """ Finish commands for a particular axes. Parameters ---------- ax : matplotlib.Axes The Axes which is finished being drawn. """ pass def open_legend(self, legend, props): """ Beging commands for a particular legend. Parameters ---------- legend : matplotlib.legend.Legend The Legend that will contain the ensuing elements props : dictionary The dictionary of legend properties """ pass def close_legend(self, legend): """ Finish commands for a particular legend. Parameters ---------- legend : matplotlib.legend.Legend The Legend which is finished being drawn """ pass def draw_marked_line(self, data, coordinates, linestyle, markerstyle, label, mplobj=None): """Draw a line that also has markers. If this isn't reimplemented by a renderer object, by default, it will make a call to BOTH draw_line and draw_markers when both markerstyle and linestyle are not None in the same Line2D object. """ if linestyle is not None: self.draw_line(data, coordinates, linestyle, label, mplobj) if markerstyle is not None: self.draw_markers(data, coordinates, markerstyle, label, mplobj) def draw_line(self, data, coordinates, style, label, mplobj=None): """ Draw a line. By default, draw the line via the draw_path() command. Some renderers might wish to override this and provide more fine-grained behavior. In matplotlib, lines are generally created via the plt.plot() command, though this command also can create marker collections. Parameters ---------- data : array_like A shape (N, 2) array of datapoints. coordinates : string A string code, which should be either 'data' for data coordinates, or 'figure' for figure (pixel) coordinates. style : dictionary a dictionary specifying the appearance of the line. mplobj : matplotlib object the matplotlib plot element which generated this line """ pathcodes = ['M'] + (data.shape[0] - 1) * ['L'] pathstyle = dict(facecolor='none', **style) pathstyle['edgecolor'] = pathstyle.pop('color') pathstyle['edgewidth'] = pathstyle.pop('linewidth') self.draw_path(data=data, coordinates=coordinates, pathcodes=pathcodes, style=pathstyle, mplobj=mplobj) @staticmethod def _iter_path_collection(paths, path_transforms, offsets, styles): """Build an iterator over the elements of the path collection""" N = max(len(paths), len(offsets)) if not path_transforms: path_transforms = [np.eye(3)] edgecolor = styles['edgecolor'] if np.size(edgecolor) == 0: edgecolor = ['none'] facecolor = styles['facecolor'] if np.size(facecolor) == 0: facecolor = ['none'] elements = [paths, path_transforms, offsets, edgecolor, styles['linewidth'], facecolor] it = itertools return it.islice(py3k.zip(*py3k.map(it.cycle, elements)), N) def draw_path_collection(self, paths, path_coordinates, path_transforms, offsets, offset_coordinates, offset_order, styles, mplobj=None): """ Draw a collection of paths. The paths, offsets, and styles are all iterables, and the number of paths is max(len(paths), len(offsets)). By default, this is implemented via multiple calls to the draw_path() function. For efficiency, Renderers may choose to customize this implementation. Examples of path collections created by matplotlib are scatter plots, histograms, contour plots, and many others. Parameters ---------- paths : list list of tuples, where each tuple has two elements: (data, pathcodes). See draw_path() for a description of these. path_coordinates: string the coordinates code for the paths, which should be either 'data' for data coordinates, or 'figure' for figure (pixel) coordinates. path_transforms: array_like an array of shape (*, 3, 3), giving a series of 2D Affine transforms for the paths. These encode translations, rotations, and scalings in the standard way. offsets: array_like An array of offsets of shape (N, 2) offset_coordinates : string the coordinates code for the offsets, which should be either 'data' for data coordinates, or 'figure' for figure (pixel) coordinates. offset_order : string either "before" or "after". This specifies whether the offset is applied before the path transform, or after. The matplotlib backend equivalent is "before"->"data", "after"->"screen". styles: dictionary A dictionary in which each value is a list of length N, containing the style(s) for the paths. mplobj : matplotlib object the matplotlib plot element which generated this collection """ if offset_order == "before": raise NotImplementedError("offset before transform") for tup in self._iter_path_collection(paths, path_transforms, offsets, styles): (path, path_transform, offset, ec, lw, fc) = tup vertices, pathcodes = path path_transform = transforms.Affine2D(path_transform) vertices = path_transform.transform(vertices) # This is a hack: if path_coordinates == "figure": path_coordinates = "points" style = {"edgecolor": utils.color_to_hex(ec), "facecolor": utils.color_to_hex(fc), "edgewidth": lw, "dasharray": "10,0", "alpha": styles['alpha'], "zorder": styles['zorder']} self.draw_path(data=vertices, coordinates=path_coordinates, pathcodes=pathcodes, style=style, offset=offset, offset_coordinates=offset_coordinates, mplobj=mplobj) def draw_markers(self, data, coordinates, style, label, mplobj=None): """ Draw a set of markers. By default, this is done by repeatedly calling draw_path(), but renderers should generally overload this method to provide a more efficient implementation. In matplotlib, markers are created using the plt.plot() command. Parameters ---------- data : array_like A shape (N, 2) array of datapoints. coordinates : string A string code, which should be either 'data' for data coordinates, or 'figure' for figure (pixel) coordinates. style : dictionary a dictionary specifying the appearance of the markers. mplobj : matplotlib object the matplotlib plot element which generated this marker collection """ vertices, pathcodes = style['markerpath'] pathstyle = dict((key, style[key]) for key in ['alpha', 'edgecolor', 'facecolor', 'zorder', 'edgewidth']) pathstyle['dasharray'] = "10,0" for vertex in data: self.draw_path(data=vertices, coordinates="points", pathcodes=pathcodes, style=pathstyle, offset=vertex, offset_coordinates=coordinates, mplobj=mplobj) def draw_text(self, text, position, coordinates, style, text_type=None, mplobj=None): """ Draw text on the image. Parameters ---------- text : string The text to draw position : tuple The (x, y) position of the text coordinates : string A string code, which should be either 'data' for data coordinates, or 'figure' for figure (pixel) coordinates. style : dictionary a dictionary specifying the appearance of the text. text_type : string or None if specified, a type of text such as "xlabel", "ylabel", "title" mplobj : matplotlib object the matplotlib plot element which generated this text """ raise NotImplementedError() def draw_path(self, data, coordinates, pathcodes, style, offset=None, offset_coordinates="data", mplobj=None): """ Draw a path. In matplotlib, paths are created by filled regions, histograms, contour plots, patches, etc. Parameters ---------- data : array_like A shape (N, 2) array of datapoints. coordinates : string A string code, which should be either 'data' for data coordinates, 'figure' for figure (pixel) coordinates, or "points" for raw point coordinates (useful in conjunction with offsets, below). pathcodes : list A list of single-character SVG pathcodes associated with the data. Path codes are one of ['M', 'm', 'L', 'l', 'Q', 'q', 'T', 't', 'S', 's', 'C', 'c', 'Z', 'z'] See the SVG specification for details. Note that some path codes consume more than one datapoint (while 'Z' consumes none), so in general, the length of the pathcodes list will not be the same as that of the data array. style : dictionary a dictionary specifying the appearance of the line. offset : list (optional) the (x, y) offset of the path. If not given, no offset will be used. offset_coordinates : string (optional) A string code, which should be either 'data' for data coordinates, or 'figure' for figure (pixel) coordinates. mplobj : matplotlib object the matplotlib plot element which generated this path """ raise NotImplementedError() def draw_image(self, imdata, extent, coordinates, style, mplobj=None): """ Draw an image. Parameters ---------- imdata : string base64 encoded png representation of the image extent : list the axes extent of the image: [xmin, xmax, ymin, ymax] coordinates: string A string code, which should be either 'data' for data coordinates, or 'figure' for figure (pixel) coordinates. style : dictionary a dictionary specifying the appearance of the image mplobj : matplotlib object the matplotlib plot object which generated this image """ raise NotImplementedError()
bsd-3-clause
zihua/scikit-learn
sklearn/metrics/classification.py
3
71852
"""Metrics to assess performance on classification task given class prediction Functions named as ``*_score`` return a scalar value to maximize: the higher the better Function named as ``*_error`` or ``*_loss`` return a scalar value to minimize: the lower the better """ # Authors: Alexandre Gramfort <[email protected]> # Mathieu Blondel <[email protected]> # Olivier Grisel <[email protected]> # Arnaud Joly <[email protected]> # Jochen Wersdorfer <[email protected]> # Lars Buitinck # Joel Nothman <[email protected]> # Noel Dawe <[email protected]> # Jatin Shah <[email protected]> # Saurabh Jha <[email protected]> # Bernardo Stein <[email protected]> # License: BSD 3 clause from __future__ import division import warnings import numpy as np from scipy.sparse import coo_matrix from scipy.sparse import csr_matrix from ..preprocessing import LabelBinarizer, label_binarize from ..preprocessing import LabelEncoder from ..utils import assert_all_finite from ..utils import check_array from ..utils import check_consistent_length from ..utils import column_or_1d from ..utils.multiclass import unique_labels from ..utils.multiclass import type_of_target from ..utils.validation import _num_samples from ..utils.sparsefuncs import count_nonzero from ..utils.fixes import bincount from ..exceptions import UndefinedMetricWarning def _check_targets(y_true, y_pred): """Check that y_true and y_pred belong to the same classification task This converts multiclass or binary types to a common shape, and raises a ValueError for a mix of multilabel and multiclass targets, a mix of multilabel formats, for the presence of continuous-valued or multioutput targets, or for targets of different lengths. Column vectors are squeezed to 1d, while multilabel formats are returned as CSR sparse label indicators. Parameters ---------- y_true : array-like y_pred : array-like Returns ------- type_true : one of {'multilabel-indicator', 'multiclass', 'binary'} The type of the true target data, as output by ``utils.multiclass.type_of_target`` y_true : array or indicator matrix y_pred : array or indicator matrix """ check_consistent_length(y_true, y_pred) type_true = type_of_target(y_true) type_pred = type_of_target(y_pred) y_type = set([type_true, type_pred]) if y_type == set(["binary", "multiclass"]): y_type = set(["multiclass"]) if len(y_type) > 1: raise ValueError("Can't handle mix of {0} and {1}" "".format(type_true, type_pred)) # We can't have more than one value on y_type => The set is no more needed y_type = y_type.pop() # No metrics support "multiclass-multioutput" format if (y_type not in ["binary", "multiclass", "multilabel-indicator"]): raise ValueError("{0} is not supported".format(y_type)) if y_type in ["binary", "multiclass"]: y_true = column_or_1d(y_true) y_pred = column_or_1d(y_pred) if y_type.startswith('multilabel'): y_true = csr_matrix(y_true) y_pred = csr_matrix(y_pred) y_type = 'multilabel-indicator' return y_type, y_true, y_pred def _weighted_sum(sample_score, sample_weight, normalize=False): if normalize: return np.average(sample_score, weights=sample_weight) elif sample_weight is not None: return np.dot(sample_score, sample_weight) else: return sample_score.sum() def accuracy_score(y_true, y_pred, normalize=True, sample_weight=None): """Accuracy classification score. In multilabel classification, this function computes subset accuracy: the set of labels predicted for a sample must *exactly* match the corresponding set of labels in y_true. Read more in the :ref:`User Guide <accuracy_score>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) labels. y_pred : 1d array-like, or label indicator array / sparse matrix Predicted labels, as returned by a classifier. normalize : bool, optional (default=True) If ``False``, return the number of correctly classified samples. Otherwise, return the fraction of correctly classified samples. sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- score : float If ``normalize == True``, return the correctly classified samples (float), else it returns the number of correctly classified samples (int). The best performance is 1 with ``normalize == True`` and the number of samples with ``normalize == False``. See also -------- jaccard_similarity_score, hamming_loss, zero_one_loss Notes ----- In binary and multiclass classification, this function is equal to the ``jaccard_similarity_score`` function. Examples -------- >>> import numpy as np >>> from sklearn.metrics import accuracy_score >>> y_pred = [0, 2, 1, 3] >>> y_true = [0, 1, 2, 3] >>> accuracy_score(y_true, y_pred) 0.5 >>> accuracy_score(y_true, y_pred, normalize=False) 2 In the multilabel case with binary label indicators: >>> accuracy_score(np.array([[0, 1], [1, 1]]), np.ones((2, 2))) 0.5 """ # Compute accuracy for each possible representation y_type, y_true, y_pred = _check_targets(y_true, y_pred) if y_type.startswith('multilabel'): differing_labels = count_nonzero(y_true - y_pred, axis=1) score = differing_labels == 0 else: score = y_true == y_pred return _weighted_sum(score, sample_weight, normalize) def confusion_matrix(y_true, y_pred, labels=None, sample_weight=None): """Compute confusion matrix to evaluate the accuracy of a classification By definition a confusion matrix :math:`C` is such that :math:`C_{i, j}` is equal to the number of observations known to be in group :math:`i` but predicted to be in group :math:`j`. Thus in binary classification, the count of true negatives is :math:`C_{0,0}`, false negatives is :math:`C_{1,0}`, true positives is :math:`C_{1,1}` and false positives is :math:`C_{0,1}`. Read more in the :ref:`User Guide <confusion_matrix>`. Parameters ---------- y_true : array, shape = [n_samples] Ground truth (correct) target values. y_pred : array, shape = [n_samples] Estimated targets as returned by a classifier. labels : array, shape = [n_classes], optional List of labels to index the matrix. This may be used to reorder or select a subset of labels. If none is given, those that appear at least once in ``y_true`` or ``y_pred`` are used in sorted order. sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- C : array, shape = [n_classes, n_classes] Confusion matrix References ---------- .. [1] `Wikipedia entry for the Confusion matrix <https://en.wikipedia.org/wiki/Confusion_matrix>`_ Examples -------- >>> from sklearn.metrics import confusion_matrix >>> y_true = [2, 0, 2, 2, 0, 1] >>> y_pred = [0, 0, 2, 2, 0, 2] >>> confusion_matrix(y_true, y_pred) array([[2, 0, 0], [0, 0, 1], [1, 0, 2]]) >>> y_true = ["cat", "ant", "cat", "cat", "ant", "bird"] >>> y_pred = ["ant", "ant", "cat", "cat", "ant", "cat"] >>> confusion_matrix(y_true, y_pred, labels=["ant", "bird", "cat"]) array([[2, 0, 0], [0, 0, 1], [1, 0, 2]]) """ y_type, y_true, y_pred = _check_targets(y_true, y_pred) if y_type not in ("binary", "multiclass"): raise ValueError("%s is not supported" % y_type) if labels is None: labels = unique_labels(y_true, y_pred) else: labels = np.asarray(labels) if np.all([l not in y_true for l in labels]): raise ValueError("At least one label specified must be in y_true") if sample_weight is None: sample_weight = np.ones(y_true.shape[0], dtype=np.int) else: sample_weight = np.asarray(sample_weight) check_consistent_length(sample_weight, y_true, y_pred) n_labels = labels.size label_to_ind = dict((y, x) for x, y in enumerate(labels)) # convert yt, yp into index y_pred = np.array([label_to_ind.get(x, n_labels + 1) for x in y_pred]) y_true = np.array([label_to_ind.get(x, n_labels + 1) for x in y_true]) # intersect y_pred, y_true with labels, eliminate items not in labels ind = np.logical_and(y_pred < n_labels, y_true < n_labels) y_pred = y_pred[ind] y_true = y_true[ind] # also eliminate weights of eliminated items sample_weight = sample_weight[ind] CM = coo_matrix((sample_weight, (y_true, y_pred)), shape=(n_labels, n_labels) ).toarray() return CM def cohen_kappa_score(y1, y2, labels=None, weights=None): """Cohen's kappa: a statistic that measures inter-annotator agreement. This function computes Cohen's kappa [1]_, a score that expresses the level of agreement between two annotators on a classification problem. It is defined as .. math:: \kappa = (p_o - p_e) / (1 - p_e) where :math:`p_o` is the empirical probability of agreement on the label assigned to any sample (the observed agreement ratio), and :math:`p_e` is the expected agreement when both annotators assign labels randomly. :math:`p_e` is estimated using a per-annotator empirical prior over the class labels [2]_. Read more in the :ref:`User Guide <cohen_kappa>`. Parameters ---------- y1 : array, shape = [n_samples] Labels assigned by the first annotator. y2 : array, shape = [n_samples] Labels assigned by the second annotator. The kappa statistic is symmetric, so swapping ``y1`` and ``y2`` doesn't change the value. labels : array, shape = [n_classes], optional List of labels to index the matrix. This may be used to select a subset of labels. If None, all labels that appear at least once in ``y1`` or ``y2`` are used. weights : str, optional List of weighting type to calculate the score. None means no weighted; "linear" means linear weighted; "quadratic" means quadratic weighted. Returns ------- kappa : float The kappa statistic, which is a number between -1 and 1. The maximum value means complete agreement; zero or lower means chance agreement. References ---------- .. [1] J. Cohen (1960). "A coefficient of agreement for nominal scales". Educational and Psychological Measurement 20(1):37-46. doi:10.1177/001316446002000104. .. [2] `R. Artstein and M. Poesio (2008). "Inter-coder agreement for computational linguistics". Computational Linguistics 34(4):555-596. <http://www.mitpressjournals.org/doi/abs/10.1162/coli.07-034-R2#.V0J1MJMrIWo>`_ .. [3] `Wikipedia entry for the Cohen's kappa. <https://en.wikipedia.org/wiki/Cohen%27s_kappa>`_ """ confusion = confusion_matrix(y1, y2, labels=labels) n_classes = confusion.shape[0] sum0 = np.sum(confusion, axis=0) sum1 = np.sum(confusion, axis=1) expected = np.outer(sum0, sum1) / np.sum(sum0) if weights is None: w_mat = np.ones([n_classes, n_classes], dtype=np.int) w_mat.flat[:: n_classes + 1] = 0 elif weights == "linear" or weights == "quadratic": w_mat = np.zeros([n_classes, n_classes], dtype=np.int) w_mat += np.arange(n_classes) if weights == "linear": w_mat = np.abs(w_mat - w_mat.T) else: w_mat = (w_mat - w_mat.T) ** 2 else: raise ValueError("Unknown kappa weighting type.") k = np.sum(w_mat * confusion) / np.sum(w_mat * expected) return 1 - k def jaccard_similarity_score(y_true, y_pred, normalize=True, sample_weight=None): """Jaccard similarity coefficient score The Jaccard index [1], or Jaccard similarity coefficient, defined as the size of the intersection divided by the size of the union of two label sets, is used to compare set of predicted labels for a sample to the corresponding set of labels in ``y_true``. Read more in the :ref:`User Guide <jaccard_similarity_score>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) labels. y_pred : 1d array-like, or label indicator array / sparse matrix Predicted labels, as returned by a classifier. normalize : bool, optional (default=True) If ``False``, return the sum of the Jaccard similarity coefficient over the sample set. Otherwise, return the average of Jaccard similarity coefficient. sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- score : float If ``normalize == True``, return the average Jaccard similarity coefficient, else it returns the sum of the Jaccard similarity coefficient over the sample set. The best performance is 1 with ``normalize == True`` and the number of samples with ``normalize == False``. See also -------- accuracy_score, hamming_loss, zero_one_loss Notes ----- In binary and multiclass classification, this function is equivalent to the ``accuracy_score``. It differs in the multilabel classification problem. References ---------- .. [1] `Wikipedia entry for the Jaccard index <https://en.wikipedia.org/wiki/Jaccard_index>`_ Examples -------- >>> import numpy as np >>> from sklearn.metrics import jaccard_similarity_score >>> y_pred = [0, 2, 1, 3] >>> y_true = [0, 1, 2, 3] >>> jaccard_similarity_score(y_true, y_pred) 0.5 >>> jaccard_similarity_score(y_true, y_pred, normalize=False) 2 In the multilabel case with binary label indicators: >>> jaccard_similarity_score(np.array([[0, 1], [1, 1]]),\ np.ones((2, 2))) 0.75 """ # Compute accuracy for each possible representation y_type, y_true, y_pred = _check_targets(y_true, y_pred) if y_type.startswith('multilabel'): with np.errstate(divide='ignore', invalid='ignore'): # oddly, we may get an "invalid" rather than a "divide" error here pred_or_true = count_nonzero(y_true + y_pred, axis=1) pred_and_true = count_nonzero(y_true.multiply(y_pred), axis=1) score = pred_and_true / pred_or_true # If there is no label, it results in a Nan instead, we set # the jaccard to 1: lim_{x->0} x/x = 1 # Note with py2.6 and np 1.3: we can't check safely for nan. score[pred_or_true == 0.0] = 1.0 else: score = y_true == y_pred return _weighted_sum(score, sample_weight, normalize) def matthews_corrcoef(y_true, y_pred, sample_weight=None): """Compute the Matthews correlation coefficient (MCC) for binary classes The Matthews correlation coefficient is used in machine learning as a measure of the quality of binary (two-class) classifications. It takes into account true and false positives and negatives and is generally regarded as a balanced measure which can be used even if the classes are of very different sizes. The MCC is in essence a correlation coefficient value between -1 and +1. A coefficient of +1 represents a perfect prediction, 0 an average random prediction and -1 an inverse prediction. The statistic is also known as the phi coefficient. [source: Wikipedia] Only in the binary case does this relate to information about true and false positives and negatives. See references below. Read more in the :ref:`User Guide <matthews_corrcoef>`. Parameters ---------- y_true : array, shape = [n_samples] Ground truth (correct) target values. y_pred : array, shape = [n_samples] Estimated targets as returned by a classifier. sample_weight : array-like of shape = [n_samples], default None Sample weights. Returns ------- mcc : float The Matthews correlation coefficient (+1 represents a perfect prediction, 0 an average random prediction and -1 and inverse prediction). References ---------- .. [1] `Baldi, Brunak, Chauvin, Andersen and Nielsen, (2000). Assessing the accuracy of prediction algorithms for classification: an overview <http://dx.doi.org/10.1093/bioinformatics/16.5.412>`_ .. [2] `Wikipedia entry for the Matthews Correlation Coefficient <https://en.wikipedia.org/wiki/Matthews_correlation_coefficient>`_ Examples -------- >>> from sklearn.metrics import matthews_corrcoef >>> y_true = [+1, +1, +1, -1] >>> y_pred = [+1, -1, +1, +1] >>> matthews_corrcoef(y_true, y_pred) # doctest: +ELLIPSIS -0.33... """ y_type, y_true, y_pred = _check_targets(y_true, y_pred) if y_type != "binary": raise ValueError("%s is not supported" % y_type) lb = LabelEncoder() lb.fit(np.hstack([y_true, y_pred])) y_true = lb.transform(y_true) y_pred = lb.transform(y_pred) mean_yt = np.average(y_true, weights=sample_weight) mean_yp = np.average(y_pred, weights=sample_weight) y_true_u_cent = y_true - mean_yt y_pred_u_cent = y_pred - mean_yp cov_ytyp = np.average(y_true_u_cent * y_pred_u_cent, weights=sample_weight) var_yt = np.average(y_true_u_cent ** 2, weights=sample_weight) var_yp = np.average(y_pred_u_cent ** 2, weights=sample_weight) mcc = cov_ytyp / np.sqrt(var_yt * var_yp) if np.isnan(mcc): return 0. else: return mcc def zero_one_loss(y_true, y_pred, normalize=True, sample_weight=None): """Zero-one classification loss. If normalize is ``True``, return the fraction of misclassifications (float), else it returns the number of misclassifications (int). The best performance is 0. Read more in the :ref:`User Guide <zero_one_loss>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) labels. y_pred : 1d array-like, or label indicator array / sparse matrix Predicted labels, as returned by a classifier. normalize : bool, optional (default=True) If ``False``, return the number of misclassifications. Otherwise, return the fraction of misclassifications. sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- loss : float or int, If ``normalize == True``, return the fraction of misclassifications (float), else it returns the number of misclassifications (int). Notes ----- In multilabel classification, the zero_one_loss function corresponds to the subset zero-one loss: for each sample, the entire set of labels must be correctly predicted, otherwise the loss for that sample is equal to one. See also -------- accuracy_score, hamming_loss, jaccard_similarity_score Examples -------- >>> from sklearn.metrics import zero_one_loss >>> y_pred = [1, 2, 3, 4] >>> y_true = [2, 2, 3, 4] >>> zero_one_loss(y_true, y_pred) 0.25 >>> zero_one_loss(y_true, y_pred, normalize=False) 1 In the multilabel case with binary label indicators: >>> zero_one_loss(np.array([[0, 1], [1, 1]]), np.ones((2, 2))) 0.5 """ score = accuracy_score(y_true, y_pred, normalize=normalize, sample_weight=sample_weight) if normalize: return 1 - score else: if sample_weight is not None: n_samples = np.sum(sample_weight) else: n_samples = _num_samples(y_true) return n_samples - score def f1_score(y_true, y_pred, labels=None, pos_label=1, average='binary', sample_weight=None): """Compute the F1 score, also known as balanced F-score or F-measure The F1 score can be interpreted as a weighted average of the precision and recall, where an F1 score reaches its best value at 1 and worst score at 0. The relative contribution of precision and recall to the F1 score are equal. The formula for the F1 score is:: F1 = 2 * (precision * recall) / (precision + recall) In the multi-class and multi-label case, this is the weighted average of the F1 score of each class. Read more in the :ref:`User Guide <precision_recall_f_measure_metrics>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) target values. y_pred : 1d array-like, or label indicator array / sparse matrix Estimated targets as returned by a classifier. labels : list, optional The set of labels to include when ``average != 'binary'``, and their order if ``average is None``. Labels present in the data can be excluded, for example to calculate a multiclass average ignoring a majority negative class, while labels not present in the data will result in 0 components in a macro average. For multilabel targets, labels are column indices. By default, all labels in ``y_true`` and ``y_pred`` are used in sorted order. .. versionchanged:: 0.17 parameter *labels* improved for multiclass problem. pos_label : str or int, 1 by default The class to report if ``average='binary'`` and the data is binary. If the data are multiclass or multilabel, this will be ignored; setting ``labels=[pos_label]`` and ``average != 'binary'`` will report scores for that label only. average : string, [None, 'binary' (default), 'micro', 'macro', 'samples', \ 'weighted'] This parameter is required for multiclass/multilabel targets. If ``None``, the scores for each class are returned. Otherwise, this determines the type of averaging performed on the data: ``'binary'``: Only report results for the class specified by ``pos_label``. This is applicable only if targets (``y_{true,pred}``) are binary. ``'micro'``: Calculate metrics globally by counting the total true positives, false negatives and false positives. ``'macro'``: Calculate metrics for each label, and find their unweighted mean. This does not take label imbalance into account. ``'weighted'``: Calculate metrics for each label, and find their average, weighted by support (the number of true instances for each label). This alters 'macro' to account for label imbalance; it can result in an F-score that is not between precision and recall. ``'samples'``: Calculate metrics for each instance, and find their average (only meaningful for multilabel classification where this differs from :func:`accuracy_score`). sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- f1_score : float or array of float, shape = [n_unique_labels] F1 score of the positive class in binary classification or weighted average of the F1 scores of each class for the multiclass task. References ---------- .. [1] `Wikipedia entry for the F1-score <https://en.wikipedia.org/wiki/F1_score>`_ Examples -------- >>> from sklearn.metrics import f1_score >>> y_true = [0, 1, 2, 0, 1, 2] >>> y_pred = [0, 2, 1, 0, 0, 1] >>> f1_score(y_true, y_pred, average='macro') # doctest: +ELLIPSIS 0.26... >>> f1_score(y_true, y_pred, average='micro') # doctest: +ELLIPSIS 0.33... >>> f1_score(y_true, y_pred, average='weighted') # doctest: +ELLIPSIS 0.26... >>> f1_score(y_true, y_pred, average=None) array([ 0.8, 0. , 0. ]) """ return fbeta_score(y_true, y_pred, 1, labels=labels, pos_label=pos_label, average=average, sample_weight=sample_weight) def fbeta_score(y_true, y_pred, beta, labels=None, pos_label=1, average='binary', sample_weight=None): """Compute the F-beta score The F-beta score is the weighted harmonic mean of precision and recall, reaching its optimal value at 1 and its worst value at 0. The `beta` parameter determines the weight of precision in the combined score. ``beta < 1`` lends more weight to precision, while ``beta > 1`` favors recall (``beta -> 0`` considers only precision, ``beta -> inf`` only recall). Read more in the :ref:`User Guide <precision_recall_f_measure_metrics>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) target values. y_pred : 1d array-like, or label indicator array / sparse matrix Estimated targets as returned by a classifier. beta: float Weight of precision in harmonic mean. labels : list, optional The set of labels to include when ``average != 'binary'``, and their order if ``average is None``. Labels present in the data can be excluded, for example to calculate a multiclass average ignoring a majority negative class, while labels not present in the data will result in 0 components in a macro average. For multilabel targets, labels are column indices. By default, all labels in ``y_true`` and ``y_pred`` are used in sorted order. .. versionchanged:: 0.17 parameter *labels* improved for multiclass problem. pos_label : str or int, 1 by default The class to report if ``average='binary'`` and the data is binary. If the data are multiclass or multilabel, this will be ignored; setting ``labels=[pos_label]`` and ``average != 'binary'`` will report scores for that label only. average : string, [None, 'binary' (default), 'micro', 'macro', 'samples', \ 'weighted'] This parameter is required for multiclass/multilabel targets. If ``None``, the scores for each class are returned. Otherwise, this determines the type of averaging performed on the data: ``'binary'``: Only report results for the class specified by ``pos_label``. This is applicable only if targets (``y_{true,pred}``) are binary. ``'micro'``: Calculate metrics globally by counting the total true positives, false negatives and false positives. ``'macro'``: Calculate metrics for each label, and find their unweighted mean. This does not take label imbalance into account. ``'weighted'``: Calculate metrics for each label, and find their average, weighted by support (the number of true instances for each label). This alters 'macro' to account for label imbalance; it can result in an F-score that is not between precision and recall. ``'samples'``: Calculate metrics for each instance, and find their average (only meaningful for multilabel classification where this differs from :func:`accuracy_score`). sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- fbeta_score : float (if average is not None) or array of float, shape =\ [n_unique_labels] F-beta score of the positive class in binary classification or weighted average of the F-beta score of each class for the multiclass task. References ---------- .. [1] R. Baeza-Yates and B. Ribeiro-Neto (2011). Modern Information Retrieval. Addison Wesley, pp. 327-328. .. [2] `Wikipedia entry for the F1-score <https://en.wikipedia.org/wiki/F1_score>`_ Examples -------- >>> from sklearn.metrics import fbeta_score >>> y_true = [0, 1, 2, 0, 1, 2] >>> y_pred = [0, 2, 1, 0, 0, 1] >>> fbeta_score(y_true, y_pred, average='macro', beta=0.5) ... # doctest: +ELLIPSIS 0.23... >>> fbeta_score(y_true, y_pred, average='micro', beta=0.5) ... # doctest: +ELLIPSIS 0.33... >>> fbeta_score(y_true, y_pred, average='weighted', beta=0.5) ... # doctest: +ELLIPSIS 0.23... >>> fbeta_score(y_true, y_pred, average=None, beta=0.5) ... # doctest: +ELLIPSIS array([ 0.71..., 0. , 0. ]) """ _, _, f, _ = precision_recall_fscore_support(y_true, y_pred, beta=beta, labels=labels, pos_label=pos_label, average=average, warn_for=('f-score',), sample_weight=sample_weight) return f def _prf_divide(numerator, denominator, metric, modifier, average, warn_for): """Performs division and handles divide-by-zero. On zero-division, sets the corresponding result elements to zero and raises a warning. The metric, modifier and average arguments are used only for determining an appropriate warning. """ result = numerator / denominator mask = denominator == 0.0 if not np.any(mask): return result # remove infs result[mask] = 0.0 # build appropriate warning # E.g. "Precision and F-score are ill-defined and being set to 0.0 in # labels with no predicted samples" axis0 = 'sample' axis1 = 'label' if average == 'samples': axis0, axis1 = axis1, axis0 if metric in warn_for and 'f-score' in warn_for: msg_start = '{0} and F-score are'.format(metric.title()) elif metric in warn_for: msg_start = '{0} is'.format(metric.title()) elif 'f-score' in warn_for: msg_start = 'F-score is' else: return result msg = ('{0} ill-defined and being set to 0.0 {{0}} ' 'no {1} {2}s.'.format(msg_start, modifier, axis0)) if len(mask) == 1: msg = msg.format('due to') else: msg = msg.format('in {0}s with'.format(axis1)) warnings.warn(msg, UndefinedMetricWarning, stacklevel=2) return result def precision_recall_fscore_support(y_true, y_pred, beta=1.0, labels=None, pos_label=1, average=None, warn_for=('precision', 'recall', 'f-score'), sample_weight=None): """Compute precision, recall, F-measure and support for each class The precision is the ratio ``tp / (tp + fp)`` where ``tp`` is the number of true positives and ``fp`` the number of false positives. The precision is intuitively the ability of the classifier not to label as positive a sample that is negative. The recall is the ratio ``tp / (tp + fn)`` where ``tp`` is the number of true positives and ``fn`` the number of false negatives. The recall is intuitively the ability of the classifier to find all the positive samples. The F-beta score can be interpreted as a weighted harmonic mean of the precision and recall, where an F-beta score reaches its best value at 1 and worst score at 0. The F-beta score weights recall more than precision by a factor of ``beta``. ``beta == 1.0`` means recall and precision are equally important. The support is the number of occurrences of each class in ``y_true``. If ``pos_label is None`` and in binary classification, this function returns the average precision, recall and F-measure if ``average`` is one of ``'micro'``, ``'macro'``, ``'weighted'`` or ``'samples'``. Read more in the :ref:`User Guide <precision_recall_f_measure_metrics>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) target values. y_pred : 1d array-like, or label indicator array / sparse matrix Estimated targets as returned by a classifier. beta : float, 1.0 by default The strength of recall versus precision in the F-score. labels : list, optional The set of labels to include when ``average != 'binary'``, and their order if ``average is None``. Labels present in the data can be excluded, for example to calculate a multiclass average ignoring a majority negative class, while labels not present in the data will result in 0 components in a macro average. For multilabel targets, labels are column indices. By default, all labels in ``y_true`` and ``y_pred`` are used in sorted order. pos_label : str or int, 1 by default The class to report if ``average='binary'`` and the data is binary. If the data are multiclass or multilabel, this will be ignored; setting ``labels=[pos_label]`` and ``average != 'binary'`` will report scores for that label only. average : string, [None (default), 'binary', 'micro', 'macro', 'samples', \ 'weighted'] If ``None``, the scores for each class are returned. Otherwise, this determines the type of averaging performed on the data: ``'binary'``: Only report results for the class specified by ``pos_label``. This is applicable only if targets (``y_{true,pred}``) are binary. ``'micro'``: Calculate metrics globally by counting the total true positives, false negatives and false positives. ``'macro'``: Calculate metrics for each label, and find their unweighted mean. This does not take label imbalance into account. ``'weighted'``: Calculate metrics for each label, and find their average, weighted by support (the number of true instances for each label). This alters 'macro' to account for label imbalance; it can result in an F-score that is not between precision and recall. ``'samples'``: Calculate metrics for each instance, and find their average (only meaningful for multilabel classification where this differs from :func:`accuracy_score`). warn_for : tuple or set, for internal use This determines which warnings will be made in the case that this function is being used to return only one of its metrics. sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- precision: float (if average is not None) or array of float, shape =\ [n_unique_labels] recall: float (if average is not None) or array of float, , shape =\ [n_unique_labels] fbeta_score: float (if average is not None) or array of float, shape =\ [n_unique_labels] support: int (if average is not None) or array of int, shape =\ [n_unique_labels] The number of occurrences of each label in ``y_true``. References ---------- .. [1] `Wikipedia entry for the Precision and recall <https://en.wikipedia.org/wiki/Precision_and_recall>`_ .. [2] `Wikipedia entry for the F1-score <https://en.wikipedia.org/wiki/F1_score>`_ .. [3] `Discriminative Methods for Multi-labeled Classification Advances in Knowledge Discovery and Data Mining (2004), pp. 22-30 by Shantanu Godbole, Sunita Sarawagi <http://www.godbole.net/shantanu/pubs/multilabelsvm-pakdd04.pdf>` Examples -------- >>> from sklearn.metrics import precision_recall_fscore_support >>> y_true = np.array(['cat', 'dog', 'pig', 'cat', 'dog', 'pig']) >>> y_pred = np.array(['cat', 'pig', 'dog', 'cat', 'cat', 'dog']) >>> precision_recall_fscore_support(y_true, y_pred, average='macro') ... # doctest: +ELLIPSIS (0.22..., 0.33..., 0.26..., None) >>> precision_recall_fscore_support(y_true, y_pred, average='micro') ... # doctest: +ELLIPSIS (0.33..., 0.33..., 0.33..., None) >>> precision_recall_fscore_support(y_true, y_pred, average='weighted') ... # doctest: +ELLIPSIS (0.22..., 0.33..., 0.26..., None) It is possible to compute per-label precisions, recalls, F1-scores and supports instead of averaging: >>> precision_recall_fscore_support(y_true, y_pred, average=None, ... labels=['pig', 'dog', 'cat']) ... # doctest: +ELLIPSIS,+NORMALIZE_WHITESPACE (array([ 0. , 0. , 0.66...]), array([ 0., 0., 1.]), array([ 0. , 0. , 0.8]), array([2, 2, 2])) """ average_options = (None, 'micro', 'macro', 'weighted', 'samples') if average not in average_options and average != 'binary': raise ValueError('average has to be one of ' + str(average_options)) if beta <= 0: raise ValueError("beta should be >0 in the F-beta score") y_type, y_true, y_pred = _check_targets(y_true, y_pred) present_labels = unique_labels(y_true, y_pred) if average == 'binary': if y_type == 'binary': if pos_label not in present_labels: if len(present_labels) < 2: # Only negative labels return (0., 0., 0., 0) else: raise ValueError("pos_label=%r is not a valid label: %r" % (pos_label, present_labels)) labels = [pos_label] else: raise ValueError("Target is %s but average='binary'. Please " "choose another average setting." % y_type) elif pos_label not in (None, 1): warnings.warn("Note that pos_label (set to %r) is ignored when " "average != 'binary' (got %r). You may use " "labels=[pos_label] to specify a single positive class." % (pos_label, average), UserWarning) if labels is None: labels = present_labels n_labels = None else: n_labels = len(labels) labels = np.hstack([labels, np.setdiff1d(present_labels, labels, assume_unique=True)]) # Calculate tp_sum, pred_sum, true_sum ### if y_type.startswith('multilabel'): sum_axis = 1 if average == 'samples' else 0 # All labels are index integers for multilabel. # Select labels: if not np.all(labels == present_labels): if np.max(labels) > np.max(present_labels): raise ValueError('All labels must be in [0, n labels). ' 'Got %d > %d' % (np.max(labels), np.max(present_labels))) if np.min(labels) < 0: raise ValueError('All labels must be in [0, n labels). ' 'Got %d < 0' % np.min(labels)) y_true = y_true[:, labels[:n_labels]] y_pred = y_pred[:, labels[:n_labels]] # calculate weighted counts true_and_pred = y_true.multiply(y_pred) tp_sum = count_nonzero(true_and_pred, axis=sum_axis, sample_weight=sample_weight) pred_sum = count_nonzero(y_pred, axis=sum_axis, sample_weight=sample_weight) true_sum = count_nonzero(y_true, axis=sum_axis, sample_weight=sample_weight) elif average == 'samples': raise ValueError("Sample-based precision, recall, fscore is " "not meaningful outside multilabel " "classification. See the accuracy_score instead.") else: le = LabelEncoder() le.fit(labels) y_true = le.transform(y_true) y_pred = le.transform(y_pred) sorted_labels = le.classes_ # labels are now from 0 to len(labels) - 1 -> use bincount tp = y_true == y_pred tp_bins = y_true[tp] if sample_weight is not None: tp_bins_weights = np.asarray(sample_weight)[tp] else: tp_bins_weights = None if len(tp_bins): tp_sum = bincount(tp_bins, weights=tp_bins_weights, minlength=len(labels)) else: # Pathological case true_sum = pred_sum = tp_sum = np.zeros(len(labels)) if len(y_pred): pred_sum = bincount(y_pred, weights=sample_weight, minlength=len(labels)) if len(y_true): true_sum = bincount(y_true, weights=sample_weight, minlength=len(labels)) # Retain only selected labels indices = np.searchsorted(sorted_labels, labels[:n_labels]) tp_sum = tp_sum[indices] true_sum = true_sum[indices] pred_sum = pred_sum[indices] if average == 'micro': tp_sum = np.array([tp_sum.sum()]) pred_sum = np.array([pred_sum.sum()]) true_sum = np.array([true_sum.sum()]) # Finally, we have all our sufficient statistics. Divide! # beta2 = beta ** 2 with np.errstate(divide='ignore', invalid='ignore'): # Divide, and on zero-division, set scores to 0 and warn: # Oddly, we may get an "invalid" rather than a "divide" error # here. precision = _prf_divide(tp_sum, pred_sum, 'precision', 'predicted', average, warn_for) recall = _prf_divide(tp_sum, true_sum, 'recall', 'true', average, warn_for) # Don't need to warn for F: either P or R warned, or tp == 0 where pos # and true are nonzero, in which case, F is well-defined and zero f_score = ((1 + beta2) * precision * recall / (beta2 * precision + recall)) f_score[tp_sum == 0] = 0.0 # Average the results if average == 'weighted': weights = true_sum if weights.sum() == 0: return 0, 0, 0, None elif average == 'samples': weights = sample_weight else: weights = None if average is not None: assert average != 'binary' or len(precision) == 1 precision = np.average(precision, weights=weights) recall = np.average(recall, weights=weights) f_score = np.average(f_score, weights=weights) true_sum = None # return no support return precision, recall, f_score, true_sum def precision_score(y_true, y_pred, labels=None, pos_label=1, average='binary', sample_weight=None): """Compute the precision The precision is the ratio ``tp / (tp + fp)`` where ``tp`` is the number of true positives and ``fp`` the number of false positives. The precision is intuitively the ability of the classifier not to label as positive a sample that is negative. The best value is 1 and the worst value is 0. Read more in the :ref:`User Guide <precision_recall_f_measure_metrics>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) target values. y_pred : 1d array-like, or label indicator array / sparse matrix Estimated targets as returned by a classifier. labels : list, optional The set of labels to include when ``average != 'binary'``, and their order if ``average is None``. Labels present in the data can be excluded, for example to calculate a multiclass average ignoring a majority negative class, while labels not present in the data will result in 0 components in a macro average. For multilabel targets, labels are column indices. By default, all labels in ``y_true`` and ``y_pred`` are used in sorted order. .. versionchanged:: 0.17 parameter *labels* improved for multiclass problem. pos_label : str or int, 1 by default The class to report if ``average='binary'`` and the data is binary. If the data are multiclass or multilabel, this will be ignored; setting ``labels=[pos_label]`` and ``average != 'binary'`` will report scores for that label only. average : string, [None, 'binary' (default), 'micro', 'macro', 'samples', \ 'weighted'] This parameter is required for multiclass/multilabel targets. If ``None``, the scores for each class are returned. Otherwise, this determines the type of averaging performed on the data: ``'binary'``: Only report results for the class specified by ``pos_label``. This is applicable only if targets (``y_{true,pred}``) are binary. ``'micro'``: Calculate metrics globally by counting the total true positives, false negatives and false positives. ``'macro'``: Calculate metrics for each label, and find their unweighted mean. This does not take label imbalance into account. ``'weighted'``: Calculate metrics for each label, and find their average, weighted by support (the number of true instances for each label). This alters 'macro' to account for label imbalance; it can result in an F-score that is not between precision and recall. ``'samples'``: Calculate metrics for each instance, and find their average (only meaningful for multilabel classification where this differs from :func:`accuracy_score`). sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- precision : float (if average is not None) or array of float, shape =\ [n_unique_labels] Precision of the positive class in binary classification or weighted average of the precision of each class for the multiclass task. Examples -------- >>> from sklearn.metrics import precision_score >>> y_true = [0, 1, 2, 0, 1, 2] >>> y_pred = [0, 2, 1, 0, 0, 1] >>> precision_score(y_true, y_pred, average='macro') # doctest: +ELLIPSIS 0.22... >>> precision_score(y_true, y_pred, average='micro') # doctest: +ELLIPSIS 0.33... >>> precision_score(y_true, y_pred, average='weighted') ... # doctest: +ELLIPSIS 0.22... >>> precision_score(y_true, y_pred, average=None) # doctest: +ELLIPSIS array([ 0.66..., 0. , 0. ]) """ p, _, _, _ = precision_recall_fscore_support(y_true, y_pred, labels=labels, pos_label=pos_label, average=average, warn_for=('precision',), sample_weight=sample_weight) return p def recall_score(y_true, y_pred, labels=None, pos_label=1, average='binary', sample_weight=None): """Compute the recall The recall is the ratio ``tp / (tp + fn)`` where ``tp`` is the number of true positives and ``fn`` the number of false negatives. The recall is intuitively the ability of the classifier to find all the positive samples. The best value is 1 and the worst value is 0. Read more in the :ref:`User Guide <precision_recall_f_measure_metrics>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) target values. y_pred : 1d array-like, or label indicator array / sparse matrix Estimated targets as returned by a classifier. labels : list, optional The set of labels to include when ``average != 'binary'``, and their order if ``average is None``. Labels present in the data can be excluded, for example to calculate a multiclass average ignoring a majority negative class, while labels not present in the data will result in 0 components in a macro average. For multilabel targets, labels are column indices. By default, all labels in ``y_true`` and ``y_pred`` are used in sorted order. .. versionchanged:: 0.17 parameter *labels* improved for multiclass problem. pos_label : str or int, 1 by default The class to report if ``average='binary'`` and the data is binary. If the data are multiclass or multilabel, this will be ignored; setting ``labels=[pos_label]`` and ``average != 'binary'`` will report scores for that label only. average : string, [None, 'binary' (default), 'micro', 'macro', 'samples', \ 'weighted'] This parameter is required for multiclass/multilabel targets. If ``None``, the scores for each class are returned. Otherwise, this determines the type of averaging performed on the data: ``'binary'``: Only report results for the class specified by ``pos_label``. This is applicable only if targets (``y_{true,pred}``) are binary. ``'micro'``: Calculate metrics globally by counting the total true positives, false negatives and false positives. ``'macro'``: Calculate metrics for each label, and find their unweighted mean. This does not take label imbalance into account. ``'weighted'``: Calculate metrics for each label, and find their average, weighted by support (the number of true instances for each label). This alters 'macro' to account for label imbalance; it can result in an F-score that is not between precision and recall. ``'samples'``: Calculate metrics for each instance, and find their average (only meaningful for multilabel classification where this differs from :func:`accuracy_score`). sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- recall : float (if average is not None) or array of float, shape =\ [n_unique_labels] Recall of the positive class in binary classification or weighted average of the recall of each class for the multiclass task. Examples -------- >>> from sklearn.metrics import recall_score >>> y_true = [0, 1, 2, 0, 1, 2] >>> y_pred = [0, 2, 1, 0, 0, 1] >>> recall_score(y_true, y_pred, average='macro') # doctest: +ELLIPSIS 0.33... >>> recall_score(y_true, y_pred, average='micro') # doctest: +ELLIPSIS 0.33... >>> recall_score(y_true, y_pred, average='weighted') # doctest: +ELLIPSIS 0.33... >>> recall_score(y_true, y_pred, average=None) array([ 1., 0., 0.]) """ _, r, _, _ = precision_recall_fscore_support(y_true, y_pred, labels=labels, pos_label=pos_label, average=average, warn_for=('recall',), sample_weight=sample_weight) return r def classification_report(y_true, y_pred, labels=None, target_names=None, sample_weight=None, digits=2): """Build a text report showing the main classification metrics Read more in the :ref:`User Guide <classification_report>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) target values. y_pred : 1d array-like, or label indicator array / sparse matrix Estimated targets as returned by a classifier. labels : array, shape = [n_labels] Optional list of label indices to include in the report. target_names : list of strings Optional display names matching the labels (same order). sample_weight : array-like of shape = [n_samples], optional Sample weights. digits : int Number of digits for formatting output floating point values Returns ------- report : string Text summary of the precision, recall, F1 score for each class. Examples -------- >>> from sklearn.metrics import classification_report >>> y_true = [0, 1, 2, 2, 2] >>> y_pred = [0, 0, 2, 2, 1] >>> target_names = ['class 0', 'class 1', 'class 2'] >>> print(classification_report(y_true, y_pred, target_names=target_names)) precision recall f1-score support <BLANKLINE> class 0 0.50 1.00 0.67 1 class 1 0.00 0.00 0.00 1 class 2 1.00 0.67 0.80 3 <BLANKLINE> avg / total 0.70 0.60 0.61 5 <BLANKLINE> """ if labels is None: labels = unique_labels(y_true, y_pred) else: labels = np.asarray(labels) last_line_heading = 'avg / total' if target_names is None: target_names = ['%s' % l for l in labels] name_width = max(len(cn) for cn in target_names) width = max(name_width, len(last_line_heading), digits) headers = ["precision", "recall", "f1-score", "support"] fmt = '%% %ds' % width # first column: class name fmt += ' ' fmt += ' '.join(['% 9s' for _ in headers]) fmt += '\n' headers = [""] + headers report = fmt % tuple(headers) report += '\n' p, r, f1, s = precision_recall_fscore_support(y_true, y_pred, labels=labels, average=None, sample_weight=sample_weight) for i, label in enumerate(labels): values = [target_names[i]] for v in (p[i], r[i], f1[i]): values += ["{0:0.{1}f}".format(v, digits)] values += ["{0}".format(s[i])] report += fmt % tuple(values) report += '\n' # compute averages values = [last_line_heading] for v in (np.average(p, weights=s), np.average(r, weights=s), np.average(f1, weights=s)): values += ["{0:0.{1}f}".format(v, digits)] values += ['{0}'.format(np.sum(s))] report += fmt % tuple(values) return report def hamming_loss(y_true, y_pred, labels=None, sample_weight=None, classes=None): """Compute the average Hamming loss. The Hamming loss is the fraction of labels that are incorrectly predicted. Read more in the :ref:`User Guide <hamming_loss>`. Parameters ---------- y_true : 1d array-like, or label indicator array / sparse matrix Ground truth (correct) labels. y_pred : 1d array-like, or label indicator array / sparse matrix Predicted labels, as returned by a classifier. labels : array, shape = [n_labels], optional (default=None) Integer array of labels. If not provided, labels will be inferred from y_true and y_pred. .. versionadded:: 0.18 sample_weight : array-like of shape = [n_samples], optional Sample weights. classes : array, shape = [n_labels], optional (deprecated) Integer array of labels. This parameter has been renamed to ``labels`` in version 0.18 and will be removed in 0.20. Returns ------- loss : float or int, Return the average Hamming loss between element of ``y_true`` and ``y_pred``. See Also -------- accuracy_score, jaccard_similarity_score, zero_one_loss Notes ----- In multiclass classification, the Hamming loss correspond to the Hamming distance between ``y_true`` and ``y_pred`` which is equivalent to the subset ``zero_one_loss`` function. In multilabel classification, the Hamming loss is different from the subset zero-one loss. The zero-one loss considers the entire set of labels for a given sample incorrect if it does entirely match the true set of labels. Hamming loss is more forgiving in that it penalizes the individual labels. The Hamming loss is upperbounded by the subset zero-one loss. When normalized over samples, the Hamming loss is always between 0 and 1. References ---------- .. [1] Grigorios Tsoumakas, Ioannis Katakis. Multi-Label Classification: An Overview. International Journal of Data Warehousing & Mining, 3(3), 1-13, July-September 2007. .. [2] `Wikipedia entry on the Hamming distance <https://en.wikipedia.org/wiki/Hamming_distance>`_ Examples -------- >>> from sklearn.metrics import hamming_loss >>> y_pred = [1, 2, 3, 4] >>> y_true = [2, 2, 3, 4] >>> hamming_loss(y_true, y_pred) 0.25 In the multilabel case with binary label indicators: >>> hamming_loss(np.array([[0, 1], [1, 1]]), np.zeros((2, 2))) 0.75 """ if classes is not None: warnings.warn("'classes' was renamed to 'labels' in version 0.18 and " "will be removed in 0.20.", DeprecationWarning) labels = classes y_type, y_true, y_pred = _check_targets(y_true, y_pred) if labels is None: labels = unique_labels(y_true, y_pred) else: labels = np.asarray(labels) if sample_weight is None: weight_average = 1. else: weight_average = np.mean(sample_weight) if y_type.startswith('multilabel'): n_differences = count_nonzero(y_true - y_pred, sample_weight=sample_weight) return (n_differences / (y_true.shape[0] * len(labels) * weight_average)) elif y_type in ["binary", "multiclass"]: return _weighted_sum(y_true != y_pred, sample_weight, normalize=True) else: raise ValueError("{0} is not supported".format(y_type)) def log_loss(y_true, y_pred, eps=1e-15, normalize=True, sample_weight=None, labels=None): """Log loss, aka logistic loss or cross-entropy loss. This is the loss function used in (multinomial) logistic regression and extensions of it such as neural networks, defined as the negative log-likelihood of the true labels given a probabilistic classifier's predictions. The log loss is only defined for two or more labels. For a single sample with true label yt in {0,1} and estimated probability yp that yt = 1, the log loss is -log P(yt|yp) = -(yt log(yp) + (1 - yt) log(1 - yp)) Read more in the :ref:`User Guide <log_loss>`. Parameters ---------- y_true : array-like or label indicator matrix Ground truth (correct) labels for n_samples samples. y_pred : array-like of float, shape = (n_samples, n_classes) or (n_samples,) Predicted probabilities, as returned by a classifier's predict_proba method. If ``y_pred.shape = (n_samples,)`` the probabilities provided are assumed to be that of the positive class. The labels in ``y_pred`` are assumed to be ordered alphabetically, as done by :class:`preprocessing.LabelBinarizer`. eps : float Log loss is undefined for p=0 or p=1, so probabilities are clipped to max(eps, min(1 - eps, p)). normalize : bool, optional (default=True) If true, return the mean loss per sample. Otherwise, return the sum of the per-sample losses. sample_weight : array-like of shape = [n_samples], optional Sample weights. labels : array-like, optional (default=None) If not provided, labels will be inferred from y_true. If ``labels`` is ``None`` and ``y_pred`` has shape (n_samples,) the labels are assumed to be binary and are inferred from ``y_true``. .. versionadded:: 0.18 Returns ------- loss : float Examples -------- >>> log_loss(["spam", "ham", "ham", "spam"], # doctest: +ELLIPSIS ... [[.1, .9], [.9, .1], [.8, .2], [.35, .65]]) 0.21616... References ---------- C.M. Bishop (2006). Pattern Recognition and Machine Learning. Springer, p. 209. Notes ----- The logarithm used is the natural logarithm (base-e). """ y_pred = check_array(y_pred, ensure_2d=False) check_consistent_length(y_pred, y_true) lb = LabelBinarizer() if labels is not None: lb.fit(labels) else: lb.fit(y_true) if len(lb.classes_) == 1: if labels is None: raise ValueError('y_true contains only one label ({0}). Please ' 'provide the true labels explicitly through the ' 'labels argument.'.format(lb.classes_[0])) else: raise ValueError('The labels array needs to contain at least two ' 'labels for log_loss, ' 'got {0}.'.format(lb.classes_)) transformed_labels = lb.transform(y_true) if transformed_labels.shape[1] == 1: transformed_labels = np.append(1 - transformed_labels, transformed_labels, axis=1) # Clipping y_pred = np.clip(y_pred, eps, 1 - eps) # If y_pred is of single dimension, assume y_true to be binary # and then check. if y_pred.ndim == 1: y_pred = y_pred[:, np.newaxis] if y_pred.shape[1] == 1: y_pred = np.append(1 - y_pred, y_pred, axis=1) # Check if dimensions are consistent. transformed_labels = check_array(transformed_labels) if len(lb.classes_) != y_pred.shape[1]: if labels is None: raise ValueError("y_true and y_pred contain different number of " "classes {0}, {1}. Please provide the true " "labels explicitly through the labels argument. " "Classes found in " "y_true: {2}".format(transformed_labels.shape[1], y_pred.shape[1], lb.classes_)) else: raise ValueError('The number of classes in labels is different ' 'from that in y_pred. Classes found in ' 'labels: {0}'.format(lb.classes_)) # Renormalize y_pred /= y_pred.sum(axis=1)[:, np.newaxis] loss = -(transformed_labels * np.log(y_pred)).sum(axis=1) return _weighted_sum(loss, sample_weight, normalize) def hinge_loss(y_true, pred_decision, labels=None, sample_weight=None): """Average hinge loss (non-regularized) In binary class case, assuming labels in y_true are encoded with +1 and -1, when a prediction mistake is made, ``margin = y_true * pred_decision`` is always negative (since the signs disagree), implying ``1 - margin`` is always greater than 1. The cumulated hinge loss is therefore an upper bound of the number of mistakes made by the classifier. In multiclass case, the function expects that either all the labels are included in y_true or an optional labels argument is provided which contains all the labels. The multilabel margin is calculated according to Crammer-Singer's method. As in the binary case, the cumulated hinge loss is an upper bound of the number of mistakes made by the classifier. Read more in the :ref:`User Guide <hinge_loss>`. Parameters ---------- y_true : array, shape = [n_samples] True target, consisting of integers of two values. The positive label must be greater than the negative label. pred_decision : array, shape = [n_samples] or [n_samples, n_classes] Predicted decisions, as output by decision_function (floats). labels : array, optional, default None Contains all the labels for the problem. Used in multiclass hinge loss. sample_weight : array-like of shape = [n_samples], optional Sample weights. Returns ------- loss : float References ---------- .. [1] `Wikipedia entry on the Hinge loss <https://en.wikipedia.org/wiki/Hinge_loss>`_ .. [2] Koby Crammer, Yoram Singer. On the Algorithmic Implementation of Multiclass Kernel-based Vector Machines. Journal of Machine Learning Research 2, (2001), 265-292 .. [3] `L1 AND L2 Regularization for Multiclass Hinge Loss Models by Robert C. Moore, John DeNero. <http://www.ttic.edu/sigml/symposium2011/papers/ Moore+DeNero_Regularization.pdf>`_ Examples -------- >>> from sklearn import svm >>> from sklearn.metrics import hinge_loss >>> X = [[0], [1]] >>> y = [-1, 1] >>> est = svm.LinearSVC(random_state=0) >>> est.fit(X, y) LinearSVC(C=1.0, class_weight=None, dual=True, fit_intercept=True, intercept_scaling=1, loss='squared_hinge', max_iter=1000, multi_class='ovr', penalty='l2', random_state=0, tol=0.0001, verbose=0) >>> pred_decision = est.decision_function([[-2], [3], [0.5]]) >>> pred_decision # doctest: +ELLIPSIS array([-2.18..., 2.36..., 0.09...]) >>> hinge_loss([-1, 1, 1], pred_decision) # doctest: +ELLIPSIS 0.30... In the multiclass case: >>> X = np.array([[0], [1], [2], [3]]) >>> Y = np.array([0, 1, 2, 3]) >>> labels = np.array([0, 1, 2, 3]) >>> est = svm.LinearSVC() >>> est.fit(X, Y) LinearSVC(C=1.0, class_weight=None, dual=True, fit_intercept=True, intercept_scaling=1, loss='squared_hinge', max_iter=1000, multi_class='ovr', penalty='l2', random_state=None, tol=0.0001, verbose=0) >>> pred_decision = est.decision_function([[-1], [2], [3]]) >>> y_true = [0, 2, 3] >>> hinge_loss(y_true, pred_decision, labels) #doctest: +ELLIPSIS 0.56... """ check_consistent_length(y_true, pred_decision, sample_weight) pred_decision = check_array(pred_decision, ensure_2d=False) y_true = column_or_1d(y_true) y_true_unique = np.unique(y_true) if y_true_unique.size > 2: if (labels is None and pred_decision.ndim > 1 and (np.size(y_true_unique) != pred_decision.shape[1])): raise ValueError("Please include all labels in y_true " "or pass labels as third argument") if labels is None: labels = y_true_unique le = LabelEncoder() le.fit(labels) y_true = le.transform(y_true) mask = np.ones_like(pred_decision, dtype=bool) mask[np.arange(y_true.shape[0]), y_true] = False margin = pred_decision[~mask] margin -= np.max(pred_decision[mask].reshape(y_true.shape[0], -1), axis=1) else: # Handles binary class case # this code assumes that positive and negative labels # are encoded as +1 and -1 respectively pred_decision = column_or_1d(pred_decision) pred_decision = np.ravel(pred_decision) lbin = LabelBinarizer(neg_label=-1) y_true = lbin.fit_transform(y_true)[:, 0] try: margin = y_true * pred_decision except TypeError: raise TypeError("pred_decision should be an array of floats.") losses = 1 - margin # The hinge_loss doesn't penalize good enough predictions. losses[losses <= 0] = 0 return np.average(losses, weights=sample_weight) def _check_binary_probabilistic_predictions(y_true, y_prob): """Check that y_true is binary and y_prob contains valid probabilities""" check_consistent_length(y_true, y_prob) labels = np.unique(y_true) if len(labels) > 2: raise ValueError("Only binary classification is supported. " "Provided labels %s." % labels) if y_prob.max() > 1: raise ValueError("y_prob contains values greater than 1.") if y_prob.min() < 0: raise ValueError("y_prob contains values less than 0.") return label_binarize(y_true, labels)[:, 0] def brier_score_loss(y_true, y_prob, sample_weight=None, pos_label=None): """Compute the Brier score. The smaller the Brier score, the better, hence the naming with "loss". Across all items in a set N predictions, the Brier score measures the mean squared difference between (1) the predicted probability assigned to the possible outcomes for item i, and (2) the actual outcome. Therefore, the lower the Brier score is for a set of predictions, the better the predictions are calibrated. Note that the Brier score always takes on a value between zero and one, since this is the largest possible difference between a predicted probability (which must be between zero and one) and the actual outcome (which can take on values of only 0 and 1). The Brier score is appropriate for binary and categorical outcomes that can be structured as true or false, but is inappropriate for ordinal variables which can take on three or more values (this is because the Brier score assumes that all possible outcomes are equivalently "distant" from one another). Which label is considered to be the positive label is controlled via the parameter pos_label, which defaults to 1. Read more in the :ref:`User Guide <calibration>`. Parameters ---------- y_true : array, shape (n_samples,) True targets. y_prob : array, shape (n_samples,) Probabilities of the positive class. sample_weight : array-like of shape = [n_samples], optional Sample weights. pos_label : int (default: None) Label of the positive class. If None, the maximum label is used as positive class Returns ------- score : float Brier score Examples -------- >>> import numpy as np >>> from sklearn.metrics import brier_score_loss >>> y_true = np.array([0, 1, 1, 0]) >>> y_true_categorical = np.array(["spam", "ham", "ham", "spam"]) >>> y_prob = np.array([0.1, 0.9, 0.8, 0.3]) >>> brier_score_loss(y_true, y_prob) # doctest: +ELLIPSIS 0.037... >>> brier_score_loss(y_true, 1-y_prob, pos_label=0) # doctest: +ELLIPSIS 0.037... >>> brier_score_loss(y_true_categorical, y_prob, \ pos_label="ham") # doctest: +ELLIPSIS 0.037... >>> brier_score_loss(y_true, np.array(y_prob) > 0.5) 0.0 References ---------- .. [1] `Wikipedia entry for the Brier score. <https://en.wikipedia.org/wiki/Brier_score>`_ """ y_true = column_or_1d(y_true) y_prob = column_or_1d(y_prob) assert_all_finite(y_true) assert_all_finite(y_prob) if pos_label is None: pos_label = y_true.max() y_true = np.array(y_true == pos_label, int) y_true = _check_binary_probabilistic_predictions(y_true, y_prob) return np.average((y_true - y_prob) ** 2, weights=sample_weight)
bsd-3-clause
poryfly/scikit-learn
examples/classification/plot_classifier_comparison.py
181
4699
#!/usr/bin/python # -*- coding: utf-8 -*- """ ===================== Classifier comparison ===================== A comparison of a several classifiers in scikit-learn on synthetic datasets. The point of this example is to illustrate the nature of decision boundaries of different classifiers. This should be taken with a grain of salt, as the intuition conveyed by these examples does not necessarily carry over to real datasets. Particularly in high-dimensional spaces, data can more easily be separated linearly and the simplicity of classifiers such as naive Bayes and linear SVMs might lead to better generalization than is achieved by other classifiers. The plots show training points in solid colors and testing points semi-transparent. The lower right shows the classification accuracy on the test set. """ print(__doc__) # Code source: Gaël Varoquaux # Andreas Müller # Modified for documentation by Jaques Grobler # License: BSD 3 clause import numpy as np import matplotlib.pyplot as plt from matplotlib.colors import ListedColormap from sklearn.cross_validation import train_test_split from sklearn.preprocessing import StandardScaler from sklearn.datasets import make_moons, make_circles, make_classification from sklearn.neighbors import KNeighborsClassifier from sklearn.svm import SVC from sklearn.tree import DecisionTreeClassifier from sklearn.ensemble import RandomForestClassifier, AdaBoostClassifier from sklearn.naive_bayes import GaussianNB from sklearn.lda import LDA from sklearn.qda import QDA h = .02 # step size in the mesh names = ["Nearest Neighbors", "Linear SVM", "RBF SVM", "Decision Tree", "Random Forest", "AdaBoost", "Naive Bayes", "LDA", "QDA"] classifiers = [ KNeighborsClassifier(3), SVC(kernel="linear", C=0.025), SVC(gamma=2, C=1), DecisionTreeClassifier(max_depth=5), RandomForestClassifier(max_depth=5, n_estimators=10, max_features=1), AdaBoostClassifier(), GaussianNB(), LDA(), QDA()] X, y = make_classification(n_features=2, n_redundant=0, n_informative=2, random_state=1, n_clusters_per_class=1) rng = np.random.RandomState(2) X += 2 * rng.uniform(size=X.shape) linearly_separable = (X, y) datasets = [make_moons(noise=0.3, random_state=0), make_circles(noise=0.2, factor=0.5, random_state=1), linearly_separable ] figure = plt.figure(figsize=(27, 9)) i = 1 # iterate over datasets for ds in datasets: # preprocess dataset, split into training and test part X, y = ds X = StandardScaler().fit_transform(X) X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=.4) x_min, x_max = X[:, 0].min() - .5, X[:, 0].max() + .5 y_min, y_max = X[:, 1].min() - .5, X[:, 1].max() + .5 xx, yy = np.meshgrid(np.arange(x_min, x_max, h), np.arange(y_min, y_max, h)) # just plot the dataset first cm = plt.cm.RdBu cm_bright = ListedColormap(['#FF0000', '#0000FF']) ax = plt.subplot(len(datasets), len(classifiers) + 1, i) # Plot the training points ax.scatter(X_train[:, 0], X_train[:, 1], c=y_train, cmap=cm_bright) # and testing points ax.scatter(X_test[:, 0], X_test[:, 1], c=y_test, cmap=cm_bright, alpha=0.6) ax.set_xlim(xx.min(), xx.max()) ax.set_ylim(yy.min(), yy.max()) ax.set_xticks(()) ax.set_yticks(()) i += 1 # iterate over classifiers for name, clf in zip(names, classifiers): ax = plt.subplot(len(datasets), len(classifiers) + 1, i) clf.fit(X_train, y_train) score = clf.score(X_test, y_test) # Plot the decision boundary. For that, we will assign a color to each # point in the mesh [x_min, m_max]x[y_min, y_max]. if hasattr(clf, "decision_function"): Z = clf.decision_function(np.c_[xx.ravel(), yy.ravel()]) else: Z = clf.predict_proba(np.c_[xx.ravel(), yy.ravel()])[:, 1] # Put the result into a color plot Z = Z.reshape(xx.shape) ax.contourf(xx, yy, Z, cmap=cm, alpha=.8) # Plot also the training points ax.scatter(X_train[:, 0], X_train[:, 1], c=y_train, cmap=cm_bright) # and testing points ax.scatter(X_test[:, 0], X_test[:, 1], c=y_test, cmap=cm_bright, alpha=0.6) ax.set_xlim(xx.min(), xx.max()) ax.set_ylim(yy.min(), yy.max()) ax.set_xticks(()) ax.set_yticks(()) ax.set_title(name) ax.text(xx.max() - .3, yy.min() + .3, ('%.2f' % score).lstrip('0'), size=15, horizontalalignment='right') i += 1 figure.subplots_adjust(left=.02, right=.98) plt.show()
bsd-3-clause
liberatorqjw/scikit-learn
examples/decomposition/plot_pca_vs_lda.py
182
1743
""" ======================================================= Comparison of LDA and PCA 2D projection of Iris dataset ======================================================= The Iris dataset represents 3 kind of Iris flowers (Setosa, Versicolour and Virginica) with 4 attributes: sepal length, sepal width, petal length and petal width. Principal Component Analysis (PCA) applied to this data identifies the combination of attributes (principal components, or directions in the feature space) that account for the most variance in the data. Here we plot the different samples on the 2 first principal components. Linear Discriminant Analysis (LDA) tries to identify attributes that account for the most variance *between classes*. In particular, LDA, in contrast to PCA, is a supervised method, using known class labels. """ print(__doc__) import matplotlib.pyplot as plt from sklearn import datasets from sklearn.decomposition import PCA from sklearn.lda import LDA iris = datasets.load_iris() X = iris.data y = iris.target target_names = iris.target_names pca = PCA(n_components=2) X_r = pca.fit(X).transform(X) lda = LDA(n_components=2) X_r2 = lda.fit(X, y).transform(X) # Percentage of variance explained for each components print('explained variance ratio (first two components): %s' % str(pca.explained_variance_ratio_)) plt.figure() for c, i, target_name in zip("rgb", [0, 1, 2], target_names): plt.scatter(X_r[y == i, 0], X_r[y == i, 1], c=c, label=target_name) plt.legend() plt.title('PCA of IRIS dataset') plt.figure() for c, i, target_name in zip("rgb", [0, 1, 2], target_names): plt.scatter(X_r2[y == i, 0], X_r2[y == i, 1], c=c, label=target_name) plt.legend() plt.title('LDA of IRIS dataset') plt.show()
bsd-3-clause
scharch/SONAR
tests/run_tests.py
1
3419
#!/usr/bin/env python3 #clean up function def cleanup(): shutil.rmtree( "output", ignore_errors=True ) shutil.rmtree( "work", ignore_errors=True) try: os.remove("f0_merged.fq") os.remove("derepAllRawSeqs.uc") os.remove("lineage.fa") except: pass #test imports (it's a bit silly to include builtins in this list...) import importlib, sys for checkModule in ['airr', 'atexit', 'Bio', 'collections', 'colorsys', 'csv', 'datetime', 'docopt', 'ete3', 'fileinput', 'functools', 'fuzzywuzzy', 'glob', 'gzip', 'io', 'itertools', 'Levenshtein', 'math', 'multiprocessing', 'numpy', 'os', 'pandas', 'pickle', 'PyQt4.QtGui', 'random', 're', 'shutil', 'statistics', 'string', 'subprocess', 'sys', 'time', 'traceback']: try: my_module = importlib.import_module(checkModule) except ImportError: sys.exit(f"module {checkModule} not found") #check Biopython submodules (not sure this is necessary) for submodule in ['Align', 'AlignIO', 'Alphabet', 'Data.CodonTable', 'Phylo', 'Seq', 'SeqIO', 'SeqRecord']: try: my_module = importlib.import_module(f"Bio.{submodule}", package="Bio") except ImportError: sys.exit(f"module Bio.{submodule} not found") #check for master script import shutil if not shutil.which('sonar'): print("Master script not found in PATH, programs will be invoked directly", file=sys.stderr) #test SONAR scripts import os, subprocess SONARDIR = os.path.abspath(sys.argv[0]).split("SONAR/tests")[0] os.chdir(f"{SONARDIR}/SONAR/tests") for command in [ [f"{SONARDIR}/SONAR/annotate/1.0-preprocess.py", "--input", "subsample_r1.fq.gz", "--reverse", "subsample_r2.fq.gz"], [f"{SONARDIR}/SONAR/annotate/1.1-blast_V.py", "--fasta", "f0_merged.fq", "--derep", "--npf", "2000", "--threads", "2"], [f"{SONARDIR}/SONAR/annotate/1.2-blast_J.py"], [f"{SONARDIR}/SONAR/annotate/1.3-finalize_assignments.py"], [f"{SONARDIR}/SONAR/annotate/1.4-cluster_sequences.py"], [f"{SONARDIR}/SONAR/lineage/2.1-calculate_id-div.py"], [f"{SONARDIR}/SONAR/plotting/4.1-setup_plots.pl", "--statistic", "div"], [f"{SONARDIR}/SONAR/lineage/2.4-cluster_into_groups.py"], [f"{SONARDIR}/SONAR/utilities/getReadsByAnnotation.py", "-f", "output/sequences/nucleotide/tests_goodVJ_unique_lineageNotations.fa", "-a", "clone_id=000(01|07|08)", "-o", "lineage.fa"], [f"{SONARDIR}/SONAR/phylogeny/3.2-run_IgPhyML.py", "-v", "IGHV4-39*01", "--seqs", "lineage.fa", "--quick", "--seed", "321325749"], [f"{SONARDIR}/SONAR/utilities/flipTree.pl", "output/tests_igphyml.tree", "output/tests_igphyml.flipped.tree"] ]: s=subprocess.Popen( command, universal_newlines=True, stderr=subprocess.PIPE ) o,e = s.communicate() if s.returncode != 0: cleanup() sys.exit( f"Received error \"{e.strip()}\" running {command[0].split('/')[-1]}" ) #validate rearrangements output #at the moment, it seems like IgPhyML output varies a bit even with a specified seed, so skip that test for now. import hashlib checksums = { "output/tables/tests_rearrangements.tsv":"f9065c38ae0f5713ccc68cade8592183" }#, "output/sequences/nucleotide/tests_inferredAncestors.fa":"46b03fc95afec5fda950f048d99db34b"} for toValidate in checksums: h = hashlib.md5() with open(toValidate, 'rb') as handle: buf=handle.read() h.update(buf) if not h.hexdigest() == checksums[toValidate]: cleanup() sys.exit( f"{toValidate} failed validation!") #All done! cleanup() print("All tests passed!")
gpl-3.0
gregcaporaso/qiime
qiime/compare_distance_matrices.py
15
11259
#!/usr/bin/env python from __future__ import division __author__ = "Jai Ram Rideout" __copyright__ = "Copyright 2012, The QIIME project" __credits__ = ["Jai Ram Rideout", "Michael Dwan", "Logan Knecht", "Damien Coy", "Levi McCracken", "Greg Caporaso"] __license__ = "GPL" __version__ = "1.9.1-dev" __maintainer__ = "Jai Ram Rideout" __email__ = "[email protected]" from os import path from skbio.stats import p_value_to_str from skbio.stats.distance import DistanceMatrix, mantel from qiime.util import make_compatible_distance_matrices from qiime.stats import MantelCorrelogram, PartialMantel def run_mantel_test(method, fps, distmats, num_perms, tail_type, comment, control_dm_fp=None, control_dm=None, sample_id_map=None): """Runs a Mantel test on all pairs of distance matrices. Returns a string suitable for writing out to a file containing the results of the test. WARNING: Only symmetric, hollow distance matrices may be used as input. Asymmetric distance matrices, such as those obtained by the UniFrac Gain metric (i.e. beta_diversity.py -m unifrac_g), should not be used as input. Arguments: method - which Mantel test to run (either 'mantel' or 'partial_mantel') fps - list of filepaths of the distance matrices distmats - list of tuples containing dm labels and dm data (i.e. the output of parse_distmat) num_perms - the number of permutations to use to calculate the p-value(s) tail_type - the type of tail test to use when calculating the p-value(s). Can be 'two-sided', 'greater', or 'less'. Only applies when method is mantel comment - comment string to add to the beginning of the results string control_dm_fp - filepath of the control distance matrix. Only applies when method is partial_mantel (it is required then) control_dm - tuple containing control distance matrix labels and matrix data. Only applies when method is partial_mantel (it is required then) sample_id_map - dict mapping sample IDs (i.e. what is expected by make_compatible_distance_matrices) """ if len(fps) != len(distmats): raise ValueError("Must provide the same number of filepaths as there " "are distance matrices.") if comment is None: comment = '' result = comment if method == 'mantel': result += 'DM1\tDM2\tNumber of entries\tMantel r statistic\t' + \ 'p-value\tNumber of permutations\tTail type\n' elif method == 'partial_mantel': if not control_dm_fp or not control_dm: raise ValueError("You must provide a control matrix filepath and " "control matrix when running the partial Mantel " "test.") result += 'DM1\tDM2\tCDM\tNumber of entries\t' + \ 'Mantel r statistic\tp-value\tNumber of permutations\t' +\ 'Tail type\n' else: raise ValueError("Invalid method '%s'. Must be either 'mantel' or " "'partial_mantel'." % method) # Loop over all pairs of dms. for i, (fp1, (dm1_labels, dm1_data)) in enumerate(zip(fps, distmats)): for fp2, (dm2_labels, dm2_data) in zip(fps, distmats)[i + 1:]: # Make the current pair of distance matrices compatible by only # keeping samples that match between them, and ordering them by # the same sample IDs. (dm1_labels, dm1_data), (dm2_labels, dm2_data) = \ make_compatible_distance_matrices((dm1_labels, dm1_data), (dm2_labels, dm2_data), lookup=sample_id_map) if method == 'partial_mantel': # We need to intersect three sets (three matrices). (dm1_labels, dm1_data), (cdm_labels, cdm_data) = \ make_compatible_distance_matrices( (dm1_labels, dm1_data), control_dm, lookup=sample_id_map) (dm1_labels, dm1_data), (dm2_labels, dm2_data) = \ make_compatible_distance_matrices( (dm1_labels, dm1_data), (dm2_labels, dm2_data), lookup=sample_id_map) if len(dm1_labels) < 3: result += '%s\t%s\t%s\t%d\tToo few samples\n' % (fp1, fp2, control_dm_fp, len(dm1_labels)) continue elif len(dm1_labels) < 3: result += '%s\t%s\t%d\tToo few samples\n' % (fp1, fp2, len(dm1_labels)) continue dm1 = DistanceMatrix(dm1_data, dm1_labels) dm2 = DistanceMatrix(dm2_data, dm2_labels) if method == 'mantel': corr_coeff, p_value, n = mantel(dm1, dm2, method='pearson', permutations=num_perms, alternative=tail_type, strict=True) p_str = p_value_to_str(p_value, num_perms) result += "%s\t%s\t%d\t%.5f\t%s\t%d\t%s\n" % ( fp1, fp2, n, corr_coeff, p_str, num_perms, tail_type) elif method == 'partial_mantel': cdm = DistanceMatrix(cdm_data, cdm_labels) results = PartialMantel(dm1, dm2, cdm)(num_perms) p_str = p_value_to_str(results['mantel_p'], num_perms) result += "%s\t%s\t%s\t%d\t%.5f\t%s\t%d\t%s\n" % ( fp1, fp2, control_dm_fp, len(dm1_labels), results['mantel_r'], p_str, num_perms, 'greater') return result def run_mantel_correlogram(fps, distmats, num_perms, comment, alpha, sample_id_map=None, variable_size_distance_classes=False): """Runs a Mantel correlogram analysis on all pairs of distance matrices. Returns a string suitable for writing out to a file containing the results of the test, a list of correlogram filepath names, and a list of matplotlib Figure objects representing each correlogram. The correlogram filepaths can have an extension string appended to the end of them and then be used to save each of the correlogram Figures to a file. Each correlogram filepath will be a combination of the two distance matrix filepaths that were used to create it. WARNING: Only symmetric, hollow distance matrices may be used as input. Asymmetric distance matrices, such as those obtained by the UniFrac Gain metric (i.e. beta_diversity.py -m unifrac_g), should not be used as input. Arguments: fps - list of filepaths of the distance matrices distmats - list of tuples containing dm labels and dm data (i.e. the output of parse_distmat) num_perms - the number of permutations to use to calculate the p-value(s) comment - comment string to add to the beginning of the results string alpha - the alpha value to use to determine significance in the correlogram plots sample_id_map - dict mapping sample IDs (i.e. what is expected by make_compatible_distance_matrices) variable_size_distance_classes - create distance classes that vary in size (i.e. width) but have the same number of distances in each class """ if len(fps) != len(distmats): raise ValueError("Must provide the same number of filepaths as there " "are distance matrices.") if comment is None: comment = '' result = comment + 'DM1\tDM2\tNumber of entries\t' + \ 'Number of permutations\tClass index\t' + \ 'Number of distances\tMantel r statistic\t' + \ 'p-value\tp-value (Bonferroni corrected)\tTail type\n' correlogram_fps = [] correlograms = [] # Loop over all pairs of dms. for i, (fp1, (dm1_labels, dm1_data)) in enumerate(zip(fps, distmats)): for fp2, (dm2_labels, dm2_data) in zip(fps, distmats)[i + 1:]: # Make the current pair of distance matrices compatible by only # keeping samples that match between them, and ordering them by # the same sample IDs. (dm1_labels, dm1_data), (dm2_labels, dm2_data) = \ make_compatible_distance_matrices((dm1_labels, dm1_data), (dm2_labels, dm2_data), lookup=sample_id_map) if len(dm1_labels) < 3: result += '%s\t%s\t%d\tToo few samples\n' % (fp1, fp2, len(dm1_labels)) continue dm1 = DistanceMatrix(dm1_data, dm1_labels) dm2 = DistanceMatrix(dm2_data, dm2_labels) # Create an instance of our Mantel correlogram test and run it with # the specified number of permutations. mc = MantelCorrelogram(dm1, dm2, alpha=alpha, variable_size_distance_classes=variable_size_distance_classes) results = mc(num_perms) # Generate a name for the current correlogram and save it and the # correlogram itself. dm1_name = path.basename(fp1) dm2_name = path.basename(fp2) correlogram_fps.append('_'.join((dm1_name, 'AND', dm2_name, 'mantel_correlogram')) + '.') correlograms.append(results['correlogram_plot']) # Iterate over the results and write them to the text file. first_time = True for class_idx, num_dist, r, p, p_corr in zip( results['class_index'], results['num_dist'], results['mantel_r'], results['mantel_p'], results['mantel_p_corr']): # Format p-values and figure out which tail type we have based # on the sign of r. p_str = None if p is not None: p_str = p_value_to_str(p, num_perms) p_corr_str = None if p_corr is not None: p_corr_str = p_value_to_str(p_corr, num_perms) if r is None: tail_type = None elif r < 0: tail_type = 'less' else: tail_type = 'greater' if first_time: result += '%s\t%s\t%d\t%d\t%s\t%d\t%s\t%s\t%s\t%s\n' % ( fp1, fp2, len(dm1_labels), num_perms, class_idx, num_dist, r, p_str, p_corr_str, tail_type) first_time = False else: result += '\t\t\t\t%s\t%d\t%s\t%s\t%s\t%s\n' % (class_idx, num_dist, r, p_str, p_corr_str, tail_type) return result, correlogram_fps, correlograms
gpl-2.0
wk8910/bio_tools
01.dadi_fsc/02.two_pop_model/05.Mpre/01.model.py
1
2604
#! /usr/bin/env python import os,sys,re # import matplotlib # matplotlib.use('Agg') import numpy import sys from numpy import array # import pylab import dadi spectrum_file = sys.argv[1] data = dadi.Spectrum.from_file(spectrum_file) data = data.fold() ns = data.sample_sizes pts_l = [40,50,60] # params = (nuPre,TPre,s,nu1,nu2,T,tx,m12,m21) from dadi import Numerics, PhiManip, Integration from dadi.Spectrum_mod import Spectrum def simple_mig(params, ns, pts): """ params = (nuPre,TPre,nu1,nu2,T,m12,m21) ns = (n1,n2) Simple migration model, the population size is constant nuPre: Size after first size change TPre: Time before split of first size change. nu1: size of pop 1. nu2: size of pop 2. T1: Time from divergence to migration end (in units of 2*Na generations) T2: Time from migration end to present n1,n2: Sample sizes of resulting Spectrum pts: Number of grid points to use in integration. """ nuPre,TPre,nu1,nu2,T,m12,m21 = params xx = Numerics.default_grid(pts) phi = PhiManip.phi_1D(xx) phi = Integration.one_pop(phi, xx, TPre, nu=nuPre) phi = PhiManip.phi_1D_to_2D(xx, phi) phi = Integration.two_pops(phi, xx, T, nu1, nu2, m12=m12, m21=m21) fs = Spectrum.from_phi(phi, ns, (xx,xx)) return fs func = simple_mig # nuPre,TPre,nu1,nu2,T,M.m12,M.m21 upper_bound = [10, 1, 10, 10, 1, 10, 10] lower_bound = [1e-2, 1e-2, 1e-2, 0, 0, 0, 0] p0 = [3.58393534462, 0.486773940004, 0.823557413109, 0.322669721201, 0.20555616477, 1, 1] func_ex = dadi.Numerics.make_extrap_log_func(func) p0 = dadi.Misc.perturb_params(p0, fold=1, upper_bound=upper_bound, lower_bound=lower_bound) print('Beginning optimization ************************************************') popt = dadi.Inference.optimize_log(p0, data, func_ex, pts_l, lower_bound=lower_bound, upper_bound=upper_bound, verbose=len(p0), maxiter=30) print('Finshed optimization **************************************************') print('Best-fit parameters: {0}'.format(popt)) model = func_ex(popt, ns, pts_l) ll_model = dadi.Inference.ll_multinom(model, data) print('Maximum log composite likelihood: {0}\n'.format(ll_model)) theta = dadi.Inference.optimal_sfs_scaling(model, data) print('Optimal value of theta: {0}\n'.format(theta)) result=[ll_model,theta]+popt.tolist() print('###DADIOUTPUT###') # nuPre,TPre,nu1,nu2,T,M.m12,M.m21 print('likelihood\ttheta\tN.nuPre\tT.Tpre\tN.nu1\tN.nu2\tT.T\tM.m12\tM.m21') print("\t".join(map(str,result)))
mpl-2.0
ArmstrongYang/StudyShare
Spark-Python/Spark_ML.py
1
1339
from pyspark import SparkContext, SparkConf ''' spark机器学习笔记:(二)用Spark Python进行数据处理和特征提取 http://blog.csdn.net/u013719780/article/details/51768720 ''' appName = 'spark-ml' master = 'local' scconf = SparkConf().setAppName(appName).setMaster(master) sc = SparkContext(conf=scconf) def plot(): import matplotlib.pyplot as plt from matplotlib.pyplot import hist ages = user_fields.map(lambda x: int(x[1])).collect() hist(ages, bins=20, color='lightblue',normed=True) fig = plt.gcf() fig.set_size_inches(12,6) plt.show() if __name__ == '__main__': print(__file__) file_name = "ml-100k/u.user" user_data = sc.textFile(file_name) print(user_data.first()) user_fields = user_data.map(lambda line: line.split('|')) num_users = user_fields.map(lambda fields: fields[0]).count() #统计用户数 num_genders = user_fields.map(lambda fields : fields[2]).distinct().count() #统计性别个数 num_occupations = user_fields.map(lambda fields: fields[3]).distinct().count() #统计职业个数 num_zipcodes = user_fields.map(lambda fields: fields[4]).distinct().count() #统计邮编个数 print ("Users: %d, genders: %d, occupations: %d, ZIP codes: %d"%(num_users,num_genders,num_occupations,num_zipcodes)) plot() exit(0)
apache-2.0
cbertinato/pandas
pandas/tseries/holiday.py
1
16245
from datetime import datetime, timedelta from typing import List import warnings from dateutil.relativedelta import FR, MO, SA, SU, TH, TU, WE # noqa import numpy as np from pandas.errors import PerformanceWarning from pandas import DateOffset, Series, Timestamp, date_range from pandas.tseries.offsets import Day, Easter def next_monday(dt): """ If holiday falls on Saturday, use following Monday instead; if holiday falls on Sunday, use Monday instead """ if dt.weekday() == 5: return dt + timedelta(2) elif dt.weekday() == 6: return dt + timedelta(1) return dt def next_monday_or_tuesday(dt): """ For second holiday of two adjacent ones! If holiday falls on Saturday, use following Monday instead; if holiday falls on Sunday or Monday, use following Tuesday instead (because Monday is already taken by adjacent holiday on the day before) """ dow = dt.weekday() if dow == 5 or dow == 6: return dt + timedelta(2) elif dow == 0: return dt + timedelta(1) return dt def previous_friday(dt): """ If holiday falls on Saturday or Sunday, use previous Friday instead. """ if dt.weekday() == 5: return dt - timedelta(1) elif dt.weekday() == 6: return dt - timedelta(2) return dt def sunday_to_monday(dt): """ If holiday falls on Sunday, use day thereafter (Monday) instead. """ if dt.weekday() == 6: return dt + timedelta(1) return dt def weekend_to_monday(dt): """ If holiday falls on Sunday or Saturday, use day thereafter (Monday) instead. Needed for holidays such as Christmas observation in Europe """ if dt.weekday() == 6: return dt + timedelta(1) elif dt.weekday() == 5: return dt + timedelta(2) return dt def nearest_workday(dt): """ If holiday falls on Saturday, use day before (Friday) instead; if holiday falls on Sunday, use day thereafter (Monday) instead. """ if dt.weekday() == 5: return dt - timedelta(1) elif dt.weekday() == 6: return dt + timedelta(1) return dt def next_workday(dt): """ returns next weekday used for observances """ dt += timedelta(days=1) while dt.weekday() > 4: # Mon-Fri are 0-4 dt += timedelta(days=1) return dt def previous_workday(dt): """ returns previous weekday used for observances """ dt -= timedelta(days=1) while dt.weekday() > 4: # Mon-Fri are 0-4 dt -= timedelta(days=1) return dt def before_nearest_workday(dt): """ returns previous workday after nearest workday """ return previous_workday(nearest_workday(dt)) def after_nearest_workday(dt): """ returns next workday after nearest workday needed for Boxing day or multiple holidays in a series """ return next_workday(nearest_workday(dt)) class Holiday: """ Class that defines a holiday with start/end dates and rules for observance. """ def __init__(self, name, year=None, month=None, day=None, offset=None, observance=None, start_date=None, end_date=None, days_of_week=None): """ Parameters ---------- name : str Name of the holiday , defaults to class name offset : array of pandas.tseries.offsets or class from pandas.tseries.offsets computes offset from date observance: function computes when holiday is given a pandas Timestamp days_of_week: provide a tuple of days e.g (0,1,2,3,) for Monday Through Thursday Monday=0,..,Sunday=6 Examples -------- >>> from pandas.tseries.holiday import Holiday, nearest_workday >>> from dateutil.relativedelta import MO >>> USMemorialDay = Holiday('Memorial Day', month=5, day=31, offset=pd.DateOffset(weekday=MO(-1))) >>> USLaborDay = Holiday('Labor Day', month=9, day=1, offset=pd.DateOffset(weekday=MO(1))) >>> July3rd = Holiday('July 3rd', month=7, day=3,) >>> NewYears = Holiday('New Years Day', month=1, day=1, observance=nearest_workday), >>> July3rd = Holiday('July 3rd', month=7, day=3, days_of_week=(0, 1, 2, 3)) """ if offset is not None and observance is not None: raise NotImplementedError("Cannot use both offset and observance.") self.name = name self.year = year self.month = month self.day = day self.offset = offset self.start_date = Timestamp( start_date) if start_date is not None else start_date self.end_date = Timestamp( end_date) if end_date is not None else end_date self.observance = observance assert (days_of_week is None or type(days_of_week) == tuple) self.days_of_week = days_of_week def __repr__(self): info = '' if self.year is not None: info += 'year={year}, '.format(year=self.year) info += 'month={mon}, day={day}, '.format(mon=self.month, day=self.day) if self.offset is not None: info += 'offset={offset}'.format(offset=self.offset) if self.observance is not None: info += 'observance={obs}'.format(obs=self.observance) repr = 'Holiday: {name} ({info})'.format(name=self.name, info=info) return repr def dates(self, start_date, end_date, return_name=False): """ Calculate holidays observed between start date and end date Parameters ---------- start_date : starting date, datetime-like, optional end_date : ending date, datetime-like, optional return_name : bool, optional, default=False If True, return a series that has dates and holiday names. False will only return dates. """ start_date = Timestamp(start_date) end_date = Timestamp(end_date) filter_start_date = start_date filter_end_date = end_date if self.year is not None: dt = Timestamp(datetime(self.year, self.month, self.day)) if return_name: return Series(self.name, index=[dt]) else: return [dt] dates = self._reference_dates(start_date, end_date) holiday_dates = self._apply_rule(dates) if self.days_of_week is not None: holiday_dates = holiday_dates[np.in1d(holiday_dates.dayofweek, self.days_of_week)] if self.start_date is not None: filter_start_date = max(self.start_date.tz_localize( filter_start_date.tz), filter_start_date) if self.end_date is not None: filter_end_date = min(self.end_date.tz_localize( filter_end_date.tz), filter_end_date) holiday_dates = holiday_dates[(holiday_dates >= filter_start_date) & (holiday_dates <= filter_end_date)] if return_name: return Series(self.name, index=holiday_dates) return holiday_dates def _reference_dates(self, start_date, end_date): """ Get reference dates for the holiday. Return reference dates for the holiday also returning the year prior to the start_date and year following the end_date. This ensures that any offsets to be applied will yield the holidays within the passed in dates. """ if self.start_date is not None: start_date = self.start_date.tz_localize(start_date.tz) if self.end_date is not None: end_date = self.end_date.tz_localize(start_date.tz) year_offset = DateOffset(years=1) reference_start_date = Timestamp( datetime(start_date.year - 1, self.month, self.day)) reference_end_date = Timestamp( datetime(end_date.year + 1, self.month, self.day)) # Don't process unnecessary holidays dates = date_range(start=reference_start_date, end=reference_end_date, freq=year_offset, tz=start_date.tz) return dates def _apply_rule(self, dates): """ Apply the given offset/observance to a DatetimeIndex of dates. Parameters ---------- dates : DatetimeIndex Dates to apply the given offset/observance rule Returns ------- Dates with rules applied """ if self.observance is not None: return dates.map(lambda d: self.observance(d)) if self.offset is not None: if not isinstance(self.offset, list): offsets = [self.offset] else: offsets = self.offset for offset in offsets: # if we are adding a non-vectorized value # ignore the PerformanceWarnings: with warnings.catch_warnings(): warnings.simplefilter("ignore", PerformanceWarning) dates += offset return dates holiday_calendars = {} def register(cls): try: name = cls.name except AttributeError: name = cls.__name__ holiday_calendars[name] = cls def get_calendar(name): """ Return an instance of a calendar based on its name. Parameters ---------- name : str Calendar name to return an instance of """ return holiday_calendars[name]() class HolidayCalendarMetaClass(type): def __new__(cls, clsname, bases, attrs): calendar_class = super().__new__(cls, clsname, bases, attrs) register(calendar_class) return calendar_class class AbstractHolidayCalendar(metaclass=HolidayCalendarMetaClass): """ Abstract interface to create holidays following certain rules. """ rules = [] # type: List[Holiday] start_date = Timestamp(datetime(1970, 1, 1)) end_date = Timestamp(datetime(2030, 12, 31)) _cache = None def __init__(self, name=None, rules=None): """ Initializes holiday object with a given set a rules. Normally classes just have the rules defined within them. Parameters ---------- name : str Name of the holiday calendar, defaults to class name rules : array of Holiday objects A set of rules used to create the holidays. """ super().__init__() if name is None: name = self.__class__.__name__ self.name = name if rules is not None: self.rules = rules def rule_from_name(self, name): for rule in self.rules: if rule.name == name: return rule return None def holidays(self, start=None, end=None, return_name=False): """ Returns a curve with holidays between start_date and end_date Parameters ---------- start : starting date, datetime-like, optional end : ending date, datetime-like, optional return_name : bool, optional If True, return a series that has dates and holiday names. False will only return a DatetimeIndex of dates. Returns ------- DatetimeIndex of holidays """ if self.rules is None: raise Exception('Holiday Calendar {name} does not have any ' 'rules specified'.format(name=self.name)) if start is None: start = AbstractHolidayCalendar.start_date if end is None: end = AbstractHolidayCalendar.end_date start = Timestamp(start) end = Timestamp(end) holidays = None # If we don't have a cache or the dates are outside the prior cache, we # get them again if (self._cache is None or start < self._cache[0] or end > self._cache[1]): for rule in self.rules: rule_holidays = rule.dates(start, end, return_name=True) if holidays is None: holidays = rule_holidays else: holidays = holidays.append(rule_holidays) self._cache = (start, end, holidays.sort_index()) holidays = self._cache[2] holidays = holidays[start:end] if return_name: return holidays else: return holidays.index @staticmethod def merge_class(base, other): """ Merge holiday calendars together. The base calendar will take precedence to other. The merge will be done based on each holiday's name. Parameters ---------- base : AbstractHolidayCalendar instance/subclass or array of Holiday objects other : AbstractHolidayCalendar instance/subclass or array of Holiday objects """ try: other = other.rules except AttributeError: pass if not isinstance(other, list): other = [other] other_holidays = {holiday.name: holiday for holiday in other} try: base = base.rules except AttributeError: pass if not isinstance(base, list): base = [base] base_holidays = {holiday.name: holiday for holiday in base} other_holidays.update(base_holidays) return list(other_holidays.values()) def merge(self, other, inplace=False): """ Merge holiday calendars together. The caller's class rules take precedence. The merge will be done based on each holiday's name. Parameters ---------- other : holiday calendar inplace : bool (default=False) If True set rule_table to holidays, else return array of Holidays """ holidays = self.merge_class(self, other) if inplace: self.rules = holidays else: return holidays USMemorialDay = Holiday('Memorial Day', month=5, day=31, offset=DateOffset(weekday=MO(-1))) USLaborDay = Holiday('Labor Day', month=9, day=1, offset=DateOffset(weekday=MO(1))) USColumbusDay = Holiday('Columbus Day', month=10, day=1, offset=DateOffset(weekday=MO(2))) USThanksgivingDay = Holiday('Thanksgiving', month=11, day=1, offset=DateOffset(weekday=TH(4))) USMartinLutherKingJr = Holiday('Martin Luther King Jr. Day', start_date=datetime(1986, 1, 1), month=1, day=1, offset=DateOffset(weekday=MO(3))) USPresidentsDay = Holiday('Presidents Day', month=2, day=1, offset=DateOffset(weekday=MO(3))) GoodFriday = Holiday("Good Friday", month=1, day=1, offset=[Easter(), Day(-2)]) EasterMonday = Holiday("Easter Monday", month=1, day=1, offset=[Easter(), Day(1)]) class USFederalHolidayCalendar(AbstractHolidayCalendar): """ US Federal Government Holiday Calendar based on rules specified by: https://www.opm.gov/policy-data-oversight/ snow-dismissal-procedures/federal-holidays/ """ rules = [ Holiday('New Years Day', month=1, day=1, observance=nearest_workday), USMartinLutherKingJr, USPresidentsDay, USMemorialDay, Holiday('July 4th', month=7, day=4, observance=nearest_workday), USLaborDay, USColumbusDay, Holiday('Veterans Day', month=11, day=11, observance=nearest_workday), USThanksgivingDay, Holiday('Christmas', month=12, day=25, observance=nearest_workday) ] def HolidayCalendarFactory(name, base, other, base_class=AbstractHolidayCalendar): rules = AbstractHolidayCalendar.merge_class(base, other) calendar_class = type(name, (base_class,), {"rules": rules, "name": name}) return calendar_class
bsd-3-clause
rabipanda/tensorflow
tensorflow/contrib/labeled_tensor/python/ops/ops.py
77
46403
# Copyright 2016 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Non-core ops for LabeledTensor.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import collections import types import numpy as np from six import string_types from tensorflow.contrib.labeled_tensor.python.ops import _typecheck as tc from tensorflow.contrib.labeled_tensor.python.ops import core from tensorflow.python.framework import dtypes from tensorflow.python.framework import ops from tensorflow.python.ops import array_ops from tensorflow.python.ops import functional_ops from tensorflow.python.ops import math_ops from tensorflow.python.ops import numerics from tensorflow.python.ops import random_ops from tensorflow.python.training import input # pylint: disable=redefined-builtin @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensor, ops.Tensor, core.Axis, tc.Optional(string_types)) def _gather_1d_on_axis(labeled_tensor, indexer, axis, name=None): with ops.name_scope(name, 'lt_take', [labeled_tensor]) as scope: temp_axes = core.Axes([axis] + list( labeled_tensor.axes.remove(axis.name).values())) transposed = core.transpose(labeled_tensor, temp_axes.keys()) indexed = core.LabeledTensor( array_ops.gather(transposed.tensor, indexer), temp_axes) return core.transpose(indexed, labeled_tensor.axes.keys(), name=scope) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Mapping(string_types, tc.Union(slice, collections.Hashable, list)), tc.Optional(string_types)) def select(labeled_tensor, selection, name=None): """Slice out a subset of the tensor. Args: labeled_tensor: The input tensor. selection: A dictionary mapping an axis name to a scalar, slice or list of values to select. Currently supports two types of selections: (a) Any number of scalar and/or slice selections. (b) Exactly one list selection, without any scalars or slices. name: Optional op name. Returns: The selection as a `LabeledTensor`. Raises: ValueError: If the tensor doesn't have an axis in the selection or if that axis lacks labels. KeyError: If any labels in a selection are not found in the original axis. NotImplementedError: If you attempt to combine a list selection with scalar selection or another list selection. """ with ops.name_scope(name, 'lt_select', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) slices = {} indexers = {} for axis_name, value in selection.items(): if axis_name not in labeled_tensor.axes: raise ValueError( 'The tensor does not have an axis named %s. Its axes are: %r' % (axis_name, labeled_tensor.axes.keys())) axis = labeled_tensor.axes[axis_name] if axis.labels is None: raise ValueError( 'The axis named %s does not have labels. The axis is: %r' % (axis_name, axis)) if isinstance(value, slice): # TODO(shoyer): consider deprecating using slices in favor of lists if value.start is None: start = None else: start = axis.index(value.start) if value.stop is None: stop = None else: # For now, follow the pandas convention of making labeled slices # inclusive of both bounds. stop = axis.index(value.stop) + 1 if value.step is not None: raise NotImplementedError('slicing with a step is not yet supported') slices[axis_name] = slice(start, stop) # Needs to be after checking for slices, since slice objects claim to be # instances of collections.Hashable but hash() on them fails. elif isinstance(value, collections.Hashable): slices[axis_name] = axis.index(value) elif isinstance(value, list): if indexers: raise NotImplementedError( 'select does not yet support more than one list selection at ' 'the same time') indexer = [axis.index(v) for v in value] indexers[axis_name] = ops.convert_to_tensor(indexer, dtype=dtypes.int64) else: # If type checking is working properly, this shouldn't be possible. raise TypeError('cannot handle arbitrary types') if indexers and slices: raise NotImplementedError( 'select does not yet support combined scalar and list selection') # For now, handle array selection separately, because tf.gather_nd does # not support gradients yet. Later, using gather_nd will let us combine # these paths. if indexers: (axis_name, indexer), = indexers.items() axis = core.Axis(axis_name, selection[axis_name]) return _gather_1d_on_axis(labeled_tensor, indexer, axis, name=scope) else: return core.slice_function(labeled_tensor, slices, name=scope) @tc.returns(core.LabeledTensor) @tc.accepts( tc.Collection(core.LabeledTensorLike), string_types, tc.Optional(string_types)) def concat(labeled_tensors, axis_name, name=None): """Concatenate tensors along a dimension. See tf.concat. Args: labeled_tensors: A list of input LabeledTensors. axis_name: The name of the axis along which to concatenate. name: Optional op name. Returns: The concatenated tensor. The coordinate labels for the concatenation dimension are also concatenated, if they are available for every tensor. Raises: ValueError: If fewer than one tensor inputs is provided, if the tensors have incompatible axes, or if `axis_name` isn't the name of an axis. """ with ops.name_scope(name, 'lt_concat', labeled_tensors) as scope: labeled_tensors = [ core.convert_to_labeled_tensor(lt) for lt in labeled_tensors ] if len(labeled_tensors) < 1: raise ValueError('concat expects at least 1 tensor, but received %s' % labeled_tensors) # All tensors must have these axes. axes_0 = labeled_tensors[0].axes axis_names = list(axes_0.keys()) if axis_name not in axis_names: raise ValueError('%s not in %s' % (axis_name, axis_names)) shared_axes = axes_0.remove(axis_name) tensors = [labeled_tensors[0].tensor] concat_axis_list = [axes_0[axis_name]] for labeled_tensor in labeled_tensors[1:]: current_shared_axes = labeled_tensor.axes.remove(axis_name) if current_shared_axes != shared_axes: # TODO(shoyer): add more specific checks about what went wrong, # including raising AxisOrderError when appropriate raise ValueError('Mismatched shared axes: the first tensor ' 'had axes %r but this tensor has axes %r.' % (shared_axes, current_shared_axes)) # Accumulate the axis labels, if they're available. concat_axis_list.append(labeled_tensor.axes[axis_name]) tensors.append(labeled_tensor.tensor) concat_axis = core.concat_axes(concat_axis_list) concat_dimension = axis_names.index(axis_name) concat_tensor = array_ops.concat(tensors, concat_dimension, name=scope) values = list(axes_0.values()) concat_axes = (values[:concat_dimension] + [concat_axis] + values[concat_dimension + 1:]) return core.LabeledTensor(concat_tensor, concat_axes) # TODO(shoyer): rename pack/unpack to stack/unstack @tc.returns(core.LabeledTensor) @tc.accepts( tc.Collection(core.LabeledTensorLike), tc.Union(string_types, core.AxisLike), int, tc.Optional(string_types)) def pack(labeled_tensors, new_axis, axis_position=0, name=None): """Pack tensors along a new axis. See tf.pack. Args: labeled_tensors: The input tensors, which must have identical axes. new_axis: The name of the new axis, or a tuple containing the name and coordinate labels. axis_position: Optional integer position at which to insert the new axis. name: Optional op name. Returns: The packed tensors as a single LabeledTensor, with `new_axis` in the given `axis_position`. Raises: ValueError: If fewer than one input tensors is provided, or if the tensors don't have identical axes. """ with ops.name_scope(name, 'lt_pack', labeled_tensors) as scope: labeled_tensors = [ core.convert_to_labeled_tensor(lt) for lt in labeled_tensors ] if len(labeled_tensors) < 1: raise ValueError('pack expects at least 1 tensors, but received %s' % labeled_tensors) axes_0 = labeled_tensors[0].axes for t in labeled_tensors: if t.axes != axes_0: raise ValueError('Non-identical axes. Expected %s but got %s' % (axes_0, t.axes)) pack_op = array_ops.stack( [t.tensor for t in labeled_tensors], axis=axis_position, name=scope) axes = list(axes_0.values()) axes.insert(axis_position, new_axis) return core.LabeledTensor(pack_op, axes) @tc.returns(tc.List(core.LabeledTensor)) @tc.accepts(core.LabeledTensorLike, tc.Optional(string_types), tc.Optional(string_types)) def unpack(labeled_tensor, axis_name=None, name=None): """Unpack the tensor. See tf.unpack. Args: labeled_tensor: The input tensor. axis_name: Optional name of axis to unpack. By default, the first axis is used. name: Optional op name. Returns: The list of unpacked LabeledTensors. Raises: ValueError: If `axis_name` is not an axis on the input. """ with ops.name_scope(name, 'lt_unpack', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) axis_names = list(labeled_tensor.axes.keys()) if axis_name is None: axis_name = axis_names[0] if axis_name not in axis_names: raise ValueError('%s not in %s' % (axis_name, axis_names)) axis = axis_names.index(axis_name) unpack_ops = array_ops.unstack(labeled_tensor.tensor, axis=axis, name=scope) axes = [a for i, a in enumerate(labeled_tensor.axes.values()) if i != axis] return [core.LabeledTensor(t, axes) for t in unpack_ops] @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Collection(string_types), tc.Collection(tc.Union(string_types, core.AxisLike)), tc.Optional(string_types)) def reshape(labeled_tensor, existing_axes, new_axes, name=None): """Reshape specific axes of a LabeledTensor. Non-indicated axes remain in their original locations. Args: labeled_tensor: The input tensor. existing_axes: List of axis names found on the input tensor. These must appear sequentially in the list of axis names on the input. In other words, they must be a valid slice of `list(labeled_tensor.axes.keys())`. new_axes: List of strings, tuples of (axis_name, axis_value) or Axis objects providing new axes with which to replace `existing_axes` in the reshaped result. At most one element of `new_axes` may be a string, indicating an axis with unknown size. name: Optional op name. Returns: The reshaped LabeledTensor. Raises: ValueError: If `existing_axes` are not all axes on the input, or if more than one of `new_axes` has unknown size. AxisOrderError: If `existing_axes` are not a slice of axis names on the input. """ with ops.name_scope(name, 'lt_reshape', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) original_axis_names = list(labeled_tensor.axes.keys()) existing_axes = list(existing_axes) if not set(existing_axes) <= set(original_axis_names): raise ValueError('existing_axes %r are not contained in the set of axis ' 'names %r on the input labeled tensor' % (existing_axes, original_axis_names)) start = original_axis_names.index(existing_axes[0]) stop = original_axis_names.index(existing_axes[-1]) + 1 if existing_axes != original_axis_names[start:stop]: # We could support existing_axes that aren't a slice by using transpose, # but that could lead to unpredictable performance consequences because # transposes are not free in TensorFlow. If we did transpose # automatically, the user might never realize that their data is being # produced with the wrong order. (The later will occur with some frequency # because of how broadcasting automatically choose axis order.) # So for now we've taken the strict approach. raise core.AxisOrderError( 'existing_axes %r are not a slice of axis names %r on the input ' 'labeled tensor. Use `transpose` or `impose_axis_order` to reorder ' 'axes on the input explicitly.' % (existing_axes, original_axis_names)) if sum(isinstance(axis, string_types) for axis in new_axes) > 1: raise ValueError( 'at most one axis in new_axes can have unknown size. All other ' 'axes must have an indicated integer size or labels: %r' % new_axes) original_values = list(labeled_tensor.axes.values()) axis_size = lambda axis: -1 if axis.size is None else axis.size shape = [axis_size(axis) for axis in original_values[:start]] for axis_ref in new_axes: if isinstance(axis_ref, string_types): shape.append(-1) else: axis = core.as_axis(axis_ref) shape.append(axis_size(axis)) shape.extend(axis_size(axis) for axis in original_values[stop:]) reshaped_tensor = array_ops.reshape( labeled_tensor.tensor, shape, name=scope) axes = original_values[:start] + list(new_axes) + original_values[stop:] return core.LabeledTensor(reshaped_tensor, axes) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, string_types, string_types, tc.Optional(string_types)) def rename_axis(labeled_tensor, existing_name, new_name, name=None): """Rename an axis of LabeledTensor. Args: labeled_tensor: The input tensor. existing_name: Name for an existing axis on the input. new_name: Desired replacement name. name: Optional op name. Returns: LabeledTensor with renamed axis. Raises: ValueError: If `existing_name` is not an axis on the input. """ with ops.name_scope(name, 'lt_rename_axis', [labeled_tensor]) as scope: if existing_name not in labeled_tensor.axes: raise ValueError('existing_name %r are not contained in the set of axis ' 'names %r on the input labeled tensor' % (existing_name, labeled_tensor.axes.keys())) new_axis = core.Axis(new_name, labeled_tensor.axes[existing_name].value) return reshape(labeled_tensor, [existing_name], [new_axis], name=scope) @tc.returns(tc.List(core.LabeledTensor)) @tc.accepts(string_types, collections.Callable, int, bool, tc.Collection(core.LabeledTensorLike), bool, tc.Optional(string_types)) def _batch_helper(default_name, batch_fn, batch_size, enqueue_many, labeled_tensors, allow_smaller_final_batch, name=None): with ops.name_scope(name, default_name, labeled_tensors) as scope: labeled_tensors = [ core.convert_to_labeled_tensor(lt) for lt in labeled_tensors ] batch_ops = batch_fn([t.tensor for t in labeled_tensors], scope) # TODO(shoyer): Remove this when they sanitize the TF API. if not isinstance(batch_ops, list): assert isinstance(batch_ops, ops.Tensor) batch_ops = [batch_ops] if allow_smaller_final_batch: batch_size = None @tc.returns(core.Axes) @tc.accepts(core.Axes) def output_axes(axes): if enqueue_many: if 'batch' not in axes or list(axes.keys()).index('batch') != 0: raise ValueError( 'When enqueue_many is True, input tensors must have an axis ' 'called "batch" as their first dimension, ' 'but axes were %s' % axes) culled_axes = axes.remove('batch') return core.Axes([('batch', batch_size)] + list(culled_axes.values())) else: return core.Axes([('batch', batch_size)] + list(axes.values())) output_labeled_tensors = [] for i, tensor in enumerate(batch_ops): axes = output_axes(labeled_tensors[i].axes) output_labeled_tensors.append(core.LabeledTensor(tensor, axes)) return output_labeled_tensors @tc.returns(tc.List(core.LabeledTensor)) @tc.accepts( tc.Collection(core.LabeledTensorLike), int, int, int, bool, bool, tc.Optional(string_types)) def batch(labeled_tensors, batch_size, num_threads=1, capacity=32, enqueue_many=False, allow_smaller_final_batch=False, name=None): """Rebatch a tensor. See tf.batch. Args: labeled_tensors: The input tensors. batch_size: The output batch size. num_threads: See tf.batch. capacity: See tf.batch. enqueue_many: If true, the input tensors must contain a 'batch' axis as their first axis. If false, the input tensors must not contain a 'batch' axis. See tf.batch. allow_smaller_final_batch: See tf.batch. name: Optional op name. Returns: The rebatched tensors. If enqueue_many is false, the output tensors will have a new 'batch' axis as their first axis. Raises: ValueError: If enqueue_many is True and the first axis of the tensors isn't "batch". """ def fn(tensors, scope): return input.batch( tensors, batch_size=batch_size, num_threads=num_threads, capacity=capacity, enqueue_many=enqueue_many, allow_smaller_final_batch=allow_smaller_final_batch, name=scope) return _batch_helper('lt_batch', fn, batch_size, enqueue_many, labeled_tensors, allow_smaller_final_batch, name) @tc.returns(tc.List(core.LabeledTensor)) @tc.accepts( tc.Collection(core.LabeledTensorLike), int, int, int, bool, int, tc.Optional(int), bool, tc.Optional(string_types)) def shuffle_batch(labeled_tensors, batch_size, num_threads=1, capacity=32, enqueue_many=False, min_after_dequeue=0, seed=None, allow_smaller_final_batch=False, name=None): """Rebatch a tensor, with shuffling. See tf.batch. Args: labeled_tensors: The input tensors. batch_size: The output batch size. num_threads: See tf.batch. capacity: See tf.batch. enqueue_many: If true, the input tensors must contain a 'batch' axis as their first axis. If false, the input tensors must not contain a 'batch' axis. See tf.batch. min_after_dequeue: Minimum number of elements in the queue after a dequeue, used to ensure mixing. seed: Optional random seed. allow_smaller_final_batch: See tf.batch. name: Optional op name. Returns: The rebatched tensors. If enqueue_many is false, the output tensors will have a new 'batch' axis as their first axis. Raises: ValueError: If enqueue_many is True and the first axis of the tensors isn't "batch". """ def fn(tensors, scope): return input.shuffle_batch( tensors, batch_size=batch_size, num_threads=num_threads, capacity=capacity, enqueue_many=enqueue_many, min_after_dequeue=min_after_dequeue, seed=seed, allow_smaller_final_batch=allow_smaller_final_batch, name=scope) return _batch_helper('lt_shuffle_batch', fn, batch_size, enqueue_many, labeled_tensors, allow_smaller_final_batch, name) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Mapping(string_types, int), tc.Optional(int), tc.Optional(string_types)) def random_crop(labeled_tensor, shape_map, seed=None, name=None): """Randomly crops a tensor to a given size. See tf.random_crop. Args: labeled_tensor: The input tensor. shape_map: A dictionary mapping axis names to the size of the random crop for that dimension. seed: An optional random seed. name: An optional op name. Returns: A tensor of the same rank as `labeled_tensor`, cropped randomly in the selected dimensions. Raises: ValueError: If the shape map contains an axis name not in the input tensor. """ with ops.name_scope(name, 'lt_random_crop', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) for axis_name in shape_map: if axis_name not in labeled_tensor.axes: raise ValueError('Selection axis %s not in axes %s' % (axis_name, labeled_tensor.axes)) shape = [] axes = [] for axis in labeled_tensor.axes.values(): if axis.name in shape_map: size = shape_map[axis.name] shape.append(size) # We lose labels for the axes we crop, leaving just the size. axes.append((axis.name, size)) else: shape.append(len(axis)) axes.append(axis) crop_op = random_ops.random_crop( labeled_tensor.tensor, shape, seed=seed, name=scope) return core.LabeledTensor(crop_op, axes) # TODO(shoyer): Allow the user to select the axis over which to map. @tc.returns(core.LabeledTensor) @tc.accepts(collections.Callable, core.LabeledTensorLike, tc.Optional(string_types)) def map_fn(fn, labeled_tensor, name=None): """Map on the list of tensors unpacked from labeled_tensor. See tf.map_fn. Args: fn: The function to apply to each unpacked LabeledTensor. It should have type LabeledTensor -> LabeledTensor. labeled_tensor: The input tensor. name: Optional op name. Returns: A tensor that packs the results of applying fn to the list of tensors unpacked from labeled_tensor. """ with ops.name_scope(name, 'lt_map_fn', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) unpack_lts = unpack(labeled_tensor) # TODO(ericmc): Fix this upstream. if labeled_tensor.dtype == dtypes.string: # We must construct the full graph here, because functional_ops.map_fn # doesn't work for string-valued tensors. # Constructing the full graph may be slow. map_lts = [fn(t) for t in unpack_lts] return pack(map_lts, list(labeled_tensor.axes.values())[0], name=scope) else: # Figure out what the axis labels should be, but use tf.map_fn to # construct the graph because it's efficient. # It may be slow to construct the full graph, so we infer the labels from # the first element. # TODO(ericmc): This builds a subgraph which then gets thrown away. # Find a more elegant solution. first_map_lt = fn(unpack_lts[0]) final_axes = list(labeled_tensor.axes.values())[:1] + list( first_map_lt.axes.values()) @tc.returns(ops.Tensor) @tc.accepts(ops.Tensor) def tf_fn(tensor): original_axes = list(labeled_tensor.axes.values())[1:] tensor_lt = core.LabeledTensor(tensor, original_axes) return fn(tensor_lt).tensor map_op = functional_ops.map_fn(tf_fn, labeled_tensor.tensor) map_lt = core.LabeledTensor(map_op, final_axes) return core.identity(map_lt, name=scope) @tc.returns(core.LabeledTensor) @tc.accepts(collections.Callable, core.LabeledTensorLike, core.LabeledTensorLike, tc.Optional(string_types)) def foldl(fn, labeled_tensor, initial_value, name=None): """Left fold on the list of tensors unpacked from labeled_tensor. See tf.foldl. Args: fn: The function to apply to each unpacked LabeledTensor. It should have type (LabeledTensor, LabeledTensor) -> LabeledTensor. Its arguments are (accumulated_value, next_value). labeled_tensor: The input tensor. initial_value: The initial value of the accumulator. name: Optional op name. Returns: The accumulated value. """ with ops.name_scope(name, 'lt_foldl', [labeled_tensor, initial_value]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) initial_value = core.convert_to_labeled_tensor(initial_value) @tc.returns(ops.Tensor) @tc.accepts(ops.Tensor, ops.Tensor) def tf_fn(accumulator, next_element): accumulator_lt = core.LabeledTensor(accumulator, initial_value.axes) next_element_lt = core.LabeledTensor( next_element, list(labeled_tensor.axes.values())[1:]) return fn(accumulator_lt, next_element_lt).tensor foldl_op = functional_ops.foldl( tf_fn, labeled_tensor.tensor, initializer=initial_value.tensor) foldl_lt = core.LabeledTensor(foldl_op, initial_value.axes) return core.identity(foldl_lt, name=scope) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Optional(tc.Collection(string_types)), tc.Optional(string_types)) def squeeze(labeled_tensor, axis_names=None, name=None): """Remove size-1 dimensions. See tf.squeeze. Args: labeled_tensor: The input tensor. axis_names: The names of the dimensions to remove, or None to remove all size-1 dimensions. name: Optional op name. Returns: A tensor with the specified dimensions removed. Raises: ValueError: If the named axes are not in the tensor, or if they are not size-1. """ with ops.name_scope(name, 'lt_squeeze', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) if axis_names is None: axis_names = [a.name for a in labeled_tensor.axes.values() if len(a) == 1] for axis_name in axis_names: if axis_name not in labeled_tensor.axes: raise ValueError('axis %s is not in tensor axes %s' % (axis_name, labeled_tensor.axes)) elif len(labeled_tensor.axes[axis_name]) != 1: raise ValueError( 'cannot squeeze axis with size greater than 1: (%s, %s)' % (axis_name, labeled_tensor.axes[axis_name])) squeeze_dimensions = [] axes = [] for i, axis in enumerate(labeled_tensor.axes.values()): if axis.name in axis_names: squeeze_dimensions.append(i) else: axes.append(axis) if squeeze_dimensions: squeeze_op = array_ops.squeeze( labeled_tensor.tensor, squeeze_dimensions, name=scope) else: squeeze_op = array_ops.identity(labeled_tensor.tensor, name=scope) return core.LabeledTensor(squeeze_op, axes) # pylint: disable=invalid-name ReduceAxis = tc.Union(string_types, tc.Tuple(string_types, collections.Hashable)) ReduceAxes = tc.Optional(tc.Union(ReduceAxis, tc.Collection(ReduceAxis))) # pylint: enable=invalid-name @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, core.LabeledTensorLike, tc.Optional(string_types)) def matmul(a, b, name=None): """Matrix multiply two tensors with rank 1 or 2. If both tensors have rank 2, a matrix-matrix product is performed. If one tensor has rank 1 and the other has rank 2, then a matrix-vector product is performed. If both tensors have rank 1, then a vector dot-product is performed. (This behavior matches that of `numpy.dot`.) Both tensors must share exactly one dimension in common, which is the dimension the operation is summed along. The inputs will be automatically transposed if necessary as part of the matmul op. We intend to eventually support `matmul` on higher rank input, and also eventually support summing over any number shared dimensions (via an `axis` argument), but neither of these features has been implemented yet. Args: a: First LabeledTensor. b: Second LabeledTensor. name: Optional op name. Returns: LabeledTensor with the result of matrix multiplication. Axes are ordered by the current axis_order_scope, if set, or in or order of appearance on the inputs. Raises: NotImplementedError: If inputs have rank >2 or share multiple axes. ValueError: If the inputs have rank 0 or do not share any axes. """ with ops.name_scope(name, 'lt_matmul', [a, b]) as scope: a = core.convert_to_labeled_tensor(a) b = core.convert_to_labeled_tensor(b) if len(a.axes) > 2 or len(b.axes) > 2: # We could pass batched inputs to tf.matmul to make this work, but we # would also need to use tf.tile and/or tf.transpose. These are more # expensive than doing reshapes, so it's not clear if it's a good idea to # do this automatically. raise NotImplementedError( 'matmul currently requires inputs with rank 2 or less, but ' 'inputs have ranks %r and %r' % (len(a.axes), len(b.axes))) if not a.axes or not b.axes: raise ValueError( 'matmul currently requires inputs with at least rank 1, but ' 'inputs have ranks %r and %r' % (len(a.axes), len(b.axes))) shared_axes = set(a.axes) & set(b.axes) if len(shared_axes) > 1: raise NotImplementedError( 'matmul does not yet support summing over multiple shared axes: %r. ' 'Use transpose and reshape to create a single shared axis to sum ' 'over.' % shared_axes) if not shared_axes: raise ValueError('there must have exactly one axis in common between ' 'input to matmul: %r, %r' % (a.axes.keys(), b.axes.keys())) shared_axis, = shared_axes if a.axes[shared_axis] != b.axes[shared_axis]: raise ValueError('axis %r does not match on input arguments: %r vs %r' % (shared_axis, a.axes[shared_axis].value, b.axes[shared_axis].value)) result_axes = [] for axes in [a.axes, b.axes]: for axis in axes.values(): if axis.name != shared_axis: result_axes.append(axis) axis_scope_order = core.get_axis_order() if axis_scope_order is not None: result_axis_names = [axis.name for axis in result_axes] new_axis_names = [ name for name in axis_scope_order if name in result_axis_names ] if new_axis_names != result_axis_names: # switch a and b b, a = a, b # result_axes is a list of length 1 or 2 result_axes = result_axes[::-1] squeeze_dims = [] if len(a.axes) == 1: a_tensor = array_ops.reshape(a.tensor, (1, -1)) squeeze_dims.append(0) transpose_a = False else: a_tensor = a.tensor transpose_a = list(a.axes.keys()).index(shared_axis) == 0 if len(b.axes) == 1: b_tensor = array_ops.reshape(b.tensor, (-1, 1)) squeeze_dims.append(1) transpose_b = False else: b_tensor = b.tensor transpose_b = list(b.axes.keys()).index(shared_axis) == 1 result_op = math_ops.matmul( a_tensor, b_tensor, transpose_a=transpose_a, transpose_b=transpose_b) if squeeze_dims: result_op = array_ops.squeeze(result_op, squeeze_dims) result_op = array_ops.identity(result_op, name=scope) return core.LabeledTensor(result_op, result_axes) @tc.returns(types.FunctionType) @tc.accepts(string_types, collections.Callable) def define_reduce_op(op_name, reduce_fn): """Define a reduction op for labeled tensors. Args: op_name: string name of the TensorFlow op. reduce_fn: function to call to evaluate the op on a tf.Tensor. Returns: Function defining the given reduction op that acts on a LabeledTensor. """ default_name = 'lt_%s' % op_name @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, ReduceAxes, tc.Optional(string_types)) def op(labeled_tensor, axes=None, name=None): """Computes the given reduction across the given axes of a LabeledTensor. See `tf.{op_name}` for full details. Args: labeled_tensor: The input tensor. axes: A set of axes or None. If None, all axes will be reduced. Axes must all be strings, in which case those dimensions will be removed, or pairs of (name, None) or (name, label), in which case those dimensions will be kept. name: Optional op name. Returns: The reduced LabeledTensor. Raises: ValueError: if any of the axes to reduce over are not found on `labeled_tensor`. """ with ops.name_scope(name, default_name, [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) if axes is None: axes = labeled_tensor.axes.keys() if isinstance(axes, (string_types, tuple)): axes = [axes] reduction_axes = {} axes_to_squeeze = [] for a in axes: if isinstance(a, string_types): # We squeeze out this axis. reduction_axes[a] = a axes_to_squeeze.append(a) else: # We keep this axis, with the user-provided labels. (axis_name, label) = a if label is not None: # The input was a single label, so make it a list so it can be # turned into an Axis. label = [label] reduction_axes[axis_name] = (axis_name, label) for axis_name in reduction_axes: if axis_name not in labeled_tensor.axes: raise ValueError('Axis %s not in axes %s' % (axis_name, labeled_tensor.axes)) intermediate_axes = [] reduction_dimensions = [] for i, axis in enumerate(labeled_tensor.axes.values()): if axis.name in reduction_axes: intermediate_axes.append(reduction_axes[axis.name]) reduction_dimensions.append(i) else: intermediate_axes.append(axis) reduce_op = reduce_fn( labeled_tensor.tensor, reduction_dimensions, keep_dims=True) reduce_lt = core.LabeledTensor(reduce_op, intermediate_axes) return squeeze(reduce_lt, axes_to_squeeze, name=scope) op.__doc__ = op.__doc__.format(op_name=op_name) op.__name__ = op_name return op reduce_all = define_reduce_op('reduce_all', math_ops.reduce_all) reduce_any = define_reduce_op('reduce_any', math_ops.reduce_any) reduce_logsumexp = define_reduce_op('reduce_logsumexp', math_ops.reduce_logsumexp) reduce_max = define_reduce_op('reduce_max', math_ops.reduce_max) reduce_mean = define_reduce_op('reduce_mean', math_ops.reduce_mean) reduce_min = define_reduce_op('reduce_min', math_ops.reduce_min) reduce_prod = define_reduce_op('reduce_prod', math_ops.reduce_prod) reduce_sum = define_reduce_op('reduce_sum', math_ops.reduce_sum) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Mapping(str, tc.Union(int, ops.Tensor)), tc.Optional(string_types)) def tile(labeled_tensor, multiples, name=None): """Constructs a tensor by tiling a given tensor. Only axes without tick-labels can be tiled. (Otherwise, axis labels on tiled tensors would no longer be unique.) See lt.tile. Args: labeled_tensor: The input tensor. multiples: A mapping where the keys are axis names and the values are the integer number of times to tile along that axis. Only axes with a multiple different than 1 need be included. name: Optional op name. Returns: A tensor with the indicated axes tiled. Raises: ValueError: If the tiled axes are not axes in the input tensor, or if any axes in multiples have tick labels. """ with ops.name_scope(name, 'lt_tile', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) if not set(multiples.keys()) <= set(labeled_tensor.axes.keys()): raise ValueError('tile axes %r are not contained in the set of axis ' 'names %r on the input labeled tensor' % (multiples.keys(), labeled_tensor.axes)) labeled_axes = [ name for name in multiples if labeled_tensor.axes[name].labels is not None ] if labeled_axes: raise ValueError('cannot tile axes with tick labels: %r' % labeled_axes) multiples_list = [multiples.get(name, 1) for name in labeled_tensor.axes] tile_op = array_ops.tile(labeled_tensor.tensor, multiples_list, name=scope) new_axes = [ axis.name if axis.labels is None else axis for axis in labeled_tensor.axes.values() ] return core.LabeledTensor(tile_op, new_axes) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Mapping(str, tc.Tuple(core.AxisValue, core.AxisValue)), string_types, tc.Optional(string_types)) def pad(labeled_tensor, paddings, mode='CONSTANT', name=None): """Pads a tensor. See tf.pad. Args: labeled_tensor: The input tensor. paddings: A mapping where the keys are axis names and the values are tuples where the first element is the padding to insert at the beginning of the axis and the second is the padding to insert at the end of the axis. mode: One of "CONSTANT", "REFLECT", or "SYMMETRIC". name: Optional op name. Returns: A tensor with the indicated axes padded, optionally with those axes extended with the provided labels. Raises: ValueError: If the padded axes are not axes in the input tensor. """ with ops.name_scope(name, 'lt_pad', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) if not set(paddings.keys()) <= set(labeled_tensor.axes.keys()): raise ValueError('pad axes %r are not contained in the set of axis ' 'names %r on the input labeled tensor' % (paddings.keys(), labeled_tensor.axes)) new_axes = [] padding_pairs = [] for name, axis in labeled_tensor.axes.items(): if name in paddings: padding_before, padding_after = paddings[name] axis_before = core.Axis(name, padding_before) axis_after = core.Axis(name, padding_after) new_axes.append(core.concat_axes([axis_before, axis, axis_after])) padding_pairs.append((len(axis_before), len(axis_after))) else: new_axes.append(axis) padding_pairs.append((0, 0)) pad_op = array_ops.pad(labeled_tensor.tensor, padding_pairs, mode, name=scope) return core.LabeledTensor(pad_op, new_axes) @tc.returns(core.LabeledTensor) @tc.accepts( tc.Union(np.ndarray, list, tuple, core.Scalar), tc.Optional(dtypes.DType), tc.Optional( tc.Union(core.Axes, tc.Collection( tc.Union(string_types, core.AxisLike)))), tc.Optional(string_types)) def constant(value, dtype=None, axes=None, name=None): """Creates a constant tensor. If `axes` includes any strings, shape is inferred from `value`. Otherwise, the sizes of the given `axes` are used to set `shape` for `tf.constant`. See tf.constant for more details. Args: value: The input tensor. dtype: The type of the returned tensor. axes: Optional Axes, list of strings or list of objects coercible to Axis objects. By default, axes are assumed to be an empty list (i.e., `value` is treated as a scalar). name: Optional op name. Returns: The tensor with elements set to zero. """ with ops.name_scope(name, 'lt_constant', [value]) as scope: if axes is None: axes = [] if isinstance(axes, core.Axes): axes = axes.values() if any(isinstance(ax, string_types) for ax in axes): # need to infer shape shape = None else: # axes already indicate shape axes = [core.as_axis(a) for a in axes] shape = [a.size for a in axes] op = array_ops.constant(value, dtype=dtype, shape=shape, name=scope) return core.LabeledTensor(op, axes) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Optional(dtypes.DType), tc.Optional(string_types)) def zeros_like(labeled_tensor, dtype=None, name=None): """Creates an identical tensor with all elements set to zero. Args: labeled_tensor: The input tensor. dtype: The type of the returned tensor. name: Optional op name. Returns: The tensor with elements set to zero. """ with ops.name_scope(name, 'lt_zeros_like', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) op = array_ops.zeros_like(labeled_tensor.tensor, dtype=dtype, name=scope) return core.LabeledTensor(op, labeled_tensor.axes) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Optional(dtypes.DType), tc.Optional(string_types)) def ones_like(labeled_tensor, dtype=None, name=None): """Creates an identical tensor with all elements set to one. Args: labeled_tensor: The input tensor. dtype: The type of the returned tensor. name: Optional op name. Returns: The tensor with elements set to one. """ with ops.name_scope(name, 'lt_ones_like', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) op = array_ops.ones_like(labeled_tensor.tensor, dtype=dtype, name=scope) return core.LabeledTensor(op, labeled_tensor.axes) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, tc.Optional(dtypes.DType), tc.Optional(string_types)) def cast(labeled_tensor, dtype=None, name=None): """Casts a labeled tensor to a new type. Args: labeled_tensor: The input tensor. dtype: The type of the returned tensor. name: Optional op name. Returns: A labeled tensor with the new dtype. """ with ops.name_scope(name, 'lt_cast', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) op = math_ops.cast(labeled_tensor.tensor, dtype=dtype, name=scope) return core.LabeledTensor(op, labeled_tensor.axes) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, string_types, tc.Optional(string_types)) def verify_tensor_all_finite(labeled_tensor, message, name=None): """Asserts a tensor doesn't contain NaNs or Infs. See tf.verify_tensor_all_finite. Args: labeled_tensor: The input tensor. message: Message to log on failure. name: Optional op name. Returns: The input tensor. """ with ops.name_scope(name, 'lt_verify_tensor_all_finite', [labeled_tensor]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) op = numerics.verify_tensor_all_finite( labeled_tensor.tensor, msg=message, name=scope) return core.LabeledTensor(op, labeled_tensor.axes) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, core.LabeledTensorLike, tc.Optional(string_types)) def boolean_mask(labeled_tensor, mask, name=None): """Apply a boolean mask to a labeled tensor. Unlike `tf.boolean_mask`, this currently only works on 1-dimensional masks. The mask is applied to the first axis of `labeled_tensor`. Labels on the first axis are removed, because True indices in `mask` may not be known dynamically. Args: labeled_tensor: The input tensor. mask: The type of the returned tensor. name: Optional op name. Returns: The masked labeled tensor. Raises: ValueError: if the first axis of the mask """ with ops.name_scope(name, 'lt_boolean_mask', [labeled_tensor, mask]) as scope: labeled_tensor = core.convert_to_labeled_tensor(labeled_tensor) mask = core.convert_to_labeled_tensor(mask) if len(mask.axes) > 1: raise NotImplementedError( "LabeledTensor's boolean_mask currently only supports 1D masks") mask_axis = list(mask.axes.values())[0] lt_axis = list(labeled_tensor.axes.values())[0] if mask_axis != lt_axis: raise ValueError('the first axis of the labeled tensor and the mask ' 'are not equal:\n%r\n%r' % (lt_axis, mask_axis)) op = array_ops.boolean_mask(labeled_tensor.tensor, mask.tensor, name=scope) # TODO(shoyer): attempt to infer labels for the masked values, by calling # tf.contrib.util.constant_value on the mask? axes = [lt_axis.name] + list(labeled_tensor.axes.values())[1:] return core.LabeledTensor(op, axes) @tc.returns(core.LabeledTensor) @tc.accepts(core.LabeledTensorLike, core.LabeledTensorLike, core.LabeledTensorLike, tc.Optional(string_types)) def where(condition, x, y, name=None): """Return elements from x or y depending on condition. See `tf.where` for more details. This function currently only implements the three argument version of where. Args: condition: LabeledTensor of type `bool`. x: LabeledTensor for values where condition is true. y: LabeledTensor for values where condition is false. name: Optional op name. Returns: The labeled tensor with values according to condition. Raises: ValueError: if `x` and `y` have different axes, or if the axes of `x` do not start with the axes of `condition`. """ with ops.name_scope(name, 'lt_where', [condition, x, y]) as scope: condition = core.convert_to_labeled_tensor(condition) x = core.convert_to_labeled_tensor(x) y = core.convert_to_labeled_tensor(y) if not condition.axes == x.axes == y.axes: raise ValueError('all inputs to `where` must have equal axes') op = array_ops.where(condition.tensor, x.tensor, y.tensor, name=scope) return core.LabeledTensor(op, x.axes)
apache-2.0
tzk/EDeN
eden/__init__.py
2
2422
#!/usr/bin/env python """Provides interface for vectorizer.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import dill from sklearn.base import BaseEstimator, TransformerMixin __author__ = "Fabrizio Costa" __copyright__ = "Copyright 2015, Fabrizio Costa" __credits__ = ["Fabrizio Costa", "Bjoern Gruening"] __license__ = "MIT" __version__ = "v2.0.1202" __maintainer__ = "Fabrizio Costa" __email__ = "[email protected]" __status__ = "Production" __magic__ = ('EDeN', 42) __magic_py2hash__ = -7048895691955021301 __magic_py3hash__ = -1821860980875793120 _bitmask_ = 4294967295 class AbstractVectorizer(BaseEstimator, TransformerMixin): """Interface declaration for the Vectorizer class.""" def annotate(self, graphs, estimator=None, reweight=1.0, relabel=False): raise NotImplementedError("Should have implemented this") def set_params(self, **args): raise NotImplementedError("Should have implemented this") def transform(self, graphs): raise NotImplementedError("Should have implemented this") def vertex_transform(self, graph): raise NotImplementedError("Should have implemented this") def run_dill_encoded(what): """Use dill as replacement for pickle to enable multiprocessing on instance methods""" fun, args = dill.loads(what) return fun(*args) def apply_async(pool, fun, args, callback=None): """ Wrapper around apply_async() from multiprocessing, to use dill instead of pickle. This is a workaround to enable multiprocessing of classes. """ return pool.apply_async(run_dill_encoded, (dill.dumps((fun, args)),), callback=callback) def fast_hash_2(dat_1, dat_2, bitmask=_bitmask_): return int(hash((dat_1, dat_2)) & bitmask) + 1 def fast_hash_3(dat_1, dat_2, dat_3, bitmask=_bitmask_): return int(hash((dat_1, dat_2, dat_3)) & bitmask) + 1 def fast_hash_4(dat_1, dat_2, dat_3, dat_4, bitmask=_bitmask_): return int(hash((dat_1, dat_2, dat_3, dat_4)) & bitmask) + 1 def fast_hash(vec, bitmask=_bitmask_): return int(hash(tuple(vec)) & bitmask) + 1 def fast_hash_vec(vec, bitmask=_bitmask_): hash_vec = [] running_hash = 0xAAAAAAAA for i, vec_item in enumerate(vec): running_hash ^= hash((running_hash, vec_item, i)) hash_vec.append(int(running_hash & bitmask) + 1) return hash_vec
gpl-3.0