Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
by 6081? 503 Calculate the remainder when 5996260 is divided by 218. 170 Calculate the remainder when 3799365018 is divided by 4180. 4178 What is the remainder when 662356304 is divided by 393? 392 What is the remainder when 27332680 is divided by 277? 259 Calculate the remainder when 14872295 is divided by 973. 963 What is the remainder when 9249567 is divided by 1652? 19 What is the remainder when 32495 is divided by 2946? 89 Calculate the remainder when 1197443 is divided by 293. 245 Calculate the remainder when 123666232 is divided by 4235. 4232 What is the remainder when 48636210 is divided by 305? 300 What is the remainder when 5066 is divided by 2682? 2384 Calculate the remainder when 573860 is divided by 448. 420 What is the remainder when 485968 is divided by 26998? 4 Calculate the remainder when 94311 is divided by 47047. 217 What is the remainder when 8988150 is divided by 38? 10 What is the remainder when 23608364 is divided by 1601? 18 What is the remainder when 306650 is divided by 567? 470 What is the remainder when 6023597 is divided by 158512? 141 What is the remainder when 186414 is divided by 93176? 62 What is the remainder when 2298616587 is divided by 695? 692 What is the remainder when 591514 is divided by 196975? 589 Calculate the remainder when 63151583 is divided by 62. 57 Calculate the remainder when 73327206 is divided by 2715822. 12 Calculate the remainder when 5073396 is divided by 86. 84 What is the remainder when 3762345 is divided by 341962? 763 Calculate the remainder when 26659334 is divided by 381. 2 Calculate the remainder when 1641853 is divided by 96576. 61 What is the remainder when 153464211 is divided by 30692842? 1 Calculate the remainder when 63916 is divided by 63437. 479 Calculate the remainder when 26709407 is divided by 1119. 1115 What is the remainder when 46608490 is divided by 17? 15 What is the remainder when 78796 is divided by 39303? 190 Calculate the remainder when 356619 is divided by 1193. 1105 Calculate the remainder when 246830 is divided by 2079. 1508 What is the remainder when 129659 is divided by 2468? 1323 Calculate the remainder when 126541715 is divided by 866724. 11 Calculate the remainder when 2668521 is divided by 401. 267 Calculate the remainder when 1750737 is divided by 234. 183 Calculate the remainder when 21090 is divided by 4205. 65 What is the remainder when 79831 is divided by 1697? 72 Calculate the remainder when 1384405 is divided by 1384311. 94 Calculate the remainder when 6259350 is divided by 232. 222 Calculate the remainder when 5637443 is divided by 3822. 3815 Calculate the remainder when 9017432 is divided by 1269. 1187 Calculate the remainder when 9445068 is divided by 7. 3 What is the remainder when 1291146 is divided by 4609? 626 What is the remainder when 34858958 is divided by 22? 2 What is the remainder when 1031517 is divided by 205? 162 What is the remainder when 304734 is divided by 76161? 90 Calculate the remainder when 1127919 is divided by 166. 115 Calculate the remainder when 2300103 is divided by 5. 3 What is the remainder when 3984822 is divided by 8551? 56 Calculate the remainder when 893516314 is divided by 16. 10 Calculate the remainder when 90917 is divided by 2589. 302 What is the remainder when 1566509486 is divided by 16? 14 Calculate the remainder when 9361911 is divided by 640. 631 What is the remainder when 1954129 is divided by 996? 973 What is the remainder when 56387 is divided by 7? 2 Calculate the remainder when 6371 is divided by 110. 101 Calculate the remainder when 26315 is divided by 181. 70 What is the remainder when 7736138 is divided by 182? 46 What is the remainder when 1476279 is divided by 624? 519 Calculate the remainder when 1680405 is divided by 5735. 50 Calculate the remainder when 1128067 is divided by 16836. 55 What is the remainder when 1812331 is divided by 21321? 46 Calculate the remainder when 740913 is divided by 740753. 160 What is the remainder when 115171 is divided by 56251? 2669 Calculate the remainder when 39452 is divided by 6559. 98 What is the remainder when 546156 is divided by 150? 6 What is the remainder when 582425 is divided by 2898? 2825 What is the remainder when 168752162 is divided by 19? 14 What is the remainder when 445725 is divided by 16471? 1008 Calculate the remainder when 1067284 is divided by 6428. 236 Calculate the remainder when 18206377 is divided by 655. 652 Calculate the remainder when 1554 is divided by 864. 690 Calculate the remainder when 1907957 is divided by 205. 22 Calculate the remainder when 55097172 is divided by 2448. 36 What is the remainder when 8841115 is divided by 659? 630 Calculate the remainder when 19013 is divided by 53. 39 Calculate the remainder when 1064741 is divided by 45. 41 Calculate the remainder when 68038 is divided by 1260. 1258 What is the remainder when 689943 is divided by 935? 848 Calculate the remainder when 220536 is divided by 110192. 152 Calculate the remainder when 929037 is divided by 1139. 752 What is the remainder when 62297 is divided by 1917? 953 What is the remainder when 235350 is divided by 2199? 57 Calculate the remainder when 253421548 is divided by 1839. 1831 Calculate the remainder when 49677 is divided by 1574. 883 Calculate the remainder when 1117238 is divided by 354. 14 What is the remainder when 630215293 is divided by 8? 5 Calculate the remainder when 647697607 is divided by 511. 508 Calculate the remainder when 228442 is divided by 11991. 613 What is the remainder when 24325 is divided by 716? 697 Calculate the remainder when 188618 is divided by 52. 14 What is the remainder when 860343 is divided by 326? 29 Calculate the remainder when 2149 is divided by 394. 179 Calculate the remainder when 29416549 is divided by 1472. 101 Calculate the remainder when 8534857 is divided by 319. 12 What is the remainder when 88110 is divided by 14644? 246 Calculate the remainder when 260819797 is divided by 92391. 4 What is the remainder when 1364974 is divided by 20? 14 What is the remainder when 2735843 is divided by 111? 26 What is the remainder when 5099443 is divided by 1291? 1284 What is the remainder when 26404791 is divided by 61264? 7 Calculate the remainder when 702150 is divided by 855. 195 What is the remainder when 40475887 is divided by 53? 52 What is the remainder when 61594424 is divided by 6075? 6074 Calculate the remainder when 415561 is divided by 1171. 1027 Calculate the remainder when 12587620 is divided by 1053. 58 Calculate the remainder when 1800321 is divided by 1387. 1382 Calculate the remainder when 1892963 is divided by 319. 17 Calculate the remainder when 62214 is divided by 14. 12 Calculate the remainder when 34802087 is divided by 174. 173 What is the remainder when 129934352 is divided by 95? 2 What is the remainder when 41821910 is divided by 88? 86 What is the remainder when 270351 is divided by 134038? 2275 What is the remainder when 150830054 is divided by 89? 63 What is the remainder when 420665 is divided by 779? 5 What is the remainder when 125533910 is divided by 6698? 6692 What is the remainder when 4493746 is divided by 748956? 10 What is the remainder when 184073 is divided by 2746? 91 Calculate the remainder when 6559 is divided by 1725. 1384 What is the remainder when 194323 is divided by 1943? 23 What is the remainder when 246278416 is divided by 82092801? 13 What is the remainder when 2793414 is divided by 6099? 72 What is the remainder when 22811 is divided by 5428? 1099 What is the remainder when 13463009 is divided by 224383? 29 Calculate the remainder when 374014 is divided by 1565. 1544 What is the remainder when 1356501 is divided by 7372? 53 Calculate the remainder when 851139 is divided by 2737. 2669 What is the remainder when 18650081 is divided by 204? 197 Calculate the remainder when 13897876 is divided by 235. 211 Calculate the remainder when 108553 is divided by 12057. 40 What is the remainder when 10167056 is divided by 1452436? 4 What is the remainder when 5728814 is divided by 52? 26 Calculate the remainder when 8219746 is divided by 150. 46 What is the remainder when 1659571 is divided by 284? 159 Calculate the remainder when 7699860 is divided by 405. 0 Calculate the rem	{ "pile_set_name": "DM Mathematics" }
d q? 14 Let s be 130/(-15) + (-1)/3. Let b = s - -20. Suppose -2q - 4j + 242 = 0, -5q - 6j + 605 = -j. Calculate the highest common factor of b and q. 11 Suppose -12h + 17h - d - 748 = 0, -h + d + 148 = 0. Calculate the greatest common factor of 45 and h. 15 Let k = -64 - -113. Calculate the highest common divisor of 14 and k. 7 Suppose -5n - 2x + 640 = -4x, 0 = -3x. Let w = 26 - -6. What is the greatest common factor of n and w? 32 Let a be ((-48)/(-40))/(1/5). Suppose 5h + 0 = -2c + 1, -3c - 3h + a = 0. Suppose 0u = cu - 21. What is the greatest common factor of 21 and u? 7 Suppose 0 = 7r - 157 - 1901. Calculate the highest common factor of r and 42. 42 Let v be (-1666)/(-105) + 2/15. Suppose -5q = -5x + v + 4, 5q - 2x = -35. Let a be (-5 - q)(-50)/(-4). What is the greatest common divisor of 10 and a? 10 Let f(s) = -s*2 + s + 4. Let h be f(-4). Let r be (-172)/h - 2/(-8). Calculate the highest common factor of 1 and r. 1 Let c be (-2)/8 - 87/(-12). Suppose 4u - 132 = -4v, -5u - v + 14 = -131. Calculate the greatest common factor of c and u. 7 Suppose 2k = -8k + 70. Suppose 2m - 22 - k = 5i, 2i = -2. What is the highest common factor of m and 8? 4 Let h(l) = l - 2. Let c(v) = -3v + 8. Let b(m) = -2c(m) - 9h(m). Let n be b(-2). Suppose p = 2p - 20. Calculate the greatest common factor of p and n. 4 Let v(d) = d3 + 10d*2 - 2d - 15. Let o be v(-10). Suppose 12 = -oh + 637. Calculate the greatest common factor of h and 50. 25 Let h be -31 - (-20 + -9). Let x = h + -8. Let z = x - 8. What is the greatest common divisor of 50 and z? 10 Suppose -9a + a = 48. Let r be 8/a(-24)/8. Suppose d = 4o - 134, -2d = -4d - r. Calculate the greatest common factor of 99 and o. 33 Suppose -5114q + 90 = -5109q. What is the greatest common divisor of q and 90? 18 Let w = -1974 + 1985. Calculate the greatest common divisor of w and 88. 11 Suppose 4r - 4w - 4 = 0, 3r - w = 5r - 5. Let n be (-2)/8r-4. Suppose -97 = z - 5z - a, 0 = -nz + a + 47. What is the highest common divisor of z and 3? 3 Let b be (-8 - (-300)/36)/((-2)/(-336)). Calculate the greatest common factor of b and 28. 28 Let a(f) = -5f*2 - f + 4. Let n be a(2). Let b = 66 + n. What is the highest common factor of b and 12? 12 Let n(a) = 144a - 773. Let m be n(6). What is the highest common factor of m and 39? 13 Suppose -2i + 3i = 10. Let q(d) = -4d2 + 5 + 11d*3 - 1 - id*3 - 4d. Let p be q(5). What is the highest common divisor of 36 and p? 9 Let u be 122 - 12/30-5. Calculate the greatest common factor of u and 4. 4 Suppose -4 = -b + 305. Let v = b + -181. Calculate the greatest common factor of 32 and v. 32 Suppose -l = 2l - 3v - 171, -3l = 3v - 189. Suppose 3m + 96 = 5m. Suppose 0 = 5c - 3c - m. Calculate the greatest common divisor of l and c. 12 Let y(s) = s3 - s2 + s - 1. Let m be y(2). Let a = -57 - -62. Suppose an = -0 + 5. Calculate the highest common factor of n and m. 1 Let y be (-1)/((-9)/6 - -1). Suppose -2b = yb - 40. Let m(z) = z*3 + 37z*2 + 70. Let c be m(-37). Calculate the highest common factor of c and b. 10 Suppose s - 2 = 10. Suppose 4p + 49v - 771 = 50v, -2p - v + 381 = 0. Calculate the greatest common factor of s and p. 12 Let h(o) = -5o + 15. Let w = 16 + -27. Let l be h(w). Let z = -25 - -39. Calculate the greatest common divisor of z and l. 14 Let o(k) = -k*3 - 2k*2 + 6k + 6. Let j be o(-3). Let z be (1/(-3))/(1/(-27)). Let x be 141/9 - j/z. Calculate the highest common factor of 4 and x. 4 Let r(p) = -p3 - p2 + 7. Let w be r(0). Suppose -wv = -3v - 8. Suppose -2 = -3y + 4. What is the highest common divisor of y and v? 2 Let c(a) = a2 + 6a - 59. Let x be c(-12). Let r(g) = 20g2 - 2. Let p be r(2). What is the highest common divisor of x and p? 13 Suppose -28r = -266 - 154. What is the highest common divisor of 40 and r? 5 Let v be ((-12)/(-8))/((-1)/(-22)). Suppose 0 = 3q + 2 + 7, -l + 3q + 306 = 0. Calculate the greatest common divisor of v and l. 33 Suppose -4d = 4f - 236, -4d + 0d + 5f = -191. Let m be 1(-10)/65 + (-3514)/(-26). Calculate the greatest common divisor of m and d. 27 Let h = 4 - -59. Suppose 12z + 6 - 102 = 0. Suppose -i = zi - 81. Calculate the highest common factor of h and i. 9 Suppose 0 = -5b + 36 + 24. Let t = 1247 + -1223. What is the highest common divisor of t and b? 12 Let i be (14 - 744/(-60))(-680)/(-6). Calculate the highest common factor of i and 44. 44 Let n be -303/((-9)/4). Suppose -3f + n = -2f. Let w be -1141/(-7) + (-66)/231. What is the greatest common factor of w and f? 8 Suppose 0 = -5g + x + 167 + 132, -116 = -2g + 4x. Suppose -68 = -6i + 4i. Let n = g - i. Calculate the greatest common factor of n and 52. 26 Suppose 2k - 4g - 242 = 0, -5g + 86 + 266 = 3k. Suppose -636q + 187 = -625q. Calculate the highest common divisor of k and q. 17 Let u(j) = -608j - 185. Let r be u(-4). What is the highest common factor of r and 42? 21 Let p(v) = 12v - 4. Let x be p(-1). Let w be ((-39)/(-2))/(20/x - -2). What is the highest common factor of w and 286? 26 Let k = 112 - -64. Let t be (-1 + 0)/(-1 - 0). Suppose 5f = -z + t, 4z = -0z - 4f + 52. Calculate the greatest common divisor of z and k. 16 Let v be 256/6 - 4/6. Let h = v - 70. Let b be (h/21)/(2/(-6)). Calculate the greatest common factor of 4 and b. 4 Let x(i) = i3 - i2 + i + 4. Let c = 25 + -25. Let z be x(c). Let j be z/(-10) - (-4101)/15. Calculate the highest common factor of 39 and j. 39 Suppose -526 = -3x - 16. What is the greatest common factor of x and 34? 34 Let x(n) = -n*3 - 2n*2 + 52. Let v be x(0). Calculate the highest common factor of v and 286. 26 Let o(y) = 6y*2 - 13y - 42. Let n be o(-7). What is the greatest common divisor of n and 7? 7 Let u(r) = -4r3 + 3r*2 + 2r. Let x be u(-2). Let h = -32 + x. Calculate the greatest common factor of 20 and h. 4 Let p(l) = l*3 + 4l*2 - 5l + 3. Let y be p(-5). Suppose 16n - 177 = -30n - 13n. What is the highest common divisor of y and n? 3 Let i = 15 - 11. Let h(l) = -9l*2 - 1 + 3l2 + l3 + il2 + 2l. Let t be h(2). What is the highest common factor of t and 12? 3 Suppose -l - 2c + 257 = 0, 88 = l - 5c - 176. What is the greatest common factor of 28 and l? 7 Suppose -4a + 4 = 4x, -a + 0x = 5x - 13. Let o(c) = -3c. Let k be o(a). Let l be (-86)/(-6) + (-6)/(-9). What is the greatest common divisor of k and l? 3 Let m = 515 - 233. What is the highest common divisor of 18 and m? 6 Let t be (220 - 18) + 20/4. Calculate the highest common factor of 230 and t. 23 Let d = -294 + 319. What is the greatest common factor of d and 125? 25 Let i be 10/(-1 - 4) - 3-1. Let n be -7(-2)/14 - i-43. What is the greatest common factor of 220 and n? 44 Let s = -4 - 0. Let b be s/14 - (-148)/28. Let h be (0 - -33) + -4 + -4. What is the highest common factor of h and b? 5 Let k(f) = -4f3 - f2 + f. Let v be k(-1). Suppose -6b = -b - 10, -5b + 8 = -2d. Let i be (-2)/(1-2) + d. What is the highest common divisor of i and v? 2 Let t be (1 - (0 + 1)) + 5. Let u be 31/7 + 36/63. Suppose -3k + 42 = uh - 35, -tk - 2h + 122 = 0. Calculate the highest common factor of k and 36. 12 Let k = -340 - -494. What is the highest common divisor of k and 198? 22 Let d(c) be the third derivative of c5/5 - c3/6 + 12c*2. Let u be d(1). What is the highest common factor of u and 1? 1 Suppose -2u + 40 = 2a, 23a = 20a + u + 76. Calculate the greatest common divisor of a and 246. 6 Let m(b) = b3 + 47b*2 + 90b + 246. Let z be m(-45). Calculate the highest common factor of 287 and z. 41 Let o(h) = -2h + 2. Let k be o(1). Suppose -7r + 9r + 6 = k. Let v = r - -30. What is the highest common divisor of v and 189? 27 Let h = -2269 + 2668. Calculate the highest common divisor of 38 and h. 19 Suppose -3a + 3i = -3, 7a - 1 = 2a + i. Suppose 245 = -au + 5u. What is the greatest common factor of u and 392? 49 Suppose 862 = 23z - 12. What is the highest common factor of z and 456? 38 Let w be 0 + -1 + (-5)/(-1). Suppose 48 = wj + c - 132, -j = -2c - 36. What is the greatest common divisor of j and 11? 11 Let x be (-81)/(-18)*2/(-3). Let z be x - 3/((-6)/26). Let w = -268	{ "pile_set_name": "DM Mathematics" }
+ 625 = 0. Suppose -31y = 12y + z. Let q(i) = -5i - 2. Give ym(x) - 5q(x). -2x + 1 Let b(x) = -61x3 - 5x*2. Let a be (-6897)/231 + 30 - (-68)/14. Let g(n) = -1067n*3 - 88n*2. Determine ag(c) - 88b(c). 33c*3 Let r(a) = -9a*2 + 2a - 8. Let v(g) = -4g2 - 9g - 10. Let y(l) = 3l2 + 6l + 7. Let o(j) = -2v(j) - 3y(j). What is 4o(c) - r(c)? 5c*2 - 2c + 4 Let f(m) = 42m + 7. Let t(r) be the second derivative of 43r*3/6 + 4r*2 - 11r + 160. Calculate -6f(d) + 5t(d). -37d - 2 Let p(h) = -53h*3 - 9h - 9. Let o be -4 - -11 - (6/(-15))/(2/10). Let z(j) = -13j3 - 2j - 2. What is oz(l) - 2p(l)? -11l3 Let v(i) = 28i*3 + 3i*2 - 6i - 41. Let y(d) = -86d3 - 8d*2 + 16d + 124. What is -8v(l) - 3y(l)? 34l3 - 44 Let q(l) = 6l + 64. Let j(c) = 5. Determine -4j(i) + q(i). 6i + 44 Let d(x) = x*2 + 10x - 3. Let u(g) = 9g - 2. Suppose -5q = r + 7 - 21, -q - 2r = -1. Let p(y) = -y2 + 9y - 15. Let o be p(q). What is ou(f) - 2d(f)? -2f2 + 7f Let r(j) = -9j - 43. Suppose 8b + 62 - 9 + 51 = 0. Let o(u) = -4u - 21. Calculate bo(s) + 6r(s). -2s + 15 Suppose 0 = r + 1 + 3. Let l(d) = -81d + 0 - 4 + 1 + 2 + 42d + 38d. Let b(u) = -u - 1. Calculate rl(y) + b(y). 3y + 3 Let r(h) = 4h*2 - 8h - 2595. Let o(f) = -2f2 + 5f + 1298. Determine 5o(v) + 3r(v). 2v2 + v - 1295 Let f(l) = -10l*2 - 52l + 3. Let m(j) = -28j2 - 150j + 7. What is 8f(g) - 3m(g)? 4g2 + 34g + 3 Let s(c) = -9c2 + 29c + 12. Let m(y) = 16y2 - 56y - 23. Give 4m(x) + 7s(x). x*2 - 21x - 8 Let l(o) = 121o2 + 26o + 2046. Let q(w) = -56w2 - 12w - 1023. Give -6l(i) - 13q(i). 2i2 + 1023 Let q(d) = 33d*2 + 9d + 8. Let y(k) = 31k2 + 8k + 6. What is 4q(c) - 5y(c)? -23c2 - 4c + 2 Let r = -3 - -2. Let j = -615 + 1583. Let w(k) = 1939 - j - 972 - k. Let y(x) = -x*2 - x - 1. Give rw(l) + y(l). -l*2 Suppose -5a - 45 = -5m, -16 = 4a - 0a. Let q(g) = 7g + 1. Let c(f) = -6f - 1. Calculate mc(l) + 4q(l). -2l - 1 Let r(h) = -h*2 - h - 1. Let t(a) = a. Suppose -16q + 18 = -21q - g, 5q - 3g = -26. Give qt(n) - 3r(n). 3n2 - n + 3 Let f(g) = g3 - 2g2 - 2g + 7. Let s be f(2). Let u(y) = s + 244y - 247y - 8y3 + 9y*3. Let t(v) = v - 1. What is -3t(x) - u(x)? -x*3 Suppose 4o + 1 = 9. Let k(p) = 190p + 55. Suppose 7c + 606 = 1418. Let h(j) = -7j + 75 + 39 - c. Give ok(a) + 55h(a). -5a Let p(h) = 371h - 210. Let b(a) = 68a - 38. What is -49b(l) + 9p(l)? 7l - 28 Let x(h) = -53h + 91. Let u(t) = -161t + 276. Give 2u(m) - 7x(m). 49m - 85 Let b be (-48 + 48)/(-41) + 2/1. Let o(j) = 3j. Suppose u = -m + 9, 3u - 16 - 3 = -m. Let k(y) = 19 - 3y - y - 19. Calculate bk(q) + mo(q). 4q Let w(v) = -15v3 - 28v*2 - 21. Let r(u) = 16u*3 + 24u*2 + 21. Calculate 7r(o) + 6w(o). 22o*3 + 21 Let f(l) = 191l*3 + 3l + 9. Let r(t) = 572t3 + 9t + 30. Calculate -13f(m) + 4r(m). -195m3 - 3m + 3 Let v(g) = -1. Let a(l) = 273l - 26. Let f(i) = 355i - 36. Let c(u) = 13a(u) - 10f(u). What is -c(s) + 6v(s)? s - 28 Let c(s) = -68s*2 + 5s - 5. Let q be (-30)/(-21)(-581)/166. Let g(r) = 34r*2 - 3r + 3. What is qg(a) - 3c(a)? 34a2 Let u(f) = -45 + 0f + f + 0f + 87 - 43. Let h(d) = -17d*3 - 85d + 66 + 19d + 7d*3 + 21d*3. Calculate h(j) + 66u(j). 11j3 Let k(r) = 60r*2 - 4r - 155. Let m(h) = 30h2 - 2h - 77. Give 2k(b) - 5m(b). -30b2 + 2b + 75 Let i(a) = -4a3. Let c(z) = 2401z*3 + 2z*2. Give c(q) - 3i(q). 2413q3 + 2q*2 Let g = 10747 - 10746. Let m(s) = s. Let r(h) = 4h*2 - 5h + 6. What is gr(n) + 5m(n)? 4n2 + 6 Let q(j) be the second derivative of 105j - 1/2j3 + 1/2j*2 + 0. Let w(o) = -3o + 2. Let p(m) = -m + 1. Let d(b) = -2p(b) + w(b). Give -2d(a) + q(a). -a + 1 Let h(q) = 3q2 - 3q + 5. Let m(a) = a*2 - 15a + 6. Let b(r) = -35r + 11. Let d(s) = -2b(s) + 5m(s). Let n = 28 + -20. Calculate nh(g) - 5d(g). -g2 + g Let d(u) = 11u*3 - 9u*2 - 13u - 5. Let h(m) = -6 - 54m2 + 7 + 56m*2 + 23m - 3m3 - 20m. What is -2d(g) - 9h(g)? 5g3 - g + 1 Let q(d) = -55d + 2. Let j(f) = 195f - 7. Let r(c) = 2j(c) + 7q(c). Let h(a) = 5a. Give -6h(g) + 5r(g). -5g Let x be (-22)/33(-1 - 0)(-30)/4. Let r(j) = 12j + 7. Let l(b) = -6b - 3. Give xl(h) - 2r(h). 6h + 1 Let h(o) = -17o2 + o + 1. Let s(u) = 122u*2 - 10u - 11. Calculate -6h(q) - s(q). -20q*2 + 4q + 5 Let b(v) = 112v + 399. Let r(a) = -40a - 133. Give 6b(x) + 17r(x). -8x + 133 Let l(b) = -3b*2 + 15b - 4. Let p(j) = j - 1. Suppose -3t = 24, 5h - 3t + 35 = -8t. Determine hl(y) - 4p(y). -3y2 + 11y Let d(j) = -54060j3 - 2862. Let f(g) = -151g*3 - 8. Determine -4d(c) + 1431f(c). 159c*3 Let o(a) = 2a*2 + 5a + 6. Let s be (-42)/(-15)(-468)/546(-10)/6. Let c(u) = u*2 + 2u + 2. What is so(y) - 11c(y)? -3y2 - 2y + 2 Let l(i) = 10i + 11. Let s(j) = -19j - 22. Let h(b) = 13l(b) + 7s(b). Let f(p) = -p - 5. What is 9f(w) - 4h(w)? 3w - 1 Suppose 2u - 12 = -z, -z = -370u + 365u + 30. Let y(h) be the second derivative of -50/3h3 + 31h + zh2 + 0. Let j(s) = 11s. Give 55j(m) + 6y(m). 5m Let l(t) = -20t*2 + 2089t - 11. Let h(k) = 11k2 - 1044k + 6. What is -11h(q) - 6l(q)? -q*2 - 1050q Suppose 0 = -42y - 64 + 148. Let w(h) = 6475h*3 + 333h. Let m(i) = -39i3 - 2i. What is yw(u) + 333m(u)? -37u3 Suppose 0 = 5s + 2s + 14 + 28. Let p(q) = -4q - 13 - 25q2 - 5q + 0q - 4q. Let y(j) = 12j2 + 6j + 6. Calculate sp(x) - 13y(x). -6x2 Let b(r) = 58. Let f(t) = 22t - 289. Let q(l) = -5b(l) - f(l). Let s(o) = -110o - 4. What is 14q(j) - 3s(j)? 22j - 2 Let m(v) = -v3 - 2v - 2. Let i(u) = -91u3 + 4u*2 - 4u*2 - 272 + 93u*3 + 3u + 275. Give -2i(z) - 3m(z). -z*3 Let o(m) = 4340m*2 - 5m - 20. Let q(l) = 2170l2 - 3l - 12. What is 3o(n) - 5q(n)? 2170n2 Let c(d) = -d - 3. Let z(k) = -k - 7. Let f = -24660 + 24664. Calculate fz(s) - 9c(s). 5s - 1 Let v(q) = -2q - q + q2 + 7 + 6q - 8 + 13q3. Let d(u) = -38u*3 - 2u*2 - 8u + 2. Calculate -3d(x) - 8v(x). 10x3 - 2x*2 + 2 Let d(a) = 3a*3 + 4a. Suppose 11x = -2x + 24 + 28. Let j(h) = 4h3 + 3h. What is xj(r) - 5d(r)? r*3 - 8r Let h(c) = c*2. Let j(x) = -4x*2. Suppose -95s + 77s = 144. Let n be 7 + -14 + s/(-1). Give nj(m) + 8h(m). 4m*2 Let m(p) = 85p*2 - p. Let b(l) = 514l*2 - 2l. Determine b(s) - 6m(s). 4s*2 + 4s Let o(h) = -h + 1. Let n(j) be the first derivative of 109 - 2j - 1/3j*3 + 1/2j*2. Let i(k) = -k. Let g be i(-3). Determine go(w) + n(w). -w*2 - 2w + 1 Let x(w) = -46w2 - 132w + 315. Let i(u) = 16u2 + 47u - 106. Calculate -17i(q) - 6x(q). 4q2 - 7q - 88 Let p(d) = -7d2 - 98d - 2. Let l(m) = 4m2 + 59m + 1. Let x(i) = -5l(i) - 3p(i). Let q(u) = -4u2 - 4u + 4. What is -3q(c) + 12x(c)? 24c2 Let m = 21 - 9. Let d(c) = -12 + m - c. Let u(n) = -8n. Suppose 409i + 17 = 392i. What is iu(w) + 3d(w)? 5w Let o be (-2250)/(-2205) + 7/(-343). Let w(l) = 8l - 9. Let u(g) = -15g + 17. Let j(n) = -6u(n) - 11w(n). Let h(z) = -z + 1. Determine oh(y) + j(y). y - 2 Let x(t) = -101t2 + 3t + 6. Let k(q) = -196q2 + 6q + 10. Determine -3k(r) + 5x(r). 83r2 - 3r Let s(r) be the first derivative of 3r4/4 + 4r*3/3 - 3r - 98286. Let g = 5 - 0. Let i(o) = 4o3 + 5o*2 - 3. Determine gs(l) - 4i(l). -l3 - 3 Let z(a) = 2a. Let c = -769 + 773. Suppose 3 + 8 = 3j - k, 0 = 2j + ck - 12. Let p(x) = -4x. Determine jp(v) + 7z(v). -2v Suppose 16n + 1031 = 1063. Let a(r) = -3r - 8. Let s(v) = v2 - v + 1. What is ns(w) + a(w)? 2w2 - 5w - 6 Let b(q) = -q2 + q + 1. Let n(o) be the third derivative of o4/6 + o*3/2 - 6o*2 + 4o. What is -b(p) + n(p)? p*2 + 3p + 2 Let f(a) = -a*3 - 89a*2 - 164a + 638. Let i be f(-87). Let c(z) = -58z2 - 232z - 232. Let b(x) = -x - 1. Give ib(v) + c(v). -58v*2 Suppose -2q + 13 = -d, 0d + 4 = -q - 3d. Let u(z) = -2z - 10. Let v(x) be the third derivative of x4/8 + 10x*3/3 - 885x*2. Determine qu(g) + 3v(g). -g + 10 Let i(d) = 4d*2 + 3d - 93. Let j(t) = -9t2 - 5t + 183. Giv	{ "pile_set_name": "DM Mathematics" }
- h. Let g = 5 - a. Solve 5 = 5l, 4q + gl + 7 + 1 = 0 for q. -3 Suppose -9 + 1 = -2a. Solve -4h = -ai - 40, 2i + 2h = -2i - 10 for i. -5 Let t = 15 - -5. Let y be t/(-8)(-132)/10. Solve -v = 3c + 17, c = 5v + 3c + y for v. -5 Suppose -q + 3y = -26 + 4, -8 = -q - 4y. Solve 5l = j - 9, 5j + 5l + q = 1 for j. -1 Let f(i) be the second derivative of -i + 0 - 1/3i3 - 1/20i*5 - 5/12i4 - i2. Let d be f(-5). Solve -o = 3v - dv, 3o = -3v for v. 0 Let w(i) = i*2 + 10i + 14. Let s be w(-9). Solve -c - 2c - 32 = -5p, sc = -4p - 4 for c. -4 Suppose -5b = -2v + 4, 3b - b = v - 2. Suppose vf = -2f. Solve -5x - 6g + 2g - 8 = 0, f = 4x + 4g + 8 for x. 0 Let i = -9 + 24. Solve -5q + 5a - i = 0, q - 4a + 5 = -5a for q. -4 Let r = -41 - -45. Solve 0 = 2l + 4g - 20, l = rl + 5g - 25 for l. 0 Let d(u) = -u*2 - 5u. Let i be d(-5). Solve -4c + 5y = 3 - 23, c - 4y - 5 = i for c. 5 Let n = -2 + 5. Suppose 9 = nq - 0. Solve 4o - 8 = 2h, 0o = qo - h - 7 for o. 3 Let c(g) = 2 - g*3 - 2g*2 - g + 0g + 0g. Let o be c(-2). Suppose ot = -h - 14, 0t - 2t - 8 = 0. Solve hu = -0u - 6, 0 = -3m - 3u - 18 for m. -3 Let y(b) = 6b + 3. Let v be y(1). Solve j - 5j - f = v, 4j + 3 = 5f for j. -2 Suppose -7k - 21 + 49 = 0. Solve -2j + 9 + 2 = -5w, -kj = w - 11 for w. -1 Let x be 9/(9/6 - 0). Solve 0 = 2l + x, 24 + 8 = -4j - 4l for j. -5 Let x be (-1 - 3/(-3)) + 10. Solve 5d - f - 5 = -3f, -x = -2f for d. -1 Suppose -4k - 25 = 5m, -2k - 3k + 4m = -20. Let n = -14 + 15. Solve k = 4y + 5z - n, y + z - 5 = -y for y. 4 Suppose f + 95 = 5r, 5f - 105 = -7r + 3r. Solve -4m + r = 0, -2c = -0c + 2m for c. -5 Suppose -11p = -14p + 6. Let z be (p/1 - 1)2. Solve -4g - zr = -10, 0 = -3g - 0g - 4r + 5 for g. 3 Let j be 3(-4 + 3)-1. Let x = j - 3. Suppose -g + o + 9 = x, 5g - 5o = -2o + 37. Solve 23 = gv + 2c, -3v - 4c + 19 = -2v for v. 3 Let v(b) = b2 - 2b - 1. Let u be v(3). Let w = 8 + -6. Suppose c - 7d - 15 = -wd, -2d = -c + 9. Solve 0 = ca + uk - 29, -a - a + 12 = k for a. 5 Let z be (-64)/6(-8 + 5). Suppose -3t - 4q + z = t, -4q = -4. Solve -s - k + 0k = -t, -2k = -5s for s. 2 Suppose -4h = -9 + 25. Let l = 7 + h. Let r(n) = n2 + 7n - 5. Let f be r(-8). Solve -4z + lx = -3, 2z - fz - 3 = -2x for z. 3 Suppose -1 = -4n - 3h + 22, -3n - 4 = -2h. Solve 0 = -b - 4a + 16, nb + 2b + 5a = 20 for b. 0 Let r be 6(-1)/10-5. Suppose n = -3v + 9, -2n - n + 15 = 3v. Suppose -6x = nt - x - 35, -5x = -20. Solve -g - 7 = d, rg = -td + g - 20 for d. -2 Suppose -2p + 0p = -8. Let o(i) = -i + 4. Let y be o(0). Solve -yg = -b + 17, 4g = -2b + pb - 22 for b. 5 Let v = 49 + -44. Solve 4x - g - 4g = -7, -vx - 14 = -g for x. -3 Let k(b) = -b*2 - 11b + 12. Let a be k(-11). Suppose 3t = -0t + a. Solve 3h + i - 6 = 0, -6h - ti + 17 = -h for h. 1 Suppose 6t = 10t - 12. Let a = -12 - -17. Solve -f + tp = -19, 0p = -5f - 3p + a for f. 4 Let j = 4 + 1. Let b = -4 - -3. Let q be (-1 - 1) + 8 + b. Solve r - 3r = qc + j, 0 = -r - 5c for r. -5 Let p = 21 + -7. Solve 3b - 2j = -2b - 29, 0 = 4b + 3j + p for b. -5 Suppose 2i = -3g + 25, -5g = -8 - 7. Solve -3 = 3c + 9, -4h - 5c - i = 0 for h. 3 Suppose 3a + 3a = 90. Solve -2i + 5 = -5y, i + 5y = -i + a for i. 5 Let r = 21 + -6. Suppose -r + 3 = -3c. Solve -q + 5m - 40 = 4q, -4q - c = 3m for q. -4 Suppose 0 = -3y + 1 + 11. Let u be (-3)/2 + 176/32. Solve -k - 19 = -5m - 0k, uk - y = 0 for m. 4 Suppose 14 = -2g - 2. Let u be 4/g1-6. Solve 5d = 5l + 25, -ul - 2d = -4d + 10 for l. 0 Suppose -5s + 66 = y, -2y = -5s + y + 82. Let m = s - 8. Solve 3 = a - 2z, -a + 3z + m = -0z for a. -3 Suppose 0 = -5c + 4 + 1. Let d be 50/10 + (c - 2). Solve -b + r = 1, -b - 17 = -db - r for b. 4 Let h(c) = -8c - 2. Let u be h(-3). Let f = u - 18. Solve 0 = -fa - 16, 2p - 16 = 4a + a for p. -2 Let a = -3 - -5. Let m(c) = -2c - 4c - 5 + 4ca + c3 - 1. Let r be m(-4). Solve -n + 9 = -2n + 2b, 5n - b = -r for n. -3 Let r(f) = 5f + 1. Let v be r(3). Suppose -5g = 5j - 10, 3g - j - v = g. Let i be (32/g)/((-2)/(-6)). Solve 2k - 5k - 4a + i = 0, 4a = 4 for k. 4 Let r(u) be the second derivative of -u4/12 + 4u*3/3 + 17u*2/2 + u. Let o be r(8). Solve -17 = -3k + c, 4k = c + o + 4 for k. 4 Suppose 0 = 3p + 4w - 19, -w + 3w = 2. Solve 0 = pd + 5g + 25, 3d - d - 18 = 5g for d. -1 Let s(v) = -v + 4. Let b be s(4). Suppose -5w - 4q + 3 + 2 = 0, b = w - q - 10. Solve p - 5u - 25 = -3, wu + 24 = 2p for p. 2 Suppose -2i - 3w - 3 = -17, -3w + 7 = -5i. Solve 2f = 2s - 3s - i, 5s + 5f - 10 = 0 for s. 5 Let w = -12 - -18. Let s(b) = 5b2 - 4b*3 + 3b*3 + 2 + 4b*3 - 4b*3. Let t be s(5). Solve -2n - 2l = -wl - 18, -9 = tn + 5l for n. 3 Let m be -3 - -1 - 12/12. Let t be (14/(-6) - m)6. Solve 3l = -k - 16, 5l + 25 - t = 4k for l. -5 Let b(u) = u*2 + 4. Let j be b(0). Solve 0x + jx = -o + 1, -o = -2x - 1 for o. 1 Let i = 5 - 3. Suppose n + ij = 1, -j - 13 = -3n - 2j. Solve 5s = 3v - 2v - 5, 1 = nv - s for v. 0 Let n(i) = -i3 + 2i*2 - 2i + 1. Let q be n(1). Solve 3z + 3 = -3b - qz, -2b - 5z = -4 for b. -3 Suppose w = 2t + 9 + 7, 4w = -2t + 14. Suppose -15 = s - ws. Let r be 14/(-21) - (-112)/6. Solve -u + sv = -2u, -3v + r = -5u for u. -3 Suppose 29 - 42 = -n. Solve 18 = -3o + 4a - n, 2a - 28 = 4o for o. -5 Let s be (-1)/(-1) - 4/(-1). Let d = 7 - s. Solve -g - d = -5i, i = -i - 2g + 8 for i. 1 Let v(x) = 10x + 43. Let q be v(-4). Solve -g + 4b = -1 + 4, g - qb = -1 for g. 5 Suppose 4f = -0f. Suppose 0 = -5x + 3t + 6 + 23, 0 = 4x + 3t - 7. Solve -5j + 7 = -2d, xd - 2d - 8 = f for j. 3 Let d(i) = i*2 - i - 8. Let s be d(-6). Suppose -2h + 5y = 2y - s, 5y = -2h + 34. Solve 5n + 33 = -2o, 3o + 2n - n = -h for o. -4 Suppose 0 = -2z - 2h + 8, -3z + 3h = z - 9. Suppose -6i + 33 = -zi. Suppose 7 = o - i. Solve 0 = s - 4, -o = -5p - 5s + 22 for p. 4 Let w be 2/9 + (-303)/27. Let x = w + 36. Solve -x = 6n - n, 5n + 25 = -4c for c. 0 Suppose 25 = 2j - 2y - y, 5j + 2y - 15 = 0. Solve -5s - 26 = 4p, 13 = -p - 2s + j for p. -4 Let m = -37 + 51. Solve v - m = 4u, 2 = -4v + 3u + 6 for v. -2 Let n = -11 + 7. Let l be (-10)/n(6 - 4). Suppose 48 = -p + lp. Solve -i = 3t + 2 - 14, -4i = p for t. 5 Let o(i) = i3 + 7i*2 + 4i - 7. Suppose 4a - 5v - 13 = 3, -v - 23 = -3a. Let k = 3 - a. Let n be o(k). Solve 0b = -2b + 4h + 18, -nh = b + 12 for b. 3 Suppose 0 = 3y + y - 32. Let q = y + 0. Suppose -6 = 2w - q. Solve -4r - 3k + 6k - w = 0, -3r - 6 = -4k for r. 2 Let q be 28/6 + 6/18. Suppose 2 = qr - 13. Solve 5b = 5a - 6 - 4, -6 = -4a + rb for a. 0 Let l(f) = -f2 - 12f - 8. Let y be l(-11). Solve 6b - 15 = b, 4z + yb - 1 = 0 for z. -2 Let l(n) = 2n - 1. Let c be l(2). Let r(q) = q*2 + 3q - 2. Let d be r(2). Suppose -cx + 10 = -d. Solve -8 = -4b, -2g - 3b = -xb + 4 for g. 1 Let o = -6 + 2. Let j(u) = -2u - 3. Let p be j(o). Let s(n) = -2n - 22. Let v be s(-13). Solve -pm - k - v = 0, -m = 3m - 5k + 9 for m. -1 Suppose z + 4z = 20. Let j(t) = t2 - 5t - 3. Suppose 4b = -11 + 3, n + 2b - 2 = 0. Let q be j(n). Solve 2l = -1 + q, -zf - l = 3 for f. -1 Suppose 2s = 8 + 12. Let b = 5 - 4. Suppose 0 = 5o - 20, 4x = -2o + b + 15. Solve r - xl - 3l = 22, 5l = 5r - s for r. -3 Let f = 97 - 67. Suppose 4 = 2n - 0, -16 = -5i - 3n. Let j be (-3 - -2) + i + f. Solve -2d + 0y = 4y - 26, 0 = 3d + 4y - j for d. 5 Suppose -24 = -4l - 2l. Solve -6 = -2g + 3w, -w = -4g + l + 8 for g. 3 Let k(l) = -l3 + 8l*2 - 6l - 4. Let a be k(7). Suppose -9 = -5i - 2n, -3i + 3n = -0n + a. Solve -3s - 2o + 2 = 0, -3s + 5o - i = 4o for s. 0 Suppose -9 - 2 = j. Let i = j + 14. Solve 2v - z = 1, iv - 2z - 2 = 7v for v. 0 Suppose 0 = -5c + 4c + 2. Solve 0 = -0z - 2z - c, -5z = -5q for q. -1 Let i be (4 - -2)(-2 + 1). Let y be -1 + 2i/(-4). Solve ya = -4w - 8, 0 = 3a + w - 0w - 3 for a. 2 Let m(i) = 4 - 2i - i2 - 9i + 10i. Let b be m(0). Solve 0 = 3s - 4n - b + 3, 2n + 8 = 0 for s. -5 Suppose 5 = 4f - 0z	{ "pile_set_name": "DM Mathematics" }
-8 Let r(a) = a*3 + 366a*2 + 28012a - 33. Determine r(-109). 76 Let d(z) = 19z2 + 859z + 2405. Calculate d(-3). -1 Let m(g) = 166g - 2684. What is m(14)? -360 Let r(w) = -19w*2 - 404w + 7366. Give r(-33). 7 Let i(o) = -o*3 - 47o*2 + 3476o - 327. Give i(-87). 21 Let x(w) = -w*2 - 167w - 2133. What is x(-149)? 549 Let t(m) = -46m2 + 1094m - 113. Give t(29). -7073 Let z(w) = -192w2 - 1562w - 117. What is z(-8)? 91 Let v(f) = -142f2 - 5491f - 16491. What is v(-3)? -1296 Let m(d) = -d*3 - 26d*2 - 86d + 207. What is m(-16)? -977 Let m(a) = 9518a - 47602. Determine m(5). -12 Let s(f) = 55f*3 + 5722f*2 + 210f + 86. What is s(-104)? -122 Let p(f) = -15f - 759. Determine p(-91). 606 Let b(d) = d3 + 148d*2 + 74d - 226944. Give b(-135). -9 Let c(b) = -65b2 + 374b - 92. Calculate c(6). -188 Let u(o) = -45o - 5987. Calculate u(-140). 313 Let i(p) = -p2 + 109759p - 2304501. What is i(21)? -3 Let j(s) = 287233s - 18670140. What is j(65)? 5 Let g(v) = -4v*2 + 141v + 1025. What is g(41)? 82 Let u(k) = 2k3 - 7k*2 + 37k + 183. What is u(8)? 1055 Let a(g) = -1497g2 + 13479g + 15. Determine a(9). 69 Let d(s) = 5502s + 1369999. Determine d(-249). 1 Let r(b) = 2b*3 + 62b*2 - 611b + 561. Give r(7). 8 Let m(v) = -9066v + 126602. Determine m(14). -322 Let k(o) = 30867o + 1512477. Determine k(-49). -6 Let b(m) = -m*3 + 18m*2 + 640m + 121. Determine b(36). -167 Let y(n) = 1218n2 + 207083n + 3908. Give y(-170). -2 Let s(p) = 12268p - 36612. Give s(3). 192 Let l(s) = -23147s - 300885. Determine l(-13). 26 Let o(r) = r*2 + 9084r + 541438. What is o(-60)? -2 Let x(w) = -13w2 + 2w - 12. What is x(-2)? -68 Let w(h) = -28h2 + 1647h - 1069. Determine w(58). 265 Let g(o) = 5606o + 61647. Determine g(-11). -19 Let g(b) = -b3 + 1521b*2 + 37060b + 30892. Determine g(1545). -8 Let b(k) = 2k2 - 2356k + 114967. What is b(51)? 13 Let h(i) = -22i3 + 15i*2 - 33i - 36. Give h(4). -1336 Let r(a) = -a*2 - 17493a + 40. What is r(0)? 40 Let c(w) = 64w - 6826. Calculate c(109). 150 Let o(z) = 34z - 2781. Determine o(39). -1455 Let q(t) = 2t3 - 136t*2 + 141t - 101. Calculate q(67). 368 Let o(w) = -177w2 + 298w + 18. Give o(3). -681 Let b(c) = 399c + 48. Determine b(-1). -351 Let x(d) = d2 - 2861d + 23117. Calculate x(8). 293 Let k(o) = -544205o - 29931275. What is k(-55)? 0 Let u(t) = -6919t - 27666. Calculate u(-4). 10 Let u(a) = 100541a - 4423815. Determine u(44). -11 Let c(v) = 398v + 58798. Calculate c(-147). 292 Let t(d) = -48d2 - 329d + 1003. Give t(3). -416 Let j(x) = -6053x + 326858. What is j(54)? -4 Let b(f) = 20913f + 250926. Give b(-12). -30 Let i(y) = -4038y - 35673. Calculate i(-8). -3369 Let d(c) = 29c*2 + 106c + 11. Determine d(-3). -46 Let u(x) = x*3 - 636x*2 + 17014x + 6135. What is u(608)? 55 Let j(m) = m*3 - 17m*2 - 73m + 706. Determine j(18). -284 Let a(r) = -5368r - 53674. What is a(-10)? 6 Let o(a) = -2198a2 - a - 107. Determine o(0). -107 Let v(q) = -q2 + 2704q - 51005. Give v(19). 10 Let b(s) = -s3 + 55s*2 + 1213s - 66709. Give b(55). 6 Let v(r) = 37r + 3106. Give v(-52). 1182 Let f(t) = -5t*2 + 416t + 160. Give f(83). 243 Let l(t) = 6t2 - 340t + 1422. Calculate l(69). 6528 Let z(q) = 2250q - 92319. Give z(41). -69 Let f(t) = -92t*3 - 73t*2 + 15t + 30. Determine f(-4). 4690 Let f(t) = -661t - 46929. What is f(-71)? 2 Let o(q) = -q3 - 47q*2 - 638q - 2603. What is o(-10)? 77 Let t(d) = -d*3 + 104d*2 - 1099d + 1793. Give t(2). 3 Let m(p) = 2p3 - 5p*2 - 3958p + 15884. Calculate m(4). 100 Let b(n) = 76n - 13612. Give b(181). 144 Let q(n) = -n3 - 106n*2 - 762n - 57617. Calculate q(-104). -1 Let n(x) = 3x2 - 9548x - 19126. Calculate n(-2). -18 Let g(s) = -3s2 + 12379s + 248837. What is g(-20)? 57 Let i(u) = 2u3 + 41u*2 - 45514u - 910690. Determine i(-20). -10 Let x(f) = -f*2 + 99f + 3606. Calculate x(-30). -264 Let p(a) = -a*3 - 129a*2 - 686a - 324. Determine p(-5). 6 Let a(i) = i*2 + 977i - 73309. Determine a(70). -19 Let y(i) = -i*3 - 1089i*2 + 101051i - 95. Give y(86). -9 Let d(u) = 1700u + 25466. Calculate d(-15). -34 Let w(h) = 125h*3 - 70h*2 + 116h - 47. What is w(1)? 124 Let z(v) = -18v2 + 2345v + 8. Give z(130). 658 Let k(w) = 339w2 + 1802w - 1374. Calculate k(-6). 18 Let j(n) = 126n + 15462. What is j(-111)? 1476 Let m(j) = 860j - 4490. Give m(5). -190 Let s(p) = 3p3 + 59p*2 - 266p - 5086. Determine s(-20). -166 Let m(l) = -29l2 - 44l + 8. Calculate m(-4). -280 Let r(h) = -h*3 - 36h*2 + 65h - 473. Give r(-38). -55 Let p(u) = -29u2 - 2081u - 1559. Determine p(-71). 3 Let g(a) = 105a2 - 1277a - 167. Determine g(12). -371 Let y(x) = 3372x - 785673. Give y(233). 3 Let f(o) = -12o*3 - 110o*2 - 178o - 66. Determine f(-9). 1374 Let a(p) = -2663p + 85225. Determine a(32). 9 Let k(a) = -5a*2 + 1288a - 31188. Give k(27). -57 Let z(n) = 64n3 - 51n*2 + 60n + 89. Calculate z(2). 517 Let d(j) = -533j + 118027. What is d(219)? 1300 Let u(k) = -2k*2 - 7363k - 51429. Give u(-7). 14 Let f(y) = -3y2 - 181y + 524. Calculate f(-38). 3070 Let o(m) = m*3 - 57m*2 + 32m + 58. Give o(57). 1882 Let d(h) = h*2 - 7881h + 4025268. What is d(549)? 0 Let a(k) = -2167k + 320720. Give a(148). 4 Let n(w) = 4w*3 + 166w*2 + 157w + 3004. What is n(-41)? -71 Let a(r) = -r*3 - 105r*2 + 211r + 38. Calculate a(-107). 359 Let m(d) = 34d - 3877. Determine m(150). 1223 Let t(r) = -r2 + 5102r + 112961. What is t(-22)? 233 Let x(l) = -53l2 - 1093l - 126. What is x(-15)? 4344 Let i(b) = -1316b - 265819. Give i(-202). 13 Let h(j) = 267426j - 3209112. Determine h(12). 0 Let t(w) = -3747460w + 7494922. Give t(2). 2 Let q(g) = -3g*3 + 71g*2 - 83g. What is q(1)? -15 Let d(x) = -x*3 + 64x*2 - 158x + 4466. Calculate d(63). -1519 Let g(o) = 44o2 + 12491o - 26589. What is g(-286)? 9 Let w(j) = 385j + 22759. What is w(-58)? 429 Let p(z) = 32z*2 + 1438z + 934. Give p(-44). -386 Let h(r) = -634r + 10127. Give h(17). -651 Let v(a) = -a3 - 87a*2 + 656a - 102. Give v(-94). 86 Let k(a) = -6001a + 156011. What is k(26)? -15 Let n(p) = 2p*2 + 2205p - 209532. Give n(88). -4 Let c(g) = 323g3 + 73g*2 + 74g. Give c(-1). -324 Let j(v) = 11136v - 3797429. Calculate j(341). -53 Let p(a) = -a3 + 69a*2 + 513a + 1450. Determine p(76). 6 Let r(y) = -y*3 - 50y*2 + 2622y + 77. What is r(32)? 13 Let j(c) = -3c3 + 105c*2 - 16c + 542. What is j(35)? -18 Let m(p) = 14p3 + 65p*2 - 47p - 52. Determine m(-5). 58 Let p(l) = -l3 + l2 + 3765l - 18749. Determine p(5). -24 Let u(n) = 20n*2 - 5286n + 22361. What is u(260)? 1 Let v(j) = -25073j + 1078146. Give v(43). 7 Let c(p) = p3 + 165p*2 - 385p + 19980. What is c(-168)? -12 Let w(b) = 47702b - 381633. Determine w(8). -17 Let v(p) = -8160p - 48791. What is v(-6)? 169 Let v(g) = -g*3 + 8g*2 - 183g + 1232. Give v(7). 0 Let x(m) = m*3 - 52m*2 + 88m - 662. What is x(51)? 1225 Let x(d) = -d*3 + 483d*2 + 2310d - 649907. What is x(485)? -7 Let y(t) = t*3 + 51t*2 + 32t - 750. Give y(-50). 150 Let i(w) = -w*3 - 23w*2 - 14w + 591. What is i(-21)? 3 Let h(l) = 100834l - 907522. Determine h(9). -16 Let g(j) = -189033j - 2079367. Give g(-11). -4 Let m(c) = -20c2 - 318c + 1184. Calculate m(-19). 6 Let w(m) = 5m2 - 1782m - 39630. Determine w(-21). -3 Let m(w) = -w*2 - 78710w - 7154320. What is m(-91)? 9 Let u(m) = 10m2 - 23m - 555. Calculate u(-13). 1434 Let c(p) = -108p - 17035. What is c(-164)? 677 Let t(q) = -40q*2 - 18926q - 2737. Give t(-473). 101 Let f(c) = -c*3 + 43c*2 - 192c - 404. Calculate f(33). 4150 Let r(d) = -8d3 - 10557d*2 + 3969d + 11876. Calculate r(-1320). -4 Let j(r) = r*2 + 184r - 109161. Calculate j(251). 24 Let b(r) = 251r - 664. What is b(0)? -664 Let b(x) = 2x*3 + 484x*2 + 25926x + 480. Determine b(-80). 0 Let d(f) = -2f3 - 12f*2 - 902f - 7495. What is d(-8)? -23 Let k(c) = -c*3 - 179c*2 + 2499c + 608. What is k(-192)? 32 Let h(p) = 198876p - 2983111. Determine h(15). 29 Let i(s) = -13s*2 + 3031s - 58002. Give i(21). -84 Let r(m) = -83m*2 - 3	{ "pile_set_name": "DM Mathematics" }
e 0 = 366y + 289 - 1021. What is the fourth biggest value in y, -5, -0.01, d? -5 Suppose -10w + 6w = 24. Let y = w - -74. Let r = y + -71. Which is the second biggest value? (a) -4 (b) r (c) 2/9 b Let o be ((-78)/8)/((-6)/8). Suppose -12f + o + 23 = 0. Which is the second smallest value? (a) -4 (b) 7 (c) f (d) -5 a Let y = -14247 + 14244. Let r = -27 + 28. Which is the biggest value? (a) r (b) 1/30 (c) y a Suppose 23m - 5658 = 33m + 31m. What is the second biggest value in 0.5, 2/25, -3, m? 2/25 Suppose o - 9l - 221 = -246, l - 2 = 0. Let n = 0.07 + -0.13. Let i = n + -3.94. Which is the third smallest value? (a) 0.3 (b) o (c) i a Suppose 43h = -209 - 49. Let z(a) = a + a2 - 5a + 2a - 5 - 2a. Let t be z(5). What is the third biggest value in t, -4, -0.1, h? -4 Let q = 0.1 - -0.4. Let l = 0.71 - -2.29. Let g be (-4)/(-5) - (-7 + (-849)/(-105)). Which is the biggest value? (a) q (b) g (c) 10 (d) l c Let m = 20.78 - 20.7. Let b = -0.32 - m. What is the third smallest value in -2, b, -3, 0.7? b Let g = -39 - -45.8. Let s = -1.8 + g. What is the smallest value in s, 0.4, -11, 0.3? -11 Let o = 120 - 119.7. Let r = -7 - -17. Let m = r + -31/3. What is the third smallest value in 0.4, 2/3, m, o? 0.4 Let d = -0.7178 - -0.6178. What is the second biggest value in d, 0.1, 6/7, -0.3, -2? 0.1 Let a = 3.512 - 13.512. What is the third smallest value in a, 4, 2/11? 4 Let z = -15073 + 15073.3. Which is the second biggest value? (a) -1 (b) -4/7 (c) 1 (d) z (e) -13 d Let i = -37 + 70. Let z = i + -33. Let t be (1 - z) + 0 + 2 - -1. Which is the third smallest value? (a) 0.3 (b) t (c) 5 (d) 0.1 b Let g = -339/2813 - -5/97. Which is the fifth biggest value? (a) g (b) 5 (c) 2 (d) 2/3 (e) -1 e Let m = -6.054 - -6.58. Let o = m - 0.546. Let z be 1/(-1 + -1)1. What is the second smallest value in 0.2, z, o? o Let x = -112.7 + 118. Let o = 5 - x. Suppose -487h = -506h + 57. Which is the third smallest value? (a) -1 (b) h (c) o (d) -14 c Let k be 3/(-2) - (-1960)/1470. Let i = -5 - -4.92. Let t = i - -1.08. What is the second biggest value in t, k, 2? t Let f(k) = -k3 + 12k*2 - 15k + 41. Let r be f(11). Which is the second biggest value? (a) 2/29 (b) 19 (c) r a Let k = 14643 + -219644/15. What is the second biggest value in -3/5, k, 3? k Let r = 1517.4 + -1517.4. Which is the second smallest value? (a) -45/7 (b) r (c) -1.3 c Let t = -396 - -392.34. Let q = t - -2.66. What is the biggest value in 0.3, q, -1.5, 5? 5 Let f = -0.01 - -52.01. Let m = f + -25. Let k = -28 + m. What is the biggest value in -1/7, -2/13, k? -1/7 Let l be -5 + 4 + 3 + -3. Let k be l/(7 - 66/9). What is the biggest value in -0.5, k, -36? k Let v = -6986 - -6991. Which is the smallest value? (a) 0.1 (b) -0.082 (c) v (d) 2 b Let z be -32/(-180) + (-2)/12. Let j = 61/105 - -3/35. Let u = 3/256 - -247/768. Which is the third smallest value? (a) z (b) -5 (c) u (d) j c Suppose -i - 11 = -9, 0 = 2r - 5i - 22. Suppose 2174a - 2170a + 8 = 0. What is the second biggest value in -1, r, a? -1 Let m = 5.57 + -5.17. What is the second smallest value in 0, 2, 27, -4, m? 0 Suppose 2 = 4q - 18, 4c - 3q + 39 = 0. What is the biggest value in -3, -0.05, c, 2/3, 0.4? 2/3 Let x = -22/15 + 83/60. Which is the smallest value? (a) -0.5 (b) x (c) 1.5 a Let b = -3.89 - -4.09. Let r = -0.071 - -4.071. What is the third smallest value in -1/2, r, 2, b? 2 Let u be -1((-15)/(-18))/5. Let c be (-18812)/(-78) - 11/((-286)/4). Let o = -240 + c. What is the third biggest value in u, o, -2/3? -2/3 Suppose -127 = 2n + u, n = 6n - 3u + 312. Let w be ((-1)/(-3))/(7/n). Let a = 24.096 - 24.096. What is the biggest value in a, 2/17, w? 2/17 Let n(y) = y*2 - y + 6. Let m be n(0). Let o be 23 - ((-9)/3 + m). Let l be (-4)/o - 4 - -4. What is the third smallest value in -0.5, 0, l? 0 Let g = -4/51 + 83/408. Suppose -17q + 107 = -97. Which is the smallest value? (a) g (b) q (c) 6 a Let q = 0.57 + -3.57. Which is the third biggest value? (a) 0.5 (b) -24 (c) 1/4 (d) q (e) 22 c Suppose 12 = 12i - 6i. Let w = i + -7/2. What is the third smallest value in -6, w, 1/3? 1/3 Let f = -87 - -67. Let u = 0 - 0.1. Let h(m) = -m*3 + 42m*2 - 218m + 73. Let q be h(36). What is the biggest value in q, f, u? q Let s = -27.01 + 32.01. Which is the third biggest value? (a) 38 (b) -3 (c) s (d) -2 d Let p be 456/126 + (-8)/28. Let o = 5.13291 - 0.13291. What is the fourth smallest value in -3, p, -7, o? o Let f = 5.2 + -5. Let y be (49/14)/(3/6). Suppose ys + 57 - 29 = 0. Which is the third smallest value? (a) -6 (b) f (c) s b Suppose -5r + 5z = 15, -z + 12 = 2r + 3z. Let s be ((-6)/(-1 + r) - 5)-4. What is the biggest value in s, -10, -2/7, -5? -2/7 Suppose 4y - r = -52, 4y + 2r + 65 = -y. Let u be (1/y)/(-3(-5)/(-30)). Let l = -26/5 + 27/5. What is the third biggest value in u, -1, l? -1 Suppose 0 = -1956l + 1955l + 2u + 14, -u - 14 = -4l. Which is the fifth biggest value? (a) -5 (b) 48/11 (c) 5 (d) l (e) -2 a Suppose -42v - 81v + 693 = -24v. What is the third biggest value in -0.1, v, -2, -0.2, -1/17? -0.1 Let p(w) = -10w*3 + 2963w*2 - 889w + 297. Let t be p(296). Let r = 11 + -17. Let j = r + 6.3. What is the fourth biggest value in 2/21, j, t, 0? 0 Let n = -34.95 - -34.95. Which is the second smallest value? (a) 7 (b) n (c) 2/7 (d) -7 b Let v = 235 - 5. Let l = -1144/5 + v. Let x = -19365 + 19362. Which is the biggest value? (a) -3/2 (b) l (c) x b Let w = -604.105 + 604. Let p = w + 0.038. Which is the third smallest value? (a) p (b) -0.5 (c) 1 c Let w(l) = 5l - 47 + l - 14l - 5l. Let v be w(-4). What is the second biggest value in v, -1/3, 1? 1 Let f = -0.28 + 157.28. Let s = f - 157.3. Let u = -0.05 + 4.05. Which is the third biggest value? (a) u (b) -5/3 (c) s b Let s(y) = -3y*3 + 68y*2 - 45y + 28. Let p be s(22). Which is the third smallest value? (a) 8 (b) 2 (c) p a Let c(q) = q*3 - 18q*2 + 32q + 6. Let n be c(16). Let p be -41/(-5)n/8. What is the second smallest value in -0.9, p, -0.5, 2/9? -0.5 Let l = 4.135 + -6.135. Which is the smallest value? (a) 0.2163 (b) -1 (c) l c Let p = -136 - -140. Let j = -0.829 - 8.951. Let t = j - 0.22. Which is the third smallest value? (a) p (b) t (c) -1 a Let l = -424 + 2124/5. Let d = -7 - -11. Which is the smallest value? (a) d (b) l (c) 1/3 c Let j = 113279/6 + -18824. Let h = -56 + j. Which is the third biggest value? (a) 1 (b) -2/11 (c) h (d) -4 b Let i = 3.649 - 3.449. What is the smallest value in i, -3, 5, 4? -3 Let n be (-1)/252-164 + 8. Let s = -59/7 + n. What is the third biggest value in -5/3, 4, s, 2? s Suppose -6w - 5d = 30, -3w + d = 1122 - 1128. What is the smallest value in -0.3, 0.1, 5/2, w, 1.4? -0.3 Suppose -470o + 12 = 12. What is the third biggest value in 6/11, 1/6, o, -5, -2? o Let n be 1 + -1 + 2/(-6). Let s be 55450/(-23289) - 2/6-5. Which is the fourth smallest value? (a) s (b) 2/5 (c) n (d) 0 b Let f = -0.0535 - -4.4585. Let i = 0.405 - f. Which is the fourth biggest value? (a) i (b) -2/7 (c) 4/5 (d) -16 d Let w be 2/5 + 632/(-5). Let s = 39588 + -276235/7. Let m = s + w. Which is the smallest value? (a) m (b) -0.4 (c) -8/13 c Let g = -1 + 1.01. Let t = 1945/2769 + -33/923. What is the fourth biggest value in 0.5, 1, t, g? g Let i = -2.9762 + 0.9762. Which is the second biggest value? (a) 1 (b) -0.2 (c) i (d) 0.92 d Let m be (-4)/(-3)3/(-14). Let p = 65.4 - 69. Let t = p - -3. Which is the second biggest value? (a) m (b) -1/3 (c) t b Let p = -6817/2 - -3410. Which is the third smallest value? (a) -36 (b) p (c) 0 b Let u = -10 + 11. Let l = -0.201 - -133.201. Let i = l + -132.6. Which is the second biggest value? (a) u (b) i (c) -2/5 (d) -11 b Let k = -114.3 + 110.8. Which is the biggest value? (a) 3 (b) 0.08 (c) 4 (d) k c Let k be (4 - 44/12) + -1 + 1. Let u = 779.7 - 779. Which is the third smallest value? (a) -4/7 (b) u (c) k b Suppose 0 = -4105i + 4082*i - 69. Which is the second smallest value? (a) i (b) 69 (c) -4 a Let f = 3701 - 3700.8. What is the third smallest value in -14/3, 0.4, f, 5? 0.4 Let i = 78962/19 - 4156. Let s = -1.1 - 3.9. Which is the third sm	{ "pile_set_name": "DM Mathematics" }
value in 11/3, 0, m, -0.4? 11/3 Let b = -407/274 - 2/137. Suppose 5n - 6 = 9. Suppose 0 = -0m + m + n. What is the second smallest value in m, b, 4? b Let p = 0 - -3. Suppose -2m + 4w + w = -8, 3m - 12 = -pw. Let y be (-8)/120 + m/10. Which is the biggest value? (a) y (b) -3/8 (c) 0.4 c Let i = -19 - -15. What is the second smallest value in 0.3, i, -6? i Let r be 6/2 + (-6)/1. Let y be (-2)/r + 26/6. Which is the second biggest value? (a) y (b) -4 (c) 0.1 c Let h = 0.09 - 0.06. Let a = h + 0.27. Let f = a - 0.5. What is the smallest value in f, 0, -2/17? f Let c = -47 - -49. Let f = 0 - 0.5. What is the third smallest value in -4/5, c, f? c Let b = -0.2 - -0.3. Let y be (18/88)/(21/(-56)). What is the third biggest value in y, b, 4? y Let f be ((-64)/36 + 2)/(4/6). Which is the smallest value? (a) f (b) 0.05 (c) -1/2 c Let s = 0.24 + -1.24. Let i(v) = -2v2 - 1. Let f be i(2). What is the third smallest value in s, f, -2/3? -2/3 Let q = -11 - -10. Let a = -9 + 14. Suppose 3k + 10 = -a. What is the third biggest value in k, q, -0.5? k Let m = 8 + -14. Let r = 16 + m. Let q = -14 + r. What is the biggest value in 0, q, 0.2? 0.2 Let d be -1 - (2 + 46/(-14)). Let v = -65 + 65.3. Which is the biggest value? (a) d (b) v (c) 1/6 b Let a = -65 - -58.6. Let p = -7 - a. Let i = 0.1 + p. What is the third smallest value in -1/3, i, 0? 0 Let p = 257/9 - 85/3. What is the third smallest value in 1/2, p, -3/2, -2/7? p Let r be -3 - (-2 - (38/10 + -3)). Let k be ((-25)/(-6))/(-5) - -1. Let o = -8 + 8.3. What is the smallest value in o, k, r? r Suppose 0 = 2i - 6 + 14. Let s = 124 - 622/5. Which is the second smallest value? (a) s (b) i (c) 0.4 a Let m(i) = i2 + 8i - 4. Let a be m(-8). What is the third smallest value in -1, a, 0.1? 0.1 Let t = -2 - -1. Let g = -4 + 5. Let d = g + -1. Which is the second smallest value? (a) -1/12 (b) d (c) t a Let o = -9.5 + 10. Let l = -1.8 + 2. Let k = 0.1 - l. Which is the biggest value? (a) o (b) k (c) -0.5 a Let k = 16 + -11. Let m = -0.03 - 0.37. Suppose -3j = -3, -4d + 2d = 2j + 6. Which is the second smallest value? (a) m (b) k (c) d a Let z be 3(-2)/(-24)-6. Let f = -1 + 1.06. Let l = -2.06 + f. What is the smallest value in 0, l, z? l Let y = 10/9 + -25/9. Let t = 0.52 + -0.08. Let m = -0.06 - t. Which is the second smallest value? (a) -2/3 (b) y (c) m a Let y = 9/44 + 1/22. Which is the fourth biggest value? (a) -1 (b) -1/3 (c) 0.01 (d) y a Let u(b) = -b*3 - 9b*2 - 14b - 9. Let p be u(-7). What is the second biggest value in p, 1, 0.1? 0.1 Let x = 0 + -5. Let r = x - -4.7. Which is the second smallest value? (a) r (b) -2/21 (c) -1 a Let t = -0.05 + 0.35. Let p = 8 - 12. Which is the smallest value? (a) -1 (b) p (c) t b Let l = -66.66 - -66. Let u = l - -0.16. What is the third smallest value in -9/5, u, 3? 3 Let q = -0.1 + 0. Let f = q + 1.1. Let c = 0.9 - f. What is the second biggest value in c, 2/7, -2? c Let y = 0.11 - -0.09. Let r = -0.05 + y. Let x = 0.05 + r. What is the second smallest value in 0.3, x, -2/11? x Let f = -24.04 - -24. Which is the second smallest value? (a) 1/2 (b) f (c) -2/5 b Let l = 28/3 + -115/12. Let y = -6 - -4. What is the third smallest value in y, -0.2, l? -0.2 Let q = 73 + -73.1. Which is the second smallest value? (a) -0.4 (b) q (c) -2 a Let v = 0.2 - 0.4. Let z = 801.11 - 797. Let h = z - 0.11. What is the third biggest value in v, 2/13, h? v Let o = 5.75 - 5.85. Suppose -3y - 9 = 3i - 3, y = 5i + 22. Suppose -2z = yz - 20. What is the second smallest value in o, -2/9, z? o Suppose -23 = -4j - 3. Suppose jg = 4z + 4 + 18, 5z + 19 = 2g. What is the smallest value in -4/9, 1, g? -4/9 Let f be 5/45(3 + 1). Which is the biggest value? (a) 2 (b) f (c) -0.3 (d) -3/2 a Let h = -100 + 103. Let l = -6/5 - -3/5. Which is the third smallest value? (a) -5 (b) h (c) l b Let m be (-8)/20 - 8/(-20). Let y be -6((-2)/4 - -1). Which is the smallest value? (a) m (b) 2 (c) y c Let i be (-24)/10 - (-2)/5. Let h be (-24/6)/i. Let z = -139 + 140. Which is the second smallest value? (a) -2 (b) h (c) z b Let r = 18.8 + -19. Which is the third biggest value? (a) -0.1 (b) -11 (c) r b Let s = 5 + -4. Let n be 2 - (-2 + 2 + 1). Let o be 5/2 + 0/n. Which is the third smallest value? (a) o (b) 2 (c) s a Let w = -1.2 + -6.8. Let q = w + 7.6. Which is the biggest value? (a) -0.2 (b) q (c) 0 c Let j be (8 - 1) + -1 + 2. Suppose -3k - 2h + 0h = -j, -h + 6 = 2k. What is the third smallest value in k, -0.1, 0? k Let x = 0.11 - 0.22. Let n = x - 0.29. Which is the second smallest value? (a) n (b) -2 (c) -1/7 a Let g = 6.1 + -6.6. What is the second smallest value in g, 1, 0? 0 Suppose 13s - 24 = 5s. Let m be (-21)/27 + (1 - 0). Which is the third smallest value? (a) s (b) m (c) 4 c Let x = -26 - -26.1. What is the second biggest value in 2/15, x, -4? x Let m = -0.01 + 8.01. Let a = 19 - m. Let r = a - 6. What is the third biggest value in 0, r, 0.1? 0 Let h be 1 + (-64)/4 + 5. Which is the third smallest value? (a) 1/11 (b) 3/4 (c) -2 (d) h a Let m = -4 + 1. Let z = -0.1 + -3.9. What is the biggest value in -0.3, m, z? -0.3 Let z = 39 + -43. What is the second smallest value in 0.2, 2/5, z? 0.2 Let j = 62.2 - 62. Let m = 354/455 - -2/91. What is the third smallest value in 0, j, m? m Let m be -9(1 - (-16)/(-12)). What is the third biggest value in m, -3, 0.2? -3 Let f = 23.2 - 23. Which is the biggest value? (a) 2/15 (b) 0.1 (c) f (d) -0.3 c Let v be -1 - (1 + 14/(-8)). Which is the second biggest value? (a) 1/2 (b) -4 (c) v c Let n = 757 + -753. Let f = 4 + -3. Which is the third biggest value? (a) 0 (b) f (c) n a Let s = -3.5 + 3. Let p = -13 + 11. Suppose 16 = 5m - 9. Which is the third smallest value? (a) p (b) m (c) s b Let n = 15 - -23. Let p = n + -73/2. Which is the smallest value? (a) 2/19 (b) p (c) 4 a Let d be 2/(-8) - (-4)/(-48). What is the smallest value in -10, -4, d? -10 Let k = -4/25 - 1/25. What is the smallest value in -1/2, -6, k? -6 Let n = -13 + 14.1. Let b = n + -1.6. What is the third biggest value in -3/5, b, 0.4? -3/5 Let u = -0.2 + 0.1. Let t be 1/(1/(-191)) - 3. Let k = t - -1356/7. Which is the smallest value? (a) u (b) -0.3 (c) k b Let p be 121/4 - 10/6. Which is the third smallest value? (a) -5 (b) 0 (c) p c Let i be -2 + (4 - (-3 - 1)). Which is the second smallest value? (a) i (b) 2/3 (c) 0.2 b Let h = 0.06 - 0.03. Let x = h - 2.03. Let z = -4/9 - -2/3. Which is the smallest value? (a) x (b) z (c) -4/3 a Let j = 88.6 + -89. Let o be (-5)/(-6)(-3)/(-10). What is the smallest value in 2/7, j, o? j Let a = -379.98 + 374. Let r = a - 0.02. Let w = -10 - r. What is the third biggest value in -3, w, 0.5? w Let s = -0.7 + 0.4. Let z = -30 + 29.8. Let k be 2 + -3 + 0 + 3. What is the second biggest value in z, s, k? z Let x be (-2)/51/(-2). Let i = 0.02 + 0.68. Let m = -0.4 + i. Which is the second smallest value? (a) x (b) -3/2 (c) m a Let l = -33/26 - 42/13. What is the third smallest value in -5, l, 5? 5 Suppose 0 = -5c - 2w + 23, 0c + 5w = 3c - 20. Let u = -3.2 + 3. Let t = u + 0.6. What is the third biggest value in c, t, -1? -1 Suppose 4t - 44 = 3q + 27, 2t + 5q - 29 = 0. Let y = 33/2 - t. What is the biggest value in y, -1/4, -0.3? -1/4 Let q = 1 + 1. Suppose 0g + 3g + 16 = 4n, -4n - g + 16 = 0. Let r = 0 - -0.1. Which is the third smallest value? (a) r (b) q (c) n c Let n = 115 + -110. Which is the smallest value? (a) 0.4 (b) 9 (c) n a Let z = 95 + -53. Let m be (-7314)/z - (-1)/7. Let u = m + 527/3. Which is the third smallest value? (a) u (b) 3 (c) 4 c Let q be -3 - -3(-46)/(-42). Let k(v) = v*2 + 5. Let r be k(0). Let c = 3 - 2. What is the smallest value in q, r, c? q Let j = -0.088 + -3.912. Which is the second smallest value? (a) 0.3 (b) -3 (c) j b Let s = -135 - -135. Which is the third smallest value? (a) s (b) 1/4 (c) -14/3 b Let t = 7 - 2. Let z = -135 - -947/7. Suppose i - 4 = -5f, 7f + 4i = 2*f + 16. Which is the biggest value? (a) z (b) f (c) t c Let k = 1.1 - 1.4. Which is the third biggest value? (a) k (b) 1 (c) 0.2 a Let k = -0.48 + 0.58. Which is the biggest value? (a) 0.	{ "pile_set_name": "DM Mathematics" }
st ten thousand. -5640000 What is 477.882591 rounded to the nearest integer? 478 What is -224.627295 rounded to 0 decimal places? -225 What is 8.66478906 rounded to 4 dps? 8.6648 Round -0.03040964203 to three dps. -0.03 Round 2023.599412 to the nearest 100. 2000 What is 1.08482676 rounded to 1 dp? 1.1 What is -2986.986246 rounded to the nearest 100? -3000 What is -38406.641 rounded to the nearest 10000? -40000 Round 2.176386 to two decimal places. 2.18 Round 1230.22878 to 0 decimal places. 1230 What is -3438.175637 rounded to the nearest integer? -3438 Round 0.00270687468 to 5 dps. 0.00271 Round -70.5880999 to 0 decimal places. -71 Round 352641613 to the nearest ten thousand. 352640000 Round -0.000008500117 to six decimal places. -0.000009 Round -4887.609659 to the nearest one thousand. -5000 Round 736037180 to the nearest one hundred thousand. 736000000 Round 115.751452 to the nearest 100. 100 Round 1267.524027 to the nearest 10. 1270 Round 429.45092 to the nearest one hundred. 400 Round -1481602596 to the nearest 1000000. -1482000000 What is 65916174.4 rounded to the nearest 1000000? 66000000 What is -0.1496472747 rounded to 2 dps? -0.15 Round 16.4237225 to zero decimal places. 16 Round 180.17772 to the nearest 10. 180 Round 3241.8862 to the nearest integer. 3242 What is 10778.029864 rounded to the nearest one thousand? 11000 Round -8137548 to the nearest 1000000. -8000000 Round 50946093.39 to the nearest 100000. 50900000 What is 0.0632460848 rounded to 5 decimal places? 0.06325 Round 15.89424889 to zero decimal places. 16 What is -1.388719373 rounded to 3 decimal places? -1.389 What is 15564119300 rounded to the nearest 1000000? 15564000000 Round 20440791.99 to the nearest one hundred thousand. 20400000 Round -75944253.9 to the nearest 100000. -75900000 Round 0.069004196 to 4 decimal places. 0.069 What is -0.00000069609846 rounded to six decimal places? -0.000001 What is 0.4329682509 rounded to 3 dps? 0.433 Round -12698023690 to the nearest one hundred thousand. -12698000000 Round -30.6131996 to three decimal places. -30.613 What is -0.0000308339776 rounded to 7 dps? -0.0000308 What is -7.495705 rounded to one decimal place? -7.5 What is 3569491.5 rounded to the nearest 10000? 3570000 What is -0.00005233451 rounded to five dps? -0.00005 What is -0.00000502674749 rounded to 6 dps? -0.000005 What is 0.630704714 rounded to 4 decimal places? 0.6307 Round -0.00000065566423 to seven dps. -0.0000007 What is -2113244220 rounded to the nearest 1000000? -2113000000 Round 2.915615 to 1 dp. 2.9 Round 4939207600 to the nearest 100000. 4939200000 What is -0.6668827 rounded to four dps? -0.6669 Round -0.00000046489056 to 7 decimal places. -0.0000005 Round 1.027378895 to 2 decimal places. 1.03 What is 2567.9697792 rounded to the nearest 100? 2600 What is 72.333069 rounded to 1 decimal place? 72.3 Round 1208120143 to the nearest one million. 1208000000 What is 124.276306 rounded to the nearest integer? 124 What is 2260575000 rounded to the nearest one hundred thousand? 2260600000 Round 7977.8037 to zero decimal places. 7978 What is -0.000012037291 rounded to 7 dps? -0.000012 Round 2577604.477 to the nearest 1000. 2578000 What is -0.003294507543 rounded to 3 dps? -0.003 What is 0.0076614606 rounded to three dps? 0.008 What is 56.365368 rounded to two dps? 56.37 What is 0.006578032944 rounded to four dps? 0.0066 What is -2.1193222 rounded to 2 decimal places? -2.12 Round 0.012579103169 to seven dps. 0.0125791 What is 0.0000451693897 rounded to seven decimal places? 0.0000452 Round -0.1260744405 to five dps. -0.12607 Round -3403744.415 to the nearest 1000. -3404000 Round -0.00080400574 to six dps. -0.000804 What is -0.00000010963559 rounded to 7 dps? -0.0000001 What is 596.5863376 rounded to the nearest integer? 597 What is -11300289 rounded to the nearest 1000000? -11000000 What is 1726.89526 rounded to the nearest 100? 1700 What is 0.00048373316 rounded to six dps? 0.000484 Round -355.560278 to zero decimal places. -356 What is -1111260400 rounded to the nearest 100000? -1111300000 What is -0.12875071473 rounded to 6 dps? -0.128751 What is -0.000002356098834 rounded to seven dps? -0.0000024 What is 26.0184004 rounded to three decimal places? 26.018 What is 0.023037648303 rounded to three dps? 0.023 What is -2882.0561 rounded to the nearest 1000? -3000 What is 413.53911 rounded to one decimal place? 413.5 What is -128.9368602 rounded to zero dps? -129 Round 688542180 to the nearest 100000. 688500000 Round -4424566.74 to the nearest one million. -4000000 Round 11975828.7 to the nearest one thousand. 11976000 Round -0.00817377266 to five decimal places. -0.00817 Round -20110722 to the nearest one thousand. -20111000 Round -478.392035 to 1 dp. -478.4 Round -55.703455 to zero decimal places. -56 What is -25819641.9 rounded to the nearest one hundred thousand? -25800000 Round -0.063558918 to four dps. -0.0636 What is -5.77454684 rounded to one dp? -5.8 Round 0.001804307311 to 5 decimal places. 0.0018 What is 80270.304 rounded to the nearest 1000? 80000 Round 77553.67 to the nearest one thousand. 78000 Round 102.8240475 to two decimal places. 102.82 What is -0.00121551228 rounded to 5 decimal places? -0.00122 Round 0.000000201207504 to 7 dps. 0.0000002 Round -1.6312092 to the nearest ten. 0 What is -45.29116953 rounded to the nearest integer? -45 What is 0.00283850634 rounded to 7 decimal places? 0.0028385 What is 613416.62 rounded to the nearest ten thousand? 610000 What is 1.7606707 rounded to 2 dps? 1.76 Round 1558345.242 to the nearest one million. 2000000 Round 2.283911294 to 5 decimal places. 2.28391 What is 0.0149708352 rounded to 4 decimal places? 0.015 What is 949630696 rounded to the nearest 100000? 949600000 What is 37019.2523 rounded to the nearest 100? 37000 Round -1097.954251 to 2 decimal places. -1097.95 What is -151218750 rounded to the nearest 100000? -151200000 What is -926691.4867 rounded to the nearest one thousand? -927000 Round -0.0018043743331 to 6 dps. -0.001804 What is -38719.1074 rounded to the nearest 100? -38700 Round 50.5304167 to 0 decimal places. 51 What is -0.00005836503 rounded to 7 decimal places? -0.0000584 Round -3656.191 to the nearest ten. -3660 Round 184422.3984 to the nearest ten thousand. 180000 Round 1281.35977 to the nearest one hundred. 1300 Round -22848855.04 to the nearest one thousand. -22849000 Round 3112.023705 to 1 decimal place. 3112 What is 143806080 rounded to the nearest 1000000? 144000000 Round 0.0010337476075 to 5 decimal places. 0.00103 Round -272456.815 to the nearest one thousand. -272000 Round -27554.7478 to the nearest integer. -27555 What is -0.0000268629878 rounded to 7 dps? -0.0000269 What is -0.0001087104347 rounded to seven dps? -0.0001087 What is 0.0340994042 rounded to three decimal places? 0.034 Round 2046.234394 to zero dps. 2046 What is 1.071805601 rounded to 3 decimal places? 1.072 Round -84.9997158 to zero dps. -85 Round 0.0001860176396 to seven dps. 0.000186 What is 0.006080709635 rounded to 4 dps? 0.0061 Round -31109205.95 to the nearest 100000. -31100000 Round -0.03597194 to one decimal place. 0 What is 0.0000218229366 rounded to six decimal places? 0.000022 Round 1657.750402 to the nearest 10. 1660 What is -0.045205155 rounded to five dps? -0.04521 What is 0.05071367163 rounded to 3 decimal places? 0.051 Round 0.000047225256 to 6 decimal places. 0.000047 What is 0.995746835 rounded to 3 dps? 0.996 What is -1278.70074 rounded to the nearest integer? -1279 Round 9354260.06 to the nearest 1000000. 9000000 What is -0.000120486238 rounded to 5 decimal places? -0.00012 Round -0.00093869575 to 6 decimal places. -0.000939 Round 0.000083084105 to 5 dps. 0.00008 Round 246.5218465 to the nearest ten. 250 What is 0.00020967743 rounded to 7 decimal places? 0.0002097 Round -0.092829878 to 3 dps. -0.093 What is -19599506260 rounded to the nearest one million? -19600000000 What is -0.00857034 rounded to 4 decimal places? -0.0086 Round 37944.4951 to the nearest integer. 37944 What is 827354.364 rounded to the nearest 100? 827400 Round -23888.98309 to the nearest 100. -23900 What is -22620.4864 rounded to the nearest 100? -22600 What is -783.592578 rounded to the nearest 10? -780 What is 23712217700 ro	{ "pile_set_name": "DM Mathematics" }
ing o is positive. o(-795/56) Simplify (u(-23/5)u)(5/13)/(u(-2/85)uu/u(-14)) assuming u is positive. u(-19184/1105) Simplify ((u(-1/3))(-4/3)/(u0)(-35))/((u(-2/21)u6)/(u(-2/3)/u(-2))) assuming u is positive. u(-260/63) Simplify ((rr/(rr/(r/(r/(r/((r*(-4)r)/rr))))r))/(r/r(-4)))(19/2)/(r/r*(-7)(rr(-2/3)r)/r(rr*(-1/5))/(rr(-1)/r)) assuming r is positive. r(-437/15) Simplify ((s*(-2/9)s*4)/((sss/(ss*(-1/5)s))/ss((s/s(9/5))/s)/s))(5/4) assuming s is positive. s(121/18) Simplify ((h/((h(-13)/h)/h))*(-1/45)/(h/((hh*(-7)h)/h))18)(1/19) assuming h is positive. h(-5686/855) Simplify (j/j(2/7))*(-43)(j1)(2/3)((j/(j/(jj(1/3))))(20/9))(-43) assuming j is positive. j(-29759/189) Simplify (g*(-6/11)g(g(-1/3)g)/g)*(-21)/(((gg/(g/(g(g(-3/5)g)/g)g)g)/(gg(-3/7)))/(g/((g/(g/(g1/gg)))/g))10) assuming g is positive. g(2551/385) Simplify (s0)40(s2s)/((ss(-1)s)/s)s(1/6)ss(2/19)s*7s(-1) assuming s is positive. s(1171/114) Simplify (n*(-19)/(n/(nn*(2/53)/nnn)n)(nn/(n/n(-9)))21)21 assuming n is positive. n(-208089/53) Simplify (j*(-17)j*(-27)(j/(j*(2/109)/jj))/(j*(-14/9)j))(1/39) assuming j is positive. j(-41656/38259) Simplify ((mm(-1/3)m)/m(-13))(-12)(m1)(-4/3)/(m(-4/7)mm/m(7/2)) assuming m is positive. m(-7361/42) Simplify (u0uu(2/5))(-25/6)/((u/(u/(u/u0)u))*(-1/30)/(uu(u(-1/4)/u)/uu)(-10/3)) assuming u is positive. u(-25/3) Simplify (r/(r/(r/r*(-2/13)))r*3)/(((rr2)/r)/r(1/3))rr*2rr(-4/5)(r3/r)/(r(4/9)r) assuming r is positive. r(3652/585) Simplify (((ccc(-4)/c((c/(c*(-8/5)cc))/c)/c)(-19))(-15/2))33 assuming c is positive. c(-20691) Simplify (((q(qq30)/qq)/q37)(18/7))(6/11) assuming q is positive. q(-540/77) Simplify (((y*(-23)y)/y*(-3/8))/((y((((y*(-26)y)/y)/y)/y)/y)/(y*(2/17)y)))(-9/8) assuming y is positive. y(-9171/1088) Simplify ((v(2/5))(-18/11)(vv(-4))/(v/(v/v(-7)v)))/(((v/(v0/v)v)/v)(-31/3))7 assuming v is positive. v(24587/165) Simplify ((o(-2/55)o(-19/5))/(((o/o(5/4))/o)/o(1/5)))(-2/5) assuming o is positive. o(21/22) Simplify (f((ff14f)/fff)/ff(-2/11)f)*37/(((f/(ff/(f*(-9)/f)f))/ff(f(f(-1)f)/f)/f)/(f*(-2/5)f(-7/2)/f)) assuming f is positive. f(73411/110) Simplify (c(-2/3))(22/3)/((c/(cc/(c/c(-8))))/c(2/5))((c/(c*0c))/(c/c(6/5)))(-42) assuming c is positive. c(-188/9) Simplify ((g/g2)/gg(2/17)/g(g0)(-25/4))/(((g/(g/(g/(g*(-3/4)/g)))g)/g)/ggg*(-2/7)g*(2/5)g(2/17)) assuming g is positive. g(-821/140) Simplify ((f/(f*(-1/14)/f)f/(((ff(1/3)/ff)/f)/f))/((f29/f)/f(1/3)))(29/5) assuming f is positive. f(-1943/14) Simplify ((j/j*(-29/3)j*33j)/((((j*31j)/j)/j)/(j*17j)))(-34) assuming j is positive. j(-3332/3) Simplify ((bb/b(-9/7))/(bb(-8)))(-44)((b3)(-3))(-18/11) assuming b is positive. b(-33714/77) Simplify (gg/g3)/(g(2/15)g)(g*(-6)g)/g*(-4)((g*4g)/(gg3))/(g4g/g(-2/13)) assuming g is positive. g(-1421/195) Simplify (d*(-2/7)/ddd(1/4)dd(-18)(d*1/ddd)/d)(-1/27) assuming d is positive. d(449/756) Simplify (mm/((m*5/m)/m)mm/(mmm/(mm*(1/11)/m)m))19/(m1(m(mmm*(-1/5)m)/m)/m)(-7) assuming m is positive. m(-1962/55) Simplify ((i*(-9)ii(17/3))/((i(-4)/i)/iiii((i(ii20/i)/i)/i)/iii))(-1/4) assuming i is positive. i(29/6) Simplify ((k/(k/(k(kk(2/75)k)/k)))*(-20)(k/k(1/23))(-46))(-47) assuming k is positive. k(59596/15) Simplify ((((ss/s(-1))(-39))(-29/3))38)(-28) assuming s is positive. s(-1203384) Simplify ((m(5/6))(-5)/(mmm(-4)mm(-2/7)/m))(-5) assuming m is positive. m(395/42) Simplify (((r/(rr*(-31)))/rr(r/(r/(rr/r*27)))/rrr)/(r/((r((r/(r*(4/3)r))/r)/r)/r)r)(-3/26))(-2/59) assuming r is positive. r(-198/767) Simplify (m24m)*(-45)m(-4)/m(-33) assuming m is positive. m*(-1096) Simplify ((g/(g/((((gg*5g)/gg)/g)/g)))/g(-4/3)g*(-2)/gg((g/g5)/g)/g)/(g(-2)g(-1))(-46) assuming g is positive. g(-419/3) Simplify ((u(2/7)u/u(-3))/((u(-2/3)/u)/u(2/7)))/(uu/u*(3/2)uu5)(-2/37) assuming u is positive. u(5120/777) Simplify ((q/((qqq28)/qq))/(qq18/q)q/q*(-1/13)(q((qq*(-8)/q)/q)/qq)/q)(-1/20) assuming q is positive. q(357/130) Simplify ((n(-1/2))(-3/32)((n0n)/n)*(3/14))/((nn*1n)*39(n(1/2))(-34/3)) assuming n is positive. n(-21367/192) Simplify (((i(-9)/i)/(i/(i/(i*(-2)i))))/(i(-14)/(i/(i(2/5)i))))(-1/17) assuming i is positive. i(-23/85) Simplify (d(-4/7)d/d(-1/3))/(d(-1/3)/dd7/d)(d/((dd/(d(-2)/d))/d))(-4/13)/(dd/(dd(-2)d))(1/8) assuming d is positive. d(-3529/1092) Simplify ((a(a(a(aa/a(-1/3))/a)/a)/a)/a)(-4/21)/(((aa(-1))/aaa)/(aa*(-8)))(a*4a(-2/17))(-2/27) assuming a is positive. a*(-9148/1071) Simplify ((oo(2/5))(-15/7)o(-2/9)o0)/(((o(-1)/o)/o)*15/(o((oo(2/9))/o)/o)(20/7)) assuming o is positive. o(2672/63) Simplify (z(3/14)/(z(1/3)z))/(z/(z/(z/z*(-7)z)))5 assuming z is positive. z(-1937/42) Simplify (((n/((n*(-5)/nn)/n))/((n(1/12)/n)/n))/(n/n5n/((n0n)/n)))(-49) assuming n is positive. n(-7007/12) Simplify ((rr0/r)/(r(-3/7)r))41/(((r/(((r(2/13)r)/rr)/r))/(r*2r))/(r0)12) assuming r is positive. r(-1936/91) Simplify (x(-10)x10/x)(16/11)x5/(((x/(x/x(-2/9))x)/x)/x)x*(-4)xx(-6) assuming x is positive. x(-419/99) Simplify ((i/(iii(1/23)i)ii(-30))/((i/(i(2/21)/i))/(i/(i/(i*(-1/15)/ii)))))(-3/7) assuming i is positive. i(79731/5635) Simplify (v*(2/75)/v)/(vv/v*(21/5)v)v(-2/21)/(v/(v/(vv/(v/(v/(v*34/v)vv)v)))) assuming v is positive. v*(5273/175) Simplify (((aaaa*(-3/2)a)/aaa)(-4)/(a6aaa(-3)a))13 assuming a is positive. a(-260) Simplify (w(w(-12)w)/w)(-5/3)/((w(-1/5)w)/(w(2/13)ww)) assuming w is positive. w(3839/195) Simplify (w/w4ww(-2/5))/((w/w(-2))/ww)*39(w(-2))(-4)/((w/w*(5/6))/(ww*(-5)w)) assuming w is positive. w(-3437/30) Simplify (p(1/4)(pp3)/p)/((p/p1)/ppp/p*0)((p/(pp(-1)))16)3 assuming p is positive. p(201/4) Simplify ((((ff*(-2/17)ffff)/ff)/(ff/f(4/7)))/(f/(f(-1/7)f))(-7/3))(-13) assuming f is positive. f*(-17576/357) Simplify ((zz1)/z)/z(-4/5)(z(z*(-4/5)/z)/zzz)/z(2/15)(z(2/7))(3/7)(z(1/4))(-40) assuming z is positive. z(-5888/735) Simplify ((j/(j(2/5)j))*(2/35)/(jj/j*6j(1/4)))/(((j/j0)/j)11/(j7j/j3j)) assuming j is positive. j(6809/700) Simplify (l(-13)l31)/(l(4/9)/ll39) assuming l is positive. l(-184/9) Simplify ((s(ss/s*(-3))/s)/sss(-3/7)s(s(-1/3))(-39))/((s/s(2/9))/((ss*(-3))/ss))(-26) assuming s is positive. s(5720/63) Simplify (d(-2/13)/(d/((d/d(2/17)d)/d))d(-6)/d(-2/5))/((d0/d)(3/34)(d(-1))24) assuming d is positive. d(40259/2210) Simplify ((sss1/ss)33)(-44)(ss*(2/3)s)40/(((s/s3)/sss)/s(5/4)) assuming s is positive. s(-50965/12) Simplify ((h/(hhh/(hh(-8))h))*(-2/51)/((hh*(-25))/hh)39)(-44) assuming h is positive. h(-2101264/51) Simplify (r(4/15)/(r/(r*(-2/5)/r))(r/(r/(rrr(-6/5))))/r(-12))(1/9) assuming r is positive. r(32/27) Simplify ((t*0t)(-3))(-7/5)/((((t*0t)/tt)/(tt(-4)))/(t(2/5)t(-2/3))) assuming t is positive. t(-1/15) Simplify (((rr*(-11/3))/(rrr(-15)))/(rr(-1/3))16)(-8/3) assuming r is positive. r(8/9) Simplify (f(-1))13/(f/(f/(ff(ff0f)/f)))*(-43)(f/(((f/f0)/f)/f))(2/23)/(f4/(f/f(-3))) assuming f is positive. f(2672/23) Simplify ((w(-11)(ww*(-3)ww)/w(w/(w(ww/w*0ww)/w)ww)(3/13))(-1))(-19/5) assuming w is positive. w(-3021/65) Simplify ((m/(m7m))/m*(-8)mmm(mm*18)/mm/m(-1/10))(-5) assuming m is positive. m(-231/2) Simplify ((n(1/2)/nn/(nnnn/((nn8/n)/n))((n*(-2/11)n)/n)(2/97))(-1/26))*	{ "pile_set_name": "DM Mathematics" }
= 0 for u. -784, -4, 0 Solve s*4/6 + 73s*3/6 + 243s*2 + 1746s + 4140 = 0 for s. -46, -15, -6 Factor 200452i2 - 57216i - 16. 4(7i - 2)(7159i + 2) Solve -3i2/4 - 571395i/4 - 571389/2 = 0. -190463, -2 Determine i so that 162i4/5 - 1162926i*3/5 + 645956i*2/5 + 459384i/5 + 57424/5 = 0. -2/9, 1, 7178 Factor 2b2/15 - 486572b/15 + 29594038898/15. 2(b - 121643)2/15 Factor u4/6 - 8u*3 + 757u*2/6 - 745u + 4400/3. (u - 22)(u - 16)(u - 5)2/6 Determine c so that -c3/2 + 5491c2/2 - 5489c = 0. 0, 2, 5489 Suppose v*3/2 + 237v*2/2 - 185v - 98700 = 0. Calculate v. -235, -30, 28 Find j, given that -3j4 + 189j*3 - 1209j*2 + 1863j - 840 = 0. 1, 5, 56 Let -x*4/5 + 23684x*3/5 - 140256646x*2/5 + 280442244x/5 - 140209281/5 = 0. What is x? 1, 11841 Factor -93b2/7 + 300b/7 - 9. -3(b - 3)(31b - 7)/7 Find d, given that 6d*4/5 - 172d*3/5 - 686d*2/5 + 1492d/5 - 128 = 0. -5, 2/3, 1, 32 Factor -4u2 - 8u + 4092. -4(u - 31)(u + 33) Determine l so that l*5/4 + 12709l*4/4 - 420233l*3/4 + 3224083l*2/4 + 1137079l - 1841219 = 0. -12742, -2, 1, 17 Determine n, given that 100n5 - 2420n*4 + 22496n*3 - 98128n*2 + 190848n - 112896 = 0. 1, 28/5, 6 Let 9x5/8 - 177x*4/2 - 36x*3 + 2013x*2/4 + 279x/8 - 1659/4 = 0. What is x? -7/3, -1, 1, 2, 79 Let 2w3 + 269w*2/5 + 404w + 705 = 0. What is w? -15, -47/5, -5/2 Determine f so that -f*5 - 38485f*4 - 370254558f*3 + 370485482f*2 + 1851580703f + 1110879147 = 0. -19243, -1, 3 Determine u, given that -u*5/6 - 40u*4/3 + 593u*3/3 - 1064u*2/3 + 341u/2 = 0. -93, 0, 1, 11 Factor -3f3/7 + 13110f*2/7 - 14322675f/7. -3f(f - 2185)*2/7 Factor 2i*3/9 + 892i*2/9 + 28480i/3 + 260800. 2(i + 60)2(i + 326)/9 Factor 6h3 + 446h*2 + 2170h - 2622. 2(h - 1)(h + 69)(3h + 19) Determine b so that -4b3/5 - 11004b*2 - 220032b/5 - 220016/5 = 0. -13751, -2 Factor -5m2 - 36960m - 68302080. -5(m + 3696)2 Factor d2 + 390d - 5656. (d - 14)(d + 404) What is n in -3n*2/7 + 186n/7 + 3744/7 = 0? -16, 78 Solve -2g3 + 57766g*2 - 346542g + 519786 = 0. 3, 28877 Determine l so that 2l2 + 41108l + 211233458 = 0. -10277 Find b such that 2b5/7 + 26b*4 + 990b*3/7 - 2854b*2/7 - 3760b - 40800/7 = 0. -85, -4, -3, 5 Suppose -5q3/2 + 3283q*2/2 - 983q - 656 = 0. What is q? -2/5, 1, 656 Factor -s*3 - 6791s*2 - 40715s - 33925. -(s + 1)(s + 5)(s + 6785) What is p in 2p2 + 498218p - 498220 = 0? -249110, 1 Factor l*2 + 22242l + 123676641. (l + 11121)2 Let o4 + 387o3 + 1155o*2 + 1153o + 384 = 0. What is o? -384, -1 Determine g so that -3g4 + 1140g*3 - 136656g*2 + 4964544g = 0. 0, 68, 156 Determine t so that 125t4 + 24575t*3 + 14655t*2 - 8815t + 980 = 0. -196, -1, 1/5 Factor 2y3/7 + 236y*2/7 + 1362y/7 + 288. 2(y + 3)2(y + 112)/7 Factor 5r2/2 - 10055r/2. 5r(r - 2011)/2 Factor -111081675d2 + 73020d - 12. -3(6085d - 2)*2 Factor 2b*2/9 + 3364b/9 + 3358/3. 2(b + 3)(b + 1679)/9 Factor 3k2 - 28902k + 57792. 3(k - 9632)(k - 2) Solve k*2 + 4954k - 9912 = 0. -4956, 2 Factor -k*2/2 + 57654k - 1661991858. -(k - 57654)*2/2 Find o such that -4o*5 - 1276o*4 + 6488o*3 + 2496o*2 - 31104o = 0. -324, -2, 0, 3, 4 Factor -y*5/6 - 7y*4/2 - 25y*3/3 + 69y*2 + 657y/2 + 765/2. -(y - 5)(y + 3)3(y + 17)/6 What is q in 5q3 - 76405q*2 + 291924400q - 291848000 = 0? 1, 7640 What is l in -400l5 - 540l*4 + 16764l*3 + 5972l*2 - 4380l + 504 = 0? -7, -3/4, 1/5, 6 Let -u*2/6 + 19556u/3 - 26072 = 0. Calculate u. 4, 39108 Suppose 477o3/2 - 12399o*2 - 25593o/2 - 159 = 0. What is o? -1, -2/159, 53 Factor 5d3/2 - 21375d*2/2 - 74935d. 5d(d - 4282)(d + 7)/2 Find h such that -131h*4 - 3408h*3 - 52h2 = 0. -26, -2/131, 0 Solve -j3/6 - 1733j2 = 0. -10398, 0 Solve -u2 + 2630314u - 1729637934649 = 0. 1315157 Determine c, given that 4c4 - 2096c*3 + 290508c*2 - 4094480c - 4387088 = 0. -1, 17, 254 Find x, given that 3x5/5 - 371x*4/5 + 5057x*3/5 + 2099x*2/5 - 1012x - 1728/5 = 0. -1, -1/3, 1, 16, 108 Factor -4t3/5 - 116t*2/5 + 5668t/5 + 6148. -4(t - 29)(t + 5)(t + 53)/5 Factor 4i*3 - 1344i*2 + 95040i + 3110400. 4(i - 180)2(i + 24) Factor -3x4/4 + 15375x*3/2 + 23067x*2 + 46137x/2 + 30759/4. -3(x - 10253)(x + 1)3/4 Factor v2/2 + 1581v + 134117/2. (v + 43)(v + 3119)/2 Factor 2b3/7 - 152b*2 + 454b - 2116/7. 2(b - 529)(b - 2)(b - 1)/7 Let y3/5 - 3687y*2/5 + 210423y/5 + 214111/5 = 0. What is y? -1, 59, 3629 Suppose l*4 - 56l*3 + 1055l*2 - 7000l + 6000 = 0. What is l? 1, 15, 20 Factor c*3 - 1787c*2 + 793856c + 4014080. (c - 896)*2(c + 5) Factor m*2/2 + 73847m + 5453379409/2. (m + 73847)2/2 Solve -d2 + 1205198d + 1205199 = 0 for d. -1, 1205199 Find d, given that -30d*3 - 985d*2 + 4570d + 5525 = 0. -221/6, -1, 5 Factor 5z2 - 22595z + 67740. 5(z - 4516)(z - 3) Factor -2z2 + 1787364z - 399333758562. -2(z - 446841)2 Let -1922h*5/3 + 5828h*4/3 + 1157h*3/2 - 11653h*2/6 + 373h/6 - 1/2 = 0. What is h? -1, 1/62, 1, 3 Suppose 2v4 - 448v*3 - 4728v*2 + 11232v = 0. What is v? -12, 0, 2, 234 Factor -f*3/3 - 53f*2 + 3752f - 168560/3. -(f - 28)*2(f + 215)/3 Factor -26z2/9 + 1094z/3 + 1120. -2(z + 3)(13z - 1680)/9 Factor -m5/4 + 7m*4/4 - 9m*3/2 + 5m*2 - 2m. -m(m - 2)3(m - 1)/4 Factor -2d2/3 - 554d/3 - 2784. -2(d + 16)(d + 261)/3 Let -y*3/4 + 771y*2 - 594441y = 0. What is y? 0, 1542 Suppose -z*2/5 + 1556z/5 - 48768/5 = 0. What is z? 32, 1524 Factor -4z2 + 184572z - 553680. -4(z - 46140)(z - 3) Find q such that -10q3/3 - 494q*2/3 - 5248q/3 + 5720 = 0. -30, -22, 13/5 Find c such that c*2/6 + 204344c/3 + 20878235168/3 = 0. -204344 Let -2x3 + 5636x*2 - 39354x = 0. Calculate x. 0, 7, 2811 Factor -3k2 - 6027k + 66660. -3(k - 11)(k + 2020) Let -4g2 + 1968g + 22132 = 0. Calculate g. -11, 503 Solve -q*3/7 - 31427q*2/7 - 251332q/7 + 628380/7 = 0 for q. -31419, -10, 2 What is a in -4a4 + 3332a*3 - 856032a*2 + 45910784a + 5705553920 = 0? -55, 296 Determine k so that 4k2/9 - 1182368k/9 - 394124/3 = 0. -1, 295593 Determine u, given that 5u3 + 17155u*2 + 14688935u - 44221335 = 0. -1717, 3 Factor 3b3 + 153b*2 - 12126b. 3b(b - 43)(b + 94) Factor 3o*5 - 2934o*4 + 5856o*3. 3o*3(o - 976)(o - 2) Factor -64l*3 - 2253l*2 - 4500l + 5049. -(l + 3)(l + 33)(64l - 51) Determine t, given that 2t*3/9 + 24680t*2/9 + 2742t = 0. -12339, -1, 0 Determine v, given that -v*4 + 33v*3 + 351v*2 - 913v - 1230 = 0. -10, -1, 3, 41 Solve -17o5/2 + 125o*4/2 + 21o*3/2 - 401o*2/2 - 140o = 0 for o. -1, 0, 40/17, 7 Suppose -5v4 + 285v*3 - 3530v*2 - 12660v - 8840 = 0. What is v? -2, -1, 26, 34 Suppose -2z3 - 134922z*2 + 809586z - 1214406 = 0. What is z? -67467, 3 Factor -y*2 + 301y + 100200. -(y - 501)(y + 200) Let 2t*4/5 + 214t*3/5 - 386t*2 - 10422t/5 - 1656 = 0. What is t? -115, -3, -1, 12 What is k in -k*5/7 + 72k*4/7 + 222k*3/7 + 32k*2 + 75k/7 = 0? -1, 0, 75 Determine o so that -3o5/2 + 200o*4 - 3473o*3/2 + 28o*2 + 4198o + 2232 = 0. -1, -2/3, 2, 9, 124 Suppose -3i3 + 2523618i*2 - 530718127200i - 1061446348896 = 0. What is i? -2, 420604 Find v such that -4v4 - 8039v*3 - 14058v*2 - 4015v + 2008 = 0. -2008, -1, 1/4 Suppose -5n3/4 - 1923n*2/4 - 183543n/4 + 260743/4 = 0. What is n? -193, 7/5 Factor 3q3 + 147q*2 - 810q. 3q(q - 5)(q + 54) Factor -5y*3/2 - 3415y*2/6 - 100240y/3 - 344960/3. -5(y + 112)2(3y + 11)/6 Let -7214b*5/7 - 7213b*4/7 + 21643b*3/7 + 36067b*2/7 + 14423b/7 - 2/7 = 0. Calculate b. -1, 1/7214, 2 Let 2j4/9 - 328j*3/9 + 970j*2/9 - 644j/9 = 0. What is j? 0, 1, 2, 161 Factor -3i2/8 - 575565i/8 + 863361/4. -3(i - 3)(i + 191858)/8 Determine p, given that -5p3 + 362265p*2 - 362260p = 0. 0, 1, 72452 Factor m*3/10 - 183m*2/5 + 1443m/10 + 181. (m - 362)(m - 5)(m + 1)/10 Factor -p*3/4 + 97p*2/4 + p - 97. -(p - 97)(p - 2)(p + 2)/4 Factor d5/8 - 37d*4/8 + 99d*3/4 - 191d*2/4 + 313d/8 - 93/8. (d - 31)*(d	{ "pile_set_name": "DM Mathematics" }
2.41 What is -0.1 less than -35626204.54968? -35626204.44968 -6031.8+4689199576 4689193544.2 What is 21680 less than -803355911? -803377591 What is the distance between -0.571 and 6579641097? 6579641097.571 Total of -2153.9205 and 0.01316. -2153.90734 Calculate 6 - 0.146388278965396. 5.853611721034604 What is -80958411 - -4705.3? -80953705.7 What is 3271397 less than 2362576? -908821 Calculate 97063524718 - -6.6. 97063524724.6 What is 207588845 less than 0.0297384? -207588844.9702616 What is -0.7 plus 13181528260985? 13181528260984.3 Work out -0.050108 - 2560180. -2560180.050108 Calculate 100.82 + -24450. -24349.18 What is -2898638883 plus -41? -2898638924 What is 4 - 353406369.6533? -353406365.6533 Add -5 and 71429374031. 71429374026 What is 262528408532 minus 0.169? 262528408531.831 Work out -3596072407580 - -5. -3596072407575 Add 398.192788679 and 1. 399.192788679 What is the distance between 64378521 and 0.5957? 64378520.4043 Subtract 2 from 201435417957. 201435417955 What is -3.97506 take away 5705.6658? -5709.64086 What is -20527960 - 8155.745? -20536115.745 What is -248260982284 - -118? -248260982166 9898631989189+-6.3 9898631989182.7 What is -1368.01 + -1495.85385? -2863.86385 What is -1025088113159 - 17? -1025088113176 What is the difference between -264395953 and 505? 264396458 Total of -0.02 and -472838202.75. -472838202.77 Calculate 8 + -228007860253. -228007860245 -1 + 1489914042735 1489914042734 -0.57973137 - -61 60.42026863 What is the distance between 5 and 0.076307842063? 4.923692157937 Sum 0.1247443711 and 23087. 23087.1247443711 What is -4 take away 81469998326? -81469998330 Add together -123.108 and 8.222979. -114.885021 Put together -7437 and -29546807. -29554244 What is the distance between 90012167579 and 0.389? 90012167578.611 What is -1 take away -2290546426221? 2290546426220 1427493719.673 + 0.4 1427493720.073 Total of 5030.4 and 23783321873. 23783326903.4 Calculate 1.33631 - 5008205. -5008203.66369 Total of 452.84 and -8252644. -8252191.16 What is 3.97162 take away 5793602.1? -5793598.12838 Calculate -20063917.28 - -99. -20063818.28 What is -93.373 less than -8250225? -8250131.627 Add 483899890.54 and -21. 483899869.54 -595.512 - 0.085224704 -595.597224704 Work out 2901897395855 + 2. 2901897395857 -3359583 + -79944918 -83304501 Add together 901065439 and -5. 901065434 What is the difference between -1135706975 and 807? 1135707782 What is 78429 less than 1000.1731? -77428.8269 Add together 13887576768868 and 3.5. 13887576768871.5 Subtract -16034.40545 from -0.1972. 16034.20825 What is the distance between -82015 and -4885128? 4803113 Add together -107911862729222 and 0.03. -107911862729221.97 What is 402678983 take away 22432? 402656551 Add together -0.5 and -1449051954749.7. -1449051954750.2 Sum -21275 and -0.16570745. -21275.16570745 82121.576287+3 82124.576287 Work out -0.06639 - 94791917. -94791917.06639 What is -1 + -1286987671102? -1286987671103 Work out 1359.29 - 719.7032. 639.5868 What is -61392 - -33888.187? -27503.813 Subtract -20318.792 from 1308619. 1328937.792 What is -0.1992 take away 773829323? -773829323.1992 Add -191163245973 and -10.6. -191163245983.6 Work out -751924206 - 11140.9. -751935346.9 Work out -45903659670250 - 24. -45903659670274 What is -15.052344507 + -12? -27.052344507 Put together 0.138 and -210184338. -210184337.862 Add together 2278.93556 and 13.564. 2292.49956 What is the distance between 1959321740 and -50? 1959321790 What is the difference between 845954.8525 and 8049? 837905.8525 What is 68 take away 2778057449? -2778057381 What is -39516.505906 + 580.4? -38936.105906 Put together 74852774.575 and 520.7. 74853295.275 What is -76.51894 take away 53593? -53669.51894 Put together -292691583722 and 0.1. -292691583721.9 What is the distance between -18 and 10596353623567? 10596353623585 Work out 0.2069 + 1224.689236. 1224.896136 Calculate -92295251888 + -0.1. -92295251888.1 Total of -3235188919162 and 35. -3235188919127 Add together 5387280652.63 and -0.8. 5387280651.83 What is 195607205 take away -8219.2? 195615424.2 Put together 125589211 and -219030. 125370181 Calculate -612 - -847267507.69. 847266895.69 Add together -88.4278 and -12099. -12187.4278 Total of -49034438.53 and -0.3118. -49034438.8418 What is -8337.24934 less than -48269? -39931.75066 What is -1889.0959 take away -0.002521? -1889.093379 What is -715298049 less than 10201? 715308250 What is -1415 less than 2067120.2211? 2068535.2211 Calculate -79559 + -4.985396. -79563.985396 Add 0.1 and 35.0677793101. 35.1677793101 Subtract 3.56749408183 from -0.215. -3.78249408183 0.5766396 + -0.0825245 0.4941151 What is the distance between -10010013.39 and 120332? 10130345.39 -6686637691.8+883 -6686636808.8 What is the distance between -0.0681625 and 30888919? 30888919.0681625 What is 9637951015 + -2667? 9637948348 Subtract 387436861826 from 19. -387436861807 What is 6542 take away -1.9093864704? 6543.9093864704 Sum -16 and -760311.9030755. -760327.9030755 -349.4285989+950 600.5714011 28668.2366 - -588 29256.2366 What is -21.2 less than 863163947? 863163968.2 What is 19 take away -267141758055? 267141758074 Sum 2985386849.714 and 0. 2985386849.714 What is -0.0398983934921 - -0.1? 0.0601016065079 Calculate 2828.5745126 + 5.27. 2833.8445126 Calculate -129433570969 + -107. -129433571076 Sum -0.019 and -5961635926. -5961635926.019 What is the difference between 3 and 1620290803458? 1620290803455 What is -5.578 take away 2988509? -2988514.578 Work out 42857642931 - -5. 42857642936 -0.1+-409.79608091 -409.89608091 Subtract 4030339 from -821267. -4851606 Add -0.661 and -0.7083248688. -1.3693248688 What is -55.054064 less than -12316? -12260.945936 What is 8550 minus -23796339? 23804889 What is the distance between 0.186764787 and 23680? 23679.813235213 Total of -39196547 and 57.76. -39196489.24 What is 1780 plus 5015595046? 5015596826 Calculate 2367 + -1.258594431. 2365.741405569 What is the difference between 0.12492004 and -38609.15? 38609.27492004 -24 - -68.27634144 44.27634144 Calculate -7.7612 + -0.168213072. -7.929413072 -4+-164.6123924721 -168.6123924721 Add -3.7662697194 and 0.15. -3.6162697194 3383026.15060206 + -0.3 3383025.85060206 What is -6 plus -3208856.116? -3208862.116 Work out -0.5 + -187.51065943. -188.01065943 What is the difference between -0.3 and 15621988962193? 15621988962193.3 What is the difference between 943116814416 and 0? 943116814416 Total of -59573839967 and 81. -59573839886 What is the distance between -0.2 and 693235303084? 693235303084.2 Subtract -0.87 from 128040012. 128040012.87 Subtract -67076553128 from 1. 67076553129 What is 1633481726180 less than 2? -1633481726178 -10.1 - 144943190.0996 -144943200.1996 Calculate -423334630.44 - -0.15. -423334630.29 What is -3756769 + -182503? -3939272 Add together 162 and 3791749354933. 3791749355095 Total of -1.3 and 21096097845. 21096097843.7 1.7112548+0.15755 1.8688048 What is 0.311228431054 minus 2.2? -1.888771568946 What is -64119 - -29802.21? -34316.79 What is 5153750 take away -243663.92? 5397413.92 Calculate 1575031746 + 621647. 1575653393 What is 5830.5 plus -6296876.9? -6291046.4 What is -9.78 plus -2548.45503? -2558.23503 What is -29.07257719 take away 0.085? -29.15757719 Calculate 5802642 + -67490. 5735152 Work out 3.8721631673 + -6705. -6701.1278368327 What is -16379.20648 take away -3734? -12645.20648 What is 377 plus 6607710949? 6607711326 What is -1 take away 259488505452? -259488505453 Add together 0.1 and 76947.33093368. 76947.43093368 Work out -73013458 - -41.91. -73013416.09 What is the difference between -16.97473 and -33507873? 33507856.02527 What is -0.2 - -10880912578? 10880912577.8 Put together -4.27383 and -47346477. -47346481.27383 17272066501 + -3658 17272062843 What is 0 take away 15050027886001? -15050027886001 What is the difference between -4783133.276554 and -0.2? 4783133.076554 Add -561 and -142597.64. -143158.64 Work out -4.547104 - -0.808118. -3.738986 What is -4.1055874 - 37108? -37112.1055874 Calculate 0.042 - 106104530852. -106104530851.958 1.1+0.62429389616 1.72429389616 What is -0.0649485 take away -42491208? 42491207.9350515 Total of 391299687 and -0.0285159. 391299686.9714841 Add together -6.055 and 1467054.7. 1467048	{ "pile_set_name": "DM Mathematics" }
) assuming t is positive. t(43/18) Simplify ((s/s(2/5)s(-7/5)((s/s(-1/2))/s)/(s/(s/s(-8))))35)(18/7) assuming s is positive. s*693 Simplify ((bb*(-13))/bbb(-10)b)*(16/5)/(((bb/((b*(-2/7)/bb)/b)b)/(b/(bb*7)))/(bbb/b(1/9)bbb(2/5))) assuming b is positive. b(-23057/315) Simplify (f*(-3/7)/ff6)39/((((f/(ff7))/f)/(f/(f3/f)))/(f1/f)(12/5)) assuming f is positive. f(1297/7) Simplify ((i(-1/3)i(i(i*(1/14)i)/i)/i)/(i(-1/2))49)/((i/(i*(-3/11)ii))/i(12/11))(-1/23) assuming i is positive. i(133670/5313) Simplify ((ii((ii1)/i)/i)/i(4/5)(i(-2/7))(-19))/((i(2/5))25)8 assuming i is positive. i(-2568/35) Simplify ((u(9/4)/(u/(u/(uu*(-3/4)))u))/(u*(2/47)(u*(-28)/u)/uu))(3/16) assuming u is positive. u(264/47) Simplify (w*(2/7)w)*(1/52)(ww6/w)/w(-2)(w*(-1/9)/(w((ww/(w4ww))/w)/w))/(ww*(2/3)w)(3/14) assuming w is positive. w(40433/3276) Simplify ((g(-10))(2/145)/(((g*12g)/g)/(g/(g(gg*19)/g)gg)))9 assuming g is positive. g(-7605/29) Simplify (((pp(-2/3)/p)(-3/26)/(((pp9p)/p)/(p(-1/4)/p)))(-28))(-16/3) assuming p is positive. p(-65072/39) Simplify (((n*1nn(-1/3))/((n/(n/(nnn(-1/4)nnn)))/n)(-13))(1/30))(-6) assuming n is positive. n(-121/12) Simplify (xx0xxx)*(-10)x*(2/5)x*1xx(x(-1/2))(1/57)/(x/x*(-3/4)x(-7)) assuming x is positive. x(-35749/1140) Simplify (t0)(-23)/(tt/(tt(-1)/t))25(t(-1/4)/t1)/(tt/t*(-6)t2) assuming t is positive. t(-345/4) Simplify (((s30)47)48)(3/10) assuming s is positive. s*20304 Simplify (ss/s*(2/9)s(-4))/(s1)*(-23)(s(-2/15)/(s2/s))/(s(-6)/((s/(s(-7)ss))/s)) assuming s is positive. s(1379/45) Simplify ((f/(f/(f5/f)))*(-4/23)f(-2/5)/f(-20))(2/59) assuming f is positive. f(4348/6785) Simplify ((((b*2b)/(b*10b))(-11))4)(1/6) assuming b is positive. b(176/3) Simplify (((u*0uu)(-3/7)u((u(6/11)u)/u)/uu(5/3))34)(-29/3) assuming u is positive. u(-308618/693) Simplify ((n(1/2)n)(-4/7))10/(((n/n*(-6/11))/(nnn/(nn*(-1)nnnn)))/(((n/(n/(nn/n*(-6/5))))/n)/n(nn(-2/3)n)/n)) assuming n is positive. n*(-11069/1155) Simplify (r(r/r*(-48))/rrrrrrr(-2/69))/(r47r(2/11)) assuming r is positive. r(5153/759) Simplify ((c(2/5))(6/5)/(c(-1)/c(-1/2)))/(((cc((c/(c/c(-1)))/c)/c)/c)(4/25))16 assuming c is positive. c(61/10) Simplify ((n(n(-1)n)/n)/(n/(n(-7)/n)))(-9/2)/((n/(n/(n*(-6)n)))/n((n/(n(-4)/n))/n)/nn(n(-3)/n)/(n(3/7)/nn)) assuming n is positive. n(643/14) Simplify ((o/o(-3))(-4))(-31)(o5o*(-5/2)o)/(o*(-1/8)ooo(-6/11)/o) assuming o is positive. o(43927/88) Simplify (ll(2/133))(-1/22)/(l/(l2/l)ll/l(-17/7)) assuming l is positive. l(-13093/2926) Simplify (zz*(-11/3)z/z*(-17)z/(z/(zz(-4/3)zz)z)z(-8))9 assuming z is positive. z72 Simplify ((w0w)/w)*(4/17)w*(-3/8)/ww*(-5)((ww(1/2)w)(-49))2 assuming w is positive. w(-2011/8) Simplify ((x(-1/4))*(-4/11)(x(-1))(4/13))/((x*1x)20)(-23/2) assuming x is positive. x(65749/143) Simplify (j(-3/8)j/(jj(-2)))(-4/17)/((j/(j/j7))/j(-1))(-21/8) assuming j is positive. j(701/34) Simplify (((h*5h)/(h(h/(hhh(-1/23)/hh))/h))/(h*(-15)h(7/3)))1 assuming h is positive. h*(1354/69) Simplify (((r/(rr*(-34)r))/rr(-27))(-7))(-1/7) assuming r is positive. r5 Simplify ((r(2/23)/(r/r(2/11))((rr(-1/2)/r)/r)(3/5))(1/15))(-38) assuming r is positive. r(78413/18975) Simplify ((s/(ss/((s/(ss/((ss((ss/s*(5/6))/s)/s)/s)s))/s)))*30(((s/(ss/((s(-1/3)/s)/s)s))/s)/s)/((sss(-6))/s))(-43) assuming s is positive. s(15007/3) Simplify (f(-2/5)f)(2/53)(ff(2/5)ff)(9/4)((ff(1/2)/f)/((f/f8f)/f))/(f*(-4)(f*9f)/f) assuming f is positive. f(10783/1060) Simplify (z/z(-2/169))/z*(-1/2)z(9/5)/(z(-33)z) assuming z is positive. z(59677/1690) Simplify (p(-1/2)p*(-2/9)(p(1/3))6)/((p(-4/7)/p(-1))/((p/(p/p*(-7)))/p(p/(pp(-1/6)))/p)) assuming p is positive. p(-503/63) Simplify (o(4/7)/(o/o1))(-20/11)((ooo*(-1/2))/ooo/((o/(oo*(1/2))o)/oo))(-15) assuming o is positive. o(-2390/77) Simplify ((l0)28(l/(l/l(-2)))32)/(l*(1/2)(((lll*(-9))/l)/l)/l(l(-1/5))(13/3)) assuming l is positive. l*(-1609/30) Simplify ((j/(((j/((jjj/j(2/9))/j))/jj)/j)jj*(-1/2)/jj)/((((jj(-1/2))/j)/jj)/jjj*(-2)))/((jj/j1)9)(-21) assuming j is positive. j(1753/9) Simplify ((n(1/4)/n)40/(nn(-1)n*(2/5)))/((n/(nn0))(-2/3)/((nn/((nn/(n(nn(-3))/n))/n))/((n(-1/2)n)/n))) assuming n is positive. n(-309/10) Simplify (x(5/6)xx/((x6/x)/xx)x)(2/53)x*(-1/2)x/x*0x/(x(x3x)/xxxx)x*(-6)x assuming x is positive. x*(-3353/318) Simplify ((a(a*(-1/2)a)/a)(1/12)/(((a/a(-3/4))/a)/a(-4/5)))/((a(1/4)a/(aa/(a/(aa0/aa))))/((a*(2/13)a)/aa/(a2/a))) assuming a is positive. a(-943/1560) Simplify (m(-2/69)/(m(-3/32)m))/(m/m*(4/7)mm(-1/41)) assuming m is positive. m(-1482479/633696) Simplify (p/p(-2/17))/(p/(pp*(1/8)p))(p/p(-2/37))/((p/(p/(p/(pp*(-41))pp)p))/p) assuming p is positive. p(-189723/5032) Simplify (w(1/4)w)(1/13)/((www(3/8)/w)/(w/w(2/9)))((w/(ww5)w)/w*(-1/3))/((w/(www4))/(ww*(1/7)w)) assuming w is positive. w*(19493/6552) Simplify (((d/(d(dd5d)/d))/d(-2/3))/(d(-2/11)/d(-2)))/((d/(d0/d)d)(-1/68))(-11/4) assuming d is positive. d(-65281/8976) Simplify (t38/(t/((t(1/21)/t)/t)))/((tt/t*35)/t(t/(t/t(-10/9)))/t) assuming t is positive. t(4483/63) Simplify rr2r*2r(r/r(-2/9))/(r(-1/6)r)(r(-8)(rrr/r(-1/5))/r)/(r(-6)/r(-6)) assuming r is positive. r(53/90) Simplify ((xx2xx)(-40))(-3/25)/((x(-2/5)/(x/x(1/2)))/(xx/(x/(x*(-2/11)/x)x)xxx3/x)) assuming x is positive. x(3049/110) Simplify (j/(jj(jj*(5/4)jj)/jj))*(-2/3)j*39jjj(11/3) assuming j is positive. j(289/6) Simplify ((b(-1))(4/3))(-23)/((b(-4)b/(bb*(2/11))bb)/(b(1/2))(10/11)) assuming b is positive. b(1099/33) Simplify (u/u(2/5)uu(1/6)uu(-1/23)uuuuuu(u*(3/8)u)/uu)(1/86) assuming u is positive. u(27871/237360) Simplify (((g/((g(3/8)/ggg)/g))/(gg*3)gg/(((g(-5)g)/gg)/g)g*(4/7)/gg)(3/14))38 assuming g is positive. g(13395/392) Simplify (n1/nnn/(n/(n/n*(-7))))/(n(n*(-4)/n)/nnn3)(((nn/(n(3/2)/n))/nn)/nnnnn/n*(-7/3)n)/(n/n2)(1/42) assuming n is positive. n(125/7) Simplify (d/d(-1/4))(-2/23)/(d/(d/(d7/d)d)dd(1/5))(d(d(1/4)d)/dd)(-35)/(d3d(-2/5)) assuming d is positive. d(-40323/460) Simplify ((uu(3/4))/u(-2/5))(-45)((u3/u)/(u/u(-1)u))/(u(2/5))47 assuming u is positive. u(-2331/20) Simplify (i(-1/6)(i*(-6)i)/ii)(3/7)/((((i/(i3i))/i)/ii)/(ii*(-7))(i(2/7))(-20/11)) assuming i is positive. i(-569/154) Simplify ((d(-29/2)d(3/7)d)/((dd(-17))/d)(13/6))5 assuming d is positive. d(2495/21) Simplify (u(-9)u7/u)(-50)/((u*(4/7)u*(1/14))/(u/(uuu(2/5)))37) assuming u is positive. u(6829/70) Simplify ((n/n(-1)n)22)(-1/7)((((nn*(-6/7)n)/n)/n)/(nn(6/7)))(-3/37) assuming n is positive. n(-2385/259) Simplify ((c(2/7)c2)/((c(5/4)c)/(c(-2/9)/c)))(6/11) assuming c is positive. c(-299/462) Simplify ((k(-1/3))(-14/5))42/(((((k(-7)/k)/k)/k)/k(k(-6)/k)/k)/(k5k(-1))) assuming k is positive. k(311/5) Simplify (l(-2)/(l/(ll*5))((lll(-1))/l)22)/((l*(2/7)l)/l(llll*(1/4)l)/l(l/l(-4)l)/(l/(l/l*(-3/5)l))) assuming l is positive. l(-1139/140) Simplify ((a(3/4)/(aa/(a/(a/a(-5/2)))aa))/(a(2/5)(a(-2/7)/a)/a))/(a5/(aa1)(aa(-2))(-16)) assuming a is positive. a(-3201/140) Simplify (o13)(2/49)(o/((o/o(5/3))/o))/(o(1/5)/o) assuming o is positive. o(2938/735) Simplify (((f/(f/(f/f(-3/5)))f)/f)(39/4)(f12)(8/13))(2/21) assuming f is positive. f(996/455	{ "pile_set_name": "DM Mathematics" }
er? False Is 104793063 composite? True Is 11404651 a composite number? True Is 123910607 composite? True Is 53866237 a composite number? False Is 3193081 a composite number? False Is 4050661 composite? True Is 88210487 a composite number? True Is 243062263 prime? False Is 18799733 composite? True Is 132501907 a composite number? False Is 509292037 a prime number? False Is 80028053 a prime number? False Is 1322639 a prime number? False Is 4689883 a prime number? False Is 5023423 a prime number? False Is 11486219 composite? False Is 30386821 prime? True Is 11159011 a prime number? False Is 12729653 a composite number? False Is 4981157 a prime number? True Is 2133421 a prime number? False Is 6776717 composite? False Is 66222073 composite? False Is 1204751 a prime number? False Is 12341321 prime? False Is 473273 composite? True Is 71063 a composite number? True Is 260217143 a prime number? True Is 64789217 a composite number? False Is 89029795 composite? True Is 71081211 a composite number? True Is 3929421 a prime number? False Is 242037241 composite? False Is 18279741 composite? True Is 27711637 a prime number? True Is 3998993 composite? False Is 8287907 a composite number? True Is 129341 a composite number? False Is 237531039 composite? True Is 79133243 prime? False Is 30150331 prime? False Is 3332843 a prime number? True Is 1567459 a prime number? False Is 8435893 prime? False Is 8799829 a composite number? True Is 13802959 composite? True Is 6168289 a composite number? True Is 142249 a composite number? True Is 29799941 a composite number? False Is 4710983 a prime number? True Is 8680003 prime? True Is 6575809 prime? False Is 609784115 a composite number? True Is 42036989 a composite number? False Is 10980313 a composite number? True Is 9826847 composite? False Is 16435913 composite? True Is 431585447 composite? False Is 3157711 a composite number? False Is 8903 a composite number? True Is 2982771827 prime? False Is 40553831 a composite number? False Is 237997 composite? False Is 72074507 prime? True Is 60230663 composite? False Is 369637 composite? False Is 126708817 a prime number? False Is 101526943 a prime number? False Is 42526739 composite? False Is 10929221 prime? True Is 12451 a composite number? False Is 359791 prime? False Is 95705537 prime? True Is 2845631 a prime number? True Is 354271501 composite? False Is 20584439 a composite number? False Is 4705931 a prime number? True Is 188689003 composite? False Is 3923638 composite? True Is 20079689 a composite number? True Is 252217649 composite? False Is 240592411 composite? False Is 771469 a prime number? False Is 2944973 composite? True Is 1434677 a composite number? False Is 84117679 prime? True Is 40858163 prime? True Is 11592274 prime? False Is 22278793 prime? True Is 1790443 a prime number? True Is 727541 composite? False Is 851438255 a composite number? True Is 151680041 a prime number? True Is 45377 composite? False Is 67255 a prime number? False Is 4010333 a prime number? False Is 182132381 composite? False Is 62774707 a composite number? False Is 56772389 prime? False Is 16983419 a prime number? True Is 277259941 a composite number? True Is 453251 a prime number? False Is 13242811 composite? False Is 24337403 prime? True Is 86070773 composite? False Is 959449 a composite number? False Is 35577986 prime? False Is 14137549 composite? False Is 37335041 composite? True Is 158306111 a prime number? False Is 3728357 prime? True Is 28639862 prime? False Is 31700299 composite? False Is 54889 a composite number? True Is 16087 a prime number? True Is 108719381 prime? False Is 26174959 a prime number? True Is 4989599 prime? True Is 40336073 a prime number? False Is 63591521 composite? True Is 77549687 composite? False Is 5442483 composite? True Is 67015037 composite? True Is 22207973 a composite number? False Is 9607 prime? False Is 1255249 composite? False Is 123001 prime? True Is 359287 composite? True Is 139811387 composite? False Is 35079277 composite? False Is 4568557 a prime number? False Is 149375999 composite? True Is 9660649 prime? False Is 4754107 composite? False Is 283007911 prime? False Is 8990873 composite? False Is 3487021 a composite number? False Is 19236817 composite? True Is 194976057 a composite number? True Is 1662811 prime? False Is 117469687 prime? True Is 149666497 a composite number? True Is 9458359 composite? True Is 6247901 a prime number? False Is 2556227 prime? False Is 192305053 prime? True Is 200553917 composite? True Is 14229659 a composite number? True Is 306083 a prime number? True Is 3531989 a composite number? False Is 230424463 a prime number? True Is 70177729 prime? False Is 101725553 composite? False Is 171391 a prime number? False Is 7637293 a composite number? True Is 681612881 composite? False Is 2593679 a composite number? True Is 4508951 prime? False Is 3338039 composite? False Is 716260837 a prime number? False Is 4281254 prime? False Is 17629519 a composite number? False Is 256879527 composite? True Is 78571349 composite? True Is 67214359 a prime number? True Is 79632299 a prime number? True Is 52343497 a prime number? False Is 45042059 a prime number? True Is 270186941 a composite number? False Is 1863707 composite? False Is 781589245 prime? False Is 16754813 composite? True Is 1865681 prime? True Is 2686393 prime? True Is 29320471 prime? True Is 18159901 a composite number? True Is 50001703 a composite number? False Is 3750022 a prime number? False Is 94095919 a prime number? True Is 25561 composite? False Is 4536751 composite? True Is 1599803 a prime number? True Is 1506503 prime? False Is 67937539 prime? False Is 314149 prime? False Is 3220051 a prime number? True Is 29258909 prime? True Is 165929149 a prime number? False Is 1236407 prime? False Is 4402841 a prime number? True Is 195403847 prime? False Is 79840069 a prime number? True Is 48439 composite? True Is 101169649 composite? True Is 9678901 composite? False Is 23427539 prime? True Is 4628387 prime? False Is 6432107 a prime number? False Is 78628217 a composite number? False Is 71195093 a prime number? False Is 36284441 a prime number? True Is 3209543 a prime number? True Is 52410107 prime? True Is 2092339 a prime number? False Is 335609 a composite number? False Is 3507667 a prime number? True Is 575167121 a prime number? False Is 32045489 composite? True Is 962778623 a composite number? False Is 5315753 prime? False Is 34168423 a prime number? True Is 7212417 prime? False Is 5828731 composite? True Is 347842199 a composite number? False Is 7241 composite? True Is 353323 a prime number? False Is 286379 a composite number? True Is 365313713 a prime number? False Is 9199151 prime? False Is 845561 a composite number? True Is 1055671 a prime number? True Is 2628229 a composite number? False Is 48696391 composite? False Is 226909 prime? False Is 236784629 composite? False Is 278305 a composite number? True Is 1653853 a composite number? False Is 169502777 a composite number? False Is 283292813 composite? True Is 60740599 a prime number? False Is 2505611 a composite number? False Is 5314409 a prime number? False Is 953319 a composite number? True Is 220885391 composite? False Is 10423463 composite? True Is 607840663 composite? False Is 91973563 a prime number? False Is 1952551 a prime number? True Is 12940654 prime? False Is 10429337 a composite number? False Is 1442362 composite? True Is 150782147 prime? False Is 46376767 prime? False Is 10858831 a composite number? False Is 20885331 a composite number? True Is 50606477 prime? False Is 66106697 a composite number? False Is 12966407 prime? False Is 3331046 composite? True Is 4434019 composite? False Is 18604063 composite? False Is 189388091 prime? True Is 5143837 a prime number? True Is 881509 prime? True Is 4042993 composite? False Is 91622749 composite? False Is 36125863 a composite number? True Is 975959 a composite number? True Is 17917387 a composite number? True Is 2855247 a prime number? False Is 8305051 prime? True Is 91436803 prime? False Is 29517907 composite? False Is 184239742 composite? True Is 5870159 prime? False Is 4034011 composite? False Is 1608611 a prime number? True Is 1468877 composite? False Is 1369889 prime?	{ "pile_set_name": "DM Mathematics" }
ate -5 divided by -4852018. 5/4852018 556082235 divided by 2586429 215 -10288 divided by -905 10288/905 Calculate 7810908 divided by -2. -3905454 -10295656 divided by -11389 904 Divide 129035 by -159. -129035/159 54360811 divided by -47 -1156613 Divide 7085203 by 1187. 5969 What is -17712640 divided by -43520? 407 Calculate -21643820 divided by 98381. -220 What is 1188525 divided by 22425? 53 Calculate 60627168 divided by 111447. 544 What is -28674330 divided by 4779055? -6 Calculate -18791740 divided by 4103. -4580 Calculate -1 divided by 1083245. -1/1083245 What is -11109768 divided by 2777442? -4 48229637 divided by -3 -48229637/3 Divide 3 by -49759664. -3/49759664 Divide 120510 by 7773. 40170/2591 0 divided by 165073786 0 -155238200 divided by -3880955 40 103 divided by 1027151 103/1027151 Calculate -142165128 divided by -11452. 12414 Calculate -9106460 divided by -11. 827860 Divide 48948297 by -349. -140253 55206179 divided by -5 -55206179/5 Calculate 8349 divided by -33597. -2783/11199 Divide 86 by 1051864. 43/525932 What is 474109904 divided by -2456528? -193 -886026 divided by -39 295342/13 What is 19 divided by -18493884? -19/18493884 -7 divided by -1943360 7/1943360 What is -24013315 divided by -121895? 197 Divide -835962713 by 2687983. -311 -759606 divided by 93 -253202/31 -51499 divided by 1972 -51499/1972 What is 12082 divided by -1? -12082 0 divided by 1012324 0 -1 divided by -37538909 1/37538909 -32485404 divided by -42 773462 Calculate 320 divided by -150248. -40/18781 What is -57240820 divided by -408863? 140 Divide 4 by 42020708. 1/10505177 Calculate 32416752 divided by -69. -469808 -12515198 divided by -59 212122 38993516 divided by 1344604 29 Calculate 0 divided by -2631683. 0 What is -40251065 divided by -8050213? 5 -42596540 divided by 8519308 -5 What is -195905 divided by -82? 195905/82 -30 divided by 13632623 -30/13632623 Calculate -633121623 divided by -1. 633121623 What is 906784 divided by 16? 56674 What is 21568830 divided by 1? 21568830 Calculate -579551 divided by 8. -579551/8 What is 1 divided by 6507170? 1/6507170 Calculate 90246084 divided by -4. -22561521 What is -893424 divided by -37226? 24 What is -4705 divided by 22794? -4705/22794 Calculate 26106850 divided by 74591. 350 26776123 divided by -723679 -37 What is 75109984 divided by 1252? 59992 Calculate 4 divided by 8416336. 1/2104084 167735106 divided by -23962158 -7 Calculate 4083357 divided by -111. -36787 Calculate 9325 divided by 1911. 9325/1911 Calculate 7916760 divided by -72. -109955 -343 divided by 204883 -49/29269 Calculate -1711053 divided by 570351. -3 2 divided by -8249183 -2/8249183 Calculate -5028336 divided by -24. 209514 -1481804 divided by 5 -1481804/5 Calculate -30416536 divided by 7604134. -4 Calculate 3 divided by -271051709. -3/271051709 -93 divided by -590131 93/590131 What is -96022080 divided by -770? 124704 Divide 768620820 by -6. -128103470 -198 divided by -24028 99/12014 Calculate 7459312 divided by 266404. 28 What is -489448896 divided by 59? -8295744 Divide -2 by -102581914. 1/51290957 Divide 550293 by 177. 3109 -313179988 divided by -7117727 44 Divide -1343 by 274. -1343/274 Divide 38856628 by -19428314. -2 6045 divided by 1178 195/38 What is -32024784 divided by 40744? -786 Calculate -285828 divided by 71457. -4 81687519 divided by -3 -27229173 Calculate 4 divided by -5249610. -2/2624805 What is -1672566 divided by -238938? 7 Divide 18 by -351018. -1/19501 What is -426024 divided by 1? -426024 1254396 divided by 4 313599 Calculate -4 divided by 32467505. -4/32467505 What is -136751376 divided by 117484? -1164 Calculate 774 divided by -32846. -387/16423 197037225 divided by -79611 -2475 Calculate 421800 divided by 1110. 380 12569223 divided by -17 -12569223/17 Divide 56177 by -4462. -56177/4462 What is -4594 divided by -1100? 2297/550 Divide 253353 by 2015. 253353/2015 What is -1587403 divided by 10? -1587403/10 Divide 7002336 by 228. 30712 What is -102158 divided by -159? 102158/159 -2247180 divided by -187265 12 -16853871 divided by -3 5617957 262014732 divided by -3119223 -84 Calculate 3 divided by 114134232. 1/38044744 What is -112371 divided by -40? 112371/40 Divide 41852277 by -23. -41852277/23 Divide 122240294 by 87502. 1397 Divide 9935424 by 551968. 18 Divide -812639691 by -111611. 7281 Calculate 334007968 divided by -11741. -28448 What is 128122 divided by -9170? -64061/4585 246620 divided by -42 -123310/21 What is -1287529 divided by 25? -1287529/25 -339457569 divided by 1969 -172401 What is -3 divided by 10924128? -1/3641376 Divide -34325777 by 1. -34325777 30774414 divided by -726 -42389 -2381529 divided by 36 -793843/12 -11172524 divided by -360404 31 Divide -205543156 by -15811012. 13 Calculate -1202 divided by 15842. -601/7921 Divide 25025836 by -368027. -68 Calculate -1742680 divided by 38. -45860 -8 divided by -4075024 1/509378 What is 1635231 divided by 1106? 1635231/1106 What is -3673458 divided by 1836729? -2 Calculate -30896958 divided by -1343346. 23 What is -4 divided by -2506981? 4/2506981 Divide 4395 by -339. -1465/113 -15777057 divided by -3 5259019 22338414 divided by -2394 -9331 Divide 4243891 by 23. 184517 Divide 820818380 by -2270. -361594 Calculate 25144145 divided by 10. 5028829/2 What is -6 divided by 1545452? -3/772726 What is 13518538 divided by -22? -614479 What is -8475876 divided by 3? -2825292 Calculate -34258481 divided by 6. -34258481/6 What is -843 divided by -26030? 843/26030 What is 74339089 divided by -152647? -487 -103666422 divided by 6 -17277737 What is -27754 divided by 1293? -27754/1293 What is 93698 divided by 236? 46849/118 Divide -111636254 by -1924763. 58 -134759646 divided by 188739 -714 Calculate 304456 divided by -304456. -1 Divide 4 by 14457119. 4/14457119 11132667 divided by -9 -1236963 213757445 divided by 6 213757445/6 Calculate 2 divided by 129077568. 1/64538784 Calculate 0 divided by -159859. 0 Divide 7604672 by 496. 15332 Divide -793478400 by -8. 99184800 What is -27 divided by -21160834? 27/21160834 Calculate 23724462 divided by 2. 11862231 What is -212810894 divided by 6? -106405447/3 -9223326 divided by 6 -1537221 -3017370 divided by 33 -1005790/11 Calculate -34471947 divided by -3. 11490649 What is 9 divided by 1177215? 3/392405 Divide -165011840 by -35. 4714624 What is 4183745 divided by -6? -4183745/6 Divide 375238032 by 1. 375238032 3380 divided by 18841 3380/18841 -36386133 divided by 5198019 -7 3153405 divided by -210227 -15 What is -37 divided by -3036144? 37/3036144 11619876 divided by -138 -84202 78 divided by 528476 3/20326 -362 divided by -7364 181/3682 Divide 6489 by 542. 6489/542 Calculate 128898162 divided by 6. 21483027 What is -1 divided by 7459119? -1/7459119 Divide -1 by -10543487. 1/10543487 Calculate -17361863 divided by -1. 17361863 Calculate 134560 divided by -8. -16820 -4 divided by 534179 -4/534179 Calculate 43506515 divided by -5. -8701303 Calculate 626777 divided by 49. 626777/49 Calculate 7943 divided by 53488. 7943/53488 -27 divided by 2914197 -9/971399 Divide 244007242 by 662. 368591 What is -46 divided by -261882? 23/130941 Calculate -1012 divided by -755. 1012/755 Divide -147251512 by 18406439. -8 What is 57978 divided by -3? -19326 Calculate 5 divided by 213643957. 5/213643957 Calculate -1 divided by -7309408. 1/7309408 Divide -4 by 19401323. -4/19401323 1247496 divided by -1416 -881 What is 702995618 divided by 27038293? 26 Calculate 0 divided by -17038563. 0 -53345625 divided by -5 10669125 What is -8877448 divided by 8? -1109681 Divide -1428 by -57804. 119/4817 Divide 103441285 by -20688257. -5 Calculate 2025751 divided by 10. 2025751/10 Divide -3 by 147659785. -3/147659785 4558334 divided by -414394 -11 Divide -796808 by 35. -796808/35 35323285 divided by -17273 -2045 Calculate 25030 divided by 519. 25030/519 -37314608 divided by -5008 7451 What is 567579012 divided by -94502? -6006 What is 201 divided by 36296? 201/36296 -6 divided by 103757 -6/103757 What is -2770670 divided by 79162? -35 Calculate -41 divided by -62260. 41/62260 What is 3442 divided by 1201? 3442/1201 Divide 12256 by 82. 6128/41 1247303080 divided by -249460616 -5 Calculate -161655960 divided by -189960. 851 Calculate 9727239 divided by -3242413. -3 -	{ "pile_set_name": "DM Mathematics" }
h. -5 Let t(q) = 39q2 + 52q - 101. Let k be t(2). Solve 157g = kg + 4 for g. -2 Let m(o) = -4o3 + o3 - 2o*3 - 13o + 4o3 - 11o*2 - 30. Let f be m(-10). Let y be 0/(-22/(-4)). Solve -2a + fa = y for a. 0 Suppose d = 3i - 8, -d - 12 = -5i + 2. Suppose -3q + 26 = 5g, -iq + q - 4g + 20 = 0. Solve qb + 3 = 5b for b. 1 Let w(s) = -2s - 20. Let t be w(30). Let q = 85 + t. Suppose -g - 2 = -3p, 3g - p = 4p + 14. Solve -g = 4i - q for i. -2 Let o(b) = -b3 - 14b*2 + 5. Let l be o(-14). Suppose 2s + p + l - 39 = 0, 2p + 52 = 4s. Let u = s - 10. Solve 2m - 15 = -u for m. 5 Let b = -5 + 9. Suppose -5s - 5v = -100, 4v = -2s + 42 + 8. Suppose sx - 10 = 10x. Solve xq = bq - 10 for q. 5 Suppose -14 = -5i + 31. Let g be (-18)/5 + 16/(-40). Let l be 4/8 - 6/g. Solve m + lm = -i for m. -3 Suppose 3t + 0t = -6. Let m = t + -12. Let j = m + 16. Solve -2n = -4n + j for n. 1 Let q = 29 - 29. Suppose -3y + 4y = q. Let j be (0 - 0) + 1 + 2. Solve yl = -jl for l. 0 Let o(p) = p - 5. Let c be o(9). Suppose -d + cf + 26 = d, -2f = -4d + 52. Solve -3s + 2 = -d for s. 5 Suppose -19 = -3p + 4a, -3a - 8 = -a. Suppose 124 = 6r - 260. Let s = r - 63. Solve p = -u - s for u. -2 Let l(b) = -b3 - b - 1. Let m be l(2). Let k = m - -6. Let c be 1/k(-10)/2. Solve c = -3j - 14 for j. -5 Let g(t) = t3 + 3t*2 - 4t + 1. Let m be g(-4). Suppose -3w - 14 = m. Let c = 8 + w. Solve 2r = -cr for r. 0 Suppose a - 3n = -a + 30, 5a = -2n + 75. Suppose 4b - 21 = a. Suppose -6q = -bq. Solve 2o = -8 - q for o. -4 Let d(y) = 2y3 + 2y - 2. Let n be d(1). Suppose n = -5f + 12. Let l = 4 + 1. Solve 0 = -fa + l - 1 for a. 2 Suppose -932 = o - 937. Solve ou + 12 + 8 = 0 for u. -4 Suppose 0 = -3z - y, -5z = -y + 2y. Solve zf + 2 = f for f. 2 Let t(b) = -b2 + 12b + 2. Let p be t(12). Suppose -pk + 14 = 8. Let o = -4 + 4. Solve -kv = -ov + 15 for v. -5 Let q(f) be the third derivative of -f5/60 - f4/3 + 2f*3/3 + 7f*2. Let z(k) be the first derivative of q(k). Let g be z(-5). Solve 3h = gh + 3 for h. 3 Let h be 13(-16)/(-16). Solve -35 = hc - 29 for c. -2 Let c = 119 - 114. Solve 0 = 2q - cq + 15 for q. 5 Suppose -g = 4t - 24, 2g + 3g = 2t + 10. Suppose -4z + 4 = -g. Let w be (-3)/2(-48)/9. Solve 3u = z - w for u. -2 Let u = -78 - -140. Let j = 65 - u. Solve -js - 7 = -16 for s. 3 Let p(j) = j + 33. Let h(r) = -2r - 33. Let s(n) = 6h(n) + 7p(n). Let v be s(5). Solve -x + 5 - v = 0 for x. -3 Let w be (-1)/(1/2) + -2. Let o(a) = a3 + 6a*2 + 3a + 2. Let y be o(w). Let u = y - 16. Solve k - 2 + u = 0 for k. -4 Suppose -5p - 22 + 95 = -4g, g - 20 = -p. Suppose 0s = 2s + 4f + 8, -s + p = -5f. Suppose k - 2i = sk, -i = 5k - 18. Solve 3r - k = 2r for r. 4 Let r(w) = -3w - 4. Let q be r(-3). Suppose -qx = -2x - 15. Suppose 4p - 17 = -x. Solve 0 = h - ph - 2 for h. -1 Let x(t) = t*3 - 4t*2 + 2. Suppose -c + 12 = 2c. Let i be x(c). Let j(r) = -r*2 + 78r - 621. Let k be j(69). Solve k = -iq - q - 9 for q. -3 Let u be 8/(-16) - (-27)/6. Suppose uv - 3v - 4o - 4 = 0, -3o - 4 = -v. Let x be v(7/(-4) - -2). Solve 2 = q - x for q. 3 Let p = -4 - -7. Suppose 12 = -pz - z. Let f be z/(-4) + 1/4. Solve 2r = r + f for r. 1 Suppose -16 + 72 = 4q. Suppose 0p + q = 2p. Suppose -r + 5r - o - 11 = 0, r + 1 = 4o. Solve ri = pi for i. 0 Let a = 619 - 619. Solve a = -0c - 4c - 16 for c. -4 Suppose -3o = 5g + 15, g - 6o - 10 = -4o. Solve 12i - 16i = g for i. 0 Let f = -707 + 709. Solve -f = 12r - 14 for r. 1 Let d(h) = -h*3 - 11h*2 - 3h + 16. Let n be d(-11). Suppose -6 = np - 51p. Solve -9 = 4y + p for y. -3 Suppose 18 = 4f + 5l, 4l - 6 = l. Suppose -4j = 12, 8w - 4w = -2j - 6. Solve w = -fg - g for g. 0 Let j(y) = y2 + 3y + 2. Let r = 1 + -2. Let v = r + -1. Let p be j(v). Solve 5n = -pn + 25 for n. 5 Let q be 4 + 1(3 - 4). Suppose t + q - 4 = 0. Solve -7 = 4a + t for a. -2 Let q(a) = 2a3 + 10a*2 - 12a + 4. Let w be q(-6). Solve -wk + k - 9 = 0 for k. -3 Let h = 29 + -18. Let y = h - 9. Suppose 3w = y + 10. Solve 1 + w = t for t. 5 Suppose -2b - 13 = -47. Let k(m) = -m3 + 19m*2 - 34m + 2. Let g be k(b). Solve -gr + 1 = 11 for r. -5 Suppose 5d - 4 = -3z, -2d - 24 = -z + 2d. Suppose z = -10a + 11a. Solve 2i - a - 2 = 0 for i. 5 Let o = 34 + -31. Suppose -j - i - 1 = 0, -2j = -5j + oi + 27. Solve -j + 13 = 3g for g. 3 Let t be (120/18)/(2/9). Let m be (1 + -3)t/12. Let l = m - -5. Solve -2x + 0x + 6 = l for x. 3 Suppose 4s - 6s + 6 = 0. Let i be 6 + -6 - (-3 - -1). Let v be (-4 - 0)/(i - 4). Solve v = -sn + 2n for n. -2 Suppose q = -8q + q. Let h = -12 - -17. Solve q = -0o - o - h for o. -5 Suppose -48a - 20 = -53a. Solve an + 3 = n for n. -1 Let s = -24 - -18. Let t be (-58)/s - (-7)/21. Suppose 3m - 5 = t. Solve -m = 6l - l for l. -1 Let c be (-68)/(-18) - (-2)/9. Suppose 2 = 3s - c. Suppose -5r = -4f - 27, -f + 3 = 4r - sr. Solve 0 = -rk - 2k for k. 0 Let u be 9/6 - ((-3)/2 + 0). Solve 0o = uo for o. 0 Suppose 5r = -101 + 6. Let u = 23 + r. Suppose -3v + u = -2a - 16, 0 = v + 4a + 12. Solve -20 = -0s - vs for s. 5 Let a(v) = 2v - 2. Let j be a(5). Let q = j - -6. Suppose 16b + 100 - 164 = 0. Solve -2p - q = -b for p. -5 Let b = 76 + -67. Let l be 30/b30/25. Solve 3n = 4n + l for n. -4 Suppose 2o = s + 114, 2s = o + 5s - 50. Let t be 192/o - (-8)/14. Solve 0z = -z + t for z. 4 Suppose 6m - 16 = 2m. Suppose 34b - 8 = 32b. Let i(z) = -z3 - 6z*2 + z + 6. Let q be i(-6). Solve -m + q = bj for j. -1 Suppose -2q - 6 = -3p, -3q - 3p + 29 = 8. Solve 6 = qa + 15 for a. -3 Let b be (-13)/(-13) - (1 - 2). Let y be 4 + (-1 + b - 2). Solve -yc - 1 = -13 for c. 4 Suppose -30 = -28s - 2. Solve -24r + s + 23 = 0 for r. 1 Let n = -17 + 5. Let l be n/(-66) - (-590)/22. Let g = l - 17. Solve 0 = q + q + g for q. -5 Let m(y) = y*3 - 2y*2 - 3y - 1. Let h be m(3). Suppose -7b - 16 = -23b. Let g be (-2)/b - h6. Solve -k + g = k for k. 2 Let z be 0 + 1 + (-1)/(7/21). Let r be 5 + 5(1 + z). Solve y + 0 + 2 = r for y. -2 Suppose 5p = -1 - 9, 4p - 22 = -5l. Solve 2i + l - 14 = 0 for i. 4 Let f be (21/6)/7-14. Let a = -4 - f. Let u = 6 - a. Solve -uy + 7 + 8 = 0 for y. 5 Let x(m) = 5m + 8m - 12m + 20. Let a be x(-18). Solve -v = -av for v. 0 Suppose 92 = 4g - 3g - 5r, 3g + 3r - 366 = 0. Let c = g - 109. Solve cf = 3f for f. 0 Suppose 2t - 4r = 0, 2 = -t + 5r - 4. Suppose 2w = w - 5l - 14, -10 = -tw + 2l. Solve -w = -4z + 7 for z. 2 Suppose 10 = 6h - h. Suppose -9p - 10 = -12p + 4l, -p + 3l + 5 = 0. Suppose -h - 4 = -pc. Solve -c = 2a + 1 for a. -2 Suppose 5z = -z + 120. Let o be ((-64)/z)/1-5. Solve 2d + 2d = -o for d. -4 Suppose 5k + 125 = 5r + 10, 3r + 2k = 89. Solve rg - 2 = 25g for g. 1 Let l(j) = j + 7. Suppose -2m - 4z + 20 + 8 = 0, 2m - 22 = -2z. Let c be -4 + -1 - (m + -7). Let y be l(c). Solve 3d - 2d - y = 0 for d. 1 Suppose 0 = 6m + 92 - 8. Let k = m - -13. Let s = 3 + k. Solve -3z - sz = -5 for z. 1 Let w be 9((-13)/(-39) - 4/(-6)). Solve -5z = -11 - w for z. 4 Let h(m) = m + 5. Suppose -6 = -3q + q. Let w be h(q). Solve -3j - 4 = w for j. -4 Let r(n) = -n2 + 2n - 9. Let v be r(0). Let b be (-33)/v + 3/9. Solve -bz - 9 = 7 for z. -4 Suppose 0 = -13t + 15t + 174. Let r be 8/(-36) - t/27. Suppose -p + 23 = -5c + 6, p = rc + 11. Solve -p = 2n + 2 for n. -2 Suppose 0 = 5s + s - 18. Solve -si + 0i = -2i for i. 0 Let f(r) = -r*3 + 6r*2 + 17r - 61. Let t be f(7). Solve 4m + t = m for m. -3 Let i(p) = -p2 - 10p - 13. Let t = 18 + -24. Let d be i(t). Solve -d = 2b - 1 for b. -5 Suppose n - 46 = -2n + 5k, -20 = -2n - 2k. Let d = n + -9. Suppose do - 8 = -o. Solve 0 = 3b - ob for b. 0 Let y be (-162)/(-10) + (-6)/30. Let n(x) = -x*3 + 10x*2 + 10x - 3. Let r be n(11). Let b = r + y. Solve -3 = bq - 7 for q. 2 Let i be 3/((-3)/(-13)) + -4. Solve 4v + i + 3 = 0 for v. -3 Suppose 4 = 7n - 5n. Suppose -3i + 11 = -2i - 2t, i = -nt - 5. Solve -4b - 5 = -ib for b. -5 Let i be ((-99)/6)/(-6 + (-63)/(-12)). Solve 10a - i - 28 = 0 for a. 5 Suppose -7i = -4i - 12. Let f(u) = 23u +	{ "pile_set_name": "DM Mathematics" }
56)*2. 9072 Simplify (-3(sqrt(45) + sqrt(3645)))/(-2sqrt(18)/sqrt(2))-4. -60sqrt(5) Simplify 6(sqrt(136) - sqrt(136)-1-3)/(sqrt(8) - -6(sqrt(8) + sqrt(128))). -12sqrt(17)/31 Simplify (sqrt(243)2 + sqrt(243))/(sqrt(9) + (sqrt(900) + -1sqrt(900) - sqrt(900))) + 0. -sqrt(3) Simplify 6(1((sqrt(304)1 - sqrt(304)) + -5) - 3(5 + (sqrt(304) + -2 + sqrt(304) - sqrt(304))))*2. 2016sqrt(19) + 17592 Simplify (2 + -1-2((sqrt(171) - 2sqrt(171)4) + 5sqrt(171)-1))*2. -288sqrt(19) + 98500 Simplify -4 + (-1(sqrt(119) + 2sqrt(119)) + 2sqrt(119)3 + sqrt(119))/(sqrt(77)/((sqrt(1100) - (sqrt(1100) + sqrt(1100)2 - sqrt(1100))) + sqrt(11))). -36sqrt(17) - 4 Simplify -6(sqrt(176)4 + -4 + 5 + -5 + sqrt(44)). -108sqrt(11) + 24 Simplify ((sqrt(7) - (sqrt(7) - (sqrt(35)/sqrt(20) + sqrt(7) - sqrt(7)))) + -21sqrt(7) + sqrt(7) + -2 + (sqrt(49)-1)/sqrt(7))2. -3sqrt(7) - 4 Simplify ((sqrt(605) - (sqrt(605)2 + -3 - sqrt(605))) + sqrt(605))2 + ((-1sqrt(300))/sqrt(10))/sqrt(6). 65sqrt(5) + 614 Simplify ((((sqrt(95) + sqrt(95)-2)2 - sqrt(95))-6)/(-5sqrt(40)/sqrt(32)))2. 24624/25 Simplify (sqrt(9)/sqrt(3)4 - (-4 + sqrt(12) + sqrt(3)))-1. -4 - sqrt(3) Simplify 4 + (2 + sqrt(68))2 + (-1sqrt(136))/sqrt(8)4. 4sqrt(17) + 76 Simplify (sqrt(3648)2)/(1sqrt(432) + sqrt(432) - sqrt(432)) + -5. -5 + 4sqrt(19)/3 Simplify -2 + (2sqrt(17)2 - (1 + (sqrt(17) + 3)2)) + 3. -26 - 2sqrt(17) Simplify ((sqrt(104) + sqrt(104) + -6(sqrt(104) + 1sqrt(104)) + sqrt(104))2)/(-1sqrt(968) - (sqrt(968)2 - sqrt(968))). 9sqrt(13)/11 Simplify 3((sqrt(17) - (2sqrt(2448) + sqrt(2448)) - (-3 + sqrt(51)/sqrt(3)))*2 + 1) + -5. -648sqrt(17) + 66121 Simplify (-3 + sqrt(1300)-4 + sqrt(1300) + -3 + sqrt(325))2. 300sqrt(13) + 8161 Simplify (((sqrt(187) + (sqrt(187)2 + sqrt(187) - sqrt(187)))6 - sqrt(187))-3)/(sqrt(88)/(sqrt(32)/sqrt(4)-3)). 153sqrt(17) Simplify ((sqrt(76) - sqrt(76)1-4 - sqrt(76))5)/(sqrt(48)/(sqrt(12) - (sqrt(432) - sqrt(432)2))). 140sqrt(19) Simplify (sqrt(26)/sqrt(2) + 5 + (sqrt(325) + 1 - sqrt(13)) + -2(sqrt(156)/sqrt(4))/sqrt(3))2. 36sqrt(13) + 153 Simplify 6((3sqrt(132)/(sqrt(12) - sqrt(12)-1))2 + (sqrt(11) - sqrt(121)/(sqrt(33)/sqrt(3))) + -4 + (-1sqrt(11))*2). 381/2 Simplify -3(0 + 1((sqrt(2) - 53sqrt(2)) + sqrt(2) + sqrt(8)/sqrt(256)))2. -31827/32 Simplify 5(-1 + 0 + sqrt(17) + 1)5. 25sqrt(17) Simplify -3 + (-4(sqrt(95)/sqrt(5) + -1) - (2 + 1 + sqrt(171) + sqrt(19)))2. -16sqrt(19) + 1214 Simplify ((sqrt(209) - -1sqrt(209)3)-6)/(-5(-5sqrt(44)/sqrt(4) - sqrt(11))). -4sqrt(19)/5 Simplify (sqrt(98) + 2 + sqrt(98) + 0 + (sqrt(98) - -51sqrt(98)))*2. 224sqrt(2) + 6276 Simplify (42sqrt(38))/(sqrt(2) + sqrt(36)/sqrt(2)) + 4 + 1. 5 + 2sqrt(19) Simplify (-5(sqrt(704) + 2) + sqrt(704))*2 + ((0 + sqrt(396))1)*2. 640sqrt(11) + 11760 Simplify sqrt(1331)2 + -4 + sqrt(1331) + sqrt(396) + 1 + (sqrt(275)2)*2. 39sqrt(11) + 1097 Simplify ((sqrt(91)3-3)/(sqrt(847) + (4sqrt(847) - sqrt(847) - sqrt(847))))2. 117/121 Simplify (2sqrt(300)-6 - (5 + sqrt(300)-3))*2 + 4. 900sqrt(3) + 24329 Simplify (5 + 3 + sqrt(176))*2 + (-5sqrt(704) + 0)*2. 64sqrt(11) + 17840 Simplify (sqrt(110)/(sqrt(11)-3))/(-2sqrt(5)-2) + 1. -sqrt(2)/12 + 1 Simplify (((sqrt(136) - -4-2sqrt(136))-5)/((sqrt(392)2 - sqrt(8))-6)3)2. 20825/676 Simplify ((sqrt(65) + sqrt(65)-24 - sqrt(65)) + sqrt(65) - ((sqrt(65) - (sqrt(65) - 2sqrt(65))) + sqrt(65))-2)/(sqrt(500) + sqrt(500)-2-3). -sqrt(13)/70 Simplify 3 + (-5(sqrt(21) - sqrt(84)/sqrt(100)))/((sqrt(72)/(sqrt(3)2 - sqrt(3)))/sqrt(8)). -4sqrt(7) + 3 Simplify ((sqrt(270) - (2(1sqrt(270) - sqrt(270)) + sqrt(270))) + sqrt(270) + -1sqrt(270)-1)/(2(sqrt(216)2 + sqrt(6))). 3sqrt(5)/13 Simplify 2(3 + (0 + sqrt(425) - sqrt(425)) + -2 + 1)*2. 8 Simplify -2(4 + 1sqrt(2880) + 4)2. -5888 - 768sqrt(5) Simplify ((-3 + sqrt(2299))-2 + (sqrt(2299) + 3)-5 + 1)*2. 1232sqrt(19) + 112715 Simplify -2(-1 + (sqrt(144)6)/(6(sqrt(48) + sqrt(3)))). -8sqrt(3)/5 + 2 Simplify (((2 + sqrt(147) + sqrt(147))-3 - (sqrt(147) + (sqrt(147) + 1)3)) + -2)*2. 1540sqrt(3) + 14821 Simplify (sqrt(156) + (sqrt(156) - (6(4sqrt(156) - sqrt(156)) - sqrt(156))) + sqrt(156))/(sqrt(12) + sqrt(36)/(4sqrt(3))). -56sqrt(13)/5 Simplify -4 + -5 + sqrt(300)-2-4 + (sqrt(300) + -3 + (sqrt(300) - (1 + sqrt(300))) - sqrt(300) - sqrt(300))*2. 160sqrt(3) + 307 Simplify 2 + (sqrt(65) - (2sqrt(65) - sqrt(65))4)/(-2sqrt(180)) + 2. sqrt(13)/4 + 4 Simplify -4(0 + sqrt(245))*2 + sqrt(245) - (-1 + (sqrt(320)-1)*2). -1299 + 7sqrt(5) Simplify (sqrt(3) - ((sqrt(3) + -2sqrt(3) + -4)2 - sqrt(3))) + (-3-2sqrt(3))2 + ((sqrt(54)/(-1sqrt(9) - sqrt(9)))/(sqrt(2) + 1sqrt(18)))2. -6sqrt(3) + 5699/64 Simplify (sqrt(539)-1 - (sqrt(11)-1-5 + sqrt(11))2 - (0 + sqrt(11) + 1 - ((sqrt(66) - (-2sqrt(66) + sqrt(66) + sqrt(66)) - sqrt(66))/sqrt(6))*2)) + -2. -399 - 8sqrt(11) Simplify ((1 + (sqrt(112) - -3sqrt(112) - sqrt(112)) + sqrt(112) + sqrt(112) + sqrt(112))-6 - (sqrt(112) + -3 + -1 + -4))*2. -592sqrt(7) + 153332 Simplify sqrt(704) + 3 + sqrt(704) + 0 + (-1 + (2sqrt(704))2 - sqrt(704)) + -2 + 2. 8sqrt(11) + 2818 Simplify 1((sqrt(1134) - (sqrt(1134)-4 - sqrt(1134)))/(sqrt(7) + (sqrt(847)4 - sqrt(7)) + sqrt(7)) + 0). 6sqrt(2)/5 Simplify ((sqrt(162) + sqrt(162)41 - sqrt(162)) + 4(1sqrt(162) + sqrt(162)) + 2)*2. 432sqrt(2) + 23332 Simplify -1 + (-2 + ((-4sqrt(1216)-1)*2 - sqrt(1216)-2-2))5. -160sqrt(19) + 97269 Simplify 1 + (sqrt(500) + (3(sqrt(500) + 2) - sqrt(500)) - ((sqrt(60) + sqrt(420)/sqrt(7))/sqrt(6))/sqrt(2))*2. 336sqrt(5) + 3957 Simplify (sqrt(270) + sqrt(270) + sqrt(270)23)/(-3sqrt(90)-3). 8sqrt(3)/9 Simplify 4((-3 + sqrt(176) + -1sqrt(176) + -3)-4)*2. 2304 Simplify (sqrt(1584) + 6((sqrt(1584) + -1 - sqrt(1584)) + sqrt(1584) + sqrt(1584)) + ((sqrt(165)/sqrt(3))/sqrt(5) - sqrt(11)) + -3 + 2)*2. -2184sqrt(11) + 267745 Simplify 6(sqrt(117) - sqrt(13)) + 3 - sqrt(39)/(sqrt(3) + sqrt(75)1). 3 + 71sqrt(13)/6 Simplify (sqrt(2600) + sqrt(2600) + (sqrt(2600) - -1sqrt(2600))-6)/((sqrt(72) - sqrt(72)-1)2). -25sqrt(13)/6 Simplify ((-1sqrt(315))/sqrt(9))/(sqrt(7) + sqrt(3087)). -sqrt(5)/22 Simplify ((sqrt(135)1 + sqrt(135))/sqrt(9)-5)/(sqrt(36)/(sqrt(192)6)). -240sqrt(5) Simplify -5 + ((sqrt(99) + -1sqrt(99) + sqrt(99))5 - sqrt(99))/sqrt(9) + -4(sqrt(1100) + 0)*2 + sqrt(1100) + sqrt(1100) + sqrt(1100). -4405 + 34sqrt(11) Simplify (5(sqrt(350) + -2sqrt(350)))/(1-2sqrt(98) - sqrt(98)). 25sqrt(7)/21 Simplify -5(-1sqrt(315)-6)/((sqrt(240)-2 + sqrt(60))/sqrt(12)). 30sqrt(7) Simplify (-4-4(sqrt(13) + sqrt(13) + 2) - (2sqrt(143)2)/sqrt(11))1. 32 + 28sqrt(13) Simplify (sqrt(18)2-2 + 1)15. -60sqrt(2) + 5 Simplify (5 + sqrt(847)-2 + sqrt(847) - sqrt(847)) + 5 + 1 + (sqrt(77) - (sqrt(77) + -3-1sqrt(77)) - sqrt(77))/sqrt(11). -26sqrt(7) + 11 Simplify (-2(sqrt(1216)-1 + -1 - sqrt(1216) - -2-2sqrt(1216))2 + 3)-4. 768sqrt(19) + 350204 Simplify ((-1sqrt(154)5)/sqrt(7))/((sqrt(48)/sqrt(4))/sqrt(6)3). -5sqrt(11)/3 Simplify -5 + (sqrt(1088) - (sqrt(1088) + 3)) - (sqrt(2448)-4 + 4). -12 + 48sqrt(17) Simplify 4 + (((sqrt(110) - (sqrt(110) + -5sqrt(110)))-3)/(6-3sqrt(10)))2. 419/36 Simplify ((4sqrt(231)/sqrt(7))/(sqrt(3) + ((sqrt(3) + (sqrt(3) - sqrt(9)/sqrt(3)) + sqrt(3))4 - sqrt(3))))2. 11/4 Simplify -3(sqrt(33)/sqrt(3) + -1) - ((sqrt(1584) + -2 + sqrt(1584))1)2. -6337 + 93sqrt(11) Simplify ((-1(1 + sqrt(300)))2 + sqrt(300) - ((sqrt(300) + (sqrt(300) + sqrt(300)-2-3 - sqrt(300)))2 - sqrt(300))) + (2sqrt(300)-1-5)*2. 40sqrt(3) + 15601 Simplify ((2sqrt(91)-1-2)/(-4(sqrt(7) + sqrt(28)/sqrt(4) + sqrt(7) + sqrt(7)) + (sqrt(28) - sqrt(448))))*2. 52/121 Simplify 3((-2sqrt(2299) - sqrt(2299)) + -1sqrt(19) + -3 + (sqrt(931) + -1 + sqrt(931))5)2. -1728sqrt(19) + 74064 Simplify (sqrt(6655)5)/(sqrt(66)/(sqrt(30)/sqrt(5))). 55sqrt(5) Simplify ((sqrt(133)-5 - sqrt(133))4 + sqrt(133))/(3(sqrt(700) + sqrt(7))). -23sqrt(19)/33 Simplify ((3 + 4(sqrt(13) + 1))-3 + 3)*2. 432sqrt(13) + 2196 Simplify (((sqrt(91) - (sqrt(91) - (sqrt(91)25 - sqrt(91)))) + sqrt(91) +	{ "pile_set_name": "DM Mathematics" }
n(z) = -z*2 - 2z + 7. Let s be n(2). Let c be (79183/(-26))/(s/2). Suppose 3641 = 2m + m - 5f, 5m + 3f - c = 0. Is m prime? True Suppose -2b - 13804 = -3q + 24427, -q + b = -12746. Is q prime? True Let v(t) = 9t3 + 15t*2 + 9t - 52. Let d(y) = 8y3 + 15y*2 + 10y - 50. Let u(j) = -3d(j) + 2v(j). Is u(-11) prime? False Is (-74460000)/(-1224) - 1/3 prime? False Let o be (4/3)/((-2)/9). Let v(i) = -i - 1. Let t be v(o). Is (t + 848/(-6))-3 a composite number? False Suppose 366872 + 389285 = 5x + 4y, 604955 = 4x - y. Is x composite? False Suppose 816 = -9u - 8u. Is ((-60)/u)/(3/59676) prime? False Is 12(-12)/(-336) - 319834/(-7) composite? False Let l(a) = a3 - 4a*2 - 19a + 45. Let r(y) = -y - 1. Let g(t) = l(t) + 3r(t). Is g(19) composite? False Let i(j) = j2 - 12j + 35. Let a be i(8). Suppose ad - 1323 = 300. Is d a prime number? True Let f be (-3)/12 + (-791)/4. Suppose 0 = -5k - 5n + 2970, n + 1176 = 2k - n. Let x = k - f. Is x composite? True Let n(s) = 96s2 - 15s - 2. Let p be n(-13). Let m = -11714 + p. Is m a composite number? False Let s = 4105 + -2160. Suppose -s - 437 = -6p. Is p a prime number? True Let k = -33 + 65. Let d = -40 + k. Is -1d/(-4)(-377)/2 a prime number? False Let u be (-50)/(-15)(-18)/12. Is (-2 - 3) + (-1406)/(u/5) a prime number? False Let l(y) = 5113y2 + 84y - 606. Is l(9) a composite number? True Let f = -132 + 130. Let j be -2 + (1 - (-4 - f)) - 0. Is (j-2)/(-3 + 5) - -480 a prime number? True Is (-119302)/5405/(-162) a composite number? False Suppose -2a - 9d + 3296 = -2d, a - 1639 = -5d. Is a composite? False Suppose 389t + 5733853 = 420t. Is t a prime number? False Let q = 983 + -520. Suppose 11n - 9362 + q = 0. Is n composite? False Let n = -260 + 262. Is (2 + -1 - n) + 23940/19 a composite number? False Suppose -4c - 166 + 222 = 0. Suppose w - 23 + 6 = 0. Suppose cy = wy - 2859. Is y prime? True Suppose 33199 = z - 4g - 97938, 0 = -5z - 5g + 655685. Is z composite? True Let w(p) = 51p - 9. Let r = -77 - -50. Let l = r - -29. Is w(l) a composite number? True Let o(t) = -13t + 37. Let f be o(3). Is (-273 + -13)/(f1) a prime number? False Suppose 2r - 5y - 73935 = 0, -38693 + 1729 = -r - y. Is r prime? False Let g be (8/14 - (-720)/14) + 1. Suppose -gp + 252790 + 187693 = 0. Is p a composite number? False Let w(s) = s3 + 15s*2 + 11s + 19. Let q be w(-14). Suppose 17423 = qa - 54a. Is a prime? False Let r be 8/(-52) - (-30)/26. Suppose 3g = -p + 18, 0p + 16 = 4p - 2g. Is (-7 + p)/((-7740)/7737 + r) composite? False Let s = 3248229 + -2059772. Is s a composite number? False Let k = -4361 + 3060. Let s = k - -2250. Is s prime? False Suppose 0 = -4z + 2868 - 804. Suppose -z = 4r - 4352. Is r prime? False Let d(k) = 19k3 - 2k*2 + 4k - 2. Let i be d(1). Suppose 12 = 17s - is. Is (31)/(s/(-546)7) a composite number? True Let a = -955 - -825. Suppose -v + 3 = 2. Is (a/(-78))/(v/1011) composite? True Let t be -3(-4 - -16) + (-6)/(-3). Let c(r) = -267r + 13. Is c(t) a composite number? False Suppose -28 - 80 = 4g. Let r = -55 - g. Is (-389 - r)1/(-1) a composite number? True Let y = 53543 + -32625. Is y prime? False Is 546671742/710 - 1/((-20)/16) composite? False Let i be ((-8)/(-3) - -2)/((-2)/3). Let l be (i - -1)(-46)/69. Is l/10 + 2/((-30)/(-12609)) prime? False Let z(y) = 20y - 11. Suppose 3b - 18 = -h, -h + 8 = -0b + 5b. Suppose 0 = 5o - h - 22. Is z(o) composite? True Let l(g) = -88g + 3. Let s(z) = -3z*3 + 4z*3 - 7z - 4 - 6z2 + 0. Let u be s(7). Is l(u) a prime number? False Let i(o) = o2 + 5o - 18. Let q be i(-8). Let y be 5 + (q/24)/((-1)/4). Suppose 8d - 6d - 7734 = -yk, 1941 = k + 2d. Is k prime? True Let n = -23 + 49. Suppose 762 = ng - 23g. Suppose v + b = 129, -2v + b = 4b - g. Is v composite? True Let x = -331 - -341. Suppose 13h = xh + 26031. Is h a composite number? False Let u = -170012 + 285069. Is u a prime number? True Let k be (-12)/(-7)21/6. Suppose 2x - 7024 = kx. Let s = 2595 + x. Is s composite? False Let s(m) = -2m*2 + 39m - 86. Let n be s(18). Is ((-48813)/(-12))/((-8)/n) a prime number? False Is (282/(-27))/((-68)/93942) a composite number? True Suppose 3160 = 4c - 2o - 0o, -3c - 2o = -2384. Let j be -11838/(-4) - 0. Let z = j - c. Is z prime? False Let j(r) = 715r2 - 6 - 663r*2 + 1 + 13r + 3. Is j(-7) composite? True Suppose -4f + 4i = -1552, -4f = -4i + i - 1552. Let t = 1067 - f. Is t composite? True Let n = 2082 + 1671. Suppose f = -u + 5f + 3777, u + 2f = n. Is u a prime number? True Suppose 217110 = 5i - h, 10357 + 76504 = 2i + 3h. Is i a prime number? False Suppose -736g = -741g + 29755. Is g a composite number? True Suppose -5u - 1941 = b - 2b, 0 = -5b - 4u + 9560. Suppose 4m - b = w, 3m - 3w - 1725 = -288. Is m prime? True Let f(j) = -16j3 - 21j*2 - j + 116. Let n(z) = 24z*3 + 31z*2 + z - 174. Let x(r) = 7f(r) + 5n(r). Is x(8) a prime number? False Let i be 1/(33/(-7612)) - 4/(-6). Is (-24106)/(-10) - 92/i composite? False Suppose 12 = -4n + 8. Is 4 + 985 - n - (-3 - 2) a prime number? False Suppose -2s = -7s + 1370. Suppose -3y + v = 3v - s, -5y = -v - 448. Suppose y = -2t + 2108. Is t prime? True Suppose 2d = -2z + 1898514, 0 = d + 52z - 56z - 949237. Is d prime? True Let b be 34/187 + 17772/22. Suppose -m = i - b, 0 = 2m - 3m - 5i + 828. Is m a composite number? True Let i(p) = -2p + 1. Let l(a) = -5a + 3. Let x(j) = -7i(j) + 4l(j). Let v be x(0). Suppose vd - 1027 = 268. Is d composite? True Suppose -537 = -5z + 2698. Is z a composite number? False Let g = 98 - 95. Is (-13)/39 - (-5668)/g a prime number? True Is (832/128)/(1/15838) a prime number? False Let y = -410 + 412. Is (5 + 33197 + (5 - 1))/y prime? True Let c(s) = s3 + 138s*2 + 1402s - 196. Is c(-111) a prime number? True Let p = 2453 + -971. Suppose 3i = 4d + p, -2475 = 2i - 7i + 5d. Suppose 5z + z = i. Is z a composite number? False Let w = -31716 - -51853. Is w composite? True Let p = 9 - 15. Let o be 2/((-16)/3) - 7167/24. Let v = p - o. Is v prime? True Suppose -4m + 293 = 5b, 0 = 4m + 2b - 281 - 9. Suppose 66n - mn = -70458. Is n a composite number? False Let c be 306/24 - (21/12 - 2). Suppose 5o = -9o + co. Suppose o = 5x - 5, 2921 = 2r - 3x - 146. Is r a prime number? False Is 528574 + (-31)/(558/270) prime? True Let z be (-52)/(-91) - 538/(-14). Let t = 41 - z. Suppose -3b - 8533 = -2v, 3b = tv + b - 8528. Is v composite? False Let k(o) = -80073o + 19864. Is k(-19) prime? True Let b(f) = 14045f - 34. Is b(3) composite? False Suppose 4a = 2r + 383 + 24523, -4r - 6209 = -a. Is a a composite number? False Suppose 16v = 7v - 6v + 7132335. Is v a prime number? False Let l(v) = -555v - 39. Let p be l(-8). Let r be p/(-2)((0 - 1) + -1). Suppose 13279 = 3x + 4n, x + 0n - r = 5n. Is x prime? True Let a = 371 + -366. Suppose af = -3y + 8204, 12y = -3f + 7y + 4932. Is f a composite number? True Let c be (-209259)/(-36) + (5/4)/5. Suppose 2i - c = -3o, -2i = -o - 4286 - 1507. Is i a prime number? False Let z(p) = -2p3 + 267p*2 + 301p + 231. Is z(124) a prime number? False Let u(o) = -o*2 - 16o - 25. Let w be u(-2). Is (-2370)/(-1) + -4 + (8 - w) a composite number? False Let u(y) = 68y2 - 29y + 377. Is u(18) prime? False Let r(y) = -7y3 - 4y*2 + 18y - 6. Let f be r(7). Let c = f + 4602. Let x = 3024 - c. Is x prime? False Suppose -7v + 4 + 24 = 0. Suppose 0 = 2d - vp - 2107 - 3559, 5d - 14190 = 5p. Is d composite? False Let i(c) = -2c*2 + 7c - 10. Let q be i(3). Let z(t) = t*2 + 9t + 26. Let h be z(q). Suppose -2f = w - 414, -2w - h = -5w. Is f a prime number? False Let x(i) = 19i*3 - 5i*2 + 2i - 5. Let v = 64 - 60. Let w be x(v). Suppose -w - 190 = -3t. Is t prime? True Let k = -56595 - -204196. Is k a composite number? True Suppose -84i = -170i + 71i + 6379635. Is i prime? True Let d(x) = -268284x + 599. Is d(-3) prime? True Let w be 4736/72 - (-2)/9. Let s = 72 - w. Suppose -sz + 95 = -1495. Is z composite? True Suppose -12s + 134552 = -8s + w, -168201 = -5s - 4w. Is s prime? True Is (-3 + -495475 + -5)*(-3 - 40/(-15)) a composite n	{ "pile_set_name": "DM Mathematics" }
4, -2/19, -7 Sort -1/10, -1, -4, -0.3, -2 in increasing order. -4, -2, -1, -0.3, -1/10 Sort -3, -5, 0, 5. -5, -3, 0, 5 Sort 3, 5, 1/9 in decreasing order. 5, 3, 1/9 Put -5, -19, -2 in increasing order. -19, -5, -2 Sort -3/7, 3, -2/9, 29/3, -1. -1, -3/7, -2/9, 3, 29/3 Sort 0.4, -1/3, 0.2, -4 in descending order. 0.4, 0.2, -1/3, -4 Put 3, 2/3, -6, 2 in decreasing order. 3, 2, 2/3, -6 Sort -0.1, 1/8, -0.06. -0.1, -0.06, 1/8 Sort 0.1, 0.2, -3, 9 in decreasing order. 9, 0.2, 0.1, -3 Put -13, 0, 1, 11 in decreasing order. 11, 1, 0, -13 Sort 17, 1, -29, -3 in ascending order. -29, -3, 1, 17 Put 12, 0, -98 in descending order. 12, 0, -98 Put -0.4, 6, 3, -2, 10 in increasing order. -2, -0.4, 3, 6, 10 Sort 1, -2, 5, -3 in decreasing order. 5, 1, -2, -3 Sort -1, 3, 2/349, -1/6, -0.1 in ascending order. -1, -1/6, -0.1, 2/349, 3 Sort -14, -11, -3, 11. -14, -11, -3, 11 Put 3, -5052, 4 in descending order. 4, 3, -5052 Sort 5, -4/7, -2, 3/4 in decreasing order. 5, 3/4, -4/7, -2 Put -6, -2, 0.5, -0.1 in descending order. 0.5, -0.1, -2, -6 Put 4, -3, -18, 5 in descending order. 5, 4, -3, -18 Put 12, 4, 21 in descending order. 21, 12, 4 Put 63, 5, 2/13 in decreasing order. 63, 5, 2/13 Put 3, 324, 5, -4 in ascending order. -4, 3, 5, 324 Put -0.4, 3, -2, 4, 49 in increasing order. -2, -0.4, 3, 4, 49 Sort 0, 42, 2, -2. -2, 0, 2, 42 Sort 1/3, 3, -1/4, -9 in descending order. 3, 1/3, -1/4, -9 Put 4, 3, 0, 21 in increasing order. 0, 3, 4, 21 Put 4, -27, -15 in decreasing order. 4, -15, -27 Sort 0.7, -0.5, 350 in decreasing order. 350, 0.7, -0.5 Sort 5, 8, 2, -3 in descending order. 8, 5, 2, -3 Put 4, -4, 1/2, -2 in descending order. 4, 1/2, -2, -4 Put -5, 47, 4 in increasing order. -5, 4, 47 Put -3, 125, -1, -2 in decreasing order. 125, -1, -2, -3 Sort 0.2, 2/7, 3/4, -2 in descending order. 3/4, 2/7, 0.2, -2 Sort -4, 1, -528, 5. -528, -4, 1, 5 Put 4, -427, 0 in descending order. 4, 0, -427 Put -2/5, 5/3, -1, 0.3, 4 in descending order. 4, 5/3, 0.3, -2/5, -1 Sort -9, -2, 7, -1, 1 in ascending order. -9, -2, -1, 1, 7 Put 0.33, -1.5, -0.2, -11, 2/11 in descending order. 0.33, 2/11, -0.2, -1.5, -11 Put -35/2, -0.12, 6/5, 3 in decreasing order. 3, 6/5, -0.12, -35/2 Put 35, -34, 1 in decreasing order. 35, 1, -34 Put -35, 4, 1, -7 in increasing order. -35, -7, 1, 4 Sort 4, -5, -6, -47. -47, -6, -5, 4 Put 5, -2, 15 in descending order. 15, 5, -2 Sort 0, -3/14, -0.5 in decreasing order. 0, -3/14, -0.5 Sort -5, -2, -1/578 in ascending order. -5, -2, -1/578 Sort -28, -10, 20 in decreasing order. 20, -10, -28 Sort -5, 22, -4 in descending order. 22, -4, -5 Sort -0.2, 13, 26, -1/11 in increasing order. -0.2, -1/11, 13, 26 Sort 8, 0.3, 0.4 in descending order. 8, 0.4, 0.3 Sort 1, 4, 3/19, 2 in increasing order. 3/19, 1, 2, 4 Put 0, -27, 2, -1, 4 in decreasing order. 4, 2, 0, -1, -27 Put -335, 0, 4, -5 in increasing order. -335, -5, 0, 4 Put 3, -3/25, 0.7 in decreasing order. 3, 0.7, -3/25 Sort -4, -1631, 0 in descending order. 0, -4, -1631 Put 5, -3, -0.1, 2/7 in ascending order. -3, -0.1, 2/7, 5 Put 14/169, 2, 3 in increasing order. 14/169, 2, 3 Sort 0, 54, 3. 0, 3, 54 Put -1, -32, 4 in ascending order. -32, -1, 4 Sort -5/3, -4, 24, -6 in increasing order. -6, -4, -5/3, 24 Put 8, 4, 112 in descending order. 112, 8, 4 Sort 3/5, -2, 0, 2/15 in increasing order. -2, 0, 2/15, 3/5 Put -32, -5, 3, -4, 2 in descending order. 3, 2, -4, -5, -32 Sort 0, 0.1, -1/22, 1 in ascending order. -1/22, 0, 0.1, 1 Sort -14, 5, 4, -20, -1 in increasing order. -20, -14, -1, 4, 5 Put 3, 41, -3, -1 in increasing order. -3, -1, 3, 41 Sort 2/19, 3, 20, -5. -5, 2/19, 3, 20 Sort 3, 0, -9 in ascending order. -9, 0, 3 Sort 2, -12, 4, 1 in ascending order. -12, 1, 2, 4 Put 65, -5, 31 in descending order. 65, 31, -5 Sort -2, 91, 4. -2, 4, 91 Put 3, -2, -3, 3/166, 0 in decreasing order. 3, 3/166, 0, -2, -3 Put 1/4, -3, 3/2, -2 in decreasing order. 3/2, 1/4, -2, -3 Sort -34, 64, -3 in descending order. 64, -3, -34 Sort -37, -2, 3, -4. -37, -4, -2, 3 Sort 1, 5/3, -2 in increasing order. -2, 1, 5/3 Sort -5, 27, -4.8 in descending order. 27, -4.8, -5 Sort -6, 3, -20 in decreasing order. 3, -6, -20 Sort -8, 2/7, -3, 0.2. -8, -3, 0.2, 2/7 Sort -1, -10, 10, 5 in increasing order. -10, -1, 5, 10 Sort 1, 14, 9 in ascending order. 1, 9, 14 Sort -4/3, 0, 6/7, 3/4. -4/3, 0, 3/4, 6/7 Sort -3, 1, -1, 35, 5 in descending order. 35, 5, 1, -1, -3 Sort -1/6, -3.8, 1. -3.8, -1/6, 1 Sort -1/6, -89, 2 in descending order. 2, -1/6, -89 Put 6, 3, -1, -17, 4 in decreasing order. 6, 4, 3, -1, -17 Sort 1, 176, -1, 3 in descending order. 176, 3, 1, -1 Put 5, -3, 4, -8 in decreasing order. 5, 4, -3, -8 Put 75, 0.2, 3, 5 in decreasing order. 75, 5, 3, 0.2 Sort -1, 94, -6 in decreasing order. 94, -1, -6 Sort -1/3, 6, 0.35 in decreasing order. 6, 0.35, -1/3 Put -4, 4, 0, -63, 3 in decreasing order. 4, 3, 0, -4, -63 Put 2, -3/4, -0.14 in increasing order. -3/4, -0.14, 2 Sort -1/6, 1, 3/8 in descending order. 1, 3/8, -1/6 Sort -5, 3, -157 in increasing order. -157, -5, 3 Put -1, -2/17, 0.2 in descending order. 0.2, -2/17, -1 Put 1, -3, 2 in ascending order. -3, 1, 2 Sort 4, -0.03, -0.5, -0.1 in descending order. 4, -0.03, -0.1, -0.5 Put 3, 1458, 1 in increasing order. 1, 3, 1458 Sort 85, 2, -5 in descending order. 85, 2, -5 Sort -89, -1/2, 3/2. -89, -1/2, 3/2 Put -2, 7, 3, -53 in ascending order. -53, -2, 3, 7 Put 2/3, 4, 2, 3/5 in descending order. 4, 2, 2/3, 3/5 Sort -2, 0.6, -2/5. -2, -2/5, 0.6 Put -8, -29, -4 in descending order. -4, -8, -29 Sort -2/7, 76, 17 in increasing order. -2/7, 17, 76 Put -76, 12, -0.4 in descending order. 12, -0.4, -76 Sort 22, 0, 4, 49. 0, 4, 22, 49 Sort -1, -11, -2, 5, 3 in ascending order. -11, -2, -1, 3, 5 Sort -3, 0, 2, -5 in descending order. 2, 0, -3, -5 Sort 3, -5, 0, 4, -89. -89, -5, 0, 3, 4 Sort 0.137, -0.2, -2 in ascending order. -2, -0.2, 0.137 Sort -11, 2/3, 1, -4 in decreasing order. 1, 2/3, -4, -11 Put -79, 3/17, -2/9, 4 in descending order. 4, 3/17, -2/9, -79 Sort -15, -14, -5, 1, 5 in descending order. 5, 1, -5, -14, -15 Put 11, -2, 2 in descending order. 11, 2, -2 Put 23, -1, 0.2 in descending order. 23, 0.2, -1 Put 5, -224, 0 in descending order. 5, 0, -224 Sort 334, -10, -5. -10, -5, 334 Sort -5, -1, -91 in decreasing order. -1, -5, -91 Sort 15, -4, 0, 8, -1/7 in increasing order. -4, -1/7, 0, 8, 15 Sort 2, -5, 3620, -1. -5, -1, 2, 3620 Sort -7, -25, -30 in ascending order. -30, -25, -7 Put 14, 1, 2/15 in increasing order. 2/15, 1, 14 Sort -8, -5, -3, 23 in descending order. 23, -3, -5, -8 Sort 2, -4, 0.5, -9. -9, -4, 0.5, 2 Put -53, -5, 5 in ascending order. -53, -5, 5 Put 1, -0.5, -5, -0.91 in decreasing order. 1, -0.5, -0.91, -5 Sort 10, 2, 4, -18, 3 in decreasing order. 10, 4, 3, 2, -18 Sort -2/13, 1, 51 in ascending order. -2/13, 1, 51 Sort 0, -5, -25 in increasing order. -25, -5, 0 Sort 2/7, -291, 0 in ascending order. -291, 0, 2/7 Put -5, 4, -20, -2, 10 in descending order. 10, 4, -2, -5, -20 Sort -0.16, -4, -206/9 in descending order. -0.16, -4, -206/9 Sort 0, -40, -1, 5 in descending order. 5, 0, -1, -40 Put -7, 0, -3, -5 in ascending order. -7, -5, -3, 0 Sort -25, 4, 5 in descending order. 5, 4, -25 Put -2, 2, 0, 7 in descending order. 7, 2, 0, -2 Sort -4, -2/11, -142, -5 in decreasing order. -2/11, -4, -5, -142 Sort 5, -24, 25, 4 in increasing order. -24, 4, 5, 25 Put -2, 2, -115 in descending order. 2, -2, -115 Sort -4, 52, -2 in decreasing order. 52, -2, -4 Sort -2/7, 0.3, 0, -6.3 in increasing order. -6.3, -2/7, 0, 0.3 Sort 1, 4, 7, -83 in descending order. 7, 4, 1, -83 Sort 33, 2, -3, 5. -3, 2, 5, 33 Sort -1, 9, 2, -3. -3, -1, 2, 9 Sort 23, -5, 3 in ascending order. -5, 3, 23 Sort 11, -25, 3 in descending order. 11, 3, -25 Sort -4, 2, 7, 1. -4, 1, 2, 7 Sort 238, -5, -3 in ascending order. -5, -3, 238 Sort 5, 3, -21, 1 in decreasing order. 5, 3, 1, -21 Sort 5, 25, -1 in decreasing order. 25, 5, -1 Sort 1, 1/2, -1, 8/33 in descending order. 1, 1/2, 8/33, -1 Sort -14, 10, 4/13 in descending order. 10, 4/13, -14 Sort -4, 4.5, 0 in ascending order. -4, 0, 4.5 Put 1, -62, -1, -4 in ascending order. -62, -4, -1, 1 Put 1, 5, -946, -3, -4 in decreasing order. 5, 1, -3, -4, -946 Sort 4, -5, 0, 20, -8. -8, -5, 0, 4, 20 Put 0.1, 5505, -0.4 in increasing order. -0.4, 0.1, 5505 Sort 0, 6, 3	{ "pile_set_name": "DM Mathematics" }
. -991.590772 What is -1753 + -0.04394849294? -1753.04394849294 What is 348 + -43065143952? -43065143604 -142434526492+-3 -142434526495 What is the distance between 3 and -1482979244423? 1482979244426 4190309 - 36.7759 4190272.2241 What is 1497183935 less than 16580? -1497167355 42828734+-115261 42713473 Subtract 0.152 from -61418377381. -61418377381.152 Calculate -5209749196 - 185.5. -5209749381.5 Total of 129612 and -181.83638. 129430.16362 What is 2919328738.6 + 1.643? 2919328740.243 Add together 0.119215 and 6733863447. 6733863447.119215 What is 47191663173 take away -1033? 47191664206 Calculate -42514 + 4670618. 4628104 What is the difference between -215716276 and -1489? 215714787 Work out 4.534160793 - 0.04. 4.494160793 Work out 9 - 113334175.4172. -113334166.4172 What is -4890201563.799 minus 7? -4890201570.799 What is the difference between 16011 and 123713.11638? 107702.11638 Put together 0.03972929575354 and -12. -11.96027070424646 Work out -15 - -146.54840612958. 131.54840612958 What is -4258.86991 take away 66.365? -4325.23491 What is the distance between -2102.659 and -100572950? 100570847.341 Add -25194325.346 and 6082. -25188243.346 214684445 - -52102 214736547 7267 - 687111453 -687104186 What is 0.1324 minus -30988616778? 30988616778.1324 Add together 14.06381523524 and -0.4. 13.66381523524 Work out -0.65 - 47682.376852. -47683.026852 What is -1043305224 plus 0.038148? -1043305223.961852 What is -1380.0825612 - 38? -1418.0825612 Work out -1.01411 + 93.1765. 92.16239 Work out -119909 - -1494086. 1374177 Work out 2146554310 + -13141. 2146541169 Add together -32.227 and -5.439833169. -37.666833169 15.32 - 356763088 -356763072.68 What is the difference between -5.857513 and -15793? 15787.142487 What is -0.06 + -0.07831000294? -0.13831000294 Put together 2 and 0.04892431902062. 2.04892431902062 Subtract 9181067100 from -0.75. -9181067100.75 What is the difference between -64719.09718916 and -0.08? 64719.01718916 What is the difference between 7575683 and 1.0661? 7575681.9339 What is the distance between 204191 and -1460808734? 1461012925 Add together -75 and -39490199183. -39490199258 -29033394 + -627.5 -29034021.5 What is the distance between 365984912175111 and -0.2? 365984912175111.2 What is -688.4834142 less than -19793? -19104.5165858 0 - 5223617957312 -5223617957312 Calculate -0.11563330328 - 2. -2.11563330328 What is 198 less than -470259951? -470260149 Calculate -1004648609834 - 2. -1004648609836 Subtract 0.2 from -14028009241113. -14028009241113.2 Subtract -5 from -346.417192697491. -341.417192697491 What is -22.473 take away 9363730418? -9363730440.473 What is 80688076 - -462894? 81150970 -34247 - 2613614923 -2613649170 Add together 14657355065 and -13.06. 14657355051.94 -2845912 - 120177.8 -2966089.8 26638813.34+-6.6 26638806.74 19271.17 - -14.22521 19285.39521 Subtract 3760765658859 from 6. -3760765658853 Work out 29.6818633 + 2.224. 31.9058633 What is -3161860661632 less than -0.1? 3161860661631.9 What is -416.5304585 take away -0.051? -416.4794585 What is -54060617373 plus 0.578? -54060617372.422 Add 2228147020225 and -12. 2228147020213 Sum 23 and 56.2159736. 79.2159736 What is -4624525161551 less than -0.25? 4624525161550.75 What is -316 plus -548907359716? -548907360032 Work out -0.025 - 3089721327. -3089721327.025 0.4 - 2771422083362 -2771422083361.6 What is 383395719986 take away 0.2? 383395719985.8 What is -191.81 plus -541774330? -541774521.81 Subtract 5292229978 from 484. -5292229494 Work out 2005190 + -13807022. -11801832 -117231084278 - 0.3 -117231084278.3 Calculate 153837.24469 - 2. 153835.24469 Total of 0.4 and -145.6267999081. -145.2267999081 Calculate 4073.6 - -306.2901973. 4379.8901973 What is -180867 take away -17446.4533? -163420.5467 Put together -63.82 and 254712.8701. 254649.0501 What is 10.55 take away 143829481? -143829470.45 1215744124 + 78 1215744202 Put together 18334169626 and -2.1. 18334169623.9 -70043296+-114504 -70157800 Work out -2 - 0.310272257953762. -2.310272257953762 What is -1.08 - -0.044273970821? -1.035726029179 Sum 3021.1770944 and 642. 3663.1770944 Sum 13.709594322 and 32914. 32927.709594322 Put together 6625230381 and 0.047. 6625230381.047 Put together 9756 and -3565.2958. 6190.7042 Subtract 131.7101531 from -12.23. -143.9401531 Add together -413279131 and -502. -413279633 What is 0.1445 less than -3937270076? -3937270076.1445 Total of 5.8 and -13851735.9866. -13851730.1866 -6 + 3826.21995194 3820.21995194 What is -0.4 minus -238167031145716? 238167031145715.6 Add -1168282570330 and -5.1. -1168282570335.1 What is -0.0913840697 minus 65? -65.0913840697 44618661555089 - 8 44618661555081 Sum -404 and 40.929405. -363.070595 Calculate 147 - -10.58114697513. 157.58114697513 -0.06646+-162367223 -162367223.06646 Subtract -3 from -10.1347271373. -7.1347271373 What is 0.07 take away 159918.62202? -159918.55202 What is -329153.16793 plus 1.857? -329151.31093 Add 64.99 and 69749585. 69749649.99 Calculate 2214 + -11.21041658. 2202.78958342 Total of 46879 and 9056390. 9103269 What is the distance between 45 and 1454432483023? 1454432482978 Subtract -476 from 780315.00266. 780791.00266 Total of -1559663.3916367 and 4. -1559659.3916367 What is -1426 less than 0.325208594? 1426.325208594 Calculate 806622.9108 + 815. 807437.9108 What is 1949.2 plus -0.0081719498? 1949.1918280502 Calculate -9 - 24482962749. -24482962758 What is -7618134 plus -209813? -7827947 0.122 + -16368629279 -16368629278.878 Calculate -165710 - -603.6. -165106.4 What is the difference between -15098589.65 and 431? 15099020.65 Sum -320048681773 and -2696. -320048684469 Put together -8305495 and -23525.931. -8329020.931 -3019510 - 0.0526539 -3019510.0526539 Add together 187.92 and -2724280. -2724092.08 Calculate 33523 - 0.0143254006. 33522.9856745994 Calculate 8852605 + 21642655. 30495260 What is -7405272 + 199.86? -7405072.14 What is the difference between -14 and 2952.39865274? 2966.39865274 What is 394872804 take away -25958? 394898762 Work out 288051512 - 287. 288051225 Subtract -6936.1 from 1058.0401. 7994.1401 Calculate -0.24 + -589984208011. -589984208011.24 What is 0.4 + -670.00501609? -669.60501609 4.024505+11092.7 11096.724505 Calculate -268840455229 - -0.3. -268840455228.7 Calculate -2.4808679139804 - -0.07. -2.4108679139804 Work out -14 - 343.3952014. -357.3952014 Subtract 0.02531 from -57.634305. -57.659615 What is 14.20506 + 108079? 108093.20506 Total of 102 and 191760.39114. 191862.39114 What is the distance between -326998043010 and 0.44? 326998043010.44 Subtract -2 from 5046765229338. 5046765229340 Subtract 4 from 26442891391. 26442891387 What is -618709 - 3442556? -4061265 Add together 0.09849 and -6042601624. -6042601623.90151 What is -48.389493 minus 576? -624.389493 Calculate -12210410079134 - 3. -12210410079137 Calculate -84531 - 81679172. -81763703 Work out 510228767.4 - 120. 510228647.4 What is -444745130 plus 47? -444745083 Put together 38465.456977 and 63. 38528.456977 What is -19424.7 minus 674.18604? -20098.88604 0.016 + -0.0389532152249 -0.0229532152249 Add -18546632 and 10.802825. -18546621.197175 -503.2138329703+-31 -534.2138329703 -0.16+-73556487572 -73556487572.16 -0.2 - -8158767031077 8158767031076.8 Sum -14 and -10444704405. -10444704419 Add together -0.0528455160959 and -0.1. -0.1528455160959 What is -0.01184528 - 0.11403284? -0.12587812 What is the difference between 2419.1794 and -2.504? 2421.6834 13384 - -238269509 238282893 Calculate -0.6332589271827 + 0.2. -0.4332589271827 What is 0.2 take away 274548215.491? -274548215.291 What is -1.139977525 minus 99.552? -100.691977525 What is -29360130.47 take away 36.095? -29360166.565 0.17 - 4783555159137 -4783555159136.83 What is 88886283.5589 take away -0.4? 88886283.9589 What is 120515.53 + -12932? 107583.53 What is 113705 minus -94764.2? 208469.2 What is -31.921 - -12230055298? 12230055266.079 What is -1 take away 5766259388847.7? -5766259388848.7 Work out 3745.302825 - 0.05791. 3745.244915 -0.7 - 0.279959271318 -0.979959271318 What is 2263.136528974 less than 60.8? -2202.336528974 Work out -2572177735 - 0.0128. -2572177735.0128 Put together -805211850694 and -0.4. -805211850694.4 What is the difference between 132.70745 and 27355? 27222.2	{ "pile_set_name": "DM Mathematics" }
g? (a) t (b) -5 (c) 3/5 c Let i = 63.5 - 64. What is the nearest to -1 in i, -5, -8? i Let o be -3 + 3/(-3) + 9. What is the nearest to 3 in o, 3/4, 0.01? o Let h = 0.15 - 0.15. What is the closest to -1 in h, 2, -3? h Let y = 0.09 + -1.09. Let k = y + 1.2. Let o be (-2)/6 + 22/12. What is the closest to 1/4 in k, -2/5, o? k Let x = -38/7 + 41/7. Let m(o) = o*2 + 3o - 1. Let i be m(-3). Let u = 10.1 - 10. Which is the nearest to u? (a) i (b) x (c) -3 b Suppose t + 10 = -0. Let i = t - -6. Let x = 1 - 0.8. Which is the closest to i? (a) x (b) 4/9 (c) -0.4 c Let f = 4 + -7. Let v = 2.4 + -2. Let z = -0.2 - -0.2. Which is the closest to 1? (a) z (b) v (c) f b Let u be ((-3)/(-10))/((-12)/(-10)). Let d be (-2)/(130/(-3)) + (-4)/(-26). Which is the closest to -1? (a) u (b) d (c) -3/5 c Let r be ((-1)/(-2))/(11 - 12). What is the closest to 1 in -0.3, r, -3? -0.3 Let q = 3.01 + -0.01. Let p be 6/162/3. Which is the closest to p? (a) 2/7 (b) -5 (c) q a Let m = 3/116 + 327/812. What is the nearest to 2 in -3, 0, m? m Let t be (-74)/(-14) - 2/7. Let n = -139.8 - -140. Let w(i) = -i + 6. Let o be w(6). Which is the nearest to n? (a) o (b) -0.1 (c) t a Let n = -1.14 - -0.14. Let t = -0.14 - -0.04. What is the closest to n in 4, 3/5, t? t Let u = -202 - -1613/8. Let y be ((-3)/2)/(45/(-4)). What is the nearest to -2/3 in 4/5, y, u? u Let y be 4/(-48) + 2/6. Let j = 375/826 + -3/118. Which is the nearest to y? (a) 0.2 (b) j (c) 0.5 a Let d = 1 + -3. Let k = -0.69 + 1.09. Which is the closest to d? (a) k (b) 0.5 (c) -0.5 c Let j = -9 + 14. Let f = j + -4.92. Let o = f - 0.28. What is the closest to 0.3 in -5, -2, o? o Let q = 21.8 - 24. Let i = -2 - q. Let z = -0.1 + i. What is the nearest to z in 0.5, -4, 5/4? 0.5 Let i = -4 + 2. Let u = 15 + -11. Let h = i + u. What is the closest to h in -3, -0.4, 1? 1 Let k be (3/4)/(-1) - -1. Let z = 0.1 + -0.2. Let o = -11 + 8. Which is the nearest to 0.1? (a) k (b) z (c) o a Let x be (-6 - -6)/((-2)/2). What is the nearest to 0 in 2, x, 4/9? x Let s = -248/5 - -49. Which is the closest to -3? (a) -5 (b) 1/3 (c) s a Let i = -3.9 - -4. Let w = -2.6 - 0.4. Which is the nearest to i? (a) w (b) 3/8 (c) 3 b Suppose -x - 6 = -3x. Let r = 22 + -26. Suppose -2q = 5l + 9, 0l - 1 = l. What is the nearest to 1 in x, q, r? x Let g = 31.3 + -31. Which is the nearest to 0? (a) 0.2 (b) g (c) -4 a Let t = -1/79 - -167/711. Which is the closest to t? (a) -2/7 (b) 2 (c) 2/15 c Let o = -61 - -40. Let m = -20.6 - o. Which is the nearest to -0.2? (a) 4 (b) m (c) -1/4 c Let m = -1.65 + 0.65. What is the closest to 0.1 in 0.3, m, -0.06? -0.06 Let b be (4 + -2)7/(-14). Let k be (0 + b)/(1 - 2). What is the closest to 0.1 in 0.4, 3, k? 0.4 Let k be 24/20-7. Which is the closest to -2/7? (a) 1 (b) k (c) 4 a Let x be 170/51 - (-2)/(-6). Let o = 0.2 + -0.6. Let q = 0.7 - -0.3. Which is the closest to q? (a) x (b) -0.1 (c) o b Let f(g) = 3g - 4. Let d be f(3). Let i = -0.3 - -0.32. Let x = i - 4.02. What is the closest to 0 in x, 0, d? 0 Let f be (-2)/(-4)(-1 + -1). Let h = 139 - 697/5. Which is the nearest to f? (a) h (b) 2/3 (c) 2 a Let t be (86342/8)/(8358/(-4)). Let j = 2/1393 - t. Let z = 11/2 - j. Which is the nearest to z? (a) 2 (b) 5 (c) -2 a Let m(w) = w*2 - 4w + 1. Let g be m(3). Let u be (-3)/(-5) - g/5. What is the closest to -0.1 in u, 0.2, -1/5? -1/5 Suppose 5n - 2n = -n. Let l = 3 + -3.1. What is the closest to l in -3, 1/7, n? n Let n = 2 + -3. Which is the closest to 2/5? (a) 2 (b) n (c) 2/19 c Let f be (-72)/2672/56. Let y = f + 50/13. Which is the closest to -1? (a) 1/4 (b) y (c) 3 a Let q = 15.9 + -16. Let t = 3 - 3. What is the closest to q in -3, 5, t? t Let i = 0.41 - -0.09. What is the closest to 1 in i, -1/9, -3/7? i Let t be (((-7)/(-6))/(-7))/(3/12). What is the nearest to 0 in -2, 0, t? 0 Let c(o) = -o3 - 4o*2 + 4o + 1. Let r be c(-5). Let m(x) = -4x + 0x - 13 + x*2 - 13 + 19. Let q be m(r). What is the nearest to -2 in q, 4, -0.4? -0.4 Let t = 1 + -2. Let z be (-1)/((-22)/4 + 2). What is the closest to t in -0.5, z, -2? -0.5 Let x = 0.2 + -0.32. Let w = 0.52 + x. Which is the closest to 1? (a) -1 (b) w (c) 0 b Let l = 490/611 - 16/47. Let u = -12/143 - l. What is the nearest to 0.1 in 2/9, u, -0.4? 2/9 Let x = 4 + -1. Which is the nearest to 0.3? (a) 5 (b) x (c) -2/19 c Let k = 682145/115839 + 2/12871. Let x = 6 - k. Which is the nearest to 0? (a) -5 (b) -2/3 (c) x c Let r be 24/90 - 4/6. What is the nearest to 0.1 in -0.3, r, 1? -0.3 Suppose -a + 5a = 0. What is the closest to a in -2, 0.5, 0.1? 0.1 Let t = -26.4 + 5.4. Let q = 21.5 + t. Let d = -38/33 - -20/11. Which is the nearest to 0.1? (a) -4 (b) d (c) q c Let f(y) = 6y. Let q be f(2). Let h be (-3)/(-1 + 21/q). What is the closest to 2 in 4, h, 5? 4 Let v = 0.2 + 0. Let p = -0.023 + 0.223. What is the nearest to v in p, -0.2, -0.3? p Let v be (-4)/(-10)(-6)/(-4). Let n = 0.03 - -1.97. Which is the nearest to 2/7? (a) n (b) 4 (c) v c Let v be (1-1)/1(-76 + 77). Let j = 0.07 + 0.23. What is the closest to v in j, -2/3, -6/5? -6/5 Let t = 36 + -26. Let l = 7 - t. Let x = -203/159 - 3/53. What is the closest to 1/2 in 1/5, x, l? 1/5 Let s = 5 + -2. Suppose 2g - 10 = -sg. Let b be (0/(-2))/(0 - -1). What is the closest to 2/3 in 0.5, g, b? 0.5 Let j = -5.8 + 2.8. What is the closest to 2/5 in 0.2, -9, j? 0.2 Let t = -3 - -3. Let p = 2 - -2. Let j be (-2)/8 + 1/p. What is the closest to t in 0.2, 0.4, j? j Let y = -137 - -134. Which is the closest to 4/27? (a) y (b) -0.3 (c) 5 b Let s = -0.3 - -3.3. Let g = 9 - 7. Let f = 6.7 + -7. What is the closest to g in s, 2/7, f? s Suppose -3o + 7 + 2 = 0. Let j = -0.01 - -0.21. Which is the nearest to j? (a) 1/4 (b) -0.5 (c) o a Suppose -2h + 9 = 11. Which is the closest to h? (a) -3 (b) -1 (c) 0 b Let l be ((-15)/(-10))/((-18)/(-8)). Suppose 0 = -t + 3j + 1 + 3, 0 = t - 5j - 4. Let y be t/(-99) + 2/9. Which is the nearest to 2/3? (a) y (b) l (c) -0.1 b Let s = 75/4 - 19. Let l be 3 + (1 - 3/(-3)). What is the nearest to 0.1 in -5/6, l, s? s Let d be 9/((-9)/4) + 3. Which is the closest to -0.02? (a) d (b) -1/7 (c) -0.1 c Let d(x) = x + 2. Let f be d(-7). What is the closest to -1 in 0.4, 1/7, f? 1/7 Let h(n) = -n + 0 + 4 - 3 + n*3. Let r be h(1). Let g = -0.7 - 0.3. What is the closest to g in r, 1/4, 5? 1/4 Let i = -9 - -14. Let f = -77.1 - -72. Let t = i + f. What is the closest to t in -0.2, 2, 5? -0.2 Let n = 0.11 + 2.89. Let u = n - -2. Which is the closest to 2/3? (a) -4 (b) u (c) -0.3 c Let i = 1.79 - -0.21. Which is the closest to 0? (a) 0 (b) -32 (c) i a Let s = 0.5 + -9.5. Let h = -13 - s. What is the closest to 0.01 in h, -2, 3? -2 Let p = -129 + 259/2. Let z = -0.2 - 0.8. What is the closest to z in -0.4, p, 3? -0.4 Let j be (14/(-98))/((-2)/4). Which is the nearest to j? (a) 3/5 (b) -0.2 (c) -0.3 a Let g = -0.034 - 0.366. Let i = 15 - 10. Which is the closest to -1? (a) g (b) 3 (c) i a Suppose 3t - 5 = j + 3j, 0 = -4t + j + 11. What is the nearest to 0.1 in -4, 5, t? t Let n = -10.1 - -10. What is the nearest to 1/6 in -2, n, 1? n Let y(w) = w*2 + 7w + 1. Let k be y(-6). Suppose 4p + v - 3 = -0v, -4 = 4v. Suppose -3u + 2u - p = 0. What is the closest to -1/2 in -4, k, u? u Let l(i) = -i2 - 15i - 1. Let q = -23 + 8. Let p be l(q). Let s = 0.2 + -0.6. What is the closest to p in -1/6, s, 0.2? s Let q = 2632/9 + -292. Let j = 6.15 + -0.15. Let x = 5 - j. What is the closest to x in 1/2, q, 2/3? q Let s = -25 - -18. Let y = 7 + s. Let m = -0.05 - -0.15. Which is the closest to y? (a) m (b) 0.2 (c) 3/4 a Let l = -34.91 - -35. What is the nearest to l in 0.5, -0.5, -1? 0.5 Let r be ((-30)/(-36))/5-2. What is the nearest to 0 in -1/9, r, -1/4? -1/9 Let q(u) = 2u - 7. Let y be q(6). Let n = 18.1 + -17.7. Which is the nearest to 1/4? (a) -0.3 (b) n (c) y b Let x = 1.7 + -2. Which is the closest to 2/3? (a) -5 (b) x (c) -0.1 c Let v = 180.7 - 181. Which is the nearest to 2/39? (a) 3 (b) v (c) 1/5 c Let n = -2.3 + 0.3. Which is the nearest to n? (a) 1 (b) 1/6 (c) 6 b Let h = -0.1 - 0.3. Let f = -0.3 - h. Suppose -w + 5l = -0w + 21, 2*w - l - 3 = 0	{ "pile_set_name": "DM Mathematics" }
-1 in q, o, 5, -0.4? -0.4 Let o = -8458.9 - -8458. Which is the nearest to 0? (a) 0 (b) -0.4 (c) o (d) -0.5 a Suppose 68u + 97u - 33u = -87u. Which is the closest to 4/5? (a) 0.3 (b) 0.16 (c) u a Let p be (-2)/(-7) + 8/(-14). Let k = -39205 + 39205. Let t = 26/51 + -20/17. Which is the closest to 0? (a) k (b) p (c) t a Let l = 0.29 + -0.39. Let q = 31019/8 - 3878. What is the closest to 2/3 in q, 5/6, l, -3? 5/6 Let f = -10900 - -10905. Which is the closest to -1.6? (a) 1 (b) -0.3 (c) f b Let z = 161/206 + -1359/2266. Which is the closest to 1? (a) 4/7 (b) z (c) -1.05 (d) 3 a Let u be (-7 - 2 - -9)/2. Let i be (2 - 0) + -9 + 3. Let k be 14/i(-4)/7. What is the closest to u in 2/11, k, 2/15? 2/15 Let f = -13.74 - -25.74. What is the nearest to -0.2 in 0.2, 2, -0.3, f? -0.3 Let z = 17419 + -17414. What is the nearest to -1 in z, -597, -3, -4? -3 Let s = 1.194 - 1.694. Suppose 4l - 2u = 10, 2l - 18 = 4u - 4. Suppose 0 = k - 1 - 3. Which is the nearest to l? (a) 7 (b) k (c) s c Let w be 43(-4 + (1 - -2)). Let p = -15 - w. Let b be -2((-8)/28 + (-34)/p). What is the nearest to 2/3 in 8, b, 1? 1 Let x be ((-111)/(-74))/((-3)/824)(-3)/12. What is the nearest to x in 2/23, 1/4, 3? 3 Let h(k) = k*2 - 38k + 76. Let b be h(2). What is the nearest to -2/17 in 3, 0.017, b, 1/2? 0.017 Let l = 18/487 - -812/4383. Which is the closest to -2/7? (a) -4 (b) l (c) 12/19 b Let c = -16153 + 16158. What is the nearest to -0.1 in c, 0.43, -0.027? -0.027 Let x = 39691/2 + -19845. What is the closest to 0 in 0, -0.12, x? 0 Suppose 0 = -5y - 5h + 35, -2y + 13h = 12h - 5. Which is the closest to -1? (a) y (b) -0.07 (c) 5/4 b Let m = 3.07 - -41.93. Let r = -46 + m. Which is the closest to r? (a) -2/9 (b) 2 (c) 0.3 a Let j = 8.83 - 8.33. Let c = 1.1 + -1. What is the nearest to c in -1/12, 2/13, j? 2/13 Let g = -0.25534 + 0.75534. What is the nearest to 0 in 2, g, 1, -1/7? -1/7 Let k = -1051/7287 - -10/7287. Let o(l) = -3l*2 - 1. Let v be o(1). Which is the nearest to v? (a) 1 (b) 0.09 (c) k c Let t = 17849 - 17849.21. What is the nearest to 118 in t, 2, 2/3? 2 Let k = 333 - 60. Let x = -273.5 + k. Which is the closest to 10? (a) x (b) -5 (c) 0.5 (d) -4/5 c Suppose -3o - 19 = -3v + v, -2o = -v + 12. Let l = -9976.3 + 9976. Let m be ((-12)/(-28))/(9/6). Which is the closest to m? (a) -0.2 (b) l (c) v a Let z = 2218/5 - 444. Let i = -0.037 - 0.653. Let f = -0.7 - i. What is the nearest to z in -2/3, 2, f? -2/3 Let g = -13734 - -13728. What is the nearest to g in 46, 4/3, 0.3? 0.3 Let l = 6215 + -6217. What is the closest to l in -0.16, -1/6, -23, 0? -1/6 Let k = 28569 + -28566. Which is the closest to -0.1? (a) -3 (b) k (c) 1.72 (d) 2 c Suppose y - 5 + 2 = 0, 5s = 5y - 135. Let i be (2/s-4)/((-24)/18). Let o = 16 - 11. Which is the nearest to 1? (a) o (b) 9 (c) i c Let o = -4985 - -4988. Let h be (0/2)/(2/2). Suppose h = k - 2k - 2. Which is the closest to 2? (a) -2/7 (b) k (c) o c Let z be -5(-3 + 0 + 2). Suppose -2d - u + 1 = -1, zd = u + 12. Let l be (-5(-13)/650)/((-3)/12). What is the closest to d in l, -3, 0? 0 Suppose -44c - 91 = -3. Let j = 0.2 + 3.8. What is the nearest to 5 in j, 0.5, c? j Let i = -9869 - -9869.5. Which is the nearest to -2/11? (a) i (b) -24/23 (c) 5 (d) -1/2 d Suppose 82m + 764 = 78m. Let p = m - -1335/7. Suppose 3r + 45 = 8r. Which is the closest to p? (a) r (b) -2/3 (c) -0.2 c Let g = 31 + -30.86. Let p = 0.45 - g. Let d = p - 0.71. Which is the closest to -0.4? (a) -1/7 (b) 5 (c) d c Let v be (-133)/76 + 186/120. Let d(p) = p - 4. Let n be d(3). What is the closest to n in -1, v, -0.3? -1 Let q = 2673 - 16039/6. What is the closest to -2 in 0.1, q, -11/3, 4? -11/3 Let q = 63 + -62. Let p = -624 + 618. What is the nearest to -4 in p, 0.2, 1/3, q? p Let d be 3/(-1 + 2 + 0). Let p(i) = -i2 + 2i + 3. Let n be p(d). Let g = 75 - 74.6. Which is the closest to n? (a) -0.1 (b) g (c) 0.5 a Let g(c) = -c + 83. Let r be g(86). Let x be 153/6(-12)/9. What is the closest to 1 in r, 1, x? 1 Let t = 54.498 - 54.458. Let d = -0.35 + -0.05. Which is the closest to -1? (a) d (b) 0.1 (c) t a Let y(o) = -1020o - 4075. Let t be y(-4). What is the closest to -0.028 in 2, t, -0.2, 3? -0.2 Let f = -280 - -513. Let t = f + -244. What is the nearest to 0.6 in t, 5, -2/7? -2/7 Let y = -5.17 + -6.83. Let v = -0.13 + -1.87. Let s be 1 - 1 - 2/(-5). What is the closest to y in v, s, -0.4? v Let u = -0.0944 + 0.5944. Let d = -37 + 36. Which is the nearest to -6? (a) d (b) -0.1 (c) u a Let y = 0.701 + -0.404. Let l = -2.703 - y. Which is the nearest to 4? (a) -2/5 (b) -2/21 (c) l b Let r = -0.9 - -0.5. Let p = 363 - 282. Let f = p + -79. Which is the closest to -2? (a) 1/3 (b) r (c) f b Let m be 0 + -2(-4 - -1). Suppose -3t - 18 = -m. Let d = -61/2 + 30. What is the closest to -2 in d, -5, t? d Let y be (55/(9075/(-55)))/((-1)/3). Let w = 411 + -2459/6. What is the closest to y in w, 1, 2/21? 1 Let y(o) = 16o + 19. Let g be y(-1). Which is the nearest to 0? (a) g (b) 1/36 (c) -0.5 b Let q = 437.1 - 459. Let o = 22.1 + q. Which is the nearest to o? (a) 0.05 (b) 2/5 (c) 5 a Suppose 0s = -5s - 60. Let b be (-36)/30 + s/(-15). Let x = -0.0039 - 0.3961. What is the closest to b in 2/15, 4, x? x Let b be 690/84 + 133/38 + -12. What is the closest to 5.1 in 18, 2/5, b? 2/5 Let f = 1.686 + -1.686. Let t = -0.28 - -0.78. Which is the nearest to 5/6? (a) t (b) f (c) 1 c Let r = -0.346 - -0.546. What is the closest to r in 0, -4, 28? 0 Let z be (-21)/(-36)((-54)/(-14) - (31 - 27)). Which is the nearest to -1.4? (a) z (b) -0.3 (c) 2 (d) -0.09 b Let l = -70 - -75. Suppose 1 = lw + 21. Let r = 0.04 - 0.14. What is the closest to -1 in 1, w, r? r Let v = 7 + -6. Suppose -s - 19 = 5m - 22, -2m = s + 9. Which is the closest to s? (a) v (b) 3 (c) 4 a Let k = 16423 - 16422.6. Which is the nearest to 4/13? (a) -0.3 (b) k (c) -10 b Suppose -4v - 6u + 4u = 54, -4v = -3u + 29. Let c be ((-10)/6)/(v - (-1651)/156). Let h = -2 + 1.9. What is the nearest to -2 in h, c, -3? -3 Let l be (-12)/(-54) + 112/(-18). Suppose -3f - 1 = -2w + 9, 5w - 10 = 0. Let g be (f/14)/(8/28). What is the nearest to 1/3 in 3/2, g, l? g Let v = 0.3 + 0.7. Let q = -287/229 + 1780/1603. What is the closest to 4 in q, v, 0, -3? v Suppose r - 142 = 4u, 2u + 11 = r - 131. Let t = r - 424/3. Which is the closest to -0.4? (a) -4 (b) -2 (c) t c Let t be (-774)/(-585) - (-4)/(-10). Let n = t - 106/143. What is the nearest to 0.3 in n, -1, 3/5? n Let z = 193 + -197. Let h = 11.26 - 11. Let i = -125/7 + 18. Which is the nearest to h? (a) 1 (b) i (c) z b Let l = 1.758 - -3.242. Which is the closest to l? (a) -11 (b) 3 (c) -2/7 (d) -1 b Let s = 101/5 + -203/10. Let m = 394.1 - 394. What is the nearest to m in s, -0.4, -3? s Let q = -38.97 - -38.95. What is the nearest to q in 0.2, -5, 0.1? 0.1 Let q(t) = 3t*3 + 80t*2 - 24t + 79. Let k be q(-27). Which is the closest to k? (a) -1/8 (b) 4 (c) -2/101 (d) 5 a Let a be (-788 - -779)(8/(-126) - 6/(-21)). What is the closest to 2/3 in 145, a, 0.1? 0.1 Let d = 30.44 + -30.94. What is the closest to d in -3, 4, 8? -3 Let f = -16 - -12. Let k be (-8)/(-18) - (-480)/135. Let t be (-36)/(-12) + (-13)/k. Which is the closest to -0.1? (a) f (b) t (c) 4 b Let f = -0.3 + 2.3. Suppose -j + g - 2g = 0, -4g - 5 = 5j. Let l = -9681 - -9686. What is the closest to f in 2, j, l? 2 Let d be (-2 + 1)1/(-3). Let y = 215 + -187. Let k = -31 + y. What is the nearest to d in 0.3, 0.1, k? 0.3 Let x = -27 - -29.6. Let n = -1.6 + x. Let o = -1.975 + -0.025. What is the nearest to 0 in o, 5, n? n Let m = -1210 - -1202. Which is the closest to m? (a) -3 (b) -0.3 (c) 0 (d) -4 d Let j = -6458 + 6456. Which is the closest to 0.1? (a) j (b) 147 (c) -1 (d) 0.1 d Let z be 84/102914 + 11/(-28). Let t = 264 + -5277/20. What is the closest to 1 in z, -4/3, t? z Let t = 291.92 + 3.08. Let l = t - 290. Let q = -1.1 - -1. What is the nearest to q in -4, -2, l? -2 Let v = -8 - -7. Let j(n) = n*2 - 48n + 303. Let g be j(40). Which is the nearest to v? (a) g (b) 3 (c) 0 c Let l = 756.8 + -756.9. Let p = 1.4 + -0.9. Which is the closest	{ "pile_set_name": "DM Mathematics" }
What is the greatest common factor of 91908 and 282? 6 Calculate the highest common factor of 518 and 263956002. 74 Calculate the greatest common factor of 34080 and 134280. 120 Calculate the greatest common divisor of 99 and 2666835. 9 Calculate the greatest common factor of 239726212 and 572. 44 What is the highest common divisor of 27621306 and 18? 18 Calculate the highest common factor of 9 and 451336419. 9 Calculate the highest common factor of 4142628 and 812. 28 Calculate the greatest common factor of 20257987 and 5593. 47 What is the greatest common divisor of 195571 and 101911? 223 What is the highest common factor of 78498 and 87318? 882 What is the greatest common factor of 1385 and 37202762? 277 What is the greatest common factor of 132 and 1243056? 12 What is the greatest common factor of 1392 and 122132688? 1392 What is the highest common factor of 19304792 and 3328? 104 Calculate the highest common divisor of 8528736 and 272144. 1168 Calculate the greatest common factor of 10099858 and 328. 82 Calculate the greatest common factor of 1685134 and 517. 11 Calculate the highest common divisor of 2993753 and 71904. 749 Calculate the highest common factor of 619407 and 9234. 243 What is the greatest common factor of 6 and 278526324? 6 What is the highest common divisor of 102351 and 33804939? 939 What is the highest common divisor of 42216190 and 50? 10 What is the highest common factor of 141 and 1921431? 3 Calculate the highest common divisor of 20566 and 5577. 13 Calculate the highest common factor of 3250 and 4993426750. 3250 Calculate the highest common factor of 265425 and 61759089. 10617 What is the greatest common divisor of 116 and 7681433? 29 What is the highest common divisor of 2420 and 1604372? 44 What is the highest common factor of 5797316 and 13790? 2758 What is the highest common divisor of 24319 and 157119? 83 What is the highest common factor of 5406 and 29816844? 102 What is the highest common factor of 586794943 and 1239? 413 What is the greatest common factor of 96583 and 3141403? 1637 Calculate the highest common factor of 46797 and 43513. 821 Calculate the highest common factor of 4194614 and 54570. 3638 What is the highest common factor of 271872 and 4547484? 2124 What is the highest common divisor of 276438192 and 8? 8 What is the greatest common divisor of 2346564 and 16356? 348 What is the greatest common divisor of 120 and 232362? 6 Calculate the greatest common factor of 21359 and 285193. 53 What is the highest common divisor of 31244 and 7519? 73 What is the greatest common factor of 117912 and 64824? 24 Calculate the greatest common factor of 194666 and 2181448. 1486 Calculate the highest common factor of 3159 and 3526263. 117 Calculate the highest common divisor of 50817 and 3081. 39 Calculate the greatest common factor of 19550112 and 30. 6 Calculate the greatest common divisor of 2688 and 9668232. 168 Calculate the greatest common divisor of 30 and 1593402. 6 What is the greatest common divisor of 1220365 and 2665? 205 What is the greatest common divisor of 401330 and 296810? 670 Calculate the greatest common divisor of 295715 and 18935. 35 Calculate the highest common divisor of 26912 and 5288. 8 Calculate the greatest common divisor of 57302619 and 1079. 83 Calculate the highest common divisor of 492804 and 91962. 702 What is the greatest common divisor of 2233 and 5136538? 319 What is the greatest common factor of 342 and 272795274? 342 What is the highest common divisor of 7080437 and 6032? 377 What is the highest common divisor of 464 and 23945822? 58 Calculate the highest common factor of 222794 and 15466. 418 Calculate the greatest common factor of 72 and 365551092. 36 What is the greatest common factor of 594950 and 240? 10 What is the highest common factor of 7205 and 88294? 131 Calculate the highest common factor of 31023 and 151285. 383 What is the highest common divisor of 7728704 and 4334? 394 What is the highest common factor of 38 and 104003359? 19 Calculate the highest common factor of 1191 and 606219. 1191 Calculate the greatest common divisor of 454238 and 38300. 766 Calculate the greatest common factor of 2567 and 1722865. 17 Calculate the greatest common divisor of 14 and 5037770. 2 What is the highest common divisor of 3242150 and 9150? 3050 What is the greatest common divisor of 105280 and 57792? 448 What is the greatest common factor of 758375 and 17000? 125 What is the highest common factor of 1107 and 6547782? 123 Calculate the highest common divisor of 2107236 and 34850. 82 What is the highest common divisor of 836360181 and 54? 27 What is the highest common factor of 1827349 and 5609? 79 What is the highest common divisor of 400 and 68506160? 80 Calculate the greatest common divisor of 31311 and 206829. 441 What is the greatest common divisor of 1330 and 794917060? 1330 Calculate the greatest common factor of 9609284 and 1020. 68 Calculate the greatest common factor of 132500013 and 1167. 1167 Calculate the greatest common factor of 18004032 and 1836. 108 Calculate the highest common divisor of 87 and 393924255. 87 What is the highest common divisor of 11376 and 1119351? 237 Calculate the highest common divisor of 647325630 and 285. 285 What is the highest common factor of 20211 and 2187? 3 Calculate the greatest common factor of 378468126 and 5427. 5427 What is the greatest common divisor of 12592 and 47248? 16 What is the highest common divisor of 1436336 and 418? 22 What is the greatest common factor of 2483 and 152672? 13 What is the highest common divisor of 3147 and 6245746? 1049 Calculate the greatest common factor of 802588 and 10188. 1132 Calculate the greatest common factor of 104 and 4771897. 13 What is the highest common divisor of 123296484 and 36? 12 Calculate the greatest common divisor of 12797 and 55772. 191 What is the highest common divisor of 24 and 2705199? 3 What is the highest common factor of 57764 and 54124? 28 Calculate the greatest common divisor of 2996 and 285520298. 1498 What is the greatest common divisor of 177737 and 791? 7 Calculate the highest common factor of 44225436 and 24. 12 Calculate the greatest common divisor of 556 and 46660493. 139 What is the greatest common factor of 1675194 and 602774? 3698 Calculate the highest common factor of 3528 and 282744. 504 Calculate the greatest common factor of 56210 and 352660. 770 Calculate the greatest common divisor of 2055075 and 41250. 825 Calculate the highest common divisor of 356559951 and 5505. 1101 What is the greatest common divisor of 14304164 and 536039? 7343 Calculate the greatest common divisor of 66568992 and 39353. 1357 What is the highest common divisor of 37 and 1557244863? 37 Calculate the highest common factor of 27452595 and 91065. 7005 What is the highest common divisor of 18992708 and 98? 14 What is the highest common factor of 190593 and 31850? 13 What is the highest common factor of 2419320 and 1640? 40 Calculate the highest common factor of 63 and 2632797. 9 Calculate the greatest common divisor of 332 and 4651154. 166 What is the highest common divisor of 74279534 and 104899? 5521 Calculate the greatest common factor of 986 and 661674034. 986 What is the highest common factor of 95 and 2122376? 19 Calculate the greatest common divisor of 52746 and 41542962. 354 What is the greatest common divisor of 118001 and 117247? 377 What is the highest common divisor of 9656 and 42147233? 1207 Calculate the greatest common divisor of 874 and 1470220. 38 Calculate the highest common divisor of 2821 and 896441. 91 What is the highest common divisor of 39046 and 6104? 14 What is the highest common divisor of 9445942 and 44? 22 Calculate the greatest common divisor of 4608 and 21176576. 256 What is the highest common factor of 158061 and 175997? 1121 Calculate the greatest common factor of 224108 and 142484. 716 What is the greatest common divisor of 68677676 and 149? 149 What is the highest common divisor of 888093 and 3636? 909 What is the greatest common factor of 99441 and 47763? 783 What is the highest common factor of 407609 and 5831? 17 What is the greatest common divisor of 1027 and 3936491? 1027 Calculate the highest common divisor of 7155 and 2285955. 135 What is the hig	{ "pile_set_name": "DM Mathematics" }
t s? 61528s3 - 6s*2 - 2s - 6 What is the derivative of -157505006m - 260842434? -157505006 Find the third derivative of -503c*5 - 28477c*4 - 3413258c*2. -30180c*2 - 683448c What is the derivative of -3bo*4 + 1098bo - 36594by + 93764oy - 316 wrt o? -12bo3 + 1098b + 93764y Find the second derivative of -455i4 + i3 - 4125i2 - 48522i - 7. -5460i2 + 6i - 8250 What is the derivative of 6349373g3 + 3100483? 19048119g*2 Differentiate 6628558q + 8001551 with respect to q. 6628558 Differentiate 46929d2t*2 - 27dt2 - 16t*2 + 164447t - 1 wrt d. 93858dt*2 - 27t*2 Find the second derivative of -8p*5 - 2p*4 - 488981p*2 - 5328601p - 2. -160p3 - 24p2 - 977962 What is the third derivative of -f5 - 10538794f3 - 8669685f*2 + f - 2 wrt f? -60f*2 - 63232764 What is the third derivative of -4131739p*3 - 3p*2 + 527604 wrt p? -24790434 What is the first derivative of 4r*3 - 42r*2 + 484300r + 67436603 wrt r? 12r2 - 84r + 484300 What is the first derivative of 229m3 - 5m*2 - 388m + 36535955? 687m2 - 10m - 388 What is the second derivative of 12127p4s - 870p2s - 1256709ps + 5s - 2 wrt p? 145524p*2s - 1740s Find the second derivative of 4i*3m*2 - 749345i*3m - 307i2m*2 + im*2 - 26m*2 + 9m wrt m. 8i3 - 614i*2 + 2i - 52 What is the derivative of -91813809i4 + 153729344? -367255236i3 Find the third derivative of -p3r - 3449461p*3 - 238p*2r - p*2 + 9pr - 31p - 1 wrt p. -6r - 20696766 Find the second derivative of 11603695f*2 + 18021865f wrt f. 23207390 Find the third derivative of 4n3w - 2549546n3 - 3n*2w + n*2 - nw - 1513n - 9w + 12 wrt n. 24w - 15297276 What is the third derivative of -3n*6 - 11531n*4 + 221n*3 + 5002n*2 - 113n - 58 wrt n? -360n3 - 276744n + 1326 What is the second derivative of -7716538f5 - f3 - 183f + 808? -154330760f3 - 6f What is the third derivative of 1318g5h - 11586g5 + 1369g*2h + 2g2 - 3gh + 34g + 13h + 2 wrt g? 79080g*2h - 695160g2 What is the third derivative of -2g*3kv + 478031g*3v*3 + 56g*3v + 3831gkv2 + 8kv3 wrt v? 2868186g*3 + 48k Differentiate -18777292tv*3 + 17591219v*3 wrt t. -18777292v*3 Find the third derivative of 4b*2o*4 - 104b*2o*3 + 22b*2o*2 + 939b*2o - 194bo*3 + 194o wrt o. 96b2o - 624b2 - 1164b Find the first derivative of 143868227v3 - 37603113. 431604681v*2 What is the third derivative of -8n*6 - 162n*5 + 257n*3 - 322n*2 + n - 17866? -960n*3 - 9720n*2 + 1542 What is the derivative of -4929s*4 + 30s*3 - s + 31536031? -19716s*3 + 90s*2 - 1 What is the first derivative of -137296t*3 + 1379t*2 + 953163567 wrt t? -411888t*2 + 2758t Differentiate 43304016q + 340030375 wrt q. 43304016 Find the second derivative of -1617296ux2 - 2ux - 98156u + x + 15 wrt x. -3234592u Differentiate -1431c*2j*4 + 7885c*2j - 68c2 + 777504c wrt j. -5724c2j*3 + 7885c*2 What is the first derivative of 481973778v + 491058976? 481973778 Find the third derivative of 22921d6 + 8d*5 + 3d3 + d2 + 541d + 402. 2750520d*3 + 480d*2 + 18 What is the derivative of 374l*2 + 5891l - 251642213 wrt l? 748l + 5891 What is the second derivative of -670134m*3 - 45m*2u*2 + mu*2 + 20417145mu wrt m? -4020804m - 90u2 Differentiate 4gp2 + 452gp + 429g + 4p2 + 150398p - 1 with respect to g. 4p2 + 452p + 429 Find the second derivative of -68623757h2r*3z - h*2z*3 - 2642hr3z*2 + 222hr3 + 30rz3 wrt h. -137247514r*3z - 2z3 What is the derivative of -5463n*2p - 9n2 - 2np - 1368n - 13p + 1581768 wrt n? -10926np - 18n - 2p - 1368 What is the derivative of 6786828f*2v*2 + 67184316f*2 - 2fv2 wrt v? 13573656f*2v - 4fv What is the third derivative of 158754f3m3 - f3m2 - f3 - 520767f*2 - 13fm3 + 3fm2 - m3 - 2m*2 wrt m? 952524f*3 - 78f - 6 Differentiate 22044244htw2 + hw*2 - 3tw2 - 552tw - 10w*2 + 5w - 5 wrt h. 22044244tw2 + w2 What is the second derivative of 18649879r5 + 39774r + 88? 372997580r3 What is the derivative of -2ck3 + 3378ck2 - 228ck - 12k3 - k2 - 477990k wrt c? -2k*3 + 3378k*2 - 228k Find the third derivative of -281640433l4 + 181729l*2 - 1611. -6759370392l What is the second derivative of -704u5 - 55960u*4 - 249630952u? -14080u3 - 671520u*2 What is the third derivative of -9802594m6 - m2 + 2559360 wrt m? -1176311280m3 Find the third derivative of -77645659f*4 + 156772f*2 + 31 wrt f. -1863495816f Find the second derivative of 68ags2 + 14ags + 2ag + 128273as*2 - 11a - 48g + s - 265 wrt s. 136ag + 256546a Find the second derivative of -6l5 - 2l*4 + 919283l*2 - 2l - 114372422 wrt l. -120l3 - 24l*2 + 1838566 What is the second derivative of 2b*3g*2 - 461650b*3g - 4b2 - 4bg + 3b - g*2 + 20g - 1 wrt b? 12bg*2 - 2769900bg - 8 What is the second derivative of -13457i*4j - 4167i2j*3 + 2ij3 - ij*2 + 3ij + 320j*3 + 13j*2 + 10j wrt i? -161484i2j - 8334j3 Find the third derivative of -1996177t*5 - 9t*3 + 297967t*2 + 4t + 13. -119770620t2 - 54 What is the third derivative of 815b*3h*3 - 388399b*3h*2 + bh*2 + 2bh - 59373h*3 - 8h + 2 wrt h? 4890b3 - 356238 Find the third derivative of 2dt3x*3 + 68448dt2x*3 - dt*2x - 8dtx3 + 32463476t*4x wrt t. 12dx*3 + 779123424tx What is the second derivative of -1067q*5 + 106q*3 - 327038354q? -21340q3 + 636q What is the third derivative of 1421804766k4 + 840k*2 - 80k + 1018 wrt k? 34123314384k Find the second derivative of -a2c*2 + 10061a*2c + 90a2 + 3ac2 + 2a + 2215c2 - 16 wrt a. -2c*2 + 20122c + 180 Find the first derivative of -26wz*3 - wz*2 - 7507wz - 2w - 2780z3 + 17z*2 + 2z - 14 wrt w. -26z3 - z2 - 7507z - 2 What is the second derivative of -41415111p2 - 14436p + 19601? -82830222 Find the third derivative of -4519ad*4 - ad*3 - a - 33d*4 - 27663957d*2 wrt d. -108456ad - 6a - 792d What is the second derivative of -35552271c*5 - 36648600c wrt c? -711045420c3 Find the second derivative of -235o*3y*2 - 1134o*3 + 2o*2y*2 + 347o*2 - oy + 24356y2 - 1 wrt y. -470o*3 + 4o*2 + 48712 Find the second derivative of 165553b*5 - 269b*3 + 23666332b + 2. 3311060b3 - 1614b Find the second derivative of -13919357qw*2 - 2qw + 237100q wrt w. -27838714q What is the third derivative of r5 + 208822872r*4 + 29934396r*2 wrt r? 60r*2 + 5011748928r What is the third derivative of -4348r6 - 473r5 + r3 + 1171243r2 - 2r - 3 wrt r? -521760r3 - 28380r2 + 6 Find the third derivative of -q6 - 220q4 + 17155q3 + q2 - 502q + 951 wrt q. -120q*3 - 5280q + 102930 What is the second derivative of -39711471pq*2 - pq + 1937p + q - 294 wrt q? -79422942p What is the first derivative of 948936523l2 - 928695276 wrt l? 1897873046l Find the third derivative of 2885909r4 - 36412776r*2. 69261816r What is the derivative of -155841620b2 - 56324627? -311683240b What is the third derivative of -23012720g3w*2 - 12g*2w*2 + 20g*2w + 63g + 19w*2 wrt g? -138076320w*2 What is the third derivative of -10373135b*6u*3 - 3b*2u*2 + 9146bu3 + u3 + 13u*2 wrt b? -1244776200b*3u*3 Find the second derivative of 20l4 + l3 + 128607l2 + 2361738l. 240l2 + 6l + 257214 Differentiate -10916op + 681197o - 66p*4 + 3 with respect to p. -10916o - 264p3 Find the first derivative of -492891827bdho - 7bdo + 15bd - 10bo - 2do + 71d + 2o wrt h. -492891827bdo What is the first derivative of -11762652i*4t - i*3 - 59625378t wrt i? -47050608i3t - 3i2 What is the second derivative of 4a*3x*2 + 2a*3x - 416a2x + 3ax*2 - 11ax + 242294x*2 - 346x - 2 wrt x? 8a3 + 6a + 484588 Differentiate 13558377c - 2221444 with respect to c. 13558377 Find the second derivative of 4k*3v*2 - 2k*	{ "pile_set_name": "DM Mathematics" }
433t3/6 + 6t*2 = 0. 0, 1/6, 36 Solve -10t*2 + 71205t - 35600 = 0 for t. 1/2, 7120 Let -5n3 - 995n*2 - 990n = 0. What is n? -198, -1, 0 Determine h so that h*4 - 3571h*3 - 7147h*2 + 3571h + 7146 = 0. -2, -1, 1, 3573 What is f in f*2/7 - 96408f/7 + 2323625616/7 = 0? 48204 Find r such that -15r4 - 642r*3 + 3744r2 = 0. -48, 0, 26/5 Solve -l5 - 1727l4 - 739517l*3 + 5320739l*2 + 25488066l - 30067560 = 0. -867, -4, 1, 10 Suppose 2p4/9 + 16p*3/9 - 338p*2/3 - 700p - 1056 = 0. What is p? -24, -3, 22 Suppose -d*2 - 1941300d - 942161422500 = 0. What is d? -970650 Let -5s5/4 - 378s*4 + 911s*3/4 + 303s*2/2 = 0. Calculate s. -303, -2/5, 0, 1 Let 4s*4 + 2716s*3 - 8188s*2 - 2716s + 8184 = 0. Calculate s. -682, -1, 1, 3 Suppose 5d3 - 7805d*2 + 62180d - 93180 = 0. Calculate d. 2, 6, 1553 Factor 5d3/3 - 3683d*2/3 - 35044d/3 - 4476. (d - 746)(d + 9)(5d + 2)/3 Let n3 + 47n*2 + 559n + 513 = 0. What is n? -27, -19, -1 Find j, given that -5j3 + 86375j*2 + 345560j + 345580 = 0. -2, 17279 Let -5g5/4 - 1875g*4/2 + 30205g*3/4 - 43515g*2/2 + 26515g - 11370 = 0. What is g? -758, 1, 2, 3 Factor 2i2/15 - 88i/3 + 17702/15. 2(i - 167)(i - 53)/15 Determine x so that -2x4/7 + 32x*3/7 + 470x*2/7 + 1300x/7 = 0. -5, 0, 26 Let -3b4 - 5991b*3 + 30006b*2 - 48036b + 24024 = 0. What is b? -2002, 1, 2 Factor 2m3/13 + 6088m*2/13 - 24384m/13. 2m(m - 4)(m + 3048)/13 Determine q, given that -4q*4 - 1372q*3 - 44272q*2 - 353520q + 399168 = 0. -308, -18, 1 Solve 2x5/3 - 10x*4/3 - 134x*3/3 + 802x*2/3 + 260x - 2400 = 0 for x. -8, -3, 5, 6 Determine t so that -15987t5 - 256230t*4 - 406686t*3 + 660456t*2 + 18321t + 126 = 0. -14, -3, -1/73, 1 Solve -m*4 + 15417m*3 - 30831m*2 + 15415m = 0. 0, 1, 15415 Solve 2w5/13 + 26480w*4/13 - 158952w*3/13 + 64w*2/13 + 847744w/13 = 0 for w. -13246, -2, 0, 4 Solve h*5 + 494h*4 + 61501h*3 + 121524h*2 + 60516h = 0. -246, -1, 0 Find k such that -2k3/3 - 388k*2/3 - 5352k - 27600 = 0. -138, -50, -6 What is o in -o*5 + 38o*4 - 507o*3 + 2770o*2 - 5300o + 3000 = 0? 1, 2, 10, 15 Factor -3s4 - 90s*3 + 216s*2 + 768s. -3s(s - 4)(s + 2)(s + 32) Factor 5y3 + 3285y*2 - 33305y + 30015. 5(y - 9)(y - 1)(y + 667) Let 3h*3 + 11850h*2 - 106833h + 237540 = 0. Calculate h. -3959, 4, 5 Solve i*4 - 13502i*3 + 46445181i*2 - 5867834180i + 188868468100 = 0. 65, 6686 Suppose 18p3 - 599304p*2 - 799096p - 266368 = 0. Calculate p. -2/3, 33296 Factor -4z3 + 1314312z*2. -4z*2(z - 328578) Let 3y3 + 165y*2 - 1539y - 1701 = 0. What is y? -63, -1, 9 Solve -c*4/2 + 1780c*3 - 1779c*2 - 1780c + 3559/2 = 0 for c. -1, 1, 3559 Factor -2m2/3 + 8854m/3 - 8852/3. -2(m - 4426)(m - 1)/3 Solve 5b4 + 6245b*3 - 18765b*2 + 18775b - 6260 = 0 for b. -1252, 1 Let 15m5 + 42m*4 - 69m*3 + 12m*2 = 0. What is m? -4, 0, 1/5, 1 Solve -2l*5/7 + 36l*4/7 + 314l*3/7 + 860l*2/7 + 984l/7 + 400/7 = 0 for l. -2, -1, 25 Let -5f3 - 6955f*2 + 69925f - 175125 = 0. Calculate f. -1401, 5 Factor i*3/5 - 1304i*2/5 - 9221i/5 + 57684/5. (i - 1311)(i - 4)(i + 11)/5 Determine u, given that u*5/3 + 16u4/3 + u3 - 352u2/3 - 4u/3 + 112 = 0. -14, -6, -1, 1, 4 Find f such that -3f2 - 20916f - 20913 = 0. -6971, -1 Let -3c3 - 1726941c*2 - 248527964925c - 248526237987 = 0. What is c? -287823, -1 Find g such that 3g4 - 57g*3 - 6384g*2 + 160140g + 166464 = 0. -48, -1, 34 Suppose -2u3/3 + 134120u*2/3 + 134122u/3 = 0. What is u? -1, 0, 67061 Let y*4 + 140y*3 + 5302y*2 + 28140y + 40401 = 0. Calculate y. -67, -3 Solve 2c4/3 + 2044c*3/3 - 16466c*2/3 + 14420c/3 = 0 for c. -1030, 0, 1, 7 Let z*4/4 - 11z*3 + 393z*2/4 + 677z/2 - 986 = 0. What is z? -4, 2, 17, 29 Solve j*3/4 - 248057j*2/4 + 496111j/4 - 248055/4 = 0. 1, 248055 Solve 4f2/9 + 215480f/9 - 3017504/9 = 0. -53884, 14 Determine t so that 2t5 + 189t*4 + 1168t*3 + 2121t*2 + 792t = 0. -88, -3, -1/2, 0 Solve -2h2/17 - 394268h/17 - 19430906978/17 = 0. -98567 Find q, given that 4q2 - 616q - 137888 = 0. -124, 278 Find f such that 5f2/4 - 137f/2 - 55/4 = 0. -1/5, 55 Factor -3a2/5 + 1473a/5 - 12282. -3(a - 445)(a - 46)/5 Factor -c*3/3 + 6517c*2/3 - 10369216c/3 - 271590400. -(c - 3296)*2(c + 75)/3 Determine l so that -64l5 + 23008l*4 - 387652l*3 + 1574784l*2 + 861516l + 110808 = 0. -1/4, 9, 342 Find p, given that 4p2/7 + 19528p/7 - 234912/7 = 0. -4894, 12 Solve 168p5 + 2540p*4 - 9816p*3 - 33428p*2 - 9960p = 0 for p. -249/14, -2, -1/3, 0, 5 Let r*5/4 - 427r*4/4 + 51031r*3/4 - 1173037r*2/4 + 2373700r - 6370000 = 0. What is r? 7, 13, 200 Let 3p2/5 - 9366p/5 - 9369/5 = 0. Calculate p. -1, 3123 Suppose -46h2/9 + 1832h/9 - 1160/3 = 0. What is h? 2, 870/23 Let -3x2 + 2622x + 37296 = 0. What is x? -14, 888 Factor t*5 + 24t*4 - 2t*3 - 48t2 + t + 24. (t - 1)2(t + 1)2(t + 24) Factor 4n2 + 5660n - 311216. 4(n - 53)(n + 1468) Find g such that g*2/4 - 93408g - 373633/4 = 0. -1, 373633 Factor i*4 - 1853i*3 + 864863i*2 - 5985655i + 10223148. (i - 923)*2(i - 4)(i - 3) Suppose -2g*4/11 - 4618g*3/11 - 2686416g*2/11 - 23841800g/11 - 21160000/11 = 0. What is g? -1150, -8, -1 Determine x so that -2x2/7 - 49712x/7 - 496920/7 = 0. -24846, -10 Solve -3i2 - 31386i - 82090083 = 0. -5231 Factor -2t2 + 1032t - 15030. -2(t - 501)(t - 15) Let -q*4/4 - 267q*3/2 + 673q*2 - 813q/2 - 4851/4 = 0. What is q? -539, -1, 3 Factor 2045c2 - 1701450c + 8320. 5(c - 832)(409c - 2) Factor -3i*2 + 3969i - 3966. -3(i - 1322)(i - 1) Factor 2t3/7 - 800t*2/7 + 80000t/7. 2t(t - 200)*2/7 Factor 5u*3 - 7405u*2 + 2745400u - 2738000. 5(u - 740)2(u - 1) Suppose 4a2 + 12704a + 63420 = 0. Calculate a. -3171, -5 Factor 5i2 - 233350i + 2722611125. 5(i - 23335)2 Solve -j5/4 + 5015j*4/4 - 5011j*3/4 - 15043j*2/4 + 1253j + 2507 = 0 for j. -1, 1, 2, 5014 Let 2w3 + 320w*2 - 1650w = 0. What is w? -165, 0, 5 Solve 3m3/7 + 121185m*2/7 + 1224483264m/7 + 13454656512/7 = 0. -20192, -11 Solve -27i3/5 + 2328393i*2/5 + 5174328i/5 + 1034868/5 = 0 for i. -2, -2/9, 86239 Factor 3i2/8 + 85815i/4 - 858225/8. 3(i - 5)(i + 57215)/8 Determine o so that 2o5/11 - 130o*4/11 - 1274o*3/11 - 4214o*2/11 - 5736o/11 - 2664/11 = 0. -3, -2, -1, 74 Factor -h*2 - 9h + 90. -(h - 6)(h + 15) Factor -4n*2 - 3235404n - 3235400. -4(n + 1)(n + 808850) Suppose 4w4 - 1496w*3 - 7632w*2 + 19736w - 10612 = 0. What is w? -7, 1, 379 Solve -4f2 - 4444640f = 0 for f. -1111160, 0 Factor l*5/2 + 67l*4/2 - 456l*3 + 1422l2. l2(l - 6)2(l + 79)/2 Factor r*2/12 + 14591r/6 + 212897281/12. (r + 14591)*2/12 Factor -24q*3 - 10324q*2 - 12016q - 1716. -4(q + 1)(q + 429)(6q + 1) Let -3i3 - 6378i*2 - 4486020i - 1042318200 = 0. What is i? -770, -586 Suppose 5w2 + 28625w - 834330 = 0. Calculate w. -5754, 29 Suppose -4m3/9 + 7628m*2/9 - 4224m - 5072 = 0. What is m? -1, 6, 1902 Factor -2l3/7 + 4150l*2/7 + 12468l/7. -2l(l - 2078)(l + 3)/7 Factor 33t*3/7 + 17148t*2/7 + 61920t/7. 3t(t + 516)(11t + 40)/7 Factor -2v2/11 - 82232v/11 - 411110/11. -2(v + 5)(v + 41111)/11 Factor 2n3/9 - 350506n*2/9 + 701006n/9 - 116834/3. 2(n - 175251)(n - 1)*2/9 Determine k, given that 3k*3/8 + 13485k*2/2 + 60615075k/2 = 0. -8990, 0 Let t*2/6 + 7t - 1581/2 = 0. What is t? -93, 51 Factor -5d2 + 217110d - 217105. -5(d - 43421)(d - 1) Factor -2j2/7 + 200j + 14200/7. -2(j - 710)(j + 10)/7 Determine o, given that 2o2 + 24146o - 556416 = 0. -12096, 23 Factor m*2 - 51532m - 51533. (m - 51533)(m + 1) Factor 5u*4 - 260u*3 + 1605u*2 - 1350u. 5u(u - 45)(u - 6)(u - 1) Solve 4j3 - 884j*2 + 11960j + 82400 = 0. -5, 20, 206 Factor 3s2 + 2349153s - 2349156. 3(s - 1)(s + 783052) Let 2q4/5 - 2484q*3/5 - 14958q*2/5 - 22464q/5 = 0. What is q? -3, 0, 1248 Solve -2p3/5 + 96838p*2/5 - 1161768p/5 = 0. 0, 12, 48407 Suppose -5i2/6 + 2530i/3 + 25550/3 = 0. Calculat	{ "pile_set_name": "DM Mathematics" }
((sqrt(128) - sqrt(128)2)3 - sqrt(128)) + sqrt(128) + -2 + 1)*2 + -1. -80sqrt(2) + 152 Simplify ((-2sqrt(99)-3 + sqrt(99) + sqrt(99)-1-5)/((-3sqrt(243))/sqrt(3))6)*2. 704 Simplify -5 + (((sqrt(208)-1 + 5)1 - -2(2sqrt(208) + -2))3)*2. 216sqrt(13) + 16852 Simplify ((3sqrt(640) + sqrt(640) - sqrt(640))1)/(sqrt(30)/sqrt(6)-5 - (sqrt(35)-3)/sqrt(7)). -12sqrt(2) Simplify (((-5sqrt(171) - sqrt(171))3 - (sqrt(171) + (-6sqrt(171)5 - sqrt(171))))/((3((-1sqrt(99) - sqrt(99)) + sqrt(99)))/(sqrt(275)-3)))*2. 68400 Simplify ((sqrt(209) - -12sqrt(209)) + sqrt(209)-1-4)/(61sqrt(539) - (-2sqrt(539) - sqrt(539))1). sqrt(19)/9 Simplify (sqrt(40)/(sqrt(10)-1) - sqrt(4) - (sqrt(256) - sqrt(4))-3)/(sqrt(200)-12 - sqrt(200)2-5). 19sqrt(2)/80 Simplify ((sqrt(77) + (sqrt(77) + sqrt(77)-1)-6 - sqrt(77))5)/(-1sqrt(1100)5). 0 Simplify 3((4(sqrt(78) - (sqrt(78) + (sqrt(78) - 1sqrt(78)))))/(sqrt(24)-3) - (-4 + sqrt(104)/(sqrt(48)/sqrt(54)))). -9sqrt(13) + 12 Simplify (((sqrt(405) + sqrt(405) + (sqrt(405)-6 - sqrt(405)))6)/(sqrt(90)/sqrt(490)))*25. 9922500 Simplify (6(sqrt(342) - (sqrt(342) + 1sqrt(342))))/(sqrt(50)-62)-2. -3sqrt(19)/5 Simplify 2((sqrt(162) - (-1sqrt(162)-2 + sqrt(162)))/((sqrt(1920)1)/sqrt(5)) + 3). -3sqrt(3)/2 + 6 Simplify (-1-32sqrt(187)6)/((sqrt(891) + (sqrt(891) - sqrt(891)-2))-5 + (sqrt(891) - 6sqrt(891)1) + sqrt(891)). -sqrt(17)/6 Simplify (4 + (5 + sqrt(288) + (sqrt(288) + (-1sqrt(288) - sqrt(288)) - sqrt(288)) - (sqrt(288) - (-2 + sqrt(288) + sqrt(288) + -1))) + -3)*2. 9 Simplify (41sqrt(196)-6)/(sqrt(56)/(sqrt(32)-2 + sqrt(8) + sqrt(8)))-5. -480sqrt(7) Simplify -2(sqrt(1700) + 1) - ((sqrt(1700) - (4 + sqrt(1700)-2))2 - sqrt(1700)) - ((1 + sqrt(17))5 - (-2 + sqrt(17)-2 + sqrt(17)))-6. -15276 + 266sqrt(17) Simplify (-5 + 5 + -1 + (0 + sqrt(288))2 + (1 + sqrt(288) + 5 + 6(sqrt(288) + (sqrt(288) + 1 - sqrt(288))))1)*2. 2376sqrt(2) + 23449 Simplify (21-2sqrt(110)2)/((sqrt(80) + (sqrt(80) - 5-2sqrt(80)))/(sqrt(72)1)). -2sqrt(11) Simplify (sqrt(3) + 5 + 0)5 + (sqrt(15) + sqrt(135))/sqrt(5) + 3 + 2sqrt(3) + 0. 11sqrt(3) + 28 Simplify (5sqrt(1215)2 + sqrt(1215)-1-2)/((sqrt(270)/(sqrt(27)/sqrt(3)))/((-1sqrt(1210) - sqrt(1210) - sqrt(1210)) + sqrt(10))). -3456sqrt(5) Simplify 2(3 + ((sqrt(147) - (0 + sqrt(147)2 + sqrt(147)))-5)*2)-5 + 3. -147027 Simplify ((-1 + sqrt(1872))3 + -1((sqrt(117) + 5 - sqrt(117)) + sqrt(117) - sqrt(117)) + sqrt(117) + -2)*2. -780sqrt(13) + 19873 Simplify 2((1sqrt(98) + -5)*2 - 4-5sqrt(2)-3)4. -1040sqrt(2) + 984 Simplify 65(-2 + sqrt(99)) - 5-2(-6-3sqrt(11) + sqrt(11) - sqrt(11)). -60 + 270sqrt(11) Simplify -4 + ((sqrt(68)/(sqrt(20)/sqrt(5)) - (-3 + sqrt(1377) + sqrt(17))) + 3 + 2)2 + 2. -144sqrt(17) + 1439 Simplify ((sqrt(66)/sqrt(48) - (-2sqrt(2200) + sqrt(22) + sqrt(22)))-2)/(6(sqrt(275) + sqrt(275)2)-3). 73sqrt(2)/540 Simplify (-2 + 0 + sqrt(112) - (sqrt(28)/(-1sqrt(4)) - (sqrt(63) - (sqrt(189)/sqrt(3) - sqrt(63)))/sqrt(9))2) + -4 + 1sqrt(7)-4 + -2sqrt(448). -16sqrt(7) - 34 Simplify 0 + ((sqrt(78)/sqrt(6) + 2)2 + 2 - ((3 + sqrt(13) + sqrt(468))2 + -4)). -623 - 38sqrt(13) Simplify 3 + ((-2 + sqrt(1008)2)1)*2 + ((sqrt(1008) - (sqrt(1008) + 1))1 - sqrt(1008) - (sqrt(1008) - -3(sqrt(1008) - (sqrt(1008) + -1))))2 + 4. 96sqrt(7) + 8091 Simplify (sqrt(85) - (sqrt(85) + 2sqrt(85)2))/(sqrt(40)/(sqrt(16)/sqrt(2) + sqrt(8))) + (-1 + sqrt(612))-21 + -5 + -3. -20sqrt(17) - 6 Simplify (-3 + (14(sqrt(117) - -1sqrt(117))-2)/(sqrt(63)/(sqrt(7) + -2sqrt(7)) - sqrt(9) - 1sqrt(45)/sqrt(5)))2. -32sqrt(13) + 3409/9 Simplify (((sqrt(68) + 0)-5 - (-2sqrt(68) + 4)) + 0)*2 + (sqrt(153) - (5 + sqrt(153) + -2) - -1sqrt(153)2)2. 12sqrt(17) + 1249 Simplify (sqrt(1700) - 1sqrt(1700)) + sqrt(17) - ((-2 + sqrt(1377))2 - sqrt(17)) - (-4 + sqrt(17)-2 + -2 + sqrt(17) + 3 + sqrt(17))*2. -1390 + 38sqrt(17) Simplify (2 + 2 + -6(sqrt(44) + 2 + -1 + -4 + (-1sqrt(66))/sqrt(6)) + 4)*2. -312sqrt(11) + 1072 Simplify (-62-3sqrt(170)-6)/(-4sqrt(1000) + sqrt(1000) - sqrt(360)3). 9sqrt(17)/2 Simplify ((sqrt(363) - (2 + sqrt(363) + 1)) + sqrt(363)1-1 - ((sqrt(363) + sqrt(363) + -1 + 2 - sqrt(363)) + 5))2-2. -3066 - 792sqrt(3) Simplify (sqrt(30)/(sqrt(14)/sqrt(7)) - sqrt(120)/(sqrt(48)/sqrt(6)))/(-1((sqrt(324)1)/sqrt(12))/sqrt(9)). 0 Simplify (-33sqrt(190) - sqrt(190) - ((sqrt(190) - 1sqrt(190))5 - sqrt(190)))/(sqrt(640)1-4 + sqrt(640) + sqrt(640) + 11sqrt(640)). 9sqrt(19)/8 Simplify (-16sqrt(624)1)/(sqrt(75) + 1sqrt(75)2 - -6sqrt(75)2). -8sqrt(13)/25 Simplify (2(-1 + -5(-4 + 1 + sqrt(700) + -1 + sqrt(700) - (-1 + sqrt(700) + 3 - (sqrt(700) + 0)-6))))2. 58000sqrt(7) + 1753364 Simplify (-64(0 + (sqrt(210)/(sqrt(20)/sqrt(2)) - sqrt(84)/sqrt(4)-3)/(-4-6sqrt(12))))2. 28 Simplify (-4 + 3(sqrt(17) - (2sqrt(204))/sqrt(12)) + 4 + (sqrt(68) + 1)6)*2. 108sqrt(17) + 1413 Simplify (2(sqrt(77) - 4(sqrt(77) + -4sqrt(77))))/((sqrt(343)4 - sqrt(343))1) + 1. 1 + 26sqrt(11)/21 Simplify (sqrt(66)22)/(sqrt(600) + 2sqrt(600) + sqrt(600)) - (-2sqrt(77)2)/(sqrt(63)-1 - sqrt(63)). -17sqrt(11)/30 Simplify 6sqrt(192)/(sqrt(48)/(sqrt(48)/sqrt(4))) - ((1(sqrt(1200) + 1 + sqrt(1200)))2 - -6(0 + sqrt(1200))). -4801 - 176sqrt(3) Simplify (2(-4 + (-1(sqrt(833) - sqrt(17))3 - (sqrt(425) + 4)-1))2)*2. 45968 Simplify (5-3-4-1(sqrt(720) + 2sqrt(720) + sqrt(720))6 + 4)2. -138240sqrt(5) + 1492992016 Simplify -3-5(4sqrt(320)1 - (sqrt(320) - (sqrt(320) - (sqrt(320)1 + -1))))2 + -1. 720sqrt(5) + 43214 Simplify (2(-3 + -3 + sqrt(704) - sqrt(704)) - ((sqrt(704) - (-2sqrt(704))*26) + -1)) + 3. -8sqrt(11) + 16888 Simplify (((sqrt(108) + sqrt(108)2)/(sqrt(2) - sqrt(72)1))/(-3sqrt(5808)-1))2. 9/24200 Simplify ((sqrt(5324) + sqrt(5324)-2)6-3)/(-6(sqrt(484) + (sqrt(484) - (sqrt(484) + sqrt(484) + 1sqrt(484)-4)))). -3sqrt(11)/4 Simplify ((3 + 0 + -1sqrt(720) - (sqrt(720) + 5(sqrt(720) - -1sqrt(720)) + sqrt(720) + sqrt(720))5)2)2-5. -62726580 + 95040sqrt(5) Simplify ((sqrt(1100) + 1 + sqrt(1100) + -5)-6)*2 + 3 + 4 + -3. -5760sqrt(11) + 158980 Simplify (-3 + -1 + -1 + sqrt(72) + 2 + (sqrt(72) + 0 + sqrt(72) - sqrt(72)) + -6(5(sqrt(72) + 0) + sqrt(72)))*21. 1224sqrt(2) + 83241 Simplify (sqrt(136) + 1sqrt(136)2 + sqrt(136))/(-2sqrt(648)) - ((-2sqrt(1088))23 + -61sqrt(1088)). -13056 + 430sqrt(17)/9 Simplify -2 + sqrt(147) + 0 + 4 + ((sqrt(3) - 2sqrt(3)2 - sqrt(3)) + (sqrt(21)5)/sqrt(7))*2. 5 + 7sqrt(3) Simplify (-4sqrt(336)/sqrt(6) - sqrt(56))/(sqrt(200)2 + sqrt(200) + sqrt(200)) + (12(-4 + (sqrt(175) - sqrt(7))))*2. -513sqrt(7)/4 + 512 Simplify -4 + (-2sqrt(2000)5)*2-41. -800004 Simplify ((5(-3sqrt(204) - sqrt(204)))/(-1-2sqrt(12)) + -5 + -5(sqrt(17) + (sqrt(17) + 1)-3))2. 100 Simplify (5 + (-6(sqrt(1331) + 1) - sqrt(1331)) - (sqrt(55)/sqrt(5)-6 - (sqrt(176)3 + sqrt(11)))) + 2. -58sqrt(11) + 1 Simplify (4-1(sqrt(150) - (sqrt(150) + sqrt(150)-4)))/((-52sqrt(10) - sqrt(10))/(sqrt(320)/sqrt(4) - sqrt(5))). 240sqrt(3)/11 Simplify (sqrt(96) + (sqrt(96) - sqrt(96)11) - (sqrt(96) - (sqrt(96) - (sqrt(96) - sqrt(96)-3)))-5)/(sqrt(192)-1 + -2sqrt(12)3). -21sqrt(2)/5 Simplify (2(-5 + ((sqrt(833) - (-1 + sqrt(833)))5)2) + -2)-4 + 4. -148 Simplify ((sqrt(160) + sqrt(160)-1)/(sqrt(240)/sqrt(3)) - (-1 + 1 + (sqrt(2) - (sqrt(2) + -1 + sqrt(2))) + (sqrt(2) - sqrt(6)/sqrt(3)-4)))*2. 8sqrt(2) + 33 Simplify (-52sqrt(102) + sqrt(102)3-4)/(5(sqrt(864) + ((1sqrt(864) + sqrt(864))4 - sqrt(864)))). -11sqrt(17)/240 Simplify (2 + -25(sqrt(1872) + sqrt(1872)-2 + -2 + 4)4)*2. -74880sqrt(13) + 3001284 Simplify (-1(-4 + (sqrt(512) - (sqrt(512) + 2)) + sqrt(512) + sqrt(512)))2 - ((-5(1 + sqrt(128)))*22 + 1). -4367 - 1184sqrt(2) Simplify -66(-1(-5(sqrt(88) + 1sqrt(88)) - sqrt(88)))/(((sqrt(64) - sqrt(64)1) + sqrt(64))/sqrt(8) - 3sqrt(128)) + 2. 2 + 36sqrt(11) Simplify ((sqrt(2736) - (sqrt(2736) + -2)) + 3 + (-2 + sqrt(2736))-3 - (4 + -1sqrt(2736) + -6(sqrt(2736) + sqrt(2736)-1) + sqrt(2736)))2. -504sqrt(19) + 24673 Simplify ((-3sqrt(117)-	{ "pile_set_name": "DM Mathematics" }
z: 9}. What is prob of picking 2 e, 1 g, and 1 z? 21/170 Two letters picked without replacement from {c: 10, k: 2}. Give prob of picking 2 k. 1/66 Calculate prob of picking 3 j and 1 e when four letters picked without replacement from {i: 3, j: 5, k: 4, e: 2, m: 5}. 5/969 What is prob of picking 2 q and 1 o when three letters picked without replacement from {b: 7, o: 2, q: 4, w: 5}? 1/68 Calculate prob of picking 1 g and 1 x when two letters picked without replacement from gxggggggxg. 16/45 Three letters picked without replacement from {d: 2, v: 4, l: 2, a: 3, e: 7}. Give prob of picking 1 l and 2 d. 1/408 Two letters picked without replacement from eppppeepee. What is prob of picking 1 e and 1 p? 5/9 What is prob of picking 2 m when two letters picked without replacement from wommwb? 1/15 What is prob of picking 1 h, 1 k, and 2 m when four letters picked without replacement from hhkmiimhhimikkmm? 6/91 Calculate prob of picking 3 q when three letters picked without replacement from qqqq. 1 Two letters picked without replacement from idprrddddrrdrrirrr. Give prob of picking 1 i and 1 d. 4/51 Three letters picked without replacement from ddbdddddddddllddd. Give prob of picking 3 d. 91/170 Two letters picked without replacement from jkkrrkkrks. What is prob of picking 2 r? 1/15 Four letters picked without replacement from wgwgewwwweeefeweeee. What is prob of picking 2 g and 2 e? 3/323 Three letters picked without replacement from axaxxaxxaaxx. What is prob of picking 3 x? 7/44 Calculate prob of picking 1 b, 1 q, 1 z, and 1 c when four letters picked without replacement from {q: 1, z: 4, j: 7, b: 1, m: 5, c: 1}. 1/969 What is prob of picking 1 p and 1 s when two letters picked without replacement from tmzztzmzizpis? 1/78 Three letters picked without replacement from {t: 1, h: 1, o: 8, r: 2, e: 4}. Give prob of picking 1 e and 2 o. 1/5 Calculate prob of picking 2 t when two letters picked without replacement from trtgttttttt. 36/55 Calculate prob of picking 4 u when four letters picked without replacement from {u: 5, w: 10, z: 4}. 5/3876 Four letters picked without replacement from eeegaaharaergghhjaea. What is prob of picking 1 a and 3 g? 2/1615 What is prob of picking 3 q when three letters picked without replacement from {q: 7, x: 6, o: 1, v: 3, r: 2}? 35/969 Two letters picked without replacement from {s: 1, g: 1, k: 5, c: 2, m: 11}. Give prob of picking 1 g and 1 c. 1/95 Calculate prob of picking 1 n and 2 r when three letters picked without replacement from {n: 4, r: 3}. 12/35 What is prob of picking 1 v and 2 s when three letters picked without replacement from ssssssvsvv? 21/40 Four letters picked without replacement from {h: 1, c: 2, k: 1, m: 1, s: 2}. What is prob of picking 2 s, 1 h, and 1 c? 2/35 Two letters picked without replacement from {d: 1, w: 1, k: 1, b: 1, s: 1}. Give prob of picking 1 w and 1 d. 1/10 Four letters picked without replacement from {r: 6, j: 7, h: 6}. What is prob of picking 1 r and 3 j? 35/646 Two letters picked without replacement from hhehhpell. What is prob of picking 1 h and 1 l? 2/9 Three letters picked without replacement from iiiiiiiii. Give prob of picking 3 i. 1 Calculate prob of picking 3 v when three letters picked without replacement from {v: 9}. 1 Calculate prob of picking 2 v when two letters picked without replacement from eaaevaadvaadava. 1/35 Calculate prob of picking 1 s and 2 r when three letters picked without replacement from {s: 2, r: 1}. 0 Calculate prob of picking 1 u, 1 j, 1 i, and 1 h when four letters picked without replacement from {f: 3, u: 4, n: 1, j: 3, i: 1, h: 3}. 12/455 Calculate prob of picking 1 y and 1 h when two letters picked without replacement from {x: 1, c: 1, y: 3, h: 3, w: 3}. 9/55 Calculate prob of picking 2 z and 1 m when three letters picked without replacement from zmzm. 1/2 Calculate prob of picking 2 m and 2 z when four letters picked without replacement from {m: 5, z: 2, t: 4, e: 4}. 2/273 Three letters picked without replacement from {b: 1, c: 5, l: 6, x: 4}. Give prob of picking 1 b, 1 l, and 1 x. 3/70 What is prob of picking 2 c and 1 f when three letters picked without replacement from {c: 4, f: 3}? 18/35 What is prob of picking 1 l and 1 x when two letters picked without replacement from xxxxxlxxlxxxxlx? 12/35 What is prob of picking 2 w when two letters picked without replacement from {s: 1, g: 2, h: 7, w: 3, n: 1, t: 4}? 1/51 Calculate prob of picking 1 m, 1 x, and 1 u when three letters picked without replacement from momuxuvb. 1/14 Calculate prob of picking 1 a and 2 u when three letters picked without replacement from {r: 4, a: 2, u: 2, p: 5}. 1/143 Calculate prob of picking 3 n and 1 o when four letters picked without replacement from ononenngoonononeogn. 98/969 Calculate prob of picking 3 y when three letters picked without replacement from hyhmyhhyhyhhyhhyymy. 56/969 Two letters picked without replacement from oooodoooyyyoyyy. Give prob of picking 1 d and 1 o. 8/105 What is prob of picking 2 p when two letters picked without replacement from {p: 3, t: 8, z: 5, m: 3, j: 1}? 3/190 Two letters picked without replacement from {m: 1, b: 4, z: 5}. What is prob of picking 2 b? 2/15 What is prob of picking 1 h, 1 p, and 1 c when three letters picked without replacement from {p: 2, c: 3, q: 2, d: 3, h: 6, w: 2}? 3/68 Three letters picked without replacement from {f: 1, d: 1, h: 1, u: 1, q: 2, w: 1}. What is prob of picking 1 h, 1 d, and 1 w? 1/35 What is prob of picking 1 i and 2 m when three letters picked without replacement from nynimxnimn? 1/60 Two letters picked without replacement from wjjhk. Give prob of picking 1 j and 1 h. 1/5 What is prob of picking 1 b and 1 o when two letters picked without replacement from {o: 1, e: 2, j: 1, b: 1, i: 2}? 1/21 Three letters picked without replacement from xppfenet. What is prob of picking 1 f and 2 p? 1/56 What is prob of picking 2 j and 1 c when three letters picked without replacement from {r: 4, u: 1, c: 1, z: 4, j: 2, o: 2}? 1/364 What is prob of picking 1 u, 1 p, and 1 k when three letters picked without replacement from dukupaksdadudap? 12/455 What is prob of picking 1 w and 1 b when two letters picked without replacement from {a: 1, b: 1, o: 2, w: 1}? 1/10 Three letters picked without replacement from vpuxuwwh. What is prob of picking 1 h, 1 v, and 1 x? 1/56 What is prob of picking 2 n and 1 l when three letters picked without replacement from {n: 8, r: 1, l: 6}? 24/65 Three letters picked without replacement from zzzzzzzzzzzdjddzz. What is prob of picking 3 d? 1/680 Three letters picked without replacement from {o: 4, g: 6}. Give prob of picking 1 g and 2 o. 3/10 Calculate prob of picking 1 n and 2 v when three letters picked without replacement from vvnmv. 3/10 Four letters picked without replacement from uupupuupupuppuppuupp. Give prob of picking 2 p and 2 u. 135/323 Calculate prob of picking 1 a, 1 m, and 1 b when three letters picked without replacement from {a: 11, v: 1, n: 1, f: 1, b: 3, m: 3}. 33/380 Two letters picked without replacement from nnnnnnssnnnsnnnnsn. What is prob of picking 2 n? 91/153 Three letters picked without replacement from iiiihhi. Give prob of picking 1 h and 2 i. 4/7 Calculate prob of picking 1 q, 1 l, and 2 m when four letters picked without replacement from mmqmmqmmmgwmmmgmmwml. 52/1615 Four letters picked without replacement from {z: 7, m: 12, x: 1}. What is prob of picking 2 z and 2 m? 462/1615 What is prob of picking 1 o, 2 j, and 1 k when four letters picked without replacement from jeskkqsjseeeseeoq? 1/1190 Calculate prob of picking 1 q and 1 s when two letters picked without replacement from {q: 1, s: 1, e: 9}. 1/55 Calculate prob of picking 3 y when three letters picked without replacement from {y: 11, d: 3}. 165/364 Calculate prob of picking 2 o, 1 v, and 1 i when four letters picked without replacement from ooovvowoocionwoowv. 3/85 Three letters picked without replacement from {x: 5, f: 5}. What is prob of picking 1 f and 2 x? 5/12 Two letters picked without replacement from iiiiiii. What is prob of picking 2 i? 1 Four letters picked without replacement from {r: 3, w: 1, t: 7, s: 6}. Give prob of picking 1 w, 1 s, and 2 t. 9/170 What is prob of picking 2 h when	{ "pile_set_name": "DM Mathematics" }
408 Three letters picked without replacement from {e: 2, m: 1, p: 1, n: 2, x: 1}. What is prob of sequence pnx? 1/105 What is prob of sequence fq when two letters picked without replacement from nfqqfkknf? 1/12 What is prob of sequence dvvv when four letters picked without replacement from {d: 2, v: 6}? 1/7 Two letters picked without replacement from {r: 7, e: 6, f: 1}. Give prob of sequence fe. 3/91 Three letters picked without replacement from {s: 1, j: 1, y: 17}. Give prob of sequence yyy. 40/57 What is prob of sequence zy when two letters picked without replacement from {p: 7, z: 2, y: 3}? 1/22 Calculate prob of sequence js when two letters picked without replacement from {j: 5, z: 2, s: 3}. 1/6 Calculate prob of sequence bl when two letters picked without replacement from lzbzbbz. 1/14 What is prob of sequence rw when two letters picked without replacement from {r: 3, w: 1, v: 2, h: 4, b: 1}? 3/110 What is prob of sequence zypy when four letters picked without replacement from zkypyzkkzyzpykqy? 1/273 What is prob of sequence ul when two letters picked without replacement from dduuuldvuee? 2/55 What is prob of sequence rcc when three letters picked without replacement from cccrccccccccccrrcccr? 8/57 Four letters picked without replacement from jyhndhhjhdjdjhi. Give prob of sequence hddh. 1/273 Three letters picked without replacement from jjcjywweyjjjwcc. What is prob of sequence cyw? 3/455 What is prob of sequence qrxx when four letters picked without replacement from {q: 3, x: 2, k: 2, r: 5}? 1/396 Three letters picked without replacement from aqqtqqqqxqxqa. What is prob of sequence qaa? 4/429 Calculate prob of sequence njp when three letters picked without replacement from {p: 1, n: 2, k: 1, j: 1}. 1/30 What is prob of sequence kxeh when four letters picked without replacement from {e: 6, i: 2, h: 2, x: 1, k: 1}? 1/990 Two letters picked without replacement from qqdqdqqdqqdqqqddddd. What is prob of sequence dd? 4/19 Three letters picked without replacement from {k: 8, h: 2}. What is prob of sequence kkh? 7/45 Two letters picked without replacement from zdhxhjy. Give prob of sequence zj. 1/42 Four letters picked without replacement from yzayyayazzy. What is prob of sequence ayya? 1/66 Two letters picked without replacement from qqnqaonnnoaoooqono. Give prob of sequence nn. 10/153 Calculate prob of sequence iz when two letters picked without replacement from {z: 6, i: 2, a: 5, t: 1, x: 3, k: 3}. 3/95 Calculate prob of sequence yf when two letters picked without replacement from {d: 1, o: 1, v: 1, a: 2, y: 1, f: 1}. 1/42 What is prob of sequence iiw when three letters picked without replacement from iufiffuiimfiwefmffif? 1/228 Calculate prob of sequence uv when two letters picked without replacement from {v: 5, u: 2}. 5/21 Three letters picked without replacement from {e: 9, p: 7}. What is prob of sequence epe? 3/20 Two letters picked without replacement from {g: 3, u: 13, v: 1}. Give prob of sequence gv. 3/272 Calculate prob of sequence vry when three letters picked without replacement from {y: 3, r: 2, v: 3}. 3/56 What is prob of sequence uumx when four letters picked without replacement from uumxumxmuuuu? 7/330 Three letters picked without replacement from nntttntntnttn. What is prob of sequence ntn? 35/286 Four letters picked without replacement from {a: 1, n: 10, k: 2, u: 1, c: 2}. Give prob of sequence kcun. 1/1092 Calculate prob of sequence rfif when four letters picked without replacement from {r: 1, k: 4, i: 4, f: 3, y: 2, v: 1}. 1/1365 Calculate prob of sequence ede when three letters picked without replacement from {e: 3, d: 4}. 4/35 Two letters picked without replacement from {w: 1, z: 1, y: 1, o: 1, f: 1, v: 2}. What is prob of sequence fy? 1/42 Three letters picked without replacement from {q: 3, i: 9, w: 5, u: 2}. What is prob of sequence quq? 2/969 Four letters picked without replacement from {t: 9, x: 10}. What is prob of sequence xttx? 45/646 Three letters picked without replacement from {w: 1, c: 2}. Give prob of sequence cwc. 1/3 Three letters picked without replacement from grgycie. Give prob of sequence igc. 1/105 Calculate prob of sequence fefg when four letters picked without replacement from eegfwefwgefewfgwge. 1/255 Calculate prob of sequence wuua when four letters picked without replacement from {u: 3, a: 13, w: 2}. 13/6120 What is prob of sequence zwk when three letters picked without replacement from kwhzekzhhzwekwew? 3/280 Two letters picked without replacement from {i: 1, j: 2, y: 9, w: 1}. Give prob of sequence wy. 3/52 Four letters picked without replacement from {k: 7, x: 12}. Give prob of sequence kkxk. 35/1292 Two letters picked without replacement from hvifgri. Give prob of sequence if. 1/21 What is prob of sequence lr when two letters picked without replacement from {l: 4, r: 2, a: 4, j: 7, u: 1, y: 1}? 4/171 What is prob of sequence sss when three letters picked without replacement from {s: 7, d: 12, c: 1}? 7/228 Calculate prob of sequence jmja when four letters picked without replacement from mmjjemjjammmajjaama. 175/15504 What is prob of sequence aaa when three letters picked without replacement from aaaaa? 1 Four letters picked without replacement from {u: 4, l: 1, c: 1, k: 3, q: 2}. Give prob of sequence kqkk. 1/660 Four letters picked without replacement from ugufgggggggfuuuguuu. What is prob of sequence ugug? 14/323 Three letters picked without replacement from jjvvqqlvvvjjvrjk. What is prob of sequence kjv? 1/112 Calculate prob of sequence gd when two letters picked without replacement from {a: 1, d: 2, j: 1, l: 1, y: 1, g: 2}. 1/14 Calculate prob of sequence qq when two letters picked without replacement from qqccccccllccc. 1/78 Three letters picked without replacement from ylyyll. What is prob of sequence yyy? 1/20 Calculate prob of sequence dz when two letters picked without replacement from {x: 1, d: 4, t: 3, m: 3, z: 7}. 14/153 Calculate prob of sequence nn when two letters picked without replacement from rrnn. 1/6 Calculate prob of sequence oto when three letters picked without replacement from {o: 2, t: 7}. 1/36 Calculate prob of sequence rr when two letters picked without replacement from rjlrtvjlrrrr. 5/22 What is prob of sequence jxjw when four letters picked without replacement from xxwxwxxxxwjj? 7/1980 Calculate prob of sequence hhe when three letters picked without replacement from heiilleelhhihl. 3/182 Calculate prob of sequence hnn when three letters picked without replacement from nnsssnshhs. 1/60 What is prob of sequence ff when two letters picked without replacement from {x: 2, f: 2}? 1/6 What is prob of sequence arey when four letters picked without replacement from {r: 1, y: 3, a: 1, z: 3, f: 1, e: 2}? 1/1320 What is prob of sequence xxox when four letters picked without replacement from oooxox? 0 Three letters picked without replacement from hlvlhvlvhllllhlh. What is prob of sequence llh? 1/12 Three letters picked without replacement from {g: 4, f: 1, k: 1, j: 1, w: 6, z: 2}. Give prob of sequence fjz. 1/1365 What is prob of sequence lrmk when four letters picked without replacement from {s: 1, k: 1, m: 1, r: 1, l: 1}? 1/120 What is prob of sequence oooa when four letters picked without replacement from {o: 15, a: 3}? 91/816 Calculate prob of sequence qqb when three letters picked without replacement from bbqqbb. 1/15 Calculate prob of sequence ddk when three letters picked without replacement from kxxdxkxccxgxc. 0 Three letters picked without replacement from {h: 1, s: 1, i: 4, m: 5}. What is prob of sequence smi? 2/99 Calculate prob of sequence lwl when three letters picked without replacement from {w: 2, l: 3}. 1/5 Calculate prob of sequence we when two letters picked without replacement from {w: 7, e: 2}. 7/36 Three letters picked without replacement from {e: 2, c: 1, f: 1, l: 2}. Give prob of sequence cll. 1/60 Two letters picked without replacement from {h: 2, o: 4, q: 3, y: 3, l: 6}. What is prob of sequence qh? 1/51 Calculate prob of sequence kyky when four letters picked without replacement from {y: 3, k: 6, s: 8, v: 2}. 5/2584 Three letters picked without replacement from {u: 9, l: 2}. What is prob of sequence luu? 8/55 What is prob of sequence rem when three	{ "pile_set_name": "DM Mathematics" }
ve c. -15 Express (6v2 - 3v*2 - 2v*2)(14 + 65 + 24)(-22v - 28 + 28) as tv2 + y + bv*3 + ov and give b. -2266 Rearrange -48r2 - 8 + 19 - 46r*2 - 7 to x + ur*2 + cr and give u. -94 Rearrange -561p2 + 155p - 310p + 155p + 104p2 to the form ip*2 + r + jp and give j. 0 Express -27 - 21 + d*2 - 2d*3 + 42 - d as rd*3 + od*2 + p + vd and give o. 1 Express (d3 + d3 + 0d3)(d + 0d + d + (-1 + 2 + 0)(-3d + 0d + 4d) - 83d + 25d - 78d) as xd2 + cd + sd3 + r + ad*4 and give a. -266 Rearrange -7 + 4 - 42r + 1 + 23r to tr + f and give f. -2 Rearrange -3641w + 2 - 6w*2 + 3644w + 0 to k + mw + dw*2 and give k. 2 Express 5f*3 + 10f*3 + 2 - 2f + 3f4 + 9f*3 - 29f*3 - 6f*2 in the form gf*4 + uf + r + of3 + df*2 and give r. 2 Express (115 + 368 - 141)(-z - z + 4z) as oz + f and give o. 684 Rearrange (3 - 1 + 0)(60 - 445 - 2)(d + 3d - 3d) to z + wd and give w. -774 Express 21 + b2 + 26 + 39 - 40 as sb*2 + i + tb and give t. 0 Rearrange 3f3 + f + 8f*2 - f + 2 - 5f*3 to the form of*2 + g + if + kf3 and give k. -2 Express 64p - 13p - 1 - 25p - 15p as x + op and give x. -1 Express 1 - 8u2 - 8u*2 - 2u + 4u2 - 7u*2 - 5u*2 in the form yu*2 + gu + b and give g. -2 Rearrange -99g - 268g - 36g - 2g*2 + 133g to r + hg + dg*2 and give d. -2 Rearrange 28d + 4d4 + d2 + 2 - 28d - 4d3 - d3 to the form qd*3 + md + rd4 + a + td*2 and give a. 2 Rearrange (3 + 28 + 22)(2w2 - 3w*2 + 4w*2 + (3w + 0w + 2w)(w + 1 - 1))(0 - 1 + 0) + 2w - 2w - w*2 to the form cw + s + tw2 and give t. -425 Rearrange -3n*2 + 1816n*3 + 2n*2 - 1690n*3 to the form a + qn + rn3 + ln*2 and give l. -1 Express -3 + 5 + 6 - 6 + 52q - 54q in the form b + zq and give z. -2 Express -84x3 + 2x + 42x3 + 44x*3 - 5x*2 as qx*2 + n + ix + px3 and give i. 2 Rearrange 4s*2 - 7s*2 - 81 - 41 to the form qs + i + fs2 and give f. -3 Express 2 - 931r*2 - 399r*2 - 2 in the form tr*2 + h + jr and give t. -1330 Rearrange 135t2 + 2 - 2 - 6t*3 + 7t*3 + 87t*2 to the form pt*2 + mt*3 + zt + o and give p. 222 Express -4 + 4 + k*2 + 0k*2 + 0k*2 + 2k*2 + (-9k + 13k2 + 9k)(-3 + 0 + 1) in the form q + gk + wk2 and give w. -23 Rearrange -6 + 18m*4 - 2m*3 + 3 + 36m*2 - 19m*4 to the form qm + rm3 + jm*2 + tm*4 + n and give t. -1 Express -16v - 79 + 77 + 3v in the form j + gv and give j. -2 Express -2 + 3 + 4 - 4 - 109t in the form pt + q and give q. 1 Rearrange 0v - v + 3v + (1 + 2 - 1)(0v + v + 2v) - 28v - 31v - 39v to w + ov and give o. -90 Express 0p*3 - 7p - 13 + 3p3 + 15p2 - p3 + 6p in the form z + lp*3 + hp + dp2 and give z. -13 Rearrange 3j*2 + 2 - 6j*2 + 329j*3 + 4j*2 - 410j*3 to the form qj*2 + h + rj*3 + nj and give n. 0 Express 24 - 603g2 + 19 - 43 in the form rg*2 + pg + y and give r. -603 Rearrange (-2y2 - 8y*2 + 3y*2)(-7476 + 12364 - 6288) + 2y2 + 1 - 1 to the form t + ry*2 + ny and give r. 9802 Express -384u4 + 768u*4 - 378u4 + 53 + u2 in the form mu2 + o + gu + cu3 + lu*4 and give l. 6 Rearrange (-6x + 227x + 349x)(0x + 0x - 2x) to rx2 + ox + j and give r. -1140 Rearrange -97y + 3y*4 - 799y*2 + 799y*2 - 116y*3 + 94y to the form sy2 + fy*4 + x + ty*3 + py and give t. -116 Rearrange (32q + 6q - 11q)(-6 - 5 + 4)(0q*3 - 2q*3 + 4q*3) to bq*3 + j + aq*4 + dq + vq2 and give a. -378 Rearrange (2v - 4v - 38 + 67 + 45)(-6v + 2v - 3v) to the form qv + p + xv2 and give q. -518 Express (2o + 0o - o)(-41o + 18o + 24o + 584) as to + do2 + s and give d. 1 Rearrange (3 + 0 - 2)(-13 + 0 + 3)(-23n + 11n - 33n)(-1 + 2 - 3) to the form p + bn and give b. -900 Express 184z - 143z - 128z in the form q + cz and give c. -87 Rearrange (-2u + 1 - 1 + (-3 - 2u + 3)(-1 - 1 + 0))(0u2 + 2u*3 + 0u*2) to the form du*3 + v + iu*2 + ju + gu4 and give g. 4 Rearrange ((-3b - b + 5b)(2 - 1 - 2) + 2b + 0 + 0 + 4 - 4 - 2b)(2756 - 2756 - 47b)(1 + 0 + 2) to the form y + cb + wb2 and give y. 0 Express (v - 4v + v + (-4v + 2v + v)(2 - 5 + 2))(0v + 6v - v) + (v*2 + 2v*2 + 0v*2)(-1 + 5 - 3) in the form l + kv2 + av and give k. -2 Express (-4197 + 2392 + 2487)(-2j + 2j + j) as uj + y and give u. 682 Express 21 + c*3 + 18 + 53 + 0c*3 as nc*3 + t + gc + rc2 and give n. 1 Express 123 - 384 + 131 - 91x + 130 in the form t + cx and give c. -91 Express (1787 + 0k + k - 1783)(4k*2 + 0k2 + k2) + (2k + 0k - 3k)(k*2 + 4k - 4k) as bk + zk2 + ck*3 + m and give c. 4 Rearrange 11u*3 - 4 + 10u - 15u + 5u to the form pu3 + au*2 + qu + z and give p. 11 Rearrange 5h - 6 + 7h*3 - 36h3 + 7 - h2 - 3h to f + xh + sh3 + wh*2 and give s. -29 Express ((-2 - 1 + 0)(5 - 5 + 2t) - 5 - t + 5 + 0t - t - t)(2 + 1 - 2) in the form ht + s and give h. -9 Express 0t3 - 3t*2 - t + 2t*4 + 16t*3 + 6t*2 - 4t*2 as xt*4 + rt*3 + kt + vt2 + h and give k. -1 Rearrange (-8s*2 - 18s + 18s)(3 + 0 - 4) - 1 + 4s2 + 251s - 1 - 241s to u + ls + ns2 and give l. 10 Rearrange 22 - 10 + 510h*2 + 195h*2 - 32h*2 - 10 to nh + ch2 + k and give c. 673 Express -41 + 77 - 38 + 32j*2 - 338j*2 + 34j*2 as g + wj*2 + rj and give g. -2 Rearrange -v*4 + v - 5v + 2v - v3 - 14 + 37 to cv + dv2 + xv*3 + pv*4 + z and give z. 23 Express -12 + 12 - 514c + 1084c in the form jc + f and give j. 570 Rearrange -140s3 + s2 + 215s*3 - 125s*3 to the form gs*2 + rs + p + ms3 and give m. -50 Rearrange (-515 - 164 - 80 - 411)(2j4 - 2j4 + j4) to the form ij4 + l + pj + hj2 + yj*3 and give y. 0 Express -412 + 64 - 34 - 4d*2 in the form qd + a + ld2 and give l. -4 Express ((-2 - 2 + 2)(-5 + 3 + 4) + 7 + 4 - 1)(3x*2 - 3x2 + x3) + (x + 5 - 5)(x2 + 2x2 + x2) in the form ix3 + yx + nx2 + r and give i. 10 Express (s + s + 2s)(5s - 5s - s) - 2s*2 + 4s*2 + 0s*2 + 0s*2 - 4s*2 - 2s*2 as ks*2 + os + n and give k. -8 Rearrange (5f + 5f - 5f)(2f - f + f) + (f - 7f + f)(23 - 30f - 23) - 2f2 - 3 + 3 to j + tf + gf2 and give g. 158 Rearrange -10 + 10 - 11k - 7k - 4k + k + (k - 1 + 1)(2 - 1 - 3) to bk + u and give b. -23 Express (-5m - 2 + 6 + 4m)(58 - 19 - 29) as sm + n and give n. 40 Express 2331 + 2349 - 4630 + 2q2 in the form lq*2 + tq + h and give h. 50 Rearrange -2x - 56x*2 - 2x + 106x2 + 151x*2 to y + vx*2 + ux and give u. -4 Express -586t - 268t - 91t - 366t as bt + v and give b. -1311 Rearrange 25 + 5t*3 - 2t*3 + t - 26 + 2t*4 + 0t*3 - 2t*3 - 3t*2 to n + gt*3 + yt + pt4 + st*2 and give g. 1 Rearrange 0o*2 - 2 + 22084o*4 - 2o - 22150o4 - o2 to fo*4 + po + c + ko2 + lo*3 and give c. -2 Rearrange 20372d - 20372d + 47d*2 to the form kd + td2 + v and give t. 47 Rearrange (-3h - 5h + 2h)(57h + 36 - 36)(-4 + 0 + 2) to qh*2 + mh + s and give q. 684 Express 14n + 5n*2 + 3n + 11n - 46n + 14n in the form p + un + yn2 and give y. 5 Express -82 + 32 + 34 - 2c + 39 - 2c2 in the form ic + yc2 + a and give i. -2 Rearrange (4y + 2 - 2)(2156y + 2165y - 4257y + (1 + 3 - 6)(-y + 0 + 0)) to the form ly + d + ty2 and give t. 264 Rearrange (-3 + 1 - 2)(5i - 4i + 0i)(17 + 39 + 60) to mi + p and give m. -464 Express -2 + 1 + 2 - 20b in the form x + fb and give f. -20 Express 57a*2 + 809a - 2 - 809a as n + ma*2 + xa and give m. 57 Rearrange -1278i + 1257i + i*2 - 2i*3 + 4 - 5 to the form l + ci*2 + oi + si3 and give l. -1 Rearrange (-s + 0s - s)(3s - 3s + 2s) + 12 + s*2 - 12 - 2150s + 2150s + 89s*2 to o + ks*2 + cs and give k. 86 Express (-167p2 - 18p*3 + 167p*2)(-19p + 50 - 50) + (-2p3 + p3 + 3p3)(-2 + 2 + p) as l + vp2 + kp*4 + gp + tp3 and give k. 344 Express 6 + 389x*2 + 14 - 387x*2 in the form mx + h + kx2 and give k. 2 Rearrange -599l + 627l - 959l to i*l + q and give i.	{ "pile_set_name": "DM Mathematics" }
7) + -1) + -1 + ((sqrt(2057)-2 + sqrt(2057) - sqrt(17))2 + (-1 + sqrt(68))2)2. -4sqrt(17) + 5049 Simplify 6(-4 + -4(1sqrt(200) - sqrt(200)) + sqrt(200) - -3(-6(sqrt(200) + -1 - sqrt(200)) - sqrt(200)))*2. -3360sqrt(2) + 5976 Simplify (((-3sqrt(2112) - sqrt(2112)) + sqrt(33) + 3sqrt(33)3)/(sqrt(33)/sqrt(3)1 + 2(sqrt(11) - sqrt(396))) + -1)2. -44sqrt(3)/9 + 511/27 Simplify (sqrt(12)/(-2sqrt(2)))/(sqrt(48)/sqrt(4)) - ((sqrt(200) + 2 - sqrt(2)) + (sqrt(98))2 + -4). -96 - 37sqrt(2)/4 Simplify ((-1 + -5(sqrt(288) + 1) + -3 + 1 + -2)-1)*25. 6000sqrt(2) + 36500 Simplify (sqrt(72)/sqrt(4)4 + ((sqrt(72)-5)/sqrt(4) - sqrt(18)))/(6(sqrt(150) - 5sqrt(150)-2)). -sqrt(3)/165 Simplify (-1 + -5 + (-4 + -5-1sqrt(175) - 2((sqrt(175)2 - sqrt(175)) + 5 + sqrt(175))) + 2)*2. -180sqrt(7) + 499 Simplify ((sqrt(108) + (2(sqrt(108) + -1sqrt(108)) - sqrt(108)) + -62sqrt(108) + (4 + 2sqrt(108) - sqrt(108))-4)2)2. 12288sqrt(3) + 111616 Simplify (0 + (-2(-1sqrt(245) + -2 + (-1 + sqrt(245))5))2)-6. -95256 + 9408sqrt(5) Simplify (0 + 21sqrt(2420) + 2 - ((-1 + sqrt(2420) + -3)2 + -4))*2 + 2. 198 Simplify (1(sqrt(130) - -4sqrt(130)-1)-4)/(-2(2(sqrt(90) + sqrt(10)) - (sqrt(810) + sqrt(810)1)))-5. -3sqrt(13) Simplify (-4-2(sqrt(612)-1 + sqrt(612) + -2) + ((sqrt(612) - 1sqrt(612)) + -3 + -5(sqrt(612) + sqrt(612) + sqrt(612) + 1))3)*2. 21600sqrt(17) + 1240900 Simplify (-2(-4((sqrt(264) - -4sqrt(264)) + sqrt(264))/sqrt(11))/(-165sqrt(8))-1)2. 192/25 Simplify (((-4(-2sqrt(343) + sqrt(343)))2 - sqrt(343)) + 2 + sqrt(343)2 - -6(sqrt(343)-22)2)-2. -76836 - 14sqrt(7) Simplify (sqrt(2)1 + -5 - (sqrt(6)/sqrt(3) + -4))-2 + -5((4 + sqrt(18))*2 + sqrt(2) + sqrt(2) + -4). -130sqrt(2) - 148 Simplify (-5 + -2((sqrt(243)3 + 3)*2 - (-4 + sqrt(243) + 1)))-2 + -2. 612sqrt(3) + 8804 Simplify (-5-1sqrt(77) + sqrt(77))/(2sqrt(704) + sqrt(704) - sqrt(704)) + 2(sqrt(63)/(sqrt(9) - sqrt(144)) + sqrt(7) + sqrt(7)2 + -3). -6 + 137sqrt(7)/24 Simplify 5((-4 + 2sqrt(475) + (sqrt(475) - 2sqrt(475))-4)2-4)2. -76800sqrt(19) + 5477120 Simplify 2 + (-5 + 2 + (-2sqrt(500) + -5 - ((sqrt(500) - 2sqrt(500)) + -1)) + 5)*2. 40sqrt(5) + 506 Simplify -3(-1 + ((3 + -1sqrt(1088))2 - ((sqrt(1088) - (0 + sqrt(1088)1)) + 5sqrt(1088)2 + sqrt(1088))))*2. -551691 + 3120sqrt(17) Simplify (((2sqrt(198))/sqrt(9) - sqrt(22))/(sqrt(539)-1 - sqrt(539) - sqrt(539)) + 3)*2 - (-2sqrt(50) + sqrt(50))-516. -1052sqrt(2)/7 + 3971/441 Simplify (5 + -3sqrt(320)3 + -4)*2 + 4 + (2 + sqrt(320) + sqrt(320))61. -48sqrt(5) + 25937 Simplify (4 + sqrt(1088) + (sqrt(1088) + -1)6 + 3 - ((1sqrt(1088)3 - (-5 + sqrt(1088) + -1)) + 4))2. -720sqrt(17) + 27281 Simplify (((sqrt(600) - sqrt(600)2 - sqrt(600))5 + sqrt(600) + sqrt(600))/(sqrt(10) - sqrt(90)/sqrt(144)))/(-25(sqrt(12) + sqrt(1200)3)). 16sqrt(5)/465 Simplify ((4-1sqrt(110) + sqrt(110))/(-2sqrt(704)))/((sqrt(30)/sqrt(3)2)/(sqrt(5) + (sqrt(5) + sqrt(15)/sqrt(3))-3)). -15sqrt(5)/32 Simplify (1-3sqrt(102) + sqrt(102) + sqrt(102) + 3sqrt(102)3 + sqrt(102))/((-5sqrt(72)-2)/(sqrt(192)4)). 72sqrt(17)/5 Simplify -6((sqrt(2) + 3)2 + 0 + 1 + (3(sqrt(6)/(sqrt(3) - (sqrt(3) + sqrt(48))) - sqrt(2)))*2 + 2). -1011/4 - 36sqrt(2) Simplify -4(3(sqrt(32) + sqrt(32)3)-4 + sqrt(96)/(1sqrt(3) + sqrt(3) + sqrt(3)) + sqrt(32)-2-1)-1. -2192sqrt(2)/3 Simplify (-4 + 5 + (sqrt(343)/sqrt(7)3)/(sqrt(14)/(sqrt(32) + sqrt(2))))-1. -15sqrt(7) - 1 Simplify (-2 + sqrt(13) + sqrt(13) + sqrt(104)/sqrt(8) - (sqrt(1872) + sqrt(1872)6))2 - (-3sqrt(117)/sqrt(9) + 4 + 4). 327sqrt(13) + 85289 Simplify (6(2 + 3 + (sqrt(1008) - (3sqrt(1008) + -3) - sqrt(1008)))-1)*2 + -1. -20736sqrt(7) + 328895 Simplify (-3 + -2((-3 + sqrt(425))6 - 4(3 + sqrt(425)))-1-2)2. -9360sqrt(17) + 40889 Simplify ((1sqrt(385)6)/((sqrt(7)-1 - sqrt(7))1))/(sqrt(25)/(-3sqrt(5))51). 9sqrt(11)/5 Simplify (3 + (4 + (5(sqrt(288) + 0 + -4))2 + -4)5)2-5. -380030 + 120000sqrt(2) Simplify ((-2(sqrt(2299) + 2) - sqrt(2299)) + -5 + sqrt(2299) + -2)*2 + 6((3(sqrt(19) + 1) - sqrt(19)) + sqrt(209)/(sqrt(11)-2)). 493sqrt(19) + 9335 Simplify ((4 + (sqrt(35) + sqrt(315)6)/(sqrt(175)-3))-5)*2 + 0. -760sqrt(5)/3 + 5405/9 Simplify (1sqrt(1617)5 + -5sqrt(1617)1)/((sqrt(240)/sqrt(2))/(1sqrt(1210))). 0 Simplify (1 + (-3(sqrt(243) + -2 + sqrt(243)) - sqrt(243))*2 + 3 + (-1(sqrt(243) + -1)2 - (-5 + sqrt(243) + (1 + sqrt(243) + sqrt(243))2)))-5. -53675 + 3915sqrt(3) Simplify (sqrt(1089)4-6)/(sqrt(9)/(sqrt(363) + -2sqrt(363))). 2904sqrt(3) Simplify ((61sqrt(119) + sqrt(119))22)/(sqrt(112)-22 + (sqrt(112) - (sqrt(112) - (61sqrt(112) + sqrt(112))))). 7sqrt(17)/3 Simplify ((-3 + (sqrt(72) - ((2sqrt(72) + 3 - sqrt(72)) + sqrt(72))) + -3sqrt(72)-3 + 2)2)2-6. -110976 + 9216sqrt(2) Simplify 1(6(0 + sqrt(1539) + -3) + (0 + sqrt(1539)-5)1)2. -324sqrt(19) + 1863 Simplify ((sqrt(100) + (sqrt(100) - ((sqrt(100)1 + sqrt(100))2 - sqrt(100))))/(-5(sqrt(2) + sqrt(4)/sqrt(2))))/(sqrt(10)-1-3 + (-1sqrt(70))/sqrt(7)). sqrt(5)/20 Simplify 3((sqrt(520)34)/sqrt(10))/(-1sqrt(8)/(-3sqrt(2))). 108sqrt(13) Simplify 23(5 + sqrt(108) + ((sqrt(108) - 2sqrt(108) - sqrt(108)) + -4 + sqrt(108) - sqrt(108)) + sqrt(108) + (sqrt(108) + sqrt(108)3)1 + 1). 12 + 144sqrt(3) Simplify (4(-2 + ((sqrt(125)/sqrt(5) + sqrt(25))-1)/(sqrt(40)/(sqrt(40)/sqrt(5))) + -1)1)2. 192sqrt(5) + 464 Simplify 5 + (-2 + -3(4(-1 + sqrt(320)) + sqrt(320) + -1 + -3 + -1))*2. -6000sqrt(5) + 72630 Simplify (5(sqrt(128) + 2) + (sqrt(128) + 2 - sqrt(128))-2 - (-1 + -3sqrt(128) - (4 + sqrt(128) + sqrt(128)1)))*2. 1760sqrt(2) + 12921 Simplify 1-5(-5((-4sqrt(65)/sqrt(5))*2 - sqrt(13)) + sqrt(156)/(sqrt(1452)-3 + sqrt(1452))). -545sqrt(13)/22 + 5200 Simplify 6(((sqrt(99) + (sqrt(99)2 + sqrt(99))3)-2)/((sqrt(1089) + sqrt(1089)2 + sqrt(1089))1 - sqrt(1089)) + -1). -40sqrt(11)/11 - 6 Simplify 3 + ((sqrt(363) - -1(-2 + sqrt(363))) + (sqrt(363) + 0 - sqrt(363))-1 - (5 + -5 + -4sqrt(363)))2. -264sqrt(3) + 13075 Simplify (-2 + -2 + -2 + (sqrt(1100) - (1 + (sqrt(1100) - (1 + sqrt(1100))))) + -4)*2. -200sqrt(11) + 1200 Simplify 4 + sqrt(27)/sqrt(144)-2 - ((sqrt(2160) + sqrt(2160)2 - sqrt(2160))/(6-1sqrt(5)))*2. -44 - sqrt(3)/2 Simplify ((-4(0 + 5 + sqrt(1584)-2 + 42sqrt(1584)) + -1)-5)*26. 1814400sqrt(11) + 136923750 Simplify ((1sqrt(832) + 4 + sqrt(832))2 - (0 + sqrt(832) + sqrt(832) + 1)2) + sqrt(65)/sqrt(45) + (2sqrt(78))/sqrt(6) + (-5 + -1sqrt(325))*2. 365 + 445sqrt(13)/3 Simplify ((sqrt(1300) - ((1 + sqrt(1300))-1)2 - (sqrt(1300) - (sqrt(1300) + 0))-5) + 2 + (sqrt(13) + 1)-1-4)6. -7770 - 36sqrt(13) Simplify (sqrt(216)/(2sqrt(1296))-3)/((sqrt(768)-1 - sqrt(768))15). sqrt(2)/640 Simplify 0 + -2 + sqrt(847)25 + (sqrt(1008) - 1(-1 + sqrt(1008)))*2 + -2(0 + sqrt(7) + 5). -11 + 108sqrt(7) Simplify -2 + (-6(sqrt(35)/sqrt(5))*2 - sqrt(700)1) + 6-4sqrt(1008)-6. -44 + 1718sqrt(7) Simplify 12-2(4(sqrt(176)-1 + 4))21. -12288 + 2048sqrt(11) Simplify ((sqrt(24) + -6sqrt(24)3)/(sqrt(12) - sqrt(60)/(sqrt(5) - sqrt(20))))2 - (1(sqrt(2) + -1)-2 + (sqrt(20)/sqrt(2))/sqrt(5) + sqrt(18) + -2)2. 273/2 Simplify ((5 + (sqrt(108) - (1sqrt(108) + sqrt(108))) - (1 + sqrt(108))-2) + (sqrt(108) - ((sqrt(108) - (sqrt(108) + -1)) + -2))-4 + 3)*2. -216sqrt(3) + 1008 Simplify (-6(-1 + sqrt(1088) + sqrt(1088)) - (sqrt(1088) + 1 + sqrt(1088))3)*2 + 6((2sqrt(68) + -4)4)*2. -3936sqrt(17) + 380169 Simplify -5 + sqrt(1584)-2 + -3 + 4 - (sqrt(1584) - (-1(sqrt(1584) + -2) + sqrt(1584) - sqrt(1584)) - -4(sqrt(1584)5 - sqrt(1584)))*2. -513224 + 840sqrt(11) Simplify 6((1sqrt(726) + sqrt(726))/(sqrt(30)/(sqrt(20)/sqrt(2) + sqrt(10))) - (sqrt(2420)-2)/(sqrt(160)1)). 297sqrt(2) Simplify 2 + -3(-3(1sqrt(468))*2 + sqrt(468) + 2 + (0 + (-1sqrt(468))*2 - (2(1 + sqrt(468)))*2)) + 5. 126sqrt(13) + 8437 Simplify (-1-1sqrt(102)1-3)/((sqrt(3456)1)/(-1sqrt(100))). 5sqrt(17)/4 Simplify ((14sqrt(2200))/(((sqrt(80) + sqrt(80)6)/sqrt(8))/sqrt(5)))*2. 17600/49 Simplify -5 + (sqrt(133)4*6)/	{ "pile_set_name": "DM Mathematics" }
/(981/218))/(1/2)? -2/9 What is the value of 216/(-297)(-24)/288? 2/33 What is ((-2652)/(-65))/51(-30)/2? -12 What is the value of ((-1)/(-2)-2)/(35/350)? -10 Evaluate (10/(-14))/(28/49). -5/4 Evaluate (15(-4)/(-21))/(-154/63). -10/3 Evaluate (-48)/(-64)168/(-18). -7 7(11/308)/((-2)/88) -11 (-104)/936(-81)/(-6)20 -30 Calculate ((-11)/(440/2))/(5/((-120)/42)). 1/35 Evaluate 12/(-134)(35/840)/(2/16). -2/67 What is the value of ((4-4)/(-2))/((-903)/(-3612))? 32 What is ((-29)/29)/(7/(-1120)5)? 32 Calculate (-5(-2)/(-6))/((-99)/594). 10 What is (184/(-230)10/6)/(1/(-12))? 16 What is the value of ((-2)/34)/(((-7)/14)/1)? 2/17 Evaluate ((-12)/(-8))/173/(438/(-140)). -35 What is the value of 18/(-420)-21(-10)/(-3)? 3 What is the value of ((144/(-6))/(-12))/((-6)/(-33))? 11 Evaluate 54(-9)/378-428/8. 18 What is the value of (2057/242)/((-2)/8)? -34 (15/18)/((-5)/8) -4/3 What is the value of ((-60)/300)/((-30)/345(-2)/20)? -23 (13/52)/(861/84(-2)/(-4)) 2/41 What is the value of ((-4)/(-2))/(21/((-3402)/36))? -9 (8/24)/((-6)/270) -15 Calculate (744/(-62))/((-3)/4). 16 Calculate 15((-51)/5)/17. -9 Evaluate (-20)/2513/109221. -1/5 What is the value of ((-51)/(-12))/((-11)/(1760/20))? -34 What is the value of (4/(-34))/((23/(-69))/((-2)/(-6)))? 2/17 What is the value of 2/(3/((-3)/3))? -2/3 What is the value of 2((-6)/(-12))/(-1)(-130)/(-5)? -26 Evaluate 464/696(-3)/34. -1/17 Evaluate (9/(-3))/((-2)/(-2(-4)/(-12))). -1 Calculate ((-144)/9)/6452. -13 ((-882)/(-48))/21((-9)/(-14))/(-3) -3/16 What is the value of (-44)/14-9105/1080? 11/4 What is (-1)/((1/9)/((-2254)/(-294))3)? -23 What is the value of (-48)/(-10)-135/(-28)? 6 Calculate (14/(-35))/(((-4959)/45)/19). 2/29 What is the value of (561/748)/(((-2)/6)/((-32)/(-12)))? -6 What is (32/(-640)30)/45? -1/30 What is (4/(-4))/(309/5152/6)? -5 What is (-4)/(-20)-3-10? 6 315/4902(-9)/(-27) 3/7 What is the value of (((-16)/(-4))/(-56))/((-2)/(-84)7)? -3/7 What is 17/(-17)0/2? 0 (-2)/9(3/1)/((-16)/(-176)) -22/3 Evaluate ((-26)/(-6))/((-502)/(-1506)). 13 (((-85)/153)/1)/((-2)/(-2)) -5/9 What is ((-2)/52)/(315/1890)? -3/13 Evaluate ((-50)/80)/(49/(-576)). 10 Calculate ((-130)/110)/(10/(-550)5). 13 Evaluate (-3)/(((-425)/275)/(-17)). -33 What is the value of (-36)/(-10)31/279? 2/5 What is (2232/9672)/(-1(-6)/4)? 2/13 What is (-4800)/640(-4)/(-5)? -6 What is 13/((-1872)/18)2? -1/4 Evaluate ((-24)/(-60))/((-17)/1445). -34 What is ((-220)/(-25))/((-226)/(-565))? 22 Calculate (3/(-2))/((-1492)/(-2611)42/32). -2 Evaluate (936/6318)/(6/(-27)-1). 2/3 (21/4)/(49/(-3136)2) -16 Calculate ((-1)/(10/26))/(1882/9410). -13 ((-636)/742)/(6/28) -4 What is the value of 12/(-4)14/14(-2)/18? 1/3 What is 291/9710/15? 2 Evaluate 1/(27/(-30))19/((-114)/27). 5 What is the value of (-17(-65)/884)/(35/476)? 17 What is the value of 8/((-264)/(-3))3/3? 1/11 What is the value of 985/(-394)22/4? -5/2 ((-2)/10)/((-833)/(-595)) -1/7 (20/(-1050)7)/((-12)/(-30)) -1/3 (2/(-12))/((-854)/40992) 8 Calculate ((-12)/(-24))/((-2)/(-8)). 2 Evaluate 1(-51)/6(-888)/(-444). -17 What is the value of (-1966)/(-8847)((-54)/(-8))/(15/40)? 4 Evaluate 20/(-90)12/(-8). 1/3 What is the value of (-26)/442(-4)/(-12)-6? 2/17 Calculate ((-15)/(-54))/((135/(-72))/(-3)). 4/9 Evaluate (480/(-4))/48/(112/7). -15 24/15(-40)/28182/104 -4 Evaluate 8/((164/902)/(15/(-33))). -20 ((-14)/(-28))/(1/(-8)) -4 What is ((-9)/13510)/((-4)/(-30))? -5 What is ((-56)/(-196))/((-5)/(35/(-4)))14? 7 Calculate ((-5)/65)/((-7)/(42/(-6))). -1/13 Calculate (8/(-26))/(132/(-26)). 2/33 What is (33/(-44))/((-35)/206/21)? 3/2 11/2((-162)/108)/((-3)/4) 11 Calculate (-4)/(-10)1995/931. 6/7 What is (-5)/(-13)(-32)/4005? -2/13 Evaluate ((-76)/(-532))/(1/2). 2/7 Evaluate ((-1)/(-4))/((-365)/(-11680)). 8 What is (10/(-6))/((-15)/108)-1? -12 Evaluate ((16/4)/28)/(37/2331). 9 What is (-165)/90-88/352? 1/3 Calculate ((-210)/(-5915))/((-162)/(-234)). 2/39 What is the value of 455/(-52)(-21)/98? 15/8 What is the value of (-56)/(-80)7(-12)/(-882)? 1/15 What is the value of 1728/162(-27)/(-12)? 24 Calculate (20/(3740/(-33)))/(12/8). -2/17 Evaluate (1272/20352)/((6/16)/3). 1/2 (36/(-6))/((21/(-252))/((-2)/16)) -9 Calculate ((-87)/(-116))/(32/80300/(-16)). -1/10 Calculate -14/48-24. 2 Calculate 4/5(-7)/14. -2/5 What is ((-12)/1767)/((-68)/646)? 2/31 Calculate ((-18)/(-4))/(((-4284)/48)/17). -6/7 Evaluate ((-58)/696)/((-16)/192). 1 What is the value of (-2)/3-3((-4947)/714)/97? -1/7 Evaluate ((-8)/((-49)/(245/(-510))))/(2/(-3)). 2/17 Calculate (-990)/99162/(-60). 27 Calculate (-4578)/(-109)1/3. 14 ((-26)/546)/((-1)/63) 3 What is the value of 18(-1)/(-3)-1? -6 What is the value of ((-5)/2)/(26/52)2/(-65)? 2/13 Evaluate 1-136/(-182). 3/7 ((-855)/114)/(-64/82) 5/4 Calculate ((-18)/(-16))/((-2849)/3256). -9/7 What is the value of (-24)/24(-4)/(-4)(-6)/(-30)? -1/5 What is 253/(-46)4/118? -16 What is the value of -4((-8)/7)/((-340)/(-238))? 16/5 -6(-4)/(-84)(-10647)/(-234) -13 27/(-9)(-4)/54(-51)/34 -1/3 What is (44/305)/(51/153)? 22 What is the value of (-9352/(-8316))/(4/(-1))? -2/21 What is (2100/(-630))/(2/(-3))? 5 Evaluate (3/36-3)/(14/9520-5). 34 ((-20)/2)/((1496/(-17))/(-11)) -5/4 Evaluate (-6)/327/18(-3)/531. 1/59 Calculate (46800/40)/26(-1)/(-3). 15 Evaluate 845/(-24)(-143)/(-715). -3 Evaluate -51(-1)/(11/(66/(-30))). -1 What is the value of (72/(-44)(-1177)/2247)/((-1)/(-21))? 18 What is ((-663/(-45))/(-4))/(70/(-175))? 11/4 What is the value of (-21)/((-882)/(-4))6? -4/7 What is (-1)/(21/840-4)(-14)/(-10)? 14 Evaluate (-35)/63(243/(-27))/(2/2). 5 What is the value of (-14)/(-4)((-1)/3)/((-301)/(-2193))? -17/2 Evaluate ((-2200)/770)/(23/7). -10/3 Evaluate (-21)/(-66)(-396)/693. -2/11 Evaluate (-34/2)/((72/(-9))/4). 3 Evaluate (3/312)/(24/(-192)). -1/13 Calculate 4/(-5)56/(-42)36/(-64). -3/5 What is -6325/1538/247? -20 What is ((-2)/(-26))/((-4340)/(-1820))-1? -1/31 Calculate (-3)/6-775/(-7000)-32. 6/5 ((4/6)/(1/6))/((-1560)/(-3510)) 9 5/((-105)/18)28/164 -6 Evaluate ((-315)/182/14)/((-10)/20). 5 What is (-306)/(-2652)4/3? 2/13 What is the value of (3/((-21)/8))/5(-2390)/(-956)? -4/7 What is ((-284)/8165)/((-13)/(585/(-6)))? -6/23 ((-5)/6)/(((-10)/(-3))/(36/18)) -1/2 What is the value of 190/(-57)12/32(-2)/(-5)? -1/2 What is (18/(-27))/((-27)/54)(-9)/6? -2 Evaluate (30/(-18))/(65/78). -2 What is the value of (-12)/451/612? -1/4 Calculate ((-2088)/(-4872))/((-3)/(-98)). 14 (((-57)/(-133))/3)/(1/(117)) 11 What is 2/12(-453)/(-151)? 1/2 What is the value of 90/25(-3)/(54/(-30))? 6 Calculate 81/(-30)(-620)/744. 9/4 What is ((-200)/(-25))/(3/(-3))? -8 Calculate (3/2)/(7/14)43/(-301). -3/7 49/2110/(-595)3 -2/17 Evaluate ((572/(-26))/44)/((-3)/204-10). -17/5 (((-4)/(-3))/4)/(-86/(-864)) 6 What is -37/((-252)/(-88))(-33)/66? 11/3 Evaluate (((-108)/99)/2)/(3(-3)/99). 6 Evaluate ((-529)/(-1587))/((-6)/4). -2/9 What is the value of ((-44)/6)/((-2104)/1578)? 11/2 Calculate ((-3)/(-18)3)/((-165)/4290). -13 What is (-3080)/(-462)(27/(-4))/9? -5 What is the value of -515/(-1250)5? 3/10 Calculate 6/(-522)(-36)/(-6). -2/29 What is the value of (-13)/(39/(-2))-3630/36? -35 What is (4/(-8))/(165/30)? -1/11 Evaluate ((-48)/(-2))/((-5)/(800/(-128))). 30 What is (39/104)/((-14)/224)? -6 What is the value of (159/(-1908))/((-6)/(-32))? -4/9 What is the value of 76/(-494)52(-1)/4? 2 What is ((-320)/(-48))/2(-30)/25? -4 Evaluate (12/470)/(1482/2470). 2/47 ((6/(-18))/1)/((30/6)/(-255)) 17 What is ((18/72)/((-2)/18))/(1/4)? -9 What is the value of ((-8)/(48/(-9)))/((-153)/(-102))? 1 Calculate (2/2)/((-11)/(550/10)). -5 What is 4204/84083/((-6)/(-64))? 16 What is the value of (5/(-11))/511/(-2)? 1/2 Evaluate (920/(-132))/23(-6)/2. 10/11 What is (6/4(-338)/4056)/((-3)/(-24))? -1 Evaluate (-127/56)/((-10)/(-20)). -3 Calculate (846/2115)/(9/662/15). 2/31 Calculate (2/159)/((-4)/3)(-4512)/1128. 2/53 Evaluate (-442)/(-663)(-2)/((-4)/2). 2/3 What is the value of (9/(-1))/45-2(-5)/(-7)? 2/7 (21/(-72))/(7/(-280)5-2) -7/6 Calculate (-2)/2226/(-4294). 1/19 What is the value of (((-10)/(-4))/(-5))/(50/2403)? -4/5 What is (-221/6)/(-17*6/(-204))? -14 What is the va	{ "pile_set_name": "DM Mathematics" }
-9 - -5. Let l be ((-2)/(-1))/(75 + -74). Let p(f) = 1 - f*l + 13f - 29f + 13f. Calculate p(w). -3 Let g(a) = -435a + 177a + 108a - 6 + 168a. Determine g(-4). -78 Let o(b) = -b*2 - 29b - 6. Let i = 658 - 687. Give o(i). -6 Let p be (2 + -1)/((-11)/(-22)). Suppose -5j + 5 = -5, n - 2j - 1 = 0. Let o(t) = -10t + 18t + 10 - pt - nt. What is o(-9)? 1 Let g(q) be the first derivative of -q4/4 - q3/3 + q*2/2 + 8q + 21. Let y = -22 - -22. Determine g(y). 8 Let n = 25 - 25. Let h be 6 + (-8)/4 + n. Let v be 117/(-18) + 2/h. Let x(u) = u*2 + 9u + 5. Give x(v). -13 Let n(h) be the third derivative of -3h5/20 + h4/24 - h3/6 - 110h*2 + 24h. Let m be (1 - -2) + (1 - 3). Give n(m). -9 Let r(y) = -y*3 + 5y*2 + 5y - 4. Suppose 0 = -45o + 54o - 180. Let l be 1/2-214. Let a = l + o. Determine r(a). -10 Let o(b) = 6b3 - 5b*3 - 1415b*2 - 7b + 0b - 2 + 1421b*2. Give o(-7). -2 Suppose 7j - 12j = -25. Suppose jd - 2s + 38 = 0, 4d + s = -0s - 20. Let m(h) = 5 - 13h*3 + 27h*3 + 7h - 13h3 + 7h2. What is m(d)? -1 Let p(b) be the second derivative of b7/2520 - b6/240 - b5/40 - 3b4/4 + 74b. Let i(t) be the third derivative of p(t). Let n = -4 - -7. What is i(n)? -3 Let x(m) = 15m2 - 27m + 5. Let f(p) = -7p2 + 13p - 2. Let b(j) = 13f(j) + 6x(j). Suppose -19w = 52 - 204. What is b(w)? -4 Suppose 13524f = 13538f - 42. Let q(p) = -1. Let n(u) = u - 8. Let o(a) = -n(a) + 6q(a). What is o(f)? -1 Let w(t) = -t*2 - 15t - 35. Suppose 2574 = -154v - 44v. Determine w(v). -9 Let b(t) = -t + 77 + 86 + 17t. Let u be b(-10). Let c(x) = x - 3. Calculate c(u). 0 Let k(a) = -a3 - 7a*2 - 18a - 39. Let i be k(-5). Let d(t) = -4t + 1. What is d(i)? -3 Let l(t) be the second derivative of -2t*3 - 321t*2/2 + 7425t. Determine l(-26). -9 Let z = -93 + 132. Let r = 30 - z. Let t(v) = v*2 + 8v - 9. Determine t(r). 0 Suppose -4y - 4v = -8y - 524, -2y = 4v + 268. Let i = y - -123. Let c(p) = p + 3. Determine c(i). -6 Let x(h) = 2h*2 - h - 1. Let p(v) = 13v*2 - 8v - 11. Let b(a) = 13a2 - 8a - 10. Let c(g) = -3b(g) + 4p(g). Let o(m) = c(m) - 6x(m). Calculate o(5). 7 Let a(r) be the second derivative of -r4/12 + 19r*3/6 + 3r*2/2 + 5r - 288. What is a(20)? -17 Suppose -16d + 11d + 1845 = -5m, 5d - 1845 = m. Let n = d + -363. Let o(v) = v*3 - 8v*2 + 7v - 2. Calculate o(n). -32 Let a be 20/(-8)4 - -14. Let v(p) be the third derivative of -1/60p*5 + 0 + 1/4p*4 - 3p*2 + 0p - 2/3p3. What is v(a)? 4 Let r(c) = 4c3 + c2 + 51c - 16. Let j(l) = -3l3 - l2 - 36l + 11. Let a(f) = -7j(f) - 5r(f). Determine a(-5). -57 Let q(w) = -w + 17. Suppose -155d + 304 = -193d. What is q(d)? 25 Suppose -r = -5k - 35, -k - 284r - 3 = -285r. Let o(x) = x*2 + 13x + 43. Calculate o(k). 3 Let t(m) be the third derivative of -m5/10 - m4/8 + m*3/2 + 208m*2 + 2m. Calculate t(1). -6 Let v be -4 - (-70)/(-10) - 12/(-2). Let u(b) = 9b2 + 46b + 1. Calculate u(v). -4 Suppose 5j + 18 - 38 = 0. Suppose -6w = -8w + j. Suppose -wt = m - 3t, -3m = t. Let x(g) = -g2 + g + 6. What is x(m)? 6 Let o(d) = d2 - d - 2. Suppose -a + 17 = c - 0c, 9 = 2c - 3a. Suppose -16i = -ci - 16. Let n be (1 + 3)1/i2. Give o(n). 0 Let g be 1162/415(-2 - -8 - 1). Let f(x) be the third derivative of x*4/24 - 11x*3/6 - 4x2. What is f(g)? 3 Let k(d) = -d3 + 3d2 + 4d. Let x = 302 - 300. Let w be -7 + 7 + (6/1)/x. Determine k(w). 12 Suppose 0 = -19c + 4c + 30. Let z(j) = -9 - 4j + 6j + cj. Determine z(4). 7 Suppose -g + 1 = 0, -2n = -2g + 74 - 84. Let t(s) = s2 - s. Let d(v) = -4v*3 - 8v*2 + 9v + 3. Let r(q) = nt(q) + d(q). Give r(-2). 21 Let q(o) be the first derivative of -2o*3/3 + 15o*2 + 4o + 1542. What is q(15)? 4 Let k(i) = -34 + 317i2 - 8i + 11 + 322i2 - 640i2. What is k(-8)? -23 Let l(h) = -3 + h2 + 3h3 + 0h2 + 1. Let t(z) = z3 - 6z2 - 28z + 10. Let y be t(9). Let a be l(y). Let g(o) = -4o2 - o - 1. Calculate g(a). -19 Let h(w) = 13w*3 - 16w*2 + 41w*3 - 23 + 22w*3 - 77w*3 + 35w. What is h(-18)? -5 Let m(x) = 2x. Let z be m(-6). Let o(n) = 402n + 13 - 1613n - 6 + 399n + 406n + 408n. Calculate o(z). -17 Let f(b) = b*3 - 3b*2 + 2b + 1. Suppose -7a = -2a - 15. Let r be a - (-1 + 4 + (-2 - 1)). Let j be ((-1)/r)/((-11)/(-6) + -2). Determine f(j). 1 Let m = -58 + 123. Let f = 125 - 191. Let x = m + f. Let q(z) = 5z - 1. Calculate q(x). -6 Let b(v) = -6v - 43. Let a be -35(296/(-20) - -15). Give b(a). -1 Let n = 128 + -127. Let f(i) = -3985i*2 + n + 3 + 4i - 3 + 3986i2. Calculate f(-3). -2 Let i(r) be the first derivative of r2 + 26r + 3485. What is i(23)? 72 Let y(g) = 10g2 + 5 - 5 + 49g*3 - 96g*3 + 48g3. Let m(c) = -c2 - 10. Let d be m(0). Determine y(d). 0 Let i(f) = -8f2 + f + 1. Let r(p) = p3 - 103p*2 - 27p - 184. Let j(m) = -8i(m) + r(m). Determine j(40). 8 Suppose 24x + 360 = 96x. Let y(h) be the third derivative of 0h - 33h2 - h3 - 1/60h*x + 13/24h4 + 0. Give y(12). 6 Let c(z) = -z3 + 37z2 - 5z - 8. Let a(f) = 2f3 - 79f*2 + 10f + 15. Let k(h) = -6a(h) - 13c(h). Calculate k(4). -14 Suppose -n = -2n + 2. Let m(a) = -a3 + 1 - a - na*2 + 0a + a + a. Suppose 58i - 57i + 3 = 0. What is m(i)? 7 Let h(b) be the first derivative of 2b - b2 - 2/3b3 - 30. Suppose -5 + 1 = d. What is h(d)? -22 Let h(w) = -w2 + 9w - 15. Let j = 1704 + -1696. Give h(j). -7 Suppose 5p = 2289 + 5906. Let i(m) = m*3 - 1638m + 3282m - pm - 5m2. Give i(4). 4 Let j = 6201 - 6196. Let f(p) = -3p + 9p - 2p - p*2 + 7p - 6. What is f(j)? 24 Let x(o) be the second derivative of -o5/20 - o4/3 - o*3 - 7o*2/2 + 12o - 13. Give x(-5). 48 Let g(d) be the third derivative of -d6/120 + d5/5 - 5d4/12 + 4d*3/3 + 3d*2 + 35. Determine g(11). 19 Let c(m) = 14m*2 + 36m + 1. Let f(u) = -29u2 - 60u - 2. Let x(l) = 5c(l) + 3f(l). Let a be ((-14)/4 + 3)-2. Determine x(a). -18 Let o = 64 + -56. Let l(k) = -9k*2 - 3 - ok + 8k2 + 6k - 1. What is l(-3)? -7 Let o(v) = 2v2 + 10v - 49. Let a be -9 - (1/(-4))/(2970/(-176) - -17). Calculate o(a). -21 Suppose 10t - 152 = 28. Suppose 5n - 2n - t = 0. Let b(k) = -k2 + 7k - 1. Let c be b(n). Let w(y) = -y*2 + 5y + 5. Calculate w(c). 5 Suppose 10j + 60 = 5v, -2v + 3v + 8 = -2j. Let o(r) be the third derivative of r6/120 + r5/12 + r4/24 + r3/2 + 2r2. Calculate o(j). -2 Let f = -3677 - -3683. Let m(x) = x2 - 4x - 1. What is m(f)? 11 Suppose -66m + 39 = -27m. Let q(t) = -t3 - 2t*2 + 6t - 4. Determine q(m). -1 Let s(n) be the second derivative of n4/6 + n3 + 2n2 + 6n - 1. Suppose 5w - 13p = -15p - 20, 2w = 4p - 8. Give s(w). 12 Let i(d) be the second derivative of 0 - 46d - 3d2 + 1/2d3. Calculate i(5). 9 Let s(x) be the third derivative of x4/24 - 4x3/3 + 2x*2. Let h be (690/(-20) + 34)2-8. Determine s(h). 0 Let q(f) be the third derivative of f4/8 + 23f*3/3 + 44f*2 - 26. Calculate q(-21). -17 Let y(t) = 3t*2 - 4t + 5. Let u(l) = -l*2 + 7l + 46. Let w be u(11). Suppose wz - 6z + 20 = m, -m - 4 = -2z. What is y(z)? 37 Let v(r) = -5r*3 + 10r*2 - r + 1. Let u(a) = -4a*3 + 9a*2 - a. Let i(b) = 6u(b) - 5v(b). Let f(q) = 70q + 276. Let l be f(-4). Determine i(l). -1 Let f = -285 + 300. Suppose 4l = -2a + 4 + 16, 4a - 3l + f = 0. Let x(w) = w3 - w - 4. Calculate x(a). -4 Let p(s) = s - 2. Let r be p(3). Let n(a) be the third derivative of a4/6 + a*3/6 - 124a*2. Let m(w) = 9w + 4. Let t(v) = -2m(v) + 7n(v). What is t(r)? 9 Let j(s) = 187s + 347296 - 186s - 347289. Let f = -27 - -18. Give j(f). -2 Let z(k) = -2k2 - 6k. Suppose 0 = -53h + 37h - 64. Give z(h). -8 Suppose 299q - 485 = 256q + 160. Let x(z) = -z*3 + 13z*2 + 20z + 34. Give x(q). -116 Let c be ((-46)/(-8))/((-45)/(-140) + 4/(-7)). Let n(i) = -i*3 - 22i*2 + 27i + 63. Calculate n(c). -29 Let w(z) = 2z2 - 1. Let c be 5 + (-3 - 1) + 4. Suppose cn + 26 + 3 = -2d, n = -2d - 9. Calculate w(d). 7 Suppose 4n = -2g + 24, 2n = 8g - 10g + 14. Let k(r) = r + 12 - rg + 6 - 18. Suppose -j = -0j - 4. Give k(j)	{ "pile_set_name": "DM Mathematics" }
0.6306626258 rounded to four dps? 0.6307 Round -61.813755 to 2 dps. -61.81 What is 0.077581082 rounded to 4 decimal places? 0.0776 Round 99391930 to the nearest one hundred thousand. 99400000 What is -73434234 rounded to the nearest 10000? -73430000 What is 68.8513003 rounded to three dps? 68.851 What is 130453.161 rounded to the nearest one hundred? 130500 Round -78205420 to the nearest one million. -78000000 What is -8.3753597 rounded to the nearest integer? -8 What is 3346645.265 rounded to the nearest 100? 3346600 Round 75.85826139 to 2 decimal places. 75.86 Round -889.501054 to 1 dp. -889.5 Round -30836615.5 to the nearest one hundred thousand. -30800000 What is -0.0000170934376 rounded to 7 decimal places? -0.0000171 What is -14173.39989 rounded to the nearest ten? -14170 Round 0.08389840789 to 3 decimal places. 0.084 Round -2932769.23 to the nearest one million. -3000000 What is 4805.589859 rounded to the nearest integer? 4806 Round 21.47671961 to 2 dps. 21.48 What is -0.000047105863 rounded to six dps? -0.000047 What is -1451.281 rounded to the nearest one thousand? -1000 Round -0.0000193438376 to seven dps. -0.0000193 What is -3.59945721 rounded to 2 decimal places? -3.6 What is 0.066504 rounded to one dp? 0.1 What is -75476.281 rounded to the nearest ten thousand? -80000 What is 2585071400 rounded to the nearest one million? 2585000000 What is 0.018059001 rounded to five decimal places? 0.01806 Round 64942.806 to the nearest 100. 64900 What is 0.00286754116 rounded to 4 decimal places? 0.0029 What is 59.7102163 rounded to 1 decimal place? 59.7 Round 4497521975 to the nearest 1000000. 4498000000 What is -662.254138 rounded to the nearest ten? -660 What is 92.09745701 rounded to 2 dps? 92.1 Round 10.1129279 to four decimal places. 10.1129 What is 0.0000101849053 rounded to seven decimal places? 0.0000102 Round -14512715.534 to the nearest one hundred. -14512700 Round -17209576.2 to the nearest 1000. -17210000 Round 494646.9498 to the nearest one hundred. 494600 Round -1478.6299104 to one decimal place. -1478.6 Round -694.1058 to 1 decimal place. -694.1 What is -0.02609333067 rounded to 3 decimal places? -0.026 What is 445566377.4 rounded to the nearest ten thousand? 445570000 What is 11543.92192 rounded to the nearest 100? 11500 What is 0.01255793627 rounded to three dps? 0.013 What is 38170.1922 rounded to the nearest one thousand? 38000 What is -0.0000262881911 rounded to seven dps? -0.0000263 Round -314394.9476 to the nearest one hundred. -314400 What is -7.23895587 rounded to zero dps? -7 Round -108392348.7 to the nearest one thousand. -108392000 Round 95226088190 to the nearest 1000000. 95226000000 What is -7778.404847 rounded to the nearest one thousand? -8000 Round -13675.16878 to the nearest 10. -13680 What is -11.4828768 rounded to 2 dps? -11.48 What is 730896.8 rounded to the nearest 1000? 731000 Round 2820783.8 to the nearest 1000. 2821000 What is -0.00000831467137 rounded to six dps? -0.000008 Round -1107972.9 to the nearest one thousand. -1108000 Round 7.79363991 to 3 dps. 7.794 Round 0.00872519967 to six decimal places. 0.008725 Round 0.194515774 to three dps. 0.195 What is -49390.97534 rounded to the nearest 10000? -50000 Round 0.0214987658 to 5 dps. 0.0215 Round 6622800660 to the nearest one million. 6623000000 Round -0.000008362881679 to six dps. -0.000008 Round 97411.27 to the nearest 100. 97400 What is 11203665.8 rounded to the nearest one hundred thousand? 11200000 What is 0.00445644204 rounded to seven decimal places? 0.0044564 What is 0.000874500619 rounded to six decimal places? 0.000875 What is -283212388.3 rounded to the nearest one hundred thousand? -283200000 Round -1.771771234 to one dp. -1.8 What is 48.189638 rounded to zero decimal places? 48 What is -86.5965698 rounded to the nearest integer? -87 Round -141900.793 to the nearest one hundred. -141900 What is 101485508 rounded to the nearest ten thousand? 101490000 What is 4043195550 rounded to the nearest one hundred thousand? 4043200000 What is 1.33338018 rounded to 3 decimal places? 1.333 What is -52164894 rounded to the nearest 10000? -52160000 What is -0.0000324327048 rounded to six dps? -0.000032 What is -959616.222 rounded to the nearest one thousand? -960000 What is 0.000467927821 rounded to 7 dps? 0.0004679 What is 54478680.6 rounded to the nearest 100000? 54500000 Round -49.98500285 to zero dps. -50 Round 0.0007608225439 to four dps. 0.0008 Round 0.0194471066 to 5 decimal places. 0.01945 Round 100.323572 to the nearest integer. 100 Round 0.4006604341 to two dps. 0.4 What is -0.0000016598294492 rounded to 7 dps? -0.0000017 Round 144423251.88 to the nearest one million. 144000000 Round 21530.924 to the nearest 1000. 22000 What is 1.0847500521 rounded to 5 decimal places? 1.08475 Round -2.45685416 to 1 decimal place. -2.5 Round 0.0000693234046 to five decimal places. 0.00007 Round 0.314915228 to four decimal places. 0.3149 Round 15495369.37 to the nearest one thousand. 15495000 Round -14.59655645 to 2 decimal places. -14.6 Round 25093.577697 to the nearest one hundred. 25100 What is 0.0001236484185 rounded to 7 dps? 0.0001236 What is -0.000752205 rounded to 7 dps? -0.0007522 Round -108017.422 to the nearest ten. -108020 What is 0.0023186317 rounded to seven dps? 0.0023186 Round 0.0000209452054 to 6 dps. 0.000021 What is -3294432.45 rounded to the nearest one million? -3000000 What is 4037890616 rounded to the nearest 1000000? 4038000000 What is 0.074858958 rounded to 3 dps? 0.075 Round 4537.433294 to the nearest 100. 4500 Round -113611.5614 to 0 decimal places. -113612 What is -204580.1194 rounded to the nearest one thousand? -205000 Round 16.7038763 to 3 dps. 16.704 Round -1652661.33 to the nearest one thousand. -1653000 What is -3915.154075 rounded to the nearest integer? -3915 Round 11078570.96 to the nearest 1000000. 11000000 What is 102300.764 rounded to the nearest one hundred? 102300 What is 0.004468184261 rounded to 7 decimal places? 0.0044682 Round -5490592.359 to the nearest 1000000. -5000000 What is 0.0111457704 rounded to six decimal places? 0.011146 Round 223.786413 to zero decimal places. 224 Round -8620914.79 to the nearest 10000. -8620000 What is -243.285452 rounded to the nearest ten? -240 What is 0.0081600236 rounded to 3 dps? 0.008 What is -56699.4022 rounded to the nearest 10? -56700 What is -0.040416671 rounded to 5 decimal places? -0.04042 What is -0.000000925229836 rounded to 7 dps? -0.0000009 Round 0.0001233385126 to 7 dps. 0.0001233 What is 536.05203 rounded to 1 decimal place? 536.1 What is -200154.953 rounded to the nearest one thousand? -200000 Round 5473.35556 to 1 decimal place. 5473.4 Round -729414.4371 to the nearest ten. -729410 What is -79952289.6 rounded to the nearest 1000000? -80000000 Round 11.1755161 to one decimal place. 11.2 What is 0.00409567715 rounded to 3 decimal places? 0.004 What is -51.3099527 rounded to zero decimal places? -51 Round 0.0003163888 to five dps. 0.00032 What is -567.025472 rounded to zero decimal places? -567 What is 846.6439 rounded to the nearest one hundred? 800 What is -0.0000095030599 rounded to six decimal places? -0.00001 What is -0.0401676036 rounded to two decimal places? -0.04 What is -392166.4898 rounded to the nearest ten? -392170 What is 0.62209154 rounded to one dp? 0.6 What is 2.14173957 rounded to 3 dps? 2.142 Round -1.812718089 to five dps. -1.81272 Round 0.000206473766 to seven decimal places. 0.0002065 What is -63406.253 rounded to the nearest one thousand? -63000 What is 0.73892873 rounded to 4 decimal places? 0.7389 Round 3393.83519 to the nearest ten. 3390 What is -16238.268 rounded to the nearest one thousand? -16000 Round 37563567 to the nearest one million. 38000000 What is -0.3011547144 rounded to two decimal places? -0.3 Round 254.657196 to zero dps. 255 What is 0.321034451 rounded to 3 decimal places? 0.321 Round -0.0010868934368 to five dps. -0.00109 What is 340.568644 rounded to two dps? 340.57 Round -0.00000014923584 to 7 dps. -0.0000001 What is 5374.81 rounded to the nearest one thousand? 5000 What is -0.43748528 rounded to 2 dps? -0.44 Round 4592444.327 to the nearest 100. 4592400 Round -5.23397753 to four dps. -5.234 Round 1.234384918 to 2 dps. 1.23	{ "pile_set_name": "DM Mathematics" }
10 Is 4/5 less than or equal to 1816613? True Which is greater: -10/1434261 or 0? 0 Is -14 at least 13426064? False Which is bigger: -300546 or -300405? -300405 Which is bigger: -131727/116 or -1137? -131727/116 Is 0.1 not equal to 1018260672? True Which is smaller: -347198/753 or -0.1? -347198/753 Which is greater: 237106632/31 or 7648601? 237106632/31 Is -2/57 > -0.562934? True Which is bigger: 9/7516285 or -1? 9/7516285 Is 1377918434 equal to 1377918433? False Which is smaller: 3/130 or -0.00484? -0.00484 Is 0 < -5/214623882? False Is -21355/3 at most as big as -1/351? True Is 185561670 smaller than 185561669? False Is 9149 at most 212.2? False Which is smaller: -1160 or 94048? -1160 Is -2680 > 421? False Is -9780434 >= 2/35? False Is 1606164799 at least as big as 1606164799? True Is 13784.35 at most as big as 136? False Are -816894 and 0.008 equal? False Is -247733 > -247692? False Do 13005 and -0.38249 have the same value? False Which is smaller: 92 or 969404? 92 Is -175615542 >= -175615543? True Is 27426088 greater than 27426090? False Which is bigger: -27 or -186371/6904? -186371/6904 Which is bigger: 178586/3 or 1/37? 178586/3 Is -1634544 greater than -5/7? False Are 0 and -1/3421319 non-equal? True Is 1 less than 2123/3664? False Is -1 at most as big as -480/140059? True Which is smaller: 0 or 6/37122857? 0 Which is greater: -1026 or -231649/226? -231649/226 Are 178208 and 178040 equal? False Is 13400448 at least 2? True Is 1151973 at most as big as 4607889/4? False Is 311383 less than or equal to -18? False Which is greater: -116689741 or -116689743? -116689741 Which is smaller: 3112/1015 or 4? 3112/1015 Which is smaller: 267140 or -2? -2 Which is smaller: -110765/9 or -2/9? -110765/9 Is -170 greater than -111729? True Which is smaller: -292384.73 or 7? -292384.73 Which is greater: -2322945 or -2322949? -2322945 Is 237403 at most as big as 236389? False Which is greater: 76 or -40/21987? 76 Is -26338498 less than or equal to -26338496? True Is 22956960 less than 114784801/5? True Is -25419 smaller than -4244895/167? True Is 22 < 5179? True Which is smaller: 434672 or 434662? 434662 Is 96733.1 >= 1/49? True Which is bigger: 1/299568699 or -1? 1/299568699 Which is smaller: 331256 or 3? 3 Which is smaller: 503676/5 or 100734? 100734 Is -137644 greater than -137644? False Is -866500421 greater than -866500419? False Which is bigger: -12468 or 96? 96 Which is bigger: -79364486 or -873009336/11? -873009336/11 Is -2/53776175 <= 1? True Is 181205/9 > -2? True Is 19340022 <= 19340012? False Is -0.1 <= -10561516? False Which is smaller: -223 or -15528? -15528 Which is smaller: 62967 or 63105? 62967 Is 0.9 greater than -8794889? True Is -449172451 at least as big as -449172451? True Which is smaller: 319295 or 319281? 319281 Is -1117.2 less than 2477? True Which is greater: -4/52229 or -43? -4/52229 Is -2191 equal to -4561? False Which is smaller: -39275 or -39046? -39275 Which is greater: 4668291 or 4668284? 4668291 Which is bigger: -0.07465 or -33? -0.07465 Is 1 != -28/46177? True Do 101003343 and 101003344 have different values? True Is 2 less than 15706/9217? False Is -1 less than 251/38578? True Which is greater: -258567 or -258570? -258567 Which is bigger: 0.1 or -5490705? 0.1 Is 1 greater than or equal to -1760/15233? True Is -31.42759 at most as big as -0.08? True Is -426797 < -7682329/18? True Which is smaller: 36785259/5 or 7357052? 36785259/5 Is -6568 smaller than 2/9? True Is -136100/23 < -5916? True Is 2571408 at most 0.21? False Is -71 at least as big as -593133? True Which is smaller: 91639/35 or -1? -1 Is -95243 > -94955? False Which is greater: -1 or 389/10066? 389/10066 Which is greater: -290.872 or 46? 46 Which is smaller: 173527208 or 173527209? 173527208 Is -466941 at most -8871907/19? False Do 1223385/556 and 2200 have the same value? False Is 28362 at most 29578? True Is 276076 smaller than 276039? False Which is greater: -83973425 or -83973423? -83973423 Which is smaller: -143408 or -5.5? -143408 Are 5613345 and 28 equal? False Is -0.1 <= -4742484/649? False Is 1/128587571 > 1? False Which is smaller: 8159246 or 8159222? 8159222 Are -124683652 and -124683658 unequal? True Is -2/15 less than 4405572? True Which is smaller: 8581 or 8765? 8581 Is 30/891023 at least as big as 0? True Is 1140 <= 0.15414? False Which is smaller: 1 or -19/1237613? -19/1237613 Is 1/2 < 5482256/3? True Is -7290 equal to -6084? False Is 1135 bigger than 1426253/1256? False Does -20/2868051 = 0? False Is 0 > 41/218648? False Is -3/380 greater than 1198? False Is 4881301 smaller than 4881301? False Is 0 > 60807750? False Is -53666.1 smaller than 25/3? True Which is smaller: 5029896 or -4? -4 Which is greater: -36434 or -40038? -36434 Which is smaller: -122389/367 or -334? -334 Which is smaller: -2 or 6844201? -2 Do 60 and 98736/1685 have the same value? False Are -7921768 and -39608842/5 unequal? True Which is greater: -30/1751221 or 1? 1 Is -142223222 >= -142223220? False Which is bigger: 0 or 2/22601939? 2/22601939 Is 230 smaller than -25034? False Which is bigger: 105 or 0.029052? 105 Which is smaller: 1 or -3/14827556? -3/14827556 Is 2453 > -7222? True Which is smaller: -2/408037683 or -1? -1 Do -59211546 and -59211539 have the same value? False Is -266380 != -266482? True Which is smaller: 232/3 or 0.09294? 0.09294 Is 10668/1319 greater than or equal to 7? True Which is smaller: -8 or 7710696? -8 Which is smaller: 35825 or 10448? 10448 Which is bigger: -146/2716909 or 0? 0 Is -1187 != 3340.2? True Do 9 and 16413/1988 have the same value? False Which is smaller: -152358170 or 0.07? -152358170 Is 15632 not equal to 15747? True Which is smaller: -3534552 or -3534551? -3534552 Is 35283 <= 246991/7? True Which is smaller: 90/78583 or 2/7? 90/78583 Is -1/30069358 bigger than -1? True Is -1/2240 >= -2/13981? False Is -26.8 not equal to -3539.866? True Which is smaller: -323647 or 127? -323647 Is -2/47 > -47528? True Which is smaller: -122724/62999 or -2? -2 Is -3684/23027 less than -1? False Is 2411779172 less than or equal to 2411779171? False Is -9624797 > -9624797? False Which is greater: 5543 or -22522? 5543 Do -406922 and -1/167 have the same value? False Do 251193576 and 251193578 have different values? True Which is greater: 13864545/118 or 117496? 13864545/118 Is 9811481 <= -1/2? False Which is smaller: 7569 or 6372? 6372 Is 378.8 < 5759? True Which is bigger: 3 or -71445865? 3 Which is bigger: -168778 or -168766? -168766 Which is smaller: -167026 or -167046? -167046 Which is greater: -76/21349351 or 1? 1 Which is smaller: -7/12972 or 707? -7/12972 Are -54.59 and -165 equal? False Is -4001476 != -4001479? True Which is smaller: -3661659 or -3661647? -3661659 Is 9662772/115 >= 84024? True Is 49196006 at most as big as 49196005? False Is 1707584 <= 25613782/15? True Is -1057141 greater than or equal to -1057188? True Is -6 greater than -5094388? True Which is bigger: -457307157 or -457307158? -457307157 Which is smaller: -53 or 10692? -53 Is 1515 greater than or equal to -36717/5? True Which is smaller: -6301 or -15337? -15337 Is 9 at least 28088505? False Is -19322 greater than 2072? False Which is bigger: 1054090 or 1053992? 1054090 Is 6734 at least 8341? False Is 141627 less than 141651? True Which is greater: 6125361 or 6125363? 6125363 Is 1 smaller than -1383/173360? False Which is bigger: 465553091 or 465553090? 465553091 Which is greater: 13.34 or 4392? 4392 Is 118528.44 smaller than 0.17? False Is -29684 at least as big as 16613? False Is 31631/345 != 91? True Which is smaller: -1/2440169 or 0.33? -1/2440169 Which is greater: -1082969/6 or -180496? -1082969/6 Which is smaller: -58328 or -7.074? -58328 Which is smaller: 49265 or 49149? 49149 Are 403.24 and -0.102 equal? False Which is greater: -1/4 or -95/9565422? -95/9565422 Which is smaller: -764157 or -109? -764157 Which is greater: 393789861 or 1/2? 393789861 Which is smaller: 130684929 or 130684928? 130684928 Is 73277887 greater than 73277886? True Which is bigger: 0.0052 or 231983/3? 231983/3 Is -307.41308 smaller than -17? True Is -209818 at least as big as -210119? True Is -371971 smaller than -371970? True Which is smaller: 0 or 6/45838321? 0 Which is greater: -14707525/2 or	{ "pile_set_name": "DM Mathematics" }
- 42k + 11. What is s(-21)? 11 Let v(q) = -q3 + 5q*2 + 6q - 7. Give v(6). -7 Let z(a) = -a*3 + 8a*2 - 6a + 5. Calculate z(2). 17 Let k(c) = -c*2 + 7c - 14. What is k(12)? -74 Let a(f) = -6f2 - 29f - 3. Calculate a(-5). -8 Let r(g) = -7g3 - 2g - 2. Give r(-1). 7 Let l(f) = -f*3 + 9f*2 - 5f + 42. Calculate l(9). -3 Let o(a) = a*3 - 4a*2 - 6a + 6. Determine o(5). 1 Let s(x) = -x*3 - 5x*2 + 7x + 7. Determine s(-6). 1 Let r(g) = -7g - 1. What is r(1)? -8 Let a(n) = -13n - 599. Calculate a(-46). -1 Let z(b) = 37b - 883. Determine z(24). 5 Let s(o) = -o3 - 22o*2 + 2o + 40. Give s(-22). -4 Let h(w) = -w*3 + 3w*2 - 2w + 4. Give h(3). -2 Let t(u) = 14u + 709. Give t(-51). -5 Let v(n) = n3 + 13n*2 + 11n - 13. Determine v(-12). -1 Let h(n) = -n*3 - 15n*2 - 5n + 130. Determine h(-14). 4 Let z(i) = i*3 + 10i*2 + 7i - 22. Give z(-9). -4 Let j(s) = s*3 - 6s*2 - 2s + 13. Calculate j(6). 1 Let h(y) = -16y2 + 3y + 3. Determine h(-1). -16 Let x(k) = -10k + 115. What is x(11)? 5 Let i(b) = -2b*2 - 10b + 6. Give i(-6). -6 Let r(x) = -11x - 2. Determine r(2). -24 Let h(t) = 2t*3 - 37t*2 + 19t + 9. Give h(18). 27 Let f(v) = -v*3 + 10v*2 - 26v - 2. Calculate f(6). -14 Let v(u) = -11u2 - u + 1. Determine v(1). -11 Let b(m) = 6m + 48. Determine b(-5). 18 Let c(a) = -a*2 + 20a - 3. Give c(15). 72 Let c(q) = -4q3 + 17q2 - 6. What is c(4)? 10 Let d(g) = g + 3. Calculate d(-4). -1 Let g(b) = b3 + b2 + b - 27. Determine g(0). -27 Let p(i) = -i3 + 6i2 + 4i - 4. Calculate p(6). 20 Let t(k) = 2k2 - 19k + 40. What is t(6)? -2 Let u(k) = -k*2 - 62k - 478. Calculate u(-9). -1 Let a(q) = q*2 + q + 2. What is a(-2)? 4 Let c(y) = -2y*2 - 62y - 164. Give c(-28). 4 Let h(j) = -84j3 - j + 1. Determine h(1). -84 Let g(c) = c2 - 40c - 80. What is g(42)? 4 Let m(s) = -8s3 + 3s*2 - 5s + 2. Calculate m(1). -8 Let d(n) = -n*2 + 8n - 4. Calculate d(7). 3 Let p(k) = 39k + 84. Calculate p(-2). 6 Let h(g) = -2g*2 + 6g + 1. Give h(-2). -19 Let f(v) = 4v2 + 33v - 3. Determine f(-8). -11 Let x(z) = 16z - 91. What is x(6)? 5 Let g(b) = -b2 - 16b - 30. What is g(-15)? -15 Let t(o) = o*3 - 9o*2 + 2o - 10. Determine t(6). -106 Let d(n) = 2n2 - 5n + 7. What is d(4)? 19 Let s(z) = -14z - 56. Calculate s(-7). 42 Let w(a) = -18a - 20. Give w(7). -146 Let r(c) = c*3 + 14c*2 - 21c - 80. What is r(-15)? 10 Let r(y) = 2y - 6. Calculate r(8). 10 Let q(y) = y3 + 16y*2 - 6y - 35. Give q(-16). 61 Let h(w) = w*3 - 12w*2 - 14w - 15. What is h(13)? -28 Let f(p) = -7p - 96. What is f(-13)? -5 Let r(b) = b3 + b + 7. Calculate r(0). 7 Let u(f) = f2 + 12f - 31. Determine u(-13). -18 Let w(t) = -t*3 - 12t*2 - 9t + 2. Calculate w(-11). -20 Let f(l) = -l*3 + 16l*2 - 2l + 33. Give f(16). 1 Let m(x) = x*3 - 6x*2 + x + 2. What is m(6)? 8 Let z(l) = 11l + 6. Calculate z(-2). -16 Let n(u) = u*2 + 23u + 44. What is n(-20)? -16 Let n(z) = -z3 - z2 + 2z + 1. Give n(-2). 1 Let c(d) = -d3 + 5d*2 - 7d + 34. What is c(5)? -1 Let w(n) = n*3 - 16n*2 - 20n + 34. Calculate w(17). -17 Let p(g) = g*2 + 3g - 41. Calculate p(0). -41 Let g(f) = -f + 4. Determine g(6). -2 Let c(a) = -a*3 - 16a*2 + 20a + 54. Calculate c(-17). 3 Let h(s) = 4s - 23. Calculate h(9). 13 Let i(u) = -u2 + 5u - 6. Calculate i(6). -12 Let h(a) = a*2 - 6a - 2. Determine h(-6). 70 Let h(b) = -2b - 1. Give h(-3). 5 Let g(f) = 8f - 4. Calculate g(-4). -36 Let t(j) = 2j3 - 68j*2 + 66j - 1. What is t(33)? -1 Let w(f) = -31f - 1. Calculate w(2). -63 Let x(t) = 2t*3 + 13t*2 - 9t + 7. Calculate x(-7). 21 Let a(h) = -15h3 + 2h - 1. What is a(1)? -14 Let k(t) = 162t - 317. What is k(2)? 7 Let k(i) = -i3 - i2 - 2i + 1. Calculate k(-4). 57 Let z(r) = -r - 27. Give z(-19). -8 Let b(p) = -58p + 1. What is b(2)? -115 Let v(g) = g2 + g + 22. Determine v(0). 22 Let b(w) = -w3 + 9w*2 - 8w + 2. What is b(5)? 62 Let m(r) = 2r3 + r2 - 4r - 1. What is m(-2)? -5 Let h(i) = -2i3 + 5i + 5. What is h(-2)? 11 Let f(s) = 10s - 33. Give f(3). -3 Let q(a) = -a - 37. Give q(-12). -25 Let t(m) = -4m + 37. Calculate t(13). -15 Let v(i) = -2i - 2. Determine v(-1). 0 Let k(m) = 2m + 102. What is k(-29)? 44 Let y(i) = i*3 - 22i*2 - 44i - 101. What is y(24)? -5 Let g(x) = -37x - 225. Give g(-6). -3 Let w(z) = 760z - 3803. Calculate w(5). -3 Let c(v) = -6v2 - 5v + 3. Determine c(2). -31 Let n(w) = -w*3 + 11w*2 - 9w - 4. What is n(10)? 6 Let k(h) = 10h - 14. Give k(-3). -44 Let c(q) = 2q3 + q2 + 4q + 2. Calculate c(-3). -55 Let x(h) = h - 45. Determine x(26). -19 Let q(d) = d3 - 11d*2 - 9d - 20. Determine q(12). 16 Let t(p) = p*3 - 25p*2 + 45p + 16. Calculate t(23). -7 Let m(b) = -5b - 91. Calculate m(-21). 14 Let f(q) = 6q*2 + 32q - 22. What is f(-6)? 2 Let f(a) = -a - 63. Determine f(12). -75 Let v(w) = -w*3 + 12w*2 + 18w - 75. Determine v(13). -10 Let q(z) = -z*3 - 4z*2 - 4z - 6. What is q(-4)? 10 Let u(b) = -b*2 - 13b + 11. What is u(-7)? 53 Let k(o) = -2o3 + 8o*2 + 13o - 10. Determine k(5). 5 Let l(a) = 23a2 + 2. Give l(3). 209 Let y(u) = -5u - 45. Give y(-9). 0 Let p(b) = b*2 + 6b + 1. Give p(-4). -7 Let s(b) = -3b - 15. Calculate s(-10). 15 Let r(j) = j2 - j + 16. Calculate r(-5). 46 Let f(c) = -c2 - 23c - 105. Calculate f(-8). 15 Let l(x) = -10x3 + 4x2 - 6. What is l(2)? -70 Let u(c) = -c3 - 18c2 - 16c + 9. Calculate u(-17). -8 Let b(l) = -l*3 + 9l*2 + 12l - 6. Determine b(10). 14 Let t(u) = -u*3 - 6u*2 - 2u + 7. Give t(-5). -8 Let j(u) = -3u2 + 4u - 2. Determine j(2). -6 Let s(t) = -t*3 - 19t*2 - 17t + 16. Calculate s(-18). -2 Let x(b) = -b3 - b + 4. What is x(0)? 4 Let b(x) = -x2 + 25x - 103. What is b(6)? 11 Let x(l) = -3l*2 + 4l - 2. What is x(2)? -6 Let n(b) = -b*3 - 11b*2 - 26b - 75. Determine n(-10). 85 Let g(p) = -p*3 - 9p*2 - 8p + 4. What is g(-8)? 4 Let a(c) = 2c2 + 12c + 3. Give a(-9). 57 Let m(v) = v*2 + 12v + 15. What is m(-9)? -12 Let n(b) = -b*2 - 5b - 10. Calculate n(-9). -46 Let p(w) = -w*2 - 12w + 54. Determine p(-15). 9 Let l(p) = -p*3 - 15p*2 + 2p + 26. What is l(-15)? -4 Let j(p) = p*3 - 55p*2 + 108p - 89. Determine j(53). 17 Let r(v) = v*2 - 7v + 15. Calculate r(10). 45 Let n(m) = -12m - 131. Give n(-10). -11 Let t(h) = 2h*2 - 5h - 27. Determine t(-3). 6 Let k(r) = r*3 + 6r*2 - 4r + 22. Calculate k(-7). 1 Let u(t) = t*3 - 12t*2 + 6t + 59. What is u(11)? 4 Let w(t) = -2t + 17. Calculate w(-23). 63 Let y(d) = 109d + 2. Give y(1). 111 Let v(k) = 2k2 - 2k - 39. Give v(-5). 21 Let w(h) = 14h3 + h2 - 10h + 10. Give w(1). 15 Let p(b) = 2b3 - 7b*2 + 6b + 5. Determine p(4). 45 Let u(b) = -b*2 - 30b - 87. Calculate u(-27). -6 Let a(r) = r - 1. What is a(7)? 6 Let x(q) = 2q2 - 6q - 15. Calculate x(-4). 41 Let j(b) = -3b - 5. Determine j(-5). 10 Let g(k) = -k2 + k + 2. Calculate g(2). 0 Let s(n) = -6n + 2. Determine s(-5). 32 Let n(g) = g*3 - 12g*2 - 28g - 5. Determine n(14). -5 Let a(q) = q*2 + 13q - 2. Give a(-14). 12 Let p(l) = -2l2 - 25l - 21. Calculate p(-12). -9 Let y(d) = -3d + 30. Give y(6). 12 Let j(a) = -2a*2 - 47a + 12. What is j(-24)? -12 Let p(c) = c*3 - 2c2 + c + 2. Give p(-1). -2 Let u(n) = -n3 - 11n2 - 6n + 11. Determine u(-11). 77 Let w(d) = d - 31. Determine w(27). -4 Let k(l) = -l*2 - 6l - 2. Calculate k(-5). 3 Let j(s) = -41s2 - 121s + 3. Determine j(-3). -3 Let d(s) = -s*3 + 6s*2 + 8s. Calculate d(7). 7 Let i(b) = 6b + 53. Determine i(-7). 11 Let u(a) = -3a*3 - 6a*2 - 10a - 16. Calculate u(-4). 120 Let q(r) = 7r2 - 92r + 2. Calculate q(13). -11 Let n(a) = -10a + 15. What is n(-4)? 55 Let r(g) = 12g + 148. Determine r(-6). 76 Let x(d) = d*3 + 3d2 + d + 3. Give x(-3). 0 Let p(u) = -u2 - 40u - 245. Calculate p(-7). -14 Let g(x) = -11x - 57. Determine g(-7). 20 Let v(h) = h*2 - 7h - 22. What is v(10)? 8 Let s(q) = q*3 - 6q*2 - 2q + 7. Calculate s(5). -28 Let c(m) = -10m. Calculate c(4). -40 Let f(p) = 2p*3 - 7p*2 - 4p + 3. Determine f(4). 3 Let b(p) = -p*3 - 8p*2 - 12p - 1. Determine b(-6).	{ "pile_set_name": "DM Mathematics" }
+ 10 = 9r. Suppose 2x - 210 = -3x. Let g = x - 30. Calculate the smallest common multiple of g and r. 12 Let m be 7/(-28) + 439/(-4). Let i be (-2)/(-8) + 125/(-20). What is the lowest common multiple of (-4)/i + m/(-15) and 12? 24 Suppose 0 = 4a + a - 50. Suppose -6w = -w. Suppose -2l + wl = -20. What is the least common multiple of a and l? 10 Suppose 3n - 8n + 440 = 0. Calculate the smallest common multiple of n and 12. 264 Let g = 7 - -13. Calculate the common denominator of 0/(-2) + (-195)/g and -47/2. 4 Suppose -x = 6 - 38. Suppose -3h = h - x. What is the smallest common multiple of 6 and h? 24 Calculate the common denominator of 22/9 and 505/(-4)(-16)/120. 18 Let t(l) = l + 5. Let x be t(-4). What is the common denominator of (x + 28/(-6))/2 and (-1)/5 + 1415/(-50)? 6 What is the smallest common multiple of 10 and (-6)/(-15) + -531/(-5)? 110 Let n = 27221/22 - 1241. What is the common denominator of 5/2 and n? 22 Suppose 2i + 2o + 168 = -i, -4i - 2o = 224. Let g be (-4)/(80/(-94))i. Let p = g + 21451/80. Find the common denominator of p and 3/4. 16 Calculate the common denominator of 43/3 and -4 + 2 - (-5)/(90/393). 6 Suppose 3o = 8o - 385. Calculate the lowest common multiple of 10 and (22/o)/(1/7). 10 Let s be 2/(-5) - 22/(-5). Suppose -2l + 4 = -6. Calculate the lowest common multiple of 16 and 1 + s/(4/l). 48 Let j(k) = -k - 4. Suppose z + 14 - 2 = 0. Calculate the least common multiple of j(z) and 12. 24 Let z = 44213/4 - 486965/44. Let l = z - -62/11. What is the common denominator of -41/8 and l? 8 Let k = -6983/4 - -1737. Let p = 15065/4 + -3746. What is the common denominator of p and k? 4 Find the common denominator of -41/17 and 2 + 512/(-8). 68 Let h = 6 + -3. Let d be 4/6 - 2/h. Let k = d - -2. What is the smallest common multiple of k and 8? 8 Let a be (-12)/(-32)(-28004)/(-9). Let c = -1172 + a. Calculate the common denominator of c and 50. 6 Let i(n) = n*2 + 5n + 2. What is the lowest common multiple of i(-5) and 3? 6 What is the common denominator of (-6)/4284/(-18) and -51/5? 15 Let v(q) = 622q*2 + 3q + 3. Let o be v(-2). What is the common denominator of o/(-56)4/(-10) and -4/9? 36 Let i = -1/1329 + -13729/5316. Let j be 300/(-8)(-4)/5. Calculate the common denominator of ((-166)/j)/(12/10) and i. 36 Let k be (12/9)/((-3)/423). Calculate the common denominator of -83/14 and (2/4)/((-32)/k). 112 Suppose 0 = -a - 2s + 9, -4a + 2a = 3s - 16. Let k(d) = d*3 - 5d*2 + d. What is the smallest common multiple of k(a) and 3? 15 What is the lowest common multiple of 6 and (-57)/(-2) + -3 - (-6)/(-4)? 24 Let t be ((-56)/12)/(4/54). Let i = -947/2 - -465. Calculate the common denominator of 224/t + (-4)/2 and i. 18 Suppose 0o = -2q - 2o - 8, 0 = 2q - 2o + 28. Suppose -4b = -9b + 610. Find the common denominator of q/6b/(-6) and -93/10. 10 Suppose -3d + 22 = -38. Calculate the smallest common multiple of d and (-41)/(-2) - (-1)/(-2). 20 Let f be (-2)/(1/((-2)/4)). Calculate the common denominator of 39/(-66) - (f + 1) and 362/56 + (-24)/(-84). 44 Suppose -2o - 2o + 4 = 0. Let t = 2 + -4. Calculate the least common multiple of 20 and 20 - (4 + t/o). 180 Let u be 37212/39 - (-4)/(-26). Find the common denominator of 67/18 and (-8)/28 + u/(-140). 90 Let a = 40 + -26. Suppose 3p - 12 = 24. Calculate the smallest common multiple of a and p. 84 Let h(k) be the third derivative of k5/60 - k4/2 + k3/3 - 4k*2. Calculate the lowest common multiple of 9 and h(12). 18 Let l = -1826 - -20137/11. Calculate the common denominator of 40/6(-10)/4 and l. 33 Let j = -2533468486/7921 + 319842. Let q be -3 + 1 - 768385/95052. Let n = q - j. What is the common denominator of -37/8 and n? 24 Suppose a + 3a = 32. Suppose 3q = -18 + 66. Let r = q - a. Calculate the smallest common multiple of r and 5. 40 Let v(r) = -4r. Let t(h) = -3h. Let p(l) = -3t(l) + 2v(l). Let a be p(-1). Calculate the smallest common multiple of ((-1)/1 + -2)/a and 2. 6 Let a = 150 - 219/2. Calculate the common denominator of 270/56 + (-2)/(-8) and a. 14 Let y = -186 + 413/2. Find the common denominator of 62/9 and y. 18 Find the common denominator of ((-9)/6)/((-3)/22-2) and -9/14. 14 Let l(f) = -26f3 + f2 - 1. Let p be l(-1). Let u = p + -15. What is the smallest common multiple of -1(-2 + -10 + 1) and u? 11 Suppose -2v + 5l + 73 = 0, -8l + 74 = v - 3l. Suppose -3w - 5t + v = w, 0 = -2w + 4t + 18. What is the least common multiple of w and 4? 44 Calculate the common denominator of (-1)/259/(-4) and 109/12. 24 Let m(j) = 2j3 - 17j*2 - 7j - 9. What is the smallest common multiple of m(9) and 10? 90 Let n = -4 - -7. What is the common denominator of (582/(-8))/n1 and -145/6? 12 Suppose -13h = -h - 108. What is the lowest common multiple of 6 and h? 18 Let k be -1 - (-299)/(-2 + 1). Let y = -324/4003 - -19159539/64048. Let p = y + k. Calculate the common denominator of p and -95/14. 112 Suppose c = -5t - 0c + 47, 2t - 5c - 35 = 0. Calculate the least common multiple of 14 and t. 70 Let f be 186/(-9)6/(-4). Suppose -2j - f = -5o - 10, -4j - 4o = 0. What is the common denominator of (j - 0)164/72 and -49/16? 48 Let u be 1 + 1 + (3 - -1). Calculate the smallest common multiple of 8 and (-1)/(-2)u3. 72 Suppose 3n - 10 = 8. What is the lowest common multiple of n and 22? 66 Let s be -2 + 14/2 - -3. Let t be (-1)/(-3) + (-2)/6. Suppose h - s = -th. Calculate the least common multiple of h and 5. 40 Let y = 6/749 - 2459/293608. Let x = -100151/13720 + y. What is the common denominator of x and 81/4? 20 Suppose -4o = 5b - 41, 2b - b - 5o = -15. Suppose 4u - 13 = -3r, -3u + 4r + 17 = 1. Calculate the least common multiple of u and b. 20 Let u be 4/(-22) + 26280/(-1265). Let d = 13019/506 + u. Calculate the common denominator of d and 7/6. 66 Let q be (-1)/(-2)(-168)/90. Let d = -44/65 + 1/13. Let c = d - q. Calculate the common denominator of c and -67/8. 24 Suppose 5w + 71 = -64. Find the common denominator of (-4)/(-6) - (-226)/24 and -1 + w/(-24)-6. 12 Let d(c) = c3 + 11c*2 - 2c - 15. Calculate the lowest common multiple of d(-11) and 1. 7 Suppose -4y - 4t - 35 = y, 0 = 3t. What is the least common multiple of 2 and (y - -5)/(1/(-10))? 20 Let t = 3301659 - 66052941/20. Let l = 4922/5 + t. What is the common denominator of l and -41/42? 420 Let y(c) = -16c + 1. Let m be y(-3). Calculate the common denominator of -124/(-15) - 2 and 5 + -4 + m/3. 15 Let x = -34 + 56. Calculate the least common multiple of 34 and x. 374 Let v = -74 + 112. Suppose -5n - 4k + 108 = 0, n - v + 10 = -4k. What is the least common multiple of n and 6? 60 Let m = -689 - -1353/2. Let z = -26/33 - 155/22. Calculate the common denominator of m and z. 6 Suppose 2q - p - 9 = 0, 3q - 24 = -q + 4p. Suppose 5d - 88 = -4s, 0s - qs + 2d = -66. What is the smallest common multiple of 8 and s? 88 Let h = 165 + -111. Calculate the lowest common multiple of h and 8. 216 What is the least common multiple of (2/(-3))/((-4)/18) and 11? 33 What is the common denominator of 67/6 and 80/123/24? 6 Let p = 4 - 0. Let k(l) = 3 - pl + 2 + 4l2 - 2l + l*3. Calculate the smallest common multiple of k(-5) and 12. 60 Suppose -21 = -f - 0f. What is the lowest common multiple of f and 21? 21 Let z = -1956 - -9742/5. Let s = 146/207 - -5/69. Calculate the common denominator of s and z. 45 Let t(g) = -4g + 6. Calculate the least common multiple of t(-4) and 10. 110 Let b = -22 - -32. What is the common denominator of 2/4 - 56/b and 129/(-4) + (-1)/4? 10 Let t = 625 - 1901/3. Find the common denominator of -4/9 and t. 9 Let q = -4890 + 117407/24. Find the common denominator of 89/6 and q. 24 Let j = 4/1497 - 28531/32934. Find the common denominator of j and 61/4. 44 Let c = -5 + 3. Let o = c - -6. Calculate the smallest common multiple of o and 20. 20 Suppose -4v = -45 + 1. Calculate the least common multiple of v and 3. 33 Let k = 2313915/52921 - -16/4811. Let j = k + -43. Let y = -123/68 - -290/17. Calculate the common denominator of j and y. 44 Let u(r) = -6r - 5r - 5 + 1. Let o be u(-5). Find the common denominator of o/(-60) + (-1)/(-1) and -87/4. 20 Suppose 14 = -4*h + 30. What is the least comm	{ "pile_set_name": "DM Mathematics" }
igit of 171291? 9 What is the units digit of 1454350? 0 What is the tens digit of 175210? 1 What is the hundred thousands digit of 1976415? 9 What is the hundreds digit of 3126459? 4 What is the hundreds digit of 279730? 7 What is the hundreds digit of 9709265? 2 What is the units digit of 3225162? 2 What is the ten thousands digit of 3829081? 2 What is the millions digit of 6019200? 6 What is the units digit of 18609859? 9 What is the thousands digit of 13625291? 5 What is the ten thousands digit of 946787? 4 What is the ten thousands digit of 254794? 5 What is the millions digit of 13740152? 3 What is the units digit of 2345180? 0 What is the tens digit of 608361? 6 What is the thousands digit of 3177535? 7 What is the tens digit of 124535? 3 What is the thousands digit of 168300? 8 What is the tens digit of 1948865? 6 What is the units digit of 92329? 9 What is the ten thousands digit of 8113305? 1 What is the units digit of 4502? 2 What is the ten thousands digit of 1360294? 6 What is the units digit of 21240418? 8 What is the ten thousands digit of 13420260? 2 What is the thousands digit of 222272? 2 What is the units digit of 232930? 0 What is the tens digit of 187043? 4 What is the ten thousands digit of 1243317? 4 What is the thousands digit of 1990504? 0 What is the hundreds digit of 1477570? 5 What is the tens digit of 110724? 2 What is the tens digit of 4099318? 1 What is the hundreds digit of 9616350? 3 What is the millions digit of 4964499? 4 What is the ten thousands digit of 1025015? 2 What is the tens digit of 3821839? 3 What is the ten thousands digit of 63618? 6 What is the hundreds digit of 61457? 4 What is the ten thousands digit of 27303? 2 What is the hundreds digit of 1419759? 7 What is the hundreds digit of 360250? 2 What is the units digit of 558849? 9 What is the tens digit of 183846? 4 What is the ten thousands digit of 19581611? 8 What is the ten thousands digit of 16269335? 6 What is the thousands digit of 414895? 4 What is the tens digit of 118727? 2 What is the hundreds digit of 6746259? 2 What is the tens digit of 467805? 0 What is the units digit of 509859? 9 What is the hundreds digit of 359675? 6 What is the thousands digit of 12135150? 5 What is the hundred thousands digit of 9407665? 4 What is the hundreds digit of 46052? 0 What is the millions digit of 12540338? 2 What is the tens digit of 1114789? 8 What is the units digit of 210538? 8 What is the units digit of 4743717? 7 What is the ten millions digit of 33450176? 3 What is the tens digit of 3908584? 8 What is the tens digit of 121171? 7 What is the millions digit of 2271666? 2 What is the ten millions digit of 30022160? 3 What is the hundreds digit of 6687528? 5 What is the millions digit of 4548210? 4 What is the millions digit of 8664079? 8 What is the ten millions digit of 21331526? 2 What is the hundred thousands digit of 550897? 5 What is the ten thousands digit of 4249940? 4 What is the hundreds digit of 501661? 6 What is the units digit of 1066241? 1 What is the hundred thousands digit of 2226148? 2 What is the hundreds digit of 4508? 5 What is the units digit of 3395084? 4 What is the tens digit of 417664? 6 What is the hundred thousands digit of 376698? 3 What is the tens digit of 5012137? 3 What is the hundred thousands digit of 1953726? 9 What is the ten thousands digit of 1038791? 3 What is the millions digit of 1747397? 1 What is the millions digit of 8623268? 8 What is the hundreds digit of 38707700? 7 What is the millions digit of 10699075? 0 What is the units digit of 2913990? 0 What is the hundred thousands digit of 617832? 6 What is the thousands digit of 1139401? 9 What is the units digit of 1042173? 3 What is the units digit of 671269? 9 What is the ten thousands digit of 346124? 4 What is the millions digit of 22321624? 2 What is the tens digit of 20215? 1 What is the thousands digit of 43802? 3 What is the hundreds digit of 7051995? 9 What is the tens digit of 1972? 7 What is the millions digit of 2289502? 2 What is the ten thousands digit of 815256? 1 What is the thousands digit of 876812? 6 What is the millions digit of 4210387? 4 What is the hundred thousands digit of 5209185? 2 What is the tens digit of 772178? 7 What is the hundred thousands digit of 192158? 1 What is the ten thousands digit of 226230? 2 What is the hundred thousands digit of 8335657? 3 What is the units digit of 14657360? 0 What is the tens digit of 2381489? 8 What is the ten thousands digit of 5995674? 9 What is the hundred thousands digit of 2382825? 3 What is the hundred thousands digit of 1569843? 5 What is the ten thousands digit of 316384? 1 What is the ten thousands digit of 6696075? 9 What is the hundred thousands digit of 16552244? 5 What is the tens digit of 290516? 1 What is the ten thousands digit of 220952? 2 What is the thousands digit of 597534? 7 What is the hundreds digit of 481429? 4 What is the tens digit of 2371962? 6 What is the tens digit of 41885607? 0 What is the hundreds digit of 165716? 7 What is the thousands digit of 241137? 1 What is the thousands digit of 63581? 3 What is the hundred thousands digit of 745791? 7 What is the thousands digit of 541695? 1 What is the tens digit of 195594? 9 What is the thousands digit of 511287? 1 What is the ten thousands digit of 5956506? 5 What is the ten thousands digit of 6506641? 0 What is the units digit of 1726297? 7 What is the hundreds digit of 7881325? 3 What is the hundred thousands digit of 896626? 8 What is the units digit of 147728? 8 What is the units digit of 81147? 7 What is the millions digit of 30810221? 0 What is the hundreds digit of 606263? 2 What is the tens digit of 4758572? 7 What is the ten thousands digit of 77615? 7 What is the units digit of 11334444? 4 What is the hundred thousands digit of 7728578? 7 What is the hundreds digit of 642175? 1 What is the ten thousands digit of 4337973? 3 What is the tens digit of 238152? 5 What is the hundreds digit of 292020? 0 What is the thousands digit of 895235? 5 What is the millions digit of 1424227? 1 What is the hundreds digit of 674688? 6 What is the ten thousands digit of 23549647? 4 What is the thousands digit of 1120855? 0 What is the hundred thousands digit of 3257036? 2 What is the thousands digit of 70255? 0 What is the hundreds digit of 165080? 0 What is the units digit of 935419? 9 What is the tens digit of 723340? 4 What is the units digit of 407323? 3 What is the ten thousands digit of 7611373? 1 What is the units digit of 90770? 0 What is the ten thousands digit of 81057? 8 What is the thousands digit of 4323586? 3 What is the hundreds digit of 172257? 2 What is the hundreds digit of 4295524? 5 What is the hundred thousands digit of 1036944? 0 What is the hundred thousands digit of 18740252? 7 What is the tens digit of 979647? 4 What is the thousands digit of 765340? 5 What is the units digit of 1300958? 8 What is the units digit of 257524? 4 What is the hundred thousands digit of 2720310? 7 What is the thousands digit of 1569997? 9 What is the units digit of 19592? 2 What is the ten thousands digit of 89573? 8 What is the hundred thousands digit of 9152946? 1 What is the hundred thousands digit of 4524022? 5 What is the tens digit of 3403621? 2 What is the hundreds digit of 18603670? 6 What is the units digit of 292867? 7 What is the hundreds digit of 274413? 4 What is the hundred thousands digit of 681622? 6 What is the tens digit of 2105195? 9 What is the millions digit of 7522071? 7 What is the hundreds digit of 41388? 3 What is the units digit of 663218? 8 What is the ten millions digit of 11505636? 1 What is the units digit of 1913197? 7 What is the hundreds digit of 357871? 8 What is the tens digit of 1045972? 7 What is the tens digit of 19891514? 1 What is the hundred thousands digit of 2993026? 9 What is the thousands digit of 7913370? 3 What is the millions digit of 36770120? 6 What is the millions digit of 7793566? 7 What is the tens digit of 144659? 5 What is the units digit of 544634? 4 What is the millions digit of 1792222? 1 What is the ten thousands digit of 73333? 7 What is the thousands digit of 793679? 3 What is the thousands digit of 25281085? 1 What is the hundreds digit of 231055? 0 What i	{ "pile_set_name": "DM Mathematics" }
ate the greatest common factor of 15 and c. 3 Let f = 137 + -98. What is the greatest common divisor of f and 26? 13 Let p = -125 - -244. What is the greatest common factor of 17 and p? 17 Suppose -3h - 3f = h - 129, -3h = 5f - 105. What is the highest common factor of h and 3? 3 Suppose 0 = -3x + 7 - 1. Suppose -4m + 2p = 6 - 272, 0 = -xm + 3p + 143. Let z be (m/(-20))/(1/(-10)). Calculate the greatest common divisor of z and 4. 4 Suppose 30 = 5l - 0. Suppose lh = 4h + 26. What is the highest common divisor of h and 117? 13 Let i = 95 - 55. Calculate the greatest common divisor of 16 and i. 8 Suppose 0 = 4a - 3r - 215, 3a - 4a + r = -55. Calculate the highest common divisor of a and 20. 10 Let b(a) = a*2 - 7a - 2. Let c be b(-7). Suppose -2r = -5l + 56, l - 5r - 2 = -0l. Calculate the highest common factor of c and l. 12 Let t = 4 + 12. Let o(b) = -b*2 - b + 16. Let f be o(0). Calculate the highest common factor of t and f. 16 Suppose -10 = -3v - 4y + 35, 3v = 3y + 45. Let n be ((-6)/(-7))/((-1)/(-7)1). Calculate the greatest common divisor of v and n. 3 Let l be 4/(-16) + 42/8. Suppose -lu = -1497 + 217. Let z = -144 + u. Calculate the highest common divisor of 14 and z. 14 Let o be (2 + -1)-10. Suppose -d + 3 + o = 0. Suppose v + 7 = -dl, 5v = -4l - l + 15. What is the greatest common factor of v and 16? 8 Suppose x = -n - 3x - 17, -3x = 3n + 6. Suppose -21 = -nw - 3. Let y = -24 + 54. Calculate the greatest common divisor of y and w. 6 Let s(r) = 2r2 - 3. Let q be s(-5). What is the greatest common divisor of 282 and q? 47 Suppose -5i + 4z + 125 = -40, -4i + 132 = -3z. What is the greatest common factor of i and 297? 33 Let h(u) = -31u*2 - 9u + 23. Let s(p) = 15p2 + 4p - 11. Let r(a) = 6h(a) + 13s(a). Let t be r(3). What is the highest common factor of 28 and t? 14 Let l = 7 - 5. Let g be 0 - (-21)/6l. Calculate the greatest common divisor of g and 77. 7 Let b be (9/(-2))/(1/2). Suppose 5x = 4j - 116, 0 = -j - 5x + 2x + 12. Let y = j + b. What is the greatest common factor of y and 3? 3 Let j(s) = 45s + 2. Let g be j(2). Let a = g + -28. Let i = -12 - -20. Calculate the greatest common factor of i and a. 8 Let z(s) = s*3 - 18s*2 - s + 26. Let i be z(18). What is the highest common factor of 6 and i? 2 Let f be 2/6(-8 + 20). Suppose 2m = 2 - 12, 0 = -5w - 4m - 20. Suppose 0 = 4l - wl - 16. Calculate the highest common divisor of l and f. 4 Suppose -2m + 5m + 25 = -4c, -4c + 80 = -4m. Let y = -11 - m. Suppose 80 = 4b - yg, -3b + g = -11 - 51. What is the highest common factor of b and 42? 21 Suppose 0 = s + 3n + 12, 0s - 5n - 22 = s. Let z be 23/s - (-8)/(-12). Calculate the greatest common factor of 7 and z. 7 Let a(b) = 3b2 + 3b - 5. Let j be a(4). Calculate the greatest common factor of 11 and j. 11 Suppose 3d - 17 - 16 = -2l, 5l = 15. What is the greatest common factor of d and 6? 3 Let s = -29 + 69. Let x(u) = 3u - 5. Let k be x(5). Calculate the greatest common factor of k and s. 10 Suppose -3g = -2d - 57, 49 = 4g - 2g - 5d. Let l(a) = -16a*3 - 3a*2 - 2a - 1. Let i be l(-2). Calculate the greatest common factor of i and g. 17 Let b be (-2)/(-9) + 1069/9. Suppose -235 = -6r + r. Let d = r - 30. Calculate the greatest common factor of d and b. 17 Let a be -2((-135)/(-6))/(-5). What is the greatest common divisor of 63 and a? 9 Suppose 0l - 2l - 5x = -35, -3l - x = -46. What is the greatest common factor of 5 and l? 5 Let w = -87 - -129. Suppose 3a + 2r - 19 = 0, -4r + 6r - 4 = 0. Suppose -ay + 56 = -y. Calculate the highest common divisor of w and y. 14 Let u(i) = i3 + i2 - 4i + 4. Let b be u(3). Suppose 2o - 3x - b = 0, -4o = -x - 0x - 76. What is the greatest common factor of o and 8? 4 Suppose 6 = 2k + k, 5q - 342 = 4k. Calculate the highest common factor of q and 7. 7 Suppose 0 = -4q - 6q + 90. Calculate the greatest common divisor of 6 and q. 3 Let b = 52 + 102. Let a be 113 - (-1 - 0). What is the highest common divisor of b and a? 14 Let n be (-27 - 0)/(-3)1. Calculate the highest common divisor of n and 9. 9 Suppose 0 = -0m + m - 96. What is the highest common factor of m and 12? 12 Suppose -s = 0, -2w + 4s - 4 = -4w. Suppose 0 = -wt - 1 + 9. Calculate the greatest common factor of 28 and t. 4 Let g be 6/(-4)(3 - 5). Let i be g/(18/70)3. Suppose -b = -9 + 4. What is the greatest common divisor of b and i? 5 Suppose 3o - 2v + 21 = v, -o = 2v + 16. Let c(m) = -5m - 1. Let j be c(o). What is the greatest common factor of j and 7? 7 Let n(y) = -y*2 - 14y + 4. Let h be n(-8). Suppose -8x + h = -4x. What is the greatest common divisor of x and 39? 13 Suppose 32 + 28 = 6o. What is the greatest common factor of 90 and o? 10 Let g = -14 + 16. Suppose t + 0k + gk - 30 = 0, -5k + 87 = 3t. Calculate the greatest common factor of 24 and t. 24 Let o(v) = 30 - v - 31 + v2 + 0v2. Let d be o(5). Calculate the highest common factor of 171 and d. 19 Let f = 110 + -59. Let p(u) = u3 - 6u2 - 3u + 6. Let j be p(7). What is the greatest common factor of j and f? 17 Let i(o) = o*2 - o - 9. Let l be i(-3). Calculate the highest common divisor of 9 and l. 3 Let v(f) = -1. Let d(t) = -t - 13. Let c(r) = -d(r) + 5v(r). Let g be c(0). What is the highest common divisor of g and 40? 8 Let z = -28 - -118. Calculate the greatest common factor of z and 10. 10 Suppose -j = -102 + 11. What is the greatest common factor of 39 and j? 13 Suppose 0 = -22s + 18s + 16. Calculate the highest common factor of 2 and s. 2 Let t be 8/1 + 2 + -5. What is the highest common divisor of t and 35? 5 Suppose -3r + 2t + 140 = 0, 5t - 135 = -2r - 29. What is the greatest common factor of 6 and r? 6 Let w(j) = j*3 - 4j*2 - 5j - 4. Let g be (-3 - 39/(-6))2. Let a be w(g). What is the highest common divisor of 12 and a? 12 Suppose 0 = -5l - 11 - 14, 5l - 105 = -5q. Let v(b) = -110b - 12. Let r be v(-2). What is the highest common divisor of q and r? 26 Suppose -4g + 0g = -16. Let o be 3/(-12) + 161/g. Let p(h) = 11h - 1. Let f be p(1). What is the greatest common factor of o and f? 10 Let c be 4/((-8)/6) - -103. Suppose c = -t + 6t. What is the greatest common divisor of t and 10? 10 Let q be 0/(-2) + (88 - 10). Let o = -42 + q. Calculate the greatest common factor of o and 18. 18 Suppose d = -3g - 4, -3g = -4d + 6d + 8. Suppose -3o + 4j + 33 = 5, g = 3o + 3j - 21. What is the highest common divisor of o and 56? 8 Let c = 0 - -9. Let q = -2 + c. What is the highest common divisor of q and 1? 1 Suppose 34 = 2x - 5j, 2x + 4j - 15 - 1 = 0. Let h be (114/x)/(1/22). What is the greatest common factor of h and 19? 19 Let t(o) be the third derivative of 1/24o*4 + 3o*2 + 1/3o*3 + 0o + 0. Let k be t(3). Calculate the greatest common factor of k and 10. 5 Suppose -5s + 0 + 5 = -5y, 0 = -4y - s + 1. Suppose y = v - 8 - 4. Calculate the greatest common divisor of v and 24. 12 Suppose -3 = -i + 2. Suppose -ig = -4g - 99. What is the greatest common divisor of g and 9? 9 Let j(l) = -2l*3 - 3l*2 + 1. Let a be j(-3). What is the highest common divisor of 308 and a? 28 Suppose -4n = 4, 3n - 37 = 4v - 6v. Calculate the greatest common divisor of 100 and v. 20 Let h = 103 + -83. Calculate the highest common factor of 220 and h. 20 Let m be ((-8)/(-6))/((-6)/(-27)). Suppose -11k + mk + 345 = 0. Calculate the highest common divisor of k and 23. 23 Let w(q) = -q2 - 7q + 1. Let y be w(-6). Suppose -ys = -9s + 12. What is the greatest common divisor of s and 48? 6 Suppose -2z + 66 = -14. What is the greatest common divisor of z and 60? 20 Let o(w) = 5w + 58. Let m be o(-9). Calculate the greatest common divisor of 104 and m. 13 Let h = -1 + 5. Suppose -5d - 3z = -10, 3d = d + hz + 30. Suppose -3s + dt = 4, 0 = -3s - t + 3 + 5. What is the highest common divisor of 8 and s? 2 Suppose 5h + 21 = 111. What is the highest common divisor of 45 and h? 9 Suppose 0 = 4k - 12. Let b be ((2 + -2)/k)/1. Suppose b = -y - y + 60. Calculate the highest common factor of 6 and y. 6 Let i(j) = 3j*2 - 3j - 2. Let g be i(-1). Calculate the greatest common factor of 26 and g. 2 Suppose -3d + 2a -	{ "pile_set_name": "DM Mathematics" }
when two letters picked without replacement from {l: 5, z: 2, e: 2, g: 2, x: 1, j: 1}. 5/78 Two letters picked without replacement from {y: 1, c: 2, i: 1, g: 2}. What is prob of sequence gy? 1/15 Three letters picked without replacement from {d: 4, f: 1, l: 12, u: 3}. Give prob of sequence dfd. 1/570 Four letters picked without replacement from dqqmqqqmqmuumlddq. Give prob of sequence dulu. 1/9520 Three letters picked without replacement from ssssssssssscssssss. Give prob of sequence sss. 5/6 Four letters picked without replacement from bwuvuwhs. Give prob of sequence subw. 1/420 Calculate prob of sequence ssr when three letters picked without replacement from {r: 2, z: 2, s: 9}. 12/143 Two letters picked without replacement from blalabjowwbl. What is prob of sequence jw? 1/66 Calculate prob of sequence xw when two letters picked without replacement from twuowluuutwux. 1/52 Calculate prob of sequence qq when two letters picked without replacement from kkqyqyqkqqqkqqkeqqq. 55/171 Two letters picked without replacement from {k: 6, c: 2, r: 1, n: 3, p: 1, o: 2}. What is prob of sequence pc? 1/105 Four letters picked without replacement from {p: 2, a: 6}. What is prob of sequence apap? 1/28 Three letters picked without replacement from {u: 2, p: 2, c: 4}. Give prob of sequence cpu. 1/21 What is prob of sequence ooo when three letters picked without replacement from oqoooq? 1/5 Calculate prob of sequence wwi when three letters picked without replacement from {w: 6, g: 4, i: 4}. 5/91 Three letters picked without replacement from phphyvyvyhyhpv. What is prob of sequence hyy? 2/91 Calculate prob of sequence yyfn when four letters picked without replacement from nyyfryywwf. 1/210 Calculate prob of sequence hy when two letters picked without replacement from bbyhbjhyb. 1/18 What is prob of sequence qrj when three letters picked without replacement from {q: 1, c: 1, a: 1, r: 1, j: 3}? 1/70 Calculate prob of sequence yyuy when four letters picked without replacement from uuuyuyy. 1/35 Four letters picked without replacement from wwwwwqwqwqwqwa. What is prob of sequence awqq? 9/2002 Two letters picked without replacement from {s: 2, e: 2, z: 8, j: 5}. Give prob of sequence je. 5/136 Calculate prob of sequence gos when three letters picked without replacement from gzzzsszgguozj. 1/286 Two letters picked without replacement from {p: 3, n: 8}. What is prob of sequence pp? 3/55 Calculate prob of sequence xxp when three letters picked without replacement from ropoxxx. 1/35 Two letters picked without replacement from {v: 1, b: 1, q: 7, j: 2, i: 1, p: 2}. What is prob of sequence bp? 1/91 Calculate prob of sequence plt when three letters picked without replacement from {p: 2, x: 2, l: 1, t: 1}. 1/60 Two letters picked without replacement from kznmwxzw. What is prob of sequence xm? 1/56 Three letters picked without replacement from jjjjjjjtjdjddddjjdjd. What is prob of sequence dtj? 7/570 What is prob of sequence bb when two letters picked without replacement from bnnnnjnbbnbnnnnbn? 5/68 Two letters picked without replacement from vlblpnd. Give prob of sequence pn. 1/42 Three letters picked without replacement from kkwkswkkkwwsskkrwkw. What is prob of sequence kkr? 4/323 Three letters picked without replacement from {x: 4}. Give prob of sequence xxx. 1 Calculate prob of sequence rg when two letters picked without replacement from {r: 4, a: 1, g: 1, e: 2, s: 2}. 2/45 Calculate prob of sequence hhhh when four letters picked without replacement from {h: 9, m: 3}. 14/55 Calculate prob of sequence yttu when four letters picked without replacement from ussutuussutuuy. 1/1716 Three letters picked without replacement from {l: 1, q: 6, c: 2, h: 2}. Give prob of sequence qlh. 2/165 Calculate prob of sequence ds when two letters picked without replacement from kgkdkkkggggsgggkgsk. 1/171 Four letters picked without replacement from {v: 3, k: 2, y: 4, b: 1, r: 2, l: 2}. What is prob of sequence vvvk? 1/2002 Four letters picked without replacement from pwowoppwwwjw. Give prob of sequence jwow. 1/198 What is prob of sequence kaf when three letters picked without replacement from kkkakkkfk? 1/72 Calculate prob of sequence yd when two letters picked without replacement from {m: 7, d: 10, y: 1, t: 1}. 5/171 What is prob of sequence ubu when three letters picked without replacement from {b: 2, u: 2}? 1/6 Three letters picked without replacement from ddkkxdxkdlddxk. Give prob of sequence xdk. 3/91 Calculate prob of sequence yv when two letters picked without replacement from {y: 1, v: 2, q: 1, s: 2, h: 1}. 1/21 Two letters picked without replacement from {l: 4, q: 2, y: 3, c: 1, t: 2}. Give prob of sequence tq. 1/33 Two letters picked without replacement from {r: 5, p: 14}. What is prob of sequence pr? 35/171 Calculate prob of sequence gbg when three letters picked without replacement from {v: 2, u: 1, c: 2, b: 1, g: 2}. 1/168 Two letters picked without replacement from {a: 2, c: 3, i: 9, h: 2}. Give prob of sequence ci. 9/80 What is prob of sequence rg when two letters picked without replacement from gggggggggrggrggrgggg? 51/380 Four letters picked without replacement from {g: 1, f: 2, b: 1, q: 1}. Give prob of sequence gqqg. 0 What is prob of sequence imfi when four letters picked without replacement from {m: 2, k: 3, i: 2, f: 3, e: 1, v: 1}? 1/990 Two letters picked without replacement from pfpfffp. Give prob of sequence fp. 2/7 Calculate prob of sequence lx when two letters picked without replacement from xlxlll. 4/15 Two letters picked without replacement from aeaaenqabbyaaa. Give prob of sequence bb. 1/91 Four letters picked without replacement from nnccnncfnncfnn. Give prob of sequence fncn. 8/429 What is prob of sequence wtww when four letters picked without replacement from {w: 10, t: 9}? 45/646 What is prob of sequence kkb when three letters picked without replacement from kkkkkbkkkkbb? 9/55 Three letters picked without replacement from {y: 4, f: 1, z: 3, k: 1, g: 2}. Give prob of sequence kzy. 2/165 Calculate prob of sequence yxy when three letters picked without replacement from yyyyyxx. 4/21 What is prob of sequence ddss when four letters picked without replacement from uszsdszddse? 1/110 Calculate prob of sequence ss when two letters picked without replacement from gffggfss. 1/28 Two letters picked without replacement from {a: 1, o: 2, c: 1, l: 1}. What is prob of sequence oa? 1/10 Four letters picked without replacement from {s: 9, f: 7}. Give prob of sequence ffsf. 9/208 Two letters picked without replacement from {m: 4, d: 16}. Give prob of sequence dm. 16/95 Two letters picked without replacement from etuuuuuqeeqeqwqtuu. Give prob of sequence wu. 7/306 Calculate prob of sequence ccln when four letters picked without replacement from {w: 6, n: 1, l: 4, c: 4}. 2/1365 Calculate prob of sequence cc when two letters picked without replacement from {u: 13, d: 2, c: 3}. 1/51 Calculate prob of sequence xy when two letters picked without replacement from {r: 1, y: 1, g: 1, t: 1, x: 1, d: 2}. 1/42 What is prob of sequence jrj when three letters picked without replacement from {y: 1, t: 2, r: 4, z: 1, j: 4, c: 2}? 2/91 Two letters picked without replacement from kxbxarrjkaxkkarxkaba. Give prob of sequence rr. 3/190 Calculate prob of sequence jbv when three letters picked without replacement from jrblvjvr. 1/84 Two letters picked without replacement from qqkqqqqqdqkkjkq. What is prob of sequence qq? 12/35 What is prob of sequence sb when two letters picked without replacement from {p: 1, b: 2, o: 1, i: 4, s: 1}? 1/36 Three letters picked without replacement from bqbfd. Give prob of sequence dqb. 1/30 Three letters picked without replacement from bbaaxttptbpl. Give prob of sequence att. 1/110 Calculate prob of sequence nin when three letters picked without replacement from {n: 4, i: 15}. 10/323 Two letters picked without replacement from nnicnncin. What is prob of sequence cc? 1/36 Two letters picked without replacement from pppppppplpppp. Give prob of sequence lp. 1/13 Two letters picked without replacement from cccohujccjjscjjoccuh. Give prob of sequence sc. 2/95 What is prob of sequence tt when two letters picked without replacement from teeeeeeeeeet? 1/66 What is prob o	{ "pile_set_name": "DM Mathematics" }
of 1292 and 33492193. 323 Calculate the highest common factor of 282 and 2510682. 6 What is the greatest common factor of 38798 and 59546? 38 Calculate the greatest common factor of 8946 and 102627. 63 What is the highest common factor of 1830 and 20382357? 183 Calculate the greatest common factor of 11039 and 4468135. 133 Calculate the highest common factor of 1321106 and 3149. 67 What is the highest common divisor of 102 and 10143866? 34 What is the highest common divisor of 2622 and 4545789? 69 Calculate the greatest common factor of 725694 and 35550. 474 Calculate the greatest common divisor of 4802098 and 8854. 38 What is the highest common divisor of 51066612 and 4552? 2276 What is the highest common divisor of 7426 and 56337349? 3713 What is the greatest common divisor of 3012 and 176451243? 753 What is the greatest common divisor of 60 and 119058? 6 Calculate the highest common divisor of 22842379 and 147. 49 What is the highest common divisor of 2679848 and 41048? 5864 Calculate the highest common factor of 1353351 and 3249. 57 What is the greatest common factor of 520005 and 57? 3 What is the highest common divisor of 1001 and 2569385? 91 Calculate the highest common factor of 19027 and 6290941. 53 Calculate the greatest common factor of 24 and 354884. 4 What is the highest common divisor of 42208 and 704? 32 Calculate the highest common divisor of 3950 and 344120050. 3950 Calculate the highest common factor of 1041966 and 60642. 18 Calculate the highest common divisor of 26 and 1028344798. 26 Calculate the highest common divisor of 77303 and 2796352. 3361 What is the greatest common factor of 406814 and 2354? 214 Calculate the greatest common factor of 7294 and 1295014. 14 Calculate the greatest common factor of 616477840 and 436. 436 Calculate the highest common factor of 440 and 182505576. 88 Calculate the greatest common divisor of 18003 and 2892618. 51 What is the highest common divisor of 21121902 and 378? 18 What is the greatest common factor of 209 and 39204391? 19 Calculate the highest common factor of 380380 and 152893. 247 What is the greatest common factor of 8668 and 199446740? 788 What is the highest common factor of 7 and 16363151? 7 Calculate the greatest common divisor of 5 and 1591685. 5 What is the greatest common factor of 3640 and 8436792? 728 Calculate the highest common factor of 128691407 and 12415. 2483 What is the highest common factor of 128635 and 380? 5 What is the highest common factor of 86 and 86069746? 86 Calculate the highest common factor of 976813491 and 3309. 3309 Calculate the highest common factor of 1120 and 20739040. 1120 Calculate the highest common factor of 518540 and 275. 55 Calculate the greatest common divisor of 42 and 20466894. 42 Calculate the greatest common factor of 21604314 and 782. 782 What is the highest common divisor of 16598 and 14018? 86 What is the greatest common divisor of 78202 and 16008334? 1282 What is the greatest common divisor of 5179785 and 477345? 3945 Calculate the greatest common factor of 19 and 6532059191. 19 Calculate the highest common divisor of 534910 and 155. 5 What is the highest common factor of 3709282 and 19468? 314 What is the greatest common divisor of 7929 and 118206? 9 Calculate the highest common factor of 6 and 2567169. 3 Calculate the highest common divisor of 100188673 and 26. 13 What is the greatest common factor of 5325931382 and 874? 874 Calculate the greatest common factor of 4947 and 142118289. 291 Calculate the greatest common factor of 42 and 29372896. 14 Calculate the highest common divisor of 14004 and 52956. 36 Calculate the highest common divisor of 71761944 and 1149. 1149 Calculate the highest common divisor of 4263 and 1136800. 1421 What is the highest common divisor of 389340 and 29700? 540 Calculate the highest common divisor of 622300837 and 292. 73 Calculate the highest common factor of 146009625 and 6. 3 What is the highest common divisor of 12 and 400035? 3 What is the highest common factor of 212 and 41048129? 53 Calculate the highest common factor of 1415 and 22296155. 1415 Calculate the greatest common divisor of 14 and 184802639. 7 What is the greatest common divisor of 1968 and 11257616? 656 What is the greatest common factor of 5804 and 5370151? 1451 Calculate the greatest common divisor of 1142029031 and 143. 143 What is the greatest common divisor of 1529990836 and 176? 44 What is the greatest common factor of 654 and 18937442? 218 Calculate the greatest common factor of 10 and 323887750. 10 Calculate the greatest common factor of 804 and 14876412. 804 What is the highest common factor of 5061807 and 17127? 1557 What is the highest common factor of 329443668 and 18? 18 What is the greatest common factor of 11840 and 298608? 16 What is the greatest common divisor of 28902146 and 182? 182 Calculate the greatest common divisor of 12 and 234434796. 12 Calculate the highest common divisor of 2 and 194156234. 2 What is the greatest common divisor of 30582558 and 17? 17 Calculate the greatest common divisor of 2382363918 and 1089. 1089 Calculate the greatest common divisor of 12 and 175983. 3 Calculate the highest common factor of 108676 and 2918900. 404 What is the greatest common divisor of 2466205 and 34720? 1085 What is the greatest common divisor of 22885 and 18845? 5 What is the highest common factor of 866630 and 456620? 790 What is the greatest common divisor of 2085 and 24666245? 695 What is the greatest common divisor of 2145561 and 34207? 79 Calculate the greatest common factor of 1570863 and 2793. 399 Calculate the greatest common divisor of 196150 and 4225. 25 What is the highest common factor of 39 and 51566918? 13 Calculate the greatest common factor of 519622 and 1023468. 986 Calculate the greatest common divisor of 62 and 1237706. 62 What is the greatest common factor of 1704 and 1527068? 284 Calculate the greatest common divisor of 11963144 and 536. 8 What is the highest common divisor of 2045537 and 2119? 13 Calculate the greatest common factor of 123 and 9617739. 123 Calculate the greatest common factor of 4983841039 and 6473. 6473 What is the highest common factor of 5408924 and 4913? 289 Calculate the highest common divisor of 120401502 and 65. 13 Calculate the highest common divisor of 247 and 123063551. 247 Calculate the greatest common factor of 5796 and 617688. 828 What is the greatest common factor of 122650 and 13850? 50 Calculate the greatest common divisor of 125 and 2299235. 5 Calculate the greatest common factor of 25433595 and 93555. 13365 Calculate the highest common divisor of 1726 and 562802861. 863 What is the highest common divisor of 771 and 33268393? 257 What is the highest common divisor of 57482791 and 293? 293 What is the highest common divisor of 45600 and 29775? 75 What is the highest common divisor of 4050 and 30171150? 1350 What is the greatest common divisor of 51 and 67918944? 51 Calculate the greatest common factor of 37 and 38945571. 37 What is the greatest common factor of 35016670 and 145080? 4030 Calculate the greatest common divisor of 147919260 and 110. 10 What is the greatest common divisor of 217184292 and 468? 468 What is the highest common factor of 80 and 89722096? 16 Calculate the greatest common factor of 79007 and 7661. 47 What is the highest common factor of 500256 and 14058? 18 What is the greatest common factor of 146294486 and 238? 34 What is the highest common factor of 1944 and 11567286? 486 Calculate the greatest common factor of 2502 and 3505752. 18 What is the greatest common divisor of 357882 and 1890? 42 Calculate the greatest common divisor of 756 and 47766796. 28 What is the greatest common factor of 6670 and 1400010? 230 What is the greatest common divisor of 235 and 1071788? 47 Calculate the highest common factor of 18 and 910935. 9 What is the highest common divisor of 1776 and 6466284? 12 What is the highest common divisor of 91020 and 35520? 2220 What is the highest common factor of 22962 and 17649234? 534 Calculate the highest common divisor of 2422121 and 221. 13 Calculate the greatest common divisor of 42031589 and 2707. 2707 What is the highest common factor of 23 and 538776472? 23 What is the highest common factor of 48886500 and 30	{ "pile_set_name": "DM Mathematics" }
+ xj2 + lj*4 + qj*3 and give h. 2 Rearrange (-u - u + 0u)(-2u + 168 - 168) to the form ku + s + yu*2 and give y. 4 Express (-5i2 + i2 + i*2)(i - 2i - i)(-39 + 0 + 17) in the form mi + ni*3 + pi*2 + g and give n. -132 Express (0w - 3w + w)(w2 + w2 + 0w2 - 1)(-9w - w - 2w) as jw3 + iw*2 + tw + l + dw4 and give i. -24 Express 33h - 80 + 80 in the form sh + m and give s. 33 Express 15l*2 - 11l*2 + 4l*3 - 2l*3 + (l - 2l - l)(2l*2 - 4l*2 + 0l*2) in the form al*3 + il + pl2 + c and give a. 6 Express (0u*2 + 0u*2 + 2u*3)(47u - 18u + 48u) as gu*4 + c + mu + qu2 + vu*3 and give g. 154 Rearrange 5t2 + t3 + t*3 + 8t*2 to the form ut*2 + st + mt3 + k and give u. 13 Express (4v*2 - 3v*2 - 2v*2)(-2 + 6 + 7)(-4v + 5 - 5) in the form fv + jv*3 + y + zv*2 and give j. 44 Rearrange (3s*2 - 4s*2 + 0s*2)((3 - 2 - 2)(5 - 5 - s) - 3 + 3 + 2s) to the form fs2 + ts + is3 + a and give i. -3 Rearrange -2c2 + c3 + 0c3 + 11 - 3 to the form g + lc*3 + jc + nc2 and give g. 8 Express 13z*3 + 2 - 7z*3 - 7z*3 + z + 0z as b + rz3 + xz*2 + iz and give i. 1 Rearrange -4a4 + 4a*4 - 3a*4 + (-2a + a + 2a)(a*3 + 2a - 2a) + 1 - 2 + 0a*4 + 4a*4 to n + ka*4 + ja + wa3 + ca*2 and give w. 0 Express -2o*2 - 5 - 2o*2 + 4o*2 - 3o*3 as vo*2 + to*3 + i + qo and give t. -3 Express (-1 + 2 - 2)(-15 - n + 15) in the form ln + s and give l. 1 Rearrange s3 - 6 - s2 - 2s2 + s2 to the form l + gs*3 + ps*2 + ns and give p. -2 Express (0s4 + 0s*4 + 4s*4)(-62 - 103 + 89) in the form fs4 + as*2 + w + ps + xs3 and give p. 0 Express -p2 + p4 + 5p - 10p3 - 6p*3 + 16p*3 in the form z + gp*3 + op + jp2 + rp*4 and give r. 1 Rearrange 10a*2 + 17a*2 - 11a*2 + (a + 0a - 4a)(-2 + 3 - 2)(-2 + 1 - 1)(0a + a + 0a) to the form ia + l + ja*2 and give j. 10 Rearrange 2l*2 - 1 - 2l + 0 - l2 + l4 + l*2 - 5l*3 to the form xl*3 + tl + c + rl2 + jl*4 and give r. 2 Rearrange -2u - 7u + 0u to the form gu + i and give g. -9 Rearrange 21i + 7i + 250 - 250 to the form si + c and give s. 28 Express 70m - 2m*2 - 70m + 3 in the form vm2 + tm + q and give t. 0 Express (-53 + f + 107 - 52)(-2f + 1 + 0f - f) as k + hf + cf2 and give k. 2 Express -57b*2 + 0b + 68b2 + b as k + ob*2 + cb and give o. 11 Express -41 - 3b4 + 41 + (-b4 + 0b*4 + 2b*4)(-1 - 1 + 3) + (-1 - b*3 + 1)(2b - 5b - b) in the form mb3 + tb + cb4 + p + nb*2 and give c. 2 Express 122 - 69u*2 - 122 in the form tu + w + hu2 and give h. -69 Express -10w*2 - 4w*2 - w + 0w*2 in the form d + cw + gw2 and give c. -1 Express (-3 - 2h3 + 0 + h3)(2 + 0 - 1 + (-2 + 7 - 4)(0 - 1 - 1) - 4 + 16 - 9) in the form b + yh3 + ih + lh2 and give l. 0 Rearrange (2 - 2 - 2c)(16 + 13 - 4) to the form fc + j and give f. -50 Rearrange v*3 + 12v + 2 + 0v - v2 - 3v2 + v2 to the form f + dv3 + wv + nv2 and give n. -3 Express -2s4 + s4 - 2s4 + (-11 + 4 - 3)(-3s4 - 3s*4 + 4s*4) as u + fs*4 + as + ls2 + is*3 and give f. 17 Rearrange -9236 + 26w + 9236 to d + ow and give o. 26 Rearrange (-2d*4 + 4d*4 + 2d*4 - 2d4 - d3 + d3 + (-d3 + 1 - 1)(2d - 4d + 3d))(0 - 2 - 5) to gd*3 + y + hd*4 + zd + td2 and give g. 0 Rearrange (-8x + 2x + 3x)(-4 + 4 - 1)(2 - 1 + 2)(3x - 4x + 3x) to q + tx + cx*2 and give t. 0 Rearrange (4 - 4 - x)(x - 5x + x) + (x + 4x - 4x)(-12x + 29x + 11x) to the form qx + dx2 + k and give d. 31 Rearrange -4 - 56h + 20 - 18 to the form n + jh and give j. -56 Rearrange -16f + 11f - 10f - 24f to the form w + uf and give u. -39 Rearrange -4t4 - 7 + 7 + (-t3 - 4t*3 + 4t*3)(-101 - 11t + 101) to the form zt + jt3 + mt*4 + v + wt*2 and give m. 7 Express -5s + 0s + 4s + (-2 + 54 - 1)(0 - 2s + 0) in the form t + ps and give p. -103 Rearrange 10f*2 - 6f + 13229 - 13229 to jf + kf*2 + i and give k. 10 Rearrange 2 + 14o2 + o3 - 4 + o - 15o2 to the form t + zo*3 + lo*2 + xo and give t. -2 Express 2 + 2s2 + 3s - 13s3 + 12s*3 + 0s*3 as ts*3 + ds + js2 + z and give d. 3 Rearrange -185h + 4 - h*2 + 175h - 4 to the form c + th2 + mh and give m. -10 Rearrange (49 - 80 - 66)(-3q + 0q + q) + (4 - 2 + 0)(2q + q - q) - 5q + q + 3q + 0q + q + q to the form yq + t and give t. 0 Rearrange 78v2 - 2 - v4 - 77v2 + 2v*3 - 4v + 2v to the form tv*4 + pv*2 + nv*3 + av + o and give o. -2 Rearrange 86 - 86 + 8m2 + (-2m*2 + 0m2 - m2)(3 + 0 - 1) + (-3m + 3 - 3)(-m + 4m - m) to the form f + lm + nm2 and give n. -4 Rearrange m4 - 22m3 + 23m3 + m4 - 20m to hm*2 + q + zm + jm4 + sm*3 and give z. -20 Rearrange -4f + f + f to tf + r and give r. 0 Rearrange -2g*2 + 3g2 + g3 - 1 - 4g2 - 1 + 2g to vg + og*3 + kg*2 + m and give o. 1 Rearrange (-3w + 5w + 0w)(-5 - 1 + 1)(-2 - 2 - 2) to c + jw and give c. 0 Rearrange s + 0s + s + (-11 - 11 + 0)(s + 1 - 1) - s + 4 - 4 to the form q + as and give a. -21 Rearrange 24x + 4 + 21x - 48x to the form lx + j and give j. 4 Rearrange -22h2 + 6h*2 - 34h + 14h2 to g + ah + zh2 and give a. -34 Rearrange -2y + 0y + 3y - y - 4y + 4y + (3 - 2 - 3)(-3y + 3y - 5y) + 3y + 2y - 4y to ky + g and give k. 11 Express (3v - 8v + 0v)(-2 + 2 + 2v) + (-5v + 20v + 17v)(-v + 2v - 2v) in the form kv + xv2 + r and give k. 0 Express -44h*3 - 3h*2 + 3h*2 + 2h + 40h3 in the form n + kh*3 + sh + jh2 and give k. -4 Express w + 1 - w2 - 482w*3 + 480w*3 - 6w*2 in the form aw*2 + rw + d + pw3 and give d. 1 Express d2 + d - d + (-6d + 0d - 22d)(-d + 3d - 4d) - 4d - d*2 + 4d + 2d2 - 5d2 + d2 in the form xd2 + k + vd and give x. 54 Express -3 + 2y + 6 + 33y*3 - 35y3 - y2 - y - 2y4 as hy + j + iy3 + oy*2 + ky*4 and give i. -2 Rearrange 10y - 18 + 18 to the form ty + d and give t. 10 Rearrange -124q*3 + 4q*2 + 122q*3 - q - 2q to lq + bq*3 + xq*2 + y and give x. 4 Rearrange -53d + 151d - 57d to j + zd and give z. 41 Rearrange 25h*2 - 9h*3 - 2h*4 + 1 - 25h*2 to the form dh + jh4 + qh*3 + y + th*2 and give j. -2 Rearrange -7q + 8 - 13q2 + 25q*2 - 7 - 15q*2 to c + uq*2 + aq and give c. 1 Rearrange -y*2 + 391y*3 - 2y*2 - 381y*3 to d + iy*2 + wy + hy3 and give i. -3 Express 16q*3 - 2q3 + q4 - 2 - 6q3 as j + cq + rq2 + lq*3 + aq*4 and give l. 8 Express (-2h + 0h + 2 - h)(h + 2h + h) in the form k + rh*2 + jh and give r. -12 Express (-1 + 6 + 0)(6 + 0 - 3)(6d + 0d - 2d) in the form r + wd and give w. 60 Express 30b4 + 2b*3 - b - 32b*4 - 5b*2 + 2b*2 as r + yb*2 + jb*3 + nb*4 + wb and give y. -3 Express 16 - 23 + 0k2 + 3k*2 + (4k - 5k + 3k)(-k - 5k + 4k) - k2 + 3k2 + k2 as d + nk2 + fk and give n. 2 Express (-65i + 8i*3 + 65i + (-i + 2i + i)(i*2 - 3i*2 + 0i*2))(i + i - 3i) in the form ui + pi3 + wi*2 + ai*4 + l and give a. -4 Rearrange 58b*3 - 2b*4 - 1 - 60b3 + b2 + 2 + b*2 to qb + t + mb3 + lb*2 + ib*4 and give t. 1 Express -4 + 2 + 31n*2 + 1 - 4n*4 - 32n*2 + 2n in the form bn3 + ln*2 + t + dn*4 + an and give a. 2 Rearrange 30 - 8m - m - 30 to the form rm + d and give r. -9 Express -3b3 - 3b*3 - 8b*4 - 2b - 6b3 + 13b*3 as fb*2 + s + ub + ib3 + nb*4 and give f. 0 Rearrange -2y - 11y2 + 10y*3 + 10y*2 + 2y to the form sy2 + d + vy*3 + by and give s. -1 Express -34q3 - 2q*4 + 1 + 4q*4 + 32q*3 in the form gq*4 + iq*2 + p + lq*3 + nq and give l. -2 Express -1 + 1 - 2 + t*2 - 3t*3 + 0 in the form rt*2 + c + ot + zt3 and give z. -3 Express 2y*2 - 6y*2 + 11y*2 + y + 4y*2 as v + py + zy2 and give p. 1 Rearrange -18s - 67s2 + 18s - 3s2 to k + bs*2 + vs and give b. -70 Rearrange 3k + 3k + 11k - 4k to the form u + c*k and give c. 13 Rearrange (1 +	{ "pile_set_name": "DM Mathematics" }
(-7) a composite number? False Let q(v) = 12v2 + 7v - 3. Let b be q(6). Suppose 7f - 4f = b. Is f composite? False Suppose -12s + 556 = -8s. Is s composite? False Let g(i) = 279i2. Let n be g(1). Suppose -u - s + 139 = u, 0 = 4u + 3s - n. Is u prime? False Let h(l) = -145l + 10. Is h(-3) composite? True Let v(k) = 44k - 2. Let p be v(3). Let d = 217 - p. Is d prime? False Let n = -7 - -12. Suppose f = 17 - n. Suppose k + 2k + f = 0, 0 = 2r - 5k - 46. Is r a prime number? True Let n = -119 - -330. Is n a composite number? False Let z = -15 + 2978. Is z a composite number? False Let f be -8-2(-3)/(-12). Suppose -l + f = -190. Is l composite? True Let v = -4 - -6. Let a be 2 - (v - 1) - 0. Is (a/3)/(1/69) prime? True Suppose 0s + 575 = s + 2g, 4s - g = 2255. Suppose -6r + r + s = 0. Is r a prime number? True Suppose 0 = -2d + 4u + 7788 + 742, -u + 12795 = 3d. Is d a prime number? False Suppose -2t + 925 = 3t. Is t composite? True Suppose -g + 52 = 3g. Suppose 2x = g + 1. Is x prime? True Let f(t) = 15t*2 + 2t + 3. Let i be f(-5). Suppose b - 214 = i. Suppose b = 5z + 7. Is z a prime number? False Suppose 15 = 3z, -4j - 4z + 1452 = -444. Is j prime? False Let a(q) = 16q2 + 6q + 5. Is a(-9) a prime number? False Suppose -2o = -5d + 3d + 30, -d - 4o = -35. Is d a composite number? False Let r(u) = -u*3 + 7u*2 + 6u - 1. Let w = 15 + -10. Is r(w) a prime number? True Let p be 4/10 - 6865/(-25). Suppose 0 = -z + 4, -2h + 2z - p = 57. Let b = -85 - h. Is b prime? False Let i = 16 - 11. Suppose 4q + 7 = -5, 0 = -ix - 5q + 790. Is x a composite number? True Let u = 176 + -105. Is u prime? True Let n(r) = -177r + 4. Is n(-5) a prime number? False Suppose v + 4v = s + 17, 2v - 3s = 12. Let n = -1 + v. Suppose -nf = -4f + 178. Is f a prime number? True Suppose -p - 4 = p + 4s, 6 = -2s. Suppose pj - 1307 = -0j - 3r, 2r - 1639 = -5j. Is j prime? False Let x(s) = 6s + 29. Is x(8) prime? False Let w(n) be the second derivative of n3/6 - 2n*2 - n. Let v be w(7). Suppose -2t - v = -41. Is t a composite number? False Suppose -160 = -s + 22. Let l = 6 - 2. Is (s/l-2)/(-1) a prime number? False Let z(p) be the first derivative of p4/4 + 17p*3/3 + 11p*2/2 + 7p - 7. Is z(-16) composite? True Let v(m) = -m*3 + 6m*2 - 5m - 2. Let x be v(4). Suppose -2 - x = 2i. Is (-2)/i - (-276)/9 prime? True Let o(i) = 0 + 51i - 9i + 5 + 23i. Suppose r - 4 = -w - 4r, -4w + 16 = 4r. Is o(w) prime? False Let c = -255 - -490. Is c a composite number? True Let h(v) = 57v - 8. Let x be h(4). Let c = 381 - x. Is c composite? True Let b(h) = -2h + 8. Let m be b(4). Is (-230)/4(-2 - m) composite? True Let t be (-144)/(-84) + 4/14. Suppose tv + v - 177 = 0. Is v composite? False Let o = 55 - 8. Let x(w) = -w2 - w + 2. Let h be x(0). Is (o/h)/((-2)/(-4)) composite? False Suppose 9c - 11c + 102 = 0. Is c a prime number? False Let t(h) = -2h*3 - 6h*2 + 3h - 2. Let r = 0 + -1. Let x(m) = 5m. Let v be x(r). Is t(v) composite? False Let i be (-7 - -6)/((-1)/8). Suppose -2 = 3a - 4a. Is a/i + (-315)/(-4) a prime number? True Let n(m) = 291m*2 - 1. Let b be n(-1). Suppose 3i = i + b. Is i composite? True Let t(o) be the third derivative of 41o6/24 + o5/60 - o4/24 - 5o*2. Is t(1) a composite number? True Let o(s) = 2s*3 - 23s*2 - 9s + 18. Let y(j) = -j*3 + 11j*2 + 4j - 9. Let z(x) = -4o(x) - 9y(x). Is z(7) a prime number? False Suppose -2s + 4 = -0. Suppose -3b + 146 + 969 = -sy, -4b = 2y - 1482. Is b a prime number? False Suppose -2c + c = 2x - 257, 3x - 510 = -2c. Suppose 0 = 3n + 4r - c, -2n + 127 = -r - 50. Is n a prime number? False Let z(l) = -4l3 - 5l*2 - 5l - 5. Is z(-4) a composite number? False Let a = -416 + 795. Is a prime? True Let h(p) be the third derivative of 0 + 5/24p4 + 0p + 1/6p3 + 1/30p*5 - 2p*2. Is h(-5) composite? True Suppose -2w - 21180 = -4f, 0 = f + 3f - 5w - 21192. Is f prime? False Suppose 0 = 2c - 2y - 602, c + 4y = -2c + 882. Is c a prime number? False Suppose 11 = 2b + 5f, -f = 3b - 0f - 10. Is (-1)/2(-11 - b) composite? False Suppose 9k = 5k + 20. Suppose 131 = 2f - b, 5b = kf + b - 323. Suppose -2p = -p - f. Is p a prime number? True Suppose 0 = -i - 4i + 725. Is i a prime number? False Let o = 34 - 11. Let z = -4 + o. Is z a composite number? False Let i(g) = -5 + 0 + 1 + 112g + 3. Is i(1) prime? False Suppose -794 = m - 3m. Is m a prime number? True Let g(k) = 18k - 1. Let m be g(5). Let c = m - 44. Suppose 3v - 38 = -3h + 7, -3v - 2h + c = 0. Is v a prime number? False Suppose -3166 = -9a + 875. Is a composite? False Suppose -5g + 3f - 439 = -0g, 0 = 2g + 4f + 160. Let a = 883 + g. Is a prime? True Let h(z) = -41z + 6. Is h(-5) composite? False Is 6 + -3 - (0 - 146) a prime number? True Let g = -28 - -16. Let m be (-2)/(-3) - (-1412)/g. Let x = -70 - m. Is x a prime number? True Let t(d) = -d3 - 3d*2 + 2d - 3. Let w be t(-4). Suppose -2i - 951 = -5s, ws - 762 = -i + 195. Is s prime? True Let y = 17 + -54. Let x = 1 - 0. Is (0 + (-1)/x)y prime? True Let h(s) = s*3 - 8s*2 + 7s + 4. Let w be h(7). Suppose 0 = o + wm - 630 - 11, -5o + 3m + 3159 = 0. Suppose -2j = -5j + o. Is j a prime number? True Let k be 8/28 + 54/7. Suppose -k + 0 = -4v. Suppose -41 = -vg - 5b + 39, 3g = -5b + 115. Is g composite? True Suppose -l + 4h + 4253 = 2l, 0 = 2h - 8. Is l composite? False Let r(p) = -p3 + 5p*2 - p. Suppose 0u = -x - u - 9, 3x = -u - 25. Let b be r(x). Suppose 4k - b = 4a, 4 = 3a + a. Is k a composite number? False Suppose 0g = 4g + 412. Let n(z) = z*3 + 11z*2 + 5z + 20. Let s be n(-8). Let d = s + g. Is d prime? False Let n(h) = -h*2 + 5h. Let i(l) = 3l2 + 1. Let w be i(1). Let j be n(w). Suppose 2v + 2c = -v + 69, -46 = -2v - jc. Is v prime? True Suppose -4x - 4f + 488 = 0, -2x + 102 = -2f - 142. Suppose -4w + x = -114. Is w composite? False Let s = 11 - 8. Suppose -i - 9 = -sm, -5i + 6 + 9 = -3m. Is (1 - i)/(2/(-4)) a prime number? False Suppose -3p - 340 = -4y, -2y + 4p + 80 = -90. Suppose h + n - 52 = 0, -2n - 140 = -5h + y. Is h a composite number? False Let b(l) = -41l + 6. Suppose 4 = 2i + 18. Is b(i) a prime number? True Let v(t) = 18t*2 + 2t + 1. Let f(c) = -37c2 - 4c - 2. Let g(a) = 6f(a) + 13v(a). Suppose -3o + 0 = 3. Is g(o) composite? False Suppose 188 = -4t - 72. Let k = 99 + t. Suppose v - k - 19 = 0. Is v a prime number? True Let s(c) = c*3 + 4c*2 - 5c + 3. Let o be s(-5). Let k be (0 - o) + 5/1. Suppose -105 = -5q - 0f - kf, -5q = 5f - 120. Is q composite? False Let v = -12 - -18. Suppose -o - 4 = 2n - 4n, 4n - 3o = v. Suppose -nz + 15 + 3 = 0. Is z a prime number? False Let f = 1286 + 337. Is f prime? False Suppose 2q + 80 = -s, -121 - 81 = 5q + 2s. Let z = -5 + q. Is (z/2)/((-3)/6) a prime number? True Suppose 4s = 2l - s - 6, 3l - 9 = 4s. Let g(p) = 25p + 8. Let m(n) = -12n - 4. Let i(v) = 3g(v) + 5m(v). Is i(l) a prime number? False Let g = -247 + 353. Suppose -g - 105 = -t. Is t composite? False Suppose -3p = 3j - 30, -2p + 6 = -5j - 7. Suppose 3i = p + 39. Suppose -4n = -28 - i. Is n a composite number? False Let u = -8 - -7. Is (-371 - u)3/(-6) prime? False Let b = -454 - -1961. Is b a prime number? False Let z(u) = 3u + 7. Let f be z(-13). Is (-3 + 2)(f - -1) composite? False Suppose -s - 3 = 0, s = -g - 0s + 2. Suppose 3q + 46 = gq. Is q prime? True Let d(k) = -12k*2 + k + 1. Let u be d(-1). Let z = u - -47. Is -3(-3)/9z a prime number? False Let z(p) be the second derivative of 29p*3/6 + p. Is z(3) prime? False Let y(g) = 83g + 7. Let h be y(-4). Let j = h - -578. Is j a prime number? False Is (-30)/50 + 27856/10 a prime number? False Let l(n) = n*3 + 15n*2 + 10n - 11. Let y = 57 + -80. Let m = y - -11. Is l(m) a composite number? True Suppose -44 = -k + 59. Let q = k + 108. Is q a prime number? True Is ((-13)/(-2))/(1/1383) composite? True Let q(r) = 9r*2 + 8r - 3. Let d be q(3). Suppose d = g - 19. Is g a composite number? True Let c = 396 - 161. Is c a prime number? False Let h(i) = 5i2 + 2i - 3. Let g = 4 - 2. Is h(g)	{ "pile_set_name": "DM Mathematics" }
he nearest integer? 3 What is 17677629 to the power of 1/4, to the nearest integer? 65 What is 348992 to the power of 1/2, to the nearest integer? 591 What is the square root of 12482749 to the nearest integer? 3533 What is 589288 to the power of 1/8, to the nearest integer? 5 What is 3052329 to the power of 1/8, to the nearest integer? 6 What is the cube root of 2272234 to the nearest integer? 131 What is 853892 to the power of 1/2, to the nearest integer? 924 What is the square root of 109295 to the nearest integer? 331 What is the third root of 10239403 to the nearest integer? 217 What is the tenth root of 1242988 to the nearest integer? 4 What is the cube root of 6045757 to the nearest integer? 182 What is the square root of 3720787 to the nearest integer? 1929 What is 6553352 to the power of 1/3, to the nearest integer? 187 What is 821396 to the power of 1/2, to the nearest integer? 906 What is the eighth root of 740229 to the nearest integer? 5 What is the eighth root of 7988904 to the nearest integer? 7 What is 2521899 to the power of 1/2, to the nearest integer? 1588 What is the ninth root of 6402168 to the nearest integer? 6 What is the square root of 625064 to the nearest integer? 791 What is 2027667 to the power of 1/9, to the nearest integer? 5 What is the third root of 219109 to the nearest integer? 60 What is the fifth root of 4965145 to the nearest integer? 22 What is the square root of 3174864 to the nearest integer? 1782 What is the eighth root of 8145839 to the nearest integer? 7 What is 873669 to the power of 1/3, to the nearest integer? 96 What is 299037 to the power of 1/5, to the nearest integer? 12 What is 928623 to the power of 1/10, to the nearest integer? 4 What is the cube root of 5227955 to the nearest integer? 174 What is the fourth root of 10293369 to the nearest integer? 57 What is the cube root of 1992110 to the nearest integer? 126 What is 8016134 to the power of 1/2, to the nearest integer? 2831 What is the cube root of 30119835 to the nearest integer? 311 What is 394777 to the power of 1/2, to the nearest integer? 628 What is 3033711 to the power of 1/10, to the nearest integer? 4 What is 363383 to the power of 1/2, to the nearest integer? 603 What is 10945187 to the power of 1/9, to the nearest integer? 6 What is the sixth root of 4617965 to the nearest integer? 13 What is 21172 to the power of 1/3, to the nearest integer? 28 What is 680493 to the power of 1/9, to the nearest integer? 4 What is 2475370 to the power of 1/3, to the nearest integer? 135 What is the sixth root of 3843154 to the nearest integer? 13 What is the square root of 343496 to the nearest integer? 586 What is the third root of 33699187 to the nearest integer? 323 What is the eighth root of 825310 to the nearest integer? 5 What is 6500062 to the power of 1/2, to the nearest integer? 2550 What is the cube root of 8339762 to the nearest integer? 203 What is 110095 to the power of 1/2, to the nearest integer? 332 What is 6219996 to the power of 1/3, to the nearest integer? 184 What is the ninth root of 4964306 to the nearest integer? 6 What is 375763 to the power of 1/2, to the nearest integer? 613 What is 24576034 to the power of 1/8, to the nearest integer? 8 What is the seventh root of 379290 to the nearest integer? 6 What is the square root of 1051562 to the nearest integer? 1025 What is the third root of 336055 to the nearest integer? 70 What is the third root of 211321 to the nearest integer? 60 What is 2427225 to the power of 1/2, to the nearest integer? 1558 What is 1494552 to the power of 1/3, to the nearest integer? 114 What is the fifth root of 12422203 to the nearest integer? 26 What is the square root of 13188602 to the nearest integer? 3632 What is the square root of 384360 to the nearest integer? 620 What is the third root of 518249 to the nearest integer? 80 What is 9022709 to the power of 1/2, to the nearest integer? 3004 What is the square root of 710095 to the nearest integer? 843 What is the third root of 1344762 to the nearest integer? 110 What is the cube root of 14723135 to the nearest integer? 245 What is the square root of 1300908 to the nearest integer? 1141 What is the square root of 1499172 to the nearest integer? 1224 What is 8170722 to the power of 1/10, to the nearest integer? 5 What is 6074841 to the power of 1/7, to the nearest integer? 9 What is the square root of 456228 to the nearest integer? 675 What is the third root of 142254 to the nearest integer? 52 What is 174858 to the power of 1/2, to the nearest integer? 418 What is 877442 to the power of 1/5, to the nearest integer? 15 What is 10512338 to the power of 1/7, to the nearest integer? 10 What is 12792800 to the power of 1/3, to the nearest integer? 234 What is the eighth root of 409741 to the nearest integer? 5 What is 443961 to the power of 1/2, to the nearest integer? 666 What is the third root of 16501463 to the nearest integer? 255 What is 8490174 to the power of 1/2, to the nearest integer? 2914 What is the square root of 153300 to the nearest integer? 392 What is the third root of 72636 to the nearest integer? 42 What is the third root of 177059 to the nearest integer? 56 What is 175304 to the power of 1/2, to the nearest integer? 419 What is 1409716 to the power of 1/3, to the nearest integer? 112 What is 22200901 to the power of 1/2, to the nearest integer? 4712 What is the cube root of 6735506 to the nearest integer? 189 What is the cube root of 1221068 to the nearest integer? 107 What is the cube root of 716668 to the nearest integer? 89 What is 19974 to the power of 1/2, to the nearest integer? 141 What is 521466 to the power of 1/2, to the nearest integer? 722 What is 6943098 to the power of 1/2, to the nearest integer? 2635 What is the third root of 2672551 to the nearest integer? 139 What is the square root of 4944634 to the nearest integer? 2224 What is 10958206 to the power of 1/3, to the nearest integer? 222 What is the eighth root of 6004512 to the nearest integer? 7 What is 23395671 to the power of 1/6, to the nearest integer? 17 What is the cube root of 3110377 to the nearest integer? 146 What is 2651499 to the power of 1/5, to the nearest integer? 19 What is 134360 to the power of 1/10, to the nearest integer? 3 What is the cube root of 273062 to the nearest integer? 65 What is the fifth root of 7155214 to the nearest integer? 23 What is the seventh root of 1285823 to the nearest integer? 7 What is 26219 to the power of 1/2, to the nearest integer? 162 What is the square root of 68130 to the nearest integer? 261 What is the ninth root of 2006071 to the nearest integer? 5 What is 2892212 to the power of 1/2, to the nearest integer? 1701 What is 1791707 to the power of 1/6, to the nearest integer? 11 What is the seventh root of 281634 to the nearest integer? 6 What is the sixth root of 1884178 to the nearest integer? 11 What is 978504 to the power of 1/2, to the nearest integer? 989 What is 1008279 to the power of 1/9, to the nearest integer? 5 What is the square root of 5629594 to the nearest integer? 2373 What is 222380 to the power of 1/2, to the nearest integer? 472 What is the third root of 1856149 to the nearest integer? 123 What is 1787095 to the power of 1/6, to the nearest integer? 11 What is 295302 to the power of 1/3, to the nearest integer? 67 What is 9683112 to the power of 1/2, to the nearest integer? 3112 What is the sixth root of 3379051 to the nearest integer? 12 What is 4530889 to the power of 1/7, to the nearest integer? 9 What is the third root of 699933 to the nearest integer? 89 What is the fourth root of 411684 to the nearest integer? 25 What is 1933083 to the power of 1/9, to the nearest integer? 5 What is the seventh root of 6079036 to the nearest integer? 9 What is 70162 to the power of 1/2, to the nearest integer? 265 What is the fifth root of 4241 to the nearest integer? 5 What is the third root of 249177 to the nearest integer? 63 What is the cube root of 739883 to the nearest integer? 90 What is the eighth root of 301399 to the nearest integer? 5 What is the cube root of 10984493 to the nearest integer? 222 What is the fourth root of 195273 to the nearest integer? 21 What is 543299 to the power of	{ "pile_set_name": "DM Mathematics" }
grams. 419652000 Convert 4900.522mm to nanometers. 4900522000 How many millilitres are there in twenty-five halves of a litre? 12500 Convert 57649.14 months to years. 4804.095 What is 27/5 of a century in decades? 54 How many grams are there in 3/50 of a tonne? 60000 Convert 987.285mm to micrometers. 987285 How many millilitres are there in 81.46442l? 81464.42 How many millimeters are there in 91.9761 kilometers? 91976100 Convert 0.2340192l to millilitres. 234.0192 How many kilograms are there in eleven quarters of a tonne? 2750 How many millimeters are there in one fifth of a centimeter? 2 What is 0.9356341ml in litres? 0.0009356341 What is 6/5 of a tonne in kilograms? 1200 How many milliseconds are there in 345.8772us? 0.3458772 Convert 502277.4 decades to years. 5022774 How many months are there in twenty-three thirds of a decade? 920 What is nineteen quarters of a millennium in years? 4750 How many meters are there in twenty-one fifths of a kilometer? 4200 What is one twentieth of a kilometer in millimeters? 50000 What is 394062.6 decades in centuries? 39406.26 What is 20422.19l in millilitres? 20422190 How many seconds are there in two fifteenths of a hour? 480 Convert 19646.08s to milliseconds. 19646080 Convert 71238.53 decades to centuries. 7123.853 How many milliseconds are there in 1/4 of a second? 250 Convert 879913.1ml to litres. 879.9131 How many hours are there in nineteen sevenths of a week? 456 How many millimeters are there in 44.98842um? 0.04498842 What is thirteen eighths of a minute in milliseconds? 97500 How many years are there in one twentieth of a century? 5 What is fifteen quarters of a week in minutes? 37800 What is one sixteenth of a kilogram in milligrams? 62500 What is three fifths of a tonne in kilograms? 600 How many minutes are there in 25/2 of a day? 18000 How many meters are there in 41/2 of a kilometer? 20500 How many grams are there in 1/4 of a kilogram? 250 Convert 4315.709 millilitres to litres. 4.315709 What is 470213.64s in days? 5.4422875 What is 13.323084 months in millennia? 0.001110257 What is 12915.6006 hours in weeks? 76.878575 Convert 0.406959nm to meters. 0.000000000406959 How many months are there in 3/40 of a century? 90 What is thirteen eighths of a millimeter in micrometers? 1625 What is 9348.378 weeks in days? 65438.646 How many months are there in 79/3 of a decade? 3160 How many centimeters are there in 194.8319 millimeters? 19.48319 What is 1/10 of a gram in micrograms? 100000 What is 225977.1 centuries in years? 22597710 Convert 13.62857 centuries to millennia. 1.362857 What is 7/2 of a millimeter in micrometers? 3500 How many micrograms are there in 1/10 of a gram? 100000 What is 0.0809541l in millilitres? 80.9541 What is 88.9812mg in grams? 0.0889812 How many millilitres are there in three fifths of a litre? 600 What is eleven tenths of a micrometer in nanometers? 1100 How many centimeters are there in three eighths of a kilometer? 37500 How many kilometers are there in 43636.1 nanometers? 0.0000000436361 What is 3.337171cm in millimeters? 33.37171 What is 21/5 of a litre in millilitres? 4200 How many centimeters are there in 3/50 of a meter? 6 What is 0.3711686 years in centuries? 0.003711686 How many litres are there in 4.294145ml? 0.004294145 How many minutes are there in seven eighths of a day? 1260 How many milliseconds are there in 5/8 of a minute? 37500 Convert 87125.03 millennia to months. 1045500360 How many micrograms are there in 17/4 of a milligram? 4250 What is seven halves of a second in milliseconds? 3500 Convert 228.0417ml to litres. 0.2280417 How many minutes are there in 381835.9 days? 549843696 How many micrograms are there in 6031.953ng? 6.031953 What is 6523.767 centimeters in micrometers? 65237670 Convert 164.62134ns to minutes. 0.000000002743689 How many millilitres are there in 8096.899l? 8096899 How many grams are there in five quarters of a kilogram? 1250 How many kilometers are there in 968.04nm? 0.00000000096804 How many millilitres are there in 65978.45l? 65978450 Convert 907.8218 meters to millimeters. 907821.8 How many micrograms are there in 27/5 of a milligram? 5400 What is 95862.11 grams in tonnes? 0.09586211 What is two sevenths of a week in minutes? 2880 What is twenty-seven fifths of a litre in millilitres? 5400 Convert 114370.14 months to decades. 953.0845 What is five eighths of a day in seconds? 54000 How many milligrams are there in 82.90532kg? 82905320 What is 9/10 of a milligram in micrograms? 900 What is 54.1824 centuries in decades? 541.824 Convert 5298.412 centuries to months. 6358094.4 Convert 0.793707l to millilitres. 793.707 How many seconds are there in 13/12 of a hour? 3900 What is 37/5 of a centimeter in micrometers? 74000 How many seconds are there in 1/45 of a week? 13440 How many nanoseconds are there in 9.572443 weeks? 5789413526400000 Convert 58.2308 centuries to decades. 582.308 How many micrometers are there in 3/5 of a centimeter? 6000 How many decades are there in 0.3262024 millennia? 32.62024 How many millilitres are there in thirty-two fifths of a litre? 6400 How many micrograms are there in 0.4681124t? 468112400000 Convert 213.6273 nanometers to kilometers. 0.0000000002136273 How many months are there in 302.9627 centuries? 363555.24 What is ten thirds of a hour in seconds? 12000 Convert 961.2138 centimeters to nanometers. 9612138000 How many micrometers are there in three fifths of a millimeter? 600 How many minutes are there in 20/9 of a week? 22400 What is 44.069832us in hours? 0.00000001224162 What is twenty-one fifths of a micrometer in nanometers? 4200 What is 41/6 of a hour in minutes? 410 What is 17/2 of a tonne in kilograms? 8500 What is fourty-eight fifths of a millimeter in micrometers? 9600 Convert 877.1677g to kilograms. 0.8771677 How many nanometers are there in 21/5 of a micrometer? 4200 How many months are there in one quarter of a century? 300 How many micrometers are there in 3/5 of a centimeter? 6000 How many milligrams are there in 6/5 of a gram? 1200 What is 7597.01nm in kilometers? 0.00000000759701 What is 394.6313 millennia in centuries? 3946.313 What is 18238.29 years in months? 218859.48 How many minutes are there in seven quarters of a hour? 105 Convert 8316.275t to micrograms. 8316275000000000 What is 34/5 of a decade in months? 816 How many minutes are there in eleven halves of a week? 55440 What is 155.057nm in centimeters? 0.0000155057 How many millennia are there in 38.8378 decades? 0.388378 What is 90132.29 litres in millilitres? 90132290 What is 0.213664ml in litres? 0.000213664 How many meters are there in five eighths of a kilometer? 625 Convert 8949250.8 nanoseconds to hours. 0.000002485903 How many tonnes are there in 7.545209ug? 0.000000000007545209 What is 2.166641 milligrams in nanograms? 2166641 What is thirteen eighths of a microgram in nanograms? 1625 How many seconds are there in 3/25 of a hour? 432 What is 21/5 of a litre in millilitres? 4200 How many minutes are there in 10/9 of a day? 1600 Convert 518.228l to millilitres. 518228 What is 80264.35 millilitres in litres? 80.26435 Convert 23242.74 micrometers to kilometers. 0.00002324274 How many minutes are there in 51/2 of a day? 36720 What is 25/2 of a second in milliseconds? 12500 What is 21.45724m in nanometers? 21457240000 How many months are there in four thirds of a year? 16 What is three fifths of a millennium in decades? 60 What is 37/5 of a millisecond in microseconds? 7400 How many litres are there in 575080.7 millilitres? 575.0807 What is twenty-seven quarters of a litre in millilitres? 6750 What is 148.5334 millilitres in litres? 0.1485334 How many years are there in 7/2 of a decade? 35 What is twenty-one fifths of a meter in millimeters? 4200 How many milligrams are there in 3/40 of a kilogram? 75000 What is five quarters of a meter in millimeters? 1250 What is fourty-nine fifths of a week in minutes? 98784 What is 5/8 of a kilometer in centimeters? 62500 Convert 0.5855108 kilograms to tonnes. 0.0005855108 How many millilitres are there in 7/2 of a litre? 3500 How many milligrams are there in twenty-seven quarters of a gram? 6750 How many meters are there in 0.571192mm? 0.000571192 What is 3/5 of a millennium in	{ "pile_set_name": "DM Mathematics" }
10356 - 8sqrt(13) Simplify (sqrt(110) + -4(sqrt(110) - -3sqrt(110)))/(sqrt(10) + (sqrt(10) - (sqrt(110)-2)/sqrt(11))). -15sqrt(11)/4 Simplify 1 + ((sqrt(450) - sqrt(450)-11) + sqrt(450))/(sqrt(40)/(1sqrt(4)))-6. -54sqrt(5) + 1 Simplify (sqrt(351)-43)/((sqrt(1215)2)/sqrt(5)). -2sqrt(13) Simplify (sqrt(76) + (sqrt(76) - 2sqrt(76)-1))/(-2sqrt(36)). -2sqrt(19)/3 Simplify (-1 + (sqrt(35)/sqrt(5))*2 + sqrt(7) + 2 + 5 + 0 + -4)4. 4sqrt(7) + 36 Simplify (((sqrt(110) + (-2(sqrt(110) + sqrt(110)-2) - sqrt(110)))/sqrt(10) - 5(sqrt(33) - sqrt(1617))/sqrt(3)) + 2)*2. 128sqrt(11) + 11268 Simplify 5(5 + (-3sqrt(19))*2 + sqrt(57)/sqrt(12)). 5sqrt(19)/2 + 880 Simplify ((-3(sqrt(600) + 4sqrt(600)))/sqrt(10))/(-3sqrt(300) + (sqrt(192) - (-1sqrt(192) + sqrt(192)))). 15sqrt(5)/11 Simplify (sqrt(2057) + -1 + sqrt(612)2 - (5 + 0 + (-1sqrt(17) - sqrt(17) - sqrt(17)) + -5))2. -52sqrt(17) + 11493 Simplify 4 + (-3sqrt(1944))/(sqrt(588) - -1sqrt(588) - sqrt(12)). -27sqrt(2)/13 + 4 Simplify ((sqrt(7) - sqrt(63)/(sqrt(36)/sqrt(4)) - sqrt(7) - sqrt(7)) + sqrt(14)/sqrt(2) + -3 + 4 + ((-1sqrt(315) + sqrt(315))/sqrt(5))/(12sqrt(9)))*2. -2sqrt(7) + 8 Simplify 2((0 + 1 + sqrt(153))2 + 0 + sqrt(68) + 0). 16sqrt(17) + 308 Simplify 3 + ((sqrt(1900) + sqrt(1900) + 2sqrt(1900)-3)*2 + sqrt(1900) + 2 + -5)-3. -91188 - 30sqrt(19) Simplify 0 + (sqrt(187)/(sqrt(77)/(sqrt(21)/sqrt(3))) + (2sqrt(153) - sqrt(153)) + 0)*2. 272 Simplify -6(((sqrt(700) + 0 - sqrt(7) - sqrt(7))6)2 + (sqrt(7) + -1)5 + (1 + sqrt(700))*2). -100944 - 150sqrt(7) Simplify (sqrt(39)/(sqrt(27)-4) - 4(sqrt(65)/sqrt(5))*2-1)3. -sqrt(13)/4 + 156 Simplify 5 + (0 + sqrt(704) - (2sqrt(66))/sqrt(6)). 5 + 6sqrt(11) Simplify (sqrt(231)/(sqrt(33)/sqrt(3))1)/(sqrt(70)/(sqrt(40)-6)). -12sqrt(3) Simplify (-1 + 1 + (sqrt(17)-1)2 + (sqrt(6171) + 2sqrt(6171))/sqrt(3))3. 51 + 99sqrt(17) Simplify -2(((sqrt(20) - sqrt(40)/sqrt(18))-4)/(sqrt(4)25 + sqrt(4) + 6sqrt(16)/sqrt(4)))2. -640/2601 Simplify (0 + 2sqrt(2)-3 - sqrt(18)/((sqrt(9) + (sqrt(9)2 - sqrt(9)) + sqrt(9))4))6. -73sqrt(2)/2 Simplify -4 + (-5 + (sqrt(125) + 0 + sqrt(125) + sqrt(125) - sqrt(125)) + sqrt(125) + 1 + sqrt(125) + 1)2 + -3. -120sqrt(5) + 2002 Simplify (sqrt(33) - (sqrt(33) - sqrt(1617)-2))/(sqrt(3) + sqrt(3) + (sqrt(1152)/sqrt(6) - sqrt(3))). -14sqrt(11)/9 Simplify 2sqrt(242)6 - (3 + sqrt(2) + sqrt(242)2)2. -1067 - 6sqrt(2) Simplify ((-2 + 1sqrt(153) + -4)1 + 2)*2. -24sqrt(17) + 169 Simplify 0 + -2 + (3 + 0 + sqrt(1331))*2. 66sqrt(11) + 1338 Simplify (-5 + (4(-3sqrt(76) - sqrt(76)))/(sqrt(4) + -4sqrt(484)))2. -160sqrt(19)/43 + 51089/1849 Simplify (2(-2sqrt(425) + sqrt(425))2 - (-2sqrt(1700) + 5)-2)2. -1200sqrt(17) + 61300 Simplify (-4 + 1((sqrt(2) - 2sqrt(8)/sqrt(4)) + sqrt(4)/sqrt(2)3 - (2 + (sqrt(2) - (0 + sqrt(2)1)))))*2. -24sqrt(2) + 44 Simplify -1((-2sqrt(5040) + sqrt(5040) + sqrt(35))/sqrt(7) + -5)-1. -11sqrt(5) - 5 Simplify (4(sqrt(80) - sqrt(80)-2)4 - -6sqrt(30)/(sqrt(48)/(-1sqrt(8))))2. 172980 Simplify (-4-1sqrt(121)3)/(2sqrt(11)-4 - (2sqrt(99) - sqrt(99))). -12sqrt(11)/11 Simplify (-4sqrt(80)/(sqrt(8)/sqrt(2)))/(sqrt(576) + (sqrt(576) - -6-1sqrt(576))). sqrt(5)/12 Simplify (sqrt(175) + sqrt(175) + (-3 + sqrt(175) + -1 + sqrt(175))2 + (2sqrt(175)-2 - sqrt(175))2 + -2 + -4)3. -210sqrt(7) + 15255 Simplify (sqrt(216)/(sqrt(9) - sqrt(9)1-5))/((sqrt(972) - (-2sqrt(972) + sqrt(972) + sqrt(972) - sqrt(972) - sqrt(972)))-5)-3. sqrt(2)/270 Simplify (-4 + sqrt(26)/(sqrt(200)/sqrt(4)) + -3)1. -7 + sqrt(13)/5 Simplify -5((-3(1sqrt(114) + sqrt(114)))/(sqrt(6) - 1sqrt(384))-1 + 3). -15 + 30sqrt(19)/7 Simplify (sqrt(304) + 2 + sqrt(304) + sqrt(304) + 0)23 + -1(sqrt(2299) + -2)2 + 1. 188sqrt(19) + 5918 Simplify 0 + -1 + sqrt(1008) + 0 + sqrt(1008) - (3 + sqrt(1008) + 1 - sqrt(1008) - (sqrt(1008) + -1)-3). -12sqrt(7) - 2 Simplify (6(1sqrt(686) + sqrt(686)))/(sqrt(2) + (sqrt(8)/(sqrt(64) + sqrt(4)) + sqrt(2) - sqrt(2)) + 61sqrt(2)). 35sqrt(7)/3 Simplify ((0 + -2 + sqrt(396) + sqrt(396))-14)2. -768sqrt(11) + 25408 Simplify ((-4(-1sqrt(77) + sqrt(77)))/sqrt(7) + sqrt(891) + 2sqrt(891) + -4 + sqrt(891))2. -288sqrt(11) + 14272 Simplify ((sqrt(637) + 2 - sqrt(637))*2 + 3 - (4 + sqrt(39)/(sqrt(3) + sqrt(15)/sqrt(5)))) + 4. -sqrt(13)/2 + 7 Simplify (0 + sqrt(128))4 + (-3(sqrt(128) + -1 + sqrt(128)) - sqrt(128))2. -304sqrt(2) + 6281 Simplify (-1((sqrt(136) + sqrt(136)1 - sqrt(136)) + sqrt(136))-3)/(sqrt(200) + sqrt(200) + sqrt(200) + (12sqrt(200) + sqrt(200) - sqrt(200)) + sqrt(200)). sqrt(17)/5 Simplify 2((2sqrt(96) - sqrt(96) - sqrt(96))4 - sqrt(96) - sqrt(96))/((-1sqrt(48))/sqrt(6)) + -3. -3 + 8sqrt(3) Simplify -2(5 + (sqrt(539)2-4)21). -69002 Simplify ((-5(sqrt(5) + -1)5)*2 + (sqrt(45)2)*2 + -4)1. -1250sqrt(5) + 3926 Simplify (sqrt(21)/(-5sqrt(28)) - (0 + -1 + sqrt(147) - sqrt(147))) + -4. -3 - sqrt(3)/10 Simplify ((sqrt(567) + 2 + sqrt(567))3 - (sqrt(84) + (sqrt(84) + sqrt(84)1)-5)/sqrt(12))2. 756sqrt(7) + 27819 Simplify (2sqrt(76) + 3 - sqrt(76))-31 + 4. -6sqrt(19) - 5 Simplify (2 + (sqrt(1377)3)2 - ((2sqrt(102) + sqrt(102))/sqrt(6) - (sqrt(153)/sqrt(36) - sqrt(17)))*2) + -3. 48735/4 Simplify (-1 + (sqrt(320) - 2sqrt(320)6) + -2sqrt(320)3 + 2sqrt(320) + 0)*2. 240sqrt(5) + 72001 Simplify (sqrt(14) - sqrt(350)2 - sqrt(686)1)/(4sqrt(242)-2). 2sqrt(7)/11 Simplify -1 + 5 + 3 + (-3(-1 + sqrt(180)))*2. -108sqrt(5) + 1636 Simplify 4(sqrt(17) - sqrt(17)2)*2-3 + 2(-5 + sqrt(17) + 3). -208 + 2sqrt(17) Simplify (sqrt(637) + -1)*25 - (sqrt(637) - (sqrt(637) + 1)*2)2 - (-2sqrt(78)-1)/(sqrt(6) - sqrt(24)/sqrt(4)5). -111sqrt(13)/2 + 4466 Simplify (4(12sqrt(84) + sqrt(84)))/((32sqrt(108) - sqrt(108))/sqrt(9)). 12sqrt(7)/5 Simplify ((sqrt(84) + sqrt(84) + sqrt(84) + 2sqrt(84))-6)/(sqrt(48)/sqrt(4)-2)-6. -90sqrt(7) Simplify sqrt(21)/(sqrt(63)/(sqrt(54)/sqrt(6))) + (sqrt(36)/(-3sqrt(48)/sqrt(4)))*2. 1/3 + sqrt(3) Simplify (6(sqrt(68) + sqrt(68)-1 + sqrt(68))5)/((3(sqrt(48) - -1sqrt(48)))/sqrt(12)). 5sqrt(17) Simplify 4 + ((((sqrt(95) + sqrt(95) + 1sqrt(95))-4 + sqrt(95) + sqrt(95))-4)/((2sqrt(245) + sqrt(245) - sqrt(245))-6))*2. 3664/441 Simplify (-5(-1 + (1 + sqrt(832) - sqrt(832)) + sqrt(832) + 0 + 3))*2 + 1. 1200sqrt(13) + 21026 Simplify (-1 + sqrt(121)/(sqrt(1331) + sqrt(1331)1 - sqrt(1331)) + 3(5 + sqrt(176)))*2. 3724sqrt(11)/11 + 19845/11 Simplify 4(3(1sqrt(228) + sqrt(228) - sqrt(228)))/(sqrt(108) + 1sqrt(108) + sqrt(108)). 4sqrt(19)/3 Simplify sqrt(5)1 + -3 + -5 - (-3 + sqrt(15)/sqrt(3) + 0). -5 Simplify 66(sqrt(6480)1)2. 233280 Simplify 5(sqrt(204) + (sqrt(204) + sqrt(204)-2)-6 - sqrt(204))/((sqrt(12)-2 - sqrt(12))-4). 5sqrt(17)/2 Simplify 4 + (sqrt(4400)2 - 5sqrt(528)/sqrt(12)). 4 + 30sqrt(11) Simplify -5((sqrt(1728) + 0)-1-4)2. -138240 Simplify 3(sqrt(1053) - (sqrt(1053)4)2) - -5sqrt(1053)-6. -50544 - 243sqrt(13) Simplify (-4sqrt(76)2-5)/(sqrt(20)/(sqrt(40)/(sqrt(8) - sqrt(8)-1))). 20sqrt(19) Simplify (-1sqrt(720)-22 + -2 + 0)*2. -192sqrt(5) + 11524 Simplify (-11sqrt(76))*2 + 0 + sqrt(76) + 2 - (-5 + (sqrt(228) - 1sqrt(228))/sqrt(12) + -4). 2sqrt(19) + 87 Simplify ((sqrt(228) - 1(sqrt(228) - (1sqrt(228) + sqrt(228))))6)/(3sqrt(36)/sqrt(3)2)-1. -2sqrt(19) Simplify ((-5 + 2sqrt(200))-5 + sqrt(200) + 1 + -5 + (2 + sqrt(200) + sqrt(200) + -1 + sqrt(200) - sqrt(200)))*2. -3080sqrt(2) + 10284 Simplify (-3 + 26sqrt(448)-2-4)*2. -4608sqrt(7) + 4128777 Simplify sqrt(55)/(sqrt(405)1 - sqrt(5)) - (-3sqrt(44) + sqrt(132)/(sqrt(12)-2))2. -1859/4 + sqrt(11)/8 Simplify (((sqrt(76)-2 - sqrt(76)) + 2 + sqrt(76) + sqrt(76))-3 + 0)2. -72sqrt(19) + 720 Simplify 0 + 2 + 1 + 2sqrt(891) + ((-1 + sqrt(891)2)-6)2. -1278sqrt(11) + 128343 Simplify 4 + (sqrt(176) + (sqrt(176) + -3)6 + sqrt(176))52. -176 + 320sqrt(11) Simplify ((-1sqrt(240) + sqrt(240) + sqrt(240))/sqrt(10))/(((sqrt(144) + sqrt(36))4)/sqrt(12)). sqrt(2)/6 Simplify (5(sqrt(130)-3-3)/((sqrt(90) - (sqrt(90) - 2sqrt(90))) + sqrt(90) - sqrt(90)))**2. 2925/4 Simpl	{ "pile_set_name": "DM Mathematics" }
mon multiple of 3297996 and 624? 13191984 What is the common denominator of 89/355096 and 71/34? 355096 Calculate the least common multiple of 72 and 159480. 159480 Calculate the common denominator of 17/275713 and -38/11. 3032843 What is the smallest common multiple of 846 and 49444? 444996 What is the common denominator of 33/35650 and -19/124775? 249550 What is the common denominator of -70/78447 and 71/175761? 13885119 Calculate the common denominator of 73/23382 and -59/6. 23382 What is the common denominator of 107/30 and -8/18873? 188730 Calculate the common denominator of -1/3240 and -101/90. 3240 Find the common denominator of -37/500 and 31/370. 18500 Find the common denominator of -101/280 and -71/339. 94920 What is the common denominator of -191/10920 and 179/1680? 21840 Calculate the common denominator of 19/546 and 109/30786. 400218 Calculate the common denominator of 101/4858 and 97/4858. 4858 What is the common denominator of 14/130005 and -86/45? 130005 Calculate the smallest common multiple of 1011170 and 101117. 1011170 Find the common denominator of -8/157 and -49/6908. 6908 Calculate the least common multiple of 99 and 29088. 319968 What is the common denominator of 109/29628 and 115/4938? 29628 What is the common denominator of -51/1162 and -67/28? 2324 What is the common denominator of -59/102069 and -7/81? 918621 What is the smallest common multiple of 14 and 6128? 42896 Find the common denominator of 74/195 and -169/32472. 2110680 Calculate the common denominator of 81/3770 and -33/143390. 4158310 Calculate the smallest common multiple of 24 and 44222. 530664 Calculate the lowest common multiple of 37352 and 1176. 784392 What is the lowest common multiple of 25452 and 84? 25452 Calculate the least common multiple of 111804 and 37268. 111804 Calculate the common denominator of 25/9177 and 131/7820. 3120180 What is the smallest common multiple of 452 and 256058? 512116 Calculate the lowest common multiple of 24340 and 8. 48680 Find the common denominator of 65/352 and 101/40000. 440000 Find the common denominator of 67/12780 and 19/8520. 25560 Calculate the lowest common multiple of 810 and 360. 3240 What is the lowest common multiple of 31426 and 96? 1508448 Calculate the common denominator of -5/1672 and 87/5548. 122056 Calculate the lowest common multiple of 15598 and 6. 46794 Calculate the common denominator of -34/135 and 119/63288. 316440 Calculate the least common multiple of 330670 and 1538. 330670 Find the common denominator of -89/135 and -97/31104. 155520 Calculate the least common multiple of 103929 and 1212. 415716 Calculate the smallest common multiple of 127568 and 191352. 382704 Calculate the least common multiple of 122220 and 122220. 122220 What is the least common multiple of 12065 and 4826? 24130 What is the smallest common multiple of 3781 and 597? 11343 What is the least common multiple of 4729 and 148? 699892 Calculate the smallest common multiple of 45684 and 35532. 319788 Calculate the lowest common multiple of 1485 and 2805. 25245 Find the common denominator of 11/7165 and -71/8598. 42990 Calculate the common denominator of -143/360414 and 75/40046. 360414 What is the common denominator of -53/111940 and -22/139925? 559700 Calculate the smallest common multiple of 48210 and 144630. 144630 Calculate the common denominator of -65/27216 and -111/140. 136080 What is the least common multiple of 15902 and 12? 95412 What is the least common multiple of 84 and 592? 12432 What is the common denominator of -73/1572 and 83/1728? 226368 Calculate the smallest common multiple of 318 and 297754. 893262 Calculate the smallest common multiple of 474 and 2844. 2844 Calculate the common denominator of -105/33044 and -61/8. 66088 What is the least common multiple of 68284 and 16? 273136 Find the common denominator of 1/272 and -1/800. 13600 Calculate the least common multiple of 8316 and 263340. 790020 Calculate the smallest common multiple of 6222 and 122. 6222 Calculate the common denominator of -65/222 and 143/2220. 2220 What is the lowest common multiple of 288765 and 22770? 6352830 What is the smallest common multiple of 96 and 3040? 9120 What is the common denominator of 113/160 and -57/4720? 9440 What is the least common multiple of 71175 and 351? 640575 What is the common denominator of -38/1047219 and 70/33? 11519409 Calculate the least common multiple of 54 and 24. 216 What is the least common multiple of 33082 and 1668? 198492 Calculate the common denominator of -50/15741 and 26/93. 487971 Calculate the smallest common multiple of 951745 and 1020. 11420940 Calculate the common denominator of -95/868506 and -70/1302759. 2605518 Calculate the lowest common multiple of 388824 and 9. 1166472 Calculate the lowest common multiple of 50 and 488845. 4888450 Find the common denominator of -48/165517 and 17/121. 1820687 Find the common denominator of 37/348 and 13/828. 24012 Calculate the common denominator of -169/113232 and -91/2696. 113232 What is the least common multiple of 6948 and 1158? 6948 Calculate the lowest common multiple of 22 and 223786. 2461646 What is the common denominator of 55/10377 and 51/4612? 41508 What is the least common multiple of 60288 and 5024? 60288 Find the common denominator of -67/110292 and -19/25452. 330876 What is the common denominator of 101/78918 and -17/3? 78918 Calculate the smallest common multiple of 180 and 4716. 23580 What is the common denominator of -7/121 and -50/957? 10527 Calculate the common denominator of -127/2920 and -61/28. 20440 What is the lowest common multiple of 16827 and 56090? 168270 Calculate the common denominator of -83/5985 and 88/25935. 77805 What is the least common multiple of 18391 and 13? 239083 What is the common denominator of -77/180 and -57/75280? 677520 Find the common denominator of 11/1190 and 61/17955. 610470 What is the smallest common multiple of 1781 and 47676? 619788 Calculate the common denominator of 29/4736 and 73/159. 753024 Calculate the least common multiple of 1012662 and 126. 1012662 Calculate the smallest common multiple of 603 and 75. 15075 What is the smallest common multiple of 2947087 and 7241? 2947087 What is the lowest common multiple of 38960 and 128? 311680 What is the common denominator of 107/425784 and 31/40? 2128920 Find the common denominator of 63/445 and -113/60876. 304380 What is the lowest common multiple of 168 and 8848? 26544 What is the common denominator of 39/275 and 121/5750? 63250 Calculate the lowest common multiple of 215 and 2494. 12470 Find the common denominator of 129/328000 and -52/451. 3608000 What is the common denominator of -52/2385 and -113/11130? 33390 What is the common denominator of 127/6 and 137/73272? 73272 What is the lowest common multiple of 355 and 281018? 1405090 Calculate the lowest common multiple of 1573 and 131. 206063 Calculate the common denominator of -52/1725 and 109/8748. 5030100 Calculate the least common multiple of 68952 and 432. 1241136 What is the smallest common multiple of 208 and 520? 1040 What is the common denominator of -73/124732 and 25/249464? 249464 Calculate the common denominator of 103/2208 and -123/10. 11040 Calculate the common denominator of 47/160 and 39/6304. 31520 Calculate the common denominator of 101/9380 and -13/4690. 9380 Calculate the least common multiple of 2816 and 199804. 12787456 Calculate the common denominator of 32/39 and 83/1065324. 1065324 Find the common denominator of 73/95160 and 89/36. 285480 What is the least common multiple of 128856 and 4? 128856 Find the common denominator of -27/440 and -1/514030. 2056120 Find the common denominator of 77/10390 and 47/37. 384430 What is the common denominator of -91/304 and -31/60952? 121904 What is the smallest common multiple of 23430 and 10650? 117150 Find the common denominator of -33/3346 and 7/4780. 33460 Calculate the least common multiple of 143448 and 788964. 1577928 Calculate the lowest common multiple of 22 and 1360530. 14965830 What is the smallest common multiple of 73832 and 60? 1107480 Calculate the common denominator of -137/2090 and 139/2640. 50160 What is the lowest common multiple of 2250 and 50175? 501750 Find the common denominator of -21 and 121/246. 246 Calcu	{ "pile_set_name": "DM Mathematics" }
wrt o. -340o3 Let g(f) be the third derivative of 61f*5/12 + 100f*3 + 574f*2. Differentiate g(j) wrt j. 610j Let g = -27481/2 + 13744. Let t(d) be the first derivative of -gd2 + 16d + 6. What is the first derivative of t(q) wrt q? -7 Let g(a) be the first derivative of -a5/5 - a4/4 - 345a3 - 100a*2 - 11a + 11968. Find the second derivative of g(m) wrt m. -12m2 - 6m - 2070 What is the derivative of 48f - 2980 - 29f + 16f2 - 123f wrt f? 32f - 104 Let t(j) = -2j*2 + 19j + 48. Let f be t(11). What is the third derivative of fa2 + 0a*2 + 21a*2 - 21a*3 + 2a*4 + 29a*2 wrt a? 48a - 126 Let b(m) be the first derivative of -24m5/5 - 13m*4/4 - 546m - 157. What is the derivative of b(v) wrt v? -96v3 - 39v2 Let s(h) = h3 - 8h2 + 7h + 3. Let g be s(7). What is the second derivative of 4x3 + 14x*3 + 14x*3 + 10x*g - 70x wrt x? 252x Suppose -22i + y - 3 = -23i, -13 = -4i - 5y. Find the third derivative of -16t*6 + 4t*3 - 3 - 963t*i + 3 + 864t*2 wrt t. -1920t*3 + 24 Let i(v) = 248v*5 + 26v*4 - 946v*2. Let x(p) = -372p*5 - 39p*4 + 1418p*2. Let y(c) = 14i(c) + 9x(c). Find the third derivative of y(t) wrt t. 7440t*2 + 312t Find the third derivative of 1734a6 + 2 - 268a + 1581a - 1485a*6 + 1313a + 3946a6 - a2 wrt a. 503400a*3 Let b be (-117)/(-27) + 2/(-6). Suppose -z - 4z - 15 = 0, -by - 4z - 4 = 0. What is the first derivative of 5w2 - 3 + 2 + 11 + y wrt w? 10w Let p = 8385 - 8361. Let x(y) be the second derivative of -py - 12y*2 + 0 - 7/12y*4 + 0y*3. Differentiate x(a) wrt a. -14a Let o(z) = 0z2 - z2 + 2z*2 + 1 - 6z + 5. Let i be o(6). What is the third derivative of 113n6 + 8n*2 - 94n*i + 21n*2 wrt n? 2280n*3 Let s(a) = -2a*2 - 28a - 46. Let f be s(-12). Let n = 26 + -11. Differentiate ni2 - 15i*f - 11 + 8i*4 + 41 with respect to i. 32i*3 Suppose -12 = -6q - 0. Differentiate -229 - 242 + 429 + 3kq - 14k*4 with respect to k. -56k*3 + 6k Let o(y) be the second derivative of 2 - y*2 + 0y*3 - 109/20y*5 + 49/12y*4 + 9y. What is the third derivative of o(r) wrt r? -654 Let b(y) = 2y2 + 4y + 1. Let r be b(-3). Let v(n) = -n*2 + 6n + 9. Let a be v(r). Find the first derivative of 6 + 12 + 11g2 - a - 9g*2 wrt g. 4g Suppose 62x - 20 = 52x. Find the second derivative of -151vx + 26v + 120v - 9v wrt v. -302 Let u(f) = f*2 - 10f - 37. Let y be u(13). Differentiate -115v - 103 + 19v*y + 115v with respect to v. 38v Suppose 8u + 8 = 64. Suppose l = -ul + 40. What is the first derivative of 0s - 199 + 181 - ls wrt s? -5 Let u = 349 - 346. Find the second derivative of -16 + u - 32q*2 - 5 + 3q*3 + 3q - 5q3 - 17q*2 wrt q. -12q - 98 Let l(u) = 4u2 - 2u + 3. Let n be l(1). Find the third derivative of s*n - 33s*2 + 37s*5 - 85s*2 + 29s*5 wrt s. 4020s*2 Let l = 3 + 3. What is the third derivative of -4t*2 + 2t - lt + 18t + 27t3 + 2t*4 wrt t? 48t + 162 Let k(x) = -x*2 - 9x + 2. Let n be k(-9). Suppose y - 30 = -4w, -nw + 3 + 45 = 2y. Find the second derivative of 26f + yf3 + 28f*3 + f + 11f wrt f. 300f Let a(l) be the first derivative of 309l*4 - 8812l + 8317. What is the first derivative of a(n) wrt n? 3708n2 Let o(v) be the first derivative of -5v*7/7 - 483v*5/5 + 2v*3/3 + 62v*2 + 2684. What is the third derivative of o(f) wrt f? -600f*3 - 11592f Let v(w) = -28w2 - w + 1. Let l be v(1). Let c = 47 + l. Find the second derivative of -7m*2 + cm*2 + 0m + 5m + 10m wrt m. 24 Let m be -3 - (0 - (0 - 1)). Let u(z) = z*3 + 6z*2 + 4z - 8. Let r be u(m). Find the second derivative of ri3 + 29i - 38i + 24i wrt i. 48i Let s(j) = 695j*2 + 2j - 722. Let c(o) = 2779o2 + 9o - 2891. Let v(h) = -4c(h) + 18s(h). Find the first derivative of v(u) wrt u. 2788u Let b(y) be the first derivative of -y4 - 4y*3/3 - 36y*2 - 5021y + 1523. Differentiate b(l) wrt l. -12l2 - 8l - 72 Let m(s) be the third derivative of -s*6/60 - 8s*5/15 + 437s*4/24 - 1220s*2. Find the second derivative of m(q) wrt q. -12q - 64 Suppose 47 - 50 = -r. Let o be r - ((-15)/(-20))/((-2)/8). Find the second derivative of 22f2 + 34f - of2 - 13f wrt f. 32 Let k = -14175 - -850513/60. Let o(i) be the third derivative of 0i + 0 - 23/24i*4 + 14i*2 + 0i*3 + ki*5. Find the second derivative of o(x) wrt x. 26 Let q be 12 - 7 - 3/1. Suppose 0 = 5b - qb - 6. What is the first derivative of -29 - 4m*2 + 31m*b - 2m*2 wrt m? 50m Suppose 2t = 4f + 60, 0f - 85 = -2t - f. Let d = -37 + t. What is the third derivative of 26i2 + 316i - 10i3 - 316i - 12id wrt i? -132 Let q(i) = 113i*2 + 10i + 74. Let t(c) = 224c2 + 18c + 142. Let v(o) = 7q(o) - 4t(o). What is the second derivative of v(h) wrt h? -210 Let p = 244 + -242. What is the first derivative of 59s2 + 81s*2 - 97s*p - 33 wrt s? 86s Let v(g) be the first derivative of 1/6g6 + 0g*5 + 0g*2 + 109/3g*3 + 0g + 23/4g4 + 176. What is the third derivative of v(z) wrt z? 60z2 + 138 Let r(u) be the third derivative of u7/210 + 389u5/15 - 443u*4/8 - 1081u*2. Find the second derivative of r(t) wrt t. 12t2 + 3112 Let c(q) be the third derivative of -q7/210 + 4517q6/120 - 129q*5/5 + 7413q*2. Find the third derivative of c(k) wrt k. -24k + 27102 Let i(t) be the first derivative of -157t5/5 - 2t3/3 - t2/2 - 75t + 1239. Find the second derivative of i(n) wrt n. -1884n*2 - 4 Suppose 640 = 12z - 4z. What is the second derivative of 18g + 68g + 15g + 59g + zg*4 wrt g? 960g*2 Suppose 5v - 1 = 4v + 3i, -v = 4i - 8. Suppose 1 = 2m + 4a - 47, m = 4a. What is the second derivative of -2n3 - v - 4 + mn + 8 wrt n? -12n Let p(w) be the first derivative of 138w*5/5 - 2w*3/3 + 2516w + 2092. Differentiate p(r) wrt r. 552r3 - 4r Suppose 66 = -29f + 51f. What is the third derivative of 69d4 - 11d*3 + 186d*2 - 11d*3 + 160d*4 + 22d*f wrt d? 5496d Let r(o) be the first derivative of 2o3/3 + 78o*2 + 1656o + 808. Differentiate r(n) with respect to n. 4n + 156 Find the third derivative of 68i*2 + 66i*6 - 45i*2 - 3736i*6 - 18 + 56 wrt i. -440400i3 Let g(j) = j3 + 218j2 - 125. Let f(q) = 3q*3 + 650q*2 + q - 377. Let y(s) = 2f(s) - 7g(s). What is the second derivative of y(b) wrt b? -6b - 452 Find the third derivative of -76n3 - 20n*2 + 320n*4 + 24n*3 + 5 - 98n*4 + 5 + 47n*3 wrt n. 5328n - 30 Suppose 11z - 2790 = -20z. What is the third derivative of 537 - 536 - zv3 + v6 - 59v*3 + 48v*2 + 48v*3 wrt v? 120v*3 - 606 Suppose 0 = -5m + 201 - 191. What is the derivative of 0y2 - 14 + 6 + 146 + 12y*2 - 6y*m + 8y wrt y? 12y + 8 Let f(z) be the second derivative of 1/2z*3 + 0 + 59/2z*2 - 119z. Find the first derivative of f(p) wrt p. 3 Let y(q) = -2q3 + q2 - 2q - 7. Let n(x) = x*2 + 1. Let w(b) = -6n(b) - y(b). Let f be w(4). Differentiate -14 + 38z3 - fz*3 - 36z*3 wrt z. -69z*2 Let k(y) = y + 7. Let t be k(-3). Suppose -3i - 27 = -3m, -m + ti - 7 = -25. Find the third derivative of 49lm - 6l*2 + 63l*6 - 95l*6 wrt l. 2040l*3 Differentiate 10v + 1885 + 1215 - 509 + 180v2 - 206v*2 + 2v*3 wrt v. 6v*2 - 52v + 10 Let j(q) be the second derivative of -2267q5/20 - q4/4 + 499q*2/2 - 1139q. What is the third derivative of j(n) wrt n? -13602 Let f(i) = -3509i3 - 11556i*2 + 18. Let o(y) = 2631y*3 + 8667y*2 - 14. Let s(l) = -7f(l) - 9o(l). What is the third derivative of s(q) wrt q? 5304 Let k(m) be the first derivative of 3m*4/2 + 31m3/3 + m2 - 105m + 2875. Find the second derivative of k(h) wrt h. 36h + 62 Suppose 8s - 3s - 4r - 46 = 0, -4s - 3r + 43 = 0. Find the second derivative of -21 - 17i*3 - 17i*3 + 20 + si wrt i. -204i Let q = -115 + 115. Find the third derivative of qa3 - a3 - 2a3 - 21a*5 + 9a*5 - 42a*2 wrt a. -720a*2 - 18 Let m(r) = -6075r*2 + 225r + 2284. Let l(q) = 6075q2 - 210q - 2281. Let k(j) = 15l(j) + 14m(j). Differentiate k(b) with respect to b. 12150*b What is the second deriv	{ "pile_set_name": "DM Mathematics" }
+ 27/2d2 + 81/4 - ad*c - 27d. (d - 3)4/4 Let c(m) be the second derivative of -m5/5 + 2m3/3 + 17m. Factor c(r). -4r(r - 1)(r + 1) Let 4/3 - 4/3p + 1/3p2 = 0. Calculate p. 2 Let a(b) be the third derivative of -b7/1470 + b5/420 - 3b*2. Solve a(t) = 0. -1, 0, 1 Suppose k - 16 = -12. Let g(c) be the second derivative of -1/120c*6 - 1/80c*5 + 0c*2 + 0 + 1/48c*k + 1/24c*3 + 2c. Determine h, given that g(h) = 0. -1, 0, 1 Suppose 2t - 6 = 6. Let a(d) be the first derivative of -1/20d*5 + 0d - 2 + 0d3 + 0d*2 + 0d*4 - 1/24dt. Factor a(j). -j4(j + 1)/4 Let n(h) be the second derivative of -h5/10 + 8h4/9 - h3/3 - 10h2/3 - 24h. Let n(y) = 0. Calculate y. -2/3, 1, 5 Suppose 0 = -5a + 3r + 12, 3a - 2r + 0r = 7. Let 0i*2 + 0i - 1/4i5 + 0i*a + 1/4i4 + 0 = 0. What is i? 0, 1 Let a(g) be the second derivative of g4/12 - g*3/2 - 3g*2 - 2g. Let f be a(6). Factor 12 - 8v2 - 2v - f. -2v(4v + 1) Let i(r) = -r4 + r + 1. Let s(m) = 8m*4 - 2m*3 - 6m*2 - 4m - 2. Suppose 60 = -12u + 17u. Let n(w) = ui(w) + 2s(w). Factor n(p). 4(p - 2)(p - 1)(p + 1)2 Let k(i) be the first derivative of -3i*4/4 + 9i*2/2 - 6i + 25. Factor k(d). -3(d - 1)2(d + 2) Let q be 12/560/24. Let j(m) be the third derivative of 0m*4 + 0m - m*2 + 1/6m*3 + 1/480m*q + 0 - 1/80m5. Solve j(r) = 0 for r. -1, 2 Let w(p) be the third derivative of -p7/210 - p6/40 - p5/60 + p4/8 + p3/3 - 8p2 - 3. Suppose w(u) = 0. What is u? -2, -1, 1 Let b(z) be the third derivative of z5/180 - z4/9 + 8z*3/9 + 4z*2. Solve b(t) = 0 for t. 4 Suppose 4/5 + 16/5v*2 + 14/5v - 2/5v5 - 4/5v*4 + 4/5v*3 = 0. Calculate v. -1, 2 Find u such that 3u2 - u2 + 288 + 430u - 478u = 0. 12 Suppose -3 + 31 = 4c - 4f, -4c + 13 = -f. Factor 0 + 0a - 2/5a3 - 2/5a*c. -2a*2(a + 1)/5 Let i = 321 - 3525/11. Factor -iy - 4/11 + 4/11y*2. 2(y - 2)(2y + 1)/11 Let s = -1634/5 - -328. Suppose -237k - 2 = -238k. Let -sm + 4/5 + 2/5mk = 0. What is m? 1, 2 Let z(k) = -k3 - 4k2 - 2k - 6. Let f be z(-4). Let v = -111 - -563/5. What is j in vj2 + 2/5 - fj = 0? 1/4, 1 Find v such that -3v3 + 1/2v + 4v4 + 0 + 0v*2 - 3/2v*5 = 0. -1/3, 0, 1 Let i(o) = -2o + 1. Let y be i(-10). Let k = y + -15. Factor -27u2 - 10 - ku - 36u3 - 15u*4 + 10. -3u(u + 1)2(5u + 2) Let f = 715 + -2123/3. Factor 4/3 + fx + 8x2. 2(3x + 2)(4x + 1)/3 Suppose q = -3o - 2q - 27, q + 1 = 0. Let j be ((-30)/o - 3)4. Find w such that -4/11w2 + 0w + 0 + 6/11wj - 2/11w*4 = 0. 0, 1, 2 Let s be (-123/(-6))/2. Factor 0 + 0 + 2j2 + 1 - sj*2. -(j - 1)(j + 1) Let h be 4 - 0 - (-26 + 26). Let t(f) be the second derivative of 0 + 0f3 - 1/12f*4 + hf + 0f2. Factor t(n). -n2 Let 4w*2 - 3w3 + w3 - 2w + 2w = 0. What is w? 0, 2 Let c(y) be the second derivative of -5y4/12 + 5y*3/2 + 10y*2 - 18y. Factor c(i). -5(i - 4)(i + 1) Let n(g) = 2g. Let l be n(2). Let k = 192/7 - 190/7. Factor 0p*2 + 0p*l - 2/7p*5 + 4/7p*3 + 0 - kp. -2p(p - 1)*2(p + 1)2/7 Let f(q) be the second derivative of q4/18 - 2q3/9 - q2 - 4q. Factor f(c). 2(c - 3)(c + 1)/3 Determine d, given that -1/3d2 - 1/3 + 2/3d = 0. 1 Let w be -1 + (-2 - -2 - -3). Let c(i) be the third derivative of -1/48i4 + 0i + 1/120i5 + 0i*3 + 0 - wi*2. Factor c(q). q(q - 1)/2 Solve -1/2l2 - 1/4l*4 + 0l + 3/4l3 + 0 = 0. 0, 1, 2 Let p(n) = 2n3 + n2 - 2n - 1. Let f(d) = 5d*3 + 3d*2 - 5d - 3. Let w(m) = 3f(m) - 8p(m). Find o, given that w(o) = 0. -1, 1 Let 5/4w3 + 1/2 - 5/4w - 5/4w2 + 3/4w*4 = 0. What is w? -2, -1, 1/3, 1 Let x(h) be the second derivative of 0h*2 + 2/9h*3 - 7h + 0 - 1/18h4 - 1/30h*5. Factor x(n). -2n(n - 1)(n + 2)/3 Let i(g) = 7g3 - 20g*2 - 23g + 2. Let n(s) = -50s3 + 140s*2 + 160s - 15. Let y(q) = -15i(q) - 2n(q). Find z, given that y(z) = 0. -1, 0, 5 Let i be (-52)/(-96) - (-4)/32. Find k, given that -2/3k3 + 0k*2 + ik + 1/3 - 1/3k4 = 0. -1, 1 Determine o so that -46o*2 - 2o - 2 + 45o2 + 0o + 5o = 0. 1, 2 Let p(u) be the first derivative of -32/9u - 112/27u3 + 16/9u*4 + 1/27u*6 + 16/3u*2 - 2/5u*5 + 2. Factor p(q). 2(q - 2)*4(q - 1)/9 Factor -4/9q - 2/9 - 2/9q*2. -2(q + 1)2/9 Let g(j) be the first derivative of j5/10 + j4/3 + j3/3 - 6j - 5. Let f(u) be the first derivative of g(u). Find c, given that f(c) = 0. -1, 0 Let o be (-1)/(-4 + (-21)/(-6)). Find t such that -4/5t + 4/5 + 1/5to = 0. 2 Let m = 10 + -5. Let l = m + -2. Factor -1/3g + 0 + 1/3g2 - 1/3g*4 + 1/3g*l. -g(g - 1)*2(g + 1)/3 Let b be (-23)/(-7) - 4/14. Suppose -l - 1 = -b. Solve -lc2 + 2c*3 - 2 - 6c - 4c3 - 4c2 = 0. -1 Let f(s) be the second derivative of s6/165 - s5/55 + s4/66 - 8s. Factor f(q). 2q*2(q - 1)*2/11 Let m be 4(3 + (1914/(-60))/11). Determine w so that mw3 - 4/5w + 2/5w2 + 0 = 0. -2, 0, 1 Let h be ((-4)/(-9))/((-1)/(12/(-16))). Factor -1/3z*2 + 0 - hz. -z(z + 1)/3 Let l(q) be the third derivative of -q7/840 - q6/240 - q5/240 + 4q*2. Suppose l(j) = 0. Calculate j. -1, 0 Let k(o) = 14o*2 - 2o + 1. Let b be k(1). Let r(s) = s*2 - 12s - 11. Let w be r(b). Factor -2/11f3 - 8/11 + 0f + 6/11fw. -2(f - 2)*2(f + 1)/11 Determine h so that 3h4 - 3h*2 + 2h + 6h3 + 3h + 0h4 - 11h = 0. -2, -1, 0, 1 Let r = 197 - 197. Factor rm3 + 1/3m + 2/3m2 - 2/3m*4 + 0 - 1/3m*5. -m(m - 1)(m + 1)3/3 Let z = 66/1229 - 3259770/8603. Let c = z - -380. Suppose 0 - 2j*4 + 2/7j*2 - cj*5 + 0j - 4/7j3 = 0. Calculate j. -1, 0, 1/4 Let n(x) be the first derivative of 2x*4 - 32x*3/3 + 21x*2 - 18x - 34. Solve n(f) = 0. 1, 3/2 Suppose 0 = -5w + 169 + 6. Let b be (-2)/3 + w/30. Factor -1/4i*3 + 0i - bi2 + 0. -i2(i + 2)/4 Let u(r) = r*2 + 8r - 20. Let b be u(-10). Factor -o + b + o*3 + 5/2o*4 - 5/2o*2. o(o - 1)(o + 1)(5o + 2)/2 Let p(f) be the first derivative of -f6/42 + 6f5/35 - f4/2 + 16f3/21 - 9f*2/14 + 2f/7 - 14. What is n in p(n) = 0? 1, 2 Let a = -318 - -2228/7. Factor 6/7f - 18/7 + 10/7f*2 + af*3. 2(f - 1)(f + 3)2/7 Suppose 3p + 3 = 5v + 15, -3v = -4p + 16. Factor 0 + 0m*3 + 0m + m*p - 1/2m*5 + 0m2. -m4(m - 2)/2 Factor -10r*2 - 5r + 122r4 + 5r*3 + 114r*4 - 226r*4. 5r(r - 1)(r + 1)(2r + 1) Let z(q) be the second derivative of 1/24q3 + 0 + 1/48q*4 - 1/4q*2 - 7q. Find w, given that z(w) = 0. -2, 1 Let n(f) be the second derivative of -f*4/3 - 2f*3/5 + 4f*2/5 + 13f. Factor n(m). -4(m + 1)(5m - 2)/5 Let z = 12/13 - 82/117. Solve zu + 2/9u5 + 0u*4 - 4/9u*3 + 0u*2 + 0 = 0 for u. -1, 0, 1 Suppose -96/7n*2 - 2/7n*4 + 0 + 24/7n*3 + 128/7n = 0. Calculate n. 0, 4 Let u = -24/11 + 26/11. Determine q so that -8/11q - uq2 - 8/11 = 0. -2 Let s(g) be the third derivative of -g8/9240 - g7/4620 + g6/1980 + g5/660 + g3/6 + g*2. Let x(t) be the first derivative of s(t). Factor x(k). -2k(k - 1)(k + 1)*2/11 Determine r so that 20r + 21r3 - 40r*4 + 4r*3 + 40r*2 + 45r4 = 0. -2, -1, 0 Let m(r) be the second derivative of -r10/15120 - r9/3780 - r8/3360 - r*4/4 + 2r. Let d(q) be the third derivative of m(q). Factor d(h). -2h3(h + 1)*2 Suppose 5t - 7 = 13. Let z(l) be the first derivative of 2 - 1/4l2 + 0l*3 + 1/4l + 1/8lt - 1/20l*5. Find q such that z(q) = 0. -1, 1 Suppose 7/3q*4 - 19/3q*3 + 25/3q*2 - 16/3q + 4/3 - 1/3q5 = 0. What is q? 1, 2 Suppose -5v = -25, -3v + 17 = -3b + 4b. Determine k so that 8k + 4 - 4k - 2k - 2kb + 0k*2 = 0. -1, 2 Let d(x) = -x + 20. Let c be d(18). Suppose 3t - 9 = 5f, -2t = 3t + 5f - 15. Factor -1/3v + 0 + 4/3vt + vc. v(v + 1)(4v - 1)/3 Suppose 2v + 6 = 0, 0v + 2v + 8 = r. Suppose 0 = 5i + a - 5, 4 + 6 = -i + ra. Find j, given that 2/9j2 + 0j + i = 0. 0 Suppose 4p - 16 + 8 = 0. Factor 0i - 2/7ip + 2/7. -2(i - 1)(i + 1)/7 Factor 9/4z*2 - 1/2z - 5/2z3 + 0 + 3/4z*4. z(z - 2)(z - 1)(3z - 1)/4 Let 0 - 4/7y - 2/7y*2 = 0. What is y? -2, 0 Let g = 1426	{ "pile_set_name": "DM Mathematics" }
undreds digit of 915? 9 What is the thousands digit of 4759? 4 What is the units digit of 11099? 9 What is the tens digit of 4601? 0 What is the tens digit of 941? 4 What is the hundreds digit of 1042? 0 What is the tens digit of 123? 2 What is the units digit of 3250? 0 What is the units digit of 14009? 9 What is the hundreds digit of 763? 7 What is the tens digit of 10194? 9 What is the thousands digit of 9532? 9 What is the thousands digit of 12380? 2 What is the tens digit of 130? 3 What is the ten thousands digit of 67018? 6 What is the thousands digit of 47617? 7 What is the units digit of 83? 3 What is the hundreds digit of 4772? 7 What is the ten thousands digit of 44167? 4 What is the ten thousands digit of 56831? 5 What is the tens digit of 104? 0 What is the hundreds digit of 191? 1 What is the thousands digit of 2019? 2 What is the tens digit of 422? 2 What is the tens digit of 7476? 7 What is the tens digit of 11487? 8 What is the thousands digit of 61036? 1 What is the units digit of 391? 1 What is the tens digit of 117761? 6 What is the tens digit of 24133? 3 What is the thousands digit of 17916? 7 What is the ten thousands digit of 19795? 1 What is the ten thousands digit of 96884? 9 What is the ten thousands digit of 33071? 3 What is the hundreds digit of 2990? 9 What is the thousands digit of 36696? 6 What is the thousands digit of 2559? 2 What is the tens digit of 4500? 0 What is the hundreds digit of 577? 5 What is the hundred thousands digit of 108552? 1 What is the hundreds digit of 816? 8 What is the units digit of 3838? 8 What is the tens digit of 705? 0 What is the units digit of 740? 0 What is the tens digit of 8097? 9 What is the ten thousands digit of 39613? 3 What is the units digit of 2055? 5 What is the thousands digit of 1019? 1 What is the units digit of 37532? 2 What is the thousands digit of 2725? 2 What is the thousands digit of 12919? 2 What is the tens digit of 135264? 6 What is the units digit of 18605? 5 What is the thousands digit of 9713? 9 What is the tens digit of 19930? 3 What is the units digit of 492? 2 What is the hundreds digit of 29291? 2 What is the ten thousands digit of 42846? 4 What is the tens digit of 466? 6 What is the tens digit of 708? 0 What is the hundreds digit of 18310? 3 What is the ten thousands digit of 27904? 2 What is the thousands digit of 1061? 1 What is the hundreds digit of 5251? 2 What is the units digit of 683? 3 What is the hundred thousands digit of 176653? 1 What is the hundreds digit of 417? 4 What is the hundreds digit of 8320? 3 What is the hundreds digit of 36178? 1 What is the tens digit of 657? 5 What is the ten thousands digit of 15200? 1 What is the units digit of 2900? 0 What is the units digit of 4179? 9 What is the ten thousands digit of 19847? 1 What is the units digit of 3491? 1 What is the thousands digit of 106184? 6 What is the units digit of 152439? 9 What is the thousands digit of 2993? 2 What is the hundreds digit of 1171? 1 What is the tens digit of 768? 6 What is the hundreds digit of 1755? 7 What is the units digit of 10816? 6 What is the ten thousands digit of 14114? 1 What is the units digit of 98506? 6 What is the thousands digit of 2119? 2 What is the units digit of 6456? 6 What is the units digit of 8802? 2 What is the tens digit of 7465? 6 What is the units digit of 16351? 1 What is the thousands digit of 1541? 1 What is the units digit of 888? 8 What is the tens digit of 67140? 4 What is the units digit of 80? 0 What is the units digit of 9067? 7 What is the tens digit of 4737? 3 What is the units digit of 1011? 1 What is the tens digit of 396? 9 What is the thousands digit of 2300? 2 What is the tens digit of 12920? 2 What is the units digit of 55503? 3 What is the hundreds digit of 549? 5 What is the units digit of 1352? 2 What is the units digit of 32774? 4 What is the hundreds digit of 430? 4 What is the thousands digit of 1067? 1 What is the hundreds digit of 36303? 3 What is the hundreds digit of 17732? 7 What is the tens digit of 55? 5 What is the tens digit of 27061? 6 What is the ten thousands digit of 11660? 1 What is the units digit of 885? 5 What is the units digit of 11874? 4 What is the hundreds digit of 12969? 9 What is the units digit of 14216? 6 What is the thousands digit of 22575? 2 What is the thousands digit of 4537? 4 What is the tens digit of 219? 1 What is the tens digit of 797? 9 What is the hundreds digit of 78374? 3 What is the units digit of 34755? 5 What is the hundreds digit of 893? 8 What is the units digit of 8575? 5 What is the tens digit of 4082? 8 What is the thousands digit of 80130? 0 What is the tens digit of 609? 0 What is the units digit of 621? 1 What is the hundreds digit of 149723? 7 What is the thousands digit of 3203? 3 What is the units digit of 60519? 9 What is the tens digit of 255? 5 What is the thousands digit of 8896? 8 What is the tens digit of 1146? 4 What is the units digit of 48918? 8 What is the ten thousands digit of 15229? 1 What is the tens digit of 244? 4 What is the hundreds digit of 4634? 6 What is the tens digit of 351? 5 What is the tens digit of 629? 2 What is the tens digit of 7338? 3 What is the units digit of 1088? 8 What is the ten thousands digit of 35416? 3 What is the hundreds digit of 4306? 3 What is the units digit of 1108? 8 What is the tens digit of 618? 1 What is the units digit of 10013? 3 What is the units digit of 29249? 9 What is the units digit of 50421? 1 What is the units digit of 482? 2 What is the units digit of 634? 4 What is the ten thousands digit of 116204? 1 What is the units digit of 13462? 2 What is the hundreds digit of 117? 1 What is the ten thousands digit of 13984? 1 What is the hundreds digit of 2279? 2 What is the units digit of 2583? 3 What is the hundreds digit of 7904? 9 What is the units digit of 806? 6 What is the hundreds digit of 1254? 2 What is the hundreds digit of 4525? 5 What is the tens digit of 65359? 5 What is the tens digit of 5037? 3 What is the tens digit of 1833? 3 What is the units digit of 60251? 1 What is the hundreds digit of 18290? 2 What is the hundreds digit of 6564? 5 What is the hundreds digit of 9208? 2 What is the thousands digit of 44490? 4 What is the units digit of 14581? 1 What is the tens digit of 98555? 5 What is the tens digit of 3028? 2 What is the units digit of 16346? 6 What is the ten thousands digit of 105684? 0 What is the units digit of 2280? 0 What is the thousands digit of 8987? 8 What is the units digit of 41965? 5 What is the ten thousands digit of 21938? 2 What is the units digit of 36096? 6 What is the ten thousands digit of 12830? 1 What is the tens digit of 1316? 1 What is the thousands digit of 1145? 1 What is the thousands digit of 4021? 4 What is the tens digit of 1004? 0 What is the ten thousands digit of 32791? 3 What is the units digit of 799? 9 What is the hundreds digit of 2430? 4 What is the units digit of 1257? 7 What is the hundreds digit of 40560? 5 What is the hundreds digit of 2684? 6 What is the hundreds digit of 5165? 1 What is the units digit of 3917? 7 What is the hundreds digit of 52910? 9 What is the thousands digit of 1003? 1 What is the hundreds digit of 1215? 2 What is the hundreds digit of 323? 3 What is the ten thousands digit of 12349? 1 What is the thousands digit of 3688? 3 What is the units digit of 26542? 2 What is the units digit of 6671? 1 What is the ten thousands digit of 55282? 5 What is the units digit of 6130? 0 What is the units digit of 8378? 8 What is the hundreds digit of 67394? 3 What is the hundreds digit of 1411? 4 What is the hundreds digit of 9556? 5 What is the ten thousands digit of 21343? 2 What is the thousands digit of 1264? 1 What is the thousands digit of 2481? 2 What is the tens digit of 10998? 9 What is the hundreds digit of 856? 8 What is the hundreds digit of 52213? 2 What is the units digit of 972? 2 What is the units digit of 316? 6 What is the units digit of 65541? 1 What is the units digit of 230? 0 What is the tens digit of 8235? 3 What is the hundreds digit of 540? 5 What is the thousands digit of 53937? 3 What is the hundreds digit of 52777? 7 What is the thousands digit of 11676? 1 What is the tens digit of 887? 8 What is t	{ "pile_set_name": "DM Mathematics" }
ine f(a). 3 Let m(t) = -2t + t + 20 - 19 + t2. Calculate m(3). 7 Let i(b) be the first derivative of b2/2 + 6b + 2. Give i(5). 11 Let j(w) = 3w + 2. Let b be j(1). Let i(x) = -3x + 7. Determine i(b). -8 Let t = -21 + 19. Let f(c) = -4c - 3. Give f(t). 5 Suppose -4j + 3 = -1. Let y = -2 - j. Let m(x) = -2x - x2 + 2x - 2 - 4x. Determine m(y). 1 Let m(b) = 0b + 2b + 338 - b - 346. Determine m(0). -8 Let g(b) be the first derivative of -b4/4 - b3/3 - b2/2 + 4b + 1. Suppose -5q + 5n + 25 = 0, 2q - 2n - 19 = -3q. Let d = q + -3. Determine g(d). 4 Let u be -5 - (0/3 + -4). Let a(k) be the third derivative of -k7/1260 + k5/60 + k2. Let w(l) be the third derivative of a(l). Calculate w(u). 4 Let l(v) = v + 6. Let r be 0/11/(-1). Determine l(r). 6 Let a(t) = -271t + 0 + 272t + 6. Calculate a(-8). -2 Let j(k) = k - 1. Let i(n) = n*3 - 2. Let r be i(2). Let p be r-21/(-4). Give j(p). 2 Let j(r) = 5r*2 + 3r - 6. Let w(d) = -d*2. Let q(g) = j(g) + 4w(g). What is q(-6)? 12 Let u(g) = g*2 + g - 4. Let c(d) = d + 1. Let x(n) = -5c(n) - u(n). Suppose 11 = -2f + 1. Determine x(f). 4 Let i(w) = -3w - 4. Let n(c) = -c*3 - 4c2 - 3. Let s be n(-4). Let u be i(s). Let h(b) = 3 + 1 + b2 + 0b2 - 5b. Give h(u). 4 Let z(s) = -s*2 + 3s + 2. Suppose 3 = 3k - 6. Let p be z(k). Let y(r) = -1. Let v(j) = 4j*2 - 3j - 5. Let m(i) = v(i) - 5y(i). Calculate m(p). 10 Suppose -2d = 3 + 1, -5d = -4s + 18. Let w(o) be the first derivative of o4/6 - o3/3 + o2 + 3. Let a(h) be the second derivative of w(h). Give a(s). 6 Let t(k) be the third derivative of k9/60480 - k8/6720 - k7/5040 + k6/720 + k5/12 - 4k2. Let h(f) be the third derivative of t(f). Calculate h(3). -2 Let y(c) be the third derivative of c5/24 - c4/24 - c3/6 - 4c*2. Let q(u) be the first derivative of y(u). What is q(1)? 4 Suppose 0 = 3v + 3r + 1 - 4, -v + 5r = 17. Let o be (-33)/7 - v/(-7). Let w(b) = b*3 + 5b*2 + b. What is w(o)? -5 Let t(d) be the third derivative of 1/10d*5 + 0d + 5/6d3 + 2d*2 - 1/6d*4 - 1/120d*6 + 0. What is t(5)? 10 Let f(v) = -2v*3 - 13 - 2v - 5v + 2v*2 - 7v*2. Let i(b) = 3b*3 + 8b*2 + 11b + 19. Let j = -17 + 10. Let x(o) = jf(o) - 5i(o). Give x(-4). 4 Suppose 0 = 6m - m - 2b - 15, -2b = m - 3. Suppose -8 = -my + 7. Suppose yw = f + 18, 0 = 4f - 5 + 17. Let v(c) = -2c2 + 4c - 1. Give v(w). -7 Let s(b) = b*2 + 2b - 2. Suppose -6n - 12 = -3n. Give s(n). 6 Let j be -3(-2 + 5)/95. Let z(b) be the first derivative of b*3/3 + 7b*2/2 + 5b - 1. Calculate z(j). -5 Let h(o) be the third derivative of o8/6720 + o7/2520 + o*6/720 - 11o5/120 - o4/24 + 4o2. Let g(u) be the second derivative of h(u). What is g(0)? -11 Let v(c) = -c + 9 + c2 - 8 - 6. Determine v(0). -5 Let m be ((-2)/(-4))/(1/4). Let k(i) = 1 + m + 0 - i2 + 4i. Let x be 12/96 - 39/(-8). Give k(x). -2 Let l(z) = -2z - 3. Let q(y) = 2 - 4 + 3. Let h(j) = -l(j) - 4q(j). Let c(b) = b*2 + 9b + 11. Let m be c(-8). Calculate h(m). 5 Let q(d) be the third derivative of -5d4/24 - d3 - d2. Let f(n) = -14n - 18. Let b(x) = 4f(x) - 11q(x). Calculate b(-5). -1 Let w(y) = y - 16. Suppose 16o - 24o = -64. Calculate w(o). -8 Let u(v) = 10v - 17. Let c(h) = 5h - 8. Let x(r) = 13c(r) - 6u(r). Determine x(2). 8 Suppose n - 4n - 3 = 0. Let s(v) be the first derivative of 3v*4/2 - 2v3/3 + v - 4. Calculate s(n). -7 Let u = 26 - 22. Let z(n) = -n2 + 5n + 5. What is z(u)? 9 Suppose -28 = -3z - 22. Let s(h) be the first derivative of -1/4h4 - 3h*2 + zh*3 + 5h - 3. Give s(5). 0 Let o(n) = n*2 - 2n - 3. Let g = 10 - 5. Let i(f) be the second derivative of f4/12 - f3/3 - 3f2/2 + f. Let a(z) = gi(z) - 6o(z). Give a(4). -5 Let d(q) = -4 - 1 + 4q2 + q + q3 - 10q2. Let y be (10/(-15))/(4/(-36)). What is d(y)? 1 Let q(r) be the first derivative of r6/90 + r5/60 + r4/24 + r3 - 3. Let t(d) be the third derivative of q(d). Calculate t(-1). 3 Let n be 4 + (-6)/(-2) + 2. Let q(x) = 4x - 15. Let i(k) = -2k + 7. Let v(c) = ni(c) + 4q(c). What is v(3)? -3 Let l(j) = -j - 4. Suppose -2b - b = 3. Let o be (-1 + 2)0/b. Give l(o). -4 Let l(t) = 2t - 10. Suppose 0 = 5x - x - 16. Let s(h) = 2h - 10. Let r(g) = xl(g) - 3s(g). Let q be r(7). Let v(k) = k*3 - 3k*2 - 6k + 3. What is v(q)? -5 Let a(k) = -k*2 - 8k - 3. Let o(v) = v*3 - 5v*2 + 4v + 1. Let y be o(3). Give a(y). 12 Let u(n) = n - 6. Suppose 0 = 2i - k + 6, -8 = 2k. Calculate u(i). -11 Suppose 3l - 5l - 3n + 4 = 0, 0 = 2n. Let t(w) = 3w2 - 7w*l - w - 3w + w. Calculate t(-2). -10 Let s(z) = -5 - 62z + 66z - z*3 - 5z2 + z2. Calculate s(-5). 0 Let t(y) = -3 - 5 + 0y + 2y - 5y. Calculate t(-6). 10 Let p(u) = -u2 + u. Let b(h) = -7h*2 + 4h. Let r(w) = b(w) - 5p(w). What is r(-2)? -6 Let c(w) be the third derivative of -w4/6 - w3/2 - 23w2. Calculate c(-5). 17 Let t be (-2)/((-12)/9 - -2). Let l(h) = h3 + 4h2 - 4. Calculate l(t). 5 Suppose 0 = -7q + 11q + 24. Let x(c) = c2 + 7c + 7. Calculate x(q). 1 Suppose -3s = 2s - 25. Suppose 2w + 0w = 20. Suppose sr = -5 - w. Let m(h) = -h - 5. Determine m(r). -2 Let v(x) = x - 2. Let z(s) = -3s + 7. Let g(n) = 7v(n) + 2z(n). Let o(u) = -1 + 0 + 4 - 2 - 5u. Let a(t) = -6g(t) - o(t). Determine a(2). -3 Let q(i) = -2i - 6. Let f be q(-4). Suppose -5g = -j - 17, 5j + 1 + 4 = 5g. Let a(x) = 6 - 5 + 3x2 + xj + 4x + 3xf. Calculate a(-5). 6 Let v(t) be the first derivative of -t3/3 - 2t*2 + 5t - 4. Calculate v(-5). 0 Let d(z) = -11z3 + 8z*2 + 11z - 2. Let b(m) = -7m3 + 5m*2 + 7m - 1. Let r(c) = 8b(c) - 5d(c). Determine r(-2). 8 Let m(w) = -16w + 6. Let p(z) = -3z + 1. Let s(h) = -4m(h) + 22p(h). Let t(a) = 6a + 2 - a3 + 2 + 2a*3 + 5a*2. Let u be t(-4). Determine s(u). 6 Let f(b) = -11b2 - 1. Let c(q) = -q - 6. Let i be c(0). Let u = i - -7. Give f(u). -12 Let o(t) be the first derivative of -t4/2 - 4t3/3 - 3t*2/2 + 2. What is o(-2)? 6 Let y(a) = -5a3 + a2 - a - 1. Let r(n) be the first derivative of n4/4 + n3/3 - n*2/2 + 3. Let x(t) = -4r(t) - y(t). What is x(4)? 5 Let j(n) = -7 - 8 + 7 - n*2 + 0n*2 - 7n. Give j(-6). -2 Let b(m) = 2m + 8. Suppose 5z - 2n + 17 = -11, -4 = 4n. Calculate b(z). -4 Let l(w) = w*2 + 6w + 4. Let x(o) = 7o. Let s be x(2). Let f = s - 18. Give l(f). -4 Let n = -1 - -3. Let b(a) be the second derivative of a4/3 - a3/2 + 15a. What is b(n)? 10 Let s(h) = -13h2 - h + 9. Let r(f) = -7f*2 + 5. Let m(u) = 11r(u) - 6s(u). Give m(-5). -4 Let u(k) = 43k + 40k - 81k. What is u(1)? 2 Let n(f) be the second derivative of 3f4/4 - f3/6 + 10f. Give n(-1). 10 Let o(x) be the first derivative of x4/4 - x3/3 - 2x2 - x - 1. Suppose -1 = 2h + 3. Let n be 2 + 2(-1)/h. What is o(n)? 5 Suppose -2m + k + 11 = 2, -2k - 10 = 0. Let b(f) = -10f*2 + 3. Let g(z) = 3z*2 - 1. Let u(s) = -2b(s) - 7g(s). Calculate u(m). -3 Let j(h) be the first derivative of h4/4 + h3/3 + h2/2 + 2h + 3. Let y be (-1 - -2 - 2)0. Suppose -t - t = 2i, t = y. Calculate j(i). 2 Let p(b) = 26b - 2b*2 - 26b + 0b2. Let g be (-4)/31-3. Suppose -36 + 14 = -2j + 5c, -5j = -gc - 21. Give p(j). -2 Suppose 2v + 2o + 8 = 7v, -4v + 3o = -5. Let a(y) = -3yv + 4y + 2 - 3y + y2. Suppose 4f + 6 = 3g, f + 2 = -1. What is a(g)? -8 Let i = 1 - -1. Let t(l) = 6l*2 - 18 - 5l*i + 12l + 0l2. Let y be t(-13). Let d(q) = -q2 - 7q - 3. Calculate d(y). 7 Suppose 16 = -6o + 2o. Let d(x) = 2x + 2. Determine d(o). -6 Let v(u) be the third derivative of -u6/120 - u5/60 - u4/12 - 3u*2. Determine v(-2). 8 Let w(r) = -47 + r + 2r + 42 - 4r. Let g(q) = q - 10. Let k be g(6). Determine w(k). -1 Let o(d) = -d - 2. Suppose 4 = -4g, 4g + 12 = -4x - 0x. Let p be (2 - (-3)/x)0. Calculate o(p). -2 Suppose 7i = 2i - 20. Suppose -5x = -3d - 5, -4d + 0d + 4x + 4 = 0. Let v(t) = t + 1 + 0 + 2t*2 - d + 4t. Give v(i). 8 Let q(v) be the second derivative of 2v2 - 2/3v*3 + 0 - 1/12v4 + v. Determine q(-3). 7 Let b(d) = d2 - 2d - 1. Let h = 2 - 4. Determine b(h). 7 Let r(w) = -w*2 - w	{ "pile_set_name": "DM Mathematics" }
(d) be the first derivative of -d*2/2 + 6d + 2. Let p be v(9). Does 4 divide (-69)/(-15) - p/(-5)? True Suppose 5s + 9 + 18 = 4f, 5s + 2f = -9. Does 19 divide 1/((-3)/(-177)) - s? False Let s = 217 + -113. Is 13 a factor of s? True Suppose -3c - 3p - 8 = -p, -4p - 16 = 5c. Suppose n - 18 = -cn. Is 18 a factor of n? True Let b be (-6)/8(-6 + 42). Let v be (-2)/(-5) + (-15)/(-25). Is -2 + (v - b) - 0 a multiple of 9? False Suppose -o + 19 = -16. Does 9 divide o? False Let d(y) = -3y. Let u be 2/1 - (9 + -3). Does 5 divide d(u)? False Suppose 5370 = 12j + 1338. Does 42 divide j? True Let k(i) = -15i + 1. Let s = -4 + 6. Let w be k(s). Let b = w + 59. Is b a multiple of 8? False Suppose 5o + 8 = -2. Let r(p) = p*2 + 1. Let d be r(o). Suppose q - 5 = 2k, 4q + 3 = dk + 23. Does 5 divide q? True Suppose -2t = -2c + 240, -2t = -5c + 858 - 249. Suppose i = -2i + c. Is 13 a factor of i? False Suppose -4b - 12 = 4x, -5x + 5b - 34 = -9. Let r(a) = 3a*2 + 5a - 3. Let o be r(x). Suppose 0 = 5c - o, 5c = -4l - 0l + 41. Is 2 a factor of l? True Let h be 2096/20 - (-2)/10. Let g = h - 72. Does 14 divide g? False Suppose 0g - 2g = -2q - 10, 4g + 3q = 41. Let w(l) be the second derivative of l5/20 - 7l*4/12 - 4l*3/3 + 3l*2 + l. Does 3 divide w(g)? True Is (3/(-9))/(2/(-108)) a multiple of 3? True Suppose -a = -2y + a + 8, -y - 3a = -8. Suppose 5l - 3t = 5, 0l = -l + yt + 1. Is 4l + 0 + 2 a multiple of 3? True Let t(j) = j + 2. Let a be 58/8 + (-1)/4. Is t(a) a multiple of 9? True Let l(q) = q*3 - 2q*2 + q - 1. Suppose 5s = 2r + 28, 3s + 3r + 28 = 7s. Let o be l(s). Is 8/(-12) - o/(-3) a multiple of 7? False Is ((-50)/(-15))/(3/99) a multiple of 22? True Suppose -3t + 74 = t + 2m, -54 = -3t - 3m. Suppose 0 = -4p + 3p + 2l + 35, -p = 2l - t. Suppose -4c + p = -9. Is c a multiple of 7? False Let w(q) = -q2 - 7q + 1. Let b be w(-6). Let p(s) = -s*2 + 10s - 7. Does 9 divide p(b)? False Let v = 9 - 21. Let b = 24 + v. Is b a multiple of 3? True Suppose 3o = 2q - 170, 2o - 4 = 4o. Is q a multiple of 41? True Let r be (-105)/(-49) + 1/(-7). Suppose -5j + 2i + 55 = 0, -rj - 4i = -6 - 16. Is 3 a factor of j? False Let s(y) = y*2 + 2y - 1. Let j be s(1). Suppose 3k - 37 = -x + jx, 0 = -2k - 3x + 43. Does 5 divide k? False Let c(y) = -9y2 - 33y - 21. Let a(p) = 4p2 + 16p + 11. Let u(s) = -7a(s) - 3c(s). Is 4 a factor of u(-11)? True Suppose 67 = f - x, -3f + 4x - 6x + 216 = 0. Is 5 a factor of f? True Let u = 11 + -24. Suppose 2p - 112 = -5c, 0 = -0c + c + 4p - 8. Let d = c + u. Does 8 divide d? False Suppose -4o = 3f - 416, 0 = -o - 5f + 80 + 24. Suppose -4w + 2u = -0u - o, 2w - 5u - 68 = 0. Is w a multiple of 12? True Let g = 66 - 122. Does 4 divide g/6(-12)/8? False Let z be 46/(-5)(2 + 3). Is 19 a factor of (z/(-3))/(2/6)? False Let g(l) = l + 1. Let f be 3/(-12) - (-43)/(-4). Let i = f + 19. Is 4 a factor of g(i)? False Suppose -2q + 140 = 3a, -2q + 16 = 2q. Suppose 4d + a = 4b, -3b + 5d + 36 = 5. Is 6 a factor of b? True Let m(v) = v - 5 - v2 + 4v - 4v + 7. Let s be m(0). Suppose -w + 18 = sw. Is w a multiple of 6? True Let d(k) = k + 2. Let t = 2 + -2. Let j be d(t). Suppose -57 - 23 = -ju. Is u a multiple of 20? True Suppose -6q + 1091 = 371. Does 9 divide q? False Suppose -2r = -0r - 4. Suppose ri - 7i + 355 = 0. Is i a multiple of 16? False Let w = 8 - 3. Let b = w + 1. Does 2 divide b? True Let o = 27 + -11. Suppose 5j = j + o. Is 4 a factor of j? True Suppose -5x - 71 = -5w - 446, -3w + 55 = x. Is 10 a factor of x? True Let y be (-4 + 0)/(-1) + -1. Suppose 1 = 4o + yv - 4, 4o - 30 = 2v. Suppose 0 = 5f - h - 37, 0 = -h + oh + 8. Is f a multiple of 3? False Let k = -11 + 13. Suppose -2m = 4g - 42, -km - g - 5 + 41 = 0. Does 17 divide m? True Let s be (-4)/(-10) - (-4)/(-10). Let t be 4(-3)/18-12. Let w = t - s. Is w a multiple of 3? False Suppose 0 = 9z - 4z - 40. Is 8 a factor of z? True Suppose 14 = 4x - 2b, -3x - b - b + 7 = 0. Let i(d) = 3d2 - d + 1. Is i(x) a multiple of 10? False Suppose 26v = 25v + 63. Is 21 a factor of v? True Let k(o) = -o3 + 4o*2 + o - 2. Let w be k(4). Suppose 3h - 2v = 12, -4h + 33 = 7v - 4v. Let u = h - w. Is 4 a factor of u? True Let o(f) = f - 7. Let a be o(8). Let c(p) = 21p + 1. Is c(a) a multiple of 11? True Let q = 0 + 2. Suppose -qu = u. Suppose -2v - v + 51 = u. Is 17 a factor of v? True Is (-346)/(-18) - (-6)/(-27) a multiple of 3? False Suppose -3k = -6k. Suppose k = 3n + 3 - 9. Suppose -7 = -nh + 23. Is 6 a factor of h? False Let f be 8/(-4) + (-1 - 2). Let k = 5 - f. Does 3 divide k? False Let o(d) = -7d + 7 - 11d + 17d. Is o(3) a multiple of 2? True Let b = 54 + -37. Is 17 a factor of b? True Let u(v) = 2v - 5. Let w be u(5). Suppose 0 = -wo + 202 + 83. Is o a multiple of 15? False Is 13 a factor of ((-19)/38)/(1/(-74))? False Let v(r) = -11r3 + 2r*2 - r - 2. Is v(-2) a multiple of 24? True Suppose -10 = -3q - 1, 5q = 2b - 9. Does 4 divide b? True Let s(n) = -15n - 5. Let k be (2 + (-9)/6)-12. Let y be s(k). Let h = y - 42. Is 15 a factor of h? False Let p = 264 + -91. Let k = p - 110. Does 21 divide k? True Suppose -3b = -5b + 30. Is (-26)/(-3) + 5/b even? False Let c = 6 + -4. Suppose 3i - 104 = -5o, -i - 4o - 29 = -ci. Is i a multiple of 12? False Let o(b) = -b*3 + 8b*2 + 11b - 7. Let h = 25 + -16. Is 8 a factor of o(h)? False Suppose 0 = 4u + 3o + 2, u = 3u + 2o. Is u((-57)/6 + 1) a multiple of 17? True Let k be 0 + (-4)/((-12)/9). Suppose -kr + 131 = 50. Is 9 a factor of r? True Suppose -z + 3m + 104 = 0, -4z = -6z - 3m + 244. Let v(u) = -3u + 4. Let k be v(0). Suppose 47 = 2c + o - 0o, -z = -5c - ko. Is 24 a factor of c? True Suppose -2r + 3j = -7r + 7, 8 = 5r + 2j. Let f be -1 + -1 - r/2. Is 14 a factor of f2/(-9)30? False Let x = 27 - -6. Is x a multiple of 10? False Suppose -6c + 500 = -2c. Suppose 5b + 20 = c. Is 7 a factor of b? True Let x(g) = 12g*2 - 12g - 1. Does 19 divide x(-5)? False Let l be 7/2 + 2/4. Let r(v) = v. Let h be r(l). Suppose -4u + 4o + 64 = 0, -o = 4u + ho - 28. Is u a multiple of 6? True Suppose -5q = -5j + 39 + 6, 5q + 27 = -4j. Let l(v) = -v*3 - 6v*2 - 2v + 10. Is 16 a factor of l(q)? False Let q = -64 - -146. Let b = q + -29. Is b a multiple of 20? False Let w(h) = h*3 + 12h*2 - 15h - 13. Is 2 a factor of w(-13)? False Let k = 5 - 9. Does 17 divide ((-2)/k)/((-4)/(-136))? True Let a(q) = 17q - 35. Is a(8) a multiple of 10? False Let p(s) = s2 + 5s. Suppose 3w + 29 = 11. Let i be p(w). Does 17 divide 34/i - -15? True Let f = -7 - -13. Let p(o) = o*3 - 6o*2 + 7o - 1. Is 16 a factor of p(f)? False Let z(j) = j*2 + 3j + 1. Let a be z(-5). Suppose -2l + 3 = a. Is 21 a factor of l/3(-126)/4? True Let t = 28 - 1. Suppose -4j = -7j + t. Does 2 divide j? False Suppose -2b = -5v - 0 - 6, -5v - 15 = -5b. Suppose f + bp - 22 = -f, 4f - 4p = 84. Is 17 a factor of f? True Let n = -73 + 10. Suppose -2h + h = i - 100, 4i = -3h + 402. Let s = i + n. Does 14 divide s? False Let o(c) = -2c + c - 2c - 16 + 6. Is o(-8) a multiple of 7? True Let r be (-1 - -45) + 4 + -4. Suppose q - 49 = -3t + 12, 4q - r = -2t. Is t a multiple of 10? True Let a(c) be the first derivative of -c3/3 + 3c*2 + 10c + 2. Let i be (-2)/6 - 66/(-9). Does 3 divide a(i)? True Suppose -5d - 1 = -26. Suppose -ds + 27 = -38. Suppose 0 = -3r - 2b + 54, 1 - s = -4b. Is 10 a factor of r? False Let n = -120 + 173. Is n a multiple of 8? False Suppose 2 = 2c - 4, 3l = c + 3. Suppose 2m = h + 8, lm = -h + 3m - 4. Suppose -4t = -ht - 192. Does 25 divide t? False Let t(m) = -m*2 + 5m + 6. Let g(b) = b*2 + 11b + 15. Let u be g(-10). Is 3 a factor of t(u)? True Let s = 16 + 53. Is 3 a factor of s? True Let m be (3 + 0)/(3/2). Suppose -2a + 20 = -2h, 0h + 36 = ma + 2h. Is 4 a factor of a? False Suppose -75 = 5q + 2c + 80, 2q + 2c = -56. Does 24 divide 8/(-6)(q - 3)? True Does 27 divide (-7)/((-6)/(-174)-1)? False Let a = -70 - -127. Is a a multiple of 11? False Let y be (8/(-20))/((-3)/60). Suppose 12a - y*a - 232 = 0. Does 29 divide a? Tru	{ "pile_set_name": "DM Mathematics" }
8i Expand (-6c*2 - 3c*2 - 16c*2)((-3 + 4 - 2)(3c - 4c + 3c) + 6c + 2c - 4c + c - 3c + c). -25c3 Expand (-3m - 1 + 4m - 4)(-m + 0m - m + (-3 + 3 + m)(0 - 309 + 21)). -290m2 + 1450m Expand (k - 7k - 3k)(0 + 3 - 2)(-4 + 4 + 1)(-3 + 2 - 1)(-14 + 9 + 42)(-1 - 6 + 4). -1998k Expand (1 - 1 - 2b)(-4b2 + b2 + 1334529b - 1342876b). 6b*3 + 16694b*2 Expand (1 - 4 + 2 + (5 - 2 - 1)(0 + 1 - 2) - 3 - 2 + 2 + 48 - 22 - 24)(o - 2 + 2 + (-1 + 2 - 2)(-2o + 4o - 3o)). -8o Expand (3413d2 + 1285d*3 - 6835d*2 + 3422d*2 + 2476d*3)(-5 + 1 + 0). -15044d3 Expand (-10 + 6 + 15)(-6f - 2f + f) + (6 - 2 + 2)(0f - 2f + f) + 2f - 5f + f + (-1 + 0 + 3)(-2 - 2f + 2). -89f Expand (f5 + f5 - f*5)(1 - 1 - 2)(2 - 2 + 6)(-19 + 71 - 7). -540f5 Expand (2c*4 - 4c*4 + 0c + c)((-5 + 3 + 3)(1 - 3 + 3) + (0 + 1 + 0)(-5 + 4 - 5) - 2 + 5 + 1). 2c*4 - c Expand (7 + 9 - 22)(-2w + w - 3w + (-5 + 2 + 4)(-w + 0w - w))(0 - 2 + 1)(-5 - 10 + 5). 360w Expand (2w - 3w + 2w)(-w4 - 5w*4 + 3w*4) + 2535 - 2535 + 41w*5 + 68w*5 + 4w2 + w2 + w*2 - 6w*2. 106w*5 Expand (13 - 13 - 2d*2)(-5d2 - 3d*2 + 0d*2) - 10d*2 - 9d*4 + 10d*2. 7d*4 Expand -2693v - 70v3 + 2693v + (2 - 2 + 2)(9v*3 - 2v3 + v3 - 4 - 2v3 + 4 + (-2v*2 + 2 - 2)(5v + 0v - 3v)). -66v*3 Expand (2 - 1 - 2)(-204w5 + 1570w*5 - w - 81w*4 + 85w*4). -1366w*5 - 4w*4 + w Expand (15c - 11c - 19c)(3 - 5 + 0) + 2c + 0c + 0c + 1 + c - 1 + (c + 0c + c)(-1 - 3 + 5) - c + 4c - c. 37c Expand 53t3 - 3t*4 - 53t*3 + (-1 - 4 + 1)(-t*4 + 3t*4 - 4t*4). 5t*4 Expand (5099 - 5099 + 459b)(-2b*4 + 11b*4 + 5b*4). 6426b*5 Expand (3310 - 3310 - 36w)(3 + 0 - 2)(-3w - 8 + 20 - 13). 108w*2 + 36w Expand (-3p + 7p - 20p)(2p2 - 2p + 2p) + (6 - 6 + p)(-7p2 + 14p - 14p). -39p*3 Expand 11m*2 + 7m*2 - 8m*2 + (3m - 4m - m)(-2 + 2 + m) - 695m2 + 86871 - 86871 + m. -687m*2 + m Expand (34829n - 18198n - 17872n)(-4 - 1 + 3)(-3n3 + 2n*3 + 0n*3). -2482n*4 Expand 143f*2 - 23f*5 - 143f*2 + (-3f*5 + 6f*5 - 2f*5)(-1 - 9 + 4) + 3f5 - 8f*5 + 4f*5 + 0f*5 + 3f*5 - 4f*5. -31f*5 Expand (b - 3b + 4b)(2b4 - 2b*3 + 2b*3) + (-24 + 24 + 13b)(8b*4 + 2b*4 + 2b*4) + 0b*4 - 7b*5 + 0b*4. 153b*5 Expand (4 - 4 - 3)((-g + 2g - 2g)(3g2 - g2 - g*2) - 4g*3 + 2g*3 + 4g*3 + 3g - 3g - 2g3 - g3 + 3g3 - 4g*3 - 1417 + 1417 + 163g*3). -480g*3 Expand -87k - 74k + 308k - 38k - 130k + 30k + k - 2 + 2 + 2k + 2k - 3k + (-2k + 3k + k)(-1 + 1 - 2). 7k Expand (-31a - 23a + 53a)(-6a - 7 + 7)(17 - 5 + 4). 96a2 Expand (-8 + 13 + 17)(3y3 + y4 - 3y*3 + (-y + 3y - y)(-5y*3 + 2y3 + y3)) + (-2y2 - 4y*2 + 0y*2)(2y2 + 0y*2 + 2y*2). -46y*4 Expand (0 + 0 - j)(-4j3 + 2j*3 + 3j*3) + ((j - j + j)(-2 + 2 - j) + 22j2 + 2j*2 + 88j*2)(0 + 6j2 + 0). 665j*4 Expand (2q*2 - 2q*2 - 2q*3)(556 - 16q2 - 564 - 78q*2). 188q*5 + 16q*3 Expand x - 2x + 0x + (-x - 2x + 4x)(0 + 1 - 2) + 3x - x - 3x + 0x + x + 0x + 3x + 31x + 16x + (0 + 0 - 2)(-1 + 1 + 2x) - 15x - 3x + 5x. 31x Expand (-3a - a - a)(a - a - 2a) + (-a + 3a - a + (-2 + a + 2)(8 + 0 - 4))(4 - 4 + a). 15a*2 Expand -41y - 6y + 7y + (-3y + 4y - 2y)(-7 + 0 + 1). -34y Expand (2k + 2 - 2)(4k - 3 + 3) + 185k2 + 3 - 363k*2 + 190k*2 + 4k. 20k2 + 4k + 3 Expand (-2 + 2p + 2)(-p + 189 - 189) - 3122 + 56p2 + 3122. 54p*2 Expand (0m + 0m + 4m)(56m + 67 - 26m - 32m). -8m2 + 268m Expand 10k3 + 18k*3 + 8k*3 + 0k*3 + 2k3 - k3 + (1 - 1 + 2k)(-k*2 + 3k*2 + 2k*2) + 2k3 - k3 - 2k3. 44k*3 Expand (-82 + 146 + 107)((0 + 0 + 1)(n2 + 3 - 3) - 3n*2 + 0n*2 + 4n*2). 342n*2 Expand 8 - 2o3 - 8 + (-o2 - 2o2 + 2o*2)((4 - 1 - 1)(0o - 3o + 4o) + 60o - 110o + 72o). -26o*3 Expand (1013627 - 1013627 + 2148f)(2f*2 - 4 + 4). 4296f*3 Expand (-15118c - 1149c + 4090c)(0 + 0 - 3c + 1 - 2c - 1 - c - 4c + 3c + (-2 + 4 - 4)(-2c + 1 - 1) + c + 1 - 1 - 2c + 3c + 0c + 3c - 4c + 3c). -12177c*2 Expand (4r + 6r - 6r)(-r - r + 0r) + 467r2 - 331r*2 - 292r*2. -164r*2 Expand (345x*2 + 5066x - 10115x + 5052x)(x3 - 3x3 + x3). -345x5 - 3x*4 Expand (5 + 0r + r - 2)(-1268 - 662 + 379 - 451 - 781). -2783r - 8349 Expand (-7y - 2153 - 6y + 2150)(-1 - 3 - 1 - 3). 104y + 24 Expand (1 + 3 - 5)(5 + 308n*2 - 323n*2 - 3). 15n*2 - 2 Expand -1487i*4 + 1028i*4 + 734i*4 + (-2i*2 + 2i*2 + 2i*3)(-4i + 3i + 0i). 273i*4 Expand (0 - 4 + 2)((-2 + 2 - 2b)(-4b + 3b + 5b) + 74b - 74b + 9b*2). -2b*2 Expand (3r - 2r + r)(24 - 24 - 8r3)(34r + 78r - 184r) + r5 + r5 - 3r*5. 1151r*5 Expand (4u - 3u - 2u)(1 - 1 + 2u + (12 - 4 + 0)(2u - 4u + 3u) + 3u - 2u - 3u). -8u*2 Expand 0 + 2w*2 + 0 + (2w*2 + 0w2 - w2)(4 - 3 + 1) + w2 - 1 + 1 - 420w + 211w2 + 420w + 22w - 22w + 8w2. 224w*2 Expand -143b*2 - 203187b - 84b2 + 1199b*2 + 203189b + 678b2 + (-4 - 2b + 4)(5b - 2b - b) - 4b2 + b2 + b*2 - 5b*2 + 6b2 + b2. 1646b2 + 2b Expand 166a + 19a - 774a - 665a + (-2a - 3 + 3)(5 - 1 - 3) + 2a + 2a - 3a. -1255a Expand (-929f + 146f - 220f)(3 + 1 - 2f3 - 1). 2006f*4 - 3009f Expand -3z2 - z4 + 3z*2 + (2z*2 - 3z*4 - 2z*2)(33 - 40 + 27) + (4z2 - 4 + 4)(24z2 - 58z*2 + 7z*2). -169z*4 Expand 2w*4 + 2w*4 - 3w*4 + (2w2 + w2 - 2w2)(2w2 - 1 + 1) + (-3w + w - 4w)((4 - 4 - 2)(0 + 2 - 3) + 2 + 4 - 10)(w*3 - 6w*3 + 0w*3). -57w*4 Expand -1 + 1 + 10n + (-3 + 0 + 8)(2 - 2 + 2n) + 3n - 3 + 0 - 4n. 19n - 3 Expand (-2n*3 - 3n*3 + 3n*3)(3n + 0n + 3n) + 8n*4 - 6n*4 - 7n + 19n. -10n*4 + 12n Expand (97 - 85 - 60)(-6u + 6u + 5u) + (2 + 0 - 1)(-6 + 3u + 6). -237u Expand (4a*2 - 7a2 + a2)(0a2 - a2 + 2a2) + 286a*4 - 343a*4 + 320a4 + (a3 - a2 + a2)(-2a - 2a + 2a). 259a4 Expand -458q + 1929q - 1289q + 6165q - 2q + 3q - 3q + (5 - 2 - 1)(-2q + 3q + q) - 2 + 2q + 2 + 2q + 0q - q. 6352q Expand -7z4 - z4 + 2z4 + (-8z + z*2 + 8z)(15z*2 + 22z*2 - 14z*2). 17z*4 Expand -27i*5 + 17i*5 - 80i*5 + (3i*3 + i - i)(i*2 + 2i*2 - 4i*2) + (3i - 3i + i5)(1 + 1 + 0). -91i5 Expand ((-1 - 1 + 1)(0 - 2 + 4) + (-2 - 1 - 1)(2 + 0 - 1))(928x2 - 1500x*2 + 2x*4 + 0x*4 + 2). -12x*4 + 3432x*2 - 12 Expand (-4y + 4y + 5y)(-2 + 3 + 0) + 3y + 6 - 6 + 2y - y + 2y - 9y - 21 + 21. 2y Expand 4y3 - 91y*5 - 8045y*2 + 8045y2 + (y3 - 3y3 + 3y*3)(-2y2 - 2y*2 + 2y*2). -93y*5 + 4y*3 Expand -9q - 7q2 + 9q + (7 - 3 + 125q - 112q)(5q - q + q). 58q2 + 20q Expand 485l - 485l - 235l3 + (2 - 1 + 0)(-2l2 + 2l2 - l3) + 3l3 - 4l3 - l3. -238l3 Expand (-9 + 6 + 0)((1 + 0 - 3)(-2 + 4 - 1) + 55 + 43 + 61)(-3 + d + 3). -471d Expand (u + 2u - u)(6 + 6 - 3) + 5u + 2u + 2u - 21u - 8 + 8. 6u Expand (2n2 + 2n*3 - 2n*2)(-4 + 5 + 1) + 3n3 - 6n*3 - 6n*3 + (-3n - 3n + 3n)(6n + 5n - 4n)(2n + 25n + n)(0 + 0 + 1). -593n3 Expand (6 - 12 + 7 + 3 - 1 - 3 + (1 - 1 + 3)(8 - 3 + 7) + 1 - 4 - 1)(2l - l - 2l). -32l Expand -2153z2 + 29z + 2153z2 + 20z*3 - 180z*3 + (-z - z + 3z)(-5z*2 + 3z*2 + 3z*2). -159z*3 + 29z Expand -5395q3 - 764138 + 764138 + (-2 + 4 + 0)(-1 + 1 - q*3). -5397q*3 Expand (3h*3 - 3h*3 - 2h*3)(-5235 + 5235 + 2790h). -5580h*4 Expand (-7v + 0 + 0)(-245 + 59 - 60). 1722v Expand (-11p + 6p - 13p)(-1 + 1 + 2)(3 - 6 + 1) + 52 - 52 + 2p. 74p Expand (3s - 8 - 65s + 6)(1 - 2 - 1)(2s + s - 4s) + s2 + 6s*2 + 2s*2. -115s*2 - 4s Expand (5d2 + 1 - 1)(57d - 15 + 264d + 283d - 10d + 13). 2970d3 - 10d*2 Expand (2o + 3 - 3)(114 - 114 - 10o*2 - 2o*4) + (0 + 0 + o)(-28 - 8o4 + 28). -12o*5 - 20o*3 Expand (25a4 - a + a3 - 12a4 + 41a*4)(	{ "pile_set_name": "DM Mathematics" }
4. 4 Calculate 8313 divided by -2771. -3 49 divided by -2 -49/2 What is -318 divided by 8? -159/4 What is -25 divided by -5? 5 What is -8 divided by 1? -8 Divide 735 by -3. -245 Calculate 2960 divided by 4. 740 What is 17 divided by 586? 17/586 Calculate 84 divided by -3. -28 -362 divided by 2 -181 Calculate -33 divided by -4. 33/4 What is -35 divided by 5? -7 -965 divided by 1 -965 What is 47 divided by 2? 47/2 What is -5 divided by 299? -5/299 Calculate 5 divided by 402. 5/402 Calculate -2868 divided by -1434. 2 Calculate -470 divided by -1. 470 What is -2212 divided by -4? 553 Calculate 10 divided by -17. -10/17 Divide -155 by -1. 155 73 divided by 2 73/2 Calculate 7740 divided by 10. 774 What is 1937 divided by -3? -1937/3 -145 divided by -29 5 What is 5796 divided by 276? 21 Calculate 0 divided by -393. 0 What is 3072 divided by -256? -12 -15 divided by -596 15/596 -6015 divided by 3 -2005 -9252 divided by 6 -1542 Calculate 480 divided by -120. -4 Divide 114 by -1. -114 Calculate -6 divided by -9. 2/3 Divide 5 by -407. -5/407 Calculate 21 divided by -156. -7/52 Divide -4 by -6647. 4/6647 Calculate 1 divided by 27. 1/27 Divide -840 by -21. 40 Divide 1332 by 1. 1332 Divide -50 by 4. -25/2 What is 12082 divided by -2? -6041 -2360 divided by -6 1180/3 63 divided by 21 3 What is 12114 divided by 1? 12114 What is -4 divided by -4576? 1/1144 Divide -135 by -27. 5 What is 3 divided by -217? -3/217 Divide 1 by -514. -1/514 Calculate -4 divided by -69. 4/69 Divide 8 by -6. -4/3 What is -11 divided by 2? -11/2 -1046 divided by -12 523/6 Divide -7 by -1681. 7/1681 Divide -963 by -321. 3 -205 divided by -100 41/20 8470 divided by -5 -1694 Calculate -5 divided by 184. -5/184 What is -2 divided by -55? 2/55 Divide -2975 by 595. -5 What is 120 divided by -3? -40 What is -393 divided by 3? -131 1308 divided by -327 -4 0 divided by -3679 0 What is 3528 divided by -252? -14 -13 divided by -531 13/531 Calculate 2772 divided by -924. -3 What is 11076 divided by 4? 2769 Divide -1 by 203. -1/203 Divide 370 by -1. -370 What is 39 divided by -26? -3/2 3885 divided by -1295 -3 0 divided by 17 0 Divide 93568 by -4. -23392 What is 0 divided by 1? 0 Divide -144 by -2. 72 Calculate 28 divided by -62. -14/31 Divide 10280 by -2570. -4 Divide 22 by 3. 22/3 Calculate -3180 divided by 1590. -2 What is -210 divided by -14? 15 Calculate 256 divided by 64. 4 What is -44 divided by -1? 44 -2 divided by 8 -1/4 Calculate 1045 divided by 5. 209 What is 2520 divided by 360? 7 275 divided by -6 -275/6 20216 divided by 5054 4 Divide -4112 by -2. 2056 3 divided by -46 -3/46 Divide 1656 by 1. 1656 What is -483 divided by 2? -483/2 Divide 1236 by -6. -206 Calculate -57 divided by -4. 57/4 What is -1425 divided by -285? 5 What is 4086 divided by -6? -681 Calculate 31 divided by -5. -31/5 Calculate -84 divided by 76. -21/19 What is 5 divided by 75? 1/15 -145 divided by 145 -1 139 divided by 6 139/6 333 divided by 333 1 Divide 1014 by -3. -338 Divide -3 by 142. -3/142 Calculate 114 divided by -19. -6 What is 33 divided by -1? -33 What is 780 divided by -30? -26 Divide -2181 by -1. 2181 1 divided by 26 1/26 Calculate 9075 divided by 25. 363 Calculate -15441 divided by -5147. 3 Calculate -2 divided by -8. 1/4 2 divided by 72 1/36 -360 divided by -72 5 Divide 2412 by 6. 402 4900 divided by -245 -20 What is -468 divided by -3? 156 Calculate 4268 divided by 2134. 2 Calculate -135 divided by -9. 15 Divide 2140 by 1. 2140 What is 9150 divided by -1830? -5 Calculate 108 divided by 77. 108/77 What is -15290 divided by -3058? 5 -3375 divided by -1125 3 3 divided by -23 -3/23 1 divided by 114 1/114 What is 24819 divided by -2? -24819/2 Divide 1364 by 31. 44 What is 73 divided by 3? 73/3 Divide -3 by 2852. -3/2852 -3 divided by 840 -1/280 Calculate -57 divided by 1. -57 Divide -2464 by 2. -1232 Calculate -177 divided by 4. -177/4 3 divided by 30 1/10 Calculate -4110 divided by -6. 685 What is -19 divided by -1540? 19/1540 Calculate -3876 divided by -3876. 1 Calculate 234 divided by -6. -39 Calculate -67 divided by -67. 1 Calculate 2052 divided by -513. -4 Calculate 2 divided by -107. -2/107 Divide 5 by 707. 5/707 Calculate -43 divided by -1. 43 -5013 divided by 557 -9 Calculate 10844 divided by -6. -5422/3 What is 1055 divided by -4? -1055/4 -47 divided by 47 -1 Divide 172 by 2. 86 Calculate 192 divided by -32. -6 Calculate -6 divided by 23. -6/23 What is -5980 divided by -5? 1196 -3 divided by -1 3 -354 divided by -3 118 What is 272 divided by -4? -68 Divide 1 by 29. 1/29 Divide -45204 by -6. 7534 Divide -2 by -116. 1/58 Calculate 510 divided by 4. 255/2 -1515 divided by -3 505 -7348 divided by -668 11 Calculate 6355 divided by -5. -1271 34826 divided by 1 34826 Calculate 60 divided by 15. 4 Calculate -620 divided by -9. 620/9 What is 8 divided by 15? 8/15 Divide -117 by 13. -9 Divide -2 by -77. 2/77 Divide 6 by 900. 1/150 1216 divided by -4 -304 What is -2638 divided by 1? -2638 Divide -1449 by -7. 207 1044 divided by 3 348 Calculate 5 divided by -1886. -5/1886 -29 divided by -29 1 Calculate 5 divided by 342. 5/342 Divide -2130 by 2. -1065 What is -8 divided by -76? 2/19 Divide 4962 by 1654. 3 Divide -40 by 47. -40/47 Calculate 5 divided by -51. -5/51 Divide 62 by 24. 31/12 Divide -414 by -2. 207 Calculate -36 divided by -9. 4 Calculate -20 divided by 4. -5 Calculate -6135 divided by 5. -1227 Divide 3 by 1296. 1/432 Divide 1806 by -301. -6 236 divided by 4 59 Divide 10955 by 5. 2191 Calculate -5280 divided by 6. -880 What is -1 divided by -71? 1/71 Divide 260 by -52. -5 -3 divided by -32 3/32 What is -3 divided by 28? -3/28 Divide -2 by 3. -2/3 83 divided by 4 83/4 Divide -321 by 15. -107/5 -726 divided by 1 -726 What is -130 divided by -65? 2 What is 5 divided by 23? 5/23 0 divided by -72 0 Calculate 2249 divided by -1. -2249 Divide 1929 by -643. -3 -2 divided by -61 2/61 -2929 divided by 4 -2929/4 15 divided by 1 15 -855 divided by -57 15 -29920 divided by -5 5984 What is -240 divided by 48? -5 Calculate 178 divided by 24. 89/12 Calculate 558 divided by 31. 18 Divide 12642 by -602. -21 Calculate -437 divided by 23. -19 Calculate 2508 divided by -418. -6 Calculate 2288 divided by -4. -572 Calculate -35 divided by -164. 35/164 What is 272 divided by -4? -68 What is 328 divided by 1? 328 Calculate 322 divided by 3. 322/3 -384 divided by -4 96 What is -19 divided by -221? 19/221 Divide 1420 by 284. 5 184 divided by -92 -2 What is -120 divided by -24? 5 Calculate -61 divided by 16. -61/16 Calculate 0 divided by 2425. 0 What is -7992 divided by -72? 111 Calculate 822 divided by -1. -822 Calculate 52 divided by -26. -2 Calculate 31 divided by 30. 31/30 Calculate 90 divided by -5. -18 -175 divided by 1 -175 Divide -222 by -37. 6 -4220 divided by 1055 -4 What is 0 divided by 109? 0 What is 0 divided by -14? 0 What is -40 divided by 1? -40 Divide 647 by 5. 647/5 Calculate -154 divided by 1. -154 47 divided by -179 -47/179 Calculate -1 divided by 1451. -1/1451 Calculate -8 divided by 431. -8/431 13746 divided by 4582 3 Divide 223 by 10. 223/10 3 divided by 54 1/18 5 divided by -129 -5/129 What is -620 divided by -4? 155 Divide 72 by -3. -24 What is 1 divided by -251? -1/251 Divide 621 by 5. 621/5 Divide 825 by -3. -275 What is -3 divided by -30? 1/10 -658 divided by -94 7 What is 36 divided by 4? 9 Divide 1224 by 3. 408 Calculate 123 divided by 51. 41/17 10467 divided by -3489 -3 Calculate -656 divided by -4. 164 Divide 144 by 4. 36 What is 79 divided by -39? -79/39 What is -5368 divided by 4? -1342 -4 divided by -80 1/20 What is 26315 divided by -95? -277 125 divided by 14 125/14 245 divided by 49 5 Calculate 395 divided by 79. 5 Calculate -2 divided by -1016. 1/508 Calculate 35 divided by 15. 7/3 18692 divided by -1 -18692 994 divided by -3 -994/3 Calculate 7 divided by 19. 7/19 Divide -25032 by -24. 1043 Divide 13704 by 1142. 12 Divide 1 by -74. -1/74 Calculate 3860 divided by 4. 965 -340 divided by -68 5 What is 3 divided by -59? -3/59 -28520 divided by 3565 -8 -263 divided by 1 -263 Calculate 0 divided by 1395. 0 What is -1494 divided by -3? 498 What is -11754 divided by 3? -3918 What is -4 divided by -109? 4/109 -18 divided by -291 6/97 What is 0 divided by 231? 0 Calculate 6440 divided by -4. -1	{ "pile_set_name": "DM Mathematics" }
to the nearest integer? 11 What is 43012 to the power of 1/2, to the nearest integer? 207 What is 9116 to the power of 1/3, to the nearest integer? 21 What is the cube root of 16257 to the nearest integer? 25 What is 1137 to the power of 1/2, to the nearest integer? 34 What is the ninth root of 4556 to the nearest integer? 3 What is the cube root of 3273 to the nearest integer? 15 What is 7333 to the power of 1/2, to the nearest integer? 86 What is the cube root of 1386 to the nearest integer? 11 What is the square root of 2921 to the nearest integer? 54 What is the sixth root of 1383 to the nearest integer? 3 What is the cube root of 16899 to the nearest integer? 26 What is 683 to the power of 1/2, to the nearest integer? 26 What is the square root of 1821 to the nearest integer? 43 What is the square root of 2722 to the nearest integer? 52 What is 972 to the power of 1/2, to the nearest integer? 31 What is 47132 to the power of 1/3, to the nearest integer? 36 What is the third root of 1865 to the nearest integer? 12 What is 2438 to the power of 1/3, to the nearest integer? 13 What is the square root of 112740 to the nearest integer? 336 What is the third root of 1627 to the nearest integer? 12 What is the cube root of 28583 to the nearest integer? 31 What is 474 to the power of 1/3, to the nearest integer? 8 What is 2316 to the power of 1/2, to the nearest integer? 48 What is 328 to the power of 1/3, to the nearest integer? 7 What is the cube root of 105537 to the nearest integer? 47 What is 7089 to the power of 1/3, to the nearest integer? 19 What is 8317 to the power of 1/2, to the nearest integer? 91 What is the ninth root of 18915 to the nearest integer? 3 What is the seventh root of 12371 to the nearest integer? 4 What is the cube root of 872 to the nearest integer? 10 What is the third root of 21804 to the nearest integer? 28 What is 13224 to the power of 1/9, to the nearest integer? 3 What is 4037 to the power of 1/4, to the nearest integer? 8 What is 607 to the power of 1/2, to the nearest integer? 25 What is 829 to the power of 1/6, to the nearest integer? 3 What is 1243 to the power of 1/3, to the nearest integer? 11 What is the fifth root of 918 to the nearest integer? 4 What is 4462 to the power of 1/8, to the nearest integer? 3 What is the third root of 18547 to the nearest integer? 26 What is the seventh root of 2041 to the nearest integer? 3 What is 16398 to the power of 1/6, to the nearest integer? 5 What is 909 to the power of 1/4, to the nearest integer? 5 What is 3767 to the power of 1/2, to the nearest integer? 61 What is 39440 to the power of 1/2, to the nearest integer? 199 What is the cube root of 53325 to the nearest integer? 38 What is the eighth root of 173681 to the nearest integer? 5 What is the cube root of 3256 to the nearest integer? 15 What is the eighth root of 665 to the nearest integer? 2 What is 113295 to the power of 1/2, to the nearest integer? 337 What is the sixth root of 62648 to the nearest integer? 6 What is the eighth root of 3209 to the nearest integer? 3 What is 69 to the power of 1/3, to the nearest integer? 4 What is 4592 to the power of 1/2, to the nearest integer? 68 What is the ninth root of 4920 to the nearest integer? 3 What is 65 to the power of 1/3, to the nearest integer? 4 What is 3117 to the power of 1/2, to the nearest integer? 56 What is the square root of 41546 to the nearest integer? 204 What is the fourth root of 106 to the nearest integer? 3 What is the square root of 60354 to the nearest integer? 246 What is 78725 to the power of 1/2, to the nearest integer? 281 What is 761 to the power of 1/3, to the nearest integer? 9 What is the eighth root of 1281 to the nearest integer? 2 What is 28906 to the power of 1/8, to the nearest integer? 4 What is 2833 to the power of 1/2, to the nearest integer? 53 What is 2717 to the power of 1/2, to the nearest integer? 52 What is the cube root of 707 to the nearest integer? 9 What is the fourth root of 45618 to the nearest integer? 15 What is 1192 to the power of 1/10, to the nearest integer? 2 What is the third root of 6850 to the nearest integer? 19 What is the tenth root of 44202 to the nearest integer? 3 What is 1019 to the power of 1/6, to the nearest integer? 3 What is the square root of 1653 to the nearest integer? 41 What is the sixth root of 258 to the nearest integer? 3 What is 6093 to the power of 1/6, to the nearest integer? 4 What is the third root of 610 to the nearest integer? 8 What is 72 to the power of 1/2, to the nearest integer? 8 What is 25698 to the power of 1/3, to the nearest integer? 30 What is the square root of 37786 to the nearest integer? 194 What is the eighth root of 568 to the nearest integer? 2 What is the third root of 290 to the nearest integer? 7 What is 7608 to the power of 1/3, to the nearest integer? 20 What is 108549 to the power of 1/3, to the nearest integer? 48 What is 799 to the power of 1/7, to the nearest integer? 3 What is 12097 to the power of 1/4, to the nearest integer? 10 What is the cube root of 34082 to the nearest integer? 32 What is the ninth root of 871 to the nearest integer? 2 What is the cube root of 1892 to the nearest integer? 12 What is the fifth root of 7545 to the nearest integer? 6 What is 1648 to the power of 1/4, to the nearest integer? 6 What is 11366 to the power of 1/3, to the nearest integer? 22 What is the third root of 7441 to the nearest integer? 20 What is the cube root of 10639 to the nearest integer? 22 What is the ninth root of 7140 to the nearest integer? 3 What is the cube root of 11278 to the nearest integer? 22 What is 13386 to the power of 1/2, to the nearest integer? 116 What is 1144 to the power of 1/3, to the nearest integer? 10 What is the ninth root of 38973 to the nearest integer? 3 What is the cube root of 6864 to the nearest integer? 19 What is the ninth root of 2407 to the nearest integer? 2 What is 103089 to the power of 1/4, to the nearest integer? 18 What is the cube root of 776 to the nearest integer? 9 What is 798 to the power of 1/3, to the nearest integer? 9 What is the square root of 873 to the nearest integer? 30 What is the square root of 67007 to the nearest integer? 259 What is the third root of 4318 to the nearest integer? 16 What is 1765 to the power of 1/2, to the nearest integer? 42 What is the cube root of 8103 to the nearest integer? 20 What is 308 to the power of 1/4, to the nearest integer? 4 What is the sixth root of 10934 to the nearest integer? 5 What is the cube root of 9752 to the nearest integer? 21 What is 8598 to the power of 1/3, to the nearest integer? 20 What is 439 to the power of 1/2, to the nearest integer? 21 What is the square root of 8290 to the nearest integer? 91 What is the tenth root of 702 to the nearest integer? 2 What is 34565 to the power of 1/10, to the nearest integer? 3 What is 7365 to the power of 1/2, to the nearest integer? 86 What is 842 to the power of 1/2, to the nearest integer? 29 What is the square root of 2321 to the nearest integer? 48 What is the seventh root of 1078 to the nearest integer? 3 What is the third root of 4098 to the nearest integer? 16 What is 810 to the power of 1/2, to the nearest integer? 28 What is the fifth root of 6687 to the nearest integer? 6 What is 151760 to the power of 1/2, to the nearest integer? 390 What is the third root of 298 to the nearest integer? 7 What is the sixth root of 21240 to the nearest integer? 5 What is 4823 to the power of 1/6, to the nearest integer? 4 What is the cube root of 2096 to the nearest integer? 13 What is 715 to the power of 1/2, to the nearest integer? 27 What is the square root of 511 to the nearest integer? 23 What is 48362 to the power of 1/9, to the nearest integer? 3 What is the third root of 106563 to the nearest integer? 47 What is the sixth root of 3543 to the nearest integer? 4 What is the ninth root of 32201 to the nearest integer? 3 What is the cube root of 389 to the nearest integer? 7 What is the cube root of 10922 to the nearest integer? 22 What is 8180 to the power of 1/6, to the nearest integer? 4 What is 5023 to the power of 1/10, to the nearest integer? 2 What is 2060 to the power of 1/3, to the nearest integer? 13	{ "pile_set_name": "DM Mathematics" }
f 2219a3j*3 - 3a*3j*2 + 57a*3j - 2 wrt j. 13314a3 Find the first derivative of -11dik*3q + 4dk*3 - 31dk2q + ik3q - ikq wrt i. -11dk*3q + k*3q - kq Differentiate 10c*2x - 3c2 - 2cx - 108x - 3 wrt c. 20cx - 6c - 2x Differentiate 2il*2 + 1094i - 148l2 + 4l + 2 with respect to i. 2l2 + 1094 Find the first derivative of 97i*4 + 11i + 490. 388i3 + 11 What is the derivative of 7i*2z*3 + 3i*2 - 9iz2 - 30i wrt z? 21i2z*2 - 18iz What is the third derivative of 258f*5 + 10f*2 - 3f? 15480f2 What is the first derivative of 4ny3 - 852n + 59y4 wrt y? 12ny2 + 236y*3 Find the third derivative of 2h*4nx - 10h*4 + 2h*3nx - 2h*2nx - 2h*2n - 16hnx - nx wrt h. 48hnx - 240h + 12nx What is the second derivative of 763g3 - 2586g? 4578g Find the second derivative of -335a*2f*3 + 5a*2f + 47a2 - 3af - 2f*3 + 2f wrt f. -2010a2f - 12f Find the second derivative of -12d*2k*2 + 6d*2k - 10dk*3 - 1152d - 13k3 wrt k. -24d*2 - 60dk - 78k Find the second derivative of 9d2n*3 + 58d*2ny - 6dn2y + 2dny - n3y wrt n. 54d2n - 12dy - 6ny Find the third derivative of 85qx*5 + 2qx3 - 13q + 3x6 + 63x*2 wrt x. 5100qx2 + 12q + 360x3 Find the third derivative of -6a*2n*3 + 32a*2n - 66n3 - 2n*2 wrt n. -36a*2 - 396 What is the third derivative of -5p*6 + 2256p*3u*3 + 5p*2u*3 + 4p*2u - 3pu*3 + 19u wrt p? -600p3 + 13536u*3 What is the derivative of 163ps2 - p - 1876s*2 wrt p? 163s*2 - 1 Find the third derivative of 3m*3n*3 - 122m3 + m2n2 + 29mn2 - 2n*3 wrt m. 18n*3 - 732 What is the third derivative of 1366g*2u*3 - 12g*2 - 31u*2 wrt u? 8196g*2 What is the third derivative of -2h*3tx2 - 2h*3tx - h2x + 3ht + 122x2 wrt h? -12tx2 - 12tx What is the second derivative of -1432m*2u*2 + 3mu2 + 4m - 2u2 + 87u wrt m? -2864u2 What is the first derivative of 1544q*3 - 214 wrt q? 4632q2 Find the first derivative of -i3kwz - 116i*3w - i*2wz - i2w - 322ikz - 7ik wrt z. -i3kw - i2w - 322ik What is the first derivative of -o*4 + 30o*3 - 3? -4o*3 + 90o*2 Find the first derivative of -5c*2p*3 + 881c*2 + 3p*4 - 11p*2 wrt p. -15c*2p*2 + 12p*3 - 22p Differentiate -437n3y4 + n3y + 176n*3 + 2n with respect to y. -1748n3y3 + n3 Find the second derivative of 2j5u + 1152j4u - 1585ju wrt j. 40j3u + 13824j2u What is the first derivative of 347bj*4 + 3480b - 4j4 wrt j? 1388bj3 - 16j*3 What is the first derivative of 27qz3 + 14qz - 8z*3 + 7z wrt q? 27z3 + 14z What is the first derivative of -2166n3p*2 + 243n*3v - 5p2v wrt v? 243n3 - 5p*2 Differentiate -53p*3 - 3p*2 + 30p - 7910. -159p2 - 6p + 30 What is the second derivative of 2iqsy*3 + 3iqy*2 + 97iq - isy + qs - 42qy*3 - 2y wrt y? 12iqsy + 6iq - 252qy Find the first derivative of 440t4 + 4146 wrt t. 1760t3 Differentiate a2t + 2a*2 + 4847at - a + 748t - 3 with respect to a. 2at + 4a + 4847t - 1 What is the third derivative of 2t6 + 434t*5 - 9t*2 - 104t - 3? 240t3 + 26040t*2 Differentiate lz*3 - 74l - 3z3 - 15z2 with respect to l. z3 - 74 Find the second derivative of 2r4t3 - r4t + 11r + 38t3 wrt r. 24r*2t*3 - 12r*2t Find the third derivative of -5f6 - 5f*5 - 33f*2. -600f*3 - 300f*2 What is the third derivative of -3m*5 + 246m*3 + 285m*2? -180m*2 + 1476 What is the derivative of -14r*2v*2 - 8r*2v - v*2 - 713 wrt r? -28rv2 - 16rv What is the third derivative of -5381z*5 + 2z*2 + 3z - 43 wrt z? -322860z2 What is the first derivative of 83q*2 + 370 wrt q? 166q Find the second derivative of 3r3 - r2 + 15r - 2 wrt r. 18r - 2 What is the first derivative of 4a*4 - 44a*3 + 38 wrt a? 16a*3 - 132a*2 What is the second derivative of -33dy4 + dy + 2y5 + 2y*3 - 2y - 24 wrt y? -396dy*2 + 40y*3 + 12y What is the second derivative of -107i2v*2w2 + i2w2 + 4i*2 - 3iw + 8v*2w wrt w? -214i2v*2 + 2i*2 What is the second derivative of 8v*5 - 5v*3 + 207v? 160v3 - 30v What is the second derivative of -48h2vw3z + 2h2vz - 31hvw*3z - 4hvw2z wrt h? -96vw*3z + 4vz What is the derivative of -2h3ux + h3u + 6h3x - 54h3 - 8hux + 4u2 wrt u? -2h*3x + h*3 - 8hx + 8u Find the third derivative of -5209s5 - 1636s*2 wrt s. -312540s*2 Differentiate 11299a*4y*3 - 12899y*3 wrt a. 45196a*3y*3 What is the second derivative of 2l*3 - 22220l*2 - 6761l - 1? 12l - 44440 Find the second derivative of -263g5 - g2 + 864g. -5260g*3 - 2 Differentiate -20a*3z - 2a2z*3 + 129z*3 with respect to a. -60a*2z - 4az*3 Differentiate -18s*3x - 5691s3 + 2sx + 26x*2 wrt x. -18s*3 + 2s + 52x What is the third derivative of 2969q*5 - 53q*2 wrt q? 178140q*2 What is the derivative of nz*3 - 2n + 5z3 - 69z - 755 wrt z? 3nz*2 + 15z*2 - 69 What is the derivative of -3cs2 - 4c - 4s2 + 1 wrt s? -6cs - 8s Find the second derivative of 481o2s*3 - 2os2 - 2o - 24s3 wrt o. 962s*3 Differentiate -1095n + 1694. -1095 Differentiate 33a2i*2j + 14a2i - 3706i2j with respect to a. 66ai*2j + 28ai What is the derivative of 3ku*3w + 388ku*2w2 + u3w2 - 158u*3 + 1 wrt k? 3u*3w + 388u2w*2 What is the third derivative of -2v*6 + 541v*3 - 3v*2 + 4v - 9 wrt v? -240v3 + 3246 Differentiate f3z2 - f3 - 4f2z*2 + 11fz2 - 27 wrt z. 2f*3z - 8f2z + 22fz Find the third derivative of 3k6o - 344k3o*2t3 - k2t3 - 2ko2t + o*2 - 92t*3 wrt k. 360k*3o - 2064o2t*3 Find the second derivative of 4698m*3r - m*3 - 57mr - m - r wrt m. 28188mr - 6m What is the derivative of -44d3 + 430? -132d*2 Differentiate -2122t*3v*3 - 3706t3 - t2v3 wrt v. -6366t*3v*2 - 3t*2v*2 Find the second derivative of 2c*3t*2 - 232c*3 - 5c*2t*2 - ct - 2t2 - t + 82 wrt c. 12ct2 - 1392c - 10t2 What is the third derivative of 174g*6 + 2g*2 + 137 wrt g? 20880g*3 Find the third derivative of -19lv3x*2 + 7lv3 - 33lv2x*3 + 5lv2x + lvx*3 - 2v*3x*3 + 2v wrt v. -114lx*2 + 42l - 12x3 Find the third derivative of -5a*5y*3 + 3a*5 - 24a*2y*3 - 4a*2y wrt a. -300a2y*3 + 180a*2 What is the derivative of -11289d + 3583? -11289 Find the second derivative of -29a4k + 6a2k*2 - 45ak2 - 7ak - 2a wrt a. -348a2k + 12k2 Differentiate -7gx3 - 2165g + 69x3 + x with respect to x. -21gx2 + 207x*2 + 1 What is the third derivative of 10h*2j*3 + 3h*2 + 2j*4 + 65j*2 wrt j? 60h*2 + 48j What is the first derivative of -17i2pz2 + 2i*2z*2 + p + 369z*2 wrt i? -34ipz*2 + 4iz2 Find the first derivative of 555cz3 - 190z*3 + 2z*2 wrt c. 555z*3 Differentiate -3d*3y - 41dy + 692y with respect to d. -9d*2y - 41y What is the third derivative of -293m*3x*3 + 396m*3 + 2mx2 wrt x? -1758m3 What is the third derivative of -g3u5 + 206g*3u*4 - 7g*3u*2 - 2g*3u - 2g + 22u*2 wrt u? -60g*3u*2 + 4944g*3u Find the third derivative of 1683r3tv - 2r*3t + r*3v - 5r2t + 29r2 - 4rtv - 2tv + t wrt r. 10098tv - 12t + 6v What is the third derivative of -3p5 + 8p*4 + 24p*2 + 6p? -180p2 + 192p Differentiate 12q3 + 2q*2 - 4q - 18938. 36q2 + 4q - 4 What is the third derivative of -59gl*5 + 2gl3 + 337gl2 - 2gl + l3 wrt l? -3540gl2 + 12g + 6 Find the third derivative of 76k3 + 77k*2 + 3k wrt k. 456 What is the third derivative of 11s6 - 9s*4 + 15s*2 - 39s + 1 wrt s? 1320s3 - 216s Find the second derivative of -21898k3o*2 + 3k*3o - 10k3 - 162k wrt o. -43796k3 Find the first derivative of -64b*	{ "pile_set_name": "DM Mathematics" }
(n/((nn/(n/((nn((n/((n/(nn*4/n))/n))/n)/n)/nn)))/n)))/(n29/n(-6)) assuming n is positive. n*(-377/12) Simplify (aa2)35(a4)18 assuming a is positive. a177 Simplify ((((n/n(-2))/n)/n)(-14/11))(3/26) assuming n is positive. n(-21/143) Simplify (((vv*(-1)v)(-2/129))(2/87))35 assuming v is positive. v(-140/11223) Simplify ((ii(5/4))/iii(-16)/i)/(((ii/i*8ii)/i)/i)(-46) assuming i is positive. i(-1163/4) Simplify (y(2/61)y)/yy(-5/4)yyy*(-1/13)y(-14) assuming y is positive. y(-42169/3172) Simplify ((r*(1/2)r)*(-2/5)(r/(r*(-1/14)/r))/(r/(r/(rr(-8/5)))))(-1/21) assuming r is positive. r(-29/294) Simplify ((f/f(-25))/((ff/(f/((f3f)/ff)))/fffff))/((f5f)/(f*24f)) assuming f is positive. f37 Simplify ((h/(h/h(-9)))(-2/37))17 assuming h is positive. h(306/37) Simplify (q(-5))(-9)/(q(-14)/(q(-2)/q)) assuming q is positive. q56 Simplify (((y*3y)/y)/(y*(-27)y))/(y(9/8))(-3/2) assuming y is positive. y(491/16) Simplify (((r(-18)r)/r(-3/7))26)27 assuming r is positive. r(-81432/7) Simplify i(-13/2)/(ii*(-34))(i/(ii(-2)ii))/i(-1/4) assuming i is positive. i(107/4) Simplify ((u12/((u(u/(uu/(u/((u/u(1/7))/u))))/uu)/u))(9/2))(-4/23) assuming u is positive. u(-1494/161) Simplify ((g(2/7))(-30/13)/((g(-1/7)/g)/(ggg/g*5g)))(-1/20) assuming g is positive. g(47/1820) Simplify ((kk/(k/(k(6/11)/k)k)k)(-2/93))(-45) assuming k is positive. k(180/341) Simplify (t/t(-4/9))(19/6)(t(1/9))25 assuming t is positive. t(397/54) Simplify b(4/5)/(bb/(b/(b11/bb)))bb*(-5/4)b(-3)/b assuming b is positive. b(-309/20) Simplify (zz(-7))/(zz/((zz9)/z))z/(z/(zz(-1)))z(1/2) assuming z is positive. z(3/2) Simplify (q/(q/(((qq(-1)/q)/q)/q)))/((q/(q(-2/19)q))/q)(q/q(-12))/qq(-7) assuming q is positive. q(55/19) Simplify (w(ww*(-3/8)/ww)/w)/w*12(w/w(-1/2))/((w(2/17)w)/w) assuming w is positive. w(-1359/136) Simplify ((s5s)/(s*(-1/4)/sss))/(ss*12/ss/s*(-6)s) assuming s is positive. s(-59/4) Simplify (((y/(y/((y(1/3)y)/y)y))/y)*(-7/10)(y3)40)(2/97) assuming y is positive. y(727/291) Simplify ((qq/(q(-5)q)q(-2/17)q)/((qq5)/(q/(qq*(3/2)qq))))(28/5) assuming q is positive. q(-1246/85) Simplify (q18/qq*(-9))/(q/(qq/(qq(-3/10)q)))(4/9) assuming q is positive. q(346/45) Simplify (m*(-5/3)mm/(mm*(-5)m))/(m/(mm(m/(m(m/((((mm*1m)/m)/m)/m))/m))/mm))(-6) assuming m is positive. m(-8/3) Simplify a(-4)a/a*(-23)((a/a(-9))/a)(-16) assuming a is positive. a(-124) Simplify (((c/c(-1))/c)(1/80)/(c0c)(-7))(-13) assuming c is positive. c(-7293/80) Simplify (p(1/7)p)(-2/37)/((p/(p(-3/2)p))/p(-6)) assuming p is positive. p(-3917/518) Simplify (((a/((a/a9)/aa))/(a/(a2/a)))44)(-3) assuming a is positive. a(-1188) Simplify ((w*(-5)/(w/(w/(ww(-1/2)))))(2/63))16 assuming w is positive. w(-176/63) Simplify m*16m/(m*(-2/35)m)(mmm24)/mm/m(11/7) assuming m is positive. m(1417/35) Simplify ((ww/((w/(w/(w(-7)/w)))/w))/www((w/((ww(-3)/w)/w))/ww)/ww/w(2/13)w/(w(w/(w(w*(2/7)w)/w))/w))(-9) assuming w is positive. w(-14850/91) Simplify (((u/u3)/u)/(u(-3/7)u)(((uu/(u/(uu(-8))))/u)/u)/((u(-1/4)u)/uu))(1/24) assuming u is positive. u(-115/224) Simplify (s(s(-24)s)/ssss(-7/5))/(((s(1/10)s)/s)/(s*(3/5)s)) assuming s is positive. s(-209/10) Simplify (y(-10/9)y/y(-32))24 assuming y is positive. y(2296/3) Simplify ((u/(uuu/(u6u)))/uu/(((uu*(4/5))/u)/u)uu(3/4)/((u(1/3)u)/u))(-9) assuming u is positive. u(-1191/20) Simplify (p/(ppp(-1)))(-3/17)p0/(p(-14)p) assuming p is positive. p13 Simplify y14yyy(2/7)(y/y*(-16)y)/(y/y0) assuming y is positive. y(233/7) Simplify (f(-4))40/(ff(-14)f(2/17)) assuming f is positive. f(-2501/17) Simplify (m/m0)40(mm*(-4)mmmm)(-44) assuming m is positive. m(-4) Simplify (b12/b(2/5))/(b/(bb*(-1/12))b*(-11)b) assuming b is positive. b(1291/60) Simplify l5/(ll6l)(l(lll*(-1/5))/l)/ll19 assuming l is positive. l(84/5) Simplify ((m(m/m(-19))/m)/m(-2/37))/(m(-32)m(-24)) assuming m is positive. m(2814/37) Simplify (i*(1/21)/(iiii(i(-1/13)ii)/i))/(i(-2/19)ii19i) assuming i is positive. i(-133670/5187) Simplify (v(-2)v)(-9/2)v*(1/10)vv(-7)/vv assuming v is positive. v*(-7/5) Simplify ((yy*(4/5)y)/y*(-3/11)y8/(y(-7)/yy))(2/11) assuming y is positive. y(1988/605) Simplify (b/(b/b20b)b)/(b(2/27)/bb)b(-14)/b(-17) assuming b is positive. b(619/27) Simplify ((((r0/r)/r)/r)/r)(-46)/(r(-9)/(r/(r/(r/r(-3/4)r)))) assuming r is positive. r*(783/4) Simplify ((g(g/((g/(gg/((gg*10ggg)/g)))/g))/gg)/gg*(-3)/gg)/((gg(1/3)/g)/gg(-13)) assuming g is positive. g(2/3) Simplify ff/f(-15)((f/f*9)/f)/f(f/f(-3))/f3 assuming f is positive. f8 Simplify (((y(3/5))(-46))(15/7))(-28/9) assuming y is positive. y184 Simplify (d/(d(dd*14)/d)d(-1))/(d(2/3)/d(-13)) assuming d is positive. d(-86/3) Simplify ((x(2/11)/x)/x(-26))/(x/(x/(x/(x*(-4/3)/x))x))39 assuming x is positive. x(-724/11) Simplify (k(2/9))(-13)/(k/((kk(-2)/kkkk)/k))(-25) assuming k is positive. k(199/9) Simplify (d(-2)/d)(-26)/(d*(-14)/((((dd*(-3/14)/dd)/d)/ddd)/dd)) assuming d is positive. d(1299/14) Simplify (h40/(hhhhh/(hhh(-2/5))h))(-18) assuming h is positive. h(-3204/5) Simplify (f*(-22)f)/(ff(f/f*(-4/9))/f)f*(-4/13)/(f/((fff(2/7))/f)) assuming f is positive. f(-19219/819) Simplify ((h(-9/4))31)(28/9) assuming h is positive. h(-217) Simplify x(1/20)xxx/(xx(-1/6))x*(-3)/(x(x/(((x/x*12x)/xx)/x))/x) assuming x is positive. x(-767/60) Simplify ((rr/((rrr*(-4))/r))/rr/(rr/r(2/11))(r(-3/5)/r)/(r/(r(-5)/r)))(-2/145) assuming r is positive. r(596/7975) Simplify ((i/i*11)/ii*5ii(-4)iii(1/9))34 assuming i is positive. i(-2108/9) Simplify ((h(-4/11)h)/(hh/(h*(1/14)/h)hh))/(hh*8hh(-18/5)) assuming h is positive. h(-8233/770) Simplify o(1/6)o/(o*(-12)/o)o(o(-2/9))17 assuming o is positive. o(205/18) Simplify (k(-2/17)/kk)/(kkkkkk(-24)kk)kk15(k(kk(-22))/k)/k assuming k is positive. k(185/17) Simplify (r(-2/7))46(r(-2/13))22 assuming r is positive. r(-1504/91) Simplify (((x(2/7))(-20))(-48))27 assuming x is positive. x(51840/7) Simplify (m(-3/8))(-6)(mm(-8/5)m)/(m*(-1/3)mm) assuming m is positive. m(59/60) Simplify a(-27)a*6a*(-19)/aaa(1/12) assuming a is positive. a(-479/12) Simplify (i/(i(2/3)i)ii(-37))(-41) assuming i is positive. i*(4510/3) Simplify (b(bbbbb/(bb/(b(3/14)/bb)b)b)/bb)/b(1/4)b/b*(-13)(b/b*(-1/12)b)/b assuming b is positive. b*(400/21) Simplify ((a/(a/(a(a/(aa0/a))/a)))/a)(9/4)a*(-7/6)a10 assuming a is positive. a(53/6) Simplify ((o(1/2)/(o(2/7)/o))/(o*4o*(-2/3)/oo))(-1/10) assuming o is positive. o(89/420) Simplify (xx(1/2))(-2/9)/(((xx(xx((xx/x*(-5)xx)/x)/x)/xxx)/x)/(x(3/11)/x)) assuming x is positive. x(-398/33) Simplify (p/(p/(p(-10)/p))p*24p)(-17/5) assuming p is positive. p(-238/5) Simplify (ww/((w2/ww)/w))*(-3/32)ww8w(-1/2) assuming w is positive. w(269/32) Simplify (w*(5/3)w)(-1/5)/(w(4/11)/ww)43 assuming w is positive. w(-2668/165) Simplify (s3)(-1/3)/(s/(s/(s(-2/9)/s)s)s)48 assuming s is positive. s(173/3) Simplify (m(-12)/((mmm(-3/10))/m))/((m(-9)/m)/mm*(6/17)m) assuming m is positive. m(-519/170) Simplify g(-24)/(g*(-5/3)g)(gg*(2/15))/gg/(gg/g5g) assuming g is positive. g*(-101/5) Simplify ((u(u*20/u)/u)/uu*5/u)/((uu(uu*(-1/8))/uu)/((u*(-9)/u)/uu)) assuming u is positive. u(73/8) Simplify (b2/b*21)/(b((b*(-2/87)bb)/b)/bbb(5/6)) assuming b is positive. b(-1265/58) Simplify (yy*(-6/5)yyyy	{ "pile_set_name": "DM Mathematics" }
or 5? 322/85 Is 95 >= 96? False Which is greater: -0.19 or 725? 725 Is 0.4229 at least 0.3? True Which is smaller: 131 or 138? 131 Is 349 greater than 139? True Are -29 and -18 unequal? True Are 520 and 520 unequal? False Which is smaller: -0.1 or -3756? -3756 Is -3 smaller than -229? False Which is greater: -16/1313 or -1? -16/1313 Which is smaller: 8642 or 8643? 8642 Which is bigger: 125 or -34? 125 Is 8 greater than 622? False Which is greater: -0.09 or -5? -0.09 Which is smaller: 1/60 or 5/7? 1/60 Is -73 greater than -77? True Which is bigger: 1448 or 1453? 1453 Which is smaller: -1550 or -0.3? -1550 Which is bigger: -1 or -1124? -1 Are 2304 and 2302 unequal? True Do 2455 and -0.01 have the same value? False Is -47/152 greater than or equal to 0? False Is 249 less than 248? False Which is smaller: 15 or 21? 15 Is -1 != 2/2597? True Which is greater: -50.62 or -1? -1 Is -353 less than or equal to -375? False Is 54 equal to 94? False Which is bigger: -946 or -947? -946 Which is smaller: 2/23049 or -1? -1 Is -172 bigger than -175? True Which is greater: -1/733 or 0? 0 Which is smaller: -1149 or -1153? -1153 Which is greater: -132 or -1053/8? -1053/8 Which is smaller: -3/10685 or 0? -3/10685 Is 0.09 > 31? False Is 0.3 bigger than -13? True Is 1/3 bigger than 2.04? False Which is greater: 0 or -13? 0 Which is smaller: 206 or 190? 190 Which is greater: -702/205 or -3? -3 Do -70 and -65 have the same value? False Is -6 greater than 618? False Is 101 less than 101? False Is 1/4 bigger than 0.539? False Is 70 less than 0.3? False Is 21/4379 at most as big as -1? False Is -204 less than 0.066? True Is -295 at least -295? True Is -130/23 equal to -7? False Which is smaller: 1195 or 1193? 1193 Which is greater: 873 or 870? 873 Are 3/4 and 38 equal? False Is -585 <= 23? True Which is greater: -0.1 or -0.213? -0.1 Is 11859 equal to 11859? True Which is smaller: 2 or 92? 2 Is -1 at least -2/131? False Which is smaller: -445.1 or -1? -445.1 Is 25 >= -1? True Which is bigger: 0 or -9/85? 0 Which is bigger: 1/33 or 0? 1/33 Do -19 and -1/2 have the same value? False Which is bigger: 113 or 114? 114 Which is greater: -1 or 147? 147 Do 126 and 624/5 have different values? True Which is smaller: -10.6 or -1/2? -10.6 Which is bigger: -485 or -483? -483 Is 19/586 bigger than 0? True Which is smaller: 47 or 16? 16 Does 7 = -824? False Which is greater: 234 or 236? 236 Which is bigger: 1290/19 or -4? 1290/19 Is -117 bigger than -120? True Which is bigger: 4 or 87/31? 4 Which is greater: -24 or -170/7? -24 Which is smaller: 114 or 113? 113 Is 6 smaller than -0.52? False Do -248 and -253 have the same value? False Do 0 and -2/389 have different values? True Are -286 and 18 nonequal? True Do 1067/24 and 45 have different values? True Which is smaller: 67/11 or 6? 6 Is -171 <= 0.1? True Is -13 greater than 266? False Which is smaller: 476 or 495? 476 Which is greater: -891 or -895? -891 Which is smaller: 51 or 27? 27 Is -2307 != -7? True Is 2 less than or equal to -2140? False Is 0 not equal to 24/43? True Which is smaller: -3/238 or -1? -1 Which is smaller: 235/9 or 0.1? 0.1 Is -22/439 smaller than 0? True Which is smaller: -1 or -38? -38 Are 112/85 and 0 equal? False Is -624 smaller than 2/13? True Does -130/7 = -19? False Which is smaller: 15/79 or -0.04? -0.04 Which is smaller: 622 or 1/3? 1/3 Which is smaller: -1 or -8/205? -1 Which is bigger: 11 or 17? 17 Which is smaller: 131 or 91? 91 Which is smaller: 4/2003 or 1? 4/2003 Is -61 bigger than -62? True Which is greater: -128 or -63? -63 Is -0.16 at least 12.36? False Is 0 smaller than 3/884? True Is 0 equal to 2/7467? False Does -2 = -1/686? False Are -1/5705 and 1 nonequal? True Which is greater: -604 or -605? -604 Which is bigger: 24 or 71/3? 24 Is 1/1387 bigger than 0? True Is -0.1 equal to -20049? False Which is smaller: 406 or 408? 406 Which is greater: 1 or 2/715? 1 Is 663 greater than or equal to 661? True Which is greater: -2/4557 or -0.1? -2/4557 Is 0 smaller than -63/118? False Is 36785 at least 36785? True Which is smaller: -134 or -934/7? -134 Which is greater: 1040 or 1053? 1053 Is 326 at most -2? False Do 4980 and 4980 have the same value? True Do 1 and 5/6 have the same value? False Which is smaller: 1 or 2878/5? 1 Does 167/17 = 8? False Is -85 >= -82? False Which is bigger: 680 or 679? 680 Which is greater: -2 or 31? 31 Which is smaller: -21 or 8? -21 Which is smaller: -2/3 or -4? -4 Which is smaller: -49.5 or 0.02? -49.5 Which is smaller: -5266 or -5267? -5267 Which is bigger: -2 or 1/1107? 1/1107 Which is smaller: 53 or 54? 53 Is -1/4 greater than 16/93? False Do 2/3 and -2338 have the same value? False Is -4/6501 <= 1/3? True Is -820 smaller than -822? False Which is greater: 2 or 120? 120 Is 0 at most as big as -52? False Is 0.3 < 9? True Is 4771 <= 4771? True Are 20/151 and 0 equal? False Which is smaller: 4 or -864? -864 Which is bigger: -2/5 or 1? 1 Which is bigger: -33881 or -33882? -33881 Is -2/7 greater than -6/1693? False Which is smaller: -3.4 or 8/9? -3.4 Is -203 at least as big as -209? True Is 94 >= 99? False Do -32/13 and -3 have different values? True Which is smaller: -239 or -3123/13? -3123/13 Which is smaller: 467/18 or 25? 25 Is -44/9 <= -4? True Which is smaller: 801 or -3? -3 Are 1500 and 1498 equal? False Is -1 <= 1/1319? True Is 9824 >= 9824? True Which is greater: 5 or -11/9? 5 Is -854 >= -855? True Which is smaller: 359 or 335? 335 Do 11 and -1 have the same value? False Which is smaller: -295/4 or -73? -295/4 Which is greater: -82 or -327/4? -327/4 Which is smaller: -45/191 or -1? -1 Are 0 and 1/301 equal? False Which is greater: 78 or 3/4? 78 Are 0.1 and 5 equal? False Is 180 != 155? True Are -189 and -189 unequal? False Is -14 != -2/7? True Is 5 != 126? True Is 1575 greater than 1574? True Which is smaller: -91 or -274/3? -274/3 Is 1155 <= 1156? True Is 4/303 less than or equal to 1? True Which is bigger: 192 or 180? 192 Is 249 != 245? True Is -1/148 at most as big as 0? True Which is greater: -82 or -78? -78 Which is bigger: -1463/3 or -489? -1463/3 Which is bigger: -349 or -340? -340 Is -1 at least as big as -1/1068? False Which is bigger: 1 or -42/149? 1 Are 0 and -70/109 non-equal? True Which is smaller: -43 or -6? -43 Which is greater: -14277/5 or -2854? -2854 Which is bigger: 2/7 or 228? 228 Which is smaller: 129/8 or 16? 16 Is 2/525 at most -2? False Is -109 at least -543/5? False Are -1 and -39/35 non-equal? True Which is smaller: 111 or 1? 1 Which is smaller: 71 or 283/4? 283/4 Is 2/3 less than -2232? False Which is greater: 0 or 1/492? 1/492 Which is smaller: -299 or -0.02? -299 Which is greater: -0.091 or 2? 2 Is 3244 >= 3245? False Which is smaller: 6492 or 6491? 6491 Is 3/39407 smaller than -1? False Is 54 greater than or equal to 50? True Do -3334 and -3333 have different values? True Which is greater: 458 or 473? 473 Is 3/130 >= -1? True Which is smaller: -5.9 or -3? -5.9 Is -899 bigger than -6288/7? False Which is smaller: -1/2 or 2057/3? -1/2 Are 384 and 384 equal? True Which is greater: 23/34 or 1? 1 Are 45 and 274 nonequal? True Is -1 at least -2/18333? False Do -0.6 and -0.1 have the same value? False Which is greater: 2025 or 2031? 2031 Which is smaller: 1/3690 or -1? -1 Which is smaller: 2/7 or 173? 2/7 Is -1405 at least -4219/3? True Which is bigger: 1 or 11/30? 1 Is -642 less than or equal to -657? False Is 5 greater than -8? True Is -1 smaller than 1/6380? True Is -94/1103 greater than or equal to 0? False Is 2 greater than -17.1? True Is 608/25 > 24? True Is -39 smaller than -48? False Is 1/12310 <= -1? False Which is bigger: 0.05 or -2/53? 0.05 Do 774/7 and 112 have the same value? False Is -2/7 not equal to -0.08? True Are 431 and -2/9 non-equal? True Do 123/8 and 14 have different values? True Which is smaller: 0 or -174/563? -174/563 Is 638 < 642? True Is -13/254 equal to 1? False Does -691/2 = -347? False Which is smaller: -2 or 43/33? -2 Do 8995 and 8995 have the same value? True Is 5877 at least as big as 5877? True Do 5/58 and 1 have different values? True Which is greater: -2/69 or 0? 0 Which is smaller: 4609/3 or 1536? 1536 Which is smaller: -14/23 or -1? -1 Are -22490 and -22488 equal? False Are 285 and 286 non-equal? True Whi	{ "pile_set_name": "DM Mathematics" }
= -33 + 38. Suppose 2d = 0, o = go + 2d - 3416. What is the tens digit of o? 5 Suppose 0 = 3j - 6j + 672. Suppose -4 = -5h + 4y, 4 = -4h - 0h + 5y. Suppose -4x - f = -j, -hx + f + 139 + 93 = 0. What is the units digit of x? 7 Let o be (-6(-15)/(-25))/(6/200). Let v = o + 251. What is the tens digit of v? 3 Let d(p) = 6p*2 + 145p + 361. What is the hundreds digit of d(25)? 7 Let p = 2211 + -2219. Let t(o) = -5o - 5. Let c be t(-5). What is the tens digit of (-2)/p - (-3335)/c? 6 Let q = -746 + 764. Suppose qf = 15141 - 1443. What is the hundreds digit of f? 7 Let w be (-2)/3(-51)/34. Let x(y) = y3 + 2y*2 - y - 1. Let u be x(w). What is the units digit of -168(u + (-6)/4)? 4 Suppose 38 = 9z - 142. Suppose 2h + z - 148 = 0. Suppose -h = -8p + 7p. What is the tens digit of p? 6 Suppose 2p - 208 + 69 = 3u, 4u + 77 = p. Suppose 4i + 311 = -5w, -2i + 3w - 74 = p. Let y = i - -103. What is the tens digit of y? 2 Suppose 2d = 37 - 179. Let i = 19 - d. What is the units digit of i? 0 Let u(x) = 27x2 + 8x + 12. Let o(y) = 29y2 + 7y + 12. Let b(g) = 4o(g) - 3u(g). What is the units digit of b(-5)? 7 Let i(c) be the second derivative of 15c4/2 - c3/6 - 6c. Let f be i(1). Suppose 5r + 2j - f = 0, -4r + 0r = 2j - 70. What is the tens digit of r? 1 Suppose -235 = -3p - 0h - 5h, -p - h = -81. Let t = p - 39. What is the tens digit of t? 4 Let q = -118 - -125. Suppose ql + 20 = 153. What is the tens digit of l? 1 Let h(j) = 4283j*2 + 24j + 58. What is the units digit of h(-2)? 2 Let o(x) = 20x - 22. Let q be 8 + -6 + (14 - 1). Suppose 17c = qc + 20. What is the hundreds digit of o(c)? 1 What is the units digit of (80 + -2347)/(-2 + 1)? 7 Let r(s) = -9s + 123. Let u be r(22). Suppose 2w + 8 = -0w, 2w - 260 = -2c. Let i = c + u. What is the tens digit of i? 5 Let d(k) be the third derivative of 0 - 23/30k6 + 0k*3 + 0k*4 + 0k + 0k5 - 20k*2. What is the tens digit of d(-1)? 9 Let o be 56/(-84)(-60)/2. Let y be (-3 - 4124/o)25/(-10). Suppose -4g + z = 2z - 511, 5z = -4g + y. What is the tens digit of g? 2 Suppose -4x = -k + 80, 8 + 176 = 2k - 2x. Let h(b) = -20b2 + 596b + 39. Let u be h(30). Let j = k + u. What is the tens digit of j? 1 Suppose -y = y + 136. Suppose -2f + 3r - 315 = 188, 2f + 501 = 5r. Let o = y - f. What is the tens digit of o? 8 Suppose -15k - 168k + 297558 = 0. What is the thousands digit of k? 1 Suppose 3r - 39 = 2r + 55643. What is the ten thousands digit of r? 5 Let p = 94 + -92. Suppose -5t + 4k + 24 = k, -3t - pk + 3 = 0. What is the units digit of t? 3 Suppose 0 = -0i + 3i + 3. Let t be (i/(-1))/((-4)/(-111 - -3)). Suppose -x + 87 = -t. What is the hundreds digit of x? 1 Suppose -14 + 8 = -t. What is the tens digit of (-27)/6(-572)/t? 2 Let u(q) = 66q*2 - 9q - 5. Let c be u(-2). Let x = -211 + c. What is the units digit of x? 6 What is the ten thousands digit of -20 + (16 - -18) - -20553? 2 Suppose -9u + 145 + 17 = 0. What is the tens digit of (-11296)/48(u/4)/(-3)? 5 Let a(y) = 173y2 - 57y + 284. What is the tens digit of a(6)? 7 Let u be (-2)/((-6)/(-45)(-4 + -1)). Let x = -37 - -36. What is the units digit of 1 - x - (-5 - u - -4)? 6 Let t(h) = 8 + 64h*2 - 14h*2 - 19h*2 - h + 56h*2. What is the tens digit of t(-3)? 9 Let x be (-76)/(-13) - (-2)/13. What is the units digit of (-12)/x - 0 - -466? 4 Let x(r) = -5r + 47. Let n be x(-21). Let u be (5/4)/((-2)/n). Let a = u + 111. What is the tens digit of a? 1 Let z(y) be the second derivative of -y5/20 - y4/3 + y3 - y2 + 11y. Let f be z(-6). Let i = f - 27. What is the units digit of i? 7 What is the tens digit of 1184 - ((-72)/(-8) - -2)? 7 Let o(l) = -30l - 44. Let v be o(-6). Let m(p) = -v - 6p + 69 - 17p - 1. What is the tens digit of m(-8)? 1 Suppose 373a + 359a - 4279953 = 639a. What is the ten thousands digit of a? 4 Let r(l) = l2 + 3l - 7. Suppose 0o + 63 = -3o. Let x = -28 - o. What is the tens digit of r(x)? 2 Let d(f) = f*2 + 6f - 4. Let v be d(-4). Let q(z) be the first derivative of -z*3/3 - 7z*2 + 40z - 3804. What is the tens digit of q(v)? 6 Let i(q) = 1701q3 + q2 - 4q + 1. What is the hundreds digit of i(1)? 6 Let c be 11/(-2) + (-3)/2-1. What is the tens digit of (-252)/(-210)(-2)/c1085? 5 Suppose -13 = -3n - 2y, 2y - 1 = 3. Suppose 0 = a + 2p - n, 5p = -0p. Suppose -2r + 4k = -0k - 122, -266 = -5r - ak. What is the tens digit of r? 5 Let y = -690 - -1221. Let l = y - 273. What is the tens digit of l? 5 Let h = -32705 - -32861. Let m(u) = -25u + 2. Let w be m(-2). Let l = h - w. What is the hundreds digit of l? 1 Let m = 10116 + 39845. What is the ten thousands digit of m? 4 Suppose -2w + 3i + 4276 = -i, -8604 = -4w - 5i. Suppose 420 = -u - 4j, -3u + 3j = 2u + w. What is the tens digit of (-5 - -6)/(-3) + u/(-6)? 7 Let u = 28495 + 12853. What is the hundreds digit of u? 3 What is the tens digit of ((-17634)/(-15) - 2)((-4725)/42)/(-9)? 7 Let c be (-6 - -8 - 6/8)4. Suppose -x - c = -14. What is the hundreds digit of (x/4)/((-3)/(-208))? 1 Let l be 842/12 - (0 + (-6)/(-36)). Suppose 104 + l = 6y. What is the units digit of y? 9 Suppose 3f + 14 = 8, 2i + f - 1644 = 0. Suppose -3r = 2d - 1521, -2d = 2r - 693 - i. What is the units digit of d? 3 Let y = 5756 + 2610. What is the tens digit of y? 6 Let c(n) = 3n2 - 72n - 9092. What is the hundreds digit of c(-86)? 2 Suppose -3n = -6, 29z - 24z - 4n = 2492. Suppose -2p = -3f + 955 - 215, -2f = -3p - z. What is the units digit of f? 4 Let x(r) = -r*2 + 20r + 45. Suppose 67h + 30 = 69h. What is the tens digit of x(h)? 2 Let g(p) = 72p - 660. What is the thousands digit of g(77)? 4 Suppose -3s - 91 = -298. Let m = 258 - s. What is the units digit of m? 9 Let r(z) = 138z2 + z. Let l be r(-1). Suppose -3g = -4i - 8g - 252, 5i + 4g = -315. Let x = l + i. What is the units digit of x? 4 Let g(y) = -y*3 - 12y*2 - 9y + 16. Let x be g(-9). Let r = 143 + x. Let h(v) = -30v + 1. What is the units digit of h(r)? 1 Suppose -26u - 1050148 = -29u - 55u. What is the units digit of u? 6 Suppose -5z = r + 2234, -2r + 2230 = -3r - 4z. Let l = r + 4379. Suppose 445 = -8k + l. What is the hundreds digit of k? 2 Let q = 19348 + 41644. What is the thousands digit of q? 0 Suppose 6 = 3t + 24. Let k be (-3)/t(5 - (-3 + 4)). Let r = k + 2. What is the units digit of r? 4 Suppose 0 = 4g - 2 - 10. Suppose -3r - 645 = -3d, -75 = -5d - gr + 1024. Let b = d - 116. What is the hundreds digit of b? 1 Let r(s) be the third derivative of 139s5/30 + 7s*4/12 + 4s*3 - 27s*2. Let z be r(-4). Suppose 12d - z = -4d. What is the units digit of d? 6 Let i(r) = 12r*2 - 42r + 9. Let x(y) = -14y2 + 41y - 9. Let u(q) = -6i(q) - 5x(q). What is the units digit of u(21)? 6 Let r be (30/8)/(-121/(-448)). Let w(d) = d3 + 10d*2 + 7d + 1. Let s be w(-7). Let g = s - r. What is the units digit of g? 9 Let g(c) = -c*3 + 5c*2 + 2c. Suppose -11x - 15 = 4x. Let s(i) = 6i2 + 3i + 2. Let q be s(x). What is the tens digit of g(q)? 1 Suppose -3o - 2o = 3k - 137389, -3k = 2o - 54952. What is the thousands digit of o? 7 Let i = 9 - -5. Suppose 3h - 5p = i, 0 = h - 4p + 2p - 6. What is the hundreds digit of h/(-3) - (-5 - 2695/21)? 1 Let y(b) = 69b*2 - 153b*2 + 6b*3 - 3b + 64b2 + 1. What is the tens digit of y(6)? 5 Let m(n) be the first derivative of 46 + 1/2n*2 + 31n. What is the tens digit of m(-4)? 2 Let z(l) = 155l - 1. Let c be z(5). Let r = -1258 + 1258. Suppose -5v + c = -3g, 2v - 7v - 5g + 790 = r. What is the tens digit of v? 5 Let c(a) = -a*2 + 111a + 1086. Let l be c(-9). Suppose 4u + 5 = 5j, 1 = 3u - j + 2. Suppose -lm - 4m + 120 = u. What is the units digit of m? 2 What is the hundreds digit of ((-60)/28)/(35/(-89425))? 4 Suppose 71j - 2812325 = -24j + 28j. What is the ten thousands digit of j? 4 Let t(g) = -g*2 - 9g - 12. Let f(w) = -w*2 - 10w - 12. Let i(n) = 2f(n) - 3t(n). Let b be i(-7). Suppose -4z + 0 = -b. What is the units digit of z? 3 Let o = 2554 + 2980. What is the thousands digit of o? 5 Let w(u) = -4u - 28. Let v be w(-8). Let q be 2 + 5/(-5) + v.	{ "pile_set_name": "DM Mathematics" }
utes after 7:03 AM? 6:33 PM How many minutes are there between 2:45 PM and 10:04 PM? 439 How many minutes are there between 8:23 AM and 9:55 AM? 92 How many minutes are there between 12:40 AM and 10:22 AM? 582 What is 399 minutes after 5:36 AM? 12:15 PM How many minutes are there between 1:18 AM and 1:17 PM? 719 What is 492 minutes after 10:24 AM? 6:36 PM What is 707 minutes after 3:36 AM? 3:23 PM What is 647 minutes after 1:04 AM? 11:51 AM What is 36 minutes before 10:11 PM? 9:35 PM What is 315 minutes before 9:00 AM? 3:45 AM What is 700 minutes after 6:15 AM? 5:55 PM What is 33 minutes after 7:26 PM? 7:59 PM What is 56 minutes after 10:26 PM? 11:22 PM How many minutes are there between 7:34 PM and 8:33 PM? 59 What is 624 minutes before 2:50 PM? 4:26 AM What is 709 minutes after 4:10 AM? 3:59 PM How many minutes are there between 9:27 PM and 7:52 AM? 625 What is 96 minutes after 5:22 AM? 6:58 AM How many minutes are there between 6:27 PM and 5:30 AM? 663 What is 468 minutes after 6:28 PM? 2:16 AM What is 323 minutes after 3:49 PM? 9:12 PM What is 231 minutes before 10:27 PM? 6:36 PM How many minutes are there between 3:30 AM and 7:55 AM? 265 How many minutes are there between 3:45 AM and 6:10 AM? 145 How many minutes are there between 1:35 PM and 7:29 PM? 354 How many minutes are there between 12:30 AM and 8:08 AM? 458 What is 155 minutes after 10:56 PM? 1:31 AM What is 624 minutes after 4:32 PM? 2:56 AM What is 662 minutes after 7:09 PM? 6:11 AM What is 706 minutes after 10:02 PM? 9:48 AM What is 223 minutes after 10:58 AM? 2:41 PM What is 503 minutes before 3:21 AM? 6:58 PM What is 573 minutes before 9:02 AM? 11:29 PM How many minutes are there between 11:48 AM and 3:46 PM? 238 How many minutes are there between 11:36 PM and 12:14 AM? 38 What is 402 minutes before 11:37 AM? 4:55 AM How many minutes are there between 3:12 AM and 10:11 AM? 419 How many minutes are there between 3:05 PM and 1:35 AM? 630 How many minutes are there between 3:39 PM and 12:55 AM? 556 How many minutes are there between 4:54 AM and 5:35 AM? 41 How many minutes are there between 8:59 AM and 9:26 AM? 27 How many minutes are there between 12:46 AM and 2:53 AM? 127 What is 53 minutes after 7:49 PM? 8:42 PM How many minutes are there between 6:26 PM and 9:18 PM? 172 How many minutes are there between 6:05 AM and 11:36 AM? 331 What is 492 minutes before 1:45 PM? 5:33 AM What is 424 minutes before 5:58 AM? 10:54 PM What is 19 minutes before 2:24 AM? 2:05 AM What is 40 minutes before 2:58 PM? 2:18 PM What is 446 minutes before 11:37 AM? 4:11 AM What is 305 minutes after 7:12 PM? 12:17 AM How many minutes are there between 11:50 AM and 10:24 PM? 634 How many minutes are there between 9:50 AM and 4:06 PM? 376 How many minutes are there between 3:22 PM and 6:27 PM? 185 How many minutes are there between 7:28 PM and 8:18 PM? 50 What is 167 minutes before 7:15 PM? 4:28 PM How many minutes are there between 3:59 AM and 3:17 PM? 678 What is 482 minutes before 2:00 PM? 5:58 AM How many minutes are there between 4:08 PM and 11:36 PM? 448 How many minutes are there between 7:10 PM and 4:46 AM? 576 What is 535 minutes after 3:35 PM? 12:30 AM What is 480 minutes after 1:14 AM? 9:14 AM How many minutes are there between 7:53 PM and 7:13 AM? 680 How many minutes are there between 2:00 AM and 6:24 AM? 264 How many minutes are there between 8:14 PM and 2:53 AM? 399 How many minutes are there between 10:13 PM and 9:23 AM? 670 What is 446 minutes after 10:41 AM? 6:07 PM What is 539 minutes before 1:43 AM? 4:44 PM What is 36 minutes after 8:59 PM? 9:35 PM How many minutes are there between 2:36 AM and 1:31 PM? 655 How many minutes are there between 11:58 AM and 11:29 PM? 691 How many minutes are there between 1:50 PM and 2:15 PM? 25 What is 82 minutes after 12:47 AM? 2:09 AM How many minutes are there between 6:15 AM and 2:55 PM? 520 What is 175 minutes after 8:41 AM? 11:36 AM What is 556 minutes after 8:20 PM? 5:36 AM What is 117 minutes before 2:59 PM? 1:02 PM How many minutes are there between 2:03 AM and 4:53 AM? 170 How many minutes are there between 3:41 PM and 6:55 PM? 194 What is 277 minutes before 4:27 AM? 11:50 PM How many minutes are there between 5:24 AM and 12:28 PM? 424 How many minutes are there between 11:29 AM and 11:41 AM? 12 What is 414 minutes after 3:31 AM? 10:25 AM What is 502 minutes before 2:04 PM? 5:42 AM How many minutes are there between 8:32 PM and 8:34 PM? 2 How many minutes are there between 11:44 PM and 10:56 AM? 672 How many minutes are there between 2:48 AM and 11:46 AM? 538 How many minutes are there between 8:57 AM and 9:22 AM? 25 What is 145 minutes before 9:00 PM? 6:35 PM How many minutes are there between 11:36 PM and 3:13 AM? 217 How many minutes are there between 3:11 AM and 12:03 PM? 532 How many minutes are there between 7:04 AM and 9:59 AM? 175 How many minutes are there between 11:09 PM and 11:11 PM? 2 What is 293 minutes before 8:36 PM? 3:43 PM How many minutes are there between 11:55 PM and 6:36 AM? 401 How many minutes are there between 6:41 AM and 9:36 AM? 175 What is 158 minutes before 7:14 AM? 4:36 AM What is 503 minutes before 1:08 PM? 4:45 AM What is 88 minutes before 8:37 PM? 7:09 PM What is 300 minutes before 7:32 AM? 2:32 AM How many minutes are there between 7:36 PM and 5:53 AM? 617 How many minutes are there between 8:13 AM and 11:44 AM? 211 How many minutes are there between 2:22 AM and 12:56 PM? 634 How many minutes are there between 12:49 AM and 10:59 AM? 610 What is 587 minutes before 8:17 AM? 10:30 PM What is 526 minutes after 10:45 AM? 7:31 PM What is 50 minutes after 6:27 AM? 7:17 AM What is 145 minutes before 8:10 PM? 5:45 PM What is 685 minutes before 3:08 AM? 3:43 PM How many minutes are there between 7:30 AM and 11:36 AM? 246 What is 255 minutes before 10:48 PM? 6:33 PM What is 609 minutes after 6:21 AM? 4:30 PM How many minutes are there between 3:21 PM and 6:27 PM? 186 How many minutes are there between 5:15 AM and 7:51 AM? 156 How many minutes are there between 8:17 PM and 10:27 PM? 130 How many minutes are there between 5:00 AM and 11:40 AM? 400 How many minutes are there between 9:18 PM and 3:02 AM? 344 How many minutes are there between 6:22 AM and 2:01 PM? 459 What is 291 minutes before 2:05 PM? 9:14 AM What is 485 minutes after 9:03 AM? 5:08 PM What is 90 minutes after 8:41 PM? 10:11 PM How many minutes are there between 5:34 PM and 3:58 AM? 624 How many minutes are there between 8:22 AM and 7:49 PM? 687 How many minutes are there between 5:18 PM and 9:27 PM? 249 How many minutes are there between 5:24 AM and 9:48 AM? 264 What is 485 minutes before 2:31 PM? 6:26 AM What is 432 minutes after 2:19 AM? 9:31 AM What is 127 minutes after 5:22 PM? 7:29 PM How many minutes are there between 5:03 PM and 9:46 PM? 283 What is 454 minutes before 8:21 AM? 12:47 AM How many minutes are there between 2:48 PM and 2:54 PM? 6 How many minutes are there between 9:43 PM and 12:11 AM? 148 What is 374 minutes after 7:24 AM? 1:38 PM How many minutes are there between 10:41 AM and 1:33 PM? 172 What is 194 minutes before 2:13 PM? 10:59 AM How many minutes are there between 9:32 AM and 7:13 PM? 581 How many minutes are there between 11:05 AM and 3:05 PM? 240 How many minutes are there between 8:45 PM and 12:56 AM? 251 How many minutes are there between 11:57 PM and 10:43 AM? 646 What is 456 minutes after 7:22 PM? 2:58 AM What is 25 minutes after 7:38 PM? 8:03 PM What is 627 minutes after 4:50 AM? 3:17 PM How many minutes are there between 2:43 AM and 3:22 AM? 39 What is 39 minutes before 3:41 AM? 3:02 AM How many minutes are there between 12:59 PM and 4:16 PM? 197 How many minutes are there between 7:17 PM and 5:37 AM? 620 How many minutes are there between 10:11 AM and 8:31 PM? 620 What is 332 minutes after 4:37 AM? 10:09 AM How many minutes are there between 2:31 AM and 4:31 AM? 120 How many minutes are there between 8:36 AM and 1:27 PM? 291 What is 10 minutes after 10:00 AM? 10:10 AM What is 274 minutes before 7:55 AM? 3:21 AM What is 691 minutes after 4:27 PM? 3:58 AM How many minutes are there between 8:58 AM and 9:37 AM? 39 How many minutes are there between 8:33 AM and 9:24 AM? 51 How many minutes are there between 5:04 PM and 11:	{ "pile_set_name": "DM Mathematics" }
a(-9). Is j less than or equal to r? True Suppose -g + 3q = 3g - 28, -5g + 2q = -42. Suppose -gi + 17 = -3. Let k be i(10 + (1 - -2)). Which is bigger: k or 25? k Let w be 4/8(-4 - -10) - 1. Suppose -wf - 15m - 14 = -19m, 3f - 5m = -18. Is 1/259 bigger than f? True Let d = -2541/17 + 5732513/38352. Is d less than or equal to 1? True Let z = 173.906 - -0.094. Let n = -173.962 + z. Is n > 0? True Let u be (-5712)/(-98)49/2. Let n be (-520)/u - (3 + 115/(-35)). Which is bigger: n or 0? 0 Suppose -4a = -30 - 26. Suppose 2h = v - 7, -2v - a = -3h + 6h. Do v and -3/140 have different values? True Let n be 13 + (-994)/84 - (-1514)/(-12). Which is bigger: -115 or n? -115 Let i = 0.5247 - 0.3247. Is i at least as big as 0.1291? True Let z(g) = -g - 16. Let o be ((-4)/2 - 12)10/(-35). Let f be z(o). Is f less than -22? False Let k(o) = 70o + 3852. Let t be k(-57). Do -146 and t have different values? True Let z = -1247 - -1456. Which is greater: 1458/7 or z? z Let i = 18.79 - 17.79. Is i at least 14726? False Let k = -75 + 203. Suppose -7y + 23y - k = 0. Let q be (34/8)/((-5)/(-8)). Which is greater: q or y? y Let l = 2140/9 - 238. Let a = -294.61 - 5.29. Let d = -300 - a. Is d > l? True Let r = -2808 - -6206. Is r at least 3396? True Let b = -77.0648 + -0.0352. Let z = b + 75. Let i = z - 0.5. Are -1/3 and i unequal? True Let l(y) = 20y + 120. Let f be l(-6). Let o be f + -3 + 8 + -1137. Do o and -132 have the same value? True Let l = -2123 - -2124. Let y = -4 + 2. Let r be (1/y)/((-1446)/(-24)). Do l and r have the same value? False Let m(y) = 74 - 5y2 - 84y - y*2 + 9y*2 - 5y2 - y2. Let g be m(-30). Is g smaller than -744/7? False Let o(t) = 42t - 4. Let c be o(-2). Let d be 67/38 + c/16 + 4. Suppose -2a - r = a - 5, 5a + 3r = 15. Is d greater than or equal to a? True Let o = 1163789/24 - 3473870221/71640. Let f = 2/995 - o. Which is smaller: f or -1? -1 Let k = -0.126 - -28.926. Let w = -38 + 9. Let r = k + w. Which is smaller: 1/43 or r? r Let j(o) = -241o + 2483. Let s be j(10). Which is smaller: s or 70? 70 Suppose 5n - 180 = -2q + 100, 3q + 4n - 371 = 0. Let w = 0 + 0.1. Which is greater: q or w? q Let c = -3962 - -3438. Is c not equal to -523? True Suppose 216o - 188o = -1204. Is o equal to -46? False Let m = -38.86 + -465.14. Which is greater: m or 4? 4 Let d(j) = 4j + 4. Let x be d(0). Let p be (105/(-14))/((-3)/x). Suppose -5t + pt = -120. Do -26 and t have different values? True Let d = 0.06 - -0.04. Let c = -22162.4 + 22158. Which is bigger: c or d? d Let c = 13.98 - 14. Let b = 7.9 + 80.1. Let w = b - 87.9. Which is smaller: w or c? c Suppose 4t + 12 = 0, 3y - 3t + 640 = -383. Let s = -342 - y. Which is greater: 4/3 or s? s Let t be (3 - 11) + ((-4980)/124)/(-5). Suppose 3p = 7p + 2b - 2, 5p + 1 = b. Let w be 0/(-1(-2 + p)). Which is smaller: w or t? w Let c be 632/498 + (-4)/6. Let o be (6 - 11348/664)/(-4). Let n = o + c. Which is bigger: 3 or n? n Let c be 198/(-45) + (-12)/(-30). Let p be (-6 + 0 - 0)c/(-8). Suppose -3z + 0z = -3. Are z and p equal? False Let n(a) = a2 + 2a - 28. Let q = -160 + 173. Let y be n(q). Is y greater than 166? True Let d = -12280.9 - -12281. Is 46/71 <= d? False Suppose 26 = -4j + 6. Let k be (-3 + (-10)/j)(-2 + -13). Let m = k - 16. Which is smaller: m or -3/62? m Let q be (-5)/(-11)(34980/175)/(-11). Let h = 6/11 + q. Which is bigger: -8 or h? h Let a(d) = 239d - 3123. Let j be a(6). Is -1687 < j? False Suppose a = 5k - 3329, 1211a - 5k - 13366 = 1215a. Which is smaller: -3337 or a? a Let r = 442 - 441. Let i be (-70)/28 - (r + (-33)/6). Let f be 3/9 + 4/6. Are f and i unequal? True Let b be 690/(-3220)(-34)/(-36). Which is smaller: b or -1? -1 Let h = 604315/57 + -10602. Is -5 less than h? True Let u be ((-2)/6)/(-3 + 133/42). Let j be (107104/52)/u - (-4)/(-26). Let p be 5130/j - (-1 - 4). Which is smaller: p or -1? -1 Let u = -37789 + 37789.833. Is u less than or equal to 10? True Suppose 4v + r - 954 = -r, r = -5v + 1191. Let t be (-35)/(455/(-3042)) + 5. Is v >= t? False Suppose -5o = -s - 3o + 2, -s = 3o + 3. Let k = 4 + s. Let t = 7108 - 7107.95. Are k and t unequal? True Let r = -1717 + 3694. Which is smaller: r or 1978? r Suppose -20 = -4y + 4a, -5y + 0a + 21 = -a. Suppose 877 = yk - 943. Let d = 1837/4 - k. Which is smaller: 4 or d? 4 Suppose 3f + s = -34, -4f - f - 53 = -2s. Let r = 1238 + -1248. Which is smaller: f or r? f Let x(i) = 353i - 2117. Let b be x(6). Is -1/132 > b? False Let b(i) = -2i*2 + 3i + 4. Let c(v) = v. Let d(m) = m*2 - 14m + 21. Let q(l) = 3c(l) + d(l). Let n be q(9). Let j be b(n). Are -6 and j equal? False Let z be (((-8)/(-6))/2)/(3/(-45)). Let m = z - -1. Is -9 less than or equal to m? True Let l(r) = 2r*3 - 14r*2 + 21r - 230. Let a be l(8). Which is smaller: 14 or a? 14 Suppose -6 = -12r + 11r + 5p, -2p + 24 = 4r. Suppose -25o + r = -19o. Is 2/209 less than o? True Let m be (49/(-413658))/(4/45561). Let q = -75/56 - m. Which is bigger: 1 or q? 1 Suppose 9n - 11n + 451 = 3q, 2q - 1144 = -5n. Let p be (-1 - (-398)/n) + (-18)/30. Is p greater than -1? True Let u = 241 - 261. Let r be (-9 + (-2082)/(-234))/(u/(-66)). Which is smaller: 1 or r? r Suppose 5 = 50m + 255. Let g = -46 - -43. Is g equal to m? False Let n = -7 + -2292. Is -2/3 less than or equal to n? False Suppose -k = -5h + 217, h - 2k = -3h + 176. Suppose 117 = 46f - hf. Let b be (f/52)/((-5)/(-16)14). Is 1/2 less than b? False Suppose 40 + 74 = -x. Let q = x + 568/5. Which is bigger: 0.05 or q? 0.05 Let x be (-51)/15 + 3 + (-48)/(-20). Suppose 16 = d - xv, -3d + 0v + 28 = -v. Which is greater: d or 9? 9 Let h = 0.0003 - 213.0003. Let p = 1077 + -1076.9. Are p and h unequal? True Let l = 0.31688 - 0.01688. Which is greater: l or -0.132? l Let q(s) = 421s - 2912. Let j be q(8). Which is greater: j or 454? j Let i be (14/(-6))/((-188)/(-564)). Which is smaller: 405 or i? i Let a = 369.79 - 372. Let v = a - -1.91. Is v bigger than -4/7? True Let j = -67.1 + 67.05. Is -18 greater than j? False Let j = 5597/585327 + 1/1497. Which is smaller: -1 or j? -1 Suppose 0 = 2d + 3u, 5d + 0u = 5u. Suppose d = y + 1 - 17. Suppose -3v + y = 4. Which is smaller: 5 or v? v Let d be (-24)/(-21) + (-66)/77. Suppose f - 2l - 1 + 3 = 0, 0 = l - 1. Is f at most d? True Let u(l) = -55l + 1614. Let t be u(15). Is t bigger than 789? False Let l = -17365/6916 - -129/52. Let n be (0(49/21)/7)/4. Which is smaller: n or l? l Let u = 219476355/44 - 4988516. Let g = 417 + u. Suppose 4a - 6a = 2. Which is bigger: a or g? g Let i = -772 - -764. Let y = -0.114 - -0.164. Which is bigger: i or y? y Let c = 1569.6 + -1569.6. Let d = -0.054 + -39.946. Which is bigger: d or c? c Let u = 4.5953 + 0.0447. Let g = u + -4.54. Let q be (-5)/(-3)15/(-65). Is q not equal to g? True Let f = -34169/2960 - -197/80. Is -8 bigger than f? True Let a = -25 - -43. Let g(n) = -7n + 11n2 + 8n2 - n3 + 28n - 3. Let r be g(20). Is a smaller than r? False Suppose -59g + 63g + 572 = 0. Let b = g - -146. Let j be (-25)/b(-2 - 1). Which is greater: j or -1? j Let t = -397 + 7540/19. Let c = -24 + 25.76. Let q = c - 0.76. Is q greater than or equal to t? True Let c be (-4)/(-18) - (-11)/(792/8912). Is 3 greater than or equal to c? False Let v be -3 - (-5 - (-465)/90 - 215029/6). Which is bigger: v or 35834? v Suppose 76c + 1467 = 85c. Suppose 2f - 157 = -c. Is f at most as big as -27? False Let k = -176 - -201. Let g = -24.91 + k. Is g at least as big as -0.3? True Let o = 0.028 - 0.051. Let s = 0.079 + o. Let p = s + 2.944. Which is greater: p or -2/9? p Let q(p) = -263 + 266 - 3p - 5p - 3p - 2p2. Let c be q(-6). Suppose 17 + 3 = -4b. Is b equal to c? False Let t = 55 + -40. Suppose 0 = 5a - t + 190. Let y = a - -21. Which is smaller: 2/3 or y? y Let i = 27.15 + -14.862. Let n = i + -0.288. Which is bigger: -9 or n? n Let m be (-6)/91/2. Let v be 124/(-682)(-6)/(-4). Is v at least m? True Let n(h) = 2h + 36. Let r be n(-14). Suppose -5y + y - 738 = 5a, -370 = 2y + 2a. Let j be (-2)/r + y/68 + 6. Is 7/4 greater than or equal to j? False Suppose 3i - i = -2q + 40, -2q = 4i - 40. Suppose 6 = 2z + 5u + q, 8	{ "pile_set_name": "DM Mathematics" }
increasing order. -88, 0, v, 4 Suppose 0 = 4s + 5g + 22, -s - 3g = -50 + 52. Suppose 0 = 4w + 5m - 12, -5w - 2m + 15 = -4m. Suppose wt + 15 = 3. Sort s, t, 1 in descending order. 1, t, s Suppose -271 - 788 = 3z. Let j = z + 354. Let i = -6 + 3. Sort 0, -13, j, i. -13, i, 0, j Let v(j) = 32j3 - j2 - j. Let o be v(-1). Let r be ((-2)/(14/(-3)))/((-39)/9828-36). Put r, 1, o in ascending order. o, 1, r Let m = -0.2725 - -0.5725. Sort 2/9, 3, 2/1059, m in ascending order. 2/1059, 2/9, m, 3 Let s = 0.33 + -0.03. Let c = -83199 + 4076749/49. Sort 2, c, s in decreasing order. 2, s, c Let j be 16 - (-1 + (-2)/(-2)). Let x(a) = -36a2 - 8a - 5. Let u be x(-1). Let m = -36 - u. Sort m, j, -2 in decreasing order. j, -2, m Let r = 92 - 85. Suppose 2y - 2 = -9m + rm, 0 = -5y + 4m + 5. Let c = 203 - 198. Sort y, -5, c. -5, y, c Let j = -175313/9 + 19479. Put 2/5, 0.2, -17, 13/5, j in increasing order. -17, j, 0.2, 2/5, 13/5 Let n = 0.0941 + -0.1941. Put 4, -1, n, -0.174 in descending order. 4, n, -0.174, -1 Let v be (16/(-20))/((-18)/15)-279. Let r = v + 189. Sort 2, r, 4. 2, r, 4 Let l be ((-23)/138)/((-4)/(-18)). Suppose 22p - 1200 = -18p. Sort p, 1/3, l. l, 1/3, p Let w = -57/40 + 13/10. Suppose -3204s + 5t = -3209s - 30, 2t + 16 = 0. Put s, w, -3 in decreasing order. s, w, -3 Suppose -5a = 3f + 17, 4 = 20f - 16f. Put a, 3, -17, 15 in ascending order. -17, a, 3, 15 Suppose h + 10 = -h, 0 = -t - 4h + 3760. Let n be ((-12)/(-14))/(120/t). Let o be -22/6-3. Put o, n, 0, 3 in decreasing order. n, 3, o, 0 Let b = -0.5 + 1. Let k = 1.579 - -0.539. Let l = 0.118 - k. Put b, l, 3 in increasing order. l, b, 3 Let p be (-5 - 96/(-18))/(3(-3)/27). Sort -33, 4, 10, p. -33, p, 4, 10 Suppose 3q = -2d + 7 + 66, 54 = d + 5q. Sort d, 4, 2 in decreasing order. d, 4, 2 Let z = -1 + -1. Suppose -18t - 10t + 14000 = 0. Suppose 139y - 39y = -t. Put 0.007, z, y in decreasing order. 0.007, z, y Let l = -0.94 - -1.04. Let f = -61.9 - l. Let c = f - -57. Put c, 5, 0.4 in decreasing order. 5, 0.4, c Let m(i) = 10i*2 + 184i + 77. Let w be m(-18). Put -2, w, 45 in increasing order. -2, w, 45 Let z = 45.257 - 45.381. Let r = 0.33 + 0.07. Sort z, r, -0.1 in descending order. r, -0.1, z Let n(f) = -f*2 + 10f + 22. Let q be (-4)/(-6) - ((-62)/6 + -1). Let h be n(q). Let c = 27 + -21. Put c, h, -1 in decreasing order. c, -1, h Suppose 2s - 1 + 3 = 0. Let m be (20/4)/(2/(3 + s)). Suppose 3j + 36 = 7j - mf, -5j = f - 16. Sort -3, -4, -1, j in decreasing order. j, -1, -3, -4 Suppose -56z + 7z - 245 = 0. Let p = 0.1 + -0.3. Let a = -4.8 - -5.1. Put p, a, z, 2/9 in increasing order. z, p, 2/9, a Let t = -25 - -63. Let h = 22 - t. Let v be -12 + (-1)/(4/h). Sort v, 2, -1, 4 in descending order. 4, 2, -1, v Suppose 5w + 24h - 15 = 25h, -5w - 2h = -30. Suppose -11 = -42g + 43g + 4o, wg + 5o + 22 = 0. Let j be (1 - -2)4/3. Put -31, g, j in ascending order. -31, g, j Let b = -16601 + 16601.08. Let r = -6.9 - -7. Sort 3, b, 5, r in decreasing order. 5, 3, r, b Let f = 186 - 171. Let b be 0/((-5)/(f/6)). Put -3, b, 37, 4 in decreasing order. 37, 4, b, -3 Let k = 707 - 705. Let u be (-4)/(-16) + 7/4. Suppose -uo + k = 8. Put o, 8, -4 in descending order. 8, o, -4 Let v = 5 + -9. Let q be 25048/(-14140) + 18/7. Sort v, -0.4, -2, q in decreasing order. q, -0.4, -2, v Suppose 5n = 71 - 21. Let j be (-1023)/(-15) - (-8)/n. Let y = j - 38. Sort 0, y, -1 in decreasing order. y, 0, -1 Let i = -11093 - -33277/3. Put -5, -0.2, i, -2/9, 2/11 in descending order. 2/11, -0.2, -2/9, i, -5 Suppose -2g + 13 = -4x + 5, 3x + 34 = 5g. Suppose 5h = -22 - g. Put 4, -2, -5, h in descending order. 4, -2, -5, h Let o = -219 + 209. Let s be 2 + o/(-4)66/55. Sort s, -1, 2 in ascending order. -1, 2, s Suppose 0 = -3z - 94s + 95s - 10, 2z = -4s + 12. Sort z, -3, -4, 1, 6 in increasing order. -4, -3, z, 1, 6 Let p(k) = -k3 - 12k*2 - 92k - 1120. Let i be p(-12). Put 0, i, -48, -5 in decreasing order. 0, -5, i, -48 Let m = 536 + -359. Let t = 179 - m. Let h(o) = o*3 + 4o*2 + 2o - 4. Let a be h(-3). Put -11, a, t in ascending order. -11, a, t Suppose 3l - 495x - 226 = -500x, 4l - 216 = 4x. Sort 1, l, 5 in decreasing order. l, 5, 1 Let c = -23.57 - -24.711. Let d = -7.26 + c. Let j = d - -0.119. Sort -4, -2/9, j. j, -4, -2/9 Suppose 5n + 2k + 3k + 335 = 0, -3k + 219 = -3n. Let u = n + 69. Let w be (-154)/(-44)u/(2/(-4)). Put 0, w, 2 in increasing order. 0, 2, w Suppose 10 = 7f - 2f. Suppose -18t + 15t - 2i = -75, 0 = 4t + 3i - 102. Put 5, f, t in increasing order. f, 5, t Let k be (51 - 50)/(3 - 16/5). Sort 13, -9, k in decreasing order. 13, k, -9 Let u = 39 + -37.1. Let n = 4.9 - u. Let m = -49 - -62. Sort m, n, 0.4, 1/9 in descending order. m, n, 0.4, 1/9 Suppose 0m + 12 = 3m. Let c be -2((-1 - 2) + 6)-6. Let u = -34 + c. Put -5, m, u in descending order. m, u, -5 Let z(c) = -c*2 + 30c + 869. Let b be z(-18). Let s be 3/9 - 2/(-3). Sort s, b, -3 in descending order. b, s, -3 Let l = 273.6 - 272.6. Sort -2/5, -67, -4/9, l, 0.1 in descending order. l, 0.1, -2/5, -4/9, -67 Let v = -9 + 0. Let m = 27 + v. Suppose -2k - 15 = -x + 3k, 33 = 5x - 4k. Sort 1, x, m in ascending order. 1, x, m Let n = -2843/2 - -1422. Put 2, -482, n in decreasing order. 2, n, -482 Let b = -0.15 + 4.15. Put -48, -7, b in ascending order. -48, -7, b Suppose 5n + 18 = -4q - 2, 3q - 3n = -15. Put q, 429, 3, -4 in increasing order. q, -4, 3, 429 Let d be 381((1 - 4/3)19 + 6). Sort 4, -4, d in descending order. 4, -4, d Let j = 29.609 - 40.609. Let s be (0 - 0) + 6/14. Sort j, 2, s in decreasing order. 2, s, j Let b = -0.2174 - 0.0826. Put b, 447, -4, 2/5 in increasing order. -4, b, 2/5, 447 Suppose 6s + 544 = -6s + 28s. Put 2, 1, s, -3 in increasing order. -3, 1, 2, s Suppose -296 = a + 3a + u, 5u = 3a + 222. Let g be a/(-26) + (-8)/(-156)3. Sort 0, g, -5, 2 in ascending order. -5, 0, 2, g Let a be 150/9(-9)/(-6). Suppose 42f - a = 47f. Let x(n) = n3 - n2 - n + 1. Let w be x(1). Sort f, w, 4, 9 in increasing order. f, w, 4, 9 Let r = -19 - -22. Suppose 0 = ri + 12, -i - 11 = -3a + i. Suppose -u + a + 16 = 0. Sort u, 2, -4 in descending order. u, 2, -4 Suppose -y - 6 = -q - 12, y + 5q + 18 = 0. Sort -88, y, 8 in decreasing order. 8, y, -88 Let t = 2819.17 + -2819. Sort t, -4, 8, -0.2 in descending order. 8, t, -0.2, -4 Suppose -40 = -4l + 72. Let i be (-12)/14l/(-6). Let r be 3 - (-24)/(-3) - 9/(-3). Sort i, -3, r, -4 in ascending order. -4, -3, r, i Let t = 1/827 + 1639/12405. Let j = -4.1 - 0.9. Put t, j, 2/3, 1/9 in descending order. 2/3, t, 1/9, j Let p = -31364 - -31363. Let s = -0.09 - 0.41. Put p, 6, s in decreasing order. 6, s, p Let c = 2781 + -2781.2. Suppose s = w - 2, 3w - 7 = w + 5s. Sort -2/35, w, c. c, -2/35, w Suppose -p - 8 = -5l, -2l = -5p - l - 16. Let k = 42 - 52. Let w(a) = a*3 + 9a*2 - 10a + 4. Let t be w(k). Put p, t, 5 in descending order. 5, t, p Let w be (-11 - 1) + -7 - -7. Let h(s) = -5s3 - s2 + 1. Let p be h(1). Suppose -8n + 2n = 18. Put n, w, 0, p in ascending order. w, p, n, 0 Suppose -5146 = -224s + 255s. Sort -3, -5, -2, s in descending order. -2, -3, -5, s Suppose -10 = -5f + b + 21, -3f - 5b - 15 = 0. Sort -1, 0, 7, f, -12. -12, -1, 0, f, 7 Let r(n) be the third derivative of 0n + 1/15n*5 + 0 + 1/6n*4 - 10n*2 + 1/2n*3 + 1/60n*6. Let s be r(-2). Put 2, 0, -1, s in decreasing order. 2, 0, -1, s Suppose 3465 = 924u + 231u. Suppose -2 = z - 3. Sort 2, -4, z, u. -4, z, 2, u Suppose -35i + 1075 = 1075. Put -59, i, 2, 3 in ascending order. -59, i, 2, 3 Let f = -128 - -302. Sort -5, f, -3, -4, -1 in decreasing order. f, -1, -3, -4, -5 Suppose -9 = -0x + 3x. Let p be -1 + (3 - 3)/x. Suppose a = 5s + 26, 2 = s - 4a + 11. Sort s, 3, p, -18. -18, s, p, 3 Let t = -3394 - -3400. Sort -572, t, 0.4 in decreasing order. t, 0.4, -572 Let u = -0.04 - 3.96. Let c be (-4)/(-1) - (-3024)/(-462). Let x = c - -230/99. Put 2/7, x, u in decreasing order. 2/7, x, u Suppose -455 - 222 + 23 = 109o. Let n be (-3)/(-21)(-14)/(-12). Put n, -4, o in ascending order. o, -4, n Let s be (-34)/(-308) + 2/420*15. Sort 21, 37, 3/2, 5, s. s, 3/2, 5, 21, 37 Let d be (-21)/(-3 + 52/	{ "pile_set_name": "DM Mathematics" }
sqrt(324))). -10sqrt(19) Simplify -3 + (sqrt(833)-16)*2-2 + -3 + sqrt(68) + (sqrt(68) + 1)*2 + -3 + -1. -59917 + 6sqrt(17) Simplify 0 + 1(-1 + -3sqrt(125)2-5 + ((sqrt(125) - (-1 + sqrt(125) + sqrt(125))) + 4)3)2. 3780sqrt(5) + 91321 Simplify -5(sqrt(20)-6 - (5sqrt(20)/sqrt(4))2) - (-2sqrt(55)-1)/(sqrt(275)-2). 301sqrt(5)/5 + 625 Simplify (-1 + 5(-4(3 + -1 + sqrt(5) + sqrt(640)/sqrt(8)))2)44. 25600sqrt(5) + 165104 Simplify (sqrt(405)-1)2 + (3sqrt(245))*2 + ((sqrt(5) - sqrt(125)) + 5 - (sqrt(405)1)*2). -4sqrt(5) + 2210 Simplify (1((sqrt(2) - (-4 + sqrt(16)/sqrt(8)) - (-4(3 + sqrt(2)) + sqrt(2))) + -5((1sqrt(72) - sqrt(72)) + 0)))*2. 96sqrt(2) + 274 Simplify (-6(-1 + -3 + 2sqrt(891)))*2 + 1((sqrt(66) - 3sqrt(66))/sqrt(6) + 2 + sqrt(11)-3). -5189sqrt(11) + 128882 Simplify 6(2(2sqrt(1700) + 4 + 2(1 + sqrt(1700)))2 + 1) + 4. 5760sqrt(17) + 326842 Simplify (-3(sqrt(1470) + sqrt(1470)14 + sqrt(1470) + sqrt(1470)13)/(2-4(sqrt(120)2)/sqrt(12)))*2. 107163/256 Simplify (-66((-4sqrt(2057)1 - (sqrt(2057) + 0 + -1)) + -1 + -1)-1)*2. 142560sqrt(17) + 66648096 Simplify 0 + (sqrt(76)/(sqrt(4) + 1sqrt(144) + sqrt(144) + sqrt(144)))2 + -4 + -4 + (3 + (sqrt(475)1-2 - sqrt(475)) + sqrt(475))2. -60sqrt(19) + 36120/19 Simplify (0 + 3 + -3(-5 + sqrt(175) + 1 + sqrt(175))-3 + -5)*23. -20520sqrt(7) + 174432 Simplify -2(2-1sqrt(119) - 1sqrt(119)-2)/((sqrt(84)/sqrt(3))/sqrt(4) + sqrt(28)3) + -2. -2 Simplify -3(((-2 + sqrt(304))-4 + 3)2 - 1-1(2 + sqrt(304) + sqrt(304))). -14961 + 1032sqrt(19) Simplify ((sqrt(4212) + (-62sqrt(4212) - sqrt(4212) - sqrt(4212)) + -1)*2 - -4-3(sqrt(4212) + 2)2) + 3. -396sqrt(13) + 661240 Simplify (1 + (5 + sqrt(684)-1 + 3 - 6(-2 + 3sqrt(684))))2. -4788sqrt(19) + 247365 Simplify (((sqrt(140)/(sqrt(14)/sqrt(2)))/sqrt(10) + 2)*2 + 2(sqrt(2) + (sqrt(36)/sqrt(2))/sqrt(9))*2 + 4)-6. -156 - 24sqrt(2) Simplify -4((5 + 1 + sqrt(1573) + sqrt(1573))*2 - ((sqrt(1573) + 1)6)*2) + 3 + (sqrt(1573) + 0 + -1 - (-2(1 + sqrt(1573) - sqrt(1573)))*2). 2123sqrt(13) + 201342 Simplify (sqrt(99)-1 - (sqrt(275) + 0 - sqrt(11)))2 + 1 - (sqrt(77)25)/(5sqrt(21)/sqrt(3)). -2sqrt(11) + 540 Simplify (((-2sqrt(297))/sqrt(11) + sqrt(27))/((sqrt(33)-1)/sqrt(11)))/((sqrt(99)/(1sqrt(3)))/(22sqrt(11)))-5. -20sqrt(3) Simplify (sqrt(26) + (sqrt(52) + sqrt(832))/sqrt(2))/(-2sqrt(18) + sqrt(18)) + -4 + sqrt(468)3. -4 + 16sqrt(13) Simplify (sqrt(2592) + (2sqrt(2592) - sqrt(2592)) + sqrt(2592))/(1sqrt(96))1 + ((sqrt(72)/sqrt(4) + sqrt(18))6)/(sqrt(96)-1). 6sqrt(3) Simplify (sqrt(8) + sqrt(72)-4 + sqrt(8) - (-2sqrt(200) + sqrt(200)))/(((2sqrt(88) - sqrt(88))/sqrt(11))/(sqrt(50) + sqrt(50)-2)) + -5. -5 + 25sqrt(2) Simplify -3(5 + 3(-4(sqrt(1700) + (sqrt(1700) - (-1 + sqrt(1700))2)) - (-2(sqrt(1700) - (1sqrt(1700))2) - sqrt(1700))))2. -61302 + 2340sqrt(17) Simplify ((sqrt(88)2-4 + sqrt(88) - (sqrt(88) - sqrt(88)2 - sqrt(88))-3)3)/(-2(sqrt(288) + 1sqrt(288) - sqrt(288))-5) + 3. -13sqrt(11)/20 + 3 Simplify (5 + (sqrt(72) + sqrt(72)2 - (sqrt(8) - sqrt(32))6)/(-5(sqrt(36) - (sqrt(324) + 3sqrt(324) - sqrt(324) - sqrt(324))/sqrt(9))/sqrt(9)))*2. 30sqrt(2) + 43 Simplify (4 + -4(3 + 1sqrt(1573)) + 1((sqrt(1573)-2 - sqrt(1573)) + 3) + -5 + 2 + 1)*2. 1078sqrt(13) + 77126 Simplify (2sqrt(35)2-1)/(5sqrt(605)4). -sqrt(7)/55 Simplify 1 + (-2(sqrt(245) + -1 - sqrt(245)))*22 - ((sqrt(245) + 1 + sqrt(245))*2 + -5 + ((3(sqrt(245) + -2))*2 - sqrt(245))). -3208 + 231sqrt(5) Simplify (-65-36(sqrt(153) + -1)-1 + -4)2. -1736640sqrt(17) + 44902096 Simplify 4(((sqrt(315) - (sqrt(315) + sqrt(315) + (sqrt(315) - sqrt(315)-1)-3))/sqrt(7) + -2(-1sqrt(495))/sqrt(11))2 + -4). 8804 Simplify (sqrt(19) + sqrt(76)/sqrt(4) + -2 - -3(0 + sqrt(19)) - (-5(-2 + sqrt(1539)) + 3))2. -30 + 100sqrt(19) Simplify -6(-1 + (-4 + (sqrt(480)-2)/sqrt(10) + sqrt(48) - (sqrt(192) + 0 + 5)) + 4 + 0)2. -2808 - 864sqrt(3) Simplify -5(-4sqrt(110)2 + (sqrt(110) + 11sqrt(110) - sqrt(110)))/((3sqrt(90) + (sqrt(40)-1)/sqrt(4))2). 35sqrt(11)/16 Simplify ((42sqrt(18)1)/(4sqrt(36)/sqrt(4) + (sqrt(225) - ((-1sqrt(225) - sqrt(225)) + sqrt(225)) - sqrt(9))) + -2)*2. -32sqrt(2)/13 + 804/169 Simplify -5 + (sqrt(99)-3 + sqrt(99))2 - (sqrt(99) - 42sqrt(99)) - 3(-4(0 + sqrt(99)) - (sqrt(99) + -2 + -4))2. -7142 + 561sqrt(11) Simplify (-2((sqrt(19) - sqrt(114)/(1sqrt(6))) + 3))2 - (-3 + (sqrt(114)/sqrt(6))2 - (2 + 3 + sqrt(19))). sqrt(19) + 25 Simplify ((3(2 + sqrt(2299) - sqrt(2299))-1 - (-1 + sqrt(2299) + sqrt(2299) + 0 + sqrt(2299)2-6))2)2. -4400sqrt(19) + 919700 Simplify (1 + -3(3 + 3(-1 + sqrt(304)) + 0 + sqrt(304) + -1 + sqrt(304) + 2)5)2-6. -10261176 - 50400sqrt(19) Simplify -6((-1sqrt(384) + 4(sqrt(6) + sqrt(96)))/(1(1sqrt(200) + sqrt(200) - sqrt(200))) + -1)*2. -798/25 + 72sqrt(3)/5 Simplify -5 + -3 + -2(((sqrt(117)/sqrt(9))2 + 1 - (sqrt(78) - 2sqrt(78))/sqrt(6)) + 5). -46 - 2sqrt(13) Simplify (((sqrt(171)3 + sqrt(171))-6 + sqrt(171) - (sqrt(171) - 4-1sqrt(171)))/(-3sqrt(108)/(sqrt(768) - (sqrt(768) + 1sqrt(768)))))2. 953344/9 Simplify -5(3((sqrt(75) - (sqrt(75) + sqrt(75) + 1 - sqrt(75)))-6)2 - ((-1 + sqrt(75))2-6 - 1(sqrt(75) + (sqrt(75) + 1)*2))). -3200 + 225sqrt(3) Simplify -5 + ((sqrt(162) + 0)6-4 - (sqrt(162)22 - (-2 + sqrt(162))4)2) + -4. -216sqrt(2) - 73 Simplify (-3 + 2 + (sqrt(475)1 - sqrt(475)) + -3 + -1(0 + sqrt(475)) + -1)*2. 50sqrt(19) + 500 Simplify ((-1sqrt(245) + 2)2 - 3sqrt(245)1) + -5(sqrt(245) - (-3 + -1 + sqrt(245)) - (-5 + sqrt(245) + 0 - sqrt(245)))*2. -156 - 49sqrt(5) Simplify (-3 + -1(sqrt(80) + (sqrt(80) - (sqrt(80) + 0 - sqrt(80))))-15 + 6((-2 + sqrt(80) - sqrt(80)) + -5) + -4)*2. -3920sqrt(5) + 10401 Simplify (616-1-5(3 + sqrt(320))-5)*2. 38880000sqrt(5) + 266490000 Simplify 3(0 + (0 + sqrt(1573))-4)2 - (((sqrt(130)/(sqrt(40)/sqrt(4)))2 - (sqrt(208) + 1)) + -2sqrt(1573) + 1). 26sqrt(13) + 75491 Simplify (4 + -23(sqrt(2057) + sqrt(2057)1 + 4 + -3)-24)2. 109824sqrt(17) + 18960016 Simplify (-1(sqrt(117)3-6 + sqrt(117)))/(4sqrt(27)/sqrt(48)). 17sqrt(13) Simplify ((sqrt(16) - sqrt(4))-4)/(sqrt(2) + sqrt(2) + (sqrt(288)1 - sqrt(2))) - ((sqrt(72)-3 + sqrt(72))-64)*2. -165888 - 4sqrt(2)/13 Simplify (sqrt(8) - ((sqrt(72))2 + 5)) + (sqrt(200) + sqrt(200) + 2)2 - ((1sqrt(72))2 + sqrt(10)/sqrt(5) + 0 + -1). 81sqrt(2) + 656 Simplify 4(-6-5sqrt(450) + sqrt(450) + 1 + 0 + (sqrt(450) + -2)3)*2. -20400sqrt(2) + 2080900 Simplify 3 + (-6sqrt(32)/sqrt(2) - sqrt(400)3)/(1((sqrt(1152) + sqrt(1152)3 - sqrt(1152)) + sqrt(1152) + sqrt(1152))4). -7sqrt(2)/80 + 3 Simplify -3 + (-2(sqrt(176) + sqrt(176) + 2) - (-3-1sqrt(176) - sqrt(176)) - (sqrt(176) + -1 + -2 + sqrt(176) - 2sqrt(176)-6))2. 160sqrt(11) + 70398 Simplify -5(((sqrt(112) + 1)-6 - (0 + (sqrt(112) + -1)*2)) + (-6(42sqrt(112) - sqrt(112)))*2). -987245 + 80sqrt(7) Simplify (22(sqrt(72)1 + 2 + 5 + 4(-5 + 0 + sqrt(72))))*2 + -3. -12480sqrt(2) + 31501 Simplify (-5((sqrt(84) + (sqrt(84) - 3sqrt(84))5 - sqrt(84)) + sqrt(84)))/(sqrt(132)/((sqrt(1584) + sqrt(11))5)). 2925sqrt(7) Simplify -4 + -2((0 + sqrt(320) + 2)*21 + (sqrt(320) + -1 + sqrt(320) + -3)*2 + 3)2. -6496 + 384sqrt(5) Simplify 45(4(sqrt(22) + -4sqrt(44)/sqrt(2)))/(sqrt(22)/(2sqrt(704))). -3840sqrt(11) Simplify ((5sqrt(684) + sqrt(684))*2 - sqrt(19) - (sqrt(19) - (sqrt(19) + 1 + -3))) + ((sqrt(19) + sqrt(19) + -2 - sqrt(19)) + -2 - (2 + 1sqrt(19)))*2. -sqrt(19) + 24658 Simplify ((sqrt(360) - (sqrt(360) + 1(sqrt(360) + (sqrt(360)3 - sqrt(360))) - sqrt(360))) + sqrt(360))/(sqrt(200)-3)4 + 1. 1 + 4sqrt(5)/5 Simplify (((1sqrt(132)6 - sqrt(132)) + sqrt(132) - sqrt(132) - sqrt(132))13)/(sqrt(1452) + (2sqrt(1452) + sqrt(1452))-2 + -2sqrt(1452)2). -4sqrt(11)/33 Simplify (((0 + (sqrt(425) + 3)-5 + sqrt(425))*2 - (-2 + 3sqrt(425) - sqrt(425))*2-4) + -5)2. 880sqrt(17) + 27672 Simplify (3sqrt(20)-1 - (1sqrt(80) + sqrt(80)))/(sqrt(64)-4 - sqrt(100)2). 7sqrt(5)/26 Simplify -2*((-4 + 1 + sqrt(13) + -1 + -	{ "pile_set_name": "DM Mathematics" }
934 rounded to 1 decimal place? -2455 What is 19.8954625 rounded to two dps? 19.9 Round 3.9481018 to one dp. 3.9 What is -713.652625 rounded to the nearest 100? -700 What is -8757.909435 rounded to the nearest 1000? -9000 Round 4490267889 to the nearest 1000000. 4490000000 What is -15190.8058 rounded to 0 decimal places? -15191 What is -33120.04178 rounded to the nearest one hundred? -33100 What is -293415.559 rounded to the nearest one hundred? -293400 Round 3667.2312 to the nearest 1000. 4000 What is 6718.90252 rounded to one decimal place? 6718.9 Round 6750833700 to the nearest one million. 6751000000 Round -0.12400218 to 3 dps. -0.124 Round -136278.21933 to the nearest 10. -136280 Round 11.376454215 to two decimal places. 11.38 Round -592.59272 to the nearest integer. -593 What is 67176.869 rounded to the nearest 10000? 70000 What is -0.000002492998847 rounded to six decimal places? -0.000002 What is -10075065.9 rounded to the nearest one thousand? -10075000 What is 2889155510 rounded to the nearest one million? 2889000000 What is -161.93278 rounded to 2 decimal places? -161.93 What is 0.89449658 rounded to 1 decimal place? 0.9 Round 10690521.19 to the nearest 10000. 10690000 What is -142.710727 rounded to one decimal place? -142.7 Round 138.749273 to two dps. 138.75 Round 778153280 to the nearest 100000. 778200000 What is 0.25416527 rounded to one decimal place? 0.3 What is -0.0000523327704 rounded to six decimal places? -0.000052 What is 0.000022017292 rounded to seven dps? 0.000022 What is -5.0851971 rounded to the nearest integer? -5 Round 922290230 to the nearest one hundred thousand. 922300000 Round 3258746 to the nearest 1000000. 3000000 Round -179.778882 to one decimal place. -179.8 What is -0.700477043 rounded to 2 decimal places? -0.7 Round -279.665522 to the nearest integer. -280 Round -59569605 to the nearest 10000. -59570000 What is -28.90294662 rounded to 3 dps? -28.903 Round -33606147.5 to the nearest 10000. -33610000 Round 5622.2827 to the nearest integer. 5622 What is 0.00002060086549 rounded to 7 dps? 0.0000206 What is 11371295.3 rounded to the nearest 1000? 11371000 Round -26726356 to the nearest ten thousand. -26730000 Round -721.160658 to 0 decimal places. -721 What is 1477138670 rounded to the nearest one million? 1477000000 What is -0.283264258 rounded to 2 decimal places? -0.28 What is 0.00074636664 rounded to five decimal places? 0.00075 What is 9738094.151 rounded to the nearest ten thousand? 9740000 What is -1140.330744 rounded to the nearest integer? -1140 What is 17.834224 rounded to one dp? 17.8 Round -6789696 to the nearest 1000000. -7000000 What is -0.512610535 rounded to 5 dps? -0.51261 Round -489287716 to the nearest 100000. -489300000 What is -0.000441034097 rounded to four decimal places? -0.0004 Round 8700.98219 to the nearest ten. 8700 Round 1628061.1791 to the nearest 10000. 1630000 What is -1298.65281 rounded to the nearest 100? -1300 Round 0.000469472276 to five dps. 0.00047 What is 0.00002191366494 rounded to seven decimal places? 0.0000219 Round 0.000006758503492 to seven decimal places. 0.0000068 What is -33.983444 rounded to two decimal places? -33.98 Round 0.0001540591079 to seven decimal places. 0.0001541 What is -0.01645244649 rounded to four decimal places? -0.0165 Round -509.2097488 to the nearest 100. -500 What is -0.317277526 rounded to three decimal places? -0.317 What is 0.00002547698445 rounded to 6 decimal places? 0.000025 What is 0.0006257530235 rounded to 4 decimal places? 0.0006 What is -0.0004198111 rounded to 5 decimal places? -0.00042 Round 0.000107145417 to seven decimal places. 0.0001071 What is -0.549532958 rounded to 1 decimal place? -0.5 What is -0.000000563211838 rounded to seven decimal places? -0.0000006 Round 0.000636923242 to four dps. 0.0006 Round 0.040408803 to 5 decimal places. 0.04041 What is 0.0000145841494 rounded to four dps? 0 What is 11919921700 rounded to the nearest one million? 11920000000 What is 0.763297793 rounded to two decimal places? 0.76 What is 113.49387 rounded to one dp? 113.5 What is -0.0000112145037 rounded to 6 decimal places? -0.000011 Round 365497.8048 to the nearest ten. 365500 What is 66092.31 rounded to the nearest one thousand? 66000 Round 0.000352562572 to 6 decimal places. 0.000353 Round -121.1647387 to zero decimal places. -121 Round 656356.1 to the nearest one thousand. 656000 Round -2516954.74 to the nearest one thousand. -2517000 What is -450260665.9 rounded to the nearest 10000? -450260000 Round 3.710080316 to 1 decimal place. 3.7 What is -110804228 rounded to the nearest 1000000? -111000000 Round 0.0037321386 to 4 dps. 0.0037 Round 109767963 to the nearest one hundred thousand. 109800000 Round 0.0001013982 to two dps. 0 What is -1463.217392 rounded to the nearest 10? -1460 Round 71.317643 to the nearest ten. 70 What is 3.67536816 rounded to the nearest integer? 4 Round -0.00357576593 to 4 decimal places. -0.0036 What is 0.000005849684595 rounded to seven dps? 0.0000058 What is -3.6714857 rounded to one decimal place? -3.7 What is 1107.13667 rounded to one decimal place? 1107.1 Round 0.00000226630967 to seven decimal places. 0.0000023 What is -0.000018443620255 rounded to seven dps? -0.0000184 What is 20155.056 rounded to the nearest ten? 20160 Round -90475748.5 to the nearest 10000. -90480000 What is -0.000700701277 rounded to six dps? -0.000701 What is 0.00326634138 rounded to six decimal places? 0.003266 Round 0.0000007052462175 to 7 decimal places. 0.0000007 Round 251910478.5 to the nearest one hundred thousand. 251900000 What is 3544.263446 rounded to the nearest integer? 3544 Round -2341.32932 to 1 decimal place. -2341.3 What is -0.5736313308 rounded to three dps? -0.574 Round -0.00117471746 to 5 dps. -0.00117 Round 0.00051899592 to 5 decimal places. 0.00052 What is -0.000422992638 rounded to five decimal places? -0.00042 What is 437.338815 rounded to the nearest integer? 437 Round 0.0955275486 to 2 decimal places. 0.1 What is -580495191 rounded to the nearest one million? -580000000 What is 0.0002169047303 rounded to six dps? 0.000217 What is 80086661 rounded to the nearest 1000000? 80000000 What is 0.000086432104 rounded to 6 dps? 0.000086 Round 0.0575644484 to 5 decimal places. 0.05756 What is 0.0046650405 rounded to 7 dps? 0.004665 Round -435842.57 to the nearest one thousand. -436000 What is 9.1567023 rounded to 3 decimal places? 9.157 Round 185249.9276 to the nearest 10. 185250 What is 76011.2356 rounded to the nearest 10? 76010 What is -0.0002612856403 rounded to five dps? -0.00026 Round 994.328348 to the nearest 100. 1000 What is -0.000006131477 rounded to 7 dps? -0.0000061 Round 0.00950210112 to 4 decimal places. 0.0095 What is -9000.7783 rounded to the nearest one thousand? -9000 Round -989247.984 to the nearest one hundred thousand. -1000000 What is 7732.06531 rounded to the nearest one thousand? 8000 What is 145522852.9 rounded to the nearest 10000? 145520000 What is 439.010251 rounded to the nearest 10? 440 What is -0.0317460309 rounded to four dps? -0.0317 Round -4419674.444 to the nearest ten thousand. -4420000 Round -10651.62551 to the nearest one hundred. -10700 Round -2.05720984 to 3 dps. -2.057 What is 635.8967118 rounded to the nearest ten? 640 Round -0.146188536 to two dps. -0.15 What is 0.001080101187 rounded to 7 decimal places? 0.0010801 Round -2794.491411 to the nearest ten. -2790 Round -1999514.844 to the nearest one million. -2000000 What is 4.80961422 rounded to the nearest integer? 5 What is 49240820 rounded to the nearest 1000000? 49000000 What is -3225293.27 rounded to the nearest one million? -3000000 What is 1309.34023 rounded to the nearest one hundred? 1300 Round -1.035682335 to one dp. -1 Round 0.011734504 to 4 dps. 0.0117 Round -3184.475376 to 1 decimal place. -3184.5 What is -0.00094546555 rounded to 7 decimal places? -0.0009455 Round 0.0506302333 to four decimal places. 0.0506 What is 0.00207808295 rounded to 5 decimal places? 0.00208 Round 7515.5173 to the nearest integer. 7516 What is 0.12889856 rounded to 1 decimal place? 0.1 Round -0.00110569891 to seven dps. -0.0011057 Round -181991.042 to the nearest 10000. -180000 Round 2588218.248 to the nearest 1000000. 3000000 Round 6.7951	{ "pile_set_name": "DM Mathematics" }
of j? True Is 8 a factor of ((4 - 0) + -3)14? False Suppose -x + 3x - 81 = 5m, 4x = 4m + 144. Does 9 divide x? False Suppose -4c + c - x = -59, -64 = -3c - 2x. Does 6 divide c? True Let l = -4 - -9. Suppose 129 = li + 34. Is i a multiple of 6? False Is 19 a factor of -4 - (-1656)/15 - 4/10? False Is 6 a factor of -36(-3 + (-15)/(-6))? True Suppose 25 = -2a + 295. Is a a multiple of 45? True Suppose t + 3t - 176 = 0. Is 11 a factor of t/39/6? True Let t be -16(-33)/(-11). Does 2 divide (t/21)/((-4)/28)? True Let x = 227 - 123. Is x a multiple of 57? False Let c = -10 - -17. Suppose c = -a - 1. Does 13 divide ((-78)/(-8))/(a/(-32))? True Does 11 divide ((-16)/(-12))/((-4)/(-42))? False Let p(s) = s3 + s2 + s - 648. Let b be p(0). Is 3/(-5) - b/30 a multiple of 7? True Let r be 32/(-5) + 2/5. Let h be (-2)/(-6)(6 - r). Suppose 3y = hc + 60, -c - 100 = -5y + 4c. Does 20 divide y? True Suppose 249 = 6n - 159. Does 17 divide n? True Let d = -10 - 12. Suppose 0 = -s + 18 - 97. Let a = d - s. Is 19 a factor of a? True Suppose -3y + 3 = -3g, -5y - g + 29 = -0g. Suppose yz - 20 = 0, -5z + 2z - 38 = -2c. Is c a multiple of 8? False Suppose 3k - 3 = 2k. Let y be 2/k + 164/6. Suppose 3f + y = 4q, q = -q + 5f. Does 5 divide q? True Let a be ((-16)/6)/((-2)/3). Let d(q) be the first derivative of q3/3 + q2/2 - q - 2. Is 7 a factor of d(a)? False Let z(n) = 2n2 + 27n - 3. Is z(-15) a multiple of 21? True Suppose -3u + 0i = -3i - 69, 2u - 3i - 46 = 0. Does 6 divide u? False Let k be (1/(-3))/((-3)/36). Suppose 0 = 3z + ku - 158, 0 = -2z + 4u + 128 + 4. Is z a multiple of 15? False Suppose 0 = -2r - 5d + 1, 2d = -5r + d + 14. Suppose 2k + 3p - 22 = 0, k + rp + 26 = 5k. Is k a multiple of 4? True Let s(m) = -m3 + 7m*2 + 10m + 8. Is s(8) a multiple of 12? True Let a = 22 + -22. Let r be (-1)/(-2) - 210/(-4). Suppose 4w - 27 - r = a. Does 7 divide w? False Suppose -3k + 0k + 42 = 0. Let q be (-6)/(-4)(-16)/(-6). Suppose 2d + 3m - k = 7, -4d = qm - 36. Does 2 divide d? True Suppose 0 = -2m + 10, 75 + 14 = 3k + m. Is 11 a factor of k? False Let t = 0 + 4. Suppose -4h + 43 = 3q + h, -4q = th - 44. Suppose -qd + d = -95. Is 19 a factor of d? True Suppose 0 = -77w + 80w - 39. Is w a multiple of 13? True Let c(i) = -4i*2 - i - 15. Let u(h) = -5h*2 - h - 16. Suppose -3s - 9 = -w - 24, -2s = -5w - 36. Let k(d) = wc(d) + 5u(d). Is 4 a factor of k(0)? False Let x = 2 + 0. Let r = 8 - 8. Suppose -xi = -ri - 70. Is i a multiple of 12? False Let k(n) = n - 4. Let x(h) = -h*3 - 14h*2 - 15h - 18. Let p be x(-13). Does 3 divide k(p)? False Let j = -149 + 622. Is j a multiple of 73? False Suppose -4k + 5 = -3k. Suppose 0 = -4q + kq - 13. Does 6 divide q? False Let d(m) = -m - 2. Let k be d(-7). Suppose 95 = 4f + 4b - 5, -kf + b + 101 = 0. Is f a multiple of 7? True Let o be (-2)/(-8) + 477/12. Suppose x = -q + 10, 0q - x = 3q - o. Does 5 divide 6/q + (-96)/(-10)? True Let g(w) = -w2 + 10w + 2. Let k be g(10). Suppose -kx = -7x + 285. Does 19 divide x? True Let o(c) = c*2 + 4c + 1. Let j be o(-3). Is 15 a factor of (79 - -7)/((-4)/j)? False Let x be 4/(-10) - 12/(-5). Suppose -o + 90 = xo. Suppose 2k = 7k - o. Is k a multiple of 3? True Suppose -3v + t + 311 = 0, -362 = -3v + 4t - 45. Does 23 divide v? False Let s be (1/(-1))/((-1)/4). Let h = s + -2. Suppose -hn + 120 = 3n. Does 12 divide n? True Suppose n + 9 = 2k, -12 = -2k - 2. Let h be (1 + -11)/(15 + -16). Let x = n + h. Does 11 divide x? True Suppose 5m = 9m + 8. Let v = m + 6. Does 4 divide v? True Let v be ((-1)/1)/((-2)/4). Let f(u) = 17u + 4. Does 9 divide f(v)? False Let d be ((-28)/(-35))/((-1)/(-10)). Let v = d - 7. Suppose -15 = -u - v. Does 5 divide u? False Suppose 0 = 5s - 299 - 1. Does 12 divide s? True Let c = 34 + -7. Is c a multiple of 4? False Let l = -9 - -40. Suppose -2g - 17 = -6g - s, -3s + 12 = -g. Suppose -gw + l = 5o, 0 = -5o - w - w + 34. Is o a multiple of 8? True Let y = -8 + 68. Suppose -r = -6r + y. Is r a multiple of 12? True Let c = -157 + 457. Is 25 a factor of c? True Let f = -661 - -385. Let x be 3/2f/(-9). Suppose 4r = 3m + 42, -6m + x = 3r - m. Does 12 divide r? True Let b = -70 - -30. Let h = b + 6. Let k = h - -60. Is k a multiple of 13? True Let p(q) = 2q - 3. Let x be p(4). Let l be 1-1(1 - 8). Let b = l - x. Is 2 a factor of b? True Let h = 1717 - 1133. Let f be (4/(-10))/((-7)/(-105)). Is 17 a factor of f/(-21) - h/(-14)? False Let y = 18 - 16. Suppose 102 = yk - 2z, -3k + 42 + 71 = 5z. Does 23 divide k? True Suppose -3n - 54 = -264. Is 14 a factor of n? True Let d = 0 - -3. Suppose 2b = j + 11, 0 = -4j - j + db - 27. Is (j/2)/(2/(-32)) a multiple of 11? False Suppose -5b + 40 - 10 = 0. Suppose -3o = -o - b. Suppose -24 = -ow - w. Does 6 divide w? True Suppose 75 = 2f - 31. Is f a multiple of 11? False Suppose 20 = 5b - 5f, 2b - 3f = b + 8. Does 19 divide (120 - 3)/3 - b? False Let j be 4/(-4)(-23)/1. Let m = j + 1. Suppose -2o - o + m = 0. Does 5 divide o? False Let l be 18/(-81) - (-508)/18. Suppose -4t - z = -118, 2t - 4z - 40 = l. Is t a multiple of 15? True Let z = -13 - -13. Let w = z + 22. Is w a multiple of 6? False Let q = -6 + 9. Suppose 6 = -qn + 3c, -5n - 4c + 20 = -3c. Suppose -38 = -2r + nu, 2u - 4 = u. Is 13 a factor of r? False Suppose 0 = 3w + 5t - 53, -3t + 9 = -w + 2t. Let l = 3 + w. Suppose 0 = 4n - l - 6. Is 2 a factor of n? False Suppose 3z + 0z - 5c - 129 = 0, -4z + 5c + 177 = 0. Is 3 a factor of z? True Suppose -4j + 6d = 3d - 279, 0 = -5j + 5d + 345. Is 4 a factor of j? True Suppose -185 = -3w - y, -37 = -3w - 4y + 163. Suppose 5j - j = w. Is 15 a factor of j? True Suppose -q = -179 + 27. Is q a multiple of 38? True Suppose 0 = v - 2v + k + 2, -3k = 4v - 15. Suppose 2l = -s + 59, -l = vs + 2s - 52. Is 9 a factor of l? True Suppose 3s = 0, 0 = -k - 4k - 5s + 250. Does 23 divide k? False Let k = -5 + 5. Suppose k = -2o + 5o - 12. Suppose -f + x = -47, -143 = -of - 0x - 5x. Is 21 a factor of f? True Suppose -3i + 5l + 40 = 0, 0i - i = l. Let t = -1 + i. Is (-152)/(-20) + t/10 a multiple of 7? False Let p = -5 + 0. Is (-22)/(-2) - (p - -3) a multiple of 11? False Suppose -3p = -2p + 5. Let m(n) = -n*2 - 6n + 6. Does 5 divide m(p)? False Let h(x) = -x + 4. Let t be h(6). Is 15 a factor of (-1)/(2t/136)? False Let a(j) = 5j. Let d be a(1). Let y be -1 + (-162)/(-24) - 3/4. Suppose 4f + l - 100 = 0, dl - 52 = -yf + 73. Is 11 a factor of f? False Let i be 1/(-3) + (-364)/6. Suppose -2m - 273 = -5m. Let j = i + m. Is 19 a factor of j? False Let w = -15 - -51. Suppose -22 - w = -2i. Is i a multiple of 7? False Let c(m) = -16m. Let x be c(-5). Suppose 0 = 5p - 0p - x. Is 9 a factor of p? False Suppose 3u = 3j, 2j + 15 = -4u + 3j. Let h = u + 7. Is h even? True Let y = -16 - -119. Is y a multiple of 34? False Let k(c) = -c*2 - 9c - 3. Does 8 divide k(-6)? False Let d = -14 + 24. Suppose 215 = 5g + d. Is 23 a factor of g? False Suppose -3u - 17 + 111 = -2d, -u - d = -33. Is u a multiple of 14? False Let p be 180/(-16)(-40)/3. Suppose 0x - p = -5x. Is ((-14)/(-5) + -2)x a multiple of 8? True Let k(n) = -n3 + 13n*2 + 14n + 3. Let h be k(14). Suppose hy + 4z - 20 = 25, -5y - 2z = -75. Is y a multiple of 15? True Let h = -5 - -18. Suppose 2t - h = 43. Is 14 a factor of t? True Suppose 0 = -4m - 12, -3m + 19 = -4l + 124. Is l a multiple of 8? True Let t(z) = -z*2 + 1. Let i be t(1). Suppose i = -4o - 0o + 16. Is o a multiple of 4? True Suppose -3i + 3r = -171, 3i - r = -0r + 167. Let q = i + -19. Is 16 a factor of q? False Let k(v) = 3v*2 + 13v + 28. Is 2 a factor of k(-4)? True Let k(u) = 37u2 - 3u - 1. Let d be k(-2). Suppose 3m - d = 3r, -47 + 237 = 4m + 3r. Does 8 divide m? False Let p(o) be the second derivative of 1/20o5 + 3/4o*4 + 9/2o*2 + o + 0 - 1/2o3. Is 12 a factor of p(-9)? True Let f(d) = d2 - 3d - 4. Is f(-2) a multiple of 3? True Suppose -4 = 5z - 49. Suppose 6a = 4a - x + 6, -3a + x = -z. Suppose 4 = 2k, -ad + 2 = 2k - 56. Does 11 divide d? False Does 17 divide 1090/8 - (2	{ "pile_set_name": "DM Mathematics" }
0 to the nearest one hundred thousand. 1600000 What is -130 rounded to the nearest 100? -100 Round 0.000971 to four decimal places. 0.001 Round 1.3892 to two decimal places. 1.39 What is 0.000173 rounded to 5 decimal places? 0.00017 What is 7242 rounded to the nearest one hundred? 7200 What is -0.00000175833 rounded to seven dps? -0.0000018 Round 3.722 to 0 decimal places. 4 Round 0.000514 to four dps. 0.0005 Round 486 to the nearest ten. 490 What is -58724000 rounded to the nearest 1000000? -59000000 Round -3751000 to the nearest one hundred thousand. -3800000 Round -0.00107579 to 5 decimal places. -0.00108 What is 15960000 rounded to the nearest 1000000? 16000000 Round 0.000011573 to six dps. 0.000012 What is -0.015562 rounded to 3 decimal places? -0.016 Round -1609400 to the nearest 10000. -1610000 Round -3.88 to two dps. -3.88 Round 765000000 to the nearest 1000000. 765000000 What is -145.682 rounded to 1 decimal place? -145.7 Round -0.000169832 to seven dps. -0.0001698 What is 501.54 rounded to the nearest ten? 500 Round -0.000011286 to six dps. -0.000011 What is 0.0032168 rounded to four dps? 0.0032 What is -0.00039 rounded to 3 decimal places? 0 What is -0.0000407 rounded to 4 decimal places? 0 What is 0.1259 rounded to 2 dps? 0.13 What is -3.63 rounded to 1 dp? -3.6 What is 8534 rounded to the nearest 1000? 9000 What is 7057 rounded to the nearest one thousand? 7000 What is 7.9 rounded to the nearest 10? 10 Round -2.5 to the nearest 10. 0 What is -4859 rounded to the nearest one thousand? -5000 What is 25660 rounded to the nearest 1000? 26000 Round 771.36 to the nearest one hundred. 800 Round 0.00000028735 to seven dps. 0.0000003 Round -1306 to the nearest 1000. -1000 What is -10921 rounded to the nearest one thousand? -11000 Round 0.7405 to 2 decimal places. 0.74 What is -2183.9 rounded to the nearest 10? -2180 What is 141740000 rounded to the nearest 1000000? 142000000 Round 2.894 to 1 dp. 2.9 Round -3.7826 to 0 decimal places. -4 Round 12165 to the nearest one thousand. 12000 What is 8765.1 rounded to the nearest ten? 8770 What is -79.719 rounded to zero dps? -80 Round 0.00007166 to 6 dps. 0.000072 Round 0.0000924 to five dps. 0.00009 Round 1849.93 to the nearest 100. 1800 What is 79.9 rounded to zero decimal places? 80 Round 101490 to the nearest one thousand. 101000 What is -0.000319 rounded to three dps? 0 Round 0.000000959 to 7 decimal places. 0.000001 Round 1360.6 to the nearest 1000. 1000 Round -0.00000213012 to seven dps. -0.0000021 Round -68880000 to the nearest 1000000. -69000000 What is -3.6437 rounded to one dp? -3.6 Round 0.0036798 to three dps. 0.004 Round 0.001039 to five dps. 0.00104 Round 0.00000481 to six decimal places. 0.000005 What is 36.7 rounded to the nearest 10? 40 Round 0.000004645 to 6 decimal places. 0.000005 Round 1555.9 to the nearest 10. 1560 What is -0.000101999 rounded to 5 decimal places? -0.0001 Round 0.005332 to three decimal places. 0.005 What is -1096710 rounded to the nearest ten thousand? -1100000 What is -591.66 rounded to the nearest ten? -590 Round 25990000 to the nearest 1000000. 26000000 Round 0.00000816 to five decimal places. 0.00001 What is 0.00001261 rounded to 6 decimal places? 0.000013 Round 0.1309 to 3 dps. 0.131 What is -2890 rounded to the nearest 100? -2900 Round 12202000 to the nearest one million. 12000000 What is -0.0000005797 rounded to six dps? -0.000001 Round -0.0002875 to 5 dps. -0.00029 What is -25654000 rounded to the nearest 100000? -25700000 Round 1.3486 to 2 dps. 1.35 Round -126600000 to the nearest one million. -127000000 What is -1784.7 rounded to the nearest one hundred? -1800 Round 0.010155 to 4 dps. 0.0102 Round 4228900 to the nearest one million. 4000000 What is -101000000 rounded to the nearest one million? -101000000 What is -3602000 rounded to the nearest 100000? -3600000 Round 0.728 to the nearest integer. 1 Round -1238570 to the nearest 100000. -1200000 Round 3319300 to the nearest 10000. 3320000 What is -18.551 rounded to one dp? -18.6 What is 9464500 rounded to the nearest one million? 9000000 Round -0.0258 to 3 dps. -0.026 Round -0.00000089 to 7 dps. -0.0000009 Round -1.019 to 1 decimal place. -1 Round 2064500 to the nearest 100000. 2100000 What is -78.98 rounded to the nearest integer? -79 What is 426390000 rounded to the nearest one million? 426000000 What is 0.2664 rounded to one decimal place? 0.3 Round -2777.6 to the nearest 100. -2800 What is -545380 rounded to the nearest one hundred thousand? -500000 Round 38526 to the nearest one thousand. 39000 What is 0.0000904 rounded to five decimal places? 0.00009 Round 0.00044614 to five decimal places. 0.00045 Round 22970 to the nearest one thousand. 23000 Round -0.14211 to 2 dps. -0.14 What is -0.00003082 rounded to 5 dps? -0.00003 What is -0.0000803 rounded to 5 decimal places? -0.00008 What is 376620000 rounded to the nearest 1000000? 377000000 What is -5179000 rounded to the nearest one million? -5000000 What is 5790000 rounded to the nearest 1000000? 6000000 What is -0.00921 rounded to three dps? -0.009 What is -0.0139547 rounded to 3 dps? -0.014 Round 50.8 to the nearest ten. 50 What is 67369000 rounded to the nearest one million? 67000000 Round -711400000 to the nearest one million. -711000000 What is 0.0000029772 rounded to 7 decimal places? 0.000003 What is 0.000001257 rounded to seven decimal places? 0.0000013 Round 0.0005054 to 5 decimal places. 0.00051 Round -24140 to the nearest one thousand. -24000 What is -5964.2 rounded to the nearest one hundred? -6000 What is 12523 rounded to the nearest one thousand? 13000 What is 25650 rounded to the nearest one hundred? 25700 What is -0.11702 rounded to 2 dps? -0.12 What is 0.0028634 rounded to four dps? 0.0029 What is -204750000 rounded to the nearest 1000000? -205000000 Round 0.000013863 to seven dps. 0.0000139 What is 0.000084062 rounded to 7 dps? 0.0000841 What is 0.000109 rounded to four dps? 0.0001 What is 115 rounded to the nearest one thousand? 0 Round -503800 to the nearest ten thousand. -500000 Round -0.000007486 to six dps. -0.000007 What is -0.000002004 rounded to 7 decimal places? -0.000002 What is 0.813 rounded to 3 decimal places? 0.813 What is -0.14196 rounded to two decimal places? -0.14 What is -57740 rounded to the nearest one thousand? -58000 Round 771240 to the nearest one thousand. 771000 What is 8916000 rounded to the nearest 100000? 8900000 What is 938.4 rounded to the nearest one hundred? 900 Round -0.00000068263 to seven dps. -0.0000007 What is -1620 rounded to the nearest one thousand? -2000 What is -21220 rounded to the nearest 1000? -21000 Round 0.41066 to two dps. 0.41 What is 0.0001655 rounded to 5 decimal places? 0.00017 What is -0.0666 rounded to two dps? -0.07 What is 7.0096 rounded to two dps? 7.01 Round 0.00038181 to five dps. 0.00038 What is 325300 rounded to the nearest ten thousand? 330000 What is -0.00005893 rounded to 6 decimal places? -0.000059 Round 0.023301 to four dps. 0.0233 What is 0.0003583 rounded to 5 decimal places? 0.00036 What is -1245000 rounded to the nearest 100000? -1200000 What is 0.000005633 rounded to 6 dps? 0.000006 Round 6321000 to the nearest 100000. 6300000 What is 2820 rounded to the nearest ten thousand? 0 What is -0.003075 rounded to four decimal places? -0.0031 Round 72.9 to the nearest 10. 70 What is 0.0397 rounded to one decimal place? 0 Round 0.000296 to 5 decimal places. 0.0003 What is -8215.2 rounded to the nearest one thousand? -8000 What is -0.000010636 rounded to six dps? -0.000011 What is -203.09 rounded to the nearest integer? -203 Round -12 to the nearest one hundred. 0 What is -14.297 rounded to one decimal place? -14.3 What is 0.3268 rounded to 1 dp? 0.3 What is 12828600 rounded to the nearest one million? 13000000 Round -0.00871 to four decimal places. -0.0087 What is -130980 rounded to the nearest one thousand? -131000 Round 22.124 to the nearest integer. 22 Round -0.84244 to three dps. -0.842 Round 5120.13 to the nearest ten. 5120 Round 0.4715 to two dps. 0.47 Round 1796.84 to the nearest 100. 1800 Round 5355 to the nearest 1000. 5000 What is -5244000 rounded to the nearest one hundred thousand? -5200000 What is -0.0000062 rounded to six decimal places? -0.000006	{ "pile_set_name": "DM Mathematics" }
xpand (0 + 4 - 5)(d4 + 2d4 + d4 + (-d*3 + 2 - 2)(-2d + 0 + 0) - 4d*4 + 0d*4 + 3d*4). -5d*4 Expand (-4 + 4 - 1)(-2v - v + 5v) - 3v - 2v + 6v + (-1 + 1 - 7)(-3v + v + 5v). -22v Expand (v3 + 2v3 - v3)(-3v - 2 + 1 + 5). -6v4 + 8v*3 Expand -5q*4 - 18q*4 + 4q*4 + (-2 + q + 2)(q - q*3 - q). -20q*4 Expand (-1 + 2 + 1)(0d + 0d - d + (1 + d - 1)(1 - 1 + 2) + 3d - d - d + 2d + 0d - 3d). 2d Expand 0a5 + 3a*5 + 0a*5 + (-a + 1 - 1)(-1 - 2a3 + 1)(3a - a - 4a). -a*5 Expand (-1 - 7 + 0)(-2 - 1 + 1)(0n - 2n + n). -16n Expand (2 + 4 - 5 + (-1 - 3 + 6)(0 - 4 + 2) - 2 + 2 + 1)(0u5 + 2u*5 - 5u*5). 6u*5 Expand (-1 + 0 - 2)(2x + 4x - 2x + (2 - 2 + 2)(-x - x + x)). -6x Expand (2g*2 - 2g2 + g3)(3 + 2g*2 - 3) - 4g*5 + 2g*5 + 3g*5 + 1 + 0g - 25g3 + 27g*3 + g + 5g*5. 8g*5 + 2g*3 + g + 1 Expand (-6l*2 + 3l*2 + 2l*2)(l - 3l - 2l)(7l*2 - 2l*2 - 3l*2). 8l*5 Expand 4f*2 - 3f*2 - 4f*2 - 2f4 + (-f2 + 0f2 - 2f*2)(-4f2 + 2f*2 + 4f*2). -8f*4 - 3f2 Expand x2 - x*2 + 2x*2 + (12x - 12x - 4x*2)(-2 - 8 - 6). 66x2 Expand 0 + 0 + t2 + (-2t - 1 + 1)(-2t - t + 5t) - 20t*2 + 34t*2 - 2t2 + t2 - 3t2 + t2. 8t*2 Expand 22y5 - y4 + 5y4 - 15y*5 + (-2y*3 - 1 + 1)(y*2 + 0y*2 - 2y*2). 9y*5 + 4y*4 Expand (2 - 6h + 9h - 4h)(3 + 2 - 2). -3h + 6 Expand (-2c + 2c + c)(-20 - 22 - 44). -86c Expand (0k2 + 0k2 - k2)(19k + 0k + 14k)(2 - 4 + 0). 66k*3 Expand (4y - 8y2 - y + 7y*2)(-2y - y + 5y). -2y3 + 6y2 Expand (-d2 - 2d2 + 2d*2 + (-2 + 6 - 2)(3d2 - 3d*2 - 2d*2) + 2d*2 - 2d*2 - 2d*2)(2d + d + 9d). -84d3 Expand (6w - 4 + 4)(-2w + 3w + 0w). 6w2 Expand -5b + 5b + b + (4b - 4b + 2b)(4 + 1 - 4) + 6b - 4b - b + (-2 + 4 - 1)(-b - b + 3b) - 2 - 5 - 2b + 4. 3b - 3 Expand 2p*2 - 5p*2 + 0p*2 + (p - 2p*2 - p)(4 + 2 - 5) + (-p*2 + 2 - 2)(-2 - 2 + 3). -4p2 Expand (-2t*2 + 4t*2 - 29t*2)(-2t + t - t). 54t*3 Expand (1 - 2 + 4 + (-1 - 3 + 3)(0 - 3 - 2))(4l2 - l2 - 2l2). 8l2 Expand c3 + 0 + 0 + 0c2 - c3 + 0c*2 + (0c + 0c + 2c*2)(c - 2c - 2c). -6c3 Expand -z4 + 17z*3 - 17z*3 + (-z + 4z - 4z)(-6z3 + 10z*2 - 10z*2). 5z*4 Expand (-2s*3 + 2s*3 - 2s3 - s3 + 4s3 - s3 + (-s + s - s)(-1 + 1 + s2) - s2 + s*2 + 3s*3)(2 - 1 + 2). 6s3 Expand (1 - 2 + 77n - 90n)(4n + 2n*4 - 4n). -26n5 - 2n*4 Expand (v - 2 + 2)(0 + 5 - 1)(-5v + v + 2v)(-1 - 3 + 6) - 3v + 2v*2 + 3v. -14v2 Expand (f + 2f - 4f)(4f - f + 0f)(-2 + 1 - 1)(-2 + 2 + 2f). 12f*3 Expand ((-2 + 2 - 2)(-f + 5f - 5f) + 7f - 5f - 6f)(3 - 5 + 4). -4f Expand (2x + 36x - 6x)(2x - 2x - 2x*4) - 2x*3 + 2x*5 + 2x*3. -62x*5 Expand -15c*2 + 1 - 1 + (-2 + 2 + 2)(-c + 2c2 + c) + 2c2 - 3 + 3 - c2 - 4c + 4c. -10c2 Expand (1 - 1 - 4h)(-2h*3 - 2h2 - h3 + 6h3). -12h*4 + 8h*3 Expand -4f - 1 + 2 + 3f + (-2f - 1 + 1)(2 + 4 - 2) + 4 - 4 + 2f + (3f - 2f + 0f)(1 - 1 + 2) - 4f + f + 2f. -6f + 1 Expand 3j - 3j - 2j*4 + (-2j*3 + 2j*3 - 3j*3)(-3j + 3j + 2j) + (3j2 - j3 - 3j2)(4j - 4j + 2j). -10j*4 Expand (3 + 0s*2 + 31s - 35s + 2s*2)(-1 + 3 - 3). -2s2 + 4s - 3 Expand (0q2 - 3q2 + q2)((-2 + 0 + 0)(2q + 0q - 3q) + 3q - 3q + 2q + (-1 + 3 + 1)(-4q + 2q + 3q)). -14q3 Expand -w5 + 0w*5 + 2w*5 + (11 - 11 - 5w*4)(2w - 3w - w) - 2w3 + 2w*3 - 2w*5. 9w*5 Expand (-2a + 2a - 2a)(-4a + 4a - 2a) + 4a2 + 0a2 - a2 + 5a2 + 6a - 8a - 2a*2. 10a*2 - 2a Expand (-2h4 - h2 + h2 + 2h*3 - 2h*3 - 2h*4 + (3h2 + h2 - 2h2)(-2h2 + h2 + 0h*2) - 2h + 2h + h4)(3h - 5h + 3h). -5h*5 Expand (-3o + 4o + 0o)(1 - 3 + 4)(-4 + 3 - 2)(1 - 2 + 0). 6o Expand (-5w + w + 2w)(2 + 3w - 2) + (-1 + w + 1)(-2w - 2w + w). -9w*2 Expand ((4 - 6 + 5)(4t + 2t - 4t) + 1 - 1 - 3t)(-2t + 0t + 3t) - 3t + 3t - t*2. 2t*2 Expand 3n*2 - 2 + 2 + (2n - 3n + 2n)(-2n - 2n + 5n) + 3n2 - 2n*2 + 2n*2. 7n*2 Expand (i + 0i + i)(22i*2 + 3i2 - i2). 48i3 Expand -31w*3 + 13w*3 - 20w*3 + (0w*2 + 2w2 - w2)(w + 0w + w). -36w3 Expand (-3 + 3 - 2f)(-1 - 2f + 3 - 1). 4f2 - 2f Expand (3g + 0g + g)(3g*3 - 3g3 - g3) + (-3g2 + 2g*2 + 3g*2)(2g2 + 0g2 - g2). -2g4 Expand ((-4 + 2 + 0)(-1 + 4 - 1) + 3 - 1 - 1)(-t2 + 0t + 0t). 3t*2 Expand 0m - 3m2 + 0m + 10m2 + m2 - 7m*2 + (-2 + 2m + 2)(-1 - m + 1). -m2 Expand -2 - 2y + 2 + (y - 4y + 0y)(1 - 5 + 3). y Expand ((-2 + 2 - 2)(1 - 1 - x) + x - 2 + 2 - 5x + 7x + 5x)(-2x + 2x + 2x2)(-1 + 1 + 2x). 40x*4 Expand (3o + 0o + o)(-o*3 + o - o) + 2o4 + o2 - o*2 + 2 + 3o*4 - 2 + (-4o - 2o3 + 4o)(-o + 0 + 0) + o4 + 0 + 0 - 3o*4 + 0o4 + o4. 2o4 Expand ((0f + 4f - 3f)(-1 - 4 + 0) - f + 0f + 3f)(-f*3 + 0f*2 + 0f*2). 3f*4 Expand (2 - 4 + 4)(-5i3 + 6i*3 - 2i*3). -2i*3 Expand -2 + 2 - 2t - 6t + 2t + 2t + (0t - t + 3t)(3 - 1 - 3). -6t Expand (j + 0j - 4j)(-2 - 3 + 2). 9j Expand (6 - 3 - 1)(3y - 2y + 4y)(-1 - 1 + 8). 60y Expand (-3b - 4b + 5b)(5 - 11 - 17)(-3 - 4 + 6). -46b Expand (g2 - 2g3 - g2)(-2g + 2g + g) + (3g*4 - 2g*4 - 2g*4)(2 - 3 + 0) + 5g4 + 22g*2 - 22g*2. 4g*4 Expand (4 - 4 + 2y*2)(-2y2 + 8y*2 - 2y*2 - y). 8y*4 - 2y*3 Expand (-3p + 5p2 + p + 3p)(-p - 4p + 3p). -10p*3 - 2p*2 Expand (-105f + 1 + 0 + 88f)(-f*4 - 2f*4 + 2f*4). 17f5 - f4 Expand (-3x - x + 2x)(-4x + x + 4x) + (0x + 0x - x)(2x - 5x + 2x). -x2 Expand (d2 + 1 - 1)(-58 - 118 - 16 - 8). -200d2 Expand (1 + 3 - 7)(-2d + 5d - 4d). 3d Expand (-9 + 16 - 2)(-f - 5f + 2f). -20f Expand (3z + 6z - 4z)(z - 14 + 14) + 3z2 - 2z*2 - 3z*2. 3z2 Expand 1 - 1 - a4 + (17 - 3a2 - 17)(4a + a2 - 4a) + 4a4 - 2a*4 + 0a*4. -2a*4 Expand -4n*2 + 4n2 - n2 + (2 + 2n - 2)(-5n - 5n - n). -23n2 Expand 0w2 - w2 + 4w2 + 0w*2 - 5w*2 + 3w*2 + (0w + w + 0w)(5w - 4w - 3w) + 1 + 2w*2 - 1 - 5w + 5w + 2w*2. 3w*2 Expand (26o + o*2 + 10 - 26o)(1 + 3 - 3 + (2 + 0 + 0)(1 + 1 - 1)). 3o2 + 30 Expand (-2d + 4d - 5d2 - d2)(-d + 3d + 0d + (4 - 4 - 2)(6d - 4d + 0d)). 12d*3 - 4d*2 Expand (2 - 6 + 2 - 2 + 2 + 2 + (-1 + 2 - 2)(-1 - 4 + 3) + 1 + 3 - 3)(-k - k - 2k). -12k Expand (2b*2 + 2b*2 - 3b*2)(0b - 4b + 2b) + (3b - 5b + 3b)(-4b*2 + 3b*2 + 2b2). -b3 Expand (17 + 0 - 7)(-3v2 + v2 + 5v2) + (0v - 3v + 4v)(0v + v + v). 32v2 Expand ((2d + 2d - 6d)(1 - 5 + 1) - 4d + 2d + 4d)(1 + 2d - 1 + 2 - 2 + d + (-d + 1 - 1)(1 + 1 - 4)). 40d*2 Expand (2 - 1 - 14)(1 + w*4 - 1 + (-5w*2 - 2w*2 + 5w*2)(-4w + 4w - 2w2) + 0w4 - w4 + 0w4 + 2w4 - w3 + w*3). -78w*4 Expand (l + l - 4l)(2 + 0 - 4) - 5 - l + 5 - 5 + 5 + l + (0l + 4l - 6l)(0 + 1 - 5). 12l Expand (-5j + j + 6j)(0 + 0 - 1) - j + j + j + (-3j + 3j - 3j)(-1 + 5 - 5). 2j Expand (3z3 - 2z*3 + 3z*3)(0 - 4z + 0). -16z*4 Expand (-2y + 2 - 5 + 0)(-4796y*2 - 65y*3 + 4796y*2). 130y*4 + 195y*3 Expand (2d - d + d)(2d*4 + 0d*4 + 0d4) - d2 + d*2 + 2d*5. 6d*5 Expand (13 - 13 - 17)(-3y + 3 - 3). 51y Expand (1 + 1 + 0)(t4 + 2t*4 + 3t*4) - 6t*4 + 0t*4 + 3t*4. 9t*4 Expand (-2 + 1 - 2)((4 - 3 + 0)(-4j + 0j + 7j) - 3j + 3j + j + j - 4j + 2j). -9j Expand (4a - 2a + 0a)(a + 3a - 2a)(a*3 + 4 - 4). 4a*5 Expand (-3 + 5 + 0)(2 - 1 + 0)(-2 - 1 + g - 1). 2g - 8 Expand 2k2 + 0k*2 - 3k*2 + (-2 + 2 + 5k)(-5k + 6k - 5 + k) + 0k2 + k2 - 3k2. 7k*2 - 25k Expand 2c + 2c*3 - 2c + (-6c2 + 9c - 9c)(3c - 2c + 0c) + (-2c*2 + 2c*2 - 3c*2)(c + 2 - 2). -7c3 Expand (0 - 4 + 7)(1 + 1 + 0)(4b*3 + 5b*3 - 8b*3)(-5 + b + 5). 6b4 Expand (-j + 2 - 2)(-j*2 - 19j*2 + 0j*	{ "pile_set_name": "DM Mathematics" }
625. Calculate h(245). 4790 Let t(c) = 5771c + 213518. Give t(-37). -9 Let w(p) = 3p*2 - 266p + 185. Give w(86). -503 Let k(r) = r*3 + 13r*2 + 3r + 177. What is k(-13)? 138 Let g(t) = -3t3 - 369t*2 + 1627t - 402. What is g(4)? 10 Let l(f) = -20268f - 19356. Determine l(-1). 912 Let s(y) = -3y*3 - 56y*2 + 106y - 2503. Determine s(-22). 5 Let i(x) = -14x2 + 5116x + 10238. Give i(-2). -50 Let x(o) = 1153o + 6982. Give x(-6). 64 Let v(z) = -12403z + 12451. Give v(1). 48 Let f(x) = 99632x + 298906. Determine f(-3). 10 Let d(a) = a3 - 29a*2 - 216a + 844. Calculate d(34). -720 Let h(y) = 39y + 396. Give h(-12). -72 Let x(i) = -29989i + 179464. Determine x(6). -470 Let a(q) = 1452q2 + 10151q + 5. Give a(-7). 96 Let f(q) = -261q - 21759. Determine f(-83). -96 Let z(v) = 76v*3 - 255v*2 + 240v + 14. Determine z(1). 75 Let d(s) = -1611s - 125659. Determine d(-78). -1 Let a(v) = -2v*2 - 11933v - 308896. What is a(-26)? 10 Let b(o) = 597o3 + 8o*2 + 196o + 195. Calculate b(-1). -590 Let u(w) = -w*2 + 515w + 7. Determine u(0). 7 Let r(w) = -11w2 - 1928w + 3852. Calculate r(2). -48 Let u(k) = -k*3 - 197k*2 - 245k - 9677. Give u(-196). -73 Let a(r) = r*3 - 3289r*2 - 6r + 7. Give a(0). 7 Let l(v) = -723v - 7451. What is l(-11)? 502 Let u(q) = 2q*3 - 178q*2 - 38q + 3481. Calculate u(89). 99 Let w(z) = -z*3 - 5338z*2 - 27z + 29. Calculate w(0). 29 Let x(s) = s*2 - 53536s + 267677. What is x(5)? 22 Let p(j) = -212109j - 636337. Calculate p(-3). -10 Let c(h) = h2 + 4439h + 564229. Determine c(-131). -119 Let s(h) = 11h2 - 42h - 494. Give s(9). 19 Let a(d) = 131d2 + 33d + 513. Calculate a(-5). 3623 Let h(b) = 2b3 + 2b*2 + 157b + 1033. What is h(-6)? -269 Let w(p) = -868p3 - 3p*2 + 26p + 28. What is w(-1)? 867 Let c(p) = -196518p - 393059. Determine c(-2). -23 Let i(m) = 62923m - 2579854. Determine i(41). -11 Let z(u) = 2u3 - 112u*2 + 346u - 12977. Calculate z(55). 3 Let f(y) = -y*3 + 16y*2 - 75y + 122. Determine f(23). -5306 Let b(s) = s*2 + 70s - 1191. Calculate b(14). -15 Let r(a) = -35405a - 106184. What is r(-3)? 31 Let p(r) = -9r*2 + 174r - 104. Determine p(23). -863 Let c(w) = w*3 + 19w*2 - 40w - 1436. Give c(-15). 64 Let x(l) = -331422l + 2319948. Calculate x(7). -6 Let z(n) = -2n*2 + 69n + 90. What is z(22)? 640 Let b(n) = -562n - 117627. Determine b(-209). -169 Let c(s) = -134s*2 + 62s + 23449. Give c(-13). -3 Let p(m) = 141m - 20643. Calculate p(146). -57 Let l(y) = -y3 + 92y*2 - 1862y - 2805. Determine l(33). 0 Let q(j) = -380042j - 1520158. Determine q(-4). 10 Let h(z) = z3 + 14z*2 - 4310z + 122. Give h(59). -55 Let w(x) = 70x - 6662. Give w(104). 618 Let d(a) = 351a - 5261. Determine d(16). 355 Let j(a) = 2a3 + 117a*2 + 1014a + 314. Calculate j(-48). 26 Let f(k) = 8420k + 59102. Determine f(-7). 162 Let q(a) = a2 - 16966a - 833703. Calculate q(-49). 32 Let s(y) = -2y2 + 36505y + 8352293. Determine s(-226). 11 Let x(d) = 10d2 + 536d + 317. Give x(-54). 533 Let j(r) = 330r - 23225. What is j(70)? -125 Let r(k) = 63495k + 254011. Determine r(-4). 31 Let y(l) = 36345l - 327116. Give y(9). -11 Let r(h) = 185h + 22041. Calculate r(-119). 26 Let k(o) = -124023o - 992219. What is k(-8)? -35 Let i(x) = -160x*2 + 15368x - 117. Determine i(96). 651 Let c(t) = -2t2 + 6329t + 121051. Give c(-19). 78 Let q(s) = -22s3 + 287s*2 - 308s + 3789. Give q(13). -46 Let b(o) = 3o3 + 110o*2 + 115o - 1992. Calculate b(-35). 108 Let h(u) = -u*3 - 172u*2 - 25u - 4205. Give h(-172). 95 Let d(z) = -4z3 - 141z*2 - 401z - 12803. Give d(-35). 7 Let i(a) = 345a2 - 1010a - 82. What is i(3)? -7 Let o(x) = 29x3 + 1710x*2 - 1057x - 58890. Calculate o(-59). -8 Let b(f) = -f*2 - 32f + 3150. What is b(-73)? 157 Let j(t) = 20t3 + 4t*2 + 65t - 158. Calculate j(2). 148 Let f(g) = -2g3 + 46g*2 + 84g - 731. What is f(24)? 133 Let t(w) = 19w3 + 4066w*2 - 3w - 990. Determine t(-214). -348 Let u(b) = 26931b - 134586. What is u(5)? 69 Let d(a) = -6252a + 1175381. Determine d(188). 5 Let b(v) = -66v2 - 1865v - 6729. Calculate b(-24). 15 Let f(n) = -9346n - 177039. Determine f(-19). 535 Let y(c) = -c2 - 49c + 3590. Calculate y(-96). -922 Let z(w) = -w*2 + 142w + 8408. Calculate z(-45). -7 Let z(r) = 21715r - 130144. Give z(6). 146 Let s(r) = 1399r + 198648. Give s(-142). -10 Let p(h) = h*2 - 111h - 4065. What is p(-24)? -825 Let f(t) = -t*2 - 30t + 1660. Determine f(-57). 121 Let u(s) = 3256s + 234448. Calculate u(-72). 16 Let j(q) = 2q*3 - 480q*2 - 3245q + 434241. Calculate j(243). 0 Let b(c) = -13c2 + 395c + 4043. Determine b(-8). 51 Let b(v) = 4v2 - 1830v - 7372. Determine b(-4). 12 Let o(d) = -2d2 - 206d + 1946. Determine o(-106). 1310 Let w(a) = 18a2 - 463a + 2766. Determine w(6). 636 Let j(u) = 2u3 + 65u*2 + 437u + 43. Determine j(-9). -83 Let l(d) = -65d + 12534. Determine l(192). 54 Let c(v) = -v2 - 2561v - 634934. Determine c(-278). -260 Let b(c) = c*3 - 67c*2 - 895c + 59953. Determine b(67). -12 Let y(b) = 22b2 - 15963b + 15937. Give y(1). -4 Let a(t) = 4t2 + 286t - 18159. Calculate a(-112). -15 Let q(o) = 2o2 - 9805o + 58778. What is q(6)? 20 Let l(p) = 2p2 - 39p - 1248. Determine l(0). -1248 Let b(c) = 31515c + 126049. Give b(-4). -11 Let w(k) = -k3 + 890k*2 - 11407k + 97. What is w(13)? 19 Let s(p) = 416p + 468807. What is s(-1127)? -25 Let d(p) = -36p*2 + 2187p - 43. What is d(61)? -592 Let w(p) = -93130p + 558746. What is w(6)? -34 Let h(m) = -6m*2 + 3354m - 23432. Calculate h(7). -248 Let z(o) = o*2 + 10377o + 2314011. Determine z(-228). 39 Let p(g) = 70130g + 1051952. Determine p(-15). 2 Let d(r) = -593r - 3187. Determine d(-6). 371 Let i(d) = 65d + 4951. Determine i(-84). -509 Let i(c) = -c3 - 240c*2 + 3021c + 51. Calculate i(12). 15 Let s(m) = -52515m - 157539. What is s(-3)? 6 Let s(f) = -476f - 6447. Give s(-13). -259 Let x(i) = -444i - 19646. What is x(-44)? -110 Let d(j) = -j2 - 110j - 3265. Calculate d(-63). -304 Let y(j) = 4j2 + 4873j - 24348. What is y(5)? 117 Let y(k) = -2k3 + 8k*2 + 8661k + 17305. What is y(-2)? 31 Let n(p) = 2p3 + 146p*2 + 484p + 4520. What is n(-70)? 40 Let k(w) = w*3 - 42w*2 - 100w + 620. What is k(44)? 92 Let j(a) = -123772a + 371036. Calculate j(3). -280 Let z(m) = -15m*2 - 647m + 5903. Calculate z(8). -233 Let t(u) = -12u3 + 771u*2 - 221u - 56. What is t(64)? -1912 Let u(x) = -x*3 - 17x*2 - 18x + 74. Give u(-13). -368 Let y(i) = 2i3 - 79i*2 + 7i + 19. Determine y(39). -1229 Let g(l) = -5l3 + 102l*2 + 239l - 3703. Calculate g(21). -7 Let y(r) = -379r - 20191. What is y(-55)? 654 Let j(r) = -r3 - 84r*2 - 1205r - 449. Give j(-66). 673 Let u(n) = 875n + 5044. What is u(-4)? 1544 Let t(u) = 15u*2 + 6591u - 32802. Calculate t(5). 528 Let h(p) = p*2 - 9001p - 45035. Give h(-5). -5 Let w(o) = 2097100o + 117437603. Give w(-56). 3 Let p(g) = 1318114g + 3954355. Give p(-3). 13 Let f(r) = -1002r - 4431. What is f(-4)? -423 Let b(f) = -f3 + 84f*2 + 106f + 13516. Calculate b(87). 31 Let t(k) = 20k3 + 1320k*2 - 55k - 3623. What is t(-66)? 7 Let g(x) = -165x2 + 6584x + 689. Give g(40). 49 Let d(f) = 509f2 + 95685f - 1326. Give d(-188). -10 Let w(g) = 1386g - 221796. What is w(160)? -36 Let a(n) = 3324n - 146231. Calculate a(44). 25 Let l(y) = -43y3 - 6537y*2 - 155y - 386. Determine l(-152). 70 Let f(l) = 2l2 - 704l + 58247. Calculate f(218). -177 Let i(p) = 195p + 12521. Give i(-64). 41 Let s(u) = -4u*3 - 14u*2 + 21u + 231. Give s(-5). 276 Let b(u) = 3419u - 687239. Calculate b(201). -20 Let y(o) = -11834o + 579908. Determine y(49). 42 Let q(i) = -4i3 + i2 + 29i + 1. Give q(-3). 31 Let h(n) = -n*3 - 223n*2 + 945n - 44446. Determine h(-228). 14 Let d(h) = 1749h + 56032. What is d(-32)? 64 Let t(v) = 57v*2 + 641v + 1704. Determine t(-7). 10 Let d(s) = 8s2 - 452s + 6364. Give d(29). -16 Let i(y) = 62y - 6432. Calculate i(104). 16 Let i(h) = -4495h - 2331. Determine i(0). -2331 Let o(j) = j*3 - 16j*2 - 240j + 2413. Give o(1	{ "pile_set_name": "DM Mathematics" }
82078? False Is 37746423 a multiple of 39? True Does 13 divide 41298075? True Is 303079674 a multiple of 131? False Does 13 divide 3964118896? False Does 810 divide 24402474? False Is 6 a factor of 454172449? False Does 1217 divide 31556810? True Is 10416 a factor of 2591479968? True Does 3 divide 161926280? False Is 18 a factor of 3484548? True Is 569554593 a multiple of 28? False Is 141462090 a multiple of 990? True Does 85 divide 444210? True Is 62085576 a multiple of 29? False Does 108 divide 96309540? True Is 6116 a factor of 271473886? False Does 240 divide 93660431? False Is 4 a factor of 9270079? False Does 13 divide 14095780? False Is 1669561166 a multiple of 26? True Does 13 divide 8224070? False Is 112 a factor of 18972002? False Does 15 divide 15435135? True Is 146976683 a multiple of 323? False Is 28346288 even? True Is 180163434 a multiple of 111? True Is 225402092 a multiple of 44? False Is 30525120 a multiple of 48? True Does 2652 divide 223972008? True Is 494 a factor of 40885889? False Does 1441 divide 53549001? True Does 45 divide 42462591? False Is 8933085 a multiple of 345? True Is 21 a factor of 8923131? True Is 30 a factor of 16741830? True Is 1464 a factor of 594154152? True Does 60 divide 5735460? True Is 143836214 a multiple of 150? False Is 376 a factor of 646050301? False Is 44193996 a multiple of 77? True Is 464184908 a multiple of 1709? True Is 300 a factor of 53529762? False Does 55 divide 45316329? False Is 2412 a factor of 73865088? True Is 1539 a factor of 70383087? True Does 76 divide 32666210? False Is 35 a factor of 47599974? False Is 1111 a factor of 770149644? True Is 48905740 a multiple of 316? True Does 42 divide 73822350? True Does 40 divide 106354520? True Is 26995431 a multiple of 32? False Is 142 a factor of 641590092? False Does 3126 divide 238721582? False Is 57952958 a multiple of 6114? False Is 31 a factor of 37318801? False Does 88 divide 132438328? True Is 49305444 a multiple of 230? False Is 582753801 a multiple of 61? True Is 3 a factor of 9310426? False Does 50 divide 2202006000? True Is 17669407 a multiple of 8? False Is 6257842864 a multiple of 13? True Is 91669392 a multiple of 674? True Is 16446821 a multiple of 15? False Is 1700 a factor of 8506800? True Does 866 divide 160708823? False Is 82876880 a multiple of 710? True Is 19616685 a multiple of 37? False Is 207305041 a multiple of 149? True Does 391 divide 1346406936? True Is 1260766596 a multiple of 124? False Is 9541198 a multiple of 72? False Is 5 a factor of 135966640? True Is 1225889756 a multiple of 26? True Is 8487950 a multiple of 10? True Does 3 divide 18470908? False Is 18623872 a multiple of 2? True Is 123910944 a multiple of 48? True Is 971041480 a multiple of 932? True Is 4988188 a multiple of 695? False Is 17315774 a multiple of 151? True Is 2339 a factor of 435594309? True Is 780389012 a multiple of 6169? False Is 29475393 a multiple of 393? True Is 226 a factor of 537635694? True Does 52 divide 4126765113? False Does 51 divide 54410729? False Does 2 divide 4619? False Is 52843701 a multiple of 39? False Does 1242 divide 114132348? True Does 1076 divide 382495936? False Is 55 a factor of 1008093803? False Is 2030 a factor of 61905947? False Is 104 a factor of 99765328? True Is 13 a factor of 125929164? False Is 11429250 a multiple of 49? True Is 12 a factor of 17690424? True Does 29 divide 207834213? True Is 613 a factor of 351498891? False Is 79 a factor of 62539560? True Is 127847022 a multiple of 331? False Does 4417 divide 493352398? True Does 2646 divide 22792644? True Does 260 divide 205723440? True Is 50283654 a multiple of 599? True Is 376 a factor of 691515099? False Is 65 a factor of 684049015? True Is 12 a factor of 102921972? True Is 10 a factor of 215319? False Is 14744444 a multiple of 4? True Is 5988000 a multiple of 35? False Does 33 divide 98106327? True Is 93878097 a multiple of 1249? False Is 17779854 a multiple of 2016? False Is 6680 a factor of 1677675320? True Does 45 divide 21018929? False Is 26608788 a multiple of 22? False Does 93 divide 195207465? True Does 453 divide 4331133? True Is 406 a factor of 690808188? True Is 10 a factor of 388930965? False Does 1002 divide 241471991? False Is 18 a factor of 2796649632? True Does 3 divide 47616609? True Is 5662740 a multiple of 114? False Is 352 a factor of 442768508? False Is 171 a factor of 132906999? False Is 73785600 a multiple of 105? True Does 3902 divide 1220744008? False Does 469 divide 75168183? False Is 125982000 a multiple of 143? False Is 8915034 a multiple of 1882? True Is 4 a factor of 57336896? True Is 19 a factor of 8283905? True Is 875342924 a multiple of 244? True Does 61 divide 103757367? False Is 36210515 a multiple of 49? False Is 38274704 a multiple of 78? False Is 191311799 a multiple of 1253? True Does 3036 divide 261256908? True Is 120285973 a multiple of 19? False Does 69 divide 122550734? False Is 1666 a factor of 400593032? True Is 268664802 a multiple of 626? True Does 28 divide 32979548? True Is 4662125 a multiple of 95? True Does 1102 divide 16953776? False Does 39 divide 412249032? True Is 125450064 a multiple of 144? True Is 2382516774 a multiple of 5283? True Is 23 a factor of 79835392? True Is 12 a factor of 347268167? False Does 94 divide 497628289? False Does 10 divide 371469269? False Is 86979248 a multiple of 26? False Is 69 a factor of 946549521? True Is 17 a factor of 44072406? False Does 8 divide 1177686591? False Is 326642040 a multiple of 10? True Is 1171 a factor of 1098960080? True Is 888326977 a multiple of 1489? True Is 24120740 a multiple of 28? True Is 27 a factor of 38116413? True Is 26 a factor of 11328961? False Is 53410644 a multiple of 868? True Is 544702026 a multiple of 22? True Is 59 a factor of 413765230? True Does 13 divide 45881552? False Is 546 a factor of 4327736868? True Does 307 divide 79722681? True Is 91777686 a multiple of 4366? True Is 3051786 a multiple of 58? True Is 210 a factor of 432313680? False Is 41 a factor of 41968348? False Is 42 a factor of 44802804? False Does 4013 divide 702623603? False Is 9 a factor of 7346142? True Is 207447561 a multiple of 11? False Is 9 a factor of 146365758? True Does 81 divide 796523841? False Is 4063066 a multiple of 223? False Is 166 a factor of 34231026? True Does 2339 divide 136344988? True Is 83 a factor of 34366980? True Is 136 a factor of 809268681? False Does 7 divide 12514026? True Is 431325917 a multiple of 103? False Does 3051 divide 77604564? False Is 65545021 a multiple of 59? False Is 186 a factor of 2451294? True Is 76930410 a multiple of 25? False Is 4996 a factor of 1023800304? True Is 786 a factor of 28953882? True Is 2 a factor of 65546066? True Does 39 divide 530884965? True Is 17 a factor of 11216039? True Is 223 a factor of 58220394? True Is 92 a factor of 201944539? False Is 107 a factor of 38355862? True Is 39 a factor of 2048049432? True Is 52 a factor of 1003092948? True Is 3 a factor of 34102218? True Is 289188289 a multiple of 149? True Is 2512070 a multiple of 151? False Is 6527151 a multiple of 116? False Is 3028 a factor of 25387332? False Is 4594992 a multiple of 16? True Is 3449502 a multiple of 23? False Does 872 divide 58211232? True Is 345632440 a multiple of 8? True Is 798897467 a multiple of 337? False Does 130 divide 23158382? False Does 272 divide 15191472? True Is 1389968920 a multiple of 40? True Is 300144007 a multiple of 19? True Does 112 divide 47843514? False Is 433 a factor of 521369238? True Is 818956521 a multiple of 59? True Is 39 a factor of 12051968? False Does 566 divide 1059776845? False Is 823755181 a multiple of 883? False Is 33 a factor of 1708889? False Does 294 divide 1749112114? False Is 106672463 a multiple of 12? False Is 521217119 a multiple of 24? False Is 800120277 a multiple of 1199? True Is 7410405730 a multiple of 98? True Is 150 a factor of 18610500? True Does 541 divide 22534803? False Does 142 divide 12511566? False Is 176727040 a multiple of 4480? True Is 1665640147 a multiple of 332? False Is 203522699 a multiple of 19? True Does 9 divide 17632224? True Does 6 divide 2908594? False Is 128 a factor of 93514240? True Is 331880868 a multiple of 6732? True Is 980 a facto	{ "pile_set_name": "DM Mathematics" }
9 What are the prime factors of 1833543685? 5, 103, 307, 11597 List the prime factors of 196556582. 2, 79, 1244029 List the prime factors of 7613577. 3, 41, 47, 439 What are the prime factors of 3154826? 2, 17, 92789 List the prime factors of 1916456227. 7, 273779461 What are the prime factors of 38555631? 3, 107, 40037 List the prime factors of 56707123. 11, 5155193 List the prime factors of 277944188. 2, 97, 716351 What are the prime factors of 3454168064? 2, 149, 22639 What are the prime factors of 262592596? 2, 7, 9378307 List the prime factors of 669917442. 2, 3, 111652907 What are the prime factors of 5694969269? 11, 1693, 305803 List the prime factors of 1032241909. 23, 5843, 7681 List the prime factors of 6591666206. 2, 3295833103 What are the prime factors of 213831333? 3, 307, 8599 List the prime factors of 138818106. 2, 3, 7, 89, 12379 What are the prime factors of 976717300? 2, 5, 13, 751321 What are the prime factors of 217204199? 449, 483751 What are the prime factors of 4697388246? 2, 3, 782898041 What are the prime factors of 4651291725? 3, 5, 23, 43, 73, 859 List the prime factors of 344054947. 344054947 What are the prime factors of 60487167? 3, 13, 47, 32999 What are the prime factors of 5215928667? 3, 21601, 80489 List the prime factors of 5611777. 313, 17929 What are the prime factors of 73012414? 2, 233, 156679 List the prime factors of 418434160. 2, 5, 5230427 What are the prime factors of 45929712? 2, 3, 23, 41603 List the prime factors of 492704511. 3, 13, 12633449 What are the prime factors of 109991086? 2, 67, 193, 4253 List the prime factors of 35480815. 5, 7096163 What are the prime factors of 1317913017? 3, 19, 23121281 List the prime factors of 90912704. 2, 1420511 List the prime factors of 16688096. 2, 521503 What are the prime factors of 456349822? 2, 31, 53, 113, 1229 What are the prime factors of 5189603? 19, 71, 3847 List the prime factors of 138179073. 3, 46059691 What are the prime factors of 85054216? 2, 13, 29, 28201 What are the prime factors of 1669658249? 7, 2609, 91423 What are the prime factors of 145620159? 3, 167, 290659 What are the prime factors of 124413669? 3, 13823741 What are the prime factors of 65743468? 2, 7, 2347981 What are the prime factors of 55540557? 3, 311, 19843 What are the prime factors of 5170429612? 2, 31, 691, 60343 What are the prime factors of 2548754132? 2, 2999, 212467 List the prime factors of 46257456. 2, 3, 7, 31, 4441 What are the prime factors of 155949058? 2, 17, 4586737 List the prime factors of 963677351. 7, 13, 17, 311, 2003 What are the prime factors of 1918037? 11, 174367 List the prime factors of 2434684893. 3, 811561631 What are the prime factors of 48054928? 2, 3003433 What are the prime factors of 4936100569? 17, 53, 257, 21317 List the prime factors of 1260807045. 3, 5, 29, 31, 93497 List the prime factors of 210859014. 2, 3, 43, 47, 17389 What are the prime factors of 162308050? 2, 5, 859, 3779 What are the prime factors of 928878254? 2, 127, 157, 23293 What are the prime factors of 158972916? 2, 3, 17, 509, 1531 What are the prime factors of 5601591? 3, 622399 What are the prime factors of 719000691? 3, 239666897 List the prime factors of 165302506. 2, 1699, 48647 What are the prime factors of 8089872983? 43, 71, 2649811 List the prime factors of 63406534. 2, 19, 1668593 List the prime factors of 200990442. 2, 3, 33498407 List the prime factors of 42325948. 2, 7, 61, 24781 What are the prime factors of 3122761373? 83, 37623631 List the prime factors of 2215323493. 43, 51519151 List the prime factors of 140869216. 2, 863, 5101 List the prime factors of 57849090. 2, 3, 5, 13, 148331 What are the prime factors of 163145652? 2, 3, 13595471 List the prime factors of 706668397. 73, 439, 22051 What are the prime factors of 333095072? 2, 113, 251, 367 List the prime factors of 27673152. 2, 3, 13, 11087 What are the prime factors of 30004014? 2, 3, 17, 294157 List the prime factors of 29350975. 5, 109, 10771 List the prime factors of 2194729092. 2, 3, 23, 2650639 What are the prime factors of 4955269? 11, 450479 What are the prime factors of 962323670? 2, 5, 7, 11, 461, 2711 List the prime factors of 1748350338. 2, 3, 7, 31, 293, 4583 List the prime factors of 2406218815. 5, 7, 11, 13, 47, 53, 193 List the prime factors of 6684586414. 2, 11, 43, 97, 751 What are the prime factors of 9656163? 3, 11, 8867 What are the prime factors of 113621034? 2, 3, 1787, 10597 List the prime factors of 139283475. 3, 5, 1857113 What are the prime factors of 1624620478? 2, 13, 199, 313997 What are the prime factors of 2542853400? 2, 3, 5, 29, 146141 What are the prime factors of 96626568? 2, 3, 4026107 What are the prime factors of 21954123? 3, 17, 43, 47, 71 List the prime factors of 610228329. 3, 203409443 List the prime factors of 897573573. 3, 13, 7671569 List the prime factors of 52667714. 2, 11, 2393987 List the prime factors of 1101896475. 3, 5, 229, 64157 List the prime factors of 275581634. 2, 137790817 What are the prime factors of 31268801? 31, 191, 5281 List the prime factors of 24919328. 2, 7, 53, 2099 List the prime factors of 2708145064. 2, 6211, 54503 What are the prime factors of 1740433949? 557, 3124657 List the prime factors of 20272524. 2, 3, 1689377 What are the prime factors of 8080951? 8080951 What are the prime factors of 4563917386? 2, 7, 325994099 List the prime factors of 2113804300. 2, 5, 53, 109, 3659 List the prime factors of 3915865851. 3, 23, 56751679 List the prime factors of 133009659. 3, 59, 250489 List the prime factors of 2332452759. 3, 7, 13, 157, 54419 What are the prime factors of 30094316? 2, 7, 587, 1831 What are the prime factors of 193209848? 2, 13, 617, 3011 What are the prime factors of 176608526? 2, 3499, 25237 List the prime factors of 99721356. 2, 3, 7, 1187159 What are the prime factors of 17100383? 59, 289837 What are the prime factors of 4603930120? 2, 5, 47, 179, 13681 List the prime factors of 2187372988. 2, 1423, 384289 List the prime factors of 56917246. 2, 28458623 What are the prime factors of 219113108? 2, 109, 502553 What are the prime factors of 71169311? 71169311 What are the prime factors of 4858460066? 2, 41, 59249513 List the prime factors of 884614050. 2, 3, 5, 331, 5939 List the prime factors of 30006775. 5, 421, 2851 What are the prime factors of 51356829? 3, 19, 900997 What are the prime factors of 72662181? 3, 71, 89, 3833 What are the prime factors of 422157132? 2, 3, 31, 378277 What are the prime factors of 126087599? 11, 997, 11497 What are the prime factors of 33019200? 2, 3, 5, 2293 List the prime factors of 50262070. 2, 5, 5026207 What are the prime factors of 1338307347? 3, 13, 34315573 What are the prime factors of 487137001? 13, 613, 61129 List the prime factors of 139468. 2, 7, 17, 293 List the prime factors of 53769314. 2, 31, 223, 3889 What are the prime factors of 2529221944? 2, 316152743 What are the prime factors of 362017842? 2, 3, 37, 137, 11903 List the prime factors of 759121974. 2, 3, 13, 257, 971 What are the prime factors of 73090142? 2, 36545071 List the prime factors of 387207212. 2, 7, 282221 List the prime factors of 1239615435. 3, 5, 17, 4861237 List the prime factors of 85378402. 2, 31, 1377071 List the prime factors of 737275496. 2, 431, 213827 List the prime factors of 3617044. 2, 904261 What are the prime factors of 432689465? 5, 13, 337, 19753 List the prime factors of 22191203. 1163, 19081 List the prime factors of 320653194. 2, 3, 53442199 List the prime factors of 569184558. 2, 3, 19, 179, 27893 List the prime factors of 14141403. 3, 1571267 What are the prime factors of 96888187? 11, 53, 166189 What are the prime factors of 2844481548? 2, 3, 17, 47, 241, 1231 What are the prime factors of 27873204? 2, 3, 2322767 List the prime factors of 82825480. 2, 5, 173, 11969 List the prime factors of 1682802535. 5, 863, 389989 List the prime factors of 30448494. 2, 3, 97, 5813 List the prime factors of 17615121. 3, 5871707 What are the prime factors of 99036427? 7, 14148061 List the prime factors of 455996700. 2, 3, 5, 506663 What are the prime factors of 170071883? 170071883 What are the prime factors of 127937408? 2, 23, 43457 What are the prime factors of 6294694? 2, 7, 449621 Wh	{ "pile_set_name": "DM Mathematics" }
264n3y*2 + 3n*2y*2 - 5553670y*2 wrt n. -41880n*3y + 1584y2 What is the first derivative of -326806079p*2 - 333286229 wrt p? -653612158p What is the third derivative of 497851o6 + 144o*3 - 4o*2 - 440o + 18663? 59742120o3 + 864 What is the first derivative of -2424751w - 791999 wrt w? -2424751 Find the second derivative of 2j2k*3x + 124041705j2k*2x + 3jk*3 + 2jk2x - 2jkx + 5j - 2k3x + 2k2x - 3601k2 wrt j. 4k*3x + 248083410k2x Find the second derivative of -1313w4 - 14w*3 + 47w*2 - 45w - 14322. -15756w2 - 84w + 94 Differentiate 102231565f4 + 93759847 wrt f. 408926260f*3 What is the second derivative of -15720152w*4 - 260w - 1072? -188641824w2 Differentiate -1059y*3 + 30y*2 - 667y + 786663706 with respect to y. -3177y2 + 60y - 667 Find the first derivative of -371435624j - 407627824. -371435624 What is the third derivative of 38306o*5 - 29o*4 - 7160142o*2? 2298360o*2 - 696o Find the second derivative of 15214726h4 + 6910096h wrt h. 182576712h2 What is the third derivative of -23275464bz3 + 6bz2 + 109bz + 7b + 395 wrt z? -139652784b What is the third derivative of giq2 + 26giq - 36gi - gq3 - 18817892iq4 + 583iq2 - 2iq + 2q*4 wrt q? -6g - 451629408iq + 48q Find the second derivative of 117588799ck2 - 65ck + 8257c - k - 15 wrt k. 235177598c What is the derivative of 6923gh3 - 278g + 8440938h3 wrt g? 6923h*3 - 278 Find the first derivative of 8v*3 + 86v*2 + 1454v + 114916815 wrt v. 24v2 + 172v + 1454 What is the derivative of -62391o3 + 13o*2 - 2o + 5678219? -187173o2 + 26o - 2 Find the second derivative of -151876385r3 - 11442r + 1322 wrt r. -911258310r What is the second derivative of -20996488dn5 + 2dn + 3d + 4n + 2243 wrt n? -419929760dn3 Find the third derivative of 27m*3p*4 - 35661m*3p*2 + 294mp2 + 19p*4 + 115p*3 wrt p. 648m*3p + 456p + 690 Find the third derivative of -485n*5 - 1541n*3 + 20064003n*2 wrt n. -29100n*2 - 9246 Find the third derivative of 28644rw6 - 72rw4 - 2rw2 + rw - 4r - 5w*2 + 254 wrt w. 3437280rw3 - 1728rw Find the third derivative of 8208511u*4 + 349877u*2 + 8 wrt u. 197004264u What is the second derivative of 44364387x2 - 348312x - 5 wrt x? 88728774 Find the first derivative of -63pqs + 210ps + 7qs - 30q + 7s - 636 wrt p. -63qs + 210s What is the first derivative of 1975424c4r*2 - 136cr2 - 430605287r*2 wrt c? 7901696c*3r*2 - 136r*2 What is the third derivative of -8331549x*4 + 4910984x*2 wrt x? -199957176x What is the third derivative of -736922f5 - 11f3 - f2 - 3765655f wrt f? -44215320f*2 - 66 What is the second derivative of -292j*3 + 286563j*2 + 299353704j? -1752j + 573126 What is the second derivative of 155455999f*2s*2 + 7f*2s + 26f2 + 34fs - 578f - s + 1 wrt s? 310911998f2 Find the second derivative of -z4 + 924z*3 + 273z*2 - 32722z - 237. -12z2 + 5544z + 546 Find the second derivative of 55429350z2 + 20504z + 1874. 110858700 What is the third derivative of 123966072g4 + 20g*2 - 135383g - 20 wrt g? 2975185728g What is the second derivative of 2hi3 + hi*2 + 8hi - 406602h + 16943712i3 wrt i? 12hi + 2h + 101662272i Differentiate 22263a*2k*2 - 244a*2 - 11502ak2 + 7332a - 14 wrt k. 44526a2k - 23004ak Differentiate 367n3ox + 2n*3x - 14n3 - 3968n*2x - 6n2 + 4nox - 3ox - 183o - x with respect to o. 367n*3x + 4nx - 3x - 183 What is the derivative of 32177077v*3 - 27980766? 96531231v*2 Differentiate 6691509l*2 + 11335171 with respect to l. 13383018l Find the second derivative of 6303ar*4 + 2ar3 + 331ar2 - ar - 13916426r wrt r. 75636ar2 + 12ar + 662a What is the third derivative of -26033122z4 + 2z*2 - 3636606? -624794928z What is the second derivative of -23113185a2 + 21708522a? -46226370 Find the second derivative of -71986597o2 + 77721656o. -143973194 What is the second derivative of 35861398d4 - 79519939d - 1 wrt d? 430336776d2 What is the third derivative of -1313d*5 + 21551d*4 + 18d*2 + 1035183d wrt d? -78780d2 + 517224d Find the third derivative of -16939o4z + 779o3z*3 + 4o*2z*3 - 4o*2 - 8oz2 - 3o - 9z3 + 1289z*2 wrt o. -406536oz + 4674z*3 Find the first derivative of 1459285j*2 + 180033 wrt j. 2918570j Differentiate -1254k2 + 36985k + 179992515 with respect to k. -2508k + 36985 What is the third derivative of -17429771v6 + v3 - 136568051v2 wrt v? -2091572520v*3 + 6 Find the third derivative of 1529973021k*4 + 170570669k*2 wrt k. 36719352504k Find the first derivative of 22yz*4 - 3yz3 + 45069yz - 37295604y wrt z. 88yz*3 - 9yz2 + 45069y Find the third derivative of 103425s3y*3 - 3s*3y*2 - 20s*2y*5 - 14138s*2y*2 + 2s*2y + s*2 - sy*2 wrt y. 620550s*3 - 1200s*2y*2 Find the first derivative of 19vw2 - 12842422v - 56222w2 wrt w. 38vw - 112444w What is the second derivative of -4991p3x*3 - 10p*3x + 13p3 + 3p*2x + 175px*3 - px*2 - 3p - 123 wrt x? -29946p3x + 1050px - 2p What is the first derivative of 253830945lp + 847017p + 94 wrt l? 253830945p What is the third derivative of 746559329o*5 + 49987o*2 - 76o - 1? 44793559740o2 What is the third derivative of 8308000z*3 + 3z*2 - 133129 wrt z? 49848000 Find the second derivative of -42316488z*2 - 394z + 15677 wrt z. -84632976 What is the first derivative of -2681859f + 872947? -2681859 Find the first derivative of 5x*4 - 4658576x*3 - 57324852. 20x*3 - 13975728x*2 Find the third derivative of -2430779r*4 + 14r*2 - 584r - 14. -58338696r What is the derivative of -q2z + 321071q2 + 3q + 220894192z wrt q? -2qz + 642142q + 3 What is the second derivative of -2q3t*3 - 2416q*3 + 215q*2 + 15601qt3 - 8q - 2t3 + 4t*2 - 2 wrt q? -12qt3 - 14496q + 430 Differentiate 7573633g - 2807706. 7573633 Find the third derivative of 207520737l*3s*3 - 131480l*2s2 + s3 - 1042s2 wrt l. 1245124422s*3 Differentiate -3593j*2x + 3j2 + jx - 28j + 21571760x with respect to j. -7186jx + 6j + x - 28 What is the third derivative of 190994334g*4 + 21571849g*2 - 6g wrt g? 4583864016g Find the first derivative of 30h*2y - 7086762h2 + 325523hy3 wrt y. 30h*2 + 976569hy2 What is the second derivative of 21689591m*2 + 7645604m wrt m? 43379182 What is the second derivative of 108ow*3 + 82ow2 + 3801056ow + 141w*3 + 3w*2 - 4w wrt w? 648ow + 164o + 846w + 6 Find the third derivative of -2w5 - 6022805w*4 - 66w*2 + 8w - 22176. -120w2 - 144547320w What is the third derivative of 24885089v5 - 82405052v*2? 1493105340v*2 What is the third derivative of 5048243hj3 + 11hj2 - 93hj + 286h + 2j2 - j - 2 wrt j? 30289458h What is the third derivative of -78845549d3g3 + d3g2 + d3g + d*2 - 1954dg + 10d - 3g wrt g? -473073294d*3 What is the third derivative of 14l*5 + 100948l*4 + 8l3 + l2 - 50963472? 840l2 + 2422752l + 48 Find the third derivative of -15136274a5 - 15322a*2 + 93 wrt a. -908176440a*2 What is the first derivative of 2a*3b - 27a3 - a2b + 2944ab + 12b - 17860 wrt b? 2a3 - a2 + 2944a + 12 Find the third derivative of 54189490z4 + z3 + 2099513z2 + z + 20. 1300547760z + 6 Find the second derivative of 775n4w - 670n2 + 2nw - 893n - 170w - 10 wrt n. 9300n*2w - 1340 Find the first derivative of -8s2 + 357192s - 3121695 wrt s. -16s + 357192 Find the second derivative of 123024u*2v*2 - 3u*2v - 13uv*3 - 9537162uv + 4v*2 wrt v. 246048u*2 - 78uv + 8 What is the derivative of 105293632u - 22826945? 105293632 What is the third derivative of -8060602x6z - 11x3z*2 + 13079827x*2z2 - x2z wrt x? -967272240x*3z - 66z2 What is the derivative of -12b4 - b2 + 954472b + 1059230351 wrt b? -48b*3 - 2b + 954472 What is the third derivativ	{ "pile_set_name": "DM Mathematics" }
3, 1119369? 1461965 What comes next: -465, -900, -1335, -1770, -2205? -2640 What is the next term in 2086, 2103, 2116, 2125, 2130, 2131? 2128 What is the next term in -2982, -2907, -2804, -2691, -2586, -2507, -2472, -2499? -2606 What is the next term in -24775, -24764, -24753, -24742, -24731, -24720? -24709 What is next in 57475, 114947, 172419? 229891 What comes next: 19028, 38054, 57068, 76064, 95036? 113978 What is the next term in 153, 584, 1307, 2340, 3701, 5408, 7479? 9932 What is next in -44057, -88136, -132233, -176348? -220481 What is the next term in -2136, -2172, -2208, -2244, -2280? -2316 What comes next: -104, -269, -430, -587, -740? -889 What is the next term in 84427, 84425, 84423, 84421, 84419? 84417 What is the next term in 29976, 29971, 29964, 29955, 29944? 29931 What is next in -312, -1258, -2844, -5076, -7960, -11502, -15708, -20584? -26136 What is the next term in 748020, 748019, 748018, 748017? 748016 What comes next: 1060, 2179, 3298, 4417, 5536, 6655? 7774 What is next in -223, -457, -711, -991, -1303, -1653? -2047 What comes next: 23450, 46902, 70354? 93806 What is the next term in 14, 144, 498, 1190, 2334? 4044 What is the next term in 988, 4160, 9448, 16852, 26372? 38008 What comes next: 462, 415, 276, -3, -470? -1173 What is the next term in -2749, -2752, -2757, -2764, -2773, -2784? -2797 What comes next: -1712, -3515, -5318, -7121, -8924, -10727? -12530 What is next in -344, -2806, -9478, -22466, -43876? -75814 What is next in -29940, -29934, -29928, -29922, -29916, -29910? -29904 What is the next term in 36282, 36297, 36312? 36327 What is next in 2805, 2851, 2997, 3297, 3805, 4575? 5661 What is the next term in 87, 150, 167, 114, -33, -298? -705 What is the next term in -3827, -7650, -11473, -15296, -19119, -22942? -26765 What is next in 45, 76, 79, 42, -47, -200, -429, -746? -1163 What comes next: -2826, -11337, -25520, -45375, -70902? -102101 What is the next term in 1476, 1587, 1726, 1899, 2112, 2371? 2682 What is next in 868, 2709, 4550? 6391 What is the next term in -4054, -4687, -5320, -5953, -6586, -7219? -7852 What comes next: -4475, -4479, -4483, -4487, -4491? -4495 What comes next: 48, 569, 2012, 4845, 9536? 16553 What is the next term in 412, 1113, 3016, 6721, 12828, 21937, 34648? 51561 What is the next term in 710, 277, -156? -589 What is next in -1671, -2081, -2491, -2901, -3311, -3721? -4131 What is the next term in 117926, 235849, 353772, 471695, 589618, 707541? 825464 What is next in -18933, -37856, -56779? -75702 What is next in 105, 183, 261? 339 What is next in 1115, 524, -465, -1858, -3661, -5880, -8521? -11590 What is the next term in -16416, -32924, -49432, -65940, -82448, -98956? -115464 What is the next term in 1788, 3389, 4990? 6591 What comes next: -323, -1395, -3223, -5807, -9147? -13243 What is the next term in 193, 1528, 5143, 12178, 23773, 41068? 65203 What comes next: -429258, -429262, -429266, -429270, -429274, -429278? -429282 What is the next term in -8901, -8912, -8923, -8934, -8945? -8956 What comes next: -3612, -7213, -10790, -14331, -17824, -21257, -24618? -27895 What comes next: 163, 143, 123, 103? 83 What is the next term in 2149, 2793, 3437, 4081, 4725? 5369 What is the next term in -9849, -9858, -9879, -9918, -9981, -10074, -10203, -10374? -10593 What is the next term in 125974, 125979, 125984, 125989, 125994? 125999 What comes next: -4713, -4772, -4871, -5010, -5189, -5408, -5667? -5966 What is next in 100, 67, 24, -17, -44? -45 What comes next: -5100, -10186, -15272, -20358, -25444? -30530 What comes next: 74058, 74059, 74060, 74061, 74062, 74063? 74064 What is the next term in 9102, 18137, 27174, 36213? 45254 What comes next: 289, 654, 1009, 1348, 1665? 1954 What is next in 1614, 330, -3162, -9966, -21186, -37926, -61290, -92382? -132306 What comes next: -1836, -3679, -5556, -7485, -9484, -11571? -13764 What is the next term in 3090569, 3090571, 3090573? 3090575 What is next in 12990, 25978, 38964, 51948, 64930, 77910, 90888? 103864 What comes next: 197, 346, 705, 1364, 2413, 3942? 6041 What is the next term in -3988, -3983, -3978, -3973, -3968? -3963 What comes next: 270, 46, -192, -450, -734, -1050? -1404 What is the next term in -1536, -2942, -4348, -5754, -7160? -8566 What is next in 1145, 1060, 951, 806, 613? 360 What is the next term in -319, -509, -699, -889, -1079, -1269? -1459 What comes next: -52, -48, -46, -46? -48 What is next in 29, 132, 307, 554, 873, 1264? 1727 What comes next: -2777943, -2777942, -2777941, -2777940, -2777939, -2777938? -2777937 What is next in 1400, 3514, 5628, 7742? 9856 What comes next: 104715, 104721, 104731, 104745, 104763? 104785 What is next in -1770, -7086, -15952, -28374, -44358, -63910, -87036, -113742? -144034 What comes next: -679, -869, -1059, -1249, -1439? -1629 What is the next term in 109540, 109519, 109496, 109471? 109444 What is the next term in 442, 907, 1388, 1885, 2398, 2927? 3472 What is the next term in 177, 526, 875, 1224, 1573? 1922 What is the next term in -183488, -366968, -550448, -733928, -917408? -1100888 What comes next: 163, 1922, 6753, 16210, 31847, 55218? 87877 What comes next: 3531, 3523, 3511, 3495, 3475, 3451? 3423 What is next in 373, 324, 297, 304, 357, 468, 649? 912 What comes next: -14, 2, 58, 148, 266, 406? 562 What comes next: -1521, -3115, -4781, -6519, -8329, -10211? -12165 What is the next term in 1971, 1989, 2015, 2043, 2067, 2081, 2079? 2055 What comes next: -29089, -29093, -29097? -29101 What is the next term in 2972, 3425, 4172, 5207, 6524? 8117 What comes next: 258054, 258051, 258048, 258045? 258042 What is the next term in -69, -6, 191, 516, 963, 1526, 2199? 2976 What is the next term in 16, -20, -124, -332, -680? -1204 What is next in -62541, -62540, -62529, -62502, -62453, -62376, -62265? -62114 What is the next term in -396, -394, -368, -306, -196, -26, 216, 542? 964 What is the next term in -475, -488, -491, -478, -443, -380, -283? -146 What is next in 74, 356, 928, 1874, 3278, 5224, 7796? 11078 What is next in 3548, 14167, 31870, 56663, 88552, 127543? 173642 What comes next: 45900, 183629, 413178, 734547, 1147736, 1652745, 2249574? 2938223 What comes next: -120, -275, -384, -423, -368, -195? 120 What is the next term in -5597, -5597, -5611, -5645, -5705? -5797 What comes next: -1314, -1313, -1316, -1323? -1334 What comes next: 65, 227, 653, 1475, 2825, 4835, 7637? 11363 What comes next: -1840, -1846, -1852? -1858 What is next in 1020, 2052, 3076, 4086, 5076, 6040, 6972, 7866? 8716 What is the next term in 178986, 178984, 178980, 178974, 178966, 178956? 178944 What comes next: -100689, -200950, -301199, -401430, -501637, -601814, -701955, -802054? -902105 What is next in 1598, 3152, 4654, 6104, 7502? 8848 What comes next: -243, -478, -703, -918, -1123? -1318 What is next in -6186, -6156, -6104, -6018, -5886, -5696, -5436? -5094 What is next in 206, 371, 506, 605, 662, 671, 626, 521? 350 What is the next term in -11796, -23608, -35418, -47226, -59032, -70836? -82638 What is next in -487, -493, -499? -505 What is the next term in -6640, -13285, -19928, -26569, -33208, -39845? -46480 What comes next: -154, -679, -1546, -2743, -4258, -6079? -8194 What is the next term in -787, -1542, -2297, -3052, -3807? -4562 What is next in -186, -243, -308, -381? -462 What comes next: 11, 62, 199, 464, 899, 1546, 2447? 3644 What is next in -3312, -3308, -3290, -3252, -3188, -3092, -2958? -2780 What is next in 7, -14, -63, -158, -317, -558, -899? -1358 What is next in -90, -243, -398, -555, -714, -875? -1038 What is next in 4, -94, -300, -614, -1036? -1566 What comes next: 2241, 4664, 7087, 9510, 11933? 14356 What comes next: 17376, 17369, 17362, 17355? 17348 What is next in -1315, -1311, -1307? -1303 What is next in 948, 2071, 3194, 4317, 5440? 6563 What comes next: -39772, -39763, -39754, -39745, -39736, -39727? -39718 What is the next term in -26939, -26947, -26955, -26963? -26971 What is the next term in 4456, 18080, 40786, 72574, 113444? 163396 What is next in -46894, -46887, -46876, -46861, -46842, -46819? -46792 What is the next term in 105721, 105720, 105719, 105718? 105717 What is next in 4987, 20348, 45949, 81790? 127871 What comes next: -16676, -33416, -50156? -66896 What is the next te	{ "pile_set_name": "DM Mathematics" }
? 4 Suppose 4w = 90 + 50. What is the units digit of w? 5 Let v(n) be the first derivative of 1 - 3/2n*2 - 2n. What is the units digit of v(-3)? 7 Let s = 17 - -21. Suppose -s = 3c - 107. What is the tens digit of c? 2 Suppose 27z = 26z + 56. What is the units digit of z? 6 Suppose 0 = -i - 4, -x = -5x + 3i + 132. What is the tens digit of -5 + 6 + x + -1? 3 Suppose x - 2x + 2 = 0. Let o be (-1)/(-4) - 14/(-8). Suppose 20 = oh - x. What is the units digit of h? 1 Suppose -s + 38 = -43. What is the tens digit of s? 8 Let g(l) = l2 + l + 18. Let d be g(0). Suppose 5u - d = 2u. What is the units digit of u? 6 Let s = -5 - -8. Let p(x) = x3 + 6x*2 - 8x - 7. Let a be p(-7). Suppose sd - 6 = a, -4q + 45 = 2d - 11. What is the units digit of q? 3 Let z(g) = 2g*2 + 16g + 15. Let o(y) = 3y2 + 24y + 22. Let s(u) = -5o(u) + 7z(u). Let w be s(-7). What is the units digit of 32/6 + w/(-6)? 5 Let y(k) = k - 3. Let s be y(3). Suppose 5m = 10 - s. Suppose 3d = 5d + 2f - 6, 3d - mf = 24. What is the units digit of d? 6 Suppose -3o + o = -24. What is the tens digit of o? 1 Let t(r) = -r2 - 5r + 8. Let v be t(-6). Let b = v + 0. Suppose -17 = -h + bg, -2h + h + 3g = -22. What is the units digit of h? 7 Suppose 0 = -3u + u + 8. Suppose l - 5 = 0, 2x - l = ul + 11. What is the tens digit of x? 1 Let n be (-4)/(-6) - (-24)/(-9). Let o = -1 - n. What is the units digit of o? 1 Suppose -63 - 555 = -3a. What is the hundreds digit of a? 2 What is the hundreds digit of (-6952)/(-28) - 4/846? 2 Let r = 13 - 8. Suppose x + rh + 17 = 0, 2x + 5h + 29 = 5x. Suppose xl - 5g = 33, -2g + 51 - 18 = 3l. What is the tens digit of l? 1 Let u = 372 - 217. What is the tens digit of u? 5 Suppose -y = y - 16. Suppose y = 2k - 0k. What is the units digit of 1 - (-2)/1k? 9 Let o(y) = -13y + 70. What is the tens digit of o(-10)? 0 Suppose -26 = 2o - 4l, 0 = 5l - 3l - 8. Let f be o/(15/(-6)) + -7. Let h(j) = -j + 6. What is the units digit of h(f)? 1 Let l(v) = -v + 1. Let k be l(-3). Let f = -1 + k. Suppose 1 = fp - 5. What is the units digit of p? 2 Suppose 9 = s - 4s, -5q - s = -202. Let v = q + -21. What is the units digit of v? 0 Suppose 4m + 2 = 3l - 24, 4m - 5l + 30 = 0. Let f = m + 6. What is the units digit of f? 1 Let x = -24 + 33. What is the units digit of x? 9 Suppose 2k - 30 = -3k. Let n(d) = 7d3 + d2 - 5d + 2. Let z(m) = 8m*3 + 2m*2 - 5m + 3. Let a(t) = 7n(t) - 6z(t). What is the units digit of a(k)? 2 Let r = -74 - -121. What is the units digit of r? 7 Let j(n) = 7n3 - 2n2 + 1. Let k(r) be the second derivative of -r3/6 - 3r2/2 - r. Let b be k(-4). What is the units digit of j(b)? 6 What is the units digit of ((-91)/26)/((-1)/14)? 9 Suppose 4p - 2p = 106. Suppose p = 3q - 7. What is the units digit of q? 0 Let d(n) = n - 10. Let q be d(9). What is the units digit of q + 3 - (2 + -9)? 9 Suppose 70 = 5o - 3q + q, -5o + 60 = -4q. Let x = 22 + -12. Let l = o - x. What is the units digit of l? 6 Let t = 30 + 74. Suppose 0 = 4x + 12 - t. What is the units digit of x? 3 Let k = -10 - -3. Let i = k + 11. Suppose u - 22 = -iv, 4v - u + 0u - 18 = 0. What is the units digit of v? 5 Suppose -2t + 60 + 198 = 0. What is the units digit of t? 9 Let n(v) = -v3 - 6v*2 + 7v - 7. Let t be n(-7). Let h be 0 + 7/(t/(-10)). Suppose 9x + 2 = hx. What is the units digit of x? 2 Suppose 4i - 27 = i. What is the units digit of i? 9 Suppose 2d - 2 = 3w, 2d - 2 = w + d. Suppose -5v - 19 + 1 = -m, m - wv = 12. What is the units digit of m? 8 Let t be 16(3 + -1 + -1). Suppose 0 = -7d + 5d + 64. Let p = d - t. What is the units digit of p? 6 Suppose 4h - 5h + 170 = 0. What is the units digit of h? 0 Let z be (1 + -1)/3 + 0. Suppose -5q - 2i + 73 = z, -i + 45 + 24 = 5q. Suppose -b - 4 = -q. What is the units digit of b? 9 What is the units digit of (6/4)/((-20)/(-80))? 6 Let d = 48 - 1. What is the units digit of d? 7 Let w be 37 - 0(0 - 1). Suppose -4x - 3j + 46 = 11, 0 = -4x - 5j + w. What is the units digit of x? 8 Let v be (-10)/(-15) + 34/(-6). Let w(n) = n2 - 3n - 2. Let r be w(4). Let m = r - v. What is the units digit of m? 7 Let i(v) = -v*3 + 6v*2 + 8v - 6. Let h be i(7). Suppose m + h - 3 = 0. What is the units digit of m? 2 Let y(s) = -5s + 5. What is the units digit of y(-6)? 5 Let b(f) = f2 + 9f - 16. Let j be b(-11). Suppose -t = -jt + 185. What is the tens digit of t? 3 Let v = -3 - 2. Let t = 9 + v. Suppose -tl = l - 30. What is the units digit of l? 6 Let f(t) = 31t3 - 2t*2 + t. Let k be f(1). Let q = k + -10. Suppose -q = -2z - 0z - 2c, 0 = 3z - c - 14. What is the units digit of z? 6 Suppose 330 = 2f + 70. What is the tens digit of f? 3 Suppose 2y + 3 = 3y. Let j(z) = 2z3 - 4z*2 + 2z + 2. What is the units digit of j(y)? 6 Let a(k) = k*2 + 5 + 2k*2 + 3k - 2k + 0k. What is the tens digit of a(-3)? 2 Let p = -9 + 18. Let r = p - 0. What is the units digit of r? 9 Let a(g) = -9g + 2 - g2 - 8 + 5. Let f(z) = 2z - 1. Let d be f(-2). What is the tens digit of a(d)? 1 Let d = 663 - 447. What is the hundreds digit of d? 2 Let b(d) = -d - 3. Let z be b(-5). What is the units digit of z + 2 + (3 - 0)? 7 Suppose 8 + 8 = 4t. Let k = t - 4. Suppose k = -a - 3a + 20. What is the units digit of a? 5 What is the units digit of 18/2 - (-7 - -4)? 2 Let j(m) be the first derivative of m6/24 + m5/60 + m*2 + 1. Let c(k) be the second derivative of j(k). What is the units digit of c(1)? 6 Let u = 6 + 8. Suppose 1 = 5t - u. Suppose 6i - 60 = ti. What is the units digit of i? 0 Let d(v) = 24v - 3v - 2 + 2. What is the units digit of d(1)? 1 Suppose 0 = -4o - 2 - 6. Suppose 3 - 7 = 4j. What is the units digit of j + 6o/(-4)? 2 Suppose -5n + s = -864, -n = 8s - 3s - 178. What is the units digit of n? 3 Let t(z) = 2z2 + z + 1. Let h be t(-1). Let p(w) = -5w + w*2 + 5 + hw - 2w. What is the units digit of p(4)? 1 Suppose -57 = g - 4g. What is the tens digit of g? 1 Let n = -47 - -81. Let b = n + 6. What is the units digit of b? 0 Let k = 21 - 13. Let z = k - -3. What is the units digit of z? 1 Let w = -5 - 11. Let n = 0 + w. Let k = -5 - n. What is the tens digit of k? 1 What is the units digit of (-5 - -3) + -2 + 94? 0 Let s be ((-3)/(-9))/((-5)/15). Let m(t) = 12t2. What is the units digit of m(s)? 2 Suppose 17 - 1 = 4o. Suppose 0 = -os - 0s - 124. What is the tens digit of s/(-3) + 1/(-3)? 1 Let f = -7 - -272. What is the hundreds digit of f? 2 Let u be 5 + 3/(-4 - -3). What is the tens digit of 0/(u - -1) + 23? 2 Suppose 25 = -3m - m - 5c, -5c = m + 25. Let x be m + 3 - 9/3. Suppose 6d - d - 29 = 2j, -2d + 2j + 14 = x. What is the units digit of d? 5 Let h(o) be the second derivative of o4/12 + 3o. Let v(r) = 7r2 - 3r. Let k(t) = -2h(t) + v(t). What is the tens digit of k(2)? 1 Let s = -23 - -85. What is the tens digit of s? 6 Suppose -133 = -5q + 67. What is the tens digit of (-1)/((-82)/q - -2)? 2 Let m = -8 + 18. What is the tens digit of m? 1 Let z = 22 - 19. Suppose zl = 2l + 45. What is the tens digit of l? 4 Let i be -1 - 0 - -4 - -152. Suppose 4z + i = 9z. What is the units digit of z? 1 Let h be (-44)/6 - (-1)/3. Let n be 0 + (5 - 1 - 7). Let w = n - h. What is the units digit of w? 4 Suppose 0 = 5z - 269 - 36. What is the units digit of z? 1 Let m(j) be the second derivative of j6/360 - j5/20 + j4/24 - j3/6 - 2j. Let l(t) be the second derivative of m(t). What is the units digit of l(6)? 1 Let t(n) = 5n - 4n + 2 - 2n. Let z be t(3). What is the units digit of z/(-2) - (-44)/8? 6 Suppose -4l - 5a + 106 = 0, -5l + 7a - 3a = -153. What is the tens digit of l? 2 Let i(l) = -l*2 - 8l + 11. Let y be i(-9). Suppose -2f + 3f - y = 0. Suppose -5u - 5r + 10 = 0, -fr + r = 4u - 14. What is the units digit of u? 4 Let r be 17/5 + (-6)/15. Suppose -s + 41 = v, s = -rs - 2v + 172. What is the units digit of s? 5 Let j(o) = -o + 24. What is the tens digit of j(-7)? 3 Let q(x) = -x*3 - 2x2 + x + 4. Let o be q(-3). What is the units digit of 1 + 1 - o/(-5)? 4 Let f(w) = w3 - 5w*2 - w + 5. Let j be f(4). What is the units digit of ((-7)/5)/(3/j)? 7 Sup	{ "pile_set_name": "DM Mathematics" }
35u + 614 What is the b'th term of 91917, 183830, 275743, 367656, 459569? 91913b + 4 What is the i'th term of 20166, 40327, 60488, 80649? 20161i + 5 What is the r'th term of -2216, -2192, -2180, -2186, -2216, -2276, -2372? -r3 + 31r - 2246 What is the m'th term of -3147, -6282, -9405, -12516, -15615, -18702? 6m2 - 3153m What is the z'th term of -25069, -25068, -25067, -25066, -25065, -25064? z - 25070 What is the w'th term of 34122, 34121, 34112, 34089, 34046, 33977, 33876? -w*3 + 2w*2 + 34121 What is the k'th term of 148, 1387, 4896, 11857, 23452, 40863, 65272? 197k*3 - 47k*2 + k - 3 What is the m'th term of -659, -1306, -1953, -2600, -3247, -3894? -647m - 12 What is the q'th term of -33, -79, -137, -201, -265, -323? q*3 - 12q*2 - 17q - 5 What is the n'th term of -100, -180, -340, -604, -996? -4n3 - 16n*2 - 4n - 76 What is the h'th term of -17925, -17941, -17983, -18063, -18193, -18385? -2h3 - h2 + h - 17923 What is the d'th term of 3377, 13498, 30373, 54008, 84409? d3 + 3371d*2 + d + 4 What is the t'th term of 1184359, 2368719, 3553079, 4737439, 5921799? 1184360t - 1 What is the d'th term of 763, 3213, 9037, 19921, 37551? 281d3 + d2 + 480d + 1 What is the w'th term of 4171, 4295, 4421, 4549, 4679? w*2 + 121w + 4049 What is the a'th term of -13468, -13489, -13510, -13531, -13552? -21a - 13447 What is the d'th term of -1350, -1409, -1512, -1665, -1874, -2145, -2484? -d3 - 16d*2 - 4d - 1329 What is the x'th term of -23234, -46457, -69680, -92903? -23223x - 11 What is the r'th term of -17813, -35608, -53369, -71078, -88717? 3r3 - r2 - 17813r - 2 What is the y'th term of 563356, 563357, 563358? y + 563355 What is the f'th term of -5447, -5401, -5355, -5309, -5263, -5217? 46f - 5493 What is the q'th term of -223, -566, -1137, -1936, -2963, -4218, -5701? -114q2 - q - 108 What is the r'th term of -1086, -2729, -4928, -7683? -278r*2 - 809r + 1 What is the w'th term of 73, 110, 171, 256, 365? 12w2 + w + 60 What is the h'th term of 24971, 49945, 74907, 99851, 124771, 149661? -h3 + 24981h - 9 What is the g'th term of -39254, -39264, -39278, -39296? -2g2 - 4g - 39248 What is the z'th term of 166, 248, 464, 880, 1562, 2576, 3988, 5864? 11z3 + z2 + 2z + 152 What is the l'th term of 1520, 6096, 13696, 24296, 37872, 54400, 73856? -4l3 + 1536l*2 - 4l - 8 What is the t'th term of -1675, -6854, -15535, -27718? -1751t2 + 74t + 2 What is the o'th term of 302, 551, 762, 917, 998, 987, 866, 617? -3o3 - o2 + 273o + 33 What is the h'th term of 9028, 9027, 9026, 9025, 9024? -h + 9029 What is the x'th term of 12487, 12491, 12497, 12505, 12515, 12527? x2 + x + 12485 What is the s'th term of 52664, 52670, 52678, 52688, 52700, 52714? s2 + 3s + 52660 What is the q'th term of -66953, -66943, -66919, -66875, -66805, -66703, -66563, -66379? q3 + q2 - 66955 What is the z'th term of -1415, -1405, -1395? 10z - 1425 What is the r'th term of 58, 209, 450, 781, 1202, 1713? 45r2 + 16r - 3 What is the v'th term of 465, 1709, 3699, 6429, 9893, 14085? -v*3 + 379v*2 + 114v - 27 What is the l'th term of -627, -459, -305, -171, -63, 13? -l3 - l2 + 178l - 803 What is the l'th term of -1091, -2212, -3335, -4460, -5587, -6716, -7847? -l2 - 1118l + 28 What is the r'th term of 6168, 6095, 6026, 5961, 5900, 5843, 5790? 2r2 - 79r + 6245 What is the l'th term of -712021, -712022, -712023, -712024? -l - 712020 What is the p'th term of 5568, 5582, 5590, 5586, 5564? -p*3 + 3p*2 + 12p + 5554 What is the k'th term of -30893, -30913, -30947, -30995, -31057, -31133? -7k2 + k - 30887 What is the z'th term of 253, -500, -1755, -3512, -5771? -251z*2 + 504 What is the l'th term of -692, -866, -1160, -1574, -2108, -2762? -60l*2 + 6l - 638 What is the q'th term of 135, 157, 189, 231, 283, 345, 417? 5q2 + 7q + 123 What is the g'th term of -1002976, -2005952, -3008928, -4011904? -1002976g What is the s'th term of 262, 543, 840, 1153? 8s*2 + 257s - 3 What is the i'th term of -1190, -5994, -14000, -25208, -39618? -1601i2 - i + 412 What is the v'th term of -49, -449, -1529, -3625, -7073, -12209? -56v*3 - 4v*2 + 4v + 7 What is the c'th term of -193695, -193712, -193729? -17c - 193678 What is the q'th term of -347, -731, -1121, -1499, -1847, -2147? 3q*3 - 21q*2 - 342q + 13 What is the y'th term of 82952, 165931, 248924, 331937, 414976, 498047, 581156? y3 + y2 + 82969y - 19 What is the n'th term of -18, -124, -346, -720, -1282, -2068, -3114, -4456? -6n*3 - 22n*2 + 2n + 8 What is the x'th term of 93, 1059, 3717, 8913, 17493? 141x3 - 21x - 27 What is the v'th term of 9, 8, 13, 24, 41, 64, 93? 3v2 - 10v + 16 What is the y'th term of 96, 198, 370, 612, 924? 35y2 - 3y + 64 What is the u'th term of -113, -81, -39, 19, 99? u3 - u2 + 28u - 141 What is the z'th term of -199, -174, -133, -76? 8z*2 + z - 208 What is the a'th term of 28745, 57468, 86191, 114914? 28723a + 22 What is the p'th term of 7241, 14518, 21795, 29072, 36349, 43626? 7277p - 36 What is the c'th term of -1833, -1746, -1659, -1572, -1485? 87c - 1920 What is the y'th term of -31, 60, 221, 452, 753, 1124? 35y2 - 14y - 52 What is the y'th term of 5911, 11831, 17751, 23671, 29591? 5920y - 9 What is the r'th term of 3, -52, -141, -282, -493? -3r3 + r2 - 37r + 42 What is the m'th term of -40908, -40909, -40910, -40911? -m - 40907 What is the a'th term of 1065, 2118, 3167, 4212? -2a*2 + 1059a + 8 What is the f'th term of -43643, -43643, -43641, -43637, -43631, -43623? f*2 - 3f - 43641 What is the j'th term of 785, 738, 687, 632, 573, 510? -2j2 - 41j + 828 What is the i'th term of 321, 1024, 2931, 6642, 12757? 100i3 + 2i*2 - 3i + 222 What is the d'th term of -3426, -3627, -3828? -201d - 3225 What is the x'th term of -3586, -7202, -10842, -14506, -18194, -21906? -12x*2 - 3580x + 6 What is the f'th term of -195851, -783369, -1762565, -3133439, -4895991, -7050221? -195839f2 - f - 11 What is the h'th term of -919, -3591, -8007, -14167, -22071? -872h*2 - 56h + 9 What is the x'th term of -2287, -4509, -6731, -8953, -11175? -2222x - 65 What is the b'th term of -6695, -13386, -20077, -26768, -33459? -6691b - 4 What is the j'th term of -209, 455, 2857, 7867, 16355, 29191, 47245? 145j3 - j2 - 348j - 5 What is the h'th term of -1344790, -1344786, -1344780, -1344772, -1344762, -1344750? h2 + h - 1344792 What is the w'th term of 5218, 5223, 5230, 5239, 5250? w2 + 2w + 5215 What is the m'th term of -94625, -189252, -283879? -94627m + 2 What is the b'th term of -17484, -69943, -157378, -279789, -437176, -629539? -17488b2 + 5b - 1 What is the b'th term of 669, 1680, 2689, 3696, 4701, 5704? -b*2 + 1014b - 344 What is the n'th term of -104318, -104311, -104306, -104303, -104302, -104303, -104306? -n*2 + 10n - 104327 What is the h'th term of 2231, 4865, 7497, 10127, 12755? -h*2 + 2637h - 405 What is the d'th term of -13895, -55592, -125089, -222386, -347483, -500380, -681077? -13900d2 + 3d + 2 What is the f'th term of 110, 544, 1274, 2306, 3646, 5300, 7274, 9574? f*3 + 142f*2 + f - 34 What is the s'th term of -10401, -10397, -10393, -10389, -10385, -10381? 4s - 10405 What is the h'th term of -100, -242, -384? -142h + 42 What is the j'th term of -13, -91, -239, -469, -793, -1223, -1771, -2449? -2j*3 - 23j*2 + 5j + 7 What is the m'th term of 1291, 1148, 1005? -143m + 1434 What is the n'th term of 3812, 3902, 4054, 4268? 31n*2 - 3n + 3784 What is the z'th term of -5127, -20515, -46161, -82065, -128227? -5129z2 - z + 3 What is the a'th term of 5955, 5969, 6001, 6057, 6143? a3 + 3a*2 - 2a + 5953 What is the p'th term of 608, 476, 344, 212, 80, -52? -132p + 740 What is the h'th term of -53757, -53751, -53745, -53739, -53733, -53727? 6h - 53763 What is the a'th term of -9245, -9243, -9239, -9233, -9225? a2 - a - 9245 What is the a'th term of -165, -158, -153, -150, -149, -150, -153? -a2 + 10a - 174 What is the l'th term of -467, -2050, -4709, -8456, -13303, -19262? -2l*3 - 526l*2 + 9l + 52 What is the q'th term of -223, -853, -1881, -3307, -5131, -7353, -9973? -199q2 - 33q + 9 What is the l'th ter	{ "pile_set_name": "DM Mathematics" }
What is the highest common divisor of 75 and 3409480? 5 What is the highest common factor of 345744 and 95746? 98 What is the greatest common factor of 1078 and 5250350? 98 Calculate the greatest common factor of 232694 and 8316. 154 Calculate the highest common divisor of 2076 and 401844. 12 What is the highest common factor of 1887725 and 2450? 1225 What is the highest common factor of 69549 and 224943? 291 Calculate the greatest common factor of 4960644 and 2496. 156 What is the greatest common factor of 2500260 and 8820? 420 What is the greatest common divisor of 28 and 478530962? 14 What is the greatest common divisor of 22022 and 273? 91 What is the highest common divisor of 24430868 and 11858? 1694 What is the highest common factor of 4 and 1092096716? 4 What is the highest common divisor of 35119 and 17371? 29 Calculate the highest common factor of 6976 and 181081264. 1744 Calculate the greatest common factor of 13 and 19463717. 13 Calculate the highest common divisor of 65698650 and 265185. 3735 What is the highest common divisor of 25773 and 793638? 213 What is the highest common factor of 20 and 87553540? 20 What is the highest common factor of 79662 and 74681? 17 Calculate the greatest common factor of 130 and 258985. 5 Calculate the greatest common factor of 51 and 151254287. 17 Calculate the highest common divisor of 664459488 and 1494. 1494 Calculate the greatest common divisor of 245604 and 801608. 388 What is the greatest common divisor of 92 and 218334101? 23 What is the highest common divisor of 2784 and 21159? 3 Calculate the greatest common factor of 1620350 and 32200. 1150 What is the highest common factor of 12497032 and 120? 8 What is the greatest common factor of 82429273 and 1861? 1861 Calculate the highest common divisor of 528 and 280549808. 176 What is the highest common factor of 13869 and 190682? 67 What is the highest common factor of 2336644 and 15692792? 9092 What is the highest common divisor of 8181353 and 138? 23 What is the highest common divisor of 42 and 2445317? 7 What is the greatest common factor of 420384 and 571184? 464 Calculate the highest common factor of 117956678 and 2036. 1018 Calculate the greatest common factor of 450941 and 1591. 43 Calculate the highest common divisor of 10856750 and 10000. 250 What is the highest common divisor of 293472 and 39456? 288 What is the greatest common factor of 48 and 4848582? 6 What is the highest common divisor of 266624 and 5792? 32 Calculate the highest common divisor of 198 and 80015661. 99 Calculate the highest common factor of 116539246 and 6. 2 What is the highest common factor of 22504 and 1046824? 776 What is the highest common divisor of 1040961 and 9588? 51 Calculate the greatest common factor of 37949986 and 1630. 326 What is the greatest common divisor of 28853 and 448877? 473 Calculate the highest common divisor of 4293933 and 435372. 1533 What is the highest common divisor of 678780 and 500? 20 Calculate the highest common factor of 641650071 and 438. 219 Calculate the highest common factor of 5117916 and 912. 228 What is the highest common factor of 424028 and 598? 46 Calculate the highest common divisor of 2282992 and 7355. 1471 Calculate the highest common divisor of 14826874 and 1547814. 8458 What is the greatest common factor of 330 and 1071203870? 110 What is the highest common divisor of 417852 and 1595196? 2628 What is the greatest common divisor of 16992 and 1246788? 2124 What is the highest common divisor of 825 and 598400? 275 What is the greatest common factor of 2048 and 50704? 16 Calculate the greatest common factor of 306493 and 30481. 187 Calculate the greatest common factor of 19 and 56186116. 19 Calculate the highest common factor of 286300365 and 2535. 2535 What is the highest common factor of 87750 and 1270350? 1350 Calculate the highest common factor of 787340078 and 42. 14 Calculate the highest common divisor of 26059 and 6279704. 103 Calculate the highest common divisor of 135198 and 32290398. 3654 Calculate the highest common factor of 14 and 61216218. 14 What is the highest common factor of 7688408 and 288392? 6136 What is the highest common divisor of 5744712 and 36816? 1416 Calculate the greatest common divisor of 192 and 18343752. 24 What is the highest common factor of 100831 and 509282? 1709 What is the highest common divisor of 10864 and 2709016? 776 Calculate the greatest common factor of 224 and 3974336. 32 Calculate the greatest common divisor of 43456 and 64000. 64 What is the highest common factor of 28045992 and 416? 104 What is the highest common divisor of 2033270 and 180913? 1601 Calculate the greatest common factor of 49887 and 18929. 23 Calculate the greatest common factor of 336479 and 157. 1 Calculate the highest common divisor of 4341072 and 4752. 48 What is the highest common divisor of 699322374 and 151? 151 What is the highest common divisor of 6022306 and 12632? 3158 What is the highest common divisor of 3220 and 17099600? 140 Calculate the highest common divisor of 12322896 and 745. 149 Calculate the greatest common divisor of 494978 and 14496. 302 Calculate the greatest common factor of 527904 and 35928. 72 Calculate the greatest common factor of 169 and 37830650. 169 Calculate the greatest common divisor of 35763 and 311125. 131 What is the greatest common divisor of 22578003 and 129150? 2583 Calculate the highest common divisor of 587491205 and 175. 35 What is the greatest common divisor of 122126 and 6004618? 538 Calculate the highest common divisor of 21842 and 44010. 326 What is the highest common divisor of 6344 and 208520? 104 What is the highest common divisor of 3142681 and 71? 1 Calculate the greatest common factor of 7765 and 4368589. 1553 What is the highest common divisor of 121876563 and 69? 69 Calculate the highest common divisor of 2072 and 9375023. 259 Calculate the highest common divisor of 3984 and 4067. 83 Calculate the highest common divisor of 108 and 5098410. 54 Calculate the greatest common factor of 3687 and 6988094. 1229 What is the highest common factor of 122114726 and 2294? 74 What is the highest common factor of 9570891 and 561? 33 What is the greatest common divisor of 8527245 and 44407? 367 Calculate the highest common factor of 176807719 and 35223. 11741 What is the greatest common factor of 76944 and 54228? 12 Calculate the greatest common factor of 92129367 and 198. 33 Calculate the highest common factor of 4316780 and 468. 52 What is the greatest common factor of 28049 and 16205? 7 What is the highest common factor of 1715003 and 110843? 557 Calculate the highest common divisor of 561 and 6359925. 33 What is the highest common divisor of 10995 and 336076835? 3665 Calculate the highest common factor of 1127 and 15094156. 49 Calculate the greatest common factor of 11874234 and 6. 6 What is the highest common divisor of 96437691 and 48762? 2709 What is the greatest common divisor of 1840482 and 8656? 1082 Calculate the highest common factor of 260 and 991510. 130 What is the greatest common factor of 5465 and 2569643? 1093 Calculate the greatest common factor of 307725 and 14650. 25 What is the greatest common divisor of 175406 and 870485? 1309 Calculate the greatest common divisor of 3703 and 2453801. 161 Calculate the highest common divisor of 419 and 532968. 419 What is the highest common divisor of 764123503 and 22? 11 Calculate the greatest common factor of 678 and 5908657. 113 Calculate the highest common divisor of 20 and 27049390. 10 What is the greatest common divisor of 6762 and 11915526? 294 Calculate the greatest common divisor of 28361241 and 2242. 59 What is the highest common factor of 3069 and 213114? 33 Calculate the greatest common factor of 6540 and 3835056. 1308 Calculate the highest common divisor of 6371 and 2152945659. 6371 What is the highest common divisor of 909795 and 7871? 463 Calculate the greatest common factor of 10061677 and 3239. 79 What is the greatest common divisor of 790 and 7535810? 790 What is the highest common factor of 35 and 504363405? 35 Calculate the greatest common factor of 11547863 and 6624. 23 What is the greatest common divisor of 6019 and 629352659? 6019 Calculate the highest common factor of 19403581 and	{ "pile_set_name": "DM Mathematics" }
+ 30. Let i be (-1)/((27/6)/u). Let p be 6/(-4)i/(-30). Which is smaller: p or 0? 0 Let x(s) = s3 + 2s*2 - 3s + 2. Let c be x(-3). Suppose 0 = cn + 2 + 6. Let j = -8 + 5. Is n at least j? False Let c = -41 - -21. Let l = -26 - 0. Let v = l + 6. Is c < v? False Let o = -0.11 - -118.11. Let w = -115.84 + o. Let z = -0.16 + w. Is -3 bigger than z? False Let k be (22764/9)/(-4) - 6/9. Which is bigger: -634 or k? k Let z be (37/5)/(2/4). Let s = z + -449/30. Suppose n = 5f - 2, 7f + 4 = 2f - 2n. Are s and f equal? False Let f = 97 - 101. Suppose 3t + 2t - 35 = 0. Let d = 4 - t. Is f greater than or equal to d? False Let f be -49 - (39 - 40)(0 + -4). Is f != -54? True Suppose 0 = -2p + q - 578, 4p - 9p + q - 1439 = 0. Which is bigger: p or -288? p Let a = 90 + -446/5. Is 1 less than or equal to a? False Let v = 2030 - 2002. Which is bigger: 88/3 or v? 88/3 Let x be (-2)/4 + (-3)/(-6). Let j = -102 - -1324/13. Is j < x? True Let y(j) = -j3 + 2j*2 + 6j + 6. Let x(b) = -b3 + b2 + 7b + 6. Let g(h) = 4x(h) - 5y(h). Let z be g(4). Let m be z/(-126) + 9/(-27). Is m <= 0? False Let y be 45(-2)/(2/5). Let x be ((-12)/y)/(2/5). Suppose -j - 9 = 3a, 4j + 11 = -3a + 2. Which is smaller: j or x? j Let f(h) = h3 + 17h*2 - 7h - 33. Let o be f(-17). Which is smaller: -2 or o? -2 Let z = 75.106 + -0.106. Let n = 81 - z. Let d = -2 - -3. Which is greater: n or d? n Let r = -81460/31 + 2628. Which is greater: r or 0? r Let c = -794 + 802. Let u = -1 - -8. Let a = u - c. Is 3 bigger than a? True Suppose 7w = -5w - 36. Let a be -1 + w/(-2) + 372/(-24). Is -15 < a? False Suppose 3y - 4y - 4 = 0, -4p - 3y - 96 = 0. Let a = p - -23. Suppose -a - 4 = w. Is w < -5? True Let x = -0.2 - -0.18. Let g = 79.02 + -78. Let f = x + g. Which is smaller: f or -4? -4 Suppose -4l + 1363 = -3s, 3l - 178 - 841 = -s. Which is bigger: l or 341? 341 Suppose 5d - 2d - 4y + 168 = 0, 0 = -5d + 4y - 280. Let p be 5555/100 - 1/(-5). Let o = d + p. Which is smaller: o or -3? -3 Suppose 0 = 4r - 2n - 34, 4r = -10n + 5n + 41. Let p(q) = -q2 - 13q - 12. Let c be p(-10). Suppose -2v + 0v = -c. Is v at most r? True Let t(y) = y*3 + 20y*2 + 2y + 42. Let f be t(-20). Let r be (-8)/24 + 0/f. Let v be (2/(-8))/((-6)/(-8)). Do r and v have different values? False Suppose 5z - 3p - 393 = 0, -z = 4p - 29 - 45. Which is smaller: 386/5 or z? 386/5 Let o be 1/4 - 165/(-2760). Let x = 10/23 - o. Is x greater than or equal to -1? True Let f = 0.73 + -0.7. Let x = 1.97 + f. Let y be 37/148 - (6/8 + -1). Which is bigger: y or x? x Let q = -938.82 - -941. Is q >= -1/3? True Let d be 7/(-15)(-14)/49. Suppose -2o = 5j + 7, -7 = 3o + 5j + 1. Which is greater: o or d? d Let m be 2((-444)/24 + -8). Which is greater: m or -160/3? m Suppose -6n + 8n = 2. Let m be 1/(((-21)/18)/(-7)). Let u = m - 6. Which is greater: n or u? n Suppose 0 = -2l + 4l + 10. Suppose -17y + 4 = -15y. Let x(z) = -4z*2 + 3z + 4. Let v be x(y). Is l greater than or equal to v? True Let p(z) = -z*2 - 7z - 10. Let m be p(-3). Suppose -3q = -15, 2q + 0q - 14 = mu. Let g be u/(1 + 12/8). Which is bigger: g or -2? g Let j = -82466/77 + 1071. Let u = -73/308 - j. Is -3 at most u? True Let d = 1649 + -44512/27. Which is bigger: 1 or d? 1 Let d be 2(-4)/186(-12)/(-24). Is d bigger than 1? False Let f be 2432/(-1881) + 0 + 8/44. Is -1 >= f? True Suppose -f - 19w = -20w - 58, 2f - 108 = 4w. Which is greater: f or -3? f Let l = 0.04 - -0.05. Let c = l - 0.09. Let n = 0.053 + -2.053. Is n at least as big as c? False Let n = 0.49 - 0.456. Let p = n + -0.034. Are p and 12/13 non-equal? True Let r be (11 - 384/36) + (-1 - 0). Let q = -5.3 + -0.7. Let v = -1 + q. Which is smaller: r or v? v Let n = 0 + -1. Let c be 3076/(-960) - (8/(-5) - -1). Let a = -8/3 - c. Is a bigger than n? True Let h be -1 + 8/(-4) - (-1910)/670. Is -0.1 < h? False Let n(z) = -6z - 9. Let r be n(-4). Suppose 0 = -21a + ra. Which is greater: a or 2? 2 Suppose 0 = -616x + 619x. Which is smaller: -16/81 or x? -16/81 Suppose m + 12 = 4m. Let f be 2/m - (-2)/2. Suppose -5j + 14 = -3l, -3j - 49 = l - 63. Which is smaller: l or f? f Suppose 3i = 3t + 6, t + 4i = -10 - 17. Suppose -4 - 16 = -4c. Suppose cl = 3l - 12. Is t less than l? True Let c(u) = -u - 2. Let i be c(-7). Is 41 at least i? True Suppose -2v + 4c - 8 = 0, c + 4c - 25 = -5v. Let h be (13/v)/(4 - (-14)/(-4)). Is 13 less than h? False Let l = -21 + 36. Is 20 equal to l? False Let j be (2 + 2)11/(-638). Is 1 greater than j? True Let n(y) = -3y + 27. Let g be n(13). Let p = g - -11. Is 2 greater than or equal to p? True Let m = 1547/3 - 517. Which is bigger: m or 5? 5 Suppose -4m - 8 = x, 2x = 7m - 2m + 10. Let s = 26.38 + -26. Let g = 0.28 - s. Which is smaller: g or x? g Let u(n) = 59n*3 - 2n*2 + n + 2. Let k be u(-1). Let l = k - -99. Is l < 40? True Suppose 5p + 145 = -2q + 1, 2p - 5q = -75. Let r be 2/((-12)/8(-52)/p). Which is greater: r or 2/7? 2/7 Let h = 19832543/1211 - 16377. Is 1 < h? False Let x = -3 - -2. Let u = 0.73 + -0.96. Let j = u + -12.77. Which is greater: x or j? x Let k be (-184)/76 - -2 - (-8)/8. Which is bigger: 2 or k? 2 Let t = -0.067 + -60.933. Let l = 66.2 + t. Let d = 5 - l. Which is smaller: d or -6? -6 Let s = -0.192 - 53.128. Let b = s - -0.32. Which is bigger: b or 2? 2 Suppose 4f + 26 = -22. Let q = 12 + f. Suppose q = -3i - 0i + 24. Is i <= 8? True Let y be 1/2 - (-300)/(-8). Suppose 4c - x + 146 = 0, -2c + 4x = 2c + 128. Is y != c? True Suppose -5 = -7f - 26. Is f <= -8/5? True Let g be 15/(-10)(-6)/9. Let a be g/3 + (-24)/(-9). Suppose 2z + az = 0. Is z at least as big as 1/17? False Let z be 1/(2/5)-6. Let t be (-6)/z(-5)/(-7). Let b = 1 - 7/5. Is t at most as big as b? False Let d = 6 + -3. Suppose 0 = -z + 3k - 1, 2 + 0 = -2z + dk. Suppose 3f + 2f - 5b = 15, 0 = 4f + 2b. Which is bigger: z or f? f Let a = 0.8 + 0.2. Let h = 0.32 - 8.22. Let x = h + 5.9. Which is greater: x or a? a Let a = -12.19 + 0.19. Let w = -12.87 - -1.07. Let n = w - a. Are n and 1/7 unequal? True Let t = -267 + 98. Is -170 at most as big as t? True Let x = 3 + 129. Let c = 583266 + -12251356/21. Let b = x + c. Which is smaller: 1 or b? b Let r = 3.33 + -3.261. Is 3 <= r? False Let v be 01/21. Let y = 7 + v. Suppose 2h - 5 = -y. Is -5/4 != h? True Let o(f) = -3f - 12. Let y be o(-6). Suppose 0x + y = -x. Let v = -7 - x. Which is bigger: -4 or v? v Suppose 3i + 2v + 17 = 0, -v + 3 = -2i - 4v. Let y(x) = -7x - 45. Let u be y(i). Is u at least 18? True Let z be 4/10 - (-28171)/(-65). Let q = 16889/39 + z. Let u(d) = 2d - 1. Let b be u(1). Is q > b? False Let p be 5/41-5(-12)/(-150). Is p >= 0? False Suppose 25l + 3c - 57 = 28l, -2l = 3c + 13. Are l and -2 nonequal? True Let u = 4 - 3. Let j be ((-224)/21)/((-4)/3 + 1). Let c be (30/j + -1)/(3/(-4)). Which is greater: u or c? u Let b = -0.9566 - 0.0434. Are 14 and b nonequal? True Let s be (-846)/(-24) + -412/(-64). Which is bigger: s or 2? s Let n be -221 + 10 - 10/(-2). Are -206 and n unequal? False Let o = 121.7 - -1.3. Let j = -124 + o. Is j greater than or equal to 75? False Let y = -3057/22 + 139. Let c = -29/88 - y. Which is smaller: 3/2 or c? c Let v = 1413 - 1413. Which is greater: 3/335 or v? 3/335 Let l be (-2)/(-12)(-15)/(-90)8. Is l < 11/2? True Let t be (6 + -4)3 - 115. Suppose -3u = -0u + 30. Is u less than t? True Suppose 0 = 3v - v - 4. Suppose v = 2w - 0w. Is w at least 0? True Let z be ((-35)/(-15))/((-1)/(-6)). Suppose zs = 12s. Which is greater: -2/111 or s? s Suppose 4b = -4 - 0. Suppose 3 - 8 = -4t - u, 2 = -t + 3u. Let z be t/(-3)(-4 + 6 + 0). Which is smaller: z or b? b Let h = -568 - -568. Is 1/115 at most h? False Let g = 805 - 783. Suppose -k - 2k = -63. Are k and g unequal? True Suppose 3 = 2k - 3k + u, 5k - 2u = 0. Which is greater: 0.0246 or k? k Let l = 1.8 - -17.2. Is 8 at least l? False Let y(a) = -9a2 + 4a - 3. Let i be y(2). Let f = 29 + i. Which is greater: -3 or f? f Let r = 2.112 + -0.112. Which is greater: -6.9 or r? r Let a(i) = -5i - 8. Let q be a(-3). Suppose 5 = -6t - q. Suppose -v - 20 = 3*v. Are t and v equal? False Let g = -0.031 + 25.0	{ "pile_set_name": "DM Mathematics" }
is 628961850 rounded to the nearest one million? 629000000 What is -4097577.08 rounded to the nearest 100000? -4100000 What is 0.0000444022108 rounded to 7 dps? 0.0000444 Round -0.00000379580357 to 7 dps. -0.0000038 What is -0.00005086287251 rounded to seven dps? -0.0000509 What is 339524800 rounded to the nearest one million? 340000000 Round -0.0052057524 to 6 dps. -0.005206 What is 1.860607775 rounded to three dps? 1.861 Round 14288527.05 to the nearest one hundred. 14288500 What is 1781923.7 rounded to the nearest 100000? 1800000 What is 0.0378629692 rounded to five dps? 0.03786 Round -784174.53 to the nearest 10000. -780000 What is -3003142626 rounded to the nearest 1000000? -3003000000 What is -148.8073714 rounded to one decimal place? -148.8 What is -0.00248782456 rounded to 5 dps? -0.00249 Round 0.01617456947 to six dps. 0.016175 What is 108268.122 rounded to the nearest 10000? 110000 Round 35.461167 to one decimal place. 35.5 Round 0.000002254481723 to 7 dps. 0.0000023 Round -333.940599 to the nearest integer. -334 Round -505338.75 to the nearest 100. -505300 What is 0.00047771643 rounded to 7 decimal places? 0.0004777 Round -627341.512 to the nearest ten. -627340 What is -73.0791293 rounded to one dp? -73.1 Round 196.235056 to two decimal places. 196.24 What is -85874.176 rounded to the nearest 100? -85900 Round 358965.785 to the nearest ten thousand. 360000 What is 0.006583931 rounded to six decimal places? 0.006584 Round -355308.4503 to the nearest 10. -355310 What is -35.0493405 rounded to two decimal places? -35.05 What is -9211964.92 rounded to the nearest 1000000? -9000000 Round 208166.656 to the nearest one hundred. 208200 What is -0.04038047512 rounded to two decimal places? -0.04 Round -0.000040066381 to seven dps. -0.0000401 What is 62.5316164 rounded to one decimal place? 62.5 Round 0.0571621641 to 3 decimal places. 0.057 What is 259853.7808 rounded to the nearest 100? 259900 Round -654839.1184 to the nearest ten. -654840 Round -10.678087879 to 2 decimal places. -10.68 What is -2.105976365 rounded to zero dps? -2 What is -0.000010623746 rounded to 6 decimal places? -0.000011 Round -2037107230 to the nearest one million. -2037000000 Round -635567.72 to the nearest ten thousand. -640000 What is 189.2181 rounded to the nearest 10? 190 What is -10261.173202 rounded to zero dps? -10261 Round 477317.862 to the nearest one hundred. 477300 What is 4.25995735 rounded to 4 decimal places? 4.26 What is -0.3932987946 rounded to 3 dps? -0.393 Round -5930147.648 to the nearest 10000. -5930000 Round -3334.49612 to the nearest integer. -3334 What is -34.3705381 rounded to 3 dps? -34.371 Round -19.59030057 to two dps. -19.59 What is -59.9094371 rounded to 2 decimal places? -59.91 What is -412.054468 rounded to one dp? -412.1 Round -0.00214571116 to six decimal places. -0.002146 Round -4176177.63 to the nearest 1000. -4176000 Round 6244036 to the nearest 1000000. 6000000 Round -0.00360319856 to seven decimal places. -0.0036032 What is -0.32867995 rounded to two dps? -0.33 Round 484905.11 to the nearest 100. 484900 What is -340.63605 rounded to the nearest 10? -340 Round 30416605.5 to the nearest 1000. 30417000 Round -0.4138632 to 3 decimal places. -0.414 What is -7.9151372 rounded to three decimal places? -7.915 What is -0.0000005195381479 rounded to 7 dps? -0.0000005 Round 1683.992584 to 1 decimal place. 1684 What is -17741.923 rounded to the nearest 100? -17700 What is -137405.8993 rounded to the nearest 10000? -140000 What is -0.5802146039 rounded to one dp? -0.6 Round 7971998500 to the nearest one million. 7972000000 Round -619771.5 to the nearest ten thousand. -620000 What is -0.974875683 rounded to 4 dps? -0.9749 Round 1.32464927 to one dp. 1.3 What is 35.408938 rounded to 1 dp? 35.4 Round 0.00000766878139 to seven dps. 0.0000077 What is -1.0203966816 rounded to two decimal places? -1.02 What is 1220.91585 rounded to the nearest 100? 1200 Round -3962813.5 to the nearest ten thousand. -3960000 Round 0.000067700648 to six decimal places. 0.000068 What is -4.7111675 rounded to 2 decimal places? -4.71 Round -0.03313403454 to six decimal places. -0.033134 Round 2455.871249 to the nearest 10. 2460 What is 1041490034.6 rounded to the nearest one hundred thousand? 1041500000 Round 39997.2619 to the nearest 10000. 40000 Round 1.215158455 to one decimal place. 1.2 What is 1887762.64 rounded to the nearest ten thousand? 1890000 What is -0.094213235 rounded to four dps? -0.0942 Round 0.000303161374 to six dps. 0.000303 Round -8589294130 to the nearest 1000000. -8589000000 What is 0.204336001 rounded to 1 decimal place? 0.2 What is 0.001071104259 rounded to six dps? 0.001071 Round 1995.07764 to 1 dp. 1995.1 Round 0.002807616 to 3 decimal places. 0.003 Round -259232970 to the nearest one hundred thousand. -259200000 Round 0.00017991014 to 6 dps. 0.00018 What is 3310.11593 rounded to 0 dps? 3310 What is -181219136.29 rounded to the nearest 10000? -181220000 Round -0.4765061 to 3 decimal places. -0.477 Round 11716.61461 to 0 decimal places. 11717 What is -147.20506 rounded to 2 decimal places? -147.21 Round -0.00326731333 to 4 dps. -0.0033 What is -1.33410067 rounded to 1 dp? -1.3 What is 423170.083 rounded to the nearest 10? 423170 What is -2887.111 rounded to zero decimal places? -2887 What is -985.07147 rounded to 1 dp? -985.1 Round -0.099979496 to 5 dps. -0.09998 Round -0.0006533016949 to six dps. -0.000653 Round 0.00000469352531 to 6 decimal places. 0.000005 What is -0.0003550343649 rounded to 6 dps? -0.000355 What is -0.00065905512 rounded to six decimal places? -0.000659 What is 0.0006159634026 rounded to 7 dps? 0.000616 Round 29656.1336 to zero decimal places. 29656 Round 1181173.55 to the nearest one hundred. 1181200 Round 9148416990 to the nearest 100000. 9148400000 Round 0.008113934 to 4 decimal places. 0.0081 What is 32881091.15 rounded to the nearest one hundred thousand? 32900000 What is -24.79089013 rounded to 2 dps? -24.79 Round 22613515 to the nearest one million. 23000000 What is -753618.419 rounded to the nearest 100? -753600 What is -1883.09343 rounded to the nearest 100? -1900 What is -0.0000028381833 rounded to 7 decimal places? -0.0000028 Round 0.04748666061 to five decimal places. 0.04749 What is 11033712.138 rounded to the nearest one hundred thousand? 11000000 Round -28212.88821 to the nearest one hundred. -28200 Round -2208.3884 to 1 dp. -2208.4 Round 313.21246 to 2 decimal places. 313.21 Round -0.0162855563 to three decimal places. -0.016 Round 4584.19587 to the nearest integer. 4584 Round 111611.731 to the nearest one thousand. 112000 Round 11.677431 to the nearest ten. 10 Round -34.4917644 to the nearest integer. -34 What is 0.0000097304337 rounded to five dps? 0.00001 Round 138.667912 to the nearest integer. 139 What is -0.0040090569 rounded to three decimal places? -0.004 What is -5776770640 rounded to the nearest 1000000? -5777000000 Round -0.0000066496283 to 6 dps. -0.000007 Round 8240764.3 to the nearest one million. 8000000 What is 28110689900 rounded to the nearest one million? 28111000000 Round 2255.58516 to one decimal place. 2255.6 What is -1.527402646 rounded to three dps? -1.527 Round -0.640138755 to five dps. -0.64014 Round -125.64779 to 1 decimal place. -125.6 What is -411877.2076 rounded to the nearest 100? -411900 Round 2.3638 to 0 dps. 2 Round 124178.824 to the nearest one hundred. 124200 What is -0.156729611 rounded to 3 dps? -0.157 What is 4348.0065 rounded to the nearest 10? 4350 What is -185869314.4 rounded to the nearest one million? -186000000 Round 44.325629 to one dp. 44.3 Round -6.048952 to two dps. -6.05 What is 40.300672 rounded to two dps? 40.3 What is -0.0016136308 rounded to 6 decimal places? -0.001614 What is -345780.6689 rounded to the nearest ten thousand? -350000 Round 10.4108049 to three decimal places. 10.411 Round -66417.6313 to the nearest 100. -66400 What is 871886.138 rounded to the nearest 1000? 872000 What is 0.1237217005 rounded to 5 decimal places? 0.12372 What is 28.6018396 rounded to 0 decimal places? 29 Round 0.000058968407 to 7 dps. 0.000059 What is -0.000092596423 rounded to 7 dps? -0.0000926 Round 37940.704 to the nearest 100000. 0 Round -26155887470 to the nearest 1	{ "pile_set_name": "DM Mathematics" }
14sqrt(11) Simplify 5sqrt(153)1-3 - ((sqrt(153) - (1 + sqrt(153))3)2 + -1). -620 - 81sqrt(17) Simplify (sqrt(33) + 4sqrt(528) + sqrt(33) + sqrt(33) + (-2sqrt(33)1 - sqrt(33)))/(sqrt(432) + 1((sqrt(432) - -2sqrt(432) - sqrt(432)) + sqrt(432))). sqrt(11)/3 Simplify (1 + (-1 + 1 + 4 + sqrt(72)-2)*2)3. -288sqrt(2) + 915 Simplify (6(2 + sqrt(153) + 1) - (-4(sqrt(153) + -1)-6)*2)1. -88686 + 3474sqrt(17) Simplify 4(3 + 0 + sqrt(700)) + 2. 14 + 40sqrt(7) Simplify ((sqrt(7) + sqrt(112)-2 + sqrt(112) - (sqrt(252)-2 + sqrt(7))) + -4)2. -64sqrt(7) + 464 Simplify (sqrt(792)-2 + (sqrt(88) - sqrt(88)1 - sqrt(22)))/((sqrt(396) - -2sqrt(396) - sqrt(396))-6). 13sqrt(2)/72 Simplify (-3-5(sqrt(1216) + -1) + 5 + (sqrt(1216) + -4 + (sqrt(1216) + 3 - sqrt(1216)) - sqrt(1216)))2. -2640sqrt(19) + 273721 Simplify (-5((5((sqrt(6) - (sqrt(96) + sqrt(6))) + sqrt(6)))/sqrt(2) - (-5 + sqrt(48))-1))2. 2750sqrt(3) + 9700 Simplify (-5sqrt(40)/sqrt(8)-5-6)26. 675000 Simplify (sqrt(288) - ((-1 + sqrt(288))4)2 - ((sqrt(288) - (sqrt(288) + -1))-3 + sqrt(288)))-61-4. -110904 + 9216sqrt(2) Simplify 4(-2 + (1sqrt(126) + sqrt(126))/((sqrt(24) + sqrt(96) - sqrt(24))/sqrt(12))). -8 + 12sqrt(7) Simplify (-3sqrt(108) - sqrt(24)/(sqrt(8)/sqrt(4)))/(sqrt(324) + sqrt(324) + (1sqrt(324)-2 - sqrt(324)) + sqrt(324) + sqrt(324)). -10sqrt(3)/9 Simplify -13sqrt(117) - (-1 + (2 + sqrt(1053))2 + sqrt(1053)). -1056 - 54sqrt(13) Simplify (((sqrt(85) + (-5sqrt(85)-1 - sqrt(85)) - sqrt(85) - sqrt(85))5)/(sqrt(180)/sqrt(4)-1))*2. 425 Simplify 6(((sqrt(4)-2)/sqrt(2) - (-4 + 0 + sqrt(2) + sqrt(2)))2 + ((sqrt(242) - sqrt(242)1) + sqrt(242))*2 + sqrt(4)/sqrt(2) + -5). -186sqrt(2) + 1710 Simplify (sqrt(567) + -3(sqrt(567) + (sqrt(567) - sqrt(567)1)))/(31sqrt(9)-4). sqrt(7)/2 Simplify 3 + (-3 + sqrt(24)/(sqrt(2) - sqrt(4)/sqrt(32)) + 3)2. 73/3 Simplify -3((sqrt(210)/sqrt(7))/sqrt(5))/(sqrt(2) - sqrt(36)/sqrt(2)). 3sqrt(3)/2 Simplify ((-1sqrt(210))/sqrt(7))/((sqrt(12) + sqrt(300))/sqrt(2)). -sqrt(5)/6 Simplify (sqrt(2)-23 - ((sqrt(2) - (sqrt(200) + -1 - sqrt(200))) + sqrt(2)) - ((1sqrt(198))/sqrt(9))/sqrt(11))-6. 6 + 54sqrt(2) Simplify (((-1 + sqrt(612) + 2)2 + (sqrt(612) - (-1 + 0 + sqrt(612))))-2 + 1)-2. 48sqrt(17) + 2454 Simplify (((5sqrt(187) - sqrt(187)) + sqrt(187) - sqrt(187) - sqrt(187))3 + sqrt(187))/(-4sqrt(11)-5 - sqrt(11)). 10sqrt(17)/19 Simplify (-2 + (sqrt(7) - (sqrt(175) + 4)) - (sqrt(448) - (sqrt(448) - sqrt(448)-3)-4))2. 1680sqrt(7) + 137236 Simplify (sqrt(77)24)/(2sqrt(7)1) + -2. -2 + 4sqrt(11) Simplify (sqrt(396)/(sqrt(36)/sqrt(3)) - (sqrt(33) + (sqrt(33) - sqrt(33)23)))/(-33sqrt(48)). -5sqrt(11)/36 Simplify ((sqrt(110) + (-3sqrt(110)-1 + sqrt(110) - sqrt(110)) + sqrt(110) + sqrt(110))-3)/((sqrt(1210)2 + sqrt(10))5). -18sqrt(11)/115 Simplify (sqrt(112) + (sqrt(112) + sqrt(112)2)-1)*2 - (-3sqrt(112)1)2. -560 Simplify -4 + sqrt(8)/sqrt(144) - ((2sqrt(128))*23 + 5). -1545 + sqrt(2)/6 Simplify -5(1(-1 + sqrt(192)) + (-4sqrt(192)2 - sqrt(192) - sqrt(192)) - 42(sqrt(192) - -2sqrt(192)))2. -1045445 - 2640sqrt(3) Simplify ((sqrt(80) + 1)5)2 - (4 + 2 + (sqrt(5)3)*2). 200sqrt(5) + 1974 Simplify (((sqrt(2) - (sqrt(8) + sqrt(8)-1)/sqrt(4)) + -1 + (sqrt(6)/sqrt(3)-3 - sqrt(32)-4))-2)*2 + -3. -112sqrt(2) + 1569 Simplify sqrt(152)/sqrt(128) + -4 - 2(sqrt(304) + -2sqrt(304) - sqrt(304)). -4 + 65sqrt(19)/4 Simplify ((sqrt(627) - (sqrt(627) - 3(sqrt(627) - 2sqrt(627))))/sqrt(11))/(sqrt(108) + sqrt(108) + -1(sqrt(108) - (sqrt(108) + -2sqrt(108))) + sqrt(108)). -sqrt(19)/2 Simplify (sqrt(756)/(sqrt(12) - -2sqrt(432)))/(sqrt(1764)1). sqrt(7)/182 Simplify ((sqrt(5) + 3 + sqrt(500) - sqrt(5))3 - (sqrt(320) + 1 + (sqrt(5) + -2)-5)) + -1. -3 + 27sqrt(5) Simplify sqrt(30)/((sqrt(30)3)/sqrt(5)) - (sqrt(125)-1 - ((sqrt(55)/sqrt(176) - sqrt(5)) + sqrt(5))). 67sqrt(5)/12 Simplify (sqrt(51) + 3sqrt(51)1)/(sqrt(24)/(sqrt(48)/sqrt(6))). 4sqrt(17) Simplify -6(3 + sqrt(162) + sqrt(18) - (sqrt(18) - sqrt(126)/sqrt(63))). -60sqrt(2) - 18 Simplify (-1(sqrt(286)/(sqrt(11)-1))/(sqrt(242)1))2. 13/121 Simplify (1sqrt(76)3)/(-5sqrt(64))-6. 9sqrt(19)/10 Simplify -5 + sqrt(17) + ((sqrt(34)/sqrt(2))*2 - sqrt(17)) + (sqrt(17) - (1sqrt(170) - sqrt(170))/sqrt(10)) - (sqrt(17) + -3 + -4 + -5). 24 Simplify (-1 + 3 + (-1sqrt(171) + sqrt(171) + 5 - sqrt(171)))2. -42sqrt(19) + 220 Simplify -5((sqrt(180)/(sqrt(12) - (sqrt(12) - sqrt(108))))/(4sqrt(3)-1))26. -25/24 Simplify 3 + (-3(sqrt(102) - (sqrt(102)2 + sqrt(102) - sqrt(102)) - sqrt(102))2)/(sqrt(12)/(sqrt(2) + 2sqrt(162) + sqrt(2) - sqrt(2))). 3 + 228sqrt(17) Simplify (((sqrt(5) - sqrt(20)) + sqrt(5))6 - (sqrt(5) + (sqrt(5) + -1 + sqrt(5) + sqrt(5))*2-3)) + -1((-1 + sqrt(80))2 - sqrt(80)) + -3. -7sqrt(5) + 54 Simplify 5-3(sqrt(75)2 - (sqrt(3) + 3)-3). -195sqrt(3) - 135 Simplify (sqrt(121) + (sqrt(121) + sqrt(121)2 + sqrt(121))6 - sqrt(121))/(sqrt(11) + -4(sqrt(22)/sqrt(2) - sqrt(11))) + 1. 1 + 24sqrt(11) Simplify (-3 + (sqrt(52) + 0 - sqrt(52)) + sqrt(52) + sqrt(52) + 2 + 2)22. 16sqrt(13) + 418 Simplify (-2((-1 + 1sqrt(2448) - sqrt(2448)) + 0 + 2))2. 4 Simplify 2 + ((sqrt(72) + sqrt(72)-1 - sqrt(2)) + (-1 + sqrt(4)/sqrt(2) - sqrt(2)) + -62sqrt(242))*2. 266sqrt(2) + 35381 Simplify ((6sqrt(98)3 - 2sqrt(36)/sqrt(2))-3)*2. 259200 Simplify ((sqrt(66) + (sqrt(66) - -1sqrt(66)-3))/((-4sqrt(60))/sqrt(10)))2. 11/16 Simplify (-5 + sqrt(20)/(sqrt(30)/(sqrt(9)/sqrt(3))))2 + (((-2sqrt(128))/sqrt(8))/sqrt(8))2 + 3. -10sqrt(2) + 38 Simplify -2 + 0 + sqrt(34)/(sqrt(2) - sqrt(216)/sqrt(12) - sqrt(2)) + 4. -sqrt(17)/3 + 2 Simplify 1 + ((sqrt(72)/sqrt(100) - sqrt(18))/((sqrt(72)3)/sqrt(8)))2-6. 11/75 Simplify ((3sqrt(66)-6)/(sqrt(600) - 2sqrt(600)))2. 891/25 Simplify (-4 + (-41sqrt(75)-4)*2)5. 95980 Simplify (-1(sqrt(216) + (sqrt(216) - -1sqrt(216) - sqrt(216)))/sqrt(9))/((sqrt(144)/sqrt(4)4)/sqrt(3)). -sqrt(2)/2 Simplify (((2sqrt(1700) - sqrt(1700)) + sqrt(1700) + sqrt(1700) - sqrt(1700)) + (sqrt(136) - (sqrt(136) - sqrt(136)-1))/sqrt(8) + (-3 + -2sqrt(17))1)2. -102sqrt(17) + 4922 Simplify (-4 + (sqrt(208) - (-2 + sqrt(208))) - (sqrt(208)22)*2) + -1(sqrt(208) - (sqrt(208) + -1))*2 + -2 + sqrt(208) + 0. -3333 + 4sqrt(13) Simplify 5 + (-46(-1 + (sqrt(245) - (sqrt(245) - sqrt(245)5 - sqrt(245))) + sqrt(245)))2. -56448sqrt(5) + 6915461 Simplify ((1 + 2sqrt(27) - sqrt(27)) + 0)2 + -4(sqrt(24)/(sqrt(8) + sqrt(72)) + (sqrt(3) - 2sqrt(3)) + 0)2. 6sqrt(3) + 85/4 Simplify 2-2(sqrt(153) - ((sqrt(153) - 2sqrt(153)) + 4))2-5. -960sqrt(17) + 12560 Simplify ((3 + -3 + sqrt(112)1)6)2. 4032 Simplify (sqrt(77) + sqrt(77)-22 - sqrt(77))/sqrt(7) + sqrt(44)/(sqrt(28)/sqrt(63)). -sqrt(11) Simplify ((sqrt(1980)3 - sqrt(1980))4 - sqrt(1980))/(sqrt(80)-43). -7sqrt(11)/8 Simplify (-2sqrt(65)-6)/(-1sqrt(5)-3)-5. -20sqrt(13) Simplify -1((sqrt(1216) + (sqrt(1216) - (sqrt(1216) + 0)))1 + sqrt(1216)) + -4(sqrt(1216) + (3-2sqrt(1216) - sqrt(1216))). 176sqrt(19) Simplify 13(sqrt(7) + (sqrt(56) + sqrt(56)1)/sqrt(8))2252. 3780 Simplify (((-2sqrt(8)/sqrt(4) - sqrt(600)/sqrt(12)) + 3)3)*2. -378sqrt(2) + 963 Simplify 5 + ((-4 + -1sqrt(175) - sqrt(175) - (3 + sqrt(175) + 0))-5)*2. 5250sqrt(7) + 40605 Simplify ((sqrt(209) - (sqrt(209) - sqrt(209)1))-1 + 6sqrt(209)1)/(-1sqrt(1100)-3). sqrt(19)/6 Simplify ((sqrt(342)/sqrt(6))/sqrt(3) - (sqrt(19) + (sqrt(19) - (sqrt(475)1)2))) + 2 + sqrt(1216) + sqrt(171) + 1. 10sqrt(19) + 478 Simplify -2((sqrt(119) + (sqrt(119) - (sqrt(119)-34 + sqrt(119) + sqrt(119) + sqrt(119)) - sqrt(119) - sqrt(119)))/(sqrt(49)/sqrt(252)))2. -99144 Simplify 6(((-2 + -1 + sqrt(2057) + sqrt(2057))*2 - sqrt(2057)) + sqrt(2057) + -5sqrt(2057) + 0). -1122sqrt(17) + 49422 Simplify ((1sqrt(33) + sqrt(33))-12)/(sqrt(1331)2 - (sqrt(704)1 + sqrt(704))). -2sqrt(3)/3 Simplify -5 + sqrt(13) + (-44sqrt(13))2 + -3 + sqrt(208). 5sqrt(13) + 3320 Simplify (sqrt(1300) + -1)-6 + -3 + -2sqrt(468). -72sqrt(13) + 3 Simplify 6(sqrt(19) - sqrt(76)/sqrt(4))*2 + -6sqrt(684) + 2*(	{ "pile_set_name": "DM Mathematics" }
2:52 AM and 4:33 AM? 101 What is 19 minutes before 5:57 AM? 5:38 AM What is 582 minutes before 5:48 AM? 8:06 PM What is 530 minutes before 11:51 AM? 3:01 AM What is 693 minutes after 11:30 AM? 11:03 PM What is 317 minutes after 3:07 PM? 8:24 PM What is 547 minutes after 4:08 AM? 1:15 PM What is 303 minutes after 1:14 PM? 6:17 PM How many minutes are there between 1:13 PM and 11:38 PM? 625 What is 496 minutes after 3:57 AM? 12:13 PM What is 547 minutes after 6:47 PM? 3:54 AM What is 617 minutes before 12:34 AM? 2:17 PM How many minutes are there between 2:21 PM and 3:20 PM? 59 How many minutes are there between 5:32 AM and 1:32 PM? 480 What is 588 minutes before 6:12 PM? 8:24 AM How many minutes are there between 12:24 PM and 10:58 PM? 634 What is 430 minutes before 3:14 PM? 8:04 AM What is 445 minutes before 3:30 AM? 8:05 PM What is 401 minutes after 3:10 AM? 9:51 AM How many minutes are there between 8:30 PM and 9:46 PM? 76 How many minutes are there between 3:21 AM and 4:23 AM? 62 What is 472 minutes after 9:33 PM? 5:25 AM How many minutes are there between 11:29 AM and 9:10 PM? 581 How many minutes are there between 5:01 AM and 3:11 PM? 610 What is 620 minutes before 3:07 AM? 4:47 PM What is 136 minutes after 11:50 PM? 2:06 AM What is 318 minutes after 4:13 AM? 9:31 AM What is 254 minutes after 4:57 PM? 9:11 PM What is 207 minutes after 11:36 AM? 3:03 PM What is 36 minutes after 11:04 PM? 11:40 PM How many minutes are there between 6:50 PM and 4:49 AM? 599 What is 96 minutes before 11:40 AM? 10:04 AM How many minutes are there between 5:07 AM and 4:37 PM? 690 What is 96 minutes after 6:40 AM? 8:16 AM How many minutes are there between 5:20 AM and 11:13 AM? 353 How many minutes are there between 11:19 PM and 9:10 AM? 591 How many minutes are there between 12:32 PM and 7:22 PM? 410 What is 304 minutes after 4:56 AM? 10:00 AM What is 573 minutes after 9:29 PM? 7:02 AM How many minutes are there between 2:21 PM and 4:03 PM? 102 How many minutes are there between 8:03 AM and 6:30 PM? 627 What is 690 minutes after 3:43 PM? 3:13 AM What is 504 minutes after 11:12 PM? 7:36 AM What is 605 minutes after 5:19 PM? 3:24 AM How many minutes are there between 1:56 AM and 11:09 AM? 553 What is 181 minutes before 2:39 AM? 11:38 PM What is 514 minutes after 11:17 AM? 7:51 PM How many minutes are there between 8:40 PM and 12:11 AM? 211 What is 652 minutes before 10:14 PM? 11:22 AM What is 481 minutes after 9:58 AM? 5:59 PM How many minutes are there between 5:41 PM and 11:35 PM? 354 What is 692 minutes before 3:33 AM? 4:01 PM How many minutes are there between 6:41 PM and 10:08 PM? 207 What is 149 minutes before 4:41 PM? 2:12 PM What is 420 minutes after 9:30 PM? 4:30 AM How many minutes are there between 2:13 PM and 12:23 AM? 610 How many minutes are there between 1:37 PM and 3:19 PM? 102 What is 581 minutes before 11:26 AM? 1:45 AM How many minutes are there between 9:53 AM and 10:44 AM? 51 What is 305 minutes before 11:23 AM? 6:18 AM How many minutes are there between 6:03 AM and 1:11 PM? 428 How many minutes are there between 11:59 PM and 6:15 AM? 376 What is 19 minutes after 10:58 PM? 11:17 PM What is 235 minutes after 4:30 PM? 8:25 PM How many minutes are there between 6:55 AM and 1:23 PM? 388 How many minutes are there between 4:01 PM and 5:10 PM? 69 How many minutes are there between 4:16 AM and 5:16 AM? 60 What is 386 minutes before 1:19 AM? 6:53 PM What is 705 minutes after 9:16 PM? 9:01 AM How many minutes are there between 5:04 PM and 7:49 PM? 165 What is 599 minutes before 10:59 PM? 1:00 PM How many minutes are there between 2:14 PM and 12:42 AM? 628 What is 520 minutes before 10:49 AM? 2:09 AM How many minutes are there between 1:41 AM and 12:01 PM? 620 What is 246 minutes after 2:56 PM? 7:02 PM How many minutes are there between 3:38 PM and 10:24 PM? 406 How many minutes are there between 12:31 AM and 5:52 AM? 321 What is 91 minutes after 4:27 PM? 5:58 PM What is 488 minutes after 9:38 PM? 5:46 AM How many minutes are there between 11:42 AM and 3:39 PM? 237 What is 217 minutes before 1:57 AM? 10:20 PM What is 160 minutes before 12:44 AM? 10:04 PM What is 376 minutes before 5:58 PM? 11:42 AM How many minutes are there between 6:04 PM and 5:48 AM? 704 What is 103 minutes before 5:50 PM? 4:07 PM What is 414 minutes after 11:17 PM? 6:11 AM How many minutes are there between 2:54 AM and 11:10 AM? 496 What is 627 minutes after 3:03 PM? 1:30 AM How many minutes are there between 4:00 AM and 4:44 AM? 44 What is 570 minutes before 6:23 PM? 8:53 AM What is 429 minutes before 3:28 PM? 8:19 AM How many minutes are there between 6:31 PM and 7:33 PM? 62 What is 424 minutes before 3:28 PM? 8:24 AM What is 360 minutes after 9:17 AM? 3:17 PM How many minutes are there between 5:04 AM and 1:20 PM? 496 How many minutes are there between 5:56 PM and 3:55 AM? 599 How many minutes are there between 10:04 PM and 6:26 AM? 502 What is 254 minutes after 2:33 PM? 6:47 PM How many minutes are there between 5:53 PM and 7:22 PM? 89 How many minutes are there between 9:08 PM and 5:24 AM? 496 How many minutes are there between 9:08 PM and 3:39 AM? 391 How many minutes are there between 9:31 AM and 10:22 AM? 51 How many minutes are there between 2:34 AM and 4:49 AM? 135 What is 647 minutes after 8:57 PM? 7:44 AM How many minutes are there between 5:14 PM and 2:32 AM? 558 How many minutes are there between 12:04 AM and 8:29 AM? 505 How many minutes are there between 3:26 AM and 8:47 AM? 321 What is 121 minutes before 12:50 AM? 10:49 PM What is 448 minutes before 8:14 PM? 12:46 PM What is 543 minutes after 1:26 PM? 10:29 PM What is 463 minutes after 4:23 AM? 12:06 PM What is 418 minutes before 3:21 AM? 8:23 PM What is 4 minutes after 6:08 AM? 6:12 AM What is 488 minutes after 7:07 PM? 3:15 AM How many minutes are there between 10:13 PM and 10:02 AM? 709 What is 249 minutes after 9:34 AM? 1:43 PM How many minutes are there between 3:18 PM and 6:09 PM? 171 How many minutes are there between 3:33 AM and 3:28 PM? 715 What is 11 minutes after 12:31 PM? 12:42 PM How many minutes are there between 2:25 PM and 11:20 PM? 535 What is 173 minutes before 6:11 PM? 3:18 PM How many minutes are there between 11:32 PM and 6:06 AM? 394 How many minutes are there between 9:15 PM and 7:42 AM? 627 What is 443 minutes after 4:46 PM? 12:09 AM What is 657 minutes before 1:58 PM? 3:01 AM What is 137 minutes after 8:45 AM? 11:02 AM How many minutes are there between 3:17 AM and 6:23 AM? 186 What is 552 minutes after 11:26 AM? 8:38 PM How many minutes are there between 1:01 AM and 10:53 AM? 592 How many minutes are there between 1:37 PM and 5:57 PM? 260 How many minutes are there between 9:28 AM and 12:34 PM? 186 What is 354 minutes after 8:09 AM? 2:03 PM How many minutes are there between 11:45 AM and 10:28 PM? 643 What is 2 minutes after 11:53 PM? 11:55 PM How many minutes are there between 7:38 PM and 2:18 AM? 400 What is 376 minutes before 8:54 PM? 2:38 PM How many minutes are there between 2:29 AM and 2:02 PM? 693 How many minutes are there between 5:51 PM and 4:27 AM? 636 What is 400 minutes after 4:32 AM? 11:12 AM How many minutes are there between 2:24 AM and 8:23 AM? 359 How many minutes are there between 5:53 AM and 2:18 PM? 505 What is 682 minutes before 3:32 AM? 4:10 PM What is 624 minutes after 3:04 PM? 1:28 AM What is 63 minutes before 10:18 AM? 9:15 AM What is 315 minutes after 1:11 AM? 6:26 AM How many minutes are there between 3:35 AM and 8:21 AM? 286 How many minutes are there between 7:59 PM and 9:56 PM? 117 How many minutes are there between 3:24 AM and 4:33 AM? 69 What is 535 minutes before 2:54 AM? 5:59 PM What is 681 minutes before 9:13 PM? 9:52 AM What is 35 minutes after 6:21 PM? 6:56 PM What is 670 minutes after 2:06 AM? 1:16 PM What is 672 minutes after 8:03 PM? 7:15 AM How many minutes are there between 3:11 AM and 5:32 AM? 141 What is 394 minutes before 4:58 AM? 10:24 PM What is 388 minutes after 4:19 PM? 10:47 PM How many minutes are there between 2:33 PM and 11:23 PM? 530 What is 492 minutes after 1:38 AM? 9:50 AM How many minutes are there between 9:37 AM and 10:40 AM? 63 How many minutes are there between 4:11 PM and 4:00 AM? 709 How many minutes are there between 2:	{ "pile_set_name": "DM Mathematics" }
- 8. Solve 2q = 3h, 0 = -cq + q - 2h - 13 for q. -3 Let l(m) = 31m - 1. Let g(y) = -30y + 1. Suppose 4h + 10 = -18. Let w(q) = hg(q) - 6l(q). Let a be w(1). Solve 3u - 4o = -7, 7 - a = -4o for u. 3 Let s(p) = 9p2 - 23p - 16. Let n(u) = 4u2 - 11u - 8. Let g(j) = -7n(j) + 3s(j). Let a be g(7). Solve -2y - 2v - v + 10 = 0, -a = -3y + 4v for y. 5 Let g = 29 - 29. Solve -4m + gy = y, 4m + 8 = -3y for m. 1 Let r(q) = -7q + 3q*2 + 2q*2 + 1 - 5 - 6q*2. Let p be r(-6). Solve -2t - 1 = b, b = t - 2 - p for b. -3 Let q(m) = -3m - 22. Let j be q(-9). Solve -22 = -2s - 4o - 0o, 3o - 20 = -js for s. 1 Suppose -2i + 34 = 6. Suppose 12 = -v + 4v. Suppose -2x = -vx + 3b + i, -3x + 14 = -b. Solve 5t - 2 = -2k - 19, -4k - 4 = xt for t. -5 Let a = 16 - 9. Suppose -4i + a = -1. Suppose iv + 2l - 23 = 37, v - 34 = l. Solve 3y - v = 4t - 0y, 4y = -3t + 1 for t. -5 Let q be 2 + 0(-1)/2. Let g = -14 + 16. Solve -s = qn - 6s + 12, gn - 4 = s for n. 4 Suppose 5d = -b - 33, b + 3b = d - 27. Let y = b + 17. Solve n - 3s - y = -3, -3s - 3 = -2n for n. -3 Let x = -2 - -4. Suppose -w + 3 = v, -2v + xw + 17 - 3 = 0. Solve -q + 10 = -3q - 3l, 0 = -q - vl - 19 for q. 1 Suppose 9 = -2d + 41. Solve -3u = -u - 4t - d, -30 = 5u + 4t for u. -2 Suppose -5v + 95 = -4m - 0, v - 2m = 25. Solve -4j = -3s + v, -3j + 4 + 11 = 3s for s. 5 Let h be 1/((9/(-3))/(-123)). Let a(f) = f3 - f2 + f. Let c be a(0). Suppose -2s = -cs - 48. Solve s = -4u - i, -u = 4u + 4i + h for u. -5 Let a(t) = -3t - t + 3t - 5. Let p be a(-9). Let x = 11 - p. Solve -n = -3f - x, 2n = -2f - 2f - 6 for f. -2 Let i be 2/(-11) - (-228)/44. Suppose -4s = 3m - 37, -23 = -4s + im + 22. Let g be 5/10(s - 0). Solve 0u + c = 4u - 1, c = gu for u. -1 Let q(n) = 5n*3 + 2n*2 - n. Let r be q(1). Let o = 7 - r. Solve 4f + 0y + y + o = 0, -3f = -y + 6 for f. -1 Suppose 2d - 16 = 4d + 4y, y + 18 = -4d. Let c be (-1)/(2/d + 0). Solve 2v - co - 11 = 1, -5v - 5o - 20 = 0 for v. 1 Let p be (-10)/3(-15)/(-10). Let v = p + 8. Suppose 0 = -2m - 4h - 2, 3h + 26 = -m + 3m. Solve 5n - vt - m = 15, 5t = 4n - 28 for n. 2 Let l(d) be the third derivative of d5/60 - d4/6 + d2. Suppose 0 = 2f + 5i, -2i - 21 = -3f + i. Let x be l(f). Solve -2q = xh - 3h, q = 0 for h. 0 Let l be (-3)/9 - (-173)/(-3). Let x be l/(-6) - (-6)/(-9). Solve 3f - x = 2w, 3f + 4w - 8 = 1 for f. 3 Let r(d) be the second derivative of 7d3/6 - d2/2 + 2d. Let s be r(3). Solve 0 = -2n - y + 4, n - s = 4y for n. 4 Let q(l) = l*2 + 2l. Let s be q(-3). Solve 5o = -3v - 37, sv - 4v + 11 = -3o for o. -5 Let z(r) = r2 + 4r. Let a be z(-3). Let i be -28(a + 10/4). Solve 2w + 0s + 2s = -2, -2w - i = -s for w. -5 Suppose 5a + 5d - 85 = 0, -2a - 40 = -6a + 3d. Let y be (10 - a)(-8)/6. Solve 0 - y = v - 3p, v = -p for v. -1 Let l = -2 - -3. Let v = l - 0. Let m be 3((-40)/(-6))/v. Solve -3q + 13 = r - 0q, m = 4q for r. -2 Suppose -2u - 3u - 4f + 132 = 0, 0 = -3u + 5f + 57. Let t = u - 20. Solve 4q + 4 = -3o, tq = -3o - o - 8 for o. -4 Let o = 50 + -46. Solve -14 = -oj + 2r, -5j = -2r - 7 - 12 for j. 5 Let j = 4 - 4. Solve -4t + 12 = -0t - 4g, -2t + 5g + 15 = j for t. 0 Let m(j) = -2j + 35. Let c be m(15). Solve -5l - 8 = 5b + 7, 23 = 3b - cl for b. 1 Suppose 2m - 5m + 18 = 0. Let z(r) = r2 - 6r + 5. Let a be z(m). Solve 2g - 2 = -2u, -g - 13 = -ag - u for g. 4 Let v(n) = -3n + 10 + 2n + 0n. Let q be v(7). Solve -y + qu - 5 = -2y, -2y + u + 3 = 0 for y. 2 Let c = 241 + -239. Suppose u - 15 = 3u - 3p, 2u - 20 = -4p. Solve -f + uf - c = d, 0 = -2d - 3f - 8 for d. 2 Suppose 2v = c - 6c - 36, 0 = -4c - v - 27. Let t = c - -8. Solve -ty = -s - y + 8, 3s - 28 = 4y for s. 4 Let y be (3/(-2))/(1/6-1). Solve -2i + 33 = -4g + y, -4i - 12 = 4g for g. -5 Suppose -5p = -10p - v - 3, -2p - 2v = 6. Suppose -a + 4a - 12 = p. Suppose ay = 2 + 14. Solve q - y + 3 = 5m, -3q = -3m + 9 for q. -4 Suppose -3u = -u + 6. Let i be 0/(-2) + (-24)/u. Solve 0 = -2h - 2n - i, h - 3n = -0h + 4 for h. -2 Let m(x) = x3 + 14x*2 + 32x - 6. Let n be m(-11). Solve 40 = 5a - 2v - v, -na = 4v - 5 for a. 5 Let j be 1/((-6)/(-4) + -1). Suppose -c + 6x + 9 = 3x, 0 = jc - 3x - 12. Solve -cp - 4b + 28 = p, 0 = p + 2b - 10 for p. 4 Let u = -8 + 13. Let b = u - 3. Suppose -3g = -2h - 0h + 12, bh = g + 4. Solve -2d + 14 = -4a, h = 6a - 3a + 5d - 22 for a. -1 Suppose 3x - 2y + 43 = 0, x + 4x + 63 = -y. Let l = -10 - x. Solve 5d + ln - 5 = 0, d = -n - 0 + 3 for d. -2 Let o(t) = 2t*2 + 3t - 8. Let j be o(-4). Suppose jk - 15k + 18 = 0. Solve 0 = -2d - kx + 2x + 30, 3d = 3x for d. 5 Suppose 18 = f - 9. Solve 0 = 4m + 20, -4z + 0m - f = 3m for z. -3 Let v(o) = o2 + o - 7. Let r be v(3). Solve f - 21 = -5s, f + 0f + 19 = rs for f. 1 Suppose 0 = 2n - 6n. Suppose n = 2v - 0v - 8. Solve 4b + 4z - 12 = 0, -5b - 2z + vz - 20 = 0 for b. -2 Let m be 4/(6/3 - 3). Let b be (9/m)/((-18)/240). Suppose 3k + 4f = b, 7f - 9 = k + 2f. Solve d + k + 9 = -4z, -17 = 4z - d for z. -4 Let o(d) be the first derivative of -d3/3 + 4d*2 - 9d + 2. Let p be o(6). Suppose -2k = pk - 10. Solve 5g = -m - 4, 2m + k = g - 6 for m. -4 Let c(l) = l*2 + 5l - 6. Suppose 2v - 3a = -7, -3v + a = -6v - 27. Let d be c(v). Solve -5w - d - 2 = 5g, 5 = -5g for w. -3 Let g = 3 + 2. Solve -4q - 5b + b - 12 = 0, -gb - 8 = -2q for q. -1 Let c = 9 + -4. Let q = c - 3. Solve -7 = 3i - 2o, 4i = -qo - 5 - 23 for i. -5 Suppose -t + 4n + 20 + 9 = 0, -3n = 3t - 42. Let k = t + -15. Solve j = -x, j = kx - x - 8 for j. -4 Let f = 21 - 15. Solve 5y + 35 = 10, 4v - 2y + f = 0 for v. -4 Let h(u) = -2u3 - 2u*2 + u - 2. Let f be h(-2). Solve 2t - 5w - 10 = 0, 0 = -fw - 8 for t. 0 Suppose n + 2 = -13. Let u be ((-4)/(-10))/(n/(-975)). Solve 0 = d + 5y - u, 0 = -d + 7y - 3y - 19 for d. 1 Let v = -9 - -8. Let t = 4 + v. Solve -y + 6 = -2n, 0y - 5 = -2y - tn for y. 4 Suppose 5t + 153 = 4j + 4, -47 = -2j - 3t. Suppose j - 86 = -5o. Solve -p + o = -3u, -3u = -2u - 4p + 11 for u. -3 Suppose 4v = -0a + 3a + 22, -4a - 8 = 0. Suppose 3x - g = 6, 2x + 4g = g + v. Solve 0 = 3t + xl + 6 + 3, 0 = -5t + 2l - 15 for t. -3 Let p(g) = -g3 - 5g*2 - 2g - 7. Let c be p(-5). Solve 6j = -4u + j + 35, -cj = -5u + 16 for u. 5 Let o be (-30)/864/(-12). Suppose -k = 4k - o. Solve 0 = 3y - c + 10, kc - 6 = 4y - c for y. -4 Let u = -123 - -128. Solve -24 = uw - 3j, 3 = -3w + 3j - 5j for w. -3 Let o(d) = 2d2 - 9d - 3. Let a be o(7). Suppose -2p + a = 8. Solve -2l + j = 2j + p, -l + 4j = -3 for l. -5 Let a(v) = 2v2 - 3v. Let g be 1312/18. Let r be a(g). Solve -4t = j - 19, -2t - rj + 11 = -j for t. 4 Let w be (-5)/((-100)/16)5. Solve 3z - 7z - 29 = 3t, -wt - 32 = 4z for t. -3 Suppose 3q = -5p + 13 + 57, 0 = -3q - 15. Suppose k + 0k = 3z - p, -2z = 5k. Solve 0 = -5n + 5l - 15, 0 = -5l - 0 - z for n. -4 Suppose -9u + 36 = -0u. Solve -um = 3f - 6m + 11, -f = 2m + 9 for f. -5 Let z(x) be the first derivative of -3x*2/2 + 2. Let p be z(-1). Solve 5k - b - 2 = 2k, 3k - pb = 0 for k. 1 Let t(o) = 2o. Let y(w) = -3w. Let q(a) = -7t(a) - 3y(a). Let h be q(-5). Solve 5v - 5z + h = 0, -5v + 3z + 4 = 25 for v. -3 Let m = 2 - -4. Let d = m - 2. Solve -di = 2r - 16, -2r = -3i + 3 + 9 for r. 0 Suppose 2n - 4 = -0. Suppose nd + 35 = -3d. Let v be 4/(d/(-2) - 3). Solve -4p + 8 = -5h, -3h + 4p - v = -0 for h. 0 Let t(x) = -4x3 + 3x*3 + x + 0x*3 + 9 + 0x*3 - 7x*2. Let d be t(-7). Solve v - 4 = -2g, -dv = 2v + 5g - 7 for v. -2 Let m be 42/98 - (-36)/14. Solve -3v + t = mt - 11, 5t - 25 = -5v for v. 1 Let o be 0/(-5) + -3 + 3. Solve -10 = 2u - 2, -2y + 2u + 8 = o for y. 0 Let l(z) = -z*3 - 6z*2 - 8z - 4. Suppose -5n + 22 = -3n. Suppose 0 = -2m - n + 1. Let t be l(m). Solve -t = 3g - f, -4f + f = -5g - 25 for g. -2 Let c be (1-3)/60. Suppose t = 6 - 2. Solve -14 = -3w - 4r, t + c = 2r for w. 2 Let i be ((-6)/(-10))/(5/25). Solve 5u = -20, i*u - 12 =	{ "pile_set_name": "DM Mathematics" }
g*3v*2 - 87gv2 - v2 wrt v. -2271030g*3 Differentiate -39350d*2q + d*2 - 2d - 735 wrt q. -39350d2 Find the first derivative of -2l*2w*2 - 4l*2 - 50508lw3 + 4l + 27 wrt w. -4l2w - 151524lw*2 Find the third derivative of 9080cl3tu2 + 3cl2t - 8cltu - 9clu2 - 2tu2 + 6tu wrt l. 54480ctu*2 What is the second derivative of 1207c*2y*3 - 21c*2y + 4507cy*3 + 27c wrt c? 2414y3 - 42y What is the third derivative of -4fgq3u - 2fgq2u*3 + 9fgqu3 - gq*2u*2 + 7gu2 - 454q*3u*3 + 14q*2u3 + q2 wrt q? -24fgu - 2724u*3 What is the second derivative of -87600dj3 - 440dj - 12d - 5 wrt j? -525600dj What is the first derivative of 985999o + 895960 wrt o? 985999 What is the derivative of 1265xy - 150168x + 3y wrt y? 1265x + 3 Find the second derivative of iu5 - 3iu - 107i + 230389u5 - u + 22 wrt u. 20iu3 + 4607780u*3 What is the second derivative of -58h*3l - 535h2l*3 + 6hl3 - 39h - 33l2 - 2l wrt h? -348hl - 1070l3 Find the third derivative of -4fp5 + 83fp3 + 45467fp2 - 9p*3 wrt p. -240fp2 + 498f - 54 Differentiate 5bn*2o*3 + 2832bno*3 + 387736n*2o*2 + 3o*3 wrt b. 5n*2o*3 + 2832no3 What is the second derivative of 38090s*2 - 39398s wrt s? 76180 What is the third derivative of 32h6 - 199h*4 - 5h*2 - 1077 wrt h? 3840h*3 - 4776h What is the third derivative of 37457d2x*3 - 2d*2x*2 + 66d*2 + 22x wrt x? 224742d2 What is the derivative of 45409z*3 + 83879? 136227z*2 Find the second derivative of 9093r*3x2 + r2x2 + 8r*2 + 2rx2 + rx - 2r + 185x*2 wrt r. 54558rx2 + 2x*2 + 16 What is the second derivative of 17z*5 + 8z*4 - 8z*3 + 87920z - 2? 340z3 + 96z*2 - 48z What is the second derivative of 1321254f5 + 2f - 497174? 26425080f3 Find the second derivative of -281697c*2 - 1182677c wrt c. -563394 What is the first derivative of 136165q4 - 87213 wrt q? 544660q*3 Find the third derivative of -20187q5 + q2 + 426599q. -1211220q*2 What is the first derivative of -111498m*3 + 1080? -334494m*2 What is the derivative of ahl2 - 83285ah + 2155hl2 + 2l*2 + 10l wrt a? hl2 - 83285h Find the second derivative of -54alt2 - 632alt + 5lt + 446t2 + 2t wrt t. -108al + 892 Find the third derivative of -w*5 + 17w*4 + 52w*3 - 27w*2 - 3616w + 1 wrt w. -60w2 + 408w + 312 Find the second derivative of -6r2w*2 - 2r*2w - 320r2 - 3533r - 5w2 wrt r. -12w*2 - 4w - 640 Find the first derivative of 2v4 + 13v*2 - 23v + 43162. 8v3 + 26v - 23 What is the second derivative of -2b2y*3 - 5141b*2y*2 + 7b*2 + by*3 - 2b + 1716y3 - 3y - 1 wrt b? -4y3 - 10282y*2 + 14 What is the second derivative of 37464d*3 - 2d*2 - 1956d - 29? 224784d - 4 Find the second derivative of 3u*4z + u*3z - 2u2z - 57u2 + 112uz + 41u wrt u. 36u2z + 6uz - 4z - 114 What is the second derivative of 98422x*5 + 759x - 22 wrt x? 1968440x3 Differentiate -211a*3 - 16a + 6689 with respect to a. -633a2 - 16 What is the third derivative of -7g*5 + 300g*4 - 47g*2 - g - 227 wrt g? -420g*2 + 7200g Differentiate gjn*2o - gjn - 1858gjo - 2gn2 + gn + go - 20g + 32j + 216n*2o + 3o wrt j. gn*2o - gn - 1858go + 32 Find the third derivative of -105390k*3l*6 + 1799k*3l - 3k3 + 2l*2 wrt l. -12646800k*3l*3 Find the first derivative of 3fm2 + 25fm + 40f - 32m2 - m + 126 wrt f. 3m*2 + 25m + 40 Differentiate h*3o*3 - 3252h*3 - 954o*3 - 2 wrt o. 3h*3o*2 - 2862o*2 Find the second derivative of -1034421f*2 - 62652f. -2068842 Differentiate 1223099l2 - 1215772. 2446198l What is the derivative of 2x4 - 604198x*3 + 2x - 1232858? 8x3 - 1812594x*2 + 2 Find the second derivative of 2832c*2r*2 + 2c*2r + 2c2 + 61cr2 + 72cr + 14c + r wrt c. 5664r2 + 4r + 4 Find the third derivative of 43v6 + 20v*5 + 83v*3 + 22v*2 - 3v - 144 wrt v. 5160v3 + 1200v*2 + 498 What is the first derivative of -2317b*4g + 2b4 - 28813g + 1 wrt b? -9268b3g + 8b3 Find the third derivative of -939o*4x + 2o4 + 262o*3x + o3 - o2x - 711440ox wrt o. -22536ox + 48o + 1572x + 6 Find the third derivative of -223201g*3 - 25g*2 + 1503. -1339206 Differentiate 123102f*3 + 213279. 369306f*2 Differentiate -1769kn - 18k + 8323n with respect to k. -1769n - 18 What is the first derivative of 3i2t - 8165i2 - 3311t wrt t? 3i2 - 3311 What is the second derivative of 2092315g*2u*3 + 74853g + 5u3 wrt g? 4184630u*3 Find the second derivative of -1166795w*2 - 6w - 74840 wrt w. -2333590 What is the first derivative of 1579o4t - 14o3t + 2o - 60t - 2316 wrt o? 6316o3t - 42o2t + 2 What is the third derivative of 20u4 - 35254u*3 - 913642u*2 wrt u? 480u - 211524 Find the second derivative of 207f3 - 4f*2 + 399f - 37 wrt f. 1242f - 8 What is the third derivative of 482j*4z*2 + 3j*3z*2 + 25j*2z*2 + 521j*2 wrt j? 11568jz2 + 18z*2 Find the third derivative of 151545n*5 + 5n*2 + 5946 wrt n. 9092700n*2 What is the third derivative of 18923i*2q*2u*3 + 625i*2q*2 + 23i*2u*2 - 2i*2u + 3iq*3 + 7i + 11q3u*3 wrt u? 113538i*2q*2 + 66q*3 Find the second derivative of -704f*2m*2 + 3f*2 - 14fm2 - 125fm + m2 wrt f. -1408m*2 + 6 What is the third derivative of 2g*4 - 11167g*3 - 219608g*2 wrt g? 48g - 67002 Find the first derivative of 40135d2s*3 + 28d*2 - 21d wrt s. 120405d2s*2 Find the second derivative of 404827a*3 - 202861a wrt a. 2428962a What is the derivative of 198651p*3 - 777878 wrt p? 595953p*2 Find the second derivative of 4277424t*2 + 208534t - 1 wrt t. 8554848 What is the second derivative of 185wx*3 + wx*2 - wx + 38w + 41x*3 - 2x*2 - 207x wrt x? 1110wx + 2w + 246x - 4 Find the second derivative of f*3l*3 - 1210f*3l - 25f2l*3 + fl*3 - 1626fl + 16f wrt f. 6fl*3 - 7260fl - 50l*3 What is the third derivative of -225b*4i + b*4x*2 + 15b*3i + 5b2ix + 2721bix*2 wrt b? -5400bi + 24bx2 + 90i What is the third derivative of 375283p3 + 388361p*2? 2251698 Find the first derivative of 343237h + 775689. 343237 Find the first derivative of 11p3 + 18p*2 - 20p - 50212 wrt p. 33p2 + 36p - 20 Find the second derivative of 86579l2 + 64327l wrt l. 173158 What is the second derivative of 46607r5 - 857r + 1 wrt r? 932140r3 Find the second derivative of 21b*2v*2 - 752b*2v - 4b2 + 1199476bv2 wrt b. 42v*2 - 1504v - 8 Find the first derivative of 121l2 - 239l - 324033. 242l - 239 What is the third derivative of -32804s*4 + 478511s*2 wrt s? -787296s What is the first derivative of 164914w2 + 2w - 210590? 329828w + 2 Find the third derivative of 72dy4 - 2dy3 - 2dy2 + 85776d + 2y4 + 12y*3 wrt y. 1728dy - 12d + 48y + 72 What is the derivative of 227417c*2 + 1170982 wrt c? 454834c What is the first derivative of -70731b + 42397? -70731 Find the third derivative of 274cz3 + 2cz2 + 845c - 11z4 - 8z*3 + 47z*2 wrt z. 1644c - 264z - 48 Find the third derivative of 231l*4 - 294l*3 - 5l*2 - 6l + 1752 wrt l. 5544l - 1764 What is the second derivative of -259996g*2 - 683920g? -519992 What is the second derivative of -55394c2d*2m*2 - 9c*2d*2m + 2c2d + 3c2m*2 - 59704cdm*2 wrt d? -110788c*2m*2 - 18c*2m Find the second derivative of 2f5 - 2875f*2 + 47240f. 40f3 - 5750 What is the second derivative of 100798f*2q*2 + 11fq2 + f + 4 wrt f? 201596q*2 Find the second derivative of -3046hn5 - hn*3 - 6hn2 - 2hn - 28h - 10n - 7 wrt n. -60920hn3 - 6hn - 12h What is the third derivative of 10n4o + 2n4 + 197n*3o + 5n3 - 34109n*2o wrt n? 240no + 48n + 1182o + 30 Find the second derivative of -22r5 - 1421r*3z*2 - 2rz2 - 262rz + r - 20z**2 wrt r.	{ "pile_set_name": "DM Mathematics" }
rom {u: 14, k: 2, d: 1, a: 2}. Give prob of sequence kd. 1/171 What is prob of sequence kdp when three letters picked without replacement from {a: 1, k: 1, d: 2, p: 1, t: 1, z: 1}? 1/105 Three letters picked without replacement from {k: 1, m: 1, j: 1, h: 5, i: 2, u: 3}. Give prob of sequence hmk. 5/1716 What is prob of sequence aaa when three letters picked without replacement from {a: 17, u: 1}? 5/6 Calculate prob of sequence ereg when four letters picked without replacement from {e: 5, x: 6, g: 6, r: 1}. 1/612 Three letters picked without replacement from {a: 8, k: 2}. What is prob of sequence aak? 7/45 Calculate prob of sequence zg when two letters picked without replacement from gdzgzddd. 1/14 Three letters picked without replacement from wwmqwwqswessmw. What is prob of sequence wqe? 1/182 Two letters picked without replacement from {f: 4, s: 14}. Give prob of sequence sf. 28/153 What is prob of sequence gvh when three letters picked without replacement from gugvhu? 1/60 Four letters picked without replacement from {j: 3, k: 4, a: 2}. Give prob of sequence kkja. 1/42 What is prob of sequence kl when two letters picked without replacement from {e: 1, c: 3, l: 3, r: 2, p: 6, k: 4}? 2/57 Calculate prob of sequence xh when two letters picked without replacement from {o: 1, x: 1, h: 2}. 1/6 What is prob of sequence yclg when four letters picked without replacement from vvcvvlgycy? 1/1260 What is prob of sequence gpgp when four letters picked without replacement from {g: 6, p: 7}? 21/286 Four letters picked without replacement from {s: 4, t: 2, m: 5}. Give prob of sequence stmm. 2/99 What is prob of sequence nzdn when four letters picked without replacement from nnpplnnpnlzpzd? 5/3003 Four letters picked without replacement from {f: 3, p: 3, d: 1, r: 3, g: 1, a: 2}. Give prob of sequence gfrp. 9/5720 Three letters picked without replacement from {m: 2, d: 4, s: 1, z: 2}. Give prob of sequence zdm. 2/63 Two letters picked without replacement from {p: 2, q: 4, s: 2, a: 3, n: 6}. Give prob of sequence qs. 1/34 Four letters picked without replacement from mmememmemememm. Give prob of sequence mmme. 15/143 What is prob of sequence lb when two letters picked without replacement from bbblbbbbbbl? 9/55 Two letters picked without replacement from {f: 2, g: 8, h: 4}. Give prob of sequence gg. 4/13 Calculate prob of sequence zf when two letters picked without replacement from ffffzfffffffffffffzf. 9/95 Three letters picked without replacement from mmmummmxmxammmmmxmau. What is prob of sequence uua? 1/1710 Three letters picked without replacement from fyvnyyyyfqyvfvnyyyy. What is prob of sequence fvy? 5/323 What is prob of sequence qsn when three letters picked without replacement from nggssfsssggqsqffs? 7/2040 Two letters picked without replacement from {k: 1, g: 5, m: 4, p: 1, n: 3}. What is prob of sequence km? 2/91 Calculate prob of sequence xgqd when four letters picked without replacement from {j: 7, g: 6, a: 1, x: 2, q: 2, d: 1}. 1/3876 Calculate prob of sequence ddee when four letters picked without replacement from {e: 5, d: 15}. 35/969 Three letters picked without replacement from ooixiuct. Give prob of sequence ooc. 1/168 Calculate prob of sequence fu when two letters picked without replacement from fnuwz. 1/20 What is prob of sequence kqql when four letters picked without replacement from vqqqkvqqqqlqq? 3/715 Three letters picked without replacement from ufkfkkkkfkkfkkbku. Give prob of sequence kbu. 1/204 Two letters picked without replacement from {s: 2, k: 1, n: 1}. What is prob of sequence sk? 1/6 What is prob of sequence ov when two letters picked without replacement from tfvotfoffyffooyfey? 2/153 Two letters picked without replacement from vavvvvvvvvtvavva. Give prob of sequence vt. 1/20 Two letters picked without replacement from qqq. What is prob of sequence qq? 1 What is prob of sequence zgg when three letters picked without replacement from zgnnmg? 1/60 Calculate prob of sequence korr when four letters picked without replacement from koyokorooroo. 7/2970 Calculate prob of sequence llll when four letters picked without replacement from zlzzllzzzzlzl. 1/143 Calculate prob of sequence gcgq when four letters picked without replacement from gcnqgcnggc. 1/140 Calculate prob of sequence aa when two letters picked without replacement from {a: 5, n: 5, x: 1, d: 6}. 5/68 Calculate prob of sequence cqcc when four letters picked without replacement from qzccfzccccnwz. 1/143 Calculate prob of sequence bl when two letters picked without replacement from {v: 3, b: 4, s: 10, l: 1, p: 1}. 2/171 Four letters picked without replacement from hhhgghg. What is prob of sequence hhhg? 3/35 Four letters picked without replacement from {i: 3, j: 7}. Give prob of sequence ijjj. 1/8 Four letters picked without replacement from {e: 1, v: 2, t: 1, n: 4, j: 3, m: 1}. What is prob of sequence temn? 1/2970 Calculate prob of sequence utt when three letters picked without replacement from {o: 2, g: 2, l: 1, n: 3, t: 2, u: 4}. 1/273 Three letters picked without replacement from rrrrrrr. Give prob of sequence rrr. 1 What is prob of sequence qw when two letters picked without replacement from {w: 7, o: 1, u: 1, s: 2, q: 1, d: 5}? 7/272 Two letters picked without replacement from {y: 12, i: 1, r: 3, t: 4}. What is prob of sequence ty? 12/95 What is prob of sequence mmee when four letters picked without replacement from {m: 9, e: 9}? 6/85 What is prob of sequence yp when two letters picked without replacement from ypvve? 1/20 Calculate prob of sequence aaq when three letters picked without replacement from {a: 3, q: 3, s: 10, l: 2}. 1/272 What is prob of sequence mz when two letters picked without replacement from ttbbmtttzzzmbtzmttm? 8/171 Calculate prob of sequence lp when two letters picked without replacement from {p: 2, e: 1, l: 4, m: 6}. 2/39 Three letters picked without replacement from cqpqecppctccqqcp. Give prob of sequence eqp. 1/210 Two letters picked without replacement from pqps. Give prob of sequence qs. 1/12 Four letters picked without replacement from llblllllllbllblblb. Give prob of sequence blbl. 13/306 Calculate prob of sequence wy when two letters picked without replacement from {w: 1, y: 12, f: 3}. 1/20 What is prob of sequence pkp when three letters picked without replacement from kpprpdppp? 5/84 What is prob of sequence rrkc when four letters picked without replacement from {k: 1, s: 4, c: 5, f: 1, r: 4}? 1/546 Calculate prob of sequence ca when two letters picked without replacement from {f: 1, a: 2, h: 7, c: 4}. 4/91 Two letters picked without replacement from catttttatttttt. What is prob of sequence tt? 55/91 Two letters picked without replacement from {o: 9, j: 10}. What is prob of sequence jo? 5/19 What is prob of sequence bl when two letters picked without replacement from blvbvmgvbvvvlmgllv? 2/51 What is prob of sequence dx when two letters picked without replacement from {d: 2, s: 1, x: 2, e: 1}? 2/15 Four letters picked without replacement from yyyyyyyyyyyiyyyyyyi. Give prob of sequence yiyi. 1/171 What is prob of sequence mcm when three letters picked without replacement from omscgmf? 1/105 Four letters picked without replacement from duhdhdddhhuvhuhhhhuh. What is prob of sequence uuhh? 3/323 Calculate prob of sequence ccka when four letters picked without replacement from {c: 3, k: 3, a: 4, m: 3}. 3/715 What is prob of sequence ii when two letters picked without replacement from fiifiii? 10/21 What is prob of sequence xixk when four letters picked without replacement from aikaaiiaxyikawakxa? 1/3060 What is prob of sequence gbg when three letters picked without replacement from {g: 7, b: 1, v: 1}? 1/12 Two letters picked without replacement from gmfvq. Give prob of sequence qf. 1/20 Three letters picked without replacement from {e: 2, c: 7}. Give prob of sequence cee. 1/36 Calculate prob of sequence nxd when three letters picked without replacement from nnaodadaxdadao. 1/273 Two letters picked without replacement from gmssmmsngs. Give prob of sequence mn. 1/30 Two letters picked without replacement from {z: 11, v: 3, n: 1}. What is prob of sequence zv? 11/70 Four letters picked without replacement from {e: 5, j: 3, p: 1}. What is prob of	{ "pile_set_name": "DM Mathematics" }
+ 5j + 69. What is the least common multiple of 20 and (-6)/2 + 0 + d? 40 Let a = 19133/7932 - -3/661. Find the common denominator of a and -25/16. 48 Let b = -8 - -23. Calculate the common denominator of 10/b + (-466)/(-12) and 40/9. 18 Let i = -12/13 + -211/208. Calculate the common denominator of (1/(-3))/(40/642) and i. 80 Let v(k) = k + 6. Let r be v(-5). Let a be (-2 + -1 + 15)/r. What is the common denominator of (-16)/a(-30)/1 and 25/3? 3 Suppose -3v - v = -16, 4v = -4c + 536. Find the common denominator of -73/20 and c/88/12. 60 Let a = -13 - -19. Suppose -2m + a - 2 = 0. What is the lowest common multiple of 18 and m? 18 Let f = -32 - -46. Calculate the smallest common multiple of f and 2. 14 Let o(k) = 8k*2. Let x = -72 + 172. Suppose -x = -8l + 3l. What is the smallest common multiple of l and o(-1)? 40 Let h(j) = -2j*3 + 3j + 3. Find the common denominator of h(-3) and 16/9. 9 Let k = 3659/6 + -602. Find the common denominator of k and -68/15. 30 Let y be (6/9 - 2)-3642. Let j be (15/(-10))/(6/y). Let s = j - -3610/3. What is the common denominator of s and -58/3? 3 Let t = -287965 - -1766675/6. Let l = -6504 + t. Calculate the common denominator of (39/20)/(1/(-3)) and l. 60 Suppose 3a - 4 = -5l, 3l = a + 1 + 7. Suppose -k = 4z - 2378, 6k - lk = -4z + 2372. Let y = 5931/10 - z. What is the common denominator of y and 61/2? 10 Let o be (-15)/(-2)(-12)/5. Let g be (-4)/o + (-68)/(-18). Let z(v) = -v3 + 6v*2 - 5v - 2. What is the smallest common multiple of 10 and z(g)? 10 Let u = 54565/30096 - 1/1881. Let z be (-18)/(-24) - 93/(-4). Find the common denominator of u and (3/(-15))/(z/(-1515)). 16 Let u(a) = -11a2 + 40a + 1. What is the least common multiple of 20 and u(3)? 220 What is the common denominator of 67/27 and (-329)/(-60) + 3/(-48)4? 270 Let a = 14 + -20. Let p(t) = t3 + 7t*2 + 2t - 6. What is the least common multiple of p(a) and 16? 144 Let k = 42353 + -213132/5. Let z = 275 + k. Find the common denominator of (-4 + 16)/((-55)/(-20)) and z. 55 Let z(q) = 3q2 + 3q. Let f = 3 - 5. Let d(y) = 3y - 6. Calculate the lowest common multiple of z(f) and d(6). 12 Let f(z) = 4 - 2z2 + z + z3 - 5z2 - z2. Calculate the lowest common multiple of f(8) and 16. 48 What is the common denominator of 213/(-10)1/(-3) and 35/13? 130 Let t be (-28)/24 - (-1)/6. Calculate the lowest common multiple of 7 and 6/15(t + 11). 28 Let q = 18 + -17. Calculate the common denominator of 13/8 and q - (-100)/8 - 3. 8 Let l = 144697/18 - 8041. Let w = 30615883/777 - 118204/3. Let k = w - -43/74. What is the common denominator of l and k? 126 Let r = 81 + -259. What is the common denominator of 47/3 and 3 + (r/16 - 3)? 24 What is the common denominator of 16/(-56) - (-418)/140 and 81/8? 40 What is the common denominator of -2(-1)/(-4) - 380/(-16) and -25/14? 28 Suppose 0u + p - 111 = -3u, 2p = 0. Let k = u - 57/2. Let w = 12 + k. Find the common denominator of w and 41/4. 4 Calculate the least common multiple of 28 and (5 + -4 - -19)1. 140 Let m be (-2)/41(-48)/(-8). Let s = -1459/82 - m. Find the common denominator of s and -41/4. 4 Let c = 15389 + -6862. Let z = 170497/20 - c. Let k = -20633/1905 - 3/1270. Find the common denominator of k and z. 60 Let h be 46/14 - (-16)/(-56). What is the smallest common multiple of (16/h)/((-5)/(-15)) and 36? 144 Let f = 17299/8 + -2155. Find the common denominator of f and -11/2. 8 Suppose -2a = -6q + q + 21, -5q + 9 = 2a. Suppose 0 = -x - 2s - 0s + 4, -9 = -x + qs. What is the smallest common multiple of 6 and x? 6 Suppose -2j + 7 = 5j. What is the lowest common multiple of 20 and j? 20 Find the common denominator of -93/16 and (-1)/(-3)86/(-28). 336 Let k(j) be the first derivative of 0j*2 + 2j*2 + 2j + 2j3 - 4j + 1 - 3j2. What is the lowest common multiple of 16 and k(2)? 144 What is the common denominator of 31/(-20) + 0 + 3 and 27/20 - (-3)/(-6)? 20 Suppose n + 2h = -2h + 46, -3n + 112 = -h. What is the lowest common multiple of n and 2? 38 Let t = 12082/9 + -8075/6. What is the common denominator of -127/6 and t? 18 Let t be 12/4(-3)/3. Let i = t + 23. What is the least common multiple of 18 and i? 180 Suppose -6 = -2n - 2o, -4o = 8n - 3n - 13. Let v(y) be the first derivative of -9y2/2 - y + 1. What is the lowest common multiple of v(-1) and n? 8 Let f = 356/3 - 134. Find the common denominator of f and 3 - ((-43)/(-2) + -2). 6 Calculate the common denominator of 1/(1 - 302/266) and -56 + 56 + 58/48 + -1. 72 Let o = 0 - -2. Suppose 2z = -3m + 54, -m - m - oz = -36. Let q = 33 - 13. What is the least common multiple of q and m? 180 Let m(a) = 2a - 9. Let h be m(6). Suppose 4d - 4 = -u - hu, -4d + 6 = 2u. Find the common denominator of -5/14 and 2/d + 20/72. 126 Suppose 3p - 7 - 56 = 0. Calculate the common denominator of 9/7 and p. 7 Suppose m - 266 = -0m. Let i = m + -1057/4. What is the common denominator of 117/10 and i? 20 Let m = 12 - 6. Suppose 0y + m = 3y. Calculate the lowest common multiple of 15 + 3 + -2 + -2 and y. 14 Let s = -497 + 10435/21. Find the common denominator of s and 151/18. 126 Let l(a) = -a3 + 21a*2 - 21a + 50. Calculate the least common multiple of l(20) and 8. 120 Suppose -21 = 2u - 7u + 3f, -2f - 18 = -4u. Calculate the least common multiple of 1 and u. 6 Calculate the lowest common multiple of 16 and (21/9-3)/(0 + -1). 112 Let d be (20/(-5))/((-1)/(-8)). Calculate the common denominator of -2((-62)/d + -3) and -17/22. 88 Let c = 3 + -6. Let z = c + 11. Calculate the least common multiple of 16 and z. 16 Suppose -5t + 4 = -3t. Suppose 2r - 23 = 5b - t, -4r - 3b - 23 = 0. Let u = 0 - r. What is the smallest common multiple of 9 and u? 18 Let h(s) = -s2 - 2s + 6. Let c = -51 + 71. Find the common denominator of (37/c)/((-5)/(-20)) and h(-6). 5 Let s(g) = -2g - 13. Let f(j) = 2j + 7. Let c(h) = 3h + 6. Let z(l) = -3c(l) + 4f(l). Calculate the smallest common multiple of s(-11) and z(0). 90 Let g be (-51(-6)/9)/2. Let z = g + 5. What is the lowest common multiple of z and 4? 44 Let o = -719 + 8391. Let d = 76833/10 - o. Let i = -1304/3 - -430. Find the common denominator of d and i. 30 Find the common denominator of 47/3 and 201/10(-5)/(-6). 12 Let m(u) = u3 - u2 + u + 3. Let x be m(0). Suppose -xq + 0 = -3. What is the lowest common multiple of (-9)/(-18) - 42/(-4) and q? 11 Let w(v) = -17v2 - 7v + 2. Let s be 3 + -1 - 14/(-2). Let k be w(s). Let c = k + 2957/2. Calculate the common denominator of 77/16 and c. 16 Let j = 20 + -16. Suppose -x + jx - 18 = 0. Calculate the least common multiple of 1 and x. 6 Let x be (-4)/(-2)(5 - 23). Find the common denominator of 362/120 + 24/x and (-22)/12 + (-2)/9. 180 Suppose 0 = 2l + 4. What is the common denominator of (-1000)/(-385)-2 - 6/(-21) and (-178)/(-12) - l/(-6)? 22 Let v = 4289/5 - 851. Find the common denominator of 31/2 and v. 10 Suppose 3d - 119 = 97. Calculate the smallest common multiple of 1 and d/7 - (-8)/(-28). 10 Suppose 0z = 5z + 80. Let r(w) = w3 + 15w*2 - 16w + 8. Calculate the lowest common multiple of 14 and r(z). 56 Suppose 6l - 7l = 60. Find the common denominator of -25/4 and l/(-66)(-16)/5. 44 Let u be 72/90 - 49399/7400. Let w = u - -1/1850. Calculate the common denominator of w and -23/10. 40 Let o be 5/(-15) + 174/9. Let k = -16 + o. Calculate the least common multiple of k and 8. 24 Find the common denominator of 25/34 and (-35)/(-10)(90/33)/2. 374 Let k = -1628/13 - -51329/416. Calculate the common denominator of 47/22 and k. 352 Calculate the lowest common multiple of (-7)/(-14)24 + (-6)/(-2) and 6. 30 Find the common denominator of ((-5)/20)/(18/(-88)) and 10/(-4)69/(-5). 18 Suppose c + 2 = 3c. What is the lowest common multiple of 8 and c? 8 Let u be (-1)/6 + (-532)/(-24). Let a = u + -11. Let y = 5 - -6. Calculate the lowest common multiple of y and a. 11 Let v(x) = -2x - 6. Let z be v(-7). Suppose -3s + s = -z. Suppose -y = -sy + 12. Calculate the smallest common multiple of y and 8. 8 Suppose -3l = -q - 736, 5l + 3*q + q = 1221. Find the common denominator of -48/7 and (0 - 1) + l/(-56). 56 Calculate the lowest common multiple of 40 and 3/18	{ "pile_set_name": "DM Mathematics" }
x(n) + 4z(n)? -2n*2 + 3n Let t(q) = 28q + 1451q*3 + 0 - 1456q*3 - 6 + 4q*2 - 4q. Let v(i) = -4i3 + 3i*2 + 23i - 5. Determine 3t(d) - 4v(d). d*3 - 20d + 2 Let q(i) = -17i3 - 11i*2 + 11i. Let c(o) = -9o3 - 6o*2 + 6o. Let r be 26 + -173 - (2 - (-1 - -3)). Let s = r + 158. Calculate sc(z) - 6q(z). 3z3 Let j(p) = 14p + 17. Suppose -311 + 98 - 393 = 101r. Suppose -57 = -3b - 2k - 4, -3k + 3 = 0. Let f(s) = 5s + 6. Determine bf(z) + rj(z). z Let n(x) be the first derivative of 2x*2 - 42 + 0x*2 - 2x + 15 - 3x2. Let m(o) = o + 1. Let i be 1 + ((-1)/(-2) - 22/4). What is in(g) - 7m(g)? g + 1 Let i(o) = 11o*2 + 11o + 7. Let k(t) = -5t2 - 5t - 3. Suppose 0 = 5v + 4b + 7, -5b = -6v + 3v - 19. Calculate vi(r) - 7k(r). 2r*2 + 2r Let c(q) = q*2 - q. Let h(m) = -18m*2 + 24m. Suppose 0 = -36s - 1195 + 3787. What is sc(f) + 3h(f)? 18f*2 Let z(j) = j + 6. Let f(a) = 269a*2 - 3a - 32. Give -f(y) - 6z(y). -269y*2 - 3y - 4 Let v(m) = 7m3 - 3m*2 - 5. Let z(r) = -50r*3 + 9 - 78r*3 + 115r*3 + 5r*2. Determine -5v(o) - 3z(o). 4o*3 - 2 Let t(g) = -1569 + 10g + g + 1573. Let j = 21 - 25. Let a(u) = -209u - 77. Give ja(b) - 77t(b). -11b Let k(l) = 2l2 - l. Let x(b) be the first derivative of 7b*3/3 - 3b*2/2 - 17. Let r(s) = 2s*2 - 25s + 30. Let u be r(11). Calculate ux(i) + 8k(i). -5i2 + i Suppose 12 = 8z - 12. Let c(h) = 24h + 39h - 69h + z. Let k(m) be the first derivative of 5m*2/2 - 2m - 1. Determine 4c(g) + 5k(g). g + 2 Let s(a) = -a - 4. Let r = 3 + 2. Let b = r + -2. Suppose 212 = 7055g - 7002g. Let h(f) = 2f + 5. What is bh(t) + gs(t)? 2t - 1 Let r(l) = 3l2 - 23l + 9. Let m(g) be the first derivative of g*3/3 - 11g*2/2 + 4g - 483. Calculate -9m(a) + 4r(a). 3a2 + 7a Let y(n) = 2n2 + 4n + 3. Let u be (59 - 26873/462)/(1/(-6)1). Let x(b) = 3b*2 + 5b + 4. Let j be 1 + -2 + -1 + 8. What is jy(d) + ux(d)? -3d2 - d - 2 Suppose 115l + 187l + 521 + 687 = 0. Let a(c) = 12c - 1. Let j(z) = -z + 1. Give lj(m) - a(m). -8m - 3 Let s(b) = -498b3 + 4b*2 - 7b + 14. Let d(y) = 249y3 - 2y*2 + 4y - 8. Determine 5d(u) + 3s(u). -249u3 + 2u*2 - u + 2 Let d(p) = -27p - 2. Let k(x) = 28x + 3. Suppose 7o + 11672 - 11700 = 0. What is od(s) + 3k(s)? -24s + 1 Let w(m) = -12m*2 - 44m + 44. Let q(s) = -2s2 - s + 1. Determine -5q(u) + w(u). -2u2 - 39u + 39 Let j(s) = -s - 1. Let h(f) be the first derivative of f + 1052. What is h(b) - j(b)? b + 2 Let a(l) = -l*3 - 2l*2 - l - 2. Let g be 2555/2409 + (-6)/99. Let z(p) = -p. Determine gz(k) - a(k). k*3 + 2k*2 + 2 Let b(j) = 11j*3 - 27j*2 + 5. Let t(u) be the second derivative of 3u*5/10 - 7u*4/6 + 3u*2/2 + 12u - 84. Determine 3b(l) - 5t(l). 3l3 - 11l*2 Let s(k) = 60k + 468. Let r(q) = 60q + 407. Give 7r(z) - 6s(z). 60z + 41 Let d(g) = -4g2 + 5g - 5. Let b(y) be the first derivative of 2y3 - 7y*2/2 + 8y + 2171. Determine -5b(w) - 7d(w). -2w2 - 5 Let m(i) = 6i + 31. Let n be ((-8)/12)/((-4)/(-498))2. Let d = 168 + n. Let z(j) = j + 6. Give dm(r) - 11z(r). r - 4 Let k(x) = 2x*3 - 6. Let u(i) = -4i*3 + 13. Let v = -17868 + 17864. Determine vu(n) - 9k(n). -2n*3 + 2 Let k(t) = -13t - 4. Let h(c) = -32c - 9. Let w(f) = 4h(f) - 10k(f). Let n(r) = r + 1. Calculate -8n(u) + 3w(u). -2u + 4 Let w(r) = -r. Let n be -2 - -4 - -1(2 + -3). Let p(x) = -3x - 2. Let o(k) = np(k) - 4w(k). Let q(g) = -2g + 3. Calculate -3o(d) - 2q(d). d Let k(w) = 26 + 33 + 27 - 87. Let d(i) = -6i*2 - 6. What is -d(z) + 2k(z)? 6z2 + 4 Let j(z) = 14 - 17z - 4 - 6 + 47z - 5z*2 - 20z - 14z. Let b(h) = -5 + 9h*2 - 1 + 9h - 3. Determine 4b(o) + 9j(o). -9o2 Let z(q) = -8q*2 + 2q + 4. Let s(a) = -a*2 + a. Let x(g) = -5s(g) + z(g). Let k(v) = -3v2 - 4v + 5. Let y = 20499 - 20493. What is yx(w) - 5k(w)? -3w2 + 2w - 1 Let v(f) = -f*3. Let t(y) = -7y*3 + 160y*2 + 2. Calculate t(x) - 6v(x). -x*3 + 160x*2 + 2 Let z(q) = 21q*2 - 18q + 55. Let j(d) = -7d2 + 6d - 18. Let n(h) = 11j(h) + 4z(h). Let k(a) = -15a2 + 13a - 45. Give 6k(i) + 13n(i). i2 + 16 Let d(l) = l2 + 10l + 4. Let b(f) = 0f2 - 6 + f2 - 3f2 - 19f. Let o(y) = -3b(y) - 5d(y). Let p(i) = i. Give o(g) - 5p(g). g2 + 2g - 2 Let i(p) = -7p + 5p + 8p + 1. Let v(c) = -7c - 1. Let n = -111 + 131. Suppose -5k - 4j + 3 + n = 0, -4k + 14 = j. What is kv(a) + 4i(a)? 3a + 1 Let a(x) = -155x - 29. Let z(h) = -465h - 80. Determine -11a(q) + 4z(q). -155q - 1 Let l(w) = -w2 + 21w*3 + w - 19w3 - w3 + 1. Let m(f) = f*3 - 4f*2 + 4f + 6. Calculate 4l(p) - m(p). 3p*3 - 2 Let v be (-28 + 26)(0 + 5)/10. Let p(i) = 8i - 2. Let f(q) = q. Calculate vp(z) - 3f(z). -11z + 2 Let b(f) = 2f2. Let i = 3 + -6. Let v = i - 2. Let z = -10479 + 10482. Let q(h) = h2. Determine vq(a) + zb(a). a2 Let z(x) = 5. Let m(q) = -q - 40. Let k(t) = -14t + 163. Suppose -6c - 48 = -10c. Let n be k(c). Give nm(r) - 40z(r). 5r Let z(c) = -c3 - 3c*2 - c - 1. Let u(p) = -594p*3 + 27p*2 + 9p + 9. What is 2u(b) + 18z(b)? -1206b3 Let p be 4/22 + (-92)/22. Let l(x) = -2 - 4x + 0 + 3x. Let t(i) be the second derivative of -i3/3 - 3i*2/2 - 832i. Give pl(d) + 3t(d). -2d - 1 Let w(m) = 776m - 74. Let l(o) = -1552o + 136. Determine 6l(a) + 11w(a). -776a + 2 Let b(f) = 9f3 + 5f*2 - 9f. Let s(p) = -11p3 - 6p*2 + 11p. Let u(o) = 5b(o) + 4s(o). Let d(t) = 12t3 - 3t*2 + 3t + 1. Give d(v) + 3u(v). 15v*3 + 1 Let y(u) = u. Let x(s) = -5s + 1200. Give x(q) + 4y(q). -q + 1200 Let z(j) = -j + 5. Let w(n) be the third derivative of -n4/24 + 2n*3/3 + 494n*2. Calculate 5w(p) - 6z(p). p - 10 Let q(f) = f2 - 2f - 1. Let c(k) = 31k3 + 7k*2 - 20k - 10. Calculate c(g) - 9q(g). 31g*3 - 2g*2 - 2g - 1 Let m = 539 - 537. Let x(n) = -16n2 + 32n*2 - 15n*m. Suppose 0p = 3p + 153. Let g(t) = 8t*2. Give px(l) + 6g(l). -3l*2 Let j(z) = 75z*2 + 17z + 13. Let g(q) = -19q2 - 4q - 3. Suppose 5n - 23 = 4m, -4m - 4n + 315 = 311. Determine mj(u) - 9g(u). 21u2 + 2u + 1 Let f(c) = 19c - 1. Let g(y) = 73y - 16. Determine -5f(b) + g(b). -22b - 11 Let y(b) = -4b - 7. Let d be (1 - -23)4/16. Let l(r) = 9 - 5 - d + 1. Calculate -6l(w) + y(w). -4w - 1 Let h(j) = 96j3 + 285j*2 + 29. Let k(a) = -55a*3 - 142a*2 - 15. Give 4h(i) + 7k(i). -i3 + 146i*2 + 11 Let v(u) = -8u - 23. Let q(d) = -16d - 3d + 2d + 6 + 19d. What is -22q(f) - 6v(f)? 4f + 6 Let a(z) = z2 + 7z. Let v(w) = 4w2 + 25w. Let t(l) = 7a(l) - 2v(l). Let y(f) = 3f2 + 2f. Calculate -14t(j) - 6y(j). -4j2 + 2j Let p(j) = 5j - 50. Let w be p(11). Let t(v) = -17 + v + 12 + w. Let q(s) = -3s + 1. Give q(f) - 3t(f). -6f + 1 Let h(r) = -8r - 6. Let i(v) = -9v - 5. Suppose 5l = -4q + 15 - 64, -12q = -l + 67. Determine lh(j) + 6i(j). -14j Let m(g) = -g*3 + 4g*2 - 1. Let b(j) = 5872j*3 - 58720j*2 + 14680. Calculate 2b(q) + 29360m(q). -17616q3 Let h(p) be the first derivative of -p2/2 - 3p - 300. Let o(q) = 0q + 9 - q - 12. What is 4h(z) - 3o(z)? -z - 3 Suppose 4p = 2b + 5p + 11, -4b - p - 19 = 0. Let y(v) = -v + 12. Let s(u) = -u + 10. Let o(w) = by(w) + 5s(w). Let r(j) = -j + 3. Give -3o(c) + 2r(c). c Let d(x) = 4x3 + 21x + 44. Let i(y) = -y*3 - 2y + 1. What is -d(f) - 3i(f)? -f3 - 15f - 47 Let y(a) = 2a2 - 3a - 6605. Let p(w) = 3w2 - 4w - 6612. Give 3p(m) - 4y(m). m*2 + 6584 Let m(i) = 3i*2 - 2i - 5. Let r(g) = -g*2 + 36g - 7. Let t(l) = 6l - 1. Let d(v) = r(v) - 6t(v). Determine 2d(z) + m(z). z2 - 2z - 7 Let t(y) = 1. Let x(q) = -2q - 1. Let j(b) = 4b + 12. Let h be j(-3). Suppose -2w + 3w - 4r + 19 = 0, h = -3w - 4r + 7. Calculate wt(o) - x(o). 2o - 2 Let k(h) be the first derivative of h3/3 - 11h*2/2 + 11h + 14856. Let z(t) = 0 + 0 + 2t - 4 + 2t. What is -4k(l) - 11z(l)? -4l2 Let a(o) = 15o*2 + 4o + 4. Let t(i) = -5410i2 - 1375i - 1245. Let g(f) = -169f2 - 43f - 39. Let d(q) = -65g(q) + 2t(q). Calculate 45a(w) - 4d(w). 15w*2 L	{ "pile_set_name": "DM Mathematics" }
se Let x = -216 - -529. Suppose -464 - x = -3u. Is u prime? False Suppose 0 = -5q + 3q. Suppose l - 3x = 71, l - x = -ql + 79. Let d = -30 + l. Is d prime? True Let n(v) = 4v*2 + 6v - 9. Let o be n(-8). Let x = -112 + o. Is x composite? True Let m(b) = 3b3 + 2b2 - b + 2. Let t(y) = -y3 + 6y2 - 6y + 3. Let g be t(5). Let n be m(g). Is (-10)/2n/10 prime? False Let n be 2(-2 - (-21)/6). Suppose ny - 197 - 10 = 0. Suppose -w = -4w + y. Is w a prime number? True Let r(h) be the first derivative of 3h4/4 - h3/3 + 5h*2/2 - 5h - 9. Is r(4) prime? True Let w(u) be the second derivative of -u5/20 - u4/2 - u*3/2 - 5u*2/2 + 3u. Is w(-9) composite? True Suppose 3c + 3743 = d, 5d + 0c = 3c + 18691. Is d composite? True Suppose -y + 1 = -4. Let t(a) = a2 + a + 1. Let r be t(y). Let l = r - 12. Is l a prime number? True Let w(r) = r3 + 6r2 + 4r - 6. Let v be w(-5). Let g be (-2 - (-3 - v))/(-2). Suppose -69 = -5h + a, g = -0h + 3h + 4a - 23. Is h a composite number? False Let y be ((-1)/(-2))/(1/10). Let f(m) = 2m3 - m2 - 3m + 1. Is f(y) a composite number? False Let p(x) = -13x2. Let c(z) = -25z*2. Let m(q) = -4c(q) + 7p(q). Is m(1) a composite number? True Let y(x) = 1 + 1 + 2x + 4x2 + x + x3. Let d be y(-2). Is 3/12 - (-643)/d a composite number? True Let b be (-3)/6 - 147/(-2). Suppose 4p + b - 193 = 0. Suppose -3y + p = 3. Is y prime? False Let a(s) = s2 - 64. Let m be a(0). Let b = 129 + m. Is b prime? False Let f(r) = -151r - 6. Let n be f(-3). Let m = 686 - n. Is m composite? False Let x(o) = 20o2 - 1. Let t be 32/(-14) - (-10)/35. Is x(t) prime? True Let n = 7 - 10. Is 2/(-3) - 383/n a prime number? True Suppose -m = -3m. Suppose m = -4q - y + 14, y + 10 = 4q - 0y. Suppose -ql + 0l = -231. Is l prime? False Let k(f) = -5 - 2 + 5 + 7f. Is k(3) prime? True Is (-121)/(0/4 - 1) composite? True Let s(z) = -523z + 1. Let h be s(-1). Suppose 2t = 5t + 2f - 393, -h = -4t + 2f. Is t a composite number? False Is 4/(-3) + 3531/9 prime? False Let w(f) be the first derivative of 47f4/12 - f3/3 + f2/2 + f - 1. Let l(j) be the first derivative of w(j). Is l(1) a prime number? False Let m be 1 + (22 - (3 - 6)). Suppose 0 = -3t + m + 49. Is t prime? False Let d(g) = -g - 1. Let t be d(-1). Suppose 10q - 13q + 165 = t. Is q prime? False Let b(z) = z2 + 9. Let k(g) = -g2 - g - 8. Let y(m) = 5b(m) + 6k(m). Let c be y(-4). Is 22 + (-2 - (0 - c)) composite? True Let p = 10 - 7. Suppose -b = -p + 1. Suppose -ba + y + 133 = -0y, -5y = -5a + 330. Is a a prime number? True Let v(t) = -t + 14. Let u be v(12). Let s(f) = -f + 4. Let g be s(4). Suppose 2x + 46 = un, g = 2n + x + 2x - 61. Is n a prime number? False Let z = 1103 + -660. Is z a prime number? True Is 761/2 - (-2)/4 prime? False Let y = 16 - -2. Suppose -6 + y = 3o. Suppose 5m - 225 = -oj, m - 6 = -j + 38. Is m prime? False Let a = 5056 - 1725. Is a a composite number? False Let q = 241 + 171. Suppose -2l - 6 = -q. Is l a composite number? True Let g(y) = 10y2 + y + 24. Is g(7) a prime number? True Let c(b) = -2b. Let u be c(-1). Let l(i) = 32i - 17. Let t be l(6). Suppose 3y + uy = t. Is y composite? True Let n be (-10)/10 - 1-8. Is n(3 + (-2 - -10)) a composite number? True Let w(i) = 51i*2. Is w(1) prime? False Let d(g) = 3g + 3g3 + 5g*2 - 2g*3 - 2 - g. Is d(-3) prime? False Let g be 1-312/9. Let p be 2/g - (-49)/2. Is 3/p1052 a prime number? False Let h(w) = -w3 - 5w*2 + 7w + 1. Let g be h(-6). Let r be -4(25/4)/g. Suppose 4k - 115 = -4v + v, -3k + 188 = rv. Is v a composite number? False Let s be (-5)/2(2 - -2). Let f(z) = -24z - 1. Is f(s) a composite number? False Suppose -2f - 55 = -n - 7f, -5f = -n + 15. Suppose n = 5k + 4m, -4k + 17 + 11 = -5m. Is k prime? True Suppose 4y + 2857 = 3d, d + 0d - 5y = 945. Is d composite? True Let w = 6 + -2. Suppose -17 = 3z - f, w = -z + 2f + 5. Let i(v) = v*2 - 3. Is i(z) a composite number? True Suppose 4x + 14 = l, -3x + 4x = 2l - 7. Is -5 + l - (-99 - 1) composite? False Suppose 3b - 3505 = -2d, 4b + 6193 = 5d - 2604. Is d a composite number? True Let z be ((-36)/3)/(-2) - 3. Let p be z(-3 + (-22)/(-6)). Suppose -15 = -u + 4v, pu + 0v = -5v + 95. Is u prime? False Suppose 11o - 3846 = 9o. Is o composite? True Let d = 8438 + -3151. Is d composite? True Let n(j) = 12j2 + 6j + 23. Is n(-6) prime? True Let x(z) be the third derivative of z6/120 + z5/15 + z4/8 + z3/3 + 3z2. Let o be x(-2). Suppose 2c + ov = 210, -3c + 3v = 2c - 460. Is c prime? False Is (6 - 1760)1/(-2) a composite number? False Let l(m) = m3 + 8m*2 - 2. Let k be l(-7). Suppose 5r - 3 = o + 6, r + 2 = 4o. Is (o - 2)k-1 prime? True Let n be (0 + -13)/(2/42). Is 0 + n/(-6)2 a composite number? True Let v = 2138 + 1127. Is v a prime number? False Suppose -5d + 10 = 5a, 5d + 0d + 2a = -5. Let h be (1 + -2)d - -4. Let j = 30 + h. Is j composite? False Is 29/24 + (-78155)/(-44) a composite number? False Let z(a) be the first derivative of 10a3/3 - a2/2 - 4a + 3. Is z(3) prime? True Let j be (-4 + 3)/((-1)/4). Suppose -2f = -jf + 134. Is f a prime number? True Let v(x) = 3x*3 - 5x*2 + 4x - 1. Suppose -4i + 2i + 4 = 0. Suppose 4p - 15 = -k, -ip = 3p - 3k - 23. Is v(p) a composite number? False Let q = -9 + 13. Let y be 582/q(-6)/(-9). Let f = y - 62. Is f a prime number? False Let s(t) = 91t + 9. Let h(p) be the second derivative of 23p3/3 + 5p*2/2 + p. Let l(d) = -7h(d) + 4s(d). Is l(2) prime? False Let f(g) be the third derivative of g4/4 - 5g*3/6 + 3g*2. Is f(6) prime? True Suppose 0 = -0f - 5f + 2k - 4102, 2474 = -3f - 2k. Let i = -2370 - f. Is (-2)/5 + i/(-20) prime? False Let n = 544 + -321. Is n composite? False Let a(z) = 5z2 + 1. Let y be a(1). Let l be (4/y)/((-1)/(-3)). Suppose -lp + 3u = -7p + 232, p + 3u = 44. Is p composite? False Suppose -8 = 4i - 0i. Let g be (-92)/(-28) - i/(-7). Suppose gj - 185 = -2j. Is j a prime number? True Let l = 82 - -12. Is l a composite number? True Suppose 3p - 135 = -4c, -4c - 4p - p = -145. Let y be (24/c)/(2/5). Is 23 - (-2 - (y + -2)) a prime number? False Suppose 0 = 5m - 15 - 0. Suppose 0 = -a + 3a + 4v - 98, 5a - 310 = mv. Is a prime? True Suppose -3l = -715 - 473. Is -3 + 13/(39/l) composite? True Suppose -15 = 3j, -5v + 4v = -4j - 177. Is v a composite number? False Let a be (-76)/10 - (-8)/(-20). Let v(g) = g3 + 7g*2 + 7g - 7. Let p be v(a). Let l = -69 - p. Is l composite? True Suppose -5m = 5v - 1105, -3v + 663 = m + m. Let f = 62 + v. Is 2/(-12) - f/(-6) prime? True Let r(u) = 2u2 + u + 1. Let f be r(-1). Let h(z) = z3 - 3z2 - 9z + 9. Let c be h(9). Suppose -c = -fd - 40. Is d prime? False Is -4(-2)/82084/4 prime? True Let l(j) = -11j + 11. Let n be l(-8). Let s = 84 + n. Is s composite? True Let r = -6 + 32. Suppose 0 = 3o + 4q - r + 6, -2o = -4q. Is o composite? True Suppose 70 = 53f - 51f. Is f a composite number? True Let b(x) = 114x2 + 18x - 7. Is b(5) composite? True Let b = 4 - 3. Is (-4 + b)(-395)/15 a composite number? False Suppose 4h - 293 = 5o, 5o - 15 = -0o. Is h composite? True Suppose 5x = 2g - 59, -3x + 6x = 4g - 41. Let r(a) = a + 29. Let s be r(-21). Is x4/(s/(-14)) composite? True Let v = -2 + 4. Suppose x - 1 = v. Suppose -30 = -0i - xi. Is i a prime number? False Let l(i) be the second derivative of 0 - 11/12i*4 - 2/3i*3 - 1/20i*5 - 3i + 15/2i2. Is l(-11) prime? True Let w = 14 + -10. Suppose 0 = z - 3 - w. Is z prime? True Let s = -19 + 236. Is s composite? True Suppose -3g = c + 3205 - 9000, 5c = 4g - 7714. Is g a prime number? True Let n(a) = -17a3 + a2 + 3a - 2. Let u be n(2). Let g = -81 - u. Is g a prime number? True Let f = -3 - -37. Suppose 8 = 2q + 3d - 5, 2q - f = 4d. Is q prime? True Is 52/61/(-2)-15 a composite number? True Suppose 5i - 269 = 201. Is i a prime number? False Let x(q) = q3 - 19q*2 + 9q - 2. Is x(19) a composite number? True Suppose -4o + 647 = 3x, 2o + 2o = x + 643. Let g = 292 - o. Is g composite? False Suppose 0 = 4m - 12, -4h + 3*m + 499 = -5	{ "pile_set_name": "DM Mathematics" }
q)(4q4 + q4 - 4q4) + (2 + 2q*4 - 2)(q - 2q + 2q). -2q5 + 2q Expand (5o3 - 3o*3 - 3o*3 + (0o - 2o + 3o)(-2o*2 + 3o*2 - 2o2) - o + o + o3 + 3o3 - 2o + 2o + o3 + 3o - 3o)(o*2 + 1 - 1). 3o*5 Expand (s + 0 + 0)(4s + 2s*3 - 4s) - 11s4 + 6s + 3s - 10s. -9s4 - s Expand (13s*2 - 5s + 18s2 - 27s*2)(-s - 2s + 5s)(-1 + 2s + 1). 16s4 - 20s*3 Expand (2u - 2u + 3u*2)(2u - 2u + 3u2) - 2u4 - u4 + 0u4. 6u*4 Expand (2 - 3 + 0)(13u + 20 - 20)(u - 2u2 - u). 26u*3 Expand (3z*2 - 4z2 - z2)(0z + 3z - z) + 9z*2 - 9z*2 + 2z*3. -2z*3 Expand 2p*3 + 2p*2 - 2p2 + (-p2 + 3p2 - 4p*2)(-2 + 2p + 2) - 2p3 - p3 + 2p3 + (2p*3 - 2p*3 - 2p*3)(7 - 4 + 1). -11p3 Expand (h4 + 2h*4 - 2h*4)(0 + 1 + 0) + h*4 - 4h*4 + 4h*4 + (-4h + 4h + 2h*3)(h - 3h + 0h). -2h4 Expand -8s*3 - 2s*4 + 8s*3 + (5s*3 + 0s*3 + 0s*3)(0s - 3s + s) + 3s4 - s4 - s4 + (-1 - 1 + 3)(-s*2 - 2s4 + s2). -13s4 Expand (8f - 30f + 0f)(-2f*3 + f - f - 3f*2). 44f*4 + 66f*3 Expand (5y - 2y + 5y)(2y + 0y - y) + 4y*2 - 2y*2 + 0y*2. 10y*2 Expand (-2 + 3 - 4)((-5 - 2b + 5)(0 - 2 + 3) - 5b + 4b + 2b)(-4 + 0 + 2). -6b Expand -o4 + 2o2 + o3 - 2o2 + (0o*3 + 4o3 - o3)(0o + 0o - 2o). -7o4 + o3 Expand (x2 - 50x*4 + 9181 - 9181)(2x + x - 2x). -50x5 + x3 Expand (4t*4 - 2t*4 - 3t*4)(t + 18t - 5t) + 2t5 + t5 - t5. -12t*5 Expand z - 4z*2 + 4z2 + z3 - 5z3 + 6z*3 - 2z*3 + (1 + 0 - 3)(-2z3 + 4z3 - z3) + 4z3 + 0z*3 - 5z*3 - 5z*2 + 5z*2 - 4z*3. -7z*3 + z Expand (3b - 3b + b)(-1 - 2 + 1 + 4 - 1 - 1 + (2 + 1 - 1)(3 + 1 - 3) - 1 + 5 - 1 + (1 - 3 + 0)(1 + 0 + 1)). b Expand 2k4 - 2k*4 - 2k5 + (-k2 + 2k3 + k2)(0 + 0 - 2k2) - 2k4 + k5 + 2k4 + 2k*5 + 0k*5 + 0k*5. -3k*5 Expand 3c*2 - 3c2 - c5 + (13c5 + 4c*4 - 4c*4)(-2 - 2 + 6). 25c5 Expand (3h + 196 + 7h - 197)(h + h - h). 10h2 - h Expand -3q*4 + 4q*4 - 2q*4 + (3q - 5q + 3q)(2q3 - 5 + 5) + q4 + 0q4 + q4. 3q4 Expand (0 + w2 + 0)(-w2 - 2w - 2w2 + 0w*2). -3w*4 - 2w*3 Expand (1 - 1 + 2)(3s5 + 0s5 - s5 + (-4s2 - 12s + 12s)(3s2 - 2s*3 - 3s*2)). 20s*5 Expand -3 - z + 3 + (-13 + 10 + 11)(3z - 2z + z). 15z Expand (2 + 0 - 1)(0y + 2y - 3y) + 2y - 2y - 3y + (0y - 2 - 2y + 1)(-1 + 4 - 2). -6y - 1 Expand -10f5 + 2f*5 + 2f*5 + (0f*3 + 2f*3 + 0f*3)(3f + f - f)(4 - 4 - 2f). -18f*5 Expand (1 - 1 - t)(5t - 5t - 2t)(-3 + 0 + 2)(1 - 1 + 2t). -4t3 Expand (-2v - 2v + 0v)(12v + 4v + 7v). -92v2 Expand (-4 - 5 + o + 1)(-3o2 + 0 + 0). -3o*3 + 24o2 Expand -k3 + 2k5 + k3 + (-4k - 2k3 + 4k)(3k*2 - 6k*2 + 2k*2) - 2 + 2 - 2k*5 - 4k*3. 2k*5 - 4k3 Expand z5 + 0z5 + 0z*5 + (2z - z*5 - 2z)(3 + 0 - 4) + 122z*4 - 12z*5 - 122z*4. -10z*5 Expand (0u + 5u - 4u)(-u + 2u - 3u) - 7u + u*2 + 7u. -u*2 Expand (5 - 2 - 5)(5 - 5 - 5n2) - 2 + 2 - 2n*2. 8n*2 Expand (-2x + 0x - x)(-5 + 5 + x) - x*2 - 2x2 + x2 - x - 3 - x*2 + 3. -6x*2 - x Expand (0l*3 - 3l*3 + 2l*3)(3l - 4l + 6l). -5l*4 Expand (-2 + 4 - 22)(5h + 0h - 3h) + 2 - 2h - 2. -42h Expand 4k*4 + 8 - 3k*4 - 5 - 2k*4 - 2k*2 + 2k*2 + (0k*2 - 2k2 + k2)(0 + 3k*2 + 0). -4k*4 + 3 Expand (0g - 2g + 3g)(g + 0g + 2g). 3g*2 Expand 2d4 - d2 + d*2 + (-2d*2 + 6d*2 - 2d*2)(-3d2 + d2 + 3d*2) + 0d4 + d4 - 2d4 + 3d*4 - 3d*4 + 9d*4. 12d*4 Expand 8m*5 - 2m*5 - 16m*3 + 18m*3 - 2m*5 - 6m*2 + 6m*2 + (0 - 3 + 1)(3m4 + m5 - 3m*4) - 2m4 + m5 + 2m4. 3m*5 + 2m*3 Expand (-4z*2 - 1 - 4z*2 + 6z*2)(2z2 + 0z2 + z2). -6z4 - 3z*2 Expand (-3n*4 + 0n*4 + 5n*4)(0n + 5n - 3n)(-3 + 4 - 3). -8n5 Expand (z + 2z - 2z)(-1 + 4 + 1). 4z Expand 3l*3 + 4l*4 - 2l*3 - 2l*4 + (2l*2 - 4l - 4l2 - l2)(-l2 - l2 + l*2). 5l*4 + 5l*3 Expand (-5 + 1 - 2)(-q - q + 6q)(2q - q - 2q). 24q2 Expand (-3b - 2b + 3b)(3 + 1 - 1)(-1 + 0 - 1) - 3 + 3 - 2b. 10b Expand (5 - 3 - 3)(-2 + 2 - l)(l + 3 - 3 - 5l + l + 2l + (0 + l + 0)(-1 + 3 - 3)). -2l2 Expand x4 + 8x4 - 2x*4 + (-2x*2 + 2x2 + x2)(-x2 - x2 + 3x*2). 8x*4 Expand (4c*2 - 2c2 + c2)(-2c - c*2 + 2c) + 1 + 0c + 0c - c*4. -4c*4 + 1 Expand (-9t + 9t + 5t*2)(19t2 - 19t*2 + 3t*3 + (-t - t + 4t)(0t*2 + 3t*2 - 4t*2)). 5t*5 Expand (-4q + 6q - q)(-7q3 + 0q3 + q3) + 3q4 - q4 - 3q*4. -7q*4 Expand (-5t - t + 4t)(0 - 1 - 1). 4t Expand ((2 + 2 - 5)(3 - 3 + 1) + (1 - 5 + 3)(0 + 0 - 2))(0 + 0 + 2v). 2v Expand (t*3 - 3t3 + t3)(10t + 2t + 3t)(-2t + 5t - 5t). 30t5 Expand (0 - 5 + 3)(-9 + 9 + 6y). -12y Expand (4l - 3l + 0l)(2 + 0 - 1) - 3 + 4 + 5l - 3. 6l - 2 Expand i*5 - 5i*5 + 3i*5 + (-4i - 2i + 2i)(2i*4 + 0 + 0) + 0 + 2i*5 + 0. -7i5 Expand (i2 - i*2 - 3i*3)(3i2 + 0i2 - i2) + 5i5 - i5 - 2i*5 + (0i - i*4 + 0i)(-3i + 8i - 2i). -7i5 Expand (2 - 3s - 2 - 4s + 4s - s + (-2 + 1 + 0)(0 + 0 - s) + 5 + 2s - 5)(-s + 3s - s)(0 + 5 - 4). -s2 Expand (-g2 + g2 - 2g*2)(-1 + 5 - 2). -4g2 Expand (-k4 + 0k4 - k4)(-2 + 2 + 2k) - k*3 - 3k*3 + 5k*3 + 2k*5. -2k5 + k3 Expand -p3 + p3 + 2p3 + (4p + p - 3p)(p*2 + 4 - 4) - 5p3 - p2 - 3p3 + p3. -3p3 - p2 Expand 4q2 - 4q2 - q3 + (-2q + 4q + 0q)(-4q2 + 2q*2 + 0q2) + q3 - 5q3 + 2q*3. -7q*3 Expand (-1 + 0 + 0)(0d + 4d + 0d). -4d Expand (g3 + g3 - 3g3 + (g - g2 - g)(1 - 1 + 2g))(-1 + 2 + 2). -9g3 Expand (-5 + 3 + 4)(2g4 + g - g) + 4g*4 + 7g*2 - 7g*2 + (2g*3 + 3g - 3g)(2g - 2g + 2g). 12g*4 Expand (-2r*2 - 2r + 2r + (-3 + 2 + 3)(r*2 + 0r*2 - 3r*2) - 4r*2 + 3r*2 + 0r*2 + 0r + 2r2 + 0r + r*2 + 0r + 0r)(r - r + 3r). -12r*3 Expand -4t*3 + 4t3 + t3 + (-6t + 2t + 5t)(0t2 - t2 + 2t2) + t3 + t*3 + 0t*3 + 3 - 3t3 - 3. t3 Expand (1 - 1 - 3g2)(-2 + 2 - 2)(10 - 10 - 2g). -12g3 Expand 1 + 2l*4 + 0l*4 - 8l*4 + (8l - 3l - 3l)(-2l*3 + 3l3 + l3). -2l4 + 1 Expand (1 + 0 + 1)(19x - 9x - 8x - 23). 4x - 46 Expand (-2q - 1 + 0 + 0)(-2q3 - 6q3 - q3). 18q4 + 9q3 Expand -j2 + 0j2 - 2j*2 + 0j2 - j2 + 0j2 + (-15 + 1 - 5)(j2 - j2 + j*2). -23j*2 Expand (2i*2 + 3i*2 - 3i*2)(i2 - i2 + 2i3) + (3i - 2i - 2i)(2 - 2 - 2i*4). 6i*5 Expand (3i*2 - 4i2 - i2)(-4i - 3i + 5i)(10 + 13 + 7). 120i*3 Expand (-2o - o + 2o)(-3o2 + 3o*2 - 2o*3)(5o + o - 2o)(-5 + 2 - 4). -56o5 Expand -d4 - d*4 + 0d*4 + (-2 + 2 + 2)(-3d3 + 2d*4 + 3d*3). 2d4 Expand (r2 + r5 - r2)(1 + 4 - 4) - 3r5 - r5 + 2r5 - 3r*5 + 5r - 5r. -4r*5 Expand (2l - 5l + 2l)(-1 - 1 + 3) + 140 + 17l - 140. 16l Expand (3b - 1 - 2b + 0)(b - b - b2). -b3 + b*2 Expand (0r*3 + 0r3 + r4)(2r - 5r + r) + (-r2 + r2 - r4)(-14 + 3 + 10 + 3r). -5r5 + r4 Expand (5v3 - 4v*3 + 2v + 0v)(-2 - 2 - 2)(1 + 1 - 4). 12v*3 + 24v Expand -v*5 + 4v*5 - 4v*5 + (-1 - 3 + 2)(0v + v5 + 0v) - 2v5 + 3v*5 + 7v*5. 5v*5 Expand 2y*2 - 3y*2 + 6y2 + y2 - 2y2 + 3y*2 + 0y + 0y + y2 - y2 + 2y*2 - 3y*2 + (-y + y - 2y)(-3y - 2y + 3y). 10y2 Expand (0 + 0 + 5y*2)(-y - 3y2 + y) + (1 - 1 - 2y)(0y3 + y3 + y3) - y4 + 2y4 - 2y*4. -20y*4 Expand (-2l*3 + 5l*3 + 0l*3)((-3 - 2 + 6)(2 - 2 - 2l) - 5l + 6 - 6) + (0l + 0l + 5l*2)(-2l2 + 0l*2 + 0l*2). -31l*4 Expand (-3f + f*2 + 3f)(-f2 - f2 + 7f*2)(-f - f - 2f). -20f*5 Expand 0q*4 + 5q*4 - 2q*4 + (5q2 - q2 - q*2)(0 + 0 - 2q2). -3q*4 Expand (-7 + 1 - 1 - 2d)(2d*3 - d + d). -4d*4 - 14d*3 Expand (3j2 + j2 - j*2)(j	{ "pile_set_name": "DM Mathematics" }
3. Suppose -o = -mo + 7634. Is o composite? True Let l be (-21)/(-9 + 8). Suppose 2q + 861 = p, 0 = p - 3p - lq + 1734. Is p composite? True Suppose -59283 = -34h - 29h. Suppose 0 = hd - 936d - 16465. Is d composite? True Let q(l) = 15l*3 - 2l*2 + 3l + 7. Let p be q(4). Let a = 807 + p. Let d = -1213 + a. Is d prime? True Suppose 3j + 334 - 2692 = -3d, 0 = 4d + 2j - 3134. Is d prime? False Suppose 6 + 24 = m. Suppose 96917 = mp - 13p. Is p composite? False Suppose -2a + 5i + 651703 = 0, 28a - 30a - 3i = -651727. Is a composite? True Let r(i) = 27i3 + i2 + 4i - 11. Let v(a) = -2a3 + a2 - 2a - 2. Let f be v(-1). Is r(f) a composite number? False Let o be ((-42)/(-35))/((-6)/(-40)). Suppose -2 = -q + o. Suppose 6t - qt = -1036. Is t prime? False Let t be ((-3)/(27/282))/((-2)/12). Suppose 5h - t = -168. Suppose 0 = -5b + hq + 12889, -2b - 2q + 5155 = -3q. Is b prime? False Let p = -214799 + 358860. Is p a composite number? False Suppose 137c + 5235 = 134c. Let i = c - -3750. Is i composite? True Let u(p) = 1270753p - 244. Let w be u(-4). Is w/(-186) + (-1)/3 a composite number? False Let r(y) = -185y + 151. Is r(-8) a composite number? True Let y(u) = -322u*3 - 437u*3 + 3u*2 - 352u*3 + 3 + 873u*3 + 6u. Is y(-2) a composite number? False Suppose 0 = -84r + 87r - 1674. Let n = 865 - r. Is n a prime number? True Let r = 51872 + 1809. Is r prime? True Let q(z) = -z - 13. Let t be q(-11). Let u be ((-273)/12 - t)/(1/(-148)). Let s = -1752 + u. Is s a composite number? False Is -12 + 95703 + (-9 - -1) + 0 a prime number? False Let c(l) = 6l - 81. Let r be c(12). Let q(a) = 34a*2 - 20a - 13. Is q(r) composite? True Let y(v) = 2v2 - 20v + 53. Let t be y(9). Is -25 + 24 - t-16 composite? True Let h = 19023 + -10933. Let b = 19573 - h. Is b composite? False Let l(t) = -2t*2 + 29t - 17. Let q be l(19). Let x be (-38)/(-57)(-1 - (1 + q)). Suppose -5f - 6c = -2c - 146, -x = -4f - 5c. Is f prime? False Let x(j) = -17j + 30. Let l be x(2). Is (l - (-1 + 1 - 1)) + 626 prime? False Let o(r) = 30r*2 - 8r - 5. Suppose 6g - 19 - 23 = 0. Let d be o(g). Suppose 0 = -2t - 6, 0 = -j + 5t - t + d. Is j prime? False Suppose -1015n = -999n - 41840. Is n a composite number? True Is 440736/(160/5)2/(-6)-1 prime? True Suppose 4h - 3382 = -2t - t, 5t = 5h - 4245. Let s = h + -278. Suppose 3w = -6, 5o + 7w - s = 4w. Is o a prime number? False Let v(y) = -28 - 1 - 442y + 22. Suppose 2h = 2z, 2h - 2z - 4 = 2z. Is v(h) composite? False Suppose 11y = 3182 - 487. Let a = 911 - y. Suppose -3j + a = -3o, 5o = 5 - 0. Is j a composite number? False Let z(w) be the third derivative of 33w5/4 - w4/6 - w*3/6 + 20w*2. Let t be z(-3). Suppose 0 = -7m - 7m + t. Is m a composite number? True Let w(j) = -25 - 7 + 14j + 7 - 3 - j*2. Let f be w(12). Is (1473 - 0) + (-1)/(-2)f a composite number? False Suppose -39p + 7088729 = 26p - 46p. Is p prime? True Suppose r = -0r + 2. Suppose 0 = 124n - 133n + 6165. Suppose 0 = rl + n - 3827. Is l prime? True Suppose 5y = 2y - 2u + 5451, 0 = -4y + 5u + 7268. Let z = 3384 - y. Let j = -582 + z. Is j prime? False Suppose 6z - 90716 = -31850. Let p = z + -2880. Is p a prime number? False Let o = -28641 - -74612. Is o a prime number? True Suppose 21 = i + 3. Suppose 0 = iw - 8w + 40. Let c(t) = -11t*3 + 11t*2 - 2t + 7. Is c(w) a composite number? True Let z(c) = 102c2 - 9c + 295. Is z(-24) a prime number? True Suppose 9j = j - 56. Is 2393 - (8 + j - 3/1) composite? True Let l = -9060 + 49403. Is l composite? False Let h be ((-8)/(-28)1)/(3/21). Suppose 0 = 3u, 3k + hu = -2u + 1839. Suppose 5j - 1868 = -k. Is j composite? False Suppose 4k = -4r + 4, 5r + 2 + 5 = -3k. Let f be (2/(-6))/(k/(-72)). Suppose 2728 = fu + 2a, -3u = -a + 2a - 2045. Is u a prime number? False Let f = 59 + -54. Suppose 4k + 203 = fk. Let g = 534 - k. Is g composite? False Let u = 46354 - 20288. Suppose 3g + 2k = 19579, -5g - 2k + 6559 = -u. Is g composite? True Suppose -25j + 180356 = -21j. Is j composite? True Suppose -11u = -10u + 8. Let k be (-70)/u - -2(-4)/(-32). Suppose 0 = -kr + 1554 + 705. Is r a prime number? True Let k(n) = -2n - 85. Let t be k(-38). Is (4 - 10407/12)/(t/24) a composite number? True Let l(m) be the third derivative of 2m5/15 + 131m*4/24 + 21m3/2 - m2 - 10. Is l(-38) prime? True Suppose 3b - 3g - 188941 = 17651, 5b - g - 344340 = 0. Is b composite? True Let s = 44 + -46. Let h(k) = -2k + 1. Let a be h(s). Suppose ar - 6614 = -3c, -2r = c + c - 4416. Is c a prime number? True Let s = 36 + -33. Suppose 4j - 2a - 10 = 10, -3j - 3a + 6 = 0. Suppose sl = 5r - 7841, -jr - r + 4l = -7843. Is r composite? False Suppose -2 - 6 = -4o. Suppose -1 = -ow - n, 4w = n + n + 14. Suppose wi = 4i, 2q + 3i - 1042 = 0. Is q a prime number? True Suppose -6a + 5i + 9 = -3a, 4a - 5i = 12. Let s be (-838)/a15/(-10). Suppose 4p - 8p - s = -5u, -p = -2u + 167. Is u prime? True Let a(h) = h*3 - 10h*2 - 10h - 5. Suppose -4l = 3o - 17, 4l + 56 = 4o + l. Let j be a(o). Suppose 4s = js - 4718. Is s composite? True Suppose -b = -3l + l, -4l - 3b = 0. Suppose 4u - 99 - 545 = l. Let a = u - 82. Is a prime? True Suppose 5p - 10y - 797415 = -5y, 3p - 2y - 478447 = 0. Is p prime? False Let c be ((-8)/(-12))/(4 - (-76)/(-18)). Is 39/(-13) - c/1 - -1903 a composite number? True Suppose -188r = -55r - 38055157. Is r composite? False Suppose 2n - 5n + 10 = -4g, -3g - 9 = -3n. Suppose nj + 1 = -c + 5, -35 = -5c + 5j. Let t(p) = 15p*2 + 11p - 20. Is t(c) a prime number? False Let f(n) be the third derivative of -n6/120 - n5/60 - n*4/4 - 5n3/6 - n2. Let l = 2108 - 2115. Is f(l) prime? True Let v(o) = 14o3 - 7o. Let j(u) = -u3 + u2 - 2u - 2. Let y(x) = -4j(x) - v(x). Is y(-7) prime? True Is 0 + (3/9)/((-5)/329325-5) prime? True Suppose 0 = -12i + 29i - 34. Suppose 5y - if = 71936 + 13849, 0 = y - 5f - 17134. Is y a composite number? False Let u(j) = -432j - 74. Let z be u(-29). Let d = z + 3879. Is d a composite number? False Suppose -8t - 5t = 28t - 7999223. Is t prime? True Suppose -2v + 417 = 3j, -15v - 4j - 600 = -18v. Let p = v - -1877. Is p prime? True Let p be (36/6 - 15)(-182)/3. Let z = p - -553. Is z a prime number? False Suppose 144 - 171 = -9k. Is (1947 + 2 - (-3)/k) + -1 a composite number? False Let b(p) = p + 20. Let g be b(-12). Let w(z) = z3 - 6z*2 - 9z + 12. Let o be w(g). Suppose -oc + 73c - 13025 = 0. Is c a composite number? True Let o(b) = -157b + 4 - 436b + 114. Is o(-13) a prime number? False Let g be 6/(-15) + (-2223)/(-95). Suppose 28p + gp = 466497. Is p prime? False Let y(t) = 695t - 440. Let g be y(9). Let v = g + 988. Is v prime? True Suppose -a + 15 = 2c, -a + 0c + c = 0. Let b = 5 - a. Suppose b = -18h + 13h + 555. Is h composite? True Suppose -15 = -5t + 10. Suppose -4j = -4r - 8180, 4r - tj + 4011 + 4174 = 0. Let z = -1187 - r. Is z a prime number? True Let x = 230072 + -139065. Is x composite? True Let k = -532890 + 890323. Is k composite? True Let c = -894974 + 1303513. Is c a composite number? False Let y(d) = 28862d2 - 75d. Is y(-1) a prime number? False Suppose -c + 54 = -3o - 4c, -2c = 4. Let x be 6 - (3 - 4 - -1). Is (-1364)/x24/o a prime number? False Suppose -4z = b - 12, 0b = -3b + 3z - 9. Suppose 151l - 140l - 42977 = b. Is l composite? False Suppose 0 = -296b + 297b - 346315. Is b a composite number? True Suppose 2627 - 44529 = 2m + p, m = 2p - 20961. Let f = 31322 + m. Is f a composite number? False Suppose 126g - 398170 = 1494273 - 529501. Is g a prime number? False Let w(d) = -8d - 102. Let j be w(-13). Suppose -jr = 4h - 0r - 6936, -h = 5r - 1743. Is h a prime number? True Suppose 0 = -2u - u + 615. Let x = -186 + u. Is x a prime number? True Let c be -2 + 7 - (6 + -1). Suppose -2o - 2k + 59 + 7593 = c, 7657 = 2o + 3k. Is o prime? True Let l be (-1)/(18/90(-10)/(-15672)). Let x = 11629 + l. Is x prime? True Let b be (-168)/252 + (6860/3 - 1). Let z = b + 15756. Is z a composite number? False Let m = 102 + -108. Let u be 2*(	{ "pile_set_name": "DM Mathematics" }
pose 3b - 27 = 5n, -b + 2n + 8 = -2. Solve -bd + 0 = 3o - 27, d + 5o - q = 0 for d. 3 Let n be (-2541)/(-105) - (-2 - (-22)/10). Let i = -33 + 46. Solve 2s - i = z, z + 3z = s - n for z. -5 Let z be 12/(-30) - 77/(-5). Solve s + z = 5k, -k - 2k + 9 = s for k. 3 Let j be (-18)/(-8) - 5/20. Let c(r) = -r - 1. Let d be c(-6). Suppose 17 = u - do, u + o = -u + 1. Solve z - 4a + u = -j, -2a + 20 = -5z for z. -4 Suppose 0 = 2s + 5x - 22, 20 = s + 4s - 5x. Let m be 2/36/2. Let u be (2/6)/(m/12). Solve -4y - 5g - 6 = 0, ug = y + sg - 4 for y. -4 Let c = -62 + 65. Solve -3y - c = -2r - 13, 13 = r + 3y for r. 1 Let i = 4 + -2. Let m(u) = -41u3 + 2u*2 - 1. Let k be m(-1). Suppose 0f + f = 4a - 33, 4a + 2f = k. Solve -p = -w + i - a, 0 = 2w + 5p - 21 for w. -2 Let x = -11 + 15. Let n be ((-6)/x)/(3/(-8)). Solve m - 2r - 5 = 0, -2m + 2r - nr + 10 = 0 for m. 5 Let m be 5/(-3)(-1 - 2). Solve 3a - 3q + 3 = -0, 6 = -4a + mq for a. 1 Let i(q) = q*2 + 2q + 5. Let o be i(-4). Solve m + o = -2s, -4m = m + 15 for s. -5 Suppose 0w + 3w - 6 = 0. Let a = -3 - -1. Let g = a + w. Solve g = -2y - o + 5, 4y - 2y - o - 11 = 0 for y. 4 Let k = 126 + -124. Suppose 2a + 4 + 4 = 0. Let u = a + 6. Solve 0 = 2v + kr - 16, -2r + u = v - 3r for v. 5 Suppose 4m - 7x + 3x - 8 = 0, -3m - x = 2. Solve -4d + w = 19, d + md = 4w - 16 for d. -4 Suppose -11c + 60 = 16. Solve 0z - 4z + cx = 4, -16 = 4z + 2x for z. -3 Let d(r) = 0 - 17r*2 + 2 + 2r + 19r2. Let z be d(-2). Let t be (-2)/4 + 50/20. Solve -zn - 10 = 4l - n, n = 5l - t for l. 0 Let h(t) = t*3 + 24t*2 + 22t - 23. Let s be h(-23). Solve s = 4c + 5f - 21, c + 3c - f = -9 for c. -1 Let y = 17 + -15. Suppose y = -4h + 14. Solve ho - 4a - 19 = -8, -4o - 3a = 27 for o. -3 Let v(q) = -q*2 + q + 2. Let f be v(1). Solve -15 = -3g + 2g + 5p, fp + 18 = -2g for g. -5 Suppose 4 = 14f - 12f. Solve -3v = -4t + 15, 0t - ft + 20 = -4v for v. -5 Let j be (-6)/(-9) - (-4)/3. Solve jg + 3 = 3u - 7, 5u = g + 5 for g. -5 Suppose 4b = -8, 7g + 6 = 3g + b. Let f be 3 - (1g - 0). Let l(j) = j*3 - 6j*2 - 7j + 3. Let m be l(7). Solve -fi = 0, 2h + i = 3h + m for h. -3 Let k(y) = -y3 - 10y*2 + 11y + 1. Suppose 38 + 17 = -5p. Let v be k(p). Suppose -o = -v - 2. Solve -m + 14 = -4l, -21 = 3m + ol - 3 for m. -2 Let m = 42 + -34. Solve -4j - q = q - 10, -j + 3q = m for j. 1 Let d be ((-9)/(-6))/((-6)/(-100)). Suppose 0 = 4c + 2w - 38, -w = -3c + w + d. Solve -2f = -h + c, -2 = -3h - 0h + f for h. -1 Suppose p - 2 = 4a, -5p - 9a = -4a - 10. Solve -4g = -2g + 2f, 0 = pf + 2 for g. 1 Suppose l = -2i - 19, 3i = -5l - 29 - 52. Let v be l/20 + (-3)/(-4). Solve m - 3j + 1 = 0, v = m - 4j + 3 for m. 5 Let o be 17/2 - (-6)/12. Suppose -4 = 3n - 10. Solve -4j = -2w + 8, 5w - o = nj + 3 for j. -1 Let l(t) = -6t2 + 13t*2 + t + 3 - 9t - 16t3 + 17t*3. Let p be l(-8). Solve -2 = g - q - 3, -pq = -2g + 6 for g. -3 Let m = 12 - 4. Solve 3n - 3x - 8 = mn, n + 2 = -x for n. -1 Suppose l + 4 - 20 = -5h, 5l = 2h - 1. Solve -o + 17 = -0x + hx, 15 = 3x for o. 2 Suppose 0 = -5x + x + 28. Suppose 0p = -p + 59. Let u = p - 42. Solve -r - 2r + u = 5j, r + 3j = x for r. 4 Suppose 0 = -u - 3u - 12. Let s = 7 + u. Solve -3f + m = -4m + 17, -sf = -5m + 21 for f. -4 Suppose 3x + 18 = 9x. Solve 3b + x + 4 = i, 0 = 3i - 5b - 9 for i. -2 Let v be (-24)/(-14)77/22. Suppose -u + 13 = 3j, -2u + vu - 16 = -3j. Solve jo + 9 = -2k - 9, 0 = -k - 1 for o. -4 Let m(b) = b*3 + 8b*2 - 2b - 11. Let h be m(-8). Solve 2 = -c, -hc - 20 = -3o - 4 for o. 2 Let x be (-6)/(-19/12). Solve 0c + x = 2c, 3v - 2c = -23 for v. -5 Let q = 7 + -2. Let s be 2 + 0 - 54/(-2). Solve 0 = 4k - 2z - 2, 2k - 2 - s = -qz for k. 3 Let n(s) = s3 + 6s*2 - 2s - 8. Let g = -4 - 2. Let i be n(g). Solve -h + 4 = z - 4z, 0 = -iz - 3h - 27 for z. -3 Suppose 4s = -q + 5 + 3, -3s = 3q - 15. Solve -3p + 3 - 12 = -2c, -p - q = -c for p. -1 Let b be (-1)/((-2)/20) - (38 - 39). Solve -5q - 2l - 31 = 0, -q - b = 2l - 0 for q. -5 Let c = -3 + 7. Solve j - n = 2j + c, -3n = 9 for j. -1 Let g be (96/(-168))/(4/(-14)). Solve gd = 6, 3x = 6x - 4d + 9 for x. 1 Suppose -8 - 1 = -3t. Solve 0 = 5r + tz - 13, -3z - z + 9 = 5r for r. 5 Let d = 8 - 28. Suppose -4q - 13 - 11 = 0. Let t be d/(-6)q/(-5). Solve -tf - 27 + 6 = 3i, -f = -i for f. -3 Suppose -2j + 7 = 1. Suppose -4b = -0b - jk - 38, -3b - 5k + 14 = 0. Solve 4s + u = -3u - 28, -4s + 5u + b = 0 for s. -3 Let l = -45 - -51. Solve 0 = q + r - 0 - l, -2r = -5q + 2 for q. 2 Let l be (-94)/(-10) + 15/25. Suppose l = -3s + 55. Solve -23 = 3a + 4j, s = -5a - 3j - 5 for a. -1 Suppose -4s = 4h - 68, s - 3s + 19 = h. Suppose -4k + 21 = 1. Solve 0 = -d + kb - h, -b + 0 = -5d - 3 for d. 0 Let h(z) = z2 + 11z - 9. Let p be h(-12). Solve 0 = -3k - u - p - 1, 2u + 8 = 4k for k. 0 Let c(u) be the third derivative of -u6/120 + 2u*5/15 - 7u*4/24 - 2u*3/3 - 5u*2. Let w be c(6). Solve -15 = 5s, -4h - 3 = -5s - w for h. 2 Suppose 60 = 6h - 2h. Let m = h - 12. Solve 3w + w - 5a - 23 = 0, -3w - a + m = 0 for w. 2 Let v(l) = 2l2 + l - 1. Suppose t - 5 = -7. Let u be v(t). Let b(d) = d2 + 6d + 3. Let z be b(-6). Solve zw + n = 7w + 12, uw = 5n for w. -4 Let x(p) = 5p + 4p2 - 2p2 - p2. Suppose q + 3 = -2. Let i be x(q). Solve -a + 10 + i = -2r, -5r - 25 = 4a for a. 0 Let h = -3 - -5. Solve -d - hf = 7, -3f + f - 6 = 0 for d. -1 Suppose 2z - 6z - 3y = -20, -3z + 15 = -2y. Solve 5g + 3h = 5h + 10, -z = h for g. 0 Let k(x) = -2x - 24. Let n be k(-11). Let c be n1 - (4 + -8). Solve 4l - 4 = -cp, 5l + 2p = 6p - 21 for l. -1 Let o = -2 + 6. Suppose -5d = -5k, 5d - 4k - 2 - 1 = 0. Suppose -h - 4 = 3z - d, -13 = -h + 4z. Solve 13 = hr + of, f - 6f - 30 = -3r for r. 5 Let v be 4/(-14) + (-26)/7. Let d be 47/7 + v/(-14). Solve -k - 5i = 0, k - 3i + 1 = -di for k. -5 Suppose -4w + 24 = -8. Let l be w/1 - (-2 - -3). Let j = -4 + l. Solve 0 = -jb + 2k + 7, -5k = -19 - 1 for b. 5 Let c(r) = r2 + 10r + 1. Let j be c(-8). Let p be (-4 - -2)j/6. Solve 4k = -s - 10, pk - 2s + 16 = -3 for k. -3 Let f = -4 + 8. Suppose fl - 6 = 2l. Solve 0 = -c + o - 5, -5c + lo - 5 = 8o for c. -3 Let b = 27 + -25. Solve 0 = -3x - 5d + 8, bx - 4d + d + 20 = 0 for x. -4 Suppose -2f + 15 = 11. Solve 0 = fy - 2z - 2 - 0, -z - 13 = 2y for y. -4 Let t(l) = -8l. Let z be t(1). Let k be z/28 - (-88)/14. Suppose 0 = 2v - 46 + k. Solve -3n - 37 = -5h - 0h, -v = 5n for h. 5 Suppose 5b - 10 = -2c + 17, 3 = -c + 3b. Let u = c + -1. Solve -u = -2a + w, 5a + w = -w - 10 for a. 0 Suppose 48 = 8d - 5d. Solve 0 = 5g - 5n, -2g - n = -7g - d for g. -4 Let f = 2 - 2. Suppose 0o + 4 = 2o. Solve f = -5z - 3h + 6 + 3, 0 = -oz - 4h - 2 for z. 3 Suppose 5f + 1 = 16. Suppose 3r - f = 6. Suppose rw = 14 + 37. Solve -w = -3o - 2h + 6, -4o + 3h + 8 = 0 for o. 5 Suppose -7h + 11 = -10. Solve -9 = 3n, 4n + 2 = 2a + ha for a. -2 Let d(p) be the third derivative of -p6/60 - p5/30 - p*4/8 + 2p*2. Let f be d(-2). Let q = 19 + f. Solve 4j = -3a + 14, 0a - 5j + q = -4a for a. -2 Let c be (2/4)/((-3)/36). Suppose 0 = -3q, -4k - 3q + q = -4. Let m be (k/(-2))/(c/252). Solve -4u = -t + m, t + 4u = -0t - 19 for t. 1 Let f = -3 + 6. Let w(s) = s*3 - 3s*2 + 5s - 3. Let k be w(f). Let c be 2 + -2 - (-1 + -1). Solve -cu + 2 = 0, -2m + 4m + k = 2u for m. -5 Let m = -50 - -52. Suppose 0 = 2b - 7 - 1. Solve -2d = bh - 5h - 15, 0 = md + 4h + 10 for d. 5 Let t(s) = 2s2 + 3s + 3. Let w be t(-2). Solve -5o = -wp + 5, o + 16 = 5o for p. 5 Let v be (1-3)/((-36)/(-15) + -3). Solve -4m + vb + 14 = 0, 5m + 3 = b + 10 for m. 1 Suppose 5q = 3q + 8. Suppose 4a + o - 2 = 10, -5a - 10 = -5o. Solve h - qh = r + 6, 0 = 3r - h - a for r. 0 Let n = -4 + 4. Solve -q - z + 3 = n, 2 + 0 = 2z for q. 2 Suppose -2l + 4 + 0 = 0. Suppose -3f = -f + lw, 3f + 4w = -5. Solve -2h - 20 = 4q, -4h + fq + 25 = -2h for h. 0 Let a = 81 + -78. Solve -h - ah - 16 = 4o, 5o + 14 = h f	{ "pile_set_name": "DM Mathematics" }
00000 What is -0.105631415 rounded to 3 decimal places? -0.106 Round 0.00018756996 to six dps. 0.000188 What is -639375.523 rounded to the nearest 1000? -639000 What is 287689250 rounded to the nearest 100000? 287700000 Round 2276046390 to the nearest 1000000. 2276000000 What is 828.556493 rounded to the nearest one hundred? 800 Round -0.40490164 to 1 dp. -0.4 Round 33334.10616 to zero dps. 33334 Round 0.08021471785 to 6 dps. 0.080215 Round -1.37214944 to 1 decimal place. -1.4 What is 650.4129 rounded to the nearest ten thousand? 0 Round 140173896.9 to the nearest 1000. 140174000 Round -2.805461965 to four decimal places. -2.8055 What is -836.375222 rounded to the nearest integer? -836 What is -0.3260696873 rounded to 3 decimal places? -0.326 What is -0.00096725682 rounded to seven decimal places? -0.0009673 Round 0.00002932286177 to 5 dps. 0.00003 What is -491.6867787 rounded to the nearest one hundred? -500 What is 336568311.6 rounded to the nearest 1000000? 337000000 Round 166.109214 to the nearest integer. 166 Round 176.6500699 to one dp. 176.7 What is 0.2652950763 rounded to three decimal places? 0.265 What is 0.00000109421583 rounded to seven dps? 0.0000011 Round 17.073164486 to one dp. 17.1 What is 61861.7457 rounded to the nearest 10000? 60000 Round 0.00033196946 to five dps. 0.00033 What is -9.3551579 rounded to two dps? -9.36 What is -0.0527041919 rounded to three dps? -0.053 Round 355.96677 to the nearest 10. 360 Round 6767.413916 to the nearest 1000. 7000 What is 109702.4147 rounded to the nearest 1000? 110000 What is 0.0000002353609543 rounded to seven decimal places? 0.0000002 Round 0.0700982067 to four decimal places. 0.0701 Round -0.007441307 to six decimal places. -0.007441 Round 0.014193267 to 3 dps. 0.014 Round -0.118983124 to 5 decimal places. -0.11898 Round 0.0034998271 to 3 decimal places. 0.003 Round 5719344.383 to the nearest ten thousand. 5720000 Round 18509680.5 to the nearest 10000. 18510000 Round 0.0227451787 to six dps. 0.022745 What is 0.002789566943 rounded to five dps? 0.00279 What is 24310.92998 rounded to the nearest one thousand? 24000 Round 7028.63832 to the nearest ten. 7030 What is -2571961250 rounded to the nearest 100000? -2572000000 Round 4812.894743 to one decimal place. 4812.9 What is 5162335.606 rounded to the nearest ten thousand? 5160000 What is -0.008557970661 rounded to seven dps? -0.008558 Round 5.070919635 to 3 dps. 5.071 Round 43.318232 to 2 decimal places. 43.32 What is 21486.5411 rounded to the nearest 1000? 21000 Round -6.74906569 to two dps. -6.75 What is -0.01781538549 rounded to four dps? -0.0178 Round 0.26409856 to 3 decimal places. 0.264 Round 2684.93609 to 0 decimal places. 2685 What is 409.281903 rounded to one decimal place? 409.3 Round -7158.034083 to 1 decimal place. -7158 What is -0.0000000964122 rounded to seven decimal places? -0.0000001 What is -896587.1422 rounded to the nearest 1000? -897000 What is -713.895434 rounded to the nearest ten? -710 Round 432.841522 to 0 decimal places. 433 What is -25654.648 rounded to the nearest ten? -25650 What is 3057686.866 rounded to the nearest 100? 3057700 What is 17916.72787 rounded to the nearest 10? 17920 What is -1568703078.3 rounded to the nearest ten thousand? -1568700000 Round 60666600.7 to the nearest 1000000. 61000000 Round 99359049020 to the nearest one million. 99359000000 Round -0.355822402 to two dps. -0.36 Round 2.2119927 to one dp. 2.2 What is -0.00000039122775 rounded to seven decimal places? -0.0000004 What is -0.1224370657 rounded to four decimal places? -0.1224 Round -1.896804147 to 1 decimal place. -1.9 What is -162.0633841 rounded to 2 decimal places? -162.06 What is 0.0000101564127 rounded to 7 decimal places? 0.0000102 Round 137208.756 to the nearest 10000. 140000 Round 70422738.02 to the nearest 100000. 70400000 What is 2791.142298 rounded to the nearest integer? 2791 Round 0.0133520488 to 5 dps. 0.01335 What is 85.2626757 rounded to the nearest 10? 90 Round 0.0001068579077 to 6 decimal places. 0.000107 Round 10410079.422 to the nearest one million. 10000000 What is -668963910 rounded to the nearest one hundred thousand? -669000000 What is -284.39649 rounded to 0 dps? -284 Round 2266.03539 to the nearest one hundred. 2300 Round -0.000004413981 to 6 decimal places. -0.000004 Round 0.0093454699 to six dps. 0.009345 What is -0.00474023024 rounded to 6 decimal places? -0.00474 What is -9.0562209 rounded to 1 dp? -9.1 Round -96.842945 to the nearest 10. -100 Round 1225754.7 to the nearest 10000. 1230000 Round -660680649.9 to the nearest 1000000. -661000000 Round -0.0012943345 to 3 decimal places. -0.001 Round -8303.588676 to the nearest 10. -8300 What is 128265.505 rounded to the nearest 10? 128270 What is -204141.4202 rounded to the nearest 10000? -200000 What is -0.56051365 rounded to four dps? -0.5605 What is 23933182.75 rounded to the nearest one million? 24000000 What is -13.6150614 rounded to the nearest integer? -14 What is -3.16199411 rounded to one dp? -3.2 What is 0.000081061696 rounded to seven decimal places? 0.0000811 What is 937541.76 rounded to the nearest one hundred thousand? 900000 Round 18.39233024 to one decimal place. 18.4 Round -0.0375233261 to five decimal places. -0.03752 What is -56296756060 rounded to the nearest 1000000? -56297000000 Round -0.380943212 to 1 dp. -0.4 What is -6367446.3 rounded to the nearest one thousand? -6367000 What is -1.4774229 rounded to 1 dp? -1.5 Round -0.829868484 to two decimal places. -0.83 What is -64786096.6 rounded to the nearest 100000? -64800000 What is 0.719105258 rounded to one decimal place? 0.7 What is -10.3483766 rounded to the nearest integer? -10 Round -231.502446 to the nearest ten. -230 What is -63539.1805 rounded to the nearest ten? -63540 Round -637226.57 to the nearest one hundred thousand. -600000 Round 4386932.163 to the nearest one hundred. 4386900 What is 0.173925618 rounded to two decimal places? 0.17 What is 103656.1459 rounded to the nearest 100? 103700 What is 0.0246584103 rounded to 3 decimal places? 0.025 Round -1717173 to the nearest one thousand. -1717000 Round 0.00025408477 to four dps. 0.0003 Round -3056154.02 to the nearest one hundred thousand. -3100000 Round -1853623.2 to the nearest one million. -2000000 What is 86837.798 rounded to the nearest ten thousand? 90000 What is 0.0682075437 rounded to 2 dps? 0.07 Round -210.3195 to two dps. -210.32 Round -8767.83303 to the nearest 10. -8770 Round -5627276.51 to the nearest one hundred thousand. -5600000 What is -4286.20839 rounded to the nearest 10? -4290 Round 12.44869328 to zero dps. 12 Round -23.2671667 to one decimal place. -23.3 What is 0.216449823 rounded to 5 decimal places? 0.21645 What is -1000666.46 rounded to the nearest one thousand? -1001000 What is 41990.5105 rounded to the nearest ten thousand? 40000 What is 17876744650 rounded to the nearest one million? 17877000000 Round -11687.2397 to the nearest 1000. -12000 Round -0.0000047239226 to 7 decimal places. -0.0000047 Round -100.981268 to one dp. -101 What is 0.0000162968082 rounded to 6 dps? 0.000016 Round -0.0000049958631 to 7 dps. -0.000005 Round -732.62962 to the nearest 10. -730 Round 398928412 to the nearest 100000. 398900000 What is 0.0084843414 rounded to 6 decimal places? 0.008484 Round -6643150.5 to the nearest 10000. -6640000 Round -254485230 to the nearest one hundred thousand. -254500000 What is 109942.63564 rounded to the nearest one thousand? 110000 What is -0.0001586188015 rounded to 6 dps? -0.000159 What is 1.353143786 rounded to 2 decimal places? 1.35 What is 23.439896803 rounded to four dps? 23.4399 Round 3780796.299 to the nearest one million. 4000000 Round 1077186.81 to the nearest 100. 1077200 What is -5392.20187 rounded to 0 decimal places? -5392 Round -9.005817095 to the nearest integer. -9 Round 0.022215023 to four dps. 0.0222 Round -412.479998 to the nearest 10. -410 Round 1801.644 to the nearest 10000. 0 Round 2376.252023 to the nearest integer. 2376 Round 5140.3202 to the nearest integer. 5140 Round 3.090363321 to one decimal place. 3.1 What is 0.0115337541 rounded to 4 decimal places? 0.0115 What is 0.00094715098 rounded to seven dps? 0.0009472 What is -0.0001519472897 rounded to seven dps? -	{ "pile_set_name": "DM Mathematics" }
earest to -0.718 in -3/5, 60, -4, 5? -3/5 Which is the nearest to -1? (a) 2 (b) -0.56 (c) -12 (d) -1 d Which is the closest to 0? (a) 0.3 (b) -261 (c) 2 (d) 0.06 d Which is the closest to -1? (a) -18.7 (b) -10 (c) -0.1 c Which is the nearest to 0.1? (a) 3/11 (b) -3 (c) 13 a Which is the closest to 0? (a) -0.5 (b) 0 (c) 76/17 b What is the nearest to 0.905 in -0.08, 0.3, -0.07? 0.3 What is the closest to -2/3 in 0.4, -3, -0.3, -221? -0.3 What is the closest to -1 in 131, -12/79, -5? -12/79 Which is the nearest to 5/22? (a) -0.3 (b) -0.13 (c) 1/5 (d) 1/4 d Which is the closest to 0.1? (a) -0.51 (b) 10/7 (c) 2/11 c Which is the nearest to 3? (a) -1/3 (b) -2/691 (c) 3 (d) -2/5 c What is the nearest to 4/7 in -1/37, 42, 2/9? 2/9 Which is the nearest to 4987? (a) 2/3 (b) -6 (c) -1/5 a Which is the closest to -4? (a) 2/9 (b) -1/4 (c) -1110/7 (d) 2/7 b What is the nearest to -12 in -3, 352, 9, 0.4? -3 Which is the closest to 2? (a) -2 (b) -1 (c) -1/145 (d) 1 (e) -3/4 d What is the nearest to -2 in 3, -1/3, 3/2, 7.08? -1/3 Which is the nearest to -0.041? (a) 2 (b) 0.4 (c) 1/4 (d) -1 c Which is the nearest to 4/7? (a) 20 (b) 3 (c) -10 (d) -1/7 (e) 5 d Which is the nearest to -0.3? (a) 1/4 (b) 7/2 (c) -6 (d) -1425 a What is the closest to -0.1 in 0.6, 1968, 0, 1/3? 0 Which is the nearest to 1? (a) -1/15 (b) 1403 (c) 2/9 c Which is the nearest to 52? (a) -17 (b) 0.07 (c) 5 c Which is the nearest to -43? (a) 52 (b) 2 (c) 0 (d) -1/3 (e) 2/11 d What is the closest to 14 in -1, -22/9, -10/9? -1 Which is the closest to -1/4? (a) -509 (b) 1/2 (c) 3 b What is the closest to 0 in -2, 1, 2/4981? 2/4981 What is the nearest to -1/96 in -2/9, -1/5, 1, 1/7? 1/7 What is the nearest to 0.1 in -0.08, 0.5, -0.5, 0.03? 0.03 Which is the closest to 1? (a) -1 (b) 0.1 (c) -1.818 b What is the closest to -4 in 1/14, 0, -2/21, 0.9, -0.5? -0.5 What is the closest to -3/8 in 1/2, 0.14, 0, 2? 0 Which is the nearest to -128? (a) -0.5 (b) -0.4 (c) -0.6 c Which is the closest to 127? (a) -13 (b) 1/5 (c) 2/5 (d) -3 c Which is the nearest to 2/5? (a) 4 (b) 0.2 (c) -26 (d) 2/7 d What is the nearest to -36 in -2/13, 1/3, 2/7? -2/13 Which is the nearest to 19? (a) 2/77 (b) 2/9 (c) -43 b Which is the nearest to -0.2? (a) -4 (b) 5 (c) 9 (d) -56/3 (e) 0.4 e What is the closest to 1/6 in 2/3, 2, -12/25? 2/3 Which is the closest to -0.1? (a) 449 (b) -1 (c) 0.255 (d) 0 d Which is the nearest to -1? (a) 4/41 (b) -583 (c) 0.5 a What is the closest to 0.1 in -11, -188, 19, 1/2? 1/2 Which is the closest to -72302? (a) -15 (b) -1 (c) -4/3 a What is the nearest to -0.3 in -0.39, -21, 0? -0.39 Which is the closest to 655? (a) 0.11 (b) 9 (c) 1/7 b What is the nearest to 3 in -0.06, 0.1, -2.05? 0.1 Which is the closest to -1/3? (a) -0.4 (b) 0.562 (c) -29 a What is the closest to -1.5 in 1/8, 1, -3? -3 Which is the closest to -0.3? (a) 47 (b) -4 (c) 2/9 (d) 0 (e) -1/6 e Which is the closest to 1/2? (a) 0.34 (b) -1 (c) 2/17 (d) 86 a Which is the nearest to 0? (a) -10/7 (b) 6/7 (c) 1/5 (d) 23 c Which is the nearest to 135? (a) 2/5 (b) -10175 (c) -2/5 a Which is the nearest to 24? (a) 3/5 (b) 0.27 (c) 6/5 c Which is the nearest to 1? (a) -5 (b) 2863 (c) 4/3 (d) -1 c What is the nearest to 2/5 in -7, 174, 9, -1/3? -1/3 What is the closest to -0.3 in 120, 0.3, -1650? 0.3 What is the nearest to -0.3 in -3, -0.05, -0.064? -0.064 What is the nearest to 0.3 in 2/21, -5/8, 4/27, 0? 4/27 What is the closest to 13/5 in 5, -13, 0.09? 5 Which is the closest to 0.05? (a) -1.9 (b) 0.16 (c) 1 b What is the closest to 14.2 in -12, 0.11, -5? 0.11 What is the nearest to 1 in 2.7, -2, 3/74, -4? 3/74 What is the closest to 0 in -0.2, -11, -2925, 2/9? -0.2 What is the closest to 1/4 in -1/4, -123/5, 2/15? 2/15 Which is the closest to -1? (a) 0.4 (b) -295 (c) 565 (d) -5 (e) 5 a Which is the closest to -2/9? (a) -119/4 (b) -1.2 (c) 3 b What is the closest to -1 in -287, -1, -0.3, 1/2, -14/3? -1 Which is the nearest to 0? (a) -1 (b) 4 (c) 1789 (d) -2/9 (e) 1/9 e What is the nearest to 328 in 5, -2, -15/11, 0.5? 5 What is the closest to -2/9 in 0, 0.4, 8, 2, 67? 0 Which is the nearest to 1? (a) 8 (b) 259 (c) -1 c Which is the closest to -2/7? (a) 3/55 (b) -0.5 (c) 0.09 b Which is the nearest to -0.2? (a) -1/613 (b) 35 (c) 4/5 a Which is the nearest to -2/9? (a) 594 (b) -2/45 (c) 1/5 b What is the closest to -0.2 in -24/13, -50, -0.1, -2/15? -2/15 Which is the nearest to -4/27? (a) -0.5 (b) -7 (c) 49 a Which is the closest to -7/5? (a) 12 (b) -2/15 (c) -7 (d) 6 (e) 0 b What is the closest to -459 in 4, -3/4, 91? -3/4 What is the nearest to 18 in -1/6, -5, -0.05, 4, -2/5? 4 Which is the closest to -1/6? (a) -2/3 (b) -3/2 (c) -8 a Which is the closest to -0.09? (a) 22084 (b) -4 (c) -1/2 (d) 1 c What is the closest to -0.1 in 0.054, 1402, 1/5? 0.054 What is the nearest to 2/11 in 398, 0, -3/4, 3, -3/10? 0 What is the closest to 2/3 in 0.2, -0.03, 0.017, -4? 0.2 Which is the closest to -0.1? (a) -25 (b) 53 (c) 17 c Which is the nearest to -5? (a) -2/7 (b) -119 (c) -49 a What is the nearest to 6 in 0.3, -11, 1/126, 0.2? 0.3 What is the nearest to 2/11 in 2/409, -4, -5? 2/409 What is the closest to 2 in 43, -5, 1, 4.3, 2? 2 Which is the closest to -6? (a) 0 (b) 0.299 (c) 3 a Which is the closest to 1? (a) 0.1 (b) 5 (c) 4822 (d) -4 (e) 4/5 e What is the closest to -2/7 in 137, 12, -5/3, -0.2? -0.2 What is the closest to -1 in 0, -2810, 1/4? 0 Which is the nearest to -0.3? (a) -1811 (b) 0.6 (c) -1/8 c Which is the closest to -4? (a) -0.28 (b) -0.5 (c) 0.088 b Which is the nearest to 0.1? (a) -1 (b) -14/11 (c) 1/7 (d) -0.1 c Which is the nearest to 2? (a) -222/5 (b) 33 (c) 0 c What is the closest to 1 in -0.1, -0.137, 1, 0.4, -9? 1 What is the nearest to -1 in 78, -2/465, 11? -2/465 Which is the nearest to 0.2? (a) 0.03 (b) 6 (c) -1 (d) 11 a What is the closest to 1 in 17, -234, 0.14, -2? 0.14 Which is the nearest to 0.1? (a) 3 (b) 10449 (c) -0.1 (d) -5/2 c What is the closest to 0 in -1/4, -4, -0.04, 79? -0.04 What is the closest to 1 in 3/2, -0.04253, 2? 3/2 Which is the nearest to -0.9? (a) -4 (b) 0.1 (c) 1 (d) 18 (e) 3/2 b Which is the closest to -0.1? (a) -0.5 (b) -57 (c) -2/11 (d) -13 (e) -2 c Which is the closest to 0.3? (a) 33/4 (b) -0.5 (c) 4 (d) 1/66 (e) 0.3 e What is the nearest to 9/4 in 4, -5, -0.1, 3/7, -1? 4 What is the nearest to 5 in 4, 5, 57, -33, 3/2? 5 What is the nearest to -3/28 in 0.6, -2/9, -0.3, 5? -2/9 Which is the closest to -0.1? (a) -0.145 (b) -1/2 (c) -7 (d) 2/7 (e) -11 a Which is the nearest to -5? (a) -0.014 (b) -3/7 (c) -1.4 (d) 5 c What is the nearest to -1 in -130, 0.013, 21? 0.013 What is the closest to 4/7 in -13/2, -6/43, -4? -6/43 What is the closest to 20 in -0.1, 3, 0.05, 0.2, 0.014? 3 What is the nearest to 0 in 3, 71.4, -5/3, 2/5? 2/5 What is the nearest to -2045 in 2/9, 0.2, 0.06? 0.06 Which is the nearest to -16? (a) -0.1 (b) -4 (c) -1 (d) -0.2 (e) 1 b What is the closest to 0.42 in -203, 0.6, 1? 0.6 Which is the nearest to 5/34? (a) -23 (b) -2/11 (c) 6 b What is the nearest to -21084/5 in -4, 0.2, 3/8, -2/7? -4 Which is the closest to -23? (a) 3 (b) 479 (c) 2 (d) 4 c Which is the closest to 0? (a) 0.015 (b) 2 (c) 5 (d) 2/187 d What is the nearest to 4 in -1, 2.4, -185, 1? 2.4 What is the closest to 0.1 in -0.09, -5, -2/1057? -2/1057 Which is the nearest to 2? (a) -0.01 (b) -0.4 (c) -3/5 (d) 1/5 d Which is the closest to -1? (a) 28019 (b) 3 (c) -3/5 c What is the nearest to 4 in 56, -1/2, -1, 0.1? 0.1 What is the closest to -12 in -62, -3, 2, 1? -3 Which is the closest to 0? (a) 4 (b) 524 (c) 2/7 (d) -5 (e) 3 c What is the closest to 1 in -0.2, -0.07, 1, -5, -168? 1 Which is the nearest to 1/2? (a) -3/8 (b) 0.5 (c) 0.1 b What is the nearest to -85 in -1/6, 1/11, -17? -17 Which is the nearest to -1? (a) 6 (b) -4 (c) -913 b What is the closest to -1 in 53, 0.2, -4/9, -0.39? -4/9 Which is the nearest to -3? (a) -0.2 (b) -1/3 (c) -50 (d) 3/8 (e) -5 e What is the closest to -0.1 in 0, 5207, 1/2, -5? 0 What is the nearest to 0.2 in 0	{ "pile_set_name": "DM Mathematics" }
, -2/3, -1/10 Let o(x) = 9x2 + 91x + 45. Let z be o(-12). Put -4, z, 0 in decreasing order. z, 0, -4 Suppose 4y = 0, -9 = -3s + y - 4y. Sort 2, s, -11, -3 in ascending order. -11, -3, 2, s Suppose 2t + 19 = 43. Suppose t = -4p + p. Let m = -211 - -210. Sort m, p, -3 in decreasing order. m, -3, p Let b(v) = 4v + 4. Let c(f) = 5f + 5. Let s(i) = 6b(i) - 5c(i). Let q be s(-5). Sort -1/5, q, -5 in descending order. q, -1/5, -5 Let x(q) = -q3 - 20q*2 + 5q + 91. Let v be x(-20). Sort 4, v, -2, 5. v, -2, 4, 5 Let i be 5/(15/(-9)) + -3. Let p be i/12 + 15/(-6). Sort 12, -5, p. -5, p, 12 Let y = 0.5 + 1.5. Suppose -6 = -8c + 34. Sort 0.2, 4, y, c. 0.2, y, 4, c Suppose 3 = -q + 1. Let o = 932 - 930. Sort -5, o, q. -5, q, o Let u be (2/(-42))/(1/(-2)). Let j = -1/14 - u. Let v = 1 - -3. Sort 1/3, j, v in increasing order. j, 1/3, v Let a be 42/((-16)/(-2)). Suppose 3m + 128 = -29m. Sort m, -1, a. m, -1, a Suppose 0 = -l - 5t + 6, -5l + 14 - 7 = 2t. Sort -1, 0, l, -2. -2, -1, 0, l Let c = -653 - -647. Sort -55, -5, 5, c. -55, c, -5, 5 Let x = 1488.2 - 1488. Let m be (-2)/8(-48)/(-156). Sort 3, m, -5, x in descending order. 3, x, m, -5 Let a = -75 - -75.4. Sort 0.6, a, -3/5, 1. -3/5, a, 0.6, 1 Let j(k) = k3 - k2 - 2k + 81. Let o be j(0). Let s = 88 - o. Sort 0.2, 2, 4, s in decreasing order. s, 4, 2, 0.2 Let j(w) = 2w - 4. Let i be j(3). Let x be i/(-11) + (-34)/(-66). Put -4, x, 2/39 in ascending order. -4, 2/39, x Let a = 10.009 + -10. Let q = a - -0.291. Let n(i) = -i*2 + 3i + 1. Let x be n(2). Sort q, x, -0.5 in decreasing order. x, q, -0.5 Let t = -0.1396 - 4.8604. Sort -18, 0, t, -4/5 in decreasing order. 0, -4/5, t, -18 Suppose -2v - 2u - 20 = -u, 3v = -5u - 16. Let s = -11 - v. Let x = 0 - 5. Put -3, s, x in descending order. s, -3, x Let n(w) = -w - 10. Let o be n(-7). Suppose 2i = 2d - 14, -2i + 2d - 16 = i. Let p be ((-8)/(-4) + i)/(-2). Sort o, 2, p in increasing order. o, p, 2 Suppose 7g - 12g + 10 = 0. Suppose 4 - 6 = ga + 4b, -3b - 12 = -2a. Put -1/4, a, -5 in descending order. a, -1/4, -5 Let q(r) = -r*3 - 8r*2 - 7r - 26. Let b be q(-7). Put -5, -4, b in descending order. -4, -5, b Let z = -3.05 - 0.85. Let v = z + -0.1. Let o be (-1)/(11/2 + 0). Put v, -0.3, o in descending order. o, -0.3, v Let u = -2.4 - -4. Let f = u + -2.6. Let g = 0 - f. Sort 0.2, -5, g in ascending order. -5, 0.2, g Let v(a) = -a*3 + 12a*2 + 21a - 257. Let f be v(12). Put 22, f, -3 in ascending order. f, -3, 22 Let d = 10.13 + -10.63. Sort 0.2, d, -1, 4/55 in ascending order. -1, d, 4/55, 0.2 Let j be 2 - 1 - (0 - -7). Let u be 8/j - (-2)/6. Suppose -22 = -2t + 5y, -5y = -5t - 8y - 7. Put t, 3, u in decreasing order. 3, t, u Suppose -32 = -12i - 20. Let w = -4 + 4. Put i, 29, w in descending order. 29, i, w Let f = -856 - -855. Let q(s) = -s - 4. Let a be q(-5). Let y be (-5)/(-2)8/(-4). Sort y, f, a in ascending order. y, f, a Suppose 64 = -5u + 4b + 24, -5u - b - 15 = 0. Let q be (-22 + 22)/(-1(-2 - u)). Sort -4, q, 5 in decreasing order. 5, q, -4 Let t = 159.4 + -159. Let q = -8 - -7.9. Put t, -3, 3, q in decreasing order. 3, t, q, -3 Suppose 5h - 5c = 0, 8h = 5h + 4c - 1. Put 2, 38, h in descending order. 38, 2, h Let i = 24 - 19. Let j be (-12)/16 + 1/(-4). Put -2, j, i, -3 in decreasing order. i, j, -2, -3 Let h(a) = -a - 6. Let m be h(-6). Suppose -15o - 2 = -13o. Let p be (-3)/(-2)(-28)/(-21). Sort o, m, p. o, m, p Let s = -670 + 670. Let c = 51 + -36. Let y = -10 + c. Put -4, s, y in increasing order. -4, s, y Suppose h - 7 = -2c - 2c, -4h + 3c + 85 = 0. Put h, -5, 3 in increasing order. -5, 3, h Suppose -10 = 2v, 3j + 2j + 4v = 0. Put j, 37, -1, -5 in ascending order. -5, -1, j, 37 Let a be 0 + (-4 - (7 - 8)). Let z(i) = i2 + 7i. Let f be z(-7). Sort a, f, -4, 2 in ascending order. -4, a, f, 2 Let v = -5.7 - -0.7. Let a = -8.37 - -2.37. Put -2, v, a in increasing order. a, v, -2 Let a(y) = y*2 + 16y + 45. Let d be a(-11). Put -1, -2, 2, d in descending order. 2, -1, -2, d Let f = 123 + -119. Sort 0.5, 3, -0.2, f in increasing order. -0.2, 0.5, 3, f Let w = -1.75 - -0.75. Suppose 5x = 4x - 31. Put 2, w, x in increasing order. x, w, 2 Let w = 295678451/10780 + -109713/4. Let y = w - -1/245. Put -1/3, y, -1 in ascending order. -1, -1/3, y Let f(x) = -x*3 - 10x*2 + 6x + 63. Let n be f(-10). Put 13, 0, n, -11 in descending order. 13, n, 0, -11 Suppose 1097 = -4i - 627. Let z = 7325/17 + i. Let g be (0 - 1)/((-11)/(-2)). Sort z, -1, g in ascending order. -1, g, z Let n be (-4)/8 - (-12)/24. Put 27, 5, n in ascending order. n, 5, 27 Let u = -0.0639 + -4.9361. Put u, -1/3, -118 in ascending order. -118, u, -1/3 Let w = -2 + -1. Let s = -2 + 6. Suppose -3p = -g - 9, -39p + 41p = 6. Put w, s, g in descending order. s, g, w Let c be 10 + 6 + 5/(-1). Put -5, 1, -4, c in ascending order. -5, -4, 1, c Suppose -12 - 33 = 3p. Let o = 18 + p. Sort 8, -5, o. -5, o, 8 Let b = -898 - -893. Sort b, -2, 0.4. b, -2, 0.4 Let p = -209 + 1879/9. Suppose 5r = -47 + 522. Let k be r/(-247)4/10. Put k, p, 0 in decreasing order. 0, k, p Let v = 4.191 - 0.191. Put 3, -3, v, 0.5 in descending order. v, 3, 0.5, -3 Let z = -4.9 - 0.1. Suppose 242 = -2x + 2f + 250, -4x + 2f = -12. Sort -4/7, x, z, 0.1 in decreasing order. x, 0.1, -4/7, z Let t = 783 - 783.2. Sort 8, t, -3 in increasing order. -3, t, 8 Suppose 4u - 52 = 8. Suppose y + 56 = 2h, -4h - 68 = -6h + 4y. Let z be h/(-6) - (-20)/u. Sort z, -1, 1 in descending order. 1, -1, z Suppose 4r + 3z - 71 = 0, 3z = 4r - z - 64. Sort 0, -3, r. -3, 0, r Let y = 192 - 200. Sort 5, y, -2 in increasing order. y, -2, 5 Suppose -2j - 5 = -j + y, -43 = 3j - 4y. Put 1, 4, j in ascending order. j, 1, 4 Let p(f) = -f + 7. Let v be p(5). Suppose -2 - v = o. Suppose 0 = -5q - 0q - 5. Sort o, 1, q in decreasing order. 1, q, o Let f = 0.52 - -4.48. Sort 1, -1, f, 0.4. -1, 0.4, 1, f Suppose 96f = 91f - 15. Sort 1, f, 0. f, 0, 1 Suppose 45 = -0x - 9x. Let a = 333.86 - 331. Let l = a - -0.14. Put x, -1, l in decreasing order. l, -1, x Let c = -18 - -30. Suppose 3j + j + c = 0. Let t be 14/(-35) + 16/(-10). Sort 3, t, j. j, t, 3 Suppose 130 = -2m + 42. Let u = m + 45. Suppose 3s = -0s + 15. Sort -3, s, u. -3, u, s Let n be (2/(-4))/(6/(-60)). Suppose 13 = nm - 22. Put 4, m, 3 in increasing order. 3, 4, m Let g(i) = -6i - 117. Let v be g(-20). Let o(f) = 5f*2 - 3f - 3. Let y be o(-2). Suppose 4k = -s + k + 7, 2k = 3s + y. Put v, s, 2 in ascending order. s, 2, v Let v(k) = -k2 + 5k + 11. Let l be v(7). Let p be -3 - ((-35)/5 - l). Let j = -4.96 + -0.04. Sort -4/7, j, p in decreasing order. p, -4/7, j Suppose 3p + 3 - 5 = 2y, -3p = -12. Let j = 111 + -97. Suppose 0 = 6k - j - 10. Put y, k, 1 in descending order. y, k, 1 Let g be (-3)/9 - 2/(-9). Suppose 5 = 6u - 7. Sort 0.1, g, u in descending order. u, 0.1, g Let x be ((-28)/28)/(2/2). Let j be 2 + x + -17 + 19. Put j, 5, -1 in increasing order. -1, j, 5 Let u(k) = k + 9. Let n be u(-7). Suppose -nj - j = -5r - 9, 19 = -5j - 3r. Suppose -c = -3q + 11, -5q = -3q - 4c - 24. Put q, 5, j in descending order. 5, q, j Let g = -1.46 - 1.54. Sort 0, 0.1, 1/2, g in increasing order. g, 0, 0.1, 1/2 Let s = 0.06 + 0.74. Let y be 7 - (-7 + 114/8). Sort s, y, 3 in decreasing order. 3, s, y Suppose -2a + 4 = 2c, -6c + 13 = -a - 2c. Sort a, 25, 3, 1 in descending order. 25, 3, 1, a Let v(x) = -4x - 4x - 7 - 7x2 + 8 + x3. Let b be v(8). Let q be (1/1)/(b/(-2)). Sort -1, q, 2 in ascending order. q, -1, 2 Let m = -9 + 0. Let n be 03/m-1. Let d be -1 + 1 + (-5)/(25/15). Put n, -5, d in ascending order. -5, d, n Suppose -3c + 3y = -12, 4c - y + 2y = -4. Suppose -4u - 5x - 4 = -2x, 8 = -2x. Sort 5, c, u. c, u, 5 Let s = 145 - 150. Put -90, s, -3 in increasing order. -90, s, -3 Suppose 5j + 9 = 29. Let p = -18 + 12. Sort j, p, -5 in descending order. j, -5, p Let b = -3690 - -11074/3. Let v be (2/4)/((-7)/(-4)). Put 4, -5, b, v in decreasing order. 4, b, v, -5 Let g = -2 + 3. Let c = -22 - -24. Suppose 0y + 4y = -5r + 30, -r + 12 = cy. Sort g, 9, r in descending order. 9, r, g Suppose -4 = -0t - t. Suppose t*j + 18 = -10. Let x be 0/7 + 1 + j. Put x, 3, -1	{ "pile_set_name": "DM Mathematics" }
, 2/9, -0.1, -3 in descending order. 4/15, 2/9, -0.1, -3 Put 70, 4, 0, 1, 3 in ascending order. 0, 1, 3, 4, 70 Put 1, -4, 35 in descending order. 35, 1, -4 Put -13547, -0.1, 2 in descending order. 2, -0.1, -13547 Sort 5.1, -0.3, 2/7 in descending order. 5.1, 2/7, -0.3 Put -2, -8, 0, -9, -6 in descending order. 0, -2, -6, -8, -9 Sort 2, -1, -60 in decreasing order. 2, -1, -60 Put -0.2, -2/11, -2/5 in descending order. -2/11, -0.2, -2/5 Put 1/7, 2/9, 39/5 in ascending order. 1/7, 2/9, 39/5 Sort -1, -254, -2/9, -0.1 in increasing order. -254, -1, -2/9, -0.1 Sort 28, 4, 5 in descending order. 28, 5, 4 Sort 36, 0, -3 in descending order. 36, 0, -3 Sort -8, 40, 3. -8, 3, 40 Sort -8, -0.01, -5 in increasing order. -8, -5, -0.01 Sort -1, -8, 4, -29 in decreasing order. 4, -1, -8, -29 Put 3, 2, -22, 39 in ascending order. -22, 2, 3, 39 Put -1/3, -5, 50, 2/11, 1 in descending order. 50, 1, 2/11, -1/3, -5 Sort 6, -4, -0.3, -60. -60, -4, -0.3, 6 Sort -5, 4, -4, -9. -9, -5, -4, 4 Put 10, 6, 1, -0.6 in ascending order. -0.6, 1, 6, 10 Put -9, 2/7, 3/10 in increasing order. -9, 2/7, 3/10 Put 1, -12, 13 in ascending order. -12, 1, 13 Sort 4, 5, 0. 0, 4, 5 Put -5, 2/7, -2, -1, -8.9 in increasing order. -8.9, -5, -2, -1, 2/7 Sort -10, 0, 5, -1, 1 in descending order. 5, 1, 0, -1, -10 Sort 4, 5, -1, -5. -5, -1, 4, 5 Put 4, -9, 10, -3 in increasing order. -9, -3, 4, 10 Put 3, 5, 37.4 in increasing order. 3, 5, 37.4 Sort 1, -0.4, -5/6, -0.2, -7/4. -7/4, -5/6, -0.4, -0.2, 1 Sort -3/7, -0.5, -4/3 in descending order. -3/7, -0.5, -4/3 Put -3, 50, 3, -1 in increasing order. -3, -1, 3, 50 Sort 338, -2, 1 in ascending order. -2, 1, 338 Sort 3, 8, 1, -26 in descending order. 8, 3, 1, -26 Sort -10, 113, -3, 5 in ascending order. -10, -3, 5, 113 Put 6, -5, -3 in decreasing order. 6, -3, -5 Sort 101, -3, 4, 0.3. -3, 0.3, 4, 101 Sort 1, 5, 3, -8 in increasing order. -8, 1, 3, 5 Sort -1, -39, 5, -3 in decreasing order. 5, -1, -3, -39 Sort 4, 55, -4 in increasing order. -4, 4, 55 Sort 0, 2, 22, -0.1 in increasing order. -0.1, 0, 2, 22 Sort 0.2, -0.2, 0.1, -3/2, 26. -3/2, -0.2, 0.1, 0.2, 26 Put -1, 0, -4288 in ascending order. -4288, -1, 0 Put 5, -0.4, 2, 13 in increasing order. -0.4, 2, 5, 13 Sort 3, -16, -2 in decreasing order. 3, -2, -16 Sort 1, -5, -89 in descending order. 1, -5, -89 Put 3, 2, 30 in decreasing order. 30, 3, 2 Put 29, -7, 18 in decreasing order. 29, 18, -7 Put -104, 1, -4, -2 in decreasing order. 1, -2, -4, -104 Put 5, 8, -1 in ascending order. -1, 5, 8 Sort 3, 5, 0, -1 in ascending order. -1, 0, 3, 5 Sort -5, 4, -64 in decreasing order. 4, -5, -64 Sort -1, 2, 1/7, 2/3 in increasing order. -1, 1/7, 2/3, 2 Sort -209, -1, -4, 1, -2 in decreasing order. 1, -1, -2, -4, -209 Sort -0.7, -52, -4/7. -52, -0.7, -4/7 Sort -4, -26, -70, 3. -70, -26, -4, 3 Sort 4, 8, -0.5, -3 in increasing order. -3, -0.5, 4, 8 Sort -109, -5, -1, 5. -109, -5, -1, 5 Sort 243, -1, 10 in decreasing order. 243, 10, -1 Sort -4, 0.1, 1, 3, -1/218 in decreasing order. 3, 1, 0.1, -1/218, -4 Put 0.6, -0.05, -4, -0.7, 0 in decreasing order. 0.6, 0, -0.05, -0.7, -4 Sort 2/3, 559, 5, 2. 2/3, 2, 5, 559 Sort -3, 3, -0.15. -3, -0.15, 3 Sort -1, 16, -1/7, -94, 0.2 in increasing order. -94, -1, -1/7, 0.2, 16 Sort -3, -3/4, 3/5, 2/7 in decreasing order. 3/5, 2/7, -3/4, -3 Sort 3, 45, -3. -3, 3, 45 Put -2, -1, 2, 5 in descending order. 5, 2, -1, -2 Put 5, -16, 0, -3 in increasing order. -16, -3, 0, 5 Put -2, -1/19, 4, 1 in increasing order. -2, -1/19, 1, 4 Sort -3, -1, -13, 10, 1 in increasing order. -13, -3, -1, 1, 10 Sort -1.4, 7, -3 in increasing order. -3, -1.4, 7 Sort 2/3, -2, -0.05 in decreasing order. 2/3, -0.05, -2 Put 3, 5, 0.5, -96 in descending order. 5, 3, 0.5, -96 Sort 3, 0.8, -0.03, 0.4 in increasing order. -0.03, 0.4, 0.8, 3 Sort -71, 5, -3 in ascending order. -71, -3, 5 Put 1, 2, 17, -2, 0 in ascending order. -2, 0, 1, 2, 17 Sort 19, -46, 1 in descending order. 19, 1, -46 Sort -0.1, 7, 0.5, -2/5, -2/67 in increasing order. -2/5, -0.1, -2/67, 0.5, 7 Sort 0.1, -3/7, 0.04, 5 in ascending order. -3/7, 0.04, 0.1, 5 Put -2, 0.3, -184 in ascending order. -184, -2, 0.3 Put -102, 0, 4 in increasing order. -102, 0, 4 Sort 6/7, 0.1, 3/8, 1/6, -30. -30, 0.1, 1/6, 3/8, 6/7 Sort -10, 2, -2, 0.3 in decreasing order. 2, 0.3, -2, -10 Sort 0.7, 17, -2 in decreasing order. 17, 0.7, -2 Put 2/3, 3, -2/3, 0.26 in increasing order. -2/3, 0.26, 2/3, 3 Put 2, 18, -4, -3, 0 in decreasing order. 18, 2, 0, -3, -4 Put 0.1, -2/13, -6, -21/2 in decreasing order. 0.1, -2/13, -6, -21/2 Sort 5, -5, 3/47 in descending order. 5, 3/47, -5 Put 2/5, 0.5, -5/2, 1/416, -1/3 in decreasing order. 0.5, 2/5, 1/416, -1/3, -5/2 Sort 3, -3, -78 in increasing order. -78, -3, 3 Put -3, 2, 4, -1576 in decreasing order. 4, 2, -3, -1576 Sort -0.2, -23, -4/9, -5 in decreasing order. -0.2, -4/9, -5, -23 Put 0.4, 251, 0.1, -1 in descending order. 251, 0.4, 0.1, -1 Put 0, 4468, -5 in ascending order. -5, 0, 4468 Put 0.1, 0.5, 2/3, -4, -2/13 in ascending order. -4, -2/13, 0.1, 0.5, 2/3 Put -72/7, 0.4, -3 in decreasing order. 0.4, -3, -72/7 Sort -12, -27, 4 in increasing order. -27, -12, 4 Sort -1, -3, -17, 4 in decreasing order. 4, -1, -3, -17 Sort -2, -1, -18, -13 in ascending order. -18, -13, -2, -1 Put -5, -1, 2/11, -2/13 in decreasing order. 2/11, -2/13, -1, -5 Sort 0.3, 3, 0.4, 0.0984, -1 in decreasing order. 3, 0.4, 0.3, 0.0984, -1 Sort 1.7, 2/3, -1/3, -12/5 in ascending order. -12/5, -1/3, 2/3, 1.7 Sort -1, 2/9, -0.4, -35, -1/5 in ascending order. -35, -1, -0.4, -1/5, 2/9 Sort 2.4, 0.1, 0.3, -1/7 in decreasing order. 2.4, 0.3, 0.1, -1/7 Put -4, -5, -14, 5 in descending order. 5, -4, -5, -14 Put 0, -6, -5/7, -3 in increasing order. -6, -3, -5/7, 0 Put 0.1, 1, -179, 5 in ascending order. -179, 0.1, 1, 5 Put -71, 4, -2, 5 in decreasing order. 5, 4, -2, -71 Put -4, -7, -5, 0 in decreasing order. 0, -4, -5, -7 Sort -184, -2, 2, -1 in ascending order. -184, -2, -1, 2 Put -4, 3, 5, -2 in decreasing order. 5, 3, -2, -4 Sort -5, 4, 13, -4 in increasing order. -5, -4, 4, 13 Put -4, 0.4, -2/5, 1327 in decreasing order. 1327, 0.4, -2/5, -4 Sort 0.5, -0.5, -9 in descending order. 0.5, -0.5, -9 Put 0, -114/53, 4, 2 in increasing order. -114/53, 0, 2, 4 Put 87, 0.2, -0.5, -0.1, -9 in descending order. 87, 0.2, -0.1, -0.5, -9 Sort -3, -0.2, 0.13, 4. -3, -0.2, 0.13, 4 Put 0, 6, -3, 5 in decreasing order. 6, 5, 0, -3 Sort -0.2, 7, -3, 0 in descending order. 7, 0, -0.2, -3 Put -2, 6, 9, -5 in decreasing order. 9, 6, -2, -5 Put -6, -1, -3, -5, -4 in decreasing order. -1, -3, -4, -5, -6 Put 3/4, 5, -6, -2/11 in decreasing order. 5, 3/4, -2/11, -6 Sort -1/6, 3, 1/5, -912, 5 in increasing order. -912, -1/6, 1/5, 3, 5 Sort -8, 6, 5, -2 in descending order. 6, 5, -2, -8 Sort 305, -0.5, -5 in increasing order. -5, -0.5, 305 Sort 0.5, -1, 5. -1, 0.5, 5 Put -126, 11, -3 in ascending order. -126, -3, 11 Sort 0.12, 4, 0.1, 1/5, -1 in ascending order. -1, 0.1, 0.12, 1/5, 4 Sort -2, 27, 0 in descending order. 27, 0, -2 Sort -32, -5, 0.1, -0.07 in increasing order. -32, -5, -0.07, 0.1 Sort 195, 5, 19 in decreasing order. 195, 19, 5 Sort 0.64, 5, 0.4, -3 in descending order. 5, 0.64, 0.4, -3 Sort -4, 2, -7, 4, 1. -7, -4, 1, 2, 4 Sort 2, -28, -2, -51 in decreasing order. 2, -2, -28, -51 Sort 1, -8, 2, -1. -8, -1, 1, 2 Put 5, 4, 52, -1 in decreasing order. 52, 5, 4, -1 Put 2, 3, 8, -5 in decreasing order. 8, 3, 2, -5 Put 57, -5, 2 in ascending order. -5, 2, 57 Sort -4, -20, 2 in descending order. 2, -4, -20 Put -5, -21, -12, 0 in descending order. 0, -5, -12, -21 Sort -1, -16, 16 in decreasing order. 16, -1, -16 Put 34, -1, 3, -7 in increasing order. -7, -1, 3, 34 Sort 0.3, -1/4, -37, 2/7 in descending order. 0.3, 2/7, -1/4, -37 Put -0.5, -2/13, 0.1, 0.18, 0 in decreasing order. 0.18, 0.1, 0, -2/13, -0.5 Sort 6, 3, -70. -70, 3, 6 Put 3, 1, -1, 2/3 in descending order. 3, 1, 2/3, -1 Put 5, -10, 2, 0 in ascending order. -10, 0, 2, 5 Sort 217, 5, -3, 4 in descending order. 217, 5, 4, -3 Sort -1, 1, -13, -2, 5. -13, -2, -1, 1, 5 Put 184, -17, -2 in decreasing order. 184, -2, -17 Sort -5, -0.3, -0.1, 12 in decreasing order. 12, -0.1, -0.3, -5 Put 2, -4, 1, -3 in descending order. 2, 1, -3, -4 Sort 0, -3, 3, 13 in ascending order. -3, 0, 3, 13 Sort 2, 142, -5, -1 in increasing	{ "pile_set_name": "DM Mathematics" }
9. Suppose 2a + 40 - 5 = ql, -4l = 5a + 5. Is 13 a factor of (-587)/a - (-12)/(-30)? True Let f(c) = 4 + 2c2 + c - 2 + 3 - 3c. Does 12 divide f(4)? False Suppose 51r = 29122 + 49367. Is r a multiple of 27? True Let q(k) = 3k - 21. Let a be q(8). Suppose -119 = -o - r, ao - 358 = -2r - 0r. Is o a multiple of 15? True Suppose -2p = -5s + 2, 0 = -s - 0p + 5p - 18. Suppose -13650 = -49q + 14q. Suppose -q + 118 = -so. Does 34 divide o? True Let m(t) = 70t2 - 4t - 4. Let f(r) = r*2 + 7r - 19. Let x be f(-9). Is 7 a factor of m(x)? True Let b be 101/(25/(-16))-5. Is (b/36)/(-4) - 652/(-18) a multiple of 2? True Let i = 372 - 363. Does 9 divide i? True Let u be 0 + 2 + -1 + -12. Let c(k) = 10k - k2 + 2k*2 + 11 + 0. Is 11 a factor of c(u)? True Let v = 332 - 330. Let z = -108 - -155. Suppose -b + 25 = l, vb + 5l - z = -0b. Is 13 a factor of b? True Suppose -3f + a + 10 = 0, 3f - 22 = 4a - 0a. Suppose c = -4 + f. Is ((-6)/(-18))/(c/(-120)) a multiple of 8? False Let b(w) = w*3 - 4w*2 - w + 2. Let r be b(4). Let z be -3(15/9 + r). Does 9 divide -27(1 + z + -3)? True Suppose -120g + 112g + 456 = 0. Is g a multiple of 13? False Let y(w) = -23w - 17. Is 9 a factor of y(-7)? True Let l = 182 + -136. Is l a multiple of 11? False Let r(s) = 2s2 - s + 2. Let h be r(1). Suppose -440 = a - hb - b, 5b = a + 439. Is a/(-14) - (-2)/7 a multiple of 9? False Suppose 0 = -5q + 4q + 5, 4q + 335 = 5n. Let g = 137 - n. Is g a multiple of 11? True Let m be -1 + -1 - (-3 - 3). Suppose -146 = -s + mi, 0s + 3i = -s + 132. Is 45 a factor of s? False Suppose -99y - 11212 = -76948. Is y a multiple of 4? True Suppose 0 = 3g - 6g + 9. Suppose -gw + 61 = -59. Does 16 divide w? False Let q(f) = -5f + 5f*2 + 4f - 4f2 + f2. Let s be q(-1). Suppose 4o - st = 90, 3t = -3o + 65 + 13. Is o a multiple of 6? True Suppose 5k = 144 - 24. Let d(n) = n*3 - 24n*2 + 4n - 42. Is d(k) a multiple of 24? False Let d be 1098/(-8) + 22/88. Let r = d - -66. Let w = 119 + r. Does 13 divide w? False Let z = 23 - 37. Let o = z - -16. Is 8 a factor of 3/(140/64 - o)? True Let r be (-24)/((-3)/6). Let s be r-1 + (-7 - -10). Let v = -10 - s. Does 2 divide v? False Suppose 10i + 2941 = 14941. Is i a multiple of 7? False Suppose 7d - 1098 - 162 = 0. Does 10 divide d? True Suppose -s = 2s + s. Let h(n) = -n3 - n2 - n + 21. Is h(s) a multiple of 6? False Suppose 98 + 898 = 3z. Does 11 divide ((-4)/8)/((-2)/z)? False Suppose 2898 = 7b - b. Does 38 divide b? False Let r(o) be the first derivative of 3o*2/2 + 196o - 8. Does 19 divide r(0)? False Suppose 2l = -92 - 98. Let w = -48 - l. Is w a multiple of 12? False Let z(s) = -2s*2 + 73s + 34. Is 15 a factor of z(16)? True Let l(m) = -m + 25. Let j be l(0). Let s = j - -14. Suppose -3v = -4v + s. Is 17 a factor of v? False Let f(u) = -u*3 - 14u*2 - 5u + 58. Is 6 a factor of f(-17)? False Let y = -860 - -1484. Is 26 a factor of y? True Suppose 0g = -3p - 2g - 4, 4 = -2p - 2g. Is 1 + p + 7 + 46 a multiple of 9? True Suppose -2476 = -7x - 999. Is 9 a factor of x? False Let n(y) = 1097y - 256. Is 22 a factor of n(1)? False Let j(v) be the third derivative of -v4/24 - v3/3 + 9v*2. Let w be j(1). Is 15 a factor of ((-67)/w)/((-6)/(-18))? False Let w be -3 + 2 + -201 + (-2)/(-1). Let c = -136 - w. Does 16 divide c? True Let t be 23((-76)/24 + 3). Does 6 divide ((-657)/(-15) - 2) + t/(-5)? True Let s(w) = 2w + 6. Let n(y) = 5y2 - 7y - 9. Let l(u) = -3u2 + 4u + 5. Let r(j) = -7l(j) - 4n(j). Let g(v) = 4r(v) - s(v). Does 6 divide g(2)? False Let b(v) = 2v*2 + 5v + 139. Is b(27) a multiple of 94? False Let g be (-4)/((-7 - -2) + 4). Suppose 0 = q + gq - 20. Suppose qa - 9a = -105. Is a a multiple of 9? False Suppose -4g = -9g - 85. Let a = 19 + g. Suppose -6y + 48 = -ay. Is y a multiple of 9? False Let m = 589 + -533. Is 6 a factor of m? False Suppose 2k - 5k = 0. Suppose -4y + 9y - 20 = k. Suppose yh - 2n = 15 + 27, h - 5n = -3. Is 6 a factor of h? True Suppose 4n = 3n - 3m + 4, -5n = -5m - 80. Does 4 divide n? False Let z = 125 + -33. Suppose 6b - 2b - z = 0. Is 18 a factor of b? False Suppose s + 3x = 0, 2s + x + 10 = 30. Let q be (-4)/(-14) + s/7. Suppose 0 = i + qw - 18, -4i = w - 6 - 73. Is i a multiple of 10? True Let v(y) = 15y*2 + 15y + 50. Does 50 divide v(-6)? True Let w(s) be the second derivative of -45s3/2 + 3s*2 - 20s. Is w(-2) a multiple of 25? False Let u be (13 - 0)/((-9)/(-9)). Let l(q) = -q*3 + 14q*2 - 5q + 19. Does 20 divide l(u)? False Suppose s + 4a + 64 = 311, -1006 = -4s + 2a. Does 3 divide s? False Suppose 5j - 94 = 3b - 0b, 3b + 95 = 4j. Let v = 24 - b. Suppose v = -5d + 297. Does 26 divide d? False Let i(f) = f3 - 12f*2 - 8f - 9. Let r(y) = -6y3 + 61y*2 + 39y + 46. Let c(m) = -11i(m) - 2r(m). Does 14 divide c(-6)? False Let y(u) = -78u + 3. Let i(r) = -r. Let d(c) = 3i(c) + y(c). Does 15 divide d(-2)? True Let y = 5 + -9. Let z be -6(-2)/y-9. Suppose -4l + z = -33. Does 15 divide l? True Let x be 12/(-3) - 6/(-2). Is 2/x(-72)/16 a multiple of 5? False Let z be 0/(12/(-3) + 6). Suppose z = -v + 3v + 8. Is 16 a factor of 53 - (3 - 4)v? False Let u(l) be the third derivative of -l*4/24 - 2l*2. Let g be u(5). Let v(m) = -m - 2. Does 3 divide v(g)? True Suppose 0 - 8 = -2z - q, -4q = -2z + 18. Let a(u) = -u + u*3 + 3u - 3u2 - zu. Is 14 a factor of a(5)? False Suppose 12039 = 3k + 1485. Is 23 a factor of k? False Let a(q) = -2q*2 - q - 5. Let u be a(6). Let z = -28 - u. Is z a multiple of 15? False Let n = -95 + 99. Let u(y) = 7y*2 - 3y - 6. Is u(n) a multiple of 18? False Let z = 599 - 202. Suppose 675 = -2l + 7l - 5r, -3l - r + z = 0. Is l a multiple of 32? False Let p = -15 - -17. Suppose k + 47 = pm, 3k - 96 = -3m - 21. Let n = m - 19. Is n even? False Let c be ((-21)/(-6))/(2/20). Let q be 7/(c/20) - -47. Suppose -191 = -5m - q. Is m a multiple of 28? True Suppose -2o + 7 = -5. Let x be (o/(-7))/(3/84). Is 15 a factor of 50/(-4)x/6? False Let g = 13 + -9. Suppose gt - 6 = t. Suppose 4k - 126 = -0h + th, -k + h = -32. Does 8 divide k? False Let z(a) be the second derivative of a3/3 - a2/2 - 2a. Let p(f) = 4f - 3. Let l(x) = 2p(x) - 5z(x). Is l(-5) a multiple of 5? False Let j be (0 + 11)/((-12)/(-156)). Suppose -5k = -5a + 365, -a = -3a - k + j. Is 8 a factor of a? True Suppose 88v = 59v + 71514. Is 137 a factor of v? True Let w(u) = -2u - 6. Let z be w(-6). Suppose -21 = -j - zj. Is j even? False Let y(r) = -28r*3 + 4r*2 + 4r - 1. Does 38 divide y(-2)? False Let q(w) = 110 + 0w2 + 15 + 28 + w2. Is 17 a factor of q(0)? True Let r = 33 - 47. Let q(o) = o2 + 10o - 20. Does 11 divide q(r)? False Suppose 27 = 5o + 7. Suppose -3f = -3p + 60, -43 = -2p + of - f. Is 15 a factor of p? False Let f = -57 - -66. Let g(s) = -s3 + 10s*2 - 8s + 11. Is 5 a factor of g(f)? True Let b be 3/(1 + (-2)/8). Let i(w) = 2w - 22. Let u be i(12). Suppose 46 + u = bj. Does 12 divide j? True Suppose 4i + 514 = 2c, -c + 242 = -0c + i. Does 13 divide c? True Let p(d) = -d3 + 6d*2 + 6d - 1. Let t be p(6). Let a = t - 21. Does 7 divide a? True Let k(r) = r*3 + 2r*2 + r + 1. Let g be k(-2). Let n be 2 - (-2)/g - 17. Does 8 divide n(-7)/(7/2)? False Suppose -1929 + 7929 = 8c. Is c a multiple of 6? True Suppose 0 = 3x, -3b = -7b - x. Suppose 0 = -3d, -5s + bd - 4d + 240 = 0. Is s a multiple of 16? True Let d(p) = 3p + 245. Let z be d(0). Let x = z + -161. Does 12 divide x? True Let r be ((-520)/(-30))/(6/1359). Suppose -u = -14u + r. Does 22 divide u? False Let r = 4 + 94. Let y be 4/(-6) - r/(-3). Suppose 5z - 68 = y. Is z a multiple of 20? True Suppose -12 = -w - 2f - 0f, 4f + 36 = 3w. Let x = w - -12. Is 8 a factor of x? True Suppose s - c - 273 = 0, -233 = -s - 4c + 35. Is 46 a factor of s? False Suppose 2c + 3 = 7. Suppose -3s = 5y + 211, -s - cs - 170 = 4y. Let x = -11 - y. Does 15 divide x? True Suppose 3z - 3374 = i - 6i, 0 = 3z + 6. Is i a multiple of 13? True Suppose 16 = -4t + 5z, 7t - 2t = -z - 20. Let j = 10 + t. Is 17 a factor of (-5)/(-10) - (-297)/j? Fals	{ "pile_set_name": "DM Mathematics" }
5013 Convert -238a10 (base 13) to base 3. -1121001121200 What is 12200210122 (base 3) in base 14? 2cc09 Convert -20243114 (base 5) to base 8. -503041 Convert 16548 (base 10) to base 12. 96b0 Convert -323366 (base 9) to base 5. -22132014 21212112210010 (base 3) to base 4 33331120110 What is -70925 (base 11) in base 2? -11001010010110011 -1000101111110101001000 (base 2) to base 8 -10576510 Convert 27740671 (base 9) to base 8. 64270722 What is -342b25 (base 12) in base 13? -232ac0 Convert -106090 (base 10) to base 8. -317152 Convert 100130202300 (base 4) to base 13. b7c420 Convert 10101000110101010110100 (base 2) to base 10. 5532340 -22a8ab (base 13) to base 10 -823171 What is 3434451 (base 7) in base 3? 210210110020 What is 996b39 (base 12) in base 11? 1415873 Convert -35a7b (base 16) to base 15. -451b6 What is 11011110010011 (base 2) in base 7? 56323 -19058 (base 11) to base 15 -7d8d What is -1210101120102 (base 3) in base 11? -5a0690 Convert 10212102202210 (base 3) to base 11. 1184459 What is 161469 (base 10) in base 4? 213122331 39a882 (base 11) to base 8 2315052 134351054 (base 6) to base 7 32153662 -93443 (base 10) to base 8 -266403 Convert 203457 (base 10) to base 9. 340073 What is -21023033 (base 4) in base 9? -56488 547902a (base 11) to base 8 44536173 What is -1210113100 (base 4) in base 13? -115162 -3aa895 (base 12) to base 6 -32501505 Convert 412430551 (base 6) to base 3. 111102002021211 Convert 10781845 (base 10) to base 6. 1023031541 -16817 (base 9) to base 5 -332344 What is -2a323 (base 12) in base 15? -12826 What is -34123 (base 13) in base 3? -11210212021 Convert -78dd45 (base 15) to base 16. -580142 -2665084 (base 11) to base 3 -22122220112022 12304025 (base 7) to base 3 2002102112022 What is 70a69 (base 11) in base 14? 29b64 Convert 4262130 (base 7) to base 5. 113104442 Convert 323928 (base 13) to base 2. 100011111111000001011 2222020221000 (base 3) to base 10 1579689 Convert -acdbdd (base 14) to base 11. -335473a -10564116 (base 8) to base 13 -621386 Convert 82990 (base 16) to base 5. 114104203 Convert -351672 (base 8) to base 9. -202222 406204 (base 8) to base 5 13244101 -11202110112 (base 3) to base 10 -93650 Convert 32204616 (base 8) to base 5. 3230234401 Convert 116b6 (base 13) to base 4. 13302301 What is 2133112 (base 5) in base 2? 1000111100110001 Convert -604622 (base 12) to base 10. -1500794 Convert 1100110001111101000010 (base 2) to base 9. 6265717 What is 42345045 (base 6) in base 8? 4573065 -129eae (base 15) to base 11 -560a03 What is 31243415 (base 6) in base 2? 11011101101011100011 What is 103211002 (base 4) in base 7? 452542 What is 11110100011010011010 (base 2) in base 4? 3310122122 What is -6e84 (base 15) in base 7? -125404 Convert 1000101100110010110110 (base 2) to base 13. 61b0b1 2e3dd (base 15) to base 3 21120220201 Convert 3247522 (base 12) to base 10. 9551402 Convert 760104 (base 8) to base 13. 8b810 -1024055 (base 6) to base 8 -141743 What is 115cde (base 15) in base 9? 1504222 Convert -180734 (base 12) to base 3. -210010022211 Convert 80912 (base 10) to base 16. 13c10 Convert -176636 (base 9) to base 5. -12003434 What is b3273 (base 12) in base 6? 5001423 Convert 68a22 (base 11) to base 10. 99728 -10102110221101 (base 3) to base 7 -21320623 Convert -1110100100010010010100 (base 2) to base 4. -32210102110 1312220 (base 8) to base 10 365712 -222200220012021 (base 3) to base 11 -8011783 What is 31350213 (base 6) in base 14? 19bd3b Convert 111110011100011001111010 (base 2) to base 15. 168524e What is 1010210210 (base 3) in base 7? 122322 Convert -30242244 (base 5) to base 9. -410848 Convert 2b591 (base 16) to base 10. 177553 What is 1212120200120 (base 3) in base 13? 28b207 12100202100202 (base 3) to base 8 12674653 Convert 28900a (base 11) to base 5. 103414334 What is -2102003100 (base 4) in base 12? -24a240 114712 (base 12) to base 7 2234021 What is 363227 (base 9) in base 8? 653407 What is -1100000000001111 (base 2) in base 4? -30000033 What is 37774 (base 9) in base 8? 61514 What is 113423201 (base 6) in base 11? 1228293 -111000111010110110 (base 2) to base 15 -4912c 21b7212 (base 12) to base 4 120221131232 Convert 1133204400 (base 5) to base 12. a6b08a 13103023 (base 5) to base 11 88610 What is -eaa469 (base 15) in base 9? -23017400 What is 143155003 (base 6) in base 15? 3d56cc 20012211002011 (base 3) to base 13 8b8640 43253134 (base 6) to base 8 4710622 884c56 (base 14) to base 11 2678632 What is 30875 (base 13) in base 14? 23a79 Convert -1b7bc9 (base 13) to base 2. -10101011100110010011 -11292a (base 16) to base 9 -2103651 What is -10928 (base 14) in base 15? -bdb1 Convert 22102011221 (base 3) to base 9. 272157 Convert 3202222113 (base 4) to base 3. 1202011112110 What is 1402412 (base 5) in base 16? 6f42 What is 101000011101101101 (base 2) in base 14? 44589 -244b77 (base 12) to base 16 -8fd8b Convert -1568292 (base 10) to base 9. -2850256 130032 (base 8) to base 9 67751 Convert -25a573 (base 14) to base 12. -526189 What is 93817 (base 10) in base 4? 112321321 Convert -2202210000 (base 3) to base 10. -54513 -1d0ca5 (base 16) to base 6 -104445445 What is 1002222222202 (base 3) in base 16? 90293 What is 1211110012 (base 3) in base 9? 54405 -26241767 (base 8) to base 16 -5943f7 2066065 (base 8) to base 16 86c35 Convert -35654620 (base 8) to base 4. -131311212100 What is 1c752c (base 15) in base 6? 45454523 Convert -450044013 (base 6) to base 15. -aa7286 23937 (base 13) to base 6 1222120 1010111111101 (base 2) to base 5 140004 What is -9d903 (base 14) in base 11? -241989 430051 (base 6) to base 5 2110043 324660 (base 10) to base 13 b4a0b What is 3050104 (base 7) in base 4? 1121013031 -6095842 (base 10) to base 12 -205b82a 101111030 (base 4) to base 3 10121101012 Convert -1214555 (base 6) to base 16. -fc47 Convert -99468 (base 10) to base 14. -2836c 2030101231 (base 4) to base 12 238611 Convert -62c336 (base 16) to base 6. -350421142 -2a942 (base 13) to base 10 -80667 2700767 (base 11) to base 7 54464145 Convert -11a1 (base 16) to base 13. -2092 10000110011110000010111 (base 2) to base 11 253a573 Convert 1034443 (base 8) to base 5. 32324041 708314 (base 10) to base 16 aceda -40330 (base 13) to base 14 -2db94 2104460 (base 7) to base 14 68667 What is -1102130321 (base 4) in base 5? -41301341 What is -3858228 (base 9) in base 10? -2105540 Convert 215ec (base 15) to base 6. 2134340 Convert -5c3a6 (base 15) to base 11. -191258 -501737 (base 8) to base 12 -7b47b Convert -338c97 (base 16) to base 14. -63d251 -10000111010111110 (base 2) to base 3 -10112002001 101011011010001100 (base 2) to base 9 300810 2150 (base 8) to base 12 7a0 Convert 1001101000001011 (base 2) to base 5. 2230220 Convert -514940 (base 10) to base 12. -209bb8 What is 2504232 (base 6) in base 3? 20202122102 2d7449 (base 14) to base 8 6053351 What is -19731b (base 12) in base 5? -103314012 Convert -210233333 (base 4) to base 3. -21122111002 -41063 (base 16) to base 8 -1010143 What is 1325a (base 11) in base 5? 1101231 Convert 78740 (base 13) to base 11. 13a383 21122220022212 (base 3) to base 15 5569a8 What is -1672c9 (base 13) in base 5? -120333131 What is -125594 (base 14) in base 12? -264352 Convert 2719482 (base 11) to base 8. 21727111 110300112330 (base 4) to base 2 10100110000010110111100 What is 11010221102 (base 3) in base 5? 10102410 1051450 (base 6) to base 8 150426 -17767e (base 15) to base 13 -30b495 a9c6b7 (base 14) to base 16 57dd29 What is -12124400 (base 5) in base 14? -2d95c What is -6c338d (base 15) in base 8? -23572633 Convert 100200220201010 (base 3) to base 11. 2a01264 Convert -34151145 (base 7) to base 6. -143400050 What is 2a326 (base 14) in base 3? 12022212222 Convert -47cd7 (base 16) to base 5. -33402403 285cc (base 13) to base 9 124763 112000000021 (base 3) to base 12 113581 Convert -1183664 (base 9) to base 5. -131130314 Convert 11100100111000100101100 (base 2) to base 13. 1727a1c What is -42557 (base 10) in base 4? -22120331 -1435403335 (base 6) to base 15 -188908b 1044021 (base 7) to base 5 13104030 Convert 22332001200 (base 4) to base 2. 1010111110000001100000 121301230 (base 4) to base 16 19c6c Convert 1a6163 (base 13) to base 7. 5461221 Convert 29a4c (base 15) to base 6. 2512043 What is -1007333 (base 11) in ba	{ "pile_set_name": "DM Mathematics" }
equal to -5457847? False Which is greater: 1577756 or 1577757? 1577757 Which is smaller: 11789757 or 11789744? 11789744 Is 0 bigger than 5164/99317? False Which is greater: 288787 or 288973? 288973 Is 128695 at least 128678? True Does -120/11 = 86/353? False Which is smaller: -1 or 879/812957? -1 Is 28553874 less than 28553874? False Which is smaller: 11814 or 945103/80? 945103/80 Which is bigger: -25101 or -25161? -25101 Which is smaller: -31 or -2144.415? -2144.415 Are 43 and 18685433 unequal? True Do -2995 and -2231 have the same value? False Which is smaller: 2431524 or 40? 40 Which is smaller: 0 or 411/401267? 0 Is -18955905/17 less than -1115052? True Which is smaller: -2952/13339 or 1? -2952/13339 Is -198 at most as big as 72.7546? True Which is smaller: 23 or 4048202? 23 Which is smaller: -2811134 or -2811131? -2811134 Which is bigger: 42/251771 or 2/3? 2/3 Does -887842 = -888076? False Is -13901 <= -708928/51? True Are 146643 and -180/17 non-equal? True Is -481634/7657 > -64? True Which is smaller: 275011 or 0.042? 0.042 Which is smaller: -97/60 or -11222? -11222 Is 582900 at most as big as 582887? False Which is smaller: 779/43876 or 0? 0 Are -8256/3775 and -2 equal? False Which is greater: 2002363/12 or 166863? 2002363/12 Which is greater: 30701 or 30764? 30764 Is -160094 smaller than -160146? False Is -3/33196681 at most 1? True Is 38638128 at least as big as 347743144/9? True Is 14/1349359 at least as big as -1? True Is 402/2897 not equal to 1? True Is -74832/403 greater than -187? True Which is smaller: 2215518 or 2215517? 2215517 Is 71 <= 36211/502? True Do -1 and -512/28745 have different values? True Which is bigger: -6257328/71 or 0? 0 Are 1 and 10/55676479 equal? False Which is smaller: 279 or 94334? 279 Are -2 and -848.1443 equal? False Which is greater: -0.1 or 22327910/7? 22327910/7 Which is greater: 137 or -108071? 137 Which is smaller: 7 or -3649/276? -3649/276 Is 3547745 at most as big as 3547749? True Which is smaller: -8861 or -180.4? -8861 Which is smaller: -115848 or 139? -115848 Is -46.3837 less than or equal to 2/35? True Which is bigger: -254482 or -33? -33 Is -399553609 equal to -399553612? False Is 29 not equal to -537816? True Do -798 and -1106 have different values? True Is -1 <= 3/669943465? True Is 1 at least as big as 8/216554311? True Is 8323193 at most as big as -0.1? False Is -34 greater than -0.14313231? False Are 1269496 and 1269503 non-equal? True Is 95865 less than 95915? True Do -72837228 and -72837228 have the same value? True Which is bigger: 187848.1 or 0.03? 187848.1 Which is greater: 188037 or 188184? 188184 Is 5045/4369 at most 0.5? False Which is smaller: 1789932 or 1789928? 1789928 Which is bigger: -433/162969 or 1? 1 Which is smaller: -4/189027 or 36? -4/189027 Is -1 >= -2/32194309? False Is -323 greater than -1719/7? False Is 84.7 != 1338? True Which is bigger: 16129571 or 16129573? 16129573 Is 1 bigger than 9975272? False Is 2.3624584 smaller than -2? False Which is smaller: -61 or 19.64248? -61 Which is smaller: -938295 or -938330? -938330 Which is smaller: 36823 or 37335? 36823 Which is smaller: -93453/31 or -2? -93453/31 Do -28 and 2407917.2 have the same value? False Is 31263 less than 31784? True Is -57320 < -77882? False Is 141071 >= 140956? True Which is bigger: 4/7 or 0.986291? 0.986291 Are 151450 and 149969 non-equal? True Is -0.1 greater than or equal to 1668804.94? False Which is smaller: -7161214 or -7161217? -7161217 Are -798546 and -426 equal? False Is -1/2 < -4/611029? True Which is smaller: 787 or -133/837? -133/837 Is 3 less than -18639.2? False Which is greater: -364/595095 or 0? 0 Do -58/12788951 and 1 have the same value? False Which is bigger: 500013 or 44? 500013 Are 15865638 and 15865639 unequal? True Which is greater: -4228 or -4773? -4228 Which is smaller: -1/3 or 6245094? -1/3 Is 125971096 less than 125971097? True Which is greater: -9868535 or 7? 7 Is -0.07807 at least 3/14? False Is 11/16179633 at most -1? False Is -115589 equal to -809125/7? False Which is smaller: 181351753 or 0.1? 0.1 Is -1005566 != -1005858? True Which is smaller: -1361513584 or -1361513583? -1361513584 Are -1 and -1469/7092 equal? False Which is smaller: -3/19426652 or -1? -1 Is -1/6 bigger than -92/46239? False Which is bigger: 0 or 281932407? 281932407 Is 2256 at most as big as 2268? True Which is smaller: -52411 or -1729549/33? -52411 Are 92.859 and 59/19 equal? False Which is smaller: 6308177 or 6308176? 6308176 Which is smaller: -595/6 or 37987? -595/6 Which is bigger: -4033893 or -0.6? -0.6 Which is smaller: -2527028 or -2527025? -2527028 Which is greater: 208/666023 or 1? 1 Is -585/1813372 smaller than 0? True Which is greater: 7682468 or 46094801/6? 7682468 Which is smaller: -3/94601483 or -1? -1 Are -18184 and 2029 equal? False Is -5/3760639 > 0? False Which is smaller: 39.98 or -1896? -1896 Is -0.1745021 smaller than 1/20? True Is -42941 greater than -56.4? False Which is smaller: 743313 or 743351? 743313 Is -3/40 != 27677.67? True Which is greater: -2783665 or -25052990/9? -2783665 Which is greater: -1/20824584 or -1? -1/20824584 Which is smaller: 65880265 or 65880264? 65880264 Which is smaller: -22673662 or -22673661? -22673662 Which is bigger: -0.14771311 or -4? -0.14771311 Which is greater: 19449 or 20462? 20462 Which is smaller: -1101471 or -1101462? -1101471 Is 1032983284 less than 1032983284? False Which is bigger: 1 or 545/9992? 1 Is 528 at least as big as 24405? False Which is smaller: -68.1 or 58964? -68.1 Is 2120590 != 2120593? True Which is bigger: -759 or -43979/58? -43979/58 Which is smaller: -8848 or -23602? -23602 Is -78/4725397 smaller than 1? True Is -11768/5 at least -2595? True Is -64520 < -64505? True Is -107841 < 32? True Are -22364/1431 and -17 unequal? True Is -4643331 >= -23216658/5? True Is -1 at most 2/3217143971? True Is 1 at least as big as -1/2598867805? True Which is bigger: 67326 or 67358? 67358 Which is smaller: -4910 or -2047447/417? -4910 Which is smaller: 3.1 or 5/10523? 5/10523 Which is bigger: 1 or -205/174663? 1 Is -41027970 at most 0.1? True Which is bigger: -2183/9412 or 1? 1 Which is smaller: 1 or 2096/20453? 2096/20453 Is -282 at least as big as -342374/1215? False Do 1245107 and 23657026/19 have the same value? False Is 2/91420493 > -1? True Which is greater: 2967/2927 or 2? 2 Does -38510438 = -38510472? False Is 1 less than 24329641? True Which is bigger: 0.2 or 325936092? 325936092 Is 15584828 greater than or equal to 15584828? True Which is smaller: -4/934537805 or -1? -1 Is 31/8 > 5/11912? True Which is greater: 0 or 111/4788149? 111/4788149 Is -17226180 smaller than -17226182? False Which is smaller: 0.1 or -5177/4701? -5177/4701 Is -28995178 greater than -28995176? False Are 1267 and -888.2 non-equal? True Is -3557876 at least -3557871? False Is 965957 greater than -9/5? True Which is bigger: 11 or -0.06942831? 11 Is 46830/38839 at most as big as 2? True Are 1010 and 183/641 non-equal? True Which is bigger: 510 or -57/80? 510 Which is smaller: 22 or 21616/955? 22 Is 773329 bigger than -687? True Do -117713/550 and -213 have the same value? False Which is bigger: 34 or 76254? 76254 Which is smaller: 4 or -0.1284967? -0.1284967 Which is smaller: 123/146027 or 1? 123/146027 Is -42912/65 greater than or equal to -660? False Is -5/12 greater than 28/6479? False Are -407542064 and -407542064 non-equal? False Are 0 and -2/610090215 nonequal? True Which is smaller: 0.49 or -2718/131? -2718/131 Which is bigger: -1180/53707 or -1? -1180/53707 Which is bigger: -1530470 or -26017992/17? -1530470 Are 0 and -1574/35229 unequal? True Which is smaller: -16 or -56400/3757? -16 Which is smaller: -25805908 or -25805907? -25805908 Which is smaller: 7 or 45409/6021? 7 Which is greater: 14 or 9767/76? 9767/76 Are -553438 and -553432 nonequal? True Is 0.081 less than -1046174? False Which is greater: -328/563871 or -1? -328/563871 Is -19907 greater than 0.594? False Is 3814072 < 3814075? True Which is smaller: 11742/6569 or 2? 11742/6569 Are -5/133 and 4/665 non-equal? True Is -3.8 at least -9/3254? False Is -6/16980167 != 0? True Is 5312331 > 0.1? True Is -5823881/52 greater than -111997? False Are -2539198/17 and -149365 equal? False Does -1 =	{ "pile_set_name": "DM Mathematics" }
What is the tens digit of o(-8)? 5 Suppose -5u = 2x - 188 - 82, -5u - 270 = -2x. Suppose 3920 - x = 5i. What is the tens digit of i? 5 Suppose 4x - n + 54 + 1 = 0, x - 3n = 0. Let k = x - 45. Let p = k + 147. What is the tens digit of p? 8 Suppose 34 + 32 = 33b. Suppose 5a = -3s + 3425, 14a = 15a + bs - 692. What is the tens digit of a? 8 Suppose 4p = -3r - r - 112, 0 = -p - 2r - 29. Let g = -198 - p. Let y = g + 245. What is the tens digit of y? 7 Suppose 5995908 = 365t + 88t. What is the hundreds digit of t? 2 Let c be 15 - (8 + 0 + -3). Let w(i) = -i*3 + 11i*2 - 22i + 13. Let h be w(c). Let y = -79 - h. What is the tens digit of y? 2 Suppose 5p = 4v - 45, -2v + 19 + 1 = -2p. Suppose 0 = 3s - vu - 83, -2u = -s - 0u + 28. What is the units digit of (-19 - -1)(-169)/s? 7 Suppose -27027 - 8197 = -5d + 65146. What is the thousands digit of d? 0 Let f = 177 - -72. What is the units digit of -4 - f/(-9) - (-8)/6? 5 Suppose -2s - 14 = 0, 70r - 66r - 53953 = 3s. What is the hundreds digit of r? 4 Let w(g) = 270g + 11231. What is the ten thousands digit of w(0)? 1 Let j = 11704 - 11526. Let h = -38 - -10. Let q = h + j. What is the hundreds digit of q? 1 Let w = -2588 - -6328. What is the thousands digit of w? 3 What is the tens digit of 497/(6 - 56529/9441) - (-3)/(-39)? 0 Let z(d) = -22d - 107. Let l be z(-7). Suppose -467 = -48n + ln. What is the tens digit of n? 6 Let t = 28034 - -12553. What is the ten thousands digit of t? 4 Let y = -99 + 102. Suppose 2o - 314 = -3f, yf - 150 = -o - 2f. What is the units digit of o? 0 Let i = 755 + -759. Let y(o) = 9o + o3 + 4o*2 + 5 - 3o*2 + 11o*2. What is the tens digit of y(i)? 9 Suppose -5967v + 5976v - 3825 = 0. What is the tens digit of v? 2 What is the units digit of (-1)/1427340/(-10)? 4 Let d(b) = -5b - 14. Let y(r) = 2r + 7. Let q(p) = 6d(p) + 14y(p). Let a(c) = c*3 - 7c*2 - c. Let n be a(7). What is the tens digit of q(n)? 2 Suppose 0o = 4g + o - 810, -g - 4o + 195 = 0. Suppose 0 = -0m + 5m + 2s + g, 0 = 3m - 3s + 105. Let a = m + 82. What is the units digit of a? 3 Let i(h) = 47h*2 + 379h - 11440. What is the hundreds digit of i(34)? 7 Suppose 2d + 198 = c + 1366, -d - 4c = -566. Let p = d - 410. Suppose -7q + 11q - p = 0. What is the units digit of q? 3 Let f = 114 - 115. Let v be (3/(-6))/(f/302). Let y = -71 + v. What is the tens digit of y? 8 What is the ten thousands digit of 6/(-14) + (-672180)/(-28)? 2 Let u = 3262 - -1785. What is the thousands digit of u? 5 Suppose -2i = -227 - 753. Let f = 719 - i. Suppose w + f = 6w + 2c, 176 = 4w - 2c. What is the units digit of w? 5 Let i = 2107 + -196. What is the hundreds digit of i? 9 What is the units digit of (3/((-42)/(-619108)))/(3 + -3 + 2)? 1 Let j be 454699/56 + (-3)/(-8). Suppose -20b + 6b = -j. What is the units digit of b? 0 Let r be (2 - 1) + (-4 - -1). Let z(k) = -k3 - k2 - k - 3. Let a be z(r). Suppose x - 124 = -ax. What is the units digit of x? 1 Let n = -57360 - -82352. What is the units digit of n? 2 Let m(c) = 8c3 + 3c*2 - 17c + 28. Let t be m(4). Suppose 1472 = 4h - 2h. Let z = h - t. What is the tens digit of z? 1 Let j(b) = 164b2 - 5b + 139. What is the ten thousands digit of j(-9)? 1 Suppose 103709 = 5x + 12z - 14z, 0 = 3z + 21. What is the hundreds digit of x? 7 Suppose -2b + 3g = -26332, -52672 = -2b - 2b + 4g. What is the hundreds digit of b? 1 Suppose -32 + 907 = 7b. Let m = b + -6. What is the hundreds digit of m? 1 Let u = 9675 + -6436. What is the hundreds digit of u? 2 Suppose -5 = -5t + 5. Suppose -5r + 18 = -t. Suppose 3a - 267 = 3j - 8j, -176 = -2a - rj. What is the tens digit of a? 9 Let a(b) = -3b + 27. Let i(v) = -4v + 55. Let y(l) = -15a(l) + 6i(l). What is the hundreds digit of y(26)? 4 Suppose -8r = 2817 - 17689. What is the hundreds digit of r? 8 Suppose 0 = -441c + 440c + 863. Let a = c + -431. What is the units digit of a? 2 Let p(q) = -q*3 - 8q*2 + 23q - 12. Let n(h) = 3h3 + 2h*2 - 2. Let l be n(3). Suppose l = -8s + 9. What is the units digit of p(s)? 8 Suppose -3l = 3c - 4563, 2c + 3042 = 4c - l. Let g = c + -316. What is the hundreds digit of g? 2 Let p be 316/(-6)(-1 + 0). Suppose 1456 = po - o. Suppose 4l - 3l - o = 0. What is the tens digit of l? 0 Let w(k) = 2k*3 + 14k*2 + 27k - 8. Let s(p) = 3p3 + 15p*2 + 28p - 9. Let r(j) = -3s(j) + 4w(j). What is the tens digit of r(11)? 5 Let f(o) = 6o2 + 6o + 7. Suppose 6x - 3x - 2z + 15 = 0, -5z = -3x - 6. What is the hundreds digit of f(x)? 2 Let m = -28 - -32. Suppose -t = -my + 21, -3t = 3y - 6t - 27. Suppose -138 = -3o - 4g + 130, 349 = yo - 3g. What is the units digit of o? 8 Let y(c) = -3c*3 + 2c*2 - 4c + 39. Let w be y(-7). Suppose w = 188q - 185q. What is the hundreds digit of q? 3 Suppose 55 = 4f + l, -13l = -9l + 20. Suppose 20j - fj = 485. What is the tens digit of j? 9 Let y be (-4)/(-7) + 537/(-21). Let o(n) = n2 + 19n - 101. What is the tens digit of o(y)? 4 Suppose o - 6m + 3419 - 12673 = 0, -o + 9219 = m. What is the thousands digit of o? 9 Suppose u - 119638 = -4k, 4u - 59826 = -95k + 93k. What is the ten thousands digit of k? 2 What is the ten thousands digit of (589118/(-135))/(4 - (-75)/(-18))? 1 Let m = -9 + 42. Let x be (m - 0)(-4)/12. Let q = 100 + x. What is the units digit of q? 9 Suppose 21p - 396621 = 627255. What is the ten thousands digit of p? 4 Suppose -20 - 1 = -x + 3z, 3x - z = 71. Suppose -1360 = -4i - 2c, 20c = 3i + xc - 1020. What is the hundreds digit of i? 3 Let r = -85 + 101. Suppose -137 = rh + 215. What is the units digit of (1680/49)/(-8)(h - -1)? 0 Suppose 3q = 11f + 42638, 0 = 4q + 15f - 14f - 56741. What is the ten thousands digit of q? 1 Let y = -529 - -531. What is the tens digit of 525 + y/(-11) + (-93)/33? 2 What is the hundreds digit of (42/5)/(-1)(-586 + 156)? 6 Let d(f) = 7f + 44. Let l be d(-6). What is the units digit of (-15078)/(-54) - l/9? 9 Suppose -2k = -4m - 83356, 53k - 57k + 166772 = 4m. What is the tens digit of k? 8 Let z(y) = -4y*2 + 4y + 12. Let d be z(-2). Let q be d(-15)/20 + -4. Suppose qw - 1371 = -271. What is the units digit of w? 0 Let h be -3 + (0 + 20 - 11). Let m(j) be the third derivative of 19j4/24 - 19j*3/3 - 3j*2. What is the units digit of m(h)? 6 Let h = 1776 - 2970. Let x(g) = -7g - 24. Let u be x(-3). What is the hundreds digit of (uh/(-18))/(2/(-2))? 1 Let d(b) = 13b - 27. Let t(c) = -17c - 44 + 3c + 6c. Let x be t(-6). What is the tens digit of d(x)? 2 Let s = 54 + -53. Let i be 1(-2s + 7 + 0). Suppose 2g - 5g - 228 = -it, 0 = 5t + 2g - 248. What is the units digit of t? 8 Let m = -293 + -57. Suppose 0 = -2y - 5w + 1011, -4y - 5w = -2w - 1987. Let z = y + m. What is the units digit of z? 3 Suppose 5y + 3o = 40, -3o = 5y - o - 35. Let q be (-2)/4(-13 - -7). Suppose g + 202 = qg - 4k, g = -yk + 129. What is the units digit of g? 9 Let p = 20751 - 12176. What is the tens digit of p? 7 Let k = 29417 - 20907. What is the tens digit of k? 1 Let j be (-16)/(-6)19/(76/48). What is the units digit of (-304)/j14-7? 1 Let v = 84 - 84. Suppose vp - 12 = -2p + 3c, -4p - 4c = -4. What is the tens digit of ((-763)/28 - -1)/(p/(-8))? 7 Let k(m) = m3 - 9m*2 + 13m + 10. Let b be k(7). Suppose -w = -4a + bw + 28, 5a = 3w + 39. Suppose -13d + ad = -104. What is the tens digit of d? 2 Suppose -2d - d + 87 = 0. Let m(l) = -l2 - 47l - 277. Let o be m(-40). Suppose -oy = -t + d, 6t - 2y - 70 = 4t. What is the tens digit of t? 3 Let f = 30052 - 11033. What is the units digit of f? 9 Let t = -13968 - -19726. What is the tens digit of t? 5 Let a be (-9(-9)/405)/((-1)/(-36035)). What is the hundreds digit of (-2)/(-9) - a(-5)/45? 8 What is the tens digit of 6/((16/16144)/(-4(-4)/6))? 4 Let t(k) = 1086k*3 + 6k*2 - 5k. Suppose -3o - 34v = -33v - 4, 3o + 5v - 8 = 0. What is the tens digit of t(o)? 8 Suppose -59q = -44q - 5t - 83440, -t + 5572 = q. What is the units digit of q? 5 Let v(j) = j*3 + 20j*2 - 7j + 14. Let i(c) = c*3 + 23c**2 - c - 43. Let s be i(-23). What is the hundreds digit of v(s)? 1 Wha	{ "pile_set_name": "DM Mathematics" }
(-21) - 3) + 65/7)? -9 What is (48/(-20) + 7/5)2? -2 Evaluate (5 - 35)8/(-20) + -61. 6 What is the value of 4/((25/35)/(1/70))? 2/25 Calculate 184/(-483)14 - -6. 2/3 Evaluate (522/(-957))/(45/(-770)) + (-1)/3. 9 What is the value of 45/(-6)(4(-77)/(-66) + -2)? -20 What is (1 + -7)-511/(-55)? -6 (71/(994/588))/(-6) -7 (-9(-10)/(-630))/(1 + 0)-3 3/7 What is the value of ((-4476)/(-5595))/((-8)/(-70))? 7 What is 105/(-441) + (-28)/(-49)? 1/3 What is (417/(-6) - -41) + ((-6)/4 - -2)? -28 Evaluate 4351/1145 + 3/(-30)-12. 5 ((-18)/(-8))/((-33)/(-132)) + (-44)/4 -2 Calculate ((-138)/(-276))/(-73/282) + 7. 2/7 Calculate (-12)/(-51)83385/1090. 18 What is the value of -11 - 0/(-510/(-50))? -11 Calculate ((-5)/(-5))/(25/375) + 21. 36 What is the value of (28/6 - 5)/((-4 + 8)/(-144))? 12 Evaluate (4/18)/((-8)/30) + 4/8. -1/3 What is (((-1)/2 - 0)(-3)/6)/(-1)? -1/4 (0 + 2)/((-40)/(-100)) - (-17)/(-3) -2/3 Calculate 1704/(-11360)2/(-3). 1/10 What is (1/1)/(-24 - (-13775)/575)? -23 (18/(-14))/((-255)/(-2380)) -12 What is the value of -2(-4 + 3 + (0 - (-2 + -4)))? -10 What is (294/33 + -9)/1? -1/11 ((-47)/((-846)/(-693)))/((-21)/12) 22 Calculate (-31 - -1) + 782880/26040. 2/31 What is (-48)/3 - -12(-975)/(-468)? 9 Calculate (36/(-5))/((-1026)/(-135) + -8). 18 Evaluate (-30)/10(6 - -8)/(-5 - -2). 14 Evaluate 7/(-5) + ((-9656)/935 - -12). 3/11 What is (-5 - 312/(-63))/((-60)/45)? 1/28 What is 72/594 - 96/(-396)? 4/11 What is the value of 0 + (-9)/(72/(-20))2? 5 What is the value of 29(-20 + 14 + 5)? -29 What is the value of (-6 - (-117)/18)/(423/(-36))? -2/47 (1190/(-714))/(0 - (-5)/18) -6 Calculate (2/893)/(-26 + 18810/722). 2/47 What is -3 + (-38046)/(-7293) + (-2)/(-22) + -2? 4/13 Evaluate 2171/501 - ((-634)/138)/(-1). -6/23 -39/(378/266) + -15 -34 Calculate (3289/184 + -16)(-1)/(-5). 3/8 Calculate ((-7)/(-6))/(((-14)/(-8))/(281/562)). 1/3 (-455)/65 + (-6)/(-1) -1 10(-2)/726488/(-6880) 11 What is 12 + 16/(-1) - (0 - (-702)/(-177))? -2/59 What is (-430)/(-4)378/(-2457) + 17? 6/13 What is the value of -4 - (3/10 + (-11556)/2520)? 2/7 What is the value of (-130)/(-14) - (-60)/(-210)? 9 Evaluate (-74)/210 + 10/35 + (-27307)/(-39480). 5/8 5 - (-114)/48 - (8 + -36)/(-4) 3/8 1860/108 + 1 - 24/108 18 What is the value of (2 + 8)1656/5520? 3 Evaluate (-1)/4 + ((-1956)/240 - (-3 + -6)). 3/5 What is -2 - (4095/285)/(-7)? 1/19 Calculate ((-2)/(-10))/((-1)/5)(2 - 1). -1 What is the value of 38/3860/(-66)2/4? -5/11 Evaluate ((-10)/5)/((-18)/333). 37 (-1)/(-42)113/13 1/8 What is the value of 69/45 - (-222)/1665? 5/3 What is (-4 + (9 - -36)/9)1? 1 What is (234/156)/(12/176)? 22 What is the value of ((-2 - 1) + 15/25)(-280)/(-84)? -8 Calculate -916/(-96) + (1 - 25/(-2)). 15 Evaluate 3-3(-4)/12 - (-87 + 84). 6 What is (-37)/888104(10 - 1)? -39 What is 4/(-22)578/(-1156)? 1/11 Calculate 56/(-420) - (-5)/((-8550)/(-168)). -2/57 What is the value of (-78)/(-468)40/(-25)? -4/15 Calculate (3/1)/(3230/(-171) + 19). 27 What is (-8624)/287 + (-5 - -35)? -2/41 (-726)/819 - 4/(-6) - (-1426)/18538 -1/7 What is the value of -24((-390)/(-702) - (-4)/(-18))? -8 (-8640)/(-1620)4/(-64)-10 10/3 Evaluate -7910/(-40) - (-63)/28. 22 -37 - (1830/210 - 46) 2/7 What is (46440/(-63))/40 - 4/7? -19 Evaluate 0 + 20/4 + ((-64)/6 - 1). -20/3 98/(-126) + (-90)/(-135) -1/9 Evaluate -1-30(-48)/120. -12 Evaluate ((2/6)/(35/(-30)))/(1/7). -2 Evaluate (1 + 26)/189 - (-10)/28. 1/2 512/20 + -2 + 7 + 2 10 What is the value of (94/16 - 6) + (-501)/216 + 2? -4/9 What is (654/(-50031))/(1/(-3))? 2/51 Calculate (-493)/(-7540)290 + -19. -1/26 (38/570)/(7/357) 17/5 What is (6/33 - 980/(-539))-13? -26 Evaluate 21(-20 - -29 - 8). 21 What is the value of 216/(-3888) + (-4)/5045? -2/21 Evaluate (56(-17)/(-2975))/(2 + (-8)/5). 4/5 4/(-1) + (-352)/24(-6)/4 18 What is the value of 12/3 + (-57)/(-36)-3? -3/4 Calculate 3((-7 + 2)/(-35) + (-52)/21). -7 -13 + 742/56 + (-2)/((-136)/(-9)) 2/17 (-261)/(-76) + 45/(-12) -6/19 What is (4/(-32))/((-112)/336)? 3/8 Evaluate (6/(-7))/(41040/(-155610)). 13/4 Calculate ((-6)/(-22))/(693/(-22869)). -9 What is -29 + (-51008)/(-1760) - ((-9)/(-5) + -2)? 2/11 What is the value of 18/21204/(-153)? -8/7 What is ((-6)/(-10))/(19/285) - 3? 6 Calculate 1785/(-3150) + 10/(-12) + 1 + 0. -2/5 What is 23/(322/63)43/(-6)? -9 What is the value of (-3 - 30/(-9))/(14/(-42))? -1 What is (33000/1200)/(0 - 5)? -11/2 What is 14/(3852/108 + -35)? 21 Calculate 6/6 - 1/1(-3 + -14). 18 What is the value of 82/2 + (68 - 93)? 16 (-33)/(-165)(-15)/(-3) - (-33)/(-18) -5/6 (445 - 467) + 12 + 0 -10 Evaluate (-7)/((67/536)/(2/16)). -7 What is the value of 15/4(296/(-108) + 48/648)? -10 Calculate 10/(-78) - 655/1965. -6/13 (-1)/(584/(-10512) - (-16)/18) -6/5 What is (320/720)/(2/54)? 12 Evaluate (-6 - 888/(-150))-318/(-216). -1/50 What is ((-110)/(-33))/((-9)/(-27)) + (-66)/6? -1 (-18 - -23)/((1566/12 - 1) + -2) 2/51 Evaluate 21144/(-2520) + 150/18. -2/35 What is the value of (-416)/156(-1)/((-8)/(-48))? 16 What is 19(610/60 - 10)? 3/2 What is the value of ((-70)/(-189))/(140/(-150)(-30)/63)? 5/6 Calculate (2002/(-65) + 29)(-10)/6. 3 What is 9/(-14)(-8)/(-6)(-1 - 0)? 6/7 (-3)/(-5(-108)/(-40)) 2/9 What is the value of -5 + -3 + (57/(-9) + 6)-3? -7 What is the value of 1-3((-3)/51 - 2016/408)? 15 (-27)/(-4)(714/(-18) + 37) -18 What is the value of (-48)/6434/(-68)4/18? 1/12 -6 - (-5966)/988 - 2/36 -2/117 (-46216)/7630 + 2/35 -6 What is (-1)/(-12)5 - (-5 + 56/12)? 3/4 Calculate (0 + 36/(-45))5. -4 What is (-468)/(-819)14/12? 16 Evaluate (4 - (-7 + 12))(-10 + 5 + -2). 7 What is (-349)/1745 + 31/130? 1/26 What is the value of (-1)/4 + (-46475)/3380? -14 (-472)/26 - 520/(-3380) -18 What is (-198)/(-6897)-114/(-6)? 4/19 (-32)/120-3 + 22/(-15) -2/3 Evaluate 32/(-20)145/36. -2 What is the value of 6/11 + ((-6156)/(-209) - 22)? 8 -8 - -11 - 7/(21/(-6)) 5 Calculate 4 + -20 - -12 - 8. -12 Evaluate (-420)/(-54) + -6 - (145/(-45) - -3). 2 Calculate -10(-9)/8118. 20 Calculate (8/14 + 1670/140)(-8)/(-10). 10 3/(-4)((-8036)/399 - -20) 2/19 What is 33/(-8) - (-17 - 2700/(-160))? -4 Calculate (-240)/(-384) - ((-2)/(-4))/(-3 - -4). 1/8 What is 4/(-94) + 9800/75670? 2/23 Calculate 10/2 - (-441 + 451). -5 What is -10(-1)/(-7 - (-6 - -1))? -5 2 - ((-42)/(-63))/(35/(-12) - -3) -6 Evaluate 5((-16)/(-10) - 1) + 2100/(-900). 2/3 Evaluate ((-21)/(-25))/((-1792)/(-70) + -25). 7/5 286/99 + -3 - (-69)/135 2/5 (-31 - (-1012)/32) + 173/(-8) -21 What is the value of ((-11)/((-66)/(-4)))/((-375)/45)? 2/25 What is ((-24)/190)/(2/8) - (-40)/100? -2/19 Calculate 388/(-1358)(-2 + (-74)/(-16)). -3/4 Evaluate (115/(-15))/23 - (-145)/(-348). -3/4 Calculate 49/(-35) + 23249/17085. -2/51 Calculate (4/(-70))/((-3585)/(-300) - 12) - 1. 1/7 Evaluate (99/(-30) - (-32)/40) + -2 + 4. -1/2 What is -1(-4)/(-18)(28 + (-611)/26)? -1 What is the value of (14(-50)/(-7000))/((-24)/(-15))? 1/16 What is the value of (9/(-6)1)/(363/(-6292))? 26 What is (-4)/58(-18 + (-192)/(-12))? 4/29 Evaluate 1/2 - (14181/174 - 54). -27 What is the value of ((-4880)/448 + 11)/((-30)/35)? -1/8 20/3(-18)/448 - (-1)/7 -1/8 19 + 0 + 28971/(-999) -10 Calculate ((-280)/(-50))/(104/(-260)). -14 9/241 - (-171)/(-3800)-5 3/5 (-2 - 0)/((-16762)/290 + 58) -10 Evaluate (-5(-10)/35)/(((-400)/224)/25). -20 Calculate 3496/4370190/(-4). -38 What is the value of (-5)/4(-18088)/1615? 14 Evaluate (2 - 10/65)-5(-11)/110. 12/13 Evaluate 26 + 621/(-92)4. -1 Calculate -15(-7)/315 + (-444)/36. -12 Calculate 190/2850 + 16/(-30)(25 - -7). -17 Evaluate -3(22/(-5))/11(-15)/42. -3/7 1/((-30)/(-4)) - (-5 + 5) 2/15 (-460)/138(21 - (-66)/(-15)) 8 Calculate 21/12(-6)/28(46 - 50). 3/2 (((2 + -6)/(-4))/(-1))/(7/(-6)) 6/7 What is the value of ((-1048)/(-5))/(-8) + (-65)/(-325)? -26 Calculate (-1 - 62/(-18))/(210/945). 11 Calculate 4/(9 + -29) + (-237)/90 + 3. 1/6 Evaluate 117/(-3) + (-288)/(1664/(-52)). -30 Evaluate 16/((77/(-21))/11-3). 16 Evaluate 2419/(-295) + 8/(-10). -9 What is -416/32(-2)/(-10)? -2/5 What is the value of (76 + -56)(34/40 - (-42)/(-70))? 5 Calculate 1 - (-1 - -2((-115)/(-10) - 6)). -9 Evaluate ((-1050)/63 - -15)/1. -5/3 What is (294/35)/(6/10)? 14 What is 2/(-3) - -8308/168? 14 What	{ "pile_set_name": "DM Mathematics" }
mplify m*(-2/9)mmmm/m8mm(-4/5)m(m(-2/13)/mm)/m assuming m is positive. m(-2443/585) Simplify (d/(d1dd))/(dd(2/13)d)(d1/d)18 assuming d is positive. d(-54/13) Simplify (c0)(-13) assuming c is positive. 1 Simplify (x/(xx(-2)))19 assuming x is positive. x38 Simplify (w(-2/9))(-27) assuming w is positive. w6 Simplify ((c6/c)/c)(-41) assuming c is positive. c(-164) Simplify (c(1/6)cc)(-3/2) assuming c is positive. c(-13/4) Simplify ((tt(-1/5))/t)(-10)/(t5tt/(t/t(-1/5)tt)t) assuming t is positive. t*(-14/5) Simplify pp*16p(-3/7) assuming p is positive. p(116/7) Simplify (m(3/5))(2/107) assuming m is positive. m(6/535) Simplify (a(1/5)/a(1/3))43 assuming a is positive. a(-86/15) Simplify (r/r(-1/5))(-31) assuming r is positive. r(-186/5) Simplify (nn/(n/n(1/12))n)/(n/(n/((nnn*3)/n)))(n/(nnn/(((nn1)/nn)/n))nn)8 assuming n is positive. n(73/12) Simplify k16/k(2/9) assuming k is positive. k(142/9) Simplify (y/(y/(y(6/7)/y))y/(yyy(y/y*(-4/3))/yy))/(y*(-2)y)35 assuming y is positive. y(641/21) Simplify (z(-2/15)/z1)(-3/2) assuming z is positive. z(17/10) Simplify z*(2/87)zzzzz*(-3/5)zzz assuming z is positive. z(2794/435) Simplify f7f5ff(-3)f/(f(-6/5)/f) assuming f is positive. f(66/5) Simplify ((u/(u/u*2u))(-4))21 assuming u is positive. u*(-84) Simplify (x/(x/(x((x*(-45)x)/x)/x)))/(x/(x/x(-22))) assuming x is positive. x(-23) Simplify (n/((n*(2/9)/nn)/n))33 assuming n is positive. n(176/3) Simplify (hhh25)/(h/h(-11)) assuming h is positive. h15 Simplify (b(-1))(-2/83) assuming b is positive. b(2/83) Simplify (rr7/r)(-6) assuming r is positive. r(-42) Simplify (s/(s(2/27)/s))(4/13) assuming s is positive. s(16/27) Simplify o2o/(oooo(1/3))(o(-1/4))17 assuming o is positive. o(-55/12) Simplify (l(2/3)l(-6))(-11/6) assuming l is positive. l(88/9) Simplify ((r(-14)r)/r)/r(12/11) assuming r is positive. r(-166/11) Simplify p*(-4)p/p*(-4)p assuming p is positive. p2 Simplify (q(2/7))(-8/7) assuming q is positive. q(-16/49) Simplify (g/(g*(-18)g))(-41) assuming g is positive. g(-738) Simplify ((i(i(1/5)/i)/i)/(ii*(1/4)i))/(i((i(i/((i/(i/(i/i*1)))/ii))/i)/i)/i(i(2/13)/i)/i) assuming i is positive. i(-313/260) Simplify ((ii15/i)/i)29 assuming i is positive. i406 Simplify (u10u(-7))(2/19) assuming u is positive. u(6/19) Simplify ((m0)(-2/29))25 assuming m is positive. 1 Simplify ((m/m(-14/5))/m15)(2/147) assuming m is positive. m(-16/105) Simplify (b(-7)b(4/3))(-16) assuming b is positive. b*(272/3) Simplify yy*(13/4)yy/(y(-2/71)y) assuming y is positive. y*(1499/284) Simplify (hh/(hh4))/(h/(h(-6)/h))h(-3)/h(2/7) assuming h is positive. h(-100/7) Simplify ((f/(f(1/2)f))/((f(-2/9)fff)/f))(1/24) assuming f is positive. f(-41/432) Simplify ((n1)(-7))(-2/33) assuming n is positive. n(14/33) Simplify ((bbb/b*9b)/b(4/7))(1/43) assuming b is positive. b(-39/301) Simplify (n/n(-7/2))/(((((n/(n*(-2/7)n))/n)/n)/n)/nn)(n2)(2/5) assuming n is positive. n*(561/70) Simplify (yy/(yy(-1)/yy))(-8)/(y/(y(-3)/y)yy(-2/9)) assuming y is positive. y(-196/9) Simplify a(13/2)/a(-3) assuming a is positive. a(19/2) Simplify ((c/c0)/(c((c(4/5)c)/c)/cc))(-2/7) assuming c is positive. c(8/35) Simplify (((d2d)/d)/d*5)/(((d/(dddd(-1/4)))/d)/(d(2/9)/d)) assuming d is positive. d(-37/36) Simplify ((y(1/4))(-2/23))(1/6) assuming y is positive. y(-1/276) Simplify ((n1n)/n)41 assuming n is positive. n41 Simplify gg*(3/4)g*(3/4)(g*(-6)g)/g(-1) assuming g is positive. g(-3/2) Simplify q*(-5)q(-10) assuming q is positive. q(-15) Simplify (s0/s)(-5/7)((s/(ss*(-1/3)))/sss)(4/3) assuming s is positive. s(157/63) Simplify (u(2/5)u)*(-2/11)/(uuu/u3(((uu/u4uu)/u)/u)/u) assuming u is positive. u(151/55) Simplify ((x(-1))(-17))(4/3) assuming x is positive. x(68/3) Simplify (((vv6)/v)/(v(-6)/vvv))/(v1)(2/43) assuming v is positive. v(471/43) Simplify (v/(v2/v))(-32) assuming v is positive. 1 Simplify (d/(d/d(-1/6)))/dd4(dd(d/d*1)/d)/(dd*(1/2)d) assuming d is positive. d*(4/3) Simplify (j/((jj/(j/((j/(j/((j/(j/j*7))/j)))/j)))/j)j)/(j*(2/9)/j)(j(-1))(-3/43) assuming j is positive. j(-833/387) Simplify (d2)*14d/d*0(((d*6/d)/d)/d)/dd assuming d is positive. d32 Simplify ((w/w(-2/35)w)/w)(1/21) assuming w is positive. w(37/735) Simplify (o(ooo*(-4)ooo)/ooo)/(o/o*0o)(o/(o/(o/o(-7))))/(o/((o/(o/(o(-1/4)o)))/o)) assuming o is positive. o*(31/4) Simplify (s(s/(ss/(ss*(1/3)ss)s)ss)/s)*41(s(-3/7)/s)/s(2/11) assuming s is positive. s(31198/231) Simplify (((z/(z/z1))/z)/(z/z*(-6)))/(((zz(z/(zz*(-1)))/z)/z)/(z(z(z(2/9)z)/z)/zz)) assuming z is positive. z(-52/9) Simplify (h(2/15)hhh)/(h/((h*(-11)hh)/h)) assuming h is positive. h(-118/15) Simplify (b((b/(bbb/b*(1/4)))/b)/bb)*(-10/9)(b/b(-4))/b9 assuming b is positive. b(-37/18) Simplify b29/(b/(bb/(bb(-1/14)))) assuming b is positive. b(407/14) Simplify ((j/j*6)/jjjj(-1/6))/(j(-2/7))(2/171) assuming j is positive. j(-9967/2394) Simplify d/d*(-20)d/d(-47) assuming d is positive. d69 Simplify (f(-1))(4/19)/(f(1/2))(-29) assuming f is positive. f*(543/38) Simplify ttt(2/9)t*(-1/3)/tt*0t/(tt(2/15)) assuming t is positive. t(34/45) Simplify ((m/((m/(mmm1))/m)m)/m)*(-1/3)(m/(m(2/3)/m))22 assuming m is positive. m28 Simplify i3i6i/i*4ii4ii assuming i is positive. i13 Simplify gg/(gg/((gg/(g*13/g))/gg))g/(ggg/g(-6)g) assuming g is positive. g*(-19) Simplify gg/g*(-15/4)(gg(-1/4))/g assuming g is positive. g(11/2) Simplify (ff(-1))/f1 assuming f is positive. 1/f Simplify ((ff9/ff)/ff/(((ff*9f)/f)/f))5 assuming f is positive. f5 Simplify z(-3/17)/(z(-20)/zz) assuming z is positive. z(337/17) Simplify hhh(h((h/((h(-2/59)h)/hh))/h)/h)/hh*43h assuming h is positive. h(2657/59) Simplify (u5u)/u(uu/(u(u(uuuu/(((uu/(u/(u2/u))u)/u)/u))/u)/u))/u(u(-3)u)/uu(-2) assuming u is positive. u(-2) Simplify ((z/z(-1/3))(-16/3))(1/9) assuming z is positive. z(-64/81) Simplify ((((d4/d)/dd)/dd)/d)(-2/111) assuming d is positive. d(-4/111) Simplify ((ff*(-3/4)f)/(f4/f))/(f3f/f6f) assuming f is positive. f*(-3/4) Simplify (n/(nnn(-1/3)nnn))(-2/53)/(n(1/4))(-9) assuming n is positive. n(1519/636) Simplify z*12/((z/(z/(zz/(((z*(2/35)z)/z)/z)zzz)))/zz) assuming z is positive. z*(212/35) Simplify (((kk(2/7))/k)(-1/10))(1/3) assuming k is positive. k(-1/105) Simplify r*(-35)r(-26) assuming r is positive. r(-61) Simplify ((x*(-1)x)(-25))(-27) assuming x is positive. 1 Simplify r*(-1/39)rrrrr(-13/5) assuming r is positive. r(268/195) Simplify u*0u*5u*1/(uu(-1/5)) assuming u is positive. u(26/5) Simplify cccc(-4)ccc/(c*3c)(c(-1))(2/61) assuming c is positive. c(-124/61) Simplify r(1/16)/(rr(r13r)/rr) assuming r is positive. r(-255/16) Simplify (u/(uu/(u/((u/(u*(-3/13)/u))/u))))/(u/(uu(7/4))) assuming u is positive. u(27/52) Simplify (l23/l)/(l13l) assuming l is positive. l8 Simplify (y18/y)/(yy*(-12)yyy) assuming y is positive. y25 Simplify s(-26)((ss*(3/14))/sss)/s assuming s is positive. s(-347/14) Simplify (t/((t(t*(-1/4)t)/tt)/t)t*3t)/(t*5/(tt(-2/5))) assuming t is positive. t(-3/20) Simplify (d(-8/7))26 assuming d is positive. d*(-208/7) Simplify www(-1/10)w(w(-5)/w)/ww(w/((w(1/3)/ww)/w))(3/4) assuming w is positive. w(-37/20) Simplify (a(-2))(-8/3)/(aa/a0aa/a4) assuming a is positive. a(16/3) Simplify (u(-1)u*0u)(3/14) assuming u is positive. 1 Simplify y1y(-2/3)y*(3/10)y**(-2/15) assuming y is positive. sqrt(y) Sim	{ "pile_set_name": "DM Mathematics" }
qrt(300) + -5 + sqrt(300)-2) + -2 + 5)2. 300sqrt(3) + 2725 Simplify (((sqrt(2448) - (-1 + sqrt(2448))) + 4)-6)2 - ((sqrt(204)/(sqrt(12)1))2 - (1 + (sqrt(425))2)). 1309 Simplify (-5-2sqrt(3600)6)/((sqrt(132)16 - sqrt(132) - sqrt(132))/((sqrt(132) + sqrt(132)2 + sqrt(132))/sqrt(12))). 600sqrt(3) Simplify (sqrt(242) + -3 + (sqrt(242) - (sqrt(242) + 0)) + sqrt(242))22 + 3 - (sqrt(8)/sqrt(64) + 4 + ((sqrt(16)2)/sqrt(8))2 + -5). -1057sqrt(2)/4 + 1950 Simplify (6(sqrt(1573) - (-5 + sqrt(1573) + sqrt(1573)))-6 + 4 + -2sqrt(1573) + sqrt(1573) + 4 + (1sqrt(1573) - sqrt(1573)))*2. -132440sqrt(13) + 1956509 Simplify 5 + ((-33sqrt(288))*23 - (4sqrt(288)1 + 5 + -1sqrt(288))2). -360sqrt(2) + 67372 Simplify (1(-3 + 2 + (sqrt(1088)4 + 0 - sqrt(1088) - (sqrt(1088) + (sqrt(1088) + 2)4 + sqrt(1088)))))2 + 5. 432sqrt(17) + 9878 Simplify ((-3 + (sqrt(17) - -3sqrt(1088))6 + (-4(sqrt(153)-1 - sqrt(153)))/sqrt(9))2)2. -3792sqrt(17) + 1697588 Simplify -1((2(sqrt(120) + sqrt(120)1))/(sqrt(4) + -1sqrt(256) + sqrt(256)))/(sqrt(72)/(sqrt(36)/sqrt(3))-5-3). -4sqrt(5)/15 Simplify (sqrt(88) - (-2(sqrt(88)-3 - sqrt(88)) - sqrt(88)) - 4sqrt(88)-3)/(1(sqrt(8) + 6sqrt(8)2)2). 3sqrt(11)/13 Simplify 2-3(sqrt(12) + sqrt(108) + sqrt(12))/sqrt(6) - ((sqrt(12)/sqrt(6) + 3)*2 + sqrt(6)/(-1sqrt(3))). -35sqrt(2) - 11 Simplify (sqrt(272) + (5 + sqrt(272) + 2 + sqrt(272) - sqrt(272)) + sqrt(272) + sqrt(272) + 1 + (4 + sqrt(272))3-6)2 + 3. 7168sqrt(17) + 57411 Simplify (-1 + ((6-3sqrt(300))/sqrt(12))/(sqrt(5) + (sqrt(5) - sqrt(25)/(sqrt(15)/sqrt(3) + sqrt(5))) - -5(sqrt(5) - sqrt(10)/sqrt(2))))2. 24sqrt(5) + 721 Simplify (sqrt(2) + sqrt(2)-55 - -6(sqrt(2) + 1))2 + (sqrt(6) - (sqrt(72)4)/sqrt(12))/sqrt(3)-2. -210sqrt(2) + 684 Simplify 3 + (2(sqrt(78)1 + sqrt(78)) + ((sqrt(78)3 - sqrt(78)) + sqrt(78))-1)/(-64-1sqrt(216)). sqrt(13)/144 + 3 Simplify (4(1 + sqrt(1152) + -2) + 2 + sqrt(1152) + (sqrt(1152)4 + sqrt(1152) - sqrt(1152)) + 0)2 + 5. -864sqrt(2) + 93321 Simplify ((-5(sqrt(3) + 4))2 - (sqrt(3) + sqrt(6)/(sqrt(2) - 4sqrt(2)))*2) + (sqrt(675)-1)/(sqrt(99)/sqrt(44)). 190sqrt(3) + 1421/3 Simplify ((sqrt(99)231 - -42((sqrt(99) - 1sqrt(99)) + sqrt(99)))/((sqrt(576)-1 - (sqrt(9) - (sqrt(144)/sqrt(4))/sqrt(4))) + 1-2sqrt(900)))*2. 11/4 Simplify (sqrt(418)/(sqrt(33)/sqrt(3)))/(sqrt(4)/(sqrt(50) + sqrt(2))) + sqrt(171)/(sqrt(441)3 - sqrt(9)) + 3. 3 + 121sqrt(19)/20 Simplify (sqrt(1216) + -6(0 + sqrt(1216) - sqrt(1216)) + 0 + sqrt(1216) + 3 - ((sqrt(1216) + 2 - sqrt(1216)) + 5 - 6sqrt(1216)-5))*2. 1792sqrt(19) + 953360 Simplify (-4(6(2sqrt(108)-4 - (-2 + sqrt(108) + -1 + sqrt(108))) + (sqrt(108) + -1 + -1)6 + 1))2. -72576sqrt(3) + 5039632 Simplify 2 + sqrt(147) + 1 - (sqrt(147) - (sqrt(147)1 + -5)) - (0 + (1 + sqrt(147) + 1 + sqrt(147) - (sqrt(147)2 + -1)))*2. -11 + 7sqrt(3) Simplify (-1sqrt(2176))/(5(sqrt(2) - (sqrt(4)/sqrt(2) + sqrt(2))))2-4-3. 192sqrt(17)/5 Simplify (6(sqrt(275)-1 + sqrt(22)/(sqrt(8)/sqrt(4)) + 1) - (-1 + (-6sqrt(88)-2)/sqrt(8) + -4))*2. -792sqrt(11) + 14377 Simplify (1sqrt(504))/sqrt(8) + 3 + 3 + sqrt(63) - (0 + (3(sqrt(126) - sqrt(126)2)/sqrt(2))2). -561 + 6sqrt(7) Simplify ((-4 + sqrt(405) + 21sqrt(405) + 5 - (-5(sqrt(405) + 0) + -3 + -4)) + 4)2. 1728sqrt(5) + 26064 Simplify (sqrt(4320)1-4)/((-2sqrt(80) + sqrt(80))/sqrt(2)) + 1. 1 + 24sqrt(3) Simplify (((sqrt(234)-4)/sqrt(9)-1)/((sqrt(490)-3 - sqrt(10) - sqrt(10))/sqrt(5))2)*2. 832/529 Simplify (5 + sqrt(175) + 0 + (0 + sqrt(175))6 + 0 - (1 + -1 + sqrt(175) + sqrt(175) + -2(-1 + sqrt(175)) + 1))2. 140sqrt(7) + 8579 Simplify (((3sqrt(228)1 - sqrt(228) - sqrt(228)) + sqrt(228) - (sqrt(228) - sqrt(228)1 - sqrt(228))1)/(sqrt(108) - -2sqrt(108) - -2sqrt(108)))*2. 19/25 Simplify ((1(sqrt(9)-5 + sqrt(9)))/(sqrt(300) + sqrt(300) + sqrt(300) + (sqrt(300) - (sqrt(300) + sqrt(300)4)))2-6 + 1 + 0)*2. -48sqrt(3)/5 + 1753/25 Simplify 3(((-1sqrt(136) - sqrt(136))6)/((sqrt(64)1)/sqrt(8)) - ((2sqrt(612))2 + (sqrt(102)-2)/sqrt(6))). -7344 - 30sqrt(17) Simplify ((sqrt(228) - sqrt(228)-2-3)/(sqrt(18)/sqrt(48) - sqrt(6)))/(sqrt(350)/(sqrt(2240)/sqrt(5) - sqrt(7))). 28sqrt(19)/3 Simplify (sqrt(300) + -1 + sqrt(300) + -2sqrt(300) + 3 + sqrt(300) + 0 + sqrt(300) + 2 + sqrt(300)-3 + (sqrt(300) - -2sqrt(300)-4 - sqrt(300)))*2 + 2. -720sqrt(3) + 24318 Simplify ((sqrt(306)/sqrt(2) + sqrt(1088) + sqrt(1088) + 3 + sqrt(1088) - (sqrt(272) - (1sqrt(272) + -1) - (sqrt(272)-1 - sqrt(272))4)) + 3)2. -50sqrt(17) + 450 Simplify (-3 + 6(2 + 2 + sqrt(1377) + 1 - (-2sqrt(1377)-4 + 5)))2. 2268sqrt(17) + 2429037 Simplify (5sqrt(180))/(sqrt(640)2 - sqrt(640)) - (sqrt(200)2-3 - ((sqrt(200) - (-2sqrt(200) + sqrt(200))) + sqrt(200) + -4))2. -16216 + 5775sqrt(2)/8 Simplify (-6sqrt(2057)-2-2)2 + -2 + (1 + sqrt(17))2 + (sqrt(17) + sqrt(68))-2 + 2. -4sqrt(17) + 1184850 Simplify 3 + (6(-6((1sqrt(425) + sqrt(425))4 + (sqrt(425) + -1 - sqrt(425)) + 3) + 2))2. 172800sqrt(17) + 35254803 Simplify (6(sqrt(891) + 0) - (sqrt(891) + 61sqrt(891))2) + 5 - 3(-1 + (-1 + sqrt(11))5 + 4)2. -44491 + 114sqrt(11) Simplify 5(-1 + ((-1 + sqrt(252))2 - ((sqrt(28) - (sqrt(56)/sqrt(2) + sqrt(28)))/sqrt(4) - sqrt(7))) + 1). -50sqrt(7) + 1265 Simplify ((1 + sqrt(468))1 - -6-2sqrt(468))2 - (((sqrt(468)2 - sqrt(468)) + 5 + sqrt(468) + sqrt(468) + sqrt(468) + 0 + sqrt(468) + 5)-5)2. -238371 - 15132sqrt(13) Simplify (((sqrt(1620) + (1sqrt(1620) - sqrt(1620)))-2 + sqrt(1620) + sqrt(1620) + sqrt(1620) + 1 + 0 + (sqrt(1620) - (sqrt(1620) + 0 + 2)))6)2. -1296sqrt(5) + 58356 Simplify (-5 + -5(sqrt(500) + 2)-1 + (-5(sqrt(500) + sqrt(500) + 2) - (sqrt(500) - -2sqrt(500))1))2. 800sqrt(5) + 32025 Simplify (sqrt(63)-3 - sqrt(70)/(sqrt(10) + (sqrt(10) + sqrt(10)-3 - sqrt(10) - sqrt(10))))*2 + (sqrt(315)/sqrt(5) - (5(2sqrt(7) + sqrt(7)) - sqrt(7)))2. 12355/9 Simplify ((-1 + sqrt(1700))3 + sqrt(1700) + (-3 + -5 + sqrt(1700))*2)31. -360sqrt(17) + 5283 Simplify (sqrt(384)-3 - (sqrt(48)/sqrt(2)-6 - sqrt(24) - sqrt(24)))/((-6sqrt(968) - sqrt(968))-3). -4sqrt(3)/231 Simplify (1 + ((2sqrt(832) - sqrt(832)) + -2 - sqrt(832) - sqrt(832)) + -4 - (-2(sqrt(832) - 2sqrt(832)) + sqrt(832) + 6sqrt(832)-2)1)2. -640sqrt(13) + 53273 Simplify ((1(2sqrt(66) + sqrt(66) + sqrt(66)) + (sqrt(66) - (4(2sqrt(66) - sqrt(66)) + sqrt(66)) - sqrt(66)))-5)/(-6-5(sqrt(1728) + sqrt(48))/sqrt(8)). sqrt(11)/42 Simplify -6(-4(5 + sqrt(12) + 1)2 - (-3 + -2 + (sqrt(75) - (0 + sqrt(75))2) + sqrt(75))). 672 + 636sqrt(3) Simplify (-3-1(-1 + sqrt(77)/(2sqrt(847) + sqrt(847) + sqrt(7)) + 3))2 + -1. 18sqrt(11)/17 + 40559/1156 Simplify ((1 + (-2sqrt(275) - sqrt(275))-3 + -1 + -2sqrt(275) + -2sqrt(275)3 + 0)-6)*2. 9900 Simplify 4 + -2 + (3sqrt(99))*2 + (sqrt(99)1)/sqrt(9) + 5 + -1. sqrt(11) + 897 Simplify -4-4(6(3((-2sqrt(152) - sqrt(152)) + sqrt(152)) + sqrt(152)-23))/(sqrt(800) + -1sqrt(800) + -1sqrt(8)-1). -1152sqrt(19) Simplify 4 + (-6-2sqrt(198) + 6(sqrt(198) - 2sqrt(198) - sqrt(198)))/(-1((-1sqrt(66))/sqrt(6) - sqrt(11))). 4 Simplify (6(2sqrt(2299) + -4) + 2 + -5 + -5)2-6. -1992480 + 50688sqrt(19) Simplify (-2((sqrt(208) + -1 - sqrt(208)) + 3)-5 + 1 + (sqrt(208) - (sqrt(208) - (1sqrt(208) + -2)))1)2. 152sqrt(13) + 569 Simplify ((3(sqrt(468) - sqrt(468)4-4) - (sqrt(468) + (sqrt(468) - (1 + sqrt(468))1) + 3))-3)26. -64800sqrt(13) + 63180216 Simplify -2((sqrt(270)/sqrt(6) + sqrt(5) - sqrt(5))2 + -5 + 1 + ((sqrt(5) + (sqrt(5) - (sqrt(5) + -1)))2 + -1)*2). -20sqrt(5) - 34 Simplify -5 + (sqrt(14)/sqrt(32) + 4)2 + (-1sqrt(196) + sqrt(49))/(sqrt(70)/(sqrt(10) - sqrt(160))). 3 + 7sqrt(7)/2 Simplify (-1(sqrt(576) - (sqrt(576) - -31sqrt(576) - sqrt(576))))/((-5(sqrt(3) + sqrt(48) + sqrt(3)) - sqrt(3))62). -4sqrt(3)/93 Simplify 5 + (1 + sqrt(72))-6 + sqrt(72) - ((-3sqrt(288) - sqrt(2)) + (sqrt(200)/sqrt(4))*2). -51 + 7sqrt(2) Simplify -2((sqrt(637) - ((-3sqrt(637) - sqrt(637)) + -1))*2 + 0 - 4(sqrt(637) + (sqrt(637) - (0 + sqrt(637))*2) + -2)) + 3. -36961 - 28sqr	{ "pile_set_name": "DM Mathematics" }
12940 - 2368 + 858 = 0 for y. -41 Solve -103f - 4714 - 2007 = -953 for f. -56 Solve -189 + 115 = 4p + 218 for p. -73 Solve 23803 = -855l - 23121 - 10069 + 14243 for l. -50 Solve 5957i - 27752 + 3275 = 1230i + 8612 for i. 7 Solve -460274t - 11152 = -460192t for t. -136 Solve -53t - 72t - 100t = 214t + 9658 for t. -22 Solve 0 = 3951o - 693799 + 89296 for o. 153 Solve -4036y - 18225 = -3307y for y. -25 Solve 1047 + 191 = -370b - 612 for b. -5 Solve -551b + 47b - 501b - 20268 = 21942 for b. -42 Solve 124h + 112h - 3536 = 28h for h. 17 Solve 21921g - 2024 = 21829g for g. 22 Solve -136a - 10877 + 5517 - 15720 = -446a for a. 68 Solve 28r + 309 + 208 + 1259 = 180 for r. -57 Solve -18242f + 132335 = -14461f for f. 35 Solve 0 = -5w + 107 + 30 + 107 - 79 for w. 33 Solve -19z + 104810 - 105513 = 0 for z. -37 Solve 2547o - 2160 = 2493o for o. 40 Solve 1244o + 88530 = -o + 2625 for o. -69 Solve 4323 = -108k + 327 for k. -37 Solve -117 = -45u - 753 + 422 - 1001 for u. -27 Solve 6608 = 13b + 114b - 15b for b. 59 Solve -11771 + 43804 = 1213w - 30238 - 2018 for w. 53 Solve 460f - 14959 = -1619 for f. 29 Solve -7q + 102 = 14q + 648 for q. -26 Solve -251 = 15t - 113 + 640 + 167 for t. -63 Solve 814h - 12082 + 16672 = -45064 for h. -61 Solve 55r = -17r + 91r + 323 for r. -17 Solve -606b = -75b - 49b + 261b - 12631 for b. 17 Solve 11152s + 1195 = 11124s + 411 for s. -28 Solve 22l - 4758652 = -29l - 4757020 for l. 32 Solve -4594y + 301145 = 39y for y. 65 Solve 2252w + 159428 + 117800 = -35800 for w. -139 Solve -202h = -177h - 156h - 3144 for h. -24 Solve -3462r + 6818 = -7030 for r. 4 Solve 22u + 95u = 2057 - 2876 for u. -7 Solve 15650 = 1285u - 13808 + 6764 - 3006 for u. 20 Solve -281m - 823 - 5481 = 1002 for m. -26 Solve -31d + 21d - 795 = 29d + 4041 for d. -124 Solve 192822 = -3637d + 18246 for d. -48 Solve 3u - 25u = -20u - 74 for u. 37 Solve -4227 = 455n + 22591 - 15126 + 21978 for n. -74 Solve -224x - 1690 = -144x - 145x for x. 26 Solve 483 = 14n - 960 + 155 for n. 92 Solve -142y + 1256 + 3638 = -2916 for y. 55 Solve 4d + 114d + 18d + 11225 = 73 for d. -82 Solve -2615p - 644p = -594p - 15990 for p. 6 Solve 46b - 4452 = -199b + 33b for b. 21 Solve -91991w + 91477w = 15169 + 1793 for w. -33 Solve -4z + 3z + 328 = 6z + z for z. 41 Solve 0 = -9379i - 70577 - 426510 for i. -53 Solve 356v + 269099 = 1661v + 3375v - 119v for v. 59 Solve 18151 + 1418 = 390n + 176n - 5335 for n. 44 Solve 3266z = -3017z + 159364 - 21138 for z. 22 Solve 295r + 91r - 18850 = -47r - 321r for r. 25 Solve -1194 + 2302 = 88k - 1532 for k. 30 Solve -2242a = 2292a - 1425a - 268262 + 97267 for a. 55 Solve -2110u - 35074 = -33646 + 72422 for u. -35 Solve 397m + 67736 = 41534 for m. -66 Solve 8762f - 5476f = 305598 for f. 93 Solve -8279 + 63945 = -1092l - 1049l for l. -26 Solve -57q - 244959 = -247581 for q. 46 Solve -934w + 68420 + 1135 = 3241 for w. 71 Solve 46153 = 4544t + 61111 + 88121 + 133209 for t. -52 Solve -2764y = 2318y - 40502 + 13179 - 28579 for y. 11 Solve 6o + 14163 = 21o - 442o - 4625 for o. -44 Solve 1495a + 10028 + 33327 = 0 for a. -29 Solve -4992c = -4595c - 14689 for c. 37 Solve -712o + 26053 = 621o - 262o - 48917 for o. 70 Solve 0 = 463u + 897u - 291u - 34u - 63135 for u. 61 Solve -48g - 2528 = 3020 - 1564 for g. -83 Solve 2613a + 761a - 276a = -768a + 119846 for a. 31 Solve 123v - 7861 = -387v - 82v + 5163 for v. 22 Solve 91404w = 94099w - 80850 for w. 30 Solve 39364 = -5709l + 7223l for l. 26 Solve 424 - 3788 = -116x for x. 29 Solve 134q - 1538 + 4693 + 4429 = -2868 for q. -78 Solve -207v - 44v + 31612 + 12564 = 251v for v. 88 Solve 290k - 342 = 233k for k. 6 Solve -27795 = 888z + 16605 for z. -50 Solve 0 = -16626q + 16220q + 24766 for q. 61 Solve -11344 = -1228f + 35971 - 15178 + 20667 for f. 43 Solve 3464j - 9011j = 124656 + 124959 for j. -45 Solve -4j - 24j - 58j - 4128 = 0 for j. -48 Solve -188r + 471r - 203r = 158r + 4368 for r. -56 Solve 709 = -2g + 683 for g. -13 Solve -17119j = -17456j - 3370 for j. -10 Solve 44m + 22m - 483 = -3m for m. 7 Solve 0 = 6i + 231 - 321 for i. 15 Solve 1210x - 1882x - 41001 = -1191x for x. 79 Solve 131v - 25809 = -344v - 117v - 8641 for v. 29 Solve -1795r + 8256r - 1856r = -7973r - 1396158 for r. -111 Solve -10556 = -65y - 9126 for y. 22 Solve 209b + 3951 + 13774 = -500b for b. -25 Solve 483m + 6188 = -6439 + 2484 for m. -21 Solve 703j - 25654 - 34636 + 13299 = 3625 for j. 72 Solve 444d + 255588 = 243156 for d. -28 Solve 21q - 23q = 19q + 12q + 825 for q. -25 Solve -284f - 239f - 585f = -162f - 24596 for f. 26 Solve -107070 = -1095y + 1546y + 3118y for y. -30 Solve 418134 = 2880u + 9846u - 1058082 for u. 116 Solve -57c - 255 - 712 = 344 for c. -23 Solve 0 = -0y - 50y + 641 - 1284 + 643 for y. 0 Solve 284v + 2143v = 3133 - 102640 for v. -41 Solve 20g + 90709 = 90129 for g. -29 Solve -354b = -25b + 3168 - 7704 - 5992 for b. 32 Solve -6590c = -54829 + 26551 - 96932 for c. 19 Solve 0 = 198s - 97s - 161s + 1320 for s. 22 Solve -5055k + 84265 = -203870 for k. 57 Solve 324027j + 1584 = 324071j for j. 36 Solve 25127 - 46916 = 11144o + 163882 - 18511 for o. -15 Solve 11516k - 20683 = 9925k for k. 13 Solve 1427t + 11851 = -35192 - 2480 - 11838 for t. -43 Solve -77z - 31z = -269z - 1654z + 49005 for z. 27 Solve -3003x - 17859 = 2916x + 505x + 155589 for x. -27 Solve -7663381n + 2050 = -7663340n for n. 50 Solve -3046 - 9741 = 342x + 847x - 3275 for x. -8 Solve 8659 = -405l - 656 for l. -23 Solve 87w - 107w - 76w + 12978 = 213w for w. 42 Solve 95j - 96j - 10 - 22 = 0 for j. -32 Solve -80948l = -80251l + 39729 for l. -57 Solve 460409i - 47400 = 461009i for i. -79 Solve -496801t = -496823t - 66 for t. -3 Solve 487o - 3065o - 1452o + 178632 = 932o for o. 36 Solve -1310w + 40w + 9713 - 96073 = 0 for w. -68 Solve -871c + 707c - 22440 = -504c for c. 66 Solve 75 - 153 = 25l + 297 for l. -15 Solve 6848 = 18p - 6508 + 13608 for p. -14 Solve 46659 + 21402 = -1144o - 15451 for o. -73 Solve 2669 + 220805 = -3853t for t. -58 Solve -80171t = -79490t + 87168 for t. -128 Solve -10058 - 9626 + 11012 = -529o + 16720 for o. 48 Solve 0 = 2884j - 8267 - 385 for j. 3 Solve -1052b - 47b + 54950 = 0 for b. 50 Solve 10889v - 399347 = 100548 + 99000 for v. 55 Solve -7259o - 10131 + 384 = -7088o for o. -57 Solve 20776i + 250304 + 2013493 = 105212 - 666951 for i. -136 Solve -90o + 2245 = -3000 + 91 + 1464 for o. 41 Solve -212l + 438l = -428l - 17942 - 31762 for l. -76 Solve -10953m - 3069 = -5434m - 5420m for m. -31 Solve -8883t = -496t + 486446 for t. -58 Solve 29j + 32j = -58j - 6783 for j. -57 Solve -1065r + 6474 = 3365 - 49076 for r. 49 Solve 343w = 483w + 1253w - 54327 for w. 39 Solve -43y = 689542 - 687220 for y. -54 Solve -30176 + 4126 = 742f + 16180 + 5258 for f. -64 Solve -24990 - 47356 = 3581n - 186525 - 175882 for n. 81 Solve -11289a + 698674 + 385070 = 0 for a. 96 Solve -182577 = -241h - 179685 for h. 12 Solve 36054o + 36176 = 36377o for o. 112 Solve 0 = 1054q + 1090q - 2270q + 5040 for q. 40 Solve 0 = 887r - 9777 + 668 - 13066 for r. 25 Solve -1269z + 1264z = 230 for z. -46 Solve 326m - 5784 + 45234 + 98259 = -637m for m. -143 Solve 96b = -227b - 219b + 106b - 24852 for b. -57 Solve 6044j + 1953j + 13550 = 1222j for j. -2 Solve -38v + 33v + 22v + 1120 = -15v for v. -35 Solve -634j + 4132j - 199949 + 4061 = 0 for j. 56 Solve -587c + 3713 = 48438 + 6344 for c. -87 Solve -1227r + 744r = -1449 for r. 3 Solve -5t - 1548 - 3572 - 10792 = -209t for t. 78 Solve 13223007 = 331j + 13193548 for j. 89 Solve 56v + 17v + 43470 = -244v - 304v for v. -70 Solve -1793z + 544 = -1761z for z. 17 Solve 4807w - 28170 = 549w + 563692 for w. 139 Solve 1871640c - 1014 = 1871614c for c. 39 Solve -108t - 117t = 322t - 5470 for t. 10 Solve -2354o = -63039 - 28767 for o. 39 Solve -150925h + 159614h + 1346795 = 0 for h. -155 Solve 648 - 1218 = 49r + 459 for r. -21 Solve -1071f - 458f - 2681f - 96012 = -781f for f. -28 Solve -520f = 290f - 502f + 104*f - 341	{ "pile_set_name": "DM Mathematics" }
13686 Find the third derivative of 1634465l3 + 5765705l*2. 9806790 What is the second derivative of 7458c*2p - 3c2 - 4cp + 830p wrt c? 14916p - 6 Differentiate -12705c3 - c2u + 6cu + 441284u wrt c. -38115c2 - 2cu + 6u Find the second derivative of -3718o2 + 216o + 4. -7436 Find the second derivative of 80p4 + 1021p*3 + p + 394. 960p*2 + 6126p What is the second derivative of -144f2w*2 - 8f*2w - 13f2 - fw - f - 30416w2 wrt f? -288w*2 - 16w - 26 What is the third derivative of 509389n3r - 2n2r + 374n2 + 2nr - 13n - 2 wrt n? 3056334r What is the third derivative of -6990c*3h - 3c3 + c2h - 9574ch wrt c? -41940h - 18 Differentiate -3a*2y*2 + 16a*2y - 69ay*2 - 2y*2 + 377y - 9 with respect to a. -6ay*2 + 32ay - 69y*2 What is the second derivative of 5890k*2p*2 + 84953k*2p + 18kp*2 wrt p? 11780k*2 + 36k What is the first derivative of 71121b3y + by3 + 103332y*3 wrt b? 213363b*2y + y*3 What is the derivative of -99dm2 - 30dmv - 2dv + 49d + 2m*2v + 2mv wrt v? -30dm - 2d + 2m*2 + 2m What is the second derivative of -20212j4 - 381229j? -242544j2 Find the first derivative of -19908p*3s - 11p3w - 4sw*3 + 1347w*3 wrt s. -19908p*3 - 4w*3 Find the third derivative of -46g*3x*3 + 3g*3x*2 + 4128g*3 - 2g + 65x3 - 2x*2 wrt x. -276g*3 + 390 What is the second derivative of -16w*2y*2 + 16w*2y - 546wy - 5974y3 - 1 wrt y? -32w*2 - 35844y Find the second derivative of 2m5 - m4 + 5045m*3 + 403m - 6. 40m3 - 12m*2 + 30270m What is the third derivative of 1084av*4 + 347av2 + 2a + v*4 + 44v*3 + 25v*2 + 7v wrt v? 26016av + 24v + 264 What is the second derivative of -11689q*3 - 2q - 7046? -70134q Find the third derivative of -1127416m*4 + 1001m*2 + 4m - 3. -27057984m What is the third derivative of -670962r*4 - 235r*2 + 122r - 1? -16103088r Find the second derivative of 881o*5 - 4o*4 + 17o*3 - 2141o - 173 wrt o. 17620o3 - 48o*2 + 102o What is the third derivative of 2q5 - 4597q*4 + 274439q*2? 120q*2 - 110328q Find the first derivative of 5s3 - 4004s + 20335 wrt s. 15s2 - 4004 What is the derivative of 547b*4 + 2b3 + b2 - 345b + 1302898? 2188b*3 + 6b*2 + 2b - 345 What is the third derivative of -176o4 + 19o*3 - 12058o*2 - 2o + 2? -4224o + 114 Find the second derivative of -196154t*5 - 44605t + 1. -3923080t3 What is the second derivative of -70v5 + v3 - 15v2 - 19371v? -1400v3 + 6v - 30 Find the third derivative of 2780r2t*3 - 17014r*2t*2 + 2r*2t - 7rt*4 - 3rt2 + 2rt + 3t*3 + 2t*2 wrt t. 16680r*2 - 168rt + 18 Differentiate 60218kz2 + 59911z*2 with respect to k. 60218z*2 Find the second derivative of -73562f*2 + 1325f - 37 wrt f. -147124 What is the derivative of -38507s2 + 63594 wrt s? -77014s Find the second derivative of -a*2jq2 - 3a*2 - 608jq2 - 20989jq wrt q. -2a*2j - 1216j What is the derivative of -75727h - 259878 wrt h? -75727 What is the third derivative of 2h5 + 34h*4 - 4308h*3 + 5331h*2 + 2? 120h*2 + 816h - 25848 What is the third derivative of -178c4 - 8c*3 + 2c*2 - 906c + 23? -4272c - 48 Find the second derivative of -330o*3 + 561o*2 - 14354o - 3 wrt o. -1980o + 1122 What is the first derivative of 127o*2 - 145o - 9321 wrt o? 254o - 145 What is the third derivative of 6d*3p*3z*3 + 5d*3p*2z*2 - 461897d*3pz3 - 3dp3z*2 + 17p*3z*2 - 21p wrt z? 36d3p*3 - 2771382d*3p Find the third derivative of -1270g3p*2 + 19g*3p - 19069g2p*2 + 2g*2p - 3g2 - gp*2 wrt g. -7620p*2 + 114p What is the second derivative of 182c3i*2 - 2c*3i + 3036c2i - 77ci*2 wrt i? 364c*3 - 154c What is the derivative of 269ks*2 - 53256k + 51s2 wrt s? 538ks + 102s What is the second derivative of -1511022i2 - 83178i? -3022044 Find the second derivative of 11752w3 - 4w*2 + 401w + 78 wrt w. 70512w - 8 Find the third derivative of 193988u*3 + 789u*2 + 25. 1163928 What is the third derivative of -474392u*3 - 3u*2 - 24279u? -2846352 Find the second derivative of 24996g2 - 42311g. 49992 What is the first derivative of -v*2x + 3v2 + 362vx - v + 462x + 67 wrt v? -2vx + 6v + 362x - 1 Find the first derivative of 139fn*2yz + fn*2 - 166fny + 65fz - 23n2y + 16n2z + n*2 - 2n + 1 wrt z. 139fn*2y + 65f + 16n*2 What is the second derivative of -22m*4 - 2005m*3 + 2m*2 + 20m + 3180 wrt m? -264m2 - 12030m + 4 What is the derivative of -585q3 + 50q*2 + q + 483981 wrt q? -1755q*2 + 100q + 1 Find the third derivative of 9p6 + 14p*3 - 132008p*2. 1080p*3 + 84 What is the third derivative of 7n*3v*3 - 13342n*3v - n*2v - 37873nv*3 wrt n? 42v*3 - 80052v What is the second derivative of 343286v2 + v - 27829 wrt v? 686572 Find the second derivative of 99av3 + 2av2 + 2a - 171v3 + 46238v wrt v. 594av + 4a - 1026v Find the first derivative of -145765o + 183370 wrt o. -145765 What is the third derivative of -5995f*3kq - 2f*3k - f*2q - 2f2 + 3fk + 3fq - 72kq wrt f? -35970kq - 12k Find the first derivative of -2284916w + 2107077 wrt w. -2284916 What is the third derivative of 37710m*3v*3 + 2m*3v + 2m2v*2 - 26v*2 - v wrt v? 226260m*3 What is the derivative of -354893k + 165871 wrt k? -354893 What is the third derivative of -8042c6 - 288c*2 + 20 wrt c? -965040c*3 Find the third derivative of -5462719z*4 + 3062124z*2 + z wrt z. -131105256z Find the second derivative of 15203h2q + hq + 151h + 2q + 20 wrt h. 30406q Find the third derivative of 2247371y4 - 3780y*2 - 50y wrt y. 53936904y What is the third derivative of 1369694k*4 + 840621k*2 - 2? 32872656k What is the second derivative of i*2u*2 + 1135i*2 - 2iu2 + 234116u*2 + 964u wrt u? 2i2 - 4i + 468232 What is the second derivative of -1990465x3 + 4614012x? -11942790x Find the third derivative of -97f5 - f4 + f*3 + 3f*2 + 3188f. -5820f2 - 24f + 6 What is the second derivative of 47406m2 - 3063m? 94812 What is the first derivative of -2k3 + 182k - 97692 wrt k? -6k2 + 182 What is the derivative of -22004u*3 - 2ux - 1221x - 3 wrt u? -66012u2 - 2x What is the first derivative of 25261k + 1498? 25261 Find the third derivative of -r6 - 1153r*4 + 71r*2 + 7r wrt r. -120r3 - 27672r What is the third derivative of 1334644nr*3 - 2nr2 - 12nr - 394n - 9r2 wrt r? 8007864n Differentiate -27240d - 59885. -27240 What is the second derivative of -13a*2w*2 + 858a*2w + 54aw*2 - 19aw - w2 + 6w - 2 wrt a? -26w2 + 1716w Differentiate 91178y3 - 20404 with respect to y. 273534y*2 Differentiate 8z*3 + 3z*2 + 1154z - 12092 with respect to z. 24z2 + 6z + 1154 What is the first derivative of 2374il + i + 18l + 51602 wrt l? 2374i + 18 What is the second derivative of 61ck*4 + ck*3 - 1142ck2 - 33ck + 880k wrt k? 732ck*2 + 6ck - 2284c Find the third derivative of 1054048c3p*3 + 6c*2p*3 - 10879 wrt c. 6324288p*3 Find the first derivative of -70347t - 20001. -70347 What is the first derivative of 501546c4 - 555206 wrt c? 2006184c*3 What is the third derivative of -87765m*3 - 3m*2 + 67608 wrt m? -526590 What is the third derivative of 1916124br3 + 3844719br2 + b wrt r? 11496744b What is the first derivative of -916503ov - 893027v wrt o? -916503v What is the second derivative of 103c3 - 133c*2g*2l + 2c2l - 2cg*2l - 19cl + c - 2g2l - 2l wrt c? 618c - 266g2l + 4l What is the first derivative of -135g*2v*3 + 1124g - 9010v3 + 18v wrt g? -270gv*3 + 1124 Find the second derivative of 215668r*5 - 560r - 138 wrt r. 4313360r3 Find the third derivative of -2a*4 - 160666a*3 + 15a*2 - 83a - 417 wrt a. -48a - 963996 What is the second derivative of 8f*3 + 1108f*2 + 77f + 73 wrt f? 48f + 2216 Differentiate -15b*4u -	{ "pile_set_name": "DM Mathematics" }
8 by -19921. 48 Divide 1278048 by 3. 426016 0 divided by 4808 0 28524 divided by 3 9508 Calculate -25848 divided by -359. 72 Divide 123 by -6648. -41/2216 -1 divided by -674878 1/674878 What is -5550 divided by -6? 925 Divide -759 by 13. -759/13 What is -275783 divided by 4? -275783/4 Calculate -17341 divided by -1. 17341 -21 divided by -19621 3/2803 137200 divided by -9800 -14 Divide 5152 by 9. 5152/9 Calculate 55 divided by 754. 55/754 Calculate -607775 divided by 755. -805 688 divided by -17 -688/17 Divide 4395 by -1. -4395 What is 502270 divided by 5? 100454 -317980 divided by -5 63596 56775 divided by 18925 3 What is -2 divided by 1137735? -2/1137735 Divide 423 by 2. 423/2 What is 1058354 divided by 11? 96214 69122 divided by -34 -2033 Divide 39792 by -4. -9948 Divide -317298 by 105766. -3 -41496 divided by -4 10374 -124 divided by -4 31 -2400036 divided by -800012 3 Calculate 2002680 divided by -3. -667560 47820 divided by 9564 5 Calculate 5762 divided by 612. 2881/306 Divide -31284 by -3. 10428 -925937 divided by 3 -925937/3 29095 divided by -529 -55 Calculate -30420 divided by -2535. 12 What is -235277 divided by -235277? 1 Divide 9302796 by 1033644. 9 Calculate 641132 divided by 160283. 4 Divide -57618 by -19206. 3 Divide -11740 by 243. -11740/243 Divide -1489981 by 1. -1489981 Calculate -186 divided by 1767. -2/19 Divide 1390349 by -37. -37577 Divide -2110 by 1055. -2 What is -23659 divided by -401? 59 -1757 divided by -14 251/2 172240 divided by -6 -86120/3 Divide -141 by 118. -141/118 What is -647629 divided by -1319? 491 Calculate -256796 divided by 172. -1493 What is 82810 divided by 5? 16562 Divide 693738 by 1. 693738 -439929 divided by 6983 -63 -119 divided by -41 119/41 Divide -577 by 29. -577/29 241116 divided by 213 1132 Calculate -1 divided by 50519. -1/50519 458184 divided by -6 -76364 What is 8208 divided by 1368? 6 Divide 66098 by -3. -66098/3 Calculate 3 divided by 25137. 1/8379 Calculate -11296 divided by -5648. 2 Divide -24 by 1141. -24/1141 -328 divided by 168 -41/21 Calculate -421578 divided by 666. -633 What is 443 divided by 111? 443/111 356355 divided by 71271 5 Divide 1 by -28701. -1/28701 Calculate 14913 divided by 4971. 3 18534 divided by -2 -9267 Calculate -1400499 divided by -2551. 549 Calculate -4672 divided by -6. 2336/3 434740 divided by 434740 1 What is 11030 divided by -1? -11030 What is 203 divided by 185? 203/185 Divide -177165 by -93. 1905 Divide 727506 by -27981. -26 What is -1545106 divided by 1545106? -1 What is -127 divided by -67? 127/67 Calculate -3743 divided by 77. -3743/77 What is 549306 divided by 2? 274653 Divide -225519 by 3. -75173 Divide 2229428 by -18274. -122 Divide 376175 by 41. 9175 What is -19 divided by -2346? 19/2346 -3089186 divided by -15293 202 1065573 divided by 5 1065573/5 Divide -18 by -114220. 9/57110 What is -5 divided by -215974? 5/215974 Divide -1393753 by -139. 10027 2229435 divided by -1 -2229435 Calculate -798958 divided by -2. 399479 -4 divided by 102746 -2/51373 What is 583746 divided by -6? -97291 Divide -492320 by -123080. 4 Divide 627396 by 28518. 22 -7759348 divided by 2 -3879674 -713652 divided by 237884 -3 9486 divided by -1054 -9 Divide 50281 by 1. 50281 Calculate 8470 divided by 11. 770 What is -5964 divided by 3? -1988 Divide -278 by 73. -278/73 Divide -52383 by -2757. 19 What is -264322 divided by -264322? 1 Calculate -1927104 divided by 3. -642368 Divide -106 by -229. 106/229 What is 2 divided by -2073? -2/2073 1071840 divided by 55 19488 Calculate 0 divided by -1528079. 0 Calculate -156800 divided by -2800. 56 Divide -505557 by 87. -5811 -1 divided by 16631 -1/16631 Calculate 121 divided by 115. 121/115 Divide 41468 by -41468. -1 What is 17 divided by -4245? -17/4245 Calculate -142692 divided by -3102. 46 What is 23674 divided by 5? 23674/5 -20181 divided by 5 -20181/5 Calculate -91008 divided by -22752. 4 Calculate 2 divided by 20806. 1/10403 Divide 21040 by 2630. 8 300 divided by 152 75/38 Divide 113 by 1216. 113/1216 Calculate 711156 divided by 711156. 1 -168 divided by -28 6 5 divided by -66675 -1/13335 Divide 38376 by 19. 38376/19 Divide 3 by 124578. 1/41526 What is 2000289 divided by -1459? -1371 Divide 5 by 8189. 5/8189 Divide -44714 by 283. -158 What is -462810 divided by 7? -462810/7 Calculate -883890 divided by 207. -4270 69 divided by 19509 23/6503 Calculate -129540 divided by -6. 21590 Divide -2390 by -17. 2390/17 307951 divided by -1517 -203 Calculate -1 divided by -33495. 1/33495 What is 13750 divided by -1250? -11 -179277 divided by -7 25611 What is 19 divided by -24207? -19/24207 Divide 70928 by 806. 88 What is -2144040 divided by 142936? -15 192805 divided by 5 38561 794172 divided by -4 -198543 -10917 divided by 1213 -9 Calculate -5 divided by -245124. 5/245124 What is -1543632 divided by -385908? 4 Calculate 231 divided by -43. -231/43 What is 334880 divided by -4784? -70 312720 divided by -12 -26060 41 divided by 16274 41/16274 What is -29888 divided by -64? 467 -2 divided by -16087 2/16087 Divide 2291440 by -572860. -4 What is 16 divided by 553? 16/553 What is -16 divided by 2034? -8/1017 What is 28569 divided by 101? 28569/101 -4808 divided by -1202 4 0 divided by 4876 0 What is -2075739 divided by -16091? 129 Calculate -3 divided by 227123. -3/227123 0 divided by -12747 0 What is 1738277 divided by -42397? -41 What is 65961 divided by 9? 7329 What is 864330 divided by 288110? 3 -15120 divided by 270 -56 839910 divided by -167982 -5 What is -11231 divided by 11? -1021 -639289 divided by -7 91327 Divide 24001 by 10. 24001/10 Divide 76362 by -13. -5874 What is 10721 divided by 71? 151 Divide -1758056 by 4. -439514 Calculate -5175090 divided by -1. 5175090 Calculate -14 divided by 2977. -14/2977 116508 divided by 292 399 Calculate 13716 divided by 9. 1524 365200 divided by -4565 -80 Divide -8 by -151. 8/151 Divide -764 by -1562. 382/781 24597920 divided by 5 4919584 36792 divided by 1314 28 Divide 417725 by -16709. -25 Divide -15563 by -15. 15563/15 Calculate 5016 divided by 4. 1254 What is -3765 divided by -24? 1255/8 -41420 divided by -5 8284 Divide 354300 by -5. -70860 What is -28224 divided by -1? 28224 Calculate -60 divided by -610. 6/61 Calculate -81280 divided by -5080. 16 Calculate -4 divided by 1151419. -4/1151419 100420 divided by -4 -25105 Divide -492506 by 554. -889 -102584 divided by -25646 4 Calculate -19 divided by -382. 19/382 Calculate 188424 divided by 15702. 12 What is 5 divided by 13629? 5/13629 Divide -175872 by -32. 5496 What is -665610 divided by 2017? -330 2 divided by -3506 -1/1753 Calculate 1 divided by 76171. 1/76171 What is 2011737 divided by -287391? -7 -58586 divided by -11 5326 -595219 divided by 7 -595219/7 What is -1337580 divided by 37155? -36 What is -1334408 divided by -4? 333602 Divide 2454969 by -3. -818323 Divide 4580 by -10. -458 Divide 1 by -908. -1/908 Divide 0 by -174627. 0 What is -50 divided by -333? 50/333 Calculate 10 divided by 1447. 10/1447 Divide 194 by 3536. 97/1768 Divide 94320 by -6288. -15 Calculate -1945 divided by -1566. 1945/1566 -49875 divided by -16625 3 What is 5207328 divided by 112? 46494 What is 144 divided by -1676? -36/419 Calculate 604737 divided by 1. 604737 What is 184 divided by 2286? 92/1143 Divide 66653 by -4. -66653/4 Divide 5259 by 1. 5259 Divide -13 by -5001. 13/5001 What is -264224 divided by -4? 66056 49232 divided by 272 181 -15609 divided by 121 -129 What is -5 divided by 5118? -5/5118 Divide -3154768 by -5402. 584 Calculate -1801200 divided by -45030. 40 What is 7 divided by 11006? 7/11006 -5588356 divided by -874 6394 -4039134 divided by -1254 3221 Calculate -405 divided by 242. -405/242 What is 21840 divided by -39? -560 -266314 divided by 26 -133157/13 Calculate -1 divided by 24214. -1/24214 Calculate -971 divided by -166. 971/166 4725 divided by 1575 3 -1356660 divided by -5 271332 -33063 divided by 103 -321 Divide 21322 by 7. 3046 What is -2 divided by 19618? -1/9809 Calculate 2 divided by 34749. 2/34749 Calculate 761262 divided by 426. 1787 What is -525 divided by -18? 175/6 Divide 248520 by -190. -1308 Divide -1128776 by -25654. 44 Divide -5 by -75329. 5/75329 What is -58 divided by -3953? 58/3953 Divide 3 by -20254. -3/20254 What is -4 divided	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.