Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
y - 32593 + 10939. What are the prime factors of y? 2, 3, 401 Let q(w) = -w + 4 - 3w + 4w - 4w. Let z be q(-3). Suppose g - z = -g. List the prime factors of g. 2 Suppose 5h = -4i + 1887, 4h + 2i + i = 1509. List the prime factors of h. 3, 5 Let x be -3 - 5(-3 - -2). Suppose -xv = 5o - 13, -12 - 2 = -5o - v. Suppose -4z + 128 = od, -d = -0z - 3z - 21. List the prime factors of d. 2, 3 Suppose -4b + 3i = -5b + 1178, 0 = 2b + 2i - 2356. What are the prime factors of b? 2, 19, 31 Suppose 5j + 990 = -35. Let f = j - -291. List the prime factors of f. 2, 43 Suppose q - 223 = -2a + 516, -2a - 4q = -736. List the prime factors of a. 2, 5, 37 Let c(x) = -x*3 + 31x*2 - 73x + 15. List the prime factors of c(21). 2, 3, 241 Let a(h) = -2h3 + 88h*2 - 52h + 91. What are the prime factors of a(43)? 1553 Let t = -262 + 1387. List the prime factors of t. 3, 5 Suppose -34c - 5c = -65208. What are the prime factors of c? 2, 11, 19 Let j = -2548 - -2847. List the prime factors of j. 13, 23 Let h = 741 + -461. List the prime factors of h. 2, 5, 7 Let v be (-3)/((-12)/(-32))9/(-12). List the prime factors of 3/(-36)-1516 - 2/v. 2, 3, 7 Suppose 0 = -5q + 22 - 12. Suppose 39 = qm + u, 5m - 105 = u - 2u. What are the prime factors of m/(-33)(-75)/2? 5 Let b(t) = -t3 - 5t*2 - 9t + 3. What are the prime factors of b(-4)? 23 Suppose 2h + 4r - 95 = 127, 4h + 4r - 452 = 0. List the prime factors of h. 5, 23 Suppose 0 = -2c + 4c - 2z - 114, -5c - 4z = -276. Let k = 100 - c. What are the prime factors of k? 2, 11 Let c(p) be the second derivative of p4/12 + p3/3 + p2/2 - 19p. Let d be 2 - ((-4)/(-2) - -4). What are the prime factors of c(d)? 3 Suppose -4s + 508 = -1720. What are the prime factors of s? 557 Suppose 2s + j - 4j - 543 = 0, 1367 = 5s + 2j. Suppose 0 = -8v + 5v + 3g + s, 2g = -4v + 352. What are the prime factors of v? 89 Suppose 2a = 0, -2m - 5a - 14 = -0a. Let d(x) = -11x + 10. List the prime factors of d(m). 3, 29 Let h be 2(-6)/12 - 31. Let s(m) = -22m - 13. What are the prime factors of s(h)? 3, 5 Let w = 45 + 291. List the prime factors of -1(0 - -7)(-11808)/w. 2, 3, 41 Let h(t) = 2 - 7t - 8t*3 + 0 + 12t*2 - 16t*2 + 0t3. What are the prime factors of h(-3)? 7, 29 Let g(q) = -q3 - 64q2 + 237q - 18. What are the prime factors of g(-68)? 2, 1181 Suppose -3m + 4c = -800, -5c - 415 - 653 = -4m. What are the prime factors of m? 2, 17 What are the prime factors of (-2)/((-26080)/(-13045) - (4 + -2))? 2609 Let y(s) = 4s2 + s - 5. Let n(z) = -z2 - z - 1. Let p(x) = -6n(x) + y(x). List the prime factors of p(-4). 7, 19 Let r be ((-1)/32)/(18/108). Let o(y) = -y + 12. What are the prime factors of o(r)? 2 Let p(q) = q2 + 14. Let h(d) = -d2 + 3d + 11. Let n be h(4). What are the prime factors of p(n)? 3, 7 Let f(a) = 113a + 55. What are the prime factors of f(9)? 2, 67 Let x = 409 - 139. Suppose 2c - 157 = -c - 2f, 5c - x = -5f. List the prime factors of c. 7 Let n be (1/(-2))/(2/32). Let c = -7 - -17. Let g = n + c. List the prime factors of g. 2 Suppose 6v - v - 15 = 0. Suppose 0 = vc + 4h - 17, 2c - 2 = -3h + 8. List the prime factors of c. 11 Let l(d) be the first derivative of d*3 - 2d*2 - 4d + 3. What are the prime factors of l(-3)? 5, 7 Let y(p) = 8p + 8. Let z = 18 - 13. What are the prime factors of y(z)? 2, 3 Let s = -123 - -126. What are the prime factors of (s - -15 - 3)(-4)/(-6)? 2, 5 Let c(o) = 4o + 10. Let l be c(-2). Suppose 3s + 309 = 2d + 10, ls + 294 = 2d. List the prime factors of d. 2, 71 Let a(g) = 69g*2 - 5g + 4. List the prime factors of a(3). 2, 5, 61 Let t be ((-9)/(-6))/(0 - 12/(-152)). Let q(p) = p*2 - 16p - 25. What are the prime factors of q(t)? 2 Let f = 31 + 9. What are the prime factors of (669/(-4))/((-30)/f)? 223 Let l(j) = 6j2 + 13j + 11. What are the prime factors of l(-11)? 2, 3, 11 Suppose -256 = 6r - 268. What are the prime factors of r? 2 What are the prime factors of (-330)/(-110)521/3? 521 Suppose -7 = -4z + 13, 0 = -2w - 5z + 27. Let p be (136/85)/(w/(-5)). Let f = p + 15. What are the prime factors of f? 7 Let s(x) = -3x*3 - 8x*2 - 9x + 1. Let q be s(-5). Let r = q - 133. What are the prime factors of r? 2, 11 Suppose 2c - 3056 = -6z, 3c + z - 1618 - 2990 = 0. List the prime factors of c. 29, 53 Suppose 4p - q - 1 = -2, 0 = -2q - 6. Let r(b) = 10b*2 - 1. Let z be r(p). Let j = -2 + z. List the prime factors of j. 7 Suppose 0 = -0s - 4s - 40. Let h = s - -2. Let d = h - -13. List the prime factors of d. 5 List the prime factors of ((-106)/318)/((-12543)/(-12546) - 1). 2, 17, 41 Let q(b) = -14b + 0 + 1 - 2b2 + 3b*2 + 3. What are the prime factors of q(18)? 2, 19 Suppose 61 = 4k - d, k = 3k + d - 29. List the prime factors of 44/6 + 10/k. 2 Let h = 1051 - 621. Suppose -2i + 10z - 6z = -430, -2i + 2z = -h. What are the prime factors of i? 5, 43 Suppose x - 3 + 6 = 0. What are the prime factors of (36/15)/(2/(-440)x)? 2, 11 Let t(c) = 29c - 4. Let x be t(3). Let i = x + -23. List the prime factors of 4748/i + (-4)/30. 79 Let f(v) = v*2 + 7v + 2. Let n be f(-7). Suppose 2r = -4m - nr + 356, 0 = -2m + 3r + 158. What are the prime factors of m? 5, 17 Suppose -d + 59 = -h - 74, 4d - h - 526 = 0. List the prime factors of d. 131 Suppose -2w = 2z - 1768, 12 = -5w + w. What are the prime factors of z? 887 Let v be -2(-34)/(-6)-3. Let o = -47 + v. Let g = o + 35. What are the prime factors of g? 2, 11 Let r = 12 - 18. Let m = 26 + r. What are the prime factors of m? 2, 5 Let d = 105 - -10. Let t = d - 69. List the prime factors of t. 2, 23 Suppose -3k + 1080 = -111. Let x = 697 - k. What are the prime factors of x? 2, 3, 5 Let w = 1357 - 965. What are the prime factors of w? 2, 7 Let r be (-1)/(-3) - 416/(-12). Suppose r = w - 15. What are the prime factors of w? 2, 5 Suppose -13c + 33 = 85. What are the prime factors of (11/(165/(-50)))/(c/210)? 5, 7 Let v = -109 - -112. Suppose vt - 49 - 11 = 0. What are the prime factors of t? 2, 5 Suppose 0 = -4m + 3m + 245. List the prime factors of -77/(m/(-50)). 2, 5 Suppose -4291 + 13491 = 20y. Suppose 176 + 67 = i - 4t, 2i + 5t = y. List the prime factors of i. 5, 47 Let o be -3 - (-629 + -6). Suppose 0 = -4x + 2w + 12, -2x - 4w = -4x + 12. Suppose q - o = -xq. List the prime factors of q. 59 Let p = 39 + 9. Suppose pq = 50q - 132. List the prime factors of q. 2, 3, 11 Let w(y) = -3y3 - 6y*2 - 3. Let o(s) = -4s*3 - 6s*2 - 4. Let v(i) = 2o(i) - 3w(i). Let u be v(-6). What are the prime factors of u/5 + 1014/30? 2, 17 What are the prime factors of ((-1610)/(-21) - -3)3? 239 Suppose v - 106 = 5z - v, -4z + 5v = 78. Let o = -27 - z. Let d = o + 7. What are the prime factors of d? 2 Let j = 8 + -11. Let h be 2/(-7)(j + -11). Suppose -4b + 4g = -64, -b + 4g + 9 = -h. List the prime factors of b. 17 Suppose 5w - 267 + 107 = 0. What are the prime factors of w? 2 Let g(r) = r3 + r2 + r + 3. Let t be g(0). Suppose 2k + 2k - x - 91 = 0, 5k + 4x = 140. What are the prime factors of k + 4/(-4) + t? 2, 13 Let h = -83 + 142. What are the prime factors of h? 59 Let o = 11 + 77. Suppose -i + o = 31. What are the prime factors of i? 3, 19 Suppose 5l - 17377 = -3a, -5l + 16036 - 4453 = 2a. What are the prime factors of a? 2, 2897 Suppose -2u + 2o = -2072, -4u + 4483 = -3o + 337. What are the prime factors of u? 2, 3, 173 Suppose -6z - 73 = -2z + m, -4z - 3m - 67 = 0. Let n = 10 + z. Let p(a) = -3a + 6. List the prime factors of p(n). 3, 11 Let v(d) = d2 + d + 1. Let b be v(0). List the prime factors of (77/b)/((-17)/(-17)). 7, 11 Let m be -1223/(-18). Let k be 47/m - 21/28. Suppose 0 = -2g - k + 51. List the prime factors of g. 2, 5 Suppose 2b - 5d - 5383 = 90, d = 3b - 8177. List the prime factors of b. 2, 3, 227 Let t(a) = -3a + 12. Let o be t(6). Let p be 0/(-1) + (-480)/o. Let h = -50 + p. What are the prime factors of h? 2, 3, 5 Let k(h) = 2h2 - 2h + 3. Let g be k(3). Let t(d) = -5 + gd - 10 - 9. What are the prime factors of t(6)? 2, 3, 11 Let z(w) = w3 - w2 - 2. Let n be z(2). Suppose -98 = l - nl. List the prime factors of -2*(-2 - l/	{ "pile_set_name": "DM Mathematics" }
5 What is the remainder when 148776 is divided by 21249? 33 Calculate the remainder when 10933 is divided by 837. 52 Calculate the remainder when 4391 is divided by 76. 59 Calculate the remainder when 15306 is divided by 3043. 91 What is the remainder when 2447 is divided by 32? 15 Calculate the remainder when 85056 is divided by 28349. 9 Calculate the remainder when 31449 is divided by 45. 39 What is the remainder when 7268 is divided by 2320? 308 What is the remainder when 22541 is divided by 471? 404 What is the remainder when 2062 is divided by 57? 10 What is the remainder when 2491805 is divided by 17? 13 Calculate the remainder when 20107 is divided by 7. 3 What is the remainder when 16244 is divided by 74? 38 What is the remainder when 7254 is divided by 7249? 5 What is the remainder when 1996 is divided by 116? 24 What is the remainder when 213675 is divided by 30524? 7 Calculate the remainder when 908 is divided by 40. 28 What is the remainder when 778050 is divided by 630? 0 Calculate the remainder when 186 is divided by 16. 10 What is the remainder when 22809 is divided by 65? 59 What is the remainder when 13798 is divided by 119? 113 What is the remainder when 38396 is divided by 6? 2 What is the remainder when 6512 is divided by 3246? 20 Calculate the remainder when 2957 is divided by 245. 17 What is the remainder when 6100 is divided by 29? 10 What is the remainder when 17664 is divided by 3514? 94 What is the remainder when 363071 is divided by 61? 60 Calculate the remainder when 4595 is divided by 1056. 371 Calculate the remainder when 255157 is divided by 31. 27 Calculate the remainder when 1452 is divided by 1371. 81 What is the remainder when 684123 is divided by 31096? 11 What is the remainder when 60981 is divided by 404? 381 Calculate the remainder when 38096 is divided by 334. 20 What is the remainder when 2234 is divided by 465? 374 Calculate the remainder when 43485 is divided by 489. 453 What is the remainder when 16610 is divided by 25? 10 What is the remainder when 32261 is divided by 8? 5 What is the remainder when 32417 is divided by 16? 1 What is the remainder when 5796 is divided by 510? 186 What is the remainder when 209 is divided by 187? 22 What is the remainder when 58603 is divided by 14? 13 What is the remainder when 59616 is divided by 15? 6 Calculate the remainder when 1539 is divided by 11. 10 What is the remainder when 13866 is divided by 13860? 6 What is the remainder when 8908 is divided by 758? 570 Calculate the remainder when 11477 is divided by 280. 277 What is the remainder when 409129 is divided by 27? 25 Calculate the remainder when 51577 is divided by 41. 40 Calculate the remainder when 77394 is divided by 2978. 2944 Calculate the remainder when 34279 is divided by 16928. 423 Calculate the remainder when 129370 is divided by 345. 340 Calculate the remainder when 45227 is divided by 6445. 112 What is the remainder when 546732 is divided by 287? 284 Calculate the remainder when 17666 is divided by 53. 17 Calculate the remainder when 89577 is divided by 3199. 5 Calculate the remainder when 335757 is divided by 28. 9 Calculate the remainder when 2213 is divided by 593. 434 Calculate the remainder when 5134 is divided by 343. 332 What is the remainder when 55991 is divided by 9319? 77 Calculate the remainder when 4701869 is divided by 25. 19 Calculate the remainder when 12464 is divided by 60. 44 What is the remainder when 22120 is divided by 3331? 2134 What is the remainder when 8827 is divided by 47? 38 Calculate the remainder when 1420 is divided by 288. 268 What is the remainder when 10801 is divided by 13? 11 What is the remainder when 17893 is divided by 884? 213 What is the remainder when 92483 is divided by 180? 143 What is the remainder when 175 is divided by 80? 15 Calculate the remainder when 4732 is divided by 1108. 300 What is the remainder when 40077 is divided by 20? 17 What is the remainder when 6589 is divided by 315? 289 Calculate the remainder when 240570 is divided by 3. 0 Calculate the remainder when 3819 is divided by 402. 201 What is the remainder when 3674 is divided by 157? 63 What is the remainder when 94375 is divided by 137? 119 What is the remainder when 4116 is divided by 374? 2 What is the remainder when 40023 is divided by 42? 39 What is the remainder when 91705 is divided by 18333? 40 What is the remainder when 9939 is divided by 287? 181 What is the remainder when 55551 is divided by 41? 37 Calculate the remainder when 66212 is divided by 31. 27 Calculate the remainder when 14090 is divided by 716. 486 Calculate the remainder when 3256 is divided by 465. 1 What is the remainder when 5937 is divided by 106? 1 What is the remainder when 21343 is divided by 1412? 163 What is the remainder when 8340 is divided by 321? 315 What is the remainder when 6752 is divided by 559? 44 What is the remainder when 42012 is divided by 186? 162 What is the remainder when 567 is divided by 282? 3 What is the remainder when 4888 is divided by 223? 205 What is the remainder when 661061 is divided by 302? 285 What is the remainder when 272682 is divided by 27? 9 What is the remainder when 393 is divided by 2? 1 Calculate the remainder when 374378 is divided by 187184. 10 What is the remainder when 5103 is divided by 45? 18 Calculate the remainder when 357 is divided by 112. 21 Calculate the remainder when 253441 is divided by 6. 1 What is the remainder when 8662298 is divided by 2060? 2058 What is the remainder when 512 is divided by 27? 26 What is the remainder when 917081 is divided by 1258? 1257 Calculate the remainder when 200521 is divided by 66823. 52 Calculate the remainder when 45610 is divided by 181. 179 What is the remainder when 6041 is divided by 443? 282 Calculate the remainder when 396336 is divided by 2477. 16 Calculate the remainder when 7778 is divided by 118. 108 What is the remainder when 1040 is divided by 364? 312 What is the remainder when 22715 is divided by 45? 35 Calculate the remainder when 408473 is divided by 1253. 1248 What is the remainder when 5786 is divided by 765? 431 Calculate the remainder when 2911 is divided by 83. 6 What is the remainder when 1289 is divided by 905? 384 Calculate the remainder when 9400 is divided by 624. 40 What is the remainder when 22923 is divided by 191? 3 What is the remainder when 6240894 is divided by 39? 36 Calculate the remainder when 298 is divided by 87. 37 Calculate the remainder when 134928 is divided by 1467. 1431 What is the remainder when 136112 is divided by 125? 112 Calculate the remainder when 5660 is divided by 2823. 14 What is the remainder when 519460 is divided by 24? 4 What is the remainder when 528 is divided by 74? 10 Calculate the remainder when 11131 is divided by 336. 43 What is the remainder when 76152 is divided by 42? 6 What is the remainder when 3663 is divided by 155? 98 Calculate the remainder when 18796 is divided by 39. 37 Calculate the remainder when 191016 is divided by 20. 16 What is the remainder when 7449 is divided by 206? 33 Calculate the remainder when 1914702 is divided by 195. 192 What is the remainder when 50815 is divided by 162? 109 What is the remainder when 5049 is divided by 210? 9 What is the remainder when 45924 is divided by 574? 4 What is the remainder when 7928 is divided by 485? 168 Calculate the remainder when 825 is divided by 24. 9 Calculate the remainder when 33928 is divided by 358. 276 What is the remainder when 4589 is divided by 144? 125 Calculate the remainder when 5181 is divided by 475. 431 What is the remainder when 21532 is divided by 312? 4 What is the remainder when 2246 is divided by 563? 557 What is the remainder when 117242 is divided by 39077? 11 What is the remainder when 4913 is divided by 1220? 33 Calculate the remainder when 1771106 is divided by 110. 106 Calculate the remainder when 6918 is divided by 570. 78 What is the remainder when 3065532 is divided by 15? 12 What is the remainder when 453116 is divided by 8? 4 What is the remainder when 1326076 is divided by 651? 640 Calculate the remainder when 643028 is divided by 216. 212 What is the remainder when 428 is divided by 158? 112 What is the remainder when 1069 is divided by 23? 11 What is	{ "pile_set_name": "DM Mathematics" }
1 Let d(l) = 12l3 - 4l*2 - 5l + 6. Let y(b) = b3 + b2 - b. Let p(n) = d(n) - 5y(n). Let s(w) = 6w*3 - 8w*2 + 5. What is 5p(c) - 6s(c)? -c3 + 3c*2 Let n(j) = 13j*3 - 6j*2 - 6j + 6. Let c(s) be the first derivative of 25s4/4 - 11s*3/3 - 11s*2/2 + 11s + 55. Determine 6c(o) - 11n(o). 7o3 Let y(u) be the second derivative of 1/10u*5 - 5/6u*3 + 0u*4 + 0 + 5/2u*2 - 9u. Let m(s) = -4s + 6s + 4 - 6s + s3. What is -5m(a) + 4y(a)? 3a*3 Let m(i) = -15i*3 - 5i*2 + 92i + 1. Let y(h) = 23h3 + 8h*2 - 138h - 2. Give 8m(x) + 5y(x). -5x3 + 46x - 2 Let z(t) = -18 + 6 + 2 + 3 + 6 - t. Let v(y) = -2y3 + 4y*3 - 2y*2 + 3 + 3y - y*3. Give -v(b) - 3z(b). -b*3 + 2b*2 Let s(u) = -2u*2 + 2u + 6. Let y(g) = -9 + 16g + 16 - 4g*2 + 6 - 12g. What is 9s(a) - 4y(a)? -2a2 + 2a + 2 Let o(k) = 7k3 + k. Let q(s) = 13s*3 + s. Let t = -122 - -119. What is tq(m) + 5o(m)? -4m*3 + 2m Let l(k) = -k*2 + k. Suppose -4i = -0i - 8. Let n = 2 - i. Suppose 29 = -3y - ny + 2h, 3 = 3h. Let a(f) = -5f*2 + 5f - 1. Determine yl(p) + 2a(p). -p*2 + p - 2 Let v(y) = y - 5. Let t(p) = 77p - 22. Give -t(i) + 6v(i). -71i - 8 Let n(b) = 1. Let r(k) = -2k3 - 3k - 2. Suppose -2w - 2v = -256, 122 = -0w + w + 4v. Let q = w + -134. Give qn(u) - r(u). 2u*3 + 3u - 2 Let m(g) = -7g3 - 21g*2 + 2g. Let u(t) = 2t3 + 7t*2 - t. Give -3m(c) - 8u(c). 5c*3 + 7c*2 + 2c Let s be 8 + -9 + 83. Let v(l) = sl + 0l + 5 - 25l. Let m(y) = y - 2. Calculate 5m(d) + 2v(d). d Let v(z) = 12z - 8. Let q(l) = 3 - 2l - 2l + 0l. Suppose -4530h = -4487h - 344. Give hq(c) + 3v(c). 4c Let c(a) = -a2 + a + 7. Let j(p) = p - 7. Let r(y) = 2c(y) + 3j(y). Let s(m) = -m2 + m + 1. Calculate -r(f) + 3s(f). -f*2 - 2f + 10 Suppose y - m = 0, -4y - m = -0y + 10. Let v(p) = -p*2 + 2p + 2. Let w(b) = -2b2 + 2b + 2. What is yw(l) + 3v(l)? l*2 + 2l + 2 Let r(v) = -10v3 + 15v*2 + 3v - 4. Let n(s) = 13s3 - 15s*2 - 4s + 3. What is 3n(h) + 4r(h)? -h*3 + 15h*2 - 7 Let v(l) = 10l*3 - 24l2 + 11. Let d(t) = t3 + t*2 + 2. Determine -7d(m) + v(m). 3m3 - 31m*2 - 3 Let x(h) = -4h + 48. Let k(b) = -12b + 144. Calculate -5k(q) + 16x(q). -4q + 48 Let b = -2506 - -2500. Let i(a) = -9a + 11. Let t(u) = 2u + 3u - 4 - 2. Determine bi(v) - 11t(v). -v Let q(v) = -646v. Let u(h) = 86h. Give -5q(p) - 38u(p). -38p Let s(t) = 41t2 - t + 2. Let f(a) = 42a*2 - a + 2. Determine 4f(b) - 3s(b). 45b*2 - b + 2 Let j(o) = 2o*2 + 2o + 1. Let t(x) = -2x2 - 2x - 1. Let f = -117 + 28. Let m = 124 + f. Suppose 0 = -9c + 4c + m. Give ct(b) + 6j(b). -2b2 - 2b - 1 Let i(o) = o. Let z be 137/5 + (-6)/15. Suppose 0 = -0c - 2c + 2n + 14, 5c - n = z. Let u(h) = -h - 6h + 17h + h - 5h. Give ci(m) - u(m). -m Let z(j) = 2j - 1. Let h(m) = -53m - 4. Give h(s) - 4z(s). -61s Let a = -52 - -49. Let i(q) = -8q3 - 3q*2 - 1. Let j(n) = -9n*3 - 4n*2 - 1. Determine aj(b) + 4i(b). -5b*3 - 1 Let s(y) = 2y*3 - 2y*2 + 30y. Let p(k) = -k*2 - k. Determine -4p(l) + s(l). 2l3 + 2l*2 + 34l Suppose 16d + 66 = 194. Let p(l) = 2l - 41. Let f(o) = -o + 14. Determine df(k) + 3p(k). -2k - 11 Let k be (3 - 161/49)-21. Let y(x) = 11x + 3. Let v(d) = 66d + 17. Determine kv(p) - 34y(p). 22p Let k(g) = -g - 56. Let b(p) = p + 29. Calculate 5b(l) + 2k(l). 3l + 33 Let a(i) = -i*3 - i + 1. Let x(w) = -46w*3 - 4w + 3. What is -5a(v) + x(v)? -41v*3 + v - 2 Suppose -3k - 6 - 6 = 0. Suppose 36 + 90 = -7r. Let v(x) = -13x - 5. Let i(y) = -1. Let u(a) = 3a - 3. Let o(n) = -4i(n) + u(n). Determine kv(j) + ro(j). -2j + 2 Let k(d) = -d2 - 9d + 195. Let j be k(-19). Let o be (3 + -1)(-1)/(-1). Let g(x) = 3x - 6. Let c(a) = -a + 3. Calculate jc(i) + og(i). i + 3 Suppose -2p - 106 = -2d, -5p - 5d - 164 - 51 = 0. Let m(l) = 60l3 + 48l - 48. Let j(v) = -v*3 - v + 1. Calculate pj(w) - m(w). -12w3 Let f = 7 + -3. Let w(p) = -4 - 2 + 3p - fp. Suppose -18a - 12a + 180 = 0. Let c(u) = -2u - 13. Give ac(o) - 13w(o). o Let y(m) = 7m - 45. Let o(t) = 5t - 45. Calculate -4o(g) + 3y(g). g + 45 Let f(y) = 4y - 1. Let t(m) = 0m + 0m + 6 - 8m + m - 4. Calculate 5f(r) + 3t(r). -r + 1 Let z(t) = -243t3 + 5 - 7 + 244t3. Let x(h) = h3 - 3. Let k(j) = -2j - 1. Let f be k(1). Give fz(o) + 2x(o). -o3 Let y(v) = -2v. Let d(o) = -4o. Let f(a) = -d(a) + 5y(a). Let r(h) = h. Calculate 6f(m) + 45r(m). 9m Let j(v) = -32v*2 - 3v + 4. Let u(k) = 63k2 + 7k - 10. What is -5j(z) - 2u(z)? 34z2 + z Let q(y) = -5y*2 - 4y - 7. Let x(h) = h*2 - 10h + 24. Let d be x(7). Let o(u) = -u*2 - u - d - 7 + 9. Give -6o(p) + q(p). p*2 + 2p - 1 Let h(j) = 17j - 12. Suppose 0 = -4i + 5w - 3, 3i = -9w + 11w - 4. Let a(b) = -4b + 3. Let f be 175/(-21) - (-4)/(-6). Calculate fa(y) + ih(y). 2y - 3 Let h(k) be the second derivative of k4/6 - k3/2 - 3k2/2 - 7k + 10. Let v(b) = b*2 - 2b - 3. Calculate 3h(a) - 4v(a). 2a2 - a + 3 Let o(a) = -20a - 6. Let q(n) = -7n - 2. Determine 6o(l) - 17q(l). -l - 2 Let k(d) be the second derivative of 15d - d*2 + 0 + 0d*3 - 1/6d*4 - 3/20d5. Let a(r) = r3 + 1. Let q be (1/(-2))/((-2)/4). Calculate qa(z) + k(z). -2z*3 - 2z*2 - 1 Let l(d) = -23d*2 - 17. Let j(c) = -8c*2 - 2c - 1. Let i(y) = -10y2 - 3y. Let h(x) = -2i(x) + 3j(x). Calculate 34h(g) - 6l(g). 2g2 Let l(n) = -5n + 2. Let g(t) be the second derivative of 2t3/3 - t2/2 - 68t. Give 4g(z) + 3l(z). z + 2 Let t(i) = i*3 + 6i*2 + 6i - 4. Let r = 402 - 409. Let v(c) = c*3 + 7c*2 + 7c - 5. What is rt(s) + 6v(s)? -s3 - 2 Let g(b) = -b3 - 5b2 - 2b - 2. Let t(i) = -1335i3 + 1334i*3 + 3 - i - 6 - i - 6i*2. Determine 6g(j) - 5t(j). -j3 - 2j + 3 Let l(j) = 2j + 251. Let h(z) = -z - 84. Give -8h(d) - 3l(d). 2d - 81 Let i(o) = -2o3 - 2o - 4. Suppose -6 = -3m + 6. Let r(q) = -5q*3 - 9 - mq + q - q. Let w = -641 + 644. What is wr(n) - 7i(n)? -n*3 + 2n + 1 Let d(n) = -11n2 - 29n + 5. Let s(r) = -10r2 - 29r + 4. What is 4d(h) - 5s(h)? 6h2 + 29h Let n(x) = -5x2 - 3x + 9. Let k(d) = 4d2 + 3d - 10. Calculate 7k(s) + 6n(s). -2s2 + 3s - 16 Let g be 11/(-3) - 49/(-21). Let r(x) be the first derivative of 7 - 3/2x*g + 7x. Let q(m) = -8m + 20. What is -6q(v) + 17r(v)? -3v - 1 Let u(k) = k + 3. Let b(o) be the third derivative of -o*3/3 + 3o*2 + 16. Calculate -3b(r) - 2u(r). -2r Suppose 3z - 7z - 12 = -0z. Let s(n) = -3n - 4. Let w(a) = -1 - a*2 + a - 2 + 4. Give zw(l) - s(l). 3l2 + 1 Let x(w) = -8w*2 - 3w + 3. Let i(c) = -23c2 - 8c + 9. Calculate 4i(b) - 11x(b). -4b2 + b + 3 Let b(o) = 7o*3 + 4o*2 + 129o + 5. Let g(x) = -3x3 - x2 - 64x - 2. Calculate -2b(k) - 5g(k). k*3 - 3k*2 + 62k Let g(n) = 842n3 + 7n. Let s(d) = -421d3 - 4d. Give -4g(p) - 7s(p). -421p3 Suppose 337 + 13 = -10d. Let v(x) = -2x + 3. Let j(l) be the first derivative of -25l*2/2 + 35l + 80. Give dv(r) + 3j(r). -5r Let h(w) = -5w*3 + 5w*2 + 6w - 10. Let v(u) = 10u3 - 11u*2 - 12u + 21. Let k(q) = -13h(q) - 6v(q). Let o(x) = -x + 1. Give k(n) - 6o(n). 5n3 + n2 - 2 Let r(g) = 2g2 - 2g - 5 + 2g + 4. Let b(v) be the first derivative of -v3 + v - 47. Determine -5b(d) - 8r(d). -d2 + 3 Let c(g) = -104g*2 - 17g + 13. Let p(l) = 26l2 + 4l - 3. Calculate 6c(z) + 26p(z). 52z2 + 2z Let p(b) be the third derivative of -b4/8 - b2 + 98b. Let w(m) = 3m + 4. Let q(l) = -2l - 3. Let o(v) = 4q(v) + 3w(v). What is 2o(c) + p(c)? -c Let a(u) = 11u2 - 4u - 9. Let g be 11 + 8 + 0/1. Let m = g - 23. Let d(p) be the first derivative of -5p3/3 + p2 + 4p + 2. Determine ma(v) - 9d(v). v*2 - 2v Let x(d) = 7d3 - 5d + 5. Let n(w) = 4w3 - 3w + 3. Let q = 78 + -24. Let a = q + -51. What is ax(f) - 5n(f)? f*3 Let o(g) = -182g - 1. Let h(b) = -732b - 4. Determine 2h(m) - 9o(m). 174m + 1 Let r(c) = -41c + 93. Let f(w) = -15w + 31. Determine -11f(q) + 4r(q). q + 31 Let a(x) = -x - 538. Let w(b) = -2. Calculat	{ "pile_set_name": "DM Mathematics" }
-243 - -728/3. What is the closest to -0.7 in 7, -5, h, 1/8? h Let i = -0.08 + 5.48. Let f = i - 5. Let n be 30/(-18) + 2 + 8/(-12). Which is the closest to n? (a) -1 (b) -4 (c) f a Suppose -460 = 5y + 200. Let s be (2/(-8))/(3/y). What is the nearest to s in -4, 0.1, -2/15? 0.1 Let c = -4326/5 - -866. What is the nearest to 1 in -1/2, -1/4, c, 16? c Let u = -783 - -782.9. Let v = 0.16 + -0.23. Let f = -8.07 - v. Which is the closest to u? (a) 1/5 (b) 3/2 (c) f a Let q = 0.095 - 1.095. Which is the closest to q? (a) -0.07 (b) -0.1 (c) 0 (d) -4 b Let z = 1314 - 1229. Which is the nearest to -0.1? (a) 4/5 (b) 0.3 (c) z (d) 0 d Let t = 1.0264 - 0.0264. What is the closest to t in 72, -0.2, -3, -1? -0.2 Let p = -238.183 + 238. Let q = p - -0.083. What is the nearest to q in -3/2, 0.18, -0.5? 0.18 Let s = -239 + 237. Let g be (-11 - -10)15. Which is the closest to -3? (a) 5 (b) g (c) s c Let m = 29/2 - 15. Let h = -49.477 + 0.077. Let g = h + 49. Which is the nearest to m? (a) -0.05 (b) -4 (c) g c Let n be ((-12)/10)/(6/(-45)). Suppose -ns = 4 + 14. Let z be (46/10 - 2) + -2. What is the nearest to s in 1/3, z, -3? -3 Let p = -6.7 - -7. Let k be (0/(1 + 0))/2. Let u = 0.046 - -0.954. Which is the nearest to -1? (a) k (b) p (c) u a Let k = -1004.2 - -1004. Which is the closest to k? (a) -5 (b) -1/3 (c) 0.5 (d) 2 b Let k = -13 + 12. Let t = -33 + 36. Which is the nearest to 0? (a) -0.1 (b) k (c) t a Let p = 297 - 3269/11. Let r = 3/13 + -54/65. Which is the closest to p? (a) 4 (b) -1/4 (c) r b Let d = 361/64 + 38005/1216. Let o = 37 - d. What is the nearest to 2/3 in o, -1/2, 3? o Let y = -466 - -465. What is the nearest to y in 0.5, -5/4, 4, 3? -5/4 Let o = 5 + -6. Let x = -29 - -28. Which is the closest to x? (a) o (b) -0.06 (c) 4 a Let l = 5/6 - 4/3. Let w = 0.1 + -0.3. What is the closest to 0 in 1, w, l? w Let r = -19 + 18.9. Let h = 1031/28 + -149/4. Which is the closest to r? (a) 2 (b) h (c) 5 b Let m(f) = 4f + 12. Let l be m(-11). Let a = l + 191/6. Let c = -0.5 - 0. What is the nearest to -2 in c, -2, a? -2 Let x = 166 + -166.1. Let z = -5.6 - -0.6. Let i = 31 - 31.2. Which is the closest to x? (a) i (b) z (c) -0.3 a Suppose 0 = 65x - 61x + 8. Let f = 37/4 + -9. Which is the closest to x? (a) -2/17 (b) 4 (c) f a Let w = -7.35 - 0.35. Let d = w + 6.7. What is the closest to d in -4, -7, -1? -1 Let u = -10 - -10.2. Let m = 2.6 - 2.1. Which is the nearest to -0.1? (a) u (b) m (c) 0.4 a Let v = -2.3 - -1.1. Let y = 30.8 - 28. Let k = v - y. Which is the closest to 2/5? (a) k (b) -0.5 (c) 0.1 c Suppose -4 = -u + 2i - 10, 0 = 4u + 4i. What is the closest to u in 2, -3/8, 43? -3/8 Let o = -16 + -14. Let x be (-45)/o - (-11 + 3). What is the nearest to -0.1 in 1, 2/9, x? 2/9 Let a = 0.1 - -0.1. Suppose -4z + m = -0m, 5z + 2m = 0. Suppose 0 = 3n - 5g - 3, -3 = -3n - zg + 4g. What is the nearest to n in -0.3, -2/17, a? a Let n be -1(-208)/44 + -5. What is the closest to -0.1 in 0.02, n, 3/5? 0.02 Let j be 1/(90/41) - 0. Let m = 2/45 + j. Let g(c) = -c2 + 12c + 66. Let a be g(16). What is the closest to a in 3, m, -0.5? 3 Let p = -1296.6 + 1299. Which is the nearest to p? (a) 1 (b) 1/2 (c) 5 a Let l = 11 - 10.87. Let j = -0.09 + l. Let f = j + -0.04. Which is the closest to f? (a) 2/5 (b) -1/3 (c) 1 b Let s = 84 - 88. Let o(k) = k - 13. Let r be o(6). Let q be (-3)/(r + 1)-2. Which is the closest to q? (a) 4 (b) -3 (c) s b Suppose 2n + 0w = -3w + 69, -4w = -3n + 95. Let o = 2262187/67028 + 2/16757. Let j = o - n. Which is the nearest to -1/4? (a) -1/10 (b) 1 (c) j a Let c = 0.17 + -2.17. Let j be 04/(-8) + 0. Let m be (0 + j)/(1 + 1). What is the nearest to m in c, 2/7, -3? 2/7 Let t = 1.308 + -1.408. Which is the nearest to t? (a) 0 (b) -2 (c) -0.163 (d) -3 c Let u = 3001/18 - 335/2. What is the closest to -0.3 in u, 2/9, -5/3? u Suppose 3u + 66 = u. Which is the nearest to -4/3? (a) 0.1 (b) u (c) -0.4 (d) -3 c Let w be (63/12 - 4) + (-2)/8. Let m = -0.6 - -0.7. What is the nearest to -3 in w, 0.02, m? 0.02 Let j be 14/49 + 972/(-21). Which is the nearest to j? (a) -5 (b) 0.3 (c) -0.5 a Suppose 3 - 1 = -v. Let y be ((-21)/(-112))/((-2)/(-8)). What is the nearest to 0.1 in y, 1, v? y Let p = 35 - 31. Let q be (1 + -1)(p + 72/(-16)). Which is the closest to -0.3? (a) -2/25 (b) -5 (c) q a Let k = 0 + 5. Let w be (-3)/15 + (-7)/15. Let p = -1 - -2. Which is the closest to w? (a) p (b) 2/3 (c) k b Let z = -0.19 + 0.2. Let x be (-18)/213/(-27)-14. Which is the nearest to 3/2? (a) x (b) 5 (c) z c Let p = -8 + 11. Let h = 1829 - 1830. What is the closest to h in 2/11, p, -2/15? -2/15 Let z be 28/56 - (19/(-10) + 2). Which is the closest to z? (a) -0.2 (b) -4 (c) 5 (d) 0.4 d Let u be ((-1)/(-11))/(2/(-2)). Suppose 7 = -5t + 87. Let l be (-6)/t(-14)/(-21). Which is the nearest to l? (a) 4 (b) 2/3 (c) u c Let l be (-38)/84 + (-4)/(-14). Let r be ((-1036)/(-592))/(1 + 6). Which is the nearest to l? (a) r (b) -5 (c) 5/2 a Let i = -0.849 + 0.649. Which is the nearest to i? (a) 3 (b) 1 (c) 0 (d) 9 c Let t = -119 - -116. Let g = 4.2 + -4. Let b = g + -0.3. What is the closest to b in -5, t, 2/13? 2/13 Suppose 6f - 14 = 8f - 3h, 0 = 5f + 4h - 11. Which is the closest to 0? (a) 0.2 (b) -0.1 (c) -3/2 (d) f b Let d = 51/35 - 13/7. Let u(y) = -y*2 - 3y + 3. Let p be u(-3). Let t = -48.8 + 48.7. Which is the closest to t? (a) p (b) 0.4 (c) d c Let h(x) = -29x2 - 3x + 2. Let k be h(1). Let n be (k/(-45))/((-8)/3). Which is the nearest to n? (a) 0 (b) 2 (c) 1 a Let t = 2.0243 + -0.0243. Let d = 7.3 + -7. What is the closest to t in -1, d, 6? d Suppose -4i - 2 = 2. Let z be (-46)/39 - 6/36-8. What is the closest to -7 in z, i, 0.1? i Suppose 0 = 5i - 9i - 16. Let w be 6/(-15)(-2)/i. Let z = 3 - 3. What is the closest to -1 in -0.5, z, w? -0.5 Suppose 0 = 2o + l - 8, -4 = 2o + 3l - 12. Let n be -2 - o/32-24. Let h = 0.3 + -0.1. What is the closest to -0.2 in 0.3, h, n? h Let m = -66/13 - -488/91. Which is the nearest to 2? (a) -0.4 (b) 0.2 (c) m c Let g(w) = -3w3 + 3w*2 + 10w - 12. Let l be g(2). What is the nearest to -1/3 in 0.1, -0.4, 0.4, l? -0.4 Let r be (10 + -9)5/1. Let s = 15452/25 + -618. Which is the closest to 2/3? (a) s (b) -2 (c) r a Let y = -162 - -159. Let i = -0.03 - 0.37. Let h(v) = -v + 3. Let j be h(0). What is the nearest to 2 in i, y, j? j Let l = 260 - 257. Which is the nearest to 8/7? (a) l (b) -5 (c) 0.4 (d) 4 c Let w = 256 + -3330/13. Let o = 797/20 - 157/4. What is the nearest to 1 in w, -3, o? o Let x = 3/332 + -1349/2324. Let p = -11 + 3. Let n = p - -5. Which is the closest to 0.2? (a) x (b) -0.1 (c) n b Let r(t) = t2 - 7t + 12. Let x be r(6). Let s = -9 + x. Let w = 0.09 + 0.21. Which is the nearest to s? (a) w (b) -0.3 (c) -1/4 b Let q = -0.9 + 5.9. Let t = 4.9 - q. Let s = 3.04 - 3. Which is the closest to 2/7? (a) s (b) 0.3 (c) t b Let q = -704 - -703. Let i be 46/84 - 2/6. Let f = 1/21 - i. Which is the closest to q? (a) -0.4 (b) f (c) 2 a Let r be 2 + ((-2)/16 - (-483)/(-168)). What is the closest to r in 2/9, -5, 0.5? 2/9 Let p = -0.08 - -0.28. Let t be (-23)/55 + (-24)/132. Let a = -0.37 + -2.63. What is the nearest to p in a, t, 0.4? 0.4 Let s = -3496 + 160823/46. Let q = 1/69 + s. What is the nearest to 0.2 in q, -2, 4? q Let r be (-2 + 0)/(-2 + -1). Suppose -12h - 4w - 23 = -9h, -h - 4w = 13. Which is the closest to r? (a) -3/2 (b) h (c) 6 a Let u = 25.7 - 1.7. Let b = -24 + u. What is the closest to 0 in b, -4, -3/5? b Let n(d) = -d*3 + 14d*2 - 14d + 11. Let k be n(13). Let v be (-1)/(-10)(3 - 15). What is the closest to 2 in k, 5/4, v? 5/4 Let x = -2249 - -2249.1. Which is the closest to x? (a) 3/2 (b) 1 (c) -16 (d) -1 b Let h be (-1)/32 - 0. Let s = -1/3 + -1/6. What is the closest to h in 1/2, s, -5? s Let p be 5/10 - 133/76. Which is the closest to p? (a) -2/5 (b) 1/4 (c) -1/8 a Let f = 237/4 + -59. Let t = -100.6 + 98. Let k = t - -3.1. Which is the nearest to f? (a) -2/19 (b) -5/4 (c) k c Let x = -8.95 - -14.46. Let r = x + 15.43. Let w = r - 21. What is the closest to 0 in -2/9, w, -2? w Let m = -21/22 + 5/11	{ "pile_set_name": "DM Mathematics" }
125772.74 What is 21974190305323 take away -1? 21974190305324 What is 1.074584517909 plus 533? 534.074584517909 What is 724.792034 + 0.42212? 725.214154 What is the distance between -0.2 and -3.51428242590753? 3.31428242590753 Calculate 413014757852 + 6. 413014757858 5223643+-23061004 -17837361 Calculate 10 - -23240773.65693. 23240783.65693 What is -8.262566666 - 21? -29.262566666 What is 0.1154219649091 minus -3? 3.1154219649091 Add together -48799 and -1.975583196. -48800.975583196 What is -5727854056.555 less than -1.5? 5727854055.055 Work out -0.06450663 - -20467.5. 20467.43549337 What is 1 + -87808045287? -87808045286 Add -3503 and 0.00440925506. -3502.99559074494 Work out 31 + -5.098969373. 25.901030627 Put together -9499351 and 30076. -9469275 Add -8017032.301 and -8. -8017040.301 157075 + 168808.05 325883.05 Total of 1024809 and -113281. 911528 Add together -630970.631797 and -3. -630973.631797 What is -72117576 less than -332190? 71785386 Work out -0.0328373 + -0.0121317. -0.044969 0.0057 + 306491674 306491674.0057 What is the distance between 3 and 215029933019718? 215029933019715 Add 6.58087 and -276569765. -276569758.41913 -6327378134 + 1.601 -6327378132.399 0.19393 - -42394.28 42394.47393 3.107657+6.07612 9.183777 What is the distance between -1 and -4.259042784367? 3.259042784367 Work out -44 - -481881992692. 481881992648 Calculate 2 + -441987892.27. -441987890.27 Subtract -0.0119 from -0.0670534434. -0.0551534434 Put together 1019961.95 and -2.881524. 1019959.068476 Add together -56404986 and -7.243. -56404993.243 What is the distance between -71535201436 and -5.7? 71535201430.3 What is 2.392333 + 3.365812? 5.758145 Work out 16.9 - 22177792.71. -22177775.81 What is -4059084451 - 0.45? -4059084451.45 What is 135809 less than 8.05224? -135800.94776 14325067021 - -1.243 14325067022.243 What is 284682.61 minus 10032491? -9747808.39 What is 4348 - -9.279301169? 4357.279301169 Calculate 117 - -418.72807331. 535.72807331 What is 388127 - -539.144? 388666.144 Work out 0.68453 - 567660. -567659.31547 Put together -23881923 and -19117. -23901040 What is -85 minus -889130.9442? 889045.9442 What is -33.4 take away 123465646? -123465679.4 What is 7.0697824 take away 0.0258? 7.0439824 Work out 1.2 - 25030.505668. -25029.305668 What is 9906735.168 minus -0.5? 9906735.668 Add 0.251135017 and -1.98. -1.728864983 Put together -0.812 and 1217891. 1217890.188 What is -5610.82286071 take away -0.4? -5610.42286071 What is the distance between -24727639.734196 and -2.1? 24727637.634196 What is 2822.35 take away 26242592? -26239769.65 What is -1935.906 - 18671? -20606.906 Work out 15 + 1937297.3756164. 1937312.3756164 Add together 111 and 191304085738. 191304085849 Total of -377087496 and 27519. -377059977 What is 0.079 take away 1162927.0618? -1162926.9828 Total of 55263425093 and -19. 55263425074 243761617+9.71 243761626.71 What is 4783336472 + -0.013? 4783336471.987 4.830018745 - 319 -314.169981255 Calculate 2360528 + -147891.1. 2212636.9 0.03+-427558525.4406 -427558525.4106 What is 7270364.4 plus -0.047896? 7270364.352104 What is -423608 + 9.849715? -423598.150285 Put together 7272.3414 and 5901.207. 13173.5484 Put together 145455585 and 335. 145455920 What is 12.75771 - -40135056? 40135068.75771 Work out -0.24 - -1.3091690472. 1.0691690472 Subtract 0.260225953 from -48.93. -49.190225953 Calculate -648340672 - -710. -648339962 -846451 + -0.47008 -846451.47008 What is 34.0358 take away 4987.2921? -4953.2563 Put together 67.79 and 18074602. 18074669.79 What is 2 less than -2573416023.4? -2573416025.4 Put together -274786 and -46309242. -46584028 236147 - -0.0266293745 236147.0266293745 Put together 0.08267000958 and 493. 493.08267000958 Calculate 10099 + -0.6128103. 10098.3871897 What is -0.06 minus 86007652061764? -86007652061764.06 147 - 0.13215464509 146.86784535491 Work out 16.48715 - 1.97778493. 14.50936507 Subtract 18 from 0.3924945264166. -17.6075054735834 Calculate 225 - 1701.4380495. -1476.4380495 Add 0.41144 and -113398816. -113398815.58856 27291 + -48.43005 27242.56995 Total of 10653725965 and 0.2. 10653725965.2 What is 0.0725 minus 42484373? -42484372.9275 Add -3 and -504924092934. -504924092937 What is -28 - 372836678111? -372836678139 What is -14692441249 less than -40.66? 14692441208.34 Subtract 3748850.8 from 0.098. -3748850.702 Calculate 0.126924352 - -1339.1. 1339.226924352 Subtract -0.1123 from 5962039014. 5962039014.1123 -124765194846 + -14 -124765194860 Put together -0.4 and -15801273.8178223. -15801274.2178223 Calculate -19 - 2521353964.707. -2521353983.707 What is the difference between -924560 and 406.65754? 924966.65754 Work out 1.4532563 - 31962. -31960.5467437 What is -0.045499 - -4583997388? 4583997387.954501 What is -4718.33 less than -2523033.2? -2518314.87 Add together 3 and -4.400362649. -1.400362649 What is 14372835855932 + 3? 14372835855935 What is -9451205912663 - 0.18? -9451205912663.18 Work out 2.6 - -411947070333. 411947070335.6 Total of 0.3 and -35298918046243. -35298918046242.7 What is -5.54743 less than -242052.54? -242046.99257 Total of -9959478374864 and -5. -9959478374869 What is -8.70036046 less than -10? -1.29963954 What is the difference between -4148480438021 and -1? 4148480438020 What is 3877 minus -41249205964? 41249209841 What is 111581.19 - -246996? 358577.19 What is -168.4015 take away 12989046? -12989214.4015 Work out -4.6 - -0.710637581727. -3.889362418273 What is 0.0033 take away 112345724? -112345723.9967 Subtract -22945.153 from -40411. -17465.847 What is the distance between -144.7 and -18279248.1? 18279103.4 271470105.22+-0.1 271470105.12 What is the distance between -0.342 and -831462277.2? 831462276.858 -119761.432 - -11.7886 -119749.6434 What is -1934578221 minus 42.7? -1934578263.7 -161271+655674 494403 What is -323569 plus -13870284? -14193853 -0.57579 - 0.856982168 -1.432772168 What is 152.46 minus 20494669? -20494516.54 Subtract -5783039162 from 1429. 5783040591 Total of 0.33 and 9734216320. 9734216320.33 What is -28795013125 take away -2.1? -28795013122.9 853636 - 14300.83 839335.17 Add 8416.3 and 171.6291. 8587.9291 What is -6033309718244 take away -6? -6033309718238 3315327+11568367 14883694 Add together 143347.1168 and -6. 143341.1168 What is the distance between -0.223616 and 70620.3895? 70620.613116 Add together 0.4 and 805792919771. 805792919771.4 Calculate 6854.43901 + 3312.7. 10167.13901 Put together 20630197 and 4182964. 24813161 Sum 18.4521805244 and 232. 250.4521805244 What is the difference between 203351.5154 and 105? 203246.5154 Sum 71917458982 and -2. 71917458980 What is 13830034 + -194.7? 13829839.3 What is -61017262.78 minus 3? -61017265.78 -0.09324083 + 66.56 66.46675917 Sum 0.2 and -1484.163249198. -1483.963249198 Total of 19 and 98732646.90766. 98732665.90766 Add -112.9197604 and 0.04874. -112.8710204 What is 209250806 take away -8190.7? 209258996.7 Calculate 0.128068 + 0.3575982. 0.4856662 Subtract 251114338.6 from -27.2. -251114365.8 What is 0.24578 plus 463668.274? 463668.51978 Total of -757540309520 and -27. -757540309547 What is 0.071040223 plus 10611? 10611.071040223 2972+-1519092.799 -1516120.799 Add -429973.4043 and 0.3189. -429973.0854 Work out 0.91049 - 656.039. -655.12851 Subtract 0.84626 from -4.2812. -5.12746 Total of -14.2393 and 11365535644. 11365535629.7607 6417291707+85 6417291792 Add together 4 and -254306766.0603. -254306762.0603 Subtract -2998 from -45269931. -45266933 What is -218217305 minus -20.147? -218217284.853 Put together 72 and -3481395175. -3481395103 -128967149788 + -0.03 -128967149788.03 -1250510662756.2 - -4 -1250510662752.2 4 + 628242962674 628242962678 Add together 880.84606 and 919. 1799.84606 Calculate 26.25 + -0.2113179. 26.0386821 What is the distance between -0.4445096 and 2008.331? 2008.7755096 Put together -0.05 and 83611200.3276. 83611200.2776 Add 25033.9198 and 119. 25152.9198 What is 0.03 + -2075485103? -2075485102.97 What is -3146.57028342 less than -0.5? 3146.07028342 Total of -0.25 and 172175390559. 172175390558.75 Total of -79976365.521 and -36. -79976401.521 What is 5.2031522 minus -6246? 6251.2031522 What is 2602438500 plus 103467? 2602541967 302436285 - -0.043215 302436285.043215 Total of 41.7136509 and 2749	{ "pile_set_name": "DM Mathematics" }
2.9 * 0 0 What is 57.8 times 6947? 401536.6 -5923970 -5745310 55737-193.8 -10801830.6 42402.944 9611.776 Multiply -21101 and -8.065. 170179.565 0.021648-401 -8.680848 Work out -55.492974 * 2. -110.985948 -11132879 times -2 22265758 What is the product of -50561763 and -0.1? 5056176.3 Multiply 70057.361 and -12. -840688.332 -607407-1.1 668147.7 Multiply 1741.91 and 211. 367543.01 220803 155 34224465 Work out -33 * 62294. -2055702 Product of -1457.368 and -0.3. 437.2104 What is the product of 1.6 and -0.0513568? -0.08217088 What is the product of -3 and -19814.62? 59443.86 What is the product of -0.36 and -1349634? 485868.24 What is 243 times -16.635? -4042.305 0-53904.706 0 What is 114383.611 times 5? 571918.055 What is the product of 39005204 and -0.27? -10531405.08 What is the product of 0.00444 and -3575? -15.873 -253708371 3 -761125113 Multiply 6466 and -197. -1273802 Product of 2267 and 457285. 1036665095 Product of 0.04 and -4953580. -198143.2 What is the product of -31 and -6.2964? 195.1884 Work out -43 * -253936. 10919248 Calculate -0.0440267092. -0.088053418 Multiply -14996 and -34287. 514167852 Multiply -0.2 and 69418008. -13883601.6 Product of 26 and 0.0630587. 1.6395262 What is the product of -757.91 and -256? 194024.96 Multiply 0.06473 and -3793.1. -245.527363 What is the product of 411164.7 and 0.03? 12334.941 -112.824315.6 -35607.2544 11-425.67 -4682.37 0.068 -957.986 -65.143048 Work out 181 * -2.42975. -439.78475 Calculate -401.76540. -2627118 Calculate -0.230.295833. -0.06804159 Calculate -2239405.9. -478811.8 -2799 4364 -12214836 -2-0.058879498 0.117758996 Multiply 18.26657 and 0. 0 Multiply 4 and -2167.721. -8670.884 Product of -1.3 and 531228.74. -690597.362 Work out -6333461 0.9. -5700114.9 Calculate 264881-325. -86086325 Calculate -16803124. -2083572 Work out -77 * -298581. 22990737 Multiply -5326 and 0.2092. -1114.1992 Calculate 76649-97. -7434953 -0.1 times 1718293 -171829.3 -40212 18 -723816 What is -28173 times -1822? 51331206 36.864 * -1873 -69046.272 Calculate 0.050731.199. 0.06082527 What is 0.149 times 77574? 11558.526 0.4 times -8237091 -3294836.4 Calculate -2.23-111342. 248292.66 Product of 0.11066 and 2.96. 0.3275536 1426 * 5236 7466536 -3776-0.3413 1288.7488 Product of 139723 and 269. 37585487 What is -615.2215 times -0.1? 61.52215 1392 -32486 -45220512 What is the product of -0.06848 and -0.14? 0.0095872 Product of -86850.3 and 12.66. -1099524.798 Product of 0.2956509 and 26. 7.6869234 Multiply 92.409409 and 0.07. 6.46865863 Calculate -4424832.8. -1092643.2 3593961 times -0.4 -1437584.4 Product of 18197829 and -5. -90989145 What is -19.13735 times 0.8? -15.30988 Work out 0.1977 -2757.8. -545.21706 Work out -0.956807 * 96. -91.853472 What is the product of -34 and -22792419? 774942246 -18262 times -416 7596992 Product of 2833 and 6953. 19697849 -0.223263869 -4652773.8 What is the product of 0.437 and 76.1982? 33.2986134 938 -27.69 -25973.22 Work out -27 * 0.2216236. -5.9838372 -0.02 times 68282553 -1365651.06 Product of 3.85 and 0.036322. 0.1398397 -0.576 * -0.02347 0.01351872 What is -4.37542 times 69? -301.90398 Product of -21 and 17914310. -376200510 -2764 times 5327 -14723828 Product of 3.59 and -65786. -236171.74 9.2-21403.7 -196914.04 -2483.442 times 12 -29801.304 What is 17013 times -21988? -374081844 What is the product of -0.068409 and 0.3? -0.0205227 Calculate 0.05-40.07641. -2.0038205 Calculate 63512.8-17. -1079717.6 Work out 2454 4775.4. 11718831.6 -1071.57 * 2920 -3128984.4 What is -4133557 times -12? 49602684 What is the product of 7 and -1994933? -13964531 -26 times 55.6538 -1446.9988 -3 times -69.14899 207.44697 What is 30 times 225.5393? 6766.179 What is the product of -0.013304 and 4? -0.053216 Work out -0.043 * -201522. 8665.446 Product of -30572 and 47.81. -1461647.32 Calculate -1-1914.7029. 1914.7029 -14563-0.1183 1722.8029 1118.013214 198.145354 -0.06 -14736658 884199.48 0.6710816 times -0.45 -0.30198672 Work out 3 * 8196.299. 24588.897 -0.1 * -6881.879 688.1879 Calculate 4980.065. 32.37 1379.096 0.3 413.7288 -0.12929670 -3827.43 -0.28 times -0.7041769 0.197169532 401304 -5 -2006520 Multiply 309000195 and 0.5. 154500097.5 -25068.4 * 1875 -47003250 -0.06-279915 16794.9 Product of 35.8 and -1664. -59571.2 -0.092057 times 3243 -298.540851 Product of 7935.814 and -2. -15871.628 -497004533 -149101359 Work out 46.08 * 20499. 944593.92 -5-17.70029 88.50145 Work out -0.0339635 0.33. -0.011207955 What is the product of 4 and -0.81652943? -3.26611772 Product of -474.3 and 0.02188. -10.377684 -12.3021-0.246 3.0263166 Product of -135.83 and 1370. -186087.1 Multiply -0.11 and -2328818.8. 256170.068 -16009696 times 0.01 -160096.96 Multiply -1.2320466 and 59. -72.6907494 178320.036 641.952 What is 30323.52 times -4? -121294.08 Multiply -191 and 26.831. -5124.721 Work out 980.3704 * 0.4. 392.14816 Work out -0.06 * 2.761992. -0.16571952 What is the product of 6 and -80596702? -483580212 What is 2467164 times -97? -239314908 -184.8374-928 171529.1072 Work out 831 3.138. 2607.678 What is the product of 7678.8 and -127? -975207.6 Work out -0.5 * 24521. -12260.5 What is the product of 1 and -1103991.6? -1103991.6 Calculate -460.48646. -241.94584 Product of 386323881 and -0.2. -77264776.2 What is the product of 1.512 and -29243? -44215.416 0.0476079 times -0.1 -0.00476079 39474 15.574 614768.076 What is -1302.6668 times -3? 3908.0004 What is -5.148414 times 63? -324.350082 Work out -0.264768486 * 0. 0 What is 0.7 times 0.022561? 0.0157927 Product of -0.1 and -2.0707514. 0.20707514 What is the product of 1 and 2037447.21? 2037447.21 Product of 320293 and 1190. 381148670 2191263-142 -311159346 What is 162100990 times 5? 810504950 Product of -7 and 20021.0899. -140147.6293 What is the product of -3.5 and 3.5743? -12.51005 Multiply 0.03 and -7629.87. -228.8961 What is the product of 0.42 and -3.003? -1.26126 Calculate 0.83-1399836.8. -1161864.544 Multiply -11.92 and -9720. 115862.4 -10894 times -4357 47465158 Multiply 26955.1 and 0.12. 3234.612 -111251.66 * -3 333754.98 Product of 1230 and 206089. 253489470 Work out 0.0007 * -183200. -128.24 What is 939 times 0.009? 8.451 10 times -8670093 -86700930 Work out -319875 * -192. 61416000 440 times 0.0216329 9.518476 Product of 5 and 11522001. 57610005 What is the product of 3 and 0.1243687? 0.3731061 Work out -12 * 2050579. -24606948 Calculate 374804425. 93701100 -0.5774704 -4 2.3098816 0.024 * 0.109357 0.002624568 -3.66 * -6851 25074.66 -19.4-21.829 423.4826 Product of 26.149 and -2.77. -72.43273 Work out 0.5 -25766596. -12883298 Work out 0.704 * 433.8. 305.3952 0.06403 * 8184 524.02152 Multiply 0.04832858 and -0.2. -0.009665716 What is the product of 132 and -731969? -96619908 -19.6566 times 2.17 -42.654822 2595067 times 0.33 856372.11 What is 1.8 times 198111? 356599.8 Calculate 1500490-6. -9002940 -382.594-0.055 21.04267 Product of -1.45469 and -1691. 2459.88079 -2661598-8.9 23688222.2 Work out 1 751842. 751842 Work out 0.9 * 29890.9. 26901.81 -5.2895233.1 -1232.98245 4105156.51 420626.04 Product of 0.054795 and -17.74. -0.9720633 Calculate 19181-430. -8247830 -2283375174 -5 11416875870 What is 50555 times 0.27237? 13769.66535 Multiply 3916 and 1077.58. 4219803.28 Work out 529310 * -114. -60341340 Calculate -50414.5615. -22994.5215 Multiply 4.71 and -111.5. -525.165 What is the product of 0.5 and -1.185673? -0.5928365 0.06 times -9024.08 -541.4448 Calculate 0.0262-34677. -908.5374 Multiply 0.1 and 3899109. 389910.9 Calculate 1331678739-5. -6658393695 13518 -0.28 -3785.04 Multiply -90.9 and -0.0658. 5.98122 Calculate -137963423. -31731582 Work out 0.01 -143201. -1432.01 Calculate -199-10.3228. 2054.2372 -9971 times 215 -2143765 0.1-4224.61 -422.461 What is the product of -0.033036 and -9363? 309.316068 14402.31664-4 -57609.26656 What is the product of 448695.5 and -1? -448695.5 Product of 209004 and 78. 16302312 -879713.8 -0.08 70377.104 -5 times 0.1071649 -0.5358245 Product of 3 and -4.215516. -12.646548 -112.594675 -562.97335 -0.062 647913 -40170.606 1.5 * 270.255 405.3825 Work out -106320 * 0.0059. -627.288 Calculate -115513915. -15513915 Work out 13752 -0	{ "pile_set_name": "DM Mathematics" }
361h - 11 What is the i'th term of 108, 90, 54, -6, -96, -222, -390, -606? -i3 - 3i*2 - 2i + 114 What is the b'th term of -147, -184, -225, -270, -319, -372? -2b2 - 31b - 114 What is the q'th term of 55, 52, 47, 40, 31? -q*2 + 56 What is the b'th term of -58, -81, -130, -217, -354, -553, -826, -1185? -2b3 - b2 - 6b - 49 What is the p'th term of 33, 67, 87, 87, 61, 3? -p3 - p2 + 44p - 9 What is the l'th term of 65, 88, 111, 134? 23l + 42 What is the t'th term of 27, 34, 37, 36, 31? -2t*2 + 13t + 16 What is the v'th term of -66, -63, -74, -105, -162, -251, -378? -v3 - v2 + 13v - 77 What is the v'th term of 23, 31, 43, 59, 79, 103, 131? 2v*2 + 2v + 19 What is the m'th term of -180, -238, -288, -324, -340, -330, -288? m*3 - 2m*2 - 59m - 120 What is the q'th term of -53, -96, -117, -104, -45, 72, 259? 2q3 - q2 - 54q What is the p'th term of 226, 219, 212, 205? -7p + 233 What is the i'th term of 149, 268, 399, 548, 721, 924, 1163? i3 + 112i + 36 What is the c'th term of -747, -749, -751, -753, -755? -2c - 745 What is the a'th term of 103, 162, 221? 59a + 44 What is the h'th term of -53, -236, -547, -986, -1553, -2248, -3071? -64h2 + 9h + 2 What is the o'th term of -41, -110, -179? -69o + 28 What is the q'th term of -25964, -25965, -25966? -q - 25963 What is the d'th term of 346, 375, 418, 481, 570, 691? d3 + d2 + 19d + 325 What is the j'th term of -47, -49, -51? -2j - 45 What is the l'th term of -1164, -1165, -1166, -1167, -1168, -1169? -l - 1163 What is the o'th term of 7, 8, 17, 40, 83, 152, 253, 392? o3 - 2o*2 + 8 What is the c'th term of -1926, -3856, -5790, -7728? -2c*2 - 1924c What is the p'th term of -15, -51, -125, -249, -435, -695, -1041, -1485? -2p3 - 7p*2 - p - 5 What is the c'th term of -3, -17, -27, -33? 2c*2 - 20c + 15 What is the q'th term of -113, -103, -91, -77, -61? q*2 + 7q - 121 What is the t'th term of -30, -42, -20, 54, 198? 3t3 - t2 - 30t - 2 What is the j'th term of 57, 94, 191, 378, 685, 1142, 1779, 2626? 5j3 + 2j + 50 What is the r'th term of 1169, 1171, 1173, 1175, 1177, 1179? 2r + 1167 What is the k'th term of 833, 1666, 2499? 833k What is the f'th term of -966, -984, -1028, -1110, -1242, -1436? -2f3 - f2 - f - 962 What is the t'th term of 94, 95, 96, 97? t + 93 What is the n'th term of -140, -276, -390, -470, -504, -480, -386? 2n3 - n2 - 147n + 6 What is the d'th term of -2965, -5933, -8901, -11869, -14837? -2968d + 3 What is the r'th term of -19, -30, -57, -106, -183, -294? -r*3 - 2r*2 + 2r - 18 What is the i'th term of -21, -49, -97, -171, -277, -421? -i*3 - 4i*2 - 9i - 7 What is the t'th term of 3, -12, -29, -48, -69, -92? -t*2 - 12t + 16 What is the q'th term of 161, 619, 1361, 2381, 3673? -q*3 + 148q*2 + 21q - 7 What is the j'th term of 34, 4, -40, -104, -194, -316, -476? -j3 - j2 - 20j + 56 What is the t'th term of -12, 3, 26, 57, 96? 4t*2 + 3t - 19 What is the q'th term of 96, 98, 102, 108, 116, 126? q*2 - q + 96 What is the p'th term of 128, 135, 142, 149, 156, 163? 7p + 121 What is the h'th term of 120, 101, 68, 15, -64, -175, -324? -h3 - h2 - 9h + 131 What is the p'th term of -206, -864, -1974, -3536, -5550? -226p*2 + 20p What is the l'th term of 86, 38, -10, -58, -106, -154? -48l + 134 What is the h'th term of 1118, 1116, 1114, 1112, 1110? -2h + 1120 What is the y'th term of 2032, 4062, 6092, 8122, 10152? 2030y + 2 What is the i'th term of 255, 254, 253, 252, 251, 250? -i + 256 What is the a'th term of 23, 156, 517, 1220, 2379, 4108? 19a3 + 4 What is the o'th term of -173, -172, -177, -194, -229, -288, -377, -502? -o3 + 3o2 - o - 174 What is the s'th term of 5846, 5847, 5848, 5849, 5850? s + 5845 What is the p'th term of -7, 1, 13, 23, 25? -p3 + 8p*2 - 9p - 5 What is the c'th term of 14, -33, -126, -277, -498? -2c3 - 11c*2 + 27 What is the p'th term of 25, 32, 1, -86, -247, -500? -3p3 - p2 + 31p - 2 What is the u'th term of 1302, 1311, 1322, 1335? u2 + 6u + 1295 What is the i'th term of 26, 130, 304, 548, 862, 1246? 35i2 - i - 8 What is the z'th term of -406, -404, -402, -400, -398, -396? 2z - 408 What is the o'th term of 117, 113, 109, 105? -4o + 121 What is the h'th term of 71, 141, 211, 281, 351? 70h + 1 What is the v'th term of -92, -101, -110, -119, -128? -9v - 83 What is the w'th term of -609, -612, -613, -612? w2 - 6w - 604 What is the x'th term of 106, 150, 184, 202, 198? -x3 + x2 + 48x + 58 What is the n'th term of 54, 111, 168? 57n - 3 What is the v'th term of -53, -50, -47, -44, -41, -38? 3v - 56 What is the j'th term of 71, 282, 631, 1118? 69j*2 + 4j - 2 What is the p'th term of -177, -181, -199, -237, -301, -397, -531, -709? -p3 - p2 + 6p - 181 What is the q'th term of -4767, -19058, -42883, -76248, -119159? -q3 - 4761q2 - q - 4 What is the y'th term of 65, 275, 633, 1145, 1817, 2655? y3 + 68y2 - y - 3 What is the n'th term of 29, 26, 17, 2? -3n*2 + 6n + 26 What is the z'th term of -66, -154, -242? -88z + 22 What is the p'th term of -29, -23, -7, 25, 79, 161, 277, 433? p3 - p2 + 2p - 31 What is the j'th term of 95, 98, 101, 104, 107, 110? 3j + 92 What is the o'th term of 22, 43, 66, 91, 118, 147? o2 + 18o + 3 What is the r'th term of 27, 64, 125, 210? 12r2 + r + 14 What is the t'th term of -5, -10, -19, -32? -2t*2 + t - 4 What is the p'th term of 5, 44, 109, 200, 317, 460, 629? 13p2 - 8 What is the m'th term of -13, -31, -51, -73, -97, -123? -m2 - 15m + 3 What is the g'th term of 190, 184, 178, 172, 166? -6g + 196 What is the w'th term of 49, 49, 45, 37, 25? -2w2 + 6w + 45 What is the x'th term of -87, -106, -143, -204, -295, -422? -x*3 - 3x*2 - 3x - 80 What is the x'th term of -3, 0, -1, -12, -39, -88, -165? -x*3 + 4x*2 - 2x - 4 What is the h'th term of 22, 44, 82, 136, 206? 8h2 - 2h + 16 What is the m'th term of 398, 818, 1250, 1700, 2174? m*3 + 413m - 16 What is the m'th term of 5574, 5571, 5568, 5565, 5562? -3m + 5577 What is the l'th term of -100, -103, -106, -109, -112, -115? -3l - 97 What is the y'th term of -385, -784, -1183? -399y + 14 What is the g'th term of -18, -111, -278, -525, -858, -1283? -g3 - 31g*2 + 7g + 7 What is the w'th term of -18, -48, -108, -210, -366, -588? -2w3 - 3w*2 - 7w - 6 What is the d'th term of -112, -78, -14, 92, 252, 478, 782? 2d3 + 3d*2 + 11d - 128 What is the p'th term of 22, 99, 226, 397, 606, 847, 1114, 1401? -p*3 + 31p*2 - 9p + 1 What is the b'th term of 1167, 1163, 1157, 1149, 1139? -b2 - b + 1169 What is the z'th term of -15, -25, -31, -27, -7, 35, 105, 209? z3 - 4z2 - 5z - 7 What is the l'th term of -60, -52, -36, -6, 44, 120? l*3 - 2l*2 + 7l - 66 What is the a'th term of 6, 39, 92, 165, 258, 371? 10a2 + 3a - 7 What is the j'th term of -38, -20, 12, 58? 7j2 - 3j - 42 What is the c'th term of -8, 5, 42, 103, 188, 297? 12c2 - 23c + 3 What is the q'th term of -1611, -3220, -4829, -6438, -8047, -9656? -1609q - 2 What is the l'th term of 17, 101, 329, 773, 1505, 2597, 4121? 12l3 + 5 What is the h'th term of -47, -100, -155, -212, -271, -332, -395? -h2 - 50h + 4 What is the w'th term of -6129, -6133, -6139, -6147, -6157? -w2 - w - 6127 What is the d'th term of 229, 582, 937, 1294, 1653? d2 + 350d - 122 What is the l'th term of 235, 233, 229, 223, 215? -l*2 + l + 235 What is the g'th term of 33, 39, 49, 63, 81? 2g2 + 31 What is the w'th term of -67, -73, -89, -121, -175, -257, -373? -w3 + w*2 - 2w - 65 What is the j'th term of -29, -55, -127, -269, -505, -859, -1355? -4j3 + j2 - j - 25 What is the z'th term of 247, 238, 239, 256, 295, 362, 463? z3 - z2 - 13z + 260 What is the j'th term of 49, 50, 53, 64, 89? j*3 - 5j*2 + 9j + 44 What is the c'th term of -26, -42, -58? -16c - 10 What is the o'th term of -79, -63, -19, 59, 177, 341, 557? o3 + 8o*2 - 15o - 73 What is the i'th term of -45, -141, -305, -537, -837, -1205, -1641? -34i2 + 6i - 17 What is the z'th term of -16, -59, -128, -223, -344? -13z2 - 4z + 1 What is the l'th term of 105, 195, 269, 327, 369, 395? -8l2 + 114l - 1 What is the w'th term of 26, 69, 114, 161, 210	{ "pile_set_name": "DM Mathematics" }
75, 741, 1083, 1507? c*3 + 23c*2 - 2c + 51 What is the j'th term of 7, 14, 25, 40? 2j2 + j + 4 What is the j'th term of 14437, 14436, 14435, 14434, 14433? -j + 14438 What is the s'th term of 18, -9, -78, -213, -438, -777? -4s*3 + 3s*2 - 8s + 27 What is the z'th term of -21, -24, -27, -30, -33? -3z - 18 What is the q'th term of 2, 31, 98, 221, 418, 707, 1106, 1633? 3q3 + q2 + 5q - 7 What is the x'th term of -18, 9, 48, 105, 186, 297, 444? x3 + 20x - 39 What is the r'th term of -3586, -3587, -3588? -r - 3585 What is the d'th term of 26, 4, -24, -58, -98? -3d2 - 13d + 42 What is the h'th term of 670, 661, 640, 601, 538, 445? -h*3 - 2h + 673 What is the o'th term of -19, -60, -171, -388, -747? -6o3 + o2 - 2o - 12 What is the h'th term of 80, 152, 214, 260, 284, 280, 242? -h3 + h2 + 76h + 4 What is the l'th term of -63, -74, -85, -90, -83, -58, -9, 70? l3 - 6l2 - 58 What is the x'th term of -107, -184, -263, -344, -427, -512, -599? -x2 - 74x - 32 What is the o'th term of -2204, -2192, -2156, -2084, -1964, -1784? 2o*3 - 2o - 2204 What is the j'th term of -11, -46, -117, -236, -415, -666? -2j3 - 6j*2 - 3j What is the o'th term of -2231, -4475, -6707, -8921, -11111, -13271, -15395, -17477? o*3 - 2251o + 19 What is the n'th term of -7, -19, -37, -61, -91, -127? -3n2 - 3n - 1 What is the w'th term of -140, -282, -424, -566? -142w + 2 What is the k'th term of -26, -33, -44, -59, -78, -101? -2k*2 - k - 23 What is the s'th term of 49, 56, 67, 82, 101, 124? 2s*2 + s + 46 What is the u'th term of -1740, -1739, -1738, -1737? u - 1741 What is the x'th term of 8, 17, 32, 53, 80, 113? 3x2 + 5 What is the g'th term of 12, 31, 66, 123, 208, 327, 486, 691? g3 + 2g2 + 6g + 3 What is the n'th term of 1038, 1049, 1060, 1071, 1082, 1093? 11n + 1027 What is the o'th term of 110, 132, 154? 22o + 88 What is the b'th term of 637, 2547, 5731, 10189, 15921? 637b2 - b + 1 What is the b'th term of 856, 861, 868, 877? b2 + 2b + 853 What is the t'th term of 5, 84, 231, 452, 753, 1140, 1619, 2196? t*3 + 28t*2 - 12t - 12 What is the p'th term of -163, -197, -281, -439, -695, -1073? -4p3 - p2 - 3p - 155 What is the c'th term of -30, -43, -44, -27, 14? c*3 - 20c - 11 What is the y'th term of 2374, 4746, 7114, 9478, 11838? -2y2 + 2378y - 2 What is the j'th term of -9, -5, -1? 4j - 13 What is the k'th term of 23103, 23102, 23101, 23100, 23099? -k + 23104 What is the u'th term of -42, -79, -114, -147, -178, -207, -234? u2 - 40u - 3 What is the h'th term of -4, 40, 100, 170, 244, 316, 380, 430? -h*3 + 14h*2 + 9h - 26 What is the d'th term of 1078, 1074, 1070? -4d + 1082 What is the a'th term of 623, 5031, 16999, 40307, 78735? 630a*3 - 2a - 5 What is the x'th term of -207, -213, -231, -267, -327, -417? -x3 + x - 207 What is the t'th term of -102, -106, -112, -120, -130, -142? -t2 - t - 100 What is the p'th term of -384, -1534, -3450, -6132, -9580, -13794, -18774? -383p2 - p What is the v'th term of -585, -587, -589, -591, -593, -595? -2v - 583 What is the y'th term of -122, -103, -84, -65? 19y - 141 What is the c'th term of -2305, -2306, -2307? -c - 2304 What is the z'th term of 3, -28, -99, -216, -385? -z3 - 14z*2 + 18z What is the l'th term of 87, 100, 113, 126, 139, 152? 13l + 74 What is the c'th term of -91, -180, -269, -358, -447? -89c - 2 What is the o'th term of 58, 83, 108, 133? 25o + 33 What is the y'th term of -110, -112, -114, -116, -118, -120? -2y - 108 What is the f'th term of 5, 17, 39, 71, 113, 165? 5f2 - 3f + 3 What is the j'th term of -412, -388, -362, -334? j*2 + 21j - 434 What is the n'th term of -9003, -18008, -27013, -36018? -9005n + 2 What is the h'th term of 2795, 2798, 2803, 2810, 2819? h2 + 2794 What is the g'th term of 1, -8, -15, -20, -23, -24, -23? g2 - 12g + 12 What is the a'th term of -380, -382, -384? -2a - 378 What is the y'th term of -318, -342, -366, -390, -414, -438? -24y - 294 What is the z'th term of -2543, -2536, -2519, -2486, -2431? z3 - z2 + 3z - 2546 What is the k'th term of 29, 44, 55, 62, 65, 64, 59? -2k*2 + 21k + 10 What is the u'th term of -15222, -15223, -15224? -u - 15221 What is the z'th term of -3013, -3010, -3007, -3004? 3z - 3016 What is the i'th term of 12, 36, 70, 114, 168, 232, 306? 5i*2 + 9i - 2 What is the m'th term of 7, -335, -1265, -3077, -6065, -10523, -16745, -25025? -49m3 + m + 55 What is the m'th term of -34, -60, -102, -160? -8m*2 - 2m - 24 What is the y'th term of 20, 15, 10, 5, 0, -5? -5y + 25 What is the i'th term of -8131, -8128, -8123, -8116, -8107, -8096? i2 - 8132 What is the v'th term of -65, -51, -19, 37, 123, 245, 409, 621? v3 + 3v*2 - 2v - 67 What is the t'th term of -3851, -3849, -3847, -3845? 2t - 3853 What is the o'th term of -111, -105, -97, -87? o2 + 3o - 115 What is the v'th term of -289, -311, -347, -403, -485, -599, -751, -947? -v3 - v2 - 12v - 275 What is the n'th term of 610, 2420, 5438, 9664, 15098, 21740? 604n*2 - 2n + 8 What is the i'th term of -40, -32, -14, 20, 76, 160, 278? i3 - i2 + 4i - 44 What is the l'th term of -6, -23, -52, -93, -146, -211? -6l2 + l - 1 What is the l'th term of 0, -124, -338, -648, -1060, -1580, -2214? -l3 - 39l2 + 40 What is the z'th term of 145, 130, 115, 100? -15z + 160 What is the d'th term of 16, -6, -52, -134, -264, -454, -716? -2d3 - 8d + 26 What is the y'th term of 7, -26, -117, -296, -593? -5y3 + y2 - y + 12 What is the g'th term of -8, -13, -16, -17, -16? g2 - 8g - 1 What is the s'th term of 52, 106, 164, 226, 292, 362? 2s2 + 48s + 2 What is the x'th term of 63, 118, 171, 222, 271? -x*2 + 58x + 6 What is the s'th term of -7, -8, -1, 14, 37, 68? 4s2 - 13s + 2 What is the j'th term of -12, -72, -188, -372, -636, -992, -1452? -2j3 - 16j*2 + 2j + 4 What is the p'th term of 29, 18, -1, -28, -63, -106, -157? -4p2 + p + 32 What is the r'th term of 1, 3, 19, 55, 117, 211? r3 + r2 - 8r + 7 What is the q'th term of -519, -517, -515, -513? 2q - 521 What is the u'th term of -17, -100, -229, -398, -601, -832, -1085? u3 - 29u*2 - 3u + 14 What is the h'th term of -948, -952, -968, -1002, -1060, -1148, -1272, -1438? -h*3 + 3h - 950 What is the f'th term of -608, -588, -568? 20f - 628 What is the c'th term of -148, -593, -1356, -2455, -3908, -5733? -3c*3 - 141c*2 - c - 3 What is the k'th term of 63, 76, 111, 180, 295, 468, 711? 2k3 - k2 + 2k + 60 What is the k'th term of -77, -506, -1669, -3932, -7661, -13222? -61k3 - k2 + k - 16 What is the f'th term of -244, -251, -262, -277, -296? -2f2 - f - 241 What is the w'th term of 604, 606, 610, 616, 624, 634? w2 - w + 604 What is the x'th term of -99, -96, -81, -48, 9, 96, 219? x3 - 4x - 96 What is the h'th term of -491, -493, -495, -497? -2h - 489 What is the g'th term of -356, -348, -326, -284, -216, -116, 22? g3 + g2 - 2g - 356 What is the q'th term of -1085, -1092, -1103, -1118? -2q2 - q - 1082 What is the t'th term of 279, 278, 277, 276? -t + 280 What is the q'th term of 35, 112, 237, 410, 631, 900, 1217? 24q*2 + 5q + 6 What is the z'th term of 29, 80, 131, 182, 233, 284? 51z - 22 What is the l'th term of -15, -49, -99, -159, -223, -285? l3 - 14l*2 + l - 3 What is the r'th term of -522, -527, -532, -537, -542, -547? -5r - 517 What is the o'th term of -38, -25, -24, -41, -82, -153, -260? -o*3 + 20o - 57 What is the c'th term of -1355, -2708, -4061, -5414, -6767, -8120? -1353c - 2 What is the t'th term of 30, 72, 114, 156, 198, 240? 42t - 12 What is the y'th term of -994, -993, -992? y - 995 What is the r'th term of -209, -208, -207? r - 210 What is the t'th term of 72, 136, 200, 264? 64t + 8 What is the w'th term of -92, -117, -178, -293, -480, -757, -1142? -3w*3 - 4w - 85 What is the o'th term of -3194, -6387, -9580, -12773, -15966, -19159? -3193o - 1 What is the m'th term of -13, -26, -47, -76, -113, -158, -211? -4m*2 - m - 8 What is the a'th term of 29, 48, 81, 128, 189, 264, 353? 7a*2 - 2a + 24 What is the r'th term of 35, 151, 345, 617? 39r*2 - r - 3 What is the c'th term of -132, -133, -134? -c - 131 What is the q'th term of -197, -	{ "pile_set_name": "DM Mathematics" }
153u3 + 2991u + 2. 20u3 - 918u What is the second derivative of -4x5 + 27x4 + x2 - 4194x? -80x*3 + 324x*2 + 2 Find the second derivative of 812b*2z*4 - 4b*2z + 12b2 - 2bz + 2z*4 wrt z. 9744b*2z*2 + 24z*2 Find the second derivative of -16416x*2 + 11879x. -32832 What is the second derivative of 12p4z*3 - 8p*3z*3 + 10pz3 - 3p wrt p? 144p2z*3 - 48pz3 Find the first derivative of -c4 + 52c*3 + 7c*2 + 11318. -4c*3 + 156c*2 + 14c What is the third derivative of -9366v3 - 17v*2 - 15v + 6 wrt v? -56196 Differentiate -143m + 209 with respect to m. -143 What is the third derivative of 2h*3m*3z + 2h3m*2 - 6h*2m*2z + 978hm*3 + 2m*2z + m*2 wrt m? 12h*3z + 5868h Find the second derivative of -40n*3z2 + n3 + 9n2 - nz*2 - 275nz wrt n. -240nz2 + 6n + 18 Find the second derivative of 8316l3 + 8965l wrt l. 49896l Find the third derivative of -106i*3l*2 - 4i*3 + 1606i*2l*2 - l wrt i. -636l*2 - 24 Find the second derivative of 2h*4 + 63h*2 + 468h wrt h. 24h2 + 126 Find the second derivative of -9x*5 - 2x*3 - x - 54 wrt x. -180x*3 - 12x Find the first derivative of 36gs + 11g - 142s - 5 wrt g. 36s + 11 What is the first derivative of -269d*3 - 19? -807d*2 Find the second derivative of -6k*3 - 7k*2q*3 + 3k*2 + 9kq + 4q*3 - 7q wrt k. -36k - 14q*3 + 6 What is the third derivative of 252b*6 + 2b*5 - 12b*2 - 6b wrt b? 30240b3 + 120b*2 What is the third derivative of -902v*4 - 9v*2 - 8 wrt v? -21648v Find the first derivative of 62p2 + 400. 124p Differentiate -664a3m*2 - 186a*3 with respect to m. -1328a*3m Differentiate -71i2x + i*2 - 2ix4 - 6 with respect to x. -71i*2 - 8ix3 What is the first derivative of -20926u*3 - 5785? -62778u*2 Find the third derivative of 214t*6 + 133t*2. 25680t*3 Differentiate 28o4 + o3 + 245 with respect to o. 112o3 + 3o*2 Differentiate 46rx2z*3 - 3rxz*2 - 2r + 2x2 - 3x wrt z. 138rx*2z*2 - 6rxz What is the third derivative of -5i4 - 1140i*3 + 205i*2 + 4i + 4 wrt i? -120i - 6840 Find the first derivative of 15o*2 + 5o - 76 wrt o. 30o + 5 What is the derivative of 88t*3 - 154? 264t*2 Find the first derivative of 841b - 3735. 841 Find the third derivative of -9ar*3t*3 - ar*3 + ar*2 - 2art*3 + ar - 4r3t*3 - 18r*2t*3 wrt r. -54at3 - 6a - 24t3 What is the derivative of -mu*2v + 16mu*2 - 3147u*2v wrt m? -u*2v + 16u2 Find the first derivative of 14i*2n - 169i2 - in wrt n. 14i2 - i Find the second derivative of -2i*3p*2 + 6540i*2p + 7ip*2 + 2ip - 7p*2 wrt i. -12ip2 + 13080p Differentiate 131o2 + 251. 262o What is the third derivative of -2dp*3z*3 + 31dp2z + 2dp2 + p2z3 - 2p wrt p? -12dz*3 What is the second derivative of -2ag2hx + 281ag2h + ag2x - 22ax + 4ghx - 2gh + 2gx wrt g? -4ahx + 562ah + 2ax What is the third derivative of 1133f5 + 4961f*2 + 1? 67980f2 Find the first derivative of m3 + 2731m - 2506. 3m*2 + 2731 Find the second derivative of -87j*4 - 2j3 + j2 - 1131j wrt j. -1044j*2 - 12j + 2 Find the third derivative of -16c3j + 1649c3q*3 - 3cjq*3 + 4cjq - 11jq*2 wrt q. 9894c*3 - 18cj Find the second derivative of 2h*2op3 + 5h*2op2 - 150h*2op + hop2 + 4hp + 2op3 - 52op2 wrt h. 4op3 + 10op2 - 300op Find the third derivative of -22686do3 - 43do2 - 130do wrt o. -136116d Find the third derivative of -12noy3 - noy2 + 21ny2 + 2oy3 - y3 wrt y. -72no + 12o - 6 Find the first derivative of 5k2o*2 + 72k*2o - 28k2 - 26 wrt o. 10k*2o + 72k2 What is the second derivative of 16p*4t + p*3t + 77p2t - 2pt + t - 61 wrt p? 192p2t + 6pt + 154t Find the first derivative of -j3q*2 - 4421jq2 - 139q*2 + 10q wrt j. -3j2q*2 - 4421q*2 Differentiate 4dk - dl - 5d + 8kl2 - 13kl + 21k + 8l2 - 1 wrt l. -d + 16kl - 13k + 16l Find the third derivative of -5014k*5 + 4k*2 + 583k. -300840k2 What is the third derivative of 2im6 - 6im4 + 2im2 - 336im - 2m*3 wrt m? 240im3 - 144im - 12 What is the third derivative of 92t*6 - 35t*2 wrt t? 11040t3 What is the first derivative of -j4 + 2j2n*2 + 2jn - 160n*2 wrt j? -4j*3 + 4jn2 + 2n What is the derivative of 2q2r*3u*2 + 6q*2r*3x + 2qr*3u*2 - 250r*3u*2 + 2u*2x wrt x? 6q2r*3 + 2u*2 Find the first derivative of -40v*4 + 2v*2 - 1333. -160v*3 + 4v What is the third derivative of 620i3k*2 + 3i*3t + 2i2k*2t - 7i2k*2 - 3i*2t wrt i? 3720k2 + 18t Find the second derivative of w*5 - 4820w*2 - 7398w. 20w3 - 9640 What is the third derivative of 45bi2v*3 + bi*2 + biv - 32bv2 - 4i*2v*4 + 2iv2 wrt v? 270bi2 - 96i*2v What is the third derivative of 21c5 - c3 - 71c*2 - 2c wrt c? 1260c2 - 6 What is the derivative of 19f*3 - 3f + 69 wrt f? 57f2 - 3 Find the third derivative of -f6 - 3f*3 + 111f*2. -120f*3 - 18 What is the second derivative of bnv2 + 9bnvz2 + 2bnz + 2bn + bvz*3 + nv*2z*3 + 22nv2 + 2vz3 wrt v? 2bn + 2nz3 + 44n Find the third derivative of 2922c5 + 1512c*2. 175320c*2 Find the second derivative of -4a*2b*2rt - a2r - 2ab*2rt + ab*2r - 4brt + 2br - 2t wrt b. -8a2rt - 4art + 2ar What is the derivative of 320o3 + 2o + 279? 960o2 + 2 What is the second derivative of 15l*3m*4 + 2l*3m + 14l2m*2 + 78m wrt m? 180l3m*2 + 28l*2 What is the second derivative of 2953b*5 + 15948b wrt b? 59060b3 Find the second derivative of 437z*4 - 714z. 5244z2 What is the first derivative of -2u*4 - 1577u*3 + 2734? -8u*3 - 4731u*2 Differentiate 5qs2 - 211qs + 3442s*2 wrt q. 5s*2 - 211s Find the second derivative of -2n5x*2 - 13n*5 + 2n*2 + 2nx - x2 + 59 wrt n. -40n*3x*2 - 260n*3 + 4 Find the first derivative of 6d*2pz3 + 63d*2pz2 + 3d*2z - 2d2 - pz - 2z3 + 364 wrt p. 6d*2z*3 + 63d*2z*2 - z What is the third derivative of 91l*5 - 4l*2 + 23l? 5460l2 Find the third derivative of 6i*5 + 4i*4p + 2i4 - 3i*2p - p - 15 wrt i. 360i2 + 96ip + 48i What is the third derivative of -b*4dx2 + b3dx3 + 15b*3d + 2b2x*2 - 5bdx*2 + 2dx3 - dx*2 wrt b? -24bdx*2 + 6dx3 + 90d What is the second derivative of -bo3y - 2bo*2 - boy + 25bo - 8o*3y - o*3 + o + 4y wrt o? -6boy - 4b - 48oy - 6o Differentiate -7810w + 2164 wrt w. -7810 What is the second derivative of -4dw*2 + 3dw - 2d - 875w2 + 2w + 46 wrt w? -8d - 1750 Find the first derivative of -z4 + 11z*3 - 9z*2 - 6169. -4z*3 + 33z*2 - 18z Differentiate -3i2o - i*2 + 13o*4 - 101 with respect to o. -3i*2 + 52o*3 Find the first derivative of -3441b - 8252. -3441 Find the third derivative of -22a3hs2 + 4a*3s*3 - 6ah2 + ahs2 + 18h*2s*3 - hs*4 wrt s. 24a*3 + 108h*2 - 24hs What is the third derivative of 3509x*5 - 10x*2 - 16 wrt x? 210540x*2 What is the third derivative of -lr*3x - 10lr*2x + 3lx + 87r3x + 2x wrt r? -6lx + 522x What is the derivative of -12cuz2 + 17cz3 - 40uz3 wrt c? -12uz2 + 17z*3 Differentiate -96a - 265 wrt a. -96 Differentiate -96o3 + 114 with respect to o. -288o*2 What is the third derivative of -16c*3jn3 - 128c*3n2 - c2j - 4cjn*3 - 2cjn*2 - 2 wrt n? -96c*3j - 24cj What is the derivative of 125lqz - 3lz + 351l + 2q2z + 3q2 wrt z? 125lq - 3l + 2q2 What is the third derivative of 43i*6 + 9i*4 - 429i*2 wrt i? 5160i*3 + 216i Find the second derivative of 222z5 + 32z - 1 wrt z. 4440z3 What is the derivative of g3 - 17g*2 + 114g - 2616? 3g2 - 34g + 114 What is the second derivative of -358t4 + 582t? -4296t	{ "pile_set_name": "DM Mathematics" }
nd2 + p + ud + md3 and give m. 141 Express 7810g - 6 + 32 - 28 + 2 in the form sg + b and give s. 7810 Express (-4 + 5 - 2b + 3b)(-1165b2 - 254054b + 254054b) in the form mb*3 + qb*2 + j + vb and give j. 0 Express 12c2 + 4c + 19c4 + 9c*2 - 36c*2 + 14c*2 + 12 - 41c*4 in the form fc*4 + jc*3 + kc*2 + oc + g and give o. 4 Express -74a4 - 3 + 35a*3 - 35a*3 + 2a*2 - 2655a + 2654a in the form f + ya + pa2 + wa*3 + qa*4 and give q. -74 Express (1438 + 67f - 1438)(3f*2 - 4f2 - f2 + 57) in the form yf2 + d + nf + of3 and give y. 0 Rearrange 3q*4 + 5q*4 + 0q*4 + (-63q*3 + 63q*3 - 9q*4)(20 + 1 - 11) to the form wq + lq*2 + gq*3 + kq4 + v and give k. -82 Express 1 - a2 - a*2 - 7a - 17a - 24a + 46a - 12a*3 in the form w + sa + fa2 + ya*3 and give s. -2 Rearrange -2u - 484u2 + 77u*2 - 196u*2 to the form du*2 + h + iu and give i. -2 Express -206c - 321c - 399c + 18c in the form r + nc and give n. -908 Express (-27 - 8 - 27)(98 - 52 - 46k - 42) as r + ck and give c. 2852 Rearrange -9997x2 - 357x*2 - 3508x*2 to the form g + ox*2 + sx and give s. 0 Express 3 + 2 - 5871n + 1714n - 4154n - 3 in the form s + cn and give c. -8311 Express -7x2 + 5x*2 + 1 - 43534x + 1 + 43531x - 142x*3 as wx + r + jx2 + vx*3 and give j. -2 Rearrange 77 + 84 + 89 - 3j + 82 - 329 - 26j2 - 2j*3 to the form tj*3 + sj + i + qj2 and give i. 3 Express (-3q + q - 2q + (4 + 0 - 1)(-2q + 4q + q))(-3q - 2q - 11q) as rq + kq*2 + w and give k. -80 Rearrange -4i - 5i - i + (i + i - i)(-33 + 128 - 4) to li + j and give l. 81 Express (2a - 4 + 4)(2a + 1 - 1) - 3a - 2a*2 + 3a - 355a2 - 1237a - 274a2 + 1234a in the form j + ua2 + la and give l. -3 Express 4363b + 4363b + 9b3 + 1 - 8714b as jb3 + s + yb + ib2 and give s. 1 Express (-175 + 19 + 69)(9r + 3r - 14r) as o + pr and give o. 0 Rearrange 1026s - 27s*2 + 1017s - 2044s - 18 to the form k + fs*2 + bs and give k. -18 Rearrange 30n - 119n + 47n - 3n*3 - 8n3 + 5 + n4 + 30n to the form vn + jn4 + un*3 + s + kn*2 and give k. 0 Express 4 - 10 + r + 24r*4 + 13r2 - r3 + 2 + 5 + 5r2 in the form qr + w + zr2 + ur*3 + kr*4 and give u. -1 Express 859d*2 - 2 + 18d - 16d + 3d*3 - 857d*2 as hd*2 + v + rd + id3 and give i. 3 Rearrange -3284b - 436b - 1602b to the form ib + n and give i. -5322 Rearrange -2y*2 + 5 - 5 + (-4y + 2y + 0y)(1 - 2y - 1) - 250y2 + 249y - 503y + 255y to ay + k + hy*2 and give a. 1 Rearrange 2 - 3657382s*3 - 3 + 3657734s*3 + 13s to ys + i + ws*3 + xs*2 and give w. 352 Express -453x*4 - 12x*2 - 427x*4 - 2 - 2x + 888x4 as sx + ix3 + l + hx*4 + ux*2 and give l. -2 Rearrange -1703000f + 1703000f - 1027f*2 to j + rf*2 + wf and give r. -1027 Express 392647y - 392643y + 1 + 6 - 4y2 in the form p + ky*2 + my and give m. 4 Rearrange 3 - 119 - 5 + 3c - 26c - 81 to the form bc + z and give z. -202 Rearrange 0 - 2457g - 312g - 518g - 3069g + 1 to the form dg + y and give y. 1 Express -t - 3t2 + t3 - 25 + t4 + 103 - 27 - 23 - 37 as yt + bt2 + c + zt*3 + ot*4 and give c. -9 Express d + 49d - 10d2 - 32d + (74d + d + 91d)(0d + d - 3d) as i + fd + sd2 and give s. -342 Express (0b - 4b + 5b)(-b2 + 2b*2 - 3b*2) - 290b*2 + 3b*3 + 15600b - 15600b as vb*2 + mb + qb3 + d and give v. -290 Express (-1 + 1 + 1)(0x + 2x + x) - 94x + 338x - 4 - 121x in the form lx + k and give l. 126 Express (-304l - 370l + 410l)(-2l - l + 10l)(2l*2 - 2l*2 - 2l*2) in the form hl*3 + fl + nl4 + gl*2 + s and give n. 3696 Express (-2u*2 + 2u2 - u2)(1435u + 160u - 666u)(-3 + 3 + 5u) as k + au2 + ou + vu3 + pu*4 and give p. -4645 Rearrange -2x*4 + 12 - 106x*2 + 2x - 3x4 + 211x*2 - 14x*3 + 4x*4 - 104x*2 to yx*4 + sx*2 + ox + px3 + v and give y. -1 Rearrange (5y - 4y + 4y + (-y - 3y - 3y)(-5 - 2 + 6))(4 - 3 - 3) + 5 - 7y - 5 to r + ky and give k. -31 Rearrange (5468d - 1403d + 10671811d2 - 10671802d*2 - 1)(3 + 0 - 2)(1 + 0 - 2) to the form p + qd*2 + id and give p. 1 Rearrange 0 - 1155n + 1120n + 7 to q + kn and give k. -35 Rearrange 2040s*2 - 469s - 4079s2 + 2038s*2 - 3s*4 to gs*3 + w + fs*4 + hs*2 + ls and give h. -1 Express (-12 + 8g + 12)(98g + 20 - 48g - 48g)(99 - 37 + 7) in the form q + og + fg*2 and give f. 1104 Express 3c*2 - 33 - 21 + 56 - 4c*3 + 16c*4 in the form jc*3 + gc + qc2 + dc*4 + s and give q. 3 Rearrange (4 - 6 + 3)(0q - 3q + 8 - 5)(-2 + 4 + 0)(-100 + 255 + 203) to tq + r and give r. 2148 Rearrange -2c - c + c + (-1 + 2 + 0)(2c + 0c - 3c) - 3308 - 2900c + 3308 to the form gc + t and give g. -2903 Rearrange -2 + 285h + 2 + 2581h to vh + f and give v. 2866 Express -337s - 146s4 + 139s - 7s2 + 1 + 2s*3 + 198s + 434s4 in the form q + ls*2 + us*4 + gs*3 + ms and give q. 1 Express (7i + 5i - 3i)(0 + 0 + 1)(5 - 3 + 5)(-10 + 5 - 22) + 4 - 4 + i + (-1 + 2 + 1)(-i - 4i + 4i) as f + ki and give k. -1702 Rearrange (-1721 + 1822 - 209 - 1852)(2 - 2 - f2) - 2f2 + f2 + 2f2 to nf + b + af2 and give a. 1961 Express -1 - 262p*4 - 269p*4 + 533p*4 - 105p as fp4 + wp*3 + sp + jp2 + v and give w. 0 Rearrange 16m*3 - 3m*2 + 32m*2 - 863 - 8m*2 + m - 15m*3 - 19m*2 to the form lm*2 + gm + h + im3 and give l. 2 Express 9809p*4 + 9820p*4 + 25p + p*3 - 3 - 19616p*4 as cp*2 + op*4 + rp*3 + jp + w and give r. 1 Rearrange 689827d + 790d*3 + 179d*3 + 1 - 689826d - d*2 - 1 to s + ld + fd2 + hd*3 and give l. 1 Express (-17 - 11 - 49 + (0 + 4 - 2)(4 - 2 - 1))(39f + 14f - 20f) in the form x + hf and give h. -2475 Rearrange -7582 - 24b*3 + 3789 + 3791 - 5b*3 - 83b*2 to the form u + cb*2 + xb*3 + lb and give u. -2 Express -l + 53l4 - 52l*4 - 1 + 11l*2 + 214l*3 - 13l*2 in the form dl + b + cl2 + fl*4 + wl*3 and give b. -1 Express 9334h + 63001h - 26151h as ch + m and give c. 46184 Rearrange -13 + 7 + 9 - 10t*3 + (2t*2 - 1 + 1)(-4t + 5t - 2t) - 120t*3 - 1382 + 1382 to qt*2 + xt*3 + f + bt and give b. 0 Express -16f3 + 5f - 2f4 - 3f + 4f4 + 13f*3 - 4 - 4f*4 in the form af*2 + rf*3 + nf + if4 + w and give i. -2 Express 32 - 3796h + 2506h - 30 in the form g + sh and give s. -1290 Express (-2g + 3g - 7g)(1 + 0 + 1) - 2g - 3g + 3g + (-2g + 1 - 1)(-1 - 1 + 3) + 0g + 0g - g - 1942g - 1393g - 86g in the form w + dg and give w. 0 Express -297m*2 - 3m - 313m2 - 5 - 301m*2 + 883m*2 as sm + fm2 + b and give s. -3 Express -28 + 34 - 45d - 78d - 5d - 21d as h + rd and give h. 6 Express (29l - 13l + 43l + (1 - 1 - 2l)(-3 + 2 + 3))(-22l + 99 - 99)(2 - 2 - 1) in the form f + xl + pl*2 and give p. 1210 Express (5 + 0 - 9)(4815x2 + 2 + 2 - 4750x*2 - 2x) as hx + o + rx*2 and give h. 8 Express -14377p + 7182p + 7185p - 44 in the form vp + f and give v. -10 Rearrange (29 + 600 - 410 + 7776)(-6r - 11r + 10r) to the form lr + f and give l. -55965 Express r*3 + 502r*2 - 56r*2 - 184 + 185 in the form lr*3 + xr + ar2 + p and give p. 1 Express -2138s - 1803s + 1 + 8869s - 1744s - 2163s in the form g + fs and give g. 1 Express -926 + 926 + 4363v as n + gv and give g. 4363 Express 619k - 2 + 1 - 6 + 1021k - 461k in the form c + qk and give q. 1179 Express -9 + 1269a*3 + 3a*4 - 2a*4 + 7 + 3a + 1339a3 - 2685a*3 as ra*4 + xa*3 + t + ca*2 + da and give c. 0 Rearrange -1489j2 + 254j*2 - 7768j*2 to tj + z + dj2 and give d. -9003 Express 0o - o + 2o + (-3 + 38 - 3)(0o - 2o + o) + (1 + 2 - 1)(36o - 84o + 61 + 46o) in the form qo + v and give v. 122 Express -3r + 2r - 2r + 4r - 4r + r + (-3 + 4 + 1)(1 - 1 - r) - 106 - 2r - 55 + 24 in the form d + ur and give d. -137 Rearrange (2938o*3 + 937 - 937)(6o - 5o + 6o) to to*3 + lo*2 + xo*4 + uo + s and give x. 20566 Rear	{ "pile_set_name": "DM Mathematics" }
-4)/58? 2/29 Evaluate -2(-1 - -5)1424/39872. -2/7 Calculate 2/(-54(-1)/(-130)). -13 What is 11 - (2 + -4)/((-53)/106)? 7 What is 656/108 + -2 + 8/(-6)3? 2/27 What is (2/8)/(((-2)/(-6))/(128/(-60)))? -8/5 Evaluate 11/333/(-2) + (-54)/4. -14 (-348)/(-261)(-1)/(-14) 2/21 Calculate (-30)/(-152) - (-192)/3648. 1/4 Calculate ((-26)/4)/(-4 - (-126)/28). -13 8/10 + (-7 - -5) + 1394/170 7 Evaluate ((-621)/(-54))/(((-28)/196)/((-4)/14)). 23 What is -1((-285)/228 - (-86)/(-8))? 12 Evaluate 81/105 - 18/(-42) - 112/10. -10 What is the value of (168/112)/((-18)/8)-3? 2 What is the value of (-64)/14 + ((-134)/(-14) - (-420)/(-42))? -5 Calculate (-4)/(-16) + (0 + 8 - 975/60). -8 What is the value of -10 - (-14 + (13 - 1)) - (-37)/5? -3/5 What is the value of (-1804)/(-165) + -12 - 4/(-6)? -2/5 What is the value of ((-180)/25)/((-12)/(-72)27/15)? -24 Evaluate -9 + 400/22414. 16 (4/(-90))/((-286)/10296) 8/5 Calculate (-238)/10 - (-2736)/3420. -23 ((807315/2070)/(-107) - (-11)/3)2 1/23 What is 7((-330)/(-42))/(-11)30/(-325)? 6/13 What is ((-500)/275 - ((-16)/(-22))/4)2? -4 What is (-8468)/(-3480) + (-2)/(-30)? 5/2 What is the value of (1/(-24))/(47/94)? -1/12 55(-13)/(-143) - ((-56)/(-4) + -1) -8 8/2 + -13 + 9 + -1 -1 Evaluate (2/6)/((-75)/(-225)). 1 What is the value of 30/20(-218)/(-1417)? 3/13 Evaluate 1750/21875(-50)/12. -1/3 What is the value of (-697)/(-221) + -3 - 464/3692? 2/71 220/(-22) - -4 - (12 + -2) -16 What is 161/(-69) + 26/9? 5/9 What is (-1008)/3256 - 12/(-33)? 2/37 Calculate (-9)/4565/156. -1/12 What is (-33)/(20/((-160)/(-24)))? -11 Evaluate 20/(-110) + 6541/341. 19 Evaluate -3 + (-35)/7 + -9 + 5 + 8. -4 What is the value of (32/(-384))/(13/(-195))? 5/4 What is the value of -16 + -6(-132)/72? -5 What is (-24)/(-120)-2(-2 - (76 - -2))? 32 Evaluate (-103 - -104) + (1 - 5/(-25)). 11/5 (-2)/((-144)/(-22)) - (-581)/(-2324) -5/9 What is the value of -26 - (-2 + 2) - -17? -9 Evaluate -3(-18 - -39 - 18). -9 Evaluate (-101)/1010 + (-142)/(-220). 6/11 What is (-101)/4 - 111/148? -26 What is the value of ((-21)/(-2))/(351/(-234))? -7 (-166)/20 + 537/1790 -8 What is (8/(-6))/((-97)/(-291)) + 15? 11 Evaluate ((-21)/(36/18))/(37/(-259)). 7 What is ((-5)/(-4))/(((-5)/(-6))/(57/1368))? 1/16 What is 32/(-84) + 440/(-240) + 2? -3/14 Calculate (-94 - 2)/(9 + -6). -32 What is (4 + -4)/(-2) - ((-570)/(-3))/10? -19 What is ((-50)/6)/((-1539)/(-4617))? -25 Calculate (2937/(-99) + 29)2-18. 24 What is the value of -981/48? -3/2 What is (27/81)/((-4)/(-180))? 15 What is the value of ((-51)/867)/(5 + -5 + (-7)/(-28))? -4/17 Evaluate (0 + 1)/(30/200(-8)/6). -5 -15 + -3 - (-84 - -47) 19 What is the value of (1 - -1)/(-129/918)? -17 What is the value of (20/45 - (-8)/(-18)) + 6/102? 1/17 Calculate 10/(21/(-567)18). -15 What is the value of -1((-25)/175)/((-6)/(-21))? 1/2 Evaluate (-693)/39905 + 51/18 + -2. -2/57 Evaluate 1443/3367 - ((-114)/189 + 1). 2/63 (-10 - (-14 + 4 - -8)) + 150/19 -2/19 Calculate -5 + (8 - (-12)/(-2) - (-663)/136). 15/8 (-507)/(-2184) + 5/255/(-8) 3/28 Evaluate ((24/54)/(2/(-12)))/((-2)/(-6)). -8 What is ((-11)/(-14))/(2 - (-936)/(-546))? 11/4 (-259)/(-9) + ((-5848)/387)/(-68) 29 What is the value of ((135/12)/5)/(11 + (-405)/36)? -9 189/21 + ((-96)/42 - 7) -2/7 What is the value of ((-8370)/60)/(-31)(-20)/(-12)? 15/2 What is (4/(-2)8/(-6))/((-80)/(-72))? 12/5 Calculate 0 - -7 - (21/(-7) + 11). -1 What is the value of 3/1(-1328)/(-249)? 16 What is 165/(-1980) + -2(-4)/(-48)? -1/4 Evaluate 14105/1560 - ((-4 - -7) + 2 + 4). 1/24 Calculate (60/750)/(96/320). 4/15 What is 2/((-64)/(-41184)39)? 33 What is (-45)/(-25)(-350)/42? -15 What is the value of (-756)/(-153) - -9 - 8 - 6/1? -1/17 What is 1(-4)/7(33 - (-17458)/(-532))? -2/19 (-5)/(-7) + 8814/(-7910) + 2/(-20) -1/2 Evaluate 51/44 + (-2 + 0)81/(-1782). 5/4 Calculate (52/(-30))/((-72)/(-60)) - (-2)/6. -10/9 Calculate (-2 + 1 + -2)5/(0 + 5). -3 (-12)/(-21)(-154)/44 -2 ((-896)/320)/(24/40) -14/3 Calculate 14/1((-518)/98 + 5). -4 Evaluate 24 + 1 + -3 + 2-1. 20 What is the value of (((-14)/(-4))/(301/86))/((-2)/4)? -2 ((-19)/(-57))/(13/273) 7 Calculate (-96)/(-11) + 219/803. 9 What is the value of (-85)/280 + 161/(-1288)? -3/7 Evaluate -6 - 4270/(-110) - 32. 9/11 Evaluate (144/42)/((-48)/(-112)). 8 What is the value of (-10)/(-12)((-6660)/225 + 30)? 1/3 What is the value of (-209)/57198/(-121)? 6 (135/10 - 14)12/3 -2 Evaluate -7014/(-112)-202/(-10). 35 What is the value of (2 - 1)/(-1) + (-733 + -23)/108? -8 What is 15 + 3 - 23989/1341? 1/9 Evaluate 16/(-22)((-40)/4)/(-40). -2/11 What is the value of ((-11)/(-1))/(-116 + 111)? -11/5 What is the value of (-139 + 126)/(-1 - -2)? -13 (144/(-21))/6 + 1 -1/7 Calculate (-7470)/(-408) + 18/(-306) - (-5)/(-4). 17 ((-24)/((-102)/17))/(2/(-3)) -6 What is the value of 5204/840 - ((-3300)/(-252) + -13) - 6? 1/10 28 - 19 - ((-150)/(-42) - -5) 3/7 Calculate 15/90(-9)/6(2 + -6). 1 1 + 22/(-5) + 546/(-78) - -10 -2/5 What is the value of (9/(-4) - -2) + -43 + 93984/2176? -1/17 Evaluate (17 + 795/(-45))/((-1)/(-18)). -12 What is the value of 9 + (-10 - (-34)/30)? 2/15 What is (4/(-3) + 1)(39574/1034 - 38)? -1/11 Evaluate ((-1)/(-5))/(4011/(-2865)). -1/7 824 + -809 - 24/2 3 -13 - (1 - 1190/84) 1/6 Evaluate (-440)/(-35) + 7/((-294)/24). 12 What is (-55 - -31) + (4 - -20)? 0 Evaluate (66/(-27))/(50 - 36). -2/21 8/(-3)(-36)/(-48) -2 Calculate (2/(-4))/((-45)/(-27 - -792)). 17/2 What is the value of (-4)/90810/16? -2/9 11/(363/(-336)) - (-4 + (-126)/(-33)) -10 What is (-3)/(63/339) + 4 + (-34)/7? -17 What is (-16 - -13) + 17 - 12? 2 Calculate 4968/207 + (-1074)/45. 2/15 6 - (11 - 9)(-5)/10 7 What is 8/12 + 676/156 + -30? -25 What is 4/6(1/(-8))/((-1)/(-6))? -1/2 What is (564/752)/(2(-15)/(-8))? 1/5 4 - (-14 - 28/(-2))/(-11) 4 What is the value of (6 - -6 - 12)/(-11) - -19? 9 What is -3 + (93/18 + -1)/((-21)/(-14))? -2/9 ((129/(-45))/(-43))/(1 + -2) -1/15 Evaluate (-2)/(-4)72/(-10)(-645)/258. 9 6/1018705/(-2494) -9/2 4/30 + 4/4801304 11 What is -76/722? -7/6 (-3)/(-84)38 - ((-184)/8)/(-46) 6/7 Calculate (-12)/(-8)((-2)/3)/(70/20). -2/7 Evaluate -9 + (23 - 14) + 9. 9 What is the value of (-18 - (-356)/20)-75? 15 19/(-57)(90/6 - 15) 0 ((-78)/(-8))/(-23 - (-5249)/232) -26 Calculate -52(-4)/(-16)(-7 + 3)/4. 13 Evaluate 136/34015/(-6). -1 What is (15 - 9)/((56/12)/7)? 9 What is the value of (-2)/((-13 + (-666)/(-54))/(1/27))? 1/9 4/14 - (-378)/49 - 1971/438 7/2 What is 10/(-14) + (3/(-24))/(1/(-8))? 2/7 Evaluate (18/72)/(22/8) + 196/22. 9 33/36(0 + 8 - (128 + -132)) 11 Evaluate ((-127)/(9144/(-576)))/(2/3). 12 What is the value of (-2 - 24/(-10)) + ((-2106)/45)/2? -23 Calculate ((-18)/(-80))/((-16488)/(-4580)). 1/16 Calculate (-630)/(-36)(-12)/15. -14 Calculate (-18)/(-60)(-90)/54. -1/2 What is the value of -22((-3)/(-2) - (405 - 403))? 11 Calculate 37/(74/(-12)) + 9. 3 Evaluate (20/(-18))/(3228/(-2421)). 5/6 Calculate (3/((-12)/(-23)))/((-35)/140). -23 Calculate (-1344)/150 - 279/(-31). 1/25 Evaluate (0 - (-1)/(-3))/((-335)/(-10050)). -10 What is the value of -12(-3 - (-93)/36)? 5 1/(-8) + 7865/520 15 Calculate -8 - -1 - (10129/(-1463) + (-6)/(-57)). -2/11 Evaluate (2-4 + 306/36)/(2/10). 5/2 What is 310/135 - -6(-623)/(-189)? 20 (-29)/((-5742)/(-1998)) + 9 -12/11 Evaluate (6/5)/(1914/(-58)(-2)/(-15)). -3/11 Evaluate (-112)/(-26) - 96/312. 4 Calculate (-52390)/1612 + 66/2. 1/2 Evaluate (7/21)/(34/2856) - 8. 20 (-1)/(-3) - (-2)/(-10)80/96 1/6 Evaluate ((-26)/(-4))/((325/(-26) + 13)-1). -13 Calculate ((-5 + 9)/56)/(((-114)/60)/19). -5/7 Evaluate 5(9/(-126))/(18/(-12) + 1). 5/7 Evaluate ((-1)/(-9))/(12 - (-483)/(-46)). 2/27 Calculate 3/(-9)(-9)/12(-8)/1. -2 What is the value of -13 + -2 + (-90201)/(-6099)? -4/19 What is the value of 11/(-44) - (-10)/((-240)/162)? -7 Evaluate 12/((38/(-152))/(2/(-36))). 8/3 Evaluate (0 + -1)(-20 - (-135)/10 - -3). 7/2 Calculate -47 + 6480/232 - (-4)/58. -19 Calculate 3 + 1 + 69/(-27) + (13 - 14). 4/9 What is (-4)/11((-4)/18)/(68/(-51))? -2/33 Evaluate 4(-2)/28(-175)/75. 2/3 What is the value of ((-98)/(-34) - 3) + 2610/510? 5 What is the value of 97/(22698/1080)26/(-4)? -30 What is the value of (-17 - -6) + 2 + 1*12? 3 What is (226/19 - 0) + (-3 - (-59)/	{ "pile_set_name": "DM Mathematics" }
culate c. -1, 0, 1 Let b be (20/16)/(1/4). Let s(z) be the second derivative of -7/20zb + 0 + 0z*2 + 3z + 0z3 + 1/6z4. Factor s(t). -t2(7t - 2) Solve -4/3p3 + 10/3 + 31/3p - 37/3p2 = 0 for p. -10, -1/4, 1 Let t(x) be the first derivative of -2x*6/21 + 16x*5/35 - 5x*4/7 + 8x*3/21 - 5. Factor t(f). -4f*2(f - 2)(f - 1)2/7 Suppose -28r = -2 - 54. What is p in 0 - p*3 - 1/3p + p*r + 1/3p4 = 0? 0, 1 Let g(f) = -f3 + 2f2 + f + 2. Suppose 6v = v - 10. Let l(q) = -3q3 + 6q*2 + 4q + 7. Let i(p) = vl(p) + 7g(p). Let i(n) = 0. Calculate n. 0, 1 Factor 5/3 - 19/3f - 4/3f*2. -(f + 5)(4f - 1)/3 What is p in -44 - 40 - 5p4 + 84 = 0? 0 Let r(h) be the first derivative of -h4/24 - 7h3/18 - 5h*2/6 - 38. Factor r(i). -i(i + 2)(i + 5)/6 Suppose 4j = -2x + 14, -2j - 6 = j - 4x. Suppose 4 - 3 + 0u - ju + u2 = 0. What is u? 1 Let o(a) be the third derivative of 0 + 0a*3 + 1/840a*8 + 0a*4 + 1/300a*6 + 0a*5 + 6a*2 + 2/525a*7 + 0a. Let o(h) = 0. What is h? -1, 0 Suppose 2m - 9 = p, 3p - 1 = -4m - 8. Let u(c) be the second derivative of 2/3c*3 + 0 + c + 0c*m - 1/6c*4. Determine h, given that u(h) = 0. 0, 2 Let u be (27/(-9) + 3)/(3 + -5). Factor u - 2/5c*4 + 0c*2 + 1/5c*5 + 0c + 1/5c3. c3(c - 1)2/5 Let y(t) be the first derivative of -t9/15120 + t8/2800 - t7/1400 + t*6/1800 + 2t3 + 6. Let h(i) be the third derivative of y(i). Factor h(l). -l2(l - 1)3/5 Factor 18/5b - 4/5 - 14/5b2. -2(b - 1)(7b - 2)/5 Factor 3/4h - 7/4h*2 - 1/4h*4 + 5/4h*3 + 0. -h(h - 3)(h - 1)2/4 Let f = 13/6 - 5/3. Let c = -2 - -2. Factor 0q + cq3 + 0 + fq*4 - 1/2q2. q2(q - 1)(q + 1)/2 Let f(l) = l5 + l4 + l*3 + l + 1. Let y(x) = 35x*5 + 25x*4 + 20x*3 + 30x + 30. Let n(d) = -30f(d) + y(d). Factor n(j). 5j*3(j - 2)(j + 1) Let p(h) be the third derivative of -h11/498960 - h10/113400 - h9/90720 - h5/20 + h2. Let u(c) be the third derivative of p(c). Factor u(l). -2l*3(l + 1)*2/3 Let v(b) = 4b - 3 + 2b2 - 3b*2 + 3b. Let g be v(6). Find h, given that 0h3 + 0h2 + h2 - h*g = 0. 0, 1 Let 0 - 2t*2 - 1/2t*4 + 0t + 2t3 = 0. What is t? 0, 2 Let r(k) = 5k*2 + 16k + 11. Let h(b) be the first derivative of b*3/3 + 3b*2/2 + 2b + 4. Let d(t) = -33h(t) + 6r(t). Determine c so that d(c) = 0. -1, 0 Let v(f) = -3f4 + 12f*3 + 9f2 + 9. Let w(q) = q3 + q*2 + 1. Let k(h) = v(h) - 9w(h). Factor k(s). -3s3(s - 1) Suppose -2j = 3j - 20. Let h(g) be the second derivative of 1/30g5 + 0g*2 + 0g*j + 0 - 1/9g*3 - 2g. Factor h(p). 2p(p - 1)(p + 1)/3 Suppose -9n + 6 = -6n. Let x(k) be the first derivative of n - 2/3k*3 + 0k + k*2. Factor x(y). -2y(y - 1) Suppose -7s = -5 - 16. Let i be 35/26 + 20/130. What is z in s + 15/2z + iz*3 + 6z*2 = 0? -2, -1 Determine b, given that 4b - 4b2 + 0 + 0 + 12b*4 - 8b*4 - 4b*3 = 0. -1, 0, 1 Let b be (-4)/5(-20)/4. Factor 0f2 - fb + f2 - f2 - f5. -f4(f + 1) Let c(u) be the third derivative of u8/1512 + u7/189 + u*6/90 - 2u*5/135 - 2u*4/27 + 2u*2. Determine w so that c(w) = 0. -2, 0, 1 Suppose 15 = -o + 5t, -3 = -3o - t + 16. Factor -1/3q*o + 25/3q*2 - 16/3q + 4/3 + 7/3q4 - 19/3q3. -(q - 2)2(q - 1)3/3 Let p(s) = -8s*2 + 20s + 10. Let q(z) = -z*2 - z + 1. Let f(l) = 2p(l) - 20q(l). Find a such that f(a) = 0. -15, 0 Let r(u) be the second derivative of -1/48u*4 + 0u*2 + 0u*3 + 0 - u + 1/40u*5 - 1/120u6. Factor r(s). -s2(s - 1)2/4 Suppose 0k*2 + 19k - 2k2 - 7k - k*2 = 0. What is k? 0, 4 Let -1/4u*2 - 1 + 5/4u = 0. What is u? 1, 4 Suppose 4c - 6 = -2l, -5c - 4l - 3 = -5l. Let k be c + (-1)/(-1) + 2. Find z, given that 2z*5 - 7z*2 + 9z*k + 0z5 - z - z5 + 3z - 5z4 = 0. 0, 1, 2 Let d(b) be the second derivative of -b5/40 + b4/8 - b3/4 + b*2/4 - 15b. Factor d(x). -(x - 1)*3/2 Suppose 0 = 2a - 29 - 67. Factor t*2 + 0t - 24t + 2t*2 + a. 3(t - 4)*2 Suppose -8/3t + 0 - 4t2 + 0t*3 + 4/3t*4 = 0. Calculate t. -1, 0, 2 Solve 2c*3 - 4 + 3c - 2c + 8c - c*3 - 6c*2 = 0 for c. 1, 4 Let g(z) = 2z*3 + 7z*2 - 14z + 8. Let x be g(-5). Factor -10/3a + 2 + 2/3a*2 + 2/3a*x. 2(a - 1)*2(a + 3)/3 Let a be 0 + 10/(-14) - (5 + -6). Let j(h) = -h3 + h2 + h - 1. Let d be j(1). Factor d - 2/7b3 + 0b*2 + ab. -2b(b - 1)(b + 1)/7 Suppose -47u = -56u. Let 0 + uj - 1/3j3 + 1/6j*4 + 1/6j*2 = 0. What is j? 0, 1 Let u = -105 - -111. Let h(n) be the third derivative of 4/9n*3 + 0 + 1/36n*u + 4/9n*4 + 17/90n*5 + 0n + 3n2. Factor h(s). 2(s + 1)(s + 2)(5s + 2)/3 Let t = 1/27 - -25/54. Let 1/2s + 0 - ts2 = 0. What is s? 0, 1 Let m(b) = -14b*3 - 21b*2 + 27b + 11. Let z(n) = 14n3 + 20n*2 - 26n - 10. Let j(t) = 2m(t) + 3z(t). Factor j(v). 2(v - 1)(v + 2)(7v + 2) Factor 2q + 5q + 2q2 + 4 - 3q + 2q. 2(q + 1)(q + 2) Let r = 66 + -66. Factor r + 4/7m - 2/7m2. -2m(m - 2)/7 Factor 0z*4 + 2z4 - z4 + z3. z3(z + 1) Let h be (-90)/(-40) - 6/(-8). Suppose 5t - 4 = hv, -2t - 12 = -7t - v. Factor -2/9i*t + 2/9 + 0i. -2(i - 1)(i + 1)/9 Factor 15g2 - 15g*3 - 26g + 21g + 0g*4 + 5g*4. 5g(g - 1)3 Suppose 0 - 2/3o*3 - 2/3o + 4/3o2 = 0. What is o? 0, 1 Let t = -1/13 + 16/39. Factor 0a*3 - 1/3a*2 + 0 + 0a + ta4. a2(a - 1)(a + 1)/3 Let g(h) be the third derivative of 0 + 0h + 1/120h5 + 0h*4 + 0h*6 - 1/24h*3 + 3h*2 - 1/840h*7. Determine u so that g(u) = 0. -1, 1 Let j(z) be the first derivative of -2z*3/33 - 2z*2/11 + 18. Determine d so that j(d) = 0. -2, 0 Factor -21m - 67m2 - 10 - 8m*2 - 64m. -5(m + 1)(15m + 2) Let p(v) be the third derivative of v8/336 + v7/210 - v6/120 - v5/60 - 7v*2. Let p(z) = 0. What is z? -1, 0, 1 Let m = -1153/2 - -577. Suppose 9/4w - w*2 - m = 0. What is w? 1/4, 2 Let j be 61/45 + 72/(-54). Let k(m) be the third derivative of -1/18m*4 - 1/360m*6 - 3m*2 - jm*5 + 0m*3 + 0m + 0. Determine r so that k(r) = 0. -2, 0 Find q such that 23q4 - 2q*2 - 21q*4 + 2q*2 + 4q3 = 0. -2, 0 Let c(p) be the second derivative of p4/30 + 4p3/15 + 3p*2/5 - 15p. Solve c(b) = 0. -3, -1 Let q(u) be the second derivative of 2u5/65 - u4/6 + 11u*3/39 - 2u*2/13 + 16u. Factor q(s). 2(s - 2)(s - 1)(4s - 1)/13 Let y(n) be the first derivative of n5/100 + n4/60 - n3/30 - n2/10 + 3n - 1. Let w(q) be the first derivative of y(q). Let w(t) = 0. What is t? -1, 1 Let o(g) = g2 + g + 3 - 5 + 4. Let t be o(0). Factor 0n3 - n4 - 5n + 3 + n3 + 3n*t + 0n - 1. -(n - 1)*3(n + 2) Let a(y) be the first derivative of -3y4/4 + 2y*3 + 6y*2 - 24y - 11. Suppose a(p) = 0. Calculate p. -2, 2 Let d(j) be the first derivative of -1/15j3 + 0j - 9 - 3/10j2. Find y such that d(y) = 0. -3, 0 Let z = -42 + 44. Let t(r) be the second derivative of -1/20r*5 + 1/12r*4 - 2r + 1/6r3 - 1/30r*6 + 0 + 0r*z. Factor t(n). -n(n - 1)(n + 1)2 Let m = 4 + 2. Suppose -18z*5 - 10z - 1 - 1 + 28z3 - mz*4 + 4 + 4z*2 = 0. Calculate z. -1, 1/3, 1 Let y(v) = -2v*3 + 2v + 2. Let t(z) = -z3 + z2 + z + 1. Let c(s) = 5t(s) - 5y(s). Factor c(f). 5(f - 1)(f + 1)2 Let v = 3 + 1. Let t = -7 + 9. Determine w, given that wt + 2 + vw2 - 3w*2 + 6w + 2 = 0. -2, -1 Let p(f) be the first derivative of 3 - 2/5f + 1/2f*4 - 4/15f*6 - 8/25f*5 + 2/3f*3 - 1/5f2. What is m in p(m) = 0? -1, -1/2, 1/2, 1 Let f(w) = w3 + 3w2 + 3w + 4. Let x be f(-2). Factor 0l + 1/2 - 1/2l*x. -(l - 1)(l + 1)/2 Factor 0 - 1/4d - 5/4d3 + d2 + 1/2d4. d(d - 1)*2(2d - 1)/4 Let g = 12/5 - 4/5. What is q in -g - 56/5q - 98/5q2 = 0? -2/7 Suppose 18 = 5t - t - 5x, -3t - 4x + 29 = 0. Let r(i) = i3 - 6i*2 - 8i + 10. Let q be r(t). Let 0s - 2sq + s + s = 0. Calculate s. -1, 0, 1 Let o(a) be the second derivative of a7/21 + a6/15 - a5/5 - 13a. Factor o(h). 2h*3(h - 1)(h + 2) Let d(h) = -h3 - h. Let a(o) = o4 - 5o*3 - 2o*2 - 5o + 1. Let r(p) = -a(p) + 5*d(p). Solve r(u) = 0 for u. -1, 1 Let j(f) = -	{ "pile_set_name": "DM Mathematics" }
7/2520 + k6/720 - 17k4/2 + 86k. Let z(o) be the third derivative of w(o). What is z(1)? -16 Let a(p) be the third derivative of -p*4/12 + 5p*3/3 - 6p*2 - 38p. Suppose -13 - 13 = -j. Suppose -j = -5f + 14. Determine a(f). -6 Suppose -90 = -8i - 282. Let b = -22 - i. Let x(g) = -b - g + 4 + 2g - 2g. Calculate x(-5). 7 Let y(z) = 82z - 1215. Let m be y(15). Let p(u) = -5u + 29. Calculate p(m). -46 Let n(r) = -2r + r2 + 5r - 3 + 5r. Suppose -96 - 76 = 145y + 698. What is n(y)? -15 Let m(f) = -f - 42. Let h be m(-44). Let g(y) = -15y2 + 13y + 43y2 - 27y*h. Give g(-9). -36 Let s(a) = 5a - 24. Suppose 0 = -4y + 2v - 2, 0 = -2y - 14v + 12v - 16. Let f(j) = 2j - 3. Let p(g) = yf(g) + s(g). Give p(-16). 1 Let u(m) = -m2 + 26m + 906. Let s be u(-20). Let a(i) = 2i3 + 27i*2 - 15i - 22. What is a(s)? -8 Let d(l) = -2l2 + 10l + 6. Let f = -21797 + 21797. What is d(f)? 6 Suppose 10 = -2u, 271u + 1 = -2h + 268u. Let a(c) = c*3 - 5c*2 - 4c - 20. Determine a(h). 50 Let v(l) = -3l2 - 2l + 83. Let x(i) = -13i2 - 9i + 330. Let o(c) = -9v(c) + 2x(c). Let b(u) be the first derivative of o(u). Give b(1). 2 Let x(g) = 10g2 - 109g - 9. Let p be x(11). Let c(d) = -23 + 3d + 8 + 12 + dp + 6. Suppose 3s - 2s = -3. Give c(s). 3 Suppose -d + v = -3v - 19, -d = -v - 7. Let s(r) = -6r2 - 2r3 + r2 + 7rd + 0 - 6r3 + 2. What is s(-5)? 2 Let h(p) = -p2 - 47816p + 47800p - 21 + 2p2. Give h(9). -84 Let k(l) = -2l*2 + 3l - 4. Let m(r) = -43 - 31 + 58 - 5r. Let i be m(-4). Determine k(i). -24 Let y(k) be the second derivative of -4k3/3 - k2/2 + 3k - 3. Let r = -50 + 52. Let n(a) = 16a + 3. Let l(s) = rn(s) + 5y(s). Determine l(3). -23 Let m(x) = -15x2 - 5x + 4. Let b(j) = 30j2 + 9j - 7. Let k(o) = 4b(o) + 7m(o). Let t be 15 - (27 + -22 - -11). Give k(t). 14 Let h(r) = r*2 + 19 - 74 - 2r*2 + 3r + 27 + 23. Determine h(1). -3 Let d be ((-6)/(-6))/((-1)/4) - 155. Let b = d - -166. Let x(q) = q*2 - 9q + 9. What is x(b)? -5 Let d be (-58)/(-3) - ((-60)/9 + 7). Suppose 9w = dw - 10. Let p(v) be the first derivative of -v4/4 - v3/3 + v*2/2 - v + 5. What is p(w)? -2 Suppose -3u + 105 = -2w, 5w - w - 54 = -2u. Suppose -2v + 3q + 21 = 0, 5v - q = u - 0. Let k(z) = 2z - 9. Give k(v). 3 Let d(c) = 4c3 - c2 + 1. Let j(p) = -70p2 + 274 + 23p*2 + 32p + 46p2. Let m be j(39). What is d(m)? 4 Let t(j) = j3 - 6j*2 + 4j - 6. Let k = -207 - -214. Let g = 12 - k. Calculate t(g). -11 Let y = 9527 - 9520. Let u(f) = 3f3 - 20f*2 - 6f - 13. Calculate u(y). -6 Let z(b) = -10b - 382. Let m be z(-36). Let j = 25 + m. Let p(x) = 7 - x2 - 3 - 6x + 4x. What is p(j)? -11 Let w(c) = -9c*2 - c + 1. Let b(s) = -18s*2 - 3s + 1. Let f(i) = -4b(i) + 7w(i). Let v be f(-1). Let h(x) = x*3 - 8x*2 + 5x + 7. Determine h(v). -7 Suppose -37s + 450 = -31s. Suppose -4j - 5h + s = j, 0 = 4j - 3h - 25. Let u(a) = a - 19. Determine u(j). -9 Suppose 10 = -x + 111. Suppose -2d + 2 = -5r - x, -3 = 3d. Let j = r - -26. Let g(v) = -v2 + 6v - 1. Give g(j). 4 Suppose 0 = -3m + 4x - 33, -2m + 2x + 60 = 80. Let d(b) = 7b2 + 50b + 14. Give d(m). 7 Let o(p) = 2p3 - 14p2 - p + 69. Let k(w) = w3 - 7w2 + 33. Let x(c) = 7k(c) - 3o(c). What is x(6)? 6 Suppose -17h + 8 = -16h. Let m(u) = -446u + 894u - 446u + 1 - h. Give m(9). 11 Let j(m) = 3m3 - 6m*2 + 9. Let d(v) = 4v*3 - 7v*2 + 10. Let u(y) = 4d(y) - 5j(y). Let s be -13 + (-5 - -9) + 9. Determine u(s). -5 Let b(m) = m2 + 3. Let i be b(0). Let v(q) = 2 + 10458q + q*2 - 10458q - qi. Determine v(2). -2 Let h(u) = u3 + 4u2 + 3u + 2. Suppose -2s = -4s. Let g = -3287 - -3290. Suppose -3f + 3d - 9 = s, gf + f - d = -15. Give h(f). -10 Let z(l) be the third derivative of -l6/120 - 3l5/20 + l4/2 + 5l3/6 + 5l*2 + 8. Calculate z(-10). -15 Let o(l) = -4l*2 - 11l + 10. Let g(f) = -3f2 - 7f + 9. Let n(t) = 3g(t) - 2o(t). Calculate n(4). -5 Let m(a) be the second derivative of -a*4/12 - 7a*3/3 - 7a*2 + 5008a. Let y(k) = -k*3 - 10k*2 + k - 2. Let u be y(-10). What is m(u)? 10 Let w(r) be the first derivative of 1/4r*4 + 18 + r - 2r*2 + 2/3r*3. Let d(j) = -j. Let a be d(3). Determine w(a). 4 Let h(l) = -3354l - 38 - 2l2 - 3330l + 6710l. Determine h(12). -14 Let b = 115 - 86. Let t(o) = -24 - 7 + b - o. Calculate t(-6). 4 Let l(v) = -2v - 1. Let b be (-14)/3 - 9/27. Let n(g) be the first derivative of 3g2/2 + g - 176. Let t(k) = bn(k) - 6l(k). What is t(2)? -5 Suppose -6s = -4s + 52. Let m = 3 + s. Let z = m + 27. Let r(v) = v3 - 4v*2 + v + 1. What is r(z)? 5 Let m(g) be the first derivative of 31g*2/2 - 226g + 3190. Determine m(7). -9 Let k(m) = -2m2 + 19m - 7. Let f be (270/12)/52. Determine k(f). 2 Let m be ((-2)/(-6))/(4/12). Let p(l) = 5l - 5. Let c(j) be the second derivative of -j*2/2 - 15j + 5. Let d(r) = -6c(r) + p(r). Give d(m). 6 Let m(t) be the first derivative of -t4/4 - 8t*3/3 - 11t*2/2 - 6t - 19303. Suppose 0 = -p - 2p - 21. What is m(p)? 22 Let x(z) = 3z*2 - 3z*2 + 1546z - 1 - 1544z + 4z*2. Determine x(1). 5 Let a(r) = -4r - 27. Let f be (-2)/(-8) + ((-102)/40)/(807/1345). Determine a(f). -11 Let c(j) = -3j - 396. Let m(u) = -5u - 582. Let n(z) = 7c(z) - 5m(z). Determine n(-37). -10 Let b(j) be the third derivative of j5/15 + j4/24 + j*3/3 - 2j*2. Let z = 29760 + -29761. What is b(z)? 5 Let w(z) = 66z + 154. Let q(c) = 5c + 12. Let h(o) = 77q(o) - 6w(o). Let y(v) = -9v. Let t(s) = -4h(s) + 5y(s). Determine t(-5). 5 Let d(o) = -5o2 + 178o + 19. Let f(c) = -14c2 + 494c + 57. Let i(x) = 11d(x) - 4f(x). Give i(-1). 0 Let n(g) = 3g2 - 6g + 6. Let a = -1286 - -1288. Determine n(a). 6 Let p(y) = 22y2 + 7. Let k(g) = 34g*2 - g + 6. Let v(m) = 2k(m) - 3p(m). Give v(0). -9 Let z(a) = 3a3 + a2 + 2a. Let q(o) = -9o*3 - 4o*2 - 9o + 2. Let i(c) = q(c) + 4z(c). Calculate i(2). 24 Let l be 9/71246/267. Let i(n) = n*2 - 8n + 13. Give i(l). 1 Let h(o) = -o*2 + 9o - 30. Suppose 96y - 19 = 93y + 4s, 51 = 5y + 3s. Calculate h(y). -30 Let i(y) be the first derivative of -y3/3 - 5y*2 - 7y - 3392. Calculate i(-5). 18 Let y(p) = 7p - 5p + 2p + p - 14 - 7p. Calculate y(13). -40 Let p = 503 + -504. Let i(v) = 10v - 2. Let t(d) = -22d + 4. Let f(o) = -5i(o) - 2t(o). Calculate f(p). 8 Let p be 2336/(-78) + (-42)/819. Let n(x) = 2x + 45. Give n(p). -15 Let w(u) = -u3 - 20u*2 + 43u - 21. Let i be w(-22). Suppose -8 + i = -7c. Let f(v) = -3v3 + v - 1. What is f(c)? -3 Let u be 12/5 - (1 + 16/(-10)). Let t(n) = -n - n3 - 5nu + n2 + 5n*3 - 4. Suppose -35z = -41z. What is t(z)? -4 Suppose -14o - 90 = -20o. Let n = o - 13. Suppose -3 = ns + 2y + 21, -s = -3y. Let v(u) = -u*3 - 10u*2 - 9u. What is v(s)? 0 Let v(c) be the second derivative of 0c3 - 1/2c*2 - 1/3c*4 - 2c + 23 + 1/20c5. Let m = 18 + -14. Determine v(m). -1 Let p(i) = -2i - 5. Let x(k) = -25k - 283. Let o be 3/(-4) + -5 + (-126)/24. Let j be x(o). Determine p(j). 11 Let w(o) = 4o + 2. Suppose 2c + 8 = 2p, -3p + 6p + 3c + 12 = 0. Determine w(p). 2 Let y(d) be the second derivative of -1/2d3 + d2 - 1/6d4 - 9 + 1/20d*5 + 3d. Calculate y(4). 22 Let v(n) be the second derivative of -7n3/6 + 9n*2/2 - 2437n + 2. What is v(10)? -61 Let b = -41 + 45. Suppose -15 = -bx + x. Suppose -n = -xt - 5, 4n - n + 2t = -19. Let w(f) = f*3 + 6f*2 + 6f - 1. Determine w(n). -6 Let j(g) = -2g2 + 5g - 2. Let m(n) = 2n + 28. Let w be m(-4). Let k be 1/(2 - w/12). Suppose 42h + k = 43h. What is j(h)? -5 Let h be -21 + 17 - (0 + -11). Let z(q) = hq + 2 - 13q + 8q - q. Suppose 2b + g - 1 + 8 = 0, 2b = -3g - 9. Determine z(b). -1 Let y(g) = 2g*2 - 7g + 7. Let x be y(1). Let j(h) be the first derivative of h4/4 - h2/2 - 42. Calculate j(x). 6 Let d(c) = -c*2 - c - 3. Suppose 4r + 26 = 3m, 525m - 527m + 24 = -4r. Give d(r). -23 Let i = -38 + 48. Suppose 0 = 4t - it + 12. Let a(p) = 11p - 10p + t + 3 - 7. Give a(8). 6 Let c(g) = 3g. Let x be (4/3)/(((-33)/(-9))/(-11)). Let q(i) = 11i - 2. Let	{ "pile_set_name": "DM Mathematics" }
2. Let p = 1.9 - 1.5. Which is the closest to j? (a) 4 (b) -1.9 (c) p c Let x be (-146)/1 + 41 + -37. Let o = x - -177. Which is the nearest to o? (a) -1 (b) 0.3 (c) 0.2 b Let f = -1.04 + -0.26. Let c = f + 0.3. Let z = 10822.6 - 10823. What is the closest to -0.2 in z, c, 3? z Let j = 41344/7 + -5906. What is the closest to 2 in 0.4, j, -8/7? 0.4 Let t = -0.95 - -1. Let j be 1075/(-195) + 6 + 24/(-72). Which is the nearest to -1? (a) -2/11 (b) j (c) t a Let u = 82.6 + -77.6. Let o = 8 - u. Let k(t) = t - 4. Let z be k(6). Which is the closest to -0.09? (a) 5 (b) o (c) z c Let u = -16 + -2. Let t be (0 - (-32)/u) + 2. Let b = -1.739 + 1.939. What is the nearest to b in t, -2, -3? t Let d = 4287 - 4291. What is the closest to 2/15 in d, -6, 4, 2/7? 2/7 Suppose i - 484 = o + 4o, -5o + 3i = 492. Let m be 4/26 + o/(-3432). Which is the closest to 4? (a) m (b) 4 (c) 9 (d) -3 b Let x = -10 + 7. Let l = 13835 - 13835.3. Which is the closest to x? (a) -1/6 (b) -0.2 (c) 0.1 (d) l d Let j = 156/35 + -34/7. Let i = 2.936 + -2.836. What is the closest to i in 2, j, 4/9? 4/9 Let r = 8564 - 8561.2. Let l = -0.3 + 0.4. Which is the nearest to 0.1? (a) r (b) 0.4 (c) l c Let w = -53.7 + 54. Let g(h) = -h3 + 7h*2 - 8h - 1. Let a be g(6). Let x be 8/84 - 44/(-77). What is the nearest to x in -3/7, a, w? w Suppose -838n + 149 - 839 = -976n. Let w = 7.26 - 0.26. Let k = -1 + 1.2. Which is the nearest to w? (a) n (b) k (c) 1/3 a Let x be 1/3 - (-10)/(-21). Let w = 5.2996 + -5.2166. Which is the closest to 2/7? (a) x (b) 3 (c) w c Suppose -24l - 10 = -19l. Let r = 42 - 51. Let s = 13 + r. Which is the nearest to s? (a) 5 (b) 1/8 (c) l a Let c be 33/6 + (0 - 2) - (53 + -48). What is the nearest to 24 in 0.3, -0.05, c? 0.3 Let a(d) be the first derivative of d4/4 + 26. Let i be a(-1). Let u be -3 - (i - (7 - 3)). What is the closest to u in -2/7, -3/7, 2? 2 Let y be -8 - (3 - 6 - 0). Let x = 500 - 1003/2. What is the nearest to -1 in x, y, 1/3? x Let f = -34.3945 + 2.3945. What is the nearest to 13/8 in 1, -2, f? 1 Let s = -19/16 - 55/48. Let k = 215.2 + -215. What is the closest to k in s, 0.3, 4? 0.3 Let d = 1895.99 - 1896. What is the closest to 0 in -2, 0.18, d? d Let o = 4.09448 - 0.09448. Which is the closest to 1/5? (a) o (b) 0.15 (c) -1/9 (d) -4 b Let q be -7 + (-3 + 1)/((228/(-24))/19). Which is the nearest to 23? (a) -1/5 (b) 1/5 (c) q (d) -1/6 b Let w be 4 + (-1059)/299 - 1. Let m = w + 16/23. Which is the nearest to -0.9? (a) m (b) 2 (c) 2/17 (d) 3 c Let c = -0.5242 + 0.6242. What is the closest to -2/3 in c, -2/9, 4/5, 8? -2/9 Let t(p) = p3 + p*2 - 2p + 1. Let y be t(0). Let w = 988 + -990. Which is the nearest to w? (a) 0 (b) y (c) 0.4 a Let q = 1.9634 + -3.9634. What is the nearest to -0.66 in -2/7, 1/7, q, 4? -2/7 Let u = -92.33 - -89.33. Which is the nearest to u? (a) -12 (b) 0.1 (c) -0.3 c Let a = -448 + 445. Let y = 49.9 - 44. Let j = y + -1.9. What is the closest to 0.2 in a, 0.2, j? 0.2 Let m = 1 + -1.15. Let f = -2358 - -2359. What is the closest to f in 3, m, -1/4? m Let i = 1.3 + -0.3. Let q = 72235 - 72233. What is the nearest to -6 in i, -5, q, -1/3? -5 Let s = 1939 - 1939.3. Which is the closest to -0.1? (a) 6 (b) 25 (c) -0.1 (d) s c Let s be 589/4960-4 - -32/16. What is the closest to -0.02 in -1, -10, -4, s? s Let s(g) = 842g + 7734. Let u be s(-9). What is the nearest to -2 in -0.2, 1/4, -4, u? -0.2 Suppose -q = -4a + 6667 - 6701, 58 = 2q - 3a. What is the closest to -0.1 in 28, 2/9, q, 1/6? 1/6 Let q = 2932/2435 - 2/487. Let a = 103142/7 + -14735. What is the nearest to 1 in a, 2, 0.03, q? q Let z = -512 + 575. What is the nearest to z in 0, -2/7, 3/5? 3/5 Let u = -253.8 + 255.8. Let z be 1 + (-4)/(-10)(-15)/12. Which is the nearest to 1? (a) z (b) u (c) -1/3 (d) 1 d Let t = -166.1 + 166. Let u = -1.35 + 0.35. What is the nearest to t in 0.1, -4/3, u? 0.1 Let a = 3 - 3.004. Let x be ((3/11)/(417/(-556)))/2. What is the closest to 0 in a, x, -0.5? a Let a be 1026/3040 - (-13)/208. What is the closest to 1 in 2, 43, a, 4? a Let k be (-1 + 4)/(1092/(-56)). What is the nearest to -10/3 in 4, 3/5, k, -3/4? -3/4 Let t = -339.2 + 471.06. Let b = t + -130. Let p = b - -0.14. What is the closest to 0.1 in p, 2/13, -0.2? 2/13 Let b = 1.256 - -0.104. Let c = -1.86 + b. What is the closest to 2/3 in c, 1, -2/11? 1 Let t = 74 - 66. Let l be 14/(-3) + (-10)/(-15) + t. Let j = -0.03 + -0.97. What is the nearest to -1/2 in l, j, -2/11? -2/11 Let z = -15.37 - -1.37. Let k(w) be the second derivative of -w5/20 + 17w. Let n be k(1). Which is the nearest to n? (a) -3 (b) z (c) -2 c Let i = 500.25 - 10.25. Let m = 492 - i. Which is the nearest to m? (a) -3 (b) -2.2 (c) -4 (d) 2/3 d Let k be (12)/(-2)-7. Let d = 7.61 + -5.68. Let h = d - 2.13. What is the nearest to -0.2 in k, 2, h? h Suppose 3v = -v. Let u = 655 + -654. Which is the nearest to 0? (a) v (b) 11 (c) u a Let q = 8327 + -8326.9. Which is the nearest to q? (a) -1.1 (b) 2 (c) -3 (d) -2 a Let v = 488.7 + -488.2. Which is the nearest to 0? (a) 2/13 (b) v (c) 108 a Suppose -l + 4m - 37 = 0, -22m = -4l - 20m - 176. Which is the closest to l? (a) -0.7 (b) 4 (c) -2/3 (d) 0 a Let t = 0.6532 + 0.1598. Let n = t + -1.213. Which is the nearest to -7.8? (a) n (b) -1/4 (c) 2 a Let h = -2072.8 + 2081. Let c = -8.416 + 0.016. Let v = c + h. What is the nearest to 2 in -3, v, 15? v Let u = 4710 + -4713. Which is the nearest to u? (a) -11 (b) -5 (c) 3 (d) 4 b Let k = -5667 - -5666.9. What is the nearest to -10 in k, 2/13, 15, 0.02? k Suppose 297z - 308z + 374 = 0. Suppose 2f - z = -34. Which is the nearest to 0.6? (a) 3 (b) -3 (c) 1/2 (d) f c Let v = 17.5 + -117.5. Let y = 99.9 + v. What is the closest to -0.1 in y, 1/7, -1/5? y Let v = -43 - -43. Let f = 16.41 - 20.41. Which is the closest to v? (a) -1/6 (b) f (c) 0.09 c Let u = -8 + 11.4. Let s = 2.6 + u. Let j = -2 + s. Which is the nearest to -0.1? (a) j (b) 5 (c) -3/4 c Let h = -73 + -42. Let x be 48/(-12) + (h - 1). Let j be 45/x(-1)/(1/2). Which is the nearest to 1/4? (a) -2/13 (b) 2/3 (c) j a Let k = -0.49321 - 0.00679. Which is the nearest to 1/2? (a) -12 (b) k (c) 0.5 (d) -0.3 c Let s = -7.313 - -6.313. Let b = 2382/85 - 141/5. What is the nearest to s in -1, b, 0.2? -1 Let n = 10.85 - 11.65. What is the closest to -3 in -3, -1/11, n? -3 Let i = 21 + -22.4. Let f = 1.6 + i. Let n = 5.0489 + -0.0489. What is the nearest to f in -0.1, -4, n? -0.1 Let m = 7366.23 + -7366. What is the closest to -0.28 in -0.4, m, 1? -0.4 Let z = -758.1 + 758. What is the closest to z in -18, -1/6, 15? -1/6 Let l = -1.2 + 0.2. Let q = 0.0258237 - -0.9741763. Let h = 7.3 - 7. What is the nearest to l in q, 0.5, h? h Let q = 225/71 + -20167/6319. Which is the nearest to -1/2? (a) 3 (b) 2 (c) q c Let d = -1404 - -803. Let b = 601 + d. Let w be (-2)/(-5) + (-11)/40. What is the closest to -1 in -3, b, w? b Let n = 5601.9 + -5602. What is the closest to 2 in -3, n, 2/3, -11? 2/3 Let s = 89.44 - 94. Let q = s + -0.44. Suppose -l = -3c - 15, -4c = 2l - 0l + 10. What is the closest to 0.2 in -3, q, c? -3 Let u = -139.77 + -3.23. Let n = u - -142.929. Let v = -2.929 + n. Which is the nearest to 0? (a) 4/5 (b) v (c) 3/4 c Let h be (24/(-7))/((-81)/27). Let j = -19 + 18.8. What is the closest to 4 in -2/15, h, j? h Let d = 9966 + -9959. Which is the nearest to -3.7? (a) -2/3 (b) 0.5 (c) d a Let c = -2/3 + 1/3. Let f be (-6)/3(4 + -6) + 210/(-55). Let y = 1.5 - -0.5. What is the closest to -5 in y, c, f? c Let b = 28.5 + -28.9. Let y = 5 + 10. Let l be 85/y + (-2)/(-6). What is the closest to 1 in b, l, -1/6? -1/6 Let n be 261/918 - 1/6. Let h = 22/1201 - -1135/3603. Which is the closest to h? (a) n (b) 3 (c) 4 a Let x = 227411 + -227411. Let y = 0.3 - 0.1. Let u = y + -0.2. Which is the closest to x? (a) 0.5 (b) -2/5 (c) u c Let o = -76.52 - -77. Let l = 3.48 - o. Which is the closest to 0? (a) 0.5 (b) l (c) -3.3 a Let n = -0.13 - -3.13. Suppose -12 = 16*m + 20. Let d be (392/(-64) - -6)/(m/8). What is the closest to d in -0.2, 2, n? -0.2 Let x = 62 + -43. Let d = x + 6. Let n = d - 25.1. Which is the nearest to 0? (a)	{ "pile_set_name": "DM Mathematics" }
4 Put 2, -14, -2/17 in increasing order. -14, -2/17, 2 Sort -8, -34, 1 in descending order. 1, -8, -34 Sort 1, -16, 0, 2, -5 in descending order. 2, 1, 0, -5, -16 Sort 0, -0.1, 1.4 in decreasing order. 1.4, 0, -0.1 Put -5, 52, 6 in descending order. 52, 6, -5 Sort 2, -11, 0, 40 in decreasing order. 40, 2, 0, -11 Put -135, 3, -1 in ascending order. -135, -1, 3 Put -0.2, -0.4, 5/6 in ascending order. -0.4, -0.2, 5/6 Put 0.2, 1/8, -19 in descending order. 0.2, 1/8, -19 Sort 9, -26, 3, 2/7 in increasing order. -26, 2/7, 3, 9 Sort 4, -125, 2 in descending order. 4, 2, -125 Sort 2, 1, -8, 4 in ascending order. -8, 1, 2, 4 Sort 1/3, 2, 3, 0.3. 0.3, 1/3, 2, 3 Put -0.4, 7/5, -8, -1, -5 in descending order. 7/5, -0.4, -1, -5, -8 Put 14, -3, 44, 5 in descending order. 44, 14, 5, -3 Sort -4, 3, 1/9, -2/3. -4, -2/3, 1/9, 3 Put 4, 2, 0, -11, -13 in increasing order. -13, -11, 0, 2, 4 Sort -2/9, 6, 5 in increasing order. -2/9, 5, 6 Sort 803, 3, -0.4, -2 in increasing order. -2, -0.4, 3, 803 Sort 2/3, -5/3, 0, -0.4 in descending order. 2/3, 0, -0.4, -5/3 Put 0.0498, 5, 0.5, 2, -3 in descending order. 5, 2, 0.5, 0.0498, -3 Put -3, 16, -6 in increasing order. -6, -3, 16 Sort -4, -3, 4, -472, 3. -472, -4, -3, 3, 4 Sort 10, -6/11, 4, 0. -6/11, 0, 4, 10 Sort 2, -8, 0, -7. -8, -7, 0, 2 Sort 3, 5, -11, -5 in increasing order. -11, -5, 3, 5 Sort 0.3, 1, -1/2, -1/4 in decreasing order. 1, 0.3, -1/4, -1/2 Sort 0, -2, -4, -20, -1 in increasing order. -20, -4, -2, -1, 0 Sort -1, -44, -4, 0. -44, -4, -1, 0 Sort 3, -417, 4. -417, 3, 4 Put 1, -5, -20 in ascending order. -20, -5, 1 Put -5, -88, -0.2, -0.4 in decreasing order. -0.2, -0.4, -5, -88 Put -5, 0.5, 1/6 in increasing order. -5, 1/6, 0.5 Sort 10, -1, 0, -3, 2 in descending order. 10, 2, 0, -1, -3 Sort 1, 5, -0.0484, -2, -5. -5, -2, -0.0484, 1, 5 Put -2, 60, 2 in decreasing order. 60, 2, -2 Sort 1/5, 5, 2, -1291 in decreasing order. 5, 2, 1/5, -1291 Sort -171/2, -5, 0.24 in decreasing order. 0.24, -5, -171/2 Put -2/7, -0.2, -35, 6.9 in descending order. 6.9, -0.2, -2/7, -35 Put -0.5, -3, 4, -2 in decreasing order. 4, -0.5, -2, -3 Put -3, -4, 2, 4, -14 in ascending order. -14, -4, -3, 2, 4 Sort -0.3, 1, 199 in decreasing order. 199, 1, -0.3 Sort -3, -9, 3, 4 in decreasing order. 4, 3, -3, -9 Sort 3, 0.5, -3/2, -0.08, 22 in decreasing order. 22, 3, 0.5, -0.08, -3/2 Put 0, -0.4, -3, 2/11 in descending order. 2/11, 0, -0.4, -3 Sort -0.3, -5, -634, -1. -634, -5, -1, -0.3 Sort -2, -90, 3/2, 4 in ascending order. -90, -2, 3/2, 4 Sort 0, -538, 5, 7 in decreasing order. 7, 5, 0, -538 Sort -2, 15, 2, 0, -5 in increasing order. -5, -2, 0, 2, 15 Put -3/2, -467/3, 0.1 in descending order. 0.1, -3/2, -467/3 Sort 97, 4, 2 in increasing order. 2, 4, 97 Put -7, 10, 4 in descending order. 10, 4, -7 Sort 3, -4, -15568 in descending order. 3, -4, -15568 Put -0.08, 1/2, 18 in descending order. 18, 1/2, -0.08 Sort -1, -474, -17. -474, -17, -1 Sort -4, 3/5, -3/4, 4/11. -4, -3/4, 4/11, 3/5 Put 2, -1, -94 in descending order. 2, -1, -94 Sort 5, 20, 2. 2, 5, 20 Sort 0.1, 0.68, -2/17, 1/3, 2/7 in increasing order. -2/17, 0.1, 2/7, 1/3, 0.68 Put -5, 0, -3, -8, 11 in decreasing order. 11, 0, -3, -5, -8 Sort -1/8, 0.3, 2/9, -10/7, -2/11 in decreasing order. 0.3, 2/9, -1/8, -2/11, -10/7 Sort 2, 0, 5, -39. -39, 0, 2, 5 Put -115, -4, -19 in ascending order. -115, -19, -4 Sort 1/4, 3, 2, 2/41. 2/41, 1/4, 2, 3 Sort -3, 0, -1, 12, 0.2 in descending order. 12, 0.2, 0, -1, -3 Put -75, -4, 3, -5, 1 in increasing order. -75, -5, -4, 1, 3 Put 4, -5, 17, 2, 1 in ascending order. -5, 1, 2, 4, 17 Put -5, -14, 3, -2 in decreasing order. 3, -2, -5, -14 Sort -7, 3, 6 in decreasing order. 6, 3, -7 Put 5, 2, 114, -4, -2 in descending order. 114, 5, 2, -2, -4 Put 2, -5, 57, 16 in decreasing order. 57, 16, 2, -5 Put -14, 3, -1 in descending order. 3, -1, -14 Sort 2/33, -1, 18 in decreasing order. 18, 2/33, -1 Put 1, -111, -2, -3, 5 in increasing order. -111, -3, -2, 1, 5 Sort 11, 3, -4 in ascending order. -4, 3, 11 Sort 9, 3, -378, 5. -378, 3, 5, 9 Put 2, -1, -43 in ascending order. -43, -1, 2 Sort -1, -30, 6, -4 in decreasing order. 6, -1, -4, -30 Put 17, -2, -3, -1, 5 in descending order. 17, 5, -1, -2, -3 Put 4, 0, 1315 in ascending order. 0, 4, 1315 Sort -4, -705, -0.4. -705, -4, -0.4 Sort 0.03, 5, -24/11 in decreasing order. 5, 0.03, -24/11 Sort 2/13, -52/7, 226 in descending order. 226, 2/13, -52/7 Put 0.05, -4, -30 in decreasing order. 0.05, -4, -30 Sort 10/11, 11, -1, 3 in increasing order. -1, 10/11, 3, 11 Sort 5, 57, 6 in decreasing order. 57, 6, 5 Sort -1, -5, 1, 344. -5, -1, 1, 344 Put -6, -2, -3, 37 in ascending order. -6, -3, -2, 37 Put -1/4, 1.3, 4 in descending order. 4, 1.3, -1/4 Sort -9, 5, 0, -8, 4 in descending order. 5, 4, 0, -8, -9 Sort 3, 16345, -1/2 in descending order. 16345, 3, -1/2 Put 0, -232, 19 in descending order. 19, 0, -232 Sort 43, 16, 4/5 in descending order. 43, 16, 4/5 Sort 10/3, -2/3, -6, -2 in decreasing order. 10/3, -2/3, -2, -6 Put 3, 0.62, 2, -0.5 in increasing order. -0.5, 0.62, 2, 3 Put -8/5, 0.1, -5, 3/5, 0.3 in ascending order. -5, -8/5, 0.1, 0.3, 3/5 Sort -12, -7, 3, -5, -1 in increasing order. -12, -7, -5, -1, 3 Sort 1/20, -1/5, 0, -4 in increasing order. -4, -1/5, 0, 1/20 Put -1, -0.022, -19 in descending order. -0.022, -1, -19 Put 9, 2/7, -1/18 in decreasing order. 9, 2/7, -1/18 Sort -2, 15, 2, -5 in increasing order. -5, -2, 2, 15 Sort -4, 1, 68, 3. -4, 1, 3, 68 Put 0.5, -28, 4 in descending order. 4, 0.5, -28 Sort -2, 2, 27 in descending order. 27, 2, -2 Sort 2, 5, -4, -14, -3. -14, -4, -3, 2, 5 Put 13, 4, 1/3, 0 in descending order. 13, 4, 1/3, 0 Sort -2, 8, -8, 35 in increasing order. -8, -2, 8, 35 Sort -103, 0, -4, 2 in ascending order. -103, -4, 0, 2 Put -4, 5, -9 in decreasing order. 5, -4, -9 Sort 0, 1, 4, -3, 3 in descending order. 4, 3, 1, 0, -3 Sort -5, -139, 1, 3 in decreasing order. 3, 1, -5, -139 Put -2, -1/3, 2/21, -0.5, -25 in increasing order. -25, -2, -0.5, -1/3, 2/21 Sort -4, 2, -6, -12. -12, -6, -4, 2 Sort 1, -2, 150, -4 in descending order. 150, 1, -2, -4 Sort 117, 1, -2, 3, -5 in increasing order. -5, -2, 1, 3, 117 Sort -1/3, -1/4, 3/8, 0 in ascending order. -1/3, -1/4, 0, 3/8 Put 1, 7, 2/11 in increasing order. 2/11, 1, 7 Sort -1, -57, -7. -57, -7, -1 Sort -2/11, -1/4, -79 in descending order. -2/11, -1/4, -79 Sort 5, -91, 2, -1, -4 in increasing order. -91, -4, -1, 2, 5 Put 0.1, 21/2, 3 in descending order. 21/2, 3, 0.1 Sort -2, 305, -5, 4 in decreasing order. 305, 4, -2, -5 Sort -3, 2, -330, -2. -330, -3, -2, 2 Sort -5, 4, 18, -6 in descending order. 18, 4, -5, -6 Sort -3, -0.3, -60/13 in decreasing order. -0.3, -3, -60/13 Sort 115, 2, 5, 3 in ascending order. 2, 3, 5, 115 Put 3, 890, 0, -4 in descending order. 890, 3, 0, -4 Put 0, 2/21, -0.2, -1.4, -7/9 in decreasing order. 2/21, 0, -0.2, -7/9, -1.4 Put -1/2, 0.1, -3, 3 in descending order. 3, 0.1, -1/2, -3 Put -3, 8, 1, -4 in descending order. 8, 1, -3, -4 Sort -6, 2, 2/7 in descending order. 2, 2/7, -6 Sort -4, 1, -917 in descending order. 1, -4, -917 Sort 53, 3, 1, 0 in increasing order. 0, 1, 3, 53 Sort -0.4, -6, -1, -3, 335 in descending order. 335, -0.4, -1, -3, -6 Put 6, 4, -30 in decreasing order. 6, 4, -30 Sort -3, 5, -1/6, -1672. -1672, -3, -1/6, 5 Put 1/3, 2, -18 in descending order. 2, 1/3, -18 Sort -1, 7, 6. -1, 6, 7 Sort 4, -12, 3, -4 in decreasing order. 4, 3, -4, -12 Sort 16, -3/8, 5. -3/8, 5, 16 Put 0, -3, 17, 1 in increasing order. -3, 0, 1, 17 Put -79, 1, -5, -4 in decreasing order. 1, -4, -5, -79 Sort 4, -1/7, -0.2, -2/7, 5/16 in increasing order. -2/7, -0.2, -1/7, 5/16, 4 Sort -5, -6, 214, -3, -4 in descending order. 214, -3, -4, -5, -6 Sort 0, 0.5, -0.0845. -0.0845, 0, 0.5 Put 16, 4, -1, -5, 5 in descending order. 16, 5, 4, -1, -5 Sort 0.6, -2/21, 29, 0.2. -2/21, 0.2, 0.6, 29 Put -7, -0.96, -3 in descending order. -0.96, -3, -7 Put 4, -29, 2, -1 in decreasing order. 4, 2, -1, -29 Sort -20, 0, 35 in descending order. 35, 0, -20 Sort 0, -0.2, -8.7, -0.5 in increasing order. -8.7, -0.5, -0.2, 0 Sort -69, 3, 2 in decreasing order. 3, 2, -69 Sort 83, 2, 17 in ascending order. 2, 17, 83 Sort 2/3, 0.11, 0.1, -4 in decreasing order. 2/3, 0.11, 0.1, -4 Sort 0.1, 14, -3/10 in decreasing order. 14, 0.1, -3/10 Put -4, 1/96, -0.1	{ "pile_set_name": "DM Mathematics" }
f? 5 Let y = -240 - -245. Let g = -1.3 - -0.3. Which is the smallest value? (a) g (b) -4/7 (c) y a Let i = -4 + 4.4. Let u = -8/45 - 1/45. Which is the third smallest value? (a) u (b) i (c) -3 b Let p(o) = o*3 - 2o - 1. Let d be p(-1). Let l = -0.12 + -0.18. What is the smallest value in l, -5, d? -5 Let f = 87 + -433/5. What is the second smallest value in -1/4, -0.1, f? -0.1 Suppose 99 = -5l + 24. Let f = l - -16. What is the third biggest value in f, 5, -3? -3 Let w be 15/(-35)(-2)/138. Let c = w + -7/69. Let j be -1 + (-16)/14 + 2. What is the third biggest value in c, 4, j? j Let g = -0.2 + -0.3. Let k = 2 - 0. Suppose -5s + 1 = -24. Which is the second smallest value? (a) s (b) k (c) g b Let q = -5.12 - -0.12. Suppose 2l + 4 = -2z - 0, 5z + 14 = -3l. Which is the second smallest value? (a) 0 (b) z (c) q b Suppose y - 50 = 3h, 0 = -h - h - 2y - 44. Let o be (-4)/h - (-1 - -1). Let m = 0.3 - 0.1. What is the third smallest value in m, 0, o? o Let w = 9.3 + -9.2. What is the biggest value in 1/4, w, -5, 0? 1/4 Let j(s) = s3 + 6s*2 - 9s - 10. Let d be j(-7). Let v be d/2 - 12/36. Let o = -882/11 - -80. What is the third smallest value in o, v, 1/3? v Let c be (16934/(-10))/34. Let s be -1 + ((-456)/20 - -4). Let k = c - s. What is the smallest value in -0.2, k, 3? -0.2 Let s = -8.5 + 8. Let h = 0.2 + s. Let f = 0.4 - 0. What is the second smallest value in h, -1, f? h Let h = -147/4 + 1045/28. Let g = -14.8 - -15. Which is the smallest value? (a) h (b) g (c) -4 c Let u be ((-2)/8)/(27/(-36)). Let l = 6 - 4. Let j be ((-1)/14)/(l/(-12)). Which is the smallest value? (a) u (b) -2 (c) j b Let h = -22 + 108/5. What is the second smallest value in -4, h, 2/5? h Let t = -0.23 - -0.03. Which is the third smallest value? (a) 27 (b) -1/3 (c) t a Let w = 0.162 + -0.062. Let f = 27 + -19. Let m = -11 + f. Which is the smallest value? (a) 0.4 (b) m (c) w b Let d = 0.13 + -5.13. Let q = 22 + -56. Let i be 1 - 1 - (-4)/q. What is the second biggest value in 5, i, d? i Suppose 3m + 18 = 8m + u, -5m + 30 = 5u. What is the second smallest value in 2/71, -0.1, m? 2/71 Let l = -0.16 + -0.54. Let f = 0.1 + 0. Let w = -0.4 + f. Which is the biggest value? (a) l (b) 2 (c) w b Let u = 13 + -8. Let z be (-4)/10 + (-8)/u. Let g be z/5 - (-144)/285. Which is the biggest value? (a) -4 (b) g (c) -3 b Let a = 6.4 - 6. Suppose 12 = 6g + 6. What is the biggest value in a, -1/2, g? g Let z = 0.84 - -4.04. Let d = z + 0.12. Which is the second biggest value? (a) 0.5 (b) 4/3 (c) d b Let b = 0.3 - -0.2. What is the biggest value in b, 1/5, 3/4? 3/4 Let c = -1 + 0.9. Let j = -0.4 - -0.45. Let s = j - 3.05. What is the second smallest value in s, c, 3? c Let k = -1.6 + 2.1. Let m be 3/(-18) - (-1)/(-3). Which is the second smallest value? (a) k (b) m (c) -4 b Let z = 5132/55 + -472/5. Which is the biggest value? (a) 1/3 (b) 4 (c) z b Let g be 8/2 - (1 - 35/(-11)). What is the third smallest value in -3, 0.1, g, 3? 0.1 Let m = 10.5 - 11. What is the smallest value in 2/13, 3/5, m? m Let u be (3 + (-47)/6 - -1) + 4. What is the second smallest value in u, 0.5, -0.9? u Let g = -1 - 3. Let t be ((-1)/(-5))/(g/10). Which is the biggest value? (a) 3 (b) 5 (c) t b Let t = -1.5 - 5.5. Let c = -1 + 0. What is the biggest value in t, c, 0.4? 0.4 Let d = -0.2 - -0.1. Let o = 370 + -2594/7. What is the third biggest value in 0.1, o, d? o Let d = 1.5 + -1.5. Which is the second smallest value? (a) d (b) 3/7 (c) 2/5 c Let b = -0.2 + 0.3. Suppose 25 = 2z - 7z. What is the second smallest value in b, 1/5, z? b Let s = -5/14 - 8/7. Which is the second smallest value? (a) 3 (b) s (c) -1/16 c Let f = -0.3 + 0.7. Which is the biggest value? (a) 0.2 (b) f (c) -1 b Let t be ((-1)/(-6))/((-21)/(-18)). What is the third smallest value in 2/5, t, -3? 2/5 Let w = -0.2 - -0.6. Let s = 1.1 + w. Let y = 2 - s. What is the smallest value in 0.4, y, 3? 0.4 Let k = 102.4 - 102. Which is the second smallest value? (a) -0.3 (b) 5 (c) k (d) -2/45 d Suppose 19d - 18d + 5 = 0. What is the second smallest value in -1/5, d, -0.09? -1/5 Let s = -0.6 - 0. Let p = s + 0.63. Let v = 0.13 - p. What is the second biggest value in v, 5, 2/3? 2/3 Let g(u) = -u*2 - u + 2. Let t be g(-3). Let m be 1 - 4/51. Which is the smallest value? (a) m (b) t (c) 0 b Let o = -10 + 15. Let a = -17 + 9. Let i be 1/2 + 2/a. What is the third biggest value in i, o, -5? -5 Let a = 4 + -2. Suppose -an + 0 = -2. What is the third biggest value in n, 0.5, -1? -1 Let m be 26/(-24) + 3/9. Let t = -668/5 - -134. Which is the biggest value? (a) m (b) t (c) -1/8 b Suppose -2q + q - 3 = 0, 0 = -4k - 4q - 4. Let j be ((-2)/(-2) - 1)/k. Let n = 59 - 57. Which is the biggest value? (a) j (b) n (c) 1 b Let o = -4.961 + -0.039. Which is the second smallest value? (a) -4 (b) o (c) -3/5 (d) -0.5 a Let i(y) = -y*2 + 12y - 3. Let l be i(12). Let k be 2/(-8)11 - l. What is the second biggest value in k, -0.4, -2? -0.4 Let n = 0.12 - 0.22. Which is the biggest value? (a) 1 (b) -5 (c) 4 (d) n c Let r = -0.77 - 0.23. Which is the biggest value? (a) 2 (b) -5 (c) r a Let l be ((-40)/84)/(-10) - 1/3. Which is the third biggest value? (a) -5 (b) -2 (c) -4/5 (d) l b Let l = -1 + 1.1. Let r(q) = -q2 + 4q + 7. Let p be r(6). Which is the third biggest value? (a) l (b) 5 (c) p c Suppose -6 = n - 3. Let s = -0.95 - -1.45. Which is the biggest value? (a) n (b) s (c) -4 b Let m = -0.05 + 2.05. Let u = 2.5 - m. Which is the third smallest value? (a) -1 (b) u (c) 2/9 b Suppose -2o + 5o - 15 = 0. Let s be 2/3 - (-224)/(-3). Let w be s/140 - 3/(-7). Which is the second biggest value? (a) o (b) 3 (c) w b Let m = 4/65 - -14/195. Which is the biggest value? (a) 0.02 (b) 1 (c) m b Let q(z) = -12z + 2. Let r be q(1). Let n be ((-2)/r)/((-54)/(-45)). Which is the biggest value? (a) 0 (b) 0.2 (c) n b Let d be 128/156 + (-4)/26. Let h be (-2 + 0)(-2)/92. Let t = -26/69 + h. Which is the third smallest value? (a) t (b) 0.4 (c) d c Suppose -5y = -0b - 2b - 142, y = 0. Let v = 354/5 + b. Let o = 0.5 - 0. What is the second biggest value in v, o, -5/6? v Let m = -0.2 - 0.3. Let b(k) = -k2 + 9k - 5. Let c be b(9). Let j = c + 0. What is the biggest value in j, 3/7, m? 3/7 Let i = 3 + -7. Let m = -9 - i. Which is the third biggest value? (a) m (b) -0.1 (c) -0.3 a Let m = 6.7 - 7. Let o be -3 - (-1 - (-32)/(-12)). Which is the second smallest value? (a) m (b) o (c) 1 b Let o(n) = n*2 + 15n + 52. Let x be o(-9). Which is the second biggest value? (a) -4 (b) x (c) -5/4 (d) -0.1 c Let v be ((-3)/(-2))/(27/(-12)). What is the fourth smallest value in 0.02, v, 5, -7? 5 Let b = -0.46 + 0.36. Let h(p) = p + 10. Let r be h(-8). What is the third smallest value in r, -3, b? r Let s = -19 + 19. Let r be 1-106/(-15). Which is the second biggest value? (a) s (b) -2 (c) r a Let c = 16920 - 3908537/231. Let d = c - 7/33. Let b = -5.1 + 2.1. What is the third biggest value in b, d, 3? b Let u = 1783/15 - 119. What is the second smallest value in -0.01, 0.5, u? -0.01 Let t = -10 - -6. Let o(y) = -y + 3. Let c be o(6). Let u be (-3)/12 - c/(-4). What is the third smallest value in u, -5, t? u Let y = -5 + 51/10. Which is the second biggest value? (a) y (b) 3/2 (c) 5 b Let z = -49 - -50. Which is the third smallest value? (a) 0 (b) z (c) 2 (d) -0.4 b Suppose 2u - 22 = -56. Which is the second biggest value? (a) u (b) -3 (c) -0.1 (d) 5 c Let m = 333 - 333.3. Let x = -1.04 + 1. Which is the second biggest value? (a) x (b) 1/7 (c) m a Let k = -13 - -10. Which is the second biggest value? (a) k (b) 4 (c) -1/4 c Let w = 13 - 11. Which is the second biggest value? (a) -5 (b) 0.5 (c) w b Let u = 8.2 + -8. Let o be -2(-1)/(-8)-1. Which is the smallest value? (a) o (b) u (c) -0.1 c Suppose 3 = 2s + 1. Let t = s - -18. Suppose 5h + t + 6 = 0. What is the second smallest value in -2, h, 0.4? -2 Suppose 21 = -3l - 24. Let h be 13 + l + 40/22. Let g = -7 - -12. What is the second biggest value in g, h, 0.5? 0.5 Let q = -1529.935 - -1534. Let j = 0.175 - q. Let i = j + -0.11. What is the third smallest value in i, -3/2, 2/3? 2/3	{ "pile_set_name": "DM Mathematics" }
4z Collect the terms in -5861f*3 - 17839f*3 + 23701f3. f3 Collect the terms in 7512 + 9i2 - 14997 + 7485. 9i*2 Collect the terms in 34f*2 - 73f*2 + 34f*2 - 6f*3. -6f*3 - 5f*2 Collect the terms in 2z + 2z2 + 59z - 117z + 56z. 2z2 Collect the terms in 338919c3 - c2 - 338963c3 + c2. -44c*3 Collect the terms in -180d*3 - 90d*3 + 30d*3. -240d*3 Collect the terms in 32i - 116i + 82i. -2i Collect the terms in 9827 - 1666s*3 - 9827. -1666s*3 Collect the terms in 9t*3 - 90994 + 90994. 9t*3 Collect the terms in 51a*2 - 88a*2 - 4a*3 + 37a*2 - 12a*3 + 18a*3. 2a*3 Collect the terms in 20l + 3l - 31l - 277 + 6l + 0l. -2l - 277 Collect the terms in -1670i + 3362i - 9 - 1681i. 11i - 9 Collect the terms in -24a*3 - 40a*3 + 54a*3 - 8a*3 - 31a*3. -49a*3 Collect the terms in 25852b*2 - 8644b*2 - 8603b*2 - 8597b*2. 8b*2 Collect the terms in 3277u*2 - 8u*3 - 1644u*2 - 1633u*2. -8u*3 Collect the terms in -46p + 8 - 8 - 21p + 75p. 8p Collect the terms in 161 - 311a*2 - 86 - 79. -311a*2 - 4 Collect the terms in 27u - 2 - 27u - 10u*3. -10u*3 - 2 Collect the terms in -195z*2 - 53z + 201z2 + 53z. 6z2 Collect the terms in -3n*3 + 1125573n + 1125578n - 2251151n. -3n3 Collect the terms in -19513o*2 + 19513o*2 + 66o*3 - 72o*3. -6o*3 Collect the terms in 875s*3 - 357s*3 + 1827s*3. 2345s*3 Collect the terms in -547j + 52j2 + 110j - 51j2 - 216j. j*2 - 653j Collect the terms in h3 + 57 - h3 + 2h3 + 413 - 3h. 2h3 - 3h + 470 Collect the terms in -380q - q2 - 255q + 635q. -q2 Collect the terms in -3 - 7c - 11c + 19c. c - 3 Collect the terms in 8q - 10q*2 - 21 + 14q*2 + 12q*2. 16q*2 + 8q - 21 Collect the terms in -15b + 27b - 12b - 316b*2. -316b*2 Collect the terms in 499 - 250 - 249 + 165r*2. 165r*2 Collect the terms in -7z*2 + 15z*2 + z - z + 3z*2. 11z*2 Collect the terms in 85g + g*2 + 112g - 4g2. -3g*2 + 197g Collect the terms in 0 - 116273l - 1 + 116277l + 1. 4l Collect the terms in -2 + 428t*2 - 2 + 0 + 4. 428t*2 Collect the terms in -139o - 81o - 868o. -1088o Collect the terms in -2u - 1204u2 - 4192u*2 + 3u. -5396u2 + u Collect the terms in -325m - 17 - 3 + 2. -325m - 18 Collect the terms in -164k*2 + 327k*2 - 162k*2 - 230k. k*2 - 230k Collect the terms in -9602 + 9602 - 211q2. -211q2 Collect the terms in -l2 + 1364l - 4104l + 1369l + 1371l. -l*2 Collect the terms in -450p*3 + 1000p*3 + 429p*3 + 1996p*3. 2975p*3 Collect the terms in 238b*3 + 233b*3 + 203b*3 - 911b*3 + 235b*3. -2b*3 Collect the terms in -77m*2 - 91m*2 - 57m*2 + 316m*2. 91m*2 Collect the terms in -163z + 48z + 115z - 19z2. -19z*2 Collect the terms in 10f - 72f + 11f + 16f + 20f. -15f Collect the terms in -61k - 3k2 - 8k*3 + 26k + 25k. -8k*3 - 3k*2 - 10k Collect the terms in -18l3 - 83l + 13l3 + 4l3. -l3 - 83l Collect the terms in 103y + 3y2 + 98y - 321y. 3y*2 - 120y Collect the terms in 12 + 15642g2 - 15647g*2 - 11. -5g*2 + 1 Collect the terms in -63y + 127y + 7y*2 - 60y. 7y2 + 4y Collect the terms in 1591j3 + 1591j*3 - 3190j*3. -8j*3 Collect the terms in -384w*2 + 133w*2 + 125w*2 + 131w*2. 5w*2 Collect the terms in 7381 - z - 3662 - 3719. -z Collect the terms in -57j*2 + 150j*2 - 28j*2. 65j*2 Collect the terms in 64028c - 64028c + 2c*3. 2c3 Collect the terms in a2 - 21 - 9 - 5 + 7 - 7. a*2 - 35 Collect the terms in -8 - 3 + 4v*3 - 27v*2 - 3 + 15. 4v*3 - 27v*2 + 1 Collect the terms in -7174 + 3589 + 3585 - 10p*2. -10p*2 Collect the terms in -478a*3 - 331a*3 + 269a*3 - 263a*3. -803a*3 Collect the terms in 1 + 4t*2 - 1 + 2353t - 2322t - 5t2. -t2 + 31t Collect the terms in 2 + j2 + 38j*2 - 6 - 31j*2. 8j*2 - 4 Collect the terms in 12p - 8p + 7p + 0p2 - 3p*2 + 2p. -3p2 + 13p Collect the terms in -1564c + 1 - 4c*3 + 0 + 1564c - 1. -4c3 Collect the terms in -10q - 126 + 8 + 118. -10q Collect the terms in 0 + 188u*2 + 651u*2 + 0 + 0u*2. 839u*2 Collect the terms in 10855c*3 - 16756c*3 + 5902c3. c3 Collect the terms in -138d + 54 - 13d*2 + 61 - 115 + 11d*2. -2d*2 - 138d Collect the terms in 75 + 82i2 - 53 + 114i*2. 196i2 + 22 Collect the terms in 109 + 21 - y3 + 277y2 - 277y2. -y3 + 130 Collect the terms in -3r2 + 58616r - 29304r - 29313r. -3r2 - r Collect the terms in 94 + 91 + 2315l*2 - 185. 2315l*2 Collect the terms in 45 - 143 + 51 + 15d*2 + 47. 15d*2 Collect the terms in -2 - 2133935r*2 + 2 + 2133937r*2. 2r*2 Collect the terms in -76722 + 76722 + 8s*2. 8s*2 Collect the terms in 2 + 15561493g - 3 - 43g2 - 15561493g. -43g2 - 1 Collect the terms in -1596m + 5245m + 7072m. 10721m Collect the terms in -3m - 135 - 224 + 612 - 127 - 126. -3m Collect the terms in -10n - 25n3 + 8 + 24n3 - 107. -n3 - 10n - 99 Collect the terms in -1103 + 1395 - 292 - 5i*2. -5i*2 Collect the terms in -120m + 1341m2 + 120m - 1376m2. -35m*2 Collect the terms in -16683a - 11775a + 1 - 1. -28458a Collect the terms in 157n + 159n + 2 - 2 - 319n. -3n Collect the terms in -6969573u - 8u*2 + 6969573u. -8u2 Collect the terms in 32 + 2 - 88 - 6b + 54. -6b Collect the terms in -231 + 222 - 5u + 0u + 8u. 3u - 9 Collect the terms in -2l - 424 + 181 + 191 + 21l2. 21l*2 - 2l - 52 Collect the terms in 42u2 + 42u*2 - 56u*2 - 18u2 - u3. -u*3 + 10u*2 Collect the terms in 2x*2 - 161003 + 322003 - 161000. 2x*2 Collect the terms in -79z*3 + 978z*3 - 169z*3 + 1453z*3. 2183z*3 Collect the terms in -118r - 115r + 572r - 111r - 109r - 112r. 7r Collect the terms in -20s2 - 7s*2 + 12s*2 - 49s*2. -64s*2 Collect the terms in 362 + 17c*3 - 232 - 130 + 2c*3. 19c*3 Collect the terms in -1673o + o*2 - 1662o + 3326o - 5o*2. -4o*2 - 9o Collect the terms in -46l3 + 303l - 606l + 303l. -46l3 Collect the terms in -23047y*3 - 23040y*3 + 46088y3. y3 Collect the terms in m*2 + 39m*2 - 70m*2 + 33m*2. 3m*2 Collect the terms in 4 - 7 + 82101q - 82111q + 3. -10q Collect the terms in -12w + 39w - 16w - 38w*2 - 11w. -38w2 Collect the terms in -822b*2 + 1629b*2 - 156b*3 + 51b*3 - 807b*2. -105b*3 Collect the terms in -246n*3 + 1276n*3 + 72n*3. 1102n*3 Collect the terms in 0c - 20c - 43c - c + 7c. -57c Collect the terms in 4949z2 - 8434z*2 + 3484z2. -z2 Collect the terms in 15o3 - 1489770o + 1489770o. 15o*3 Collect the terms in 3 + 4 - 75u*2 + 3 - 17. -75u*2 - 7 Collect the terms in 4 - 11671i*2 - 11672i*2 - 4 + 23342i2. -i2 Collect the terms in 17l2 - 510864l + 510864l. 17l*2 Collect the terms in -937r*3 + 2234r*3 - 339r*3 - 947r*3. 11r*3 Collect the terms in 351b*3 - 141b*3 - 216b*3. -6b*3 Collect the terms in -14004y + 41955y - 14007y - 13944y + 3y*2. 3y*2 Collect the terms in 14z + 13 + 21z + 29z - 13. 64z Collect the terms in 450f - 868f + 428f. 10f Collect the terms in 275u - 1512u - 5363u + 730u. -5870u Collect the terms in -2775j3 - 862j*3 + 1000j*3. -2637j*3 Collect the terms in 29647 + 275j*2 + 29655 - 59302. 275j*2 Collect the terms in -33233695f - 4 + 33233695f - 15f*2 + 4. -15f*2 Collect the terms in -59953g*2 - 59917g*2 - 59952g*2 + 179820g*2. -2g*2 Collect the terms in 105 + 40 + 16l*2 - 48 + 64. 16l*2 + 161 Collect the terms in -58l + 340l - 606l - 858l. -1182l Collect the terms in -198w - 2711w*2 + 198w + 2725w2. 14w*2 Collect the terms in 408 + 155 + 4u*2 - 3u2 + 258 - 365. u2 + 456 Collect the terms in -22y2 - 311y + 96y + 117y + 98y. -22y*2 Collect the terms in 15 - 6 + 6v - 9v + 13. -3v + 22 Collect the terms in -75 - 353 - 4g + 428. -4g Collect the terms in 0u3 - 5u*3 + 2u + 21u3 - u + 11u. 16u3 + 12u Collect the terms in -5d3 + 27d*3 - 524d + 1065d - 541d. 22d*3 Colle	{ "pile_set_name": "DM Mathematics" }
Do 173 and 175 have the same value? False Is 85339 smaller than 85314? False Which is bigger: 11897 or -2? 11897 Which is smaller: 311 or -355? -355 Which is smaller: 0.744 or 0.1085? 0.1085 Is -47 less than or equal to -8? True Which is smaller: 4800 or 4570? 4570 Which is smaller: -93219 or -93216? -93219 Do 0.005 and -23.196 have different values? True Is 0 bigger than -7/23610? True Is 18 > 2907/161? False Which is greater: -12/85 or -5416? -12/85 Which is smaller: -40 or 22060? -40 Is -21431 greater than or equal to -21439? True Which is smaller: 84/68143 or -0.1? -0.1 Which is bigger: 4 or 1/6894? 4 Which is smaller: 15230 or 5? 5 Which is bigger: -5847/943 or -6? -6 Are 0 and -100/401 non-equal? True Which is smaller: -5320 or 1.3? -5320 Is 0 less than 1/81796? True Is -4 at least as big as 260/513? False Which is bigger: -55/2087 or 1? 1 Which is bigger: 0.081931 or -9? 0.081931 Is -5 bigger than -9/539? False Which is smaller: 0.05 or 13906? 0.05 Are 789 and 893 equal? False Is -82537/9 smaller than -9172? False Which is smaller: 1/345022 or 1? 1/345022 Is 7 bigger than 284/43? True Are -3 and -22729 non-equal? True Is -134457/2 at least as big as -67229? True Which is smaller: -1 or 20/121243? -1 Is 55 bigger than 22/147? True Are 0.6 and 898.2 equal? False Which is bigger: -1 or -192/22423? -192/22423 Are 5/1792344 and 0 non-equal? True Is 1 greater than or equal to 63/2675? True Is -6.8351 bigger than -1? False Is -161 smaller than -10479/65? False Which is smaller: 5/31 or -1.14? -1.14 Is 69248 equal to 69206? False Which is greater: -1 or -2/32463? -2/32463 Which is greater: 0 or 812/15973? 812/15973 Which is smaller: -1680 or -1690? -1690 Which is greater: -0.204 or 0.8? 0.8 Which is bigger: 1 or 296.35? 296.35 Which is greater: 4.16 or 217? 217 Do -489 and -70 have different values? True Which is greater: 17776 or 17778? 17778 Does -20351 = -20359? False Is 728 != 660? True Is 188509 > 188508? True Are 107745 and 107745 nonequal? False Are 402570 and 402570 nonequal? False Which is greater: -94 or 7/268? 7/268 Which is greater: -8750 or 36? 36 Which is smaller: 785/251 or 4? 785/251 Which is bigger: -1/17324180 or -1? -1/17324180 Which is greater: 5/105058 or 0? 5/105058 Which is smaller: 875/274 or 4? 875/274 Which is smaller: 2.2 or -0.11891? -0.11891 Which is smaller: -8771 or -8611? -8771 Which is bigger: 1945 or 15571/8? 15571/8 Are 1611397 and 1611397 equal? True Which is bigger: -330/128699 or 1? 1 Is 135072 > 135071? True Is 838643/6 <= 139775? True Are -267778 and 0.1 equal? False Which is smaller: 182 or -225? -225 Is -2/45 at most 106? True Is 19 greater than -59/30? True Are 435548 and 435543 non-equal? True Is 48841 smaller than -2/5? False Which is greater: -25.11 or 80/9? 80/9 Is -2/171223 < 0? True Which is smaller: 1000054 or 2? 2 Is -3288 at least as big as -3288? True Is -192 >= 5/94? False Which is greater: -18519/23 or -805? -805 Which is smaller: -57/473 or -1? -1 Is -1/960163 at least 1? False Which is smaller: -1376 or -1366? -1376 Are 3/30773 and -1 equal? False Which is greater: 0 or 521.61? 521.61 Is -8954 smaller than -9258? False Are 236 and -318 equal? False Which is greater: -40491 or -40463? -40463 Is -1546942 >= -1546941? False Which is smaller: -3/109177 or 1? -3/109177 Are 75/4 and 2603 equal? False Is 96/869 at most as big as -1? False Is -46 bigger than 107/16? False Is -3701101 at most as big as -3701100? True Is -0.1 greater than 5607879? False Which is smaller: -59873 or 4? -59873 Is -963641 smaller than 0? True Is 1 greater than 3/217310? True Which is smaller: -5 or 549459? -5 Is -4786 >= -4978? True Which is bigger: 6 or -882236? 6 Is -1/4 equal to -16.06? False Which is smaller: 979 or 53886/55? 979 Is 15620 smaller than 15620? False Which is smaller: 1 or -19/87950? -19/87950 Is -3682 at least -3685? True Is -8.1318 <= -0.1? True Which is smaller: -1/7 or 5428? -1/7 Which is greater: -1/1401580 or 1? 1 Is -34735 > -34735? False Is -110860/17 at most -6520? True Is 168777 != 168758? True Which is greater: 3274 or 3262? 3274 Is -754142 not equal to -754140? True Is -50 less than -77586? False Which is smaller: 534 or 5391? 534 Is -3.6 greater than -785/56? True Which is greater: 610 or 0.5? 610 Which is greater: -19772 or 3? 3 Is 1 < 1/99833? False Which is smaller: 3/2 or -18/95? -18/95 Is -1 < -43/37580? True Which is smaller: 150911 or 150924? 150911 Which is bigger: -330081 or -330075? -330075 Is 58836 at least 58836? True Is -2379 less than -2347? True Which is smaller: 0.0149 or 38? 0.0149 Is 6237 >= 6238? False Is 0.42954 smaller than 3/5? True Is -3 bigger than -71965? True Which is bigger: -43479 or 0.1? 0.1 Which is smaller: -6050 or -6048? -6050 Which is smaller: 2/5 or 23179/12? 2/5 Is -50/13 less than 390? True Is 156493 > 156493? False Which is greater: 1 or -48/2081? 1 Which is greater: 32/113 or -1.69? 32/113 Is -1710/157 greater than or equal to -11? True Do -15 and 365269 have the same value? False Which is greater: -1 or -408/5705? -408/5705 Is -148 less than 83/3? True Are -1 and 211/1031 unequal? True Is 1990 smaller than 2002? True Is 0 < 56/10481? True Is -447 at least -113? False Which is smaller: 2/5 or -838? -838 Is 1 less than or equal to -7/12316? False Which is smaller: 2/602195 or -1? -1 Is -13/9 at least as big as -12515? True Which is smaller: 55 or 69? 55 Which is greater: 28174 or 84520/3? 28174 Is -159/4388 < 0? True Which is bigger: 88407 or 88390? 88407 Which is smaller: -1 or 2/8390591? -1 Which is smaller: 39 or -52? -52 Which is greater: -2301586 or 2? 2 Which is greater: 10168/3233 or 2? 10168/3233 Is 613218/17 <= 36073? True Which is smaller: 239 or 104.75? 104.75 Is -53594 > -53603? True Is -481081 not equal to -481081? False Are 389 and -34.2 nonequal? True Which is bigger: 0.55 or 2102? 2102 Is 955349 less than 955350? True Is 7194 <= 7197? True Is -141125 > -141123? False Which is greater: 5/1956 or -1? 5/1956 Is -1329/568 <= -1? True Which is smaller: -270 or -19642/73? -270 Are 1 and 13123 non-equal? True Which is greater: -2 or -125023? -2 Is -15034 greater than -15068? True Does 47.963 = 3/5? False Which is smaller: 52 or -1509? -1509 Are -2/11 and -190276 unequal? True Does -10218 = -10213? False Which is greater: 0.33 or 23207? 23207 Is 49/5003 <= 1? True Is 0 greater than 4/193905? False Which is greater: -4134 or -36? -36 Are 15717 and 15716 non-equal? True Which is smaller: -2/5 or 165241.3? -2/5 Which is greater: -4/3 or -26151? -4/3 Which is greater: 1119 or 8961/8? 8961/8 Which is bigger: -1554 or -1557? -1554 Is -18 < 3068/7? True Which is greater: 2503/5 or 502? 502 Which is bigger: -294515 or -294513? -294513 Is -61968 greater than -61968? False Which is smaller: 4585 or 158? 158 Which is bigger: -12686 or 0.07? 0.07 Which is smaller: 1 or 4290/2437? 1 Is -227 smaller than 0.619? True Is 1 greater than -1/60885? True Is 1 greater than 20/6343? True Are -2283/2 and 29 nonequal? True Which is smaller: 1056/251 or 3? 3 Is -1128643 smaller than -1128642? True Is -1 smaller than 102/3109? True Which is greater: -8 or 63603? 63603 Which is greater: 13797 or 13791? 13797 Which is smaller: 173/8 or 2/17? 2/17 Is 6170 bigger than 6145? True Which is bigger: 2/15 or -87266? 2/15 Is -6946 <= -6951? False Is -6523244 bigger than -6523243? False Are 1 and 251.24 equal? False Which is greater: 0 or -566/7157? 0 Is -0.113 != 2/95? True Is -344 > -12027/35? False Is 3006/413 at most as big as 8? True Is -61693 < -61689? True Which is bigger: 83064 or -2/51? 83064 Are -378 and -22351/59 equal? False Is -27668/63 at most as big as -439? True Which is greater: 2205 or 3031? 3031 Is -1179 less than -1667? False Is -1 at least 11/2042? False Is -1 less than or equal to -2272/1577? False Is -181501 at most -181500? True Which is smaller: 48/2581 or -1? -1 Is 23980 at most 815331/34? True Which is smaller: -153111 or -153112? -153112 Do -8/35 and -0.66 have the same value? False Which is smaller: 1 or 12/131419? 12/131419 Are 8687 and 8687 nonequal? False Which is smaller: 1785 or 1772? 1772 Which is smaller: 1 or 5/34442? 5/34442 Is 55609 > 55606? True Which is smaller: -814 or 0.28? -814 Which is smaller: -155572 or -155570? -155572 Which is	{ "pile_set_name": "DM Mathematics" }
8 - -19) + -22? -8 What is -20 - (-6 - -7 - (8 - 1))? -14 Calculate -119 - -111 - (-2 + 23). -29 What is (-7 - (-4 + -3)) + -11? -11 What is the value of 2 + (1 + 2 - 12)? -7 What is the value of (-1 + -7 - -19) + (-5 - -3 - -19)? 28 Evaluate 2 + 2 - (39 + -37) - 4. -2 What is the value of 5 + -4 + -4 - (5 - 14) - 4? 2 (18 - 8) + (-8 - (0 + -1)) 3 Calculate 2 + 7 + -2 + (9 - 3). 13 What is the value of (5 + -18 - (-3 + 8 - 9)) + -17? -26 Calculate 37 + (-22 - 5) - 29. -19 Evaluate (51 - 29 - 26) + (-5 - 0). -9 Evaluate (-16 - -45) + (16 - 61). -16 Evaluate -1 + 8 + (-33 - -15 - -11). 0 Evaluate -6 + 6 + 0 + -2 + -6. -8 What is the value of -45 - (23 - 47) - -35? 14 What is -3 - -6 - (-3 + 10 + -7 - -2)? 1 What is the value of (-1184 - -1196) + -10 + (1 - 2)? 1 What is 1 - (2 + -8) - (2 + 8)? -3 Evaluate -6 + -1 + (-1 - 0). -8 Calculate 4 - (13 + -7) - (5 - 1 - 0). -6 -3 - (9 + -1) - (9 - (8 + -5)) -17 What is -24 - (0 + (-10 - -2) - (0 - 3))? -19 What is the value of -1 + -11 + 17 + (0 - -1) + -2? 4 What is the value of (1 - 3 - 3) + (37 - 7)? 25 Evaluate 34 - (12 + -12 + -3 + 10). 27 What is ((21 - 12) + -38 - -8) + 12? -9 7 + 7 + (-4 - (-1 - 5 - -14)) 2 What is the value of -55 + 45 + -2 + 14? 2 (3 - -20 - 10) + -28 -15 What is -16 + -7 + 11 + 11 + 23 + -2? 20 What is -19 + (-12 - (15 - 45))? -1 What is the value of (-8 - (-8 + 9 + 8)) + 9? -8 (-8 + -6 + 12 - (-1 + 2)) + -9 -12 Calculate 0 + (2 - -1) + -67 + (-36 - -61). -39 Evaluate -4 - (14 + 12 + -5). -25 What is 1 - 3 - -8 - (-11 + (-15 - -26))? 6 What is the value of -22 - (31 + 4 + -50)? -7 6 - (-29 - (-21 + -3) - (3 - 1)) 13 (-11 - (-6 - -1)) + 14 + -19 - 3 -14 Calculate -24 - ((-25 + 10 - -3) + (9 - 4)). -17 What is the value of 4 + 25 + -16 + -4 - 37? -28 What is 8 + 0 + -12 + -57 + 68? 7 Evaluate -7 + -1 - ((-2 - -10) + -37). 21 Calculate 39 - 1 - (-196 - -214). 20 Evaluate 8 + -21 + 13 + -5. -5 Evaluate 16 - 0 - (378 - 326) - -6. -30 What is the value of -40 + (-25 - -58) + -2 + 21? 12 What is 4 + 1 + (-11 - (-6 + -16) - 20)? -4 What is the value of -167 - -159 - (-29 - (1 + 3 - 5))? 20 What is the value of -23 + (6 + -6 + 6 - 5) + 6? -16 Calculate (-26 - (-33 + 15)) + 0. -8 What is 0 + 4 + (-5 - 5) + 7? 1 What is the value of (8 - (31 - 17)) + 0? -6 Evaluate -37 - (-16 - (15 + 0)). -6 What is the value of 8 + (-58 - -53) + 2 + 1 + -5? 1 -6 + 2 + (3 - (4 - -19)) -24 What is 14 - (32 - (18 + (3 - 6)))? -3 What is -17 - (14 - 30) - 18? -19 Calculate 28 + -37 + -3 + -2 - (4 + -2). -16 Evaluate -2 + -17 + (-1 - -14) + -1 + 14. 7 What is -23 + (-13 - -2) + 8 + -26 + 18? -34 Calculate (0 - (10 - -5)) + 9 + 0. -6 Evaluate -3 - 11 - (-26 + 8). 4 What is the value of (11 + -18 - -1) + -6 + -1? -13 What is -6 - ((4 - 8 - 29) + (-13 - -7))? 33 What is the value of (9 - 2 - -15) + (0 - (6 - 0))? 16 What is 6 + 9 - (-80 - -85)? 10 Evaluate -19 + 24 + -24 + 13. -6 What is (11 - 35) + 0 + 30? 6 What is (-13 - 0) + (132 - 130)? -11 What is -7 + (-10 - (8 - 16 - -5) - -22)? 8 What is the value of 5 + (19 - 37 - -1)? -12 What is 22 + -21 - -2 - -28? 31 What is the value of 18 + -6 + 3 - 3? 12 Calculate -5 - (-6 + -13 + -3 + 11). 6 Calculate 9 - (30 - 25) - (1 - (0 - 2)). 1 What is 635 + -627 + 9 + (2 - 3)? 16 What is 12 + (5 - 12) + 20 + -2 + -4? 19 What is the value of -6 + 21 + 2 + -4? 13 -15 + (46 - (-8 + 14)) + (3 - -2) 30 (-1 - -9) + (7 - 2 - 17) -4 Calculate 1406 + -1371 - (-1 + 15 + 0). 21 Evaluate -4 + -1 + 17 + -13 + 1. 0 What is the value of (-1 - 9) + 10 + 7 + -11? -4 Calculate -5 - (3 + 3 + -15) - (-1 - -5). 0 What is the value of 5 + (21 - (-2 + (11 - 0)))? 17 What is (-74 - -91) + (-2 - 0)? 15 What is the value of (3 - 1) + (0 + 50 - 65)? -13 Calculate 0 + 0 + (3 - 2) - (-5 + 5). 1 What is -11 - (4 + 9 + -12 + 9 + -2)? -19 What is 28 - (-1 - ((7 - 11) + -15))? 10 Calculate (-38 - (-18 + 2)) + 8. -14 6 + -1 + (4 - -6 - 11) + -10 -6 Calculate 14 + (-11 - -14 - 19). -2 What is the value of 11 - (-1 - (-23 - -12)) - -5? 6 (4 - -2) + (7 - (1 + 0 - 1)) 13 -7 + -5 + 11 + -14 + 12 + 26 23 Evaluate 16 + (-26 - (44 - 32)). -22 Evaluate (6 - (9 + -7)) + -9 + (9 - 12). -8 -3 + (10 - 9) + 0 - 10 -12 Calculate (3 + 2 - 1) + 13 + -4. 13 Calculate -7 + (10 - -3) + (2 + 5 - 4). 9 Calculate 15 + 3 + -14 + -2 + 1 + 14. 17 Evaluate (2 - -7) + (14 - 9 - 12). 2 What is the value of (-140 - -129) + 12 + 2? 3 What is -64 + 62 - (0 - 4)? 2 9 - (-15 + (-7 - -9) - 1) 23 Evaluate -113 + 54 + 49 - (2 - -8). -20 What is -162 - -161 - (-1 + 0 + 7)? -7 What is the value of 1 + -52 + 16 + 19? -16 44 + -33 + 0 + (8 - 5) 14 Calculate 20 + -60 + (32 - 2). -10 Calculate (1 - 5) + (149 - 139) - 3. 3 -8 + -24 + 67 + -16 19 What is the value of 0 + -1 + 2 - (55 - (7 + 58))? 11 Evaluate -4 + -2 + 1 + 3 + 0. -2 (2 - (6 - (5 + -3))) + 67 + -66 -1 Evaluate -6 + 3 + (27 - 16) - (-2 + 0). 10 Calculate (-5 - -27) + -1 - (219 - 211). 13 What is (-2 - 8 - -3) + (116 - 112)? -3 Calculate (7 - (14 - 15)) + 27 + (2 - 0). 37 Calculate -84 - -92 - (-4 + 3). 9 What is 11 + 3 + -9 + -6 + 6? 5 -9 - (5 - 1) - -12 -1 Calculate (-21 - (-41 + 13)) + -3. 4 What is 16 + -45 + (22 - (2 - -12))? -21 What is the value of (11 - 8) + 6 + (-10 - -8)? 7 What is 3 + 49 - 42 - (0 + 32)? -22 Evaluate -2 - (-3 + 0) - (17 - (1 + 8)). -7 -16 - (9 - (3 - -22)) - -11 11 What is 5 - ((-22 - -53) + 4 - (9 + 1))? -20 -24 - ((-33 + 27 - (-2 + 4)) + 3) -19 What is 12 + 4 + -7 - (13 - 2)? -2 Evaluate (-131 - -148) + (2 - 6). 13 What is the value of -8 - -3 - ((1 - 6) + (9 - 6))? -3 What is the value of 1 - (431 + -425 + (-1 - 18))? 14 -21 - -3 - (35 + -42) -11 What is -16 - (-4 - (1 - (15 + -7)) - 4)? -15 What is the value of 1 - (-11 - -3 - -5) - (-8 - -3)? 9 Evaluate -3 + 12 + (17 - (-3 - -14) - -5). 20 Evaluate -1167 + 1190 - (8 - (0 - (2 - 3))). 16 What is -2 - (2 + 0 - 1) - (-207 + 219)? -15 What is the value of 2 + 0 + -78 + 71 + -3? -8 Evaluate (2 - -2 - -6) + (7 - 3). 14 Evaluate 9 - ((-10 - -8) + (-11 - -3) - -6). 13 22 + (0 - 3) + 7 - 12 14 What is -7 + -2 - (10 - (0 - -17))? -2 Calculate 0 + -12 + (148 - 147). -11 Calculate (18 - 24) + 13 + -7. 0 23 + 2 + 9 + (-4 - (17 + -8)) 21 What is -1 + (-1 + -4 + 7 - -2) - -12? 15 -1 - -2 - (-11 + 12 + -7) 7 What is the value of -15 + (11 - 2 - (-2 - -14))? -18 What is (-2 - -4 - 5) + -2 + 4 - 2? -3 Evaluate 32 - 49 - (2 + 3 + 2 - 0). -24 Evaluate 492 + -450 - (2 - -13). 27 Evaluate 21 + -16 + 13 + -5. 13 Evaluate (12 - (1 - -16) - (1 + -2)) + 6. 2 15 + 11 + -13 - 2 11 (-15 - -11) + (-18 - -9) -13 Calculate 19 + -23 - (31 - 31). -4 What is (-10 - (0 + -12)) + 10? 12 What is the value of -3 - -1 - (19 - (14 + 5))? -2 Calculate (-20 - -2 - -8) + (10 - 1) + -21. -22 -13 - (2 - 7) - -7 -1 -6 - (-9 - (-7 + (2 - 3))) -5 -2 + 11 + (4 - 17) + -7 -11 Evaluate -5 + (-9 + -1 + 16 - -2). 3 9 - (-4 - (16 + -17)) 12 Evaluate (7 - -14 - 32) + 25. 14 What is (15 - 14 - 12) + 8? -3 46 + -38 - (-2 + 10 - -4) -4 What is (10 - 24) + (-3 - -21) - -8? 12 What is the value of 1 + (-20 + 10 - -9)? 0 10 - (4 + 29 + -6 - -6) -23 Evaluate (-13 + 8 - (5 + -4)) + 21 + 0. 15 1 + (1 - ((-7 - -11) + 2)) - -16 12 Evaluate (31 - 11 - 46) + 9. -17 Calculate 6 - (9 - (14 - -3) - (12 - -2)). 28 Evaluate (-2 - (7 + -5 + 5)) + -8 + 1. -16 What is the value of 1 + 4 + (66 - (-19 + 83))? 7 Evaluate -7 + 12 + -8 - (-2 + 4). -5 What is -6 + 2 - (-21 - (-7 - -13))? 23 What is the value of (9 - 21 - -29) + (1 - 8)? 10 Evaluate -21 + 6 + -1 - -15. -1 18 - (6 + 5 + -2) 9 Calculate (180 - 192) + 1 + (-1 - 1) + 0. -13 Calculate 21 - (-8 + (12 + -4 - -9)). 12 -2 - (-8 + -2 + -2) 10 What is the value of (7 + 4 - 7) + -1 + 3 + -14? -8 What is the value of -9 + 10 + -8 + -4 + 6? -5 (9 + 3 - 23 - -36) + -11 14 Evaluate 8 + -94 + 91 + -1 + -2. 2 -1 - (-131 + 111 + (10 - -1)) 8 (39 - 44) + -1 + -7 -13 10 + (1 - 27) - ((1 - 3) + -6) -8 Evaluate (3 - (7 - (2 + 2))) + -1 - -7. 6 Calculate -1 + 1 + (176 - 189). -13 1 + -2 + (-23 - -7 - -8) -9 Calculate (16 - -3) + -17 + (2 - 4 - -4). 4 What is the value of -1 + 22 + 0 + -1 + (708 - 709)? 19 What is (28 - 77 - -28) + 10 + -2 + -1? -14 What is the value of 6 + 7 - (25 - 0)? -12 What is (8 - -13 - 12 - (5 - 6)) + -2? 8 What is the value of 11 + -35 + 31 - (1 - (3 - -1))? 10 Calculate -7 + 22 - (33 - 5). -13 What is (-2 + 2	{ "pile_set_name": "DM Mathematics" }
e third smallest value? (a) -5/3 (b) w (c) 2 c Let x = 35 - 29. Let a = -0.05 + -0.05. Let b = a + 4.1. What is the second biggest value in 5, b, x? 5 Let j = -28.5 - -12.9. Let d = j + 16. What is the third biggest value in 2, 0.2, 1/3, d? 1/3 Suppose 3k - 3v - 9 = -0k, -5k - 3v - 25 = 0. Let o be 2/(-21) - (3 - (1 - k)). What is the third smallest value in 1.3, 1, o? 1.3 Let d = 14.7 - 15. Let v = 2.5 - -12.5. Let h = v - 15.4. What is the smallest value in d, -4, h? -4 Let k be (16/(-10))/((-5)/(-200)). Let s be (-8)/k(1 - -1). Let n be ((-5)/2)/((-9)/18). What is the third biggest value in n, 0.5, s? s Let r = 21/2 - 151/14. Which is the third smallest value? (a) r (b) -7 (c) 0.5 c Let x(v) = -v*2 + 7v + 31. Let z be x(10). What is the smallest value in z, -0.2, -12? -12 Let v = 4.17 - 4.87. Which is the smallest value? (a) 5 (b) -3 (c) v b Let l = -188/7 - -52. Which is the third biggest value? (a) l (b) -0.1 (c) -3 (d) -3/5 d Let y = 2.5 + -4.5. Suppose k - 6 + 1 = 0. Which is the third biggest value? (a) y (b) k (c) 0.2 a Let p = -16.7 + 19.7. What is the third biggest value in -5/11, 0.5, p, -0.2? -0.2 Let y(w) = -w*2 - 16w - 26. Let m be y(-14). Suppose -h + 5 = 0, -4f - 15 = -9f + mh. Let l = -1.3 - -0.3. What is the second biggest value in l, f, 4/5? 4/5 Let g = 2.06 + -2.36. What is the fourth smallest value in 0.12, 2/19, g, 5/6? 5/6 Let o be 3/(18/5)45/(-12). Let f = 3 + o. What is the third smallest value in f, -2, 0.07? 0.07 Let l = 117 + -112. Let q = -0.2 + 0.5. Let v = -0.4 + q. Which is the third smallest value? (a) l (b) v (c) 3 a Let m = 214 - 78. Let j = -123 + m. Which is the fourth smallest value? (a) j (b) -3/5 (c) 2/7 (d) 0 a Let t = -13 - -7. Let j be (-3 + 4)t/21. Let s = -2.64 - -2.94. Which is the second biggest value? (a) s (b) j (c) 2/7 c Let m = -5 + 10. Let q be (-1390)/932 - m/5. Let o = q + -2/233. What is the smallest value in 1/5, 4/3, o? o Let g = -2/175 + -151/2100. Let h = -173 - -169. Which is the third biggest value? (a) h (b) -1 (c) -2/9 (d) g b Let x = -0.7166 + 0.0166. What is the third smallest value in x, 0.1, -0.1? 0.1 Let j = 193 - 193.308. Let f = j + 0.008. Let h = 0.4 - -0.1. What is the second smallest value in -0.5, f, h? f Let q = -1.94 + -1.06. What is the third smallest value in -5/2, 4, q, -4? -5/2 Let z = 0.02 + -0.42. Let k = 11.14 + -11. Let r = -3.86 - k. What is the third biggest value in 2/11, r, z? r Let w be ((-9)/(-21))/((-2)/(-14)). Suppose -wi + 16 = -2i. Suppose 18r - ir = 8. Which is the second biggest value? (a) 2/29 (b) r (c) -3 a Let i = 32 + -36. Let s = 19 + i. Let l = 16 - s. What is the second smallest value in 0.3, -0.3, l? 0.3 Let n = 0.0104 - -0.0996. Which is the second biggest value? (a) 1 (b) 4 (c) n (d) -1/4 a Let r be ((-9)/(-6))/(1 - 7). Let c(a) = 133a + 132. Let t be c(-1). What is the biggest value in t, 3, r? 3 Let q be -1 + 126/88 + (-32)/176. What is the third smallest value in 13.2, q, -5, -0.2? q Let o be (-10)/3 - (-2)/(-3). Suppose -19m - 5m = -12m + 60. Which is the fourth biggest value? (a) o (b) 9 (c) 0 (d) m d Let c be (6/3)/(2/41). Suppose 5l + o - 185 = 0, 48 = l - 72o + 70o. Let a = c - l. What is the smallest value in a, -2/7, 0? -2/7 Let h = 1117.2 + -1117. Which is the second biggest value? (a) -31.5 (b) h (c) 1/6 c Let w be (-9 + 1)16/16. Let o be (w/20)/(14/(-10)). What is the smallest value in 4/3, 1, o? o Let t(i) = -i2 + 40i - 175. Let r be t(5). What is the second smallest value in -0.054, -2/3, r? -0.054 Suppose 40 = -2p - 2p. Let n be (p/(-3))/((-3)/117). Let s = 912/7 + n. What is the biggest value in -6/5, -0.7, s? s Let i be 4/7831. Let f = -1929694/212835 + -2/42567. Let m = f - -42/5. What is the biggest value in i, 0.2, m? 0.2 Let g = -0.8 + -0.2. Let x = g + -1. Let j be 6/(-16)(-8)/12. What is the second smallest value in 1, x, j? j Let l be (-3 - -6)/(-4 - 1). Let m = 4/13 + 1/39. Let f = 3463/3 + -1155. What is the biggest value in m, l, f? m Let p = -5 + 0. Let n = -8 - -8.3. Let o = 0.835 + -0.935. What is the second smallest value in p, n, o? o Let w = 22 - 19. Let d be (2/2 - 2)/(-9 - -12). What is the smallest value in d, -2, w? -2 Let f = -73 - -113. Let h = f - 40.6. Which is the biggest value? (a) 2/17 (b) h (c) -5 a Let l = 0.9 + -1.1. Let k = -27 + 1. Let s = -21 - k. What is the second smallest value in s, l, 1/5? 1/5 Let n = 79 - 77.4. Let w = -2 + 1. Let f = n + w. Which is the third smallest value? (a) 1 (b) f (c) -2 a Let s = -9 - -4. Let n = 639/4 + -319/2. What is the smallest value in -4, s, -2/19, n? s Let y be (9/6)/((126/(-4))/9). Which is the smallest value? (a) -0.1 (b) 22 (c) y c Let y be 92/(-10 + 16/2). What is the second biggest value in 2/21, y, -0.3? -0.3 Suppose d + 20 = -13. Let r = -94/3 - d. What is the second biggest value in 3, r, 1/4? r Let s(o) = o3 + 3o*2 - 10o + 7. Let i be s(-5). Let v be (i/42 - 3/(-2))-1. What is the fourth biggest value in 1, v, -0.3, 0.4? v Let l = 0.1 + -0.3. Let p = -0.12 - 0.38. Let o = l - p. Which is the second smallest value? (a) o (b) 3/5 (c) 3 b Let q(c) = -10c + 38. Let i be q(4). Let w = 0 - i. What is the smallest value in w, 9, -2/9, -0.1? -2/9 Let f be 24/(-70)(-15)/(-6). Let c = -13 - -12.6. What is the third biggest value in 4, c, f? f Let n = -2/569 - -1723/4552. Let y = 0.7 - 0.2. Let t = 45407/13 + -3493. Which is the biggest value? (a) y (b) n (c) t a Let c = -0.4 - 2.6. Let p = 130 - 130.2. What is the biggest value in p, -2/9, c, 2/3? 2/3 Let f = -8.1 + 8. Let t = 0.11 + 0.79. Let x = -0.1 - t. Which is the second smallest value? (a) f (b) -5 (c) x c Let c = 634 - 3172/5. What is the fourth smallest value in 0.02, 1, c, -5? 1 Let h = 2.135 + -5.135. Which is the second biggest value? (a) h (b) 5 (c) 3 (d) 196 b Let a = 58/259 + -3/37. Let h = 1.38 - 1.28. What is the second biggest value in 0.3, a, h? a Let t = 0.1 - 0.5. Let i(f) = -45f - 48. Let m be i(-1). Which is the third biggest value? (a) 0.9 (b) t (c) m c Let v = -0.099 - -0.299. Which is the fourth smallest value? (a) v (b) 7 (c) -0.2 (d) -2 b Let g = 5.7 + -0.7. Let o be 5/6(1 + (-72)/40). Which is the smallest value? (a) -0.3 (b) o (c) 3 (d) g b Let z = -1/356 - 707/1780. What is the second biggest value in 2/7, z, -32? z Let u be 32/(-12)(-9)/84. Let o be (-3)/(0 - (0 + 1)). What is the third biggest value in -2, u, o? -2 Let o = 0.5 + -0.48. Let i(f) = f*3 - 21f*2 - 22f - 4. Let l be i(22). Which is the biggest value? (a) -2 (b) l (c) o c Let v = 2 - -1. Let k be (v - 0) + -9 + 3. Which is the second smallest value? (a) 3 (b) 4 (c) k a Let x = 1593 + -1588. Let t = 78 + -78.43. Let i = t + 0.03. Which is the second biggest value? (a) x (b) 3 (c) i b Suppose -97x - 72 = -73x. Which is the third biggest value? (a) 5 (b) 0.07 (c) -0.13 (d) x c Let s = -578 - -577.95. What is the third smallest value in 0.4, 1, -1, s? 0.4 Let l = -9/7 - -74/63. Let v = 5389 - 5388.9. What is the second smallest value in l, 3, -1, v? l Let t = -108/5 + 962/45. Which is the biggest value? (a) t (b) 2 (c) 42 (d) -1/4 c Let d = -0.06 - -0.11. Let u = -2.05 + d. Let z = -189.5 - -189. Which is the second biggest value? (a) -3 (b) z (c) u c Let u = 4.2 - -0.8. Let o = 58.1 + -53. Let y = o - 1.1. Which is the third biggest value? (a) 0 (b) u (c) y a Let h = 2.54 + -3.6. Let x = h + 1. Let k = -0.36 - x. Which is the biggest value? (a) k (b) 0.3 (c) 0.4 c Let y = -5906251/72174 - -2/12029. Let s = y + 82. Which is the smallest value? (a) s (b) -1 (c) -0.05 (d) -1/4 b Let o = -397 + 388. Let m = -47.9 + 48. What is the third biggest value in o, m, 5? o Let b be (4/(-68))/(3/(-3)). What is the second biggest value in 5, b, 1/9? 1/9 Suppose -4q = -x - 15, 94q - 91q = 3x. Which is the fourth smallest value? (a) 3/2 (b) 0 (c) 13 (d) x c Let f = -59 - -107. Let z = -34 + f. Let w = z - 11. What is the second smallest value in -4, 0.1, w? 0.1 Let t = -35/76 + 4/19. Which is the fourth biggest value? (a) -4 (b) t (c) -0.9 (d) -0.3 a Let y = 142/9 - 16. Which is the fourth smallest value? (a) 0 (b) 2 (c) y (d) 1 b Suppose -x - w + 16	{ "pile_set_name": "DM Mathematics" }
at comes next: 62886, 63131, 63368, 63591, 63794, 63971, 64116? 64223 What is the next term in -15378, -36506, -57636, -78768, -99902, -121038? -142176 What comes next: -17129, -11015, -805, 13507, 31927, 54461, 81115? 111895 What is next in -300669, -299679, -298687, -297693, -296697, -295699, -294699? -293697 What is the next term in -5440, -3956, -1482, 1982, 6436? 11880 What is the next term in -3544, -7050, -10544, -14026? -17496 What is next in -4486520, -4486522, -4486524, -4486526? -4486528 What comes next: -107978, -215946, -323914, -431882, -539850? -647818 What is next in 559, 1997, 4411, 7825, 12263? 17749 What is next in -10, -167, -622, -1531, -3050, -5335, -8542, -12827? -18346 What is next in 1127166, 2254223, 3381278, 4508331, 5635382? 6762431 What is the next term in 5948, 9676, 13404, 17132, 20860? 24588 What is the next term in -40818821, -81637636, -122456451, -163275266, -204094081, -244912896? -285731711 What comes next: 48235, 96579, 144933, 193303, 241695, 290115, 338569? 387063 What is the next term in -10368, -13296, -16224, -19152, -22080, -25008? -27936 What is next in 262061, 261816, 261573, 261332, 261093, 260856, 260621? 260388 What is next in -774716, -3098772, -6972168, -12394898, -19366956, -27888336, -37959032, -49579038? -62748348 What is next in -550, -4501, -15256, -36223, -70810, -122425, -194476? -290371 What comes next: 3532320, 3532326, 3532332? 3532338 What is next in 21241, 41983, 62725, 83467, 104209? 124951 What is next in 5904, 23670, 53300, 94794? 148152 What is the next term in 2121, 2142, 2183, 2250, 2349, 2486, 2667? 2898 What is the next term in 9840, 9587, 9342, 9105, 8876, 8655, 8442? 8237 What is next in -190, -1045, -2866, -5977, -10702, -17365, -26290, -37801? -52222 What comes next: 12070, 12685, 13300, 13915, 14530, 15145? 15760 What is the next term in -14467676, -14467674, -14467672, -14467670, -14467668? -14467666 What is next in -60644, -60839, -61170, -61643, -62264? -63039 What comes next: 604397, 2417607, 5439613, 9670409, 15109989, 21758347? 29615477 What is next in 4986787, 9973594, 14960389, 19947166, 24933919, 29920642, 34907329, 39893974? 44880571 What comes next: -6714, -7421, -8122, -8811, -9482? -10129 What is next in 3788, 7087, 10084, 12773, 15148, 17203, 18932? 20329 What comes next: 821395, 3285601, 7392613, 13142431, 20535055, 29570485, 40248721? 52569763 What comes next: 2425, 4697, 7003, 9349, 11741? 14185 What is next in 3907, 7990, 12065, 16132, 20191? 24242 What comes next: 68504, 136986, 205468, 273950, 342432? 410914 What is next in -2914517, -2914462, -2914409, -2914358, -2914309, -2914262, -2914217? -2914174 What is the next term in -431, -1528, -3347, -5888, -9151? -13136 What comes next: -30301340, -60602692, -90904054, -121205432, -151506832? -181808260 What is the next term in 19925672, 19925668, 19925664, 19925660, 19925656? 19925652 What is the next term in -1857, -3840, -5947, -8178, -10533, -13012? -15615 What is next in -1114286, -2228576, -3342866, -4457156, -5571446, -6685736? -7800026 What comes next: -26148, -52249, -78350, -104451? -130552 What is the next term in -1874, -3768, -5688, -7634? -9606 What comes next: 7557, 7606, 7677, 7782, 7933, 8142? 8421 What is next in 947, 535, -151, -1111? -2345 What is the next term in -6033774, -12067584, -18101394, -24135204, -30169014, -36202824? -42236634 What is next in -10688, -9867, -9046? -8225 What comes next: -7737, -30440, -68179, -120960, -188789, -271672, -369615? -482624 What is the next term in -21248, -23401, -26984, -31991, -38416, -46253? -55496 What is next in -3704, -7346, -10988, -14630, -18272, -21914? -25556 What is next in -126297, -504378, -1134215, -2015814, -3149181, -4534322, -6171243, -8059950? -10200449 What is the next term in 22416, 21041, 19666, 18291? 16916 What is next in -65628, -128914, -192198, -255480? -318760 What is the next term in -41493, -41570, -41697, -41874, -42101, -42378, -42705? -43082 What is the next term in -55647, -111358, -167127, -222948, -278815? -334722 What is next in 141240, 142224, 143208? 144192 What comes next: -27894, -54115, -80336? -106557 What comes next: -24923, -47185, -69447? -91709 What is the next term in -1497226, -1497263, -1497300? -1497337 What is the next term in 102, -507, -1862, -4239, -7914, -13163, -20262? -29487 What comes next: -772, 2531, 8018, 15689, 25544, 37583, 51806? 68213 What is the next term in 58134, 55551, 51250, 45237, 37518, 28099? 16986 What is next in 293533, 293518, 293493, 293458? 293413 What is the next term in 146593690, 146593694, 146593698, 146593702? 146593706 What is the next term in -27498, -25961, -24424, -22887, -21350? -19813 What is the next term in -27948294, -55896580, -83844866, -111793152? -139741438 What comes next: -409, -658, -851, -988, -1069, -1094, -1063? -976 What is the next term in -1130, -944, -630, -188, 382, 1080, 1906? 2860 What is next in 1155, 669, -261, -1857, -4341? -7935 What comes next: -190150, -190161, -190174, -190189, -190206? -190225 What is the next term in 461, 974, 1535, 2144, 2801? 3506 What is next in 6175580, 12351124, 18526668, 24702212, 30877756, 37053300? 43228844 What is next in 12956, 25870, 38752, 51602? 64420 What is next in 14368, 14271, 14174, 14077? 13980 What is next in 120405, 240665, 360925, 481185, 601445? 721705 What is next in -3971185, -3971188, -3971191, -3971194, -3971197, -3971200? -3971203 What comes next: 29310883, 58621749, 87932615? 117243481 What is next in 10032, 36579, 63126? 89673 What is next in -22046646, -44093291, -66139936, -88186581, -110233226? -132279871 What is next in 365155, 365156, 365157, 365158, 365159? 365160 What is the next term in -1180, -2602, -4286, -6238, -8464, -10970, -13762, -16846? -20228 What is next in 56368, 221377, 495016, 877279, 1368160, 1967653, 2675752, 3492451? 4417744 What is next in -480, -2746, -7924, -17160, -31600, -52390, -80676, -117604? -164320 What comes next: -2810624, -2810610, -2810594, -2810582, -2810580, -2810594, -2810630? -2810694 What is the next term in 21133, 85247, 192095, 341677? 533993 What comes next: -2880308, -11521289, -25922924, -46085213, -72008156? -103691753 What is next in 64290, 128833, 193830, 259509, 326098? 393825 What is the next term in 48206899, 96413802, 144620705, 192827608, 241034511? 289241414 What is the next term in 1955, 3893, 5813, 7703, 9551, 11345? 13073 What is next in -6811413, -13622789, -20434165, -27245541, -34056917, -40868293? -47679669 What is next in -412595, -412574, -412553? -412532 What is next in 43586, 43545, 43492, 43439, 43398? 43381 What is next in -44629, -51530, -58431, -65332, -72233? -79134 What is the next term in 336182, 676096, 1016010, 1355924, 1695838? 2035752 What is next in -5482, -4957, -3582, -949, 3350, 9723? 18578 What comes next: 3415829, 3415826, 3415813, 3415784, 3415733, 3415654, 3415541, 3415388? 3415189 What is next in -1618579, -3237163, -4855747, -6474331, -8092915? -9711499 What is next in -8927365, -35709480, -80346337, -142837936, -223184277, -321385360? -437441185 What is the next term in 1136476642, 1136476645, 1136476650, 1136476657, 1136476666? 1136476677 What comes next: -105422734, -210845466, -316268198, -421690930? -527113662 What is the next term in -78830, -156803, -234768, -312725? -390674 What is next in 2423, 13891, 34401, 63953? 102547 What is the next term in 1545659, 3091732, 4637807, 6183884? 7729963 What is next in 389728, 1558921, 3507580, 6235705? 9743296 What comes next: -65450, -523665, -1767398, -4189409, -8182458, -14139305? -22452710 What comes next: -2617, -9902, -22009, -38938, -60689, -87262, -118657? -154874 What comes next: -13446, -19498, -25550? -31602 What is the next term in -2251315485, -2251315483, -2251315481? -2251315479 What is the next term in 10415693, 20831390, 31247087, 41662784? 52078481 What is next in -2130, -5384, -8638? -11892 What is next in 60571, 121004, 181419, 241816, 302195, 362556? 422899 What comes next: 10724843, 21449683, 32174523, 42899363, 53624203, 64349043? 75073883 What is next in -1218, -4986, -11256, -20028, -31302, -45078, -61356? -80136 What is next in 21655522, 43311046, 64966570, 86622094, 108277618, 129933142? 151588666 What comes next: -9	{ "pile_set_name": "DM Mathematics" }
Let c = -311 + 312. What are the prime factors of -8 - (c - 5) - (-800)/2? 2, 3, 11 Let o be (0 - -4) + (1 - 1) + -3. Let u be -1 + o(-3)/(-9)9. Suppose 2s - uw = -2s + 482, 0 = -4w + 12. What are the prime factors of s? 2, 61 Let x = 30615 - 10884. What are the prime factors of x? 3, 6577 Suppose -4 = -2m, -3371 = -4t + 4m + 3753. What are the prime factors of t? 1783 Let p(h) = 2h*2 - 5. Let k be p(2). Suppose -5i - 2a + ka = -5708, -i + 3a + 1150 = 0. List the prime factors of i. 7, 163 List the prime factors of 707((-2)/5 + 2479/335). 7, 101 Let v(j) = -69j2 - 7j + 10. Let y(k) = 2k3 - 7k*2 + 3k - 6. Let z be y(3). Let l be v(z). What are the prime factors of (-128)/60 - -2 - l/15? 2, 3 Suppose -5z + 2116 = 2v, -12z + 9z + 1257 = -3v. List the prime factors of z. 2, 211 Let i = -474 - -968. Suppose -ia + 488a = -10290. What are the prime factors of a? 5, 7 Suppose -54s + 695623 = 30s - s. List the prime factors of s. 17, 29 Let m(i) = 11i*3 - 4i*2 - 17i - 29. What are the prime factors of m(7)? 3, 127 Let n(z) = 32 + 19z + 18 - 6z*2 - 10 + 5z2. List the prime factors of n(17). 2, 37 Let i be ((-5)/(-10))/(1/(-38)). Let d = -25 - i. Let z(a) = a3 + 6a2 - 6a - 12. List the prime factors of z(d). 2, 3 Suppose 18j + 2c - 15 = 17j, 40 = 5j + 3c. Suppose -y - j = -8, -5g + 3y + 2826 = 0. List the prime factors of g. 3, 7 Let l(a) = 104a - 806. Let d be l(7). Let j = 73 + 57. Let n = d + j. What are the prime factors of n? 2, 13 Let z(b) = 77b2 - 5b + 10. Let g(h) = -153h2 + 10h - 21. Let n(f) = -3g(f) - 5z(f). List the prime factors of n(2). 13, 23 Suppose 0 = 18f - 81 + 9. List the prime factors of 4950/f(-2)/(-3). 3, 5, 11 Let w = -1628 + 3452. Suppose 0 = 51m - 43m - w. List the prime factors of m. 2, 3, 19 Suppose -4l - 39998 = -2v, l - 79989 = -4v + 2l. What are the prime factors of v? 19997 Let p = -10660 + 18734. What are the prime factors of p? 2, 11, 367 Let o(w) = -3w2 - 37w + 10. Let p be o(-13). Let v(j) = -32j + 14. List the prime factors of v(p). 2, 263 Let o be 222/4. Suppose 2 = ob, -3w + 4 = -7w + 4b. Suppose w = 3t - 3, 0 = -2f - 4t + 184 + 14. What are the prime factors of f? 97 Suppose -16m - 7078 = -21m - 2k, -12 = 2k. What are the prime factors of m? 2, 709 Suppose 5f + b = 17682 + 36799, -5 = -5b. List the prime factors of f. 2, 3, 227 Let z be (-2)/4(-4)/(-6)-9. Suppose q + 3q = 4, 0 = zg + 4q - 13. Suppose j + 0j - 15 = -gy, 4j - 4y + 4 = 0. List the prime factors of j. 3 Suppose -56h + 888 = -50h. Let l = h - -218. What are the prime factors of l? 2, 3, 61 Let t = -138 - 422. Let w = -524 - t. What are the prime factors of w? 2, 3 Let u(h) = 734h*2 - 6h - 3. Suppose 4k = -10k - 14. What are the prime factors of u(k)? 11, 67 Suppose -5v + 997 = 3i, -998 = -3v - 2v - 2i. Suppose v = 4q - 352. What are the prime factors of q? 2, 3, 23 Let x = 92 - 100. Suppose 5w = 6w - 63. Let k = w - x. List the prime factors of k. 71 Suppose -i + 5 - 10 = 0. Let c be (1/(-2))/(1197/(-238) - i). Suppose cw - 492 = 15w. What are the prime factors of w? 2, 3, 41 Let m = -181 + 293. Suppose -93k - 5681 = -mk. What are the prime factors of k? 13, 23 Let m be (-7)/5 + 6/15. Let f be ((-39)/(-6))/(m/2). Let i = 4 - f. What are the prime factors of i? 17 Let n(l) = l + 1. Let z(a) = 16a + 1. Let g(f) = 3n(f) - z(f). Let b be g(-2). Suppose 32c - bc = 340. What are the prime factors of c? 5, 17 Let c be (2 - 4 - -1)/((-2)/6). Let d be (0 + -1 + c)12. What are the prime factors of (d - 303/6)/(3/(-8))? 2, 31 Let l(q) = 50q + 3 + 6q*2 - 6 - 45q. What are the prime factors of l(4)? 113 Let x be (-6)/(-39) - (-120)/65. Suppose 0 = xu + 35 - 107. List the prime factors of u. 2, 3 Let a = -921 + -1456. Let t = a + 3388. List the prime factors of t. 3, 337 Let w(c) = -c2 - 3c + 10. Let g be w(0). What are the prime factors of (318/18)/((g/5)/66)? 11, 53 Let u be (-20)/(-8)-2 + 2440/4. Let i = -148 + u. List the prime factors of i. 457 Suppose -5y + 0b + 4b + 11 = 0, 0 = 3y - 2b - 7. Suppose 4p + yp = -7. Let a = p - -88. List the prime factors of a. 3, 29 Let i be 19 - (15 + (-7 - 1)). What are the prime factors of (-260)/(-78)i/(-10) + 439? 3, 5, 29 Suppose -3h + 5q - 121 = 0, 4 = -2q - 2q. Let s = h + 62. Suppose -4i + s = -i - 2y, 4y = -i + 30. What are the prime factors of i? 2, 5 Let p(b) = -b*3 - 24b*2 - 5b - 32. Let o be p(-24). Let t be (-16)/(-7) + 4/(-14). Suppose tv - v = o. List the prime factors of v. 2, 11 Suppose -m + 6m = -4g, 0 = 4g + 4m. Suppose g = -62i + 64i - 1100. What are the prime factors of i? 2, 5, 11 Let m be (-753)/(-5) - 7/((-175)/10). Let k = 48 - m. Let g = 12 - k. List the prime factors of g. 5, 23 Let c = -77 + 114. Let x = 19 - 19. Let i = c - x. What are the prime factors of i? 37 Let v = 6 + -16. Let d(a) = -3 - 11158a + 11131a - 1. List the prime factors of d(v). 2, 7, 19 Let c(p) = 5p + p + 8p + p. Let i = -9 + 17. What are the prime factors of c(i)? 2, 3, 5 Let y be (-4)/1 + 11 + 0 + -1. Suppose -yq + 10 = -176. What are the prime factors of q? 31 Suppose -6m + 50628 = -73836 + 12132. What are the prime factors of m? 2, 11, 23, 37 Let z = 43742 - -16423. List the prime factors of z. 3, 5, 7, 191 List the prime factors of ((-287464)/48 + (-3)/(-2))/((-8)/12). 7, 1283 List the prime factors of -1 - -8 - (-14185)/((-10)/30-3). 2, 887 Let o(f) = 1 + 59f2 - 9f + 3f - 8f + 17f. List the prime factors of o(2). 3 Let o be (1 + 27/6)2. Suppose -o = -3i + 13. List the prime factors of i/4101/2. 101 Let h(x) = x*2 - 22x - 15. Let y be h(24). Suppose y = 6a - 3a. Suppose 0 = 3r - 5k - 325, -3k = 4 + a. What are the prime factors of r? 2, 5 Let q(n) be the second derivative of -3n5/5 + n4/6 + n3/2 - n2 + 44n. Let p be q(2). Let y = p + 133. What are the prime factors of y? 7 Let c(h) = 11h*2 + 86h + 86. List the prime factors of c(-37). 7, 1709 Let v = -257 - -281. List the prime factors of 1131/(4v/32). 13, 29 What are the prime factors of (-1 + 2)(15196 - -199)? 5, 3079 Suppose i - 2i - 17 = -5d, -3i = 2d - 17. Suppose dk - z = 28, 0z = k + 3z - 20. Suppose -kh = -11h + 54. What are the prime factors of h? 2, 3 Suppose 129n = 124n + 4q + 265046, 5n + 5q - 265100 = 0. List the prime factors of n. 2, 13, 2039 Suppose 5o + 10 = -10, -5s + 2o = -42308. Suppose -s = -0k - 15k. What are the prime factors of k? 2, 3, 47 Suppose 48 = -70z + 66z. What are the prime factors of ((-2)/z + (-145)/150)-440? 2, 11 Suppose 5k - 112 = 18. Let r be -23 + k + -1 + 2/2. List the prime factors of (-10)/(-3r/117). 2, 5, 13 Let p(n) = 777n2 + 37n - 83. List the prime factors of p(3). 7, 17, 59 What are the prime factors of 12385 + (-255)/3410/(-25)? 2, 19, 163 Let k(j) = 45j - 7. Let d be (1 + 2)((-4)/(-12) + -1). Let z be k(d). Let a = 155 + z. List the prime factors of a. 2, 29 Suppose -11p + 5925 + 11730 = 0. What are the prime factors of p? 3, 5, 107 Let f(t) = t*3 - 29t*2 - 3t - 24. Let w be f(31). Let m = w - 1289. What are the prime factors of m? 2, 3, 43 Suppose 4y + 2 = -26, 0 = -5s + 3y + 182126. List the prime factors of s. 7, 11, 43 Let q = -122 + 281. Suppose 5l + 3i = 351, -5i + 0i = -2l + q. Let o = l - 69. List the prime factors of o. 3 Let f = 2114 - 1214. Suppose -2d = -0d + 4, -q - 5d + f = 0. Suppose 0 = 4s + 6s - q. List the prime factors of s. 7, 13 Let l(h) = 8077h*2 + 103h - 104. List the prime factors of l(1). 2, 3, 673 Let p be (-9)/(9 + (-50900)/5655). List the prime factors of (((-28)/6)/(-7))/(6/p). 3, 13, 29 Let s = -529 - -3251. Suppose -904 = 6o - s. List the prime factors of o. 3, 101 Let m(x) be the third derivative of x5/60 - x4/6 - 28x*3/3 + 10x*2 + 3x. List the prime factors of m(-12). 2, 17 Let r(w) = -w*2 - 25w - 31. Suppose -10 = a - 2o, -5o = 5a - o + 78. List the prime factors of r(a). 3, 41 Suppose 4c - 5w - 95 = 0, 2c - 17 - 35 = 4w. Let l = c + 50. Suppose 0 = u - l + 4. List the prime factors of u. 2, 3, 11 Suppose 186h - 56 = 184h. Suppose -1050 = -3r - 2r. Suppose -31i + h*i = -r. List the prime factors of i. 2, 5, 7 L	{ "pile_set_name": "DM Mathematics" }
number? False Is 2831 composite? True Is 4890251 a composite number? False Is 269867 prime? False Is 71773 a composite number? True Is 208381 composite? True Is 6121 a composite number? False Is 4201 prime? True Is 40813 prime? True Is 1732099 composite? True Is 29219 a composite number? True Is 24803 a prime number? False Is 1352749 a composite number? False Is 82133 composite? True Is 923903 a composite number? False Is 642769 a composite number? False Is 44633 prime? True Is 11641 a composite number? True Is 11789 a prime number? True Is 4985759 a composite number? True Is 296363 prime? True Is 19607 composite? True Is 1279 prime? True Is 12763 a composite number? False Is 2419 prime? False Is 44359 a composite number? True Is 756039 prime? False Is 6065 composite? True Is 237547 composite? False Is 29243 a prime number? True Is 33997 prime? True Is 34637 prime? False Is 401623 prime? False Is 15109 a composite number? True Is 18503 prime? True Is 557 prime? True Is 3389 prime? True Is 14173 a composite number? False Is 8741 prime? True Is 3239083 a composite number? True Is 8219 a prime number? True Is 2833 a prime number? True Is 1401071 a prime number? False Is 309251 prime? True Is 593839 composite? False Is 130619 composite? False Is 238703 a composite number? False Is 154367 a composite number? True Is 648947 a prime number? False Is 29102 prime? False Is 208597 composite? True Is 124897 a composite number? False Is 1439 a prime number? True Is 174355 prime? False Is 798943 a prime number? True Is 16505 a prime number? False Is 10379 composite? True Is 75149 prime? True Is 102041 a composite number? True Is 15859 a composite number? False Is 17213 a prime number? False Is 32187 a prime number? False Is 4751 a prime number? True Is 569945 a prime number? False Is 2503 prime? True Is 144862 composite? True Is 490367 composite? False Is 3901 a prime number? False Is 163531 prime? False Is 62941 a prime number? False Is 5142785 composite? True Is 7559 composite? False Is 1001191 a composite number? False Is 968313 composite? True Is 215297 a composite number? False Is 250427 prime? False Is 8147 composite? False Is 15547 prime? False Is 9967 composite? False Is 24943 a prime number? True Is 14341 composite? False Is 7801 prime? False Is 10951 a prime number? False Is 78878 prime? False Is 787 a composite number? False Is 88687 a composite number? True Is 626239 prime? True Is 20807 composite? False Is 131591 a prime number? True Is 21377 a prime number? True Is 5039 a prime number? True Is 2591 a composite number? False Is 6521 composite? False Is 19121 a composite number? False Is 4691 composite? False Is 11157 a composite number? True Is 3646 composite? True Is 395191 a composite number? False Is 106439 prime? False Is 371 prime? False Is 57413 prime? True Is 3797 a prime number? True Is 17011 a composite number? False Is 37523 prime? False Is 5077 a composite number? False Is 222559 a composite number? True Is 104459 a composite number? False Is 211129 prime? True Is 49807 prime? True Is 63449 prime? False Is 3557 prime? True Is 29269 a composite number? False Is 8039 a prime number? True Is 13229 a composite number? False Is 575241 a composite number? True Is 2927 composite? False Is 11959 composite? False Is 1228705 a prime number? False Is 15727 a prime number? True Is 9551 a composite number? False Is 49103 prime? True Is 74751 a prime number? False Is 411637 prime? True Is 8354 a composite number? True Is 149993 composite? False Is 1597121 a composite number? True Is 20477 a prime number? True Is 11351 a composite number? False Is 494573 prime? False Is 1206301 prime? False Is 152909 a prime number? True Is 186071 a prime number? True Is 10499 composite? False Is 152879 a composite number? False Is 22467 prime? False Is 39115 a prime number? False Is 163193 composite? False Is 73433 a prime number? True Is 39 a composite number? True Is 17669 a prime number? True Is 1572481 composite? True Is 1125517 a composite number? True Is 2927 prime? True Is 19709 a composite number? False Is 630281 a composite number? False Is 5703 a prime number? False Is 174497 composite? True Is 2279669 a composite number? True Is 395807 a prime number? False Is 34247 prime? False Is 9199 composite? False Is 367357 a composite number? False Is 831911 a prime number? True Is 40897 prime? True Is 14377 a prime number? False Is 2744491 a composite number? False Is 101221 a prime number? True Is 493831 a prime number? False Is 38593 a composite number? False Is 8903 a composite number? True Is 25057 a prime number? True Is 39731 composite? True Is 297359 prime? True Is 115807 prime? True Is 10771 composite? False Is 51893 a prime number? True Is 1042009 composite? True Is 639185 prime? False Is 334349 prime? True Is 119953 composite? False Is 10765 prime? False Is 21779 prime? False Is 32909 prime? True Is 641 composite? False Is 93809 a prime number? True Is 226283 a prime number? True Is 114461 prime? False Is 89041 composite? False Is 9859 a composite number? False Is 69371 a prime number? True Is 9467 prime? True Is 17861 a prime number? False Is 529619 a composite number? False Is 3709 prime? True Is 73241 composite? True Is 169987 prime? True Is 306713 composite? True Is 721007 a prime number? False Is 2095 a composite number? True Is 3959 composite? True Is 21259 composite? True Is 28697 composite? False Is 224443 prime? True Is 17681 a prime number? True Is 769 composite? False Is 1151807 a prime number? True Is 607211 prime? False Is 29009 a prime number? True Is 14867 composite? False Is 43637 composite? True Is 4759 composite? False Is 655679 composite? True Is 5557489 a prime number? False Is 258617 prime? True Is 1544143 prime? False Is 6299 composite? False Is 13259 composite? False Is 7723 a prime number? True Is 327269 a prime number? False Is 63949 composite? False Is 28751 prime? True Is 1796809 composite? True Is 701 a prime number? True Is 59881 prime? False Is 1537 prime? False Is 197803 composite? False Is 128549 a composite number? False Is 30201 prime? False Is 87089 a prime number? False Is 379159 prime? False Is 21635 composite? True Is 413951 composite? False Is 55795 a composite number? True Is 97 prime? True Is 545297 a composite number? True Is 429647 composite? True Is 1315349 a prime number? False Is 152681 a composite number? False Is 15013 prime? True Is 129707 a composite number? False Is 171733 composite? False Is 641 prime? True Is 18897 composite? True Is 5137 a composite number? True Is 5179 a prime number? True Is 21313 a prime number? True Is 541 a composite number? False Is 3593 a prime number? True Is 83023 composite? False Is 10529 prime? True Is 23 a composite number? False Is 61041 a composite number? True Is 734 a composite number? True Is 190753 a composite number? False Is 97819 a composite number? True Is 134429 composite? True Is 66779 composite? True Is 26977 prime? False Is 8941 prime? True Is 400909 prime? False Is 24223 composite? False Is 502 composite? True Is 48073 prime? True Is 84857 composite? False Is 98961 a composite number? True Is 173969 a composite number? False Is 710777 prime? True Is 6805 a composite number? True Is 696469 a composite number? True Is 102761 a prime number? True Is 150333 a prime number? False Is 2074433 a prime number? True Is 1027223 a composite number? False Is 13667 a composite number? True Is 45763 prime? True Is 192161 prime? True Is 136127 a prime number? False Is 26753 a prime number? False Is 56395 composite? True Is 5953 a prime number? True Is 29909 prime? False Is 2459 prime? True Is 1121423 a composite number? False Is 4645 a composite number? True Is 188867 composite? True Is 42233 a prime number? False Is 13649 a prime number? True Is 15221 composite? True Is 78059 prime? True Is 26209 a composite number? False Is 184669 a prime number? True Is 751186 prime? False Is 1155373 prime? True Is 49003 composite? False Is 16361 a composite number? False Is 152183 a prime number? True Is 192715 prime? False Is 1820201 a composite number? False Is 57003 prime? False Is 7051 composite? True Is 298985 prime? False Is 2141515 prime? False Is 122263 a composite numbe	{ "pile_set_name": "DM Mathematics" }
ided by 61? 55 What is the remainder when 5225 is divided by 40? 25 Calculate the remainder when 1976 is divided by 46. 44 What is the remainder when 666 is divided by 218? 12 What is the remainder when 118 is divided by 52? 14 What is the remainder when 4739 is divided by 4734? 5 What is the remainder when 56 is divided by 16? 8 Calculate the remainder when 254 is divided by 29. 22 What is the remainder when 77 is divided by 24? 5 What is the remainder when 758 is divided by 192? 182 Calculate the remainder when 898 is divided by 12. 10 Calculate the remainder when 256 is divided by 123. 10 What is the remainder when 2325 is divided by 63? 57 Calculate the remainder when 115 is divided by 59. 56 What is the remainder when 3024 is divided by 11? 10 What is the remainder when 310 is divided by 13? 11 Calculate the remainder when 261 is divided by 113. 35 What is the remainder when 271 is divided by 22? 7 What is the remainder when 365 is divided by 75? 65 What is the remainder when 44053 is divided by 267? 265 What is the remainder when 295 is divided by 288? 7 Calculate the remainder when 65 is divided by 37. 28 What is the remainder when 325 is divided by 161? 3 Calculate the remainder when 1017 is divided by 20. 17 What is the remainder when 298 is divided by 101? 96 What is the remainder when 2126 is divided by 704? 14 Calculate the remainder when 211 is divided by 67. 10 Calculate the remainder when 259 is divided by 89. 81 What is the remainder when 12263 is divided by 4083? 14 Calculate the remainder when 62 is divided by 7. 6 What is the remainder when 1339 is divided by 71? 61 Calculate the remainder when 3702 is divided by 3700. 2 Calculate the remainder when 8271 is divided by 2750. 21 Calculate the remainder when 1516 is divided by 190. 186 What is the remainder when 125 is divided by 31? 1 What is the remainder when 188 is divided by 10? 8 What is the remainder when 2910 is divided by 2907? 3 What is the remainder when 523 is divided by 15? 13 What is the remainder when 65 is divided by 17? 14 Calculate the remainder when 6858 is divided by 73. 69 Calculate the remainder when 3584 is divided by 13. 9 What is the remainder when 2447 is divided by 81? 17 Calculate the remainder when 212 is divided by 145. 67 What is the remainder when 165 is divided by 154? 11 What is the remainder when 3968 is divided by 3956? 12 What is the remainder when 296 is divided by 43? 38 What is the remainder when 904 is divided by 130? 124 What is the remainder when 680 is divided by 174? 158 Calculate the remainder when 945 is divided by 6. 3 Calculate the remainder when 18381 is divided by 14. 13 What is the remainder when 1374 is divided by 201? 168 Calculate the remainder when 3467 is divided by 157. 13 What is the remainder when 1191 is divided by 379? 54 Calculate the remainder when 2347 is divided by 11. 4 What is the remainder when 576 is divided by 58? 54 What is the remainder when 1338 is divided by 206? 102 Calculate the remainder when 208 is divided by 19. 18 Calculate the remainder when 2539 is divided by 38. 31 Calculate the remainder when 348 is divided by 44. 40 Calculate the remainder when 554 is divided by 92. 2 Calculate the remainder when 1805 is divided by 42. 41 Calculate the remainder when 2242 is divided by 11. 9 What is the remainder when 71 is divided by 8? 7 Calculate the remainder when 1758 is divided by 124. 22 Calculate the remainder when 5860 is divided by 41. 38 What is the remainder when 264 is divided by 181? 83 Calculate the remainder when 156 is divided by 41. 33 Calculate the remainder when 218 is divided by 25. 18 Calculate the remainder when 157 is divided by 72. 13 What is the remainder when 153 is divided by 6? 3 What is the remainder when 1037 is divided by 104? 101 What is the remainder when 514 is divided by 29? 21 What is the remainder when 1013 is divided by 251? 9 Calculate the remainder when 2025 is divided by 29. 24 What is the remainder when 323 is divided by 296? 27 What is the remainder when 472 is divided by 39? 4 Calculate the remainder when 121 is divided by 25. 21 What is the remainder when 8521 is divided by 203? 198 Calculate the remainder when 196 is divided by 101. 95 Calculate the remainder when 6449 is divided by 716. 5 Calculate the remainder when 77 is divided by 60. 17 What is the remainder when 79 is divided by 5? 4 Calculate the remainder when 757 is divided by 151. 2 Calculate the remainder when 835 is divided by 179. 119 Calculate the remainder when 2448 is divided by 129. 126 What is the remainder when 122 is divided by 62? 60 What is the remainder when 107 is divided by 28? 23 Calculate the remainder when 233 is divided by 18. 17 What is the remainder when 247 is divided by 62? 61 Calculate the remainder when 4130 is divided by 84. 14 What is the remainder when 540 is divided by 68? 64 What is the remainder when 96 is divided by 36? 24 What is the remainder when 989 is divided by 159? 35 What is the remainder when 511 is divided by 19? 17 What is the remainder when 471 is divided by 118? 117 Calculate the remainder when 102 is divided by 27. 21 Calculate the remainder when 30 is divided by 18. 12 Calculate the remainder when 2205 is divided by 535. 65 What is the remainder when 94 is divided by 40? 14 Calculate the remainder when 835 is divided by 22. 21 Calculate the remainder when 220 is divided by 28. 24 What is the remainder when 543 is divided by 184? 175 What is the remainder when 3139 is divided by 9? 7 What is the remainder when 818 is divided by 41? 39 Calculate the remainder when 593 is divided by 83. 12 What is the remainder when 2076 is divided by 48? 12 Calculate the remainder when 57 is divided by 17. 6 What is the remainder when 790 is divided by 66? 64 Calculate the remainder when 2320 is divided by 14. 10 What is the remainder when 1878 is divided by 47? 45 What is the remainder when 215 is divided by 62? 29 Calculate the remainder when 4720 is divided by 62. 8 Calculate the remainder when 22663 is divided by 16. 7 What is the remainder when 13 is divided by 2? 1 What is the remainder when 5125 is divided by 177? 169 Calculate the remainder when 198 is divided by 54. 36 Calculate the remainder when 5583 is divided by 37. 33 What is the remainder when 504 is divided by 134? 102 Calculate the remainder when 731 is divided by 4. 3 What is the remainder when 331 is divided by 89? 64 Calculate the remainder when 44 is divided by 10. 4 Calculate the remainder when 186 is divided by 63. 60 Calculate the remainder when 381 is divided by 6. 3 Calculate the remainder when 1281 is divided by 56. 49 Calculate the remainder when 430 is divided by 109. 103 What is the remainder when 808 is divided by 21? 10 What is the remainder when 37882 is divided by 42? 40 Calculate the remainder when 198 is divided by 49. 2 What is the remainder when 524 is divided by 165? 29 What is the remainder when 1063 is divided by 38? 37 What is the remainder when 1395 is divided by 697? 1 Calculate the remainder when 461 is divided by 95. 81 What is the remainder when 203 is divided by 160? 43 What is the remainder when 235 is divided by 4? 3 Calculate the remainder when 375 is divided by 96. 87 Calculate the remainder when 834 is divided by 76. 74 What is the remainder when 18117 is divided by 6? 3 What is the remainder when 3279 is divided by 327? 9 What is the remainder when 100 is divided by 87? 13 What is the remainder when 191 is divided by 91? 9 Calculate the remainder when 3479 is divided by 9. 5 Calculate the remainder when 553 is divided by 20. 13 What is the remainder when 25 is divided by 22? 3 What is the remainder when 43 is divided by 11? 10 What is the remainder when 2839 is divided by 411? 373 What is the remainder when 425 is divided by 104? 9 What is the remainder when 2273 is divided by 25? 23 Calculate the remainder when 80 is divided by 23. 11 Calculate the remainder when 98 is divided by 41. 16 What is the remainder when 220 is divided by 6? 4 Calculate the remainder when 183 is divided by 34. 13 What is the remainder when 371 is divided by 93? 92 Calculate the remainder when 16 is divided by 5. 1 Calculate the remainder when 696 is divided by 115. 6 What is the remainder whe	{ "pile_set_name": "DM Mathematics" }
d be 175 + -1 - j8/(-4). Let a = d - 77. What are the prime factors of a? 3, 11 Let o = -254 + -21. Let t(c) = 94c - 90. Let m be t(6). Let r = o + m. What are the prime factors of r? 199 Suppose -3f - 8k + 10k - 12 = 0, 2k = 2f + 6. What are the prime factors of (-24 + 26)/((-2)/f)? 2, 3 Suppose -18q + 3952 = q. Let p = 665 - q. List the prime factors of p. 457 Let n(u) = u*3 - 9u*2 + 6u + 10. Let j be n(8). Let g(f) = -2f - 7f + 2f - 6f - 14 + 9f. List the prime factors of g(j). 2, 5 What are the prime factors of 1179247/214 - (-1)/2? 3, 11, 167 Suppose 162r - 159r = -h + 8389, -5h + 41855 = 5r. List the prime factors of h. 2, 37, 113 Let w(z) = -z3 - 12z*2 - 39z - 50. Let i be w(-17). Suppose -i - 5542 = -20b. List the prime factors of b. 2, 5, 19 Let f be (-4 - -1 - 4/(-4)) + 38. Suppose k + 3x = f, 3k + 0k = x + 98. Suppose p = 87 + k. What are the prime factors of p? 2, 3, 5 List the prime factors of 17127 - (10 + (-4 + 8 - 7)). 2, 5, 107 Let q(z) = 332z3. Let w be q(1). Let p be w/6(-27)/9. Let n = p - -277. What are the prime factors of n? 3, 37 Let o = 9005 + -4425. What are the prime factors of o? 2, 5, 229 List the prime factors of (-229)/((-85)/837 + 112/1736). 3, 229 Suppose p - 33173 + 85618 = 6p. What are the prime factors of p? 17, 617 Let y(s) = s3 + 13s*2 - 17s - 42. Let l be y(-14). Let t be (-65 + l)/(1 - 6/3). List the prime factors of t/1 - (2 - -3). 2, 3, 5 Let h(g) = 64g2 + 102g - 1281. What are the prime factors of h(15)? 3, 19, 257 Let t(b) = 34b - 6. Let h be t(11). Let i = 122 + h. What are the prime factors of i? 2, 5, 7 Let z = 6168 - 5112. What are the prime factors of z? 2, 3, 11 Let r = -3691 - -9865. What are the prime factors of r? 2, 3, 7 Let h(q) = -379q + 7070. List the prime factors of h(-37). 3, 79, 89 Let q = -187 + 195. List the prime factors of (q + (-92)/12)/(2/2616). 2, 109 List the prime factors of ((-7441)/(-14) - -4)620/217. 2, 3, 5, 17 Let d(m) = -m2 + 5m + 11. Let i be d(8). Let f(l) = 72l - 38 + 71l - 156l. List the prime factors of f(i). 131 Suppose 3o - 109 = 3v + 4o, -3o + 33 = -v. Let d be (-4 - -3)/((-4)/v). List the prime factors of (75/10)/(d/(-48)). 2, 5 Suppose -6z - 2437 = -7657. Suppose -5p + 2198 = n, -49n = 2p - 44n - z. What are the prime factors of p? 2, 5, 11 Let c = 3191 + 3893. What are the prime factors of c? 2, 7, 11, 23 Suppose -2n - 2f = 3f - 31, -3f + 18 = n. Let k be 41/(n - 70/25). Suppose 171 = 4a - k. What are the prime factors of a? 2, 47 Let b(y) = -y3 - 2y*2 - y - 227. Let i be b(0). Let h = i + 412. List the prime factors of h. 5, 37 List the prime factors of ((-4)/((-4)/(-5)))/1 + 28886/26. 2, 7, 79 Let v = -530 - -522. What are the prime factors of 308/32 - 10 - 4571/v? 571 Let m(c) = -24c*3 + 5c*2 + 3c + 75. List the prime factors of m(-6). 3, 13, 139 Suppose 0 = -3b - 4p + 2 - 10, -3b + 2p = 14. Suppose 0 = 4n - 4l + 28, -6l = -2n - 3l - 15. List the prime factors of -4(b/n)/(16/(-408)). 2, 17 Suppose 0 = 12r - 7r + 5m - 27015, 4m = 2r - 10836. List the prime factors of r. 2, 13 Suppose -3s + 6s - 5w = 76, -2s + 44 = -5w. Let m = -9 + 12. Suppose -2q - mo = -s, 4q - 2o = 84 - 20. List the prime factors of q. 2 Suppose n = -5f + 15300, -f = -37n + 42n - 3060. What are the prime factors of f? 2, 3, 5, 17 Let q be ((-30)/9)/((-25)/90). Suppose qw + 27269 = 49w. What are the prime factors of w? 11, 67 Let g = 17 - 5. Suppose 4i - i = -3n + g, 2i = 5n - 20. Suppose 5c - 316 = o, 12 + 224 = nc - 5o. What are the prime factors of c? 2 Let y = 988 + 106. Let g = 1556 - y. Let i = g + -212. List the prime factors of i. 2, 5 List the prime factors of (3/2(-330)/495)/(2/(-2318)). 19, 61 Let b = 92 + -75. Let i = b - 27. List the prime factors of (-10526)/(-95)i/(-4). 277 Let m(k) = 4k2 + 2k + 21. Let f be m(-10). Suppose f = 4b - 739. List the prime factors of b. 3, 5, 19 Let w(y) = 438y + 137. What are the prime factors of w(10)? 4517 Let v be (-6 + 0 + -2)2/(-16). What are the prime factors of 2/(-8)v - (-6548)/16? 409 Suppose -9 = -2q + 1. Suppose 0 = -3m - 5g + 1014, -qm - 2g = -7g - 1690. What are the prime factors of m? 2, 13 Let s(t) = -18t - 20t + 30t + 14. Suppose -10 = -2x - 28. What are the prime factors of s(x)? 2, 43 Let m(n) = -n*3 - 4n*2 + 7n - 2. Let l be m(1). Suppose l = -4q + 4o + 520, 5q = 4o + 591 + 59. What are the prime factors of q? 2, 5, 13 Let a = -13 - -15. Suppose -120 = -14m + am. List the prime factors of m. 2, 5 Let o(n) = 142n + 4. Let r be o(4). Let q be (120/(-66))/(13/(-286)). Suppose 0 = -4k - 4t + r, -5k + q = -3t - 659. List the prime factors of k. 3, 47 Let h(u) be the second derivative of u5/10 - u4/2 + 6u*3 + 7u*2 - 246u. List the prime factors of h(6). 2, 223 Let n(r) = -4r3 - 2r*2 + 13. Let d be n(-3). Let u = 626 - d. List the prime factors of u. 523 Let p be ((-79)/(-2))/(2/(-4)). Let u(y) = -2y*2 + 124y - 548. Let w be u(54). List the prime factors of (1 - 338/8)/(p/w). 3, 5, 11 Let h(p) = 37p2 + p + 10. Let m be h(-7). Suppose z + z - 5t = m, 0 = 5z - 2t - 4582. List the prime factors of z. 2, 3, 17 Let m(p) = 10p + 170. Suppose -2b = 4d - 136, -2d + 2b = -2b - 58. What are the prime factors of m(d)? 2, 5 Let x = -279 - -417. Suppose -3j + x = -j. Suppose 151 = 5n - j. What are the prime factors of n? 2, 11 Suppose -1568 = -3i - 14w + 12w, 5w = 5i - 2605. Let k = i + -128. List the prime factors of k. 2, 197 Suppose -2k + 8b + 35113 = 3b, 0 = -k + 2b + 17559. Suppose 15c - 701 - k = 0. List the prime factors of c. 2, 3, 7, 29 Let b(u) = 59u3 - 8u*2 + 8u - 44. What are the prime factors of b(4)? 2, 3, 101 Let j(b) be the first derivative of 2b3 + 9b*2/2 - 4b - 23. List the prime factors of j(-10). 2, 11, 23 Let n be -4((-76)/8 - -6). Suppose -2c - 260 = -s, -3s + nc = 11c - 780. List the prime factors of s. 2, 5, 13 Suppose -24r + 3738 + 15654 = 0. Let u = r - 401. List the prime factors of u. 11, 37 Suppose 0 = 4q + 3p - 2, 6p = 3q + 10p + 2. Let l(w) = -6w + 14. Let j be l(q). List the prime factors of 0 + 3 + j + -3 - -196. 2, 3, 11 Suppose 0 = -80n - 629790 + 1996270. List the prime factors of n. 19, 29, 31 Suppose -4g + 2j - 7j = 23, g + 2j = -8. Let l be (0(-1 - g))/(-2). Suppose 2q - 376 = -3q + o, l = 2q + 3o - 147. What are the prime factors of q? 3, 5 Let d = 32 - 250. Let v = d + 266. What are the prime factors of v? 2, 3 Let j = 56835 + -35600. What are the prime factors of j? 5, 31, 137 Suppose -3q + 4q = 5c - 70, 0 = 2c. Let v = q - -433. List the prime factors of v. 3, 11 Let p be ((-6)/4)/((-195)/3640). List the prime factors of 2506p/16(-12)/(-42). 7, 179 Let i = 43319 - 24008. What are the prime factors of i? 3, 41, 157 Let i(a) = -605a - 10328. What are the prime factors of i(-128)? 2, 8389 Let g = 6 + 11. Suppose -a + 6 = -g. Let c = 45 - a. List the prime factors of c. 2, 11 Let o = 1484 + -2921. Let v = -701 - o. List the prime factors of v. 2, 23 Let k be (3 - 2)(0 + 4951). Suppose -13x = -k - 3811. List the prime factors of x. 2, 337 Suppose 10q + 38096 = 12q + 2b, 0 = q + 4b - 19042. What are the prime factors of q? 2, 3, 5, 127 Let a(n) be the first derivative of 4n*3/3 + 10n*2 + 31n - 15. Let y(r) be the first derivative of a(r). List the prime factors of y(16). 2, 37 Let m(l) = l*3 - 6l*2 + 12l - 4. Let v be m(4). List the prime factors of v + 637 + 6 + 3/(-3). 2, 3, 109 Let y(d) = 349d3 - 5d*2 + 80d - 295. What are the prime factors of y(5)? 3, 5, 17, 19 Suppose -60x + 99457 - 68586 + 140069 = 0. What are the prime factors of x? 7, 11, 37 What are the prime factors of 1/(-9(-3)/298836)? 2, 2767 Suppose 196f - 195f = -4. Let b(p) = p*3 + 4p*2 + p + 6. Let w be b(f). List the prime factors of (235 - 0)(-8 + 7 + w). 5, 47 Let t(r) be the second derivative of -19r3 + 6r*2 - 3r. Let c be t(-2). Suppose 0 = -0b + 8b - c. What are the prime factors of b? 2, 3, 5 Suppose -9h + 45 = -0h. Suppose 5u + 4j - 1410 = 0, -3j = hu - 837 - 568. List the prime factors of u. 2, 139 Let q = -320 + 325. Suppose -600 = -j - 0j + o, -2985 = -qj	{ "pile_set_name": "DM Mathematics" }
i(1) is divided by d(9)? 15 Let b be 40/30-3 + 5 + -1. Suppose 8 = 2s - b. Calculate the remainder when 22 is divided by s. 2 Suppose -9a - 29 = -56. Suppose 27 = t - al, 4t - 2t + 2l = 14. What is the remainder when 225 is divided by t? 9 Let f(p) = 4p*2 - 4p - 182. Calculate the remainder when f(11) is divided by 7. 6 Let s = -34 - -52. Let m be (-132)/726 - (-488)/22. Let z = m - s. Calculate the remainder when 8 is divided by z. 0 Let w(v) = v*2 + 4v - 4. Let a be w(-5). Suppose -16j + 23 = -73. Calculate the remainder when j is divided by ((-3)/(-9))/(a/6). 0 Suppose -1065 + 390 = -5s. Suppose 0c = i - 2c - s, 0 = -2c. Suppose 0 = -5t + i - 50. What is the remainder when 31 is divided by t? 14 Suppose -5h = -v + 32, 2v - 2 - 27 = 3h. Let x(s) = 9s - 13. What is the remainder when x(v) is divided by 18? 14 Suppose 2x - 18 = 0, -4u + 221 = -x + 4x + 22. Let f(o) = -32o - 8. What is the remainder when f(-6) is divided by u? 12 Let z(c) = c*3 - 6c*2 - c - 29. Calculate the remainder when 2268 is divided by z(8). 84 Let c = -211 + 634. Let b(r) = 151r*2 + 1657r - 27. Calculate the remainder when c is divided by b(-11). 15 Suppose 25o - 124o = -10185 - 7536. What is the remainder when 894 is divided by o? 178 Suppose -105 = -4a + 5d, d = a + 169 - 195. Calculate the remainder when 373/1 + (4 - 5) is divided by a. 22 Let y be (1 - 52)/(-6 + 3). Suppose 8 = -3g - 4m + 1, -5m - y = g. Suppose -6 = -gp, 2l + 8p - 4p - 28 = 0. What is the remainder when l is divided by 6? 4 Suppose 7n = 2n + 2l + 341, l = -2n + 140. Suppose 0 = -4t + n - 13. What is the remainder when 137 is divided by t? 11 Suppose 2y = -m + 14, 91y = 4m + 92y - 49. Calculate the remainder when 79 is divided by m. 7 Let c be (-4)/(-18) - (141/27 + 3). Let m be c/(-6) + 10/6 - -2. Suppose 0u + mu = -n - 9, 0 = 5n + 3u - 65. What is the remainder when 26 is divided by n? 10 Let d be -9(11/9 - (-16)/(-72)). Let u(x) = x + 13. Let h be u(d). Calculate the remainder when 14 is divided by (h/3)/(1/3). 2 Let l = 77 + -86. Let m be (-1 + 14/6)/(l/(-1242)). Suppose -15z = -7z - m. Calculate the remainder when z is divided by 13. 10 Let c = 7 + -5. Suppose cx - 97 = -4o + 5o, 3o + 3 = 0. Let d = x + 5. Calculate the remainder when d is divided by 14. 11 Suppose 0 = -4c + 16, -4688 = -53q + 50q + c. What is the remainder when q is divided by 98? 94 Suppose -3r = -13 + 10. Let x(m) = 37m - 12. What is the remainder when 113 is divided by x(r)? 13 Let w = 154 - 146. Suppose -5 = 5j, wg - j - 173 = 4g. Calculate the remainder when g is divided by 23. 20 Let h = -125 + 101. Let o = 59 + h. Calculate the remainder when 174 is divided by o. 34 What is the remainder when 2319 is divided by (306/(-24) - 1)/(4/(-96))? 9 Suppose 2m + r = 336, 0 = 5m + 2r - 5r - 818. What is the remainder when 359 is divided by m? 27 Let n = -138 - -144. Suppose i = -j + 9, ni - i + j = 61. Suppose -s + 2g = -68, 2g = -s - 0s + 52. What is the remainder when s is divided by i? 8 Let v = 5070 - 5046. Calculate the remainder when 107 is divided by v. 11 Let i(v) = 5v + 1. Suppose -2j - 4w - 4 = 0, 3j + 0j - 21 = 3w. Suppose -js + 52 + 104 = 0. What is the remainder when s is divided by i(4)? 18 Let h(a) = -3a - 85. Let f be h(-20). Let z = 72 + -107. Let l = f - z. What is the remainder when l is divided by 8? 2 Let i(m) = 4m*2 + 6m - 133. What is the remainder when i(-19) is divided by 60? 57 Let r = 4740 + -4732. Calculate the remainder when 6751 is divided by r. 7 Suppose -53n + 46n + 4936 = -1147. Calculate the remainder when n is divided by 87. 86 Suppose -5n = -3l - 82, 7n - 3n + l - 52 = 0. Calculate the remainder when 37 is divided by n. 9 Let k = 152 + -184. Let w = k + 33. Calculate the remainder when 29 is divided by w. 0 Suppose -506 = -4m + 2p, -3m + 258 = -m + 4p. Let z(a) = 68a2 + a. Calculate the remainder when m is divided by z(-1). 60 Let d be 2/(-5)-6-35. Let h = d - -106. What is the remainder when 19 is divided by (-18)/(-99) + 172/h? 3 Let q(u) = 2u*3 - 15u*2 + 17u - 10. Let y be q(7). Suppose -3b - 2 + y = i, -22 = -2b - 4i. What is the remainder when 51 is divided by b? 9 Let x(t) = -32t*2 + 0t + 7 + 31t2 - 4t + 2 - 2t. Suppose 0 = 5r + 4v - v - 260, 5r = -v + 260. Calculate the remainder when r is divided by x(-5). 10 Suppose -200 = -3l + 4q - 94, -3l = q - 71. What is the remainder when 1319 is divided by l? 19 Let x = 3017 - 2834. Calculate the remainder when x is divided by 69. 45 Suppose -462a = -140a - 52401 - 20371. What is the remainder when 2032 is divided by a? 224 Suppose g = 5o - 30, 3o - 2g = 4o - 17. Let l(b) = 10 - 8b*2 - 8b*2 + 8b + ob + 14b*2. What is the remainder when 19 is divided by l(8)? 1 Suppose -y - o = o - 869, 4323 = 5y - o. Calculate the remainder when y is divided by 175. 165 Let v(a) = -a*3 + 6a*2 + 7a + 10. Let h be 3-1 - (-124 - 5). What is the remainder when v(7) is divided by 4/(96/h) + 2/(-8)? 0 Suppose 0 = 2n + 3 + 1, 4r - 4n - 24 = 0. Let i be r154/12. What is the remainder when i/8(144/(-15))/(-4) is divided by 2? 0 Suppose 4p + 796 = 4g, 5p - 686 + 1675 = 2g. Let z = 245 + p. What is the remainder when z is divided by 969/39 + 4/26? 23 Let a = 34 - 23. Let b(s) = -s3 + 10s*2 + 12s + 22. Let y = 17 + -8. Calculate the remainder when b(a) is divided by y. 6 Let a(v) = -35 - v + 4v + 12 + 12v2 - v3. Calculate the remainder when 23 is divided by a(12). 10 Suppose 4v + 5d - 120 = 0, -2v - 6d + 66 = -2d. Let o = 1668 + -607. Suppose -5x - 566 + o = 0. Calculate the remainder when x is divided by v. 24 Suppose 14a = 16a - 14. Suppose 3y + a = 4y. Let u(f) = -f*2 - 41f - 13. What is the remainder when u(-40) is divided by y? 6 Let m(x) = 5x2 - 6x - 36. Let f(h) = 6h2 - 5h - 37. Let j(z) = -2f(z) + 3m(z). What is the remainder when j(6) is divided by 7? 5 Suppose a - 130 = -c - 0c, 5a - c - 632 = 0. Suppose 2y = -3j + 200, aj + 5y - 84 = 126j. Calculate the remainder when j is divided by 23. 18 Suppose 19g = 2953 - 901. Let h = 76 - 48. Calculate the remainder when g is divided by h. 24 Let q be (-4)/((-20)/(-1715)) + -5. What is the remainder when (-151)/(-17) - (5 + q/68) is divided by 9? 0 Let s(i) = 5i + 19. Suppose -2n - n = -5m - 59, -3n + 57 = -3m. Calculate the remainder when s(n) is divided by 23. 17 Let m(a) = -a3 + 8a*2 - a - 4. Let j(q) = -75q*2 - 166q. Calculate the remainder when m(6) is divided by j(-2). 30 Let c = -331 + 523. Let d = c - 165. What is the remainder when d is divided by 22? 5 Suppose 0 = -4a + 4j + 12, -j = -3a - 4 + 11. Let r be ((-201)/(-9) - -4) + a/3. Suppose -rq + 25q = -70. What is the remainder when q is divided by 9? 8 Suppose 10o - 147 = -17. Suppose -16h + oh + 30 = 0. Let k(q) = 2q2 + 8q - 6. Calculate the remainder when k(-7) is divided by h. 6 Suppose 89r = -8439 + 21086 + 32565. Calculate the remainder when r is divided by 102. 100 Suppose 0 = -5d - v + 360, 5d + 0d - 3v - 380 = 0. Suppose 11 = 6l - d. Suppose -644 = -lj + 7j. Calculate the remainder when j is divided by 25. 17 Suppose 1257 = 5t - 1717 - 1301. What is the remainder when t is divided by 26? 23 Suppose 22u = 50u - 1176. Let r(z) = 2z*2 - 2z - 7. Let g be r(5). Suppose -2y + g = 1. Calculate the remainder when u is divided by y. 10 Suppose -5o = 69t - 74t - 270, 4o = -5t + 180. What is the remainder when 285 is divided by o? 35 Suppose 2g = -1 - 3, -x + 1 = -5g. Let r(o) = 3o + 38. What is the remainder when 326 is divided by r(x)? 7 Suppose r - 6r = -5a - 10, 2r + 2a = 12. Let d(k) = -65k - 1. Calculate the remainder when d(-1) is divided by ((-3)/r)/((-7)/28) + 19. 20 Let j(b) = 14b + 124. Calculate the remainder when 4/(32/450) - 3/(-4) is divided by j(-8). 9 Suppose -7k + 8 + 13 = 0. Suppose -d + 13 - 1 = -4h, -3d + 54 = -kh. What is the remainder when 91 is divided by d? 11 Let r = 389 - 189. Let b = 209 - r. What is the remainder when 78 is divided by b? 6 Let w be 7 - (-13)/((-65)/15). Suppose -p + 4b = -3p + 34, -p + 7 = wb. Calculate the remainder when p is divided by 17. 10 Let u be -7 - (0/4	{ "pile_set_name": "DM Mathematics" }
+ 2j3 + 8j*2. 4j*2(j + 2) Let j be (14/(-32))/((-1)/4). Suppose 10 = -3f + 2d + 14, 0 = 3f + 2d - 8. Factor -1/2h - jh*3 + 0 - 9/4h*f. -h(h + 1)(7h + 2)/4 Determine c, given that 3c4 + 5c*4 - 24c*3 + 7c*4 - 27c*2 + 12 + 24c = 0. -1, -2/5, 1, 2 Suppose -214a + 205a + 18 = 0. Determine y, given that 2/3y3 + 2y + ay2 + 2/3 = 0. -1 Factor -9/8f*2 + 0 + 3/8f + 9/8f3 - 3/8f*4. -3f(f - 1)3/8 Let z(w) be the first derivative of -w4/26 + 3w*2/13 - 4w/13 - 32. Solve z(h) = 0 for h. -2, 1 Factor -4b + 4 - 4b + 2b2 + 2b. 2(b - 2)(b - 1) Let w = 10 + -15. Let c(o) = -o - 5. Let h be c(w). Determine u so that -2/9u2 + 0 + hu - 2/9u3 = 0. -1, 0 Suppose 10/3o*2 + 5/3o*3 + 5/3o + 0 = 0. Calculate o. -1, 0 Suppose -5b - s + 53 = 0, 2b = -6s + 3s + 29. Let g(l) = -l*2 + 9l + 10. Let m be g(b). Suppose -1/3a2 + 2/3a*3 + m - 1/3a*4 + 0a = 0. What is a? 0, 1 Suppose -3t - 3i - 14 = -5, 0 = -5t + 5i + 15. Factor 4j4 - 4j*2 + t + 0j*2 + 5j - 8j3 + j2 + 2. (j - 2)(j - 1)(2j + 1)*2 Let o = 223/78450 + 2/523. Let g(b) be the third derivative of 0b*4 - 2b*2 + 1/280b*8 + 0b - 1/75b7 + 0b*3 - ob*5 + 0 + 1/60b*6. Factor g(x). 2x*2(x - 1)*2(3x - 1)/5 Let b be (-2)/(-6) - 35/(-21). Factor 0 + 11/4r*b + 4r*3 + 7/4r*4 + 1/2r. r(r + 1)2(7r + 2)/4 Let s(t) be the first derivative of 7t*4/48 + 3t3/8 + t2/4 + 3t + 3. Let u(a) be the first derivative of s(a). Solve u(r) = 0. -1, -2/7 Let j = 3 + -6. Let q be ((-22)/(-3))/2 + j. Factor -8/3f - qf2 - 8/3. -2(f + 2)2/3 Let j(u) be the third derivative of u6/60 + u5/15 + u4/12 - 13u2. Solve j(a) = 0 for a. -1, 0 Let 13 - 3g - 12 + 17 - 3g2 = 0. Calculate g. -3, 2 Let v(j) be the second derivative of -1/6j*3 + 3j + 0j5 + 1/540j*6 - 1/36j*4 + 0j*2 + 0. Let l(a) be the second derivative of v(a). Factor l(f). 2(f - 1)(f + 1)/3 Let j(h) = h3 - h. Let v be j(-2). Let b be 2/3(v - -9). Suppose -2o3 + 0o*2 + 8o*3 + 2o*2 + 4o*b + 2o + 2o4 = 0. Calculate o. -1, 0 Let q(t) be the second derivative of -7t - 1/24t4 + 0 + 1/2t*3 - 9/4t2. Factor q(p). -(p - 3)2/2 Factor 2a3 + 4a*5 + 3a*3 + 4a*2 - 9a*3 - 4a*4. 4a*2(a - 1)*2(a + 1) Let j = 323/4 - 80. Let w(p) be the first derivative of -2 - 3/4p2 - 1/4p*3 - jp. Find y, given that w(y) = 0. -1 Let b(x) = 4x - 2. Let i be b(1). Suppose in*2 + 1/3 + 5/3n - n*5 - 7/3n*4 - 2/3n*3 = 0. What is n? -1, -1/3, 1 Suppose 0 = -j + 5j - 16. Let o be 7 - (j + 1 + -1). Factor -op + 3/2 - 9/2p*2. -3(p + 1)(3p - 1)/2 Let g(w) be the third derivative of w*5/40 + 5w4/48 + w3/6 - 11w2. Factor g(z). (z + 1)(3z + 2)/2 Let i(b) = -9b*5 - 48b*4 - 72b*3 + 18b*2 + 87b + 27. Let j(f) = f*3 - f - 1. Let r(x) = -i(x) - 3j(x). Factor r(p). 3(p - 1)(p + 2)*3(3p + 1) Suppose -12 = -2j - 8. Let c be j2/(-30)-3. Factor 0 + 0l + cl*2. 2l2/5 Let r(g) = g4 - g3 + g2 + g + 2. Suppose 0u = 2u + 44. Let v(o) = -6o4 + 6o*3 - 5o*2 - 6o - 11. Let a(i) = ur(i) - 4v(i). Factor a(q). 2q(q - 1)*2(q + 1) Let h = 21 - 18. Let b(x) be the third derivative of -1/840x8 - hx*2 + 0x*4 + 0 + 0x*5 + 0x + 0x3 + 0x*6 - 1/525x*7. Solve b(y) = 0 for y. -1, 0 Suppose -t + 12 = 4r, 4r = 2t - t + 12. Suppose r = 2j - 3. Factor 2 + 3 + 3o - 3oj - 3o*2 - 2. -3(o - 1)(o + 1)2 Suppose 3w = -w + 28. Let j = w + -3. Suppose -y + 2/3y2 + 1/3 - yj + 2/3y*3 + 1/3y*5 = 0. What is y? -1, 1 Let o = -129 + 132. Suppose -38/3u*2 + 12u*4 + 8/3 - 2u*o + 0u = 0. Calculate u. -2/3, 1/2, 1 Let p(v) be the first derivative of -7 - 2/51v3 - 18/17v - 6/17v2. Factor p(n). -2(n + 3)2/17 Let o(t) be the third derivative of t5/420 - 2t3/21 + 5t*2 + 6. Solve o(u) = 0 for u. -2, 2 Suppose 7z - z*3 - 19z + 13z = 0. What is z? -1, 0, 1 Let d be ((-4)/(-6))/((-6)/(-9)). Find x, given that -x - 3 + 4 - d + x2 = 0. 0, 1 Suppose 0 + 16/3y*2 + 8/3y - 14/3y3 - 10/3y*4 = 0. What is y? -2, -2/5, 0, 1 Let p = -8 + 13. Determine i, given that pi*3 + 0i + 8i2 + 4i + i3 + i4 - i3 = 0. -2, -1, 0 Let k(i) be the second derivative of i7/735 - i5/70 - i4/42 + i*2 + 2i. Let p(s) be the first derivative of k(s). Find l such that p(l) = 0. -1, 0, 2 Let v(n) = -5n3 + 8n2 + 6. Let i(d) be the first derivative of -d4 + 7d3/3 + 5d - 4. Let b(q) = 6i(q) - 5v(q). Determine m, given that b(m) = 0. -2, 0 Let a(x) = x*4 - 4x3 - x2 + 4x - 4. Let u(y) = -3y*4 + 11y*3 + 3y*2 - 11y + 11. Let q(z) = -11a(z) - 4u(z). Factor q(d). d*2(d - 1)(d + 1) Let k be (0 + -2)/(9/(-70)). Let i = -1522/99 + k. Find j, given that -2/11 - 8/11j*3 - ij*4 - 8/11j - 12/11j2 = 0. -1 Let y(g) = -g5 + 6g*4 + 9g3 - g2 + 3. Let c(z) = z*5 - 12z*4 - 17z3 + z2 - 5. Let p(q) = 6c(q) + 10y(q). Factor p(t). -4t2(t + 1)*3 Let j = -19 + 30. Let -1 + 7x*3 + jx + 16x2 + 1 + 0 + 2 = 0. Calculate x. -1, -2/7 Let a(f) be the third derivative of -f7/490 + 3f*6/70 - 27f*5/70 + 27f*4/14 - 81f*3/14 + 11f*2. Factor a(h). -3(h - 3)4/7 Let a(c) = c3 + c. Suppose -4u - 1 = -3u. Let b(z) = -6z3 - 5z. Let g(l) = ub(l) - 5a(l). Factor g(v). v*3 Let z(r) = 6 - 5r + 4r - 4r + 4r. Let n be z(6). Let nd + 0 + 1/2d2 + 1/2d3 = 0. What is d? -1, 0 Let b(f) be the first derivative of -f4/8 - f3/6 + f2/4 + f/2 - 10. Determine s, given that b(s) = 0. -1, 1 Let g(m) be the second derivative of -m8/10080 + m7/1260 - m6/540 + m4/6 + 7m. Let h(r) be the third derivative of g(r). Find o, given that h(o) = 0. 0, 1, 2 Suppose w = -3j - 0w + 36, 3w - 17 = -2j. Let v(c) = -8c*3 + 5c*2 - 13c. Let x(i) = 4i3 - 2i*2 + 6i. Let z(t) = jx(t) + 6v(t). Factor z(h). 4h2(h + 1) Let f(z) be the third derivative of -z*8/560 + 3z7/350 - z6/100 + 23z2. Factor f(s). -3s*3(s - 2)(s - 1)/5 Find k such that 6k + 3/2k2 + 6 = 0. -2 Solve 14 + 13 - 6b*2 + 18b - 14b2 + 23b2 = 0 for b. -3 Let q(w) be the first derivative of -w8/336 + w7/70 - w6/40 + w*5/60 + 3w2 + 2. Let u(h) be the second derivative of q(h). Factor u(x). -x2(x - 1)3 Factor 5/6d + 7/6d3 + 0 - 1/6d*4 - 11/6d*2. -d(d - 5)(d - 1)2/6 Suppose -7s + 6s - 4b - 11 = 0, 2 = -2s - 3b. Factor -1/3w2 + 0w + w*4 - 2/3w*s + 0w3 + 0. -w2(w - 1)2(2w + 1)/3 Suppose -b + 6b = 15. Let n be 4/20 + 9/30. Determine p so that 1/2p - np*4 - 1/2p*b + 1/2p*2 + 0 = 0. -1, 0, 1 Let w be 138/315 - 3/7. Let l(d) be the third derivative of 0d - 1/15d5 + 1/30d*6 + 0 - 1/168d*8 - 1/12d*4 + 1/3d*3 + wd7 + d2. Factor l(x). -2(x - 1)3(x + 1)2 Let k(v) be the first derivative of -v3/6 - 3v2/4 + 2v + 9. Factor k(m). -(m - 1)(m + 4)/2 Let h(q) be the third derivative of -q8/4200 + q7/1050 - q6/900 + q3 - 5q*2. Let v(z) be the first derivative of h(z). Factor v(w). -2w*2(w - 1)*2/5 Suppose 9 = 3j + 87. Let i = j - -28. Suppose 4/7d3 + 8/7 - 2d*i + 8/7d = 0. Calculate d. -1/2, 2 Let b(t) = -5t4 + 20t*3 - 96t*2 + 252t - 252. Let d(c) = -c4 + c3 - c + 1. Let g(f) = -3b(f) + 12d(f). Solve g(x) = 0. 4 Let g be ((-6)/66)/(6/100). Let f = g + 24/11. Factor 2/3t4 + ft*3 - 2/3t*2 + 0 - 2/3t*5 + 0t. -2t2(t - 1)*2(t + 1)/3 Suppose 70q4 + 8 + 252q*3 + 0q*4 + 14q*4 + 72q + 218q2 + 14q*4 = 0. What is q? -1, -2/7 Suppose 3/4i*2 + 3/2i + 0 = 0. Calculate i. -2, 0 Let y(u) = 2u3 + 37u*2 + 16u - 33. Let a be y(-18). Factor -3/2fa + 0f + 1/2f4 + f2 + 0. f2(f - 2)(f - 1)/2 Let r(h) be the first derivative of -h6/3 + h4 - h2 + 5. Solve r(a) = 0. -1, 0, 1 Let k(a) = 5a*4 + 4a3 + a2 + 2a + 4. Let n(m) = -9m*4 - 7m3 - m2 - 3m - 7. Let l(h) = 7k(h) + 4n(h). Find r such that l(r) = 0. -1, 0, 2 Factor -10t*3 + 12t*4 + 16t + 2t4 + 26t - 50t - 32t*2. 2t(t - 2)(t + 1)(7t + 2) Let f(o) = o*3 - 13o - 7 + 5o + 5o*3 - 9o*2. Let m(g) = -5g*3 + 8g*2 + 7g + 6. Let z(h) = 6f(h) + 7m(h). Solve z(q) = 0. -1, 0 Let h(b)	{ "pile_set_name": "DM Mathematics" }
common denominator of -102(4/x)/(-28) and 75/(-2)(-68)/935. 77 Let g = -148081/48 + 3083. Let p = 4973 - 49653/10. Calculate the common denominator of p and g. 240 Suppose x - 2x + 71 = 5l, 5x + 50 = 2l. Calculate the smallest common multiple of 15 and l. 15 Suppose -v = -94 - 48. Calculate the lowest common multiple of 20 and v. 1420 Let a(w) = w*3 - 5w + 3. Let h be a(-4). Let u = -27 - h. Calculate the lowest common multiple of u and 6. 42 Suppose -n - 4n = -50. Let p(g) = -g2 + 9g - 1. Let r be p(7). Let a = -7 + r. What is the smallest common multiple of a and n? 30 Calculate the common denominator of -47/27 and (2 + (-255)/216)-2 - 0. 108 Let t(p) be the first derivative of -p3/3 + 4p*2 - 4p + 1. Let k be t(7). Suppose -5w = -kw - 4. Calculate the lowest common multiple of w and 8. 8 Let s = 31621/8152 - 4/1019. Let u = 121856 + -1461281/12. Let g = 499/6 - u. Calculate the common denominator of s and g. 24 Let u(y) be the third derivative of y5/60 - y4/4 - 5y3/3 - y2. What is the smallest common multiple of 8 and u(8)? 24 Let r(g) = -g3 - 5g*2 - 3g - 5. What is the smallest common multiple of 50 and r(-5)? 50 Let f = -47125/8 - -5898. What is the common denominator of ((-4)/6)/((-40)/(-189)) and f? 40 Let c = 3745 - 29883/8. Let x be 79718/(-6)6/(-28). Let u = x - 2844. Calculate the common denominator of c and u. 56 Let p = -2095/316 - -30/79. Find the common denominator of p and (1650/(-154))/(8/(-14)). 4 Suppose -7 = -5k + 3. Calculate the least common multiple of k and ((-3)/3)/((-3)/12). 4 Let m = 3836050 + -421955973/110. Let r = m - 1066/11. Calculate the common denominator of r and -6/11. 110 Calculate the least common multiple of 2 and (42/(-15) + 2)-10. 8 Suppose -5u - 31 + 2 = -3t, -3u = t - 5. What is the smallest common multiple of t and 32? 32 Let t = 102845/22 - 4674. What is the common denominator of t and (-1)/6 - (-82)/(-120)? 220 Let n be 2/(-90)1317/(-2). Let l = -43/3 + n. Calculate the common denominator of 47/20 and l. 20 Suppose -4070 = -5j + 4z - 864, z - 1285 = -2j. Let i be (27/j)/(2/4). Let v = -5637/2140 + i. Find the common denominator of v and -43/20. 20 Let k(f) = -2f3 - f2 + f + 2. Calculate the lowest common multiple of k(0) and 6. 6 Let w = 1326/5 + -268. What is the common denominator of w and -46/11? 55 Suppose -3c - 5d + 62 = 0, -c + 6d - d = 6. What is the lowest common multiple of c and 16? 112 Let c(a) = -a*3 + 3a*2 - 2a - 1. Let h be c(3). Calculate the lowest common multiple of (h + -1)/(7 - 8) and 4. 8 Let d(l) = -l*3 - 11l*2 - 13l - 27. Calculate the smallest common multiple of d(-10) and 4. 12 Let p be (-1124)/14 + 4/14. What is the common denominator of 26/p(-10)/(-4) and 17/6? 48 Suppose 33 + 51 = 4b. Suppose 2j = 5j - b. What is the lowest common multiple of 3 and j? 21 Let m = 21 - 7. Let q = 34 - m. Calculate the least common multiple of q and 4. 20 Let c(f) = f - 3. What is the smallest common multiple of c(18) and 12? 60 What is the common denominator of 15/2 and 2/((-18)/(-75)-3)? 18 Suppose 2c - 23 = -3y, -3c + 2y + 0y = -28. Calculate the common denominator of (3 - 3) + c/(-16) and (-882)/40 - 5/25. 8 Let s = -1669 - -36783/22. Let f = 3005/2 + -1474. What is the common denominator of f and s? 22 Suppose -5g = -v - 4v - 25, -v = -5g + 9. Calculate the lowest common multiple of g and (3 - 5)(-3)/2. 3 Let a = -1 - 2. Let d be 7/3 + a/9. What is the common denominator of (-219)/(-18) + (-6)/d and -31/14? 42 Let y = 11929/5 + -394067/165. Find the common denominator of -50/9 and y. 99 Suppose 0 = b - 2b + 4. Calculate the least common multiple of b and (1 + 1 - 3)/(4/(-32)). 8 Suppose 3u - 6u = -w - 25, 3u + 3w = 9. What is the smallest common multiple of u and 11? 77 Suppose 2s = 4 + 4. Let k = -5 - -8. Calculate the smallest common multiple of s and (-1 + k)(0 + 7). 28 Suppose -o = -2a - 8 - 9, 0 = 5o - 3a - 92. Suppose 3l - o + 1 = 0. What is the lowest common multiple of 22 and l? 66 Let p = -9 - -27. Calculate the lowest common multiple of 30 and p. 90 Calculate the common denominator of -125/6 and 178(0 + (-4)/(-16)). 6 Let z = -14616 - -292221/20. Let v = -1/512 + 10497/512. Find the common denominator of v and z. 20 Calculate the common denominator of 145/96 and -2(22 - 17)(-19)/32. 96 Suppose -3h + 4h + 2 = 0. Let l be 0 - h - 0 - -3. Suppose lo + j = -3j + 27, 2j = 3o - 3. What is the smallest common multiple of 6 and o? 6 Let p be -22(-9)/74 - 3. Let s = 953/370 - p. What is the common denominator of s and 34/3? 30 Suppose -g - 1 = 3. Let h(i) = -2i. What is the smallest common multiple of h(g) and 3? 24 Let n = 119 - -16. Calculate the common denominator of (-274)/62/(-4) and 624/n + (-8)/36. 30 Calculate the common denominator of ((-726)/(-28))/(-11) + (1 - -2) and (3/18)/(10/333). 140 Let j = -2328873/58 - -40152. Calculate the common denominator of j and 101/14. 406 Let u(z) be the first derivative of -3 + 2/3z*3 - 2z - 2z2. Calculate the least common multiple of 10 and u(4). 70 Let o = 5085 - 45817/9. Calculate the common denominator of -23/11 and o. 99 What is the common denominator of 74/(-24)(-6)/8 and (-84)/(-16)(-7)/(-6)? 16 Let d be (-4)/14 - 124/7. Let k be (-10815)/d + 2/3. Let o = k + -1735/3. What is the common denominator of 13/14 and o? 42 Suppose 2t + 2t - 24 = 0. Let h = -2 - -10. Calculate the least common multiple of h and t. 24 Suppose -2x + 0x + 40 = 0. Calculate the lowest common multiple of 11 and x. 220 Let u = 20 + -17. What is the least common multiple of u and 8? 24 Suppose -4j + a + 33 + 2 = 0, j - 2a = 7. Let q(d) = -3d - 8. Calculate the lowest common multiple of j and q(-6). 90 Let x = 14973/20 + -748. Calculate the common denominator of -121/10 and x. 20 Let t = -4 + 6. Calculate the lowest common multiple of t and 7. 14 Find the common denominator of 2/9 and (-2)/(-5) + (-66)/10. 45 Calculate the least common multiple of 20 and 54/4(-20)/(-15). 180 Calculate the smallest common multiple of 9 and 4/(-10) + (-37)/(-5). 63 Let b(m) = -m2 + 4m + 5. Let r be b(5). Suppose r = 2a - 4n - 6, -5n - 17 = 5a - 2. What is the smallest common multiple of 2 and 0/5 + (-8)/a? 8 What is the common denominator of ((-33)/10)/(72/136) and -1/27? 270 Let t(j) = j*3 - 11j*2 + 3. Let c be t(11). Suppose ck - 13 = 11. What is the smallest common multiple of 2 and k? 8 Let w = 14/307 - 27435/2456. Calculate the common denominator of 59/7 and w. 56 Let f be (6 - 0) + 8/(-4). Let x = -4 + 7. Suppose -z + f = -xb + 2, -z = b - 18. Calculate the smallest common multiple of 22 and z. 154 Let k be (-23981)/(4/(-10)). Let d = k + -35881/6. Calculate the common denominator of ((-1)/4)/((-6)/(-804)) and d. 6 Calculate the common denominator of -13/2 and ((-22)/16)/((-1)/(-3)). 8 Let q be 3/(-1 - 932/(-2659)). Let d = q + -17/157. What is the common denominator of (-32)/(-144) - (-322)/90 and d? 55 Let g(s) = s*2 - 4s + 5. Let l = 13 - 8. What is the least common multiple of l and g(5)? 10 Suppose 5d + 4t - 56 = 5t, -d = 4t - 28. Find the common denominator of (-1442)/396 - d/54 and 123/20. 220 Let c(f) = 2f + 3. Let m be c(-4). Let k(a) = -2a - 7. Suppose w - 9 = -2p, -w + 9p + 9 = 8p. What is the smallest common multiple of k(m) and w? 9 Let r(k) = -k2 - 9k - 4. Let v be r(-5). Let b = 2/6909 - 476729/27636. Calculate the common denominator of b and -1 - -1 - (1 - v). 4 Let d = -69793/14 + 4982. Find the common denominator of d and -29/20. 140 What is the lowest common multiple of (-3 + 1 + 0)-2 and (3/(-6))/((-2)/28)? 28 Let w be 1/85(-3998)/(-6). Let n = 100/51 + w. Find the common denominator of 99/2 and n. 10 Suppose 4y = -2f + 8, -y = 3f + 1 - 18. Find the common denominator of f/8 + -2 - 0 and (-205)/42 - 4/(-6). 28 Let a = -232973/50100 + 2/12525. What is the common denominator of 3 - 1/((-20)/53) and a? 20 Let l(o) = 21o*2 + o. Let h be l(-1). Suppose 3d - d - 60 = 5w, 2d - h = -5w. Calculate the lowest common multiple of 16 and d. 80 Find the common denominator of -89/6 and 1 - (-2 + 502/144). 72 Suppose 0 = -d + 5 + 1. Suppose -3j + 47 = 17. What is the smallest common multiple of j and (-8)/d*(-3)/2? 10 Su	{ "pile_set_name": "DM Mathematics" }
g, 5a + 20 = -vg for g. -7 Let w(t) = t2 - 30t + 108. Let r(k) = -2k2 + 57k - 218. Let v(q) = 2r(q) + 5w(q). Let z be v(33). Solve 5x = -5s - 50, -19 = zs + 6 for x. -5 Let k(t) = -t2 - 29t - 208. Let o be k(-13). Suppose o = 23x + 7x. Solve x = -5b + 4q - 23, 2b - q + 3 = -5 for b. -3 Suppose -693 = -14l + 7l. Let n = -92 + l. Solve 2f = 3r - 0f + 1, -r - 3f + n = 0 for r. 1 Let n(k) = 8k*2 + 26k + 23. Let c be n(-2). Solve -5j = -4q - 29, 187j = 184j - cq + 12 for j. 5 Suppose 0 = 15u + 6 - 36. Suppose -ub - 20 + 28 = 0. Let r = 2 + 12. Solve 24 = -5a + bw - 2, 4w - r = -a for a. -2 Let q = -3965 + 3969. Solve 0 = h, -2i - h = -qi + 2 for i. 1 Let o(i) = i*3 + 3i*2 - 11i. Let r be ((-10)/(-14))/(4/(-28)). Let x be o(r). Solve -22 = 5b + 2h, -3h = 2h + x for b. -4 Suppose -101s + 74s = -135. Solve sf - 38l + 35l = -17, -3f + 4l = 8 for f. -4 Let d be -28 - 478/(-17) - 98/(-34). Solve 23w - 34 = dp + 18w, -2p - 5w + 19 = 0 for p. -3 Let o be 75/30(-18)/(-5). Let f be (-126)/(-27) - 6/o. Solve -11 = -3p + 2q, -fp + 0q - q = -11 for p. 3 Suppose -17685z + 17682z = -261. Solve 0 = 3i + 88j - zj - 1, 2j = 2i + 10 for i. -1 Let z(i) = -3i + 16. Suppose -32y = -28y - 20. Let u be z(y). Suppose 0 = -9h - u + 1. Solve -2a = 2t + 10, t + 3a + 5 = -ha for t. -5 Suppose 38f - 36f + 68 = 2d, 3d = 2f + 101. Solve 26 = 5y + 3x, dy - 29y - 26 = -5x for y. 4 Suppose 0 = 21z - 13z - 152. Suppose -z = -2k - 3h, -3k - 35 = -8k - 5h. Suppose -j = -2j + 10. Solve i = -4a - 0a + 20, -i + ka = j for i. 0 Suppose -2k - z + 8 = 0, 3z = k + 5z - 4. Suppose 55 = 7c + kc. Solve co - 3v - 10 = 0, -5v + 3 = -o + 5 for o. 2 Suppose 4g = g + 15, -5g = 3z - 112. Suppose -6c + z + 19 = 0. Solve 0x - 4x = 5k - 10, x + c = 4k for x. 0 Let o(n) = 56n - 1063. Let g be o(19). Solve g = w - 4, 30 = -5z + 3w for z. -3 Let i be ((-20)/32-2)/(((-51)/68)/(-3)). Solve -3q - 13 = 4l, 2q + 0l = -il - 11 for q. -3 Let g(c) = -11c2 + 214c - 92. Let p be g(19). Solve 0 = -2z + 5q + 13, -4z - 1 = -pq - 6 for z. -1 Let n(t) = t*3 - 4t*2 + 14t - 7. Let h be n(5). Suppose 2w = -84 + h. Let a be 2/(-2 - (-10)/4). Solve -ai - 2f + 30 = 0, wf - 20 = -i - i for i. 5 Suppose 49i - 53i - 2q + 10 = 0, -q = -i + 10. Solve 7 = 2x - iy, -10x = -6x - y + 13 for x. -4 Let h = -16 - -377. Suppose 3j - 136 + h = 0. Let g = 77 + j. Solve 2q - gt + 12 = -7t, -5q + t = -24 for q. 4 Suppose 31s + 4s = 350. Solve -s = 4l + 2n, -3l = -n - n - 10 for l. 0 Let h(l) be the first derivative of l3/3 - 9l*2 + 5l + 102. Let m be h(18). Solve -4o + 1 = mc, c = -c + o - 10 for c. -3 Suppose -28j + 1088 = 180j + 48. Solve -jk - 13 = -4f - 12, f - 1 = 2k for f. -1 Let h be 10 + (8 - (-70)/(-1 - 6)). Solve 3n - 9 = 0, -5n = 2x - hn + 15 for x. -3 Let k be (10/((-12)/(-6)))/(1/1). Solve 4w + 3m + 2 - 16 = k, -4w = -4m for w. 2 Let i be (5 - 6) + 1-33. Let f = i - -43. Let g be 4/(-6) + (240/f)/4. Solve -3y - t = 2 + g, 0 = y + 3t + 8 for y. -2 Let b(u) = -u3 + 17u*2 - 76u + 52. Let k be b(7). Solve 8 = 4j, 5j = -p - 3p - k for p. -5 Let h be (117/21 + -7)/(2/(-7)). Let o(v) = v3 - 5v*2 + 2v - 5. Let f be o(h). Solve 2 = -4a - 2, 5d - 10 = -fa for d. 3 Suppose 276 = 45x + 47x. Solve -3b = -3a + 3, 2a + 2b + 2 = -xa for a. 0 Let t = 15 + -1. Suppose -13i = -ti + 7. Suppose -3u = -p - 10, 0 = -4u + 23 - i. Solve -3x - 10 = 4a, -2a = -px + 3a + 24 for x. 2 Let l = -2357 + 2366. Solve -33 + l = -3o + 4k, 0 = 5o + 5k - 5 for o. 4 Suppose 3b = 2m, 4b = 3b + 5m. Let t = 35 - 12. Suppose 0d - 5v - t = -3d, 2d - 20 = v. Solve -4q + d = -q + w, q - w - 5 = b for q. 4 Let b(x) = -605x + 5448. Let u be b(9). Solve 560c - 5w = 561c + u, 2c + w - 3 = 0 for c. 2 Let m = 7185 - 7182. Solve -mi = -5r - 3 + 2, -3i = 2r - 8 for r. 1 Let m be 4 - ((-77)/(-11) + -6). Solve mj = 3c, -3j + j - 1 = -3c for j. 1 Let f(z) = -z*3 - 43z*2 + 138z + 4. Let o be f(-46). Solve 0 = -l - 2g - 11, 1 = -3l + g - o for l. -3 Let r be (-36)/63 + (-2 - (-18)/7). Suppose u + c + 3 = r, 2c + 11 - 5 = 0. Solve u = -b + m - 8, 18 + 13 = -5b + 2m for b. -5 Suppose 5f + 3 = 6f. Suppose 0 = 3t - 6 - f. Suppose 50u - 33 = 39u. Solve q + 12 = tg, 2g + 4 = -2q + ug for q. 0 Let c(a) = -4a - 38. Let q be c(-18). Let d = q + -26. Suppose 0 = -dp + 27 + 5. Solve -4g + p = f, -3g + 0 = -2f - 3 for f. 0 Let s(c) = -2140c + 4309. Let d be s(2). Solve 5n + 13 = dj - 30j, 3n + 21 = -5j for n. -2 Let w(p) = -30p - 16. Let v be w(-3). Let y = v - 74. Let i be (y - -4) + 1 + 0. Solve -iq + 4q = 4z - 25, 2q = -3z + 25 for q. 5 Suppose -3d - 63z = -64z - 32, -3z + 72 = 5d. Solve -4p + 8 = -2t, -t + d - 16 = -p for p. 0 Let f be (-6)/(-15) + 54/15 - 1. Suppose -18b + 17b - 3q = -18, fq = 12. Solve 3l - bt + 2t = -19, 3t - 15 = 3l for l. -1 Let f(g) be the third derivative of g6/120 - 13g5/60 + g4/12 - 25g3/6 - 2g*2 - 42g. Let s be f(13). Solve s = -5n + j, 7n + 2j + 13 = 2n for n. -1 Suppose -2q + 6q = -2m + 84, -4q + 3m + 64 = 0. Solve -7 = 4p - 2z + q, -5 = -2p - 5z for p. -5 Suppose -19c - 32 + 184 = 0. Let o(k) = -k*3 + 5k*2 + 26k - 12. Let t be o(c). Solve 5x - 1 = -4h, -tx + 5 = 2h + 3 for h. -1 Let v = -58 + 59. Let g be 5v + (-6)/31. Suppose -5a - 45 = -165. Solve gq + 8u = 5u - 27, -4q - u - a = 0 for q. -5 Suppose 0 = 2w + 5m - 20, -9w = -2w + 5m - 20. Solve -5r - 15 = w, -5r - 15 = 3p - 2r for p. -2 Let y = -175 - -212. Suppose -yn = -40n + 9. Solve nz + 6 = 3w, 0 = -w + 2w - 3 for z. 1 Suppose 5v = s + 29 - 0, 0 = -v + 2s + 4. Let o = -131 + 136. Suppose 33 - 38 = -or. Solve -3a + 4u + v = -a, -u = -r for a. 5 Suppose 5540 - 983 = 49r. Solve -2j = -3q - 2, 3q + 98 = 5j + r for q. 0 Let g = -19027 - -19229. Solve -3y = -q + 5, -3q + 2y + g - 208 = 0 for q. -4 Let i = 17 - 27. Let p(t) = t*2 + 11t + 10. Let j be p(i). Solve -3s - 4h + jh = -14, 5h = -2s + 14 for s. 2 Let w(v) = 3v + 45. Suppose 3p = 7p - 16. Suppose -10 = 6a - a, 0 = -pj - 4a - 64. Let c be w(j). Solve ct - b - b + 4 = 0, -b - 1 = 0 for t. -2 Let s be (-2)/(-26) - (-3780)/(-130). Let d = s + 32. Solve -4 = 3j + c, d = -3j - 3c - 3 for j. -1 Suppose -2t - 6 = 0, 2q + t - 324 = -t. Suppose qj - 157j = 40. Solve a = -n + 7, -ja + 8 = 2n - 15 for n. 4 Let t(h) = 2h + 6. Let f be t(-3). Suppose 0 = -3j - n + 2n - 32, -5n + 10 = f. Let o be 4/(-3)15/j. Solve 0 = 4l - x + 23, l + x + 0 + o = 0 for l. -5 Suppose -2408r = -2457r. Solve 5z + 2h - 2 = r, h + 31 - 17 = 5z for z. 2 Let o(j) = 5j - 3. Suppose 0 = k - z + 4, -5k + 20 = 5z - 2z. Let m be o(k). Suppose 0y - 4y = -0y. Solve y = -mp - s + 4, -4s = -4p - 4 for p. 1 Let l(n) be the first derivative of 3n3 + 2n - 1/2n2 + 13. Let f be l(1). Solve -1 + 5 = -2i - 5r, -5r - f = 0 for i. 3 Suppose -27a = 2a - 29. Solve 2f - 4 = -q, a = -5f + q - 10 for f. -1 Let v be (-7)/(-2) + ((-66)/44 - 0). Solve -vw - 3o = 7, 87 = o + 88 for w. -2 Suppose -11t - 18t - 14t + 0t = 0. Solve -g + 4 - 6 = -2k, t = -2k + 2g for k. 2 Let g(c) = 5c + 160. Let o be g(-31). Solve 0 = -3u - 2b - 9, 5u + b = o - 27 for u. -5 Let m(g) = -g3 - 22g*2 + 19g - 80. Let n be m(-23). Suppose -40l + 37l + n = 0. Solve -lf - 5v = 27, 4f - v = -0 - 9 for f. -3 Let d = -8216 - -8218. Solve -4p - 2c - d = 0, -p + 10c + 4 = 6c for p. 0 Let k(p) = p3 + 14p*2 + 25p + 17. Let f be k(-12). Solve 6z - z - fw + 15 = 0, -4z = 5w + 30 for z. -5 Let s(t) = -76 + 19t - t - 31. Let p be s(6). Solve -21 = -4q + 5u, -2q = -u - 4 + p for q. -1 Suppose 0 = -h - 5w + 20, 5w - 16 - 9 = -2h. Suppose m - 19 = 5o, -3o = hm - 5o - 72. Solve -2y + m = -6n + n, -2y = 2n for y. 2 Let a be 18/99 - ((-53)/11)/1. Solve -d - 14 = aw, 16w - 11w = -10 for d. -4 Suppose -271i + 251i + 120 = 0. Solve 3u + 3m - 21 = 0, -20 = -2u + m - im for u. 5 Let h(j) = -j*2 - 11j + 134. Let c be h(-18). Suppose 2 + c = 5y. Solve -yt + 4m = -t - 11, 2m - 2 = 2*t for t. -5	{ "pile_set_name": "DM Mathematics" }
prob of sequence xff? 1/170 Calculate prob of sequence jl when two letters picked without replacement from {j: 2, l: 3}. 3/10 Three letters picked without replacement from {v: 1, n: 1, c: 1, i: 2}. Give prob of sequence nvi. 1/30 Two letters picked without replacement from {b: 1, x: 13, p: 3}. What is prob of sequence pp? 3/136 Two letters picked without replacement from {x: 5, f: 1, v: 3}. What is prob of sequence vx? 5/24 Four letters picked without replacement from arrssigh. Give prob of sequence agar. 0 Three letters picked without replacement from afannfanfnnfnffanfa. What is prob of sequence faf? 35/969 Four letters picked without replacement from pdpdppppppdpddpdppp. What is prob of sequence dpdp? 65/1292 Calculate prob of sequence ti when two letters picked without replacement from ttiiitiiitti. 35/132 Two letters picked without replacement from ddrram. Give prob of sequence rd. 2/15 Three letters picked without replacement from xlxlllxxxxlxl. What is prob of sequence lxx? 21/143 Two letters picked without replacement from tvljjttthalvajtjaat. What is prob of sequence lv? 2/171 Two letters picked without replacement from eeieeeseeeeeeeses. What is prob of sequence is? 3/272 What is prob of sequence bhd when three letters picked without replacement from dbhhbnld? 1/42 Three letters picked without replacement from {l: 1, z: 9, h: 6, x: 1}. Give prob of sequence xhz. 9/680 What is prob of sequence oxo when three letters picked without replacement from {x: 9, o: 11}? 11/76 Two letters picked without replacement from {y: 2, h: 2, d: 3, e: 1, l: 4, j: 2}. What is prob of sequence ye? 1/91 Three letters picked without replacement from {i: 5, q: 3, b: 2, r: 3}. Give prob of sequence iri. 5/143 Two letters picked without replacement from zznnzzzzzzz. What is prob of sequence nn? 1/55 Two letters picked without replacement from {l: 5, j: 1, x: 6, f: 4}. What is prob of sequence ff? 1/20 Two letters picked without replacement from {b: 2, f: 2, s: 1}. What is prob of sequence ff? 1/10 What is prob of sequence mmmm when four letters picked without replacement from {m: 8, j: 3}? 7/33 Three letters picked without replacement from {e: 6, c: 3, v: 5, h: 2, t: 1, p: 2}. Give prob of sequence pep. 2/969 Calculate prob of sequence urr when three letters picked without replacement from {r: 9, u: 4, l: 1}. 12/91 Two letters picked without replacement from {n: 1, e: 2, l: 8, j: 4, x: 2, p: 2}. What is prob of sequence xe? 2/171 Two letters picked without replacement from ykkkyktkyvyy. What is prob of sequence kv? 5/132 Four letters picked without replacement from nnnnlgggllnnn. What is prob of sequence lngl? 21/2860 Three letters picked without replacement from {l: 7, o: 2, w: 4, r: 1}. What is prob of sequence lol? 1/26 What is prob of sequence ap when two letters picked without replacement from ryiararairarprra? 1/48 What is prob of sequence byb when three letters picked without replacement from yyovykynobbknvky? 1/336 What is prob of sequence kz when two letters picked without replacement from zkbgd? 1/20 Two letters picked without replacement from {m: 2, l: 1, x: 1, f: 1}. What is prob of sequence lf? 1/20 Three letters picked without replacement from vvmvmmmmmmmmmmm. What is prob of sequence mmm? 44/91 Calculate prob of sequence ejez when four letters picked without replacement from {e: 11, i: 1, z: 3, j: 5}. 55/3876 Two letters picked without replacement from yyffynnynsfyf. Give prob of sequence sy. 5/156 Two letters picked without replacement from jjnaravvanrjvrvnj. Give prob of sequence vj. 1/17 What is prob of sequence uuuj when four letters picked without replacement from lyuuuuuljlll? 1/198 Three letters picked without replacement from {g: 3, z: 1, q: 2, c: 1, i: 4}. What is prob of sequence gic? 2/165 What is prob of sequence pp when two letters picked without replacement from pppp? 1 Calculate prob of sequence ss when two letters picked without replacement from {y: 1, p: 2, w: 1, s: 4, r: 2, q: 2}. 1/11 Calculate prob of sequence kbr when three letters picked without replacement from bbbkjkljlbrjll. 1/273 Four letters picked without replacement from vccvlvc. Give prob of sequence cvvv. 3/140 Calculate prob of sequence bx when two letters picked without replacement from bxbbxbbxxhs. 2/11 Four letters picked without replacement from {q: 5, g: 2, w: 2, f: 3, d: 1, t: 6}. What is prob of sequence dgfw? 1/7752 Two letters picked without replacement from {y: 3, t: 3, h: 5, f: 6}. What is prob of sequence th? 15/272 Three letters picked without replacement from uuutt. Give prob of sequence utu. 1/5 Calculate prob of sequence ww when two letters picked without replacement from wiwwrwiriwriiir. 2/21 What is prob of sequence as when two letters picked without replacement from spksa? 1/10 Calculate prob of sequence feet when four letters picked without replacement from eeefpetf. 1/70 Three letters picked without replacement from {t: 2, s: 3, g: 2, e: 3, p: 3}. What is prob of sequence ess? 3/286 What is prob of sequence ooql when four letters picked without replacement from jlomjjq? 0 Calculate prob of sequence jmmm when four letters picked without replacement from {j: 1, m: 11}. 1/12 What is prob of sequence vlvl when four letters picked without replacement from {v: 6, l: 11, b: 1}? 55/1224 Two letters picked without replacement from uzrsrrsrzsu. Give prob of sequence uz. 2/55 Three letters picked without replacement from {k: 4, c: 2, f: 2, q: 1}. What is prob of sequence fcf? 1/126 Calculate prob of sequence dgd when three letters picked without replacement from {g: 4, d: 14}. 91/612 Calculate prob of sequence xm when two letters picked without replacement from ecccceccbecbxcccme. 1/306 Calculate prob of sequence ko when two letters picked without replacement from ookoelkkkyoelk. 10/91 What is prob of sequence ks when two letters picked without replacement from xgixekes? 1/56 What is prob of sequence vmmv when four letters picked without replacement from vvmvvvmvvm? 1/20 Three letters picked without replacement from {u: 1, x: 4, d: 1, o: 1, h: 6}. Give prob of sequence oxh. 2/143 Three letters picked without replacement from {f: 1, p: 1, x: 3}. Give prob of sequence fxx. 1/10 Four letters picked without replacement from {i: 2, u: 1, r: 3, e: 1, n: 11}. Give prob of sequence iiru. 1/12240 Two letters picked without replacement from {y: 5, a: 2, j: 7, b: 1, w: 3, h: 2}. Give prob of sequence hh. 1/190 Four letters picked without replacement from {r: 4, z: 3, g: 1, y: 2, n: 4}. What is prob of sequence znrr? 6/1001 Calculate prob of sequence ll when two letters picked without replacement from {m: 9, h: 1, l: 7, f: 2}. 7/57 Two letters picked without replacement from szjjs. What is prob of sequence jz? 1/10 Two letters picked without replacement from {s: 5, p: 1, a: 5}. Give prob of sequence sp. 1/22 Four letters picked without replacement from {c: 1, p: 5, y: 1, w: 4}. Give prob of sequence pcww. 1/132 Two letters picked without replacement from {m: 3, z: 4, c: 2, a: 1, i: 9}. What is prob of sequence ci? 1/19 What is prob of sequence kmu when three letters picked without replacement from wwsmukswwsupspsss? 1/2040 Four letters picked without replacement from {i: 2, c: 5, e: 2}. Give prob of sequence ecce. 5/378 Three letters picked without replacement from {h: 1, q: 1, z: 2, j: 2, m: 2, d: 1}. What is prob of sequence hdm? 1/252 Three letters picked without replacement from wwwkwbyykbxkwkyy. What is prob of sequence kkk? 1/140 Calculate prob of sequence zgo when three letters picked without replacement from {g: 1, z: 12, o: 1}. 1/182 Calculate prob of sequence exxc when four letters picked without replacement from {c: 14, x: 3, h: 1, e: 1, l: 1}. 7/9690 Two letters picked without replacement from {a: 1, t: 1, u: 7, f: 2, p: 9}. Give prob of sequence aa. 0 Two letters picked without replacement from qxvvpwz. What is prob of sequence xp? 1/42 Four letters picked without replacement from {h: 4, y: 3, p: 1, b: 2}. What is prob of sequence pbyh? 1/210 Two letters picked without replacement from {i: 1, q: 2, r: 1, c: 5}. What is prob of sequence rq? 1/36 Four letters picked without replacement from {n: 2, d: 2, c: 1, a: 1}. What is prob of sequence dcan? 1/	{ "pile_set_name": "DM Mathematics" }
What is the hundreds digit of m? 7 Suppose -5z - 2172 = -4s - z, -2z - 2182 = -4s. What is the tens digit of s? 4 Let g(k) = 2k - 2 - k2 - 4k + k + 4. Let v be g(-5). What is the units digit of v/(-3) - 2 - -28? 2 Suppose -2k + 1929 = -3n, -4n = -k - 154 + 1116. What is the units digit of k? 6 Suppose 7 = 4o - 0y + y, -2o - 2y = -8. What is the units digit of (-1o)/(9/(-117))? 3 Let o(k) = -4k2 - 32k - 30. Let u be o(-7). Let p(g) = 3g - 6g - 2g. What is the units digit of p(u)? 0 Suppose -136 = b + 3b. Let i = b + 47. Suppose -a + 4z = 1 - i, 0 = -3a + 5z + 71. What is the units digit of a? 2 Let k(o) = 2o*2 + 96o + 100. What is the hundreds digit of k(-53)? 6 What is the thousands digit of (-23)/((-92)/(-5160))(-16)/20? 1 Let p = -147 + 97. Let g = 95 + p. What is the units digit of g? 5 What is the units digit of 42/(-7) + -3 + 2364 - 4? 1 Suppose 5s - 3k - 46 = 0, 2s - 13 = -3k + 18. Let z = s - 19. Let u = 13 + z. What is the units digit of u? 5 Suppose -3l + 17397 = 3d, -7d - l - 23211 = -11d. What is the hundreds digit of d? 8 Suppose 20k = 53108 + 18052. What is the units digit of k? 8 Suppose -2f - 5a + 7 + 8 = 0, f + 2a - 7 = 0. Suppose -fi - 53 = -3d, 4i - 3 = -7. What is the tens digit of (-8)/d + (-101)/(-2)? 5 Let g(p) = p*3 - 3p*2 - 5p + 6. Let z be g(4). Suppose -2w - z = -6. Suppose 0o + 110 = 2s - 5o, -o - w = 0. What is the tens digit of s? 5 Suppose -6y + 33 = -81. Let z = 19 - y. What is the tens digit of z/(-4 - -3) - -44? 4 Let r be (6584/6)/2. Let o = r + -160. What is the units digit of o? 2 Let d(h) = -5h3 - 3h*2 + 4h + 5. Let s be d(-4). Suppose s - 66 = -3t. Let n = -46 - t. What is the tens digit of n? 1 Suppose 3f + 20 = -f. Let q(n) = -14n - 2. Let t be q(f). Let c = t - 43. What is the tens digit of c? 2 Let p(f) = 15f*3 - 6f*2 + f + 1. What is the tens digit of p(3)? 5 Let k(p) = 7p*2 + 9p + 15. What is the hundreds digit of k(-11)? 7 Let h be 11 + (-8)/(-3 + 1). Suppose 2g - h = 39. What is the tens digit of g? 2 Let l be 165 + 2 + 0 + -18 + 21. Let c = -20 + l. What is the hundreds digit of c? 1 Let u(f) = 3f - 17. Let i be u(7). Suppose -5z + 9 = 2j - 19, -ij + 4z = -84. What is the tens digit of j? 1 Let i be 4 + 3/(9/6). Let t(f) = if - 3f + f - f - 12. What is the units digit of t(12)? 4 Suppose 0h - 48 = 4h. Let g be (h/3)/((-8)/(-12)). Let j(a) = a*2 + 2a + 12. What is the units digit of j(g)? 6 What is the tens digit of 223(-2)/(-18)-3-3? 2 Let y(h) = -h2 + 9h + 19. Let p be y(10). Let u = 32 - p. What is the tens digit of u? 2 Let j(h) = -h + 3. Let o be j(-3). Let l(v) be the third derivative of -v6/120 + v5/12 + v4/4 + v3/6 + 683v2. What is the units digit of l(o)? 1 Suppose -4c + 70 = -106. What is the units digit of (-8 - 4/(-1)) + c? 0 Let t(a) = 2a2 - 53a + 17. Suppose -2c - 142 = -5o, 0c = -5o + 5c + 145. What is the hundreds digit of t(o)? 1 Suppose 29u - 27u = 4766. What is the units digit of u? 3 Let d(w) = 5w - 12. Let n be d(5). Let c = n - 14. What is the tens digit of (c - -66)(-6)/(-15)? 2 Let o = -1718 - -629. What is the tens digit of (-1 + 3)o/(-22)? 9 Suppose 3m - 22 = -a, -5a + 3m + 7 = -31. Let n(u) be the third derivative of -u4/24 + 17u*3/6 + 2u*2. What is the units digit of n(a)? 7 Suppose 2k + 0k = 10, -2r + 5k = -727. What is the tens digit of r? 7 Suppose 0 = -3b - 5s + 44, -2s + 50 = 2b + b. Let m be 10/(-45) + 148/b. What is the units digit of 616/70 - m/10? 8 Suppose 2560 + 1169 = 11g. What is the tens digit of g? 3 Let c(q) = q*3 - 4q*2 - 5q + 3. Let z be c(5). Suppose zj + 4v = 2v + 56, -5j - 3v = -93. What is the units digit of j? 8 What is the thousands digit of -22(-106155)/140? 3 Suppose 3t + 270 = 3w, 17 = -3t + 2. Let y = 203 - w. What is the hundreds digit of y? 1 Suppose 0 = 4f + 3c - 2, -3f = -7f - 4c. Suppose 0 = -0x + fx - 10. Suppose -xl + 0l = -15. What is the units digit of l? 3 Let z be (51/9)/((-3)/(-9)). Let t = z - 13. Suppose tg + 32 - 140 = 0. What is the units digit of g? 7 Let p = 2149 + -824. What is the thousands digit of p? 1 Suppose 3j - 15 = -2j. Suppose 19 = w + d - 4, 125 = 5w + jd. What is the tens digit of (1 - w)2/(-3)? 1 Let a be (0 - (434 - -2))1/(-2). Suppose 6l + 44 = a. What is the units digit of l? 9 What is the units digit of 22170/(-30)(0 - 2 - -1)? 9 Let x be -3 + 80/5-2. Let o = -42 - x. What is the tens digit of ((-58)/(-4))/(o/(-14))? 2 Let q be 6/27 + (-328)/18. Let r = -12 - q. What is the tens digit of (-6)/(((-9)/r)/3)? 1 Let l be -52 - -51 - 3/(6/8). What is the units digit of (l + 1062/12)/((-2)/(-4))? 7 Let y = 2031 + -158. What is the units digit of y? 3 Let d(y) = 3y*2 + 2y - 4. Let k be d(2). Let x = k - 7. What is the units digit of -3 - x/((-10)/98)? 6 Let n be (1/4-5)/(1/(-84)). Suppose 0 = g, n = t - 3g - 157. What is the hundreds digit of t? 2 Suppose 2223 = g + 2r, -4g + 2r + 8862 = -0r. What is the thousands digit of g? 2 Suppose -12 = 15z - 18z. Suppose -3f = -2m + 222, 3m = zf + 271 + 63. Suppose 0b = -3b + m. What is the units digit of b? 8 Let v be -5(1 - 148/(-20)). Let z = v + 43. What is the units digit of z? 1 Let u(p) = 317p*2 + 9p + 3. What is the units digit of u(-2)? 3 Let i(k) = 2k + 4. Let n(s) = s2 - 9s. Let d be n(11). Suppose -4b = -g - 14, 5g + 2b - d = -b. What is the units digit of i(g)? 8 Let k(n) = -788n - 752. What is the tens digit of k(-6)? 7 Let b be -15((-16)/(-20) + 0). What is the units digit of 21/6b/(-7)? 6 Suppose -w = -4w + 3. Let n(k) = 4k*2 - k - 3k*2 - 14k*3 - 2k*3 - w. What is the units digit of n(-1)? 7 Suppose -12 = -4q + 2q. Suppose -2s + 5g + 46 = 0, g + 20 = s - q. Let a = 36 - s. What is the units digit of a? 8 Let w(a) = a + 27. What is the tens digit of w(-15)? 1 Suppose 0 = 6g - 49 - 5153. What is the tens digit of g? 6 Suppose -4i + 5i = -8. Let y = 142 - i. What is the hundreds digit of y? 1 Let t = -232 - -1130. What is the hundreds digit of t? 8 Let h = 609 - -481. What is the units digit of h? 0 Let s = -533 - -1027. What is the units digit of s? 4 Suppose 2z - 61 = 103. Suppose -3j - 2p = 79 + 57, 4p = 2j + 80. Let n = z + j. What is the tens digit of n? 3 Let o = 8725 - 3917. What is the tens digit of o? 0 Let h(f) = -5f*2 - 16f + 3. Let l(m) = -4m2 - 15m + 3. Let u(j) = 5h(j) - 6l(j). Let t be 172/24 - (13/6 - 2). What is the units digit of u(t)? 8 Suppose -3w = -t - 6, -2t + 8 = -3w + 7w. Suppose -wa + 647 = 91. What is the tens digit of a? 7 Suppose 4l - 972 = -9o + 4o, 2l = 5o - 984. Suppose 6m - 2m = o. Suppose -3 + m = d. What is the units digit of d? 6 Let a = 18 + -13. Suppose 8 - 2 = 2u, 13 = -f + au. Suppose -o - 14 = -5o + fl, 0 = -3o - l + 18. What is the units digit of o? 5 Let p = 359 - 192. What is the tens digit of p? 6 Let v = -10 + 5. Let i(y) = 2y*2 + 3y - 16. What is the tens digit of i(v)? 1 Let k = 273 + -35. Let t = k - 86. What is the units digit of t? 2 Let z = 116 + -94. Suppose 0 = 14p + z - 106. What is the units digit of p? 6 What is the tens digit of (-105000)/112(-12)/10? 2 Let f(n) = 2n + 7. Let z be f(-4). Let k be z + (-6)/(-2) - -1. What is the tens digit of -8(-1 - (3 + k))? 5 Suppose -3c = -4q - 506, 3q - 466 = -3c - q. Let f = 294 - c. What is the tens digit of f? 3 Suppose -5r + 2i - 5i + 19 = 0, 4 = -r + 2i. Suppose 0 = -rv + 11v - 846. What is the units digit of v? 4 Let t be 19/(3 - 1 - 1). Suppose -1 = -r, -l - r = 4l + t. What is the units digit of ((-126)/(-3))/((-3)/l)? 6 Let h be (-144)/30((-235)/(-2) + 0). What is the hundreds digit of -3 + h/8-2? 1 Let q(g) = g2 - 3g + 9. Let f = -18 - -13. What is the units digit of q(f)? 9 Let w = 7104 + -2786. What is the tens digit of w? 1 Let a = 221 - -57. What is the units digit of a? 8 Let m be (-4 + 24/5)20. Suppose -2w + 20 = m. Suppose wh = -i + 3, 0 = 2i + 2. What is the units digit of h? 2 Suppose -4*f = -80 + 8. Let w = f + 2. What is the tens digit of w? 2 Let k = -1103 + 1741. What is the units digit of k? 8 Let m = 2 + 51. Let z = m - 25. Let k = 47 - z. What is the tens digit of k? 1 Le	{ "pile_set_name": "DM Mathematics" }
- 6v - 182 What is the g'th term of -977141591, -977141590, -977141589, -977141588, -977141587, -977141586? g - 977141592 What is the x'th term of -4092, -3717, -3064, -2109, -828, 803, 2808? 4x*3 + 115x*2 + 2x - 4213 What is the f'th term of 252000, 249092, 246184, 243276? -2908f + 254908 What is the t'th term of 1238935, 2477609, 3716283, 4954957, 6193631, 7432305? 1238674t + 261 What is the b'th term of -9234, -27765, -58650, -101889, -157482? -6177b2 - 3057 What is the v'th term of 11037297, 11037284, 11037257, 11037210, 11037137, 11037032, 11036889, 11036702? -v3 - v2 - 3v + 11037302 What is the t'th term of 189663, 758611, 1706855, 3034395, 4741231, 6827363? 189648t2 + 4t + 11 What is the t'th term of 9353, 37816, 85417, 152156, 238033? 9569t2 - 244t + 28 What is the y'th term of 825, 865, 939, 1047, 1189, 1365, 1575? 17y2 - 11y + 819 What is the c'th term of -210282, -840527, -1890936, -3361509, -5252246, -7563147? -210082c2 + c - 201 What is the t'th term of 2487, 1987, 1487? -500t + 2987 What is the v'th term of -19685323, -19685325, -19685327, -19685329, -19685331, -19685333? -2v - 19685321 What is the i'th term of 266174, 266170, 266160, 266144, 266122? -3i*2 + 5i + 266172 What is the x'th term of 44, -464, -1562, -3250? -295x2 + 377x - 38 What is the x'th term of 10342, 10498, 10654, 10810, 10966, 11122? 156x + 10186 What is the y'th term of 56641, 112775, 168909, 225043? 56134y + 507 What is the a'th term of -7351, -29129, -65335, -115969, -181031, -260521? -7214a2 - 136a - 1 What is the x'th term of -8482, -8469, -8456, -8443, -8430, -8417? 13x - 8495 What is the v'th term of 6700446, 13400907, 20101368, 26801829? 6700461v - 15 What is the f'th term of -354207, -354252, -354297, -354342, -354387, -354432? -45f - 354162 What is the v'th term of -1892, -3829, -6532, -10385, -15772, -23077, -32684, -44977? -64v3 + v2 - 1492v - 337 What is the n'th term of -56987, -56555, -56123, -55691? 432n - 57419 What is the n'th term of 7904, 15953, 24144, 32477, 40952? 71n2 + 7836n - 3 What is the w'th term of -26744, -26760, -26762, -26744, -26700, -26624? w3 + w2 - 26w - 26720 What is the s'th term of 1180, 4867, 10922, 19345, 30136, 43295, 58822? 1184s*2 + 135s - 139 What is the q'th term of -19997, -79122, -177665, -315626, -493005, -709802? -19709q2 + 2q - 290 What is the w'th term of -136687, -144714, -152741, -160768, -168795, -176822? -8027w - 128660 What is the h'th term of -12552, -25052, -37510, -49926? 21h*2 - 12563h - 10 What is the f'th term of -904229, -1808415, -2712573, -3616709, -4520829, -5424939? -f*3 + 20f*2 - 904239f - 9 What is the k'th term of 184808279, 184808277, 184808275, 184808273? -2k + 184808281 What is the j'th term of -1423406, -2846997, -4270588, -5694179? -1423591j + 185 What is the o'th term of -8450, -16299, -23046, -28139, -31026? 92o3 - o2 - 8490o - 51 What is the u'th term of 249372, 253371, 257382, 261411, 265464, 269547, 273666? u*3 + 3992u + 245379 What is the a'th term of -8343, -9203, -10585, -12447, -14747, -17443, -20493, -23855? 7a3 - 303a2 - 8047 What is the w'th term of -205465, -205460, -205455, -205456, -205469? -w3 + 6w2 - 6w - 205464 What is the l'th term of 1896, 3506, 4856, 5952, 6800? l*3 - 136l*2 + 2011l + 20 What is the h'th term of -3372, -13714, -30964, -55134, -86236, -124282, -169284? -2h3 - 3442h*2 - 2h + 74 What is the v'th term of 2522178, 2522174, 2522156, 2522118, 2522054, 2521958? -v3 - v2 + 6v + 2522174 What is the x'th term of -49000, -51211, -53422, -55633, -57844? -2211x - 46789 What is the s'th term of 69029, 138068, 207115, 276164, 345209, 414244, 483263? -s*3 + 10s*2 + 69016s + 4 What is the p'th term of 126, 2658, 7584, 14892, 24570? -2p3 + 1209p*2 - 1081p What is the v'th term of 38796, 154996, 348666, 619806, 968416, 1394496? 38735v2 - 5v + 66 What is the w'th term of 56664, 227176, 511358, 909204, 1420708, 2045864, 2784666? -w*3 + 56841w*2 - 4w - 172 What is the b'th term of -729823, -1459659, -2189495, -2919331, -3649167, -4379003? -729836b + 13 What is the w'th term of -20931013, -20931012, -20931011, -20931010, -20931009? w - 20931014 What is the z'th term of 8056706, 16113404, 24170102? 8056698z + 8 What is the o'th term of 1844, 1747, 1492, 1001, 196, -1001, -2668? -13o3 - o2 - 3o + 1861 What is the g'th term of -257947241, -515894486, -773841731, -1031788976, -1289736221? -257947245g + 4 What is the j'th term of -5058, -18251, -40246, -71049, -110666, -159103, -216366, -282461? -j3 - 4395j2 - j - 661 What is the v'th term of -76089, -76021, -75901, -75723, -75481, -75169, -74781? v3 + 20v2 + v - 76111 What is the g'th term of 14958924, 14958930, 14958946, 14958978, 14959032, 14959114, 14959230? g3 - g2 + 2g + 14958922 What is the g'th term of -357270, -715009, -1072748, -1430487, -1788226? -357739g + 469 What is the r'th term of 4622, 13629, 28640, 49655? 3002r2 + r + 1619 What is the u'th term of -15881, -13282, -10673, -8048, -5401, -2726? u3 - u*2 + 2595u - 18476 What is the t'th term of -9817, -20511, -31191, -41851, -52485, -63087, -73651, -84171? t3 + t2 - 10704t + 885 What is the f'th term of 923, 755, 589, 425, 263? f2 - 171f + 1093 What is the m'th term of -1319, -2090, -2289, -1916, -971, 546? 286m2 - 1629m + 24 What is the v'th term of 190253131, 190253138, 190253157, 190253194, 190253255, 190253346, 190253473, 190253642? v*3 + 190253130 What is the m'th term of -377, -3005, -10139, -24029, -46925? -375m*3 - 3m*2 + 6m - 5 What is the p'th term of -14055, -112457, -379521, -899577, -1756955, -3035985, -4820997? -14055p3 - p2 - 14p + 15 What is the w'th term of -20182634, -40365218, -60547802? -20182584w - 50 What is the g'th term of 16560, 44216, 71872? 27656g - 11096 What is the i'th term of -2341, -4597, -6821, -9007, -11149, -13241, -15277? i*3 + 10i*2 - 2293i - 59 What is the o'th term of -13183, -26768, -40777, -55210, -70067, -85348? -212o2 - 12949o - 22 What is the o'th term of 458519179, 458519178, 458519177, 458519176? -o + 458519180 What is the a'th term of -2845, -10965, -24355, -43015, -66945, -96145, -130615? -2635a2 - 215a + 5 What is the i'th term of -19294, -34721, -50150, -65581, -81014, -96449, -111886? -i*2 - 15424i - 3869 What is the y'th term of -42480809, -42480812, -42480815? -3y - 42480806 What is the l'th term of -384062, -384502, -384942? -440l - 383622 What is the i'th term of -740515, -1481031, -2221547, -2962063, -3702579? -740516i + 1 What is the h'th term of 27725730, 27725720, 27725708, 27725694, 27725678, 27725660? -h2 - 7h + 27725738 What is the c'th term of -3340063, -3340059, -3340053, -3340045, -3340035? c*2 + c - 3340065 What is the k'th term of 211521, 211540, 211571, 211614? 6k*2 + k + 211514 What is the j'th term of 68869104, 137738212, 206607320, 275476428, 344345536, 413214644? 68869108j - 4 What is the l'th term of 12108, 24756, 37422, 50106, 62808, 75528? 9l2 + 12621l - 522 What is the v'th term of -15622, -24428, -39104, -59650, -86066, -118352? -2935v2 - v - 12686 What is the k'th term of -13, 80, 251, 542, 995, 1652, 2555, 3746? 7k*3 - 3k*2 + 53k - 70 What is the v'th term of 2964, -466, -6182, -14184, -24472, -37046? -1143v2 - v + 4108 What is the d'th term of -2981687, -5963379, -8945071, -11926763? -2981692d + 5 What is the x'th term of 51143, 50895, 50647? -248x + 51391 What is the w'th term of -9605734, -19211456, -28817180, -38422906, -48028634, -57634364, -67240096? -w2 - 9605719w - 14 What is the q'th term of 31586, 127748, 288018, 512396? 32054q2 - 468 What is the i'th term of 13451, 13310, 13169, 13028, 12887, 12746? -141i + 13592 What is the r'th term of 11126, 13981, 21732, 36827, 61714, 98841, 150656, 219607? 408r3 - r + 10719 What is the j'th term of 77, 253, 531, 905, 1369? -j3 + 57j*2 + 12j + 9 What is the r'th term of -2361, -2896, -3415, -3918, -4405, -4876, -5331? 8r2 - 559r - 1810 What is the g'th term of -40434, -40582, -40982, -41760, -43042, -44954, -47622? -21g*3 - g - 40412 What is the l'th term of 2034386, 4068756, 610312	{ "pile_set_name": "DM Mathematics" }
divided by 13? 6 Let y(c) = -4c - 1. Let r(x) = 28x + 1. Let p(s) = -r(s) - 6y(s). What is the remainder when ((-60)/14)/(1/(-7)) is divided by p(0)? 0 Let t be 10/(-20)(-76)/1. Suppose 6b - t = -x + 8b, -4x = -2b - 182. Calculate the remainder when x is divided by 25. 23 Let a be 254/(-4) - 111/(-74). What is the remainder when 194 is divided by (4/(-6))/(a/3627)? 38 Suppose 8 = -3h + 23. Suppose -245 + 40 = -hl. What is the remainder when 79 is divided by l? 38 Suppose 5a - 5d + 2d - 319 = 0, 0 = -5a - d + 307. Suppose -s - 3w = -187, 10s - w - 696 = 6s. Calculate the remainder when s is divided by a. 51 Suppose 0 = -5z + w + 399, -7z + 4z + w = -239. Calculate the remainder when 125 is divided by z. 45 Let c be (4/(-14))/((-12)/336). Suppose -3y + cy = 110. Calculate the remainder when y is divided by 6. 4 Suppose -2y - 46 + 72 = -2b, -2y - 4b + 26 = 0. Suppose -x + 7x = 4164. What is the remainder when x/8 - (-3)/12 is divided by y? 9 Let y = -1047 + 1055. What is the remainder when 438 is divided by y? 6 Suppose -2x + 2 = 0, i + 3x - 5x - 28 = 0. Calculate the remainder when 30 + 20 - ((-1)/1 - -2) is divided by i. 19 Let g = 408 + -108. Let r = g + -237. What is the remainder when 247 is divided by r? 58 Let l(r) = -r*3 + 11r*2 + 3r + 44. Calculate the remainder when l(5) is divided by 10. 9 Calculate the remainder when ((-5988)/(-9)-1)/(100/(-150)) is divided by 274. 176 Suppose -109789 = -125p + 58557 + 7529. What is the remainder when p is divided by 281? 2 Let c = 3158 - 1607. Suppose -5b + 807 = 2i + 36, c = 4i + b. What is the remainder when i is divided by 26? 24 Let q = -1645 + 1715. Calculate the remainder when 145 is divided by q. 5 Suppose -12u = -13u - 6. What is the remainder when 85 is divided by (-11)/((-110)/400) - u? 39 Suppose 0 = -3n + 2u + 107, 5n = -18u + 22u + 179. Suppose -40b + nb = -50. What is the remainder when 36 is divided by b? 6 Suppose 0 = 4s + 3m - 150, -4m + 123 = 4s - 29. Let c = -6 + s. Suppose 6k = k + c. What is the remainder when 21 is divided by k? 3 Let x be 2(-3)/(-10) - (-7)/5. Suppose 3 = h - 5k, -75 = -2h - xh - k. What is the remainder when 84 is divided by h? 12 Let t(g) = -14g + 190. Let o be t(11). What is the remainder when 95 is divided by 3/(-15)12(-90)/o? 5 Let f(s) be the second derivative of -5s3/6 + 10s*2 - 2s + 25. What is the remainder when 313 is divided by f(-3)? 33 Let d = -135 + 132. What is the remainder when (-3 - (-25)/(-10))(d + -55) is divided by 64? 63 Suppose -37 = -3i + 8. Let y = 23 - -1. Let h = 79 - y. Calculate the remainder when h is divided by i. 10 Suppose -124s + 1064 = -96s. Calculate the remainder when 43 is divided by s. 5 Let s be 0/(42/(-7) + 5). Suppose 4r + b - 20 = -3b, -2r + b + 25 = s. What is the remainder when r is divided by 1/(2/(7 + -1))? 1 Suppose -4q + 5a + 504 = 0, -113q + 639 = -108q - 4a. Calculate the remainder when q is divided by 68. 63 What is the remainder when 5 + ((-12)/(-7))/((-52)/(-30758)) is divided by 16? 11 Let s be 2/8 - 465/(-124). Suppose 1 + 43 = sd + 4i, 2d - 4 = 4i. What is the remainder when 40 is divided by d? 0 Let v(z) = z*3 - 4z*2 + 14z - 235. Calculate the remainder when v(11) is divided by 155. 146 Let a(u) = 2u2 + 168u + 990. Calculate the remainder when 1349 is divided by a(-6). 53 Let t be ((-5)/10)/((-1)/(-62)). Let c = t + 59. Calculate the remainder when c is divided by 82/(-41)(-1)/416. 4 Let i = -2939 + 2975. What is the remainder when i is divided by 20? 16 Let k(q) be the first derivative of -q*2/2 + 101q - 47. What is the remainder when k(-23) is divided by 24? 4 What is the remainder when (-514)/(-4) + (0 - ((-40)/(-16))/5) is divided by 69? 59 Let c = 33140 + -33007. Calculate the remainder when 851 is divided by c. 53 Let z = -2547 - -3355. Calculate the remainder when z is divided by 116. 112 Let q(d) = 45d2 - 1. Let n = 423 + -206. Calculate the remainder when n is divided by q(1). 41 Suppose -4a - 201 = -5c + 151, -3a - 282 = -4c. Suppose 17l - 196l = -4475. What is the remainder when c is divided by l? 22 Suppose 333 = 3m + 306. Calculate the remainder when 218 is divided by m. 2 Let j = 509 - 741. Let d = -155 - j. Calculate the remainder when d is divided by 26. 25 Let b be (-2 - -3)/(1/5). Suppose -3d + 597 = -5r + 6, -d + 597 = -br. Let x = r - -178. Calculate the remainder when x is divided by 20. 18 Let m = 5285 + -5015. What is the remainder when m is divided by 72? 54 Let q = -166 - -293. Let x be (-25 + 6 - -8) + 7. Calculate the remainder when q is divided by 18/(12/x) + 38. 31 Let d(x) = -x2 - 12x - 11. Let j be d(-11). Suppose 5p - 5m = 340, 5m - 4m = j. Calculate the remainder when p is divided by 18. 14 Suppose 3m - 5l = 2096, -2m + 2l + 2387 = 991. Calculate the remainder when m is divided by 338. 21 Suppose 0 = -2z + 403 - 121. Let d(u) = -2u*2 - 127u + 1102. What is the remainder when z is divided by d(-71)? 30 Suppose -23r + 327 = -500 + 229. Calculate the remainder when 46 is divided by r. 20 Let x(j) = j3 + 6j*2 - 7j + 4. Suppose 4339 + 4137 = -13i. Let n = i - -662. What is the remainder when x(-6) is divided by n? 6 Let b = -101 - -190. Let w(a) = -a3 + 8a*2 - 9a - 7. Let k be w(6). Suppose ku = u + 300. Calculate the remainder when b is divided by u. 29 Suppose -12q - 12 = -14q. Let j be (-2 + -133)q/(-9). Suppose 31f = 26f + j. Calculate the remainder when f is divided by 10. 8 Let o = -3101 - -4839. Let y = o - 1150. What is the remainder when y is divided by 59? 57 Let z = 34 + -22. Suppose 0 = -2q - 11q + 39. Suppose z = qd - d. Calculate the remainder when 15 is divided by d. 3 Let p = -21962 - -22027. Calculate the remainder when 304 is divided by p. 44 Let i(p) = p3 - 60p*2 + 119p - 90. Calculate the remainder when 171 is divided by i(58). 3 Let a(h) = -28h - 1874. Calculate the remainder when 2038 is divided by a(-68). 28 Suppose 21012 = 136u - 33u. What is the remainder when u is divided by 43? 32 Let g(y) = y2 - 16y - 61. Let t be g(20). Suppose -2c = -7 - t. Calculate the remainder when 50 is divided by c. 11 Let g = -538 - -679. Suppose 3v = 3f - g, -10f + 90 = -8f - 4v. What is the remainder when 95 is divided by f? 46 Suppose -171 = 4b - 5d, 3b + 120 = 2d - d. Let a = b - -44. Calculate the remainder when 47 is divided by 1 - -7(a - 4). 7 Suppose b - 34 + 39 = 0. Let l = b - -189. Calculate the remainder when l is divided by 21. 16 Suppose -z + 33 - 31 = 0. Suppose 0 = -zk + 9n - 5n - 5332, 7968 = -3k - 4n. Calculate the remainder when k/(-25) - 3/(-5) is divided by 29. 20 Suppose -12 = -4k - o, 3k - 9 + 0 = -2o. Suppose 2i - 48 = 4h, -kh + 11 = -4i + 92. What is the remainder when 69 is divided by i? 15 Let h(u) = u3 + 10u*2 + u + 15. Let i be h(-10). Suppose -n - 3 - 52 = -2k, 2k + in - 85 = 0. What is the remainder when 112 is divided by k? 22 Suppose 5k - 156 = -141. Suppose -4r + 4j + 74 = -186, kj - 281 = -4r. What is the remainder when 199 is divided by r? 63 What is the remainder when 136 + -137 + 4241 is divided by ((-2)/(-5))/(2/40)? 7 What is the remainder when (3037/2)/(107/214) is divided by 31? 30 Suppose -9b + 2 = -8b. Suppose -3q + 4d + 88 - 9 = 0, 4d - 46 = -bq. Suppose -198 = -3y + 96. What is the remainder when y is divided by q? 23 Suppose -2z - 385 = -f, 307z - 305z = -3f + 1171. What is the remainder when f is divided by 196? 193 Suppose -9a + 21a = 3648. Let i = -289 + a. What is the remainder when 131 is divided by i? 11 Let g(r) = r*2 + 8r + 19. Let z be g(-4). Suppose -74 = -3k - 5o, 11 - 61 = -2k - zo. Suppose -u + k = 6u. What is the remainder when 5 is divided by u? 1 Let m(u) be the third derivative of 7u*4/8 + 4u*3/3 + 15u*2. What is the remainder when m(7) is divided by 16? 11 Let i be ((-15)/(-3) - -45)-1. Let s = -27 - i. What is the remainder when 179 is divided by s? 18 Let k = -18 + 29. Let x(d) = d*2 - 7d. Let i be x(k). Suppose -b - l + i = -0l, 5b - 3*l = 204. What is the remainder when b is divided by 22? 20 Let y = 294 + -292. What is the remainder when ((-132)/88)/(y/(-88)) is divided by 29? 8 Let	{ "pile_set_name": "DM Mathematics" }
7y3 Collect the terms in 556o*3 - 1147o*3 + 572o*3. -19o*3 Collect the terms in 463 - 1454r*2 - 463 - 1297r*2. -2751r*2 Collect the terms in 184z*3 + 17z*2 - 347z*3 + 167z*3. 4z*3 + 17z*2 Collect the terms in -1902t + 965t + 938t. t Collect the terms in -8656h3 + 4223h*3 + 4437h*3. 4h*3 Collect the terms in 3464i + 3478i - 6942i + 70i2 - 19i*2. 51i*2 Collect the terms in -52937249p*2 + 52937249p*2 + 6p*3. 6p*3 Collect the terms in -319g*2 - 28g*2 + 353g*2. 6g*2 Collect the terms in -397h*2 - 936h*2 - 68h*2. -1401h*2 Collect the terms in 174v*2 - 239v*2 - 127v*2. -192v*2 Collect the terms in -3n + 7n + 4785 - 9620 + 4835. 4n Collect the terms in 30w3 + 32w*3 + 19w*3 - 77w*3. 4w*3 Collect the terms in -1752g + 3474g - 1719g. 3g Collect the terms in 524r*3 + 9638 - 9638. 524r*3 Collect the terms in -4s + 32s - 112s - 46s. -130s Collect the terms in -187y3 + 93y*3 + 99y*3 - 10y*2. 5y*3 - 10y*2 Collect the terms in 682a + 394a - 189a + 663a. 1550a Collect the terms in 15y3 + 177y*2 + 115y*2 - 292y*2. 15y*3 Collect the terms in -11j*3 + 2j*3 + 46j - 5j3 - 12j*3. -26j*3 + 46j Collect the terms in -2v3 - 24831659v + 24831659v. -2v*3 Collect the terms in -16049 + 16049 + 4j. 4j Collect the terms in 84r*3 - 33r*3 + 1 - 47r*3. 4r*3 + 1 Collect the terms in 1234n*3 - 2513n*3 + 7282n*3 + 2481n*3. 8484n*3 Collect the terms in 455v*3 + 451v*3 - 1351v*3 + 449v*3. 4v*3 Collect the terms in -16020 + 48053 - 16017 - 16016 - 5r. -5r Collect the terms in 26325 - 26325 + 2p - 69p. -67p Collect the terms in -3z + 3z + 413z3 + 1127z*3. 1540z*3 Collect the terms in 194q*3 + 193q*3 + 204q*3 - 584q*3. 7q*3 Collect the terms in -3171j*2 + 2332j*2 + 844j*2. 5j*2 Collect the terms in 3s*2 - 5s + 3s + 3s*2 + 2s*2 - 473. 8s*2 - 2s - 473 Collect the terms in -53387 - 2x2 - 53186 + 106573. -2x*2 Collect the terms in 0t + 7t + 4t + 3t - 16t. -2t Collect the terms in 4541q*2 - 9081q*2 + 4540q*2 - 8q*3 + 7q3. -q3 Collect the terms in 2159s - 341s*3 - 2159s. -341s3 Collect the terms in -2200j*3 + 2292j*3 - 180j + 92j + 88j. 92j3 Collect the terms in 32589u - 97837u + 32624u + 32625u. u Collect the terms in -5015 + 5015 + 54b*2 + 9b*3 - 54b*2. 9b*3 Collect the terms in -1455c + 0 - 3 + 3. -1455c Collect the terms in 7b*2 - 6b2 + b2 - 3b2 - 3b*2 - 181b. -4b2 - 181b Collect the terms in 18 - 84r2 - 31 + 13. -84r*2 Collect the terms in -77724 - 12f + 77724. -12f Collect the terms in 13056p + 13050p - 26115p. -9p Collect the terms in -89q - 169q + 58q - 93q + 9. -293q + 9 Collect the terms in 3011u2 + 4201u*2 - 1725u*2. 5487u*2 Collect the terms in 5b - 13b + 61b*3 + 8b. 61b3 Collect the terms in 1136f*2 - 560f*2 - 580f*2. -4f*2 Collect the terms in 28543g - 57088g + 28547g + 21g2. 21g*2 + 2g Collect the terms in 92f2 - 1443f*3 - 485f*3 - 92f*2. -1928f*3 Collect the terms in -67p*3 - 326p*3 + 391p*3. -2p*3 Collect the terms in -63u + 19u + 24u + 8u. -12u Collect the terms in 125 + 9s3 - 40 - 42 - 43. 9s*3 Collect the terms in 0m*3 - 4m*3 - 3157627032m + 3157627032m. -4m*3 Collect the terms in 1177m*2 + 2503m*2 + 5826m*2 - 963m*2. 8543m*2 Collect the terms in 24620h*2 + 24591h2 - h3 - 49211h2. -h3 Collect the terms in 72n + 40n - 87n + 39n. 64n Collect the terms in -1701210i3 + 3i + 1701213i3 - 3i. 3i3 Collect the terms in 8v*2 - 96v*2 - 21v*2 + 132v*2 - 19v*2. 4v*2 Collect the terms in -13f*3 - 15f*3 + 20f*3 + 12. -8f*3 + 12 Collect the terms in 10c*3 + 337 + 9c2 + c3 - 2c - 61. 11c*3 + 9c*2 - 2c + 276 Collect the terms in -8s2 + 105s*3 + 31s*2 - 202s*3 + 99s*3. 2s*3 + 23s*2 Collect the terms in -1279t*3 + 1 + 1230t*3 - 1. -49t*3 Collect the terms in 2228i*2 - 2229i2 - 4 - 7 + 11. -i2 Collect the terms in -19m - 12m + 30m - 3756. -m - 3756 Collect the terms in 410w*2 + 11 - 20w*2 + 8 - 19. 390w*2 Collect the terms in -310d*2 + 35d*2 - 346d*2. -621d*2 Collect the terms in -629j*3 + 1081j*3 - 582j*3. -130j*3 Collect the terms in 4 - 7 + 1 + 6724b*2. 6724b*2 - 2 Collect the terms in 18h*2 + 22215695 - 22215695 - 14h*2. 4h*2 Collect the terms in 19 + 879i - 268i - 19 - 344i. 267i Collect the terms in q + 4q - 12q + 6q + 0q. -q Collect the terms in 3 + 43a + 2 - 5 + 52a - 79a. 16a Collect the terms in 1 + 8v*3 - 1 + 27182v - 27182v. 8v*3 Collect the terms in -4 - 543u + 1111u - 568u - 5u2. -5u*2 - 4 Collect the terms in -90 - 14r*2 + 0r - 35 + 0r. -14r*2 - 125 Collect the terms in -2204g*2 + 4437g*2 - 2214g*2. 19g*2 Collect the terms in 133o - 10o + 168o + 25 + 9. 291o + 34 Collect the terms in -80a*3 + 15a - 5a + 23a*3 + 42a*3. -15a*3 + 10a Collect the terms in 2116m3 - 11095m - 629m3 + 11095m. 1487m3 Collect the terms in 25t*3 + 24t*3 - 41t*3. 8t*3 Collect the terms in 1225r + 1242r + 1226r - 3698r. -5r Collect the terms in 2439g3 + 1115g*3 - 1121g*3 + 2280g*3. 4713g*3 Collect the terms in 5 - 5b*2 + 2b*2 + 375b - 1054b + 0b*2. -3b*2 - 679b + 5 Collect the terms in 1542147 - 10f - 1542147. -10f Collect the terms in -112970r2 + 56482r*2 + 56483r*2. -5r*2 Collect the terms in 4 - 365s*3 - 122s*3 - 4. -487s*3 Collect the terms in 462g + 1 + 65g2 + 4g*2 - 462g. 69g2 + 1 Collect the terms in -3c + 39 - 37 + 150. -3c + 152 Collect the terms in 6 + 12a + 8 - 30 + 16. 12a Collect the terms in -4y*2 - 2y*2 + 10260 - 10260. -6y*2 Collect the terms in -34b*2 - 78b*2 + 112b2 - b3. -b*3 Collect the terms in -7l*3 + 0l*3 - 101479l*2 + 101479l*2. -7l*3 Collect the terms in -3 + 3 - 5935f. -5935f Collect the terms in 363t - 739t + 357t. -19t Collect the terms in -873b - 844b - 839b - 875b + 4259b - 880b. -52b Collect the terms in -3939t + 418t*2 + 3936t - 85t2. 333t*2 - 3t Collect the terms in 38 - 73 + 33m2 + 34 + 6m*2. 39m*2 - 1 Collect the terms in -193037m + 48261m + 48259m + 48258m + m2 + 48259m. m*2 Collect the terms in 1 + 46h - 46h + 69h*2 - 1. 69h*2 Collect the terms in 46348i + 80i2 + 1 - 46348i. 80i2 + 1 Collect the terms in -5559z - 2 - z*3 + 2772z + 2 + 2787z. -z3 Collect the terms in 10 - 13 - 7 + 9 + 2j - 17j. -15j - 1 Collect the terms in -1046971077 - 12h + 1046971077. -12h Collect the terms in 938a - 885971 + 885971. 938a Collect the terms in -734j + 3j*3 + 734j - j*3 - 15j*3 + 9j*3. -4j*3 Collect the terms in -2 + 41l - 119l + 8l - 77l. -147l - 2 Collect the terms in -6g + 2922 + 2928 + 2925 - 8775. -6g Collect the terms in 112w3 + 26w + 23w + 45w. 112w3 + 94w Collect the terms in 17y2 - 31y*2 + 17y*2 + 6y*2 - 1. 9y*2 - 1 Collect the terms in 27 + 8n*2 - 5n*2 - 30 + 4n*2 + 6n*2. 13n*2 - 3 Collect the terms in 12z + 1153828 - 1153828. 12z Collect the terms in 6132o*2 + 6096o*2 + 1 + 6093o*2 - 18318o*2 - 1. 3o*2 Collect the terms in -3028 + a - 2a + 7a + 0a. 6a - 3028 Collect the terms in -272 - 275 - 215 - 4y + 762. -4y Collect the terms in 6m + 4m2 + 3m*3 - 9m*2 + 2m*3 + 5m*2. 5m*3 + 6m Collect the terms in -3 + 2k + 8k + 1 + 7 + 4k. 14k + 5 Collect the terms in -8p + 74p*3 - 14p - 4p - 4p. 74p3 - 30p Collect the terms in -31u2 + 11 + 13 + 16u*2. -15u*2 + 24 Collect the terms in 27o - 17 + 162o + 105. 189o + 88 Collect the terms in -2 - 771z + 2 + 774z - 4z2 + 0z*2. -4z*2 + 3z Collect the terms in -3 + 6d - 4d + 13d2 + 332d*2. 345d*2 + 2d - 3 Collect the terms in -1839t2 + 2802t*2 - 965t*2. -2t*2 Collect the terms in -260h + 53h - 137h. -344h Collect the terms in 2f*3 - 1237f*2 + 0f*3 + 1237f*2 + 3f*3. 5f*3 Collect the terms in -5390257 + 10780522 - 5390265 + 6y*2. 6y**2 Collect the terms in 1 -	{ "pile_set_name": "DM Mathematics" }
5t5) - 4t*2 + 31t*5 + 15t*2 - 11t*2. 32t*5 Expand (-2u*3 - u + u)(-51u2 - 52u*2 - 17u2) - u5 - 2u5 + 6u*5. 243u*5 Expand (-r + 3r + 2r + (-r + 0r + 4r)(-6 - 5 - 4))(2r + 0r + 0r)(5 - 5 + 1) + r2 - 6r*2 + 4r*2. -83r*2 Expand 3462 - 3462 + 284p5 + (p - p4 - p)(4p + p - 4p) + 5p - 5p - p5 + 3p5 - p2 + p2 + (-p3 + p3 + p4)(p + 2 - 2). 286p*5 Expand -18c*2 + 28c*2 - 18c*2 + (3 - 3 - 1)(0c2 - 4c2 + c2). -5c2 Expand (0 - 1 - 1)(4x3 - 64 + 64 + (-2x + 0x + x)(787 - 787 - 26x2)). -60x*3 Expand (-3a - 2a + 6a)((1 - 1 + 2)(-a - 2 + 2) - 20a - 3a + 0a + 4 + a - 4). -24a*2 Expand (19x*3 - 22x*2 + 16x*3 - 28x*3)(-4x + 4 - 4). -28x*4 + 88x*3 Expand (2 - 2 - 2o + (0 - 2 + 0)(-7o + 7o + 8o))(-o2 - 1 + 1) + 0o*3 + 5o*3 - 3o*3. 20o*3 Expand (-2u*4 + 0u*3 + 0u*3)(83 - 83 - 56u). 112u*5 Expand 0u + 3u - 4u + u + 2u - 4u - u - 2 + 2 - 2 + 2 - 2u + (-2 + 2 - 1)(u + 4 - 4) + 0u - 3u + 2u + 2u + 1 - 1 + (3 - 5 + 4)(85 - 42u - 85). -89u Expand (-2285 + 1141 + 1144 + 7163t*2)((-2 - 3 + 3)(-t + t + 2t) + 4t - 2t - 4t). -42978t*3 Expand 11a*2 - 4a*4 + 1 - 11a*2 - 1901 - 66a*4 + 1901 + (-2a*3 - 4a*3 + 4a*3)(2 - 2a - 2) - 4a*4 + 3a*4 + 3a*4 - 2a*4 + 4a*4 + 0a*4. -62a*4 + 1 Expand -2c*4 - 4c*3 + 4c3 + (-c4 - 9c4 - 3c*4)(0 - 3 + 0). 37c4 Expand (v2 - v2 - 2v*2)(-2 + 3 + 0) - 2v2 - v2 + v2 + v2 + 0v*2 - 5v*2 + 31v*2 - 33v*2 + 1 - 3v + 4. -10v2 - 3v + 5 Expand (4a3 + 4a*3 - 4a*3)(0 - 2a2 + 0) - 5 - 18a*5 - 3 - 1763a*5 + 8. -1789a*5 Expand (326 + 22 - 20)(-y - 6y + 4y). -984y Expand (-3 + 1 + 5)(-5d + 8d + 5d)(4 + 1 - 4). 24d Expand (-19h + 9h - 11h)(0 + 1 - 6)(-2 + 2 + 2) - 7h - 4 + 4. 203h Expand (-2846 + 2846 + 89d)(0 + 0 + d)(2d - 3d + 3d). 178d3 Expand (-3 - 286b*2 + 140b*2 + 134b*2)(-2 - 1 + 4). -12b2 - 3 Expand (4 - 4 - 2j*2)(118j - 1 - 3j*2 - 117j - 6j2). 18j*4 - 2j*3 + 2j*2 Expand (2 + 5 - 2)(-18f - 12f - 6f)(f - 5f2 + 46 - 49 + 3f*2). 360f*3 - 180f*2 + 540f Expand (-154i + 39i - 82i)(-3i2 - 2i*2 + 4i*2)(-2i + 1 - 1). -394i4 Expand b2 + 2b2 - 4b*2 + 56b*2 - 92b + 92b + (-3b - 3b + 4b)(2b + b - 2b). 53b*2 Expand -2u2 + u2 - u*2 + (46u - 7u + 30u)(0 + 0 + 2u) + u2 + u2 - 3u2. 135u*2 Expand (-35 - 40 + 13)(-12 - 1415c2 - 6 + 1413c*2)(-c*2 + 0c*2 + 0c*2). -124c*4 - 1116c*2 Expand 2 - 3x - 2 + (-2 + 5 - 1)(3x - 7x + 3x) + x + 2x - 4x - 10x - 22x - 2 + 39x. x - 2 Expand (-w + w - w)(-40 - 24 + 88)(-5w*2 - 6w*2 + 6w*2). 120w*3 Expand -2a*3 - 2a3 + a3 + (-6 + 3 + 1)(-a - 2a*3 + a) + (2 - 6 + 3)(3 - 1 + 0)(2 - 26a*3 + 28a*3 + 2). -3a*3 - 8 Expand 31s*4 - 5s*4 + 9s4 + (-s3 - 3s3 + 2s*3)(3s - 4s - s) + 39s4 + 14s*4 - 18s*4. 74s*4 Expand ((-1 + 0 - 1)(-y - 3y + 2y) - 3y + 2y + 2y + (y + 2y - 4y)(-1 + 0 - 1))(-2 + 0 + 0)(7 - 4 + 5). -112y Expand (-2 + 0 + 5)(-25y - 25y + 10y + 19 + 35y). -15y + 57 Expand (-13 + 13 + 2j + (-12j - 4j + 3j)(-3 - 2 + 3) - 3 - j + 3 - j - 2j + 5j)(5 + 3j*2 - 5). 87j*3 Expand 6l + 0l + 4l + (5 + 1 - 5)(5l - 3l - 4l) + 1 - 3l - 1. 5l Expand (0 - 2 - 1)(0 + 0 + 2)(-19w5 - 12w*3 + 12w*3). 114w5 Expand (-t3 + 0t + 0t)(t2 - 3t + 3t + (-7 + 7 - 4t)(13 + 5t - 13)) + (2t5 - 3t*5 + 5t*5)(1 + 2 - 5). 11t5 Expand p + 1 - 1 + 2p + 0 + 0 + (-7 + 14 + 5)(0 - p + 0) + 0p - 3p + 5p. -7p Expand (-5v + 4v - 6v)(0v*3 + 0v3 + v3)(8v - 27 + 27 + (-2 + 4 - 3)(-v + 2v + v)). -42v5 Expand (2 - 1 + 0)(20 + 17 - 4)(-f + 2f - 3f). -66f Expand ((-k*3 - 2k*3 + 0k*3)(-2 - 3 + 7) - 2k3 + 2k3 - k3)(-13 + 8 - 2k*2 + 4 - 32k). 14k5 + 224k*4 + 7k*3 Expand (-3v - v + 6v)(-4 + 2 + 1)(267 - 220 - 209). 324v Expand (0p - p + 3p)(0p*3 + 7p*3 - 2p*3) - 2p*4 - 4p*4 + 0p*4. 4p*4 Expand (-7z*3 + 3z*2 - 3z*2)(3 + z*2 - 3 + (-2 + 2 - 2z)(4z - 4z - z)). -21z*5 Expand -13o + 81o3 + 80o*3 - 163o*3 + (1 - 1 - o)(3 + 2o2 - 3). -4o*3 - 13o Expand ((6d2 - 4d*2 - 3d*2)(d - d + 2d) + 0 + 0 - 2d*3)(1 - 1 - 1). 4d3 Expand -l3 - 6l*3 + 5l*3 - 3l*3 - 2l*3 + 2l*3 + (11l - 5l + 0l)(4l*2 - 4l*2 - 2l*2) - 3l*3 + 3l3 + l3. -16l3 Expand (-50n*2 + 2025n - 2025n)(2n - n + 0n)(2n + 0n + 0n). -100n4 Expand (-54d + 5 + 0 + 56d)(d3 - d3 - 3d3). -6d*4 - 15d*3 Expand (7 + 12 + 13)(2k - 1 + 1)(-k2 + k2 - k*2). -64k*3 Expand (-183n*2 + 6105n - 6105n)(-4n + 3n - n)(-1 + 0 + 0). -366n*3 Expand (5x + 6 - 9x - 3x)(8 - 4 - 2x - 2x). 28x*2 - 52x + 24 Expand 12q + 2 - 19q + 2q2 + 12q + (1 - 3 - 1)(2q*2 + 0 + 0). -4q*2 + 5q + 2 Expand (-f2 - f2 + 25f2)(2f3 - 2f3 - f3). -23f5 Expand (-1 + 1 - s)(164s3 - 1864s*2 + 1864s*2 + 2s*4). -2s*5 - 164s*4 Expand (-253a + 253a + 37a*2)(-4 - a*2 + 4) - 7a*2 + 5a*4 + 7a*2. -32a*4 Expand (0 + 3 + 2)(0 + v + 0)(1 - 1 + 2 + (-1 + 4 - 2)(0 + 1 - 2) - 1 + 3 + 2). 25v Expand (-3t - 3t + 4t)(191t*3 + 750t - 750t). -382t*4 Expand 19i*3 - 20i*3 - 26i*3 + (-2 - 2i*2 + 2)(-9 + 22i + 9). -71i*3 Expand (160v*2 - 3 + 165v*2 - 319v*2)(v*2 - 2v*2 + 3v*2). 12v*4 - 6v*2 Expand (-3 + 3 - 2x + (-1 + 2 - 3)(-3 - 2x + 3) - 2x + 1 - 1 + 3 - 3 + x - 2 + 2 + x + 2 - x + 1 + 2)(2x - 4x - 4x). -6x*2 - 30x Expand (4a3 + 24a*2 - 24a*2)((0a2 + a2 + 0a*2)(4 + 0 - 5) - 6a - 7a*2 + 6a). -32a5 Expand (-931 + 2565 - 838)(2l - 1 + 1). 1592l Expand -28v3 - 74v*3 + 6v*3 + (-1 + 1 + 2v)(-4v*2 + 4v2 - v2). -98v3 Expand (0 - 3 + 5)(-5m + 6m + 0m)(-1 + 0 - 1)(21 - 23 - 20). 88m Expand (0g + 7g + 2g)(-4g + 3g - 16g) + 0g + 0g + g2 + (3g - g + 0g)(-g + 3g - 3g). -154g2 Expand -l3 - 2l - 113l2 + 226l*2 - 115l*2 + (-4 + 1 + 2)(-2l3 - 2l*3 + 6l*3). -3l*3 - 2l*2 - 2l Expand (21790 - 21790 - 173i)(1 + 0 - 2). 173i Expand (-2c - c + c)(4c*2 + 2c*2 - 5c*2 + (3c - c - 3c)(2c - 2c - c) - 9 + 9 + 4c2)(0 + 10c2 + 0). -120c*5 Expand -3o*4 - 2o*4 + 3o4 + (o3 + 4o3 - 2o*3)(o + 0o + o) - 3273o*3 - 17o*4 + 3273o*3. -13o*4 Expand (74b + 47b - 15b - 27b)(6 - 6 + 5b). 395b*2 Expand (20 + 21 - 19)((-u - u + 3u)(2u4 + u2 - u2) - 2u*5 + 2u*5 + 8u*5). 220u*5 Expand (-11 - 1 - 2)(-3b2 + 14b*2 - 3b*2). -112b*2 Expand (4u*4 + 2u*4 - 4u*4)(3u - u - 3u) + (2 - 1 + 3)(-2 + 2 - 2u)(0u + 2u + u)(u3 - 1 + 1) + u5 + 5u5 - 4u*5. -24u*5 Expand (-10b + 39b - 5b)(5b2 - b2 - 2b2) + b3 - 2b*2 + 2b*2 + (-2 - 2b*2 + 2)(-2b - b + b) - b3 + b3 + 2b*3 + 5b - 5b - b3. 54b*3 Expand (9b + 2b - b)(-174 + 32 + 727). 5850b Expand (0 + 1 + 0)(3j4 + 4j4 - j4)(8 + 84 - 51). 246j*4 Expand -l + l + 2l*5 + (5l*5 - 2l*5 - 2l*5)(348 - 67 + 260). 543l5 Expand 0v*5 + 0v5 - v5 + (508v + 503v - 918v)(3v4 - v4 - 4v*4 + (0v - 3v + 2v)(0v*3 + 3v*3 - 2v*3)). -280v*5 Expand (-2 + 7 - 3)(-10c - c3 + 10c) - 3c + 3c - 2c3 + (123 + 19c - 123)(0 + c + 0)(2c - 2c - c) - c - 2c3 + c. -25c*3 Expand (-l + 2 - 2)(-9 - 3 + 3)(-2 + 2 - l). -9l*2 Expand (-46 + 97 - 22u - 50)(2 + 0 - 3). 22u - 1 Expand (-3l + 3l + 14l)(-2l + 2l - 2l + (2 - 1 + 1)(-l + 2 - 2)). -56l2 Expand (-70 + 7k + k - 6k)(-2 + 1 + 2). 2k - 70 Expand (-5h*4 + 0h*4 + 4h4 + (-h2 - 2h2 + h2)(3h2 + 8h*2 - 2h*2))(-5h + 7h + 6h)(1 + 0 + 1). -304h5 Expand (-4 - 3 + 6)(-k*3 + 2k*3 + 23k*3) - 2k*3 + 3k3 + k3 + (0k2 - 2k*2 + 3k*2)(-2 + 2 - 2k) + 17k3 - k3 + 4k3. -4k*3 Expand -4v*2 + 7v*2 + 4v*2 + 5v - 5v - v2 + (0v - 3v + 5v)(-v + 5v - 2v). 10v*2 Expand 2 + 28j*2 - 4j*5 + 7j*4 - 26j**	{ "pile_set_name": "DM Mathematics" }
- 5z - 22, -2u - 5z = -180. Suppose q + u = 3k, k + q = 2q + j. What are the prime factors of k? 2, 3, 5 What are the prime factors of (-8 + 12 + -5)/((-2)/1526)? 7, 109 Let i = -2580 + 4767. What are the prime factors of i? 3 Let u = -80 + 114. List the prime factors of 10/(-8)(12/6 - u). 2, 5 Let r be 20/35 + 30/21. Let s be 104/(-12)3/r. Let o = s + 57. List the prime factors of o. 2, 11 Let s(w) = 60 - 2w + 2w2 - 54 + 3w*2. What are the prime factors of s(-3)? 3, 19 Suppose -3b + 20 = -b - 2l, l - 5 = 0. Let n = -9 - b. Let g = 57 + n. What are the prime factors of g? 3, 11 Let a(t) = 9t + 26. Let p be a(8). Suppose -3f = -5r + 137, 18 + p = 4r - 4f. List the prime factors of r. 5 Let x = -199 + 199. Suppose -5w + 4 = -6. Suppose 2f - f - wq - 52 = x, 0 = q. What are the prime factors of f? 2, 13 Let z(u) = -u3 - 3u*2 + 7u + 15. Let l be z(-4). Suppose -5a = -3x - x - 831, 503 = la + 2x. List the prime factors of a. 167 Let c = 1493 + -842. What are the prime factors of c? 3, 7, 31 Let k be (0 - -3) + 8/(-8). Suppose ki - 4o - 148 = 0, -3i + 2 + 184 = 3o. List the prime factors of i. 2, 3, 11 Suppose -5q - 4l = -2q - 26, -2l = q - 6. Let x = q - 9. Suppose -i + 4g = 2i - 83, -xi + 150 = 5g. What are the prime factors of i? 29 Let x = 568 + -348. List the prime factors of x. 2, 5, 11 Suppose -5 = -t + 11. Let i be (-9)/12 - (-1932)/t. Suppose -7g + i = -3g. List the prime factors of g. 2, 3, 5 Let q = 53 - 13. Suppose -4a + 0a + q = 0. List the prime factors of a. 2, 5 What are the prime factors of ((-302)/(-3))/((3/3)/3)? 2, 151 Let o be -2(-4 - 20/(-8)). Suppose -4c - oc + 1141 = 0. What are the prime factors of c? 163 Suppose -n = 2y - 6288, -3n - 2y = -22566 + 3686. List the prime factors of n. 2, 787 Suppose 0 = -5f - 3t + 2012, 4f + 163 = t + 1759. What are the prime factors of f? 2, 5 Let d be ((-1)/(-3))/((-4)/(-216)). What are the prime factors of (-24)/(-108) + 878/d? 7 Let u(g) = g + 1. Let h be u(2). Let z(q) = 10q. Let n(f) = 9f - 1. Let t(i) = hn(i) - 2z(i). What are the prime factors of t(3)? 2, 3 List the prime factors of 10/(-4)(-5356)/130 + -3. 2, 5 Let n(z) = -63z + 53. What are the prime factors of n(-18)? 1187 Suppose -3u + 0u - 3027 = -3f, 0 = -4u + 20. What are the prime factors of f? 2, 3, 13 Suppose 3 - 23 = -5v + 4j, v - 5j = 25. Suppose -x + 46 = -v. List the prime factors of x. 2, 23 Suppose 24 = 10b - 2b. List the prime factors of b. 3 Let p(f) = f*3 + 5f*2 - 2f + 7. Let a(x) = -4x + 3. Suppose -3g + 8 = 4o - 3, -4o = -5g - 3. Let s be a(o). What are the prime factors of p(s)? 17 Let p(i) = 4 + 0i + 1 - i - 4. Let r be p(-7). Let l = 14 - r. List the prime factors of l. 2, 3 Let l = 10 - 5. Let m be 2/l - 4/10. List the prime factors of 2/(1/(7 + m)). 2, 7 Suppose 7b - 4501 = 1505. List the prime factors of b. 2, 3, 11, 13 Suppose 0 = -12a + 2830 + 1790. List the prime factors of a. 5, 7, 11 List the prime factors of 112/(-1)(3 + (-39)/6). 2, 7 Suppose -r + 21d + 787 = 16d, -2r - 2d = -1538. List the prime factors of r. 2, 193 Let v be -36 + -1(-6 - -3). Let o = v - -23. What are the prime factors of 2/o - (-336)/30? 11 Let s(m) be the third derivative of m5/60 + m4/8 + m*3/6 - 3m*2. Let o be s(-3). Let v = 23 + o. What are the prime factors of v? 2, 3 Suppose -4s + 6 = 2s. Suppose 2g + 4k = 70, -2 - s = -k. List the prime factors of g. 29 Let h(d) = -112d + 54. List the prime factors of h(-3). 2, 3, 5, 13 Let f(n) = n*2 - n + 3. Suppose -3p + 2r + 2 = -0, 0 = -2p + 4r + 4. What are the prime factors of f(p)? 3 Let u be (0 - 1) + (-2 - -19). Let i = 12 - 3. Suppose -i - u = -5h. What are the prime factors of h? 5 Suppose 0 = -25c - c + 15288. What are the prime factors of c? 2, 3, 7 What are the prime factors of 234/6 - (1 + -1)? 3, 13 What are the prime factors of ((-20)/(-25))/2 - 171224/(-40)? 3, 1427 Let a be (-10)/(-6)(-30)/(-2). Suppose 0 = -5i + r + 95, 4r = -i + 3r + a. What are the prime factors of i? 2, 5 Suppose h = -4p + 150 + 4, -3p = 4h - 590. List the prime factors of h. 2, 73 Suppose -4a - 19a + 3772 = 0. List the prime factors of a. 2, 41 Let t be (3/(-1) - -2)-1 + 215. Suppose -114 = -5q + t. List the prime factors of q. 2, 3, 11 Suppose -2b + 4 = -4u, 0 = -6u + 3u - 4b - 14. Suppose 93 = 9r + 22r. List the prime factors of 78/((-3)/(r/u)). 3, 13 Let j(t) be the second derivative of t4/12 - 13t*3/6 - 31t*2/2 + t + 10. List the prime factors of j(16). 17 Let j(y) = -6 - y + 4 + 70y*3 + 7y*2 - 33y*3 - 36y*3 + 4y. Let w(a) = -a*2 - 4. Let g be w(0). List the prime factors of j(g). 2, 17 Let w(x) = -8x + 346. List the prime factors of w(0). 2, 173 Suppose 0 = 2b, 0 = -4z + 4b - 6b - 36. Let d = z + 12. Suppose -dp = 4a - a - 78, 5a + p = 142. What are the prime factors of a? 29 Suppose -11m = -5m - 8190. Suppose -6c + m = c. What are the prime factors of c? 3, 5, 13 Let j be (2/(-3))/(6/(-18)). Suppose i = -jz + 4, -5z + 17 + 6 = -4i. Suppose -21 = -l - z. What are the prime factors of l? 2, 3 Suppose -3t + 6 = -3. Suppose 2i + 31 = td, -2d + 2i + 4 + 20 = 0. Suppose -b + 14 + d = 0. List the prime factors of b. 3, 7 Suppose -6h + 615 = 3r - 2h, -2h - 1051 = -5r. Suppose -7s + 1156 = -r. Suppose -v + s = 4v. List the prime factors of v. 3, 13 Let f(g) = 123g*2 + 14g - 29. What are the prime factors of f(2)? 491 Let h = -91 + 141. Let q = h - 41. What are the prime factors of q? 3 Let a(q) be the second derivative of q*4/12 - 3q*3/2 + 7q*2 + 6q. Let g be a(6). Let x = g + 8. List the prime factors of x. 2 Let p(j) = j*3 + 13j*2 - 16j - 20. Suppose 0 = 3u + u + 56. Let v be p(u). Suppose 3x - 3b = -27 + 87, v = x + 5b. List the prime factors of x. 2, 3 Let t = 18 - 15. What are the prime factors of 2(1 + 9 + t)? 2, 13 Let v(j) = 31j - 88. List the prime factors of v(6). 2, 7 Suppose -5x = -5m + 35, 5m + 0x - 3x = 31. Suppose -2i = -mb - 6i + 719, 3b + i = 437. What are the prime factors of b? 3, 7 What are the prime factors of 21242/38 + 1/(-1)? 2, 3, 31 Let b = -1525 - -3092. What are the prime factors of b? 1567 Let o be (-3 + 9)/60/1. Suppose 2s + s - 5f - 355 = o, 5s = -2f + 540. List the prime factors of s. 2, 5, 11 Let b = -1029 - -1480. List the prime factors of b. 11, 41 Suppose 2n - 11 = 7. Let y = n + -4. Suppose c = -1, f + 3c = yc + 25. What are the prime factors of f? 23 Let f = 34 - 21. Let o(m) = -m + 30. List the prime factors of o(f). 17 Suppose -7y = -87 + 31. Suppose 35c = 31c + y. What are the prime factors of c? 2 Suppose 0 = -4k + 3j + 1637, 2k + 2k + 2j - 1622 = 0. What are the prime factors of k? 11, 37 Let z(w) = -140w - 41. List the prime factors of z(-4). 3, 173 Let h = 717 + -170. What are the prime factors of h? 547 Let k(n) = 3n3 - 7n*2 - 6n. Let d(i) = 3i3 - 6i*2 - 5i. Let p(x) = 6d(x) - 5k(x). List the prime factors of p(1). 2 Let z(w) = 17w2 - 18w - 1. What are the prime factors of z(18)? 71, 73 Suppose 77c - 86c = -43857. List the prime factors of c. 11, 443 Let v be 810/2012. Suppose 0 = b - 2p - 19, 0p - v = -3b - 2p. Suppose 0 = z - b - 9. What are the prime factors of z? 2, 17 Suppose -2z + 0z + 6 = 0. Suppose 4h + 4y - 3 = 221, 2h - 107 = zy. Suppose h = j + 4j. List the prime factors of j. 11 Let w be 7 + 0 - (-7 - -9). Suppose -3p + wi + 60 = 0, -4p - i + 128 = 25. Suppose -a - 2q + p = 0, -q - 5 = -a + 2q. What are the prime factors of a? 17 Let t(k) = k*2 - 5k + 5. Let m be t(6). Suppose 0 = -mx + 9x + 82. What are the prime factors of x? 41 Suppose -173i = -168i + 3m - 4921, -i + 979 = -2m. What are the prime factors of i? 983 List the prime factors of (16/(-14))/((-240)/10920). 2, 13 Let z = -75 - -1. Let o = 44 - z. What are the prime factors of o? 2, 59 Let h be 6(-2 - -17) + -1. Let r = h - 52. Suppose 4d = -5 + r. List the prime factors of d. 2 Let f(y) = -2y - 13. Let t = 4 - 4. Let k be f(t). Let h = 16 + k. What are the prime factors of h? 3 Let r = -46 + 51. Suppose -2i + 4x + 222 = -100, rx - 367 = -2*i. List the prime factors of i. 3, 19 Let z(b) = b + 2. Let x be z(5). Suppose -2	{ "pile_set_name": "DM Mathematics" }
factor of j and 231. 21 Let j = -5 - 9. Let k be (j/(-4))/((-2)/(-4)). Let s be ((-52)/(-6) + -8)42. What is the greatest common divisor of s and k? 7 Let p(f) = -f3 + 9f*2 + 11f - 2. Let h be p(10). Suppose -hm + 4 = -10m. Let i be 3/(1m/(-18)). Calculate the highest common factor of i and 3. 3 Suppose 104k - 645 = 89k. What is the highest common factor of 387 and k? 43 Let w be (18 - -17)71. Let s = -128 + w. What is the greatest common divisor of s and 78? 39 Let j be (-14)/(-4) - (12/3)/8. Suppose -4w - p - 4p = -1005, -15 = -jp. Calculate the greatest common factor of w and 35. 35 Let t = 23 - 14. Suppose 0 = -5i + 5h - 17 - 43, 0 = 5h + 15. Let c = 87 + i. What is the greatest common factor of c and t? 9 Let z be 2938/13 + 4 + (0 - -6). Calculate the greatest common divisor of z and 12. 4 Suppose -4w + 3w + 1 = 0. Let d be -2 + 23 + w + -1. Suppose 3i + 3l = 24, -2i - 5l + d - 5 = 0. What is the highest common factor of 72 and i? 8 Let v(z) = -z3 - 10z*2 - 9z + 5. Let b be v(-10). Let u = b - -103. What is the greatest common divisor of 18 and u? 18 Suppose -5c + 3w = -314, 3w + 2w = -2c + 138. Suppose c = v + 2v - 4x, 26 = v + x. What is the greatest common factor of v and 12? 12 Let i = -56 - -96. Let m = 57 - i. Let y = m + -10. Calculate the greatest common factor of 7 and y. 7 Let x be 2 - -9(-1)/3. Let k be (-16 - -222) + x/(-1). Calculate the highest common divisor of 23 and k. 23 Suppose 60 = 4f + f - 4t, -5t - 60 = -5f. Let l(o) = o*2 + 9o + 22. Let d be l(-3). Calculate the highest common divisor of d and f. 4 Let h = 162 + -49. Let n = h + -69. Calculate the greatest common factor of n and 11. 11 Suppose 4716 = 82g - 79g. Calculate the greatest common divisor of 12 and g. 12 Let h be 0 - (-4)/1 - -6. Let i = 153 - 63. What is the highest common factor of i and h? 10 Suppose -4m + 33 = -43. Suppose 4y - 412 = 348. Calculate the highest common divisor of y and m. 19 Suppose 11h + 280 = -1183. Let r = h + 134. What is the highest common factor of 17 and r? 1 Let c(v) = -v2 - 7v + 4. Let o be c(-7). Let s be -2 + 11 + 1 + 0. Let b(t) = 3t + 14. Let p be b(s). What is the highest common divisor of o and p? 4 Suppose -w - 3n - 4 = 0, 2w - 5n = -0w + 25. Suppose 3x + wy + 1 = 0, 4x = -0x + 5y + 22. Calculate the greatest common divisor of x and 39. 3 Suppose -6h = -3h - 6. Let r(d) = d*2 - 19d - 112. Let x be r(-5). Calculate the greatest common factor of h and x. 2 Let l(r) = 5r + 4. Let k be l(3). Let t(c) = 74c + 1. Let s be t(2). Let q be s + 2 + 0 + 14/14. What is the highest common divisor of k and q? 19 Let f = -4 + 12. Let z = -8 + f. Suppose -4t = t - m - 11, z = 2t + 4m. What is the highest common factor of t and 22? 2 Suppose 5o - 37 = -3h, 4o - h = 28 + 5. What is the greatest common divisor of 248 and o? 8 Let c = 8 + -13. Let t(x) = 3x2 - 3007x*3 + 3x*2 + 3008x*3 + 2 + x. Let b be t(c). Calculate the greatest common factor of 11 and b. 11 Let p be -1 + (-404 + -3)/(-5 - -4). What is the greatest common factor of 14 and p? 14 Suppose -9y = -0y - 45. Let c be ((-8)/(-12))/(4/30). Let v(h) = h3 - 4h*2 - 2h. Let m be v(c). Calculate the greatest common divisor of y and m. 5 Let l be 286 - (0 + (1 - -3))/(-2). What is the highest common divisor of l and 198? 18 Let s be (-2 + -13)(-18)/30 - -1. What is the greatest common factor of s and 10? 10 Suppose 5d + 10 = r, -3d - 7 = -2r + 6. Suppose -ri + 6 = -2i. Let m be (i-11)/(26/(-13)). What is the greatest common factor of m and 77? 11 Let s(x) = x3 - 10x*2 + 9x + 8. Let u be s(9). Let l(d) = 3d - 27. Let t be l(19). Suppose -c = t - 102. Calculate the greatest common factor of c and u. 8 Let u be (-26)/(-8) - (-1)/(-4). Suppose -w = -116 + 108. Suppose -wp + 80 = -up. What is the highest common divisor of 144 and p? 16 Let r(u) = 63 + 7u - 57 + 5u2 - 2u. Let f be r(-2). Suppose 23 = -3i + 143. What is the highest common divisor of f and i? 8 Suppose 948 + 1097 = 43g - 965. Suppose -3t - 66 = -3s, 7s - 52 = 4s - 4t. What is the greatest common factor of s and g? 10 Let i(s) = 70s*2 + 7s - 7. Let d be i(-4). Suppose -92k = -97k + d. What is the greatest common divisor of k and 31? 31 Suppose -4c = -5 - 7. Suppose 2m + 5 = cm. Calculate the highest common factor of 35 and m. 5 Suppose 29d - 800 = 25d. Calculate the greatest common divisor of 50 and d. 50 Suppose 0 = -2t + 11t - 45. Suppose 0u + 2u + to - 29 = 0, -o = 4u - 67. Calculate the highest common factor of u and 68. 17 Let v be (-260)/(-22) - (-2)/11. Let h(y) = 211y + 2. Let w be h(-1). Let s = w - -317. Calculate the highest common factor of v and s. 12 Let t(o) = -10o - 10. Let g be t(-8). Suppose -i - g = -215. Suppose 6x = -5x + 638. What is the highest common factor of x and i? 29 Let p = 1702 - 1117. What is the highest common divisor of p and 45? 45 Let i(j) = 2j*2 + 5j + 3. Let x be i(-3). Suppose 126 = 2o - 0o + 3l, -2l = 3o - 184. Let q = 102 - o. Calculate the highest common divisor of q and x. 6 Let y(x) = 24x*2 - 7x - 6. Suppose 2f - w = -13, 4f + 21 = 3w - 2w. Let p be y(f). Calculate the highest common factor of p and 58. 58 Suppose 3k + 2l - 18 + 6 = 0, -2k + 8 = -l. Suppose -3q + ko = -614, -o = -0 - 4. Calculate the highest common divisor of 30 and q. 30 Suppose 4u + 155 = 5v, -5v - 95 + 250 = -2u. Calculate the greatest common divisor of 899 and v. 31 Suppose 0r + r = 90. Let j be (-1 + (-5)/(-10))/(5/(-600)). What is the greatest common divisor of r and j? 30 Let d = -5 + 34. Suppose 0 = -3c + d - 2. What is the highest common factor of c and 18? 9 Suppose -4 = 2169r - 2173r. Calculate the greatest common divisor of r and 61. 1 Let i(k) be the third derivative of -k4/8 + 4k*3/3 - 21k*2. Let d be i(-4). What is the highest common divisor of 20 and d? 20 Let v = -1 + -3. Let a be 3 + -2 - (1 + v). Let d be (-368)/((-16)/a) - 2. What is the greatest common factor of 18 and d? 18 Let b(o) = 7o + 5. Let m be b(1). What is the greatest common divisor of m and 124? 4 Suppose -100z + 64 = -96z. Calculate the greatest common divisor of 4 and z. 4 Suppose -g - y + 0 + 17 = 0, 46 = 3g - 2y. Calculate the greatest common factor of 4 and g. 4 Let y be 22/6 + -3 + (-2)/3. Let o be 6 - (y + (0 - 0)). Suppose -3 = -j + 12. Calculate the highest common divisor of j and o. 3 Suppose s = -s + 112. Let v be ((-84)/(-18))/((-16)/(-24)). Calculate the greatest common divisor of s and v. 7 Let g(s) = -85s + 77. Let d be g(-2). Calculate the greatest common divisor of d and 13. 13 Suppose 2y = 5c - 10c + 927, 5y = c - 180. Let v be (-2)/10 + (-23)/((-575)/930). What is the greatest common divisor of c and v? 37 Suppose 0r = 26r - 546. What is the highest common divisor of 9 and r? 3 Let f = -30 + 48. Let h be (-6)/(-27) - (-716)/f. Calculate the highest common factor of h and 16. 8 Let n be 2/11 - (-6)/(-33). Let j = 67 + -65. Suppose 0 = 5m - r - 235, nm - jr = 4m - 202. Calculate the highest common divisor of m and 16. 16 Let b be (9 - 11)/(3/(-6)). Suppose -72 = -2d - 3s + 6s, bs + 16 = 0. Calculate the greatest common divisor of d and 15. 15 Suppose 0t = -2t. Let a = 251 - 249. Suppose t = am - 1 - 11. What is the greatest common divisor of m and 4? 2 Suppose 6l + 4m = 3l - 22, -l - 18 = 4m. Let h be l/(-7) - 104/(-28) - -241. Calculate the highest common factor of 49 and h. 49 Let h be 0/10 + 0/1. Suppose -4n + 4r + 664 = 0, hr = 4r + 20. What is the highest common factor of n and 23? 23 Let i = -7 - -11. Suppose -d = -0d + m - 26, -im - 112 = -5d. Suppose -108 + d = -w. What is the greatest common factor of w and 12? 12 Let q(a) = -1 + a + 0 + 2 - 9. Let b be q(8). Suppose -4l - 5g = -143, 5g = -bl - 5l + 175. Calculate the greatest common divisor of 4 and l. 4 Let u(r) = r*2 - 2r - 10. Let m be u(5). Suppose 2h - 136 = -2g, -200 = -0g - 3g - mh. What is the greatest common divisor of g and 14? 14 Suppose -f + 2r + 25 = 0, -5f + 141 = -5r - 4. Let v = -96 - -195. What is the highest common factor of f and v? 33 Suppose 0 = 5j + 1 - 76. Let d = j - 14. Let z be 3/2(-16)/(-3). What is the highest	{ "pile_set_name": "DM Mathematics" }
s + 14d = 176, -4s - 5 = 229d - 230d for s. 2 Solve 30 = -2l - f, -4l - 11 = -f + 45 - 2 for l. -14 Solve -5p = 5s - 50, 2s - 35 = -p - 29 for p. 14 Solve 3c = -v - 1, 17c + 4v - 12 = 13c for c. -2 Solve 2a - 8s = -14, -2a - 25s - 6 = -29s for a. 1 Solve -5p + 33k + 25 = 31k, -5p - 4k + 55 = 0 for p. 7 Solve -s - 29 + 25 = 0, -2x = 4s + 18 for x. -1 Solve 0 = a + 3a + 5v, -2a + 2 = 3v for a. -5 Solve -5b + 13 = 4n, 7174b - 7175b - 2n - 1 = 0 for b. 5 Solve -3o - 7s + 3931 = 3981, 34 = 5o - 3s for o. 2 Solve -5t + 3o = -15, 5t - 1581 = o - 1576 for t. 0 Solve -4t - 4w = 12, 47t + 45 = 44t + 15w for t. -5 Solve -21t + 25t - 9 = -5k, 3k + t - 4 = 0 for k. 1 Solve -5b + 29 = 9, -4x - 47b + 16 = 54b - 100b for x. 3 Solve -5j - s + 29086 = 29112, -4 = 4j + 5s for j. -6 Solve p + 4s = 283 - 271, -2p = -6s + 18 for p. 0 Solve 0h - h + 13 = 0, -2u = u - 49h + 649 for u. -4 Solve 125m - 3z = 126m - 57, 2z = -m + 39 for m. 3 Solve 4p - 23 = m, 0 = -p - 38m + 34m - 24 for p. 4 Solve 2l + j - 11 = 0, j + 613 = -5l + 636 for l. 4 Solve g + 2z = 26, 0 = 3g + 12840z - 12846z + 54 for g. 4 Solve -3t - 2b - 7 = 0, 0 = -5295t + 5298t + b + 2 for t. 1 Solve -2l - 22 = 3h, 0 = -109h + 111h - 23l - 107 for h. -4 Solve 3t - 7 = 5045x - 5047x, 4x + 10 = 2t for x. -1 Solve 2a + 3p = -4, -3a - 10p + 28 = -14p for a. 4 Solve m - 25 = -5b, 408b - 411b - 8 = -4m for m. 5 Solve 5q - 3560o = -3562o + 14, 3q = 3o for q. 2 Solve -2u - 14p - 27 = -15p, -5p = u - 102 for u. -3 Solve 4t + z + 81 = 0, -3t + 274z - 51 = 278z for t. -21 Solve -5y + 5f - 80 + 45 = 0, 4y = f - 16 for y. -3 Solve 203j - 200j = -g + 1, -g = -3j + 5 for g. -2 Solve -223a + 2f - 17 = -226a, 5a + f = 26 for a. 5 Solve 10597f - x = 10598f - 9, 4f - 44 = -2x for f. 13 Solve 2p - 7g = -3g + 4, 4p + 4g + 16 = 0 for p. -2 Solve 0s = 2s - 6h + 34, -4s - 2h - 12 = 0 for s. -5 Solve 20 = 5j, -118t + 4 = -122t - 2j + 4j for t. 1 Solve 5m = 81w - 76w, 0 = 4w for m. 0 Solve 0 = 4z - 4j - 505 + 501, 0 = -4z + 3j + 2 for z. -1 Solve -4z = -d - 0d + 25, 43z - 38z + 5d = 0 for z. -5 Solve 182x + 2v = 185x - 9, 0 = x + 2v + 5 for x. 1 Solve 5w - 276g + 272g = -30, 17 = 4w + 5g for w. -2 Solve -5x = -2a + 127, x = 5a + 19233 - 19240 for a. -4 Solve -3n + 6 = -m + 1, -m = -1 for n. 2 Solve 2y = 2i - 12, 15 = 3y + 5i + 9 for y. -3 Solve -2m + a = -27, -11a = -7m - 7a + 94 for m. 14 Solve 2y + 3 = 9x - 12x, 5x + y = -12 for x. -3 Solve 4a = 3j - 2413 + 2378, 5j + 0a + a = -3 for j. 1 Solve -q + 5 = 3w, 24q + 1 = 27q - 5w for q. 2 Solve 3g - 143a = -136a + 40, -a = 3g + 16 for g. -3 Solve 18m = 21m - 4r + 1, 0 = -m + 20r - 75 for m. 5 Solve -p - y - 347 + 350 = 0, -2y = 3p - 2 for p. -4 Solve -4p + 2f - 361 = -369, 5f = -p - 75 for p. -5 Solve 3a - 3f = -0 - 24, 0 = -a + 2f - 11 for a. -5 Solve 0 = 5m + 15n - 17n - 10, 8n = -40 for m. 0 Solve -5j - d - 23 = 0, -5j = -d + 45 - 18 for j. -5 Solve 136 = -2l + 3x + 113, 0 = 4l - x + 31 for l. -7 Solve 10x = 5j + 6x + 35, 0 = x - 10 for j. 1 Solve 5a - 2p + 9 = 0, -5a - 9520 + 9484 = 7p for a. -3 Solve 2 = o - 2r, -5r = 206 - 191 for o. -4 Solve 41 = -k - 3j + 31, j = 4k + 1 for k. -1 Solve -f - 12 + 8 = 0, 0 = -2o - f - 14 for o. -5 Solve v + 6k - 40 = 9k, -4v + 3k + 52 = 0 for v. 4 Solve -167n = -4q - 171n - 24, 3n = 2q - 3 for q. -3 Solve -52d + 3a = -50d - 8, a = 2d for d. -2 Solve -x - 901 = -3i - 929, 10i = 5x - 115 for x. 13 Solve 9s = 5s + 2f - 38, -3s - 28 = -f for s. -9 Solve -5w + 178 - 210 = -2h, w - 5h + 34 = 0 for w. -4 Solve 8 = 2l - 755x + 751x, -4l = -4x - 8 for l. 0 Solve -l - 3o = -29, -5l = -o + 181 - 166 for l. -1 Solve 5g = -3z + 25, 3g - 15 = 5220z - 5222z for g. 5 Solve 46i + 5d = 40i - 8, 5i - d = 14 for i. 2 Solve -2b = 0, 2w + 12 = 3b + 10 for w. -1 Solve 5c + 3b = 1418 - 1429, c + 3b = -7 for c. -1 Solve -2n = 4p - 18, -4p - 228n = -250n + 6 for p. 4 Solve -w = 56o - 54o, 22w - 27w + 14 = -4o for o. -1 Solve 3x - 15 = 10d - 13d, 5x - 17 = -d for x. 3 Solve -7a + 4a - 3b - 18 = 0, 4b + 6 = 2a for a. -3 Solve o - v + 54256 = 54265, 0 = o + 3v + 3 for o. 6 Solve -4v = 2h - 10, 0 = h - 481v + 479v + 3 for h. 1 Solve 5b - 2w + 4w = 13, b = -98w + 109w + 14 for b. 3 Solve 3b - 3 = 0, -15 = -5z + 13z - 10z - 5b for z. 5 Solve 0 = -2l - 554w + 555w - 3, -3l - w = -8 for l. 1 Solve 416 - 400 = 4d + 8z, 3d = 4z + 12 for d. 4 Solve -3b = -5m - 28 + 11, -15 = -b + 4m for b. -1 Solve 2q - 3u + 11 = -8u, 3q - u = -8 for q. -3 Solve 30 = -766o + 770o + 6y, 5o - 2y = -29 for o. -3 Solve -5k - 308p - 20 = -306p, -4k = 3p + 16 for k. -4 Solve 16w - 11w - 3w - 16 = -3j, -5j + 2w = 0 for j. 2 Solve 0 = -7l - 5w + 36, 29 + 15 = 5l - w for l. 8 Solve 5x - 3772 = 5o - 3777, 3o + 1 = 2x for o. -3 Solve -4u - 239i = -243i + 1 + 7, 14 = -u - 3i for u. -5 Solve 2c + 64 = -u + 69, -2u + 3c = 18 for u. -3 Solve -9r + 118n + 5 = 116n, n + 3 = 4r for r. -1 Solve 12z - 101 = -w - 0z, 4w - z - 12 = 0 for w. 5 Solve -9h - 165 = -3k, -5k = -4h + 8h + 67 for h. -18 Solve -167v + 168v + 6 = -z, 4 = -2z for v. -4 Solve 2a = 2g - 2, 3g + 4 = -g for a. -2 Solve -12 = -2o, -o + 18 = -143u + 146u for u. 4 Solve 5y + 2o = 5, 20y - 16y - 4 = 2o for y. 1 Solve y - 115g + 111g = 14, 5g + 20 = 0 for y. -2 Solve 5f = -15z - 26 + 31, 3f = 5z + 11 + 34 for f. 10 Solve 16q = -2k + 14q - 6, -4k - 14 = 5q for k. -1 Solve -3u = o - 18, -5u + 20 = -592o + 597o for o. -3 Solve 10v + 4g = -62 + 76, -3v - g + 1 = 0 for v. -5 Solve -5k + 118 = -9m, -3k - 3384m = -3386m - 30 for k. 2 Solve p + 7 = 2i, 0 = -i - 25598 + 25599 for p. -5 Solve -3j - 3w = -24, -23j + 4w = -22j - 23 for j. 11 Solve -3o - 881 = -4d - 905, 2d = -2o + 2 for d. -3 Solve -d + 2o + 6 = 0, 7o + 84 - 69 = 5d for d. -4 Solve -3l = 5x + 33, 0 = 4x + 26l + 15 - 83 for x. -9 Solve 0 = 2p - 2x + 10, -5p + 38x - 29 = 35x for p. -7 Solve 2z - 7z = -20, 0 = 12v + 5z - 92 for v. 6 Solve 3n + 8 + 4 = -3i, -i - 10 = 4n for i. -2 Solve -5x = 5s + 25, 59x - 56x + 15 = 4s for s. 0 Solve 0 = 4z + y + 7, -21 = 2z - 120y + 117y for z. -3 Solve 75v + 4 = 73v - 2d, -2v + 2d = -8 for v. 1 Solve -5c - 59 + 61 = -4k, -14 = c + 4k for c. -2 Solve -85m + 91m + 4q = -8, 3m - 3q = -9 for m. -2 Solve -52i - 40 = 3j - 48i, -50 = -5j + 5i for j. 0 Solve m - 2 = 140231p - 140232p, -3m = -2p - 11 for p. -1 Solve 5 = -5i + 5y, -5i - 14172 = 3y - 14151 for i. -3 Solve -2413 = -5h - 2i - 2393, -3i = 27h - 69 for h. 2 Solve -6k = -3i - 78, 253k = 250k - 2i + 25 for k. 11 Solve -46 + 220 = -3r - 24x, 0 = 4x + 28 for r. -2 Solve v + 2c = -166 + 153, 0 = -3v - 5c - 31 for v. 3 Solve -3816z + 5d + 90 = -3821z, -3z = -d - 30 for z. 3 Solve -8 = 4f + 4c, -19c + 14c + 2 = 27 for f. 3 Solve -8s = 9r - 13s + 38, 2s + 2 = -5r for r. -2 Solve 0 = -0g - g + 15 - 11, 17g - 56 = -3l for l. -4 Solve 16q - 11 = 5y - 2, 4y + 22 = -2q for y. -5 Solve 5y + 4h = -0 + 11, -4y - 5h = -7 for y. 3 Solve -2w + 121a - 117a = -4, -2w - 31a = 101 for w. -4 Solve 20 = -4z, 2n + 424z - 421z = 3 for n. 9 Solve -3j - 27z - 24 = -25z, 9j + 3z + 54 = 0 for j. -4 Solve -r + 14 - 12 = -3m, -14r = -m + 54 for r. -4 Solve -12l + 22 = -80v + 85v, 3l = -4v + 11 for v. 2 Solve -5w = -5z - 15, -2w + 4 = 4z + 10 for z. -2 Solve -3b + 1431 - 1432 = z, b = 5z - 27 for z. 5 Solve -42 = 3j + 11x, 0 = 46x - 49x for j. -14 Solve -148x + 143x = 5z - 20, -2z - 1 = 5x - 3 for z. 6 Solve 34b + 240 = -5t, -3t - 22 = 250b - 254b for b. -5 Solve 3y - 5p + 20 = 0, 0 = -5p + 9p - 16 for y. 0 Solve 5a + 6 = -2h, -116a = h - 119a + 3 for h. -3 Solve 120l - 125l + 4h - 12 = 0, 5l = -5h + 15 for l. 0 Solve 5y + 3o - 4 = 31, -o - 3 = -2y for y. 4 Solve 5v - 2c + 4 = 25, -v - 5 = -5c for v. 5 Solve -10 = u - 2206o + 2208o, -6 = o for u. 2 Solve -11w + 66 = -3a + 127, 4w - 4a +	{ "pile_set_name": "DM Mathematics" }
Determine pz(x) + 4n(x). -x + 1 Let c(x) = 8x. Suppose 3g - 21 = -5b + 9, -g = 0. Let t(n) be the third derivative of -3n*4/8 + 3n*2 + 4652n. What is bc(w) + 5t(w)? 3w Suppose -8i = 1957 - 805. Let z = i + 146. Let f(o) = 4o2 - 6o - 10. Let a(m) = -m*2 + 2m + 3. What is zf(q) + 7a(q)? q*2 + 2q + 1 Let q(w) be the first derivative of -w - 1/2w2 + 1/3w*3 + 4. Let g(n) = -6n*2 + 2n + 5. Let l be (-7(-21)/98)/((-15)/(-10)). Calculate lg(z) + 4q(z). -2z*2 - 2z + 1 Let b = -18 + 29. Let a(u) = -u. Let x(r) be the first derivative of -5/2r2 - 1/3r*3 + 3 + 0r. Give ba(n) - 2x(n). 2n2 - n Let m(q) = -2q*2 - 5q + 3. Let n be m(0). Let v(u) = -u*2 + 8u + 8u + 1 + un - 17u. Let w(t) = -4t3 + 6t*2 + 9t - 6. Calculate -6v(l) - w(l). -2l*3 - 3l Let i(h) = -5h2 + 26. Let j(f) = 34f - 67f + 34f + 2. Let r be j(10). Let p be (7 - 6) + r/((-1)/1). Let y(k) = 2k2 - 9. Calculate py(t) - 4i(t). -2t*2 - 5 Suppose -6 = z - 4s - 13, 5z + 11 = -3s. Let l(a) = a2 + a - 1. Let n(y) = y2 - y + 5. Calculate zn(k) - l(k). -2k*2 - 4 Let c(a) = 3a + 3038a2 - 3030a*2 + 0a. Let u(o) = 105o2 + 40o. Give 40c(d) - 3u(d). 5d2 Let a(i) = i + 15. Let v(k) = -4k - 46. Suppose 12470s - 98 = 12484s. Calculate sa(g) - 2v(g). g - 13 Let o(b) = b3. Let v(i) = -i3. Let s be -1 + 6/3 + -1 + 2. Let l(f) = 2f2 + 2 - 5 + 5 + s - 8f. Let g be l(4). Give go(x) + v(x). 3x*3 Suppose -y + 2 = -2. Let p(d) = d + 2. Let b(q) = 6q + 12. Let g(i) = 6b(i) - 39p(i). Let k(s) = -9s - 17. Give yk(h) - 11g(h). -3h - 2 Let y = 5 - -2. Let i(n) = 12n - 5. Let r(z) be the second derivative of z3 - 3z*2/2 - 244159z. What is yr(x) - 4i(x)? -6x - 1 Let p(d) be the first derivative of -d2/2 + d + 2645. Let j(k) = 45k + 6. What is -j(g) + 6p(g)? -51g Let o(s) = -34 - 15s2 + 6s*2 + 5s*2 + 29 + 7s. Suppose 75p = 72p + 9. Let c(j) = 3j2 - 6j + 4. Determine pc(i) + 2o(i). i*2 - 4i + 2 Let p(r) = r. Let f(i) = 3i2 + 4i + 24. Determine f(d) - 5p(d). 3d*2 - d + 24 Let d(g) = 112g + 1141. Let p(w) = -7w - 70. What is 6d(u) + 98p(u)? -14u - 14 Let n(q) = 3q2 + 4q - 6. Let w(k) = -8k2 - 11k + 17. Suppose 4i - 3i + 5 + 6 = 0. Determine in(y) - 4w(y). -y*2 - 2 Let x(t) = 8713t + 31. Let h(k) = -4362k - 14. Give -9h(q) - 4x(q). 4406q + 2 Suppose -5d - 2 - 8 = 0. Let j = -3 - d. Let m(a) = a2 - a + 1. Let k(y) = 1939y + 15y2 - 11y*2 + 3 - 973y - 969y. What is jk(u) + 2m(u)? -2u2 + u - 1 Let g(l) = -l3 - l*2 - l + 2. Let n(z) = 1159z*3 - 8z*2 - 7z + 14. Determine -7g(s) + n(s). 1166s3 - s2 Let x(r) = 49r - 11. Let a(z) = -204z + 45. Let h(s) = 6a(s) + 25x(s). Let m(p) = 10 - 5 + p + 10 - 4p. Calculate -8h(c) - 3m(c). c - 5 Let h(v) = -2v - 256. Let g(z) = 8z + 1023. Determine -3g(n) - 13h(n). 2n + 259 Let d(x) = x3 + x2 - x - 4. Let t(z) = -4z3 - 5z*2 + 5z + 179. Determine -5d(j) - t(j). -j3 - 159 Let t(j) = -90j*3 + 34j*2 + 5j + 1. Let u(p) = 110p3 - 36p*2 - 6p - 1. Give -6t(c) - 5u(c). -10c3 - 24c*2 - 1 Let g(f) = -10f*2 + 11f + 9. Let u(m) = 10m2 - 13m - 6. What is 7g(r) + 6u(r)? -10r2 - r + 27 Let d(w) = -2w + 4. Let l(n) = 52n - 31. What is 2d(r) + l(r)? 48r - 23 Let l(n) = 1204n*2 - 4n + 5. Let r(q) = -1207q2 + 5q - 6. Give -5l(s) - 4r(s). -1192s2 - 1 Suppose r = -4, -7r + 1 = q - 6r. Let l be (12/(-2) + 5)3. Let a(t) = 15t + 5. Let b(j) = 1 + 10j + 13j - 15j + 2. Calculate la(f) + qb(f). -5f Let r(q) = -14 - 11 - 13 + 3q + 33. Let p(k) = 12k - 13. Let h(x) = -6x + 7. Let n(t) = -9h(t) - 4p(t). Determine 4n(a) - 9r(a). -3a + 1 Let t be (10 - -6 - -6)1. Suppose u - 5n - 59 = -2u, n - t = -2u. Let w(m) = -4m + 9. Let j(q) = -9q + 19. Give uw(h) - 6j(h). 2h + 3 Let k(p) = -2p2 + 4746p - 413. Let c(l) = -2l2 + 4747l - 354. Determine -7c(v) + 6k(v). 2v2 - 4753v Let m(d) = 5d3 - 131d + 11. Let j(u) = -2u3 + 44u - 4. Let w be (-7)/(-35) - 456/20. Calculate wj(q) - 4m(q). 2q*3 + 40q Let l(x) = -4x2 - 15x + 3. Let i(v) = -v*2 - 268 - v - 4v + 269 + 5v. Calculate 2i(z) - l(z). 2z2 + 15z - 1 Let c(g) = -3g2. Let r(n) = -25n*2. Let a be (-5652)/(-180) - (-3)/5. Suppose 5t = 4d - a, 3d - d - 2t = 14. Give dr(o) - 24c(o). -3o*2 Let f(i) = -3i*3 - 9i*2 - 6i - 2. Let d(j) = -6j3 - 19j*2 - 13j - 4. Let w(u) = u*3 - 9u*2 - 41u + 382. Let z be w(9). Calculate zf(l) - 6d(l). -3l3 - 3l*2 - 2 Let n(a) = -15a + 5. Suppose 16g + 561 - 641 = 0. Let y(q) = 30q - 9. Determine gn(i) + 3y(i). 15i - 2 Let g(p) = -6p*2 - 2p - 1. Let u(l) = -11l2 + 3222l - 2 + 3249l - 6476l. Give 7g(x) - 4u(x). 2x2 + 6x + 1 Let h(x) = -108x + 20. Let g(s) = 4s - 5. Determine 24g(n) + 6h(n). -552n Let x(u) = 4u*2 + 40. Let b(l) = -4l*2 - 43. What is 5b(w) + 6x(w)? 4w*2 + 25 Let f(t) = -3t - 3 + 2t + 2t. Let j(n) = n - 3. Suppose 2y = -5u + 26, 0 = 516u - 511u + y - 28. Calculate uj(a) - 5f(a). a - 3 Let i(x) = -14x - 10949. Let k(n) = 3n + 1. What is i(r) + 4k(r)? -2r - 10945 Let u(m) = m. Let r(j) = -j + 27. Let n(o) = -20o + 470. Let l(t) = n(t) - 17r(t). Give -l(x) - 4u(x). -x - 11 Let m(d) = 14d + 3. Let b = 3213 + -3210. Let y(l) = 42l + 10. Determine by(k) - 10m(k). -14k Suppose 19g + 40 + 36 = 0. Let d(o) = -2o + 7. Let h(b) = -1. Determine gh(q) - d(q). 2q - 3 Let r(z) = 13z3 - z. Let f(a) = 79 + a - a3 - 189 + 110. Give 2f(s) + 2r(s). 24s*3 Let h(z) = -47z. Let d(r) = -1180r - 1. Give -d(t) + 5h(t). 945t + 1 Let s(q) = 186q + 748. Let y be s(-4). Let i(l) = -1. Let n(f) = 4f3 + 22. Give yn(h) + 88i(h). 16h*3 Let d(m) = -13m + 2. Let y(v) = v*3 - 12v*2 + 37v - 34. Let t be y(8). Let c(x) = -12x + 1. Calculate tc(f) - 5d(f). -7f - 4 Let k(d) = -20d + 8. Let m(c) = 56c - 24. Let l(s) = -8k(s) - 3m(s). Let n(v) = 1. What is -l(t) + 2n(t)? 8t - 6 Let o(j) = 6j + 5. Let p(x) = x + 1. Suppose 0 = 3i + 399 + 66. Let n = i - -156. Give no(z) - 5p(z). z Let g be 14(3 - 488/56 - -6). Let t(h) = 35h*2 - 3h - 7. Let b(m) = 17m2 - 2m - 4. What is gt(u) - 7b(u)? 21u2 + 2u Suppose -a + 0 = -1. Let o = 81 - 82. Let z(c) be the third derivative of -c4/24 - c3/6 - c*2 - 333. Let j(r) = -1. What is az(n) + oj(n)? -n Let t(j) = 2j*3 + 15j*2 - 3j + 6. Let a(p) = 12p3 + 91p*2 - 19p + 37. What is 2a(d) - 13t(d)? -2d3 - 13d*2 + d - 4 Suppose -4f = -3c - 21, -101f + 106f = -3c - 21. Let d(y) = 2y2 + 17y. Let i(x) = x*2 + 9x. Give ci(a) + 3d(a). -a*2 - 12a Let m(h) = -2h3 + h + 1. Let w be m(3). Let z be (-3514)/70 + (-4)/5. Let x = z - w. Let i(o) = o2 + o. Let a(g) = 4g*2 + 3g + 3. Give xa(r) + 3i(r). -r*2 - 3 Let a(f) = 3f*3 - 7f*2 + 2f + 249. Let d(z) = 10z3 - 24z*2 + 7z + 745. What is 14a(y) - 4d(y)? 2y3 - 2y*2 + 506 Let x(r) = 3r2 + 3 - 6 + r2 - 7r2. Let m be ((-5)/(-65))/((-25)/975). Let b(t) = t3 + 4t*2 + 4. Determine mb(v) - 4x(v). -3v3 Let c(o) = o2 + 3. Let l = 15596 + -15598. Let t(q) = 5q2 - q + 13. Give lt(r) + 9c(r). -r2 + 2r + 1 Let m(i) = -43i2 - 2i + 187. Let d(t) = -29t2 - t + 188. Calculate -3d(k) + 2m(k). k2 - k - 190 Let r = -387 + 484. Let m(o) = 112o*2 + 0o*3 - 4o - 9o3 - ro*2. Let b(j) = -5j*3 + 8j*2 - 2j. Give 11b(n) - 6m(n). -n*3 - 2n*2 + 2n Let f(x) = 640x - 6. Let q(p) = -631p + 8. Determine -3f(a) - 2q(a). -658a + 2 Let u(d) be the second derivative of -d4/12 - d3/6 - d2/2 + 498d - 1. Let q(z) = -15z2 - 6z - 3. What is q(k) - 6u(k)? -9k*2 + 3 Let o(t) = -16t*2 + 236t + 370. Let k(r) = 3r2 - 44r - 74. What is -11k(x) - 2o(x)? -x*2 + 12x + 74 Let b(g) = -641170g + 33050. Let x(q) = 19q - 1. Give b(v) + 33050x(v). -13220v Let l(s) = 8s + 35. Let j(h) = -7h - 39. Give -9j(t) - 8l(t). -t + 71 Let f(k) = -66520113k2 - 31595k - 695090. Let n(x) = 6316x2 + 3x + 66. Give 3f(c) + 31595n(c). -6319c2 Let y(c) = 1557c + 6. Let u(a) = -1589a - 7. Give 4u(k) + 5y(k). 1429k + 2 Let u(x) = 94*x	{ "pile_set_name": "DM Mathematics" }
e 2u + 2 = 6. Find the third derivative of 0p*2 + 3p*4 - 2p*2 + 11p*2 + 2p*u wrt p. 72p Let x(p) = p*2 + 5p + 5. Let u be x(-5). Let l be 0 - (-2 + (-2 - -2)). What is the third derivative of -ln2 + n2 - n2 - 2n*u wrt n? -120n*2 Differentiate -77g + 76g + 21g*3 - 97 - 9g*3 wrt g. 36g*2 - 1 Let l = -60 + 91. Find the second derivative of 7h + 16h3 - lh*3 + 2 - 2 wrt h. -90h Let u(n) = 276n3 - 1497n*2 - 7. Let i(d) = 141d*3 - 748d*2 - 4. Let a(s) = -7i(s) + 4u(s). What is the third derivative of a(j) wrt j? 702 Let q(r) = -79r*2 - 2r + 937. Let w(p) = -158p2 - 3p + 1875. Let n(b) = -7q(b) + 4w(b). What is the first derivative of n(m) wrt m? -158m + 2 Suppose w = 5d - 33, 4d - 56 = 5w - 17. Suppose 3 = 3q - d. Find the second derivative of 3h - qh3 + 5h*3 - 3h + 5h wrt h. 12h Let t(h) be the second derivative of -4h3/3 + 35h*2 - 5h + 6. Differentiate t(k) wrt k. -8 Let l(p) = -1 - p*2 + 7p + 10p2 + 9p*2. Let n(t) = -18t*2 - 6t + 1. Let g(c) = -6l(c) - 7n(c). Differentiate g(i) with respect to i. 36i Let x(i) be the third derivative of -103i5/10 - i4/6 + 5i3/6 + 68i2 + i. What is the second derivative of x(g) wrt g? -1236 Let p(o) be the second derivative of -o7/840 - o5/24 + o3/2 + 11o. Let g(u) be the second derivative of p(u). Find the second derivative of g(f) wrt f. -6f What is the second derivative of -3 - 2p - 4p*4 + 24p*4 - 69p*4 wrt p? -588p*2 Suppose 23 = 4v + 11. What is the derivative of -46 + 6n3 + 24n*3 - 4n*v + 2n*3 wrt n? 84n*2 Differentiate -196u - 189u + 670 + 40u*3 + 2u4 + u4 + 385u with respect to u. 12u*3 + 120u*2 Find the first derivative of 115 - 9l*2 - 25l*3 - 6l*3 + 10l*4 + 31l*3 wrt l. 40l*3 - 18l Let t(q) be the first derivative of 31q4/4 - 96q - 136. Find the first derivative of t(g) wrt g. 93g2 Let r = 276 - 274. Let v(t) be the first derivative of 0t*5 + 1/3t*6 + 0t*3 + 0t + 3 + 0t4 + rt*2. Find the second derivative of v(i) wrt i. 40i3 Let d(a) be the third derivative of -a10/420 - a*6/40 + 2a*3 - 4a*2. Let y(g) be the first derivative of d(g). Find the third derivative of y(r) wrt r. -1440r3 Let n(g) be the third derivative of -g9/168 + g*8/168 + 13g5/10 - g3/6 - 3g2. Find the third derivative of n(x) wrt x. -360x*3 + 120x*2 Let g(f) = -17f*5 + 5f*4 + 29f + 5. Let q(k) = 18k5 - 4k*4 - 29k - 4. Let s(a) = 4g(a) + 5q(a). What is the second derivative of s(n) wrt n? 440n3 Find the third derivative of -783y*5 - 347y*2 + 1536y - 769y - 767y wrt y. -46980y2 Let h(p) be the second derivative of 41/12p*4 + 0 + 0p*2 + 38p - 5/2p3. What is the second derivative of h(r) wrt r? 82 Let s(i) be the first derivative of -49i*4/12 - 19i*3/2 - 46i - 43. Let r(t) be the first derivative of s(t). Find the second derivative of r(q) wrt q. -98 Suppose -8 = c + 3c - 4w, -5c + 4w = 6. Find the third derivative of -3ac - 3a*4 - 3a4 + a2 + a*4 wrt a. -120a Let d(a) = -a*3 - 42a*2 - 3a - 135. Let o(n) = n*3 + 40n*2 + 2n + 134. Let r(s) = 2d(s) + 3o(s). Differentiate r(l) with respect to l. 3l2 + 72l Let y(z) = -9 + 0z - 7z + 5z. Let r be y(-6). Find the second derivative of -90 - 3b*r - 8b + 90 wrt b. -18b Let f(v) = 71v*4 - 7v*3 - 5v*2 + 177. Let s(b) = -36b*4 + 4b*3 + 3b*2 - 89. Let d(g) = -4f(g) - 7s(g). What is the first derivative of d(a) wrt a? -128a*3 - 2a Let b(o) be the second derivative of -o*5/4 + 4o*3/3 - 133o*2/2 + 60o - 2. What is the derivative of b(j) wrt j? -15j2 + 8 Let c be 16/9 - -3(-10)/(-135). What is the third derivative of -3t4 - 20t*c - 5t*4 + 7t*4 wrt t? -24t Let r(o) be the second derivative of 89o4/12 + o3/2 + 3o*2/2 + 10o. Find the second derivative of r(g) wrt g. 178 Let l(m) = -m*4 - 20m - 179. Let d(q) = 3q4 + 43q + 358. Let k(v) = 2d(v) + 5l(v). What is the derivative of k(o) wrt o? 4o3 - 14 Find the third derivative of v5 + 33v*6 + 10v2 + v2 + 32v2 - 3v*5 wrt v. 3960v*3 - 120v*2 Let d be (1/(-3)2)/((-32)/96). Let j(t) be the second derivative of 1/2t4 + 0t*3 + 0 - 6t - 5/2td. What is the first derivative of j(o) wrt o? 12o Let b(n) be the second derivative of 0n3 + 0 + 2n*2 - 1/4n*4 - 12n. Find the first derivative of b(u) wrt u. -6u Let o(l) be the third derivative of 29l9/504 + l7/30 - 23l5/15 - l4/24 - 542l*2. What is the third derivative of o(u) wrt u? 3480u*3 + 168u Let h = 2 - -2. Let i be ((-10)/h)/(1/(-2)). Find the third derivative of -3g2 + 0g*5 + 7gi - g2 wrt g. 420g2 Let r(x) = 50x*2 + 40x - 6. Let d(h) = -102h2 - 81h + 11. Let q(i) = -6d(i) - 11r(i). What is the second derivative of q(p) wrt p? 124 Find the first derivative of -5v + 6v + 3v2 + 3 + 23v + 7v wrt v. 6v + 31 Let n = -12 + 23. What is the second derivative of -4c4 - 3c*2 - 5c*4 - nc + 3c2 wrt c? -108c*2 Let c(f) = 259f*3 - 160f*2 - 14f - 7. Let p(b) = 259b3 - 160b*2 - 12b - 6. Let w(g) = 6c(g) - 7p(g). What is the third derivative of w(u) wrt u? -1554 Let d(x) = -13x3 - 8x*2 + 5. Let z be d(-3). Find the third derivative of 40f*4 + z + 7f*2 - 285 - 4f*2 wrt f. 960f Let h(a) be the first derivative of a4/2 + a2 + 5a + 6. Let k(n) be the first derivative of h(n). Find the first derivative of k(b) wrt b. 12b Suppose -2y + x + 8 = 0, 13y - 8y + x - 20 = 0. Let z(q) be the second derivative of yq - 1/2q3 + 0 - 3/2q*2. Differentiate z(f) wrt f. -3 Suppose -a + 8 - 19 = -3n, 5 = 5n + a. What is the third derivative of 18z*3 - 16z*5 - 18z*3 + 8z*n wrt z? -960z*2 Let t(d) = 3d + 6. Let i be t(0). What is the third derivative of -20k2 + 20k*i - 6k*6 - 4k*2 wrt k? 1680k*3 Let n(v) be the second derivative of -65v*7/42 + 9v*4 + 3v - 8. What is the third derivative of n(p) wrt p? -3900p2 Differentiate -51v + 49 - 39v + 2v with respect to v. -88 What is the second derivative of 14o - 5 - 8o + 181o2 + 12o + 11 wrt o? 362 What is the first derivative of -13v4 + 35 - 14v*4 + 9 - 11v*4 wrt v? -152v*3 Let v(d) be the third derivative of 49d*5/60 + 67d*3/6 + 6d*2. What is the first derivative of v(k) wrt k? 98k Let j(i) be the third derivative of 0i5 - 2/3i*4 + 0i*3 + 0i + 30i2 - 1/210i*7 + 0 + 0i*6. Find the second derivative of j(b) wrt b. -12b*2 Let s(r) be the third derivative of 0r*3 - 1/112r*8 + 0r*6 + 0r*4 + 8r*2 + 0r*7 + 0r + 1/5r5 + 0. Find the third derivative of s(n) wrt n. -180n*2 Let v(w) be the third derivative of -187w6/60 - w5/30 - 275w4/24 - w3/3 - 819w*2. Find the second derivative of v(i) wrt i. -2244i - 4 Find the third derivative of 199d5 - d3 - 200d*5 + 217d + 3d3 - d2 + 144d*4 - 2d*3 wrt d. -60d*2 + 3456d Let f(l) = 5 - l*2 - 4 + 2l2. Let h(b) be the first derivative of b4 - 2b3 + 3b - 49. Let u(i) = -6f(i) - h(i). What is the derivative of u(s) wrt s? -12s*2 Let k(i) = 152i*4 + 168i*2 + 8. Let h(m) = -101m*4 - 112m*2 - 5. Let b(s) = 8h(s) + 5k(s). What is the third derivative of b(x) wrt x? -1152x Let c(l) = -105l2 - 2l + 26. Let v(h) = 209h2 + 3h - 57. Let p(x) = -9c(x) - 4v(x). What is the second derivative of p(m) wrt m? 218 Suppose 0 = -s + 20 + 3. What is the second derivative of 48h + 9h*2 + 0h*2 + 6h*2 - sh wrt h? 30 Let k(s) be the second derivative of -s*8/28 - 13s7/14 + s4/6 - 18s2 + 2s - 40. Find the third derivative of k(w) wrt w. -240w3 - 2340w*2 What is the second derivative of 132x*4 + 197x*4 - 62x*4 + 309x + 45x4 - 879x wrt x? 3744x2 Let q(f) = -10f*3 + 3f*2 - 2f + 37. Let t(d) = -9d3 + 2d*2 - d + 36. Let p(s) = 4q(s) - 6t(s). Differentiate p(o) with respect to o. 42o*2 - 2 What is the third derivative of 55j - 8j3 - 16j*2 + 12j*2 - 193j*4 - 14j + 8j3 wrt j? -4632j Let y = 1971 - 1957. Let g(n) be the first derivative of 0n4 - 10n - 7/5n5 + y + 0n*2 + 0n*3. What is the derivative of g(c) wrt c? -28c**3 Let f(w)	{ "pile_set_name": "DM Mathematics" }
y + a, 0 = -4z + 5y + 11 for z. -1 Suppose 5n = -2j - 0 + 28, -4j = 3n - 14. Let k be (-2)/1 - (-60)/n. Let c be (-8)/32 + 138/k. Solve -3g - x - c = -0x, 2g + x + 12 = 0 for g. -5 Let f(s) = -s*3 + 6s*2 - 4s - 1. Let u be f(4). Let z = 11 - 8. Let r = 0 + z. Solve -m + 0 = b + r, 4b - 5m = u for b. 0 Let l(z) = -21z2 - 7z + 15. Let v(u) = 11u2 + 4u - 8. Let g(j) = -6l(j) - 11v(j). Let d be g(-1). Solve 3h - dw + 3 = 0, -4h + w + 7 = -2w for h. 4 Let s(z) = -5z - 3. Let i(c) = -6c - 4. Suppose l + 7 = 3. Let j(u) = ls(u) + 3i(u). Let b be j(2). Solve 2w = -2w - t + b, 8 = 2w + 2t for w. 0 Suppose 0 = -h - 40v + 43v - 1, -2h - v = -12. Solve -5r + 19 = -n, -hn + 2n - 2r = -11 for n. 1 Let i be 0 + 3 + (-1 - 0). Let a be (24/(-10))/(5/(75/2)). Let n be 3/a-2 - 33/(-9). Solve -4j - n - i = -2m, 5j = -3m + 20 for m. 5 Suppose -4y + 2 + 22 = 0. Suppose yg = -3g + 5g. Solve -3q - 5 = 5v - gv, -16 = -3v + 2q for v. 2 Suppose 5p = -4f + 7, -5p + 2f + 12 = -7. Let o be (2 + 5 - 1) + 2. Suppose 5b - o = pb. Solve 0 = -4z - 4k + 4, b = z + 3z - k for z. 1 Suppose -5q + 5 = -0q. Let s be ((-5)/(-15))/(q/81). Suppose -sv + 8 = -23v. Solve -j + vj = -t, -t - 2j + 1 = 0 for t. -1 Suppose 4d + g = 4g - 9, -3g - 12 = 3d. Let a be 4 + (-1 + d - -3). Let i be a + 16 + 3 - -3. Solve 4m + 0m + v + i = 0, v = -m - 10 for m. -5 Let j(d) = -d*3 + 2d*2 + 2d + 1. Let n = 6 - 1. Suppose 1 = np + 6. Let h be j(p). Solve -2x - 2o = -h, -11 = -x - o - 2o for x. -4 Suppose 11 = -4l - 1. Let p be l(24/(-9) - -2). Let y be (18/45)/(6/15). Solve 0 = 5g + z + 2, 0 = -5g - pz + y - 0 for g. -1 Let d(z) = -z2 + 7z + 8. Let q be d(8). Let r = 18 - 14. Let n = r + q. Solve 3v = -4j - n, 0v - 8 = 4j + 4v for j. 2 Suppose 99s - 103s + 76 = 0. Suppose -22 = -z + s. Solve 0 = 4w + 6m - 4m + 28, -4m = 5w + z for w. -5 Let u = 99 - 206. Let r = u - -109. Solve 0t - 9 = -2h - t, 18 = 5h - rt for h. 4 Let s(g) = g*2 + 17g + 47. Let y be s(-3). Solve -yr + 3 = 4x, 5x + 2r + 9 = -0r for x. -3 Let n be (-1)/(-2)-20/(-7). Solve -6 = s + s - 2y, -4s - 3y + 2 = n for s. -1 Let l(k) = 0k + 8k - 7k + 14. Let o be l(-10). Let z(w) = -2w - 5. Let c be z(-5). Solve -cn - 3 - o = -d, -n - 14 = 4d for n. -2 Suppose 4a - 5i = -i + 28, 2a - 4i = 12. Suppose 8n - 80 = a. Let s = n + -8. Solve -z + 3z + 19 = -sl, -2l - 10 = 0 for z. -2 Suppose 13f + 105 = 8f. Let h = f + 22. Solve -l - 4o - h = 5, 0 = -3o - 3 for l. -2 Let s(v) = -3v - 22. Let g be s(-8). Suppose 20 = -4m, -13 + 5 = w + gm. Solve -wh = 4n - 0h, 5n + 3 = -h for n. -1 Let z(y) = -43y + 8. Let l be z(2). Let v = -74 - l. Solve 5c = vn + 17, -3c = -4n - 10 + 3 for c. 5 Let v be (-15)/5(2 + -1). Let y = 23 - 18. Let c = v + y. Solve -3b + 3s = cs - 11, s + 7 = 2b for b. 4 Let k(a) = 4a + 41. Let i(r) = r*2 + 8r - 1. Let d be i(-4). Let q be k(d). Let z = q - -30. Solve zb + 5 = 2n, -1 = 3b - 4 for n. 4 Let j(m) = -m3 - 2m*2 + 3m. Let k be j(1). Solve -13 = 5u - 2i, -5u - 3i + 5 + 2 = k for u. -1 Let u be ((-2)/2)/(4/(-16)). Solve 5w = -uj - 16, 2j + w = -3w - 14 for j. 1 Let x(n) = n3 + n2 - n + 4. Let i(m) = m3 - m2 - 3m + 2. Let o be i(2). Let t be x(o). Solve 12 = -6u + 4u + 3b, -5u + t = b for u. 0 Suppose 0 = l - 15 - 15. Suppose -4z = -9z + l. Solve 5p - 21 = -2j, j + z = -2j + 5p for j. 3 Suppose 5j + c = 142 + 144, 5c = -4j + 212. Suppose j - 54 = a. Suppose ay = y + 6. Solve 0 = -3w + x - 14, yw + 1 + 1 = -3x for w. -4 Suppose -z = u - 6, 5z = 4u - 22 - 2. Solve 5p - p - 2y + 4 = 0, -3p - 3y = -u for p. 0 Suppose -r + 5 - 4 = 0. Let y = -16 + 4. Let c = y + 19. Solve -5j - 10 = -3n, j + n - c = -r for j. 1 Let y = -112 - -118. Let t be y/(7 - 4/1). Solve -g - 16 = 5p + t, 4p + 22 = 3g for g. 2 Suppose 5o + 40 = 5q, -4o = 3q - 2 + 13. Solve qz + 2m + 15 = 0, -z - 3 = -2m + 2 for z. -5 Let b = -162 + 165. Solve -3w + bf - 29 + 8 = 0, 0 = 2w - f + 10 for w. -3 Suppose 24 = 75p - 69p. Solve 5i + 3q + 18 = 0, pi + 2q = q - 13 for i. -3 Let o(p) = -p2 - 4p - 3. Let n be o(-2). Let l be ((-6)/18)/(n/(-15)). Solve 5z - 10 = -lm, -4m + 32 = -2z - 2z for m. 5 Suppose -186 = 5d + 3z, 0 = 2d - z + 78 - 8. Let x be 13/(-5) - d/60. Let b be (10 - x)/41. Solve 5p = -4w, -w = bp + 4w - 13 for p. -4 Let r(q) = 2q - 25. Let d be r(18). Let j(x) = x*2 - 6x - 24. Let b be j(d). Solve -2v + 5g + b = 0, -26 = -2v + 2g + 2g for v. 3 Suppose -5d + 20 = 5, 3d - 11 = -2y. Solve 4c = -5r - 3, -y = -r - 5c + 11 for r. -3 Suppose 0 = -3d + 4d + 9. Let i = d + 7. Let c be (2 - (i - -1))1. Solve -cb = -k, -2k = 4b + 3k for b. 0 Suppose -6s - 3s + 45 = 0. Suppose -2h + sh = 12. Solve 5d - 3z = h + 10, d + 5 = -2z for d. 1 Let n(f) = f2 - 21f - 68. Let t be n(24). Solve -5v - 41 = tj, -j = 5v + j + 33 for v. -5 Let p be (-72)/(-7) - (-22)/(-77). Let t be p/40 - (-30)/8. Let o = 7 - 1. Solve -b + 2 = -3h - 0h, tb = 5h - o for h. -2 Let t be 1 + -1 + 0 + 0. Let i be 10/1((-2)/1)/(-2). Suppose -5b = i, -l - 3l + 5b + 58 = t. Solve 2d = q, 8d - 4d + q = -l for d. -2 Let d(j) = -j*2 + 10j - 11. Let p be d(10). Let v = p + 13. Suppose -2k + v = -2. Solve 5t - c = -6, 1 = -kt - c - 0c for t. -1 Let g be ((-2)/4)/(12/(11 + -611)). Solve 4n - 3 - 17 = -4b, 3b = -5n + g for b. 0 Let x be ((-9 - -6) + 13)/2. Solve 4p - 13 = 4j - x, 4p = -3j + 1 for j. -1 Let g be -2(-1 + 4 - 4). Let f be (-1 - 2 - g)-4. Solve f = -5n, -5n + 2n - 13 = r for r. -1 Suppose -2s = f - 5, -2s - 4f - 431 + 451 = 0. Solve s = -4p + 2z + 14, -p + 4z - 11 + 32 = 0 for p. 1 Let i(o) = -o3 - 16o*2 - 23o + 75. Let t be i(-14). Solve 2a + a + 5v = 15, -v = -ta + 25 for a. 5 Let s be 308/7(2 - 3). Let q = -40 - s. Suppose -m - 5 = -u - 0m, -4u = m - 20. Solve 2g = ul - g - q, 4l + 4g + 16 = 0 for l. -1 Let g(b) = -b*3 + 3b*2 + 2b - 2. Let f = 3 - 0. Let v be g(f). Suppose 10p = -7p + 51. Solve s = vu + 11, -ps = -2s + 3u + 17 for s. -5 Suppose 113 + 119 = 8u. Let v = -20 + u. Suppose -vy = -11y. Solve -2n - 2o + 4 = -0, 5n + 4o - 13 = y for n. 5 Let t be ((-52)/16)/((-1)/4). Let u = t + -12. Suppose 5f = -2v - 10, -3v = 3f + u + 5. Solve vw - w - 4n + 21 = 0, n = 4 for w. 5 Let p be 4/(-6)(-1 + (-93)/6). Suppose -4i = -16, -g - 2i = 1 - p. Solve -3z = -2y + 4, -gz - 3 = 2z - 5y for z. -2 Suppose 5k - c = 20, 4k - 3c - c = 16. Solve 0 = -4l - 3h - 10, 5h = -l + kh - 3 for l. -1 Let k = -64 - -64. Let p be k(2/(-13) - 357/(-546)). Solve 3f + 6 = -j - p, -j - 12 = 5f for j. 3 Let k be (-1)/(76/20 - (-4)/(-1)). Solve 4m = 6m + 4i, 5m + 15 = ki for m. -2 Suppose -67x + 5x = -806. Solve -2z - x = a - 2a, 0 = 2z - 2a + 18 for z. -4 Let f = -356 + 361. Solve fo + 5h - 14 = -9, 3h - 3 = 3o for o. 0 Let z = 668 + -663. Solve -zc = -5v + v - 20, 25 = -c - 5v for c. 0 Suppose j = 3y - 6, 0 = -2y + 2j + 2 + 6. Let k(x) = 3x. Let m be k(y). Solve 0 = n + 5d + 21, -2d + 5d + m = -3n for n. 4 Suppose 6n = n + 125. Let r = n - 33. Let i(l) = l*3 + 9l*2 + 7l. Let u be i(r). Solve 2a = -2p - u, 2a - 6a - 16 = -p for p. 0 Let v(o) = o*2 + 11o - 2. Let r be (-1 - 1)(2 - -4). Let j be v(r). Solve t = 3b + 1, 0 = b - 6b + 4t + j for b. -2 Let q = -1475 + 1494. Let b = 5 - 0. Suppose 5t + 3d = b, 7d + q = t + 4d. Solve 3s = -2x + 13, -s = -tx - 3s + 14 for x. 2 Suppose -2h - 3i = -19, 4h + 5 = 3i + 34. Let u(j) = -j*3 + 9j*2 - 7j - 4. Let y be u(h). Solve 3s + 2 = ys, 4s = 4l - 4 for l. 3 Let s(o) = -o*2 + 27o + 4. Let y be s(0). Solve 0 = yf + 4k, 0f = -f + 5k - 24 for f. -4 Let v(z) = -2z2 + 12z + 23. Let u be v(7). Let q be ((-15)/u)/((-5)/45). Solve 4g + 5o - 8 = q, 0 = -g - 2o + 8 for g. 2 Suppose 3n - 3o + 3 = -0, n + 4o = 19. Solve nt = 3k - 12, -3k + 0k = 5t + 20 for t. -4 Let l(b) = -76b + 68b - 22 + 8. Let u be l(-4). Solve -5r + 1 = -4x + 4, 4x = -2r - u for r. -3 Let p be 1/((-84)/(-20) + -4). Let b be -2(-6 + p - 1). Solve -1 = -4d + 3v, -5v + b = 2d - 29 for	{ "pile_set_name": "DM Mathematics" }
(1/8))) assuming u is positive. u(9/40) Simplify k/(k/(k/(kk(2/11)k)))k/k7k(-7)/k2 assuming k is positive. k*(-178/11) Simplify aaa/a14a/(aa10a)a assuming a is positive. a(-21) Simplify ((s(s*(-27)/s)/s)/ss)(-28) assuming s is positive. s784 Simplify (j*(1/2)/((j/(jjj(j/(j*(-1/5)/j))/jj))/j))/(j/(jj(-2)j)jjj/j(1/2)) assuming j is positive. j(11/5) Simplify (a/(aaa(-2/3)aa)a)*(-2/9)(a*(2/5)a)(-18) assuming a is positive. a(-3362/135) Simplify (dd/d1dd)(-38)/(d(-1/3))(2/93) assuming d is positive. d(-31804/279) Simplify (l/l(-7/2))32 assuming l is positive. l144 Simplify ((b1)(-49))(-3/7) assuming b is positive. b21 Simplify w/w(-3/4)w/w*2(w(-1/4))9 assuming w is positive. w(-3/2) Simplify (((x0x)/x)/x)(-14/9)x*1(x/((x(2/11)/x)/x))/x assuming x is positive. x(433/99) Simplify (ww/w(-22))9 assuming w is positive. w216 Simplify a(-1/8)a17 assuming a is positive. a(135/8) Simplify (rr(-1/5))(-2/13)/(rr*(-2/25)rrr/r*5r) assuming r is positive. r*(-14/325) Simplify jj*(-2/15)jj5((j*(1/12)jjj)/jj)/j(3/7) assuming j is positive. j(1333/140) Simplify t(-1/7)t((ttt/((t/((tt(t(2/7)tttt)/tt)/t)t)/t))/t)/t((t*(2/7)t)/t)(-11/5) assuming t is positive. t(193/35) Simplify (a(-1/4))49(a1)(-4) assuming a is positive. a(-65/4) Simplify ((kk/(k*7k))/(kk(-2/3)))/(k3/k)(-44) assuming k is positive. k(245/3) Simplify (k/k4)(-24) assuming k is positive. k72 Simplify jj/((j/(j*(1/2)j))/j)j/((jj*8j)/j) assuming j is positive. j(-9/2) Simplify w/(w/(w(1/4)/w))ww*2w/w*7w(1/3) assuming w is positive. w(-41/12) Simplify (((q/q*(3/2))/q)/((qq/q*(-2/5)qq)/q))/(q(-4/3)((q/(q/((q*(-1/2)q)/q)q))/q)/q) assuming q is positive. q(-1/15) Simplify (v(-7/5)/(v/(vv(-11/3))))(18/7) assuming v is positive. v(-456/35) Simplify f(5/2)/(f/(f*(-1)f))f(-2/9)/fff/f(4/3) assuming f is positive. f(17/18) Simplify ((z/z(-5/2))/(zz(-3/7)/z))(-4/13) assuming z is positive. z*(-110/91) Simplify (((((zz(2/13))/z)/z)/z)/z(-1/5))(-20) assuming z is positive. z(428/13) Simplify ((o(o(-4/9)oo)/o)/((o(-3)/o)/o))(6/23) assuming o is positive. o(118/69) Simplify ((g8)(-1/6))(1/5) assuming g is positive. g(-4/15) Simplify h1/(h(-2)h)(h(-1/2))29 assuming h is positive. h(-25/2) Simplify (nn7)16 assuming n is positive. n128 Simplify (((r/r(2/9))/r)/r5)/(r(1/2)/(r/(rrr(2/5)))) assuming r is positive. r(-641/90) Simplify (o(-6/7)/o)25 assuming o is positive. o*(-325/7) Simplify (uuu(2/7)uu(2/9))/(u/(u(1/4)u))(-4/19) assuming u is positive. u(4136/1197) Simplify (z/(zz(-3/7))z(-2/3))/(z(2/3)z)36 assuming z is positive. z(-1265/21) Simplify (a/(aa*(1/14)))/(a(((a/(a*(-1/21)/aa)aa)/a)/a)/a) assuming a is positive. a*(-47/42) Simplify (gg*(2/9)gg)/(g/(g/(g(1/8)gg)))(gg0)(2/13) assuming g is positive. g(1171/936) Simplify g/(g/(g/(g/((gg*4g)/g))))g((g8/g)/g)/g assuming g is positive. g11 Simplify (h/(((hh(2/5)h)/h)/hh))(1/15)h*(-8/3)hh/(h/h10) assuming h is positive. h(623/75) Simplify (hh*(1/13)hh)/(h/(hh*(-3/5)/hh)) assuming h is positive. h*(161/65) Simplify ((uu/((u(u(uu/((u(2/3)uu)/u))/uu)/u)/u))/(u/((u/(u*4/u)u)/u)u))7 assuming u is positive. u(-49/3) Simplify (uu*(3/7)u*10u)38 assuming u is positive. u(3306/7) Simplify h(-8/3)/(h/(h16/h)) assuming h is positive. h(34/3) Simplify ((z3/z)/z)/((zz12/zz)/z) assuming z is positive. z*(-11) Simplify (j/(jj*(-25))j)/(j25/j) assuming j is positive. j2 Simplify (hh(5/3))/((h/h(-10))/h)(hhh/(h/(((hh/h(-2/7))/hh)/hh))h)13 assuming h is positive. h(1289/21) Simplify ((m/m*(-1/10)m)/mmm)/mm(-6/7)/m assuming m is positive. m(17/70) Simplify l(1/14)/(((l(7/6)/l)/l)/l) assuming l is positive. l(40/21) Simplify (l(l/(l*(-9)l))/lll*9ll)(-9/7) assuming l is positive. l(-27) Simplify u(5/14)/u(-27) assuming u is positive. u(383/14) Simplify h(2/45)h(1/8)/h assuming h is positive. h(-299/360) Simplify b*(-3)b/(b*(1/3)bbb) assuming b is positive. b*(-16/3) Simplify ((p(p*(-4)/p)/pp)/p)/ppp*(1/15)p*7pp(3/10) assuming p is positive. p(101/30) Simplify (z/z(-3/2)z21)(-1/10) assuming z is positive. z(-47/20) Simplify (d14/d)(-2/9) assuming d is positive. d(-26/9) Simplify (h*(1/2)/hh)*34/((hhh/(h/(h(h/(h*(1/3)/h))/hh)))/hh(-2/9)) assuming h is positive. h(122/9) Simplify (a/a(1/6))/aa*(14/9)a assuming a is positive. a*(43/18) Simplify ((aaa/(a/((aa*(-18)/a)/a))a)/a)/(a/a(1/43)) assuming a is positive. a(-773/43) Simplify (v/(vv(-1/3)))(-39)(vv(2/3)v)(-35) assuming v is positive. v(-319/3) Simplify (xx(1/5))(-34)/((xx(1/10))/((x(-11)/x)/x)) assuming x is positive. x(-549/10) Simplify b9/((b(-16)/b)/b) assuming b is positive. b27 Simplify ((n/((nn/((nn(-5/2))/n))/n))/(n(4/7)n))(1/12) assuming n is positive. n(-19/56) Simplify i(-2/15)/ii*(1/14)(i/((ii0)/i)i)/i6 assuming i is positive. i(-1063/210) Simplify (a(a3aa)/aa)(1/6) assuming a is positive. a Simplify (t/t(-3)t(-7))/(t(-2))(-4/3) assuming t is positive. t(-17/3) Simplify ((nn(n(-2/3)n)/n)/nnn/(n*(5/3)/nn))/(((n*(-1)n)/nn)/(n(n*4/n)/nn)) assuming n is positive. n(14/3) Simplify (a/a7)/a2 assuming a is positive. a(-8) Simplify (v*(7/5)v/(vv(-4)/v))/(v/(v/((v(-2/9)/v)/v))v/(vvv*(-2/11))v) assuming v is positive. v(4178/495) Simplify (w(1/5))1 assuming w is positive. w(1/5) Simplify ((s/s(-2/3))(-3/14))(-2/17) assuming s is positive. s(5/119) Simplify jj(-3)j/j*3j((j/j(-6))/j)/jjjjj/((j/(j(-1/4)j))/j) assuming j is positive. j*(27/4) Simplify ((uuuu/u*3uu)/uu/((u/(u*(-7)/u))/uu))(-36) assuming u is positive. u216 Simplify (x/x(-8))/(x/(x/x4))x(-1/2)/(xx*(-4/3)x) assuming x is positive. x*(23/6) Simplify (dd*(-8)(dd(-9)d)/d)/(d2/d(-9)) assuming d is positive. d(-26) Simplify (m(-4)/(mm(-4)))(5/14) assuming m is positive. m(-5/14) Simplify (b/b(-1/2))24 assuming b is positive. b36 Simplify ((ppp(-2/9))/(p3/p))/((p9p)/p(-7)) assuming p is positive. p(-155/9) Simplify ((r/r(-3))(-9))(-42) assuming r is positive. r1512 Simplify a*(4/3)aa(1/12)((a/(a/((aaa*(-3)a)/a)))/a)36 assuming a is positive. a(-835/12) Simplify n/n*(-1)n(-3/4)/n assuming n is positive. n(1/4) Simplify (((ff(-3/4))/f)(-34))(2/49) assuming f is positive. f(51/49) Simplify (c(-3/28)/c)/c(-6) assuming c is positive. c(137/28) Simplify (f8/f5)/((f(-1)/ff)/(f/f(-2/17))) assuming f is positive. f(87/17) Simplify q15/(q/q(-10)q) assuming q is positive. q3 Simplify (qq*(2/75)q)/qqq/((q/q*20)/q)qqq assuming q is positive. q*(1952/75) Simplify i(i/(iii*(6/13)))/ii(((i(1/2)/i)/i)/i)/i assuming i is positive. i(-103/26) Simplify (i31/ii)/(i6/i) assuming i is positive. i26 Simplify (u*(-5/3)u/(uu(-1/13)uu))/((u/(u/(u(uuu/(u*(-2/3)uu))/u)))/u)(-1/18) assuming u is positive. u(-1247/351) Simplify k(-10/3)k(3/5) assuming k is positive. k(-41/15) Simplify (d(d/(d/d(4/7)))/d)/(dddd/(dd(-25))) assuming d is positive. d(-192/7) Simplify (j7j)(-3/14) assuming j is positive. j(-12/7) Simplify (v(-1/6)/(v4/v))(12/13) assuming v is positive. v(-38/13) Simplify (f(13/5)/f)50 assuming f is positive. f80 Simplify h(-1/12)/(h*(-7)/hh) assuming h is positive. h(83/12) Simplify ((x(2/7))(-16))6 assuming x is positive. x(-192/7) Simplify (r(-2/5)r)/r(2/9)(r/(r/r(-3)))/r0 assuming r is positive. r(-118/45) Simplify z/z(-1/6)(z/z16)/z assuming z is positive. z(-89/6) Simplify ((hhh0)/hh5)(1/15) assuming h is positive. h(2/5) Simplify (o(-3)((o/(oo*(-2))oo)/o)/o)/(o(-4/5)/(o/(o/(o/(o/((o*(-10)/o)/o)))))) assuming o is p	{ "pile_set_name": "DM Mathematics" }
Let l = -28/11 + 218/77. What is the common denominator of l and (-182)/10 - (-2)/10? 7 Let d(y) = y*2 + 4y + 3. Let i be d(-4). Suppose -ir = -3z + 48, -3z + 3r - r = -45. Calculate the smallest common multiple of z and 11. 143 Suppose -3b + 15 = -27. Let o be (16/10)/((-3)/(-30)). Let h = 22 - o. What is the smallest common multiple of h and b? 42 Suppose -3z + 3 = 0, 5v + 13 - 38 = 5z. What is the smallest common multiple of 18 and v? 18 Suppose -a = -3t + 45, 3a + 50 = 4t + 5a. Let k = -7 + 12. Suppose -x + 5h = 23, kh = -2x + x + 27. What is the lowest common multiple of t and x? 14 Let g = 12559 + -251267/20. Calculate the common denominator of (-25)/2 - (1 - 0) and g. 20 Let r be (6/(-3))/(2 + -4). Suppose -2y + r = -y. Calculate the lowest common multiple of 8 and y. 8 Let t be 348/207 - 1 - 2. Let v = -3101/276 - t. Find the common denominator of v and -115/14. 84 Suppose -w = -6w + 80. Find the common denominator of 498/(-420) - 2/(-5) and 10/w + (-1)/4. 56 Let p(c) = -1 - c - c2 - c + 3c - c*3. Suppose -r = -3f + 3, 0 = r - f + 5 - 2. What is the lowest common multiple of 2 and p(r)? 14 Let h be (0 + 0)/(3 - 1). What is the common denominator of 2 - (25/6 + -2) and 178/(-20) + -2 + h? 30 Let b = 10136 - 101473/10. Suppose -3z = 0, 2z - 1217 = 3o + 2584. Let u = o + 2483/2. Calculate the common denominator of u and b. 10 Suppose 4q - 2k = 67 + 5, -24 = -q + 2k. Calculate the smallest common multiple of 2 and q. 16 Let r = 9/73 - -2245/146. Let d be (-2)/(-4) - 692/1354. Let c = -30886/7447 - d. What is the common denominator of c and r? 22 Let m = -282052 - -1141199/4. Let k = m + -3225. What is the common denominator of k and 8/(-6)(-5)/(-2)? 12 Calculate the common denominator of -65/4 and (-30)/(-8)(-78)/(-25). 20 Let s(g) = -g3 + g2 - 1. Suppose -3z - 3i = 15, 0z - 2i = 5z + 13. Let h be s(z). Calculate the common denominator of (h - (-10)/(-24)) + 2 and 13/2. 12 Let i = -7060626/7 + 84069449/84. Let s = 7846 + i. Calculate the common denominator of s and 55/8. 24 Let z(c) = c3 + 7c*2 + 2c - 9. Let t be z(-7). Let q = 25 + t. Calculate the least common multiple of q and 4. 4 Let f = -64/71 + -4543/710. What is the common denominator of -17/44 and f? 220 Let o(l) = 6l - 4. What is the least common multiple of 11 and o(3)? 154 Suppose 0 = -3m + 4l + 30, -29 = -2m + 5l - 9. What is the lowest common multiple of m and 9? 90 Let m = 8 - -1. Calculate the lowest common multiple of m and (-1 - -2 - 1) + 1. 9 Suppose 4i + g = 9, -11 = -5i + 2g - 3. Calculate the smallest common multiple of 42 and i. 42 Let a = 61 - 49. Calculate the lowest common multiple of 12 and a. 12 What is the least common multiple of 59 and -5 + 2 + (14 - -1 - 2)? 590 Calculate the smallest common multiple of 2 and 1/1 + (3 + -7 - -13). 10 Let l(n) = n*3 - 7n*2 + 8n - 3. Calculate the least common multiple of l(6) and 7. 63 Let u = 4547/3 + -1532. Calculate the common denominator of -16/11 and u. 33 Let m be (-404)/3(-9)/2. Suppose 4g + 54 - m = 0. Find the common denominator of (g/40)/(-2 + 1) and -19/10. 20 Let x be 2((-110124)/40)/9. Let l = 49249/80 + x. Find the common denominator of l and 67/16. 16 Let a = -6 + 5. What is the common denominator of (-109)/22 + (0 - a) and -2 - -291/6? 66 Let l = -817/5 + 3093/19. What is the common denominator of -34/11 and l? 1045 Let k(z) = -z*2 + 5z - 4. Let m be k(4). Suppose -2v + 13 = -0v + a, m = 2v - 5a - 7. Calculate the lowest common multiple of 8 and v. 24 Suppose 18 = 5i + 2u, 4 = -4i - 3u + 6u. Suppose -2d + o = -0o - 21, 0 = 5d + io - 30. Let v = 7 + -1. Calculate the lowest common multiple of d and v. 24 Suppose 47 = 5h + 12. Suppose 0 = -q - 3q + 36. Calculate the lowest common multiple of q and h. 63 Let w(k) = -k2 - 8k + 4. Let y be w(-6). Find the common denominator of (-1)/(-3) + (-71)/24 and (110/y - -2) + 1. 8 Let s = -7972 - -191359/24. Calculate the common denominator of 47/6 and s. 24 Calculate the common denominator of 5 and 3/18912914/(-48). 72 Suppose -3q = -2 - 4. Calculate the lowest common multiple of (2/(-6))/(q/(-30)) and 7. 35 Let b be (-2)/(-7) + 52/14. Suppose -2y - 10 = -by. Suppose -yh - 30 = -10h. What is the smallest common multiple of h and 20? 60 Let b(o) = -o3 + 8. Let f be b(0). Let g = f + -4. What is the smallest common multiple of 108/10 + g/20 and 7? 77 Let l = 92/147 - 7951/882. What is the common denominator of l and -95/6? 18 Let z = -1/895 + -58169/5370. Find the common denominator of 107/22 and z. 66 Suppose 2h = -2h - 2f + 60, h - f - 18 = 0. Calculate the least common multiple of (-7)/2-22 and h. 112 Suppose t - 4p = -0t - 10, -1 = t - p. Let a(k) = -k*3 - 5k*2 + k + 5. Let g be a(-5). Calculate the smallest common multiple of t and (g - 5)9/(-15). 6 Let y(f) be the second derivative of -3f5/20 - f4/3 - f3/3 + f2 - f. Calculate the least common multiple of y(-2) and 86/6 - (-1)/(-3). 14 Let a(z) = -2z*2 + 4z - 4. Let b(w) = -w*2 + 4w. Let x be b(3). Find the common denominator of 63/2 and a(x). 2 Let o = 36 - 35. Let z(b) = b*3 + 10b*2 + 10b + 11. What is the smallest common multiple of o and z(-9)? 2 Let v = 72 - 148. Let t be (-1)/(-5) + v/(-20). Suppose tf = f + 48. Calculate the lowest common multiple of 14 and f. 112 Let j = 23495/1986 - -1/331. What is the common denominator of j and 45/14? 42 Let q(g) = g2 - 38. What is the lowest common multiple of 2/2 + -4 + 7 and q(8)? 52 Let b(q) = -8q - 2. Let r(a) = a. Let u(p) = b(p) + r(p). What is the smallest common multiple of 4 and u(-2)? 12 Find the common denominator of 41/11 and 339/(-5)2/(-12). 110 Let h = -1398 - -12626/9. Calculate the common denominator of h and -71/3. 9 Suppose 371 - 92 = 3x. Calculate the common denominator of (-4)/(-16) + x/(-44) and -71/10. 110 Calculate the common denominator of ((-86)/(-16))/(7/4) and -7((-26)/(-8) + 0). 28 Let x = 3 - 2. Calculate the common denominator of -23/10 and ((-2)/24)/(x/(-71)). 60 Let v(p) = p3 + 8p*2 - p - 6. Let j be v(-8). Suppose -4 = o - 0o, -20 = -4b - jo. What is the least common multiple of 2 and b? 14 Let a be 1/(-4) - (-447)/(-4). What is the smallest common multiple of ((-4)/7)/(32/a) and 14? 14 What is the common denominator of 30/(-27)2/(-5) and -29/10? 90 Let w = 4523 - 171851/38. Find the common denominator of 54/(-9) + 1575/108 and w. 228 Suppose -y + 14 = y. Let k be -3 + 6 + -1 + -2. Suppose -d + k = -4. Calculate the lowest common multiple of d and y. 28 Let i = 9 + -25. Find the common denominator of 49/22 and (2/i)/((-1)/25). 88 Let o = -75756 + 16742034/221. Let b = o + 25393/2210. Calculate the common denominator of b and 65/(-2) + (1 - -1). 10 Let j = -6 + 13. Suppose 0 = -u - 4s + j, -5u - 4s = -0u - 35. Suppose 5m = 54 + 1. Calculate the smallest common multiple of u and m. 77 Let p = -4 - -8. Calculate the smallest common multiple of p and 3. 12 Let t = -31 + 51. What is the lowest common multiple of 2 and t? 20 Let i = 3 - -6. Find the common denominator of -143/6 and (-6)/i + 65/(-18). 18 Suppose 2i = 3g + 11, i - 1 = 2g - 5g. Let j = 1/303 - 236/101. What is the common denominator of j and g + 1/10-57? 30 Let w = -335741/32 - -10494. What is the common denominator of 19/14 and w? 224 Suppose -18 = -4h + 18. What is the smallest common multiple of 5 and h? 45 Suppose 2a - 6 = k, 0 = -4a - k - 3k. Calculate the lowest common multiple of a and 12. 12 Let i be -1 + -1 + 515/165. Let u = 3724405925/101700786 + 2/1540921. Let h = i - u. Calculate the common denominator of h and -25/2. 2 Let f = -6 + 6. Suppose f = y + u + 5, 0y - 2y + 15 = -3u. Suppose ym + 12 = 2m. Calculate the smallest common multiple of 4 and m. 12 Let u = -10 - -7. Let l be 4/(-12) - (-370)/(-6). Find the common denominator of -83/2 and (u/(3/l))/3. 6 What is the lowest common multiple of 5 and (-12)/10(-55)/22? 15 Let d = -19 + -19/4. Let u = d + 24. What is the common denominator of 53/2 and u? 4 Suppose -4d = -9d + 10. Suppose dn + 4i = 4n - 2, -2n - 2i = -14. Calculate the least common multiple of 11 and n. 55 Let r(u) = -u*3 - 6u*2 - 10u + 5. Calculate the smallest common multiple of r(-5) and 4	{ "pile_set_name": "DM Mathematics" }
g - 770. What are the prime factors of j? 2, 79 Let h(z) = 2z*2 + 0z*2 + 15z*3 - 12 - 8z*3 - 6z*3 - 7z. Let l be h(-3). Suppose l = 3j - 5 - 22. List the prime factors of j. 3 Let t(j) = 2j - 53. Let r = -41 + 41. Let x be t(r). Let y = x - -177. List the prime factors of y. 2, 31 Let n(m) = -9m + 71. Let p be n(8). List the prime factors of (1041/6)/(p/(-2)). 347 What are the prime factors of (3/(24/10) + (-954)/424)-3859? 17, 227 Let t(c) = c*3 - 73c*2 + 128c + 242. List the prime factors of t(72). 2, 2137 Let p(k) = -18k3 + 2k*2 + 3k + 2. Let l be p(-1). Suppose 4a - 19 - 146 = -5m, -5m - 150 = -5a. Let g = l + a. What are the prime factors of g? 2, 3 Let w = -64 + 87. Let z(i) = i*3 - 23i*2 + 25i - 56. List the prime factors of z(w). 3, 173 Suppose b + 5c = 29, -4b + 2b + 84 = -3c. Suppose -bg = i - 35g - 434, 2245 = 5i - 5g. List the prime factors of i. 2, 223 Let y = 9473 + -4664. List the prime factors of y. 3, 7, 229 Suppose 2m - 4a = 9022, -3m + a + 5451 = -8077. What are the prime factors of m? 3, 167 Suppose 3o - 13 - 11 = 0. Let l = 712 - 728. List the prime factors of o/(-2)(564/l + 4). 5 Let t = -6298 - -12043. List the prime factors of t. 3, 5, 383 Suppose 0 = 18u - 31u + 2795. Let p = -144 + u. What are the prime factors of p? 71 Suppose 0 = -6n - 19001 + 68195. Suppose -11v = -n + 2028. List the prime factors of v. 3, 11, 17 Suppose 5i - 2a - 51237 = 0, 6i - 30727 = 3i + 5a. List the prime factors of i. 37, 277 Let m(w) = 29w + 16. Let q be m(-42). Let d = -599 - q. What are the prime factors of d? 3, 67 Suppose 316l - 29157 = 1287299. What are the prime factors of l? 2, 2083 List the prime factors of 5/((-1)/1) - -12344 - -8. 12347 Suppose 22761f + 492966 = 22795f. List the prime factors of f. 3, 179 Let k be 139/((9 + -12)1/(-3)). Suppose k + 1396 = 5t. What are the prime factors of t? 307 Let q(j) = 5 + 2 + 16j2 - 11 + 19j - 2. What are the prime factors of q(3)? 3, 5, 13 Let m = 22 - 20. Suppose -41 = mc - 51. Suppose cs + 287 = 2r, 255 = 5r + 3s - 478. List the prime factors of r. 2, 73 Let g be (-10 - 0) + (0 - 0). Let x = -10 - g. Suppose -4j + m + 168 = x, -4j + 9 = 2m - 171. List the prime factors of j. 43 Let v be (-3 + 2 + 2)/((-4)/(-32)). Suppose -3p - v + 48 = -2k, 4p = k + 60. List the prime factors of p. 2 List the prime factors of 4 - 402578/11(-2)/4. 3, 6101 Let i(b) = -2b3 + 8b + 2962. What are the prime factors of i(0)? 2, 1481 Let h(g) = -g*3 - 7g*2 - g - 5. Suppose -t + 28 = -5t. Let s be h(t). Suppose -4p + sk = -63 - 23, -120 = -5p + 5k. List the prime factors of p. 19 Let a(l) = 498l - 1375. What are the prime factors of a(29)? 73, 179 Suppose 5353 = 4z + p, -3z + 4p + 1839 = -2190. Suppose -16m + 5269 + z = 0. Suppose 0 = -7l + m + 833. What are the prime factors of l? 2, 89 Let u = -3837 + 3796. Let c = -111 - -203. Let q = c + u. List the prime factors of q. 3, 17 Suppose -12v - 2u + 36 = -8v, 5u = v + 13. Suppose -5a - s = -va + 1128, 5a = -3s + 2820. List the prime factors of a. 2, 3, 47 Let z(q) = -2q3 - 16q*2 - 25q + 1. Let w be z(-6). Let n(r) be the first derivative of 3r2/2 + 28r - 1. List the prime factors of n(w). 7 What are the prime factors of 107(-369)/(-6) + (-36)/(-72)? 6581 Let f = 2083 + 912. List the prime factors of f. 5, 599 Suppose -12f = -9 - 27. What are the prime factors of -4 - f9522/(-27)? 2, 17, 31 Suppose 0 = 6o + 501 - 11085. Suppose 2c - 673 = -t, -4c = -5t + o + 1545. What are the prime factors of t? 5, 7, 19 What are the prime factors of -1 + (1/3)/(18/2807730)? 2, 25997 Let w = 1379 + 6448. What are the prime factors of w? 3, 2609 Let z(l) = -l3 - 39l*2 - 191l + 222. What are the prime factors of z(-45)? 3, 29, 241 Suppose 4138o = 4129o + 636255. What are the prime factors of o? 3, 5, 1571 Let r(c) = -27c2 - 16c + 2. Let z be r(-1). Let n(p) be the third derivative of p*5/60 + 3p*4/8 + 5p3/3 + p2. List the prime factors of n(z). 2, 5 Suppose 0 = -27n + 23n + 1100. List the prime factors of n - (0 + -2 + 2 + 1). 2, 137 Let o(w) = w*3 + 11w*2 - 6w - 15. Let q be o(-11). Let n = -47 + q. Suppose -ny - 2l + 218 = 0, 0y + 181 = 3y - 2l. What are the prime factors of y? 3, 19 List the prime factors of (-75741)/(-33) - ((-70)/77)/(-5). 3, 5, 17 Let m(g) = -g3 - 8g*2 + 9g + 3. Suppose 2p - 1 = p, 19 = -2k + p. Let v be m(k). Suppose 0 = u - vu + 12. List the prime factors of u. 2, 3 Let x(t) = -t3 + 18t*2 + 12t + 114. What are the prime factors of x(-26)? 2, 11, 17, 79 Let n be (-28878)/(-6) - (3 - (1 + 1)). Suppose -5y + x + n = 790, y - 808 = 2x. List the prime factors of y. 2, 3, 67 Suppose -271n + 258n = 16809. Let t = 354 - n. What are the prime factors of t? 3, 61 Let q = -13731 + 22961. What are the prime factors of q? 2, 5, 13, 71 Let k = 14034 + -10882. List the prime factors of k. 2, 197 Suppose 3b = 3o - 213453, 273o - 277o - 4b = -284596. List the prime factors of o. 2, 5, 1423 Suppose -20l = -158810 + 2850. What are the prime factors of l? 2, 7, 557 Suppose 2u + 620 = 6u. Let l be (-35 - -32)(-7 + 1 + -2). Let s = u - l. List the prime factors of s. 131 Let s be (-32236)/(-14) - 54/(-126). Suppose 35u - 28u = s. What are the prime factors of u? 7, 47 Let p = 5 + 18. Let a be 60/((-21)/p - -1). Suppose 71f - 66f = a. What are the prime factors of f? 2, 3, 23 What are the prime factors of ((-5816)/(-22))/((-13)/(-143))? 2, 727 Suppose 3q - 3 = p, 0q - 2p - 6 = -3q. Let l(f) = -f2 - 2f + 71. Let k be l(q). Suppose -j = -k - 2. List the prime factors of j. 73 Let c be 0 - (-2)/8 - 103182/(-232). Let s = c - 128. What are the prime factors of s? 317 Let h(c) = -c*3 + 10c*2 - 21c + 26. Let g be h(8). List the prime factors of (-6 - (-4445)/g)-2. 647 Let t = 38421 - 2285. List the prime factors of t. 2, 4517 Let l be 6/((-5)/(15480/(-16))). Let i = l - 592. What are the prime factors of i? 569 Let a = -604 + 612. Suppose 0 = af + f - 4851. List the prime factors of f. 7, 11 Suppose 69s - 1856175 = 3802745 - 1894211. What are the prime factors of s? 3, 13, 1399 Let j = -352 - -599. Suppose -25f + j = -1078. What are the prime factors of f? 53 Let t be 6/(-4)(9 + -3). Let c = 13 + t. What are the prime factors of c/82 + 94? 5, 19 Let h be 5/(28/36 - (-4)/18). Suppose -hn + 0n = -10. Suppose -3l = -2m - 149, -4l + 224 = nm + 44. What are the prime factors of l? 47 Let r be 114332/16 - 6/8. What are the prime factors of (r/15)/(18/324)? 2, 3, 179 What are the prime factors of (-9 - (-16)/3 - -5)(1 + 33086)? 2, 41, 269 What are the prime factors of (-40)/(-4) + -12 - -2335? 2333 Let v be (1056/(-14))/((-243)/(-126) + -2). Let f = v + -796. What are the prime factors of f? 2, 5, 13 Let d(x) = -1746x3 + 52x*2 + 163x + 19. What are the prime factors of d(-3)? 2, 5, 2357 Let u(w) = w*3 - 75w*2 + 133w - 81. List the prime factors of u(74). 5, 857 Suppose -31z + 250494 + 289484 = 158306. What are the prime factors of z? 2, 3, 19 Let r = 402 + 210. What are the prime factors of r? 2, 3, 17 Suppose -196378 = -5n + j, -20j = -n - 16j + 39287. What are the prime factors of n? 5, 1571 Suppose 17x = 21x - 32x + 538944. List the prime factors of x. 2, 3, 401 List the prime factors of (14 - 0/(-14)) + 8502. 2, 2129 Let r be 3276 + (-6)/21-7 - 0. Suppose 5v - 8488 = -r. List the prime factors of v. 2, 521 Suppose -3d + 230 = -4x, 0 = 5d + x + 3x - 362. Let n = d - -188. Suppose -3i + n = -5q, -99 = -i - 0q + 4q. List the prime factors of i. 79 Suppose 3r - v + 4v = 45, -43 = -3r - 5v. Let y be (r/20)/(2/115). Let f = y + -29. What are the prime factors of f? 17 Let x be (-22)/(-121) - (-1 - 39/(-33)). Suppose -28s + 15s + 9828 = x. List the prime factors of s. 2, 3, 7 Let w = -23 + -11. Let k = w + 42. Suppose kg = 2g + 78. List the prime factors of g. 13 Let v(d) = d3 + 7d*2 - 39d + 328. What are the prime factors of v(17)? 7, 23, 41 Suppose 2j + 23j = -17700. Let s = -240 - j. List the prime factors of s. 2, 3, 13 Suppose 9b + 5 = 10b. Suppose -7v = -2v - 25, by = 4v + 1310. List the prime factors of y. 2, 7, 19 Suppose 0 = -3l - 4y	{ "pile_set_name": "DM Mathematics" }
order. -6, -2, 0, x Let y = -26 - -28. Let t be 0((-5)/y)/(-5). Let s be (20/(-12))/(1/3). Sort s, 4, t. s, t, 4 Let z be (-1)/1 + (-69)/(-63). Let q = -5 + 1. Let k = -9 - q. Sort k, 1, z in increasing order. k, z, 1 Let w be (-12)/(-14)(2 + 9/6). Sort w, 1, -3/7, -0.02 in increasing order. -3/7, -0.02, 1, w Let y = 1.58 + 0.42. Sort -0.7, -4, 5, y in decreasing order. 5, y, -0.7, -4 Let n be 42/(-10) - (4/(-1) + 0). Let f = 69 - 68.6. Sort n, f, -1/2 in increasing order. -1/2, n, f Let r = -160 + 160.18. Let k = 3 - -1. Put k, r, -1 in increasing order. -1, r, k Let t = 500 - 500.5. Sort t, 18, 0.03 in ascending order. t, 0.03, 18 Let h(k) = -6k3 + 18k*2 - 5k - 2. Let b(u) = 5u3 - 17u*2 + 6u + 2. Let a(x) = 7b(x) + 6h(x). Let r be a(-12). Put r, 5, 0 in decreasing order. 5, r, 0 Suppose 0 = 3n - 0n - 15. Let c = -150 - -147. Sort -15, c, -1, n in descending order. n, -1, c, -15 Let y = 378 - 380. Put y, 4, -5, 24 in decreasing order. 24, 4, y, -5 Let a be (-3)/(-215/(-20)). Let b be -5-2a/4. Let v be (4 + -2)/(2 + -1). Put b, v, -7 in descending order. v, b, -7 Let v = 39 + -44. Put 5, v, -4/11 in ascending order. v, -4/11, 5 Let n = 134.5 + -121.5. Put -2/11, n, -4 in decreasing order. n, -2/11, -4 Let i = -0.06 - 0.06. Let c = 0.08 - i. Put -0.3, 0.4, c in ascending order. -0.3, c, 0.4 Let j(z) = -z2 - 2z + 1. Let x be j(5). Let v = x + 38. Suppose -vb - 4f = b + 5, 0 = -b - 3f - 12. Sort b, 5, -1. -1, b, 5 Let k = 42 + -29. Suppose c - k = -0. Let w = 18 - c. Sort -2, w, 0.5 in descending order. w, 0.5, -2 Let o = -14 + 9. Sort o, 3, -138. -138, o, 3 Let a = -3.6 + 4. Let i = 46 - 51. Put -1, a, i in increasing order. i, -1, a Let j = -191 - -125. Let k = -61 - j. Let p = -0.1 - -0.1. Sort -2, k, p in descending order. k, p, -2 Suppose -38 = -10t - 18. Sort t, -5, 1. -5, 1, t Let p be (-38)/95 + (0 - 17/(-5)). Let b = -4 - -5. Sort 0.07, p, b. 0.07, b, p Let s = 21.493 + -0.093. Let b = 2 - 23. Let d = s + b. Sort d, 6, -0.5 in increasing order. -0.5, d, 6 Let a(f) = 6f2 - 16f - 5. Let j be a(3). Put j, -0.9, 5, -2/23 in ascending order. -0.9, -2/23, j, 5 Suppose -3i - 2 + 11 = 0. Let j(b) be the first derivative of -b2/2 + 6b - 2. Let s be j(i). Sort s, -2, 4 in increasing order. -2, s, 4 Suppose 307 = 13b + 502. Sort -3, b, 6. b, -3, 6 Let m = 14.9 - 14. Let r = 1 - m. Let c = r - -0.1. Put -3/5, 5, c in descending order. 5, c, -3/5 Let b be (-4)/(-10) + 444/(-210). Let u = -191/91 - b. Sort -3, -1, u in decreasing order. u, -1, -3 Suppose 9q - 501 = -519. Put -3, q, 4, -4 in increasing order. -4, -3, q, 4 Let d = 851 - 9363/11. Sort d, -7, 9. -7, d, 9 Let x = -248 + 230. Put -2/3, 3, x in descending order. 3, -2/3, x Suppose -3i - 14 - 2 = u, 0 = -i + 4u - 27. Put -5, i, 22 in descending order. 22, -5, i Let i(f) be the first derivative of -f*4 + 4f*3/3 - 3f - 23. Let w be i(1). Suppose -2t + 4t = -4. Sort -1, t, w. w, t, -1 Let p be 2/(-9) - (-48)/216. Let t = -1909 - -34345/18. Let s = -7/9 - t. Put s, p, 2/17 in decreasing order. s, 2/17, p Suppose 5w = -4d, 0d - 2w = 2d - 2. Suppose -s - s - 3n = -1, 3s - 3n + 21 = 0. Sort s, 0, d in descending order. d, 0, s Let o(i) = 12i2 - i - 5. Let s be o(-2). Let n be s/(-6)(-10)/(-15). Sort n, -6, 4. -6, n, 4 Let z be (-47)/(-9) - 8/36 - 0. Sort -2, z, 66 in descending order. 66, z, -2 Let f = 4 - 7. Let l = -156 - -150. Let c = 5.2 + l. Put f, c, -0.2 in decreasing order. -0.2, c, f Let z = 4 + -12. Suppose 58l = 53l, 2d - 4l = 8. Put -5, d, z in descending order. d, -5, z Suppose -5a + 24 = v, 4a - 24 = -3v + 4. Let r be (-11 - 675/(-63))/(6/(-14)). Sort 8, r, v in ascending order. r, v, 8 Let f be (-5 + 0 - 1)21/(-42). Sort -2, f, -4, -25. -25, -4, -2, f Suppose -36 + 11 = -5g. Suppose 68 = -62m + 6. Sort g, 4, m in decreasing order. g, 4, m Suppose 4c = 2c - 2. Suppose -o + 4u - u + 5 = 0, -4u = -4o + 12. Let j be (20/(-12))/(o/6). Sort j, -4, c in ascending order. j, -4, c Let y = -8.58 - -9.58. Suppose 2 = 2z + 2i, -4z + 0 + 5 = 3i. Let f be (3/z)/(3 - 6). Put f, -4, y in decreasing order. y, f, -4 Let k = 32.5 + -34. Let d = k + 1.4. Sort 4/5, 0.5, d in increasing order. d, 0.5, 4/5 Let h be (7 + (-3 - 1))22/66. Put -162, h, -2, -5 in descending order. h, -2, -5, -162 Suppose 40 = -4d + 116. Suppose -d - 11 = 5z. Let c = 1 + 1. Sort z, -2, c. z, -2, c Let p = 0.4161 + 0.0839. Let m = -3 + 2.99. Put m, -3/4, -3/5, p in decreasing order. p, m, -3/5, -3/4 Let f = 750 - 748. Put f, 45, -2 in descending order. 45, f, -2 Suppose -2j + 2m - 1 = 3, 5j = 2m - 16. Suppose o - 13 = 14o. Sort j, 1, 2, o in ascending order. j, o, 1, 2 Suppose 2o + 10 + 1 = -r, -5o = 2r + 25. Let f(g) = 6g2 + 92g + 28. Let t be f(-15). Put 8, o, t in decreasing order. 8, t, o Let u be (-25)/13 - (-4)/(-18). Let g = u + 25/13. Let k = 0.06576 + 4.93424. Sort k, -5, g in ascending order. -5, g, k Let p be -2(2-1 + (5 - 4)). Suppose -5r + 9 = -pr. Put r, 5, 2 in descending order. 5, r, 2 Let d = -342.74 + 343. Sort d, 4, -2 in increasing order. -2, d, 4 Let c = 63 - 63. Let z = 9 + -6. Sort z, c, -1 in decreasing order. z, c, -1 Suppose 4g - 12 = 0, -g + 2g + 7 = -5a. Suppose -4m + 4 = -2j, 24 = -4m + 2j - 7j. Sort m, 5, a in increasing order. a, m, 5 Let r = -0.1155 - 0.2845. Sort r, -5, 6 in decreasing order. 6, r, -5 Suppose 11y - 19 = -o + 8y, -2y = o - 14. Sort 1/7, -436, 3, o. -436, 1/7, 3, o Let j = 3 + -2.8. Let k = 2/33 + -80/231. Let i = -0.01 - 0.59. Sort j, i, k in increasing order. i, k, j Suppose l + 4x + 16 = 0, -5x + 0x - 37 = -3l. Suppose 220q - 219q - 3 = 0. Put l, q, -2 in decreasing order. l, q, -2 Let g = -0.325 + 0.445. Let x = 12 - 12.52. Let f = x + g. Put f, 1, 1/3 in increasing order. f, 1/3, 1 Suppose 0 = -l + 3l - 4. Let i = l - 1. Let m be (-6)/(-12) + (i - 1). Put m, -2/7, 4 in ascending order. -2/7, m, 4 Let b be 63/(-6)640/(-35). Let t = b + -289/4. Let n be 1(-2)/36. Put t, n, 5 in increasing order. n, t, 5 Let b = 2.884 - -0.116. Put -1, 0.2, b, -4 in descending order. b, 0.2, -1, -4 Let n be 3/(-12) - (-20)/16. Let x = n + -4. Suppose -3w + 14 = 5a, -14 = 2w - w - 3a. Put x, w, 2 in descending order. 2, w, x Suppose -78a - 84 = -36a. Suppose -4 = -3q - 16. Suppose 2v - 10 + 2 = 0. Put v, q, a in decreasing order. v, a, q Let w = 2 - -2. Put w, -3, -2, 8 in decreasing order. 8, w, -2, -3 Let b = -160 - -163. Put -1, b, 29, -2 in descending order. 29, b, -1, -2 Let r = 4.722 + 0.278. Suppose 3q + q = 8. Sort -2/27, -2/15, r, q. -2/15, -2/27, q, r Let t = -85/14 + 39/7. Sort -37, 4, 0, t. -37, t, 0, 4 Suppose -3q - 15 = -27. Suppose -2 = k + k, -x = qk. Put -3/2, 1, x, -4 in increasing order. -4, -3/2, 1, x Let f be (-44)/(-14) - (1 + (-2 - -5 - 1)). Let v = 0.7 - -0.3. Sort v, f, 0.2 in ascending order. f, 0.2, v Let i = -1.7 + -0.3. Let d = -36/77 - -2/11. Put 2/11, d, i in ascending order. i, d, 2/11 Let x(f) = -f2 - 9f + 27. Let m be x(-11). Let k(q) = -q + 4. Let w be k(m). Put w, -6, 1 in decreasing order. 1, w, -6 Let y be 2/(-5) - 164/(-10). Suppose y = 7j - 11j. Let u be (-9)/(-18) - (-10)/j. Sort -3, 1, u in descending order. 1, u, -3 Suppose 2i + 29y + 6 = 31y, 0 = -4y + 16. Suppose -7 = -v + 1. Suppose -v = 3u + 1. Sort u, i, -5. -5, u, i Let j = 4.9027 - -0.0973. Let u = -78.63 - -79. Let z = -0.03 - u. Sort j, z, -0.2 in descending order. j, -0.2, z Suppose -7w + 207 = 228. Sort -0.15, 3, -0.4, w in descending order. 3, -0.15, -0.4, w Let w be -1 + (-2)/(-1) - 0. Let c = -9805 - -39447/4. Let r = -57 + c. Put 4/3, r, w in ascending order. r, w, 4/3 Let w = 256 + -177. Let q = 80 - w. Sort -3/2, 5, q, 28 in ascending order. -3/2, q, 5, 28 Let x = -471 + 476. Sort -3, x, 11 in decreasing order. 11, x, -3 Let h = -562 + 559. Put -63, -4, 2, h in descending order. 2, h, -4, -63 Let l be 4 - 2 - (-13 + 8). Suppose -l = -2u + 1. Suppose 0 = ux - 2x + 8. Sort -0.5, x, 4 in ascending order. x, -0.5, 4 Let y = -15 + 18. Suppose yw - 36 = 234. Let q be (3 - 0)/(w/(-12)). Sort q, 1, 2/5 in decreasing order. 1, 2/5, q Suppose u - 69 = 3p + 105, 3u - 58 = p. Let n = p - -62. Sort n, -3, -20 in increasing order. -20, -3, n Let c = 20 -	{ "pile_set_name": "DM Mathematics" }
mmon denominator of -49/299 and -14/325? 7475 What is the common denominator of -163/1716 and 23/234? 5148 Calculate the smallest common multiple of 871 and 5. 4355 What is the lowest common multiple of 198 and 540? 5940 Calculate the smallest common multiple of 18 and 1389. 8334 Calculate the least common multiple of 81 and 12. 324 Find the common denominator of -149/6 and -131/90. 90 Find the common denominator of -44/21 and -111/14. 42 What is the smallest common multiple of 40 and 3528? 17640 What is the common denominator of 65/3938 and -1/2685? 59070 Calculate the common denominator of -65/6 and -101/3264. 3264 Calculate the smallest common multiple of 402 and 402. 402 Calculate the common denominator of -42/19 and -62/1615. 1615 What is the lowest common multiple of 39 and 183? 2379 What is the common denominator of -61/216 and 1/54? 216 Calculate the least common multiple of 1166 and 132. 6996 Calculate the lowest common multiple of 22 and 22. 22 What is the smallest common multiple of 2 and 16? 16 What is the common denominator of 71/21070 and 37/8? 84280 Calculate the common denominator of 1/12 and -31/876. 876 What is the common denominator of -13/36 and -131/12? 36 What is the smallest common multiple of 920 and 345? 2760 What is the lowest common multiple of 10 and 530? 530 What is the common denominator of 37/600 and -143/2700? 5400 Find the common denominator of -37/992 and -47/248. 992 What is the lowest common multiple of 27 and 5283? 15849 What is the lowest common multiple of 5580 and 32? 44640 Calculate the smallest common multiple of 65 and 10. 130 What is the common denominator of 97/6588 and 13/45? 32940 Find the common denominator of 25/576 and -169/270. 8640 Calculate the least common multiple of 12 and 212. 636 Calculate the common denominator of -151/36 and -121/756. 756 Calculate the least common multiple of 39 and 33. 429 Calculate the common denominator of -7/37 and 81/244. 9028 Calculate the common denominator of 73/276 and -55/14. 1932 What is the least common multiple of 2220 and 12? 2220 Calculate the lowest common multiple of 48 and 7224. 14448 Calculate the least common multiple of 18 and 48. 144 What is the lowest common multiple of 760 and 8056? 40280 What is the common denominator of 167/2856 and -211/3570? 14280 What is the lowest common multiple of 2050 and 615? 6150 Calculate the smallest common multiple of 4120 and 5768. 28840 What is the smallest common multiple of 6 and 68? 204 Calculate the common denominator of 19/282 and 103/48. 2256 What is the smallest common multiple of 156 and 1634? 127452 Find the common denominator of 17/264 and -59/318. 13992 What is the lowest common multiple of 61 and 132? 8052 What is the lowest common multiple of 39 and 9? 117 Calculate the common denominator of -55/9 and 7/10683. 10683 Calculate the least common multiple of 704 and 8. 704 Find the common denominator of -91/22 and 85/18. 198 What is the least common multiple of 31764 and 9? 95292 Calculate the common denominator of -22/153 and 6/85. 765 Calculate the smallest common multiple of 96 and 8. 96 Calculate the smallest common multiple of 1116 and 144. 4464 Calculate the common denominator of 121/1020 and 107/36. 3060 What is the common denominator of -31/666 and -53/74? 666 Calculate the smallest common multiple of 96 and 512. 1536 Calculate the smallest common multiple of 1380 and 24. 2760 Calculate the common denominator of 93/2200 and 123/2200. 2200 What is the lowest common multiple of 8 and 28? 56 What is the lowest common multiple of 30 and 119? 3570 What is the smallest common multiple of 321 and 9? 963 What is the common denominator of 67/448 and 53/640? 4480 What is the least common multiple of 4536 and 56? 4536 Calculate the smallest common multiple of 91 and 182. 182 What is the lowest common multiple of 108 and 132? 1188 Find the common denominator of -95/12 and 57/268. 804 What is the smallest common multiple of 3486 and 1? 3486 What is the common denominator of -56/141 and 42/517? 1551 Find the common denominator of -73/33 and -199/210. 2310 What is the common denominator of 29/66 and -97/48? 528 What is the common denominator of -109/200 and -61/140? 1400 Calculate the lowest common multiple of 3 and 201. 201 Calculate the least common multiple of 52 and 18. 468 What is the lowest common multiple of 30 and 402? 2010 Calculate the least common multiple of 1364 and 220. 6820 Find the common denominator of -125/324 and -77/60. 1620 Calculate the common denominator of -5/133 and -35/361. 2527 What is the common denominator of 49/450 and -43/55? 4950 Calculate the common denominator of 29/13400 and -9/3350. 13400 Calculate the lowest common multiple of 56 and 1408. 9856 Calculate the smallest common multiple of 153 and 85. 765 What is the common denominator of -41/60 and 48/19? 1140 Find the common denominator of -123/440 and 39/44. 440 Calculate the lowest common multiple of 11 and 30. 330 Calculate the common denominator of 5/832 and 123/320. 4160 What is the lowest common multiple of 80 and 250? 2000 Calculate the smallest common multiple of 9 and 1026. 1026 What is the least common multiple of 28 and 2? 28 Calculate the common denominator of 1/273 and -20/973. 37947 What is the least common multiple of 28 and 14? 28 Calculate the common denominator of -133/96 and -61/6. 96 Calculate the common denominator of 21/13 and 36/7. 91 Find the common denominator of -61/2 and -61/30. 30 Calculate the common denominator of -99/4 and 109/15720. 15720 Calculate the common denominator of 5/16 and 69/14. 112 Calculate the lowest common multiple of 4121 and 143. 45331 Calculate the common denominator of -11/9 and 1/157. 1413 What is the common denominator of 131/144 and -79/564? 6768 What is the smallest common multiple of 210 and 30? 210 Find the common denominator of 49 and 109/240. 240 Find the common denominator of -7/968 and 91/264. 2904 What is the common denominator of -43/1206 and -25/1474? 13266 What is the least common multiple of 46 and 8? 184 Find the common denominator of 95/33278 and 97/6. 99834 What is the common denominator of 49/80 and 59/152? 1520 What is the smallest common multiple of 81 and 90? 810 Calculate the common denominator of -43/40 and 151/1608. 8040 What is the common denominator of -99/28 and 79/54? 756 Calculate the common denominator of -63/2 and 36/157. 314 Find the common denominator of -77/306 and -55/12. 612 Calculate the smallest common multiple of 24 and 24. 24 What is the common denominator of -28/19 and 43/152? 152 Find the common denominator of -62/621 and -79/45. 3105 Calculate the smallest common multiple of 570 and 4. 1140 Calculate the least common multiple of 32 and 68. 544 Find the common denominator of -69/400 and -117/20. 400 Calculate the smallest common multiple of 20 and 620. 620 What is the least common multiple of 21964 and 4? 21964 What is the common denominator of -5/756 and 149/3780? 3780 Calculate the common denominator of -2/835 and 28/167. 835 Calculate the common denominator of 89/782 and 33/20. 7820 Find the common denominator of -123/3190 and -11/203. 22330 Calculate the lowest common multiple of 348 and 12. 348 Calculate the least common multiple of 8 and 12220. 24440 Calculate the least common multiple of 1468 and 6. 4404 Calculate the least common multiple of 196 and 308. 2156 Calculate the lowest common multiple of 1500 and 190. 28500 What is the lowest common multiple of 590 and 430? 25370 Calculate the common denominator of 13/18 and 77/219. 1314 What is the lowest common multiple of 1148 and 738? 10332 Find the common denominator of -115/6 and 33/64. 192 Calculate the smallest common multiple of 250 and 3. 750 Find the common denominator of -73/76 and -7/190. 380 Calculate the common denominator of 151/132 and -61/36. 396 What is the smallest common multiple of 72 and 72? 72 Calculate the least common multiple of 42 and 126. 126 Calculate the least common multiple of 7 and 476. 476 What is the lowest common multiple of 198 and 198? 198 What is the common denominator of 68/7839 and -7/33? 86229 What is the lowest common multiple of 666 and 222? 666 Find the common denominator of -13/99 and -107/66. 198 Calculate the lowest common mult	{ "pile_set_name": "DM Mathematics" }
2 + m + to3 + so and give m. 0 Rearrange -62i3 + 1901 + 60i*3 + i - 1905 + 10i*2 + 7i*4 to the form oi + t + yi2 + li*4 + xi*3 and give x. -2 Express 102q*2 + 1547q + 67q2 - 1553q as uq + zq*2 + g and give z. 169 Rearrange -151f*3 + 19f*2 - 19f2 + 37 - f4 + 146f3 - f to of*4 + kf*3 + mf + hf2 + b and give o. -1 Rearrange 2463o + 2565o - 4658o to the form fo + j and give f. 370 Rearrange -22u*2 + 7u + 1 - 6u2 - 8u*2 - 43u*2 - 11u*2 - 2u*3 to the form au*3 + nu + h + yu2 and give y. -90 Rearrange 86h*2 + 38h*2 + 59h*2 + (-3h*2 + 5h - 5h)(-2 - 2 + 2) + 5h2 + 3 - 3 to the form lh + fh2 + k and give f. 194 Rearrange -306w*2 + 1222w*2 - 304w2 + w3 - 309w2 + 411 - 300w*2 to lw*3 + fw*2 + jw + b and give f. 3 Express 24929k2 + 137785165 - 137785165 in the form lk + c + nk2 and give c. 0 Rearrange (f + 0 + 0)(0f + 2f + 5f)(-3907 + 5990 + 5623) to the form sf2 + bf + q and give b. 0 Rearrange -264269n + 131441n + n*2 + 131300n to the form zn2 + o + bn and give b. -1528 Rearrange 4h4 - h3 - 150486h + 75238h - 2 + 15h*2 + 75244h to the form fh4 + ph + a + zh3 + qh*2 and give f. 4 Express -9073o - 6429o + 2 - 3629o - 7657o in the form xo + r and give r. 2 Express 2l + 203373l*2 - 203286l*2 + 2l in the form dl + tl*2 + r and give t. 87 Rearrange (206 + 158 + 64)(207b - 230b + 152b + (0 + 2b + 0)(-4 - 2 + 4) + 0 + 2b + 0) to the form c + wb and give w. 54356 Rearrange 9 + 47m - 15m + 12 - 8m - 44 to the form h + pm and give p. 24 Rearrange 0 + 0 - t + (t - t - t)(4 + 0 - 5) + 0t + 4t - 3t + 29941t + 30749t - 61540t to the form gt + i and give g. -849 Express -57y*3 + 2y*4 + 17y*3 + 128y*3 + 7 as h + gy + ry2 + fy*4 + xy*3 and give x. 88 Rearrange 2 + 739b - 229b + 822b + (-1 + 1 - 2)(0b + 3b - 4b) - b + 0 + 0 to the form r + ab and give r. 2 Express (-1055 + 4t - 26t + 1064)(-t - 3 + 3) as bt2 + lt + m and give b. 22 Express -8b + 394 + 3b + 6b + 2832 + 2994 in the form hb + o and give o. 6220 Rearrange 2m2 + 1226m + 2m3 - 1375 + 1359 + m4 - 1225m to the form k + xm4 + rm*2 + tm + om3 and give r. 2 Rearrange 3099x + 1407 + 17x2 - 1472 - 3094x to the form lx + g + ox*2 and give o. 17 Rearrange (-1 - 2 + 0)(7408t4 + 5317t*4 - 16547t*4) to the form yt*2 + gt*3 + rt + wt4 + a and give w. 11466 Express (0 + 1 + 2)(1 + 0 + 1)(4 - t - 4)(-7073 + 11t + 7073) in the form lt + h + ft2 and give f. -66 Express (-80n - 547n + 118n)(-2 + 0 + 6)(-2 - 3 + 4)(-2 + 4 - 1) as sn + l and give s. 2036 Rearrange 0 + 0 + 2s4 + (2s + 4 - 4)(5 - 5 + s3) + (211s - 19608 + 19608)(s3 + 35 - 35) to the form ps*4 + ts + cs3 + r + ks*2 and give p. 215 Rearrange ((-3 + 0 + 2)(2 - 2 + 1) - 6 - 2 + 2 + 3 - 5 + 0)(-5z + 4z - 8z) - 42z - 38z + 9z to mz + x and give m. 10 Rearrange (4 - 3 + 0 - 2n)(2392 - 1040 - 4) to w + jn and give w. 1348 Rearrange 0j*3 - 2j*2 + 3 + 3j4 + j3 - 3j + 138j + 11j to gj*4 + zj*2 + d + yj*3 + bj and give g. 3 Express 11k2 - 15k - 168 + 168 - 3 + 3 + 2k2 + (-2k + 0 + 0)(-2k - k + k) + 2k2 + 6 - 6 as i + yk*2 + uk and give y. 19 Rearrange -2 + 2s2 - 2 - 2s - s*4 + 4 + 10540s*3 - 10535s*3 to q + ns*4 + as*2 + ms*3 + ls and give l. -2 Express -224y3 + 4y - 3y2 + 0y + 3y2 - 2 + 475y*3 in the form ky*2 + sy + u + wy3 and give s. 4 Rearrange -6h3 + h2 - 79 + 6h + 2h*4 + 3h*3 - 19h3 + 75 - h3 to the form oh + n + uh*2 + bh*3 + lh*4 and give o. 6 Rearrange -143n + 170 - 2n2 + 40n + 104n to the form q + rn*2 + un and give r. -2 Express 1344f2 + 1250f*2 - 359f*2 + 804f*2 in the form xf*2 + u + mf and give x. 3039 Rearrange -388n4 - 7n*4 - 4n*3 - 3n + 37 + n*3 - 35 - 3n*3 to j + dn + vn3 + an*2 + yn*4 and give v. -6 Rearrange (-4 - 1 + 3)((1 - 1 - 1)(0 - 3 - 1) + 0 - 1 + 0 + 4 - 4 - 2)(5r - 22r - 117r) to f + hr and give h. 268 Express (h + 2h - 5h)(-h + 8 - 8)(-1003h - 1147h - 1905 + 2151h) as c + nh*3 + oh + lh2 and give l. -3810 Rearrange z4 - 2z + z*2 + 0z*3 + 4z*4 + 14 - 17 - 3z4 - z3 to the form rz + uz*2 + az*3 + bz*4 + y and give a. -1 Express (-3 + 0 + 1)(-4l - 5l + 1 + 6l)((1 - 1 - 2)(-282 - 94 + 114)(-2 - 1 + 9) + 1 + 3 - 5) as dl + k and give d. 18858 Rearrange (-5 + 5 + 1)(-8 + 0 + 2 + (-3 - 1 + 3)(-1 + 3 - 1) + 5 - 4 - 4 + 2 - 2 - 4)(-3i + 0i + 5i) to the form fi + j and give f. -28 Express (-13q4 + 10q*4 + 10q*4)(84 + 169 + 719 + 27) in the form pq3 + x + zq*4 + hq*2 + fq and give z. 6993 Rearrange m*2 - 156133 + 3m - 3m + 156100 to the form um*2 + b + gm and give b. -33 Express -5p2 + 5p*2 + 5p*2 + (5p + 0p - 4p)(5p - p - 2p) + (p + 0p - 7p)(-14p - 3 - 7p - 9p) in the form i + tp + dp2 and give t. 18 Rearrange -353729 + 353729 + 3484n to the form t + ln and give l. 3484 Express -5210 + 848 + q - 2153 - 8882 + 2621 in the form uq + v and give v. -12776 Express ((1 + 4 - 4)(-3 + 1 + 1) - 4 + 4 + 10)(-5o - 19o - 16o)(-3 + 19 + 1) as xo + p and give x. -6120 Rearrange -510r + 220r + 16r*2 + 291r to the form hr2 + or + n and give h. 16 Rearrange -1093a2 - 869a*2 + 165a*2 - 247a*2 - 1605a*2 to u + ra*2 + sa and give r. -3649 Rearrange 3r - 81 - 44 - 505 - 289 + 91 to l + pr and give p. 3 Rearrange -44d2 - 35d*2 + 13d + 78d2 + 25d - 118d3 - 27d to the form td2 + yd + md3 + f and give y. 11 Express 14f + 78f2 - 14f + 201f3 + 74f*2 - 151f*2 in the form zf + of3 + vf*2 + q and give v. 1 Rearrange 8b + b*4 + 10b*3 + 927 - 2b*2 - 927 to ub*4 + ab + pb3 + cb2 + i and give a. 8 Express (-p2 + 0 + 0)(4 - 5 - 7)(-4p + 14p + 14p + (p - 3p + 3p)(1 + 1 + 0) - 1 - 4p + 1) as sp + ap3 + g + kp*2 and give k. 0 Express -2 + 37139p - 38592p + 1 as xp + s and give s. -1 Express (0 + 0 - 1)(-70q + 86 + 35 + 65q) as g + lq and give g. -121 Express -226 - 45o2 + 226 + 2 - 2 + 2o*2 + (-5o + o + 3o)(-1 + 1 - 2o) - 99o*2 + 51o*2 - 205o*2 in the form mo + r + ho2 and give h. -294 Express 59w*3 + 1151w*2 - 216w*3 + 82w*3 - 3 + 77w*3 + w in the form tw*3 + hw*2 + yw + n and give y. 1 Rearrange (56c + 35c + 338c)(2 + 0 + 0)(4 + 6 - 7) to x + lc and give l. 2574 Express 8i2 + i3 - 11i*2 + 77i3 + i3 + 23i3 as g + qi*3 + ni*2 + mi and give n. -3 Express -193k2 + 584k*2 - 229k*2 + (-k - k + 4k)(11k - 1 + 1) - 2k2 + 4k*2 - 3k*2 in the form v + zk*2 + tk and give v. 0 Express -613n + 111n + 16 - 5 - 624n as c + hn and give c. 11 Express -17r2 - 12 - 16r*2 + 6r + 29r2 - 8r*2 - 30r*2 as u + yr + tr2 and give y. 6 Express -80g*2 - 35g*2 - 52g*2 + (-3g + 2g + 3g)(47g - 53g + 105g) in the form f + wg2 + kg and give w. 31 Express (2 - 2 + 1)(3m - 4m - m)(27m + 14 - 11 - 7m) + (0 + 0 + m)(0m - m + 3m) - 15 + 15 + 10m*2 in the form a + dm*2 + bm and give d. -28 Rearrange -21167658z + 21167658z + 6z2 + 698 to bz*2 + y + qz and give b. 6 Express -524y - 1415y - y + 584y - 1930y in the form py + h and give p. -3286 Express (3 - 5 + 3)(c*3 + 2c*3 + 0c*3 + (-3c + 3c + c)(36015 + 410c2 - 36015)) in the form m + yc*2 + sc + oc3 and give y. 0 Express 2n*4 + 2n*4 + 24n - 77n + 0n*3 + 7n*3 - 5n*3 + 23 in the form cn*2 + mn*4 + kn*3 + q + gn and give k. 2 Express 11670l - 1189l - 14727l - 12884l - 11902l as kl + f and give k. -29032 Rearrange 18n2 + 2n*3 - 304n - 661 + 304n - 4n*2 - 16n*2 to in*2 + mn*3 + l + sn and give l. -661 Express -204 - 3i2 + 291i + 66 + 138 as l + mi2 + wi and give w. 291 Rearrange 66m3 - 4 - 2 - 5m - 2 - 67m3 - 6m to the form om3 + k + bm + am2 and give b. -11 Express (-133 + 133 - 18w)(0w + 0w - 4w*2) + 5w*3 + 8w*2 - 5w*3 - 3w*3 in the form c + bw + nw3 + pw*2 and give n. 69 Express 2 - 2o*2 + 2o*	{ "pile_set_name": "DM Mathematics" }
for l. -1 Solve -17x - 23 = 5a - 16x, a + 11x + 37 = 0 for a. -4 Solve 5j - 10 = -5l, 487j = l - 491j + 980j for l. 4 Solve 4b = -m + 16, -58 = -b - 3m - 65 for b. 5 Solve 18p - 5 = 5p + 8p, -p - 2p = -t for t. 3 Solve -1175o - 24 = -1169o, -4o = 4m + 20 for m. -1 Solve f + 7884 = -3i + 7888, 3f = -3i + 12 for i. 0 Solve -9y - y = -3t - 69, 6 = -4t - y for t. -3 Solve -5t + 5 = -4a, 0 = 5a - 1233t + 1237t - 45 for a. 5 Solve -3o - 673 = -3x - 616, 0 = 3o - x + 13 for o. 3 Solve 18f - o - 18 = 16f, -f - 2o - 51 = 0 for f. -3 Solve 119t = -2l + 116t + 9, 5l + t = 3 for l. 0 Solve -5y - y = -2k - 0y, -4k + 17 = 5y for k. 3 Solve 3719r - 80 = 3714r, -3l - 4r + 67 = 0 for l. 1 Solve -4673 = -u - 4671, 3l - 5u = -25 for l. -5 Solve -4u + 38 = -5c, 16c + 11 = -5u - 0c - 7c for u. 7 Solve 16616w + 4g - 23 = 16615w, -20 = 5w - 7g for w. 3 Solve -2a + 7a + 25 = -x, 47 = 2a - 11x for a. -4 Solve 12f + 3x + 42 = 0, 99x + 36 = -3f + 94x for f. -2 Solve -217c + 23 = -215c - y, -2c = 5y + 7 for c. 9 Solve 0 = -106z + 108z - 36d + 74, -3z + d = 5 for z. -1 Solve -h = 5t + 1, 0 = -94t + 91t + 5h + 5 for t. 0 Solve 4k - 2143 = 2o - 2195, -2o + 2k = -42 for o. 16 Solve -3i - 9390q = -9387q + 3, 4i - 17 = 3q for i. 2 Solve -2h = -0h + 6, 2v - h + 2h + 3h = 0 for v. 6 Solve 3j = 2k - 1, 21964k - 21961k = j - 9 for k. -4 Solve -4d - z = -27, -4z = 63d - 66d + 6 for d. 6 Solve y - 9 = -0p + 3p, -274y - 26 = -278y + 2p for y. 6 Solve -3o = 2g - 1, g - 2o = 17 - 13 for g. 2 Solve -4w - 8 = -4c, 4w = 4c + c - 11 for c. 3 Solve -21v + 5x + 47 = 0, 9v + 2x + 12 = 14v for v. 2 Solve -2k = 2k + 2w, -50k + 4w - 9w = -45k for k. 0 Solve 4p + 9 = -458c + 461c - 2, 3p + 30 = -5c for c. -3 Solve 2q = -5r, -925q = 5r - 910q - 65 for r. -2 Solve 0 = 3x - 5o + 21, 124 = -4x + 12o + 96 for x. -7 Solve -3a + p + 5 = 0, 7 = 9a - 6a + p for a. 2 Solve 3n - 24 = 2u - 4n, u + n + 3 = 0 for u. -5 Solve 23s + 2k = 26s - 3, 3s = 3k for s. 3 Solve 5w + 3o = -11, 254o - 31 = 2w + 259o for w. 2 Solve -f + 5a - 11 = 0, -f - 2 = 563a - 565a for f. 4 Solve 7c + 25 = 2n, -9c + 4n = -13c + 32 for c. -1 Solve -228963v = -228966v + 15, 27 = -2n + 5v for n. -1 Solve -3s + 56w + 20 = 60w, -7w = -s + 15 for s. 8 Solve 0 = -3w + l - 23, 310 - 215 = w + 7l for w. -3 Solve 3n - x - 462 + 471 = 0, 0 = -2x for n. -3 Solve s + 21 = -3k, 133s - 18 = 137s + k for s. -3 Solve -67i + 68i + 2u = -2, 5u - 4 = 2i for i. -2 Solve 3k = -3z - 6 + 3, 0 = z - 5 for k. -6 Solve y - 3p = 69, -6y - 43y - 3p + 81 = 0 for y. 3 Solve -8j + 2n - 141 + 115 = 0, 4n = 3j for j. -4 Solve 4c = 4o + 177 - 137, -4c = -o - 31 for o. -3 Solve 4s - k + 26 = 0, -6s = 514k - 509k for s. -5 Solve 4r + 16 = 4g, -9017r = -g - 9020r - 12 for g. 0 Solve b - 5i = 1 + 4, 15i - 21 = 5b + 13i for b. -5 Solve -j - 43 = -3x - x, 0 = -2x + 3j + 29 for x. 10 Solve -13o + 14 = -8o - v, 5o = 5v - 10 for o. 4 Solve -5f = 2n + 45, 0 = -11n + 8n + 4f - 10 for n. -10 Solve 0 = q + 5i - 33, 0 = -14q + 9q - 3i + 33 for q. 3 Solve -d - 5 = a, 3d - 1311a = -1305a - 6 for d. -4 Solve 2c + 14 = 3f, -4925c = -4921c + 5f + 6 for c. -4 Solve 5g - 73 = 4u, -u - 354g - 20 = -357g for u. -17 Solve -68 = -4a - 4f, -31a + 36a - 6f = 85 for a. 17 Solve 4y - 5r - 20 = 0, 343y + 31 = 340y - 2r for y. -5 Solve 9v + 5b - 16 = 7v, -v - 3 = -3b for v. 3 Solve 0 = 3u - 7u + 6r, -4u - 6r - 7r = -38 for u. 3 Solve 0 = -k - 3d - 7, k - 4d = -2d + 13 for k. 5 Solve -5t + 20 = 4k, 5k - 2015 = 2t - 1990 for t. 0 Solve 0 = -2v - 3s - 26, 38 = 14499v - 14503v + s for v. -10 Solve n + 5d + 661 = 664, -3n = 6d - 18 for n. 8 Solve 16 = 5k - 2a, -3k - 2a + 11 = -5 for k. 4 Solve -5f - 33q + 2 = 0, -q + 28 = 29 for f. 7 Solve 109i - 2z = 110i, z = 3i + 7 for i. -2 Solve -4f - 2077 + 2067 = -t, 10 = -2t - 2f for t. -2 Solve 633i = 631i + 3j + 1, j = -i - 12 for i. -7 Solve 3r + 4o = 0, -39r + 36r + 3o = 0 for r. 0 Solve 4h + 146 = 14u, 3u + 2h - 59 = -2u for u. 11 Solve 0 = i - b + 16, -29b + 11b + 15b + 15 = 0 for i. -11 Solve -5z - 13 = 3a - 7a, -4a = -z + 7 for z. -5 Solve -3w = -21, -j - 2j + w - 1 = 0 for j. 2 Solve -i = -4y - 2, -134i + 119i = 5y - 30 for y. 0 Solve h - 6 = -5g, 112h = 84h + 2g + 168 for h. 6 Solve -5l + 13 = 3y, y + 2l - 64 = -59 for y. 1 Solve 64b - 61b - 7j - 103 = 0, -4b - 49 = 5j for b. 4 Solve -5h = -4q + 3, -6113q - 2h = -6114q + 3 for q. -3 Solve -9g - 2d + 44 = -5g, g - 25 = -4d for g. 9 Solve -5d - 5r + 20 = 0, -70 = 374d - 369d - 5r for d. -5 Solve 2p + 8r - 31 + 15 = -20, 0 = -5r for p. -2 Solve -138z = l - 118z + 34, -14 = -3l - 2z for l. 6 Solve 5t - 6 = -29h + 55h - 23h, 0 = t for h. -2 Solve 2n + 8 - 6 = -2f, -6 = 5n + 4f for n. -2 Solve 3m - 9 = -3x, -5x + 4m - 16m + 12 = -10m for x. 2 Solve -3u - 22 = -g, -5g = 731u - 734u - 2 for u. -9 Solve -2y - 12j = -56, -140y + 141y + j - 13 = 0 for y. 10 Solve -4r + 127k = 129k - 6, 4k = 7r - 63 for r. 5 Solve 34k - 40 = 29k - 5a, 5a - 56 = 3k for k. -2 Solve 0 = 2j - k - 5, -5j + 91k - 92k + 30 = 0 for j. 5 Solve 2l + 4c - 20 = 0, 19l + c + 13 = 23l for l. 4 Solve 4j - 7j + 51 = 5z, -5j + 3z = 17 for j. 2 Solve -67a + 72a + 2c = 4, 4a + 15 = c for a. -2 Solve -3c - 4n - 2 = 0, 4176n = 3c + 4175n + 7 for c. -2 Solve -9957 = -q - 2k - 9964, 0 = 5q - 3k - 17 for q. 1 Solve 0 = 11p + 71d - 66d - 26, -3d + 46 = -p for p. -4 Solve -6n - 9 = -5d, 4n - 7807d = -7809d + 10 for n. 1 Solve -r - 1927z = -1925z + 5, 4r + 20 = -7z for r. -5 Solve 0 = -4l + 2c - 20, 66 = 2c + 58 for l. -3 Solve 0 = 5n + 2g + 1622 - 1605, 3n + 8 = g for n. -3 Solve -5i - 17 = n, 192n - 189n - 9 = 0 for i. -4 Solve -42 = 3l + 4y - 31, 23 = -5l - 2y for l. -5 Solve 0 = -z + 5, 4b + 2z + 4154 = 4152 for b. -3 Solve -1969a = -1965a + l + 23, -3l - 9 = -3a for a. -4 Solve -17l = 3w - 16l + 10, 20w = -2l - 90 for w. -5 Solve -3r - 2h + 801 = 753, 0 = -5r - 4h + 80 for r. 16 Solve 3o + 3u = 21, -2676o - 3 = -2675o - 4u for o. 5 Solve 5m = 5b - 5, m + 3b = 2664 - 2649 for m. 3 Solve 2s - 5d + 41 = 82, 3s = 3d + 21 for s. -2 Solve 72 = 3m + 3s, 343019 = -5m - s + 343051 for m. 2 Solve -40 = 11u - n, 74u - 5n = 77u + 32 for u. -4 Solve 1 = -l + 2n + 3, 26l - 21l + 20n + 20 = 0 for l. 0 Solve 5v + 8 = -4a, 449a - 447a + 4 = 0 for v. 0 Solve -2n - 136 = y - 154, -2y - 3n + 27 = 0 for y. 0 Solve 0 = 4b - 2v - 12, b - 4b = -4v - 9 for b. 3 Solve 0a = -5a - 5q - 10, 0 = -2a - 387q + 390q + 1 for a. -1 Solve h + 14 = 3j, 0 = 3h - 57j + 80j - 54 for h. -5 Solve -32h + 37h = 3x - 63, -42 = -4h - 2x for h. 0 Solve -f = -19, 79n + 4f - 17 - 47 = 76n for n. -4 Solve v + 5h - 73 = -74, 11v = h - 11 for v. -1 Solve -28 = -a + 4t, 9t = 4a + 8t + 8 for a. -4 Solve 5z - 3x = -21, 5x + 1931 - 1966 = -2z for z. 0 Solve 3y = 3z + 36, -232y + 235y + 3z = -66 for y. -5 Solve -5c = d - 126, -c - 4c + 15d + 110 = 0 for c. 25 Solve -93u = -5c - 97u - 9, u = 20c + 19 for c. -1 Solve 2c - 1 = -3f, 175c - 350c - 15 = -178c for f. -3 Solve -3s - 48 = o, 16232o - 16232o = s + 15 for o. -3 Solve -104g + 130g - 5m = 52, -2m - 46 = -2g for g. -3 Solve -3d = 9, -355l = -358l - 5d + 6 for l. 7 Solve 4a - 474 = -5f - 434, 4a = 3f + 8 for f. 4 Solve 4j + 99b - 97b = 0, 5j - b - 6 = 4j for j. 2 Solve d - 9 = t + t, -117t + 115t - 30 = -4d for t. -1 Solve -4k + 5p - 25 = 10p, 16k = 3p - 77 for k. -5 Solve -21q + 4k + 4 = -19q, 4q = -23k - 85 for q. -4 Solve -o - 160p = -157p + 9, 4o - 4p - 12 = 0 for o. 0 Solve 0 = -5k + 5q - 6 - 19, -22 + 16 = -6q for k. -4 Solve 2t + 67 = 2w + 63, -19 = -2w - 3t for w. 5 Solve 4t = 4q - 20, 0 = 8t - 10t + 3q - 15 for t. 0 Solve 3x = -128 + 143, -4d - 15 = 5x for d. -10 Solve 5k - 5r + 5 = 0, 5k - 7r - 47 = -62 for k. 4 Solve 4i - 1016q + 1017q = 12, -i = -3q - 16 for i. 4 Solve	{ "pile_set_name": "DM Mathematics" }
d = -5b + 18, -7 + 4 = -d. Let w = -3 - -2. Let j(m) = -2m*2 + m + 2. Let o be j(w). Sort o, 1, b. o, 1, b Let o be ((-2)/(-4)-1)/(-1). Let n = -20 - -9. Let u = n - -6. Sort 1, o, u. u, o, 1 Suppose 0 = 2m - 4, -4y - 5m + 2 = -2y. Let z = -173 + 176. Put -5, z, y in ascending order. -5, y, z Let x = 31 + -33.1. Let r = -0.9 + x. Put -0.2, r, 0.4 in ascending order. r, -0.2, 0.4 Suppose 0 = h - 4, z = 3h - 7 - 2. Let x be 84/(-16) + (-2)/(-8). Sort x, 1, z in ascending order. x, 1, z Let g = -4.8 + 4.5. Sort -0.5, g, -0.8 in ascending order. -0.8, -0.5, g Let d = 2 - 1.9. Sort 5, d, 0. 0, d, 5 Suppose 5u - 5 = 3l, 0l - 4l - 26 = 3u. Let k be 10/4 + u/1. Let v = -12 - -11.9. Put -5, v, k in descending order. k, v, -5 Suppose 4 - 14 = -5l. Let a be l/8 - 19/(-4). Put 0.3, -4, a in descending order. a, 0.3, -4 Let m be (-4)/6(-4 - 2). Sort 3, m, 0 in descending order. m, 3, 0 Suppose -6 = -3o - 5y, 5o - y = -6y + 10. Sort -4, -3, -1, o in increasing order. -4, -3, -1, o Let o be 4((-10)/8 - -1). Suppose -3t + 0 = -6. Suppose -tm = -5m. Sort o, 5, m in descending order. 5, m, o Let t(o) = -2o - 1. Let i be t(-6). Let w = -15 + i. Let q(m) = m3 + 5m*2 + 5m + 4. Let y be q(w). Put y, 3, -1 in increasing order. -1, y, 3 Suppose 4n + 41 = -5w, -3n = 2w - 5n + 2. Let z = -13 - -13. Sort w, 4, z in descending order. 4, z, w Suppose 0n + 17 = 3i - 2n, 2i - 12 = 2n. Sort -3, 2, i in descending order. i, 2, -3 Suppose 2i - 4r + 2 = r, 0 = i - 5r + 1. Let m = -10 + 12. Put i, m, -2 in decreasing order. m, i, -2 Let y = 0.04 + -2.04. Suppose -5m + 14 = -2v, 3m + 2 = -2v - 2v. Suppose -7l + ml + 20 = 0. Sort l, y, -5 in ascending order. -5, y, l Let u = 0.05 - 0.05. Let p = u + -0.5. Let t = 4.2 + -4. Put 1/2, p, t in decreasing order. 1/2, t, p Let q = -19 - -23. Let m = q + -3. Sort 3, 2/5, m in decreasing order. 3, m, 2/5 Suppose 11 = 2i + 3. Suppose -4l - 2o + o = 42, 0 = 5o + 10. Let g be (-4)/l + (-21)/15. Put g, 2, i in descending order. i, 2, g Let t(k) = k*3 + 7k*2 + 3k - 5. Let l be t(-6). Let b = l - 16. Sort 3, 5, b. b, 3, 5 Let a be (3/2 - 2)1. Let m = a - -1/4. Put -0.4, 2/21, m in descending order. 2/21, m, -0.4 Let p = -92 + 2207/24. Let w = -7/24 + p. Let z be 11 + -14 + (-5)/(-2). Sort 0.4, w, z in decreasing order. 0.4, w, z Let g = 53.5 - 53. Sort -5, 4, g in decreasing order. 4, g, -5 Let t = 320/1169 - -2/167. Put -3, t, -4 in descending order. t, -3, -4 Let i = 69 + -69.1. Put i, 1, -38 in decreasing order. 1, i, -38 Let m be 69/(-195) - (8/10 + -1). Sort m, -0.2, 5 in ascending order. -0.2, m, 5 Let v = 11 + 2. Suppose 3k = 4f - 11, v = -2f + 7f - 4k. Sort f, -4, -2 in descending order. f, -2, -4 Suppose 8 = -4m - 0m. Let z be (m + 7/3)9. Sort -5, z, -3 in decreasing order. z, -3, -5 Let k be -2 + (-6 + 0)-1. Let x be -1 - 2 - (4 + -7). Let p be 46/(-8) - (-3)/4. Put k, p, x in ascending order. p, x, k Let y = -25 + 22. Sort 2, -2/23, y in descending order. 2, -2/23, y Let o = 209/4 - 52. Let l = 0.07 + 0.23. Put l, -5, o in ascending order. -5, o, l Let k be 3/3-10. Let x(n) = -n*2 + 7n + 1. Let a be x(7). Sort a, 4, k in ascending order. k, a, 4 Suppose 5s - 9 = 16, -5s = g - 22. Let r = -0.01 + 3.01. Put 2, g, r in increasing order. g, 2, r Suppose 3f - 8 = -k, 7 = k - 2f + 14. Let n(y) = -y + 1. Let x be n(3). Put x, 6, k in decreasing order. 6, k, x Let s be 32/112 - 19/(-7). Put 1, s, -2 in decreasing order. s, 1, -2 Suppose -4 = -p - p. Suppose pt + 2t + 8 = 0. Sort 1, t, 5 in decreasing order. 5, 1, t Let w = 5.05 - 5. Let t = -0.35 - w. Let s = 3 - 3. Sort -2, t, s in decreasing order. s, t, -2 Suppose -4g + 20 = 0, -3x - 2g = -4g + 4. Put 0, 3, x in descending order. 3, x, 0 Let b = 2 - -2. Suppose 4u - 11 = -d, u - bd + 3d = 4. Let t = -1144/5 + 228. Sort u, t, 2 in ascending order. t, 2, u Let j = 0.4 - 0.15. Let t = 0 - -0.05. Let v = t - j. Put 4/5, v, 5 in decreasing order. 5, 4/5, v Let x = 0 - -3. Suppose xa + 2 + 1 = 0. Put -2, -3, a in ascending order. -3, -2, a Let k = -18 - -33. Let g = -12 + k. Sort -10, 0.1, g. -10, 0.1, g Let s = 55 - 49. Put s, 2/3, 4 in ascending order. 2/3, 4, s Suppose 5t - 9 = 2t, 2y = 5t - 9. Let l = 3.5 - 3. Let a = 54 + -56. Sort a, l, y in decreasing order. y, l, a Let a = 50 + -32. Sort 0, -0.4, a in descending order. a, 0, -0.4 Suppose 0 = -2o + 6o + 8. Sort -3, 2, 3, o in descending order. 3, 2, o, -3 Let s = 38 - 37. Put -3, 7, 0, s in decreasing order. 7, s, 0, -3 Suppose 2x + i - 3i = -2, 5i - 2 = 4x. Put 1, 2, x in increasing order. x, 1, 2 Let o = -9 - -18. Let j = 11 - o. Sort j, -5, -0.2 in descending order. j, -0.2, -5 Suppose -3b + 1 + 20 = 0. Put -5, 0, b in decreasing order. b, 0, -5 Let o = -6 - -8.6. Let b = o - -1.4. Let h = -51/2 + 27. Sort b, h, -0.4 in ascending order. -0.4, h, b Suppose 2j - 8 = -2j. Suppose -3m - 5 = 2s - 16, 4m - 2s = -4. Sort m, j, 4. m, j, 4 Suppose 3d + 5n - 35 = 0, -d - 3d + 4 = -4n. Let v be 24/(-108) - 508/(-18). Let s be d/(-10) + 10/v. Put 1, 3, s in descending order. 3, 1, s Let f = 5 + -10. Let u = -9 - f. Sort u, 4, -1/4 in ascending order. u, -1/4, 4 Let p = -5 - -8. Suppose pu + u + 8 = 0. Put 4, u, -3 in increasing order. -3, u, 4 Let u(g) = -g*3 + 4g*2 + 5g - 2. Let f be u(5). Suppose x - j + 3 = 0, 2 + 1 = -3j. Sort f, 4, x in increasing order. x, f, 4 Suppose 2f + 1 = s + 7, 5s + f = 25. Suppose -3 = -sr + 5. Let j = -255/4 + 64. Put r, j, 3 in ascending order. j, r, 3 Suppose -2b - 3b + 3w = 5, 0 = 5w - 25. Suppose 3h = 2f - bh - 39, 30 = 2f - 2h. Let i be (f/30)/(6/5). Put i, -1/8, 1/6 in decreasing order. i, 1/6, -1/8 Let o = -4 + 7. Let f be 2 - 1/(110/252). Let t = f - -1/11. Sort 1, t, o in decreasing order. o, 1, t Let l(a) = -a + 1. Suppose 18 = 3b - 0c + 5c, 0 = 2b - 3c + 7. Let j be l(b). Let k(f) = -f*2 - f + 3. Let s be k(0). Sort s, -1, j in descending order. s, j, -1 Suppose -3x - 12 = 0, -5x - 21 = -3i + 5. Suppose 0 = -ih + 8, 4y + 2h = -y + 13. Sort -5, y, 0. -5, 0, y Let y be (8/(-18))/((-82)/(-3)). Let z = y + 43/123. Let w(n) = n3 + 13n*2 + 8n - 49. Let d be w(-12). Put d, -0.2, z in ascending order. d, -0.2, z Suppose 5y + 14 + 1 = 0. Let k be (6/8)/(y/12). Sort -4, 3, k in descending order. 3, k, -4 Suppose 2f = 5t + 5, 4 - 5 = 4t - f. Sort -5, t, 0, -4. -5, -4, 0, t Suppose 0 = -0y - 2y. Let a(k) = -k*3 - 4k*2 - 4k. Let t be a(-3). Sort 5, t, y in descending order. 5, t, y Suppose -4r = x - 7, r = 2x - 0x + 4. Suppose 4z - 56k + 54k = -10, 0 = z + 2k + 15. Sort z, 0, r in decreasing order. r, 0, z Let k = -17 + 21. Sort 1, k, -2 in descending order. k, 1, -2 Let f = 0.03 + -0.03. Let l(p) = 4p - 1. Let r be l(-7). Let o = 117/4 + r. Sort -4, o, f. -4, f, o Let l(w) = -3w2 + 13w - 8. Let p be l(3). Let h = 10 + 12. Suppose 2b + 0q + h = 4q, -4b + 11 = 3q. Put p, 0, b in descending order. p, 0, b Let k = 27 + -7. Suppose 6q - q = k. Put q, 3, 5 in descending order. 5, q, 3 Let u(y) = 2y + 5. Let g be u(-7). Let p be -1 - ((-6)/g + -1). Put p, -4, -5 in ascending order. -5, -4, p Suppose 0 = -10n + 5n + 2a + 21, -4a = 12. Let d be n(1 + (-16)/12). Sort -3, d, 0 in decreasing order. 0, d, -3 Let n = 83 + -327/4. Put 1/4, 4, n in decreasing order. 4, n, 1/4 Let y = -34 - -239/7. Let f = -2.9 + 1.8. Let n = f - -1. Put n, 2, y in decreasing order. 2, y, n Let r = -11/6 - -7/3. Sort -1/2, r, -0.3 in ascending order. -1/2, -0.3, r Let o(c) = -2c. Let d(n) = -n2 + 5n + 4. Let r be d(6). Let y be o(r). Suppose 2z + 7q + 10 = 4q, -5z = -3q - 17. Sort z, y, 0 in increasing order. 0, z, y Let h be 25/9 + (-2)/(-9). Let q = h + -8. Sort -1/5, q, 0 in ascending order. q, -1/5, 0 Let p(q) = q3 - 10q*2 - 9q - 19. Let f be p(11). Put 8, -1, f in increasing order. -1, f, 8 Suppose y = -3y + 2c - 24, 3c = -3y - 9. Let q = y + 2. Let a be (8/(-6))/((-2)/6). Put 0, q, a in ascending order. q, 0, a Let f = 166.1 - 166. Sort 4/7, -3, f in increasing order. -3, f, 4/7 Let z be (12)/(30/(-6)). Let p = 0.8 - 4.8. Put -3, z, p in decreasing order. z, -3, p Suppose -3g - 14 = b - 0*g, g + 6 = -b. Sort -1/5, -7, b, -3 in decreasing order.	{ "pile_set_name": "DM Mathematics" }
16. Let q be w(7). Let d = q - -9. Which is the closest to d? (a) 0 (b) i (c) 2 a Let h = -17 - -103/6. Let n = -725/1659 + 2/237. What is the closest to 3 in -5, h, n? h Let q = -0.16 + 1.36. Let h = 0.2 - q. Which is the closest to h? (a) -0.5 (b) 4 (c) 0 a Let j = -13 + 15. What is the closest to -2/5 in j, -3, 0.4? 0.4 Let o = -98 + 98.2. Let i = -0.42 - -0.02. What is the closest to 1 in i, o, 3? o Let h be ((-64)/20)/(2/(-5)). Let d = -3 + h. Which is the closest to 1? (a) 0.2 (b) 2 (c) d a Let v = 8 - 9. What is the nearest to 0 in -1/3, v, 0.2? 0.2 Let s be (7/42)/((-2)/6). Which is the closest to s? (a) 3 (b) -5/2 (c) 5 b Let w = -4.24 - -0.24. Let k = -1 + w. Let c = 0.9 + -0.6. What is the nearest to 0.2 in k, c, -1? c Let c = 3 + -3.3. Let j = 12 - 11. What is the nearest to 0 in j, c, 0.4? c Let o = -63/2 - -31. Let p = -232/77 + 30/11. Let g = 179 + -1609/9. What is the closest to p in g, o, -3? o Let d = 4.4 - 32.4. Let j = 24 + d. Which is the closest to -4? (a) 2/13 (b) j (c) -0.5 b Let f be 15/18 - (-4)/(-6). Let x be (-10)/(-44)(-48)/(-60). What is the nearest to -1/4 in 4/5, x, f? f Suppose -6g = -g. Let o = g + -4. What is the closest to -4 in 1/9, 0.2, o? o Let g be ((0 + 0)/(-1 + -1))/2. Let s = -0.2 - 0.8. Which is the closest to g? (a) 5 (b) s (c) 2/5 c Suppose -5h + 19 = 4. Which is the nearest to 2/3? (a) -1 (b) h (c) 1 c Let o = 0.864 + -1.064. Let x be (-3)/(15/4) - -1. Which is the nearest to o? (a) x (b) 3 (c) -2 a Let a = -46.9 - -45. Let s = -0.1 + a. Let p = s + 2.1. What is the closest to p in -0.2, 5, 0.1? 0.1 Let r = -0.06 + 4.06. Let w = -9 - -10. Which is the nearest to -2? (a) w (b) r (c) 0.3 c Let o = -319.16 - -314. Let q = -0.16 - o. What is the nearest to 0 in -3, 0.5, q? 0.5 Suppose -6 = -4a - 2. Let n = -132/245 + -3/49. Let v = 0 + 0.1. What is the nearest to v in -4, n, a? n Let o = 28 + -29.3. Let f = -6.3 - o. Let h = f + 5. Which is the nearest to 0? (a) 1/4 (b) 3/7 (c) h c Let f = -2.13 + 0.13. Which is the closest to -1? (a) f (b) -5 (c) -1 c Let d be 2/(-2)(-22)/33. What is the nearest to d in 0.5, -8, 3/2? 0.5 Let m = -59/168 + 1/56. Which is the nearest to -1? (a) m (b) -4 (c) -3 a Let w = 0.84 + -0.61. What is the closest to 2/5 in 1, w, -5? w Let s = 1.63 - 1.66. Which is the nearest to 0? (a) s (b) -3 (c) 1/8 a Let m = -1073/1302 + -2/217. What is the closest to -1 in 3, m, -1? -1 Let a be 2 + (8/(-4) - -3). Suppose 0 - 4 = 4t, 0 = 5c + at + 23. What is the closest to -0.7 in 2, 1/2, c? 1/2 Let n be (-5)/2(-7)/175. Which is the closest to 1? (a) n (b) -2/7 (c) -0.4 a Let z be (-76)/18 - 2/(-9). Let q be (-1)/z + 2/(-4). Let k be 6/15 - (-9)/(-10). Which is the closest to 1? (a) k (b) -0.1 (c) q b Let v = 3 + -2.8. Let y = 60 - 64. What is the nearest to y in 2/3, -0.1, v? -0.1 Let r = -8 - -7.5. Let o = 12 + -7. Let p = -2 + 2.5. What is the nearest to 1 in p, r, o? p Let w(v) = 8v - 7. Let y(q) = -15q + 13. Let j(t) = -11w(t) - 6y(t). Let c be j(1). Let r be (16/(-15) + c)-3. What is the closest to 2/3 in 1/3, -3, r? 1/3 Let k = -2.2 - -1.5. Let x = 2.7 + k. Suppose 3z = 3s - z - 20, -5z = 5s + 25. Which is the closest to x? (a) s (b) -0.1 (c) -1/11 a Let l = 13 - 12. What is the nearest to l in 1/4, -2/11, -5/2? 1/4 Let v(d) = d*2 - 5d - 2. Let s be v(5). Let q(i) = -i*2 - 3i. Let p be q(s). Which is the nearest to 1? (a) p (b) -1/5 (c) -3 a Let u = 0.07 - 0.27. Let q be 12/(-9)1/(-2). Let b = 301 + -2411/8. What is the closest to u in 2, q, b? b Let f be 0 - (4 - (2 + -2)). Let j be (f1/(-2))/(-2). Let a = 5.5 + -6. What is the nearest to j in a, -4, 1/7? a Let g = 28 - 28.4. Let m = -4 + 9. What is the closest to -2 in m, 1/2, g? g Let k = 65 + -64.8. What is the closest to -1 in 0.5, k, -0.5? -0.5 Let j = 14 - 100/7. Let o = 63 + -59. Which is the nearest to 0? (a) 5 (b) o (c) j c Let i = -16 - -15.7. What is the nearest to -1 in 2/5, i, 2? i Let h be 58/(-14) + (-7)/(-49). Which is the closest to -2? (a) 4 (b) 1/6 (c) h c Let s = 11.01 + -11. Let r = -0.09 - s. What is the closest to -1 in 2/11, -0.5, r? -0.5 Let q = -0.21 + -0.09. What is the nearest to 1/3 in -2/5, q, -0.1? -0.1 Let o be 17/8 + (-8)/64. Which is the closest to -0.1? (a) 1/3 (b) o (c) -3/2 a Let w be 55/(-198) + (-2)/9. Which is the closest to -0.1? (a) w (b) -4 (c) 2 a Let g = 7 - 7.4. Which is the closest to 0? (a) g (b) -18 (c) -4 a Let q = 2.76 - -0.24. Which is the nearest to q? (a) 3 (b) 1 (c) -5 a Let x = -9 - -16. Let l = -6.7 + x. Let f(d) = d*3 - 14d*2 + 16d - 36. Let v be f(13). Which is the nearest to l? (a) v (b) -0.5 (c) -3 b Let p = 4 - -2. Let h(t) = t*3 - 6t2 - t + 4. Let i be h(p). Which is the closest to -2? (a) -4 (b) i (c) 4 b Let t = 0.04 - -0.16. What is the nearest to t in -3, 0.1, -2/3? 0.1 Let x = -0.4 + 0.6. Let p = 2.6 - -0.4. Let h = -9.7 - -10. What is the nearest to x in h, -1/8, p? h Let p(i) = -i3 - 12i2 - 11i. Let n be p(-11). What is the nearest to n in -2, 5, 0.01? 0.01 Let x = 1.64 + -1.64. Which is the nearest to 1? (a) -4 (b) x (c) 5 b Let w = -2 - -2. Let d = -36 - -35. Which is the closest to w? (a) d (b) -0.3 (c) 2 b Let h = -1011/11 - -92. Let j = -15 + 7. Let o = j + 7. Which is the nearest to o? (a) h (b) 0.2 (c) -2 c Let o be 24/(-210)(-1 + (-14)/(-4)). What is the nearest to -0.1 in 3, o, 5? o Let x = -5 + 5. Let o = -0.3 + x. Which is the closest to -2/7? (a) o (b) -4 (c) -0.4 a Let c = 0.2 + -0.3. Let i(p) = -p2 + 8p - 11. Let l be i(5). Let r = 0.2 + -1.2. What is the nearest to c in r, 1/2, l? 1/2 Let v(q) = -q3 + q2 + 5. Let m be v(0). What is the closest to 1/4 in 15, 0.5, m? 0.5 Let o = -23 - -23. What is the nearest to 0 in 5, -1, o? o Let t = 0.3 + -0.8. Let o = -0.5 - 2.5. Let v = 6 + o. What is the closest to -2 in -3, t, v? -3 Let z = 8376673204/397 - 21099900. Let s = z + -3/794. Let b = s - 33. What is the nearest to 0 in 3, -4, b? b Let s be (-1 - -2)/((-5)/4). Let d = -643/5 + 129. Suppose 3 = -3i - 0. Which is the nearest to i? (a) d (b) 1/2 (c) s c Let k be (-2)/(-4) + 7/(-6). Let g = 11.3 + -9.3. What is the nearest to k in 1, g, -5/3? -5/3 Let r be 8/(-15)21/28. Let i = -355/117 + 28/9. Let d = -17/52 + i. What is the closest to -1 in 1/3, r, d? r Let d = -9 + 21. Suppose 2c - 5c - v = 10, -2c = 2v + d. What is the nearest to 2/7 in -0.5, c, -4? -0.5 Let c = 0 + -0.02. Let r = 0.02 + c. What is the nearest to -1/4 in r, 0.2, 2? r Let i = 0 + -0.2. Let a = i + 0.1. Let z = 0.14 - 0.24. What is the nearest to a in z, -5, 0.3? z Let j = -0.52 - 2.48. Which is the closest to -0.1? (a) -0.3 (b) -1 (c) j a Let k = 2.4 + 0.6. What is the nearest to -1 in 5, 0, k? 0 Let b = -289 + 291.91. Let r = b - -0.09. What is the closest to -3 in r, 2, 2/3? 2/3 Let r be 20/3 - (-1)/3. Let l be 2/r + (-613)/14. Let n = l - -787/18. Which is the nearest to -1/4? (a) 1 (b) n (c) 2/3 b Let k = -0.02 + -0.08. Let m = 0.6 + -0.3. What is the closest to 2/5 in 0.1, k, m? m Let k = 44/115 + 2/115. Which is the closest to 0? (a) 4 (b) k (c) 3 b Let t = -3 + 5. Suppose -tr = r - 12. Let m = 0.8 - 0.7. Which is the nearest to m? (a) r (b) -0.3 (c) -2/7 c Let u be -4 - 68/(2 + 2). Let d be (-14)/u(-9)/6. What is the closest to 1 in 0.5, d, -2/11? 0.5 Let o = -0.8 + 0.9. What is the nearest to o in -0.1, -0.3, 1? -0.1 Let l = 3.83 + 0.17. Let m = -2 - -3. Let x = m - 0.9. What is the closest to -2 in 5, x, l? x Let m = 51 + -105/2. Which is the nearest to -0.1? (a) m (b) -1 (c) 3/2 b Let m(g) = -g*2 + 4g - 1. Let t be m(3). Let o(u) = -u3 + u2 + 2u - 1. Let d be o(1). What is the closest to 0.2 in 0.3, t, d? 0.3 Let l = -0.01 - -0.06. Let o = -2.05 + l. Let q be 2/(-101/(-2)). What is the closest to 3 in 3, o, q? 3 Let o = 102 + -101.7. Which is the closest to 1/4? (a) o (b) -5 (c) -0.03 a Let k be (0 + 2 + 1)/4. Which is the nearest to -1/2? (a) k (b) 1/5 (c) -0.6 c Let t(f) = -f*2 - 10f + 2. Let p be t(-11). What is the closest to -1 in 1/6, 5, p? 1/6 Let w = 15308/7 - 2183. Let y = -121/35 + w. What is the nearest to y in -0.7, -2, -1/6? -1/6 Suppose -5 = f - 5t, 3t - 20 = 8f - 4f. Let q = 2 -	{ "pile_set_name": "DM Mathematics" }
x or d? d Let w be ((46608/(-63))/1)/2. Let c = 370 + w. Which is smaller: c or -1? -1 Let g be 6/(-4)(-8)/(-18). Let t(i) = -2i*3 - 2i*2 + 3i + 2. Let v be t(2). Let n be -8 - -5 - v/6. Which is smaller: n or g? g Let c(q) = -11q2 + 1. Let l be c(-1). Let s be (-7)/30 + (-4)/l. Which is smaller: -1 or s? -1 Let r = -1.41 - -1.31. Let t be 1(-1 + 0) + 19. Do t and r have the same value? False Suppose -5f = 2u + u + 18, -3f + 5u - 4 = 0. Let t(i) = -3i + 1. Let x be t(f). Suppose -2h + 7 = -w, x = -2h + 4h. Which is smaller: 2 or w? 2 Let v be 14/5 - 4/(-20). Let z be (-5)/2v/(-15). Suppose -5n = -4r + 20, -2r + 8 = -3r - 2n. Is r equal to z? False Let b = -3 - 2. Let x be (-3)/(b + 2) + -3. Is x > -1? False Suppose -10d + 19 - 29 = 0. Let z(m) = m - 2. Let x be z(3). Let c be x - 1 - (-3)/(-12). Is c > d? True Let s be (-2)/(-2) + (-18)/(-3). Are 7 and s equal? True Let p = -17/30 + 1/15. Let b = 5 + -7. Which is smaller: p or b? b Let d = -51.3 - -49. Let o = d + 2. Let w = o + 0.4. Which is smaller: -1 or w? -1 Suppose 3r - 12 = 2r. Suppose 0 = 2v - 6v + r. Is v greater than 1? True Let b(u) = -u + 1. Let q be b(1). Suppose q = -5z + 3 + 2. Let d be (z/(-3))/(10/12). Which is greater: 2 or d? 2 Let q = -0.4 - -1.4. Let v = q - 1. Let c = 2 - 1.9. Which is smaller: v or c? v Let l(j) = 3j3 - j. Let r be l(1). Is r bigger than 2? False Suppose 0 = 3o + 2o - 25. Is o at most 2/11? False Let u = -4.11 - -4. Let z = -0.11 - u. Is z != -0.08? True Let f be ((-3)/(-6))/(6/(-4)). Is 3/5 bigger than f? True Suppose 3r - f + 22 = 0, -3r + f = 2r + 34. Suppose d - 10 = 2g, 2g + 2g - 4d = -20. Is g at least as big as r? True Let j be -3 + 1/((-1)/(-8)). Let x = j + -6. Is -2/9 smaller than x? False Let w = 17 - 29. Let n be (-30)/20(-2)/w. Are n and 2/43 non-equal? True Let w = 143.03 - 141. Let r = w + -0.03. Which is smaller: r or -0.7? -0.7 Let u(p) = p + 4. Let w(q) = -1. Let s(i) = -u(i) - 4w(i). Let y be s(2). Let r = y + 7/3. Is 3 at least r? True Suppose 0d + d + 23 = -5h, 4d + 4 = 2h. Let r be ((-1)/(-7))/(2/h). Which is smaller: r or -5? -5 Let h = 2/51 + -89/102. Let x = -0.2 + 0.1. Which is greater: h or x? x Let l = -2.12 - -2. Let y = l - -0.02. Let h = 0 + y. Do 1 and h have the same value? False Suppose -3v - r - 5 = 0, -2v - 2r - 3 = -r. Let b be (5 - (v - -1)) + -2. Which is greater: 3 or b? b Let t(q) be the third derivative of -q6/120 - q5/30 - q3/3 - q2. Let p be t(-2). Let r = -0.03 + 0.03. Is p less than or equal to r? True Let y = -0.06 - -0.16. Is y > 1? False Suppose -s - 2l + 5 = 0, -s - 2l = -5l + 15. Is s equal to -8? False Let c = 17 - 3. Let p = 15 - c. Is p not equal to 5? True Let c be 2 - ((-14)/(-49))/(3/7). Which is smaller: c or 1? 1 Let w be (-39)/18 + (-4)/(-6). Let j = 3.2 + -3. Let s = -0.1 + j. Which is smaller: s or w? w Let a = 61 + -195. Is a greater than or equal to -134? True Let d be 83/6 + -7. Are d and -1 non-equal? True Let b = -316 - -7266/23. Is -0.1 greater than b? False Suppose -5v - 23 = 2, 4y + 3 = -3v. Suppose 0 = -4n + yn. Let x be n/(3 + 0 + -1). Is x not equal to 3/4? True Let q = -6 - -10. Suppose -qx + 3y = 4y - 14, -y = -2. Is x greater than 3? False Suppose 0 = -5m + 2m - 9. Suppose 3s - 3b = -0s - 18, 2s = -b. Which is smaller: s or m? m Suppose 2b + 3 = -b. Let v = b - -3. Which is smaller: -1 or v? -1 Let q(y) = y - 3. Let a be q(1). Is a greater than -3? True Suppose 6 = -4l + 2. Is -6 <= l? True Let d(r) = r3 + 4r*2 + r + 5. Let j be d(-4). Which is smaller: j or 1/6? 1/6 Let l(q) = 3q - 23. Let o be l(7). Is -2 != o? False Suppose -4u = 2 + 14. Is u equal to 0.1? False Let t = -152 + 2566/17. Which is smaller: t or -1? t Let z = -104 + 105. Which is smaller: 19 or z? z Suppose -4i = -4l + i + 68, 2l - 2i - 32 = 0. Let k be (1/(-3))/((-44)/l). Is 1/3 >= k? True Let n = 195.2 + -195. Which is smaller: 0.074 or n? 0.074 Let z(u) = 2u*3 - 3u*2 - u + 2. Let b be z(2). Let i be 1(-2 - (-3 + b)). Is -4 < i? True Let f be (-1)/4 - (-1)/(-4). Let i = -6 - -12. Let t = i + -6. Is t <= f? False Let p = -82 - -82. Which is bigger: p or -1/65? p Let i be (1 - 2)/(5 - 6). Suppose i + 2 = -3d. Which is bigger: d or -1/5? -1/5 Let i(b) = -8b + 1. Let f(z) = 4z - 1. Let a(k) = -7f(k) - 4i(k). Let u be a(-2). Let v = u + 1. Is 0.2 less than v? False Let p = 4291834 - 90108166/21. Let i = 968 - p. Let a = -2/3 - i. Which is smaller: a or 1? a Suppose -15 = -z - 4k, 0 = z + z - 4k + 18. Which is greater: 2/105 or z? 2/105 Let t = 1/12 + 7/12. Which is smaller: t or 2? t Let h(j) = 3 - j + 0 + 4 + 0. Let d be h(13). Which is smaller: d or -8? -8 Let t be (-7)/3 - (-3)/((-54)/12). Which is bigger: 5 or t? 5 Let f(x) = -x3 + x2. Let j be f(1). Let p = j + -2. Is p >= -1/2? False Suppose 0 = -n - 3n - 5u - 3, 3u + 9 = 0. Let h = -39 - -42. Is n less than or equal to h? True Let q be 4 + 2/(3 + -1). Let x = q + -5. Does x = 0? True Let j be 3/(-4) + 132/432. Is j < 0? True Let c = -26/49 + 12/49. Which is smaller: 0 or c? c Let f = 7 + -7. Let c be f - -2 - (-3)/(-3). Which is smaller: 3 or c? c Suppose -4v = g - 2, g - 2 = -2v - 0. Suppose 0 = 5k - vk + 20. Let n be (-1)/k + (-22)/24. Are 0 and n unequal? True Let g = 8 + -13. Let k be g/(-2)(8 + -6). Which is smaller: k or 4? 4 Let w = -36 - -38. Is 8 <= w? False Let t be 1116/1496 - (-241)/119. Suppose -s - 2 = -3s. Does t = s? False Let c = 9 - -7. Let h = c + -10. Let k = h - 5.6. Is 2/5 at most as big as k? True Let t = 9 - 5. Let z(a) = a - 1. Let v be z(3). Is t at least v? True Let i = -7 - -15. Let h = i + -5. Is -1 greater than or equal to h? False Let y = 0.2 + 9.8. Is y > 1? True Let q = 2 - 4. Let d = q + 3. Suppose 0 = 4r + 5y, 0y + 4y = -2r. Which is smaller: r or d? r Suppose 5d + 24 = 3d. Let s be -3 - 64/d - 2. Which is bigger: 0 or s? s Suppose 5t + 4k - 180 = -0t, 10 = 2k. Suppose 0g = -2v - 4g + t, -4v = -3g - 9. Is 5 <= v? True Let g = 220 - 232.1. Let f = g + 12. Which is greater: f or -5/7? f Suppose 25 = 5v, 0 = 3o - 4o + 3v - 14. Let u = 0 + o. Let l be u - (0 - (-2 + 0)). Which is greater: l or -2/11? -2/11 Let h be (-2)/8 - 18/24. Let q be (1/(-2))/((-8)/(-288)). Let c be (21/28)/(q/16). Which is smaller: c or h? h Let a(h) = h2 + 20h + 20. Let r be a(-18). Which is smaller: -20 or r? -20 Suppose 5x = 13x. Which is smaller: 1/5 or x? x Suppose 4z + 2 = -6. Let c(g) = -3g - 2. Let p be c(z). Let j be (5 - p)/(1/2). Which is bigger: j or 0? j Let d be -15(12/20 - 1). Which is smaller: 4 or d? 4 Suppose 11v - 10v = -1. Which is smaller: 3/28 or v? v Let j be (-12)/(-10)30/(-42). Which is smaller: j or 0? j Suppose 0 = -4c + 3v + 642, 0c - 2c + 330 = 3v. Let d = -2108/13 + c. Suppose -5i + u = 0, 4i - 2i + u - 7 = 0. Are d and i equal? False Suppose -3u - b + 5b = -23, -4u = 4b + 16. Let i(p) = -7p + p + 5p + 1 - 7p3 + p2. Let f be i(u). Which is bigger: -7 or f? f Let r(o) = o2 + 4o - 5. Suppose -3u - 11 = 4. Let a be r(u). Let p = 0 - -1. Is p <= a? False Let f = -9 - -13/3. Which is smaller: f or -4? f Let k be 451/495 - 1/(-5). Is k > 0? True Let z = -1 + 0. Which is bigger: z or 2/5? 2/5 Let f = 0.24 + 0.06. Which is bigger: f or 1/5? f Let a = -11 - -6. Let b = a - -6. Is -3/5 not equal to b? True Let b = 1 + 1. Suppose 4c = 3c + 5l - b, 4c - 2l = -8. Is c less than 1/4? True Let u be 6/(-5) - 5/(-25). Let y = u - -1. Is 2 > y? True Let k = 9 + -8.6. Let q = 0 + k. Is -2/11 < q? True Suppose 2 = -n - 4s, 5s + 85 = -0n - 5n. Let p be (0 - 1) + (-18)/n. Let q(h) = -h*2 + 11h - 9. Let c be q(10). Which is smaller: p or c? p Suppose -5l = -5v + 50, 15 + 26 = 5v - 2l. Suppose -v = -4q - 11. Is -10/13 != q? True Let t(o) = -4o*2 - 4o + 1. Let g(z) = 5z2 + 4z - 1. Let y(a) = -5g(a) - 6t(a). Let l be y(4). Is 1/7 bigger than l? True Let m be (-2 - -2)2/4. Which is greater: 20 or m? 20 Let d(b) = b3 + 2b*2 - 2b + 1. Let k be d(-2). Suppose 5l - 2s - k = 0, -3l + 14 + 0 = s. Which is smaller: 4 or l? l Suppose -3l = -16 - 8. Is l less than 8? False Let u = -14.26 + 0.26. Let n = -14.1 - u. Which is greater: n or -18? n Let o = -2.87	{ "pile_set_name": "DM Mathematics" }
base 2, what is 1111100 - -110111110011000001? 110111110100111101 In base 16, what is -c8 - ae19b? -ae263 In base 6, what is 1510445 + -2111? 1504334 In base 8, what is 775362413 + -1? 775362412 In base 3, what is 11 + 1000022010010121? 1000022010010202 In base 2, what is 11 - 1011100110101000101000110? -1011100110101000101000011 In base 11, what is 179 + -5867? -5699 In base 16, what is 102c - -111? 113d In base 6, what is 1453 - -23522323? 23524220 In base 9, what is -2827138 - 10? -2827148 In base 15, what is 4d - 39ce18? -39cdba In base 4, what is 1031321132 + 12? 1031321210 In base 5, what is -2042333312 + 42? -2042333220 In base 4, what is -23101330302 + -13? -23101330321 In base 16, what is -1a451040 - 1? -1a451041 In base 6, what is 2035550035 + -20? 2035550015 In base 9, what is 5 + 10720313? 10720318 In base 10, what is 1295835 + -1? 1295834 In base 4, what is 12102123023 - -22? 12102123111 In base 6, what is -425 - -350543? 350114 In base 11, what is -14 - -789a87? 789a73 In base 3, what is -12020212012001 + -11101? -12020212100102 In base 3, what is 10 + 100102201001222? 100102201002002 In base 16, what is 0 - 73567? -73567 In base 13, what is -8aa140 + 2? -8aa13b In base 8, what is 4054540 + -7? 4054531 In base 7, what is 13123234 + 0? 13123234 In base 7, what is 2616 + -33325? -30406 In base 11, what is -21408795 - 6? -214087a0 In base 4, what is -3033121310200 - 0? -3033121310200 In base 9, what is -157133 - 1028? -158162 In base 10, what is 67090928 + 5? 67090933 In base 15, what is 156db + -12be? 1441c In base 12, what is -3a0 - 39b9b5? -3a0195 In base 6, what is 1411202320 - -5? 1411202325 In base 8, what is 4 - 75473217? -75473213 In base 14, what is 4b932 + 61? 4b993 In base 6, what is 3244035031 + -3? 3244035024 In base 16, what is -4 + -5444a5? -5444a9 In base 2, what is -101001001101110000100 - -1? -101001001101110000011 In base 7, what is -1 - -153355651? 153355650 In base 13, what is -1163833 - 4? -1163837 In base 12, what is 359b + -1034? 2567 In base 14, what is 24 + 30079c? 3007c2 In base 16, what is -9c7ff3 - 2e? -9c8021 In base 2, what is -10001000011101101000001010 - -10? -10001000011101101000001000 In base 9, what is -2812100 + -7? -2812107 In base 7, what is -11435 - 4514? -16252 In base 12, what is 52052389 + 4? 52052391 In base 13, what is 1761 + -1747? 17 In base 10, what is -11 + 8442979? 8442968 In base 15, what is -244e2 + 1d4? -2430d In base 14, what is 3 + -209021? -20901c In base 15, what is -14a - -5c034? 5bdd9 In base 12, what is 4 + 1b450066? 1b45006a In base 4, what is -11032030 + -10202? -11102232 In base 3, what is -2210220202221110120 + 1? -2210220202221110112 In base 5, what is -12400133133 - 2? -12400133140 In base 3, what is 122001011 + 101022121? 1000100202 In base 12, what is 7699 - -2009? 96a6 In base 10, what is 5260 + 39463? 44723 In base 8, what is 5 + -20313424? -20313417 In base 5, what is 12420 + 1444234? 2012204 In base 7, what is 1442216 - 1512? 1440404 In base 2, what is -100 - -1100011001110011000000011101? 1100011001110011000000011001 In base 12, what is -6867123 - -b? -6867114 In base 4, what is 13213112322130 + -11? 13213112322113 In base 9, what is 15 + -40722603? -40722577 In base 16, what is 18 + -18cd6? -18cbe In base 14, what is 17 + 2a440? 2a457 In base 6, what is -1 + -4513013? -4513014 In base 13, what is 83b5 + -2c8? 80ba In base 4, what is -1123221033 + -103332? -1123331031 In base 12, what is 144487a8 - -5? 144487b1 In base 15, what is 32 + -e5185? -e5153 In base 8, what is -6005 - -452534? 444527 In base 11, what is -4256 + -40117? -44372 In base 6, what is 44333 - -212204? 300541 In base 8, what is -142166 - 3421? -145607 In base 14, what is 6747 + -290? 6497 In base 2, what is -10011011101100011001001 + 110001? -10011011101100010011000 In base 13, what is -24ba - -10b7? -1403 In base 13, what is -208323 + 15? -20830b In base 2, what is -111110010100 + 110100100100? -1001110000 In base 3, what is 2102022002 + -110002? 2101212000 In base 15, what is d + 44676? 44684 In base 13, what is 56c8 - -8b8? 62b3 In base 4, what is 20312 + -2013? 12233 In base 3, what is -1121211222 - -10211111? -1111000111 In base 16, what is 1262b - -17e? 127a9 In base 2, what is -11000101011001110100 + -1110110? -11000101011011101010 In base 5, what is -13123 + 12012401? 11444223 In base 11, what is 5 - 580740? -580736 In base 9, what is 3563150833 - -5? 3563150838 In base 14, what is 72 + -17b5473? -17b5401 In base 6, what is -100213113 + 52? -100213021 In base 2, what is 10 + -100001110011010110111000010? -100001110011010110111000000 In base 7, what is -2622553 + 1344? -2621206 In base 4, what is 0 - 3220132233312? -3220132233312 In base 10, what is -2 + 27318455? 27318453 In base 4, what is 3323320 - 233231? 3030023 In base 7, what is -3054 - 62454? -65541 In base 7, what is -21205 + -51344? -102552 In base 9, what is -4836743 + 3? -4836740 In base 7, what is -10 + -3553553? -3553563 In base 4, what is -333222301 - -211? -333222030 In base 15, what is 0 + -5ee149? -5ee149 In base 3, what is 2021202 - -2100211210? 2110010112 In base 13, what is 6aa1 - -22c7? 9098 In base 3, what is 10101202220200100 + -1? 10101202220200022 In base 3, what is 22120 - -11111010202? 11111110022 In base 4, what is -3003312 + -3322000? -12331312 In base 7, what is 0 - -3301522435? 3301522435 In base 4, what is 1102 + 33332012212? 33332013320 In base 9, what is 486485 + -104? 486381 In base 16, what is -f090 + 224b? -ce45 In base 8, what is 276524 + 10727? 307453 In base 11, what is -12 + a9a15a? a9a148 In base 5, what is -21302314011 - 123? -21302314134 In base 16, what is 2e890b - -1? 2e890c In base 2, what is 11100100010010 + 101011111? 11101001110001 In base 8, what is -37 - 1560123? -1560162 In base 15, what is 9c35 + 1a5? 9dda In base 5, what is -2 - 30123341? -30123343 In base 12, what is 1baa1 + -217? 1b886 In base 7, what is 2240534 - -1332? 2242166 In base 3, what is -2001 - -112110122200? 112110120122 In base 12, what is -1 - 5a647461? -5a647462 In base 15, what is -3993191 + 5? -399318b In base 11, what is 87a6 - 30449? -22753 In base 12, what is 6734a - -44b? 67799 In base 6, what is -10135 - 105200? -115335 In base 5, what is 24112433 - -304? 24113242 In base 7, what is -1 + 530013352? 530013351 In base 10, what is 69 - 4366407? -4366338 In base 16, what is 2 - 4209d0? -4209ce In base 11, what is 173923 + -10? 173913 In base 9, what is -21813 - -4576? -16226 In base 8, what is -20751 + -237420? -260371 In base 14, what is -2 + -3c3c77? -3c3c79 In base 7, what is -133566205 - 5? -133566213 In base 6, what is -15430 - 54500? -114330 In base 15, what is -e5c2a + -e? -e5c39 In base 15, what is 468610b - 2? 4686109 In base 16, what is d5 + -7089? -6fb4 In base 13, what is b743cca + -8? b743cc2 In base 4, what is 1 + -21001003203? -21001003202 In base 8, what is -47 + 12006137? 12006070 In base 4, what is -30103 + -3220133102? -3220223211 In base 10, what is 1110490 - 112? 1110378 In base 10, what is -39 - -1680288? 1680249 In base 6, what is 211 + -445314041? -445313430 In base 7, what is 634565022 + 14? 634565036 In base 15, what is e4c44 - 40? e4c04 In base 9, what is 11320822 - -2? 11320824 In base 15, what is -1955b - -1228? -18333 In base 16, what is -3 + -f6453? -f6456 In base 11, what is -17 + -374a62? -374a79 In base 13, what is -5bb + 23b56? 23568 In base 10, what is 40865360 + -29? 40865331 In base 3, what is -2222211 + -10120002001? -10200001212 In base 4, what is 101013321 - -2200? 101022121 In base 9, what is 26312085 + -4? 26312081 In base 16, what is 4 - -1fa4bc6? 1fa4bca In base 15, what is -220a300 - 2? -220a302 In base 4, what is 12 + 10322322322? 10322323000 In base 14, what is 14 + -11ba86? -11ba72 In base 14, what is -b265 - 958? -bbbd In base 15, what is 4148 - 862? 37d6 In base 6, what is 53335 - 23? 53312 In base 5, what is -413323330 + 41? -413323234 In base 3, what is -100110 + -202101202210? -202102010020 In base 11, what is 5 - a84a64? -a84a5a In base 11, what is -622 - -11640? 11019 In base 3, what is -1211200101222210 + 121? -1211200101222012 In base 13, what is -3 + 2792b75? 2792b72 In base 4, what is -33221 - 11131112? -11230333 In base 9, what is 617002 + -8? 616	{ "pile_set_name": "DM Mathematics" }
lify ((j(1/3)/j)/(j(-2/37)j))(-3) assuming j is positive. j(179/37) Simplify (p/p(-34)p)/p*29((pp(-39)p)/pp)/(p/(p/p0)) assuming p is positive. p(-30) Simplify (s/s(-3))/s(-2)(ss(-1/17)s)(-30) assuming s is positive. s(-888/17) Simplify (((zzz*(-6))/zz*(-2/13)z)(1/4))(4/9) assuming z is positive. z(-6/13) Simplify j(-1/7)jjj14/j(j*0j)/j(-6) assuming j is positive. j(153/7) Simplify aa(1/16)a*(2/3)aaa/a*0aaa(-2/5) assuming a is positive. a(1519/240) Simplify (s/((s/(s/(s/(s*(-5)/s))))/ss))(-34)/(s(-4/13)ss/(s*1s)) assuming s is positive. s(2656/13) Simplify (h(-35)(h(-8/9)hhhhhh)/h)(4/15) assuming h is positive. h(-1112/135) Simplify (y/(y/y(1/4))y(3/2))/(((y/(y(3/4)y))/y)/y12) assuming y is positive. y(31/2) Simplify (u1u)*(-41/5)(u(1/4))(7/6) assuming u is positive. u*(-1933/120) Simplify ((((hh(-21))/h)/h)/(h/h(-13)))/(h(1/11))(-19) assuming h is positive. h(-377/11) Simplify (((w(-21)/w)/w7)(-10))(3/37) assuming w is positive. w(870/37) Simplify ((kkk/k*(-6/7)k)/((kkk*(-1/10))/k)kk8k/(kk(-3/5)))(-35) assuming k is positive. k(-949/2) Simplify (s/s(-3)s)/(ss(ss(-26)/ss)/s)(ss(-4/7))/s18 assuming s is positive. s*(80/7) Simplify (((d/(dd*6d))/d)/(d/d*(-2/7))d(-1/3)/(d/d(-6)))(1/29) assuming d is positive. d(-349/609) Simplify (u*(3/7)/uu)/(u(u/(u/((u/u(-9/4))/u)u)u)/u)u/u*17(u*(-16)u)/uu assuming u is positive. u(-919/28) Simplify ((m/m2)(-50)/(m(-2/7))(-2/23))(-1/6) assuming m is positive. m(-1341/161) Simplify (k8)(-11)/((k(-23)k)/((kkk/k*(8/5))/kkk)) assuming k is positive. k(-318/5) Simplify ((gg(-1/5))(-1/8)/(((gg/(g(-1/8)g))/g)/(g*(3/11)g)))(-1/36) assuming g is positive. g(-461/15840) Simplify (((kk(3/4))(-34))(-46))(-26) assuming k is positive. k(-71162) Simplify i16/i9ii(-3)i16 assuming i is positive. i21 Simplify ((a*0/a(aa(3/4)a)/a)/(a*(-5)/(aaaa(-5))))(-38) assuming a is positive. a(-285/2) Simplify (v2)*23/((v/(vv(-8)))/v(-1/12)) assuming v is positive. v*(455/12) Simplify ((oo*(-1)oo)(-34)(o(-2/3))(1/4))(-2/21) assuming o is positive. o(409/63) Simplify (((oo/(o/((o/(o/(o(-5/6)o)))/o)))/((oo(2/13))/oo))38)(-16/3) assuming o is positive. o(23408/117) Simplify o(-2/33)o10(ooo(1/5))(4/11) assuming o is positive. o(1772/165) Simplify (g(16/5)/g*24)/(ggg(-7)gg/((g/g34)/g)) assuming g is positive. g(-259/5) Simplify ((((oo/o*(3/5))/oo)/o*(1/4))/(o(o/o*8)/oo*(2/17)o))(-3/7) assuming o is positive. o(-7173/2380) Simplify (b/b(1/5))(-9/2)/(b(-1))(-1/2) assuming b is positive. b(-41/10) Simplify (b(-20)b(-2))/((bb(bb*(-1/14)bb)/b)/b)(-13) assuming b is positive. b(225/14) Simplify (((cc/(ccc*(-3/2)c))/cccc(1/6)c)(-44))(-28) assuming c is positive. c(9856/3) Simplify (j(-3/22)j(-2/5)/j)/(j(j/(((j*(1/9)/j)/j)/j))/j(j/j*16j)/j) assuming j is positive. j*(9479/990) Simplify ((nn(n/n(-32))/n)(-31/4))32 assuming n is positive. n(-8432) Simplify (q/(q/((q/((q/(q/(qq*(-37))q))/q))/q))q/q(2/19)q)(-6/25) assuming q is positive. q(-4548/475) Simplify z*(-7)z*34(z/(zz(-4)/z))(3/26) assuming z is positive. z(717/26) Simplify ((jj6)/j)(-12)(jj*(-3)j)(-2/5) assuming j is positive. j(-358/5) Simplify (q/(q/(q/(qq/(qq/(q*(-6/17)/q)q))))q/(q/q(-8)))(-3/26) assuming q is positive. q(237/442) Simplify ((z/(z/(z/(z/z(2/51)))))/(z(-2/7)z))/(z*(1/6)/((zz0)/z)) assuming z is positive. z(-601/714) Simplify (tt/((tt(t/t(2/3))/t)/t)t/(t(t/t10tt)/t))(-14) assuming t is positive. t(-406/3) Simplify oo*(-4)o*10(oo/o(-1/5)o)(-1/16) assuming o is positive. o(34/5) Simplify ((mm/m(-7))/(mm(m/(mmm(1/11))m)/mm)m(-8)/m(2/25))(19/2) assuming m is positive. m(-2584/275) Simplify q12/(q(-7/2)/q)(q(-2))(-17) assuming q is positive. q(101/2) Simplify ((d/d(-1/10)d*(-4/11)d)/((d/(d/(d/d(-2/19))))/(d/d(-2/31))))(10/11) assuming d is positive. d(109859/71269) Simplify (n(n/(n3n)n)/n)(-26)/((n(-2)/n)/(((n/(n(1/4)/n))/n)/n)) assuming n is positive. n(219/4) Simplify (r(2/7))27/(r(-2/7))23 assuming r is positive. r(100/7) Simplify (((ff/f*(-11)f)(-44))(-1/24))13 assuming f is positive. f(1001/3) Simplify (b*(-2/47)(b/(((b/b*17)/bb)/b))/b)/(b(1/5)/b(-2)) assuming b is positive. b(3468/235) Simplify (d(5/2)dd*(-1/33)dd)/(d7d)6 assuming d is positive. d(-2807/66) Simplify ((((zz1)/z)/z)(1/12)(z*3z)/((((z(z/(zz*(-1/2)z))/z)/z)/z)/z))(-18) assuming z is positive. z(-135) Simplify (m(((mm*(-7))/m)/mm)/mm/m5m)/(m4/m)(-40) assuming m is positive. m110 Simplify (c/c(-2/7)cc(-2/21))/((c14c)/ccc(-6/7)c) assuming c is positive. c(-272/21) Simplify p(-2/15)p(-14)p*(-2/5)p(-4/3) assuming p is positive. p(-238/15) Simplify ((o(-3/2)/o)/o)24/(o*13/oo)(-49) assuming o is positive. o553 Simplify (t*(3/14)t*8/tt)/((tt/(t(t/(t/(tt9/t)))/t)tt)/(t(t/(ttt*15))/tt)) assuming t is positive. t(-25/14) Simplify (i(-1/17)(i/(iii/(i31/i)ii)i)/i)/(((ii(-1/23))/i)/i(-2/85)) assuming i is positive. i(50754/1955) Simplify (v1/v)(-22)(v*(-1/2)/vv)(3/11) assuming v is positive. v(-3/22) Simplify (k*(1/2)k)/kk(-1)/k(kk(-7))/k(-2/5) assuming k is positive. k(-71/10) Simplify v(-1/17)v*(-17)(v(1/4))(-25) assuming v is positive. v*(-1585/68) Simplify (((oo/(o*25o)o)/o)/oooo(7/4)/o)/(o18)(4/11) assuming o is positive. o(-1267/44) Simplify (b*(8/3)/(bbb/b(-19)))13 assuming b is positive. b(-754/3) Simplify (s/s(-1/3))(1/7)(s/(s/(s/s*6)ss)s)/(s*9s) assuming s is positive. s*(-332/21) Simplify ((cc/(c/(c*(-1)cc)))/cc)/((c/c*5)/c)c(1/3)/(c/c(-6)) assuming c is positive. c(1/3) Simplify p(2/35)p/(p/(pp/(p/(ppp*7)))p)((p(-3)p)/pp)/(p(pp(-5)pp)/p) assuming p is positive. p(317/35) Simplify (((hh9)/h)/(h0/hhh))/(h1/(h/(h/((h(-2/23)/h)/h)))) assuming h is positive. h(113/23) Simplify (i(1/11)/((i/(i*(2/3)i))/i))/(i/i*(-2/7)i)(-1/13) assuming i is positive. i(5806/3003) Simplify r(-1/9)/r(-1)(rr*(-4)r)/rr(-3/8) assuming r is positive. r(-179/72) Simplify (n3)14((n/n(1/8))/n)(-40) assuming n is positive. n47 Simplify ((v/(v/v(3/5)v))/vv)(-11)/(v(-9))(-9) assuming v is positive. v(-383/5) Simplify (n*5n*(-1/8))/(nn*(-1/3)n)(1/2) assuming n is positive. n(97/24) Simplify (m19)(1/2)/(m*28m*7m) assuming m is positive. m*(-53/2) Simplify (yyy(-8)y)/(y*8y)(y(y*(-21)/yy)/y)/((y/(y/y0))/y) assuming y is positive. y(-34) Simplify p(4/3)/p(-17)(p(-21)/p)/(((p/(pp*(-1/13)ppp))/p)/p) assuming p is positive. p*(49/39) Simplify ((a(a/a*0)/aa*(-1/6))/(((aa/a*2)/aa)/((a/(a(-1/18)/a))/a)))(28/5) assuming a is positive. a*(476/45) Simplify ((qq(q(q(q(1/4)/qq)/qq)/q)/q)44(q(2/3))(-1/18))(3/8) assuming q is positive. q(334/9) Simplify ((i/i(4/9))/i)(4/7)/(iii*(-28)/iii(6/7)) assuming i is positive. i(224/9) Simplify (x(-16))35/(x/(x/(xx(18/5))))(-7) assuming x is positive. x*(-2639/5) Simplify (((i/(i/(i/(ii/(i*(-9)/i))ii)))/i)/(i/((i/(ii4))/i)))/(i1)(-15/7) assuming i is positive. i(-97/7) Simplify (h*(-1/17)h*(-26))/((hh/(h/h(-1/2)))/h)(-1/23) assuming h is positive. h(-20395/782) Simplify ((i/(i(-1/3)/ii))/(ii(-4)))/(i/(i/(i(-7/2)/i)))(-33) assuming i is positive. i(-865/6) Simplify ((g(g3g)/ggggg(-1))(-8))21 assuming g is positive. g(-1008) Simplify (t(-1))(-24)(t/(tt4))37 assuming t is positive. t(-124) Simplify (i(-1/5))*48(i/i*(-3/13))/(iii/i(-3/13)i) assuming i is positive. i(-63/5) Simplify (p(-2/3))*(-1/27)(p(-1/7)/p)(-1) assuming p is positive. p(662/567) Simplify ((t/t(3/5))/t**(2/13)	{ "pile_set_name": "DM Mathematics" }
late the remainder when 349 is divided by 114. 7 Calculate the remainder when 77 is divided by 39. 38 What is the remainder when 627 is divided by 30? 27 Calculate the remainder when 13 is divided by 4. 1 Calculate the remainder when 4450 is divided by 27. 22 Calculate the remainder when 4436 is divided by 185. 181 What is the remainder when 35 is divided by 16? 3 What is the remainder when 188 is divided by 27? 26 Calculate the remainder when 1985 is divided by 71. 68 What is the remainder when 197 is divided by 9? 8 Calculate the remainder when 941 is divided by 35. 31 Calculate the remainder when 14443 is divided by 27. 25 What is the remainder when 30461 is divided by 15? 11 What is the remainder when 922 is divided by 75? 22 What is the remainder when 4190 is divided by 190? 10 What is the remainder when 42 is divided by 25? 17 What is the remainder when 341 is divided by 335? 6 Calculate the remainder when 153 is divided by 33. 21 Calculate the remainder when 403 is divided by 170. 63 Calculate the remainder when 1942 is divided by 635. 37 Calculate the remainder when 404 is divided by 52. 40 Calculate the remainder when 298 is divided by 164. 134 Calculate the remainder when 662 is divided by 96. 86 Calculate the remainder when 445 is divided by 127. 64 What is the remainder when 118 is divided by 41? 36 What is the remainder when 226 is divided by 62? 40 What is the remainder when 517 is divided by 72? 13 Calculate the remainder when 1078 is divided by 247. 90 Calculate the remainder when 662 is divided by 133. 130 Calculate the remainder when 752 is divided by 13. 11 What is the remainder when 739 is divided by 3? 1 What is the remainder when 33 is divided by 25? 8 What is the remainder when 2703 is divided by 52? 51 What is the remainder when 27 is divided by 8? 3 What is the remainder when 1554 is divided by 68? 58 What is the remainder when 51 is divided by 30? 21 Calculate the remainder when 945 is divided by 932. 13 What is the remainder when 244 is divided by 92? 60 Calculate the remainder when 354 is divided by 51. 48 Calculate the remainder when 127 is divided by 35. 22 What is the remainder when 511 is divided by 1? 0 Calculate the remainder when 692 is divided by 7. 6 What is the remainder when 289 is divided by 29? 28 Calculate the remainder when 2070 is divided by 37. 35 Calculate the remainder when 1424 is divided by 40. 24 Calculate the remainder when 92 is divided by 11. 4 What is the remainder when 1159 is divided by 14? 11 What is the remainder when 3580 is divided by 35? 10 Calculate the remainder when 289 is divided by 4. 1 Calculate the remainder when 558 is divided by 33. 30 Calculate the remainder when 5563 is divided by 35. 33 Calculate the remainder when 268 is divided by 32. 12 Calculate the remainder when 218 is divided by 22. 20 Calculate the remainder when 261 is divided by 12. 9 What is the remainder when 1136 is divided by 565? 6 What is the remainder when 7032 is divided by 102? 96 Calculate the remainder when 5034 is divided by 48. 42 Calculate the remainder when 1795 is divided by 398. 203 What is the remainder when 112 is divided by 97? 15 Calculate the remainder when 520 is divided by 87. 85 Calculate the remainder when 2760 is divided by 551. 5 What is the remainder when 364 is divided by 76? 60 Calculate the remainder when 809 is divided by 29. 26 What is the remainder when 1481 is divided by 213? 203 What is the remainder when 1841 is divided by 41? 37 Calculate the remainder when 335 is divided by 22. 5 Calculate the remainder when 11101 is divided by 16. 13 What is the remainder when 86 is divided by 26? 8 What is the remainder when 1147 is divided by 96? 91 What is the remainder when 190 is divided by 58? 16 What is the remainder when 41 is divided by 22? 19 What is the remainder when 22502 is divided by 116? 114 What is the remainder when 1054 is divided by 132? 130 What is the remainder when 68 is divided by 19? 11 What is the remainder when 199 is divided by 88? 23 What is the remainder when 399 is divided by 4? 3 Calculate the remainder when 298 is divided by 25. 23 What is the remainder when 171 is divided by 84? 3 Calculate the remainder when 922 is divided by 413. 96 Calculate the remainder when 58 is divided by 40. 18 Calculate the remainder when 24 is divided by 16. 8 What is the remainder when 62 is divided by 16? 14 Calculate the remainder when 1337 is divided by 332. 9 What is the remainder when 2677 is divided by 20? 17 Calculate the remainder when 119 is divided by 12. 11 Calculate the remainder when 847 is divided by 61. 54 What is the remainder when 62 is divided by 39? 23 Calculate the remainder when 3115 is divided by 390. 385 What is the remainder when 2970 is divided by 185? 10 Calculate the remainder when 227 is divided by 36. 11 What is the remainder when 2761 is divided by 79? 75 Calculate the remainder when 267 is divided by 67. 66 What is the remainder when 3250 is divided by 231? 16 What is the remainder when 505 is divided by 417? 88 Calculate the remainder when 597 is divided by 151. 144 Calculate the remainder when 518 is divided by 52. 50 What is the remainder when 355 is divided by 37? 22 What is the remainder when 16 is divided by 12? 4 Calculate the remainder when 148 is divided by 37. 0 What is the remainder when 3922 is divided by 217? 16 Calculate the remainder when 2283 is divided by 9. 6 What is the remainder when 891 is divided by 15? 6 What is the remainder when 670 is divided by 42? 40 What is the remainder when 886 is divided by 5? 1 Calculate the remainder when 614 is divided by 17. 2 What is the remainder when 771 is divided by 193? 192 Calculate the remainder when 687 is divided by 10. 7 What is the remainder when 305 is divided by 76? 1 What is the remainder when 265 is divided by 68? 61 Calculate the remainder when 1100 is divided by 111. 101 What is the remainder when 388 is divided by 91? 24 Calculate the remainder when 1223 is divided by 303. 11 Calculate the remainder when 871 is divided by 101. 63 Calculate the remainder when 803 is divided by 35. 33 What is the remainder when 470 is divided by 233? 4 What is the remainder when 236 is divided by 46? 6 Calculate the remainder when 494 is divided by 100. 94 Calculate the remainder when 134 is divided by 79. 55 What is the remainder when 136 is divided by 58? 20 Calculate the remainder when 7035 is divided by 102. 99 What is the remainder when 218 is divided by 24? 2 What is the remainder when 503 is divided by 56? 55 What is the remainder when 204 is divided by 40? 4 Calculate the remainder when 268 is divided by 50. 18 What is the remainder when 215 is divided by 132? 83 What is the remainder when 378 is divided by 79? 62 Calculate the remainder when 1178 is divided by 585. 8 Calculate the remainder when 838 is divided by 30. 28 Calculate the remainder when 816 is divided by 63. 60 Calculate the remainder when 1626 is divided by 74. 72 Calculate the remainder when 347 is divided by 70. 67 Calculate the remainder when 362 is divided by 82. 34 What is the remainder when 68 is divided by 14? 12 Calculate the remainder when 2161 is divided by 2153. 8 Calculate the remainder when 150 is divided by 54. 42 What is the remainder when 104 is divided by 21? 20 What is the remainder when 351 is divided by 172? 7 Calculate the remainder when 444 is divided by 14. 10 What is the remainder when 95 is divided by 21? 11 What is the remainder when 117 is divided by 26? 13 Calculate the remainder when 1425 is divided by 46. 45 What is the remainder when 32 is divided by 16? 0 What is the remainder when 455 is divided by 418? 37 Calculate the remainder when 5243 is divided by 228. 227 Calculate the remainder when 15616 is divided by 41. 36 Calculate the remainder when 37278 is divided by 40. 38 What is the remainder when 125 is divided by 44? 37 What is the remainder when 765 is divided by 59? 57 What is the remainder when 523 is divided by 101? 18 What is the remainder when 535 is divided by 184? 167 Calculate the remainder when 4737 is divided by 60. 57 What is the remainder when 90 is divided by 17? 5 What is the remainder when 111 is divided by 40? 31 Calculate the remainder when 14665 is divided by 193.	{ "pile_set_name": "DM Mathematics" }
o the power of 1/2, to the nearest integer? 109 What is 1179 to the power of 1/4, to the nearest integer? 6 What is the third root of 83422 to the nearest integer? 44 What is the cube root of 4434 to the nearest integer? 16 What is 59395 to the power of 1/2, to the nearest integer? 244 What is the seventh root of 435 to the nearest integer? 2 What is 73019 to the power of 1/10, to the nearest integer? 3 What is the third root of 10937 to the nearest integer? 22 What is 3727 to the power of 1/3, to the nearest integer? 16 What is 4208 to the power of 1/3, to the nearest integer? 16 What is the cube root of 2245 to the nearest integer? 13 What is 2228 to the power of 1/4, to the nearest integer? 7 What is the square root of 26496 to the nearest integer? 163 What is the fourth root of 767 to the nearest integer? 5 What is 79395 to the power of 1/2, to the nearest integer? 282 What is the square root of 1162 to the nearest integer? 34 What is the square root of 12560 to the nearest integer? 112 What is 14513 to the power of 1/10, to the nearest integer? 3 What is 19386 to the power of 1/4, to the nearest integer? 12 What is the sixth root of 1366 to the nearest integer? 3 What is the square root of 7561 to the nearest integer? 87 What is the third root of 6283 to the nearest integer? 18 What is the eighth root of 37310 to the nearest integer? 4 What is 243 to the power of 1/6, to the nearest integer? 2 What is the square root of 7115 to the nearest integer? 84 What is the cube root of 3553 to the nearest integer? 15 What is 42596 to the power of 1/2, to the nearest integer? 206 What is 110 to the power of 1/5, to the nearest integer? 3 What is 3492 to the power of 1/2, to the nearest integer? 59 What is 35607 to the power of 1/6, to the nearest integer? 6 What is the square root of 962 to the nearest integer? 31 What is the square root of 1456 to the nearest integer? 38 What is the square root of 4256 to the nearest integer? 65 What is the eighth root of 16418 to the nearest integer? 3 What is the fourth root of 2542 to the nearest integer? 7 What is the sixth root of 10108 to the nearest integer? 5 What is 584 to the power of 1/7, to the nearest integer? 2 What is 18924 to the power of 1/3, to the nearest integer? 27 What is 1978 to the power of 1/3, to the nearest integer? 13 What is 34476 to the power of 1/4, to the nearest integer? 14 What is 77239 to the power of 1/3, to the nearest integer? 43 What is the fifth root of 12650 to the nearest integer? 7 What is 1620 to the power of 1/5, to the nearest integer? 4 What is 117585 to the power of 1/3, to the nearest integer? 49 What is 24643 to the power of 1/5, to the nearest integer? 8 What is the square root of 2321 to the nearest integer? 48 What is the fourth root of 150 to the nearest integer? 3 What is the tenth root of 10046 to the nearest integer? 3 What is the tenth root of 56893 to the nearest integer? 3 What is 48428 to the power of 1/7, to the nearest integer? 5 What is 1612 to the power of 1/2, to the nearest integer? 40 What is 101169 to the power of 1/2, to the nearest integer? 318 What is 4423 to the power of 1/10, to the nearest integer? 2 What is the third root of 14957 to the nearest integer? 25 What is 472 to the power of 1/2, to the nearest integer? 22 What is 12767 to the power of 1/2, to the nearest integer? 113 What is 2326 to the power of 1/8, to the nearest integer? 3 What is the sixth root of 8822 to the nearest integer? 5 What is 9354 to the power of 1/2, to the nearest integer? 97 What is the square root of 1091 to the nearest integer? 33 What is 3544 to the power of 1/2, to the nearest integer? 60 What is 4174 to the power of 1/2, to the nearest integer? 65 What is the third root of 3932 to the nearest integer? 16 What is 5522 to the power of 1/2, to the nearest integer? 74 What is 2962 to the power of 1/5, to the nearest integer? 5 What is the square root of 14091 to the nearest integer? 119 What is 1715 to the power of 1/5, to the nearest integer? 4 What is 12182 to the power of 1/2, to the nearest integer? 110 What is 88645 to the power of 1/2, to the nearest integer? 298 What is 3549 to the power of 1/2, to the nearest integer? 60 What is 14938 to the power of 1/2, to the nearest integer? 122 What is 1406 to the power of 1/4, to the nearest integer? 6 What is 3886 to the power of 1/5, to the nearest integer? 5 What is the square root of 4011 to the nearest integer? 63 What is 27922 to the power of 1/2, to the nearest integer? 167 What is the square root of 7913 to the nearest integer? 89 What is 1052 to the power of 1/2, to the nearest integer? 32 What is 298 to the power of 1/2, to the nearest integer? 17 What is the fourth root of 650 to the nearest integer? 5 What is the tenth root of 40 to the nearest integer? 1 What is the third root of 32238 to the nearest integer? 32 What is the cube root of 304 to the nearest integer? 7 What is 18697 to the power of 1/7, to the nearest integer? 4 What is the cube root of 6853 to the nearest integer? 19 What is the cube root of 7569 to the nearest integer? 20 What is the cube root of 48303 to the nearest integer? 36 What is 7644 to the power of 1/8, to the nearest integer? 3 What is the cube root of 1323 to the nearest integer? 11 What is the square root of 20335 to the nearest integer? 143 What is the eighth root of 3305 to the nearest integer? 3 What is 7652 to the power of 1/3, to the nearest integer? 20 What is the tenth root of 6517 to the nearest integer? 2 What is the seventh root of 699 to the nearest integer? 3 What is the cube root of 2234 to the nearest integer? 13 What is the fourth root of 278 to the nearest integer? 4 What is 23155 to the power of 1/2, to the nearest integer? 152 What is the cube root of 4851 to the nearest integer? 17 What is the sixth root of 716 to the nearest integer? 3 What is the cube root of 1040 to the nearest integer? 10 What is the third root of 1994 to the nearest integer? 13 What is the fourth root of 102337 to the nearest integer? 18 What is 1380 to the power of 1/2, to the nearest integer? 37 What is the cube root of 3757 to the nearest integer? 16 What is the third root of 4252 to the nearest integer? 16 What is 693 to the power of 1/9, to the nearest integer? 2 What is 1829 to the power of 1/7, to the nearest integer? 3 What is 2564 to the power of 1/3, to the nearest integer? 14 What is 1158 to the power of 1/9, to the nearest integer? 2 What is the fifth root of 2394 to the nearest integer? 5 What is 81697 to the power of 1/2, to the nearest integer? 286 What is the tenth root of 12630 to the nearest integer? 3 What is the cube root of 7294 to the nearest integer? 19 What is 4418 to the power of 1/3, to the nearest integer? 16 What is 77682 to the power of 1/2, to the nearest integer? 279 What is 70459 to the power of 1/2, to the nearest integer? 265 What is 4006 to the power of 1/2, to the nearest integer? 63 What is the cube root of 1215 to the nearest integer? 11 What is the cube root of 15526 to the nearest integer? 25 What is the seventh root of 1361 to the nearest integer? 3 What is the cube root of 23 to the nearest integer? 3 What is 143687 to the power of 1/2, to the nearest integer? 379 What is 2266 to the power of 1/2, to the nearest integer? 48 What is the third root of 10085 to the nearest integer? 22 What is the cube root of 48970 to the nearest integer? 37 What is 318 to the power of 1/8, to the nearest integer? 2 What is 85195 to the power of 1/4, to the nearest integer? 17 What is the square root of 110684 to the nearest integer? 333 What is 669 to the power of 1/2, to the nearest integer? 26 What is the cube root of 333 to the nearest integer? 7 What is the third root of 101128 to the nearest integer? 47 What is 43156 to the power of 1/3, to the nearest integer? 35 What is 22296 to the power of 1/3, to the nearest integer? 28 What is 3410 to the power of 1/3, to the nearest integer? 15 What is 45580 to the power of 1/4, to the nearest integer? 15 What is 26124 to the power of 1/6, to the nearest integer? 5 What is 96591 to the power of 1/3, to the nearest integer? 46 What is 642 to the power of 1/2, to the nearest integer? 25 What is the third root of 3	{ "pile_set_name": "DM Mathematics" }
e of 11? False Does 33 divide 3541? False Is 74605 a multiple of 43? True Is 44 a factor of 5382? False Does 24 divide 336? True Is 14 a factor of 196? True Does 230 divide 20622? False Does 47 divide 18283? True Is 52 a factor of 1560? True Is 58463 a multiple of 19? True Is 17 a factor of 1802? True Is 31668 a multiple of 56? False Does 14 divide 1260? True Does 5 divide 5953? False Is 43 a factor of 5332? True Does 123 divide 3813? True Is 19 a factor of 132263? False Is 728 a multiple of 13? True Is 25940 a multiple of 20? True Is 395 a multiple of 20? False Is 11 a factor of 92? False Is 595 a multiple of 7? True Is 176 a multiple of 82? False Is 15 a factor of 3002? False Is 7 a factor of 1330? True Is 26 a factor of 6422? True Is 11 a factor of 32846? True Is 2950 a multiple of 118? True Is 1181 a multiple of 48? False Does 14 divide 1615? False Does 25 divide 786? False Is 36 a factor of 2753? False Does 61 divide 12444? True Is 46481 a multiple of 46? False Is 3191 a multiple of 2? False Is 95 a factor of 48925? True Does 144 divide 27184? False Is 96777 a multiple of 16? False Does 25 divide 2279? False Does 31 divide 1488? True Is 21140 a multiple of 14? True Is 327 a multiple of 40? False Does 3 divide 1664? False Does 28 divide 2156? True Is 143 a factor of 22022? True Is 6 a factor of 92? False Is 54306 a multiple of 63? True Is 13 a factor of 21871? False Is 1025 a multiple of 5? True Does 7 divide 966? True Is 1023 a multiple of 33? True Is 57 a factor of 2679? True Does 46 divide 486? False Is 6880 a multiple of 215? True Is 81 a factor of 25110? True Does 10 divide 4846? False Is 11 a factor of 1171? False Is 5 a factor of 515? True Is 119 a factor of 9286? False Does 54 divide 1242? True Is 9 a factor of 393? False Is 4 a factor of 922? False Is 1323 a multiple of 32? False Is 1533 a multiple of 48? False Is 416 a multiple of 8? True Is 51942 a multiple of 66? True Is 5176 a multiple of 8? True Does 30 divide 990? True Does 4 divide 492? True Is 2 a factor of 1538? True Is 28 a factor of 11471? False Is 17 a factor of 1380? False Is 1153 a multiple of 21? False Is 116892 a multiple of 306? True Does 12 divide 24? True Is 25 a factor of 1525? True Is 32 a factor of 384? True Is 19 a factor of 665? True Is 94 a factor of 3443? False Is 5 a factor of 7405? True Does 54 divide 7646? False Is 30 a factor of 23176? False Does 8 divide 216? True Does 64 divide 57114? False Does 7 divide 652? False Is 6148 a multiple of 17? False Is 558 a multiple of 9? True Is 188 a factor of 67653? False Is 4 a factor of 91? False Does 22 divide 11066? True Does 386 divide 53654? True Does 23 divide 2484? True Does 8 divide 4270? False Is 1035 a multiple of 15? True Does 10 divide 65070? True Is 13 a factor of 4460? False Is 129 a multiple of 12? False Is 6700 a multiple of 20? True Is 66 a factor of 495? False Is 162 a factor of 16493? False Is 72 a factor of 936? True Does 2 divide 4168? True Does 41 divide 11316? True Is 8668 a multiple of 6? False Does 394 divide 68950? True Does 303 divide 10605? True Is 22 a factor of 1127? False Is 62 a factor of 2356? True Is 11 a factor of 10599? False Is 37 a factor of 12673? False Does 13 divide 91? True Is 9 a factor of 33956? False Is 66 a factor of 1452? True Is 23 a factor of 1162? False Does 90 divide 1170? True Does 36 divide 1332? True Is 62 a factor of 18352? True Is 17 a factor of 34952? True Is 45 a factor of 5893? False Does 8 divide 7720? True Is 9 a factor of 26610? False Is 15109 a multiple of 29? True Is 5009 a multiple of 27? False Does 108 divide 60480? True Is 54610 a multiple of 43? True Is 41 a factor of 140? False Is 35 a factor of 62101? False Is 263 a factor of 549? False Is 40039 a multiple of 132? False Is 29916 a multiple of 12? True Does 25 divide 3285? False Is 780 a multiple of 12? True Does 10 divide 410? True Is 3025 a multiple of 55? True Does 228 divide 85956? True Is 20 a factor of 4758? False Does 5 divide 65? True Does 31 divide 40967? False Does 23 divide 44648? False Is 490 a multiple of 4? False Does 8 divide 3360? True Is 13 a factor of 2425? False Is 108 a factor of 5422? False Is 58 a factor of 4292? True Does 24 divide 15320? False Is 12119 a multiple of 5? False Is 1485 a multiple of 45? True Is 1030 a multiple of 10? True Is 54 a factor of 47250? True Is 31312 a multiple of 76? True Is 28910 a multiple of 49? True Does 5 divide 400? True Is 2527 a multiple of 14? False Is 331 a multiple of 20? False Is 10 even? True Is 13524 a multiple of 46? True Is 18 a factor of 33678? True Does 241 divide 35427? True Is 2330 a multiple of 47? False Does 2 divide 161? False Is 14124 a multiple of 22? True Does 12 divide 5148? True Does 238 divide 9758? True Is 84 a multiple of 6? True Is 5 a factor of 4308? False Is 1560 a multiple of 12? True Is 45 a factor of 405? True Is 1819 a multiple of 107? True Is 30 a factor of 7747? False Is 6 a factor of 268? False Is 6 a factor of 6210? True Is 13 a factor of 15964? True Is 900 a multiple of 45? True Is 3340 a multiple of 31? False Does 18 divide 2867? False Is 23728 a multiple of 91? False Is 2811 a multiple of 5? False Is 3652 a multiple of 22? True Is 16438 a multiple of 217? False Is 24 a factor of 1523? False Is 3874 a multiple of 26? True Does 13 divide 3991? True Is 1210 a multiple of 22? True Does 7 divide 77? True Is 11473 a multiple of 11? True Is 35 a factor of 2450? True Is 16 a factor of 312? False Is 39 a factor of 8463? True Does 48 divide 21888? True Is 46 a factor of 3403? False Does 21 divide 5292? True Does 5 divide 15795? True Does 28 divide 3342? False Is 10087 a multiple of 7? True Is 26135 a multiple of 7? False Does 17 divide 12155? True Is 8991 a multiple of 27? True Is 16705 a multiple of 172? False Is 184 a factor of 184? True Does 6 divide 9444? True Does 14 divide 89460? True Does 9 divide 19503? True Is 1169 a multiple of 167? True Is 52834 a multiple of 12? False Is 23680 a multiple of 8? True Is 36 a factor of 79335? False Is 47160 a multiple of 60? True Is 11 a factor of 4063? False Is 8418 a multiple of 29? False Is 1005 a multiple of 32? False Is 20862 a multiple of 18? True Is 19 a factor of 3257? False Does 6 divide 3205? False Does 8 divide 2732? False Does 13 divide 605? False Is 36 a factor of 740? False Is 9858 a multiple of 318? True Is 8 a factor of 2320? True Is 2301 a multiple of 11? False Is 52 a factor of 103? False Does 11 divide 7899? False Is 48264 a multiple of 8? True Is 1654 a multiple of 109? False Does 53 divide 13409? True Is 873 a multiple of 58? False Does 74 divide 7918? True Does 23 divide 11114? False Is 10 a factor of 130? True Is 5 a factor of 7074? False Does 6 divide 6811? False Is 5 a factor of 1596? False Does 12 divide 1064? False Is 23 a factor of 22316? False Is 5 a factor of 8630? True Is 26 a factor of 13572? True Does 15 divide 2510? False Is 35 a multiple of 5? True Is 12 a factor of 26652? True Is 354 a multiple of 3? True Is 4 a factor of 3091? False Is 66 a multiple of 2? True Is 31 a factor of 628? False Is 15 a factor of 60? True Is 37 a factor of 7881? True Is 2520 a multiple of 12? True Is 3609 a multiple of 46? False Is 310 a multiple of 10? True Is 12 a factor of 9482? False Is 63 a factor of 29484? True Is 106 a factor of 907? False Is 49 a multiple of 2? False Is 28 a factor of 11031? False Is 5372 a multiple of 42? False Is 701 a multiple of 23? False Does 6 divide 845? False Is 46 a factor of 992? False Is 1064 a multiple of 19? True Is 13202 a multiple of 82? True Does 8 divide 1681? False Is 4 a factor of 1798? False Does 40 divide 9445? False Does 4 divide 1195? False Does 133 divide 1330? True Is 8091 a multiple of 9? True Does 11 divide 626? False Is 15 a factor of 59? False Is 2862 a multiple of 27? True Is 1076 a multiple of 4? True Does 30 divide 152548? False Is 38 a factor of 171? False Is 183 a multiple of 25? False Is 10 a factor of 320? True Is 23 a factor of 1411? False Does 10 divide 1449? False Is 4 a factor of 1371? False Is 100 a factor of 6600? True Is 16 a factor of 208? True Is 19396 a multiple of 20? False Is 28006 a multiple of 38? True Does 94 divide 9375? False Does 48 divide 960? True Is 50 a factor of 57668? Fa	{ "pile_set_name": "DM Mathematics" }
11 -241242 (base 5) to base 12 -5217 What is 160b (base 14) in base 6? 30111 Convert 4420 (base 6) to base 5. 13040 Convert -10001101001111 (base 2) to base 5. -242124 What is -34 (base 13) in base 16? -2b Convert -a4 (base 12) to base 2. -1111100 What is -3c5 (base 13) in base 10? -668 -14b2 (base 12) to base 15 -ac8 What is -152 (base 6) in base 10? -68 What is 41201 (base 5) in base 8? 5164 What is 20011 (base 3) in base 5? 1131 2221 (base 5) to base 8 467 Convert 221 (base 5) to base 14. 45 3cc (base 13) to base 10 675 Convert -26535 (base 8) to base 2. -10110101011101 -1303011 (base 4) to base 7 -30321 -120101 (base 3) to base 15 -1ca Convert -10540 (base 6) to base 7. -4242 Convert 20030 (base 4) to base 7. 1346 Convert -1430 (base 7) to base 12. -3a8 Convert -101601 (base 7) to base 5. -1024240 Convert 5638 (base 10) to base 8. 13006 -854 (base 14) to base 10 -1642 -358 (base 10) to base 16 -166 What is 9561 (base 11) in base 12? 73a3 What is 1cf1 (base 16) in base 11? 5626 c97 (base 15) to base 14 1070 -11101111111 (base 2) to base 12 -113b Convert 12433 (base 5) to base 11. 823 -10111101101 (base 2) to base 15 -6b2 110101100 (base 2) to base 10 428 Convert -101101001000101 (base 2) to base 12. -11459 What is 4507 (base 8) in base 2? 100101000111 Convert 67a (base 11) to base 10. 813 Convert 10011111100 (base 2) to base 7. 3502 -215 (base 9) to base 16 -b0 What is 4751 (base 12) in base 16? 1f2d What is 135 (base 16) in base 15? 159 Convert -1011002 (base 3) to base 12. -59b What is -6070 (base 14) in base 7? -66200 What is -113 (base 8) in base 16? -4b What is 1102022222 (base 3) in base 12? 14208 Convert -1120 (base 8) to base 14. -304 Convert -61462 (base 7) to base 8. -35215 What is 12455 (base 6) in base 12? 112b What is -2171 (base 11) in base 6? -21125 What is -9110 (base 10) in base 15? -2a75 What is -23 (base 4) in base 9? -12 3405 (base 9) to base 11 1988 What is 1e5 (base 16) in base 5? 3420 What is -176 (base 15) in base 6? -1320 What is 620 (base 14) in base 2? 10010110100 Convert 1869 (base 11) to base 12. 145a 13123010 (base 4) to base 10 30404 110001001111 (base 2) to base 9 4281 Convert -370 (base 11) to base 5. -3230 6ccc (base 13) to base 16 3c12 What is -1231212 (base 5) in base 3? -1012211101 What is 1aa (base 12) in base 4? 10102 6628 (base 9) to base 16 1316 120 (base 16) to base 5 2123 Convert -44c (base 13) to base 2. -1011100100 Convert -93a (base 13) to base 4. -120202 -567 (base 8) to base 7 -1044 Convert -4947 (base 10) to base 8. -11523 What is -11111010111 (base 2) in base 4? -133113 10808 (base 10) to base 9 15738 376 (base 9) to base 3 102120 Convert -567 (base 14) to base 11. -894 c962 (base 14) to base 15 a488 What is -1101011011 (base 2) in base 7? -2335 What is 210200 (base 3) in base 5? 4320 What is 11120 (base 3) in base 11? 102 4380 (base 9) to base 10 3231 Convert 133131 (base 6) to base 7. 51025 Convert -10310 (base 4) to base 16. -134 Convert 165 (base 7) to base 6. 240 Convert -12144 (base 5) to base 12. -650 5654 (base 9) to base 4 1001110 Convert -372 (base 11) to base 8. -672 What is 4635 (base 7) in base 15? 77c What is 8328 (base 9) in base 3? 22100222 Convert 69a (base 15) to base 6. 10531 Convert 27a0a (base 11) to base 8. 115613 What is 47b0 (base 14) in base 13? 58c9 Convert -11000111010000 (base 2) to base 13. -5a5c Convert -6478 (base 9) to base 2. -1001010100001 -5124 (base 7) to base 4 -123312 -1221201 (base 3) to base 6 -10331 Convert -30211 (base 5) to base 13. -b57 Convert 34141 (base 6) to base 16. 12cd -416 (base 8) to base 5 -2040 Convert 15502 (base 7) to base 4. 1010023 2122 (base 8) to base 9 1458 Convert -21430 (base 5) to base 12. -a42 18535 (base 9) to base 15 3c05 Convert -3433 (base 13) to base 9. -11021 Convert 212022110 (base 3) to base 5. 1020440 2b4 (base 16) to base 11 57a What is -380 (base 11) in base 3? -121201 What is 403121 (base 6) in base 4? 13300321 -11230 (base 7) to base 10 -2863 -2305 (base 6) to base 8 -1041 Convert -2f03 (base 16) to base 14. -4559 Convert 400134 (base 5) to base 3. 122012121 Convert -5eb0 (base 15) to base 7. -112602 Convert -c431 (base 13) to base 5. -1331310 350 (base 6) to base 11 116 What is -640 (base 7) in base 5? -2242 What is 9997 (base 11) in base 6? 140554 What is 522 (base 9) in base 6? 1545 Convert 2bdd (base 14) to base 13. 3750 What is 23096 (base 12) in base 15? dcd0 What is 8613 (base 9) in base 12? 37b6 Convert 321021 (base 5) to base 14. 3cc9 What is 43a (base 14) in base 16? 344 Convert -11111001011010 (base 2) to base 12. -92a2 Convert -7322 (base 15) to base 2. -101111100001100 -24502 (base 7) to base 8 -14425 What is -1024254 (base 6) in base 8? -142052 What is -415 (base 11) in base 14? -27a Convert -41396 (base 10) to base 3. -2002210012 What is -2111121 (base 3) in base 14? -945 Convert 100001201 (base 4) to base 15. 146a8 20333 (base 4) to base 8 1077 12220 (base 6) to base 7 5166 Convert 15a70 (base 11) to base 13. a382 What is 1111100010 (base 2) in base 12? 6aa Convert 27b (base 12) to base 16. 17f Convert -98c (base 14) to base 8. -3540 -122 (base 4) to base 16 -1a What is 1012001 (base 3) in base 5? 11430 -1b0 (base 14) to base 15 -185 -12621 (base 9) to base 6 -103244 Convert -4214 (base 6) to base 15. -431 What is 444 (base 13) in base 3? 1000010 What is -22344 (base 6) in base 10? -3160 What is -5910 (base 13) in base 5? -400034 -23665 (base 9) to base 15 -4a6e What is -222a (base 13) in base 7? -16621 300 (base 11) to base 5 2423 What is 1110 (base 2) in base 8? 16 What is -505050 (base 6) in base 8? -116066 -12321 (base 5) to base 16 -3c1 2225 (base 14) to base 9 8100 27379 (base 10) to base 13 c601 Convert 18 (base 10) to base 15. 13 -531 (base 10) to base 11 -443 Convert -3a0a (base 14) to base 15. -3052 -518 (base 12) to base 4 -23210 What is 66a (base 13) in base 8? 2116 88 (base 15) to base 10 128 1554 (base 15) to base 6 33111 What is -424233 (base 5) in base 15? -4398 What is -102133 (base 4) in base 8? -2237 2683 (base 11) to base 4 312113 What is -618 (base 16) in base 2? -11000011000 Convert -110000 (base 2) to base 15. -33 What is -5232 (base 6) in base 7? -3263 412 (base 12) to base 16 24e What is -10563 (base 9) in base 16? -1b6f What is 35411 (base 7) in base 14? 3478 -641 (base 15) to base 6 -10311 What is -110010000 (base 2) in base 7? -1111 What is -111364 (base 7) in base 3? -1000002021 Convert 1343 (base 15) to base 9. 5570 What is -21074 (base 10) in base 11? -14919 What is 14993 (base 11) in base 6? 241540 What is -2656 (base 12) in base 2? -1000100100010 dba (base 16) to base 6 24134 562 (base 12) to base 10 794 What is 20053 (base 6) in base 5? 41000 Convert -824 (base 13) to base 3. -1220012 What is 2202233 (base 4) in base 2? 10100010101111 74254 (base 8) to base 5 1442032 Convert -aa8 (base 11) to base 14. -6ac What is -12781 (base 10) in base 7? -52156 -783 (base 10) to base 8 -1417 Convert -10012112 (base 3) to base 4. -210200 Convert -30c0 (base 13) to base 6. -51123 What is -115 (base 12) in base 11? -137 Convert 399 (base 11) to base 12. 333 18c8 (base 13) to base 3 12002112 What is -1403 (base 7) in base 5? -4132 What is -2db8 (base 14) in base 12? -48b2 Convert -32514 (base 6) to base 15. -150a Convert -1cc2 (base 13) to base 9. -6010 What is -18042 (base 10) in base 5? -1034132 -862 (base 11) to base 2 -10000001100 What is -11000100001101 (base 2) in base 6? -134045 What is -35394 (base 11) in base 16? -c764 What is 10111100000010 (base 2) in base 8? 27402 What is 10130 (base 4) in base 5? 2114 679 (base 12) to base 15 43c What is 111222 (base 3) in base 16? 179 -11 (base 10) to base 13 -b -211 (base 4) to base 7 -52 What is 6513 (base 10) in base 5? 202023 What is 20302 (base 4) in base 15? 277 -15671 (base 10) to base 9 -23442 Convert 44919 (base 11) to base 2. 1111110111100101 What is 2463 (base 11) in base 5? 100330 Convert -10100000100 (base 2) to base 15. -5a9 Convert 113033 (base 4) to base 13. 8a5 15451 (base 9) to base 14 3bd6 Convert 213301 (base 4) to base 2. 100111110001 What is 10001010010 (base 2) in base 16? 452 What is -16c0 (base 14) in base 15? -1328 1227 (base 13) to base 8 5010 Convert -1856 (base 13) to base 15. -1115 -12471 (base 8) to	{ "pile_set_name": "DM Mathematics" }
*2 - 11r*2 + 3r*2 + w. -5(r - 1)(r + 1) Let d = 3587/18 - 286/9. Let k = d - 167. Determine o so that 0 + o2 - ko = 0. 0, 1/2 Let l(k) be the third derivative of -2/39k3 + 0 + 1/195k*6 + 4k*2 - 4k - 1/30k5 + 11/156k*4. Factor l(x). 2(x - 2)(x - 1)(4x - 1)/13 Let h(o) = -6o*3 - 18o*2 - 8o - 4. Let s be 250/(-50) - (1 - 3). Let k(g) = -5g3 - 16g*2 - 8g - 3. Let x(u) = sh(u) + 4k(u). Factor x(r). -2r(r + 1)(r + 4) Factor 25/3o*3 + 1/3o*4 + 42o*2 + 236/3o + 152/3. (o + 2)*3(o + 19)/3 Let z(d) be the second derivative of -1/55d6 - 32d - 1/110d5 + 1/231d*7 + 0d*2 + 1/22d*4 + 0d*3 - 2. Let z(v) = 0. What is v? -1, 0, 1, 3 Let j(r) be the first derivative of -16r + 80 - 7r4 - 2/3r*6 - 4/3r*3 + 4r*5 + 16r*2. Suppose j(p) = 0. Calculate p. -1, 1, 2 Suppose -19m + 18m = -10, -5u + 2m - 6 = 14. Suppose ui + 4/5 - 4/5i2 = 0. What is i? -1, 1 Let n(y) = 372y + 2241. Let l be n(-6). Let t(k) be the first derivative of -44 + 15k + 9/2k*4 - 5k*3 - lk2. Suppose t(a) = 0. Calculate a. -1, 5/6, 1 Let c(k) be the first derivative of -k3/15 - 146k2/5 + 525. Find o, given that c(o) = 0. -292, 0 Suppose s + 364 = 369. Factor -31p - sp2 - 8 + 25p - 26p - 57 - 38p. -5(p + 1)(p + 13) Suppose 0 = -17j + 12j. Suppose -142 = -3o - jl - 2l, -o - l = -46. Suppose -os3 + 8 - s2 - s*2 + 32s + 12s2 = 0. Calculate s. -2/5, 1 Determine f, given that 0 + 44/5f*4 + 372/5f*3 - 4/5f*5 + 612/5f*2 + 0f = 0. -3, 0, 17 Let a(p) be the second derivative of p7/3780 - p6/180 + p5/36 - p4/2 + p. Let i(r) be the third derivative of a(r). Factor i(l). 2(l - 5)(l - 1)/3 Suppose g*2 - 1/4g*3 + 9 + 41/4g = 0. Calculate g. -4, -1, 9 Let f be 8 + 0 + (-142402)/17810. Let s = f - -1361/2055. Factor -2/3 - sx2 + 4/3x. -2(x - 1)2/3 Let o(f) be the first derivative of -6f*3 + 6f*4 - 3/5f*5 - 12f*2 + 21f - 15. Let o(b) = 0. Calculate b. -1, 1, 7 Let m(i) be the first derivative of i*3/12 - 3205i*2/4 + 10272025i/4 + 2851. Let m(u) = 0. What is u? 3205 Let b(t) be the second derivative of t6/60 + t5/10 + t4/8 - t3/3 - t*2 - 241t. Solve b(a) = 0. -2, -1, 1 Let y be (((-52)/(-8))/13)/((-1)/(-4)). Find j, given that 0j - 24j + 2 + 6jy - 8j - 26 = 0. -2/3, 6 Let j(p) be the second derivative of p*5/30 + 19p*4/18 - 22p*3/9 - 40p*2/3 - 1153p. Factor j(n). 2(n - 2)(n + 1)(n + 20)/3 Let c(m) = 498m*3 - 5m*2 - 6m. Let a be c(-1). Let n = -2484/5 - a. Let 4/5l2 - nl*4 + 2/5l*3 - 2/5l - 3/5 = 0. Calculate l. -1, 1, 3 Let m be (3632/(-210) - (-316)/3318) + 19. Factor 12/5t2 - 6/5 - mt*3 + 3t. -3(t - 2)(t + 1)(3t - 1)/5 Let c be -11 - 8/6(-5226)/268. Let n(i) be the third derivative of -ci*2 + 0 - 1/8i*4 + 0i + 1/60i5 + 1/3i*3. Factor n(v). (v - 2)(v - 1) Let s(w) be the third derivative of -8/5w3 + 0w + 0 - 9/10w4 + 1/40w*6 - 59w*2 + 3/25w*5. Factor s(o). 3(o - 2)(o + 4)(5o + 2)/5 Let f(i) be the second derivative of 0 + 25/12i*4 - 1/18i*6 + 1/2i*5 - 66i + 20/9i3 + 0i*2. Suppose f(z) = 0. What is z? -1, 0, 8 Factor 12501t + 385 + 12509t - 50007t + 12535t + 12510t - t*2. -(t - 55)(t + 7) Let g(m) be the first derivative of m*3/12 - 3m*2/8 + 3673. Suppose g(k) = 0. Calculate k. 0, 3 Let z = -298038 + 3278448/11. Factor 56/11c*2 + zc + 4/11. 2(4c + 1)(7c + 2)/11 Let y(w) be the third derivative of -17w7/210 + 53w*6/120 - 19w*5/20 + 23w4/24 - w3/3 + 375w2 - 2. Solve y(a) = 0 for a. 2/17, 1 Suppose 0 = 6m + 25m - 124. Determine c, given that -2c*m - 38c*2 + 8c + 5c3 + 10c + 20c3 - 3c*3 = 0. 0, 1, 9 Let c(l) = -l + 0l - 3 - l + 13. Let s be c(3). Determine u, given that 4u2 - 8 + 2us + u2 - 2 - 15u3 + 15u + 3u4 = 0. -1, 1, 2 Let b = 23413/3 - 7803. Let d(n) be the first derivative of -16n*2 + 7n*4 - 4n*5 + 16n - 7 + bn3 + 2/3n*6. Determine x so that d(x) = 0. -1, 1, 2 Let l = 13 + -10. Factor 57b*4 + 17b*4 - 189b*l - 23b*4 + 0b*5 - 3b*5 - 243b*2. -3b*2(b - 9)*2(b + 1) Let m(n) be the first derivative of n*6/39 + 24n*5/65 - 8n*4/13 - 68n*3/39 + 63n*2/13 - 4n + 732. Let m(g) = 0. What is g? -13, -2, 1 Factor -18g + 0 + 1/3g3 + g2. g(g - 6)(g + 9)/3 Let s(c) be the second derivative of -3/10c5 - c - 19 + 7/12c*4 - 1/60c*6 - 13/4c2 + c3. Factor s(l). -(l - 1)*2(l + 1)(l + 13)/2 Suppose 0 = -3t + 2i + 31, 7i - 2i = 3t - 19. Let k = 43 - t. Find x such that 7x - 2x*5 + 10x*4 + 10x*4 - 18x*3 - 20x*2 - kx*3 + 43x = 0. -1, 0, 1, 5 Suppose -3p + 23 + 4 = 0. Suppose 0 = 4m + p - 17. Factor -1 + 2f3 + 12f*m - 17 + 24f + 34. 2(f + 2)3 Let d(s) = -2s - 9. Let p be d(-7). Suppose 0 = -2n - 2x - 14, -9n + 5n = -2x - 14. Factor 1/4a*p + 0 + na*4 + 0a*2 + 0a*3 + 0a. a5/4 Let g(j) be the first derivative of j6/27 + 4j5/15 - j4/18 - 4j*3/9 - 1621. Determine f, given that g(f) = 0. -6, -1, 0, 1 Let q(y) be the first derivative of -1/6y*4 - y + 8/27y*3 + 1/45y*5 - 26 + 1/3y*2. Solve q(k) = 0 for k. -1, 1, 3 Let v = -31/447 + -67168/447. Let z = -2243/15 - v. Factor 2/5o + 0 + zo2. 2o(2o + 1)/5 Find g, given that -43g3 + 270g*2 - 45g*4 + 20g*4 + 5g*5 + 135g - 810 + 5g4 - 17g*3 = 0. -3, -2, 3 Let r = 2/357 - -349/1428. Let m(p) be the first derivative of 0p*2 + rp*3 - 21 + 0p. Factor m(n). 3n2/4 Let w = -25990 + 26002. Let x(g) be the second derivative of g3 + 0 + 1/4g*4 + wg - 9/2g2. Determine i, given that x(i) = 0. -3, 1 Let m(l) be the second derivative of -l7/168 - l6/15 + 17l5/40 + l4/6 - 11l3/8 + l - 1959. Let m(q) = 0. What is q? -11, -1, 0, 1, 3 Suppose -t = 3a + 8 - 22, 0 = 2a - 8. Let w = 137474/13 + -10574. Factor -28/13g*3 - 32/13g*t - 2/13g*5 - wg*4 - 4/13 - 18/13g. -2(g + 1)4(g + 2)/13 Let p(g) be the second derivative of -3g + 7/5g*6 + 5/2g*4 - 29/10g*5 + 0g*2 - 10 - 5/21g*7 - 2/3g*3. Let p(f) = 0. Calculate f. 0, 1/5, 1, 2 Let g(n) be the second derivative of 3n*5/20 + 353n*4/4 + 703n*3/2 + 1053n*2/2 + 2n + 121. Factor g(c). 3(c + 1)2(c + 351) Let r(y) = -15y + 167. Let l be r(11). Solve 2 - 11b*2 + 3b*2 + 6b + lb3 - 12 + 10 = 0 for b. 0, 1, 3 Let z(m) be the third derivative of -m5/480 - m4/16 - 2m*3/3 - 21m*2 - 8m. Factor z(p). -(p + 4)(p + 8)/8 Suppose 69f = 19f + 36750. Let b = -1469/2 + f. Let 0 + 1/2o*2 + bo*3 - 1/2o - 1/2o4 = 0. Calculate o. -1, 0, 1 Suppose -41j - 15j4 + 8j + 9j2 + 400 + 413 - 807 + 33j*3 = 0. Calculate j. -1, 1/5, 1, 2 Suppose 298 = i + 2n, 21n = -i + 41n + 430. Factor -iu2 - 256/7u - 1922/7u3 - 8/7. -2(u + 1)(31u + 2)*2/7 Let c(t) be the second derivative of -8/5t*3 - 36/5t*2 - 1/10t*4 - 28t - 1. Solve c(j) = 0. -6, -2 Let a = 26 - 26. Let g be 4 + -2 + 1 - a/2. Factor 51q2 - q3 - 35q*2 + 4q*3 - 19q*g + 4q*4. 4q*2(q - 2)2 Let v(k) = k2 + 21k - 72. Let j be v(-24). Suppose -3c = -2o + 6, j = 4o + o + 4c - 15. Factor 0 - 1/4x - 1/2x2 - 1/4x*o. -x(x + 1)*2/4 Factor 167g + 48g - 431g*2 + 8 + 212 + 10g*3 - 14g*2. 5(g - 44)(g - 1)(2g + 1) Let y(b) = -2b*2 - 7b + 6. Let a be y(-4). Determine u, given that -12u2 - 53u3 + u4 + au4 + 65u*3 - 3u*5 = 0. -2, 0, 1, 2 Let g(q) = -41 - 145q + 9q2 + q2 + 1026. Let u(h) = 0h*2 + 2h2 + 2 - h - h2 + 1 - 2. Let k(a) = -g(a) + 5u(a). Solve k(p) = 0. 14 Find f, given that 537/4f - 135/2 - 9/4f3 - 261/4f*2 + 3/4f4 = 0. -9, 1, 10 Let r(h) = h2 - 2h + 1. Let a(z) = 4z*2 - 10z - 3. Let p(v) = -2a(v) + 10r(v). Let l(k) = -k*2 + k - 16. Let q(c) = -4l(c) - 3p(c). Factor q(f). -2(f - 2)(f + 4) Let u(k) = -k + 1. Let q be u(-6). Suppose qh + 11 = 8h. Let -3m*4 - 3 + 12m*3 - hm*2 - 17m*2 + 12m + 10m2 = 0. What is m? 1 Let o = -1/2783 + 2785/5566. Let a(t) be the first derivative of -1/4t*2 - 1/10t*5 + ot*3 + 1/8t*4 + 17 - t. Factor a(j). -(j - 2)(j - 1)(j + 1)2/2 Let i(f) = -2f*4 + 40f*3 + 76f*2 + 22f. Let c(u) = u*4 - 37u*3 - 76u*2 - 20u. Let s(o) = -	{ "pile_set_name": "DM Mathematics" }
sqrt(36)/sqrt(4)) - sqrt(10)))/((sqrt(180)/sqrt(3)-2)/((-1sqrt(144))/sqrt(12))). sqrt(2)/12 Simplify (0 + ((sqrt(128) + sqrt(128)1 + -2)2 - (-4sqrt(128)1)2 - (sqrt(128) + 1(sqrt(128) + sqrt(128) + -1) - sqrt(128) - (5 + 1 + sqrt(128))*2)))4. -5468 + 64sqrt(2) Simplify (-1(-2sqrt(425)2 + (sqrt(425) + -1)-6) - (-4(sqrt(425) - (1 + sqrt(425))) + (2 + sqrt(425) + sqrt(425))-5))2. 170000 Simplify ((-4 + sqrt(567) + 1sqrt(567) + 4 + 3 + -1sqrt(567) + 4 + -2 + sqrt(567) + -5)5)*2. 56700 Simplify ((sqrt(4536) + sqrt(4536)-3 + sqrt(4536) + sqrt(56) + (2sqrt(224))/sqrt(4))/((sqrt(8) - sqrt(80)/sqrt(1210))1))*2. 7623/25 Simplify 1(sqrt(3564) - (sqrt(3564) + -3sqrt(3564)))2 + 3 + sqrt(3564)3 + 5 + 3 + -1. 54sqrt(11) + 32086 Simplify (((2sqrt(648) + sqrt(648) - sqrt(648))/sqrt(12))/(sqrt(225)6))/(-1(sqrt(75)2 + sqrt(75))5). -sqrt(2)/1125 Simplify (sqrt(240)/(sqrt(192)2))/(-5sqrt(16)/sqrt(4)-4)-5. -sqrt(5)/32 Simplify -2 + (3(sqrt(108) + 1) - (0 + sqrt(108))-5)2 + ((0 + sqrt(108) + 2)2 - (sqrt(108)2 + 5)2) + -3. 192sqrt(3) + 6571 Simplify 1(((sqrt(80)/sqrt(90))/(sqrt(16) + sqrt(64)/sqrt(4)) - ((sqrt(88)/(sqrt(44)/sqrt(4)))/(-4sqrt(16)))*2) + 1). sqrt(2)/12 + 31/32 Simplify sqrt(24)/sqrt(12) + 4 + ((-1 + sqrt(2))6 - sqrt(2)) + (sqrt(44)/sqrt(2)3)/(-6sqrt(11)1). -2 + 11sqrt(2)/2 Simplify (-5(sqrt(18)/sqrt(54) + 4(sqrt(3) - (sqrt(3) + -3sqrt(3)) - sqrt(3)) + (sqrt(15)-25)/(2-1sqrt(5)))-5)*2. 1000000/3 Simplify (1sqrt(171)-1)/(sqrt(99)/(sqrt(11) + -2sqrt(11)))-4 - (4 + (-3 + sqrt(304) + sqrt(1539) + -3 + sqrt(1539))2). -9236 + 260sqrt(19) Simplify 2 + 1((-3(-1 + sqrt(68)))2 + (1 + 0 + sqrt(68))2)4 + 3. -128sqrt(17) + 2765 Simplify (2sqrt(5) + 1 + sqrt(500) + -2 + sqrt(5))2 + (sqrt(5) + sqrt(30)/(sqrt(6)-3) + -2)-4. -86sqrt(5)/3 + 854 Simplify (sqrt(72)/(sqrt(8) - 4sqrt(800) - sqrt(8)))/(sqrt(9)/(sqrt(3) + sqrt(36)/(sqrt(12) - sqrt(1200)) + sqrt(3))). -17sqrt(3)/360 Simplify ((sqrt(45) + sqrt(90)/sqrt(2))-34 + -4 + sqrt(40)/(sqrt(56)/sqrt(175)))*2. 536sqrt(5) + 22461 Simplify ((5sqrt(55)-2)/((sqrt(60) - (sqrt(120)/sqrt(2) - sqrt(60)))/sqrt(12)) + 5-3((2 + sqrt(1100) - sqrt(1100))*2 + sqrt(1100)))5. -800sqrt(11) - 300 Simplify ((sqrt(567) - (-3 + sqrt(567)4) - 3sqrt(567)-3) + 4)*2. 756sqrt(7) + 20461 Simplify 4 + 5((sqrt(156) - -3(sqrt(156) - -2sqrt(156)))/(sqrt(24)/sqrt(2)6)6)2 + 5. 6509 Simplify 2(((-4(sqrt(117) + sqrt(117)3) - -3sqrt(117)3)-1)2 + -3). 11460 Simplify -4(((sqrt(300) - (sqrt(300) + 0) - -6(sqrt(3) - (0 + sqrt(3)))) + -1(-1 + -2sqrt(3)) + 3)-3)*2. -1008 - 576sqrt(3) Simplify (((sqrt(280) - (sqrt(280) - 1sqrt(280)))/sqrt(8) + (sqrt(4235)4 - sqrt(4235)))/((-5sqrt(336))/((sqrt(36)1)/sqrt(12))))*2. 289/20 Simplify (5(sqrt(68) + (2(sqrt(68) + -1sqrt(68)) - sqrt(68) - sqrt(68) - sqrt(68)))-1)/((sqrt(4) - sqrt(4)3)1 + sqrt(36) + sqrt(36)-3)-3. 15sqrt(17)/4 Simplify (sqrt(245)-1)2 + (sqrt(45) - sqrt(5))6 - ((sqrt(25)/sqrt(605))*2 - (sqrt(5)2 + -1)). 14sqrt(5) + 29519/121 Simplify (((-1 + sqrt(176))-3 - (sqrt(176) + 5 + 2sqrt(176)) - 6(0 + sqrt(176)1))3)*2 + 2. 1728sqrt(11) + 228134 Simplify (3 + (1 + sqrt(80))*2 - sqrt(80) - 6(sqrt(80)-2)2) + 2 - ((sqrt(180)2)/(sqrt(81)-6) + -4). -1830 + 38sqrt(5)/9 Simplify -2-1-3(0 + (sqrt(720) - (sqrt(720) + -2sqrt(720) + sqrt(720) + -3))*2 + 2(sqrt(720)-2)2)-2. 864sqrt(5) + 77868 Simplify (2(sqrt(78)2 + sqrt(78))2-6)/(sqrt(216) + (sqrt(216) - (sqrt(216) + -2sqrt(216))-3 - sqrt(216)) + (sqrt(216) - sqrt(216)1)3 + sqrt(216)). 12sqrt(13) Simplify ((((sqrt(153) - (0 + sqrt(153))) + -1)6)2 + (4 + sqrt(68) - ((-1sqrt(17))*2 + -4 + sqrt(17))) + 2)-5. -145 - 5sqrt(17) Simplify ((-2sqrt(315))/(-6sqrt(25)/sqrt(5)) + (sqrt(7)-2 - sqrt(7))6 + -2 + (sqrt(7)-1 + 5 - -1sqrt(7)-2))*2. -120sqrt(7) + 2809 Simplify ((sqrt(150)/(sqrt(10) + 3sqrt(10)) + (-3sqrt(2160) - sqrt(2160)))/(sqrt(768) + -4(sqrt(768) + 2sqrt(768) + sqrt(768))))*2. 36481/184320 Simplify (sqrt(704) + 1 + (1sqrt(22))/sqrt(2) + sqrt(11))-1 - (-1 + (sqrt(99) - (-1 + -1sqrt(99) - sqrt(99))))*2. -892 - 10sqrt(11) Simplify (sqrt(2448) + 2sqrt(2448) + 4 - (-4 + ((sqrt(2448) - (sqrt(2448)1 + sqrt(2448)))*2 + sqrt(2448) - sqrt(2448))))-4 - (-5 + 1(sqrt(2448) + -2))-5. -84sqrt(17) + 9725 Simplify 1 + 3 + ((sqrt(6300) - (sqrt(6300) + 1)) + -2)2 + 5 + (sqrt(6300) - (sqrt(6300) - (sqrt(6300) + -3sqrt(6300))))*2. 25218 Simplify (-1 + 2 + (2 + 3sqrt(245) - (sqrt(245) + 0)2)-6)*2. 924sqrt(5) + 8941 Simplify (-4 + (sqrt(833) - (sqrt(833)-2 + 3)))2 + (sqrt(85)-2 + sqrt(85))/sqrt(5) + -5 + 2. -295sqrt(17) + 7543 Simplify ((sqrt(225) - sqrt(225)-3 - sqrt(225) - (-2sqrt(441) - sqrt(441) - sqrt(441)))/((sqrt(9)-16)/(sqrt(33)/(sqrt(33)/sqrt(3)))))2. 1849/12 Simplify (-3-3((sqrt(187)2 - sqrt(187)) + sqrt(187))-4)/((2sqrt(77) - sqrt(77))/sqrt(7) - sqrt(1331)2). 24sqrt(17)/7 Simplify ((sqrt(70) + sqrt(70)16 - sqrt(70) - (sqrt(70) - (sqrt(70) - (6sqrt(70)1 + sqrt(70)))))/((sqrt(90)2-1)/(6sqrt(81))))2. 567 Simplify (sqrt(156)/sqrt(12) + 5 + -2 + -4 + sqrt(13) + (sqrt(1872)2 + 5)1)1. 4 + 26sqrt(13) Simplify (-2(-2 + (2sqrt(77)1 + sqrt(77) - sqrt(77))/((sqrt(112)/sqrt(2))/sqrt(8)) + -3 + 1 + 4))*2. 176 Simplify ((sqrt(189) - sqrt(189)-2)1 - sqrt(189) - (sqrt(189)-16 - sqrt(189)))/(6sqrt(70)/(sqrt(110)/(sqrt(11) - (sqrt(11) - sqrt(44)/sqrt(4))))). 9sqrt(3)/2 Simplify (0 + (-2 + sqrt(17))44)2 - (-2 + (-3sqrt(102)2)/sqrt(6))2. -1048sqrt(17) + 4760 Simplify -2 + sqrt(363)-2 + (-1sqrt(363))*2-5 + 0 + (6(sqrt(216)1)/(5(sqrt(32) + sqrt(2))))2. -1131737/625 - 22sqrt(3) Simplify sqrt(720) + -4 + (sqrt(720) + -3)*2 + (sqrt(720) - -61sqrt(720))2 + (-4 + sqrt(720)1 - sqrt(720) - ((-1 + sqrt(720))2)2). 36sqrt(5) + 33117 Simplify ((5 + sqrt(720)1 + 2 + sqrt(720) + (5 + -1 + sqrt(720) - (-3 + (sqrt(720) - sqrt(720)-2) - sqrt(720))))4)22 + 3. 10752sqrt(5) + 29315 Simplify (-1 + -3(sqrt(363)-2 + -2)-2 + -5 + -5)*2. 6072sqrt(3) + 52801 Simplify 3((0 + sqrt(1100))-4)*2 - (5 + -2sqrt(275) + -4). 10sqrt(11) + 52799 Simplify ((sqrt(24)/sqrt(300) - (4 + sqrt(18) + sqrt(2))) + (sqrt(2) - sqrt(72) - (sqrt(14)/sqrt(7) + 5))2)1. 281sqrt(2)/5 + 93 Simplify ((sqrt(3)1)*2 + -2)2 + -6(1 + sqrt(147)) + -2sqrt(432) + sqrt(21)/(sqrt(7) - (sqrt(7) + sqrt(28))) + sqrt(48) + -1. -125sqrt(3)/2 - 5 Simplify ((2(sqrt(200) - (-2 + sqrt(200))) + sqrt(200))-1 + -4 - (-1 + 2 + sqrt(200) + sqrt(200))16)2. 3640sqrt(2) + 33996 Simplify ((-3 + ((2sqrt(84) - sqrt(84))/sqrt(6))/sqrt(2))2 - (-4 + 3(sqrt(7) + -1)-3)2)3. -1728 + 252sqrt(7) Simplify ((4-1sqrt(275))/(sqrt(640)/sqrt(8) - sqrt(5)))/((-5sqrt(375) + sqrt(15) + sqrt(15))/((sqrt(12)/sqrt(4) - sqrt(3))-5 + sqrt(3))). 4sqrt(11)/69 Simplify ((sqrt(8) - (sqrt(1400)/sqrt(7) - sqrt(8)))/(sqrt(18)-1 - sqrt(2)))/(sqrt(98) + -1sqrt(98)-3 - -4((sqrt(98) - -2sqrt(98)) + sqrt(98))). 3sqrt(2)/560 Simplify ((2sqrt(440)-4)/sqrt(8))/((sqrt(44) - (sqrt(44) + sqrt(132)/sqrt(3)))5)-2-6. 48sqrt(5)/5 Simplify (45(-4-1sqrt(19) + -2sqrt(76)) + (-2(1 + sqrt(1539)) - (sqrt(152) - sqrt(152)-14)/sqrt(8)))*2. 92sqrt(19) + 10055 Simplify (0 + sqrt(343) + (0 + sqrt(343) - sqrt(343)) + 1 - (sqrt(14)/sqrt(2) + 2 + -1 + -3))*2. 36sqrt(7) + 261 Simplify 2 + ((sqrt(228)15 + (sqrt(228) + -1sqrt(228) + sqrt(228) - sqrt(228))-4)5)/((-6((sqrt(84)-1 - sqrt(84)) + sqrt(84)) - sqrt(84))/(-1sqrt(112))). -20sqrt(19) + 2 Simplify -5(-3 + (-6((sqrt(99) - (sqrt(99) + 0 + sqrt(99) + 0)) + -3(0 + sqrt(99)) + sqrt(99) + sqrt(99)))*2-4). 285135 Simplify ((-4(sqrt(54) - sqrt(486) - sqrt(54)))/((sqrt(3) - (sqrt(3)-1 + sqrt(3)))6))/((6sqrt(144)/sqrt(3) + sqrt(48))/(sqrt(72)1 + sqrt(72))). 12sqrt(3)/7 Simplify (-5 + ((sqrt(1100) + 0 + sqrt(1100) - sqrt(1100)) + sqrt(1100) + sqrt(1100) + sqrt(1100))*2-3 + 0 - 3(-2(sqrt(1100) + 1 + sqrt(1100))*2 + -1))-4. -960sqrt(11) + 105584 Simplify -1(sqrt(16)/(sqrt(32)5)6 + (0 + (sqrt(32))*2 - sqrt(8)/sqrt(4)-1) + 3). -35 - 8sqrt(2)/5 Simplify 5(-4 + -2(0 + sqrt(192) + sqrt(3) + (-1 + sqrt(3))-3)**2 +	{ "pile_set_name": "DM Mathematics" }
or m. -1 Suppose 4w - 32 = 20. Let x = 0 + 0. Let s be (x - 1)/((-1)/w). Solve -s = -2v - 3 for v. 5 Let k(b) = b + 18. Let f be k(0). Suppose -f = -5v + 32. Solve 0n = 5n - v for n. 2 Let h(k) = 2k - 3. Let m be h(6). Suppose -4n = m - 41. Suppose -nw = -4w - 20. Solve -5p - 20 = w for p. -5 Let n = -14 + 6. Let j = 13 + n. Solve -2a = -ja + 12 for a. 4 Let q(u) = -u*2 - 6u - 5. Let o be q(-4). Suppose -w = 3i + 4 - 26, oi + 3 = 0. Suppose -4k + w = v, 2k - 27 + 12 = -v. Solve z = vz + 16 for z. -4 Suppose l = 5l. Suppose 3g - 2y + 31 = 0, lg - 8 = -g - 3y. Let q = -3 - g. Solve -8 = 3o + q for o. -4 Suppose -4 = 5p - p. Suppose 0c + 12 = 3c. Let j = c - p. Solve x + 20 = jx for x. 5 Suppose v - 2x + 5x = -12, 0 = -2v + x + 11. Solve 6 = n - vn for n. -3 Suppose -5k + 3u + 28 = -1, -5u - 3 = 3k. Suppose -3 = -o - 0. Suppose kg - 11 = om, 5g - 14 - 5 = 2m. Solve -4 = gf + 21 for f. -5 Let a = 21 + -15. Suppose -3w - 15 = -aw. Solve 30 - w = -5z for z. -5 Let a be 0/(3 + 0 + -2). Let l = a + 16. Solve -4r = -0r - l for r. 4 Let w = -135 + 192. Suppose 3t - 29 = -y, -y - w = -4t - 6y. Suppose -4c + 3i = -4, 2 + 3 = 5c - 4i. Solve -t = 3k + c for k. -3 Let z = -9 - -9. Suppose -4v + 5 - 1 = z. Solve 5a + v = -9 for a. -2 Let h = -7 + 12. Suppose -3u = -0u. Solve hx + 0x - 15 = u for x. 3 Let m = 29 - 26. Solve 8 = r + m for r. 5 Let q(v) = 2v*2 + v - 2. Let t be q(-2). Let c = 27 + -23. Suppose 1 = -ck + 9. Solve -t = ku - u for u. -4 Suppose 3w = 3y - 36, 7 = 3y - 2. Let c = -5 - w. Let l = 1 - 1. Solve q + 1 - c = l for q. 3 Suppose -2x = x - 54. Let d be (-2 - (-9)/1) + 1. Let u = x - d. Solve -4b + u = -2b for b. 5 Suppose -11 = 2n + 7. Let w be (n/3)/(9/(-24)). Solve -m = m + w for m. -4 Let f = 49 + -25. Suppose 0b + 2b = f. Let c be (4 - 1)b/9. Solve 0 = -q + c for q. 4 Suppose 4y + y - 2k + 138 = 0, y = k - 27. Let o be -6(y/12 + 2). Let h = 2 - 0. Solve 0 = f - of + h for f. 2 Suppose 0r + 21 = -r. Let h be 6/(-1 - r/12). Solve d = -d - h for d. -4 Let h(o) = 5o + 42. Let i be h(-8). Solve iv = v - 4 for v. -4 Suppose -12 = -7f + 5f. Let s(b) = 2b3 + b2 - b. Let c be s(1). Suppose -f = cm + 4v, 4v = -m - v - 12. Solve 10 = -mn + 5n for n. 5 Let b = 20 - 34. Let r = b + 24. Solve 4d + 2 = -r for d. -3 Suppose 0 = 2k - 5v, -k - 2v = k. Suppose -c - c + 4 = k. Suppose 10 = -cb, -4b = -z + 11 + 15. Solve q - z = 3q for q. -3 Suppose -2o - 3o + 15 = 4v, 4v + 9 = 3o. Solve 4 = ob - 2 for b. 2 Suppose 15v = 10v + 20. Solve 0 = -vk - 0 + 16 for k. 4 Let d be -2(-2 + (-9)/(-6)). Let o = d + 2. Let p be (-1)/3 - 14/(-6). Solve -of = pf - 25 for f. 5 Suppose -3l = -j - j + 10, -2l = 4j - 36. Let p be 1 + -2 - (9 - 1). Let g be (-6)/p - j/(-6). Solve g = -f + 1 for f. -1 Suppose -3i = 2i - 10. Let w be (-1)/(((-1)/1)/3). Solve -i = wx - 5 for x. 1 Suppose s - 21 = 4i, 3i = -4s - 6 + 52. Let k = 15 - s. Solve ko + 8 = -2o for o. -2 Let z(p) = -p*2 + 9p - 7. Let d be z(8). Solve 5l = 9 + d for l. 2 Let x(d) = d - 1. Let g be x(1). Solve g = -2m + 4 + 4 for m. 4 Suppose 0 = 7u - 35 + 28. Solve -11 = 3r + u for r. -4 Let j = 33 - 28. Solve -1 = jt + 19 for t. -4 Suppose 5 - 5 = 3k. Solve k = -5d - 10 - 10 for d. -4 Suppose 3 = v, 2o - 11 = 8v - 5v. Solve 0 = -ol + 15l for l. 0 Suppose -19 = -3y + 4i, 0 = -3y - 3i - i + 11. Suppose 0j - p - 14 = -2j, yj - 35 = 4p. Solve 10 = 2r - jr for r. -2 Let v(n) = -2n3 - 3n*2 - 5n - 2. Let x be v(-1). Solve -l + xl = 0 for l. 0 Let u(v) = -v2 - 4v - 3. Let d(q) = q + 1. Let j be d(-3). Let b be u(j). Solve -5 + b = -x for x. 4 Let b = -11 - -15. Suppose 2 = p - b. Let u be ((-24)/(-9))/(4/p). Solve -uv - 10 = 10 for v. -5 Let h(n) = n3 - n2 - n + 3. Let d be h(0). Let g(q) = q2 + 17q - 18. Let z be g(-18). Solve zr - dr = 3 for r. -1 Let d be ((-6)/2)/(-6)20. Solve -s + d = -3s for s. -5 Suppose 0 = 5u - u. Let k be (4/5)/(8/60). Solve u = -3s - k - 0 for s. -2 Suppose -5r + 10 + 10 = 0. Let c = r + -3. Let g(v) = -v2 + 5v - 3. Let a be g(3). Solve au + c = -2 for u. -1 Suppose -3l + 16 = l. Suppose -lq = -0q - 80. Let z be 0/(-1) + (0 - -3). Solve -zo = o + q for o. -5 Let h(q) = 3q2 - q3 - 2 + 9q + 6q*2 + 0 - 2q*2. Let s be h(8). Solve 2c + s = -c for c. -2 Suppose -3 = -5m + 3u - 1, 0 = m - u. Solve -4f + 5f + m = 0 for f. -1 Let k be (-55)/(-45) + (-4)/18. Let m be 1 + (k - -2)/(-3). Solve 4 = n - m for n. 4 Suppose -4q - 156 = -6q - 4h, 2h + 86 = q. Suppose -4w + q = 14. Suppose 0z + 3z - 26 = 5u, -3u = -5z + 22. Solve 7 - w = -zy for y. 5 Let u(k) = 4k + 19. Let h be u(-3). Solve -hm - 10 = -2m for m. -2 Suppose -5l = -3l. Suppose -3p = -3 - l. Let s be 1/((-1)/(-8 - p)). Solve -5v - s = 11 for v. -4 Suppose 2j - 14 = -6. Solve -q - q = j for q. -2 Suppose -2h - 22 = -6h - 3t, 0 = -h - 4t + 12. Solve p = 1 + h for p. 5 Let o be (-4 - (-9 - -5))1. Solve o = 3p - 5p - 10 for p. -5 Let j = -3 - -10. Let s(u) = -4u2 + 13u + 1. Let b(t) = t*2 - t + 1. Let w(l) = 5b(l) + s(l). Let z be w(-9). Solve -2q + z = -jq for q. -3 Suppose 0p + 9 = -p. Let u = p + 12. Solve 9 = -uv - 3 for v. -4 Let p = 4 + -2. Let c(v) = v*2 - 10v - 4. Suppose 4b = 6b - 24. Let g be c(b). Solve -g = 3s + ps for s. -4 Suppose 2a - a = 6. Suppose -5k - 5h = -65, a = h + h. Solve g = -g + k for g. 5 Let a(t) be the first derivative of 10t3/3 - t2/2 + 2. Let g be a(1). Suppose -g = -2v - n, v = -n - 2n + 12. Solve vz = -z + 20 for z. 5 Suppose -2v - 2v + 4 = 2f, 5f + 3v = 24. Solve r + f = 1 for r. -5 Suppose 2u = -0u + 16. Let t(n) = n*2 - 8n + 2. Let o be t(u). Solve -of + f = 0 for f. 0 Suppose -a = -2a + 1. Suppose a = -j + 5. Solve 11 + 9 = -jm for m. -5 Suppose -t - 10 = -6t. Let o(a) = -a + 1 - 2a2 + 1 - a + ta*3. Let c be o(2). Solve -cl = -l - 5 for l. 1 Let t be 1-2 - (1 - 6). Suppose tl + 10 = 8l. Solve 0i = li - 2 for i. 1 Let y be (-42)/(-24) - 2/(-8). Let a(u) = u3 - u2 + u - 2. Let n be a(y). Suppose 2d + 8 = nd. Solve h + 1 = d for h. 3 Let r be 6-1 + 3 - 14/(-2). Solve r = 4g - 0 for g. 1 Let v(n) = -2n*2 + 12n + 17. Let g be v(7). Solve gf + 0f = -6 for f. -2 Let n(c) = -7c. Let o(p) = -8p - 1. Let q(r) = 7n(r) - 6o(r). Let t be q(6). Solve -b - b = t for b. 0 Let u be (-40)/(-16)(-10)/(-1). Solve -2l - 3l = u for l. -5 Let j(n) = n2 + 6n - 24. Let p be j(-9). Solve u + 8 = pu for u. 4 Let x = -18 + 30. Let n be 9/x14. Solve 4f + 1 = -n for f. -1 Suppose -2w + v = -28, -6v = 5w - 2v - 44. Let n be ((-3)/2)/((-9)/w). Suppose -ng - 2g = -8. Solve 3l - g = 1 for l. 1 Let r be 6((-3 - -5) + -1). Solve -6a + 8a + r = 0 for a. -3 Let v be (-6)/8 + 51/68. Solve v = -0o + o + 2 for o. -2 Suppose -3l = x - 5l - 7, 5l + 19 = 3x. Solve 2f + xf = 20 for f. 4 Let b(r) = -r - 4. Let u be b(-8). Solve -o = -uo for o. 0 Suppose y - 4 = -4w + 3w, -16 = -4y + 2w. Solve -3v = -7v + y for v. 1 Let x be 1(-38)/8-4. Suppose -2t + x = 3. Suppose 0 = -0r + 4r - t. Solve -rk - 15 = k for k. -5 Suppose -2k = -p - 5, -p - 1 = -k - 0k. Suppose 5z = -pj + 3, -5z + 1 = 4j - 3. Solve 0t - 5t = z for t. 0 Let t = 84 + -64. Let k = 10 + -6. Solve t = -0g + kg for g. 5 Let d be 4/(-18) - (-14)/63. Solve d = -4u + 3u for u. 0 Suppose -36 + 11 = -5b. Solve -o + 8 = -bo for o. -2 Let d = 48 + -46. Solve d = -p - 0 for p. -2 Suppose -12h + 24 = -11h. Solve 4 - h = 5z for z. -4 Suppose 6l = l + 20. Solve -4u = -3u + l for u. -4 Suppose 3i = 35 + 1. Suppose 3n - i - 3 = 0. Solve -nz - 1 + 16 = 0 for z. 3 Let p be (3 - -3)/(6/20). Suppose -3y - y = -80. Suppose -4x = -4c + y, -c - 2c + 5x = -21. Solve cl - p = -3l for l. 4 Suppose 0 = 5f + 34 + 6. Let l(s) = -s2 - 7s + 8. Let n be l(f). Let h(q) = q + 10. Let j be h(-5). Solve n = 2m - jm - 9 for m. -3 Suppose 3b - 10 = 8b - 4k, -b - 2k = -12. Let y(l) = -l*2 + l + 20. Let i be y(0). Suppose 0 = -0q - 2q + i. Solve 0 = -0o - bo - q for o. -5 Let d be (-23)/2 - 3/2. Let s = d + 15. Solve 0 = so - 0o - 2 for o. 1 Suppose -p + o + 5 = 0, p = -4	{ "pile_set_name": "DM Mathematics" }
ate the remainder when -6 + 472/6y/20 is divided by 14. 11 Suppose -59c = -230c + 17100. Calculate the remainder when 289 is divided by c. 89 Let t(d) = 5d*2 - 2d - 6. Let g be t(-2). Suppose 0p = p + 2w - 17, 0 = -4p - w + 68. What is the remainder when 1492/18 + 2/g is divided by p? 15 Let u = 346 - 356. What is the remainder when (-4)/(-10) + (-686)/u is divided by 11? 3 Suppose -18r + 25r = 0. Suppose r = -5t - 5g + 250, -10t + g = -5t - 256. Calculate the remainder when 90 is divided by t. 39 Let j = 1859 - 1836. Calculate the remainder when 10462 is divided by j. 20 Let p(n) = 13n + 58. Let z(a) = 3a2 + 5a + 1. Let q be z(-2). Let h = q + 10. Calculate the remainder when h is divided by p(-4). 1 Let m(q) = q*3 - 11q*2 - 11q + 25. Calculate the remainder when 255 is divided by m(12). 33 Suppose -2i = -3h + 3572, -4h + 6218 = -i + 1457. Suppose -s - 234 = 2q - 834, -4q + h = -3s. Calculate the remainder when q is divided by 77. 68 Suppose -6p - 70 = -11p. Let h(v) = -2v2 + 185v - 1390. What is the remainder when h(84) is divided by p? 10 Suppose -6c = -11c + 410. Let b = 470 - 466. What is the remainder when c is divided by ((-1264)/(-40) - 3) + b/10? 24 Suppose -19b + 6323 = 16b - 4877. What is the remainder when b is divided by 139? 42 Suppose -2u + 19 - 1 = 0. Let o(g) = 8g + 7. Let k be o(u). Suppose 6q - k = 23. What is the remainder when 66 is divided by q? 15 Suppose 0 = 13a - 16680 - 12657 - 1499. What is the remainder when a is divided by 72? 68 Let x = 10934 + -10908. What is the remainder when 1702 is divided by x? 12 Let l(s) = -10s + 3. Let r be l(0). Suppose 0 = -x - r, -j = -2x + 4x - 129. Calculate the remainder when j is divided by 17. 16 Let w(x) = -10x - 6. What is the remainder when 7/(-35) - (1261/(-5) + -1) is divided by w(-7)? 61 Suppose 249v = 259v - 1140. Calculate the remainder when 12539 is divided by v. 113 Let g(o) = -o + 12. Let v(m) = -m*3 - 5m*2 + 5m + 1. Let r be v(-6). Let n = 58 - 44. What is the remainder when n is divided by g(r)? 4 Let p = 39 + -57. What is the remainder when (p/(-10))/(3235/(-650) - -5) is divided by (-165)/(-12) - 4/(-16)? 8 Let n(i) = i*3 - 5i*2 + 35i + 24. What is the remainder when n(7) is divided by 34? 27 Let i(f) = -f + 2. Let q be i(6). What is the remainder when (-589)/(-4) - (-1)/q is divided by (-3663)/(-66)1/(-3)-2? 36 Suppose -43 - 320 - 413 = -2j. What is the remainder when j is divided by 78? 76 Calculate the remainder when ((-23452)/(-2002))/(1 - 6/7) is divided by 3(-3)/(-3) + 21. 10 Let l(z) = -z*3 + 19z*2 - 47z + 36. What is the remainder when 81 is divided by l(16)? 29 Let m = -5322 + 6038. What is the remainder when m is divided by 180? 176 Let k = -5208 - -5275. What is the remainder when 122 is divided by k? 55 Suppose 2 - 12 = -5g + 5w, -w = 3g - 22. What is the remainder when 23 is divided by 26/(((-4)/g)/(2/(-6)))? 10 Let r(j) = -3j + 2. Let p be r(-3). Let f be 14 - (-23 + 17). Let z = p - f. Calculate the remainder when 6 is divided by z. 0 Let j(m) = -4m*2 - 273m + 576. Calculate the remainder when j(-64) is divided by 49. 47 Let v(w) = -3w2 - 211w - 532. What is the remainder when v(-14) is divided by 108? 106 Let b = -52 + 109. Suppose 7g - b = 27. Suppose -u = -5r + 226, 172 = 4r - 5u + 2u. What is the remainder when r is divided by g? 10 Calculate the remainder when 267/(-2136) - 34786/(-16) is divided by 24. 14 Suppose -3z + 0 = 48. Let y = 13824 + -13784. Calculate the remainder when y is divided by (-95)/(-4) - (-12)/z. 17 Suppose -5f + 15 = 0, 5b = -30f + 35f + 1800. Let q = b + -163. Calculate the remainder when q is divided by 35. 25 Suppose 859y = 662y + 26792. What is the remainder when 1473 is divided by y? 113 Let q(t) = -t*3 - 3t*2 + 2t - 15. Suppose -2 = -i - 10. Calculate the remainder when q(i) is divided by 49. 44 Let m(w) = -w - 6. Let f(t) = -5t - 19. Let y(z) = -2f(z) + 7m(z). Calculate the remainder when 15 is divided by y(3). 0 Suppose -96 = -17o - 11. Suppose w + 4u - 66 = -22, ou = -3w + 132. Calculate the remainder when 1009 is divided by w. 41 Suppose 0 = -6b + 4b - 4v + 406, 4v - 1033 = -5b. Suppose 54d - 528 = 1956. What is the remainder when b is divided by d? 25 Let w(b) = b3 + 90b2 + 247. Calculate the remainder when w(-90) is divided by 63. 58 Calculate the remainder when (-4)/58 - 117650/(-377) is divided by 42. 18 Let j(c) = -c2 - 36c + 71. What is the remainder when 1148 is divided by j(-14)? 11 Suppose 2x + 3n = 1912, 2x - 2321 + 439 = 2n. What is the remainder when x is divided by 161? 142 Let w(p) = 19p*2 - 11p + 27. Calculate the remainder when 421 is divided by w(2). 16 Let x be (3 - (-1)/1) + -3. Let o be 3(-5 + 2) + x. What is the remainder when ((-188)/7)/(o/28) is divided by 24? 22 Let q be -1(-1 + -1 + 0)/(-2). Calculate the remainder when 55 is divided by (1 - q)-1 - (-11 - 20). 26 Let f(t) = -2t*2 - 312t + 67. Calculate the remainder when f(-148) is divided by 20. 15 Suppose -z - 2 = -3. Let x be z((-4)/12)/((-2)/12). Suppose xp - 107 = -19. Calculate the remainder when p is divided by 15. 14 Let a be 28/37/((-245)/(-30)). Let m be -7 - -8 - a/(-2). Suppose -mo + 195 + 145 = 0. Calculate the remainder when o is divided by 24. 20 Suppose -45y = 5y - 600. What is the remainder when 176 is divided by y? 8 Let t(n) = -n*3 + 2n*2 - n - 1. Let k be t(2). Let i = 24 - k. Let q = 710 - 659. Calculate the remainder when q is divided by i. 24 Suppose -2j + n + 2n + 19 = 0, -4j - 2n = -30. What is the remainder when (-5 - 730/(-40))/(2/j) is divided by 15? 8 Let c(d) = -106d + 3. Let t(z) = 105z - 2. Let s(j) = 3c(j) + 4t(j). Let a(m) = m + 4. Let b be a(-3). Calculate the remainder when s(b) is divided by 21. 19 What is the remainder when (-5)/(-15) - (5 - (0 - 18355/(-15))) is divided by 87? 1 Let j = -86 - -178. Let q = j + -80. What is the remainder when 24 is divided by q? 0 Let u(s) = 8s*2 - s - 4. Let h be u(2). Suppose v - 4f - 9 + h = 0, 3v - 1 = -f. What is the remainder when ((-4)/12 + v)-27 is divided by 21? 15 Suppose -983m + 285 = -968m. Let p = 11 + 41. Calculate the remainder when p is divided by m. 14 Let k(r) = -2r - 2r + 2r2 + 0 + 0 + 3. Suppose -j - 12 = -2q - 4j, -5j + 25 = 5q. What is the remainder when 25 is divided by k(q)? 7 Let z = 54 - 50. Suppose 75 = -zc + 1131. Suppose -7v = -9v + c. What is the remainder when v is divided by 45? 42 Calculate the remainder when (-2)/(0 + 2 + (-4380)/(-4388) + -3) is divided by 46. 39 Suppose -194r = -192r - 56. Suppose -9m + 12m = -2g + 750, -3m + 750 = -5g. What is the remainder when m is divided by r? 26 Let k(v) = -10v + 16 - 30 - 17 - 37. Calculate the remainder when 41 is divided by k(-10). 9 Suppose -67v + 4069 = -528 - 1232. What is the remainder when 1337 is divided by v? 32 Let d = 15480 - 15475. Calculate the remainder when 8063 is divided by d. 3 Let x(i) = -6i*3 - 16i*2 + 27i + 83. Let d(b) = -b3 - b2 + b - 2. Let u(h) = 5d(h) - x(h). Calculate the remainder when 458 is divided by u(-12). 26 Calculate the remainder when -1 - 0/(-2) - 3753/(-9) is divided by 74. 46 Let m(j) = 5 + 16j + 3 - 5. Suppose -14o + 390 = 12. What is the remainder when m(3) is divided by o? 24 Let c(o) = -191o - 1254. Calculate the remainder when c(-9) is divided by 53. 41 Let p(l) = -224l + 1207. Let z = 38 + -23. Calculate the remainder when p(5) is divided by z. 12 Let c = 63 + -33. Let b be (-40)/c - 1/(-3). What is the remainder when 121 is divided by (1-25)/(2b/2)? 21 What is the remainder when 224 is divided by (-840)/(-105)((-29)/5)/(2/(-5))? 108 Let h be (5 + -2)/((-2)/(-2)). Suppose -3j + 0j - hp + 108 = 0, 5p + 36 = j. Calculate the remainder when (-2 - 9)-13 + (83 - 85) is divided by j. 33 Let s = -1302 + 1511. What is the remainder when s is divided by 23? 2 Suppose -28 = -4r - 0r. Let y be 3 + (-756)/49 - 6/(-14). Calculate the remainder when (-18)/(y/(-4)) + 75 is divided by r. 6 Let y = -23 + 42. Suppose -10n - j - 49 = -13n, 17 = n - j. Calculate the remainder when y is divided by n. 3 Suppose 3p + 33h = 36h + 1020, -2h - 1370 = -4p. Calculate the r	{ "pile_set_name": "DM Mathematics" }
base 13, what is 4 - -9a? a1 In base 14, what is 120 - 1? 11d In base 2, what is 1011111 + 11101? 1111100 In base 13, what is -c07 - 4? -c0b In base 11, what is 0 + -1547? -1547 In base 7, what is -16115 + -1? -16116 In base 10, what is 3 - 629? -626 In base 8, what is 2 + -110? -106 In base 9, what is -5 - -124? 118 In base 9, what is 175 + 27? 213 In base 8, what is 66 - 12? 54 In base 13, what is 49 + -12? 37 In base 16, what is 0 + 7a9? 7a9 In base 6, what is 335114 + 2? 335120 In base 4, what is 11 - 212? -201 In base 8, what is 15 + 55? 72 In base 3, what is -1 - 20? -21 In base 4, what is -10 + 1310? 1300 In base 9, what is 7 - 64? -56 In base 12, what is -12 - -2? -10 In base 6, what is -2 + 32? 30 In base 5, what is 3 - 240? -232 In base 13, what is 0 + 64a? 64a In base 8, what is 13 + 106? 121 In base 14, what is -37 + 3? -34 In base 3, what is -12022000 + -2? -12022002 In base 2, what is 10 - 101101? -101011 In base 13, what is -4 + -27b8? -27bc In base 3, what is 12 - 1001? -212 In base 6, what is -303 + 41? -222 In base 11, what is -380 - 0? -380 In base 6, what is 2001 - 1? 2000 In base 3, what is -1 + -102? -110 In base 4, what is -2 - -1122? 1120 In base 10, what is 73 - -4? 77 In base 16, what is 22c - 0? 22c In base 2, what is 10000 + 10001011? 10011011 In base 6, what is -3 + 33102? 33055 In base 11, what is 2a - -3? 32 In base 11, what is -4 - -200? 1a7 In base 2, what is -100 - -1000110111011? 1000110110111 In base 5, what is -2 + 3332? 3330 In base 7, what is -55 + 116? 31 In base 16, what is 24e - -6? 254 In base 13, what is 11 - c0? -ac In base 10, what is 8 + 114? 122 In base 10, what is 2911 + 2? 2913 In base 16, what is -4 - 3b? -3f In base 14, what is 90 + -4? 8a In base 8, what is 3455 - -1? 3456 In base 16, what is 1f - 10? f In base 3, what is 112201 - 11? 112120 In base 4, what is 210 - 3? 201 In base 7, what is -4 + 32? 25 In base 11, what is 11 + 374? 385 In base 15, what is -3 + -26? -29 In base 4, what is 10 - -31? 101 In base 4, what is 111 + -11111? -11000 In base 6, what is -3 - 133? -140 In base 11, what is 5 - -15? 1a In base 14, what is 0 + -15? -15 In base 8, what is -66 + -3? -71 In base 2, what is 1001000011 + -111? 1000111100 In base 3, what is -102 + -2? -111 In base 3, what is 1 - 200001? -200000 In base 9, what is -1123 + 0? -1123 In base 7, what is -3624 + -5? -3632 In base 7, what is -115 + 4? -111 In base 3, what is 101000 + -100? 100200 In base 10, what is 4 - 765? -761 In base 3, what is 1 - -21020? 21021 In base 8, what is 5 - -773? 1000 In base 16, what is c79 - 4? c75 In base 5, what is 10 - 4111? -4101 In base 7, what is 23203 - 4? 23166 In base 3, what is 0 + -22120? -22120 In base 9, what is -161 + -1? -162 In base 3, what is -10200 + 2? -10121 In base 5, what is 2 + -1413? -1411 In base 8, what is 3 - 65? -62 In base 6, what is 402 - 13? 345 In base 3, what is -1 - -102121112? 102121111 In base 5, what is 3 - -321? 324 In base 15, what is 0 + 2a? 2a In base 4, what is -13 + -213? -232 In base 15, what is -141 + -1? -142 In base 4, what is -30 + -22130? -22220 In base 11, what is -75 - -1? -74 In base 6, what is 1010 - -3? 1013 In base 9, what is -18 - -256? 237 In base 3, what is 11101 + 1112? 12220 In base 9, what is 2 + 3736? 3738 In base 10, what is -3 - 288? -291 In base 2, what is -10101011 + 1000? -10100011 In base 5, what is -113330 + -4? -113334 In base 2, what is -100 + 10100110? 10100010 In base 12, what is 1b + 165? 184 In base 12, what is -1 - -124a? 1249 In base 16, what is -7 - 1? -8 In base 3, what is 112 - 1012? -200 In base 5, what is 20 - -12? 32 In base 3, what is 1011011 + -11? 1011000 In base 5, what is 42 - 22? 20 In base 16, what is -7 - -a? 3 In base 2, what is -100 + -1110101? -1111001 In base 15, what is 4 - -3b? 40 In base 5, what is 1 + -1410? -1404 In base 4, what is 130 + 30? 220 In base 14, what is -31 - -17c? 14b In base 9, what is 3 + 644? 647 In base 11, what is -4 + -2219? -2222 In base 15, what is 11 + -4? c In base 11, what is -9 + -1? -a In base 7, what is -2421 + -13? -2434 In base 10, what is 1 - -89? 90 In base 6, what is 124 + 0? 124 In base 15, what is 1 - bc? -bb In base 5, what is -1 + 220? 214 In base 9, what is 21 + 320? 341 In base 13, what is b08 + 4? b0c In base 3, what is 10100202 - 12? 10100120 In base 11, what is -1 + -34? -35 In base 7, what is -235 + 0? -235 In base 2, what is 110 - 11? 11 In base 10, what is 1015 + -2? 1013 In base 15, what is -3 - -465? 462 In base 15, what is -2 - -c? a In base 6, what is -1 - -15545? 15544 In base 15, what is 14c + 5? 152 In base 13, what is 4 + -15? -11 In base 15, what is -a + 30? 25 In base 13, what is -5 - -1990? 1988 In base 11, what is 5 + 427? 431 In base 4, what is 20102 - -33? 20201 In base 2, what is -1111110101101 - -1? -1111110101100 In base 2, what is -11 + 1011000? 1010101 In base 8, what is -2 - -254? 252 In base 6, what is -41 + 5? -32 In base 14, what is -913 - -5? -90c In base 4, what is -3 + 11300? 11231 In base 10, what is -2513 + -4? -2517 In base 11, what is 0 - 6? -6 In base 12, what is -6a - 5? -73 In base 10, what is -28 + 269? 241 In base 9, what is -54 - -84? 30 In base 2, what is 1 - 11010101? -11010100 In base 15, what is 10 - -4? 14 In base 8, what is 1 - 503? -502 In base 13, what is -95 + -5b? -123 In base 5, what is -2 - -20303? 20301 In base 8, what is 7 + 20? 27 In base 7, what is -2 - 1246? -1251 In base 16, what is a2a - -3? a2d In base 5, what is 4334 + 12? 4401 In base 16, what is -93 + -d? -a0 In base 6, what is 2 - -12? 14 In base 7, what is -261 + -6? -300 In base 2, what is -11 + 101110010110? 101110010011 In base 10, what is 82 + 18? 100 In base 13, what is 362 + 1? 363 In base 15, what is 4 - 55? -51 In base 3, what is 220012 + -2? 220010 In base 8, what is 2776 + 0? 2776 In base 15, what is -ca - 0? -ca In base 15, what is 5 - 3e2? -3dc In base 8, what is 6517 + 1? 6520 In base 8, what is -7 + -263? -272 In base 16, what is 19f + -17? 188 In base 3, what is 2220122 - 1? 2220121 In base 3, what is 1 + -2201211? -2201210 In base 8, what is 60 + 0? 60 In base 8, what is 3273 + 1? 3274 In base 15, what is 1 - -107? 108 In base 5, what is -4122 + 3? -4114 In base 9, what is 77 - -86? 174 In base 12, what is -3b + -7? -46 In base 3, what is -10 - 1122? -1202 In base 16, what is 1 + -a2? -a1 In base 9, what is -6721 - 0? -6721 In base 14, what is -5 + 4? -1 In base 14, what is b + 286? 293 In base 15, what is 81 + -5? 7b In base 2, what is -10101000011 - 101? -10101001000 In base 5, what is -103 + -231? -334 In base 9, what is -4 + 56? 52 In base 15, what is -3 + -59? -5c In base 7, what is 164 - -10? 204 In base 16, what is -8 - f? -17 In base 6, what is -23 + -240? -303 In base 7, what is 1 + -143? -142 In base 5, what is 431 - 1023? -42 In base 5, what is 0 - 20? -20 In base 12, what is -2390b - 2? -23911 In base 11, what is 4 - 409? -405 In base 15, what is 0 - 28d? -28d In base 11, what is -3 - -109? 106 In base 2, what is 100001 + 101? 100110 In base 2, what is -10 - 100100111110? -100101000000 In base 5, what is 3 + -213? -210 In base 4, what is -30 + -103? -133 In base 15, what is -19b + 0? -19b In base 5, what is 243 + -342? -44 In base 16, what is fe1 - -4? fe5 In base 13, what is -2c - 4? -33 In base 2, what is 100011001011 + 0? 100011001011 In base 9, what is 13 - 0? 13 In base 2, what is -10 + -110111? -111001 In base 14, what is -1 - 2? -3 In base 5, what is 14 - 213? -144 In base 12, what is 0 - 711? -711 In base 5, what is -3021 + 210? -2311 In base 9, what is -36 + 33? -3 In base 7, what is -1316 + -14? -1333 In base 3, what is -1112120 + -21? -1112211 In base 6, what is -1341 - -5? -1332 In base 5, what is -101324 - -2? -101322 In base 15, what is -6e - 27? -96 In base 13, what is 4 - -22? 26 In base 10, what is -5 + -5678? -5683 In base 5, what is -221 - -2112? 1341 In base 10, what is -102 + 2? -100 In base 10, what is -438 - 1? -439 In base 2, what is -110100110 - -10? -110100100 In base 7, what is 113 + 2? 115 In base 4, what is -11 - 230? -301 In base 11, what is -3 - -4? 1 In base 6, what is -1253 + 24? -1225 In base 7, what is -305 - -1? -304 In base 8, what is -4 - -530? 524 In base 15, what is 145 + -5? 140 In base 6, what	{ "pile_set_name": "DM Mathematics" }
e (0 - 8 - 1)(2 - 1). Let z(o) = o3 + 9o*2 + 2o + 21. Let q be z(n). What is the third smallest value in 1/7, -2/7, -1, q? 1/7 Let i be 4/(-14) + 37/7. Suppose -809s + 800s + 18 = 0. What is the smallest value in s, -2, i, 0.4? -2 Let u = 24 + -21. Let d = 142 - 138. What is the fourth smallest value in 0.5, d, -4, u? d Let o = 2678 - 2677. Let y = 8 - 13. Suppose -2b - 5l + 35 = 0, 4l = b - l + 20. What is the second biggest value in b, y, o? o Let i be 44/30 + 2/10. Let a = -27 - -137/5. What is the third biggest value in i, -0.3, a? -0.3 Let u be ((-112)/12)/(2/6). Let r be u/812/(-21). Let o be 3/r3/9. What is the second biggest value in o, 0.4, -3? 0.4 Let j = -23 - 12. Let r = j + 42. Let q = -1 - -0.6. Which is the biggest value? (a) 0.2 (b) q (c) r c Let m = -4 - -5. What is the third biggest value in -1/2, m, -53? -53 Let o = 4/95 - -154/855. Which is the smallest value? (a) -48 (b) o (c) 4 a Let a = -1.962 - -2.162. What is the third smallest value in 2/45, -1/3, a? a Let v = 438/5 - 88. Which is the second smallest value? (a) v (b) -1/3 (c) 5 (d) -1 a Let x = -0.5636 + 0.6636. Let l = -68/225 - -2/25. What is the second smallest value in x, l, 2/11? x Let u = 0.4 + -0.2. Let l = -5509771/40335 - -2/8067. Let a = l - -137. What is the third biggest value in -4, u, a? -4 Let p = -31.1 - -33. Which is the second smallest value? (a) 0 (b) p (c) 3 (d) -4 a Suppose 0 = -g + 2. Suppose 0 = gq - 5q. Let p(k) = k + 2. Let m be p(2). What is the biggest value in q, 6, m? 6 Let m = -23 + 25.9. Let y = m + -3.9. Which is the second smallest value? (a) y (b) 0.2 (c) 2/13 c Suppose -6l + 6 = -4l. Let a be l + (100/(-26) - -1). Let q = -3.4 + 3.8. What is the biggest value in q, -4, a? q Let l = -0.1 + -4.9. Let y = -1.66 + 1.86. Which is the fourth smallest value? (a) -2/3 (b) y (c) l (d) 3 d Let u be (-1)/(-3)(-198)/(-14) - 5. What is the biggest value in u, -0.2, 2/9, 7? 7 Suppose -4 = 3j + 4a + 4, 0 = 4j - a - 2. Suppose j + 8 = 2r. Let s(k) = k*2 + 6k - 2. Let c be s(-6). What is the third smallest value in r, 2/5, c? r Let u(g) = g*3 - 5g + 16. Let a be u(-3). What is the biggest value in 3/50, a, 5? 5 Let g = 39 + -39. Let y = g + 0.8. Which is the fourth smallest value? (a) 1 (b) -3/4 (c) -0.5 (d) y a Let n = 0.05 - 0. Let x = -2203 - -2204. Which is the second biggest value? (a) n (b) 4 (c) x c Let h be (-1 - (-40)/30)2/(-19). Which is the second smallest value? (a) h (b) -0.4 (c) 4 a Let u(k) = 17k*3 + 2k*2 - 2k + 1. Let z be u(1). Let w = -15 + z. Which is the smallest value? (a) 9 (b) w (c) 4 b Let h = 34 - 31. Which is the smallest value? (a) h (b) -80 (c) -0.3 b Let x be 2 - 5 - (-10 - -3). Let k(t) = -t*3 + 3t*2 + 8t - 10. Let q be k(x). What is the fourth smallest value in 3, -3, 2/9, q? q Let k = 751 + -750.5. Which is the fourth biggest value? (a) 0.3 (b) k (c) 0.07 (d) 1 c Suppose g = -2m + 2g - 27, 2m + 2g = -36. Let j = -9 - m. Let h be -6 - 1/((-3)/j). Which is the smallest value? (a) h (b) 1/5 (c) -1 a Suppose 3z = z + 2. Let p = 2 + z. Let i = 23/125 + 2/125. Which is the smallest value? (a) p (b) -1 (c) i b Let n be -3 + (-2 - (-106)/22). Let l(i) = 2i - 32. Let t be l(15). Which is the third smallest value? (a) -1 (b) n (c) t (d) 2/19 b Let y = 619/3 + -196. What is the second smallest value in y, -0.3, 0.1, -1/5? -1/5 Let s = 469/540 - 16/135. Let t = -2 + 2.2. Let r be -2 + -6 + 1 + 2. Which is the second biggest value? (a) t (b) r (c) s a Let h = 4.312 + -4.412. Let a = -1 + 2. What is the second smallest value in -0.03, a, 5, h? -0.03 Suppose -7x + 12 - 26 = 0. Let l = -18 - -20. Which is the fourth smallest value? (a) x (b) -2/5 (c) -4 (d) l d Let z = 140 + -135. What is the second smallest value in -3, 2/5, z? 2/5 Suppose -3q - b - 3 = -6b, 2b = -3q + 18. Suppose p = 3p - q. Suppose pd = -1 - 1, -22 = -5f - 3d. What is the smallest value in 3/7, f, -0.3? -0.3 Let t = 21 - 74. Let a = t - -53.2. What is the third biggest value in 0.3, 10, a? a Let z = 2 + 0. Let n be (-21)/12 - -3 - 1. Which is the second biggest value? (a) n (b) -5 (c) z a Let f = -2 + 3. Let y = 19 + -18.99. Let u = -11 + 16. What is the second biggest value in u, f, y? f Let f be ((-24)/38 - -1) + -1. Let i = -41/95 - f. Let z = -1655 - -1657. Which is the second biggest value? (a) z (b) i (c) -0.1 b Let i = 137 + -133. Which is the fourth smallest value? (a) -0.2 (b) 0.4 (c) -5 (d) i d Let u = -464 - -467. What is the fourth biggest value in 2/19, 2, 5, u? 2/19 Suppose -q - 4 = -0. Let d be q + 3 - (-2 - 2). Let v = -3.1 - -3. What is the third smallest value in v, d, 2? d Let l = -889 + 875. Let r = 1.7 - 1.4. Which is the biggest value? (a) l (b) 4 (c) 5 (d) r c Let k = 8 - -18. Let n = 26.2 - k. Let l = n - -0.1. Which is the third biggest value? (a) -0.5 (b) l (c) 3/7 a Let r = 10 + -17. Let k = 6.7 + r. Let f = 0.05 + -0.05. What is the biggest value in k, f, -5? f Let y = 166.2 - 166. Which is the smallest value? (a) -9 (b) 0.3 (c) y a Let b = 1 - -8. Let y = 3 - b. Let t = 1 - 0.9. What is the third smallest value in y, -1/4, t? t Suppose -7s + 10 = -5s. Let k be -2(-2)/(-90)s/1. What is the third smallest value in 7, k, 0.3? 7 Let o = -16.9472 + -0.0528. Which is the smallest value? (a) -4 (b) o (c) 0 (d) -0.1 b Let r = 41 + -40.5. Let q = 608/5 + -122. What is the third smallest value in q, r, 0.01, -0.3? 0.01 Let v = -20 - -15. Let h be (-8)/68 + (-1484)/680. Let u = h - -9/5. Which is the biggest value? (a) 1 (b) v (c) u a Let p = -14 - 26. Let j = p + 33.8. Let y = -1.2 - j. Which is the second smallest value? (a) y (b) 3 (c) 1/4 b Let k = -23.6 - -18.6. Let a = -4.4 + 4. Let u = 1343/14 - 193/2. What is the second biggest value in a, u, k? u Let z = 80 - 80.136. Let p = -0.836 - z. Which is the second smallest value? (a) -1 (b) p (c) -5 (d) -0.5 a Let n be (-6 + 1)/10-1. Which is the third smallest value? (a) -4 (b) n (c) 7/6 (d) -2 b Let r(g) = -6g2 - 16g - 3. Let m be r(-2). Which is the third biggest value? (a) -5 (b) m (c) -1 (d) 3/4 c Let p be (-14)/(-25)1890/112. Let v = -41/4 + p. What is the second smallest value in v, 2, 15? 2 Let y = 2257/11 - 205. Which is the second smallest value? (a) y (b) -4 (c) 1 (d) 21 a Let y be 5 - (-1 + 0 + 3). Suppose -81g + 87g = 6. What is the second biggest value in 2, g, y? 2 Let j = 307 + -309. What is the third smallest value in 4/5, -3, -5, j? j Let z be 5/2 - 7/14. Let h = -2.2 + 1.1. Let s = h + 0.6. What is the smallest value in z, -5, s? -5 Suppose -u = 4s - 5u + 20, 0 = -3u + 15. Let z = -0.3 - 0.2. Which is the second smallest value? (a) s (b) z (c) 4 (d) 1 a Let f = -6 - -2. Let y = 47 - 46.94. Let j = 57/11 + -318/55. What is the biggest value in y, j, f? y Let i be (12/(-54))/(0 + (-5)/18). Which is the fourth smallest value? (a) -0.3 (b) -33 (c) 3/5 (d) i d Let w = 8.9 - -0.1. Let g = -7 + w. Let f be 6/(-15) + (-8)/30. Which is the smallest value? (a) -1 (b) g (c) f a Let s = -72 + 42. Let f = 27 + s. Which is the second biggest value? (a) f (b) -2 (c) -1 b Let d = 264 - 181. Let w = d - 413/5. What is the biggest value in -1, 0, w? w Let a(c) = 13c2 + 2c - 1. Let y be a(1). Suppose -3w + 0r + y = -r, 0 = -4w + 5r + 37. Let p = -5 - -7. What is the second smallest value in -1/3, w, p? p Suppose 17f - 8f - 9 = 0. Which is the fourth smallest value? (a) f (b) 0 (c) 2/9 (d) -5 a Let x = -3.27 + 3.39. Which is the third biggest value? (a) x (b) -3 (c) -0.1 b Let u = 76.3 - 80. Let j = 0.3 - u. What is the second smallest value in -2, -7, j? -2 Let d = 4242.1 + -4565. Let v = d + 340. Let t = 17 - v. Which is the second biggest value? (a) t (b) 2 (c) -4/9 a Let y = 38 + -32. Let f be y/8 - (6 + 51/(-12)). Let v be ((-4)/10)/(9/(-5)). Which is the second smallest value? (a) v (b) 6 (c) f a Let i = 783 + -784. What is the second smallest value in -0.13, -0.2, i? -0.2 Let q = 0.13 + -10.13. Let w = -9 - q. Which is the second biggest value? (a) 2 (b) w (c) -2 b Let b(n) = -4n. Let k be b(-1). Let y(s) = s2 - 4s - 4. Let f be y(k). Let i be (5 - 341/66)*2. What is the thir	{ "pile_set_name": "DM Mathematics" }
-8.5 + -0.5. Let o = x - -8.6. What is the third smallest value in o, -0.6, -4? o Let n be -2 - (12 + -6)52/(-162). What is the second biggest value in 0.5, n, -4? n Let x be (-1)/(-5) + (-5)/15. Let b be 8/(-5) + 2/1. What is the third smallest value in x, b, 4? 4 Let p = -0.8 + -4.2. Let k be 02/41. Suppose k = j + 1 + 1. Which is the second biggest value? (a) p (b) j (c) -4 c Let t = 8 + -4. Let p = -139 + 138.6. What is the smallest value in -3/7, t, p? -3/7 Let n = 17393/1054 + -1/527. Let y = 133/8 - n. Let j be (-3)/(-15)-315/(-21). What is the biggest value in j, -0.4, y? j Let x = 14.86 - -0.14. Let h = x - 14.9. What is the second smallest value in 1/8, 0, h? h Let g be 2(-2)/((-12)/249). Let y be g/9 - 2/9. Let q be 0 + (-1 - y/(-7)). Which is the third biggest value? (a) 4 (b) 0 (c) q b Let g = -2.6 + 3. Let r = -15 - -16. Which is the biggest value? (a) r (b) g (c) 0.3 a Let s = -13.6 + 14. What is the biggest value in 4, s, 2? 4 Let x = 94.2 - 94. Let y = 5.3 + -5. What is the second smallest value in -4, y, x? x Let h = 17 - 17.7. Let d = 0.8 + h. What is the smallest value in 4, 2/11, d? d Let t = 1 - -4. Let c = 5 - t. Let q = c + -0.5. What is the second biggest value in 3, q, -0.2? -0.2 Suppose 0 = -0y + 3y - 3. Which is the smallest value? (a) 6/11 (b) y (c) -3/7 c Let o = 19.8 - 20. What is the smallest value in -1, -4/3, o? -4/3 Let l = 0.7 - -0.3. Let o = l + -0.8. Let g = 2.4 + -0.4. Which is the second smallest value? (a) g (b) o (c) 0.4 c Let v = -71 - -66. Let q = -3 - 0. What is the second biggest value in q, v, 1? q Let l = -2.4 - -0.4. Let a be 9/3 - (3 - 4). What is the smallest value in l, -2/9, a? l Let z = 6/37 + -184/1591. What is the third smallest value in -5, z, -4? z Let v = 14 + -9. Let o = v + -4. What is the second smallest value in o, 4, -2/3? o Let f = -11 - -14. Let j = 0.03 - -4.97. Let m = j - f. What is the third biggest value in -2/3, -1, m? -1 Suppose 4f = 5g - f - 80, -5g = -3f - 70. Which is the second smallest value? (a) -1 (b) g (c) -1/4 c Suppose 19x = 51 + 6. Let g = 2 - 0. What is the third smallest value in x, g, -2/5? x Let s = -126/29 - -15333/3509. Let m = 257/605 - s. Let f be 0 + 5/((-20)/16). Which is the second smallest value? (a) m (b) -3 (c) f b Let u = 0.0839 - -12.8861. Let i = u - 13. What is the smallest value in 3, i, 2? i Let j = 0.6 + -16.6. Let y = j - -23. Which is the biggest value? (a) 2 (b) y (c) -2 b Let j = 3.976 + 0.024. Which is the fourth biggest value? (a) -3/5 (b) -0.4 (c) 2 (d) j a Let j be 4/(-12) + (-11024)/84. Let x = j - -132. Which is the biggest value? (a) x (b) -0.4 (c) -3/5 a Let g = -0.06 + -0.34. Let x = g + 0.1. Let l = -0.7 + 0.2. Which is the smallest value? (a) x (b) 5 (c) l c Let i be 4/(-10) - 120/(-175). Let y = 5.2 - 0.2. Which is the third smallest value? (a) y (b) -1 (c) i a Let f = 23 - 23.45. Let b = f + -0.05. What is the smallest value in b, 3, -3/5? -3/5 Let v(f) = f + 7. Let p be v(-7). Suppose p = -2t + t + 1. What is the second biggest value in -1/4, t, 2/15? 2/15 Let v = 1 - 6. Suppose 2f - 7 = -1. Let t be f/(-21)(3 + 1). What is the biggest value in t, -0.3, v? -0.3 Let k(v) = v*3 + 3v*2 + 2v + 3. Let u be k(-3). Let s = 65/4 - 447/28. Which is the biggest value? (a) -1/8 (b) u (c) s c Let d = 0.243 - 0.093. What is the second biggest value in -1/4, 5, d? d Let n be -1 + 1 + (-4)/(-16). Which is the third smallest value? (a) n (b) -2/7 (c) 0.06 a Let t = -0.19 - -8.19. Let z = 1 - t. Let f = z - -6.7. Which is the biggest value? (a) f (b) -1/4 (c) -1 b Suppose -2s = 2s - 8. Let p be s - ((-237)/(-27) - 1). Let v = p + 355/63. Which is the second biggest value? (a) 0 (b) -2 (c) v c Let z be 3/5(-10)/(-12). Let g = 1 + -1.3. What is the second smallest value in g, 1/11, z? 1/11 Let g = 3.366 - 0.456. Let y = 0.09 + g. What is the third biggest value in -4, 0.1, y? -4 Let s be -1(-4)/((-40)/(-5)). What is the biggest value in 2/11, 4/11, s, -4? s Suppose -17 = -3o + 28. Let i be o/108/6. Let g be (6/4)/1 - i. What is the smallest value in g, -1, 0? -1 Let v = -9 + 9.5. What is the biggest value in v, 0.06, -0.4? v Let p = -3 - -1. Let f = p - -2.5. Let c = 159 + -156. What is the biggest value in -2, c, f? c Let v = 1.5 + 1.3. Let o = 0 + -0.2. Let t = v - o. Which is the second smallest value? (a) 2 (b) -2 (c) t a Suppose 3z - z = -8. Which is the second smallest value? (a) z (b) 1/7 (c) 4 (d) -1 d Let n = 7.04 - 7. Let j = 0.24 - n. Which is the smallest value? (a) 1/3 (b) j (c) 2 b Suppose -2q + 0q = 0. Let s be (-6)/84 - 3/(-6). Which is the smallest value? (a) 5 (b) s (c) q c Let i = 3 - 4. Let x = -1 - i. Let r = -0.247 - -0.047. What is the second biggest value in 4, r, x? x Let p = 13 - 12.5. Let s = 4.5 + -5. Which is the second biggest value? (a) s (b) 2 (c) p c Let t = -47/2 + 26. Let f(o) = -o2 + o + 3. Let m be f(3). Which is the biggest value? (a) 2 (b) t (c) m b Let n = -8 - -13. Let f = 5.3 - n. Which is the biggest value? (a) f (b) -4 (c) 1 c Let m = -0.07 - 0.03. Let g = m - -0.4. What is the biggest value in g, -0.2, -0.1? g Let t be (-6)/27 + 2/9. Let p be 2/5 + (-12)/(-70). Which is the smallest value? (a) p (b) 3 (c) t c Let t = -1.5 - -1.9. Which is the second biggest value? (a) 0.2 (b) t (c) -2 a Suppose 0 = -2y - 10. Which is the second biggest value? (a) y (b) 2 (c) 2/19 c Let t = 2 - 3. Let c be (-9)/(-15) + (-2 - (-33)/20). What is the second smallest value in c, -2, t? t Let v = -39 - -55. Let h = v - 63/4. What is the biggest value in 2/9, 5/2, h? 5/2 Let z = 0.22 + -0.02. Let d be ((-4)/(-14))/(2/4). Which is the third biggest value? (a) 1 (b) z (c) d b Let u be 1 + 4 + (-460)/80. What is the second biggest value in 3, 5, -5, u? 3 Let g(f) = -f*3 - 4f*2 - 4f - 12. Let x(s) = -s*2 + s. Let j(i) = -g(i) - 2x(i). Let h be j(-6). Which is the smallest value? (a) -0.2 (b) h (c) 0.3 a Let o = -0.12 - -0.2. Let k = o + 0.22. Let s = 4.7 + k. What is the second smallest value in s, -5, -3? -3 Let i = -1076/11 - -98. Let s be ((-2)/(-10))/((-2)/6). What is the biggest value in -4, i, s? i Let d = 1.96 + -3.96. Which is the second smallest value? (a) d (b) 9 (c) -1/5 c Let m be (-2)/(-6) - (-4)/(-18). Let b = 121 + -1090/9. What is the biggest value in b, m, -0.05? m Suppose -2h - 2d = -371 + 37, -d = -4h + 678. Let s = 679/4 - h. What is the second biggest value in s, 1, 4? 1 Let z = 21 + -18. Let p = 18 + -26. Let r = -6 - p. What is the second biggest value in r, -1, z? r Let s = 20 + -19.92. Let f = s - -0.42. Let k = 1 - 1.4. What is the second biggest value in f, k, 4? f Let d = 25 - 6. Let w = 22.6 - d. Let c = -0.6 + w. What is the third biggest value in 2, c, -4? -4 Let q = 22.5 + -23. Which is the third biggest value? (a) q (b) 5 (c) 1/2 a Suppose -4t = 2q, -t + 4 = 3t. Let s be (-1 - -1)/(-3) + q. Which is the third biggest value? (a) s (b) 3 (c) -1 a Let o = 0.41 - -2.59. What is the fourth smallest value in -0.3, o, -5, -0.09? o Let l = 4 - 3. Let n = l + -6. What is the third biggest value in -0.5, n, -6? -6 Let g = 36 + -113/3. Let f = -0.1 - -0.1. What is the second smallest value in g, 2, f? f Suppose 0m = 2m + 10, -5c - 2m = 35. Let w(f) = f*2 - 2. Let z be w(c). Suppose z - 3 = 4s. What is the second biggest value in s, 0.2, -2/3? 0.2 Let d(g) = -g*3 - 5g*2 + 6g + 2. Let t be d(-6). Let u be 6/(-2) + (0 - 1). Let i be (-2 - -5)/(30/u). What is the second biggest value in t, 1, i? 1 Let k be (10/100)/((-2)/4). Which is the biggest value? (a) 1/2 (b) k (c) 4 c Let m = 5 - 4. Let c = -8/15 + 7/10. What is the second smallest value in m, -2, c? c Let o be (0/3)/(-1) + 1. Let x be -2 + (-1 - o)-1. Let n = -113/2 - -569/10. Which is the third biggest value? (a) n (b) 5 (c) x c Let y be 7/(-42) + (-34)/12. Let k be -4((-5 - y) + 3). Which is the biggest value? (a) k (b) -0.1 (c) 1/2 c Suppose -6n + 20 = -n. Let r(q) = -q3 + 3q*2 + 5q - 2. Let j be r(n). What is the second biggest value in 0, 1, j? 1 Let r = -30 + 34. Which is the smallest value? (a) 0 (b) 18 (c) r a Let u = 16 + -15. Let i = -3.93 - 0.07. What is the second sm	{ "pile_set_name": "DM Mathematics" }
, l: 3}. What is prob of picking 1 a and 1 w? 2/51 What is prob of picking 3 q when three letters picked without replacement from {q: 12, f: 6}? 55/204 Two letters picked without replacement from dqqb. What is prob of picking 1 d and 1 q? 1/3 Two letters picked without replacement from {d: 1, q: 2, n: 5, e: 4, w: 4}. Give prob of picking 1 d and 1 q. 1/60 Two letters picked without replacement from leqllellllqllvellll. What is prob of picking 2 q? 1/171 Calculate prob of picking 1 u and 1 f when two letters picked without replacement from zfdffzmfgzffuum. 4/35 Calculate prob of picking 2 a when two letters picked without replacement from iaakhhakikhhaiksp. 3/68 What is prob of picking 3 s when three letters picked without replacement from {a: 4, s: 8, x: 2, q: 1}? 8/65 Two letters picked without replacement from {e: 5, m: 2, i: 2}. What is prob of picking 2 i? 1/36 Two letters picked without replacement from {c: 2, r: 4, h: 1, g: 1, a: 3, x: 1}. What is prob of picking 1 x and 1 c? 1/33 Two letters picked without replacement from {d: 2, z: 1, x: 4}. What is prob of picking 2 d? 1/21 What is prob of picking 1 r and 2 w when three letters picked without replacement from {c: 1, g: 1, r: 5, w: 2, i: 1, o: 3}? 5/286 Calculate prob of picking 2 e when two letters picked without replacement from {e: 4, k: 2}. 2/5 Calculate prob of picking 1 e, 1 a, and 2 g when four letters picked without replacement from gegiaageiiaaeiaiiag. 9/323 Four letters picked without replacement from {d: 5, g: 7, s: 2}. Give prob of picking 3 g and 1 s. 10/143 Two letters picked without replacement from xxgqxxxxx. What is prob of picking 1 g and 1 x? 7/36 Calculate prob of picking 1 b and 1 r when two letters picked without replacement from rravrsvbbrrrb. 3/13 Two letters picked without replacement from {v: 1, h: 2, t: 2, r: 4}. Give prob of picking 2 r. 1/6 Four letters picked without replacement from {r: 2, f: 4, k: 6}. What is prob of picking 1 f, 2 k, and 1 r? 8/33 Two letters picked without replacement from {f: 3, v: 7}. Give prob of picking 2 v. 7/15 Four letters picked without replacement from {b: 7, a: 5}. Give prob of picking 1 a and 3 b. 35/99 Calculate prob of picking 2 x when two letters picked without replacement from {e: 7, x: 7}. 3/13 Calculate prob of picking 2 i and 1 g when three letters picked without replacement from {l: 12, g: 1, n: 3, i: 4}. 1/190 What is prob of picking 2 n and 2 m when four letters picked without replacement from {v: 2, n: 2, m: 2}? 1/15 Calculate prob of picking 1 t and 1 b when two letters picked without replacement from wbbmbwogbttwtbw. 1/7 Three letters picked without replacement from cgccccccccgc. What is prob of picking 2 g and 1 c? 1/22 Two letters picked without replacement from dddddidid. Give prob of picking 1 i and 1 d. 7/18 Calculate prob of picking 2 z when two letters picked without replacement from {w: 1, t: 1, z: 2}. 1/6 What is prob of picking 2 t and 1 p when three letters picked without replacement from {t: 12, p: 1}? 3/13 Calculate prob of picking 1 b, 1 i, and 1 z when three letters picked without replacement from bbbcbebiz. 5/84 What is prob of picking 1 m and 2 x when three letters picked without replacement from {x: 2, m: 3, f: 15}? 1/380 What is prob of picking 1 f and 1 b when two letters picked without replacement from {w: 1, f: 1, b: 1}? 1/3 Four letters picked without replacement from {h: 1, b: 1, n: 5, w: 4}. Give prob of picking 1 h, 2 n, and 1 b. 1/33 Two letters picked without replacement from {u: 8, n: 3}. What is prob of picking 1 n and 1 u? 24/55 What is prob of picking 1 b and 1 r when two letters picked without replacement from rrbrbbbbrrrrrr? 45/91 Three letters picked without replacement from ekeeeeeeeeekekeeeeee. What is prob of picking 3 k? 1/1140 Three letters picked without replacement from rfttntdrctfd. Give prob of picking 2 d and 1 t. 1/55 Calculate prob of picking 3 c when three letters picked without replacement from cccrcccrc. 5/12 Two letters picked without replacement from {k: 4, o: 4, i: 3, d: 3}. What is prob of picking 1 o and 1 k? 16/91 Calculate prob of picking 1 j and 1 f when two letters picked without replacement from {f: 1, b: 1, j: 2}. 1/3 Two letters picked without replacement from mbrurhy. Give prob of picking 2 r. 1/21 What is prob of picking 1 o and 1 u when two letters picked without replacement from juquuqjjqjujo? 2/39 Three letters picked without replacement from {u: 8, a: 3, k: 7}. What is prob of picking 1 k and 2 a? 7/272 Calculate prob of picking 1 n and 3 u when four letters picked without replacement from {n: 10, u: 4}. 40/1001 Two letters picked without replacement from qhnxhqqnnhqnhqnqqhqq. Give prob of picking 1 x and 1 h. 1/38 Calculate prob of picking 1 g, 1 u, and 1 b when three letters picked without replacement from {z: 1, g: 2, b: 2, u: 1}. 1/5 Three letters picked without replacement from {n: 15, b: 3}. Give prob of picking 3 b. 1/816 Two letters picked without replacement from {s: 9, m: 2, d: 3, j: 2}. Give prob of picking 1 s and 1 j. 3/20 Two letters picked without replacement from {z: 15, b: 5}. What is prob of picking 1 z and 1 b? 15/38 Two letters picked without replacement from qqghgqgeglgqgqgh. Give prob of picking 1 g and 1 h. 7/60 What is prob of picking 3 g and 1 f when four letters picked without replacement from fggffggg? 3/7 Calculate prob of picking 4 c when four letters picked without replacement from cbcbbcocbob. 1/330 What is prob of picking 1 i, 1 m, and 1 n when three letters picked without replacement from nnzminnmgzgnigzznnm? 14/323 Three letters picked without replacement from ffffjjjfffkfkj. What is prob of picking 2 k and 1 f? 2/91 Three letters picked without replacement from lvlrlvriltvatll. What is prob of picking 2 l and 1 r? 6/91 Four letters picked without replacement from {x: 2, y: 1, l: 5, m: 2, r: 1, g: 4}. What is prob of picking 1 y, 2 m, and 1 g? 4/1365 Calculate prob of picking 2 e when two letters picked without replacement from fffee. 1/10 Two letters picked without replacement from {o: 1, h: 1, w: 1, n: 1, f: 2, v: 1}. Give prob of picking 1 h and 1 v. 1/21 Four letters picked without replacement from {s: 3, v: 8}. What is prob of picking 1 v and 3 s? 4/165 Two letters picked without replacement from cccciiccccciccc. Give prob of picking 2 c. 22/35 Four letters picked without replacement from aatatt. Give prob of picking 2 a and 2 t. 3/5 Calculate prob of picking 2 c, 1 k, and 1 t when four letters picked without replacement from ckwckcccwtckx. 9/143 Three letters picked without replacement from {m: 2, q: 12, j: 3}. What is prob of picking 1 j and 2 m? 3/680 What is prob of picking 2 x when two letters picked without replacement from {a: 16, x: 2}? 1/153 What is prob of picking 2 o when two letters picked without replacement from {r: 2, o: 8}? 28/45 What is prob of picking 1 x and 1 h when two letters picked without replacement from hxhxhhhhxhhh? 9/22 Calculate prob of picking 2 y and 1 w when three letters picked without replacement from {w: 1, y: 14}. 1/5 Four letters picked without replacement from nnnnnennnnnnn. What is prob of picking 4 n? 9/13 Three letters picked without replacement from {i: 2, y: 7, e: 3, n: 5, d: 2, v: 1}. Give prob of picking 1 e and 2 d. 1/380 Calculate prob of picking 2 h and 1 u when three letters picked without replacement from pvkhouvpvhkpoph. 3/455 Two letters picked without replacement from vvkkvvvvkvvvvvv. What is prob of picking 1 k and 1 v? 12/35 Calculate prob of picking 2 e and 2 z when four letters picked without replacement from wezdeaddze. 1/70 Calculate prob of picking 3 u when three letters picked without replacement from {u: 10, c: 10}. 2/19 What is prob of picking 3 f when three letters picked without replacement from jjfjjfjfjfjfj? 5/143 What is prob of picking 1 u and 3 v when four letters picked without replacement from vvkkvkkkxuy? 1/330 What is prob of picking 1 x and 3 r when four letters picked without replacement from {g: 1, v: 1, x: 2, r: 3}? 2/35 Two letters picked without replacement from {q: 2, k: 8, f: 5, p: 1, i: 2}. What is prob of picking 1 i and 1 p? 2/153 Two letters picked without replacement from ixuxxxuxxuxxxxxiuxix. What is prob of picking	{ "pile_set_name": "DM Mathematics" }
, 3s = 3n + 3 for s. 2 Let o(u) = -4u2 + 5u - 11. Let s(q) = q*2 + q + 1. Let r(a) = o(a) + 5s(a). Let d be r(-11). Solve 2z + 2j = 6z - 8, -3z - 7 = dj for z. 1 Let b(u) = u3 + u2 - 2u + 3. Let s be b(-5). Let f = s + 91. Solve fl + 2d = 18, 3l + 4 = 5d - 2 for l. 3 Let a(w) = -w*3 + 8w*2 + 22w - 18. Let b be a(10). Solve bx - 13 = 5z, 3x + 1 = 4z + 10 for x. -1 Let f(p) = p*2 - p - 1. Let d(t) = 6t*2 + 11t + 7. Let o(x) = -d(x) + 5f(x). Let j be o(-15). Solve -5r + 5 = 5q, -5r = jq - 1 - 2 for q. 1 Suppose -9y + 4y + 10 = 0. Let x be y + (0/(-1))/3. Solve -2j - a + x - 11 = 0, 0 = -5j + 2a for j. -2 Suppose 4j + 15 = 3x, 2j + 5 = x - 0j. Suppose -5h - 40 = -5d, -d + xd - 67 = -3h. Solve 2p - 9 = -3z, -4p = -4z + d - 1 for z. 3 Let z be (14/(-4))/(6/(-12)). Suppose -2v - 2j = -j - z, 5j - 7 = 4v. Suppose 3b - 8 = -l + 2, 5l - 12 = 4b. Solve v = -4x - k, -lk - 7 = 1 for x. 0 Suppose 0 = -5j + 3v + 15, -40 = -4j - 2v - 6. Suppose jo - 28 = 20. Solve -o = -t + 2y, -2 = 4y - 3y for t. 4 Let w(k) = -k3 + 12k*2 + 13k + 7. Let m be w(13). Suppose 0 = -mr + 6r + 2. Solve rh + 6 = -3q, -3h = 2q - 5h - 6 for q. 0 Suppose -3b + 142 = -5s + s, -3s = -b + 49. Let q = 11 - b. Let h = -30 - q. Solve 5p - hu = -u - 5, -1 = p + 4u for p. -1 Let h be (-3)/(-9) - 154/(-6). Suppose -f + 4i - h = -6f, 0 = -4f - 2i + 16. Solve 3c + 24 = -4j, 0c - 2j = -c + f for c. -4 Suppose 0 = 2t + 2t - 16. Suppose -2a + 3h + 2h = -35, 2h + 46 = ta. Solve 2b = 3v + 7, -4b + 2v + a = -8 for b. 5 Suppose 3t - 5v + 9 = 0, v - 7 = t - 2v. Suppose t = -3j + 8. Solve -m = y, 4 = -jy - 2y - 2m for y. -2 Let l = -1953 - -1975. Solve 7w = -h + 3w + 7, 2h + l = 4w for h. -5 Let o = 492 - 490. Solve -w - 3s + 0s + 13 = 0, 0 = w - os + 2 for w. 4 Let c(o) = -16o2 + 110o + 17. Let u be c(7). Solve 5b + l - 18 = 5l, 0 = 3b + ul for b. 2 Let l = -3 - -25. Let t be (-1 + (-5)/(-4))/((-2)/(-24)). Suppose 2u = 5y + 3u - 18, ty = -u + 10. Solve -5x - 5o - l = -3o, x + yo = -8 for x. -4 Let t be (-1)/3 - (-38)/6. Let h be -1(-4)/(8/t). Suppose 2r + a - 10 = -r, -3a = -h. Solve 2 = 3p - 2g, 2p - rg - 3 = -2p for p. 0 Let g(q) = 6 + 1 - 12q2 + 13q*2 - 4q. Let j be g(6). Solve -4k = -6d + 4d + 10, -4k - j = -5d for d. 3 Let i(r) = 2r + 2. Let c be i(-1). Suppose 2p - 3b + 7 = 0, c + 13 = -3p + 5b. Solve -pa = -4n + 4, 14 - 4 = 2a + 2n for a. 2 Let m(w) = -w*3 - 6w*2 - 9w + 1. Suppose -4y - 2k - 26 = 0, -21 - 20 = 4y + 5k. Let t be m(y). Solve 0 = -4v + 3v + tn + 16, -2n + 4 = -3v for v. -4 Let b be (-21)/14(-8)/6. Suppose -80 + 6 = -ba. Let d = -17 + a. Solve 4w - s - 3 = d, -3w = 5s for w. 5 Let k = 859 + -849. Solve 2 = 3v - k, 0 = -4i - 4v + 16 for i. 0 Suppose 0 = 5o + 6 + 14. Let p = -10 - o. Let q be -10 + 9 - (p + 1). Solve -3m - qn - 5 = 0, 0m + 2n = -3m + 5 for m. 5 Let r(z) = -z2 + 6z - 8. Suppose 19x = x + 72. Let o be r(x). Solve -3m - 12 = -o, 0 = -3u - 3m - 24 for u. -4 Let h(d) = -2d2 - d + 7. Let l be h(-3). Let q = l + 11. Suppose 2n = 7 - q. Solve -4u - 22 = w, 10 = -3w - nu - 6 for w. -2 Suppose 5j - 2p - 40 = 0, 33p = -3j + 38p + 43. Solve 0 = -2l - o + 3 + j, 2l = -5o + 5 for l. 5 Let i(l) be the first derivative of -l3/3 - 3l*2 - 3l + 1. Let v be i(-5). Let u = -284 + 286. Solve x + 6 = -4w, -uw = vx - 0x + 6 for x. -2 Let d be ((-116)/(-6))/(-2 + 16/6). Suppose 11q = 4 + d. Solve x - 5 - 2 = -qn, 4n - 13 = -5x for n. 2 Let j = 437 + -433. Solve jp = 3f + 3, 4p - 3p + 13 = -2f for p. -3 Let n(t) = 12t + 72. Let x be n(-5). Solve 5d + 4k = -x, -5k = -4d - 10k - 15 for d. 0 Suppose 4z - 20 = 5f, 4z + 6f = 7f + 36. Let l be -3 + -1 + z - 3. Solve -2c + 23 = -lg, -g + 7 = 3c - 0 for g. -5 Suppose 0v - v - 3 = 2o, 0 = -4o. Suppose 0 = -3c + c + 4. Let k be 13/c + v/2. Solve 4d - 8 = 2d, 28 = kp + 2d for p. 4 Let r be (-2)/(-1) + 0 - 2. Suppose r = -3g + 25 + 26. Solve 5d - 16 = -2b, 0 = 4d + 2b - g + 5 for d. 4 Let p(q) = -6q + 161. Let g be p(26). Solve 0 = 3j + 4m + 16, -5j + 2m + 13 = g for j. 0 Let z = -28 - -42. Let f be 4/z + (-5)/(70/(-24)). Solve fd = 4d - 5l - 18, -2l - 12 = 4d for d. -1 Let g = 780 + -778. Solve -2o + gt + 3t = -35, 2o = 2t + 20 for o. 5 Let q(n) = -5n - 11. Let d be q(-3). Suppose p = 2p + dy + 7, y = -3p + 23. Solve -5h = j + p, -j + 3j + 5h = -8 for j. 1 Let z = 18 + -18. Suppose n + 3d = 15, 3n + 9 + 2 = 5d. Solve 4o = o - 5m, no - 3m = z for o. 0 Let w(v) = v2 - 34. Let o be w(-6). Suppose 0 = -3m + 12 + 3. Suppose -t + ot + 2r - 23 = 0, 1 = 2t - mr. Solve 3h - 3g = 6, 3h + g = -3g + t for h. 3 Suppose 2w = 7w - 20. Suppose 0 = -p + wm + 6, -3p = -2p + 3m + 1. Solve -5q - 1 = -4s, -4q + p = s - 14 for s. 4 Let j be -1 + 1065/51 + (-42)/(-357). Solve 0 = -5p - j, -c - 4p = 4 + 9 for c. 3 Suppose -3c + 5a = -c - 22, -5c = -4a - 38. Let f = 10 + 44. Suppose -b = -19b + f. Solve -u + 3z + 9 = 0, cu - bu = 5z + 15 for u. 0 Suppose 10i - 467 = -447. Solve ib = 3o - 11, 4b = -4o + 4 + 4 for b. -1 Let f = -55 + 62. Let q be f + 7/(21/(-6)). Solve -5 = -5h - 5r, -4h - qr = -4 - 1 for h. 0 Let j be 8/(-10)45/(-6). Let t be (-28)/56(-10 - 0). Solve 0 = 5r - 4u - 32, r + tu + 35 = jr for r. 4 Let t(b) be the second derivative of b3/6 + 23b*2/2 + 15b. Let c be t(-14). Solve 0 = 3h + 5m + 4, -1 = h - 3m - c for h. 2 Suppose -3b = -7x + 2x - 45, -b + 29 = -4x. Suppose 2 = 2i - 20. Solve i = q + bg, -5g + 9 = -3q + 2 for q. 1 Suppose 214 = 8j + 190. Solve 0 = 4s - ju + 1, 0 = 3s + 5u + 6 - 27 for s. 2 Let p = 14 - 5. Let k(m) = m*2 - 4m + 6. Let b be k(p). Suppose 0 = -5o + 3q + 63, 0 = 5o - 5q - 4 - b. Solve -2n - o = -2d - 5n, -n + 6 = d for d. 3 Let q(j) = 6j + 24. Let x be q(-11). Let c = -32 - x. Suppose -c = -5p - 0. Solve py = -4f - y - 8, -y - 2 = 2f for f. 1 Suppose -8z + 9z - a = 6, z - 3a = 12. Solve -17y + 22y + 20 = 5b, zb = -3y for y. -2 Suppose -x + 12 = -2d, 3x + 2 = -d + 3. Let p be x(2 + 1/2). Suppose -4 = -v - 2q + 5, -q + 18 = 2v. Solve -7 = -3m - pl, 16 = 5m - 5l - v for m. 4 Let k be 4 + (-8)/(1 + 3). Solve 4s + kp - 2 = 0, 3p + 0p = 4s + 23 for s. -2 Let n be 6858/567 - 4/42. Solve 5s = -3x + 25, -4s - 3x - n = -7x for s. 2 Suppose -2t - 12 = -3g, 7g - 4t - 14 = 6g. Solve 7q = 3q - gk, 0 = -4k for q. 0 Let k(p) = p*3 - 5p*2 - 2p. Let g be k(4). Let d = -19 - g. Solve -5z + 0z = dm - 35, 0 = m - 5z + 23 for m. 2 Let o(c) = 10c + 87. Let b be o(-6). Let z be (-2)/6 + 144/b. Solve zf + 10 = r + 4r, 5f + 12 = 4r for r. -2 Let v be 10/(-20)56/(-2). Let n = v + -9. Suppose -12 = -0t - 2t. Solve 3d = -d + nr - 7, 3d = 4r - t for d. 2 Let l = -17 + 13. Let k = 3 + l. Let w be k/(-5) + 159/5. Solve 3s - 2r + 0r + 19 = 0, -4r + w = -4s for s. -3 Let o = -126 + 256. Suppose 0 = 5i + 5s - o, i - 23 = -2s + 3. Solve c + i - 1 = 4a, -c = a for a. 5 Let k = -6 + 15. Let a be (-6)/k-3-2. Let o = -2 - a. Solve ox - 11 = 7q - 2q, 0 = 5x + 2q + 16 for x. -2 Suppose u + 13 = -5m + 8m, -9 = -2m + u. Solve -33 = mf - 5n, 2n - 10 = -2f - 4 for f. -2 Let r(j) = -j2 + 9j + 2. Let y be r(5). Let m = -20 + y. Solve -mc + 5p = -7, 6p - 2 = -4c + 4p for c. 1 Let s = -1178 - -1182. Solve c = 4k + 8, 0c - c + s = -2k for k. -2 Suppose 0 = 4g - 5o - 8, 0 = 2g + 2g - 2o - 8. Suppose -4 = 2l, -gs = -s + 2l - 1. Let m = -14 + 18. Solve -sh + 0k + m = 2k, 3h - 2k = -4 for h. 0 Suppose 2k = -157 + 161. Solve 0 = p - 1, 0 = -n - p - k for n. -3 Let q = -1462 + 1467. Solve -4n - 10m + 5 = -5m, -1 = qn - m for n. 0 Let d(t) = 3t + 7. Let p(f) = f + 2. Let j(a) = -d(a) + 5p(a). Let g be j(1). Solve 0 = -2h + 2o, -4h + go - 3o = 4 for h. -2 Let i(m) = 6m*2 - 7m + 6. Suppose -10 = 2v - 6v - 3r, 0 = 2v + r - 4. Let k be i(v). Solve -4d - kz = 29, -3d = -4d - 2z - 11 for d. -1 Suppose -3m = -9 - 18. Suppose 0 = 11t - 14t + m. Let x be (0 + -2)/(t/(-6)). Solve 4w + 18 = 5r, -5w = xr - 0 +	{ "pile_set_name": "DM Mathematics" }
n g, 3, 5? g Let g = 19665 - 137657/7. What is the nearest to g in -2/1213, -2, -3/4? -2/1213 Let t be (-106)/(-90) - 203/145. Which is the nearest to t? (a) -0.4 (b) 5 (c) -4/15 c Suppose 0 = j + 4j + x - 17, -9 = 3x. Suppose -w - 5 = 4h, -15 = -w + jw. Let q be (-24)/(-35) + (-4)/10. Which is the closest to -0.2? (a) h (b) q (c) 2 a Let f = -0.8896 + -0.4104. What is the nearest to 2 in -4, -1, -0.2, f? -0.2 Let o = 2 - 2. Let y = -1617/3365 + 458/673. Which is the closest to 3? (a) y (b) -15 (c) 4 (d) o c Let v(k) = -7k - 127. Let f be v(-18). Let q = 3.01 + -2.81. Which is the closest to -2? (a) q (b) -5 (c) f (d) -1/2 c Let i = 230/427 + 2/61. What is the closest to 178 in 3, -3/7, i? 3 Let n = -76 + 89. Let b = -15 + n. Let a = -16.4 - -2.4. What is the closest to b in 0.2, -0.1, a? -0.1 Let h = -2.399 - -2.299. Suppose 30 = -r - 5r. Which is the nearest to r? (a) -2 (b) h (c) 0.3 a Let p = -18.905 - -13. Let h = 0.095 - p. Which is the nearest to h? (a) 0.1 (b) -5 (c) -4 a Let f = -119.1 - -119. Let s be (-1045)/(-150) + -5 + -2. What is the nearest to f in -3, -0.1, s? -0.1 Let t = 0.06 + 0. Let b = 0.14 + t. Let p = 0.2284 - 2.2284. What is the closest to b in 0.3, 2, p? 0.3 Let o = -188 - -186.936. Let k = -0.064 - o. Let h = k + -0.9. What is the closest to h in -6/7, 4, -3? -6/7 Let l = -8 + 8.1. Let h = -1111 + 1111.5. Let k = 2 + -2. Which is the nearest to k? (a) -1 (b) h (c) l c Let o be (-3)/(63/(-2))((-980)/30 - -35). What is the closest to o in 0.2, -1, -280, -2? 0.2 Let z = 0.575 - 0.285. What is the closest to z in -3, 1/3, -21? 1/3 Let x = 0.26 + -0.36. Let q = -25.1 - -25.2. Which is the nearest to x? (a) 2/7 (b) q (c) -4 b Let q be 15/40 - ((-148)/(-96) + -2). Let l = 7/6 - q. Which is the nearest to 2/7? (a) l (b) 4 (c) 2/7 c Let d be 1(-1)/6 + 0. Let t be 8/(-14)5(-3)/(-20). What is the closest to 1/6 in t, -3, d? d Let o = -1 - -1. Let q = -2 - 2. Let r = -4151 + 4150.9. Which is the nearest to o? (a) q (b) r (c) 5 b Let g = 222.93 - -1.07. Let r = g + -236. What is the closest to r in 4/3, -0.3, 2? -0.3 Let h = -57828/7 - -8233. Let l = h + 28. Let g = 0.093 - -0.107. Which is the closest to 2/11? (a) g (b) -2/5 (c) l a Let w be -4((-56)/364 + (-17)/(-26)). Let p = -79 - -83. What is the closest to 2/3 in w, -0.65, -3/7, p? -3/7 Let f = 2.14 + -2.24. Which is the closest to f? (a) 5 (b) 1 (c) 24 (d) 4 b Suppose i = q - 175, 3i = 5q + 2i - 867. Let s = -173 + q. Let x = -2/105 - 58/105. Which is the nearest to x? (a) s (b) 1 (c) -0.4 c Let j be -1 - 52/360-3. Let t = j + 7/30. Which is the closest to 2/5? (a) 1/7 (b) 14 (c) 3 (d) t a Let z = 20 + -15. Let j be (-180)/(-108)-31. Which is the nearest to 3/4? (a) j (b) 4 (c) z b Let f be (-3)/45 - 2/(-5). Let i = -149 + 203.5. Let r = i - 55. Which is the closest to f? (a) r (b) 4 (c) 0.2 c Let t = 1/3577 + 2043/3577. What is the closest to -1/3 in t, 0.2, -0.3, -8/7? -0.3 Let l(p) = -p3 + 7p*2 + 20p - 21. Let q(s) = -3s - 24. Let m be q(-11). Let g be l(m). What is the nearest to 0.5 in -1/4, 0.4, g? 0.4 Let n = 34241 + -34233. Which is the closest to -5? (a) -0.4 (b) n (c) 0.88 a Let m be (468/(-54))/((70/(-21))/5). Which is the nearest to m? (a) 0.01 (b) -1 (c) 0.09 c Let p = -7.33 + -0.67. Let h = 52 - 41. Let i = p + h. Which is the closest to 5? (a) i (b) 0.3 (c) -2/13 a Let r = 8.49 + 0.11. Let t = 3.6 - r. What is the nearest to 1 in -1/2, t, 4? -1/2 Let r = -0.187 + 0.387. Let n = -34.43 - -39.43. What is the closest to 2/3 in r, 6, n, -3/8? r Let g = 0.15181 - 856.15181. What is the nearest to g in -4, 0.4, 0.1? -4 Let i be (315/12)/(1/(-16)-6). Let p be (1 - 1) + i/(-245). What is the nearest to -2 in -0.07, p, -4? p Let h(x) = -3x - 5. Let y(z) = 7z + 11. Let c(g) = 13h(g) + 6y(g). Let m be c(9). Suppose -7s + m = -9s. What is the nearest to 2/5 in s, 0.4, -0.1? 0.4 Let u = 16412.13 + -16412. What is the nearest to u in 0.4, -4, -1, 0? 0 Let a = 980.4 - 978.7. What is the nearest to -0.1 in -1, -1/4, a, -10? -1/4 Let m = -15.07 + 0.07. Let v = m + 15. Let y = -0.014 - 0.186. Which is the nearest to v? (a) y (b) -6/7 (c) -4 a Let d = 13.73 - 50.73. Which is the nearest to 1/11? (a) 5 (b) 3 (c) d b Let l = 162 - 1132/7. Let x(i) = i*3 - 40i*2 - 175i - 49. Let o be x(44). What is the closest to l in 0.6, o, 1? 0.6 Let h = 1139 - 1169. What is the nearest to -1 in -1, -1/7, h? -1 Let u = -1.98 + -0.02. Let g = 19933 + -19932.9. Which is the closest to g? (a) 2 (b) u (c) -9 a Let s = -13.6 + -4.7. Let p = -18.4 - s. Which is the nearest to p? (a) 4 (b) 26 (c) 1/3 c Let h = -0.04848 - 4.95152. Which is the nearest to 4? (a) h (b) 1 (c) 11 b Let f be (-6 + -2)/((-4)/(-34)). Let y = 64286/5 - 12925. Let d = y - f. What is the closest to 1 in 5, 0.5, d? 0.5 Let q(n) be the first derivative of -3n2/2 + 35n + 73. Let l be q(12). Let s be 2/(-2)(-4 - -1). What is the closest to l in s, -3/4, 3/8? -3/4 Let h = -10133.8 + 10134.06. Let j = -2 - -2. What is the nearest to -1 in h, 1/2, j? j Suppose 20 = 3c + 2c. Suppose -56f - 85 + 1297 = 146f. What is the closest to 10 in 0.2, c, f? f Let j be (6/(-8))/((-142)/1704) + -308. What is the closest to -7 in j, 0.3, 4? 0.3 Let c = 1278 - 3839/3. What is the nearest to -1 in -9, 1, c, -2/5? -2/5 Let z = 205 - 199.92. Let m = -1.094 + 0.014. Let p = z + m. Which is the closest to -2/5? (a) -2/7 (b) p (c) 0 a Let i = -400.18 - 0.82. Let w = -400.6 - i. What is the closest to 1 in -1, w, -3/7, 6? w Let l be -2((-33)/2)/(-11). Suppose 0 = 5r + 3c - 19, -5r = -r + c - 18. What is the closest to 4 in -2/11, r, l? r Let s = -2886 - -11535/4. What is the closest to 1/5 in 6, 2/13, s? 2/13 Let l(g) = g3 - 9g*2 + 23g - 16. Let z be l(4). Which is the nearest to -1/3? (a) z (b) -0.3 (c) 3.48 b Let g = -30033 + 30028. Which is the nearest to -255/4? (a) -1/5 (b) g (c) -2/11 b Let t = -27.29 + 27.25. What is the closest to -2/7 in t, -1/4, 1/4, -0.8? -1/4 Let s = 0.1 - 0.1. Let m = 85803/343196 - 1/85799. Which is the closest to -2? (a) 4 (b) m (c) -1 (d) s c Suppose 6t = 3t + 621. Let r be (-46)/t + (5/3 - 1). Let s = -1 + 3. Which is the nearest to s? (a) r (b) 6 (c) -5 a Let l = 91.101 - 3.101. What is the nearest to 2/3 in -2/11, 4, l, 1? 1 Let m be (8/30)/(2/(-5)). Let y(k) = k*3 - 7k*2 + 2k + 24. Let p be y(6). Let t = -0.98 - 0.02. What is the nearest to p in t, 0, m? 0 Let h(c) = -2c - 17. Let n be h(-9). Suppose -2d - 58v = -59v + 15, -5v + 15 = 2d. What is the nearest to 1 in -4, n, d, -2/21? n Let u = 103 - 111. Let o = 43.98 + -44.38. What is the nearest to 1 in 0.1, o, u? 0.1 Let q be 2/82 - 12/21. What is the closest to 2/9 in 2/7, 0.09, q? 2/7 Let k be 1/(-13)(-2 - 0). Let l = 1155 + -1156. Which is the nearest to l? (a) 0.5 (b) k (c) 2/87 c Let w = -2272/273 + 178/21. What is the closest to -1/2 in 1, w, -4/9? -4/9 Let l = -39701/12810 + -1/1281. Let r = -119/40 - l. Which is the closest to -1/2? (a) 1/3 (b) 0.5 (c) r (d) -2 c Let v = 1.4195 + -1.9195. Which is the nearest to 0.1? (a) 1/17 (b) 5 (c) v (d) -2/9 a Let h(k) = -k*3 - 11k*2 - 10k - 111. Let j be h(-11). Let m = 14 + -13.9. Let t = m + -0.31. Which is the nearest to j? (a) -3 (b) -4/3 (c) t b Let j be (-1)/6(-8)/(-6). Let w = -8802 - -8801. What is the nearest to 13 in 2, j, w? 2 Let t = -0.08457 + 0.58457. Which is the closest to -16? (a) 0.2 (b) 28 (c) t a Let u = -229.9 - -238.9. Which is the nearest to 6? (a) u (b) 1/7 (c) -1 a Let o = -1.056 + 1.296. Let h be -21(-3)/27. What is the closest to h in -2, -2/5, o? o Let x = 66259 + -66259.3. Let q = 298 + -5068/17. Which is the nearest to -1/4? (a) 0.5 (b) q (c) x c Let i = -22.51 - -0.51. Let s = -29.2 - i. Let y = 7 + s. Which is the nearest to y? (a) -2 (b) -1/5 (c) 0 b Let j = -6 + 37.1. Let k = -31.4 + j. Which is the nearest to -1/4? (a) k (b) 0.5 (c) 2 a Let j = 4389 + -4389.1. What is the closest to 0.3 in -12, 8, j? j Let p = 30 + -28. Let u be 21/77(-15 + 4)/(-2 - -1). Which is the nearest to 23? (a) u (b) -3 (c) -1 (d) p a Let m = 1422 - 1418. What is the nearest to -0.1 in m, -2, -0.089? -0.089 Suppos	{ "pile_set_name": "DM Mathematics" }
0. Suppose 4005 = 5b + 2l - 7l, u = 4b + 3l. Round b to the nearest 1000. 1000 Suppose -4133 = -3u - n - 1256, 0 = 5u - 5n - 4815. Round u to the nearest one hundred. 1000 Let m = -26 + -17. Let u = 42.9999967 + m. Round u to 6 decimal places. -0.000003 Let w = 336 - 333.03. Let y = -3 + w. Let m = 0.18 + y. Round m to 1 dp. 0.2 Let u(i) = -899i2 + 7i + 2. Let t(v) = v*3 + 6v*2 - 7v + 7. Let n be t(-7). Let x be u(n). What is x rounded to the nearest 10000? -40000 Let m = -5 - -5.0011. What is m rounded to three dps? 0.001 Let o = 2623.1994 - 2621.1. Let w = o - 2.1. Round w to four dps. -0.0006 Let a be 2 + (-483862)/(5 + -3). Let t = -1088556 + 646627. Let q = t - a. What is q rounded to the nearest 100000? -200000 Suppose -6w - 1395388 - 104612 = 0. What is w rounded to the nearest 100000? -300000 Let z = 0.00953222 + 4.99047378. Let a = 3.8 - -1.2. Let i = z - a. Round i to 6 dps. 0.000006 Let c = -1055 + 1054.9507. Round c to 2 decimal places. -0.05 Suppose -4j - 200730 = -2r + 169062, -4j = -r + 184900. Let d(y) = -10320y - 12. Let q be d(9). Let x = r + q. Round x to the nearest ten thousand. 90000 Let s(d) = 474d*2 + 3d - 2. Let l be s(2). Round l to the nearest 1000. 2000 Let q = -5 + 9. Let j be 2 + (0 - -1) + -1. Suppose jr + r + 99988 = 2m, -r + q = 0. Round m to the nearest 10000. 50000 Let a = 96.6 + -83. Let j = -142.6 + a. Let u = 128.9999929 + j. Round u to six dps. -0.000007 Let v = 13.7 - -2.9. What is v rounded to zero decimal places? 17 Let w = -309 - -207. Let g = w + 113.2. Let b = -10.73 + g. Round b to one dp. 0.5 Let j = -39 + 22. Let w = j - -17.000112. Round w to 5 decimal places. 0.00011 Let z = 32 - 30.8. Round z to 0 dps. 1 Let x be 2549/(-5) + 3/(-15). Round x to the nearest one hundred. -500 Let d(k) = 1806k2 - 4k + 8. Let p be d(6). Suppose 4u - p = -u. What is u rounded to the nearest 10000? 10000 Suppose -3 = -2x - 1. Let s be x/(-3) + 40/12. Suppose -6z - 26800012 = -2z - sq, 3z + 20099988 = -3q. Round z to the nearest 1000000. -7000000 Let j(s) = 738s3 - s2 - 4s. Let x be j(4). What is x rounded to the nearest 10000? 50000 Let u(i) = 245001i*2 - 7i + 10. Let v be u(2). What is v rounded to the nearest one million? 1000000 Let g = -22.00019 - -22. What is g rounded to 4 dps? -0.0002 Let g(s) = 3 + 167s + 105s - 1 - 38s. Suppose 2j + 5l - 14 = 0, -j = -3l + 4 - 0. Let q be g(j). Round q to the nearest one hundred. 500 Let x = 1842.863 + -1842. Let f = x - 0.053. What is f rounded to 1 decimal place? 0.8 Suppose -12001 = x - 2d - 2689468, 0 = -4x - 4d + 10709808. Suppose -b + x + 3322543 = 0. Round b to the nearest one million. 6000000 Suppose -12a + 333577807 = 1177807. What is a rounded to the nearest 1000000? 28000000 Let n be (-4 - -7) + -3 + -80000. What is n rounded to the nearest 10000? -80000 Let z = 0.06752 - 0.07. What is z rounded to four dps? -0.0025 Let t = -0.803 + 0.8. Let i = -0.1005 + t. Let o = i + 0.1. What is o rounded to 3 decimal places? -0.004 Let p = -2.200171 + 2.2. What is p rounded to 5 dps? -0.00017 Let s = 4 + -2. Suppose -344 = b + sb + f, -2b = 3f + 234. Round b to the nearest 10. -110 Let r = -115.71 + 1.71. Let i = r + 113.13. Let d = i + 0.87000051. Round d to seven decimal places. 0.0000005 Let p = 48 + -47.99999852. What is p rounded to seven decimal places? 0.0000015 Let o = -0.08 + 18.08. Let q = o + -17.99999992. What is q rounded to seven decimal places? 0.0000001 Let h(t) be the third derivative of -t5/60 - 5t3/3 - t2. Let u be h(-7). What is u rounded to the nearest 10? -60 Let r = -8 + 2. Let j be (1550/(-3))/(r/(-36)). What is j rounded to the nearest one thousand? -3000 Let d be ((-24)/30)/(2/10). What is d rounded to the nearest 10? 0 Suppose -k - k - 57590 = 0. Let c be (1 - 1) + (0 - -73795). Let q = c + k. What is q rounded to the nearest ten thousand? 50000 Let n = 0.34 - -0.11. What is n rounded to 1 decimal place? 0.5 Let l be ((-34560)/(-56))/(4/8750). Round l to the nearest 100000. 1400000 Suppose 0 = -2k - 19098748 - 39747432. Let w = k + 43738813. Suppose n = -w + 2815723. What is n rounded to the nearest one million? -12000000 Suppose 3k + 88699 + 28005 = -2n, -10 = 5n. What is k rounded to the nearest 1000? -39000 Suppose 0 = -3b - 5h + 3239975, 4b - 2b = -4h + 2159980. Suppose 2i + b = -2o, -5o - 1204321 = -5i + 1495679. Round o to the nearest 100000. -500000 Let m = 795350 - 95350. What is m rounded to the nearest one hundred thousand? 700000 Let y = -1673259127.00000053 + 1673259015. Let k = y - -112. Round k to 7 decimal places. -0.0000005 Let d = -0.75 - -0.13. Let y = d + -8.68. Let c = y + 2.6. Round c to 0 dps. -7 Suppose -5x = j + 701, 36 + 102 = -x + 2j. Round x to the nearest 100. -100 Let j = -46 + 46.00000182. Round j to 6 dps. 0.000002 Let p = -89 + 95.1. Let c = -7.1 - p. Let a = -13.83 - c. What is a rounded to 1 decimal place? -0.6 Let a = -15.8023 + 15.89. Round a to two decimal places. 0.09 Let h = 21.000088 + -21. Round h to five dps. 0.00009 Let l = 1045.3726 + -2062.35344. Let v = l - -1023.9808379. Let m = 7 - v. What is m rounded to 6 decimal places? 0.000002 Suppose 2l - y - 7 + 1 = 0, -2l - 3y = -14. Let m be 14803 - 6/(l - 2). Round m to the nearest one thousand. 15000 Suppose 7292 = 5g - g. Let m(t) = -45t*3 - 5t*2 + 4t - 3. Let n be m(-5). Let l = g + n. What is l rounded to the nearest 1000? 7000 Suppose -2h - 2p - 3 = 9, p = -4h - 15. Let b = -3 - h. Round b to 7 dps. 0 Let o = 16212 + -16228.002. Let l = o + 16. Round l to three decimal places. -0.002 Let m = 2288 - -598. Let f be 315/1 - (-2)/(-2). Suppose 5q = f + m. Round q to the nearest 100. 600 Let v = -2.80000028 + 2.8. Round v to seven decimal places. -0.0000003 Let q = -13166 - -19196. Let u(s) = qs - 25 + 27 + 6971s. Let d be u(-2). What is d rounded to the nearest ten thousand? -30000 Let i = -126.0000198 - -126. What is i rounded to six decimal places? -0.00002 Let w = 47 - 47.0684. What is w rounded to 3 dps? -0.068 Let k(f) = 10f + 10. Let r be -4(0 + (-6)/3). Let d be k(r). Let p be (d/(-8))/((-3)/(-720)). What is p rounded to the nearest one thousand? -3000 Let u = -7.811 - -8. Round u to two dps. 0.19 Let f = 355344 + -227344. What is f rounded to the nearest 10000? 130000 Let h = 0.094 + 0.13556. Let f = -0.052 + -0.178. Let m = f + h. Round m to four decimal places. -0.0004 Let k = 5.99999944 + -6. What is k rounded to seven decimal places? -0.0000006 Let p = 1.86 - 0.06. What is p rounded to the nearest integer? 2 Let m = -0.18 - 3.32. Let g = m + 4.78. Round g to one decimal place. 1.3 Suppose -88000002 = 4v - q, -2q = -3v + 2q - 66000008. Round v to the nearest 1000000. -22000000 Let v = -0.61 + 0.92. Round v to 1 dp. 0.3 Let d = -0.07364 - -0.069. Round d to 4 decimal places. -0.0046 Let f = -8.00092 - -8. What is f rounded to 4 decimal places? -0.0009 Let a = 20.008 - 20. Round a to three dps. 0.008 Let n be (-6)/(-3) - (-446)/2. Let m = -85 + n. What is m rounded to the nearest one hundred? 100 Let r = -3 - -3.00001. What is r rounded to four dps? 0 Let w = -1084 + 1083.97545. Let s = -0.023 - w. What is s rounded to 4 dps? 0.0016 Let m = -1.4 - -15.4. Let p = 13.999999 - m. What is p rounded to five decimal places? 0 Let u = -7.22281 + 452286.22281. Let j = u - 452279.02000012. Let h = j + 0.02. Round h to 7 decimal places. -0.0000001 Let n = 71 - 83.4. Let a = -7.9 + n. Let h = 20.29887 + a. What is h rounded to four dps? -0.0011 Let o = 236 + -235.999714. Round o to five dps. 0.00029 Let w = 141 - 141.203. Let v = w + 0.203083. What is v rounded to 5 dps? 0.00008 Let r = -921926235.00000122 - -921926185. Let u = r - -50. Round u to seven dps. -0.0000012 Let o = 2.9 - 0.9. Let f = 2.000014 - o. Round f to 5 decimal places. 0.00001 Let m(q) = -3499999q3 - q*2 + 2. Let j be m(-1). What is j rounded to the nearest 1000000? 4000000 Let i = -236683 + 121220. Let q = i + 72463. What is q rounded to the nearest ten thousand? -40000 Let s be (2349853/22)/(2/(-4)). Let l = 122623 + s. Round l to the nearest ten thousand. -90000 Let o = -27179539 + 27178262.1881. Let c = 1277 + o. Let i = c + -0.173. Round i to three decimal places. 0.015 Suppo	{ "pile_set_name": "DM Mathematics" }
alse Let o = -32/2833 - 373796/14165. Suppose -5r = -4u + 151, -2 = u - 6. Which is greater: o or r? o Let f = -0.12 - -3.62. Let s = 270 - 285.3. Let n = 16.3 + s. Which is bigger: f or n? f Suppose 57w = -56w + 3835 + 798. Which is greater: -32 or w? w Suppose 70a - 62a = 976. Let w = 121 - a. Is -3/220 greater than or equal to w? True Let m be (-1)/(296/90) - 2142/(-39627). Which is smaller: -2161 or m? -2161 Let o be (-242/12)/(11/121). Is 11 less than or equal to o? False Let o be 6/(-8) + 741/(-276) + 3. Let z = o + -19/115. Which is smaller: -1/17 or z? z Let s be 11/(-14) + 26/(-7) + 4. Suppose 532 = -h + n + 129, -h = -4n + 403. Which is greater: s or h? s Let l = 252/583 - -6/53. Let r = -42 - -46. Suppose 2 = -3a - 13, -2t - 18 = ra. Is l at least as big as t? False Let b(v) = v. Let c be b(4). Let w(j) = 6j - 26. Let z be w(c). Which is smaller: z or -0.12? z Let a be (-99)/(-21) + 1 + (-52)/13. Let i = a - 50/21. Is i less than or equal to 99? True Let a = 401.4 - 402.64. Which is bigger: -0.07 or a? -0.07 Let x = -2209.977 + 2210. Are x and -0.22 non-equal? True Let h = -202/363 - -67522/363. Is 185 < h? True Let g = 1187.729 + -1188. Let d = g - -0.471. Let l = -8 - -14. Is d smaller than l? True Let j = -3788 - -3365. Is j <= -423? True Let b = 4659 + -4635. Which is smaller: b or 0.26? 0.26 Let g(k) = 10k + 97. Let l be g(-7). Let d be ((-3)/(9/78))/(l + -29). Is d >= 10? True Let v = -238 - -239. Let a be (4/3 - v)-81. Which is smaller: a or -26? a Let j be (-3)/((-244650)/489272) + -6. Does j = 1? False Suppose 114 = 2u + 674. Let l be ((-6)/7)/(30/u). Let x be 4 + ((-44)/l - 4). Is x bigger than -7? True Let i be (-178020)/(-19092) - 91. Are i and -3/8 nonequal? True Let w = 919005581/10408 + -88298. Do -1 and w have the same value? False Suppose 5l + 3r = -2249, 0 = 2l - r + 74 + 830. Is l less than -454? False Suppose 0 = 5f - 845 - 235. Suppose 215u = -n + fu - 2, 0 = 3n + 2u - 4. Let c be 0 - 4/(-10)1. Which is smaller: c or n? n Suppose -5m + 17 = -4c, -m - 10 = 3c - 2m. Suppose 13 - 13 = -10k. Suppose 3x = -3i - kx - 6, i = 3x - 6. Is c > i? False Suppose -1352 = -103g + 107g. Let w = g - -129. Let s = w + 1466/7. Is -1/6 at most as big as s? True Let d = 11.7 - 6.4. Let s = d + -4. Let h = -0.08 - 0.12. Which is bigger: h or s? s Let s be 11/(19877/5)3/15. Is s not equal to 2? True Let k = -0.55 - -5.55. Let l = -33 - k. Let p = 35 + l. Is 0.5 smaller than p? False Suppose 25 = -5o, 0 = -5r - 4o + 3237 + 278. Is r at least as big as 708? False Suppose 252 = -19h - 9h. Let j(v) = -23v - 226. Let p be j(h). Is -18 != p? True Let f(j) = -70j + 561. Let x be f(8). Which is greater: -20/223 or x? x Let w(p) = 16p + 214. Let s be w(-13). Suppose -sb - 23b = 0. Is b at least -14/45? True Let a(k) = 7k - 15. Let y be a(-6). Let p = -29 - y. Suppose -2f + 5i = 2i - 69, -2f + 79 = -5i. Which is smaller: p or f? f Let a be (-29 + 23)4/30. Let q = -1.8 + -0.2. Is q less than a? True Let k be (-8)/4 - 7226966/(-3686302). Let s = k + 2/14513. Which is greater: s or 1? 1 Let d = 2081 + -1091. Suppose -14k + d = -5k. Which is smaller: k or 111? k Let l = -321.1 - -273.3. Which is greater: 3/4 or l? 3/4 Let i(s) = s*2 + 10s - 3. Let y be i(-6). Let n = 1111 + -1014. Let t = n - 97.3. Which is bigger: t or y? t Let q be (-40)/(-10) - (-12)/(-3). Suppose qk - 5k + 105 = 5p, 0 = 2p + 4k - 44. Suppose -p = 37c - 35c. Is c at most as big as -46/5? True Let h = -0.259 - -82.259. Let r = -140 + h. Which is bigger: 1/3 or r? 1/3 Let l = 0.4264 - 0.4644. Which is smaller: l or 3? l Let v = -15/44 + 1/11. Let q = -5.515 - 0.085. Let t = 5.4 + q. Which is greater: t or v? t Let i = 5269 - 5233. Which is greater: i or -3? i Let y(c) = -c - 6. Let o be y(-5). Let t be ((-734)/(-3000) - o/(-4))/2. Is 1 less than t? False Let r be ((-209)/5061)/(16/2712) - (-4 - 3). Which is greater: 0 or r? r Let a be (-1212)/42300/(-90). Is 95 at most as big as a? True Let c be ((-31)/(-186))/((-2)/(-12)). Is 24/893 smaller than c? True Let m = -236/41 - -556139/96596. Is m greater than or equal to -1? True Let b = -154004 - -153910. Let d be (1/6)/((-2)/(-6)). Which is greater: b or d? d Suppose -2w - 3 - 5 = o, -5o = -5w - 35. Suppose -2v + v + 150 = -3m, 0 = -3v + om + 450. Is 149 less than v? True Suppose -5u - 3j - 19 = -37, -3j - 12 = -5u. Suppose 2b = -0v + uv + 343, -5b + 4v = -847. Which is smaller: 169 or b? b Suppose -f = v - 109, 7v + 436 = 4f + 3v. Is -4 greater than or equal to f? False Let o be 1 + 36/4 - (5 + -1). Suppose -4r - 3m = -o, -2r - 3m = m - 8. Which is smaller: -1/56 or r? -1/56 Let n be (-4)/36(7 - 5 - 4). Suppose -7u - 25 = -2u. Let h(l) = l*3 + 3l*2 - 6l + 5. Let z be h(u). Which is smaller: z or n? z Let m = 15.2 + -7.4. Let r = m - -68.2. Let c = 76.41 - r. Which is smaller: 0.1 or c? 0.1 Let b = -1527 - -1522. Is -10.4 greater than or equal to b? False Let r(i) = -i*3 - 2i*2. Let t be r(-1). Let o be (-7054)/(-2178) - 3 - 6/27. Let z = o - -184/3509. Are t and z nonequal? True Let z = -13646 - -532502/39. Which is bigger: 9 or z? 9 Suppose 5z - 2f - 8 = 38, -f - 28 = -3z. Let s be 2/z(-50)/(-30). Which is smaller: s or 14? s Let v(j) = j - 6. Let w be v(5). Let n = -204 - -189. Let c be 35/n + (-6)/(-4). Is c <= w? False Let s = -183 + 182.7. Which is greater: s or 271? 271 Let o be (3 - 1)8-1. Let f = 253 - 197. Suppose 0 = 4q + f - 0. Is q smaller than o? False Let q = 11/12 - 3169/3444. Do q and -1 have the same value? False Let u = -0.00777 + -0.19223. Which is greater: u or 2/103? 2/103 Let m = 155582/127 - -113/254. Which is greater: m or 1227? 1227 Let f be ((136224/286)/8)/((-6)/4). Is -40 smaller than f? True Suppose -3a - 4j = 3128, 3j = 78a - 73a + 5194. Is a >= -1039? False Let k be -27(0 + 3)/(-9). Suppose kq - 214 = 7q. Suppose 5z + q = 227. Which is greater: z or 25? 25 Let b be (-12)/((49/3)/(-7)). Suppose 3t = 9, -a - 9 = -4a + 5t. Let j be a/((-16)/(-12)(-3)/(-2)). Do j and b have the same value? False Let v(s) = s2 + 23s + 41. Let c be v(-21). Let h be c/(5/(-25)-5)-205. Which is bigger: 206 or h? 206 Let u be 2/(-9) + 460/(-36). Let y = -2843 + 2829. Which is greater: y or u? u Let u = -3.8686 - 328.1214. Let m = -332 - u. Let v = 0.1 + -1.1. Which is bigger: m or v? m Let y be 4/22 + (-370)/(-22). Let j(a) = -14a3 - 2 + 18a*2 + 15a*3 - ya + 14 + 27. Let u be j(-19). Which is bigger: u or 7/25? u Let s be (-2274)/(-63) - (-226)/(-2373). Is -19 at most s? True Let h = -127.4 + 127.267. Is h <= 15? True Let n be (-2 + (-91)/(-14))4/36. Does n = 1122? False Let f(o) = 5o*2 - 101o - 107. Let t be f(-1). Is -2/77493 bigger than t? True Let k be (-198240)/(-2480) + -80 + (-33)/(-31). Let u = -129354/199 + 650. Is k not equal to u? True Let j be 3 - (6/(-18) - 2/(-6)). Let a be (2 - 9/j) + 25. Let r be (-626)/(-18) + a/108. Which is bigger: r or 34? r Let l = -358 - -230. Let y = l + 168. Suppose 0n = -4n + 164. Are n and y nonequal? True Let t = 673556/3 - 589361624/2625. Let i = t + -6/125. Let n = -7315 + 7315.2. Is i not equal to n? True Let c = -1.8354 + 1.8858. Which is greater: -25 or c? c Suppose -2s + 417 = 2w + 229, 4s + 352 = 4w. Do w and 6 have the same value? False Let m = -2681 - -9857. Let b = -35993/5 + m. Is -23 at most b? True Suppose -265 + 259 = -6x. Suppose p + 12 + x = 0. Let q(n) = n - 6. Let u be q(-5). Which is smaller: p or u? p Let o be 12/(-27) + 1 + (-147)/(-27). Suppose 3y - 2m - 14 = 3m, -2y + 1 = 5m. Suppose -os = -ys - 12. Is 3 != s? True Let b = 5.8506 + -5.95. Let a = b + 0.0294. Which is greater: a or 1? 1 Let o be (-20)/(-50) - (2 + (-50884)/(-2210)). Let z = o - -320/13. Is 0 > z? True Let k(d) = -932d - 2842. Let m be k(-7). Which is bigger: m or 3681? m Suppose 5z + 44 = -2m + 120, m = 3z - 50. Let n be 40(z/(-4) + 3). Are n and -155/4 unequal? True Suppose -1025 - 2939 = -21d - 856. Which is bigger: d or 144? d Let f = 10491/2 - 20981/4. Let g = 64 + -202. Is f less than g? False Suppose 0 = 34*k - 427 - 3993. Let h be (-39)/k - 26/(-20). Let f = 0.043 + 25.957. Which is bigger: h or f? f Let m = 156 + -155.925. Let g =	{ "pile_set_name": "DM Mathematics" }
et j(v) = -v*2 - 1900v - 63067. Determine j(-34). 377 Let u(b) = -45b - 3375. What is u(-72)? -135 Let o(c) = c3 - 19c*2 - 104c - 30. Determine o(-12). -3246 Let r(o) = o*3 - 10o*2 - 711o + 8275. Determine r(12). 31 Let l(b) = 13b2 + 1086b - 57989. Calculate l(37). -10 Let y(c) = -c + 1495. Determine y(40). 1455 Let t(x) = 5x3 - 12x*2 + 169x - 719. Give t(5). 451 Let v(k) = 30k2 + 378k - 7203. What is v(-23)? -27 Let i(a) = a*3 + 56a*2 + 298a + 2230. What is i(-51)? 37 Let n(m) = -m*2 + 306m - 11898. Calculate n(262). -370 Let w(v) = -41v3 + 8v*2 + 214v + 404. Give w(-2). 336 Let z(i) = i*3 + 433i*2 + 9604i - 5090. Calculate z(-24). -2 Let q(d) = 4321d + 69129. Calculate q(-16). -7 Let g(u) = 3u*3 - 30u*2 - 46u - 212. What is g(-8)? -3300 Let m(x) = x*3 + 382x*2 + 1206x - 256013. Give m(-377). -30 Let p(x) = 4x2 + 1316x + 42176. What is p(-36)? -16 Let w(m) = -2m3 - 37m*2 + 54m + 1028. Determine w(-20). 1148 Let i(d) = 810d2 + 12152d. Calculate i(-15). -30 Let m(y) = -7y3 - 462y*2 - 56y - 44. Determine m(-66). 3652 Let d(h) = 300h - 17388. Give d(48). -2988 Let h(r) = -20r*2 + 9671r + 362989. Calculate h(-35). 4 Let k(t) = -370t2 - 10731t + 21. Determine k(-29). 50 Let h(m) = 13m2 - 34m + 26. Give h(3). 41 Let b(y) = y*3 - 92y*2 - 267y - 3392. Determine b(95). -1682 Let t(x) = -1316x - 463328. What is t(-352)? -96 Let l(z) = 8z*3 + 85z*2 - 1129z - 11529. Calculate l(-10). 261 Let k(v) = -240888v - 10117310. Give k(-42). -14 Let k(t) = -22139t + 221239. Calculate k(10). -151 Let o(y) = 9y2 + 460y + 2989. What is o(-8)? -115 Let l(u) = -218u2 - 711u + 1308. What is l(2)? -986 Let m(t) = -4t3 - 130t*2 + 269t + 6786. What is m(-33)? 87 Let s(c) = -1965c + 13891. Calculate s(7). 136 Let k(x) = -16505x*2 + 165041x + 51. Give k(10). -39 Let r(q) = 1946q + 33368. Determine r(-17). 286 Let d(o) = -21422o + 235638. Give d(11). -4 Let k(t) = -5t3 + 24t*2 + 64t - 169. What is k(6)? -1 Let a(i) = 118469i - 13742404. What is a(116)? 0 Let c(b) = -2552b - 94433. What is c(-37)? -9 Let m(v) = -42v3 + 10v*2 + 32v + 21. Calculate m(-1). 41 Let w(b) = b*3 - 22b*2 - 212b + 5297. Calculate w(21). 404 Let u(z) = 33z2 + 7614z + 53362. Give u(-7). 1681 Let c(w) = 54288w + 108573. Calculate c(-2). -3 Let x(t) = -4t*3 + 58t*2 - 147t + 7. Determine x(7). 448 Let o(c) = 11c3 + 67c - 187. What is o(3)? 311 Let h(o) = -o*3 + 37o*2 + 183o + 174. Determine h(-3). -15 Let m(b) = 2b3 - 80b*2 + 125b - 172. Determine m(38). -1198 Let l(s) = -2552s + 17847. Give l(8). -2569 Let f(z) = 111018z - 3552587. Calculate f(32). -11 Let y(u) = u*2 - 55u - 1617. Determine y(-22). 77 Let i(f) = -f*2 - 8472f - 59253. Determine i(-7). 2 Let m(s) = 18s + 3030. Determine m(-124). 798 Let p(k) = -4487k - 421777. Give p(-94). 1 Let b(v) = v*3 - 22v*2 + 60v - 846. What is b(19)? -789 Let n(t) = t*3 - 120t*2 - 197t - 5674. Determine n(122). 60 Let y(p) = -38p - 11389. Give y(-300). 11 Let t(m) = -20236m - 206. Calculate t(0). -206 Let y(b) = b*3 - 63b*2 - 18b - 3193. Give y(64). -249 Let w(f) = 673f - 3425. What is w(4)? -733 Let z(i) = 55682i - 723841. Determine z(13). 25 Let x(h) = -5791h + 57619. Give x(10). -291 Let o(w) = -w3 - 4w*2 - 70w + 52. What is o(-13)? 2483 Let t(q) = 339q3 - 35q*2 + 6q + 3. What is t(-1)? -377 Let w(a) = -1249a - 53740. What is w(-43)? -33 Let u(l) = 8916l - 44573. Determine u(5). 7 Let y(w) = -11168w - 402043. Calculate y(-36). 5 Let z(v) = -v3 + 64v*2 + 1743v - 29643. What is z(81)? 3 Let r(v) = 1040529v - 10405294. What is r(10)? -4 Let t(a) = -a3 - 51a*2 - 295a + 216. What is t(-44)? -356 Let j(z) = z*3 + 2139z - 13025. Give j(6). 25 Let k(z) = -10524z - 484129. Calculate k(-46). -25 Let k(x) = -2x*3 + 119x*2 - 390x - 242. Give k(56). -130 Let r(x) = 6641x - 3666. What is r(0)? -3666 Let i(x) = x3 - 33x*2 + 508x - 6403. Determine i(23). -9 Let s(j) = 2j3 + 2216j*2 + 21946j - 15366. Determine s(-1098). 6 Let j(h) = h*3 - 10h*2 + 361h + 11048. Calculate j(-15). 8 Let m(g) = 7g2 - 2227g + 138874. Give m(233). 6 Let p(n) = 184n - 30345. Give p(174). 1671 Let y(p) = -86p + 1138. Give y(13). 20 Let g(y) = -y*2 + 469y + 419683. What is g(-454)? 641 Let k(x) = -5540x - 59633. Give k(-11). 1307 Let w(v) = v3 + 4v*2 - 512v + 3385. What is w(8)? 57 Let u(a) = 102a2 + 7a - 145. Give u(2). 277 Let c(a) = 61a3 + 969a*2 - 66a + 718. Determine c(-16). -18 Let f(v) = -77v - 13455. Give f(-180). 405 Let r(h) = 9992h + 149276. Determine r(-15). -604 Let l(m) = 2m3 + 62m*2 + 487m + 107. Determine l(-17). -80 Let n(d) = 1320d - 40954. What is n(29)? -2674 Let g(w) = -1356w - 25220. Give g(-19). 544 Let d(c) = -9511c + 276. Calculate d(0). 276 Let m(l) = -l2 + 9374l + 880416. Give m(-93). -15 Let v(g) = -158416g - 63049572. What is v(-398)? -4 Let s(y) = 248y - 26003. Give s(105). 37 Let w(v) = v*3 - 12v*2 - 288v - 312. Give w(-11). 73 Let b(x) = 3x3 + 104x*2 + 891x - 228. What is b(-17)? -58 Let c(v) = 8v2 - 238v + 1331. What is c(8)? -61 Let c(x) = -420x2 + 27722x - 137. What is c(66)? -5 Let m(d) = -2068d2 + 12420d - 26. Calculate m(6). 46 Let t(u) = -3u3 - 105u*2 - 8u - 121. Determine t(-35). 159 Let g(l) = -764l + 163486. What is g(214)? -10 Let i(q) = -q2 + 385q - 15030. Calculate i(341). -26 Let s(r) = 3r3 - 759r*2 - 3868r - 532. Calculate s(258). -16 Let d(w) = -w*3 - 64w*2 + 29598w + 583. Determine d(143). 154 Let z(d) = 476d + 28820. Calculate z(-61). -216 Let a(b) = -15925b - 1735888. Give a(-109). -63 Let s(z) = 16z2 - 154z + 106. Determine s(1). -32 Let g(h) = 16h2 + 9644h - 9647. Calculate g(1). 13 Let i(z) = z*3 + 17z*2 - 3923z - 73813. What is i(-19)? 2 Let k(t) = -84t2 + 988t + 209. What is k(12)? -31 Let i(y) = -141544y - 849267. Give i(-6). -3 Let t(y) = -3y*2 + 61y + 364. Give t(14). 630 Let g(o) = -11902o - 95348. What is g(-8)? -132 Let s(j) = -j3 + 45j*2 + 644j - 22882. Give s(20). -2 Let x(m) = 2m2 + 1138m + 5604. Calculate x(-5). -36 Let v(m) = -6m - 434. Determine v(19). -548 Let o(k) = -264807k + 3442483. Give o(13). -8 Let i(q) = -1181q - 8460. Calculate i(-6). -1374 Let g(z) = 144z + 14411. Determine g(-129). -4165 Let m(g) = -2g2 + 73g + 19051. Calculate m(116). 607 Let v(u) = -2903u + 493423. Determine v(170). -87 Let t(g) = 2g*3 - 127g*2 + 1519g + 14431. Calculate t(40). -9 Let t(h) = -5h2 + 330h - 253. Give t(63). 692 Let z(n) = -13n2 + 991n + 153. Give z(76). 381 Let g(u) = -719u + 146266. Determine g(203). 309 Let f(m) = -m3 - 102m*2 - 1868m + 11780. Calculate f(-75). 5 Let j(a) = -11a3 + 400a*2 + 693a - 59. Give j(38). 283 Let l(q) = -425001q + 1700025. Calculate l(4). 21 Let l(v) = 6v*3 - 13v*2 + 2v - 56. Calculate l(7). 1379 Let q(r) = 356r - 19020. Give q(54). 204 Let b(t) = -2238t + 28057. What is b(12)? 1201 Let q(t) = -629t2 - 188t - 6. Give q(0). -6 Let d(n) = -n*3 - 31n*2 + 37n + 2406. Give d(-27). -1509 Let j(g) = 10g - 355. Give j(-24). -595 Let q(o) = 67o*2 + 372o - 2768. Give q(7). 3119 Let x(u) = -86u3 - 11515u*2 + 1209u + 437. What is x(-134)? 35 Let p(s) = s*2 + 164s - 33542. Calculate p(118). -266 Let c(x) = 194x2 - 13758x - 826. Give c(71). 310 Let t(s) = s*3 + 51s*2 - 43s - 46. Give t(-52). -514 Let x(k) = 6k3 - 129k*2 + 708k - 296. What is x(12)? -8 Let q(w) = -35w3 - 750w*2 + 448w + 211. Determine q(-22). 35 Let b(s) = -4214s + 518328. Give b(123). 6 Let m(s) = s3 - 20s*2 - 348s + 7358. Calculate m(19). 385 Let v(x) = 510x + 235114. What is v(-461)? 4 Let b(w) = 3w*2 - 117w + 282. Give b(36). -42 Let x(b) = b*2 + 678b - 262129. What is x(275)? -54 Let b(f) = 2663f + 23514. Determine b(-9). -453 Let d(n) = 4n*2 + 304n - 1196. Determine d(-80). 84 Let m(w) = -8631w - 51345. Calculate m(-6). 441 Let h(f) = -21f*2 - 36f + 49. What is h(-5)? -296 Let v(z) = -37z2 - 484z + 105. Give v(-14). -371 Let p(z) = -z*3 + 26z*2 + 5608z - 35. Give p(89). 54 Let p(q) = q*3 - 2279q*2 + 15931q	{ "pile_set_name": "DM Mathematics" }
p*2 - 7p + 3. Let h be x(8). Solve y = q, -2z = -0z + 5q - h for z. 5 Suppose -12 = -2r - 4. Suppose 0 = m + rm. Solve 2x = -4w - 8, m = -5w + x + 6 - 30 for w. -4 Suppose 0 = -4v + 2v + 6. Let i = v + 0. Let x = 4 + 18. Solve 0 = -2s + 10, -c - is + x - 5 = 0 for c. 2 Let p be -2 + ((-6)/(-30) - 27/(-15)). Solve p = 5i + 2y - 35, -3i + 5y = 2y for i. 5 Suppose 0n = 8n + 336. Let f = -37 - n. Solve 0 = 3w + 5t - 7, 0 = -ft + 3 + 7 for w. -1 Suppose -5r + 26 = l + l, -3r - 96 = -5l. Suppose 26 - l = 2m. Solve -3f + b + m = 2b, 2f + 4b + 4 = 0 for f. 2 Suppose -5b = -3b - 18. Let z = 1316 + -1311. Solve -4y + 0y - 3s = -11, -s - b = -zy for y. 2 Suppose 4v = -4q + 24, -6 = -2q - 4v + 4. Let b be (6/3q - 3) + -3. Solve z - 18 = 4i, 0 = 3z + z - b for i. -4 Let x(u) = 6u*2 - u - 2. Let y be x(-1). Solve 4n - 18 = 3n + yt, 2n = -5t - 24 for n. -2 Let r(i) = 2i - 24. Let u be r(12). Suppose 5c - 2 + 2 = u. Solve c = -5s + 2k - 1, -s + 3k + 10 = -5s for s. -1 Let a(x) = -2x2 - 34x + 5. Let b be a(-17). Solve -bl = -5v + 3v - 16, -3l = -3v - 15 for l. 2 Suppose -15u = -174 + 129. Solve 4z = i - 0 - 5, 2z = -ui + 15 for i. 5 Suppose -150n + 174n - 72 = 0. Solve j + 17 = -5t, -j = nj + 3t + 17 for j. -2 Suppose -6b + 14b = 24. Solve -16 = -3y - 2i, 1 = by + 3i - 20 for y. 2 Let b = 24 - 46. Let o be (-4)/b - (-210)/55. Solve oq = 2h + 8 + 14, -2q + 13 = -3h for h. -1 Let u(v) = -v + 9. Let w be u(0). Let b be -3331/w. Let i be (33/b)/((-3)/2). Solve -g + 2g = -5t - 25, -ig - 15 = 3t for t. -5 Suppose 4p - 2 = x, -50 = 4x - 9p + 7p. Let b = x + 18. Solve -2t + 5t - 10 = -d, bt - d = 11 for t. 3 Suppose 3l - 7 = 4w + 15, 3l - 14 = -4w. Suppose j = u + 8, -10 = -j + 3u + l. Solve 5k + 5b - 40 = k, -jb + 21 = k for k. 5 Let s(p) = -2p - 10. Let g be s(-5). Suppose -v + 5v - 8 = g. Let o = 2 - v. Solve -2r - 10 = -or + 3m, 5m = -5r - 25 for r. -5 Suppose 5a + o - 103 = 2a, -3o = -3. Suppose 8 = 4t, 5g + 3t - a = -8. Solve -2y - 10 = -3y - 5l, gy + l = 2 for y. 0 Let t(g) = -g*2 - 12g - 30. Let q be t(-4). Solve -5y + 4c = 4, 3c + qc - 5 = 0 for y. 0 Let z(y) = y*3 - 31y*2 - 30y - 62. Let w be z(32). Suppose wj - 3 - 5 = 0. Solve jd - 4b - 20 = -0b, -d + 5b = -5 for d. 5 Suppose -356s = -351s. Solve y + 7 = k, -2y - 2k - 3k = s for y. -5 Let v = 449 + -444. Solve -g + 4b = -3g - 12, -3b - 16 = vg for g. -2 Suppose 3p - 17 = 4p. Let m = p + 21. Let n = 0 + 4. Solve nd = -d + mk, -4k = 20 for d. -4 Suppose -3t = 3c + 27, 4c + 11 = -2t + 3t. Let b(x) = 2x + 10. Let f be b(t). Solve n = -3k - 16, n + k = -fn - 6 for n. -1 Suppose -3n + 14 = 2t, -3n + t + 29 = -0n. Suppose -4i = -ni + 16. Let g = 6 - i. Solve -7a - 20 = -2a - y, 0 = -ga - y - 8 for a. -4 Let j(u) = u*2 - 13u + 3. Let r be j(-1). Let m = 4 + -1. Solve -v - ms = v - r, -s = -5v for v. 1 Suppose 4j - 22 = n - 6n, -2j + 20 = 4n. Solve 11i - ni - 10 = 0, -4m - 16 = 2i for m. -5 Suppose 0 = 5v - 5l - 85, -28l + 26l = -5v + 88. Solve -5h + 4h + 5 = u, -4h - 3u = -v for h. 3 Suppose 4u - 5 = 11. Let x(s) = 4s - 49. Let t be x(12). Let l = u - t. Solve -18 = m + lp - 2, 40 = 5m - 5p for m. 4 Let n(z) = 13z + 46. Let l(c) = 7c + 23. Let g(r) = -11l(r) + 6n(r). Let v be g(-16). Solve 3i = -2a + va + 8, 5a = 5i - 10 for a. -1 Suppose -k - 1 = -0t - 3t, 0 = 2t - 4. Let n = k - 4. Solve b - 10 = -3h, 2b + n = -2h + 5 for h. 4 Let j be (-3012)/(-48) + 1/4. Let k = j - 30. Solve 5y + 3o - k = -o, 0 = 5y + 2o - 29 for y. 5 Let v = 359 - 355. Solve 5i - 3 = 3z, 9 = vz + 2i - 13 for z. 4 Let b(h) = 5h*2 - 20h + 13. Let f be b(4). Solve -3u - 2u + f = -3k, -19 = -k - 3u for k. 4 Let x be -1 - 0 - 45/5. Suppose 0 = -3v + 2 + 37. Let o = v + x. Solve -z + 4 = 4g, 4g - 4 = -z + oz for z. 0 Let q be (78/(-52))/((-3)/4). Solve 0 = -w - z + 5, 0 = 4w - qz - 8 for w. 3 Let l be (-3 + -2 - -1)9/4. Let y = l - -12. Solve 4i - yg + 27 = 0, -i + 2g = -g + 18 for i. -3 Suppose -105j + 111j - 30 = 0. Solve jy = -o + 8, 5o + 6 + 2 = -y for y. 2 Suppose 5u - 119 = 6. Suppose -31 = -2l - 3w, -5l + u = -w - 78. Solve 0 = -5h + b - l, -5b + 3b = 0 for h. -4 Let d be 13/52 + 14/8. Suppose -2q - df - 5 = -7q, -2q + 16 = 2f. Solve 3p = -4g - 0p + 3, -5g - 4p = -q for g. 3 Let d be ((-4)/(-3))/((-6)/(-9)). Suppose -dl = -5u + 26, 2l - 6 = 3u - 6u. Suppose ut = -1 + 25. Solve 5s = 3c - 20, -5c + 6 = -3s - t for s. -4 Suppose -5l + 0l + t + 12 = 0, 5t = -l + 18. Let x be (3 - 0) + 0/5. Suppose -xh = -3 - l. Solve 0 = -hb + 2a - 18, 2a = -4b - 3a for b. -5 Let s(d) = d*3 + 23d*2 - 76d + 72. Let n be s(-26). Let k be 1/(-1) - -7 - 1. Solve 3m - n = f, 3f - 3m = 5f - k for f. -5 Suppose 3r + 12r = 300. Solve g + 7 = m, -5m = -2g - 0g - r for m. 2 Let u = -6 - -13. Suppose 3f - 4f = 2t + 45, f = t + 18. Let b = 21 + t. Solve 10 = -5x - a, bx = 2x + a + u for x. -1 Suppose 2k - 12 = -0. Let q(j) = 4j2 - 14j2 - j3 + 4j2. Let c be q(-6). Solve -f = c, -2a - a + f - k = 0 for a. -2 Suppose -24 = -f - 0u - 4u, -3u = -f - 11. Solve -fb - 8 = 0, 2c = -2c + 2b for c. -1 Let j = 4 - 2. Let z = -18 - -20. Suppose zo - 3o - 3v - 4 = 0, 0 = o - 3v - 14. Solve 3a + 0m = -om + 7, -4a = m + j for a. -1 Suppose 63g + 12g - 300 = 0. Solve -3n = l - 0l + 4, 4l - 8 = -gn for l. 5 Suppose 0 = 38q + 2 - 382. Solve -6d - 8 = 4j - 10d, -2d + q = j for j. 2 Let l(a) = 2a - 35. Let q be l(24). Suppose 11n = qn - 8. Solve 3 = -3u - 2r, r + n - 2 = -2u for u. -1 Let t be 2(4 + 225/(-10)). Let a = t - -42. Solve 2p + 5w = a, -2p - 1 - 4 = -5w for p. 0 Suppose -5p = -3w + 4 - 2, -3w + 10 = -p. Suppose -w + 7 = u. Solve 0x - 24 = a + 5x, -14 = a + ux for a. 1 Let r be -1 + -2 + 1 - -4. Solve -2z = -2, 0 = -2b + 6b + 2z - r for b. 0 Let p = 9 + -6. Let g(b) = 13b*p - 6b*3 + 5 + 4b - 6b3 + 4b*2 - b. Let w be g(-3). Solve -h + 4 = 3i, h + wi - 10 = -0h for h. -5 Let a = 57 - 55. Suppose 12b = ab + 40. Solve -i = 4m - 9, -8 - 15 = -3m - bi for m. 1 Let v(r) = r + 16. Let u be v(-12). Suppose -15 + 3 = uf - 5d, 0 = -5f - 3d + 22. Solve -12 = 2c - 2y, 0 = -5c - 2y - f for c. -2 Let i be ((-18)/204)/(8/(-60)). Suppose 3o + o + 16 = -4c, 3c - 4o = 16. Solve -1 = -3q + 4v + i, c = -4q - 4v for q. 4 Let x = 50 + -45. Let s be 0 - (x + -8) - 2. Solve f = 5t - 5 + s, -4t - f = 4 for t. 0 Let p be ((-2)/1)/12-6. Suppose -3s = h - p - 5, 5s = -5h. Solve 4w + 23 = si, 3i + w - 18 = -i for i. 5 Let u = -5 + 10. Let c = 142 - -17. Let g = 162 - c. Solve -s = 4n + 4, -3n = -2s + us + g for n. -1 Let k = 26 - 4. Let a be 8/(-56) - k/(-7). Suppose -az + 11 = -7. Solve -3y = -3i, 0 = -i + y - zy + 6 for i. 1 Let v = 262 + -258. Solve -5d + 2 = -vd + h, -h - 1 = 0 for d. 3 Suppose -3q - 5d + 25 = 0, -4q + 6d = -0 - 8. Solve -4t = -2y - 5t + 4, -y + 2 = qt for y. 2 Let h(m) = 7m - 76. Let o be h(13). Solve 5b - 2v = -9, -v - o = 4v for b. -3 Let f(q) = 4q + 12. Let o be f(-10). Let j be (o/(-35))/(1/5). Suppose -c + 18 - j = 0. Solve 3z - u - c = 0, -z - 5u - 8 = -18 for z. 5 Let y be -9 - (-180)/9 - 9. Solve -5m + ym + 3p = 0, 3 = 3p for m. 1 Suppose -2r - r = -12. Let i(n) = n2 - 5n + 6. Let b be i(4). Let c = -8036 - -8040. Solve 2f + b + r = cz, -z - 1 = -f for z. 4 Let q be (18/(-3 + 5))/1. Suppose 45 = 4w - 5d, 0 = 3w - d - 11 - q. Solve 15 = -5u + wv, -v - 6 = -4u - 24 for u. -5 Suppose 4z - 5z = 0. Let n(f) = 0f2 - 17f*2 - 8f + f*3 + 2 - 9f + zf. Let k be n(18). Solve 2i + 2a + 0a + 6 = 0, 4a = 4i - k for i. 1 Suppose 73 = -2q - 5s, -5q - 82 = -5s + 13. Let j(x) = -x*2 - 24x + 17. Let w be j(q). Solve -3a - 2a = -4n + w, n = -3a - 17 for a. -5 Let x(y) be the third derivative of y*5/10 - 7y*4/24 + 2y*3/3 + 8y*2. Let d be x(1). Solve -dg = f - 2, g = f + 11 - 5 for f. -4 Let k = -5 - -8. Let r = -8 - -11. Suppose 0 = rj + 1 - 25. Solve -5c = -5, -kc - 4 - j = -5m for m. 3 Let d = 7 + -4. Suppose -3k = z + 2, 2z +	{ "pile_set_name": "DM Mathematics" }
9o3 Expand (0 + 0 + g2)(-3 - 3 - 1). -7g2 Expand (-54 - 5f + 54)(5f - 2f - f) + 0f + 0f + 2f*2 + 2. -8f*2 + 2 Expand -4p*2 + 0p*2 + 3p*2 + (-p + p + p)(p - 4p + p) + 2p*2 - 6p*2 + 3p*2 + 10p - 10p - 3p*2. -7p*2 Expand (14 - 12 + 10)(l - 2l + 3l). 24l Expand (-2w - 2w + 6w)(-2 + 4 - 1) + (3w + 0w + 2w)(3 - 5 + 3). 7w Expand (-4z2 + 3z*2 + 2z*2)(4 + 3 + 5z - 4). 5z*3 + 3z2 Expand -v + v3 + v + (v + 3v - 3v)(v2 + 0v*2 + 0v*2) - 3v*3 + 3v*3 + 8v*3 + (-v + 0v - v)(2v*2 - 3v*2 + 2v*2). 8v*3 Expand (w + 2 - 2)(3w4 + 24w + 24w - 50w). 3w5 - 2w*2 Expand (2h - 4h + 3h)(-4 + 2 + 0)(-6 - 1 - 9). 32h Expand (-2 + 0 + 1)(0s3 - 3s*3 + 5s*3) + (0s - 4s + 0s)(-s2 + 3s*2 - 4s2) - s3 + 4s3 - 2s*3. 7s*3 Expand (-2o*2 + 2o*2 - 2o*2)(2o3 + 0o*3 + 0o*3) + 4o*5 + 0o*5 + 3o*5. 3o*5 Expand -4o*3 + 4o*5 + 4o*3 + (6o - 2o4 - 2o*4 - 5o)(5 - 5 + 3o). -8o5 + 3o*2 Expand ((0 + 4 - 3)(3 - 3 + 1) + 1 + 0 + 0)(-j5 + j - j). -2j*5 Expand (-2 + 2 + 2p)(0p + 0p - 2p*2) + (-9 + 9 + 2p)(-5p*2 + 4p*2 - p + 2p*2). -2p*3 - 2p2 Expand -j2 + 3j2 - j2 + (0j - 2j + 0j)(4 - 4 + j) + j2 - j2 - j2 - 64j*2 + 22j*2 + 10j*2. -34j*2 Expand (2s + 2s2 - 2s)(-s2 + 5s - 5s) + 0s*3 - 2s*3 + 3s3 - s4. -3s4 + s3 Expand (v - v - 2v*2)(0v2 + v3 + 0v*2)(-2 - 1 + 1)(3 - 5 + 4). 8v*5 Expand (q + q - 4q + 2q3)(6q2 + 4q*2 + 4 - 14q*2). -8q*5 + 16q*3 - 8q Expand (-7 + 2 + 1)(4h - 2h + h) - 4 + 4 + 2h. -10h Expand -2f*3 - 3f + 3f + (-f - 6f + 2f)(6f + 2f*2 - 6f). -12f3 Expand (0 + 2 - 4)(-1 - 3 - 4)(4h - 5h - 3h). -64h Expand (5 - 11 - 16)(0y + y - 3y)(-5y*3 + 2y*3 + 2y*3). -44y4 Expand -4 + 4 - y2 + (-1 - 3 + 5)(10y*2 + 2y*2 + 3y*2). 14y*2 Expand (32 + 38 - 76)(5a - 4a + a). -12a Expand (2h - 3h + 0h)(5h - 5h + 5h4) - 2 + 2 - h5 + 3h5 + h5 - 6h*5 + (-3h*3 + 4h*3 - 3h*3)(2h2 + 3h*2 - 3h*2). -12h*5 Expand (11 - 11 - 9p)(-10 + 10 + p3). -9p*4 Expand (-3 + 3 + 3)(w - 2w + 2w + 3w3). 9w*3 + 3w Expand (-2 - 2l + 2)(-5 - 3l2 + 5) - l3 + 20l - 20l. 5l*3 Expand (4 - 2 - 4 + (-1 + 1 + 1)(1 - 1 - 2))((-x2 + 1 - 1)(0x3 - 5x*3 + 8x*3) + 2x*4 - 2x*4 - 3x*5). 24x*5 Expand (0 + 0 - 2h)(-2h + 5h + 0h)(-h3 + 4h*3 + 0h*3). -18h*5 Expand (-h - 4h + 3h)(-h + 0h + 2h) - 2 + 2h2 + 2 - 3h2 - h2 + 3h2 + (4h*2 + 7 - 7)(-1 - 2 + 2). -5h2 Expand (0y*2 + 0y2 - y2)(-1 - 1 + 5) - 2y*2 + 3y - 3y + (3 - 2y - 3)(-2y - 4 + 4) - 6y2 + 2y2 + y2. -4y2 Expand (0 + 1 - 3)(37u + 0 - 3 - 32u). -10u + 6 Expand (5t + 1 - 1)(2t2 - t2 - 2t2)(t + 3t - 6t). 10t4 Expand -6l*5 + 17 - 17 - 2l5 - l5 + 4l5 + (2l*3 - 3l*3 + 3l*3)(-l*2 + 4l2 - l2) + 2l5 - 2l5 - l5. -2l5 Expand (3 + 0 - 1)(-4 + 4 - q)(8q*3 - 2q*3 - 2q*3). -8q*4 Expand (1 - 1 - 1)(5s + 0s - 3s) + 4s + 0s + 2s. 4s Expand 3v2 + v3 + v - 3v2 - 2 + (v2 - 3v*2 - 14v*2)(-2v + v + 2v). -15v3 + v - 2 Expand -5b + 2b - 3b + 0 + 2b + 0 + (-3b - 5b + 6b)(-2 - 2 + 3) - 3b - 2b + 3b. -4b Expand -5x*3 + 4x*3 - 3x3 + (0 - x2 + 0)(-x + x + 2x) - 3x3 - 7x*3 + 8x*3. -8x*3 Expand (3 - 2 + 0)(3d - 3d - d) + (d + 1 - 1)(-2 + 13 + 0). 10d Expand (3q - 5q + 0q)(3 - 3 + 2q) - q2 - q2 + 4q*2. -2q*2 Expand (-4m*5 + 3m*3 - 3m*3)(7 - 1 - 3). -12m5 Expand (-4 + 5 + 4)(b + 2b - b)(5 - 1 - 3). 10b Expand (730 - 730 - 40n*3)(2n + 0n - 4n - 2n*2). 80n*5 + 80n*4 Expand (-3t - 2t + 3t)(-3 + 3 + 3) + 3t - t - t. -5t Expand (0d + 8d - 2d)(-6 - 2 - 2 + (-3 + 4 + 1)(-5 + 2 + 1)). -84d Expand -14x*2 + 11x*2 + 25x*2 - 2x*2 + 2x2 - x2 - 2x2 - x2 + 4x*2 + (-x + 2 - 2)(2 - 2 - x). 23x2 Expand (-3t*2 - 4t*2 + 5t*2)(-t + 4 - 17 + 0t). 2t*3 + 26t*2 Expand (-5 + 5 + l)(13l2 - 7l2 + l2) + 2l3 - 4l*3 + 5l*3. 10l*3 Expand (0 + 0 - 2v)(-v2 - 2v2 + v2) + v*2 + 2v*2 - 11v + 2v3 + 13v. 6v3 + 3v*2 + 2v Expand (-4o - o + 4o)((4 - 4 - 3)(-2o + 0o + 3o) + 5 - 5 + o). 2o*2 Expand (13b + 54 - 54)(2 - 5 + 1 + (1 - 1 - 2)(2 + 2 - 2) + 1 + 3 - 3). -65b Expand 2s*4 - 2s + 2s + (0 + 0 - 2s*2)(s - s + 2s2) - 2s4 - s4 + s*4 - 4s*4 - 3s*4 - 7s*4. -18s*4 Expand (4d + 1 - 1)(-d + 5d - 3d)(-5 + 3 + 4d + 3). 16d*3 + 4d*2 Expand (-j - 1 + 1 + (-11j + 5 - 5)(-1 + 1 - 1))(0 - 2 + 3)(2j*3 + 0j*3 - 4j*3). -20j4 Expand -d3 - 2d2 + 2d*2 + (4d + 3d - 5d)(-3d2 + d2 + 0d2). -5d*3 Expand ((-2d + 6d - 3d)(-2d + 4d + 0d) + 2d2 - 5 + 5)(d3 + d3 - 3d3). -4d*5 Expand (15m*3 - 87m*3 + 37m*3)(-1 + 2m + 1). -70m*4 Expand (3r - 4r - r)(0r2 + 2r2 - r2)(-6 + 2r*2 + 6). -4r*5 Expand (3h + 2h - 3h)(2h + 2h - 3h)(h - 2h + 0h). -2h*3 Expand (-4 + 0 + 1)(-2 - 2f4 + 2) + (f4 + 3f*4 - 2f*4)(2 - 5 + 0)(2 + 2 - 2). -6f*4 Expand (0 + 0 - 6)(-2b + 7b + b)(3 + 0 - 2). -36b Expand (-6 + 3f2 + f2 + 6)(-8f2 - 6f + 6f). -32f4 Expand (-l2 + 4l2 + l2)(-3l - 5l + 2l)(-3l + 0l + 2l). 24l*4 Expand (6l - 4l - 3l)(-3l*2 + 2l*3 + 3l*2) + 4l*4 + 7l*4 + 0l*4. 9l*4 Expand -f + 0f + 0f + (8f + 18 - 18)(2 + 0 - 1). 7f Expand -2c2 - 3c*2 + 7c*2 - 2c*2 + 0 + 0 + (-3 + 1 + 3)(-c*2 + 0c + 0c). -c2 Expand (-2a + 8a - 2a)(0 + 1 - 3)(-2 + 1 - 1). 16a Expand (4o - 3o + 3o)(4o + 1 + o - 2). 20o2 - 4o Expand -o2 + o2 + o*3 + (6 - 6 - o)(-o + o + 2o)(2o - o + 2o). -5o3 Expand -6b + 14b - 9b + (3b - b - 3b)(-6 + 1 + 3). b Expand v2 + 2v + 0 - 25 + 7 + (-v + 0v - v)(0 + 0 - 2v). 5v*2 + 2v - 18 Expand (-1 + 4 - 2)(3p + p - 2p)(2p - 4p + 3p). 2p*2 Expand (4z + 10z - 24z)(z + 2 - 2). -10z2 Expand (-t2 + 0t2 + 3t*2)(-2t3 + 0t*3 + 0t3) + t2 + 91t5 + 0t2 - t2. 87t5 Expand (-5v + v + v)(-2 + 3 - 2). 3v Expand (-5t + t + 2t)(0 + 3 - 2) + 4t + 1 - 6 - t. t - 5 Expand (7z - 7z + 15z + 1)(-4 + 4 + 1). 15z + 1 Expand (5 - 3 - 3)(-4x + 7x - 2 - 4x)(-5x2 - 3x*2 + 5x*2). -3x*3 - 6x*2 Expand -2b + 3b - 2b + (3 + 0 - 2)(b - b + b) + 2 + 2b - 2 + 9b + 13b - 5b. 19b Expand (-4 + 2 + 5)(6 - 7c - 6). -21c Expand -5j*4 + 2j*4 + 2j4 + (-j3 - 5j3 + 4j*3)(-2j + 2 - 2) + 6j*4 - 6j*4 - 15j*4 + 5j*4 - 2j*4 - 4j*4. -13j*4 Expand -2 - 4d + 3 + 2 + 3 - 2d - 3 + (-d - 2d + 4d)(6 - 3 - 1) - 3d + 4d + 0d. -3d + 3 Expand (-1 + 1 - p)(-5p + 0 + 0) + 5p2 - 3p*2 + 0p*2 + 2p*2 - 1 + 1 + (2p + 1 - 1)(0p - 2p + 4p). 13p2 Expand 2z2 + z2 + 3z2 + (-z + z + z)(-2 - 2z + 2). 4z*2 Expand (-4y + y + 2y + (-2 - 2y + 2)(-6 + 4 + 4) + 0 - 2y + 0 + 4y - 2y + 0y - 2y + 5y - y + (-6y + 3y + 4y)(-3 + 9 - 1))(y + 5y - 3y). 6y2 Expand 0 + d + 0 + 4d - 4d - 2d + (0d + 5d - 2d)(0 - 2 - 1). -10d Expand (3 + 3 - 2)(i5 + i5 + i*5) + (-3i2 + i2 + i*2)(-3i2 + 2i*3 + 3i*2). 10i*5 Expand (-1 + 7w + 3w - 20w)(5w*3 - 4w*3 - 3w*3). 20w*4 + 2w*3 Expand (2x2 + x2 + 1 - 2x2)(x - x*2 - x + (168 - 168 - 7x)(3x + 0x - x)). -15x*4 - 15x*2 Expand (-5 + 6 + 2)(q*3 - 1 - 2q*3 + 4q*3). 9q*3 - 3 Expand (8 + 0 - 4)(-4d + 6d - 4d). -8d Expand ((2 + 1 + 0)(0 - 3 + 5) - 6 + 10 + 3)(m3 + m2 - m*2). 13m*3 Expand (2s + 3s - 3s)(-s - s + 0s) + 53s + 53s - 105s + 2s*2 + 47. -2s*2 + s + 47 Expand ((-b + 5b - 6b)(6 - 5 + 12) - b - 4b + 3b)(-4b + 0b + 5b). -28b2 Expand (2s*2 + 2s*2 - 2s*2)((-4s + 0s + 6s)(-s*2 + 3s - 3s) + (0 + 2 - 1)(-20 - 8 + 8)(0s*3 - 4s*3 + 2s*3)). 76s*5 Expand (0h + 3h - 4h)(5 + h4 - 5 + (h3 - 4h*3 + 5h*3)(3h + 3h - 4h) + h4 + 4h - 4h + (0h + 0h + h3)(2h - 3h + 0h)). -5h**5 Expand	{ "pile_set_name": "DM Mathematics" }
0). -34 What is -51 + (41 - 59) - -114? 45 What is (3 - (-2 + (-18 - -11))) + -37 + 12 - 83? -96 What is 61 + (143 - 42 - 207)? -45 Calculate 1 + 72 + 6 + -3 + -30 + 5 + 19. 70 What is 46 + 26 + (-96 - -50)? 26 25 + (8 - 96) + 182 119 What is (-7 + -8 - -17) + 13 - (-3 - 46)? 64 What is the value of 21 + 4 + (-13 - (73 - 7))? -54 85 + (-112 - -148) + -86 35 What is the value of 57 - (-8 + -12 + 11 + 0 + 10 + 1)? 55 (-10 - 56 - -85) + -61 -42 Evaluate 30 - (8 - (-22 - -7)) - -21. 28 Calculate 10 - (5 - (-20 + -22)). -37 Calculate 31 + -35 - ((-1 - (1 - 8)) + 10 + -24). 4 What is the value of (10 - 5 - 78) + (2 - (-14 - -16)) + -8? -81 (-2 + -33 - -9) + -9 + 8 + -13 -40 Calculate -96 + 55 + -1 + 8. -34 What is 21 + -59 + (-1 - -69)? 30 Evaluate (-27 - (-6 + -9) - 28) + -17. -57 Calculate 40 - ((-6 + -8 - -2) + 7 + -5). 50 Evaluate (-3 - (-7 + 71)) + (34 - 14). -47 -2543 - -2501 - (1 - 117) 74 What is the value of (617 + -580 - (27 - (-1 - -2))) + -1 + -70? -60 Calculate -14 + -40 + 47 + (45 - -1) + -11. 28 What is the value of -6 + (-11 - (21 + -16)) + 10 - (3 + 64)? -79 What is the value of (8 + -21 + 5 - 3) + 20 + -82? -73 ((-9 - 6) + -5 - -142) + -28 94 Calculate 28 - (3 + 66 + -101). 60 What is -523 - -629 - (83 + 2)? 21 Evaluate (19 - -1) + -67 + (73 - 36). -10 Evaluate 70 + (-136 - -94) + 43. 71 -56 - (-2 + 7 - 0) -61 Evaluate (-22 - -1) + 40 + 22 + -59. -18 What is 0 + -6 + (-1 - 12 - (-62 + 20 + 25))? -2 Evaluate 10 - 7 - (-103 - -88). 18 What is 21 + -12 + -26 + 32 + -36? -21 9 - (13 + -6 + -9 - (46 + -29)) 28 1 + (-17 - 1 - (-25 + 60 - 48)) -4 Evaluate -20 + 8 + 20 + -5 + (-12 - -14). 5 -2 + -3 + (-132 - (-13 - 94)) -30 Evaluate -16 + 3 - -10 - (-13 - -20). -10 Evaluate -20 - -4 - (18 - (2 + 14 - -19)). 1 What is the value of (-9 + 7 - -6) + 5? 9 Evaluate (-49 - 18 - 35) + (11 - 3) - 22. -116 Calculate (0 - -25 - 47) + -9. -31 What is 10 - (278 + -246 - (1 - 9)) - 11? -41 What is the value of (-284 - -309) + (-20 - -2) + -24? -17 -34 + (-6 - (-14 + 30 + -15)) -41 -7 + (-3 + 7 - (-18 + -2 - -18)) - 134 -135 Evaluate (134 - 23 - 103) + (1 - -23). 32 What is the value of (30 - (34 - (41 - 9))) + -74? -46 Calculate 221 + (135 - 48 - 234). 74 What is the value of 5 - (44 + (14 - 24))? -29 Calculate (6 - -37) + -53 - (47 + -1 + 0). -56 What is the value of 131 - (23 - 13) - (13 - 22) - 6? 124 What is (55 - (-25 - 2)) + -25? 57 (6 - 6 - -3) + -13 + -2 + 53 41 What is 16 + -22 - (0 - -2 - -5) - 18? -31 Evaluate (-313 - -322) + (2 + -82 - 11 - 3). -85 Calculate 3 + -3 - ((-28 - -17) + (14 - 2)). -1 -91 - 0 - (33 - (17 - (-40 + 20))) -87 Evaluate -40 + -2 + 2 + (22 - (6 - (-29 + 10))). -43 Calculate -30 + (191 + -197 - (1 - 17)) - -40. 20 What is the value of -4 + 2 + (4 - 2) + (30 + -66 - -23)? -13 What is the value of 32 - (-11 + -113 + 75)? 81 What is 2 - 5 - -6 - (-533 - -536)? 0 -52 - (32 - (50 - 18) - (4 - 0)) -48 Evaluate (4 - -5) + 36 + -34 + -3 + (2 - 30). -20 What is -6 + (8 - (39 + -31) - (-2 + 3))? -7 Calculate (0 + 28 + -14 - 4) + (-2 - -2) - -77. 87 (-5 - (10 + 30 + -34)) + (0 - 0 - 3) -14 What is the value of -2 - (5 - (-2 - (9 + -1))) - -18? 1 What is the value of -84 - ((-28 - -8) + 24 - 25)? -63 -9 + 100 - (-254 + 328) 17 Calculate -84 + 21 + -29 + 2 + -18. -108 1 + 1 + (1 - (-9 - (-34 + 17))) + 45 40 Evaluate (131 - 2) + -6 + (-14 - -21) + -3 + -14. 113 -161 + 43 + 94 - (1 + -4) -21 Calculate 5 + 4 + 0 + (127 - 96). 40 14 + 15 + (-8 - -11) + -18 + 6 20 Evaluate (19 + -5 - (34 + 24 + -5)) + 5 + -1. -35 (-9 - 1) + (85 - 1 - ((14 - 118) + 98)) 80 What is the value of -5 - ((13 - -21) + -10 + -62 + -5)? 38 Calculate 25 + 5 + (3 - 15) + (6 - (-14 - -11)). 27 What is 1 + (2 - (1 + 16 + (-45 - 0) + 33))? -2 Evaluate -14 + -30 + 10 + 6 + 24 + 1. -3 -313 + 235 + (23 - (6 + -7)) -54 What is -3 + -70 - (5895 - 5902)? -66 What is the value of 67 - (40 + -39 + 40)? 26 -4 + -1 - (43 + -51 - -29) - (14 + -14) -26 (-111 + 16 + 43 - -119) + (0 - (2 + -8)) 73 27 + -76 + 60 + -7 + 9 13 What is the value of (-77 - -66) + 73 - (2 - -20)? 40 -16 - -70 - (19 + 24) 11 What is the value of (14 + 7 - (9 - 3)) + -35 - -49? 29 (37 - 52) + 48 + 50 83 Evaluate 4 - ((5 - 13) + 2 + 4 - 4) - -1. 11 What is the value of 1 + (17 - -59) + -50? 27 Evaluate (-1 - 27) + -57 + (2 - -49). -34 What is -65 + 38 + 56 + -57? -28 What is the value of (-12 - (-15 - 0)) + (0 + 1 - 31)? -27 Calculate 6 + -2 - (1 + 4) - 4 - (6 - 66). 55 What is (-8 + 6 + -3 - -31) + (-5 - -15)? 36 Calculate 1 + 35 + -5 - (-7 + -21 + 4 + 17). 38 Calculate 93 + -83 + 37 + -84 + 133. 96 What is the value of -72 - (5 + -12 + (-7 - (-10 - -7)) - -10)? -71 What is 16 + (12 - 20 - 26) - -44? 26 Calculate 27 + -66 + 32 + 1. -6 (-8 - (-22 - 11)) + (23 - 29) + (-5 - -1) 15 Evaluate -643 - -595 - (21 + -5). -64 What is the value of 4 + (-25 - -17) + 8 + -45? -41 Evaluate -2 + -2 - (-7 - (-3 + -21)). -21 What is the value of (2 - -1) + (46 - (-1 - -57)) - 5? -12 Calculate 144 + 0 + (-2211 - -2125). 58 What is the value of 2 - ((4 - 3) + -66) - (143 + 156 + -302)? 70 Calculate (2 - 7 - ((-7 - -8) + 0 + -8)) + 10. 12 What is the value of -34 + (6 - -51) + (-1 - -2) + 15? 39 Evaluate 2 + -26 - ((145 - 120) + -143) - (0 - 0). 94 What is the value of (-17 - 16) + 40 + -83 + (-5 + 2 - 2)? -81 What is (37 - 36) + -136 + 42 + (21 - -1)? -71 What is the value of -32 - (-9 + (-12 - -7 - -7) - -3)? -28 Calculate (149 - 30) + -123 - ((1 - 0) + 10). -15 What is -140 - -138 - (-2 - (7 + -8 - (2 + -2)))? -1 What is the value of -73 + (141 - (12 - -51))? 5 What is -44 - (50 - 59) - -54? 19 What is 28 + 15 + (14 + -16 - 78)? -37 What is the value of -31 + 20 + 17 + (1 - 9) - 10? -12 Evaluate (-5 - (-1 - 2) - 58) + (-24 - (-12 + -12)). -60 What is (-68 - -124 - 63) + -57? -64 What is 22 - (-4 + 12 + 2 + (1 - 24))? 35 Calculate 383 + -223 - (-21 - -97). 84 -32 - (14 - 42) - (5 - 4) -5 Evaluate -71 + 76 - (0 - -45). -40 Calculate 28 - (-5 + 8 + -20 - -35). 10 Evaluate 5 + 4 + 58 - (25 - (2 + 22 + -4)). 62 Evaluate 87 - (84 + (-12 - 1)). 16 What is (59 - (-19 - -13)) + -95? -30 Calculate (10 - (21 + 9 + -2 + 3)) + 134. 113 What is the value of 29 - (-21 - (-134 - -61))? -23 What is the value of 17 + -14 + (-11 + 23 - -5) + -2 + -4? 14 21 - (-16 - ((1 - -3) + -15)) 26 Evaluate -159 + (-13 + 76 + -10 - 29). -135 What is (-2 - -4) + -6 - (-16 - -28 - 0)? -16 Calculate -12 - ((10 - (-28 + 15 - -10)) + -50). 25 Evaluate -38 - (-17 - (4 - (-17 - -32))) - 14. -46 Calculate -11 + (4 + -25 - (38 + (-152 - -44))). 38 What is 0 + 132 - (17071 - 16830)? -109 What is the value of (49 - (12 - (35 - -26))) + -8? 90 What is the value of -1 + -2 + (6 - (14 - (14 + -2))) - 29? -28 What is the value of 49 + -43 - (4 + (-2 - 1) + 27 + -6)? -16 What is the value of (13 - (8 + 16 + -16 + 6)) + -3 + 1? -3 Calculate (-3 - 1) + 0 - (-40 + 4 + 20 + -124). 136 What is the value of (10 - -4) + -12 + 12 + -10 + 92? 96 What is -16 + -1 + 6 + -3 + -1 + (24 - 29)? -20 3 + 41 + -105 + 13 -48 What is -67 + 127 - -32 - 47? 45 Evaluate 7 - (7 - (-22 + 11 + 17 - 16)). -10 Calculate -63 + (284 - 185) - (39 - 1). -2 -34 + (4 - (6 + -7 - -9)) -38 What is (117 - 63) + (-3 - 64)? -13 What is -19 + -22 + 25 + 14 - -10 - 66? -58 Evaluate 6 - (28 - 29 - -20). -13 Calculate -14 + -18 + (-12 - (-1 - -9)) + -16. -68 What is (237 + -116 - 104) + 27? 44 What is 53 + (-72 - (-13 + 3))? -9 What is 2 + -10 + 29 + (-17 - 20)? -16 Evaluate -23 + (13 - -28) - (-2 + -10). 30 What is -1 + 99 + (-1363 - -1252)? -13 What is the value of 66 - (-55 + 33 + 60)? 28 -15 - (6 + (-6 - (-6 - -50))) 29 Calculate -136 - (28 + (37 - (-1 + 83))). -119 Calculate -29 - (25 + 8 + 12 + -28). -46 -83 + 14 - -8 - -143 82 (41 + -57 - -23) + -12 - (-48 + 1) 42 (88 - 76) + -13 + -40 -41 Calculate -8 + (-17 + -1 - (218 - 243)) - (-1 - -106). -106 Evaluate -15 + -1 + -36 + 4 + 59 + -21. -10 -14 - (-1 + 3 + 69 + -48) -37 Evaluate (53 - -14 - 71) + -1 + 15. 10 What is the value of 17 + (16 - 67) + 36? 2 What is -1 + 35 + (-25 - -11 - -2) + 25? 47 Evaluate (20 + 14 + -5 - -3) + 6. 38 -88 + 101 - ((-1 - 0) + 68) -54 What is the value of 9 + -29 + 49 + -23 + (-2 - -52)? 56 (6 - (-3 + 6)) + -70 + (-14 + 5 - -14) -62 (23 + 7 - (26 + 4)) + -16 -16 What is the value of -5 + -1 + (-1836 - -1945)? 103 Evaluate	{ "pile_set_name": "DM Mathematics" }
(m) be the first derivative of -2m2 + 5m - 49. Let q = -251 + 254. Let c(o) = 4o - 4. Give qc(y) + 2f(y). 4y - 2 Let s(r) = -11r3 + 5r*2 - 5r - 5. Let x be (-6)/(-10)((-949)/(-39) + -16). Let d(b) = 104b*3 - 48b*2 + 48b + 48. What is xd(p) + 48s(p)? -8p3 Let r(j) = 3j + 3. Let i(t) = 71t + 88. Calculate i(s) - 4r(s). 59s + 76 Let z(a) = 43a + 221. Let j(g) = 150g + 663. Give 2j(q) - 7z(q). -q - 221 Let b(l) = -8l*2 + 192l + 67. Let v(o) = 3o2 - 88o - 33. Determine -2b(c) - 5v(c). c*2 + 56c + 31 Let s be (3 + 167)-53/30. Let n(a) = -15a + 85. Let x(r) = r - 6. Determine sx(z) - 6n(z). 5z Let l(w) = -2w + 15. Let z(k) = -k + 16. Let s(p) = p3 - 45p*2 + 233p + 3. Let n be s(6). Give nz(t) + 2l(t). -t - 18 Let b(n) = -n*3 + 2n + 19. Let c(x) be the second derivative of -x3/6 - x2/2 - 4x - 309. Give b(j) + 2c(j). -j*3 + 17 Let k(s) be the second derivative of 2s5/5 - s4/2 + 17s3/6 - 3s*2 + 190s + 1. Let w(z) = -23z3 + 17z*2 - 50z + 17. Determine 17k(q) + 6w(q). -2q3 - 11q Let t(x) = 3x + 20. Let z(k) = k + 7. Let o(v) = -13v*3 + 2v*2 + 5v + 11. Let w be o(-2). Suppose q - 116 = -w. Calculate qt(d) - 8z(d). d + 4 Let s = -236 - -239. Let v(u) = 4 - 7 - 1 - s - 3u. Let l(g) = 2g + 4. Let m be -3(-1)/((-3)/10). Calculate ml(q) - 6v(q). -2q + 2 Let y(i) = -38057i + 99. Let h(s) = 28543s - 72. Determine 11h(q) + 8y(q). 9517q Let t(k) = 6k*3 - 88k2 + 30. Let s(w) = w3 - w*2 + 2. What is -13s(j) + t(j)? -7j3 - 75j*2 + 4 Let z(c) = -161c + 10. Let g(f) = 189f - 10. Let u(s) = 6g(s) + 7z(s). Let y(n) = 6n + 9. Calculate 5u(v) - 6y(v). -v - 4 Let r(p) = -852p2 - 2p + 6. Let v(o) = -332280o2 - 781o + 2343. What is 781r(k) - 2v(k)? -852k2 Let d(y) = -2313y + 51. Let h(q) = -4626q + 85. Give -5d(b) + 3h(b). -2313b Let y = 54 - -20. Let w = y + -39. Let q = 47 - w. Let n(x) = x*3 + x - 1. Let k(c) = 9c*3 + 12c - 12. Calculate qn(i) - k(i). 3i*3 Let d(s) = -5s*3 + 403s. Let x(n) = n*3 + 15n. Give d(g) - 11x(g). -16g*3 + 238g Let x be (-3)/5(6 + -1). Let g(p) = -p2 - p. Let c(k) = -2k*2 + 2k. Calculate xg(t) + c(t). t2 + 5t Let b(t) = -6t - 370. Let g(p) = -7p - 387. What is -5b(z) + 4g(z)? 2z + 302 Let w(v) = 190v*2 - 17 + 19 + 3v - 104v2 - 82v*2. Let t(k) = 17k*2 + 12k + 9. Calculate -6t(s) + 26w(s). 2s2 + 6s - 2 Let t(l) = -1262l2 + 4l - 8. Let f(g) = 627g2 - 2g + 4. Give 9f(b) + 5t(b). -667b2 + 2b - 4 Let r(c) = 2c3 - 3c*2. Suppose -5a = -10 + 5. Let u be -3 - (a - (-9)/(-2))2. Let m(h) = uh*2 - 20h*2 - 2h*3 + 18h*2. Calculate -3m(s) - 2r(s). 2s*3 Let y(m) be the first derivative of 3/4m*4 - 81 - 2/3m*3 + 13m - 7/2m2. Let q(w) = w3 - w2 - 3w + 6. Give -7q(f) + 3y(f). 2f3 + f2 - 3 Suppose -132 = 2c - 112. Suppose -3l = -2x + 4x + 14, -2x = -3l + 2. Let w(h) = h2 - 5h - 4. Let a(f) = f + 1. Give ca(d) + lw(d). -2d2 - 2 Suppose 212 = 3i + 14. Suppose i + 60 = 6d. Suppose y - k + 4 = k, 3k - d = 4y. Let f(b) = -b + 1. Let l(g) = -7g + 6. Give yf(n) + l(n). -n Let n(b) = -b2 + 9b. Let z(y) = -3y2 + 141y - 18. Give 2n(o) - z(o). o2 - 123o + 18 Let a(f) = -17f3 - 8f*2 - 10f + 16. Let w(o) = 88o3 + 39o*2 + 50o - 84. Give -21a(k) - 4w(k). 5k3 + 12k*2 + 10k Let l(p) = 30p - 11 + 6 + 29p - 56p + 10p*2. Let u(c) = 29c*2 + 8c - 14. Determine 8l(x) - 3u(x). -7x2 + 2 Let c(k) = -2k*2 + 46k. Let j(t) = -3t2 + 47t. Suppose -22z + 21z - 16 = -2x, -20 = 3x + 4z. Give xc(n) - 3j(n). n2 + 43n Let a(u) = 6u - 17. Let g be -6((-9)/(-6))/1. Let n = g + 11. Let p(s) = 5 - 6 + 3s - ns - 2. Determine 6a(o) - 34p(o). 2o Let n(t) = 9t + 1. Let l(p) = 5p2 + 26p + 103. Calculate l(o) - 3n(o). 5o*2 - o + 100 Suppose -146j - 722 - 300 = 0. Let m(s) = -s*3 + 2s + 3. Let c(g) = 2g3 - g2 - 4g - 7. Determine jm(z) - 3c(z). z*3 + 3z*2 - 2z Let b(w) = -35w3 + 103w*2 + 190w - 57. Let q(o) = -7o3 + 20o*2 + 38o - 11. Give 6b(s) - 31q(s). 7s3 - 2s*2 - 38s - 1 Let k(r) be the first derivative of -7r2/2 - 3r + 232. Let l(u) = 15 - 3u - 5 - 11. Calculate 2k(z) - 5l(z). z - 1 Let a(t) = -2t3 + t2 - 3t + 7. Let i(x) = 2x*3 - 3x*2 + 5x - 14. Let n(d) = 5a(d) + 3i(d). Let v(z) = -z3 - z2 - 2. Determine 6n(u) - 21v(u). -3u3 - 3u2 Let h(n) = -n2 + 7n. Let c(x) = -x2 - 2x + 3. Let b be c(2). Let t(f) = f*2 - 4f. Let p be 0 - 10/(-15) - 44/12. What is bt(d) + ph(d)? -2d2 - d Let c(y) = 616y*2 + 32y. Let a(l) = -56l2 - 3l. Let o be ((-9)/1)/(-36 - -20 - -19). Determine oc(q) - 32a(q). -56q2 Let b(k) = 16k*3 - k. Let u(h) = -74h*3 - 8h*2 + 2h + 3. Determine 4b(o) + u(o). -10o*3 - 8o*2 - 2o + 3 Let f(m) = -27m3 - 52m*2 + 6m + 6. Let l(z) = 9z3 + 17z*2 - 2z - 2. Determine 4f(d) + 11l(d). -9d3 - 21d*2 + 2d + 2 Let o(h) = -832h - 89. Let d(a) = -832a - 74. What is 6d(y) - 5o(y)? -832y + 1 Let c(z) = -48z*3 + 6z*2 + 6z + 6. Let m(j) be the second derivative of 49j5/20 - 5j*4/12 - 5j*3/6 - 5j*2/2 + 105j. Determine 5c(a) + 6m(a). 54a3 Let y(d) = 14d - 2. Let j(r) = -24r + 3. Let c(s) = -3j(s) - 5y(s). Let h(f) be the first derivative of -2f*2 - 3f + 207. Give 7c(m) + 3h(m). 2m - 2 Let q = -1436 - -1447. Let h(v) = -3v*2 + 6v. Let w(i) = 8i2 - 17i. What is qh(f) + 4w(f)? -f*2 - 2f Let x(n) = 32n2 - 46n - 1377. Let o(j) = -28j2 + 41j + 1378. Determine -9o(z) - 8x(z). -4z2 - z - 1386 Let w(l) = 82l + 175. Let y be w(-10). Let g = -650 - y. Let q(a) = 4a - 1. Let k(d) = 5d - 1. Determine gk(b) + 6q(b). -b - 1 Let s(l) be the third derivative of 0 - 2/3l3 + 3/20l*5 + 0l + 57l2 - 7/24l*4. Let o(c) = 13c*2 - 10c - 6. Calculate -5o(a) + 7s(a). -2a2 + a + 2 Let g(o) = 3o*2 - 9o - 4. Let m = 6127 - 6128. Let u(b) = b + 1. Give mg(d) - 2u(d). -3d2 + 7d + 2 Let p(r) = -3r + 4 - 7r - 12 + 4r + 4r. Let u(y) = -4y - 5. Let w(g) = 2g + 3. Let q(h) = 4u(h) + 9w(h). What is 3p(a) + 4q(a)? 2a + 4 Let i(c) = -979c*2 - 10c - 2. Let w(a) = -489a2 - 6a - 1. Give -3i(b) + 5w(b). 492b2 + 1 Suppose -v - 19 = -4i - i, -5v + 21 = 4i. Let u be (72/28)/(69/378). Let r(o) = uo - i + 1 + 21o - 41o. Let y(z) = 2z + 2. What is -3r(b) - 4y(b)? -2b + 1 Let z(b) = -b*2 - b + 1. Let g be (24/9 - 3)-187/42. Let x(u) = -u2 + u + 1. Suppose t = -3t + 4. What is gx(q) + tz(q)? -2q2 + 2 Let n(t) = -526641t*2 + 2094. Let g(j) = -4540j*2 + 18. Give 698g(d) - 6n(d). -9074d*2 Let j(v) = -30v - 3072. Let p(n) = 6n + 585. Let m(g) = -4j(g) - 21p(g). Let s(i) = 7i - 2. What is -5m(t) - 4s(t)? 2t - 7 Let d(l) = l + 1. Let z(w) = -41 + 6 + 33 - 5w - 5w. Let u(q) = q3 + 6q*2 + 3q - 6. Let y be u(-5). Give yd(v) + z(v). -6v + 2 Let x(t) = 3t3 + 2t - 21. Let u(p) = -16p3 - 11p + 106. Suppose 118d - 190 = -44d + 1592. Give dx(q) + 2u(q). q*3 - 19 Let s(w) = -3w + 4. Let l(h) = -6h + 9. Let y be -7 - (6 - 2)/2. Let d = 145 - 125. Suppose 5g - 8 = -4m + 2m, -d = -5m + 4g. Determine ml(b) + ys(b). 3b Let l(r) = 63r + 776. Let t(c) = -62c + 1. Give -l(g) - t(g). -g - 777 Let b be ((-3)/8 - (-15)/(-120))8. Let k(g) = g*3 + 3g*2 + 2g + 3. Let u(w) = -4w3 - 13w*2 - 9w - 13. Calculate bu(a) - 18k(a). -2a3 - 2a*2 - 2 Let s(g) = -65g*3 + 36g*2 + 24g*3 - 3 + 21g*3 - 41g*2 + 18g*3 - 3g. Let v(d) = -3d3 - 6d*2 - 4d - 4. Give 4s(j) - 3v(j). j*3 - 2j*2 Let f(g) = -3833g*3 - 11g*2 + 6g + 11. Let i(c) = 1277c3 + 4c*2 - 2c - 4. Calculate 4f(h) + 11i(h). -1285h3 + 2h Let a(i) = -3i2 + 62i + 4. Let h(j) = 10j2 - 185j - 13. What is -7a(q) - 2h(q)? q*2 - 64q - 2 Let r(i) = i - 492. Let d(h) = -h + 487. Give -3d(k) - 2r(k). k - 477 Let l(r) = -45r2 - 36r + 30 + 18r + 2r + 16r. Let i(t) = -t2 + 1. Determine -30i(k) + l(k). -15k2 Let z(h) = -128h + 2. Let t(k) = 125k - 3. Calculate -2t(m) - 3z(m). 134m Let w(p) = 10p - 658. Let c(m) = -5m + 319. What is 7*c(z)	{ "pile_set_name": "DM Mathematics" }
-5.6. Let d = 28/5 + -24/5. Which is the third smallest value? (a) d (b) k (c) -0.4 a Suppose g - 2v = -11, 0 = -0v - 2v + 10. Let u = 147 + -1027/7. Which is the second smallest value? (a) 3/2 (b) g (c) u c Suppose -k = -2k - 4. What is the smallest value in 1, k, 1/11? k Let r = -0.18 + 10.18. Let j be -2 + (-8)/(-6)18/6. Which is the third biggest value? (a) -0.5 (b) r (c) j a Let g = 57 - 52. What is the third smallest value in -12, -0.1, g? g Let b(o) = 26o + 4. Let i be b(3). Let y = i - 740/9. Let c = -19 - -17. What is the second smallest value in y, -3/8, c? -3/8 Let u = -0.034 + 0.334. Let h = -8 - -11. Which is the third smallest value? (a) u (b) h (c) 1 b Let z be (-3)/5 + (-1)/(-5). Let x = 43 + -45. Which is the third smallest value? (a) z (b) x (c) 2 c Suppose 4 + 6 = -2r. Let v(y) = -y2 - 3y + 7. Let u be v(r). Let j = 3.1 + -3. Which is the second biggest value? (a) 1/5 (b) u (c) j c Let j be 4/((-12)/(-3)) - 2. Which is the fourth biggest value? (a) j (b) -0.1 (c) -4 (d) 5 c Let p = -0.4 - -0.8. Let w = -0.3 + p. Which is the second smallest value? (a) -2/7 (b) w (c) -0.1 c Let q = 5 + -2. Let s = 40 - 38. Which is the third smallest value? (a) -3 (b) s (c) q c Let y = 757/11 - 69. Let b be (1/15)/(2/(-3)). What is the third smallest value in y, b, -1? b Let y = -20 - -20.2. Let p = -0.6 - -3.6. Which is the second biggest value? (a) p (b) y (c) 2/9 c Let r = 3.2 - 28.2. Which is the smallest value? (a) 1 (b) r (c) 2/5 b Let x = -2.4 - -0.4. Suppose 5l = 3d + 3, -4d - 4 = -l - 4l. Let s = l + 1. Which is the biggest value? (a) 1/4 (b) x (c) s c Suppose 5d = 2d + 6. Let p be -2 + (7/d - 0). Let s = -5.7 - -6. Which is the smallest value? (a) s (b) p (c) -4 c Let y = 9 - 10. Let b = 911/44 - 85/4. Let w = 9 - 6. What is the second smallest value in w, b, y? b Let g = 7 + -7. Suppose 4 = -gb - b. Let x be (1/(-2))/((-5)/b). What is the third smallest value in 4, -1/10, x? 4 Let q = -3 + -0.5. Let a = q - -4. Let h = a + 0. What is the third smallest value in -1, h, 1? 1 Let a = -0.039 + 8.239. Let u = a + -8. What is the second smallest value in -2/17, u, 0? 0 Let f = 141 - 140. Let z = -5.09 + 0.09. Which is the third smallest value? (a) 0.3 (b) f (c) z b Let s = 0.017 - -2.983. Let y = 0.2 - 0. Which is the biggest value? (a) 0.4 (b) y (c) s c Let n = -0.05 - 0.15. Which is the third smallest value? (a) -1/4 (b) -2/7 (c) n c Let m be -4 + 3 + (-5)/1. Let k = 11 + m. Which is the second smallest value? (a) -4 (b) -9 (c) k a Let w = 49 + -57.1. Let b = w + 8. What is the smallest value in b, 3, 2/5? b Let y = 2.4 - -0.6. Let u = -7 + y. Let w = 38 - 35. Which is the third biggest value? (a) w (b) u (c) -3 b Let c = 0.3 + -0.3. Let y(p) = p3 - 4p*2 - 5p - 3. Let a be y(5). Let f = -0.7 - 1.3. What is the third smallest value in f, a, c? c Let o = -4.14 + 0.14. Let h = -86/5 - -17. What is the biggest value in -3/4, o, h? h Suppose g + 2g + 15 = 0. Let t = 58.8 - 59. Which is the second smallest value? (a) g (b) t (c) 1 b Let y = -15 + 15.4. Let c = 1.2 + -0.2. What is the second smallest value in 3, y, c? c Let f = 365/6 - 60. Let n = -23/42 + f. Which is the third biggest value? (a) 0.4 (b) n (c) -0.4 c Let r = -12.9 + 13. Let i = 2 + -2. Which is the second biggest value? (a) 5 (b) r (c) i b Let j = 5 + -3. Suppose 5y - 6y + 3 = -5c, 5y + 3c = 15. Let v = -5 + 10. What is the third smallest value in y, v, j? v Let f = -0.01 - 0.09. Which is the fourth biggest value? (a) 0.1 (b) 3 (c) f (d) -3/4 d Let j = 4.58 + 0.42. What is the third smallest value in -3, -2/13, 3, j? 3 Let n = -87 - -85. Which is the fourth biggest value? (a) -2/11 (b) -1 (c) 4 (d) n d Let z = 4.08 + -4. Let s = z - -3.92. Let x be 4/6(-6)/(-8). What is the second biggest value in 5, x, s? s Let d = -44/5 + 9. Let u = 8/15 - d. Which is the third biggest value? (a) -3 (b) 3 (c) u a Let j = 5 + -3. Let r = 7/20 + -3/4. Let z = 2.5 - 2. Which is the second biggest value? (a) z (b) j (c) r a Suppose -2 = 2k - 0k, 5i + 2k = 3. What is the biggest value in i, -19/4, 5? 5 Let q = 81/44 + -12/11. Let w = q - 5/12. What is the second smallest value in -0.5, w, 1/8? 1/8 Let g = 0.1 - -0.2. What is the second biggest value in g, 0.5, -2/9? g Let x = 126 + -124. Suppose 2g - 1 = 5t - 3, -5 = 5g + 4t. Which is the second biggest value? (a) g (b) x (c) -3 a Let i = 100 - 502/5. Which is the biggest value? (a) 5 (b) i (c) -3/2 a Let g(o) = -o3 + 6o*2 + 7o + 6. Let k be (-3)/(-61/14). Let i be g(k). Suppose -2 - i = -2h. Which is the third biggest value? (a) 2 (b) h (c) 5 a Let w = 136 + -133. Which is the second smallest value? (a) 2/5 (b) 1 (c) w b Let y be -15(3 + (-309)/105). Let o = 0.9 + 0.1. Let v = -3 + o. What is the biggest value in y, 5, v? 5 Let n = 50 + -50. What is the biggest value in n, -5, 1? 1 Let x(f) = f2 + 2f - 4. Let n be x(-4). Let l be 10/42/20. Which is the second biggest value? (a) l (b) n (c) -1 a Let d = -3364097/51915 + 1/10383. Let m = d + 65. Which is the third biggest value? (a) m (b) -3/5 (c) 0.5 b Let z be 1 - (3 - 64/36). What is the third biggest value in 0.1, z, -0.5? -0.5 Let q = 26.8 + -27. Which is the second biggest value? (a) q (b) -0.5 (c) -1/3 c Let q = 1 - -3. What is the biggest value in -8, q, 5/2? q Let z = -8.14 + 0.14. Let p = -7.6 - z. Let n = p - 4.4. Which is the biggest value? (a) 1 (b) n (c) -5 a Let r = -509 - -329. Let q be (-42)/r2/(-28). Let y = -4/15 - q. What is the second biggest value in 5/6, 0.2, y? 0.2 Let b = 10 - 12. Let n be (1/b4)/2. What is the biggest value in 8, n, 1/10? 8 Let i = 10 - 6. Let w = -8.3 + 8. What is the third smallest value in -0.2, w, i? i Suppose 4k + 2 = 5k. Suppose kp - 28 + 8 = -4q, -2p = q - 11. Let u = 2 - 4. Which is the second biggest value? (a) u (b) -0.5 (c) p b Suppose 4m = -2p - 10, 3p - 5 = -2. Let g = 5 + m. What is the second biggest value in -2/7, g, -4? -2/7 Let d be 26/(-30) + 3/3. Let y be 2 - ((0 - -2) + -3). Let p be -6-4y/(-54). What is the third smallest value in d, 1/4, p? 1/4 Let m = 0.01 - 9.01. Let c = -14 - m. What is the biggest value in -1, 0, c? 0 Let i(x) = x3 + 5x*2 + 3x - 4. Let f be i(-4). Which is the third smallest value? (a) -2 (b) -4 (c) f c Let r(q) = -3q. Let m be r(-2). Let o be (4/m)/(10/45). Suppose -4j - o = -j. Which is the smallest value? (a) 0.4 (b) 5 (c) j c Let r = 1 + 0. Suppose 5x = 5g + 30, -4g + g + 2x - 17 = 0. Let j = g + r. Which is the biggest value? (a) -1/3 (b) 2/15 (c) j b Let c(g) = -g*3 - 3g*2 + 2g + 10. Let z be c(-3). What is the third smallest value in 6, z, -1/4? 6 Let x = -4/25 - -14/25. What is the third biggest value in -2, 0.1, x, 2/11? 0.1 Let v = -47733 + 382587/8. Let s = -90 + v. Which is the third biggest value? (a) 5 (b) 0.2 (c) s b Let m = -1.3 + 1. Let p = 10.9 - 12. Let z = -1 - p. Which is the second biggest value? (a) 0 (b) z (c) m a Let m = -0.41 + 7.21. Let c = m - 7. What is the third biggest value in 4, 0.2, c? c Let t = 12 - 0. Let i = t - 9. What is the third smallest value in -2, i, 1/5? i Let j = 5 - 7. Let z = -7 + 6. Let y = z + j. What is the third biggest value in y, 1, -4/7? y Let s be (-1)/(-10)(3 - -3). Let k be 135/(-399) - (-4)/14. Let v = k - 55/38. Which is the third smallest value? (a) s (b) -3/4 (c) v a Let f(z) = -z - 2. Let v be f(0). What is the biggest value in 1/2, 0, v? 1/2 Let k = -4.92 - 0.08. Let j = 86 + -82. Let z = k + j. What is the biggest value in z, -0.5, 0.1? 0.1 Let f = -27.4 - -27. What is the second biggest value in 4, -3, f? f Let s be (2/9)/((-2)/(-25)) + -3. Suppose -3k = 0, -4l + 4k = 6 + 10. Which is the second smallest value? (a) l (b) s (c) 1 b Let t(x) = x - 10. Let g be t(11). Which is the smallest value? (a) g (b) -1 (c) -2/7 b Let z be ((-80)/(-45) + -2)9/(-4). Which is the fourth smallest value? (a) 0 (b) -3 (c) z (d) -5 c Let n = -0.5 - 0.1. Let q = n - -4.6. Which is the third biggest value? (a) -2/11 (b) -4 (c) q b Suppose l + 192 = -l. Let c = l - -387/4. What is the second biggest value in c, -0.5, 2? c Suppose -30 = 5j - 11*j. Whi	{ "pile_set_name": "DM Mathematics" }
42 + 2u2 - 98u - 44 - 5u2. -3u*2 - 98u - 2 Collect the terms in -116c + 357c - 115c - 120c. 6c Collect the terms in -31369t + 15684t + 15682t. -3t Collect the terms in -12k + 50k2 - 20k + 23k - 18k + 34k. 50k*2 + 7k Collect the terms in -119l + 81l + 26l. -12l Collect the terms in -15q - 6 - 24q + 46q - 7q + 2q2. 2q*2 - 6 Collect the terms in -1 - 175534w + 51851w - 71342w. -195025w - 1 Collect the terms in 422j*2 - 138j*2 - 152j*2 - 149j*2. -17j*2 Collect the terms in -259s*2 + 2061s*2 + 773s*2 + 457s*2. 3032s*2 Collect the terms in -391b*3 - 771b*3 + 64b*3. -1098b*3 Collect the terms in -45 - 6t*3 - 8t*3 - 11 + 7t*3. -7t*3 - 56 Collect the terms in -53i + 1 - 1 + 0 - 46i + 102i. 3i Collect the terms in 1329 - 4012 + 1327 - 2z + 1356. -2z Collect the terms in -9 + 17k*3 - 5k*3 - 3 + 0 + 10. 12k*3 - 2 Collect the terms in -12958 - t + 6228 + 6730. -t Collect the terms in 467599 + 38f - 34f - 467599. 4f Collect the terms in -148n2 - 21n*2 - 49n*2. -218n*2 Collect the terms in -4f*2 + 137f + 114f + 3f*2 + 66f. -f*2 + 317f Collect the terms in 4455b - 696b + 2901b. 6660b Collect the terms in -2054n2 - 2236n*2 + 42n*2. -4248n*2 Collect the terms in -205j*2 - 245j*2 + 397j*2. -53j*2 Collect the terms in -18 - 22k + 0 + 0 - 8. -22k - 26 Collect the terms in 19i + 29i - 48i - 816i2 + 804i*2. -12i*2 Collect the terms in -183m - 219m - 254m - 106m - 14m. -776m Collect the terms in 26l - 8 + 33l + 19 + l - 14l. 46l + 11 Collect the terms in 3p*2 + 2p*2 - 90p*3 - 6 + 2. -90p*3 + 5p*2 - 4 Collect the terms in -65s + 275s - 71s - 70s - 62s. 7s Collect the terms in 14c - 14c + 152656c*2. 152656c*2 Collect the terms in 8 - 17 + 4179i*2 + 9. 4179i*2 Collect the terms in -430f*3 - 431f*3 - 1170f*2 + 1170f*2. -861f*3 Collect the terms in -13t*3 + 42t*3 - 20t + 130t3 + 23t. 159t3 + 3t Collect the terms in 31f2 + 1608437 - 1608437. 31f*2 Collect the terms in 300r*3 - 871r*3 + 277r*3 + 265r*3. -29r*3 Collect the terms in -22358523d - 22358523d + 2d*3 + 44717046d. 2d3 Collect the terms in -17m*2 - 135736 + 135737 + 91m*2. 74m*2 + 1 Collect the terms in 2h + 171h2 - 3h3 + h3 - h. -2h3 + 171h*2 + h Collect the terms in -5 + 34563v - 34579v + 5. -16v Collect the terms in -1974 + 4217 - 2243 + 2b. 2b Collect the terms in -4n - 10 - 6n + 1 + 5n - 5. -5n - 14 Collect the terms in 517i - 177i - 3 - 170i - 173i. -3i - 3 Collect the terms in 12821 + 3q - 12821. 3q Collect the terms in 543s*3 + 464s*3 - 1008s3. -s3 Collect the terms in 4w2 - 4473w*3 + 4812w*3 - 4w*2. 339w*3 Collect the terms in 79z*2 - 8z*2 - 5z*2 - 13z + 175z2. 241z*2 - 13z Collect the terms in 201c + 1 + 2 + 442c. 643c + 3 Collect the terms in -95l - 143l + 353l - 109l. 6l Collect the terms in -10120w2 - 2519w*2 - 3690w*2 + 1995w*2. -14334w*2 Collect the terms in -1207q + 2421q - 3 - 3 - 1213q + 6. q Collect the terms in -1718 + 679 + 216u - 215u. u - 1039 Collect the terms in 44t - 39t - 18 - 3t + 13. 2t - 5 Collect the terms in -1744t - 1733t - 1746t + 6894t - 1710t. -39t Collect the terms in -12h2 + 43h*2 - 21h*2 - 13h*2. -3h*2 Collect the terms in 34i + 68i + 30i - 130i. 2i Collect the terms in 34c2 - 22c*2 - 69c*2 + 4c*2. -53c*2 Collect the terms in -73d*3 + 94d*3 + 100d*3. 121d*3 Collect the terms in 66a - 59a - 10a*3 - 7a. -10a3 Collect the terms in 38d*3 - 35d*3 - 98d + 92d. 3d*3 - 6d Collect the terms in -774s + 389s + 403s. 18s Collect the terms in -8h3 + 3h*3 + 0h*3 - 30h*3 - 6h*3. -41h*3 Collect the terms in 208v*2 + 169v*2 + 356v*2 + 33v*2. 766v*2 Collect the terms in -6h - 3434 + h + 12h + 3434. 7h Collect the terms in -29g + 5g + 17g + 2g. -5g Collect the terms in -164l*3 - 2l*2 + 6l*2 + 344l*3 + 227l*3. 407l*3 + 4l*2 Collect the terms in 3115492 - 3115492 - 9b. -9b Collect the terms in -20g + 40g - 14g - 12g. -6g Collect the terms in 50g - 8g - 223g - 89g - 92g. -362g Collect the terms in 34139w + 51660w - 6107w + 14863w. 94555w Collect the terms in -38t*3 + 24t*3 + 21t*3. 7t*3 Collect the terms in 77 - 20a*2 - 58 + 12a*2 + 10a*2. 2a*2 + 19 Collect the terms in 197w*3 - 103w*3 - 104w*3. -10w*3 Collect the terms in 12h*2 - 63h + 28h + 35h - 2831h3 + 2834h*3. 3h*3 + 12h*2 Collect the terms in -753b + 496b - 746b. -1003b Collect the terms in 1317136605 - 3z - 1317136605. -3z Collect the terms in -1196x*3 + 2374x*3 - 1180x*3. -2x*3 Collect the terms in -228s - 46s3 - 267s + 495s. -46s*3 Collect the terms in -367c*2 + 5c*2 - 244c*2 - 232c*2 - 327c*2. -1165c*2 Collect the terms in 1563v*2 - 759v*2 - 773v*2. 31v*2 Collect the terms in -7243c*2 - 7268c*2 + 14516c*2. 5c*2 Collect the terms in 489f + 429f - 858f. 60f Collect the terms in 3 + 21 + 14 - 24 - 930n. -930n + 14 Collect the terms in -56u - 1341 + 1341. -56u Collect the terms in t + 0t + 30t3 + t - 16t*2 + t. 30t*3 - 16t*2 + 3t Collect the terms in 13a2 - 150a*2 - 4a*3 - 114a*2 + 26a*2. -4a*3 - 225a*2 Collect the terms in -27a*2 + 6a*2 + 2a*2 - 8a2 + a2. -26a2 Collect the terms in -11r - 4r + 4r*2 + 4r - 9r. 4r*2 - 20r Collect the terms in -989w2 + 221w*2 + 228w*2 + 314w*2 + 227w2. w2 Collect the terms in 84k2 + 42k*2 + 11k*2. 137k*2 Collect the terms in -141z + 8z + 55z + 45z. -33z Collect the terms in 14v + 11v*2 - 5v*2 - 12v. 6v2 + 2v Collect the terms in -34t + 49t - 14t - 39. t - 39 Collect the terms in 3t*2 + 3t2 - t2 - 1525t3. -1525t*3 + 5t*2 Collect the terms in 1893z*2 - 633z*2 - 622z*2 - 635z*2. 3z2 Collect the terms in -104 + 55 + z2 + 49. z*2 Collect the terms in -10f*2 + 67f*2 - 59f*2 - 126f*2. -128f*2 Collect the terms in -1746t - 1749t - 1755t + 5269t. 19t Collect the terms in -98899l2 + 32970l*2 + 32969l*2 + 2 + 32967l*2 - 2. 7l*2 Collect the terms in 1149s*2 - 2296s*2 + 1126s*2. -21s*2 Collect the terms in 4910a + 4636a - 9546a + 3a2. 3a*2 Collect the terms in 805m + 253m3 - 251m*3 - 805m. 2m3 Collect the terms in 653a - 596a - 55a. 2a Collect the terms in 955629 - 955629 - 2l*3. -2l*3 Collect the terms in -8s*2 + 5s*2 + 0s*2 - 8s*2. -11s*2 Collect the terms in -7146b + 1 + 14286b - 1 - 7142b. -2b Collect the terms in -88l + 320l - 79l - 83l - 80l. -10l Collect the terms in 100o*3 + 36779o - 36779o. 100o*3 Collect the terms in -668 - a - 592 - a + 1260. -2a Collect the terms in -p*2 - 1 + 1 + 512p*3 + 2 - 2p*2. 512p*3 - 3p*2 + 2 Collect the terms in -3 + 2w*2 + 157w*3 + 3 + 2514w - 160w3. -3w*3 + 2w*2 + 2514w Collect the terms in -39379x2 + 19685x*2 + 13x*3 + 19693x*2. 13x3 - x2 Collect the terms in 4f3 - 4665 + 14f - 4656 + 9321. 4f3 + 14f Collect the terms in 133v3 + 135v*3 + 132v*3 - 411v*3. -11v*3 Collect the terms in -318o*3 - 305o*3 + 621o*3. -2o*3 Collect the terms in -102 - 4 + 83s*2 - 76s*2. 7s*2 - 106 Collect the terms in -200 + 42l*2 + 97 + 103 - 29l*2. 13l*2 Collect the terms in -830x - 26556x - 39262x + 10968x. -55680x Collect the terms in 1237o3 - 2429o*3 + 1220o*3. 28o*3 Collect the terms in -3l*2 + 2258l + 2266l - 8l*2 - 6761l + 2237l. -11l*2 Collect the terms in -2s + 11s + 46s + 5s - 50s. 10s Collect the terms in -52 - 808065m + 808065m - 2m*2. -2m*2 - 52 Collect the terms in -9h + 9h + 33h*2 - 43h*2. -10h*2 Collect the terms in 11093h + 20005h + 25347h. 56445h Collect the terms in 248l*2 + 265l*2 - 95l*2 + 411l*2. 829l*2 Collect the terms in 6c*3 + 3098c*2 - 6 - 13c*3 - 3098c*2. -7c*3 - 6 Collect the terms in 29686 - 29686 - 5r. -5r Collect the terms in 510a*2 + 1074a*2 + 456a*2 - a. 2040a**2 - a Collect the te	{ "pile_set_name": "DM Mathematics" }
4g + 16. Is v a composite number? False Let y(w) = 170w*2 - 8w - 5. Let l be y(-4). Suppose -l = -6h + 2575. Is h a composite number? False Is (6/9)/(16/118488) a prime number? True Let x(t) = -63t + 2. Suppose 4g + 5 + 7 = -4f, -5g - 15 = f. Is x(g) prime? True Let h(g) = g2 + 3g - 7. Let j be h(-5). Suppose -2t = -jm - 2, -3m = -3t - 1 - 2. Is -2 + (-161 - 3)/m a prime number? False Suppose 0 = -87y + 99y - 46788. Is y a prime number? False Suppose -h + 12385 = 4j, 5h = 2j - 5j + 9276. Is j a prime number? False Let c be (-6)/((-6)/1 + (6 - 2)). Suppose -5z + 4 + 1 = 0, 0 = -cn - z + 3283. Is n a composite number? True Let j = -32 + 29. Let s(d) = -6d - 13. Let r(n) = 5n + 13. Let h(a) = js(a) - 4r(a). Is h(-17) a composite number? True Suppose -n + p - 1254 = -2n, 0 = -3n + 4p + 3797. Is n a prime number? True Suppose 0 = -5u + s - 567, -5u - s + 3s - 564 = 0. Let q = 44 - u. Is q a composite number? True Let o(d) = -d*2 - 15d - 49. Let q be o(-7). Let p(s) = 29s - 5. Let h be p(5). Let v = h - q. Is v prime? False Let s(f) be the first derivative of 32f*3/3 - 7f*2/2 - 14f + 42. Is s(5) prime? True Let z = -25 - -22. Let u be (-8)/z + (-2)/(-6). Is u/43516/3 prime? False Suppose -66 + 21 = 5i. Is -6 - i - (-62 + 0) composite? True Let f(j) = -j*3 + 5j*2 + 5j - 1. Let v be f(6). Let r(t) = 1 - 1 + 4t - 2 + 9t*2. Is r(v) a composite number? True Let d(p) = 93p. Let m be d(-2). Suppose -3 = -i, -2k + 12 = 4i - 6. Is k + 0 - m/3 composite? True Suppose 4o - 6o + z = -23359, 2o + 3z - 23339 = 0. Is o a prime number? True Let d be (0 + 3)(1 - (-140)/6). Let f = 142 - d. Is f composite? True Let z = -12 + 14. Suppose -zu - 394 = -3k, 3k + 3u = u + 410. Suppose -2d + 0d + 3p = -134, 0 = 2d - p - k. Is d a composite number? False Suppose -14 = -9q + 4. Suppose qv = -r + 4008, -2v - 3r = 796 - 4800. Is v a prime number? False Suppose -5f - 10 = -0f. Is (-97)/(3/(-1) - f) prime? True Suppose 0 = -2y - 0 + 2. Suppose -x - y = -2, -v = 2x - 6. Is (-1434)/(-10) + v/(-10) a composite number? True Let m = -174 - -475. Is m a composite number? True Let w(x) be the first derivative of 4x3/3 + x2 + x + 4. Let m be w(-1). Suppose 2y + 518 = 4s, -65 + 207 = s - my. Is s composite? False Suppose 26j - 182291 = 9j. Is j prime? True Let a = 107 - 230. Let u = 1036 + a. Let l = -408 + u. Is l a prime number? False Let k(z) = 78z*2 - 22z + 67. Is k(6) prime? False Suppose -t = -5z + 21, -4t = 3z - 0z - 8. Suppose 0x = -zx + 172. Let n = x - -28. Is n a composite number? False Suppose -7t + 5207 + 1716 = 0. Suppose -4v + 5v - t = 0. Is v composite? True Is ((-129175)/(-10) + 0)(-10 - -12) a prime number? False Let w be 9 + 4/(-3 - -2). Suppose -v + 352 = 3i + 4v, wv + 481 = 4i. Is i composite? True Is -7 + (-296)/(-40) - (-106833)/5 composite? True Let n(s) = -s*3 + 5s*2 + 2. Let c be n(5). Suppose -8 = -6t + ct. Suppose 0 = -tp + 469 - 99. Is p composite? True Suppose -5s + 22 = 4z - 10s, -3z - 4s = -1. Suppose -f - 777 = -3f - 5l, 0 = -3l - z. Is f a prime number? False Let q(h) = 152h - 163. Is q(18) prime? False Let r(v) = -v3 + 5v*2 + 8v - 9. Let x be r(6). Suppose xf = -5q - 0f - 2, 14 = -q - 4f. Suppose -3t - d = -1441, 6 - q = d. Is t a composite number? False Let v be 6 + -5 - (-3)/1. Suppose -c + 0l = -l, vc + 21 = -3l. Let f(u) = -5u + 6. Is f(c) composite? True Let l(h) = 6991h - 819. Is l(6) a composite number? True Let w = 25 - 22. Is 4 + 1 + 388w prime? False Is -25 + 32 + (241 - (3 + -6)) prime? True Suppose -9 = -6l + 3l. Is (-29)/((9/l)/(-39)) composite? True Let d = -58 + 108. Suppose -125 = -5z - d. Let x = 82 - z. Is x a composite number? False Suppose 6v + 7824 = 3v. Is v/(-6) + 11/33 - -2 a prime number? False Let k = 145 + -249. Let d = -175 - k. Let q = d + 158. Is q prime? False Let h(d) be the third derivative of d6/120 + d5/6 + d4/6 + d3/3 + 3d2. Let q be h(-8). Suppose 0z = -2z + q. Is z prime? False Let t be (-1 - (-15)/10)(-1 - 133). Let o = 51 - t. Is o prime? False Suppose 0 = -5f + 5x + 11011 + 8874, -2f = -x - 7954. Is f a prime number? False Let x(m) be the first derivative of 7m - 4m + 2 - 3m - m*2 + m. Is x(-4) composite? True Suppose 0d - 5h - 903 = 4d, -5d - 1107 = -h. Let b = -73 - d. Is b prime? True Suppose -4d = 5f - 6532 - 1073, -4d = -20. Is f a composite number? True Let c = -10 + 17. Suppose -5x - 13 = -4z + c, 0 = -z + 4x - 6. Is (37/2)/(5/z) composite? False Suppose 6p = 7p - 6708. Is p/16 + (-1)/4 prime? True Suppose 5a - 55281 = 3w - 2w, -2a = 4w - 22130. Is a a prime number? True Let h be (1/2)/((-1)/(-7 - 3)). Suppose -9q = -hq - 1156. Is q a prime number? False Suppose 0 = 5p + 5x, p - 4x - 18 - 2 = 0. Suppose -2d + 5d = pt - 1555, -2t = 4d - 794. Is t prime? False Suppose -5f + 24 = -51. Is 5 + f/(-5)-147 composite? True Let u be 2/(-4) - 15/(-6). Suppose -4d + 2782 = -2b, ud = 3d + 3b - 692. Is d a composite number? True Let n(y) = -y2 + 6y + 21. Let a be n(8). Suppose -3s + 34 = j - 71, -aj + 551 = 2s. Is j prime? False Let s = 2 - 0. Suppose 0 = si - 3n - n - 1402, 2i = -n + 1377. Is i prime? True Let j(q) = -q + 213. Let a be (1/30)/(-1). Let l be j(a). Let i = -64 + l. Is i a composite number? False Let q(d) = -3 - 10d*2 - 2d + 5d + 1 + 4d - 2d3. Is q(-7) composite? True Let g(p) = p3 + 57p*2 - p - 10. Is g(11) a prime number? False Let q(u) = 26u*2 - 2u - 15. Let b be q(9). Suppose -5r + 4n + 2155 = 84, -5r + b = -2n. Is r composite? True Suppose -1769 = -2r + 989. Is r prime? False Is (-221)/39 + 6 - 109796/(-3) a prime number? True Let t(l) = 497l - 3. Suppose 7m - 4 = 5m. Is t(m) a prime number? True Suppose 0 = -r + 16 - 7. Let q be (-2 - -1)/(r/(-45)). Suppose -660 = -qn - 5o, -2o + 3o + 122 = n. Is n prime? True Suppose 0 = -t + 9 - 6. Suppose 2n + 3133 - 1030 = 3o, -n = -to + 2103. Is o a prime number? True Let v(y) be the first derivative of y3 - 7y*2/2 + 10y - 10. Let t be v(-12). Suppose -2a + t = 3s - 7a, 3a - 319 = -2s. Is s prime? True Let z be (-1)/(-1 + 3/6). Suppose -4f - 646 = -zy, -2f + 5f - 12 = 0. Is y composite? False Suppose 4h - 18 = 7h. Let j be 34/8(-792)/h. Suppose -14k + j = -11k. Is k prime? False Let p be (25975/45 - 0) + 4/(-18). Let r = -14 + p. Is r prime? True Suppose 8 = -4z - 4r, z - 3z - 16 = -r. Let h(x) = -17x - 3. Let y(l) = -9l - 1. Let s(p) = 4h(p) - 7y(p). Is s(z) a prime number? False Let j(a) be the second derivative of a3/3 + 69a*2/2 + 10a - 9. Let q = 0 + 0. Is j(q) composite? True Let q = -27 - -33. Suppose -11x + 275 = -qx. Is x prime? False Let u be 21/(4 + -1) - 1. Suppose un - n + 25 = 0. Let v(b) = -11b. Is v(n) composite? True Suppose 5s = -f + 1272, -1220 = -f + 4s + 61. Is f a composite number? False Suppose 0 = 6d - d - 610. Let i = 59 - d. Is 2(i/(-2) + 2) a composite number? False Suppose -4680 = 4d - 9d. Let q = d - 215. Is q prime? False Is 5((-7614)/(-30) - -3) - 1 a prime number? True Let v(q) = 4q - 18. Let b be v(5). Suppose bn = 5n + 4z - 2997, -2z = -6. Is n a prime number? False Suppose 0p + 5n = 5p + 45, -3n = -9. Let u be p4/(-8)1. Suppose -4m + 3s + 391 = 0, -5s + 114 + 172 = um. Is m a composite number? False Let f(q) = -1232q + 673. Is f(-8) a prime number? True Let p(b) = -3b + 18. Let k be p(8). Is 8/k3/(-2) + 555 a composite number? False Let o(c) = -385c + 48. Suppose 2n = -10n - 60. Is o(n) prime? True Suppose 18j - 21j + 12 = 0, 2z + 4j = 12822. Is z a composite number? True Let v be (-6 - -1)(-7 - 109). Suppose -2 + 4 = p. Suppose 0 = px + 2x - v. Is x prime? False Let f(t) = -24t - 5 - 5t + t. Suppose -2v - 2 = 0, 2p + 4v + 22 = -p. Is f(p) a composite number? False Let d(p) = -p*3 + 23p*2 - 8p - 127. Is d(17) a prime number? True Suppose -3m = -6t - 21579, 11m = 12m - 5t - 7190. Is m a prime number? False Let p be 36/1076740/18. Is (-2)/(-10) + 11/(110/p) a prime number? False Let s(n) = -2n + 11. Let v be s(3). Suppose -b - vo - 375 = -988, -4o = 16. Is b a prime number? False Suppose -615t - 4673 = -616*	{ "pile_set_name": "DM Mathematics" }
lve 2t - 3l - 8 = 0, -t + 2 + 0 = -l for t. -2 Solve 0 = -2b + 4b - 3n - 25, 10 = -3b - 5n for b. 5 Solve 0 = 5f - 3y + 22, 30f = 29f - 2y + 6 for f. -2 Solve -3t - 15 = 3k, 4k - t = -3t - 12 for k. -1 Solve 5 = 2c - m, -3c = -5m + 6m for c. 1 Solve 0 = -m + 3z + 13, 30 = 4m - 2z + 8 for m. 4 Solve 0 = -5r + 13q - 8q - 10, -17 = -2r - 5q for r. 1 Solve 5o + 5 = 4b, -o - 1 = 2b - 4b for b. 0 Solve i + 11 = -i + m, -5m = -3i - 34 for i. -3 Solve 6i - 3i - 4 = 4w, -5 = 5w - 5i for w. -1 Solve 3h + 21 = 3c, 6c - 4c - 11 = h for c. 4 Solve 6r - 7 = -b + r, 0 = -3b + 2r - 13 for b. -3 Solve i + n + 9 = 0, -6i - 13 = -i - 3n for i. -5 Solve -5d = -d + q + 12, 0 = -4d + 2q for d. -2 Solve 3q = m - 0m + 14, -q = -5m for m. 1 Solve 5w + 13 = -2l, 7w + l - 7 = 9w for w. -3 Solve 4j + 4 = 5c, 4 = 2c - 6j + 5j for c. 4 Solve -3c - 17 = 2u, -29u - 21 = 3c - 26u for c. -3 Solve 5f = -5q + 10, 142f - 146f = 2q - 4 for f. 0 Solve 0 = r + 3w + 12, 14 = -4r - 5w + 1 for r. 3 Solve 0 = 3j + 3s - 5s - 13, -2j = 2s - 12 for j. 5 Solve -4a - 2z = 4, a - 3 + 14 = -3z for a. 1 Solve 3o - 25 = -4k, o - 2k + 5 = -0k for o. 3 Solve 5z - 5b - 11 = 3z, -4 = -z + 2b for z. -2 Solve -j + 15 = -4z, -35j = -38j - 4z - 3 for j. 3 Solve -35 = -3b - 5u, 4u - 2u - 28 = -4b for b. 5 Solve 0 = -6d + d + 2k + 3, -3d - 5k - 23 = 0 for d. -1 Solve -l + 1 = -a, -3a - 3 = 10l - 9l for l. 0 Solve 3w - 13 = 2b, 0w = -w + 3b + 2 for w. 5 Solve 5x = -2y + 35, 0y - 3y = 2x - 25 for y. 5 Solve 24 = -3m + 5k, 11m - 3k = 9m - 15 for m. -3 Solve 0 = 3k + 3q, k = 2q - 0q + 9 for k. 3 Solve 30x - 35x = c + 8, -4 = 2x for c. 2 Solve 2t + 5b - 5 = 0, -2 - 4 = -2b for t. -5 Solve 2u = -3z - 0 + 1, 0 = -4z - 4u + 8 for z. -3 Solve 32 = -4g - 4q, 0 = -24g + 22g + 3q + 4 for g. -4 Solve -4z - 29 = 3q + 2, 10 = -2q for z. -4 Solve -2v - f = -3, -5v - 9f = -4f - 20 for v. -1 Solve -4z + 32 = -4s, 5z = -s + 12 + 4 for s. -4 Solve -y - 18 = 5n, 4y + 3n + 9 = -12 for y. -3 Solve -4z + 6z - 20 = 4p, -20 = 3p - 4z for p. -4 Solve -y = 5w + 22, 0y = -3y - 4w - 22 for y. -2 Solve -4d + 4s = 29 - 61, 4d = 2s + 24 for d. 4 Solve -5w = 46u - 44u - 24, u - 2 = 0 for w. 4 Solve 0 = -26j + 22j + 4q - 8, 0 = -3q + 12 for j. 2 Solve 5h - 25 = -g, -6h + 11h - 25 = 3g for g. 0 Solve -3i + 20 = -5h, 3i + 8h = 10h + 17 for i. 5 Solve 0 = -3i + 2b - 9, 5i + 13 = 9b - 5b for i. -5 Solve z + 9 = -2l + 6, 5z + 5 = 0 for l. -1 Solve -3t - 7 = -2n, -9n + 10n = -4t - 2 for t. -1 Solve -2p - 3k + 4 = 0, 4p - 8 = -5k - 0 for p. 2 Solve 4x + 22u + 24 = 24u, -2x + 3u - 16 = 0 for x. -5 Solve -j - f = 9, -4f + 54 = -4j + 58 for j. -4 Solve v - 4z + 20 = 4v, -2v - 3z + 15 = 0 for v. 0 Solve 0 = 4b - 4m - 24, -9 = -b + 5m + 5 for b. 4 Solve -f + 3 = 2a, -5a = 7f - 2f - 15 for f. 3 Solve -2w - 2t = -4t + 10, w - 15 = -3t for w. 0 Solve 0 = 4n - 2y, 0 = -2n - 7y + 2y for n. 0 Solve -3d + 2 = -l + 3, 3d - 2l = 4 for d. -2 Solve 3w - o = 8, -12 = -4w - 2o + 3o for w. 4 Solve 4z = 4t + 16, 0 = 5t - 2z + 8 for t. 0 Solve 0 = b - 3, -10l - 15 = -7l - 5b for l. 0 Solve -4o - 5p = 3 + 25, 5p + 10 = 5o for o. -2 Solve -2o = 4l + 18 + 10, -o + 4l = -22 for o. -2 Solve 5d = -k - 102 + 122, -2d - 2k = 0 for d. 5 Solve 3u + 11 = 2a, -5u - 4a + 23 - 12 = 0 for u. -1 Solve 24 = -x + 5h, 4h + 7 = 2x + 25 for x. 1 Solve -4u - i = 3i + 8, 4 = -4u - 3i for u. 2 Solve -2h - d - 9 = 0, h + 12 = -3d - 5 for h. -2 Solve g - 2 = n + 1, g - 4n - 18 = 0 for g. -2 Solve -4x + 16 = -5i + 3, 3x = -3i + 3 for x. 2 Solve 0 = -5o + 4i - 40, -i = 4o - 3i + 26 for o. -4 Solve 3y + 1 = -4t - 25, -5y - 4t - 30 = 0 for y. -2 Solve 2m - 37 = 5o - 55, 0 = 5o - 20 for m. 1 Solve 3o - 6n + 7 = -n, n = 4o + 15 for o. -4 Solve 5u + 87 - 71 = -f, 0 = 5f + u - 16 for f. 4 Solve o - 1 = -3w + 13, -3w + o + 4 = 0 for w. 3 Solve -6d + 18 = -7d - 4b, 3d - 6 = 3b for d. -2 Solve -2i + 5d - 19 + 6 = 0, 3 = d for i. 1 Solve 2b + 6l - 11l - 7 = 0, 5l = -15 for b. -4 Solve -1779m + 1775m = -h - 14, -m + 4h = 4 for m. 4 Solve -2i + 2z - 8 = 0, 5z - 5 - 11 = 4i for i. -4 Solve -3x - 8 = g, -7g - 3x - 6 = -4g for g. 1 Solve 2h - 3h + 5u = -25, 4h - 4u - 20 = 0 for h. 0 Solve -3f - 5i - 14 = -1, 3i = 5f - 1 for f. -1 Solve 2j + 2j - 8 = -4y, -2y = 5j - 7 for y. 1 Solve o + 5r - 12 = -38, r = 4o - 1 for o. -1 Solve 4x + 3i = -28, -2x - 4i + i - 20 = 0 for x. -4 Solve -3s = -283z + 285z + 17, 5z = 5s - 5 for z. -4 Solve 0 = s + 3w, 6s - 3s - 2w = 0 for s. 0 Solve -2y = -5r - 17, 34y + 16 = 35y - 4r for y. -4 Solve 20 = 6g - g + 3p, 4g - 16 = -4p for g. 4 Solve k + 17 = 3g + 2k, 2g = k + 3 for g. 4 Solve 2r = 3w - 5, 2w = -4r + 1 + 13 for r. 2 Solve -4 + 0 = 5m - 4g, -2m + 4g - 4 = 0 for m. 0 Solve -o = -23c + 18c + 7, 15 = 5o for c. 2 Solve -m - 2h + 7 = 0, 1 = m - h - 3 for m. 5 Solve -2z + 8 = 2p, 2z + p = -2p + 7 for z. 5 Solve -20 = -5j - 13q + 8q, -30 = -5j + 5q for j. 5 Solve 5h = -0h + 4c - 33, h = -3c + 1 for h. -5 Solve 5w = -2x + 6, 4x - 2 - 10 = -5w for w. 0 Solve -g = 2f + 9 - 5, 4f + 5g = -8 for f. -2 Solve -f + 4 = -5a, -9a + 20 = -11a + 5f for a. 0 Solve 0 = -3x - 3n, 5x = 2x - 2n + 5 for x. 5 Solve -8u = 4j - 13u - 27, -3 = u for j. 3 Solve 0 = 2o + 2o + 4t + 8, 3o + 5t = -6 for o. -2 Solve n - k + 7 = 0, n + 2n + 17 = k for n. -5 Solve -5c - 5m = -25, 3c - 15 = 4m - 0m for c. 5 Solve 5t = 3q + 20, q - 2t - 3t = -20 for q. 0 Solve 0 = 4p, -3b - 3p = -8p - 3 for b. 1 Solve -4l - 2 = 4c - 6, 4l - 5c + 23 = 0 for l. -2 Solve q - 7 = -3i, i + 3q + 3 = -0q for i. 3 Solve 13r - 2 = 14r + 3a, -2r - 3a - 4 = 0 for r. -2 Solve 5t - 4m = 35, -2t - 3m - 9 = -0m for t. 3 Solve 9d - z + 1 = 7d, -17 = 4d + z for d. -3 Solve -4c - 5m - 1 = -9, 2c - 4 = -2m for c. 2 Solve -4z = 2b - 10, 3z - b = 4z - 1 for z. 4 Solve 63p + 8 = 67p, y + 5p = 5 for y. -5 Solve -3 = -2k - j, -2k + 5j + 9 = -12 for k. 3 Solve 2q = -3p - 9, 3p + 13 = -4q - 2 for p. -1 Solve 3w = -t - 15, 2t + w + 5 = 3t for t. 0 Solve 4x - j - 15 = x, 5x + 4j = 8 for x. 4 Solve -3m + p + 11 + 0 = 0, -5m + 4p + 9 = 0 for m. 5 Solve -23 = 2t + 5m - 15, -5m + 16 = -4t for t. -4 Solve -12m - 27 = -8m - 5d, -d + 3 = 0 for m. -3 Solve -u = -93l + 88l + 10, 5l = -3u - 10 for u. -5 Solve 17t - 18t + 10 = 2k, 3k - 15 = 3t for t. 0 Solve 2d = 14f - 9f, 0 = 5d - 4f for d. 0 Solve -4j - 22 = 5u + 7, 4u = 4j - 16 for j. -1 Solve 6 = 5z - 2h, -2h - 3h = 4z - 18 for z. 2 Solve -3m + 12 = 3c, -c = 4c - 5 for m. 3 Solve 3w + 0q - 13 = -q, -5w - 5q = -25 for w. 4 Solve -2w = -c + 8, -13 = -w + 2c - 20 for w. -3 Solve 0 = 3d - 2m - 5, 7d - 5d + 5m + 22 = 0 for d. -1 Solve 19z - 16z - 4m = -10, -2m = -4z for z. 2 Solve -3o - g = -19, 0 = -3o - 2o + 2g + 17 for o. 5 Solve -2f - v = -f + 6, 6 = -4f + 5v for f. -4 Solve -3p = 7 + 2, 5f - 15 = 5p for f. 0 Solve -2l - 24f + 12 = -20f, 15 = l + 5f for l. 0 Solve x = -f + 7, 2f + 3x = 3 + 14 for f. 4 Solve -p + w = 0, 4p - p = -4w + 28 for p. 4 Solve 0 = q - 4, -2q - 2 = 2k for k. -5 Solve 10 = -v + 5s, 2s - s + 19 = -4v for v. -5 Solve 5s - 25 = -a, 0 = -5s - a - 3a + 40 for s. 4 Solve 3p + 36 = -p - 5h, -3p + 3h = 0 for p. -4 Solve 5t + 2c = -19, 10 = -2c - 3c for t. -3 Solve -3j - x + 18 = 0, -2j + 5 = 2j - 5x for j. 5 Solve -y = -1, 3 = -3i + 6i - 3y for i. 2 Solve -3l + 7l - 3j = -15, -5l + j - 16 = 0 for l. -3 Solve 0 = 4d + 8, 4h - d = -33 + 19 for h. -4 Solve 4k - 16 = -4x, 0 = -2k + 5x - 48 + 35 for k. 1 Solve 5t + 3g + 24 = 0, 4g + 3 = 3t - 0t for t. -3 Solve -8 = 4y + 4, 5y = 5s + 5 for s. -4 Solve -5w - 7 = -3m, 4m = -w - 5 + 22 for w. 1 Solve 23h - 19h = -5j - 20, 3j - 4h - 20 = 0 for j. 0 Solve 14 - 24 = -3f - r, -14 = -5f - r for f. 2 Solve -3t - d = 11, 2d = -4t - 7 - 7 for t. -4 Solve -5x = -n - 6, 2 = 5n - 18 for x. 2 S	{ "pile_set_name": "DM Mathematics" }
many minutes are there between 5:08 PM and 4:50 AM? 702 What is 154 minutes after 9:21 AM? 11:55 AM How many minutes are there between 4:25 PM and 12:41 AM? 496 What is 703 minutes before 10:35 AM? 10:52 PM What is 402 minutes before 3:40 AM? 8:58 PM How many minutes are there between 3:49 PM and 3:58 PM? 9 What is 505 minutes after 11:29 PM? 7:54 AM How many minutes are there between 7:03 PM and 4:33 AM? 570 What is 710 minutes after 7:40 PM? 7:30 AM How many minutes are there between 4:07 AM and 3:27 PM? 680 What is 331 minutes before 8:46 PM? 3:15 PM How many minutes are there between 3:36 AM and 9:21 AM? 345 How many minutes are there between 1:22 AM and 11:21 AM? 599 What is 543 minutes before 4:39 AM? 7:36 PM What is 244 minutes after 2:25 AM? 6:29 AM What is 359 minutes after 10:00 PM? 3:59 AM How many minutes are there between 2:41 PM and 11:31 PM? 530 What is 456 minutes before 2:53 PM? 7:17 AM How many minutes are there between 4:42 PM and 7:22 PM? 160 How many minutes are there between 4:52 AM and 5:51 AM? 59 How many minutes are there between 8:02 PM and 10:17 PM? 135 What is 238 minutes before 4:11 PM? 12:13 PM How many minutes are there between 12:06 AM and 10:13 AM? 607 What is 296 minutes after 11:56 PM? 4:52 AM What is 410 minutes after 11:30 PM? 6:20 AM How many minutes are there between 10:36 AM and 6:49 PM? 493 What is 667 minutes after 4:58 AM? 4:05 PM How many minutes are there between 10:25 PM and 6:49 AM? 504 How many minutes are there between 5:03 AM and 2:36 PM? 573 What is 223 minutes before 2:26 PM? 10:43 AM How many minutes are there between 8:31 PM and 6:36 AM? 605 How many minutes are there between 1:56 PM and 6:49 PM? 293 How many minutes are there between 3:14 PM and 1:32 AM? 618 What is 657 minutes after 1:00 AM? 11:57 AM What is 50 minutes after 3:22 AM? 4:12 AM How many minutes are there between 12:29 PM and 3:07 PM? 158 How many minutes are there between 12:47 PM and 3:37 PM? 170 How many minutes are there between 1:10 AM and 3:00 AM? 110 What is 277 minutes after 7:36 AM? 12:13 PM What is 14 minutes after 11:46 PM? 12:00 AM What is 289 minutes after 3:39 AM? 8:28 AM What is 63 minutes after 10:20 PM? 11:23 PM How many minutes are there between 1:57 PM and 1:51 AM? 714 What is 410 minutes after 11:00 AM? 5:50 PM How many minutes are there between 8:53 AM and 4:41 PM? 468 How many minutes are there between 4:26 PM and 6:21 PM? 115 What is 132 minutes before 4:40 PM? 2:28 PM How many minutes are there between 10:44 PM and 1:19 AM? 155 How many minutes are there between 6:46 PM and 12:03 AM? 317 How many minutes are there between 3:16 AM and 8:26 AM? 310 How many minutes are there between 1:55 AM and 7:37 AM? 342 How many minutes are there between 8:27 AM and 12:10 PM? 223 How many minutes are there between 1:13 PM and 5:33 PM? 260 What is 41 minutes before 11:35 AM? 10:54 AM How many minutes are there between 12:37 PM and 1:21 PM? 44 What is 419 minutes after 1:15 AM? 8:14 AM How many minutes are there between 9:46 AM and 10:37 AM? 51 How many minutes are there between 8:47 AM and 2:53 PM? 366 How many minutes are there between 12:26 AM and 4:36 AM? 250 How many minutes are there between 1:03 PM and 10:59 PM? 596 What is 202 minutes before 9:40 AM? 6:18 AM What is 291 minutes before 8:08 PM? 3:17 PM How many minutes are there between 8:23 AM and 11:02 AM? 159 How many minutes are there between 9:04 AM and 9:40 AM? 36 What is 670 minutes after 11:22 PM? 10:32 AM What is 41 minutes before 3:10 PM? 2:29 PM How many minutes are there between 9:10 PM and 10:00 PM? 50 How many minutes are there between 3:05 PM and 8:29 PM? 324 How many minutes are there between 1:09 PM and 4:31 PM? 202 What is 678 minutes after 11:20 AM? 10:38 PM How many minutes are there between 12:29 PM and 7:17 PM? 408 How many minutes are there between 4:26 PM and 12:27 AM? 481 What is 466 minutes after 11:24 PM? 7:10 AM How many minutes are there between 10:50 AM and 11:49 AM? 59 What is 12 minutes after 6:43 PM? 6:55 PM How many minutes are there between 7:09 AM and 11:39 AM? 270 What is 366 minutes after 9:26 AM? 3:32 PM What is 141 minutes after 5:46 PM? 8:07 PM How many minutes are there between 2:37 AM and 1:29 PM? 652 What is 160 minutes before 12:28 PM? 9:48 AM How many minutes are there between 8:59 AM and 5:49 PM? 530 How many minutes are there between 10:35 PM and 3:18 AM? 283 What is 166 minutes before 7:08 PM? 4:22 PM What is 591 minutes before 1:55 PM? 4:04 AM What is 710 minutes before 10:30 PM? 10:40 AM What is 514 minutes after 8:41 AM? 5:15 PM What is 459 minutes before 5:58 PM? 10:19 AM How many minutes are there between 6:35 AM and 4:03 PM? 568 What is 110 minutes before 9:22 AM? 7:32 AM How many minutes are there between 8:26 PM and 4:28 AM? 482 How many minutes are there between 8:13 PM and 7:50 AM? 697 What is 643 minutes before 2:53 AM? 4:10 PM What is 689 minutes before 11:45 PM? 12:16 PM How many minutes are there between 8:15 AM and 8:27 AM? 12 What is 166 minutes after 8:40 AM? 11:26 AM What is 44 minutes before 9:20 PM? 8:36 PM How many minutes are there between 10:23 PM and 3:54 AM? 331 What is 321 minutes after 9:39 PM? 3:00 AM How many minutes are there between 5:55 PM and 8:29 PM? 154 How many minutes are there between 1:50 PM and 10:57 PM? 547 How many minutes are there between 11:13 AM and 6:41 PM? 448 What is 160 minutes after 2:59 AM? 5:39 AM What is 404 minutes after 5:12 PM? 11:56 PM What is 473 minutes before 10:12 PM? 2:19 PM What is 69 minutes before 3:43 PM? 2:34 PM What is 186 minutes after 11:20 PM? 2:26 AM How many minutes are there between 9:00 AM and 11:45 AM? 165 What is 171 minutes after 9:32 PM? 12:23 AM How many minutes are there between 5:53 PM and 2:45 AM? 532 What is 641 minutes after 11:10 AM? 9:51 PM How many minutes are there between 4:40 AM and 9:42 AM? 302 How many minutes are there between 2:58 AM and 5:59 AM? 181 What is 568 minutes after 9:35 AM? 7:03 PM How many minutes are there between 10:34 PM and 4:46 AM? 372 How many minutes are there between 3:39 AM and 2:46 PM? 667 What is 611 minutes before 1:10 AM? 2:59 PM How many minutes are there between 6:14 AM and 8:09 AM? 115 How many minutes are there between 12:39 AM and 2:21 AM? 102 How many minutes are there between 8:05 PM and 10:40 PM? 155 What is 707 minutes before 11:32 AM? 11:45 PM How many minutes are there between 6:59 AM and 10:54 AM? 235 What is 424 minutes before 1:53 AM? 6:49 PM What is 704 minutes after 1:35 PM? 1:19 AM How many minutes are there between 7:23 AM and 1:51 PM? 388 What is 708 minutes before 6:28 AM? 6:40 PM How many minutes are there between 7:52 AM and 1:36 PM? 344 How many minutes are there between 5:28 PM and 4:46 AM? 678 How many minutes are there between 7:31 AM and 6:46 PM? 675 How many minutes are there between 4:30 AM and 5:11 AM? 41 What is 98 minutes before 12:05 PM? 10:27 AM What is 322 minutes after 5:47 PM? 11:09 PM What is 664 minutes after 1:52 PM? 12:56 AM What is 289 minutes after 7:18 AM? 12:07 PM What is 430 minutes after 11:51 PM? 7:01 AM What is 454 minutes before 9:49 PM? 2:15 PM How many minutes are there between 7:47 PM and 5:30 AM? 583 How many minutes are there between 12:54 PM and 12:37 AM? 703 How many minutes are there between 8:48 AM and 2:15 PM? 327 How many minutes are there between 9:35 AM and 10:42 AM? 67 What is 504 minutes after 7:29 AM? 3:53 PM How many minutes are there between 1:11 AM and 3:33 AM? 142 How many minutes are there between 7:10 AM and 8:01 AM? 51 How many minutes are there between 1:49 AM and 3:05 AM? 76 How many minutes are there between 4:57 AM and 7:21 AM? 144 What is 82 minutes after 10:49 AM? 12:11 PM What is 252 minutes after 7:13 PM? 11:25 PM What is 679 minutes before 10:30 AM? 11:11 PM What is 597 minutes before 5:29 PM? 7:32 AM What is 609 minutes after 3:34 AM? 1:43 PM What is 264 minutes before 10:00 AM? 5:36 AM What is 238 minutes after 7:07 PM? 11:05 PM What is 627 minutes after 9:35 PM? 8:02 AM What is 126 minutes after 11:10 PM? 1:16 AM How many minutes are there between 5:45 AM and 8:41 AM? 176 How many minutes are there between 8:43 PM and 11:34 PM? 171 How many minutes are there between 4:42 AM and 3:18 PM? 636 How many minutes	{ "pile_set_name": "DM Mathematics" }
*2 - 4x - 2. Let y(c) = 2c3 + 3c*2 - 3. Let z be y(-2). Let m(w) = -w - 3. Let b be m(z). What is the least common multiple of 8 and o(b)? 56 Suppose 1081 = 3d + 5p, 5d + 6p - 9p = 1745. What is the smallest common multiple of 224 and d? 2464 Suppose 0 = 5m, -o + 160 = o + m. What is the common denominator of 169/o - (-2)/10 and ((6/(-15))/1)/(64/(-1180))? 16 Let f = -26 - -75. Suppose n + 43 = f. Calculate the lowest common multiple of 8 and n. 24 Let d = 2/9797 + 519223/88173. Find the common denominator of -23/18 and d. 18 Calculate the common denominator of -19/8 and (8 - 76/8)/((-411)/(-47)). 1096 Suppose 2i = 5h + 26 - 4, -4h = -5i + 21. Suppose n - 5 = -i. Suppose p + 0p - 1 = 5v, -nv - 14 = -3p. What is the least common multiple of p and 18? 18 Let c(u) = u3 - 3u*2 - 19u + 14. Calculate the lowest common multiple of c(6) and 917. 7336 Let m be 12/14(-14)/(-3). Suppose 0 = 2a + 4f - 72, -155 = -a - ma - 5f. Suppose -s = 4 - a. What is the least common multiple of s and 6? 66 Find the common denominator of -19/77 and (1 - 66/(-105)) + 10/35. 385 Let d = -186 + 190. Calculate the least common multiple of 598 and d. 1196 Let r = 11 + 385. What is the least common multiple of 264 and r? 792 Suppose -4i - 40 = -4q, -30 = -4q - i + 30. Let z = -5 + 10. Suppose -5n + 29 = zu + 4, 15 = 5n. What is the lowest common multiple of u and q? 14 Let z(y) = y3 - 13y*2 + 16y - 30. What is the least common multiple of 36 and z(12)? 36 Let s(f) = 21f - 54. What is the smallest common multiple of 66 and s(4)? 330 Let f = 153/28 - 2417/140. Find the common denominator of 16/11 and f. 55 Suppose 0 = -5v - 51 + 71. Suppose 100 = 5k - vj, 4j + 28 = 2k - 0k. What is the lowest common multiple of 4 and k? 24 Let z = 28 + 1. Suppose 46 = 5s - z. Calculate the least common multiple of 33 and s. 165 Suppose -5r + 7r - 38 = 0. Suppose -17h + rh = 0. Suppose -x = -hx - 11. What is the least common multiple of x and 2? 22 Let n be 2212/(-16) - 9/12. Let t = n - -535/4. What is the common denominator of t and -83/2? 4 Suppose -83 = 5a - 43. What is the smallest common multiple of (-134)/(-16) + 3/a and 3? 24 Let w = 40 - 36. Calculate the smallest common multiple of 5 and 3/((1/w)/((-1)/(-6))). 10 Let u(q) = -q*2 - 6q + 33. Find the common denominator of -73/4 and u(-11). 4 Find the common denominator of 1515/(-42) + (-3)/7 and 12/115. 230 Let l(c) = c*3 - 13c*2 + 14c - 16. What is the least common multiple of (-31 + 9)(-1)/(4/8) and l(12)? 88 Suppose -4f - 2d + 160 = 0, -5 + 125 = 3f + 3d. Calculate the smallest common multiple of 31 and f/(-4)1/(-2). 155 Let p = 87 - 85. Suppose 0 - 10 = -pl. Calculate the smallest common multiple of l and 4. 20 Suppose -79z - 6006 = -92z. Calculate the smallest common multiple of 22 and z. 462 Let u = 12 + -6. Let q(p) = -2p*2 - 4p - p - 2p3 - 4 - p + 5p. What is the least common multiple of q(-2) and u? 6 Let d be -3(-3 - 69/(-9)). Calculate the common denominator of 37/14 and ((-87)/d)/(30/(-21)). 140 Let v(l) = -l2 - 5l + 7. Suppose -6 + 17 = d. What is the smallest common multiple of v(-5) and d? 77 Let p(z) = -z*3 + 5z*2 + 3z + 2. Let d be p(6). Suppose 0 = 2h - 4u + 4, 4u = -2h + h - 8. Calculate the lowest common multiple of 6 and 112/(d/h). 6 Let b be (-34)/(-12) + 3/18. Let h = b - 9. What is the lowest common multiple of 6 and (h/9)/((-6)/27)? 6 Suppose -20 = -5k - 15. Suppose -g + 2g + 5t + k = 0, -5t = 10. What is the common denominator of -27/10 and g? 10 Let n = 12 - 2. Suppose -4 = -q + n. What is the lowest common multiple of 8 and q? 56 Let n = -2717/4 + 654. What is the common denominator of 77/46 and n? 92 Let u(g) = -6g - 6. Let p be u(5). Let d be ((-3)/p)/(15/(-1418931)). Let i = d + 7886. Calculate the common denominator of -103/20 and i. 20 Let m = 927 - 4614/5. Find the common denominator of m and 6/2 - 62/3. 15 Let q = -1438/1931061 - -3/1793. Let a = q + -15439/2154. Find the common denominator of 79/8 and a. 24 Let c = 41558960407/3729710952 + 4/4709231. Let i = 23/99 + c. Calculate the common denominator of -89/18 and i. 72 Let c = -1924/5 + 15227/40. Let h = 2789/355 - 4/71. Calculate the common denominator of h and c. 40 Suppose -3l + 12 = -2l. Suppose -3j = -2b + 7b - 51, 5b - 63 = j. Calculate the least common multiple of l and 16/3 + b/18. 12 Let b = 2 - 2. Suppose 2k + bk - 14 = 0. Suppose 110 = 8q + 6. What is the least common multiple of q and k? 91 Let q = 5910/13 + -117537/260. Let l be ((-1)/(-2))/((-1)/(-30)). Calculate the common denominator of q and (1/l)/(2/(-111)). 20 Let j = -6234 + 99801/16. Calculate the common denominator of 2/(-6) - 349/60 and j. 80 Suppose 2r + 4c = -3r + 13937, 2c + 13919 = 5r. Let a = -44483/16 + r. Find the common denominator of -74/9 and a. 144 Let y = 1159 - 336109/290. Calculate the common denominator of -95/174 and y. 870 Suppose -4f - 64 = m - 145, 236 = 3m + 5f. Calculate the smallest common multiple of 35 and m. 385 Suppose 195 = 4s + s. Suppose 5a - s = -4o + 2o, 3o + 3a - 63 = 0. Let d = o - 2. Calculate the smallest common multiple of d and 2. 20 Let t = -1329 + 1569. What is the smallest common multiple of 14 and t? 1680 Suppose -x - 6 = -3d + x, 5x + 6 = 3d. Suppose -2o + 4 = -16. What is the least common multiple of o and d? 10 Let u = 7781483/175 + -44469. Let m = -44/25 + u. What is the common denominator of (24/132)/((-2)/5) and m? 77 Let c = -7010 + 11390. Let u be c/(-16) - (-2 - -4). Let n = -274 - u. What is the common denominator of n and -3/4? 4 What is the common denominator of 53/200 and ((-142)/(-5))/((-10)/(-25) - 2)? 200 Suppose -2l - 10 + 46 = 0. Let v(m) = -m*3 - 15m*2 - 28m + 12. Let w be v(-13). Let j = w - l. Calculate the smallest common multiple of j and 22. 220 Suppose -k + 5r + 30 = 0, 4k + 3r = 6k - 32. Calculate the least common multiple of (-4 + (-1 - -3))/(-1) and -6(2 - k/3). 8 Suppose h - 3k + 9 = 0, 18h - 13h = k + 25. Suppose -f + 12 = 1. What is the least common multiple of f and h? 66 Let k be -5 + (-1)/(1/(-49)). Suppose 8 = -kn + 48n. Calculate the smallest common multiple of n and 11. 22 Find the common denominator of (100 - 5)/(141 - -1) and 82/15. 2130 Suppose 8j - 199 = 817. Let o = 130 - j. What is the smallest common multiple of 3 and o? 3 Let s = -84 + 90. Let o(v) = 3v*2 - 8v. Let l(y) = -y*2 - 1. Let z(w) = -2l(w) - o(w). What is the lowest common multiple of 5 and z(s)? 70 Let i = -28/93 + 4837/930. Find the common denominator of i and 8 - (-3)/((-567)/2030). 270 Suppose 4g - 3g - 4r - 2 = 0, 3g + 5r = 23. Suppose 4q - 2y = 24, -69q = -71q + 3y + 12. Calculate the smallest common multiple of g and q. 6 Suppose l - 62 = 2u, 2l + 4u + 22 = 178. What is the least common multiple of 20 and l? 140 Let w = -4335038/1989 + 28338/13. What is the common denominator of 5/57 and w? 2907 Let b(g) = 1 + 3 - 5 + 2g*2 + 5g + 2g. Suppose 3j = -2j + 50. What is the smallest common multiple of j and b(-5)? 70 Let j be 5/1 - (0/(-1) + -2). Suppose -c = -j + 5. Calculate the smallest common multiple of 106 and c. 106 Let b be 1-4(-4)/((-52928)/(-12)). Let f = b + 50327/33080. What is the common denominator of -61/8 and f? 40 Let o be 89205/(-5810) + 4 + 4. Let m = o - 2/581. Calculate the common denominator of -65/6 and m. 42 Calculate the common denominator of (-579)/252 + ((-56)/49)/4 and 17/1110. 2220 Suppose 2l - 5w - 46 = 0, 2w - 136 = -5l + 37. What is the least common multiple of 18 and l? 198 Let b = -3 - -3. What is the common denominator of b + ((-71)/(-30) - -1) and 1020/(-40)(-1)/3? 30 Let m be ((4 - 5) + 3)/2. Let h(t) = -t. What is the smallest common multiple of h(-6) and (18/(-12))/(m/(-28))? 42 Suppose 4n - n + 3a = -36, -4n - 54 = a. Let p = n + 21. What is the lowest common multiple of 10 and p? 70 Let n = 4329/5 - 17761/20. Suppose -h + 838 = -2h. What is the common denominator of n and h/36 + 12/(-54)? 4 Suppose -16 = q - 2g, -3q - g - 4 = 9. Find the common denominator of (-149)/q - 12/9 and ((-23)/(-3))/((-3)/(-6)). 6 Let x = -57 - -101. Let k = 62 - x. What is the least common multiple of 4 and k? 36 Let r = -325 + 337. Calc	{ "pile_set_name": "DM Mathematics" }
rest ten? -60 Round -19.6785 to 1 dp. -19.7 Round 0.96 to the nearest integer. 1 What is -0.2206 rounded to two decimal places? -0.22 What is 0.08474 rounded to 3 decimal places? 0.085 Round 4527000 to the nearest one hundred thousand. 4500000 What is -0.00011766 rounded to 4 dps? -0.0001 What is 1555.8 rounded to the nearest ten? 1560 Round -0.00012056 to 5 dps. -0.00012 Round 0.09645 to 1 decimal place. 0.1 What is -671.68 rounded to the nearest one hundred? -700 Round 0.00081 to three decimal places. 0.001 Round -0.005415 to 4 decimal places. -0.0054 What is 84380000 rounded to the nearest 1000000? 84000000 Round 0.84833 to 1 dp. 0.8 Round 3.677 to one decimal place. 3.7 Round -0.0001895 to 5 decimal places. -0.00019 Round 0.0091562 to 3 decimal places. 0.009 Round -18120 to the nearest 1000. -18000 What is -5.6806 rounded to one dp? -5.7 What is 2545900 rounded to the nearest ten thousand? 2550000 What is -1355.91 rounded to the nearest 10? -1360 What is -0.0019337 rounded to four dps? -0.0019 What is 0.008683 rounded to 4 dps? 0.0087 What is 103.54 rounded to the nearest integer? 104 Round -145811000 to the nearest 1000000. -146000000 What is -3250000 rounded to the nearest one million? -3000000 Round 40.52 to the nearest integer. 41 What is -3.61 rounded to the nearest integer? -4 Round -108810 to the nearest one thousand. -109000 What is 0.0000001349 rounded to 7 dps? 0.0000001 Round 0.00000152 to six dps. 0.000002 What is -28.14 rounded to zero dps? -28 What is 1503300 rounded to the nearest one hundred thousand? 1500000 What is 0.125792 rounded to three decimal places? 0.126 What is 2173800 rounded to the nearest ten thousand? 2170000 What is 0.0000034754 rounded to 6 decimal places? 0.000003 What is -33.4 rounded to the nearest 10? -30 What is 10093800 rounded to the nearest 100000? 10100000 Round 81.8 to the nearest integer. 82 Round -19050000 to the nearest 1000000. -19000000 Round -752200 to the nearest one hundred thousand. -800000 Round 0.4206 to two dps. 0.42 What is 0.0004541 rounded to 5 dps? 0.00045 What is 34820 rounded to the nearest ten thousand? 30000 What is -0.000009275 rounded to seven dps? -0.0000093 What is -48.08 rounded to the nearest integer? -48 What is -0.0451 rounded to two decimal places? -0.05 Round 1629100 to the nearest one hundred thousand. 1600000 What is -605 rounded to the nearest 100? -600 What is 20.65 rounded to the nearest integer? 21 Round 0.01247 to four decimal places. 0.0125 What is -0.000002666 rounded to seven dps? -0.0000027 What is -3.7978 rounded to 2 decimal places? -3.8 What is 7247 rounded to the nearest one hundred? 7200 Round 2430 to the nearest 10000. 0 What is -0.0112201 rounded to five dps? -0.01122 What is 0.2538 rounded to 3 decimal places? 0.254 Round -38911000 to the nearest one hundred thousand. -38900000 What is -0.29932 rounded to three decimal places? -0.299 What is 7.151 rounded to 0 decimal places? 7 Round 0.0002442 to 4 dps. 0.0002 What is -3.36 rounded to one dp? -3.4 Round -1161400 to the nearest ten thousand. -1160000 What is 23108 rounded to the nearest 1000? 23000 Round 3356000 to the nearest 100000. 3400000 What is -0.005503 rounded to 4 dps? -0.0055 Round 0.00001525 to six dps. 0.000015 Round 0.008274 to three dps. 0.008 Round -0.0042936 to 3 decimal places. -0.004 Round -0.0001131 to 6 decimal places. -0.000113 Round -3080400 to the nearest 10000. -3080000 What is -5708.1 rounded to the nearest one hundred? -5700 What is -2061090 rounded to the nearest 10000? -2060000 What is -0.60135 rounded to two dps? -0.6 What is -0.3754 rounded to 2 dps? -0.38 What is 10370000 rounded to the nearest one hundred thousand? 10400000 What is -13209 rounded to the nearest 1000? -13000 What is 0.0000076894 rounded to 6 decimal places? 0.000008 Round 119252 to the nearest ten thousand. 120000 What is -25.696 rounded to the nearest integer? -26 Round 0.69659 to 1 decimal place. 0.7 Round -0.06254 to two decimal places. -0.06 What is -637.4 rounded to the nearest 100? -600 Round 3.66 to the nearest integer. 4 Round -0.0000034355 to 6 dps. -0.000003 What is 3376 rounded to the nearest one thousand? 3000 Round -0.009645 to 3 dps. -0.01 What is -20.254 rounded to 0 decimal places? -20 What is -0.0000008588 rounded to seven decimal places? -0.0000009 What is -0.0000499908 rounded to six dps? -0.00005 Round -7590000 to the nearest 100000. -7600000 What is -0.3909 rounded to two decimal places? -0.39 Round -0.7655 to one dp. -0.8 Round 0.000225 to four dps. 0.0002 Round 0.00000272 to six decimal places. 0.000003 What is -0.05298 rounded to 3 dps? -0.053 What is 873.56 rounded to the nearest 100? 900 What is 6580000 rounded to the nearest 1000000? 7000000 What is -0.000952 rounded to 4 dps? -0.001 Round -0.00000867 to 6 decimal places. -0.000009 Round 0.336 to one dp. 0.3 Round 32803 to the nearest 100. 32800 What is 0.000031749 rounded to 7 decimal places? 0.0000317 What is -160708 rounded to the nearest one thousand? -161000 What is 1205000 rounded to the nearest one hundred thousand? 1200000 What is -658.23 rounded to the nearest 10? -660 Round 0.0066521 to 5 dps. 0.00665 Round -10300 to the nearest 10000. -10000 What is -0.0000008825 rounded to seven decimal places? -0.0000009 What is 0.0003042 rounded to 5 decimal places? 0.0003 What is -0.00000879 rounded to 6 dps? -0.000009 What is 6907.4 rounded to the nearest one hundred? 6900 What is 1844100 rounded to the nearest 100000? 1800000 What is -23135000 rounded to the nearest one hundred thousand? -23100000 Round 0.00000704 to seven decimal places. 0.000007 Round -14.82 to the nearest integer. -15 What is 12.061 rounded to the nearest integer? 12 Round -0.512 to 1 dp. -0.5 What is -0.000979 rounded to five dps? -0.00098 What is -38.18 rounded to 1 dp? -38.2 What is 383530 rounded to the nearest 10000? 380000 What is -11.2023 rounded to 1 dp? -11.2 What is -8356000 rounded to the nearest 100000? -8400000 Round 18876 to the nearest 1000. 19000 What is 0.00000555936 rounded to 7 decimal places? 0.0000056 Round 0.000001205 to five decimal places. 0 Round -1.969 to 1 decimal place. -2 What is -0.000244 rounded to 6 decimal places? -0.000244 Round 0.00016192 to 4 decimal places. 0.0002 Round -768 to the nearest ten. -770 What is -0.20449 rounded to one decimal place? -0.2 What is 1397.47 rounded to the nearest 10? 1400 Round -0.000585 to 4 decimal places. -0.0006 Round 6.25 to one decimal place. 6.3 Round -0.000059361 to seven dps. -0.0000594 Round -0.066556 to two dps. -0.07 Round -32150 to the nearest one hundred. -32200 Round -30.48 to the nearest integer. -30 Round -2704000 to the nearest one hundred thousand. -2700000 Round -61745 to the nearest 100. -61700 What is 328200 rounded to the nearest 10000? 330000 What is 18031000 rounded to the nearest 100000? 18000000 What is 0.000020165 rounded to 7 dps? 0.0000202 What is 213400 rounded to the nearest 1000? 213000 Round -0.00000341 to 6 dps. -0.000003 What is -1.06307 rounded to two dps? -1.06 What is 0.0000067653 rounded to 7 dps? 0.0000068 What is 5594 rounded to the nearest one thousand? 6000 What is 0.0000365 rounded to 5 decimal places? 0.00004 Round -0.00001522 to seven decimal places. -0.0000152 Round 0.007391 to four dps. 0.0074 What is -285700 rounded to the nearest ten thousand? -290000 What is -7.075 rounded to 2 dps? -7.08 Round 444.46 to 0 decimal places. 444 Round 0.00308146 to 5 decimal places. 0.00308 Round 0.15206 to one dp. 0.2 Round 254900 to the nearest one hundred thousand. 300000 What is 19890000 rounded to the nearest one million? 20000000 Round 5236 to the nearest 100. 5200 Round 79806 to the nearest 1000. 80000 What is -0.000010786 rounded to seven dps? -0.0000108 Round -42429000 to the nearest 1000000. -42000000 Round 222.225 to the nearest 10. 220 Round -0.004263 to four dps. -0.0043 What is -0.000123824 rounded to six decimal places? -0.000124 Round -0.550849 to two dps. -0.55 What is -31090 rounded to the nearest 1000? -31000 Round 0.009404 to 3 dps. 0.009 What is -0.059199 rounded to two dps? -0.06 What is -19798000 rounded to the nearest one hundred thousand? -19800000 Round -0.00020022 to five decimal places. -0.0002 What is 184040 rounded to the nearest	{ "pile_set_name": "DM Mathematics" }
s picked without replacement from {o: 2, q: 10, i: 3, n: 3}. 45/272 Calculate prob of picking 2 x when two letters picked without replacement from xxmxxxxgxxxxx. 55/78 Two letters picked without replacement from {l: 1, u: 1, e: 1, j: 1, x: 1}. What is prob of picking 1 j and 1 e? 1/10 Three letters picked without replacement from mmbbbqbmbmb. Give prob of picking 1 b and 2 m. 12/55 Two letters picked without replacement from xwwwwxw. What is prob of picking 2 w? 10/21 Two letters picked without replacement from {e: 4, v: 4, b: 2, r: 5}. What is prob of picking 2 v? 2/35 Three letters picked without replacement from ikiibibikiiir. What is prob of picking 1 b, 1 r, and 1 k? 2/143 Two letters picked without replacement from {y: 6, k: 4}. What is prob of picking 1 k and 1 y? 8/15 Two letters picked without replacement from zzdedzdzdzddzd. What is prob of picking 1 z and 1 d? 6/13 What is prob of picking 1 d and 3 x when four letters picked without replacement from {d: 2, x: 4}? 8/15 Calculate prob of picking 1 d and 1 j when two letters picked without replacement from {y: 1, j: 7, d: 2}. 14/45 Calculate prob of picking 1 i, 1 n, and 1 w when three letters picked without replacement from {w: 3, v: 3, n: 3, i: 3, g: 1, s: 1}. 27/364 Three letters picked without replacement from {c: 3, o: 3, p: 1, u: 2, f: 1}. What is prob of picking 3 c? 1/120 Three letters picked without replacement from {v: 2, b: 1, g: 8, s: 2}. Give prob of picking 2 s and 1 g. 4/143 Calculate prob of picking 3 c when three letters picked without replacement from ccseeccs. 1/14 Two letters picked without replacement from gbbbpubbgbgbpgs. What is prob of picking 1 b and 1 u? 1/15 Two letters picked without replacement from {i: 6, g: 3, a: 1, p: 4}. Give prob of picking 1 i and 1 g. 18/91 What is prob of picking 2 c and 1 b when three letters picked without replacement from {c: 6, b: 4}? 1/2 Calculate prob of picking 3 r and 1 g when four letters picked without replacement from {r: 3, z: 3, y: 4, g: 4}. 4/1001 Calculate prob of picking 2 o and 2 h when four letters picked without replacement from {o: 6, h: 12}. 11/34 Calculate prob of picking 1 k and 3 w when four letters picked without replacement from izwpppzkwixwxpkpp. 1/1190 What is prob of picking 2 y, 1 n, and 1 p when four letters picked without replacement from {n: 5, p: 1, w: 6, y: 2, s: 1, t: 1}? 1/364 Three letters picked without replacement from {t: 2, j: 7, k: 5}. What is prob of picking 2 k and 1 j? 5/26 Four letters picked without replacement from {k: 2, x: 5, h: 3, f: 3, c: 2}. Give prob of picking 2 f and 2 k. 1/455 Two letters picked without replacement from {r: 7}. What is prob of picking 2 r? 1 Four letters picked without replacement from vvvvvssvvsvvssvvvv. Give prob of picking 3 v and 1 s. 143/306 Two letters picked without replacement from {o: 4, d: 3}. What is prob of picking 1 o and 1 d? 4/7 What is prob of picking 2 z when two letters picked without replacement from zzlzlzzzzzzzzzlz? 13/20 Four letters picked without replacement from ojojoofojj. What is prob of picking 3 o and 1 f? 1/21 Four letters picked without replacement from syptspk. What is prob of picking 1 k, 2 s, and 1 p? 2/35 Three letters picked without replacement from {b: 3, p: 3, r: 2, w: 4, q: 4, o: 1}. Give prob of picking 1 q and 2 r. 1/170 Calculate prob of picking 1 l and 2 a when three letters picked without replacement from {l: 4, a: 2}. 1/5 Calculate prob of picking 2 f when two letters picked without replacement from yxyyxxxxxfxxfxxfxxx. 1/57 Two letters picked without replacement from bxgxxjjxgjxjxxx. Give prob of picking 2 g. 1/105 Three letters picked without replacement from aafmvfaffjffjvm. What is prob of picking 3 a? 1/455 What is prob of picking 1 h, 1 l, and 2 k when four letters picked without replacement from {k: 2, h: 2, g: 1, l: 1}? 2/15 What is prob of picking 2 x when two letters picked without replacement from {s: 1, q: 1, p: 2, x: 2, h: 8}? 1/91 Two letters picked without replacement from iiilxiixxxlxxxll. Give prob of picking 1 l and 1 x. 7/30 Four letters picked without replacement from ooovooovoovovo. Give prob of picking 1 o and 3 v. 40/1001 Two letters picked without replacement from iiyiyggiiiiieiiegiie. What is prob of picking 2 g? 3/190 What is prob of picking 2 d when two letters picked without replacement from ddwddddwwdddwwhwddd? 22/57 Calculate prob of picking 3 p when three letters picked without replacement from {a: 2, y: 6, p: 10}. 5/34 Calculate prob of picking 1 u and 1 n when two letters picked without replacement from {e: 7, u: 2, n: 2}. 4/55 Three letters picked without replacement from {d: 9, i: 9}. What is prob of picking 2 i and 1 d? 27/68 What is prob of picking 1 i and 3 q when four letters picked without replacement from miqm? 0 What is prob of picking 1 q and 2 w when three letters picked without replacement from qwqwwwq? 18/35 Two letters picked without replacement from {r: 3, n: 1, g: 2, f: 1, d: 7}. What is prob of picking 1 d and 1 f? 1/13 What is prob of picking 1 e, 1 d, and 2 h when four letters picked without replacement from {e: 6, i: 3, k: 1, f: 4, d: 1, h: 3}? 1/170 Four letters picked without replacement from {c: 1, h: 10, l: 1, s: 1, d: 1}. What is prob of picking 1 s, 1 c, 1 d, and 1 h? 10/1001 What is prob of picking 1 n, 1 z, and 1 x when three letters picked without replacement from dzznxznddy? 1/20 Four letters picked without replacement from tgieitgwn. Give prob of picking 2 w and 2 i. 0 Calculate prob of picking 2 k and 1 v when three letters picked without replacement from vkuullu. 0 What is prob of picking 3 t and 1 h when four letters picked without replacement from tteeettettetttehte? 2/51 Three letters picked without replacement from iiowooooiioooioio. What is prob of picking 1 o and 2 i? 15/68 Two letters picked without replacement from {t: 5, e: 13}. Give prob of picking 2 e. 26/51 Three letters picked without replacement from {b: 1, t: 2, i: 1, k: 2, a: 2}. Give prob of picking 2 k and 1 a. 1/28 Calculate prob of picking 2 a when two letters picked without replacement from {a: 3, x: 3, b: 1}. 1/7 Four letters picked without replacement from rrrhvrprrrrpmhrhra. Give prob of picking 1 r and 3 a. 0 Calculate prob of picking 1 h and 1 a when two letters picked without replacement from jaxxxxxxxihhxiiixh. 1/51 Four letters picked without replacement from accignacagfiaac. Give prob of picking 1 g, 1 a, and 2 i. 2/273 Four letters picked without replacement from bxbbxxhbbxbxbxb. What is prob of picking 1 h and 3 x? 4/273 Three letters picked without replacement from vcvvvcvccvv. Give prob of picking 2 c and 1 v. 14/55 Calculate prob of picking 1 j and 1 b when two letters picked without replacement from jwebekxexewj. 1/33 Four letters picked without replacement from {h: 3, z: 3, l: 1, g: 5}. Give prob of picking 1 l, 2 h, and 1 z. 1/55 Two letters picked without replacement from vvnvn. What is prob of picking 2 v? 3/10 Three letters picked without replacement from {t: 1, h: 1, o: 1, b: 1, y: 3}. What is prob of picking 1 b, 1 t, and 1 y? 3/35 What is prob of picking 2 n, 1 a, and 1 c when four letters picked without replacement from annocoaoano? 3/110 Four letters picked without replacement from zzooozozozoooooo. What is prob of picking 1 o and 3 z? 11/182 What is prob of picking 1 s, 1 h, and 1 a when three letters picked without replacement from {a: 5, h: 4, s: 6}? 24/91 Four letters picked without replacement from hhhhhhhhhhhxhxhx. What is prob of picking 4 h? 11/28 Three letters picked without replacement from {g: 2, z: 7}. What is prob of picking 3 z? 5/12 What is prob of picking 1 o, 1 a, and 1 g when three letters picked without replacement from aggggogrgaga? 21/220 What is prob of picking 1 c and 1 s when two letters picked without replacement from {o: 4, c: 1, z: 2, u: 1, s: 1}? 1/36 Two letters picked without replacement from bffggffbbgfggfgffbgg. Give prob of picking 1 b and 1 f. 16/95 Two letters picked without replacement from grkgkkkgrkukukrkkk. Give prob of picking 1 k and 1 u. 20/153 What is prob of picking 2 r when two letters picked without replacement from {v: 2, e: 2, r: 2, n: 3}? 1/36 Three letters picked without replacement from undddgonnodud	{ "pile_set_name": "DM Mathematics" }
u = u - 5q - 11. Let d(j) = -j2 - 2j - 7. Let n(m) = -m + 0m - 1285m*2 + 1284m*2 - 6. Let p(g) = ud(g) - 4n(g). Give p(2). 3 Let j(y) be the third derivative of y5/15 + 5y*4/24 + 7y*3/3 + 3y2. Let m(u) = u2 + 2u + 5. Let x(t) = 2j(t) - 7m(t). Calculate x(5). -2 Let p(z) = -5z*3 + 9z*2 + 6z + 1. Let v(i) = 0 - i*2 + 0i*3 + 1 + 2i2 - i3. Let a(u) = p(u) - 4v(u). Determine a(6). -3 Let o(u) be the first derivative of -u3/3 + 3u*2/2 - 3u - 25. Calculate o(2). -1 Let i = -27 - -28. Let k(p) be the third derivative of p4/6 + p3/3 - p*2. Let b(h) = -2h - 1. Let t(s) = -5b(s) - 3k(s). Calculate t(i). -3 Let i = -8 + 2. Let v = i - -4. Let r = 0 + v. Let t(s) = s2 + 2. Determine t(r). 6 Let g(o) be the first derivative of -o2/2 - 11o + 1. Let k(f) = -f + 5. Let r be k(10). Calculate g(r). -6 Let l(x) = -2x3 + x2. Suppose g - u - 2 = -g, 0 = 4g - 4u - 4. Give l(g). -1 Let m(b) = 3b3 - 3b*2 + 5b + 3. Let x(j) = -4j3 + 2j*2 - 6j - 4. Let y(f) = 3m(f) + 2x(f). Calculate y(4). -3 Suppose 0 = -f - f. Let o(s) = s + 5. Let m be o(f). Let z(t) = t - 2. Determine z(m). 3 Let i = 37 - 32. Let j(l) = -l - 2. What is j(i)? -7 Let m(y) = y + 3. Let u(z) = -z*3 - 8z*2 + 2z + 12. Let t be u(-8). What is m(t)? -1 Suppose -2 = -3g + 1. Let m = 29 + -19. Let i(o) = -m - 7o + 10. What is i(g)? -7 Let d(i) = -i + 4. Suppose 6 = -2b + b - 2c, 4b + 2c = 0. Let w(y) = -y + 1. Let p be w(-4). Let q(z) = z - 8. Let v(l) = bq(l) + pd(l). What is v(4)? -8 Let k(b) = -b*2 + 7b - 8. Let h(f) = -2f + 1. Let l be h(9). Let z = 6 + l. Let c be (-6)/(-12) - z/2. What is k(c)? -2 Suppose -2m + 3m = 4. Suppose -md - d + 15 = 0. Let z(q) = q*2 + q - 1. Determine z(d). 11 Suppose 4q - 8 - 31 = -3s, -2s + 3q + 9 = 0. Let t(d) = -3d - d*2 + 0d + 2d + s - 2. What is t(0)? 7 Suppose 0 = 2s + y + 1 - 9, 3s - 14 = -y. Suppose 4 = 2i - si. Let m(r) = 10r. Let l(n) = 5n. Let u(v) = -5l(v) + 3m(v). Calculate u(i). -5 Suppose 4i - 2i + 24 = 0. Let r be i/(-2)(-2)/(-3). Let m(x) be the third derivative of -x4/24 - x3/6 + 6x2. Give m(r). -5 Suppose 3h + h = 12. Suppose -hx + 7 + 2 = 0. Let a(i) = i + 0 + 4 - 3i*x + 2i*3 - 4i*2. What is a(-4)? 0 Let p = -8 - -3. Let q(l) = -l - 10. Calculate q(p). -5 Let o(u) be the first derivative of 2u3/3 - u2/2 + 2u - 3. Determine o(2). 8 Let u be (12/(-8))/(2/(-4)). Suppose -2b - uc - 2c - 8 = 0, 2c + 4 = 0. Let l(v) = 1 - 2v - v*2 + 0 - 6v*2. What is l(b)? -8 Let b = 0 + 5. Let y(v) = -20v*3 + 15v*2 - 14v - 3. Let i(q) = 7q3 - 5q*2 + 5q + 1. Let o(h) = 17i(h) + 6y(h). Determine o(b). 4 Let v(w) = w*3 - 3w*2 - 5w + 6. Suppose -2u = -u - 7. Let z(r) = r3 - 8r*2 + 8r - 3. Let b be z(u). Determine v(b). 2 Let q(r) = -r*3 - r - 8. Let x be ((-6)/8)/(3/(-60)). Suppose -4f - 2b + 4 - 14 = 0, -3b = 5f + x. Give q(f). -8 Let i = -19 + 16. Suppose h - 4 = -h. Let w(n) = 0 - 4 + h - 2n. What is w(i)? 4 Suppose -3d + 10 = 22. Let y(l) = -l - 7. Let h be y(d). Let c(f) = f2 + 4f + 2. What is c(h)? -1 Let t = 14 - 11. Let x(o) = -o*2 + 3o + 4. Calculate x(t). 4 Let s be 1/(3/151). Suppose -37 = -4o + 7t - 2t, -25 = st. Let w(c) = -c3 + 2c*2 + 2c + 3. Determine w(o). 0 Suppose 3n = -2n + 10. Let a(g) = -14g2 - 12g + 26. Let i(k) = -5k2 - 4k + 9. Let o(c) = 6a(c) - 17i(c). Give o(n). -1 Let s(l) = -l*3 + 3l - 3. Let h be s(2). Let a(q) = q*3 + 4q*2 - 6q + 2. Calculate a(h). 7 Let o(c) = -4c + 10. Let j(r) = 5r - 11. Let b(h) = -3j(h) - 4o(h). Suppose a = -4a + 25. Calculate b(a). -2 Let z(x) = x2 - x + 1. Let r(q) = 36q*2 - 30q + 30. Let o(h) = 3r(h) - 90z(h). Calculate o(1). 18 Suppose -5w = -3w - 30. Let l be 12/w - 2/(-10). Let f(v) = -3v3 - v. Give f(l). -4 Let x(k) = -3k*2 - 8k + k2 - 9 + k2. Give x(-7). -2 Let k(v) = v*3 + 3v*2 - v - 1. Suppose 2t + h = -3h + 24, 0 = -4t + 4h - 12. Suppose 3w = tq - 11, 2w + 3q - 6 = 3w. What is k(w)? 2 Let z(q) = -q - 2. Suppose 4v - 2g + 4 = 0, 0g - 4g = 5v + 31. Let c be 0 - (3/v + -3). Let l be ((-10)/c - -3)6. Give z(l). -5 Let y(b) = b*2 - 3b - 2. Let t(v) = 4v + 31. Let l be t(-7). Determine y(l). -2 Let y(w) = -w3 - w2 - w + 6. Suppose -3z = -5z. Let p be (z2/(-6))/(-2). Calculate y(p). 6 Let y(k) = 4k - 1. Let d be (4 + -2 - 5) + 2. Give y(d). -5 Let h(z) = -3z - 13. Let c(a) = 3a + 11. Let y(m) = 6c(m) + 5h(m). Give y(4). 13 Let f(q) = 5 + 10q*2 - 7q*2 - 2q*2 - 2q*2 + 3q. Determine f(4). 1 Let o(r) = -2r - 1. Let g be o(-2). Let t(d) be the second derivative of d4/12 - d3/6 + d2 + 50d. Calculate t(g). 8 Let g(p) = -3p2 + p - p - 10 + p + 9. What is g(-2)? -15 Let r be 1/(-5)-210. Let w(y) = y2 - 3y + 6. Determine w(r). 10 Let d(h) = 8 - h - 6h2 - 1 + h3 + h2. Let a(n) = n3 - 9n*2 + 3n - 22. Let z be a(9). Give d(z). 2 Let c(j) = -6j + 6. Let w(y) = y - 1. Let i(a) = -c(a) - 5w(a). Determine i(0). -1 Let k(p) = p*2 - 1 + p + 7p*2 + 2 + 2p*2. Suppose -7 + 10 = -3j. Determine k(j). 10 Let z = -13 - -19. Let x(u) = -u*3 + 6u*2 - u + 7. Calculate x(z). 1 Let r(j) = 2j + 3. Let p(n) = 5n + 7. Let k(i) = -4p(i) + 9r(i). Let h be k(-1). Let v(g) = -g3 + g2 - g + 1. What is v(h)? 0 Suppose 5 = 2h + 3. Let l(c) = 5c + 1. Calculate l(h). 6 Let w be (-1)/2 - 35/(-14). Suppose 0 = -0v + wv - 6. Suppose 8 = -3c - vt - 1, -5t = 5. Let i(o) = -o*3 - 2o*2 + o + 1. Determine i(c). -1 Let n be ((2 + -3)4)/(-1). Let m be (n/(-3))/(4/(-6)). Let u(h) = -h*m + 4h2 + h2. What is u(1)? 4 Suppose 5g + 12 + 13 = 0. Let c(q) = 4q2 - q3 + 0 - 5q - 2 + 2q*3. What is c(g)? -2 Let l(s) = -s + 4s*2 + 3s - 2s - s3 + 3. Suppose 2q + 8 = 4q. Determine l(q). 3 Let o(n) = -n2 - n + 9. Let u = -7 - -14. Let f = 7 - u. What is o(f)? 9 Let d(a) be the first derivative of 3a*2/2 + 8a + 37. What is d(-4)? -4 Let u(i) = i*3 + 4i*2 - 5i + 5. Let v be u(-5). Suppose -vb - 4 = 1. Let p(a) = -2a*2 - a - 1. Calculate p(b). -2 Suppose -3g - 22 = -4t, -2t - 2t = 5g + 26. Let l(f) = -f*2 - 6f + 7. What is l(g)? 7 Let m(n) = 3n + 2. Let j = 10 + -6. Suppose -3i + 4 = -ji. Determine m(i). -10 Let m be (-8)/(-6)(-12)/(-8). Suppose -i + mi = 0. Let w(p) = -14p + 23. Let b(q) = -5q + 8. Let s(y) = -11b(y) + 4w(y). What is s(i)? 4 Let w(n) = -3n - 7n + 11n. Let o(k) = k*3 - 5k*2 + 3k - 1. Let u(x) = -o(x) + 2w(x). Calculate u(4). 13 Let d(r) = 3 - r2 + 2r*2 + 2r3 - r3. Let w(v) = v*3 - 5v*2 - 7v + 6. Let m be w(6). Give d(m). 3 Suppose 4 + 1 = d. Suppose 2 = 4a + 2s, -da - 4s + 0 + 7 = 0. Let w(j) = -2j - 1. Give w(a). 1 Let z(q) = 11q3 - q2 + q - 1. Suppose 1 = 3i + 5h, -4i + 0 + 3 = 5h. Suppose y = -y + i. Determine z(y). 10 Let i(v) be the third derivative of -7v4/12 - v3/6 - 25v*2. Give i(1). -15 Suppose -5b + 29 = -1. Let d(c) = -c*3 + 7c*2 - 2c - 2. Determine d(b). 22 Let r(g) = 2g + 10. Let z be r(-7). Let n = -1 - z. Let f(d) = -4 + d2 + 0 + n - 3d. What is f(3)? -1 Let c(h) = 3h - 22 + 15 + 0h. Give c(5). 8 Let u(j) = -j*3 - 5j*2 + 3j - 6. Let g(f) = -5f2 - f - 2. Let b be g(-1). What is u(b)? 12 Let v = 8 + -3. Suppose 3n = -vm - 5, m + 3n = -n + 16. Let t(r) = 38 - 4r - 43 + 2r. Determine t(m). 3 Let l(i) be the third derivative of -i6/12 - i5/30 + i4/12 - i3/6 - 8i2. Let m be 0 - -2 - (0 - -1). Calculate l(m). -11 Let n(y) be the second derivative of y4/12 - y3/6 + 3y*2/2 + 3y. Let j be (-3)/(-2 - 1) - -2. Give n(j). 9 Let z(w) = 6w - 1. Let x be z(1). Let g(h) = h. Let q(a) = -a2 + 4a - 2. Let f(n) = -g(n) - q(n). Give f(x). 2 Let z = -5 - -7. Suppose -zl - 4 = -4l. Let s(p) = p2 - p - 1. Determine s(l). 1 Let c(n) be the third derivative of n4/8 - n*3/6 + 6n2. Determine c(-1). -4 Let u(x) = -x2 + 4x - 1. Suppose -2v = -3v + 5. Suppose -4i + vi - 4 = 0. Suppose iw = 3r + 14, 4r = 2w - 6w + 28. Give u(w). -6 Let x(h) = -2h3 - 2h*2 + 4h - 1. Let r(s) = 3s3 + 5s*2 - 7s + 2. Let w(j) = -3r(j) - 5x(j). Let b be w(5). Let o(t) = -t*2 + 3t + 5. Give o(b). 1 Let f(i) = i**3 + 3	{ "pile_set_name": "DM Mathematics" }
f 33238 to the nearest integer? 182 What is the ninth root of 2108 to the nearest integer? 2 What is the square root of 1605 to the nearest integer? 40 What is the cube root of 19111 to the nearest integer? 27 What is 13094 to the power of 1/2, to the nearest integer? 114 What is 838 to the power of 1/3, to the nearest integer? 9 What is 55991 to the power of 1/2, to the nearest integer? 237 What is the third root of 14679 to the nearest integer? 24 What is the fourth root of 896 to the nearest integer? 5 What is the fifth root of 15706 to the nearest integer? 7 What is the ninth root of 4416 to the nearest integer? 3 What is the third root of 58275 to the nearest integer? 39 What is 955 to the power of 1/2, to the nearest integer? 31 What is the tenth root of 58665 to the nearest integer? 3 What is the third root of 1236 to the nearest integer? 11 What is the cube root of 4475 to the nearest integer? 16 What is 1526 to the power of 1/9, to the nearest integer? 2 What is 64487 to the power of 1/6, to the nearest integer? 6 What is 1093 to the power of 1/4, to the nearest integer? 6 What is the square root of 43359 to the nearest integer? 208 What is the seventh root of 3519 to the nearest integer? 3 What is 45460 to the power of 1/4, to the nearest integer? 15 What is the third root of 1023 to the nearest integer? 10 What is the third root of 38346 to the nearest integer? 34 What is 1600 to the power of 1/2, to the nearest integer? 40 What is the seventh root of 59764 to the nearest integer? 5 What is the cube root of 10113 to the nearest integer? 22 What is the sixth root of 53751 to the nearest integer? 6 What is the square root of 1201 to the nearest integer? 35 What is 11471 to the power of 1/2, to the nearest integer? 107 What is the third root of 27496 to the nearest integer? 30 What is 3005 to the power of 1/2, to the nearest integer? 55 What is 5531 to the power of 1/2, to the nearest integer? 74 What is the seventh root of 474 to the nearest integer? 2 What is 260 to the power of 1/10, to the nearest integer? 2 What is the ninth root of 1529 to the nearest integer? 2 What is 3630 to the power of 1/2, to the nearest integer? 60 What is 64614 to the power of 1/8, to the nearest integer? 4 What is the cube root of 11058 to the nearest integer? 22 What is 11110 to the power of 1/6, to the nearest integer? 5 What is the fourth root of 54557 to the nearest integer? 15 What is the square root of 31002 to the nearest integer? 176 What is the square root of 211 to the nearest integer? 15 What is 2464 to the power of 1/3, to the nearest integer? 14 What is the fourth root of 19647 to the nearest integer? 12 What is the square root of 8765 to the nearest integer? 94 What is the cube root of 19432 to the nearest integer? 27 What is 40874 to the power of 1/3, to the nearest integer? 34 What is 606 to the power of 1/3, to the nearest integer? 8 What is 31551 to the power of 1/3, to the nearest integer? 32 What is the eighth root of 61723 to the nearest integer? 4 What is the cube root of 3184 to the nearest integer? 15 What is the eighth root of 718 to the nearest integer? 2 What is the third root of 14791 to the nearest integer? 25 What is 388 to the power of 1/3, to the nearest integer? 7 What is 42625 to the power of 1/9, to the nearest integer? 3 What is the square root of 1993 to the nearest integer? 45 What is the square root of 122917 to the nearest integer? 351 What is the cube root of 4343 to the nearest integer? 16 What is the cube root of 2525 to the nearest integer? 14 What is the cube root of 24499 to the nearest integer? 29 What is the square root of 38001 to the nearest integer? 195 What is the square root of 408 to the nearest integer? 20 What is the sixth root of 36069 to the nearest integer? 6 What is the third root of 2023 to the nearest integer? 13 What is the fourth root of 70 to the nearest integer? 3 What is 21594 to the power of 1/3, to the nearest integer? 28 What is the fifth root of 5870 to the nearest integer? 6 What is 22062 to the power of 1/10, to the nearest integer? 3 What is 7529 to the power of 1/3, to the nearest integer? 20 What is the third root of 1433 to the nearest integer? 11 What is the third root of 200 to the nearest integer? 6 What is the seventh root of 8172 to the nearest integer? 4 What is the sixth root of 45265 to the nearest integer? 6 What is 15167 to the power of 1/2, to the nearest integer? 123 What is the third root of 44 to the nearest integer? 4 What is the fourth root of 9563 to the nearest integer? 10 What is the cube root of 62361 to the nearest integer? 40 What is 9470 to the power of 1/3, to the nearest integer? 21 What is the third root of 1463 to the nearest integer? 11 What is 15598 to the power of 1/2, to the nearest integer? 125 What is 88967 to the power of 1/6, to the nearest integer? 7 What is 5235 to the power of 1/6, to the nearest integer? 4 What is the seventh root of 104723 to the nearest integer? 5 What is the fifth root of 1367 to the nearest integer? 4 What is the tenth root of 863 to the nearest integer? 2 What is 16921 to the power of 1/2, to the nearest integer? 130 What is the third root of 156922 to the nearest integer? 54 What is 397 to the power of 1/9, to the nearest integer? 2 What is the cube root of 422 to the nearest integer? 8 What is 5111 to the power of 1/6, to the nearest integer? 4 What is 157178 to the power of 1/6, to the nearest integer? 7 What is the ninth root of 10973 to the nearest integer? 3 What is the third root of 8483 to the nearest integer? 20 What is 6551 to the power of 1/2, to the nearest integer? 81 What is the cube root of 1250 to the nearest integer? 11 What is 61558 to the power of 1/3, to the nearest integer? 39 What is the fifth root of 380 to the nearest integer? 3 What is the fifth root of 90 to the nearest integer? 2 What is the ninth root of 13489 to the nearest integer? 3 What is the third root of 3715 to the nearest integer? 15 What is 37998 to the power of 1/3, to the nearest integer? 34 What is 1802 to the power of 1/3, to the nearest integer? 12 What is the third root of 29786 to the nearest integer? 31 What is the tenth root of 19583 to the nearest integer? 3 What is 115597 to the power of 1/2, to the nearest integer? 340 What is the eighth root of 115623 to the nearest integer? 4 What is the eighth root of 599 to the nearest integer? 2 What is the third root of 5131 to the nearest integer? 17 What is 45695 to the power of 1/2, to the nearest integer? 214 What is 563 to the power of 1/5, to the nearest integer? 4 What is the third root of 2506 to the nearest integer? 14 What is the third root of 6850 to the nearest integer? 19 What is 52800 to the power of 1/3, to the nearest integer? 38 What is 13725 to the power of 1/2, to the nearest integer? 117 What is 8516 to the power of 1/2, to the nearest integer? 92 What is 65 to the power of 1/10, to the nearest integer? 2 What is the sixth root of 3098 to the nearest integer? 4 What is 6712 to the power of 1/10, to the nearest integer? 2 What is 22291 to the power of 1/3, to the nearest integer? 28 What is the square root of 24334 to the nearest integer? 156 What is 15603 to the power of 1/8, to the nearest integer? 3 What is the square root of 7817 to the nearest integer? 88 What is the eighth root of 122990 to the nearest integer? 4 What is the third root of 3743 to the nearest integer? 16 What is 142 to the power of 1/3, to the nearest integer? 5 What is 7871 to the power of 1/9, to the nearest integer? 3 What is the square root of 754 to the nearest integer? 27 What is 1434 to the power of 1/4, to the nearest integer? 6 What is 47344 to the power of 1/5, to the nearest integer? 9 What is the cube root of 51108 to the nearest integer? 37 What is 57080 to the power of 1/2, to the nearest integer? 239 What is 21440 to the power of 1/9, to the nearest integer? 3 What is the square root of 99274 to the nearest integer? 315 What is 2244 to the power of 1/8, to the nearest integer? 3 What is the cube root of 66271 to the nearest integer? 40 What is 2182 to the power of 1/3, to the nearest integer? 13 What is the square root of 3549 to the nearest integer? 60 What is the cube	{ "pile_set_name": "DM Mathematics" }
147) - sqrt(147))) + 4 + 0)4 + 0)2. 3584sqrt(3) + 37888 Simplify (sqrt(13) + 2)3 + sqrt(65)/sqrt(5)-4 - (-4 + 1 + sqrt(832) + -4)*2. -875 + 111sqrt(13) Simplify (2(sqrt(2736) + 1)-6 + 2)*2 + 5. 2880sqrt(19) + 394089 Simplify sqrt(1584) - (2 + sqrt(1584) + -2)*2 - (sqrt(1584) - (sqrt(1584) + -1 + 4)). -1581 + 12sqrt(11) Simplify 0 + 3 + (-5 + (sqrt(1216) - (1 + sqrt(1216))) + sqrt(1216) - (4 + sqrt(1216) + (3sqrt(1216) - sqrt(1216)))2). -10963 - 184sqrt(19) Simplify ((2 + 5 + (sqrt(1700) + 1 + -4 - sqrt(1700)))-3)21. 144 Simplify (-3 + sqrt(288) + 0)*2 + sqrt(22)/(sqrt(44)/sqrt(4)) + -1(sqrt(2) - (sqrt(2) + 1)). -71sqrt(2) + 298 Simplify (2 + ((sqrt(500) + -1sqrt(500))/sqrt(10))/(5sqrt(70)/sqrt(7)))2. 4 Simplify -5(4 + (sqrt(12)-2)/sqrt(4)-5-6)26. -324480 + 14400sqrt(3) Simplify 5 + ((-1 + sqrt(1331) - sqrt(1331)) + -3)2 - (sqrt(1331) + 0 + 1 + (5 + -1sqrt(1331) + sqrt(1331))*2). -11sqrt(11) - 5 Simplify 3 + (33(1 + sqrt(1331) + 1))*2. 3564sqrt(11) + 108138 Simplify (3((-1 + sqrt(1900))-5 + -2 + -1 + sqrt(1900) + sqrt(1900)))*23. -3240sqrt(19) + 461808 Simplify ((3(-3 + -2 + sqrt(28) + sqrt(28) + 1) + 3)6)2. -7776sqrt(7) + 39204 Simplify 2 + (sqrt(17) + (sqrt(119)2)/sqrt(7) + 2)2 - ((sqrt(102)/sqrt(6)5)2 - (sqrt(612) - (sqrt(612) - (sqrt(612) - (sqrt(612) + -2)) - sqrt(612)))2). 36sqrt(17) + 350 Simplify (-1sqrt(65)-1)/(sqrt(5) + sqrt(5) + sqrt(45)-1) + 5(((1sqrt(78))/sqrt(6))*2 + -3). -sqrt(13) + 50 Simplify ((sqrt(891)3 + -5)*2 - (sqrt(891)3 + 0 + sqrt(891) + sqrt(891) + sqrt(891))*2)-3-4. -288384 - 3240sqrt(11) Simplify ((3sqrt(120)/sqrt(3) - sqrt(40))/sqrt(2))/(sqrt(400)-25) + -1. -1 - sqrt(5)/50 Simplify -1 + (2(sqrt(1300) + (sqrt(1300) - (sqrt(1300) + 0)) + 5 - (32sqrt(1300) + sqrt(1300))))*2. -2400sqrt(13) + 187299 Simplify 3 + (1(2 + sqrt(245) + -1))2 + -1. 14sqrt(5) + 248 Simplify (0 + ((-5 + sqrt(1900) + 1)*2 - sqrt(1900)) + sqrt(1900) + (sqrt(1900)-1 + -5)2 + -2 + (sqrt(1900) + sqrt(1900) + 1)2)-1. -11440 - 60sqrt(19) Simplify ((sqrt(136)2 + sqrt(136))-3 - sqrt(136) - -2sqrt(136)2)/(1(sqrt(8) - sqrt(8)-1)-4). 3sqrt(17)/4 Simplify sqrt(12)/sqrt(54) + -2 + sqrt(2)1 + (sqrt(8) + sqrt(32)-1 - sqrt(8))/sqrt(4). -2 - 2sqrt(2)/3 Simplify 2 + (sqrt(76)-4-1)/((sqrt(48)/sqrt(3))/sqrt(4)). 2 + 4sqrt(19) Simplify 2 + sqrt(2880) + 1 + sqrt(45) + 2. 5 + 27sqrt(5) Simplify sqrt(15)/(sqrt(80)1) - ((sqrt(147) + -1sqrt(147) + sqrt(147))2 + -5 + sqrt(3)-1). -142 + 5sqrt(3)/4 Simplify (sqrt(252)/sqrt(6))/sqrt(6)6 + -4((sqrt(7) + -2)2 + sqrt(7) + -2). -36 + 18sqrt(7) Simplify (sqrt(605) + 2 + 2 + -1)*2-2. -1228 - 132sqrt(5) Simplify 2 + -5 + (sqrt(2057) + -2 + 3 - sqrt(2057))2 + -1. -3 Simplify (6(2 + (sqrt(245) - (sqrt(245) + sqrt(245) + 2 + 3)) + sqrt(245))5)2. 8100 Simplify 5 + 2 + -4 + 0 + (sqrt(76) + 6sqrt(76))/sqrt(4). 3 + 7sqrt(19) Simplify (2 + (sqrt(198)/(-2sqrt(11)) - sqrt(18)))*25 + -2. -90sqrt(2) + 441/2 Simplify (-2 + (sqrt(208) - (sqrt(208) + -1))3 + sqrt(208) + -5(0 + sqrt(208) + sqrt(208)) + sqrt(208))2. -64sqrt(13) + 13313 Simplify -4 + -5(-2(0 + sqrt(684)) - ((sqrt(684) - (sqrt(684)1 + sqrt(684)))2 + -5)). 60sqrt(19) + 3391 Simplify -1(sqrt(8)-2)/sqrt(4)-6 - (4(sqrt(200) - (sqrt(200) - (sqrt(200) + -4 + (sqrt(200) - sqrt(200)-2) + sqrt(200)))))2. -80256 + 6388sqrt(2) Simplify ((sqrt(525) + sqrt(525)-22)/(sqrt(63)/sqrt(36) + sqrt(112)-1))2. 2700/49 Simplify 2 + (sqrt(77) - (-3sqrt(77)-1 + sqrt(77)))/(sqrt(84)/(sqrt(96)/sqrt(8))). -3sqrt(11) + 2 Simplify 3 + (-5((sqrt(288) - (1sqrt(288) + sqrt(288))) + sqrt(288)))*2 + (1sqrt(288))*2-5 + 1. -1436 Simplify 3 + (sqrt(637) + 6(sqrt(637) + 1 + sqrt(637)) + sqrt(637) + 0)2-2. -249773 - 2352sqrt(13) Simplify 4(0 + sqrt(637) - (-4 + sqrt(52)/sqrt(4))). 16 + 24sqrt(13) Simplify (sqrt(245)/(sqrt(252)-1))/(sqrt(5) + (sqrt(320)2 - sqrt(5)) + sqrt(5) + -1sqrt(180)). -sqrt(7)/66 Simplify (1((sqrt(204) + sqrt(204) + sqrt(204)1 + sqrt(204) + sqrt(204))-2 + sqrt(204)))/((-3sqrt(6912))/sqrt(4)). sqrt(17)/4 Simplify ((sqrt(156) - (sqrt(156)-2 - sqrt(156)))-1 + sqrt(156)24)/(sqrt(36)/(sqrt(3) + (sqrt(27) - sqrt(3)))2) + -1. -1 + 6sqrt(13) Simplify ((1 + 3 + sqrt(75) - -2sqrt(6)/sqrt(2)-4) + 5)*2. -54sqrt(3) + 108 Simplify ((sqrt(50) + sqrt(200)-2)-1)/((sqrt(10) + sqrt(490)1 - sqrt(10)) + sqrt(30)/(sqrt(3)1)). 3sqrt(5)/8 Simplify ((sqrt(105)/sqrt(3))/sqrt(7) + sqrt(5) - (sqrt(125) + 1)) + (sqrt(20)/((sqrt(432) + sqrt(48))/sqrt(12)))2. -3sqrt(5) - 11/16 Simplify (-2(sqrt(875) - 2sqrt(875)))/(sqrt(175) + -3-3sqrt(175)). sqrt(5)/5 Simplify ((sqrt(2592) + 2 - sqrt(2592) - sqrt(32) - sqrt(32)) + sqrt(32) + 5sqrt(2)56)2. 584sqrt(2) + 42636 Simplify -1 + 2(-2sqrt(7)-3 + 1)6. 11 + 72sqrt(7) Simplify 1(-1(sqrt(19) + -1)5 - (2sqrt(57)/sqrt(3) + (-2 + sqrt(76))2)). -75 + sqrt(19) Simplify ((sqrt(33) + -6(sqrt(33) - (sqrt(33) + sqrt(825) - sqrt(33))))3)/(sqrt(704)-2 + sqrt(704) - -1sqrt(275)). -25sqrt(3) Simplify ((2sqrt(891)-4)*2 + sqrt(891))-3 + ((-2sqrt(891))2 + 3 - -5-1sqrt(891)). -167505 - 72sqrt(11) Simplify (-1 + sqrt(27)3)-46. -216sqrt(3) + 24 Simplify 2 + sqrt(75) + 0 + 1 + -1sqrt(6)/sqrt(2) + (sqrt(108) - 2sqrt(108)). -2sqrt(3) + 3 Simplify 1 + (2sqrt(1512)-4)/(sqrt(24)/(1sqrt(196))). -336sqrt(7) + 1 Simplify (sqrt(1216) + 3 + 2 + 1 + -5)2. 16sqrt(19) + 1217 Simplify (sqrt(308) - (-2(-2sqrt(308) - sqrt(308)) + sqrt(308)))/(-41sqrt(11)). 3sqrt(7) Simplify 0 + 1(5 + sqrt(396)2). 5 + 12sqrt(11) Simplify (-3 + sqrt(98) + sqrt(98) + sqrt(98) + 2 + -5)*2 - (3(sqrt(98)-1)2 - sqrt(98) - (5 + -2 + sqrt(98))). -238sqrt(2) + 627 Simplify (-4 + 1 + -1 + (0 + sqrt(128) + 4)-6)2. 2688sqrt(2) + 5392 Simplify sqrt(768)/sqrt(6) + sqrt(12)/(sqrt(36)/sqrt(6))3. 11sqrt(2) Simplify (((sqrt(52) + 1)2 - -6(sqrt(468) + 0 + sqrt(468))) + -1)*2. 152sqrt(13) + 75089 Simplify 2((0 + sqrt(448))2 + -1)-2. -1788 Simplify (((sqrt(104)3 - sqrt(104) - sqrt(104))-5 - sqrt(104))/(sqrt(128) - -2sqrt(128)) + 5)2. -5sqrt(13) + 113/4 Simplify (-1sqrt(5000) + sqrt(5000) + sqrt(50))/sqrt(10) + (4 + (sqrt(15)/sqrt(3) + sqrt(5))-5)*2. -79sqrt(5) + 516 Simplify -5 + 2 + (sqrt(11) + sqrt(275)-2 + sqrt(11))2 - ((-2sqrt(121))/sqrt(11) + -3sqrt(1100))2. -10563 Simplify ((sqrt(300) + 0)6)*2 - (sqrt(3)2-6 - (1 + sqrt(300))). 22sqrt(3) + 10801 Simplify (-1 + -2 + -4sqrt(4)/(sqrt(4)/(sqrt(6)/sqrt(3))))2. 24sqrt(2) + 41 Simplify (-5(sqrt(2) + -1)5 - (sqrt(16)/(sqrt(8)-1) - -3sqrt(8)/sqrt(4)))*2. -1350sqrt(2) + 2083 Simplify (-1 + 1 + 0 + (1 + sqrt(833) + 2 - sqrt(833)))*2. 9 Simplify (5 + -6((sqrt(50) - sqrt(800)) + (sqrt(2) - sqrt(22)/(-1sqrt(11) - sqrt(11)))))2. 810sqrt(2) + 13147 Simplify ((-6(1 + sqrt(720)) + sqrt(720) + 2 + sqrt(720) + sqrt(720) + 4)4)*2. 103680 Simplify sqrt(110)/sqrt(1210)-6 + (((sqrt(11) + -1)2)2 - (-5(sqrt(275))*2 + sqrt(11))). -105sqrt(11)/11 + 1423 Simplify ((1 + sqrt(242))-3 + ((0 + sqrt(242))-2)*2 + 5)6. -198sqrt(2) + 5820 Simplify (((sqrt(78) - 1sqrt(78)2) + sqrt(78) + sqrt(78)-26)/(3sqrt(6)1 - (sqrt(6) - (sqrt(726)2 + sqrt(726)))))*2. 1872/1225 Simplify ((-2(sqrt(1216) + -4) + 1)-2)2. -1152sqrt(19) + 19780 Simplify -1 + 1 + (sqrt(425)1-5)*2. 10625 Simplify ((-5-3sqrt(693))/(3sqrt(704)))*2. 1575/64 Simplify (-2sqrt(10)-5 + sqrt(20)/(sqrt(8)/sqrt(4)))/(sqrt(50) + (sqrt(450) - (sqrt(450) - (sqrt(450) + sqrt(450) + 2sqrt(450))))). 11sqrt(5)/65 Simplify sqrt(49)/(sqrt(448) - sqrt(28))-1 - (1 + 0 + (sqrt(35)/(-1sqrt(5)))2). -8 - sqrt(7)/6 Simplify ((sqrt(637) + 2)-43)2 + -5 + -1 + sqrt(637) + -3. 4039sqrt(13) + 92295 Simplify (21sqrt(32)6)2 + -4. 4604 Simplify -2(sqrt(91)/(sqrt(1575)/sqrt(9)) + (sqrt(1573) + -3 + 1)*2). -3154 + 438sqrt(13)/5 Simplify 4 + -6(sqrt(896)-4)/sqrt(8). 4 + 96sqrt(7) Simplify (-2((sqrt(480) - sqrt(480)-2) + sqrt(480)))/(sqrt(48)/(sqrt(288) + sqrt(288) + sqrt(288)-1))-2. 384sqrt(5) Simplify ((sqrt(40)2)/sqrt(2) - (1-1sqrt(20))2) + 0. -20 + 4sqrt(5) Simplify (-1 + -5(sqrt(2299)-1 - sqrt(2299)) + 2 + 5)*2. 1320sqrt(19) + 229	{ "pile_set_name": "DM Mathematics" }
- 1 for m. 4 Let b(s) = -s*3 - 13s*2 + 32s + 40. Let r be b(-15). Suppose v + 5i = -v + 54, 2v - i = 54. Solve 2c - v + 7 = 2u, -5c + r = 3u for c. 5 Let u(o) = -o*2 - 49o - 323. Let g be u(-41). Solve gw + 3n = 19, 3w = w - n + 8 for w. 5 Let y = 62 - 59. Suppose 0a - 4x - 13 = -ya, 0 = a + 4x + 1. Solve 0 = 2l - 3t, -2l - 1 = -5t + a for l. 3 Let p = -2 + 7. Suppose a - 3 - 5 = -4f, -a = -2f + 4. Suppose fz + 5h + 1 = 16, -4h = -3z - 12. Solve z = pl - 3n + 3 + 3, -n + 2 = 2l for l. 0 Suppose 306 = -0w + 6w. Let f = 54 - w. Solve 6l - 1 = fl - 2v, -3l - 4v = -11 for l. -3 Suppose 4r = 3w - 6, -r + 3w + 0w - 6 = 0. Solve 0 = 4x - 5f + 11, -x = -rx + 2f - 7 for x. 1 Let a be 51/(-119) + 92/(-14). Let q be (((-21)/(-4))/a)/((-6)/120). Solve 4y - l = -q, -2y + 6 = 3l + l for y. -3 Let g = -13 + 26. Let b be 0/(1 - (-1)/((-5)/10)). Solve 0 = -2c + 3x + g, b = c + x - 4x - 14 for c. -1 Suppose -2w + 1 = -w. Solve -2q - 12 + 9 = 3j, j + w = 4q for q. 0 Let z(t) = 2t*2 - 17t + 8. Let i be 8 + 0/(-9)2/6. Let u be z(i). Solve ud + 3d - 4m + 17 = 0, 5d + 2m = 15 for d. 1 Let q(w) = -w*3 - 9w*2 - 7w + 5. Suppose -7 = -4j - 39. Let d be q(j). Let m be 1 + (-3 - d) + 2. Solve 0 = -mr + r + 4i - 18, -16 = -4i for r. -1 Let v(y) = -y*3 + 8y*2 + 2. Let u be v(7). Let w = -31 + u. Suppose -3o = 2o - w. Solve 2i = 2a + 10, -2i + 2a - 6 = oa for i. 1 Let v be 10/10 + 10/2. Let r(o) = -o*3 + 7o*2 - 5o + 13. Let b be r(v). Solve -5d = 4s - b, -2s + 0s + 3d = 7 for s. 1 Suppose -5u = -9u. Let l(j) = j3 - j + 4. Let t be l(u). Suppose 7z = tz + 15. Solve -zg + 32 = -4d, 4d - 2d = -4g + 10 for g. 4 Let g(n) be the second derivative of n*4/12 + 5n*3/6 + 4n*2 - 5n. Let k be g(-9). Suppose 5i = i + k. Solve v + 19 = 5w, 3v + i = w - 4 for v. -4 Let v = 168 - 166. Solve 2m - 5r + 8 = 0, vm - 2r + 3 = -5 for m. -4 Suppose 0a - 3a - 18 = 0. Let l(p) = 20p - 21 + 13p - 37p. Let q be l(a). Solve -qw + 2w = 1, 3w + 2 = -f for f. 1 Let z = 3 - 1. Solve l - d + 2 = 0, 4 = -zl + 6d - d for l. -2 Let v = -32 - -41. Let u(s) = -s2 + 8s + 10. Let h be u(v). Suppose 9 = t - h. Solve 3l - l = -5r - t, -5l = -2r - 33 for r. -4 Let t = 2 - 2. Let j be 15(t + 2(-4)/(-24)). Solve -4s + 20 = -jv, 0 - 4 = v + 4s for v. -4 Let u = -9 + 11. Suppose 7w = 11w - w. Suppose -6 + w = -ui. Solve d = -3n - 1, id + 2n + 7 - 18 = 0 for d. 5 Let c = 44 - 43. Solve 5t + c = -3f - 1, -4f - 10 = 3t for t. 2 Let q(h) = -h2 + h + 2. Let b be q(0). Let x be (-6 - -3)(-1)/(-3). Let g = x - -9. Solve -f + bu = -3f - 18, 0 = 2u + g for f. -5 Let r(p) = 3p*2 - 21p + 6. Let q be r(7). Solve -3l - 2t + q = 1, -4l = -2t + 12 for l. -1 Let t = 9 + -7. Suppose 0 = c + tc. Let z be ((-10)/(-4))/(90/108). Solve -7 = -y - za, c = 2y - 5a + 19 for y. -2 Suppose -6s - 59 = -161. Solve -3j - s = 4g, 4g = 3g + j + 1 for g. -2 Let c be 4 - 39/9 - 10/(-3). Suppose 7g - cg - 33 = -5m, 29 = 2g + 5m. Solve -2f + 3i = gi - 5, 0 = -4f + 5i + 13 for f. 2 Let c be (-110)/(-44)16/10. Suppose 0 = -ci - 0i. Solve i = 4t - 5k + 3, -5t = -2t - k + 5 for t. -2 Suppose 10o = 6o + 12. Let r(g) = g + 5. Let p be r(-5). Let y = 5 - p. Solve -17 = -w - od, yd = -8 + 28 for w. 5 Let a(j) = 3j2 + 4j - 3. Let p be a(1). Suppose -4z = 2s + 4, -10 = 5s + 6z - z. Let l = s - -2. Solve 0 = u - 2r - p, -u + lr = r + 8 for u. -4 Let f be 3 - -3 - (1 + 2). Let h(r) = -r*2 + 7r - 10. Let w be h(f). Let x be w/(-1) - (8 + -12). Solve -5y - xi + 19 = 0, 5i + 2 = -13 for y. 5 Suppose -3f + 2x + 0 = -82, 0 = 5f - 2x - 142. Solve -4w - o + 15 = 0, -5 + f = -5o for w. 5 Let h(d) = -d3 - 5d*2 - 2d - 6. Let u be h(-5). Solve 2g = -ut - 20, -4t + g = t + 11 for t. -3 Let h be 5 + 0 - (2 + -3). Let k be h + (-5)/(15/9). Suppose 5r = kf - 14, -3r - r - 10 = -2f. Solve b - 2b = 4, 4x + fb = -12 for x. 0 Suppose 121v - 117v = 472. Let q = v + -115. Solve -2u = -3b - 9, u = qb + 8 + 4 for u. -3 Let w(g) = -g3 - 2g*2 - 6g - 7. Let a be w(-2). Solve -ak = -2p + 9, p + 6k = 4k for p. 2 Let y(l) = -12l - 280. Let u be y(-25). Solve r + 6o - 2o = -4, 5r - 3o + u = 0 for r. -4 Let z = 119 - 113. Let r be (z/15 - (-4)/(-10))/2. Solve -5l + rl + 31 = 4a, 0 = -2l - 5a + 26 for l. 3 Suppose -4o + 22 = -38. Solve 5j + 5b + 20 = 0, -2j - o = 2j + 3b for j. -3 Let c(b) = b*2 + 19b + 3. Suppose 2d + 3d + 2f + 91 = 0, 2d - 4f + 46 = 0. Let g be c(d). Solve i - 4 = 0, ga = 6a + 4i - 10 for a. -2 Suppose 5 = -4u + 29. Suppose r - u = -r. Solve -4n - r = -0v - v, -4n + 2v + 2 = 0 for n. -2 Let o(r) = -r - 3. Let s be o(-7). Let h(m) = 5m*3 - 3m*2 + m + 1. Let v be h(1). Suppose 0 = -0n - vn + 64. Solve -s - n = 5y, 23 = -a - 5y for a. -3 Let v be -3 + (4 - 0) + 7. Let p = -41 - -33. Let f = v - p. Solve 2h - 14 = -h - 4s, -4h - 4s = -f for h. 2 Let k(p) be the first derivative of -p2 + 10p + 9. Let j be k(5). Solve -q + 2q - 3x + 1 = j, 7 = 3q - 4x for q. 5 Let n = -79 - -79. Suppose 12 = k + k. Let m = 73 + -61. Solve 2b = -4p + k, 4b + nb - m = p for p. 0 Let m = -88 - -92. Solve -6j - mb - 8 = -2j, 1 = -b for j. -1 Let r = -124 + 124. Suppose -4v - t = -8, 2v + 2t - 4 = -rt. Suppose 4g - 5 - 11 = 0. Solve -gw + 1 + v = -3p, -5w - 4p - 4 = 0 for w. 0 Suppose -13 + 13 = -i. Let o(x) = -x*2 - 4x + 3. Let n be 6/(18/(-4) - -3). Let y be o(n). Solve yd - 5w = 10, d - 4w = -id + 1 for d. 5 Suppose -5s - 35 = -5y, 0 = -s + 20 - 24. Let w be 4-1 + 38 + 2 + -5. Suppose -3d + 2d = -5. Solve -14 = v + yf, -w + 2 = -4v + df for v. 1 Suppose -102h = -100h - 52. Solve -2l + 3x - 19 = -6l, 5x = -l + h for l. 1 Let y = 354 + -350. Solve -yb + 16 = 0, 0 = -h + 4b - 24 + 5 for h. -3 Let k(d) = -d*3 - 4d*2 + 4d + 16. Let n be k(-4). Let j be (-4 - -3)3 - -3. Solve -2p = -jp - 5x, -3x = n for p. 0 Suppose 2d - 50 = -w, 4d - 132 = -d - 6w. Solve 4v + v - 4 = -4q, q = 5v - d for q. -4 Let l = 23 + -21. Suppose 2y + ly - 5q = -12, 0 = 2y - 2q + 4. Solve 0 = yo + 4i + 2, -18 = 5o - 3o - 4i for o. -5 Let i(p) = 6p*2 - 228p + 2. Let j be i(38). Solve 5d + 5 = -0, 5r = 3d - j for r. -1 Let s(m) = m2 + 9m + 4. Let c be s(-9). Solve -5d + 19 = z, 0z - 3z - 19 = -cd for z. -1 Let u be (-160)/(-30) + (-4)/(-6). Suppose -4n + u = -18. Solve f = -2o + n, -6 = -3f + 5f - 5o for f. 2 Let n(s) = s - 6. Let w be n(8). Let o(h) = h3 - 2h*2 + 3h. Let r be o(w). Let z = r - 4. Solve -zu - 9 = 2q + 5, -4u - 18 = 2q for q. -5 Let c(p) = -5p - 9. Let n(f) = -4f - 8. Let l(i) = -3c(i) + 4n(i). Let m be l(-10). Solve mj + 2b = 5b + 8, j - 20 = -4b for j. 4 Suppose -n + 1 = 3s - 4s, 0 = 2s. Solve 11 = 4l - 3a, -3a = -l + n + 4 for l. 2 Suppose -2j - 2 = -14. Let i be (-3)/1 - (j - 9). Let t be (i/3 + -1)0. Solve t = -4d + 4s, 0d + 2s = 4d + 8 for d. -4 Suppose 1 = -2k + 3. Let t = k - -1. Let y = -3640 - -3640. Solve y = -tb - 5u - 10, -2b + 5u + 25 = -7b for b. -5 Let l(g) = g2 - 2g - 4. Let w be l(3). Let p be 8/(-10)w10. Suppose p = -d + 11. Solve di + 4s = 8i - 10, 4s + 16 = 2i for i. -2 Let w be (-16)/2(1/2 + -1). Let x(g) = -g*2 - 8g - 7. Let t be x(-7). Suppose 5z - 10z = t. Solve 2s - wv + 22 = z, -v = 2s + v - 2 for s. -3 Suppose 0 = -5n + 2y + 14, -9 = -3n + 14y - 13y. Solve -n = 2t + 3b - 0b, -2b = -3t - 19 for t. -5 Let i(x) = x2 + 13x - 20. Let k be i(-15). Let v = k + -8. Let f be -129/(-6). Solve r + 3t - v - 5 = 0, fr = t + 11 for r. 4 Let u be 6/(-5) - (-1)/5. Let a be (-10)/4 - u - (-120)/16. Solve -n + 5l - 13 = 0, 2l = 3n - 2l + a for n. 2 Let q be (-4)/(7 + -9) + 13. Solve d + 5b = 13 + q, -3d + 14 = b for d. 3 Suppose -5i = -3i - 10. Suppose -30 = -0w - iw. Suppose -3o + wo = 6. Solve 2s + 4 = -4c + 2, c + 3 = os for s. 1 Let q(k) = -81k. Let s(z) = 5z. Let l(c) = -2q(c) - 33s(c). Let y be l(-1). Let o = -2 - -4. Solve 4i - 5w - 35 = 0, -i + ow + 26 = yi for i. 5 Let o be (-2)/2-4 - (-2)/(-2). Suppose r + 6d = od + 10, -5r + 30 = 5d. S	{ "pile_set_name": "DM Mathematics" }
cement from {l: 1, o: 1, q: 2, v: 3, s: 3, i: 1}. What is prob of picking 2 q? 1/55 What is prob of picking 2 z when two letters picked without replacement from mmnzntznnnmzm? 1/26 What is prob of picking 1 e and 1 h when two letters picked without replacement from eztttzektohk? 1/33 What is prob of picking 2 n and 2 g when four letters picked without replacement from snvgsvnng? 1/42 Calculate prob of picking 1 r and 1 e when two letters picked without replacement from eeveurrreveerererre. 7/19 What is prob of picking 2 d and 1 g when three letters picked without replacement from dgddddggdgggggdgdd? 27/68 Three letters picked without replacement from iviiaiivivvvvvai. Give prob of picking 1 i and 2 v. 21/80 Calculate prob of picking 1 d and 1 o when two letters picked without replacement from {b: 3, d: 1, o: 1}. 1/10 Calculate prob of picking 3 a when three letters picked without replacement from {a: 10}. 1 What is prob of picking 1 i and 1 j when two letters picked without replacement from {g: 1, z: 14, i: 2, j: 1, p: 2}? 1/95 Three letters picked without replacement from mjmmjzsjsssmuuzums. Give prob of picking 1 z, 1 u, and 1 s. 5/136 Two letters picked without replacement from {e: 6, x: 1, s: 1, a: 4, y: 1}. What is prob of picking 1 e and 1 y? 1/13 Calculate prob of picking 3 l when three letters picked without replacement from {m: 4, a: 7, l: 4}. 4/455 What is prob of picking 1 d and 2 z when three letters picked without replacement from czdzzzdcz? 5/21 What is prob of picking 1 j and 2 k when three letters picked without replacement from {k: 3, j: 12}? 36/455 What is prob of picking 1 p and 1 g when two letters picked without replacement from {y: 2, p: 3, x: 2, r: 3, g: 5}? 1/7 Two letters picked without replacement from aelllaell. What is prob of picking 1 e and 1 a? 1/9 Two letters picked without replacement from paaappavappppppppvp. Give prob of picking 1 v and 1 a. 10/171 Calculate prob of picking 4 d when four letters picked without replacement from {g: 15, d: 3}. 0 Calculate prob of picking 3 a and 1 c when four letters picked without replacement from {c: 2, a: 5}. 4/7 What is prob of picking 1 w and 1 c when two letters picked without replacement from {w: 6, c: 6}? 6/11 Four letters picked without replacement from {x: 2, y: 3, c: 1, u: 7, g: 6}. What is prob of picking 2 g, 1 y, and 1 c? 15/1292 Four letters picked without replacement from zpppzpzzzzpz. Give prob of picking 4 p. 1/99 Two letters picked without replacement from {l: 3, g: 1, n: 4}. Give prob of picking 2 l. 3/28 What is prob of picking 1 v and 1 c when two letters picked without replacement from {d: 1, v: 11, c: 4, q: 1, t: 1, p: 1}? 44/171 What is prob of picking 1 r and 1 j when two letters picked without replacement from lrorogrorjolrjjorjj? 10/57 Calculate prob of picking 1 u and 1 t when two letters picked without replacement from {j: 1, t: 1, u: 2, k: 1}. 1/5 Four letters picked without replacement from aaaaayaa. What is prob of picking 1 y and 3 a? 1/2 What is prob of picking 1 k, 1 d, and 1 m when three letters picked without replacement from {d: 1, m: 6, o: 2, e: 5, k: 2}? 3/140 Three letters picked without replacement from {a: 16, q: 2}. What is prob of picking 3 a? 35/51 Three letters picked without replacement from uqjxb. Give prob of picking 1 q, 1 u, and 1 j. 1/10 What is prob of picking 1 n and 1 e when two letters picked without replacement from nuttueuttutren? 4/91 Four letters picked without replacement from wiydeie. Give prob of picking 1 d, 1 y, and 2 i. 1/35 Three letters picked without replacement from {a: 6, p: 4, x: 1}. What is prob of picking 2 a and 1 p? 4/11 Three letters picked without replacement from mvbvbbbbvmbvnnvbb. Give prob of picking 2 n and 1 m. 1/340 Two letters picked without replacement from hebbzxj. Give prob of picking 1 j and 1 h. 1/21 Three letters picked without replacement from {d: 1, x: 1, u: 5, j: 1, s: 2}. Give prob of picking 1 x, 1 j, and 1 d. 1/120 What is prob of picking 1 w and 2 i when three letters picked without replacement from {r: 7, w: 8, i: 5}? 4/57 What is prob of picking 1 z, 1 c, and 1 e when three letters picked without replacement from czemu? 1/10 Three letters picked without replacement from kpmkmnxxxkggknn. What is prob of picking 1 n, 1 x, and 1 p? 9/455 Calculate prob of picking 2 d and 2 a when four letters picked without replacement from {x: 2, v: 1, b: 1, q: 3, d: 3, a: 2}. 1/165 Four letters picked without replacement from hlhojhhlwolhhhwlo. Give prob of picking 2 w and 2 o. 3/2380 Four letters picked without replacement from {z: 1, i: 1, j: 1, a: 3, n: 5}. Give prob of picking 1 z, 1 j, 1 n, and 1 i. 1/66 Four letters picked without replacement from ysjssjsejssessy. Give prob of picking 1 y, 2 j, and 1 e. 4/455 What is prob of picking 3 t and 1 g when four letters picked without replacement from gtgttttttgtttttt? 33/70 What is prob of picking 1 v and 1 e when two letters picked without replacement from {r: 3, e: 1, t: 1, v: 2}? 2/21 Four letters picked without replacement from {i: 7, p: 2}. Give prob of picking 4 i. 5/18 Calculate prob of picking 2 x and 2 r when four letters picked without replacement from rxxxyxyyry. 1/35 Calculate prob of picking 3 t and 1 i when four letters picked without replacement from {t: 6, i: 4}. 8/21 Three letters picked without replacement from vgavvgvyvyyyvyysgqvy. Give prob of picking 1 g, 1 v, and 1 a. 7/380 Calculate prob of picking 3 u when three letters picked without replacement from fffuffuffuuufuffff. 5/204 Calculate prob of picking 2 v, 1 d, and 1 u when four letters picked without replacement from {v: 7, u: 2, d: 3}. 14/55 Calculate prob of picking 1 y and 2 e when three letters picked without replacement from {e: 13, y: 3}. 117/280 Two letters picked without replacement from uvuvuvuauvaprppvu. What is prob of picking 1 u and 1 a? 3/34 Calculate prob of picking 3 w and 1 u when four letters picked without replacement from wswunwsuuwwwwesu. 1/13 What is prob of picking 2 r, 1 w, and 1 n when four letters picked without replacement from {n: 10, w: 1, i: 1, a: 2, r: 3}? 3/238 Two letters picked without replacement from acss. What is prob of picking 1 c and 1 a? 1/6 What is prob of picking 1 z and 1 x when two letters picked without replacement from {t: 4, x: 1, z: 1, g: 1, w: 1}? 1/28 Two letters picked without replacement from gcpvwlpwcwvg. What is prob of picking 1 c and 1 g? 2/33 What is prob of picking 3 u when three letters picked without replacement from nucuceuceueee? 2/143 Calculate prob of picking 1 e and 1 v when two letters picked without replacement from {c: 1, e: 2, w: 3, v: 1, g: 4}. 2/55 What is prob of picking 2 f when two letters picked without replacement from {k: 7, f: 9}? 3/10 Two letters picked without replacement from ycycyoioicyc. Give prob of picking 2 o. 1/66 Calculate prob of picking 2 w when two letters picked without replacement from wjjrjjryrwwj. 1/22 Three letters picked without replacement from {x: 10, z: 2, f: 6}. What is prob of picking 2 x and 1 f? 45/136 Two letters picked without replacement from foooodooofoodo. Give prob of picking 1 o and 1 f. 20/91 What is prob of picking 2 n when two letters picked without replacement from nnfoxdnnfoon? 5/33 Two letters picked without replacement from {y: 5, u: 4, x: 1, a: 1}. Give prob of picking 1 u and 1 y. 4/11 What is prob of picking 2 u when two letters picked without replacement from {o: 1, u: 2, n: 1, k: 1, t: 2}? 1/21 Three letters picked without replacement from nuiuanniinnnwawnn. Give prob of picking 1 u, 1 n, and 1 a. 4/85 Three letters picked without replacement from {i: 11, p: 1, x: 2, z: 1, b: 2, n: 1}. Give prob of picking 1 i, 1 p, and 1 n. 11/816 What is prob of picking 1 s, 1 i, and 1 g when three letters picked without replacement from sgsi? 1/2 Three letters picked without replacement from {q: 4, x: 1, o: 1, c: 2, u: 3, j: 1}. Give prob of picking 2 c and 1 j. 1/220 Two letters picked without replacement from {t: 1, r: 5, j: 6, p: 3, f: 2, o: 2}. What is prob of picking 1 p and 1 r? 5/57 What is prob of picking 2 j when two letters picked without replacement from adjhj? 1/10 What is prob of picking 1 y, 1 k, and 1 p when three letters picked without replac	{ "pile_set_name": "DM Mathematics" }
2c3 - 19c*3 - 9c*3 - a wrt c? -18c2 Let a(l) be the second derivative of -l7/14 - 2l6/3 + 53l*3/3 + 14l + 1. Find the second derivative of a(z) wrt z. -60z3 - 240z*2 Let f = 2865 - 2865. Let m(w) be the second derivative of 0w*2 + fw*4 - 5w + 0 - 1/6w3 + 1/2w*5. Find the second derivative of m(b) wrt b. 60b Let c(k) be the first derivative of 642k5/5 - 291k - 452. What is the derivative of c(y) wrt y? 2568y3 Let y = -97 - -101. Suppose u = -4u + 10. Find the third derivative of -5o4 + 9o - 9o + yo*u wrt o. -120o Suppose 24 = 4i - 7i. Let t be -2 - -1 - (i + 4). Find the third derivative of 231p + pt - 2p*2 - 231p wrt p. 6 Let w(d) = -223d5 + 5d*2 + 17d + 4. Let l(c) = 222c5 - 7c*2 - 16c - 5. Let i(j) = -4l(j) - 5w(j). Find the third derivative of i(q) wrt q. 13620q2 Let v(a) = 31a*2 + 2a + 391. Let s(q) = q*2 + 1. Let o(i) = 6s(i) - v(i). Differentiate o(u) wrt u. -50u - 2 Let g(s) be the second derivative of 107s*6/30 - 81s*2/2 - s - 9. Differentiate g(j) wrt j. 428j*3 What is the derivative of 25 - 24 - 113 + 25n - 12n + 205n wrt n? 218 Let m(x) = x - 1. Let k(p) = -5p + 6. Let j(b) = k(b) + 6m(b). Let s(t) = 24t + 41. Let y(n) = -5j(n) - s(n). What is the derivative of y(r) wrt r? -29 Let u(a) be the third derivative of 0 + 0a7 + 0a*3 - 12a*2 + 0a*6 + 0a*4 - 9/112a*8 + 0a + 8/15a5. What is the third derivative of u(q) wrt q? -1620q*2 Let q(o) = 41o*4 + 2o*3 - 2o*2 - 52. Let p(m) = 82m*4 + 5m*3 - 5m*2 - 105. Let h(x) = -2p(x) + 5q(x). Differentiate h(a) with respect to a. 164a*3 Find the first derivative of -876d*2 + 876d*2 + 107d*3 - 31 wrt d. 321d*2 Suppose 2c - 4 + 23 = 5n, -2n + 5c + 16 = 0. Suppose -nh + 3 = -2h. What is the third derivative of hm*2 - 2m*2 + 3m*2 - 5m*5 wrt m? -300m*2 Let s(a) = -43a - 255. Let p be s(-6). Let q(k) be the first derivative of -1/2k4 + 0k*p + 2k*2 + 0k - 5. What is the second derivative of q(g) wrt g? -12g Let m(l) = -46l3 + l2 - 1. Let d be ((-6)/18)/(1/3). Let z be m(d). Find the second derivative of -46 + z + 3i + 2i*3 wrt i. 12i Let m(r) be the first derivative of -33r3 - r2/2 + 505r - 598. Differentiate m(j) wrt j. -198j - 1 Let a(h) be the second derivative of -h5/20 - 35h4/12 + h3/3 + 19h2/2 - 20h. Find the second derivative of a(p) wrt p. -6p - 70 Let x(f) be the third derivative of 23f5/60 + f4/6 + 5f3/6 + 69f*2. What is the second derivative of x(v) wrt v? 46 Let f(g) = 13g - 8. Let h(p) = -2p - 11. Let o be h(-5). Let s(y) = y. Let z(j) = of(j) - 5s(j). What is the first derivative of z(k) wrt k? -18 Let c(p) = -p4 - 2p*3. Let z(h) = -481h*4 + 6h*3 + 218h*2. Let a(o) = -3c(o) - z(o). Find the third derivative of a(k) wrt k. 11616k Let f(a) be the third derivative of -41a*6/30 - 2a5/3 - a4/12 - 378a2. Find the third derivative of f(b) wrt b. -984 Suppose -11t + 155 = -6t. Let i = t + -27. What is the second derivative of -5r*5 - 3r*5 - 4r - ir + 4r wrt r? -160r3 Let i(z) = z2 - 5z - 20. Let u be i(8). What is the third derivative of 25r4 - 11r*2 - 26r*4 + 25r*u wrt r? 576r Let w(n) be the first derivative of 0n2 + 0n - 20 - 20/3n3 + 5/4n*4. What is the third derivative of w(o) wrt o? 30 Let m(n) be the second derivative of 113n*5/20 - 7n*4/2 + 6n + 13. What is the third derivative of m(j) wrt j? 678 Let i(t) = t - 4. Let o be i(8). What is the second derivative of 45x3 - 5x*o + 12x - 45x3 wrt x? -60x*2 What is the third derivative of -2v*2 - 51v - v*2 - 50v - 80v6 + 91v wrt v? -9600v3 Let u be 38/20 - 2/(-20). What is the second derivative of -3n*u + 8n*2 + 13n - 33n2 + 19n wrt n? -56 Let d = -67 - -69. Find the third derivative of -4f - 3f*4 + 20f*d + 7f*3 - 18f*2 + 0f*4 wrt f. -72f + 42 Let u = 4 + 0. Find the first derivative of -13 + 14f3 + f3 - uf*3 wrt f. 33f*2 Find the second derivative of 6b - 50b3 - 8b + 107b3 + 266b*3 - 7 - 92 wrt b. 1938b Find the second derivative of 16z2 + 907 + 28z - 907 wrt z. 32 Let t(x) be the second derivative of -42x5/5 + 5x4/4 - x3/6 + x - 5. Find the third derivative of t(v) wrt v. -1008 Let t = -3 - -5. Find the second derivative of 0q2 - 72q*5 + 61q*5 + 20q + 0qt wrt q. -220q3 Let b(i) = i2 + 2i. Let g be b(-4). Let d = g - 6. Find the third derivative of -3r*5 - 3r*5 + 5r*5 + 2r*d wrt r. -60r*2 Differentiate -105r + 75 - 41 + 179r + 205r - 36 wrt r. 279 Let r(u) = -u3 + 2. Let g(p) = -p3 + 4p2 - 5p + 6. Let d be g(3). Let k be r(d). Find the second derivative of 3j + 2j + j*k - 6j*2 wrt j. -10 Let c be ((-5)/(-6))/((-2)/(-12)). Let y be (-5)/(-10)(-1 + c). Find the second derivative of 0t2 - 18t*5 + 20t*5 + 0t*y + 9t wrt t. 40t3 What is the third derivative of 64t*4 - 33t*4 - 35t*4 - 3t + t + 81t2 + 28t*3 wrt t? -96t + 168 Differentiate -15z3 + 39z*3 - 11z*3 + 80 - 15z*3 - 8 + 3z*2 wrt z. -6z*2 + 6z Suppose 267 = 5b + 7. What is the third derivative of 25y2 - y2 + 19y2 - by*6 + 30y*6 wrt y? -2640y*3 Let a be 1/(-2) + 5/2. Let d be (a - 3)-41. What is the derivative of -13c*d + 70 - 137 + 82 wrt c? -52c*3 What is the third derivative of 18p*2 - 38p*5 - 96p*2 - 4p*6 - 30p*2 + 0p*6 wrt p? -480p*3 - 2280p2 Let q(o) = o2 - 5o. Let g be q(6). Differentiate 4n3 + n3 + 6n3 - gn*3 + 18 with respect to n. 15n*2 Suppose -16 = -0m - m. Suppose q = -j + 4, 4j + 0j = -3q + m. What is the derivative of -1 + qu*4 - 4u*4 + 6u*4 - 3 wrt u? 8u*3 Let g(j) = -115j*2 - 6j - 397. Let h(p) = 459p2 + 27p + 1588. Let w(r) = 9g(r) + 2h(r). What is the first derivative of w(a) wrt a? -234a What is the second derivative of -292y*2 + 343y + 785y2 + 168y + 40y + 253y wrt y? 986 Let i(q) be the second derivative of 33q5/10 + 9q*3/2 - q + 1. Find the second derivative of i(a) wrt a. 396a Let a(z) be the second derivative of 11z6/30 + 8z*3 - 2z - 7. What is the second derivative of a(f) wrt f? 132f2 Let v be (18 - 33)4/(-10). What is the third derivative of 24r6 + 23r*v - 46r*6 + 10r*2 wrt r? 120r*3 What is the first derivative of 6o*2 + 49o - 8o2 - 332 - 192o - 270 wrt o? -4o - 143 Let z(g) = -205g*3 + 12g*2 - 11g - 7. Let b(l) = -204l3 + 10l*2 - 10l - 8. Let p(h) = 6b(h) - 5z(h). Find the second derivative of p(r) wrt r. -1194r What is the derivative of 68t + 28t + 54 + 63t + 29 - 14t wrt t? 145 Find the third derivative of -3f + 3f - f4 + 166f*5 - 143f*2 + 182f*5 - 462f*5 wrt f. -6840f*2 - 24f Let j(p) be the second derivative of -p*6/10 - 9p*5/20 - 31p*2 + 2p + 3. What is the derivative of j(q) wrt q? -12q3 - 27q2 Let m(j) be the second derivative of j4/6 - 107j3/6 + 2j + 140. Find the second derivative of m(k) wrt k. 4 Find the second derivative of -161x3 - 47x - 87x + 32x - 58x wrt x. -966x Let n(h) = h + 2. Let y be n(5). What is the second derivative of -yd + 4d*4 - 2d + 18d4 - 3d wrt d? 264d2 Suppose 2h = 3h - 7. What is the third derivative of -n2 - hn*6 + 11n*2 + 16n*6 wrt n? 1080n*3 Differentiate 4a - 30 - 4a - 21a*3 - 27a3 - a2 with respect to a. -144a2 - 2a Differentiate -82v + 64 + 3v*2 - 87v + 169v wrt v. 6v Let c(d) = -3d3 + 14d*2 - 7d + 44. Let g(s) = -2s3 + 8s*2 - 3s + 22. Let x(z) = -4c(z) + 7g(z). What is the first derivative of x(w) wrt w? -6w2 + 7 Let k(g) = 2g*2 - 6g. Let p be k(4). Suppose px = 4x. Differentiate x - 6 + 1 + 0o2 - 5o*2 with respect to o. -10o Suppose -11y + 10y + 6 = 0. What is the derivative of 30c + y - 13c - 16c - 11c wrt c? -10 Let p(i) be the third derivative of 13i6/24 + i5/6 - i4/12 - 60i*2. Find the third derivative of p(r) wrt r. 390 Suppose -11o = -19o + 7o. Let g(b) be the second derivative of b*2 + 2/3b*4 + 0b*3 + o + 2b. Find the first derivative of g(j) wrt j. 16j What is the derivative of -54562d*3 - 66 - 6d*2 + 161 + 54559d*3 wrt d? -9	{ "pile_set_name": "DM Mathematics" }
1? 4 Calculate the remainder when 9825 is divided by 36. 33 Calculate the remainder when 5073 is divided by 12. 9 What is the remainder when 407 is divided by 120? 47 Calculate the remainder when 3930 is divided by 127. 120 What is the remainder when 626 is divided by 35? 31 What is the remainder when 1537 is divided by 35? 32 Calculate the remainder when 1430 is divided by 181. 163 What is the remainder when 957 is divided by 25? 7 Calculate the remainder when 1391 is divided by 17. 14 What is the remainder when 3149 is divided by 38? 33 What is the remainder when 1015 is divided by 46? 3 Calculate the remainder when 619 is divided by 125. 119 What is the remainder when 1470 is divided by 25? 20 What is the remainder when 77 is divided by 33? 11 Calculate the remainder when 19 is divided by 2. 1 Calculate the remainder when 91 is divided by 19. 15 Calculate the remainder when 1221 is divided by 13. 12 What is the remainder when 784 is divided by 280? 224 Calculate the remainder when 2412 is divided by 150. 12 Calculate the remainder when 436 is divided by 132. 40 Calculate the remainder when 1213 is divided by 9. 7 Calculate the remainder when 422 is divided by 4. 2 What is the remainder when 718 is divided by 45? 43 What is the remainder when 7134 is divided by 27? 6 Calculate the remainder when 238 is divided by 19. 10 Calculate the remainder when 56794 is divided by 13. 10 What is the remainder when 271 is divided by 101? 69 Calculate the remainder when 213 is divided by 155. 58 Calculate the remainder when 62 is divided by 13. 10 Calculate the remainder when 824 is divided by 9. 5 Calculate the remainder when 555 is divided by 47. 38 Calculate the remainder when 7621 is divided by 25. 21 What is the remainder when 408 is divided by 41? 39 What is the remainder when 784 is divided by 381? 22 What is the remainder when 846 is divided by 203? 34 What is the remainder when 151 is divided by 49? 4 What is the remainder when 88 is divided by 28? 4 What is the remainder when 2245 is divided by 41? 31 Calculate the remainder when 3059 is divided by 153. 152 What is the remainder when 234 is divided by 60? 54 Calculate the remainder when 2131 is divided by 294. 73 Calculate the remainder when 110 is divided by 28. 26 What is the remainder when 74 is divided by 47? 27 What is the remainder when 616 is divided by 125? 116 What is the remainder when 471 is divided by 110? 31 Calculate the remainder when 2948 is divided by 982. 2 Calculate the remainder when 1776 is divided by 534. 174 Calculate the remainder when 398 is divided by 21. 20 What is the remainder when 58 is divided by 19? 1 What is the remainder when 595 is divided by 120? 115 Calculate the remainder when 431 is divided by 24. 23 Calculate the remainder when 2637 is divided by 165. 162 What is the remainder when 374 is divided by 62? 2 What is the remainder when 168 is divided by 43? 39 Calculate the remainder when 128 is divided by 26. 24 Calculate the remainder when 65 is divided by 11. 10 What is the remainder when 3607 is divided by 899? 11 What is the remainder when 710 is divided by 82? 54 Calculate the remainder when 372 is divided by 40. 12 Calculate the remainder when 356 is divided by 89. 0 Calculate the remainder when 544 is divided by 14. 12 What is the remainder when 40 is divided by 14? 12 Calculate the remainder when 28 is divided by 24. 4 Calculate the remainder when 38699 is divided by 25. 24 What is the remainder when 387 is divided by 64? 3 What is the remainder when 2727 is divided by 26? 23 Calculate the remainder when 4046 is divided by 156. 146 What is the remainder when 295 is divided by 13? 9 What is the remainder when 3323 is divided by 16? 11 Calculate the remainder when 404 is divided by 339. 65 Calculate the remainder when 309 is divided by 26. 23 Calculate the remainder when 1631 is divided by 32. 31 Calculate the remainder when 6553 is divided by 16. 9 What is the remainder when 242 is divided by 58? 10 What is the remainder when 35 is divided by 25? 10 Calculate the remainder when 494 is divided by 90. 44 Calculate the remainder when 14 is divided by 2. 0 Calculate the remainder when 1359 is divided by 62. 57 What is the remainder when 633 is divided by 321? 312 Calculate the remainder when 185 is divided by 17. 15 Calculate the remainder when 22 is divided by 14. 8 Calculate the remainder when 22 is divided by 15. 7 What is the remainder when 1620 is divided by 1619? 1 What is the remainder when 74 is divided by 34? 6 What is the remainder when 142 is divided by 67? 8 What is the remainder when 104 is divided by 53? 51 What is the remainder when 68 is divided by 35? 33 What is the remainder when 864 is divided by 429? 6 Calculate the remainder when 115 is divided by 43. 29 Calculate the remainder when 401 is divided by 81. 77 What is the remainder when 596 is divided by 560? 36 What is the remainder when 156 is divided by 153? 3 What is the remainder when 136 is divided by 6? 4 What is the remainder when 3665 is divided by 7? 4 Calculate the remainder when 1519 is divided by 39. 37 Calculate the remainder when 1994 is divided by 105. 104 Calculate the remainder when 429 is divided by 87. 81 Calculate the remainder when 400 is divided by 130. 10 Calculate the remainder when 127 is divided by 21. 1 Calculate the remainder when 934 is divided by 354. 226 Calculate the remainder when 389 is divided by 18. 11 What is the remainder when 1667 is divided by 19? 14 Calculate the remainder when 226 is divided by 23. 19 What is the remainder when 50 is divided by 13? 11 Calculate the remainder when 1087 is divided by 204. 67 Calculate the remainder when 47 is divided by 5. 2 What is the remainder when 94 is divided by 10? 4 Calculate the remainder when 151 is divided by 27. 16 Calculate the remainder when 614 is divided by 31. 25 Calculate the remainder when 75 is divided by 26. 23 Calculate the remainder when 226 is divided by 19. 17 Calculate the remainder when 145 is divided by 23. 7 What is the remainder when 7471 is divided by 53? 51 What is the remainder when 6091 is divided by 53? 49 What is the remainder when 6497 is divided by 325? 322 What is the remainder when 56229 is divided by 72? 69 Calculate the remainder when 1767 is divided by 13. 12 What is the remainder when 355 is divided by 39? 4 Calculate the remainder when 194 is divided by 33. 29 Calculate the remainder when 808 is divided by 22. 16 What is the remainder when 404 is divided by 27? 26 What is the remainder when 887 is divided by 7? 5 Calculate the remainder when 221 is divided by 28. 25 What is the remainder when 191 is divided by 65? 61 What is the remainder when 829 is divided by 83? 82 Calculate the remainder when 334 is divided by 85. 79 What is the remainder when 125 is divided by 52? 21 Calculate the remainder when 120 is divided by 11. 10 Calculate the remainder when 525 is divided by 24. 21 What is the remainder when 596 is divided by 152? 140 Calculate the remainder when 83 is divided by 5. 3 What is the remainder when 137 is divided by 3? 2 What is the remainder when 314 is divided by 105? 104 What is the remainder when 50 is divided by 17? 16 What is the remainder when 2827 is divided by 23? 21 Calculate the remainder when 878 is divided by 291. 5 What is the remainder when 607 is divided by 13? 9 Calculate the remainder when 254 is divided by 37. 32 Calculate the remainder when 444 is divided by 95. 64 Calculate the remainder when 515 is divided by 43. 42 What is the remainder when 371 is divided by 351? 20 Calculate the remainder when 359 is divided by 24. 23 What is the remainder when 2816 is divided by 561? 11 What is the remainder when 300 is divided by 11? 3 What is the remainder when 17172 is divided by 226? 222 Calculate the remainder when 4169 is divided by 15. 14 Calculate the remainder when 1152 is divided by 378. 18 What is the remainder when 440 is divided by 49? 48 Calculate the remainder when 353 is divided by 12. 5 Calculate the remainder when 78 is divided by 69. 9 Calculate the remainder when 1614 is divided by 15. 9 What is the remainder when 25917 is divided by 90? 87 What is the remainder when 274 is divided by 257? 17 What is the remainder when 587 is div	{ "pile_set_name": "DM Mathematics" }
6 Let t(w) = 12w - 13. Let q(y) = 35y - 38. Suppose 0 = 18o + 68 + 40. Let a = -32 + 49. Let v(p) = at(p) + oq(p). Differentiate v(l) wrt l. -6 Let u = -5 - -10. Find the second derivative of -24k + 8k2 + 17k*u + k - 8k*2 wrt k. 340k3 Let w(z) be the first derivative of z7/15 + 5z3/3 - 12z*2 + 27. Let a(o) be the second derivative of w(o). Find the first derivative of a(j) wrt j. 56j*3 Let d(c) = -19c*4 + 5c*2 - 5c + 38. Let f(z) = -18z4 + 6z*2 - 6z + 39. Let y(m) = 6d(m) - 5f(m). What is the first derivative of y(r) wrt r? -96r3 Suppose 0 = 6s - 2s - 8. Let m be 30/(-3)s/(-4). What is the second derivative of 2q3 - 2q*3 + mq + 3q4 wrt q? 36q*2 Let h be (3/6)/(4 + 174/(-44)). What is the second derivative of -28t*3 - 23t - ht3 + 18t*3 wrt t? -126t Let w(k) be the second derivative of -5k2 + 1/10k*5 + 0 + 0k*3 + 0k*4 - 3k. What is the derivative of w(p) wrt p? 6p2 Let b(d) be the second derivative of 205d*7/21 - 37d*3/2 - 3d*2/2 + 238d + 1. Find the second derivative of b(n) wrt n. 8200n3 Let x(z) be the second derivative of 299z*7/42 + 37z*4/2 + 289z. Find the third derivative of x(j) wrt j. 17940j2 Let h(g) be the third derivative of g7/105 + 7g*6/15 - 47g*5/30 + 29g*2. What is the third derivative of h(m) wrt m? 48m + 336 Let p(l) = 160l2 - 15l - 699. Let r(h) = 240h2 - 24h - 1049. Let k(f) = 8p(f) - 5r(f). What is the derivative of k(v) wrt v? 160v Let y be 44((-45)/(-12))/5. Differentiate 12 + 3q*3 - 8q*3 + 11q*3 + yq*3 wrt q. 54q*2 What is the first derivative of -41 + 356j*4 - 4j*3 - 364j*4 + 85 wrt j? -32j*3 - 12j*2 Let g(q) = -185q*3 - 933q - 5. Let x(u) = 185u3 + 936u + 6. Let n(d) = -6g(d) - 5x(d). Find the second derivative of n(m) wrt m. 1110m Find the third derivative of -4m*3 - 74m*2 + 0m3 - m4 + 0m3 - m3 wrt m. -24m - 30 Let d(f) = f*3 + 9f*2 + 14f + 8. Let s be d(-7). Differentiate -13c4 + 11 + s + 0 wrt c. -52c*3 Let q(s) be the first derivative of 6s*5 - 7s*4/4 + 367s*3/3 + 13. Find the third derivative of q(z) wrt z. 720z - 42 Suppose -a = -6 + 3. Let i(d) = -d*3 + 3d*2 + d - 1. Let x be i(a). Find the second derivative of -x - 6n + 54n2 + 2 - 44n2 wrt n. 20 Let u(o) = o2 + 2o. Let i(y) = 7y*2 + 63y. Let f(s) = -i(s) + 3u(s). Find the second derivative of f(c) wrt c. -8 Let v be (-2)/(-2)-1 - 2-2. What is the derivative of 19 - 16o + 2ov + 16o wrt o? 6o2 Find the second derivative of 7 - 4 + 0 + 2u - 60u2 wrt u. -120 Let f(u) = -5u4 + u3 + u + 1. Let j(x) = 56x4 - 3x*3 - 3x - 5. Let s(r) = 6f(r) + 2j(r). Differentiate s(w) with respect to w. 328w3 Let p(f) be the second derivative of -61f5/20 + f3/6 + 151f2/2 + 330f. Find the second derivative of p(n) wrt n. -366n Let r(u) be the third derivative of -19u*9/14 - 8u*5/5 - 48u*2 + 2. What is the third derivative of r(h) wrt h? -82080h*3 Let z be -2 + 1 - (4 + 2-475). What is the second derivative of -zv5 + 917v*5 - 11v + 37v wrt v? -560v*3 Find the second derivative of -916u - 4u3 + 23u*3 + 0u*3 - 4u2 + u2 + 1492u wrt u. 114u - 6 Let f(m) = -5m2 + 3m + 9. Let g(a) = 16a2 - 10a - 28. Suppose -4r + 7 = -17. Let y(d) = rg(d) + 20f(d). Find the first derivative of y(k) wrt k. -8k Let k(d) be the third derivative of -d7/210 + d6/60 - 32d5/15 + 135d*2. What is the third derivative of k(c) wrt c? -24c + 12 Let v(s) = 879s3 - 23s - 13. Let n(k) = 1760k3 - 45k - 26. Let x(m) = -4n(m) + 7v(m). What is the second derivative of x(h) wrt h? -5322h Let p(m) be the first derivative of -m8/112 + m4/12 + 6m*2 - 9. Let h(j) be the second derivative of p(j). Find the second derivative of h(i) wrt i. -60i*3 Let q(i) be the third derivative of -5/112i*8 + 0 + 0i*7 + 0i*6 + 0i + 2/15i5 - 16i*2 + 0i*3 + 0i*4. What is the third derivative of q(h) wrt h? -900h*2 Let v(g) = -79g*3 + 9g*2 - 92g. Let n(i) = -237i3 + 30i*2 - 277i. Let z(d) = 3n(d) - 10v(d). Find the second derivative of z(f) wrt f. 474f Let b(l) = -6l*2 - 20l - 40. Let j(v) = 7v2 + 22v + 40. Let o(y) = -4b(y) - 3j(y). What is the derivative of o(t) wrt t? 6t + 14 Suppose 42 = -3m - 33. Let r = 27 + m. What is the second derivative of 3g + 14g*r - 2g + 6g - 3g*2 wrt g? 22 Let j(l) be the third derivative of -51l7/70 - l6/60 - 7l5/15 - l4/24 - 28l*2. Find the third derivative of j(c) wrt c. -3672c - 12 Let i(v) be the third derivative of -v8/960 + v6/240 - v*4/8 + 9v*2. Let l(y) be the second derivative of i(y). Find the second derivative of l(u) wrt u. -42u Let j(v) be the first derivative of -15v - 25 + 5/2v*2. Differentiate j(w) with respect to w. 5 Suppose -d + 5d - 48 = 0. Suppose 15 = di - 7i. What is the third derivative of -3oi + 2o*2 - 2o3 - o2 wrt o? -30 Let d = 591/220 - 29/11. Let l(c) be the second derivative of 0c4 + 3c*2 + 0 + 0c*3 - dc*5 - 7c. Find the first derivative of l(o) wrt o. -3o2 Suppose 3h - 5h + 24 = 0. What is the third derivative of -11x*3 + 16x*4 + 23x*3 - hx*3 + 10x*2 wrt x? 384x Suppose 3d - 21 = 15. Suppose -5g + d + 13 = 0. What is the first derivative of -gv4 + 11 - 17 + 10v*4 wrt v? 20v*3 Let c be -7(-2)/(-4)24/(-21). Differentiate 19 + 0m*4 + 30m*c - 18 wrt m. 120m*3 Let t be (0/(-4) - -7) + (-3 - -2). Find the third derivative of 2s*5 + 0s*5 + 3s*5 - 15s*2 + ts*5 wrt s. 660s*2 Suppose 8k - 104 = -0k. What is the third derivative of -27f*4 + 34f*4 - kf*2 - 36f*4 wrt f? -696f Let a be -3 + 2 - -111. Let t be (-12)/(1 + 3) + a. What is the first derivative of 8 - 1 - tq*3 + 0 wrt q? -21q*2 Let o = 10 + -10. Suppose n + 2x - 13 = o, 4n - x = n + 11. What is the second derivative of nq - 9 - 3q2 + 9 wrt q? -6 Suppose -9 = 6o - 33. What is the derivative of 0qo + 98 - 86 - q4 - 2q*4 wrt q? -12q*3 Let s(i) be the first derivative of 0i*4 - 7 + 0i - 1/5i5 + 0i*2 - 4/3i*3. What is the third derivative of s(n) wrt n? -24n Let u(b) be the first derivative of -7b4/4 + 78b - 117. Differentiate u(n) wrt n. -21n2 Let t(x) = 9x*2 - 9 + 4x*2 - 3x2. Let a = 2 - 3. Let o(p) = p2 - 1. Let k(j) = ao(j) + t(j). What is the first derivative of k(h) wrt h? 18h Let m = 199 + -197. Let h(u) be the first derivative of -6 + 1/2um + 0u + 2u3. What is the second derivative of h(j) wrt j? 12 Let i(t) = t3 - 8t*2 + 9t - 14. Let p be i(7). What is the second derivative of pu2 - u - 9u*2 + 4u wrt u? -18 Let h(b) be the first derivative of b*2 + 3 - 2b - 5/6b3. Let i(w) be the first derivative of h(w). What is the derivative of i(u) wrt u? -5 Let g(r) = 11r + 5 - 8 + 2r + 21r*3. Let y(z) = 64z*3 + 39z - 8. Let v(l) = 8g(l) - 3y(l). What is the second derivative of v(m) wrt m? -144m Find the third derivative of -a2 - 37 - 3a*3 + 1 + 3a*3 - 337a*5 + 12 wrt a. -20220a2 Let r(u) be the third derivative of u6/120 + 11u5/12 + u4/4 - u3/2 - 151u*2. Find the second derivative of r(c) wrt c. 6c + 110 Let p(y) = 84y3 + y2 + 251y - 17. Let h(i) = -21i3 - 62i + 4. Let g(d) = -9h(d) - 2p(d). Find the second derivative of g(j) wrt j. 126j - 4 Suppose 5o - 3o + 2h = 74, -5o + 3h = -153. What is the second derivative of ov + 36v - 75v - 51v*5 wrt v? -1020v*3 Find the third derivative of 79y*3 + 2y + 91y3 - 3 + 2y - 35y2 - 4y wrt y. 1020 Let r(x) be the first derivative of -149x4/4 + 125x*3/3 - 66. What is the third derivative of r(n) wrt n? -894 Let a be ((-24)/(-4) - 3) + 2. What is the second derivative of -9y - 13y + 31y + 7ya wrt y? 140y*3 Differentiate -18 - 207m*4 - 99 - 25 - 234m*4 - 62 with respect to m. -1764m*3 Let p(k) be the first derivative of -55/4k*4 + 0k*3 + 0k - 12 + 61/2k2. What is the second derivative of p(j) wrt j? -330j Let z(n) be the second derivative of 0 - 1/3n3 - 13/20n*5 + 0n*2 - 7n + 0n4. Find the second derivative of z(c) wrt c. -78c Let h(c) = -47c3 - 8c*2 - 14c + 195. Let p(n) = -	{ "pile_set_name": "DM Mathematics" }
)/q))/q)*16(q(2/7))(-1/24)((q(1/2)/q)/((qqq(-1/4))/q))/(q(-6)/qqqqqq(9/4)) assuming q is positive. q(131/12) Simplify (((nn/(nn*32))/n)/(nn*(-9/8)n)(nn/(n*(1/11)n))/(n*(-43)n))(-5/9) assuming n is positive. n(-4415/792) Simplify ((b(-1/4)/((b/((b/b(-9))/b))/b))/(b(-2/19)/b(-2/31)))50 assuming b is positive. b(517775/1178) Simplify (p*(-1/21)p(-13/4))/(p(-16)/p)22 assuming p is positive. p(31139/84) Simplify (uu(3/5)uu1)/(u(-1/6)/(u/(uuu(1/2)u)))(u1)40u/((u/(u*(-1/4)u))/u)u0 assuming u is positive. u(2581/60) Simplify x6xxxx(-6)x(x/x(-1/2))(1/16)((x(-1/3))42)(-7) assuming x is positive. x(3267/32) Simplify (jj(7/5)(j/(j*9j))/jjjj(j*2j)/j(j(-10)/j)/jj)(-30) assuming j is positive. j408 Simplify a(4/11)/(a1a)a(1/26)/a46 assuming a is positive. a(-13613/286) Simplify (((c1)*(27/5)(ccc/(c*1/c)cc)41)(-23))(-19) assuming c is positive. c(459724/5) Simplify (l2/l(-2))(9/5)((l/(l/l*(2/5)))/ll(1/2)/l)23 assuming l is positive. l(-181/10) Simplify ((x/x(-2/5)x)19)(-10/13)x(-4)/x(2/17)(x(1/4))44 assuming x is positive. x(-6231/221) Simplify (qq(-1/30))35/(q(2/101)/(q/q19q)) assuming q is positive. q(10189/606) Simplify (((dd/(d(d(-7)d)/d)dd)/d(16/3))/(d(-12/11)d7))33 assuming d is positive. d(-41) Simplify (v5v/((v*(-3/4)/vv)/v))(-2/17)/(v/(v(-1/4)v)v(-6))(-1/17) assuming v is positive. v(-5/4) Simplify (l/((l(2/23)/l)/l)(((lll(-2/53)l)/ll)/l)/l)/(l(-1/10)l(4/9)/l) assuming l is positive. l(497081/109710) Simplify (j*14j*29jj)/(j/(j7/j)(j/(jj/(j/(j/(jj*42j)j))))/jj) assuming j is positive. j8 Simplify (x0xxx(x/x(-7))/x)(-4/7)/((x*(-1/6)x1/x)/((x/(x(-1/4)x)x)/(xx(1/7)))) assuming x is positive. x(-457/84) Simplify ((((k(k/k*9k)/k)/(k/(((kk/k(-3)kk)/k)/k)))(-18))(-31))(1/67) assuming k is positive. k(-1674/67) Simplify (s(2/9)/((s/(ss/(ss(2/7)s)))/s))*(-6)(s/s*(-2)s)/(ss(3/5)s)(s(-1))27 assuming s is positive. s(-2648/105) Simplify ((g(g*(2/5)/g)/g)/(gg*(-3))((gg(1/2)/g)/g)(-1/15))/(g(-5)g*7(g(1/4))31) assuming g is positive. g(-499/60) Simplify (((u(-3/5))*(-29)/(((uu/(u/(u/(u/u*(-5))u)))/u)/u)20)34)(-7) assuming u is positive. u(-139706/5) Simplify ((g1)(2/37)(g/(g/(g/g1)))/(g/(gg*(2/15)g)))/(g/g*(3/10)ggg*(2/37)g)(-32) assuming g is positive. g(67331/555) Simplify (v(-19))20((v/v(-26))/vv)(-3/26) assuming v is positive. v(-9961/26) Simplify ((ss(-6/11)s)*7s/(s/s*(2/9))s20)(-46) assuming s is positive. s(-138460/99) Simplify ((h(4/7)h(-3/25)/h)/(h/h(-8/5)hh(-21)))(1/4) assuming h is positive. h(2949/700) Simplify ((vvv/(((v/v(-1))/v)/v)v)/(v/(v/v*(-4)))v*(2/3)v(1/2))/(v(2/7)/v*(-1/5)(vv0)/vv4) assuming v is positive. v(983/210) Simplify (((g/(g2/g))50/(gg/(g/(gg*(-6)))g(3/4)/g))(-25))(4/9) assuming g is positive. g(-425/9) Simplify (r*(-1)/((rr/(r*(-9)/r))/r)(r/(r/r8))/r(-8))/(r/r*(-1/2)rrr11)(-1/12) assuming r is positive. r(125/24) Simplify (((z(-2/5)/zz)/((z/(z(2/5)/z))/zz))/(z*(-11)z(-1/11)))46 assuming z is positive. z(4600/11) Simplify ((((c/((c(-4)/ccc)/cc))/cc)/c(-8))/((c/c(3/4)c)/(c(-8/7)/c)))/((cc/(cc(-4))cc/(c3c))/(c*8cc(-2))) assuming c is positive. c(353/28) Simplify ((o(-2)/oo)(3/25)/(o(2/13)/(o/(o/((ooo(-6/5))/o)))))/((o/(o(-3/7)/o))/(o/(oo/o2))(o/(o9/o))/(o/o(-6))) assuming o is positive. o(27249/2275) Simplify ((o(1/12)/(ooo/((o/(o*(-3)/o)o)/o)oo)o(-5/6)/o(1/3))(-48))(-22/9) assuming o is positive. o(-1144/9) Simplify ww*(1/5)w*(2/9)((w/(w/(w*23w))w)/w)(-2/79) assuming w is positive. w(2896/3555) Simplify ((((s/s11)/(s(-11)s))/(s*(-13)s(1/10)))21)(-39) assuming s is positive. s(-105651/10) Simplify ((q/q(-1))/(q(-4)q))/(q(3/2)qq5)q(-1)/q(-5)(q3qq)/q(-1/4) assuming q is positive. q(27/4) Simplify (c(-3/13)cc/c(2/23))(-8/5)(c/(c/c*(2/17))c*(-14)c)(-21) assuming c is positive. c(6807097/25415) Simplify (((((w*(-17)w)/www)/w)/(w/(w/w*(1/4))w))/(ww/w(-3))(-6/19))(-3/37) assuming w is positive. w(3573/2812) Simplify (xx(-2/5))14x(-6)x*0(xx/(x/x6)x)/(xx(2/5))((x(-1)/x)/x)19 assuming x is positive. x(-48) Simplify ((i(-1/7)i)/iii(-1/9)(iiii/(i/(iii(-1/3)/ii)))/(i(-5)/i))/((i3/i5)/((i/i(-2/5))/i(-2/11))) assuming i is positive. i(51956/3465) Simplify (h*0h)*(-10)h/h*(-3/10)h*(-2)h((h/(h(-2/7)/h))/(h(hh(1/4))/h))(-41) assuming h is positive. h(-7303/140) Simplify (q(-7)/(((((qq*3)/q)/qq)/q)/qq)q*3/qq*(2/3))/((q/(q(q/(qqq*(-6)/qq))/q)qq(2/19))/(q8q/q(2/9))) assuming q is positive. q(913/171) Simplify (uu2)(-3/44)/(uu/((u/u(2/13))/u)u*6)(u/(u/u*(1/4)u))*(19/6)u*(-3/4)uuu(7/5) assuming u is positive. u(-46237/5720) Simplify ((m0/m)/((m/(m(-7)/m))/m))(-30)/((m/m(8/7)m)/m10)(-1/65) assuming m is positive. m(122786/455) Simplify (ww*(1/7)www/(w/w(-6)))(-6)/((((w/(w(2/3)/w))/w)/w)(4/21)/((w*5w)/w0)) assuming w is positive. w(1466/63) Simplify ((t*(2/11)t(-3/5))/(t(-2/5))*18)/((tt(4/7))/(t/(t(4/5)/tt)))(-31) assuming t is positive. t(18979/385) Simplify ((bbb(-21))/bb/(b/b*(10/7))(b*(-2/7)/b)/(bb/((b/(((bb/b(-1/4))/b)/b))/b)))(-17/2) assuming b is positive. b(10523/56) Simplify (i(-9)ii/(i/(i/(i/i(1/6))ii)i))*(-41)/((ii*(-1)i(2/15))/((i/i(2/11))/ii((ii(-7/3))/i)/i)) assuming i is positive. i(30527/110) Simplify (i(-1/8)iiii/i13)5/(((i(-1)i)/i)9)(-13) assuming i is positive. i*(-1301/8) Simplify p(p/p*2)/pppp/p*(-1/11)p*(7/10)p9 assuming p is positive. p(1297/110) Simplify ((o2)(3/28)(o(-4)/o)(-46))(-7/5) assuming o is positive. o(-3223/10) Simplify (m17m*29/m)/((mm/(m/(m/(mm/m(-3/10)))m)m)/m(-33)) assuming m is positive. m(123/10) Simplify ((((r(2/11))(4/5))31)(-12/11))(-15) assuming r is positive. r(8928/121) Simplify (n(2/35))(1/37)n*(-2/13)/(nnn(-10/3)nn) assuming n is positive. n(-41362/50505) Simplify ((((d/d(-2/9))/d)/(d/d(-9)))/((d(6/11)/d)/(d/(dd(-7)))))(3/44) assuming d is positive. d(-115/726) Simplify (((r(13/4)((rr(-17))/r)/r)(-50))(3/5))37 assuming r is positive. r(32745/2) Simplify (l(1/11)l(2/3)/l)6((l*(-14)/l)/(l/(l/(ll(2/17)))))26 assuming l is positive. l(-78636/187) Simplify (n(3/8)/n*(-6))/(((n(n/(((nnn(-25))/n)/n))/n)/n)/n(-3/5)) assuming n is positive. n*(-769/40) Simplify ((nn*22nn(-2/11)n)/(n(14/5)/(n/n4)))39 assuming n is positive. n(40794/55) Simplify (((jj31)/j)/jjj(-26/9))/((jjj(-2)/j)/j)37 assuming j is positive. j(919/9) Simplify ((t(-3)t)/t5)(-43)((t(-2/3)t)/t)/(tt(-1/5)t)(tt(1/4)/t)(-3/13) assuming t is positive. t(232811/780) Simplify ((p(-1/4)/p)(6/5))(-3/23)(p7pp(p/(((pp(p/p1)/p)/p)/p))/p)(-8) assuming p is positive. p(-3671/46) Simplify ((f(4/7)fff(-2/31)/ff(f(-1/3))(-13))(-39))(-42) assuming f is positive. f(347334/31) Simplify (l(1/2)/ll/l(-7))(-11)(l/(ll*(-1/3)l))(1/5)/(l(-2/7))3 assuming l is positive. l(-17173/210) Simplify ((k/k(2/5))7/((kk(kk(-3))/k)/(k(4/7)kk)))(-1/68) assuming k is positive. k(-4/35) Simplify aa/(aa/(a(a*(-40)a)/a))(a(a*(2/15)a)/aa)/aa((a(-11/4)aaa)/a)/aa/(a(-2/47)aa) assuming a is positive. a(-111599/2820) Simplify (a4/(a/((a(-2/5)/a)/a)))/((a0/a)/a(-2))aa6a/a*(-8)((a*(-2/17)a)/a)/aaa(-2/11) assuming a is positive. a(14306/935) Simplify (u*(-1/2)/(uu*4)(u(u/(u(-1/4)u))/uu)(-4/27))/((uuu1)/(u(1/5)u))15 assuming u is positive. u(-1765/54) Simplify (i*(-1/5)i)/i*(1/4)i*4/ii*(-8)i*(1/14)i*(-2/3)i**(-2	{ "pile_set_name": "DM Mathematics" }
b of picking 1 i and 1 y when two letters picked without replacement from {l: 2, a: 3, y: 1, n: 4, i: 1, p: 1}? 1/66 Three letters picked without replacement from {t: 10}. Give prob of picking 3 t. 1 Calculate prob of picking 1 l, 1 a, and 2 h when four letters picked without replacement from tqqhphqlqqlla. 3/715 What is prob of picking 1 a and 3 p when four letters picked without replacement from bppa? 0 What is prob of picking 3 d and 1 n when four letters picked without replacement from nnndddn? 4/35 Two letters picked without replacement from ttigiwwqqqtwui. Give prob of picking 2 q. 3/91 Two letters picked without replacement from xtxwiiaaawnx. Give prob of picking 1 a and 1 w. 1/11 Four letters picked without replacement from bizxxbvbvqxbxxx. What is prob of picking 1 i, 1 v, 1 b, and 1 z? 8/1365 Two letters picked without replacement from {i: 3, j: 15}. Give prob of picking 2 i. 1/51 Calculate prob of picking 3 k and 1 r when four letters picked without replacement from rkrrkrrrrrrrrkr. 4/455 Two letters picked without replacement from nwxwwwnwrwxw. Give prob of picking 1 x and 1 r. 1/33 Four letters picked without replacement from bbbbibbbbiiiiibibibi. Give prob of picking 1 i and 3 b. 99/323 Four letters picked without replacement from sjjjrsrsjj. Give prob of picking 2 r and 2 j. 1/21 Calculate prob of picking 1 h and 1 n when two letters picked without replacement from nnnhnnh. 10/21 Four letters picked without replacement from {j: 2, n: 1, l: 2, f: 1, u: 1, e: 1}. What is prob of picking 1 u, 1 e, and 2 j? 1/70 Calculate prob of picking 3 b when three letters picked without replacement from {b: 9, i: 5}. 3/13 Calculate prob of picking 3 p when three letters picked without replacement from pppppp. 1 Two letters picked without replacement from {b: 7, i: 3, y: 2, k: 1, l: 5}. Give prob of picking 1 k and 1 l. 5/153 Four letters picked without replacement from rmlemmeqlemm. What is prob of picking 1 e, 2 l, and 1 q? 1/165 Calculate prob of picking 1 r, 1 t, and 1 n when three letters picked without replacement from rltrfnlth. 1/21 Calculate prob of picking 1 f and 3 x when four letters picked without replacement from xxpxpfpfxp. 4/105 What is prob of picking 2 b and 1 c when three letters picked without replacement from vevrdbrbc? 1/84 Two letters picked without replacement from sksssxxxkszxsst. What is prob of picking 1 k and 1 z? 2/105 Calculate prob of picking 1 p and 1 i when two letters picked without replacement from ppmpgpiippiipm. 4/13 Calculate prob of picking 1 f, 1 p, and 2 r when four letters picked without replacement from krkfrkrkrrkpfkff. 2/91 Four letters picked without replacement from rarctaatccatcartcac. Give prob of picking 2 c and 2 r. 15/1292 Four letters picked without replacement from zzzz. Give prob of picking 4 z. 1 Two letters picked without replacement from jmfsjgsmmmjw. Give prob of picking 1 f and 1 w. 1/66 Two letters picked without replacement from {c: 1, g: 1, w: 3, t: 2}. What is prob of picking 1 t and 1 g? 2/21 Two letters picked without replacement from iininnxiieee. Give prob of picking 1 n and 1 i. 5/22 Calculate prob of picking 1 d and 2 h when three letters picked without replacement from {u: 2, k: 2, h: 8, d: 1}. 14/143 Four letters picked without replacement from mtdrdrd. What is prob of picking 1 t, 1 m, and 2 d? 3/35 Calculate prob of picking 2 g and 1 u when three letters picked without replacement from wuwugwggwuwwu. 6/143 Three letters picked without replacement from {f: 1, s: 9, r: 5, e: 2, m: 1}. What is prob of picking 1 e, 1 r, and 1 m? 5/408 Four letters picked without replacement from zjjzzjjzsszj. Give prob of picking 3 j and 1 s. 4/99 Four letters picked without replacement from {a: 1, t: 10, r: 7}. What is prob of picking 1 t, 1 a, and 2 r? 7/102 Calculate prob of picking 1 l and 1 n when two letters picked without replacement from {x: 8, n: 5, i: 1, l: 4}. 20/153 Four letters picked without replacement from uxxggxyjx. What is prob of picking 1 u and 3 x? 2/63 What is prob of picking 4 k when four letters picked without replacement from kkkkkfkkkkkk? 2/3 Two letters picked without replacement from {t: 1, g: 1, a: 1}. Give prob of picking 1 g and 1 a. 1/3 Calculate prob of picking 2 e and 1 a when three letters picked without replacement from {e: 1, a: 2, s: 2, j: 1}. 0 Three letters picked without replacement from wjjwjjjjjjjjj. What is prob of picking 3 j? 15/26 Two letters picked without replacement from aajaaapaaanannwaaya. Give prob of picking 1 a and 1 p. 4/57 Calculate prob of picking 4 h when four letters picked without replacement from {h: 7, y: 5}. 7/99 Calculate prob of picking 1 j and 1 x when two letters picked without replacement from {x: 5, l: 3, i: 1, j: 1}. 1/9 Two letters picked without replacement from hrstwdw. What is prob of picking 1 r and 1 t? 1/21 Calculate prob of picking 1 n and 1 s when two letters picked without replacement from {b: 1, n: 5, p: 3, i: 1, s: 1, k: 1}. 5/66 Two letters picked without replacement from {c: 2, g: 7, a: 1}. What is prob of picking 1 c and 1 a? 2/45 Calculate prob of picking 1 r, 1 y, and 1 f when three letters picked without replacement from raarraaaaafayaatrttt. 1/285 Four letters picked without replacement from {g: 1, m: 1, t: 2, j: 2, s: 1}. What is prob of picking 2 t, 1 g, and 1 s? 1/35 Calculate prob of picking 1 m and 1 l when two letters picked without replacement from tttmmtlhh. 1/18 What is prob of picking 1 f and 3 t when four letters picked without replacement from {f: 3, t: 8}? 28/55 Calculate prob of picking 4 v when four letters picked without replacement from vvvvvvvvv. 1 Two letters picked without replacement from hpphpppphp. Give prob of picking 2 h. 1/15 Two letters picked without replacement from nonmhohnnsnmnm. What is prob of picking 1 o and 1 h? 4/91 Two letters picked without replacement from {o: 1, r: 3, f: 2, p: 2, l: 1, t: 3}. What is prob of picking 1 f and 1 o? 1/33 What is prob of picking 1 z and 1 f when two letters picked without replacement from {f: 2, n: 3, z: 4, u: 2}? 8/55 Four letters picked without replacement from {u: 3, r: 4}. What is prob of picking 1 u and 3 r? 12/35 Four letters picked without replacement from yysts. Give prob of picking 2 s and 2 y. 1/5 Calculate prob of picking 1 v, 1 f, and 1 x when three letters picked without replacement from {f: 2, v: 1, c: 1, x: 2}. 1/5 Three letters picked without replacement from {t: 1, f: 4, x: 1, c: 4}. What is prob of picking 2 f and 1 x? 1/20 Two letters picked without replacement from kxoooooxoo. Give prob of picking 1 k and 1 o. 7/45 What is prob of picking 2 x and 2 f when four letters picked without replacement from {j: 3, v: 5, x: 3, f: 4, p: 1, z: 4}? 6/1615 Calculate prob of picking 1 y and 1 n when two letters picked without replacement from {y: 2, e: 1, n: 4}. 8/21 Calculate prob of picking 2 t when two letters picked without replacement from {p: 1, y: 1, z: 4, u: 1, w: 4, t: 7}. 7/51 Two letters picked without replacement from kayvvbky. Give prob of picking 1 k and 1 b. 1/14 Calculate prob of picking 1 v and 1 a when two letters picked without replacement from aykvkvkyvqvq. 2/33 What is prob of picking 1 s and 3 i when four letters picked without replacement from {i: 11, s: 3}? 45/91 Four letters picked without replacement from {i: 3, b: 4}. Give prob of picking 4 b. 1/35 What is prob of picking 2 j and 1 b when three letters picked without replacement from {s: 4, y: 10, b: 1, j: 3, n: 1}? 1/323 Four letters picked without replacement from yyyeyeyyyyy. What is prob of picking 3 y and 1 e? 28/55 What is prob of picking 2 r and 1 b when three letters picked without replacement from rrburbrsr? 5/21 What is prob of picking 2 v when two letters picked without replacement from {y: 1, f: 1, v: 2, i: 3}? 1/21 Calculate prob of picking 1 u, 1 f, and 2 y when four letters picked without replacement from {y: 5, t: 1, u: 2, f: 11}. 55/969 Calculate prob of picking 2 x and 1 q when three letters picked without replacement from {x: 1, f: 4, q: 5}. 0 What is prob of picking 2 w, 1 h, and 1 x when four letters picked without replacement from wwwwwwwwwwxwhxwww? 13/170 Two letters picked without replacement from {d: 4, h: 2}. Give prob of pi	{ "pile_set_name": "DM Mathematics" }
. Calculate -3h(p) + 7y(p). -5p + 3 Let w(a) = 5a - 6. Let t = -2 + 6. Let p be -12(-1)/t-2. Let o(f) = -14f + 17. Determine po(i) - 17w(i). -i Let x(m) = 4m*3 + 3m*2 - 4m + 3. Suppose -4j - 7 = 4k - 3j, -k + j = 3. Let s(n) = n3 + n2 - n + 1. Give kx(f) + 6s(f). -2f*3 + 2f Let d(f) = f*2 + 5f + 7. Suppose -4p - 10 = -2p. Let c(i) = 4i + 6. Determine pc(s) + 4d(s). 4s2 - 2 Let h(n) = n2 - n + 2. Let j(d) = 2d - 2d*2 + 18 - 34 + 10. Let o = -9 + 1. What is oh(r) - 3j(r)? -2r*2 + 2r + 2 Suppose -q + 5o = -20, 4o - 45 = 4q + 9o. Let t(f) = 5f + 7. Let i(n) be the first derivative of 2n*2 + 6n - 1. Give qt(l) + 6i(l). -l + 1 Let f(a) be the first derivative of 7a4/4 + 5a*3/3 - 3a*2 + 6a + 39. Let x(j) = -5 - j*2 + 7j - 5j2 - 2 - 8j*3. Give 7f(g) + 6x(g). g3 - g2 Let g(m) = -4m*3 + 2m*2 + 2m - 5. Suppose -30 = -5q - q. Let v(n) = n3 + 1. What is qv(l) + g(l)? l*3 + 2l*2 + 2l Let p(j) = j3 + j2 - 1. Let s(w) = 9w3 + 11w*2 - 12. Suppose -9v + 5v = 88. Determine vp(r) + 2s(r). -4r3 - 2 Let a(d) = -d2 + 2d - 2. Let y(r) be the first derivative of -r3 + 5r*2/2 - 5r + 5. Determine 15a(c) - 6y(c). 3c2 Let u(z) = -7z*2 + 2z + 4. Let v(g) = 20g2 - 6g - 11. Calculate 11u(h) + 4v(h). 3h2 - 2h Let p(u) = 3u2 + 9u. Let g(y) = -y*2 + 3y*2 + 2y*2 - 2y*2 + 5y. Give -9g(k) + 5p(k). -3k2 Let j(s) = -3s + 6. Let l(v) = 9v - 7. Let m(w) be the second derivative of 19w*3/6 - 7w*2 + 2w. Let o(c) = -13l(c) + 6m(c). Calculate 7j(n) - 6o(n). -3n Suppose 0c + 25 = 5n - c, c = 2n - 13. Let t(w) = -2w3 - 4w*2 - 6w - 4. Let p(k) = 2k3 + 5k*2 + 7k + 5. Determine np(f) + 5t(f). -2f3 - 2f Let i(r) = -7r - 1. Let j(l) = -8l - 1. What is 4i(c) - 3j(c)? -4c - 1 Let f(i) be the second derivative of -i3/6 - 3i*2 + i. Let t = 220 + -227. Let s(r) = -2r - 13. Calculate tf(p) + 3s(p). p + 3 Let v(m) = 187m. Let p(u) = 17u. Give 34p(i) - 3v(i). 17i Let u(a) = -8a - 4. Let p(j) = 23j + 12. Calculate -6p(t) - 17u(t). -2t - 4 Let y(a) = 3a - 10 + 8a - 1. Let k(f) = 5 - 4f - 3f - f + 3f. Determine -13k(h) - 6y(h). -h + 1 Let v = 6 - 15. Let n(m) = -3m*2 - 3m - 1. Let q(c) = 4 - 3 + 13c + 4 + 13c*2. Suppose -5 = 5h + o, o - 1 = 3h + 2o. Calculate hq(y) + vn(y). y*2 + y - 1 Let a(y) be the second derivative of -1/6y*3 + 0y*4 + 0 + 0y*2 - 1/20y*5 - 6y. Let l(c) = 2c3 + c2 + 2c. What is -a(r) - l(r)? -r3 - r2 - r Suppose 3o = -6u + 3u + 3, -4o + 3u - 24 = 0. Let r(p) = -2p - 4. Suppose -5 + 2 = 3h. Let s(q) = q + 1. Calculate hr(l) + os(l). -l + 1 Let j(k) = 4k*3 - 9. Let s(h) = 9h*3 - 17. What is 7j(m) - 3s(m)? m3 - 12 Let p(v) be the second derivative of v4/6 - v2 + 4v. Suppose 0n + 9 = 3n. Let r(t) = 0t3 + 2t*2 - 3t2 - tn + 1. Determine p(a) + 2r(a). -2a3 Let r be -1 + -3 + 2 - -3. Let s(n) be the second derivative of -n3/6 + n*2/2 + 2n. Let o(p) = -p*3 - 2p + 2. What is ro(w) - 2s(w)? -w3 Let z(k) = -k. Let s(y) = y2 + 5y. What is s(n) + 3z(n)? n*2 + 2n Let k(m) = m*3. Suppose 0 = -4g + 12, 4g = -5d + 2d + 27. Suppose 3u - 4v = 14, u - dv = -3u + 17. Let w(b) = 4b*3 - b. Determine uw(f) + 9k(f). f3 + 2f Let r(u) = -8 + 10 + 2 - 1. Let v(g) = g*2 - 1. What is -r(a) - 3v(a)? -3a2 Let k = 8 - 3. Let w(z) = 2z + 4. Let o(p) = 9. Let a(i) = 5. Let n(l) = 7a(l) - 4o(l). Determine kn(s) + w(s). 2s - 1 Let u(d) = d*2 + d. Let q(h) = 7h*2 + 7h + h*2 + 0h*2 + 0h*2. Give 3q(p) - 21u(p). 3p*2 Let c(q) = -11q - 5. Let r(t) = 21t + 9. Determine 11c(a) + 6r(a). 5a - 1 Let j(k) = -5k2 + 2. Let l(w) = -135w*2 + 55. Calculate 110j(f) - 4l(f). -10f*2 Let s(y) = -6y + y - y. Let x = -92 + 87. Let r(i) = -i. Give xr(l) + s(l). -l Let b(f) = -16f - 6. Let c(g) = -17g - 5. Determine 5b(y) - 6c(y). 22y Let n(l) = -l*3 - 4l + 1. Let d be n(-2). Let k(z) = 7z2 + z - 1. Let i(o) = -20o*2 - 3o + 3. Determine dk(r) + 6i(r). -r*2 - r + 1 Let x(u) = u + 1. Let p(o) = -5o. Give p(r) + 6x(r). r + 6 Let l(r) = 5r*2 + 2r - 6. Let a(z) = 16z2 + 7z - 19. What is 2a(k) - 7l(k)? -3k2 + 4 Let y(a) = a2 + 8a - 7. Let t be y(-9). Let p(x) = x + 0x + tx. Let q(m) = -13m + 1. What is 9p(h) + 2q(h)? h + 2 Let f(i) = 20i*2 - 5. Let q(c) = -30c*2 + 8. Determine -8f(m) - 5q(m). -10m*2 Let p(c) = 10c + 8. Let z(s) = -29s - 23. Calculate -17p(u) - 6z(u). 4u + 2 Let d(l) = -3l3 - 2l2 + 5. Let t(j) = j3 + j2 - 1. Let s(c) = -c2 - 7c - 13. Let q be s(-4). Give qd(v) - 2t(v). v3 - 3 Let t(d) = -5d*2 - d - 5. Let s(m) = 4m*2 + m + 4. Let h = 31 - 35. What is hs(u) - 3t(u)? -u2 - u - 1 Let w(a) = 2a*2 - 4a. Let n(h) = -h*2 + 4h - 1. What is -3n(u) - 2w(u)? -u*2 - 4u + 3 Let t(n) = n*3 - n - 1. Let b(w) = -7w - 5. Give b(a) - 5t(a). -5a*3 - 2a Let x(w) = 8w3 + 6w*2 - 6w - 1. Let q(h) = 23h3 + 17h*2 - 17h - 2. Determine -6q(d) + 17x(d). -2d3 - 5 Let a(h) = -32h + 6. Let w(f) = -11f + 2. Let i be ((-24)/(-16))/(1/(-4)). What is ia(n) + 17w(n)? 5n - 2 Let h be -2(3 + (-9)/6). Suppose -5 = -3x - 29. Let k(u) = -11u2 + 11u - 8. Let r(z) = 1 + 5 - 1 - 4z - 2 + 4z*2. Determine hk(j) + xr(j). j2 - j Let v(q) = 3q*2 - 2q. Let i(j) = -7j2 + 3j + 2. Let s(a) = -a + 1. Let w(n) = i(n) - 2s(n). Give 10v(t) + 4w(t). 2t*2 Let i(o) = 2o + 6. Let r(b) = 2b + 7. Let z(g) = 7g*3 - 2g - 1. Let p be z(-1). Calculate pi(y) + 5r(y). -2y - 1 Let u(k) = 2k*3 + 4k - 4. Let y(q) = 3q3 + 5q - 5. Let b be 5 - (-2 + (-1 - -1)). Let z = b + -12. Determine zu(i) + 4y(i). 2i3 Let w(d) = -d2 + d + 1. Let o(v) = 17v*2 - 3v - 2. What is -o(r) - 4w(r)? -13r*2 - r - 2 Let o be (-4)/(-16) + 26/(-8). Let z(g) = 2g. Let w(l) = -1 + 1 + 2l. Determine ow(c) + 2z(c). -2c Let s(p) = p*2 - 3p - 31. Let m(f) = f*2 - 2f - 16. What is 5m(b) - 3s(b)? 2b2 - b + 13 Let j(v) = -v2 - 5. Let t(d) = d - 1. What is j(z) - 3t(z)? -z*2 - 3z - 2 Let l(x) = 2x + 5. Let n(g) = g + 2. Let c = -35 - -29. Give cl(h) + 14n(h). 2h - 2 Let m = 23 + -29. Let t(o) = -4o - 6. Let c(i) = 3i + 5. What is mc(f) - 5t(f)? 2f Let b(o) be the third derivative of o5/15 - o4/24 - 6o*2. Let i(y) = 9y*2 - 3y + 1. Calculate 5b(x) - 2i(x). 2x2 + x - 2 Let w(a) = -17a - 2. Let x(v) = 17v + 1. Calculate -3w(o) - 4x(o). -17o + 2 Let t(p) = -p*3 - 1. Let r(v) = 2v*3 + 5. Calculate -r(u) - 4t(u). 2u3 - 1 Let k(n) = -7n*3 - 7n*2 + 5n + 3. Let f(c) = 138c3 - 11c*2 + 8c - 74c3 - 75c*3 + 5. Give 5f(s) - 8k(s). s3 + s2 + 1 Let b(q) = -4q*2 - 4q - 2. Let a(n) = 6n2 + 6n + 3. Let h(z) = z*2 - 15z - 7. Let y be h(15). Determine yb(t) - 5a(t). -2t2 - 2t - 1 Let d(p) = p + 9. Let l be d(-12). Let q(y) = -y*3 - 3y*2 - y - 2. Let m be q(l). Let t(a) = -2a - 5. Let f(h) = 1. What is mt(z) + 5f(z)? -2z Let q(s) = 9s*3 - 5s. Let a(b) be the third derivative of b6/30 - b4/12 - b*2. Let n = 44 - 42. Give nq(v) - 5a(v). -2v*3 Let f(c) = 11c*3 - 3c*2 + 3c + 3. Let s(x) = -198x3 + 55x*2 - 55x - 55. Give -55f(g) - 3s(g). -11g3 Let v = 9 + -20. Let k = v - -7. Let t(h) = -1. Let n(u) = -3. Let b(s) = n(s) - 2t(s). Let d(x) = x*2 + 3. Determine kb(f) - d(f). -f*2 + 1 Let a(n) = 5n - 3. Let j(i) = 16i - 8. Calculate -10a(s) + 3j(s). -2s + 6 Let x(m) = 6m - 4. Suppose -3z - 3z = 18. Let y(p) = 13p - 9. What is zy(b) + 7x(b)? 3b - 1 Let r be (3/2)/(9/(-18)). Let x(b) = -b3 - 3b. Let l be 18/10 - 2/(-10). Let y(u) = -3u + lu + 3u. Determine ry(a) - 2x(a). 2a*3 Let v be (40/6 + -7)(16 + -1). Let q(b) = -3b3 - 5b - 5. Let r(o) = o*3 + o + 1. Determine vr(h) - q(h). -2h3 Let c(m) = -m3 + 4m*2 - m - 2. Let q(w) = -3w*3 + 13w*2 - 4w - 7. Calculate 7c(x) - 2q(x). -x*3 + 2x*2 + x Let g(b) = 49 + 63b*2 - 3712b + 3712b. Let l(h) = -4h*2 - 3. What is -3g(j) - 49l(j)? 7j*2 Let w(y) = 4y*2 + 6y*3 - 2y*2 + 4 - 10y3. Let d(g) = g - 12. Let o be d(6). Let i(s) = s3 - 1. C	{ "pile_set_name": "DM Mathematics" }
p) = -3p2 - 23p - 7. Let h be ((-1)/(-2) - 0)/(17/(-238)). Let o be l(h). Is q(o) a composite number? False Is ((-765976)/(-6))/(268/201) composite? False Let h be -22/22 - 1002/(-66). Let f be (-60)/(-45)h/2. Suppose fq - 319 = 9q. Is q a prime number? False Let t = -732 + 1125. Suppose -18v + 14v = -736. Let j = t - v. Is j prime? False Suppose 3c = -2j - 51, 5j + 0c + 4c + 124 = 0. Is (-518595)/(-180) + 2/j a prime number? False Suppose 604 = 4j - 396. Let f = 959 - j. Is f a prime number? True Let d(f) = 130f2 - 230f + 89. Is d(-33) a prime number? True Let p be 5/((-125)/80)(-3015)/6. Suppose -p - 1642 = -2w. Let c = w - 60. Is c prime? False Let h(d) = 13d + 16. Let u(n) = -5n - 14. Let q be u(-12). Suppose 45z = qz - 15. Is h(z) a prime number? True Let x be 2/(-7) - 1844505/105. Is x/(-4) + 72/(-96) a composite number? False Let s be 22/(-8)-8. Suppose 0 = sd - 4503 - 1857. Suppose -d = -7p + p. Is p prime? False Suppose 29q - 26q - 5f = 259028, -5q = -f - 431706. Is q prime? True Suppose -22 = 6p + 5p. Is ((-141715)/70)/(1/p) composite? False Suppose 3v + 14 = 44. Let d(g) = 2g + 2g2 - 7g + 25 - 5g + 2g. Is d(v) prime? False Let g be (5 + -4 + -5)/((-12)/9). Suppose 3n + 3z - 2682 = 7374, -gn + 2z + 10061 = 0. Is n composite? True Suppose -45l - 24l + 853781 = -2l. Is l a prime number? True Suppose 56 = 15k - 79. Is 224490/k - -45/(-60) a prime number? True Let p = 27 - 14. Suppose 2c = 3l + p, c = -2c + 5l + 21. Suppose 0 = 4m + 4i - 792, 0m + cm = i + 411. Is m composite? True Let t = 36883 + -5876. Is t a composite number? True Let b be (0/(2 + -1))/3. Suppose b = 11c - 9c - 4w - 13818, w = 2c - 13821. Is c composite? False Let u = -31387 - -65618. Is u a composite number? False Suppose 104h - 17894110 = -26h. Is h a composite number? True Suppose -218305 - 123428 = 24t - 2066637. Is t prime? False Let m = 3382034 - 1823107. Is m a prime number? False Suppose -163c + 17c = -10597994. Is c a composite number? True Let x(j) = -309j3 + 27j*2 + 34j + 11. Is x(-10) prime? True Suppose 4a - c - 9 = 0, 5a + 5c = 6c + 12. Suppose -k - 12 + 0 = 0. Is a((-136)/k - -1) prime? True Suppose 5c = -5m - 35, 2c - m = 2m - 14. Let l(g) = -30g*3 + 11g*2 + 7g - 9. Is l(c) a composite number? False Let d = 529636 - 339747. Is d composite? True Let s = 230 + -452. Let g = s + 2531. Is g prime? True Let f be ((-3514)/(-4) + 2 - 5)2. Suppose -74i + 73i + f = 0. Is i composite? True Is 29963112/(-7 + 31) + -20 a prime number? False Is (2115/(-1260))/(2/(-360952)) composite? False Let y be 6/(-4)(-2 - 413). Let r = 97 + y. Suppose 5q - 3q = 2b - 178, 2b = -4q + r. Is b prime? True Suppose -4m = -5w - 2m + 20, 0 = 3m + 15. Suppose wa - 28 = -10. Let c(f) = -f*3 + 11f*2 + 5f - 8. Is c(a) a prime number? True Let z(k) be the first derivative of -106k2 + 39k + 116. Is z(-10) prime? False Suppose -9 = -2f + 2d + 9, -5f + 2d + 30 = 0. Suppose fc = -0c - 2248. Let i = c + 969. Is i composite? True Suppose 1 = -l - 0n - n, -5n - 15 = 0. Let x be (0 - -1)/((-103425)/(-51710) - l). Is 5/15 + (3 - x/(-6)) prime? False Let a(w) = w*2 + 1. Let k(p) = -85p*3 + 10p*2 + 8. Let b(u) = -6a(u) + k(u). Is b(-3) a prime number? True Suppose -3t + 43 = 1. Let v(x) = 5x2 - 5 + 14 + x3 + 0x3 - tx + 4x2. Is v(-7) prime? False Let t be ((-8)/36-31107)/((-7)/21). Let r = -13083 - t. Is r a composite number? True Let p(a) = -2530a + 751. Is p(-12) a prime number? False Let q = 52 + -52. Suppose -d + 0d - 2b + 7104 = 0, q = 2b - 10. Suppose 0 = -5g - 184 + d. Is g prime? False Is 3/(-9)15 + 7 + 174327 composite? False Suppose -r + 2012137 = 5v, 3r - 5v - 4392698 - 1643753 = 0. Is r composite? False Let i(n) = -3826n - 102. Let c be i(-8). Let g = c + 19799. Is g a prime number? False Let s(j) = 388j2 - 262j - 5097. Is s(-22) prime? True Suppose -2x = -4p - 119538, -4x + 8x - 2p - 239082 = 0. Is x composite? False Suppose 0 = s + 20 - 16, 4i - s = 24128. Is i a composite number? True Suppose q + 3n - 5881 = -3q, -2q + n = -2923. Is q prime? False Let u be 20/170 - (-75)/85. Let f(z) = 34z + 36z + 149z - 2. Is f(u) composite? True Suppose -u + 17528 = 3o, 3u = 8o - 3o + 52542. Let y = u + -9664. Is y a prime number? False Let o(x) = x*2 - 13x + 2. Let h be o(14). Let m be (-32)/h + 0 + 6. Suppose -4v + 4r - 1434 = -6v, -mr - 3655 = -5v. Is v a prime number? True Suppose 28s + 66s = -54s + 22672564. Is s prime? False Let p(g) = 2g - 342279 + 2g - 5g + 343394. Let r = 2 + -2. Is p(r) a prime number? False Suppose -s + 3v + 2900 = 0, -4v - 3798 = 5s - 18165. Is s a composite number? False Suppose -5x = -11x + 24. Suppose xd = 1461 + 95. Is d prime? True Suppose 2 = -4r + 10. Let f be 1966/(3/((-1)/r-3)). Let g = f - 484. Is g a prime number? True Let t(y) = y2 + 13y + 42. Let q be t(-5). Suppose -5s + 930 + 1287 = qz, 0 = -5z - 4s + 5568. Let a = 1633 - z. Is a composite? True Suppose -7a = -0a + 35. Is 44320/64(-1)/(a/6) a prime number? False Let c(y) = 16303y*2 - 118y + 231. Is c(2) composite? True Suppose -29v + 347024 = -123623 - 230254. Is v a composite number? False Let l = -604 + -1110. Let o = l + 2856. Is o prime? False Suppose r - 812156 = -4p, -2p - 5r = -180944 - 225134. Is p prime? True Let v be -155/22(-1 - -3). Is 3/(-3) + v - (2 + -3601) prime? True Let a be 6/(-4)16/(-12). Suppose 5i + 4y - 36 = 0, ai - 4 = 4i - 3y. Suppose ij = -j + 75. Is j composite? True Let x = -451 - -450. Let s(j) = 988j*2 + 6j + 1. Is s(x) a composite number? False Suppose -2a + 2102510 = -4s, -a - 43899 = -15s - 1095206. Is a a composite number? False Let d be (-22)/77 - 12/7. Let a(o) = 55o*3 - 7o*2 + 4o - 1. Let l(p) = -p3 + p2 - p. Let r(s) = -a(s) - 5l(s). Is r(d) prime? False Let d = 438 + -452. Is (-14)/d(-4)/((-4)/391) prime? False Let s = -82 + 83. Let t be 13 + (3/s)/1. Suppose tq - 11q - 115 = 0. Is q prime? True Suppose -4t - 17 = 3. Let b = t + 2. Is (-457)/(b - -4)-3 a prime number? False Let y(v) = 6v3 + 2v + 66574. Is y(0) a prime number? False Let m(k) = 6k + 45. Let r be m(-7). Suppose 4p + 7x - 6x = 16359, -12288 = -rp + 3x. Is p a composite number? False Is 1/11 + 25/(2475/2053548) composite? False Suppose -47c - 46c + 62547744 = 3c. Is c a composite number? True Let f(a) = 175a*2 + 5a - 10. Let y = -120 - -113. Let x be f(y). Suppose 5j - 7j = -x. Is j composite? True Let v be (4 + -1)3/(18/(-4)). Let s be (2/3)/(v/(-12)). Suppose -3d + 580 = 2n, 4n - 301 = 3n + sd. Is n prime? True Let o be -40 + 41 - (-1 - 0). Is o/(-3)2637/(-6) prime? True Let a(i) = 216i*2 - 275i - 445. Is a(34) composite? True Let b(w) = -w*2 - 1. Let s = 43 - 42. Let k(u) = 45u*2 - 9u + 4. Let i(q) = sk(q) + 3b(q). Is i(6) composite? False Suppose 4f - p + 6 = -2, -4f - 4p - 28 = 0. Is (5844/(-9))/(2/f) composite? True Let b be 1548/252 + 2/(-14). Let s(w) = 337w*2 - 9w + 71. Is s(b) a composite number? False Let w = -604 - -589. Is 10/w + (-4085)/(-3) prime? True Let c(z) = 3z2 + 2z + 194. Let h be c(0). Suppose -a + 1099 = -h. Is a a prime number? False Is (-1271844)/(-156) + (-21 + 24 - (-74)/(-26)) a composite number? True Suppose 245904 = 59n + 73447. Is n prime? False Let l be (-1)/2 + (-56994)/(-28). Let p = -818 + l. Is p prime? True Suppose -186520 = -3s - w, -18w + 248697 = 4s - 13w. Is s prime? False Let f(v) = -v3 - 190v*2 - 335v + 1500. Is f(-194) a prime number? False Suppose 2k - 3g = 33, 2k - 11g = -10g + 27. Is 1771 - k/6(-6)/4 composite? True Let u = 3365352 + -1487461. Is u a prime number? True Let v(b) be the second derivative of 2b4/3 - 4b*3 - 13b*2/2 + 80b - 1. Is v(-17) a composite number? False Let u(y) = -4y3 + 3y*2 - 13y + 11. Let t = 18 - 11. Suppose 12k = tk - 30. Is u(k) prime? True Suppose -4r + 62z + 845932 = 67z, 845932 = 4r + 3z. Is r prime? False Suppose 17c - 83183 = 74186. Is c a prime number? True Is (-1060864)/(-18) + ((-304)/18 - -17) a composite number? False Suppose 8*h = 5939 - 531. Let u = h + 245. Is u prime? False Is ((-42)/54 - (-4)/(-18))	{ "pile_set_name": "DM Mathematics" }
520 to the nearest integer? 1627 What is the seventh root of 186791 to the nearest integer? 6 What is 14068730 to the power of 1/4, to the nearest integer? 61 What is 6903663 to the power of 1/3, to the nearest integer? 190 What is the square root of 354413 to the nearest integer? 595 What is 5012922 to the power of 1/4, to the nearest integer? 47 What is the tenth root of 6195581 to the nearest integer? 5 What is the third root of 2965436 to the nearest integer? 144 What is the cube root of 157184 to the nearest integer? 54 What is the cube root of 4162731 to the nearest integer? 161 What is 5314655 to the power of 1/8, to the nearest integer? 7 What is the square root of 1745112 to the nearest integer? 1321 What is 4050955 to the power of 1/4, to the nearest integer? 45 What is the fourth root of 838320 to the nearest integer? 30 What is the fourth root of 788621 to the nearest integer? 30 What is the third root of 18421689 to the nearest integer? 264 What is the third root of 1194 to the nearest integer? 11 What is 234481 to the power of 1/10, to the nearest integer? 3 What is the third root of 394993 to the nearest integer? 73 What is the cube root of 1550840 to the nearest integer? 116 What is 36768162 to the power of 1/7, to the nearest integer? 12 What is 27734985 to the power of 1/7, to the nearest integer? 12 What is the cube root of 57114 to the nearest integer? 39 What is 1330596 to the power of 1/2, to the nearest integer? 1154 What is 9821212 to the power of 1/9, to the nearest integer? 6 What is the third root of 589300 to the nearest integer? 84 What is the third root of 498331 to the nearest integer? 79 What is 2007647 to the power of 1/3, to the nearest integer? 126 What is the third root of 5656298 to the nearest integer? 178 What is 1567304 to the power of 1/9, to the nearest integer? 5 What is 2968101 to the power of 1/2, to the nearest integer? 1723 What is the square root of 7060960 to the nearest integer? 2657 What is the square root of 1296473 to the nearest integer? 1139 What is 4102657 to the power of 1/2, to the nearest integer? 2026 What is 4560702 to the power of 1/2, to the nearest integer? 2136 What is the fourth root of 3974051 to the nearest integer? 45 What is the square root of 25656952 to the nearest integer? 5065 What is 2122007 to the power of 1/2, to the nearest integer? 1457 What is 36583 to the power of 1/2, to the nearest integer? 191 What is 1034298 to the power of 1/4, to the nearest integer? 32 What is 2304118 to the power of 1/3, to the nearest integer? 132 What is 115625 to the power of 1/2, to the nearest integer? 340 What is the cube root of 3902 to the nearest integer? 16 What is the square root of 676261 to the nearest integer? 822 What is 9669281 to the power of 1/10, to the nearest integer? 5 What is 366208 to the power of 1/3, to the nearest integer? 72 What is the ninth root of 16241587 to the nearest integer? 6 What is the sixth root of 75729 to the nearest integer? 7 What is the square root of 1077596 to the nearest integer? 1038 What is the ninth root of 823211 to the nearest integer? 5 What is the third root of 16567648 to the nearest integer? 255 What is the third root of 344421 to the nearest integer? 70 What is the sixth root of 305562 to the nearest integer? 8 What is the cube root of 7132809 to the nearest integer? 192 What is the cube root of 52888 to the nearest integer? 38 What is the third root of 9129 to the nearest integer? 21 What is the square root of 9084675 to the nearest integer? 3014 What is the sixth root of 2657603 to the nearest integer? 12 What is the square root of 1671966 to the nearest integer? 1293 What is 432653 to the power of 1/3, to the nearest integer? 76 What is 3058345 to the power of 1/3, to the nearest integer? 145 What is 2222005 to the power of 1/5, to the nearest integer? 19 What is 1298882 to the power of 1/4, to the nearest integer? 34 What is 13187514 to the power of 1/2, to the nearest integer? 3631 What is 105117 to the power of 1/7, to the nearest integer? 5 What is 4126000 to the power of 1/2, to the nearest integer? 2031 What is the ninth root of 197378 to the nearest integer? 4 What is the third root of 22083970 to the nearest integer? 281 What is the seventh root of 157142 to the nearest integer? 6 What is the third root of 114364 to the nearest integer? 49 What is 31989283 to the power of 1/9, to the nearest integer? 7 What is the third root of 526611 to the nearest integer? 81 What is 1248051 to the power of 1/2, to the nearest integer? 1117 What is the cube root of 24761724 to the nearest integer? 291 What is 14097858 to the power of 1/2, to the nearest integer? 3755 What is 617277 to the power of 1/2, to the nearest integer? 786 What is 433096 to the power of 1/2, to the nearest integer? 658 What is 639479 to the power of 1/5, to the nearest integer? 14 What is 2103882 to the power of 1/2, to the nearest integer? 1450 What is 5641839 to the power of 1/2, to the nearest integer? 2375 What is 458950 to the power of 1/9, to the nearest integer? 4 What is 7545962 to the power of 1/6, to the nearest integer? 14 What is the square root of 7098113 to the nearest integer? 2664 What is the cube root of 959439 to the nearest integer? 99 What is the third root of 325280 to the nearest integer? 69 What is the cube root of 504000 to the nearest integer? 80 What is 3039600 to the power of 1/3, to the nearest integer? 145 What is 576057 to the power of 1/2, to the nearest integer? 759 What is the square root of 239603 to the nearest integer? 489 What is 1714456 to the power of 1/2, to the nearest integer? 1309 What is 13847731 to the power of 1/3, to the nearest integer? 240 What is 564678 to the power of 1/4, to the nearest integer? 27 What is the square root of 3509791 to the nearest integer? 1873 What is 28763558 to the power of 1/7, to the nearest integer? 12 What is 135080 to the power of 1/3, to the nearest integer? 51 What is the cube root of 8292949 to the nearest integer? 202 What is the seventh root of 1981371 to the nearest integer? 8 What is the square root of 14420289 to the nearest integer? 3797 What is 775371 to the power of 1/2, to the nearest integer? 881 What is 16752807 to the power of 1/2, to the nearest integer? 4093 What is 9912687 to the power of 1/2, to the nearest integer? 3148 What is the seventh root of 539953 to the nearest integer? 7 What is the cube root of 24562505 to the nearest integer? 291 What is 18097876 to the power of 1/4, to the nearest integer? 65 What is the third root of 1971274 to the nearest integer? 125 What is the sixth root of 10180877 to the nearest integer? 15 What is 17844915 to the power of 1/8, to the nearest integer? 8 What is the third root of 8052889 to the nearest integer? 200 What is the square root of 273013 to the nearest integer? 523 What is 7809280 to the power of 1/6, to the nearest integer? 14 What is the third root of 27966631 to the nearest integer? 304 What is the cube root of 5600162 to the nearest integer? 178 What is 2504419 to the power of 1/2, to the nearest integer? 1583 What is 884846 to the power of 1/7, to the nearest integer? 7 What is 3361174 to the power of 1/7, to the nearest integer? 9 What is 2011841 to the power of 1/10, to the nearest integer? 4 What is 1279448 to the power of 1/2, to the nearest integer? 1131 What is the square root of 261695 to the nearest integer? 512 What is 346692 to the power of 1/7, to the nearest integer? 6 What is 30834 to the power of 1/3, to the nearest integer? 31 What is 1292469 to the power of 1/7, to the nearest integer? 7 What is 13796299 to the power of 1/3, to the nearest integer? 240 What is 193974 to the power of 1/8, to the nearest integer? 5 What is the fourth root of 12745588 to the nearest integer? 60 What is the square root of 824490 to the nearest integer? 908 What is the square root of 803555 to the nearest integer? 896 What is the square root of 1039417 to the nearest integer? 1020 What is the cube root of 248580 to the nearest integer? 63 What is 544402 to the power of 1/4, to the nearest integer? 27 What is the square root of 119751 to the nearest integer? 346 What is the ninth root of 728463 to the nearest integer? 4	{ "pile_set_name": "DM Mathematics" }
fy (x*(-1/6)/x(xx/(xx(x/(x(-3/5)x))/x))/x)/(xx0(xx(-8))/x) assuming x is positive. x(157/30) Simplify ((b(b/((b/(b/b*(-2/3)))/b))/bb)(11/2))(-6/13) assuming b is positive. b(-121/13) Simplify (v(-1/4)v)6 assuming v is positive. v(9/2) Simplify (i(-2/5))26i*(-2/5)i/i(-9) assuming i is positive. i(-4/5) Simplify ((n/(n/(n*(-1/2)n))n)(-3/19))(-16) assuming n is positive. n(72/19) Simplify (v/(v(((v*(1/8)/v)/v)/v)/vv))/(vv(-1/5))v*4v4 assuming v is positive. v(403/40) Simplify ((iii*(-6))/ii)/(i*(1/2)i)i(2/3)i/(i/((ii0/i)/i)) assuming i is positive. i(-35/6) Simplify (x3/(x/(x/(xx/(xx(-6))))))/(x(-2)/x(-1)) assuming x is positive. x(-3) Simplify (p(-5)p(-1)/p)(10/3) assuming p is positive. p*(-70/3) Simplify ((qqqq(-5))/q)(-9/5) assuming q is positive. q(27/5) Simplify ((u/u(1/3))/(uu/((u2/u)/u)))/(uu(-1))(-3/38) assuming u is positive. u(-4/3) Simplify (m3/(m(-3)/m))13 assuming m is positive. m*91 Simplify ((zz(2/5))(-11/2))(-21/8) assuming z is positive. z(1617/80) Simplify (z*(-4)z/((z/z3)/z))/((z6z)/(z(-5)/z)) assuming z is positive. z(-13) Simplify j39j(2/9) assuming j is positive. j(353/9) Simplify ((u/(uuu*(4/11)))/uuu)/((uuu(1/16)/uu)/u)u1/uu/u(-2/17) assuming u is positive. u(-923/2992) Simplify (b*(-1/5)b5)/(b(-1/2))31 assuming b is positive. b(203/10) Simplify s*(2/5)ss(-10) assuming s is positive. s(-43/5) Simplify f(-14)/ff/((f/(ff/((f/(f(-7/2)/f))/ff))f)/f)f assuming f is positive. f*(-35/2) Simplify ((bb(1/4))/b)(-2/63)(b/((b(b/(b/b*(-1)))/bbb)/b))(-18/11) assuming b is positive. b(-2279/1386) Simplify (oo*(1/5)/ooo/(ooo(1/9)/o))(-1/6) assuming o is positive. o(-49/270) Simplify ((t(-8))(-2/11))(-18) assuming t is positive. t(-288/11) Simplify (i(-2))26/(i(1/10)/(i2/i)) assuming i is positive. i(-511/10) Simplify (y(1/2)y)/y*(-1/15)((y/(y/(yy(-2/9)y)))/y)/(yy(2/7)yy) assuming y is positive. y(-593/630) Simplify (c(-7))(20/3) assuming c is positive. c(-140/3) Simplify (x1)4x*(-4)xxx6 assuming x is positive. x8 Simplify k19/(k(-1/5)kk) assuming k is positive. k(86/5) Simplify (c0/c(2/11))(-47) assuming c is positive. c*(94/11) Simplify (kk/k*7k/(k/((k*2k)/k)))/(k2)(-1/2) assuming k is positive. k*(-2) Simplify (a/(a/(aa/a*(3/11))))/(a/((aa(((a(-8)a)/a)/a)/a)/a)) assuming a is positive. a(-91/11) Simplify g(-34)/(g*15g) assuming g is positive. g(-50) Simplify (q/q(1/3)q(-6))(1/2) assuming q is positive. q(-8/3) Simplify ll/(ll(2/25)ll)lll(-22) assuming l is positive. l(-527/25) Simplify (u(3/5)/u(-5))(-1/5) assuming u is positive. u(-28/25) Simplify c*(-1)/(cc*(-2/9))c*5ccccc*(-1/3)c assuming c is positive. c(71/9) Simplify p(-13)p/(p14/p) assuming p is positive. p(-25) Simplify o/o(-6/7)(oo/(ooo(2/3)))/o assuming o is positive. o(4/21) Simplify (b/(b/(bbb(bbb*(-1))/b)b))*(-37)b*1bb3b assuming b is positive. b(-68) Simplify (((o2o)/o)(-2/3))50 assuming o is positive. o(-200/3) Simplify (v(-2/15)/v)(-1/14) assuming v is positive. v(17/210) Simplify (z/((zzz/(z(z*8z)/z))/z)z(1/11)z)/(z/z*(-2)z(-2)) assuming z is positive. z(89/11) Simplify ((f/f(-2/9))/f)(-46)ffff*(1/3)/ff/((f(-1/11)/f)/f) assuming f is positive. f(-475/99) Simplify (l*10l)/(ll/(l(2/15)l))l(-9)/(ll(((l(-2/33)l)/l)/l)/ll) assuming l is positive. l(32/165) Simplify (h/(h/(h(hh(-5)h)/h))hhh1)/((h/h(-3/2)h)/h(-4/3)) assuming h is positive. h(-29/6) Simplify k(3/11)/k9(kk(-6))/k(-7) assuming k is positive. k(-74/11) Simplify g(-10)g/(g/(gg/(g*(-10)gg))) assuming g is positive. 1 Simplify ((d/d(-4/5))/d)/(dd(-2/81)) assuming d is positive. d(-71/405) Simplify ((p*(7/4)p)/p)/p(1/23) assuming p is positive. p(157/92) Simplify w0/(w(-1)/w) assuming w is positive. w*2 Simplify (cc(2/7))(-2/63)(c1)45 assuming c is positive. c(2203/49) Simplify (u(-1)u)(-43)/(u/(u/((u6u)/u))u/(uu/(((u/(u/u0)u)/uu)/u))) assuming u is positive. u(-5) Simplify (t/t(-42))(-4/3) assuming t is positive. t(-172/3) Simplify (ll(l(2/5)/l)/ll)*(-2/13)(l0)(2/75) assuming l is positive. l*(-14/65) Simplify qq*21((qq/((q/(q(q/(qq(-23)))/qq))/q)q)/q)/qq assuming q is positive. q48 Simplify ((z/(z(6/5)zz))/z(-1/11))(1/81) assuming z is positive. z(-116/4455) Simplify d/(d(7/12)ddd)ddd/((d/(d/((d(d/d(1/6))/d)/d))d)/d) assuming d is positive. d*(7/12) Simplify (ll/(l4/l))/l(3/17) assuming l is positive. l(-20/17) Simplify ((k(2/29)k)/k(2/9))(3/8) assuming k is positive. k(221/696) Simplify ((u/(uu/(u/u(-5))))/(u/u(-2)))/(u(-1)/(u(-3/4)/u)) assuming u is positive. u*(5/4) Simplify v/(v(v/(v*(-9)v))/v)vvv(-1/3)/vv assuming v is positive. v(-19/3) Simplify (((j/((j/j(-2/11))/j))/j)/((jj(-3/7))/j))/(((j(1/6)/j)/jj)/jj/(jj/(j/(((j/(jj5))/j)/j)))j) assuming j is positive. j*(-2735/462) Simplify (ll*(2/29)ll)/(ll/(l(-17)/l)) assuming l is positive. l(-491/29) Simplify o*12(o18/o)/o assuming o is positive. o28 Simplify (aa(-2)/a)/(a/a(5/2)a)(a/a(-4))/((a/(aa/(a/((aa/a(-6/5)aa)/a))a))/a) assuming a is positive. a(97/10) Simplify ((g(-1/4))(-14))6 assuming g is positive. g*21 Simplify (ww(2/7))(-2/9)/(ww(-2/3))(3/37) assuming w is positive. w(-81/259) Simplify (y/y(-19))(-2/11) assuming y is positive. y(-40/11) Simplify ((b/((b/((b/b5b)/b))/b))/(b/(((b/(b/b(-1/4)))/b)/b)))26 assuming b is positive. b*(-325/2) Simplify ((r/(rr*6r))/r(rr*(-4/7)r)/r)30 assuming r is positive. r(-1590/7) Simplify f(7/5)/((f41f)/f) assuming f is positive. f(-198/5) Simplify v(-11)vv/v(-45) assuming v is positive. v36 Simplify (y1/y)(-2/17) assuming y is positive. 1 Simplify (m9)(-37) assuming m is positive. m(-333) Simplify (g(-2)/g)(-3/2) assuming g is positive. g(9/2) Simplify (m(1/66)m)/(m/m*(3/7)m) assuming m is positive. m(-257/462) Simplify (u(-1/2)u)(-2/7)/(u7/(u(2/27)uu)) assuming u is positive. u(-958/189) Simplify bb*6b/(b/b*(-6))(b*(-1)b)12 assuming b is positive. b Simplify a23a/a26 assuming a is positive. a(-2) Simplify r7/rr36 assuming r is positive. r42 Simplify k*(5/6)kkk/(kk(2/9)/k)k(-2/25)/k(-7) assuming k is positive. k*(4739/450) Simplify zz/(zz/z(-1/10))z7 assuming z is positive. z(69/10) Simplify w*(-1/2)/w(w*(-1/4)w)/w(w/(w(-2)w))/w(-2/15) assuming w is positive. w(23/60) Simplify ((d*(-1/7)d)/(dd0d))33 assuming d is positive. d(-264/7) Simplify ((m/m2)/m)(-29)(m(-2/5)mm)(-3/14) assuming m is positive. m(2018/35) Simplify (t(-1/5))(-4/7)/(t(-2/7))(1/30) assuming t is positive. t(13/105) Simplify i/(i/(i/(iii(-4/11)/ii))i)i*(2/7)/ii assuming i is positive. i(-104/77) Simplify (n6)(-1/37) assuming n is positive. n(-6/37) Simplify (v*(16/3)v)/v(-17/4) assuming v is positive. v(127/12) Simplify (ww(w/(w/((w(-1/4)/w)/w)))/w)(1/10) assuming w is positive. w(-1/8) Simplify (r/(((r/((r(-18)r)/rr)r)/rr)/r))/r(4/5) assuming r is positive. r(-89/5) Simplify k4/(k(-2)/k)k(3/5)kk(-1/8) assuming k is positive. k(339/40) Simplify (x(x/(x*(-1/7)/x))/xx/((x*2xx)/x)xx)40 assuming x is positive. x(600/7) Simplify r(1/4)/(r(r*(7/3)/r)/rr) assuming r is positive. r(-25/12) Simplify (a/(a(4/5)/a)aa/(((a/(a/a*(1/6)))/a)/a))/(aa*2/aaaa)(-1/11) assuming a is positive. a(1811/330) Simplify (s(-2))(1/26)(ss(-8)/s)/(s/s6) assuming s is positive. s(-40/13) Simplify (j(-8)/j)(-23) assuming j is positive. j207 Simplify (rr/(r4/rr)r)(9/13) assuming r is positive. r(-9/13) Simplify (m(3/4)/m(2/17))/(((m(-1/3)m)/m)/(mm((mmm*(2/27)m)/m)/mmmm)) assuming m is positive. m*(12925/1	{ "pile_set_name": "DM Mathematics" }
69v4 + 236v*2 - 1 wrt v. 104856v Find the third derivative of -118x6 - 2x*4 - 128x*2 + 2x. -14160x3 - 48x What is the third derivative of 10758l4 - 3l*2 + 7l - 15 wrt l? 258192l Find the third derivative of -3p*3vw2 - 2p*3vw + 826p*3v + 9p2vw2 + 2pw2 - 3vw2 - v wrt p. -18vw2 - 12vw + 4956v Find the second derivative of 38x3z*2 - 1491x*3z - x*2z - 2xz*5 + 7xz3 wrt z. 76x*3 - 40xz3 + 42xz What is the second derivative of 133b*5 - 3b*4 + 6b - 8 wrt b? 2660b3 - 36b*2 What is the second derivative of 200u*4w*2 - 7u*4 - 6uw + 96u + 2w2 + 1 wrt u? 2400u*2w*2 - 84u*2 What is the third derivative of -3312f*3 + 1353f*2 + 2f + 7 wrt f? -19872 Differentiate -3146b - 1690 wrt b. -3146 What is the first derivative of 2g*4y*2 + 7g*2y3 - g2 - 794y3 wrt g? 8g*3y*2 + 14gy3 - 2g What is the third derivative of -621h5 + 720h*2 - 2h wrt h? -37260h2 Find the second derivative of 15303m*4 - 8373m. 183636m2 What is the second derivative of 5532s*2 - 3s + 70 wrt s? 11064 Differentiate -m*2 + 93m - 631 with respect to m. -2m + 93 Find the third derivative of 7950v*3 + 7v*2 + 213v. 47700 Differentiate 1618c + 743. 1618 Find the second derivative of 15m3 - m2r3 + 9m*2r - 2m2 + 2mr3 + 23mr2 - m - 199r*2 wrt m. 90m - 2r3 + 18r - 4 What is the first derivative of 429u3 - 792 wrt u? 1287u*2 What is the second derivative of -1391z*2 + 1241z wrt z? -2782 Find the second derivative of 657bn*2 - bn - 206n wrt n. 1314b What is the third derivative of -104h4 + 7h*3 - 2416h*2 wrt h? -2496h + 42 Find the second derivative of u*3 - 118u*2 + 17u + 3. 6u - 236 What is the third derivative of -2r*5 + 20r*4 - 4r*3 - 69r*2 + 4r - 2 wrt r? -120r2 + 480r - 24 Find the second derivative of -h*3x*3 + 225h*3x*2 + hx*3 + hx*2 + 34 wrt h. -6hx3 + 1350hx2 What is the third derivative of 8c*3o2 + c3o + 149c*3 - 2c*2 + 15co2 + 11o wrt c? 48o2 + 6o + 894 What is the second derivative of -46oy*3 + 8oy2 - 14oy + 29y wrt y? -276oy + 16o Find the third derivative of 223d*2z*5 - 2d*2z*2 + 2d*2 - 13dz2 wrt z. 13380d*2z2 What is the first derivative of -d2j2 - d2t*2 + 2d*2t + 11j2 - t2 - 3 wrt d? -2dj2 - 2dt2 + 4dt What is the second derivative of 3014i*2 + 6692i wrt i? 6028 What is the second derivative of 49d3 - 5d*2 + 5d - 10 wrt d? 294d - 10 What is the second derivative of 3r*2u*3 + 4r*2u2 - r2u - 359u*2 + 14979 wrt u? 18r*2u + 8r2 - 718 What is the second derivative of 49o3 - o2 + 20113o? 294o - 2 What is the third derivative of -2o4 + 120o*3 + 211o*2? -48o + 720 What is the derivative of m*2o*2 - 12m*2 - 5m + 120o2 wrt o? 2m*2o + 240o Differentiate -1165mp + p - 89 with respect to m. -1165p What is the second derivative of 3k3 - 19k*2 - 33k - 1? 18k - 38 Find the second derivative of -1593c*2l*4 - 3859c*2l wrt l. -19116c2l*2 Find the second derivative of -6587l*2 + 2613l - 2. -13174 Find the first derivative of 2fiq2r + fq - 12iq2r + 7q2r wrt i. 2fq*2r - 12q2r Find the first derivative of 24mqv3 - 9mqv - mv3 - mv*2 + 4v*2 wrt q. 24mv3 - 9mv What is the derivative of 3178h*2 - 365? 6356h What is the derivative of -3j4p*3 + 134j*4 + 2992p*3 + p wrt j? -12j*3p*3 + 536j*3 What is the second derivative of 880y*5 + 10122y wrt y? 17600y3 Find the second derivative of -2c*3d*2q - 3c3d - 2c2dq2 + c2q*2 + 169d*2q*2 - 8dq2 wrt d. -4c*3q + 338q2 Differentiate -363k*2u - 128k2 with respect to u. -363k*2 What is the second derivative of -5i*3z - 2i2mz2 - iz*2 - 4i + 4m - 1 wrt i? -30iz - 4mz2 Find the first derivative of 2v*2w2 + v2 - 51w2 + 1 wrt v. 4vw2 + 2v Find the second derivative of 159f2 + 5f + 8. 318 What is the third derivative of 108r5 + r3 + 281r*2 + r wrt r? 6480r*2 + 6 Differentiate -4b*4c*2 - 7bc2 - 3c*2 - 1 with respect to b. -16b*3c*2 - 7c*2 Find the second derivative of -109d*5 + 73d wrt d. -2180d3 What is the first derivative of 2g*3 + 3g*2 + 85g - 3787? 6g2 + 6g + 85 Find the second derivative of -a*5 - 56a*4 - 209a + 2. -20a3 - 672a*2 What is the second derivative of 3v*5 - 263v*3 + 2v - 556? 60v3 - 1578v What is the second derivative of 4458w4 - 4107w? 53496w2 What is the second derivative of 5j*2m*3x*3 + 21j*2m*2x*3 - 6jm2x - 5jmx3 + m3x*2 wrt j? 10m*3x*3 + 42m*2x*3 Find the second derivative of 1662m*2 + 5315m wrt m. 3324 Find the third derivative of h*5 - 41h*3 + 73h*2 - h wrt h. 60h*2 - 246 What is the first derivative of -9358sy2 + 2s - 1458 wrt y? -18716sy What is the second derivative of -8k3q*2 - 2k*3 - 8k*2q + 2kq*2 + kq + 1137k wrt k? -48kq2 - 12k - 16q Differentiate 8024c - 576. 8024 What is the third derivative of 795r3 + 82r*2 + r? 4770 What is the third derivative of 8f*3x3 - f3 - 83fx*3 - 3fx2 + 7f - 29x wrt x? 48f*3 - 498f Find the first derivative of h*3 - 6h*2 + 313 wrt h. 3h*2 - 12h Find the third derivative of 311h3 + 24h*2. 1866 Find the second derivative of -17f*2r*3 - 44f*2r + f*2 + 2fr3 + 2r*3 + r wrt r. -102f*2r + 12fr + 12r What is the third derivative of -16773o*3 + 7365o*2 wrt o? -100638 What is the third derivative of -12f*3kow*2 + 4f*3kw2 + 3f*3 + 2f*2kw2 + 5fkow2 + kw*2 + 10o wrt f? -72kow2 + 24kw2 + 18 What is the derivative of -uz*3 - 95u - z3 + 63 wrt u? -z3 - 95 Find the third derivative of -4i5 + 451i*4 - 2i*3 - 2i*2 + i - 434 wrt i. -240i*2 + 10824i - 12 Find the second derivative of 25dn*4 - dn*3p - 2dn*2p - 2dnp - 8dn - 4np wrt n. 300dn2 - 6dnp - 4dp Find the first derivative of 39g4 + 5g*2 + 769. 156g*3 + 10g Differentiate dt4 - 49dt3 - 194d wrt t. 4dt*3 - 147dt2 Find the third derivative of -4l*4w*3 + 39l*3w*3 + 33l*2w*2 - l - 3w*3 wrt l. -96lw3 + 234w*3 Find the second derivative of 10987g*2i*2 - 2gi - 2167i*2 wrt g. 21974i*2 Find the third derivative of 9376in3 - 10in2 + 519i wrt n. 56256i Find the second derivative of 24f*5r*3 + 4f*5 - 3fr2 - 30r*3 wrt f. 480f*3r*3 + 80f*3 Find the first derivative of -354r*3 + 6 wrt r. -1062r*2 Find the first derivative of 17u*2 + 2u - 717. 34u + 2 Differentiate -35bg + 2091b with respect to g. -35b Find the third derivative of -9qr4 - 5qr3 + 2qr2 - 4qr - 365q + 2r3 wrt r. -216qr - 30q + 12 Find the first derivative of 5d2 - 86d + 30374 wrt d. 10d - 86 Find the second derivative of -15b*2d*2f + b*2d2 + b2f + 2bd + 2d*2f + 14f wrt b. -30d*2f + 2d2 + 2f What is the third derivative of o*3t*2 + 1776o*3 + 2o*2t2 + o2t - 9ot2 - 17t*2 wrt o? 6t*2 + 10656 Differentiate -5x*3y + x3 - x2y + 49y - 7 with respect to x. -15x2y + 3x2 - 2xy Differentiate -f3 + 2f*2 + 6fh + 183f - 6131h with respect to f. -3f*2 + 4f + 6h + 183 What is the third derivative of -4ox3 + 2ox2 + 344ox - 61x*4 - 6x*3 - 5 wrt x? -24o - 1464x - 36 What is the second derivative of 2305mz2 - 598mz wrt z? 4610m What is the third derivative of a*5m + 2a4m*2 - 21a4 + a2m - 964am2 wrt a? 60a*2m + 48am*2 - 504a Find the third derivative of -2k3qt3 + 2k*3qt2 - 3k*3qt - 6k*3t*2 + 3k*2 + kqt3 - 10qt3 wrt t. -12k*3q + 6kq - 60q Find the first derivative of 152q*2 + 254. 304q Find the first derivative of -65z4 - 158 wrt z. -260z*3 Find the second derivative of 322a*3z*3 + 333a*3 + 17az - 40z*4 wrt z. 1932a*3z - 480z2 What is the third derivative of -l5 - 162l3 + l2 - 69 wrt l? -60l2 - 972 What is the derivative of -17m*	{ "pile_set_name": "DM Mathematics" }
= 0 for x. -5 Suppose 0 = -2z + 3x + 25, -3z + 2z + 10 = -x. Suppose 1 = -zt + 26. Solve tb + 6 - 1 = 0 for b. -1 Let i be 220/35 - (-4)/(-14). Let v(t) = t*3 - 6t*2. Let p be v(i). Suppose -4n = -2z + 3 + 11, 3z + 5n = 10. Solve p = -0c + zc - 15 for c. 3 Let j(z) be the first derivative of -z3/3 - z2/2 + 12z + 3. Let d be j(0). Solve -3h + 0h = -d for h. 4 Let c = -6 + 3. Let p = -3 - c. Solve p = -2m + 2 for m. 1 Suppose 18 = 3g + 12. Solve gy - 3y = 3 for y. -3 Let a(f) = -2f + 21. Let v be a(11). Let i(p) = p2 - p. Let t be i(v). Solve t = 4d - 5d for d. -2 Suppose -w - 4u = 4, 7 - 3 = -2w - 4u. Let d(r) = 8r3 + 1. Let m be d(1). Solve 2z + z - m = w for z. 3 Let g = 2 - 4. Let t = g - -3. Suppose n + 4s = -1 - 12, t = -n - s. Solve -nf + 2 = -4f for f. -2 Let l = 6 - 8. Let v(f) = f2 - 2. Let h be v(l). Let q be (-294)/(-35) - (-4)/(-10). Solve -2 + q = hx for x. 3 Let n = 160 - 160. Solve n = -0u + 3u + 3 for u. -1 Let h(w) be the third derivative of w*4/24 - 3w*2. Let n be h(2). Solve -no = -o for o. 0 Let f = -22 + 22. Solve -5b = -fb - 10 for b. 2 Suppose -2z + 0z = 0. Let b(r) = -r - 9. Let s be b(z). Let q be (-11)/(-3) - (-6)/s. Solve -qk = -0k - 12 for k. 4 Let y(m) = m*2 + 13m - 14. Let c be y(-14). Suppose c = 2f - 0f - 10. Solve -f - 7 = -3g for g. 4 Suppose 12p = 10p + 8. Solve 3k + p = 5k for k. 2 Suppose 3w = -6 + 24. Let u = w - 7. Let r = u + 10. Solve 3f = -0f + r for f. 3 Let r(v) = v - 3. Let c be r(7). Let s = 5 - -7. Let p be 6/(-4) + s/8. Solve p = -2l + 4l + c for l. -2 Suppose 4 = -4n - 4i, 0n + 8 = n - 2i. Solve k - nk = 0 for k. 0 Let a be 2/(-7) - (-4)/14. Suppose -2g - 16 = -6g. Solve go = -ao for o. 0 Suppose -2s + 2 = 0, -5s + 8s - 7 = -4u. Solve -5j - u = 24 for j. -5 Suppose 0 = 7v - 11 - 3. Suppose -2l + 0 = -v. Solve -l - 7 = 2t for t. -4 Suppose 7c = 2c + 3b, 0 = -2c - 3b + 21. Solve 0 = k + c + 2 for k. -5 Let k(y) = -y*3 + 6y*2 - 4y - 5. Let t be k(5). Let l = t - -2. Solve lw = 4w - 4 for w. 2 Let p(h) = 4h3 + h2 - 2h + 2. Let w be p(1). Let a = w - -3. Solve a - 23 = 3o for o. -5 Let b = 11 - 8. Let m(h) = h - 2. Let f be m(5). Suppose -4u + f = -5. Solve -w + b = uw for w. 1 Let x(p) = 2p*3 - 2p*2 - 3p + 4. Let m be x(2). Solve 0 = -2r - m for r. -3 Suppose 2r + 44 = 2h, 4h - 4r - 84 = -2r. Suppose 0 = -2z + 7z - h. Solve zg = g for g. 0 Suppose -3o + 0 = -3. Let r be 4/6 + 10/(-15). Let q be (-9)/(-45) - (-138)/10. Solve r = -5k - q - o for k. -3 Let s(g) = -7g - 5. Let f be s(-1). Solve -fw = -w for w. 0 Let l(p) = -p2 - 7p - 2. Let h be l(-6). Let d(n) = -n*2 - 4n + 3. Let z be d(-4). Solve -h + z = -q for q. 1 Let a(y) = y + 3. Let s be a(-3). Solve s = 3r - r for r. 0 Let z(f) = -f - 1. Let u be z(-5). Suppose -uo + 0o = 0. Suppose -3k = -3l - 9, 0 = 2k + 2l - ol - 22. Solve -ky + 3y = 4 for y. -1 Suppose 3 = -l + 10. Let p be (-1 - -2) + 12/3. Solve -8 = -pm + l for m. 3 Let c(s) = -s2 - s. Let t(r) = -3r*2 - 6r + 5. Let g(x) = 2c(x) - t(x). Let z be g(-5). Solve z = u - 2 + 1 for u. 1 Let f be 2(2 - (2 - 2)). Suppose -58 = -j + 5j - 3g, g - 67 = 5j. Let x = -11 - j. Solve 10 - x = -fi for i. -2 Suppose -18h + 9 = -15h. Solve -3 = -hf + 2f for f. 3 Let m = 25 + 0. Solve q - m = 6q for q. -5 Suppose -3q = -2d - 3d - 4, 4q = -3d + 15. Suppose -x - q = -4. Solve j = x - 5 for j. -4 Let o = 82 + -79. Solve -h + 4 = oh for h. 1 Suppose -76 = -5h + 29. Let b = -15 + h. Let s = 110 - 110. Solve s = -bn + 2n - 20 for n. -5 Let m(v) = -v*2 + 4. Let o be m(2). Solve -5 = -od - 5d for d. 1 Suppose -4r + 46 = 2k + r, 5k - 4r - 82 = 0. Let b(u) = u + 9. Let w be b(-7). Solve -wg + 8 - k = 0 for g. -5 Let w be 76/10 - (85/(-25) - -3). Solve 6k - w = 4k for k. 4 Let k(w) = -1. Let i(v) = -v*3 + 6v*2 - v - 2. Let g(o) = -i(o) + 6k(o). Let m be g(6). Solve 7f - mf = 25 for f. 5 Let y be (-4 + 12/3)-1. Solve 4x - 5x + 1 = y for x. 1 Let l be (-8)/68 + (-174)/(-34). Solve -3 + l = -q for q. -2 Let u = 3 + 2. Suppose -4o - o = 4x - 26, -3o + 26 = ux. Solve b = ob for b. 0 Let y be 3(-2 - -4 - 1). Solve -7r + yr = -16 for r. 4 Let s(w) = 8w - 37. Let o be s(5). Solve om - 2 = 4 for m. 2 Let n(r) = 4r - 10. Let x be n(6). Let s = -2 + x. Solve 4g + 0g - s = 0 for g. 3 Let c = -5 + 8. Suppose a - 5y = -4a + 15, ca - 5 = 5y. Suppose 0 = -av - 10, 2 = -4t - v - 2v. Solve -t - 8 = 3j for j. -3 Let m(r) = r*2 - 7. Let z be m(3). Suppose -3j + 4 = c + 4c, -5c + 16 = -3j. Suppose -4g + 3g = -c. Solve g = -zo - 0 for o. -1 Let k(m) = 2m - 7. Let g be k(5). Suppose 3n + 1 = -2, -4p = -3n - g. Solve 7a - 4a - 6 = p for a. 2 Suppose 3a = -0a. Suppose -3i - q = -16, -2q + 2 + 6 = a. Solve n = in for n. 0 Suppose -j + 4 = 1. Solve -3 = -jn + 6 for n. 3 Let j(u) = -2u + 22. Let w be j(10). Solve -w = 5p + 8 for p. -2 Suppose u - m = 3, 3u + 9m = 4m - 15. Solve -7j + 10j = u for j. 0 Let w(k) = 3k*3 + 10k*2 + 2k - 1. Let u(j) = 2j3 + 5j*2 + j. Let z(g) = -5u(g) + 3w(g). Let h be z(5). Solve hp - 3 + 7 = 0 for p. -2 Let o(n) = -5n - 62. Let d be o(-13). Solve 4 = -dm + 1 for m. -1 Let d(r) = -r - 5. Let v be d(-6). Solve v = 2z - 3 for z. 2 Suppose 2b - 18 = -o - b, 5o = 4b - 5. Let x be 21 - (3 + -4 + 2). Solve -oi = i - x for i. 5 Let u = 22 + -36. Let a be (-24)/u + 4/14. Solve 3 = -ad - 1 for d. -2 Suppose 2m = 2f - f - 12, -5m = 4f + 17. Solve -fy = -6y + 12 for y. 3 Let r = -19 - -7. Let l = r + 15. Solve -l + 1 = g for g. -2 Let h(o) = -o*2 - 7o + 6. Let n = -17 - -7. Let f be h(n). Let d be -3 + (-3)/(9/f). Solve 27 = dw + 7 for w. 4 Suppose -2k - 3k + 20 = 0. Solve ko + o = 5 for o. 1 Suppose 0 = -12s + 11s + 11s. Solve 12 = -3h - s for h. -4 Let d(f) = -f*3 + 4f*2 + 7f - 7. Let v be d(5). Solve 0 = i - v + 6 for i. -3 Suppose 2q - 4 = q. Solve 0u - q = -4u for u. 1 Let q(b) = 17b*2 - b. Let o be q(1). Solve o = -3z + 1 for z. -5 Suppose 0z - s = -z - 3, 2z = s - 10. Let a = z - -3. Let k = 4 + a. Solve k = -w - 2w for w. 0 Suppose 6 = z - 19. Suppose z = -2n + 3n. Solve 2s - n = -3s for s. 5 Let p be 5/(15/(-9))-1. Solve 0 = -4w + pw - 3 for w. -3 Suppose 0s = -4s + 16. Suppose 4 = -so - 4. Let f be -1 - (1 - 2) - o. Solve fw + 12 = 2 for w. -5 Let w be (-1)/((-3)/((-21)/1)). Let r be 4/(-14) + (-16)/w. Solve ra - 1 = -3 for a. -1 Let k(p) = -p2 - 6p + 5. Let s be k(-6). Let i(n) = 2n - 1. Let g be i(s). Solve 3t = -3 + g for t. 2 Let t be 4 + -3 + 1 - -1. Let w = 4 + -2. Solve a - t = w for a. 5 Suppose 0w = 4w - 16. Solve -6x + w = -4x for x. 2 Suppose 0 = -3i + 5q - 9 + 1, -3q = i - 16. Solve 0 = -4b + 6b - i for b. 2 Suppose 2 = -4z + 14. Let h be (z - 1)(-8)/(-4). Solve -4l + h = -0 for l. 1 Suppose 3f = -f. Let m(w) = -w2 + w. Let c be m(f). Solve c = -a + 2 + 1 for a. 3 Let b(m) = -m2 + 8m. Let o(s) be the second derivative of s*4/12 + 5s3/6 + s2 + 2s. Let i be o(-6). Let h be b(i). Solve d + 3 - 2 = h for d. -1 Let a = 89 - 86. Solve -an = -2n - 1 for n. 1 Let w = -3 - -3. Suppose 0 = 3t - 7t - 8. Let o = w - t. Solve -oh + 0h = -4 for h. 2 Let t(u) = 4u + 26. Let k be t(-5). Solve 3d + 21 = k for d. -5 Suppose -5 = -2o - 3o - 4i, 4o = -5i - 5. Solve o - 13 = -4c for c. 2 Suppose -2l - 4b = -6, -l - 4b = -4 - 1. Solve -l = -3w + 4w for w. -1 Suppose 3r = -5w + 6, -r - 4 = -2w - 6. Solve -rz = z for z. 0 Suppose 4h + 4 = 12. Solve d = -hd - 3 for d. -1 Let u = -2 - -4. Suppose ux + 5 = 3x. Suppose xp - 4s = -3s - 3, -3p - 2s + 6 = 0. Solve -4f - 8 = -pf for f. -2 Suppose 5x = 5d + 20, x - 2d + 3d - 6 = 0. Let y = -10 + 18. Suppose o + y = xo. Solve 0 = -os + s - 5 for s. -5 Let d be 5 + 1 + -2 + 0. Suppose 10 = da - 6. Solve am - 8 = -0m for m. 2 Let u be (-8)/44 - (-92)/22. Solve -uq - 12 = -0 for q. -3 Let t(a) = 4a + 32. Let n be t(-8). Let x(v) = -6v - 4. Let r be x(-4). Solve ng + 4g = r for g. 5 Let c be (-2 + 1)-1 + 2. Suppose -z = 3a - c, -3 = -z + 2z. Solve a = 2d - 4 for d. 3 Suppose -5z - 123 = d, -3d + 127 - 16 = -5z. Let t	{ "pile_set_name": "DM Mathematics" }
- w*2 - 3w*2. Let d(t) = -2t*2 - t + 4. Let x(k) = d(k) + 3l(k). Determine -2h(z) + x(z). -z2 - z + 3 Let c = -193 - -190. Let w(s) be the second derivative of -s4/6 + s3/2 - 3s*2/2 - s. Let f(b) = 10b*2 - 14b + 14. Calculate cf(l) - 14w(l). -2l2 Let h(t) = -43t + 5. Let m(b) = -41b + 4. What is 5h(g) - 6m(g)? 31g + 1 Let r(q) = -32q - 3. Let n(l) = -10l - 1. Calculate -7n(h) + 2r(h). 6h + 1 Let y(c) = 14c - 65. Let g(s) = 11s - 63. Determine 5g(r) - 4y(r). -r - 55 Let u(k) = -50k + 3. Let c(j) = -152j + 10. Give -2c(a) + 7u(a). -46a + 1 Let k(u) = -u*2 - u - 4. Let j(h) = -6h*2 - h. Let p(b) = -37b*2 - 7b - 5. Let z(s) = 6j(s) - p(s). Let r be -1(1 + (2 - 0)). Determine rk(t) - 2z(t). t*2 + t + 2 Let c(z) = 14z*2 + 6z - 1. Let i(y) = -2y2 - y - 2. Determine c(l) + 5i(l). 4l2 + l - 11 Let n(d) = -6d*2 - 10d + 152. Let z(k) = k*2 + 2k - 30. What is -3n(q) - 16z(q)? 2q2 - 2q + 24 Let v(b) = -12b - 10. Let a(y) = 11y + 9. Let n(t) = 4a(t) + 3v(t). Let g(p) = -21p - 2 - 2 + 41p - 1 - 27p. Calculate 5g(m) + 4n(m). -3m - 1 Let a be 4(15/(-2))/(-15). Let u(d) = 2 + 4d*3 - 2 - 2d - 2 + 2d2. Let y(w) = -5w*3 - 3w*2 + 2w + 3. What is ay(i) + 3u(i)? 2i3 - 2i Let v(d) = 29d - 5. Let n(r) = -42r + 8. Determine -5n(c) - 7v(c). 7c - 5 Let w(i) = 2i + 2. Let m(u) = -691u - 4. Calculate -m(j) - 3w(j). 685j - 2 Let w(h) be the third derivative of -209h*4/24 + 163h*2. Let p(i) = 16i. What is -66p(v) - 5w(v)? -11v Let x(b) = b3 - 4b + 3. Let h be x(2). Suppose -2t = hs - 49, -s + 5t + 73 = 3s. Let z(l) = 2l - 9. Let c(r) = 6r - 26. Determine sz(k) - 6c(k). -2k + 3 Let d(t) = -7t*3 - 3t*2 + 5t + 7. Let z(m) = 23m3 + 9m*2 - 16m - 22. Give -7d(v) - 2z(v). 3v3 + 3v*2 - 3v - 5 Let c(o) = 5o + 3. Let n = 40 + -34. Let q be (8/4)/(-5 - -6). Let l(k) = -k - 1. Calculate nl(r) + qc(r). 4r Let p(m) be the second derivative of m*3/2 + 5m*2/2 + m. Let n(s) = -3s - 11. Let g(o) = o + 4. Let t(d) = -8g(d) - 3n(d). Determine p(k) - 4t(k). -k + 1 Let j = -110 - -115. Let u(l) = -8l + 6. Let f(v) = -v. Let m(r) = 5r - 2. Let y(b) = 2f(b) + m(b). Let d be ((-1)/(-2))/(2/56). Give dy(c) + ju(c). 2c + 2 Let m(j) = 171j + 2. Let l(t) = -4t. Determine 5l(h) - m(h). -191h - 2 Suppose -16p - 2257 = -2529. Let w(a) = 23a - 23. Let f(r) = 8r - 8. What is pf(s) - 6w(s)? -2s + 2 Let p(u) = 6u*2 + 2u - 3. Let k(a) be the second derivative of -7a4/12 - a3/3 + 2a*2 - 3a. Let n be (-724)/1267 + 24/(-7). Calculate np(y) - 3k(y). -3y2 - 2y Let r(v) = 50v - 39. Let f be r(1). Let k(s) = s2 - 2. Let p(o) = -6o*2 + o + 11. What is fk(d) + 2p(d)? -d2 + 2d Let x(r) = -4r2 - 13r + 13. Suppose 0 = -112f + 111f + 26. Let l(o) be the first derivative of 3o - 3/2o*2 + 1 - 1/3o*3. What is fl(n) - 6x(n)? -2n*2 Let f(d) = -6d*2 - 17d. Let g(u) be the second derivative of -1/12u4 + 0u*2 - 1/2u*3 + 14u + 0. What is 6f(x) - 34g(x)? -2x2 Let g(a) = -17a + 2. Let p(s) be the third derivative of -13s4/12 + s3/2 - s2 + 6. Determine 8g(v) - 5p(v). -6v + 1 Let b(n) = -20n - 10. Let m(v) = -4v - 2. Let p = -135 - -82. Let u = p + 55. What is ub(x) - 11m(x)? 4x + 2 Let x(t) = -6t*2 - 6t + 1. Let s be 2(-56)/(-24) - 1/(-3). Let u(k) = -5k*2 - 5k + 1. Calculate su(l) - 4x(l). -l*2 - l + 1 Let i(u) = -77u*2 + 11u + 29. Let o(s) = 39s2 - 6s - 16. Determine -4i(n) - 7o(n). 35n2 - 2n - 4 Let d(k) = -44k2 + 28k. Let j(y) = -8y2 + 5y. Suppose -5l - o + 5o + 20 = 0, 5l = 5o + 20. Suppose -li + 2 - 22 = 0. Calculate id(v) + 28j(v). -4v*2 Let g(i) = 21i + 16. Let a(t) = 24t + 17. Calculate -4a(m) + 5g(m). 9m + 12 Let z(l) = 2l + 7. Let g(h) = 1. What is 6g(f) - z(f)? -2f - 1 Let x(a) = 7a - 7. Let k(n) = -10n + 6. What is -3k(s) - 4x(s)? 2s + 10 Suppose 4k + 0 - 36 = 0. Let u(v) = 5v + 4. Suppose 2z - 5w + 12 = 0, 0 = -3w + 13 - 1. Let c(l) = 3 + 6 + zl + 7l. Calculate ku(m) - 4c(m). m Let f(a) = 8a - 2. Let w(y) = -7y + 2. Let l(z) = -35z - 391. Let n be l(-11). Give nf(g) - 7w(g). g - 2 Let q(c) = 5 - 2 + 1 + 9c. Let w = 4 + -11. Let j(g) = -3 - 4g + 8 - 7 + 0. What is wj(l) - 3q(l)? l + 2 Let p(g) = -3g2 - 1. Let b(f) = -7f*2 + f + 29. Give -b(j) + 2p(j). j*2 - j - 31 Let y be 4/(-5)(1 + -6) + -7. Let g(l) = 4l3 + 4l*2 - 4l. Let z(p) = 4p3 + 3p*2 - 3p. Let i = 9 - 5. Calculate iz(r) + yg(r). 4r3 Let j(x) = 5x - 4. Let w(t) = 12t - 7. What is -7j(y) + 3w(y)? y + 7 Suppose -32h + 31 - 159 = 0. Let c(f) = 11f + 5. Let k(a) = -12a - 6. What is hk(t) - 5c(t)? -7t - 1 Let y(b) = -4b - 74. Let f(k) = -11k - 221. Determine 6f(z) - 17y(z). 2z - 68 Let c(q) = -5q - 52. Let i(k) = -9k - 103. What is -5c(t) + 3i(t)? -2t - 49 Let u be (-6)/14 - (-1)/((-28)/(-68)). Suppose 2h - 5 = i + u, -4i + 3h = 28. Let w(q) = -4q. Let m(v) = 3v. What is im(l) - 5w(l)? -l Let t(b) = 7b3 - 7b*2 - 3. Suppose -14g - 100 = -34g. Let y(h) = -h3 + h2 + 1. What is gy(f) + t(f)? 2f3 - 2f*2 + 2 Let r(g) = 2g - 3. Let f(q) = -9q + 2. Let w(d) = -11d + 2. Let b(u) = -3u + 4. Let v be b(3). Let z(n) = vf(n) + 4w(n). Give 2r(o) - 3z(o). o Let m = -21 + 54. Let w(v) = -15v*2 + 11v. Let z(l) = -3l2 + 2l. Determine mz(r) - 6w(r). -9r2 Let s(t) = 6t*2 - 5t + 20. Let g(m) = -2m2 + 2m - 7. Let w = -229 - -225. Determine ws(u) - 11g(u). -2u2 - 2u - 3 Let d(i) = 5 - 2 - 2. Let z(b) = -2b. Let k = -7 + 5. Determine kd(w) + z(w). -2w - 2 Let f(a) = a2. Suppose 17j = 13j + 8. Let z(g) = -3g*2. What is jf(r) + z(r)? -r*2 Let z(w) = -16w - 1. Let h(r) be the third derivative of -47r4/24 - r3/2 + 12r*2 - 8. Calculate -2h(g) + 7z(g). -18g - 1 Let j(d) be the second derivative of -d5/10 + d4/12 + d*3 - 8d + 2. Let u(k) = 6k3 - 3k*2 - 17k. Determine 17j(a) + 6u(a). 2a3 - a2 Let j(i) = 96i + 88. Let t(v) = v + 1. What is -2j(h) + 176t(h)? -16h Let b(d) = -d. Let r(g) = g3 - 16g*2 + 4. Let k be r(16). Suppose 2a + 0 = -4n + 32, kn - 2 = 3a. Let s(w) = w. Determine ab(q) + 5s(q). -q Let d(z) = 6z*2 - 4z - 5. Let n = 9 - 12. Let o(h) = -22h2 + 16h + 12. Let i(v) = 7v2 - 5v - 4. Let y(w) = -7i(w) - 2o(w). What is nd(t) - 4y(t)? 2t2 - 1 Let q(p) = p2 + 6p. Let a(i) = -5i2 - 18i - 46. What is -a(f) - 3q(f)? 2f*2 + 46 Let j(p) = 9p + 16. Let w(u) = 8u + 14. Let h(f) = -3j(f) + 4w(f). Let i(m) = m - 1. Give h(t) + 6i(t). 11t + 2 Let v(w) = w2 + w - 1. Let u(x) = -8 + 2x*2 + 7x + 2 + 3. What is -u(g) + 5v(g)? 3g*2 - 2g - 2 Let r(x) = -298x2. Let z(g) = g2. Give 2r(i) + 6z(i). -590i*2 Suppose -17w + 92 + 27 = 0. Let b(q) = 2q3 + q + 2. Let h(a) = -3a*3 - a - 2. Give wb(d) + 6h(d). -4d*3 + d + 2 Let y(d) = -2d + 4. Let n = 20 + -8. Let h be (-3)/(-6)n1. Let v(z) = -z + 2z - 3z + 5. What is hy(i) - 5v(i)? -2i - 1 Let b(c) = 7c*2 - 7c - 7. Let m(o) = o*3 + 7o*2 + 14o + 55. Let d be m(-6). Let w(y) = 7y2 - 6y - 6. Determine dw(t) - 6b(t). 7t2 Let i(l) = 4l*3 - 5l*2 - 2l. Let b = 5 - 0. Let x(o) = 3o - 2o3 - o3 + o*3 + 8o*2 - 4o*3 + 0o*2. Give bx(p) + 8i(p). 2p*3 - p Let u(s) = -16s + 22. Let j(f) = 14f - 18. Let r(z) = -4j(z) - 3u(z). Let v(c) = 1 - 4 - 8 + 15c. Calculate 11r(l) + 6v(l). 2l Let p(v) = 5v - 1. Suppose -a = l + l + 11, -3l = 4a + 9. Let g(m) = -16m + 4. Give lp(d) - 2g(d). -3d - 1 Let y(w) = 16w3 + 4w*2 - w + 4. Let r(v) = 31v*3 + 7v*2 - v + 7. What is -4r(n) + 7y(n)? -12n*3 - 3n Let f(k) = -18k3 + 10k*2 + 1088k + 2. Let z(v) = 7v3 - 4v*2 - 544v - 1. What is 2f(n) + 5z(n)? -n*3 - 544n - 1 Let b(r) = -6r2 - 4. Let g(o) = -6o*2 - 3. Calculate -4b(d) + 5g(d). -6d*2 + 1 Let w(r) = 2r - 1. Let n(c) = 546c2 - 6c + 3. Determine -n(x) - 3w(x). -546x*2 Let n(p) = -6p + 8. Let b(z) = -z*3 - 31z*2 - 133z - 70. Let x be b(-26). Let g = -3 + 0. Let i be 3g/(-9) + 0. Let q(f) = f - 1. What is in(v) + xq(v)? 2v Let h(b) be the second derivative of	{ "pile_set_name": "DM Mathematics" }
). 39n3 - 2n + 1 Let f(k) = -3k3 + 11k*2 - 5k + 9. Let p(u) = 2u3 - 6u*2 + 2u - 5. Calculate 4f(n) + 7p(n). 2n3 + 2n*2 - 6n + 1 Let g(o) = -7o - 129. Let w(i) = -6i - 128. Determine 5g(t) - 6w(t). t + 123 Let b(m) = 16m3 - 16m - 30. Let g(o) = -3o3 + 3o + 6. Determine 2b(c) + 11g(c). -c*3 + c + 6 Let i(u) = -2u*2 - 10u + 2. Let j be i(-5). Let p(t) = 13t + 4 + 22t*2 - 21t*2 + j. Let q(m) = -4m - 2. What is 2p(c) + 7q(c)? 2c2 - 2c - 2 Let b(x) = 3x2 + 5x + 7. Let h(o) = 5o2 + 5o + 8. Let p(z) = -4b(z) + 3h(z). Let a(c) = -c*2 + 1. Calculate -4a(t) - p(t). t*2 + 5t Let k(q) = 18q2 - 7q - 1. Let j(p) = 9p2 - 3p - 1. Give -7j(v) + 3k(v). -9v2 + 4 Let b(s) = 4 + 414s - 411s - 4. Let d(p) = -p - 1. Calculate -b(k) - 2d(k). -k + 2 Let t(j) = 16j2 - 33j - 3. Let p be t(2). Let u(a) = a. Let z(o) = -15o2 - 5o. What is pu(i) - z(i)? 15i*2 Let a(m) = 35m - 11. Let j be 133/(-798) + (-131)/6. Let l(i) = 7i - 2. Calculate jl(y) + 4a(y). -14y Let p(j) be the first derivative of j*2/2 + 7j - 1181. Suppose 0 = -2w - 4, -4g = -5w + w + 20. Let k(o) = -o - 5. Give gk(d) - 5p(d). 2d Let y(a) = -a*2 - a + 1. Let g(n) = -5n*2 - 4n - 19. Calculate g(c) - 3y(c). -2c*2 - c - 22 Let z(k) = -23k*3 + 5k*2 - 14k - 14. Let s(v) = 12v3 - 2v*2 + 7v + 6. Calculate 7s(n) + 3z(n). 15n3 + n2 + 7n Let d(h) = -3h - 2. Let r(v) be the second derivative of v3/6 + 77v. Give d(q) + 4r(q). q - 2 Suppose 179w - 185w = -6. Let r(y) = -y + 1. Let k(t) = -2t - 2 - 2t + 5t + 0t. Give wk(n) + 3r(n). -2n + 1 Let o(s) = -10s3 - 5s*2 + 8. Let b(g) = 9g*3 + 3g*2 - 8. Give -3b(j) - 2o(j). -7j3 + j2 + 8 Let l(h) = h*2 - 2h. Suppose 0 = -u - 0u - 12. Let o = -19 - -33. Let s = o + u. Let c(n) = 3n*2 - 5n - 1. Calculate sc(q) - 5l(q). q2 - 2 Let n(g) = g2 - 3g. Let q(a) = -178a*2 + 15a + 1. Calculate 10n(v) + 2q(v). -346v2 + 2 Let o(k) = -8k*3 - 2k*2 + 2k. Let a(n) = -11n3 + 7n*2 + 8n + 5. Let d(m) = 2m2 + m + 1. Let v(z) = 3a(z) - 15d(z). Calculate -9o(c) + 2v(c). 6c*3 Let n(w) = 12w*2 + 237w + 10. Let r(a) = 14a2 + 237a + 12. Give 6n(k) - 5r(k). 2k2 + 237k Let t(x) = 18x2 - x + 84. Let h(o) = -14o*2 + o - 85. Determine 4h(s) + 3t(s). -2s*2 + s - 88 Let q = -6 + 10. Let y(x) = -48x + 140x - 49x - 5 - 51x - 1. Let i(d) = 3d + 2. Suppose -3r + 2m + 36 = 5, 2r + m - 23 = 0. Determine qy(w) + ri(w). w - 2 Let m(b) = 2b*2 + 5b - 5. Let n(f) = 19f + 62. Let t be n(-3). Let u(y) = 4y*2 + 9y - 10. What is tm(q) - 3u(q)? -2q2 - 2q + 5 Let m(l) = 16l3 - 20l*2 + 20l. Suppose v + 16 = a, 4v + 3a = -0v - 92. Let f(z) = -z3 + z2 - z. Give vf(n) - m(n). 4n3 Let h(x) = -25x*3 + 4x*2 - 4x + 4. Let z be ((-180)/(-120))/((-6)/16). Let d(t) = -126t3 + 21t*2 - 21t + 21. Calculate zd(r) + 21h(r). -21r3 Let i(f) = -679f*3 + 7f - 6. Let v(h) = -680h3 + 8h - 7. Give -7i(k) + 6v(k). 673k3 - k Let y(b) = -40b*2 + 6b - 16. Let z(f) = 27f2 - 4f + 11. What is 5y(s) + 8z(s)? 16s2 - 2s + 8 Let o(z) = -1. Let p(h) = h + 1. Let b(t) = -2t - 7. Let k be b(-5). Suppose -5q - 12 = ky, 8 + 2 = y - 3q. Suppose -y = -9a + 10a. What is ap(m) - o(m)? -m Let i(z) = 22z + 88. Let a(t) = -11t - 47. Calculate -5a(j) - 3i(j). -11j - 29 Let n(u) = 11u + 4. Let p be n(2). Let q(l) = -4l. Let h(d) = 51d - 6d - 28d. Calculate pq(j) + 6h(j). -2j Let f(m) = 6m + 2. Let k(p) be the third derivative of -p4/24 - p3/6 - 106p*2. Calculate -f(b) - k(b). -5b - 1 Let l(x) = 11x2 + 6x - 5. Let k(w) = -6w2 - 3w + 3. Suppose 71h = 133h + 310. What is hk(o) - 3l(o)? -3o2 - 3o Let i(u) = u. Let x be (-8)/(-4) + (1 - 5). Let l(a) be the first derivative of -a*2 + a - 157. Determine xi(c) + l(c). -4c + 1 Let a be (3 - 2)/((-1)/(-1)). Let v(y) = y3 + y2. Let o(u) be the first derivative of 3u4/4 + u3/3 + 67. Determine ao(n) - v(n). 2n*3 Let v be (-5)/(-2)(-48)/(-40). Let l(q) = 11q3 + 3q. Let c(t) = -5t3 - 2t. Determine vl(i) + 5c(i). 8i3 - i Let z(j) be the second derivative of -j5/10 + 5j*3/6 - 3j*2/2 + 74j. Let y(u) = u*3 - 5u + 2. Determine -3y(c) - 2z(c). c*3 + 5c Let f(i) = -i*2 + i. Let t = 219/422 - 4/211. Let v(z) be the second derivative of -1/2z*2 + tz*4 + 3z - 1/2z3 + 0. Give 5f(w) + v(w). w*2 + 2w - 1 Let b(l) = 30l2 + 42l - 5. Let f(y) = -46y2 - 64y + 8. Determine -8b(c) - 5f(c). -10c2 - 16c Let s(f) = -415f3 + 4f*2 + 4f + 4. Let k(q) = -413q3 + 3q*2 + 3q + 3. Calculate 4k(c) - 3s(c). -407c3 Let g(v) = 1 - 18v - 6v + 25v. Let m(y) = -2y - 4. Let n be (48/6)/(1 + 1). Suppose -4f + 16 = 4q, nf - 6 - 17 = 3q. Determine qm(r) - 4g(r). -2r Let q(k) = 43k2 - 2k + 3. Let s(u) = -42u2 + u - 2. What is 3q(p) + 4s(p)? -39p*2 - 2p + 1 Let o(a) = a - 2. Let k(r) = -2r + 3 - 1 - 3 + 6. Suppose -6h = -3h + 3d + 21, 5 = -5d. What is hk(m) - 15o(m)? -3m Let d(m) = 67m3 + 6m*2 + 6m + 6. Let n(g) = 133g3 + 13g*2 + 13g + 13. Determine 13d(y) - 6n(y). 73y3 Let i(u) = 175u - 115. Let h(l) = 22l - 14. Calculate 25h(v) - 3i(v). 25v - 5 Let k(h) = -40h + 70. Let u(z) = -14z + 23. Calculate 6k(y) - 17u(y). -2y + 29 Let s(p) = 2p + 12. Let g(d) = d + 1. What is -6g(q) + s(q)? -4q + 6 Let t(d) = d*2. Let c(g) = 592g*2. What is -c(y) + 444t(y)? -148y2 Suppose 22 = t + 19. Let c(f) = -3 + t - 2f - 4 + 5f. Let s(x) = -x + 1. Determine c(a) + 5s(a). -2a + 1 Let p(c) be the third derivative of 3c6/40 + c5/20 - c4/8 - c3/2 + 7c2 - 4. Let u(i) = 9i*3 + 4i*2 - 4i - 4. Give -4p(m) + 3u(m). -9m3 Let x(s) = -s - 1. Let h(a) = -a - 5. Let v(z) = 15z + 81. Let d(k) = -33h(k) - 2v(k). Let o = 7 - 6. Determine ox(t) + d(t). 2t + 2 Let q(r) = -r*3 + 5r*2 - 7r - 38. Let m(u) = -u*3 + 3u*2 - 5u - 25. Give 7m(g) - 5q(g). -2g3 - 4g*2 + 15 Let s(t) = 3146t. Let d(l) = 85l. Give -110d(a) + 3s(a). 88a Let l(a) = -1. Let r(g) = -4 - 9g3 + 8g*3 + 2 + 5g*3 + 2g*2. What is -2l(q) + r(q)? 4q3 + 2q*2 Let g(j) = -3 + 3 - 7j - 6 - 2j. Let d(l) = 13l + 9. Let x(i) = -5d(i) - 7g(i). Let y(b) = -b - 2. Determine 4x(z) - 7y(z). -z + 2 Let j(g) = -18g2 + 53g + 15. Let y(k) = 9k2 - 27k - 7. What is 6j(z) + 13y(z)? 9z2 - 33z - 1 Let p(h) = -2h2 + 2h + 88. Let x(l) = -4l2 + 4l + 175. Give -11p(k) + 6x(k). -2k2 + 2k + 82 Let x be (5 + -6)/(2/22). Let w(y) = y - 5. Let f(a) = -9a2 + 9a - 19. Let m(s) = -f(s) + 3w(s). Let l(p) = 17p*2 - 11p + 7. What is xm(k) + 6l(k)? 3k2 - 2 Let g(u) = 9u*2 - 4u + 7. Let b = 9 - 7. Let a(t) be the third derivative of -t5/15 + t4/12 - t*3/2 + 8t*2. What is bg(h) + 5a(h)? -2h*2 + 2h - 1 Let z(j) = 4j + 3j*3 + 2j*2 - 2j*2 - 5. Let w(c) = 246 + 253 - c - 498. Calculate -4w(u) - z(u). -3u3 + 1 Let l(f) = -5f*3 - 467f*2 + 4f - 8. Let z(i) = -6i3 - 466i*2 + 5i - 10. Give -5l(g) + 4z(g). g*3 + 471g2 Let p(b) be the second derivative of -b3/2 + 3b2/2 + 4b. Suppose -c = c. Let x(v) = cv + 0v - 4v + 4. Determine 5p(d) - 4x(d). d - 1 Let j(g) = -4g*3 + 3g*2 + 7g - 1. Let o(b) = -3b2 + 54b*3 + 1 - 102b*3 + 2b*2 + 49b*3 - b. What is j(v) + 3o(v)? -v*3 + 4v + 2 Let g(m) = 2m2 + 8m - 4. Suppose 16 = 4n, -4c - 14 + 2 = 3n. Let h(k) = -k + 1. Suppose 6 = -2r - 2j, 3r = 4j - 4 + 9. What is ch(f) + rg(f)? -2f*2 - 2f - 2 Let j(w) = 6w2 - 11w. Let y(u) be the first derivative of -u3/3 + u2 - 1. Suppose 2s - 3p = -27, -3s - 2p - 14 = s. Calculate sj(q) - 33y(q). -3q2 Let h(m) = -m3 - 4m*2 + 4m. Let i(t) = 4t2 - 42t + 25. Let x be i(10). Let n(o) = o*3 + 5o*2 - 5o. Give xh(j) + 4n(j). -j*3 Let x(u) = -u + 1. Let a(g) = 4g - 123. Determine a(f) + 3x(f). f - 120 Let f(q) = q3 + 16q*2 - 130q + 47. Let j be f(-22). Let r(p) = 12p3 - 5p*2 - 4p. Let w(g) = -6g3 + 3g*2 + 2g. Determine jr(l) + 5w(l). 6l3 - 2l Let i(f) = 1702f - 6. Let x(h) = 3094232h - 10907	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.