Datasets:

totally-not-an-llm
/

PileV2-axolotlformat-smallmix

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 23k rows

text stringlengths 0 13M
Let f be 2 + 1555972/4 + 5. Round f to the nearest 10000. 390000 Let w(b) = -48b + 2. Let k be w(-6). Round k to the nearest one hundred. 300 Let j = 186.718991004 - 186.77159. Let w = 23.052611996 + j. Let c = -23 + w. What is c rounded to 5 decimal places? 0.00001 Let m = -2954 + 5518. Let i = 5064 - m. Let y be i/(-6)(-576)/10. Round y to the nearest 10000. 20000 Let m = 130 + -130.69. Let w = m - -0.6814. Round w to three decimal places. -0.009 Suppose 9760000 = -0j + 4j. Round j to the nearest 100000. 2400000 Let c = 62.564 - 69. Let s = c + 0.136. Round s to zero decimal places. -6 Let x = 1 - -0.2. Let i = -0.11 - -0.76. Let b = i - x. What is b rounded to one dp? -0.6 Let s = -53234 - -52987.11. Let j = 248 + s. What is j rounded to one decimal place? 1.1 Let z = 2111414 + -2018869.3. Let t = z + -92544.63999976. Let u = t - 0.06. Round u to seven dps. 0.0000002 Let d = -10.2 + 15. Let b = 2 - 7. Let s = d + b. What is s rounded to one decimal place? -0.2 Let p = 46.97 - 48. Round p to one decimal place. -1 Let g = 0.9318221 + 0.1982449. Let d = 0.05 + 1.08. Let s = d - g. Round s to 5 dps. -0.00007 Let l = 0.138 - 0.1273. What is l rounded to three decimal places? 0.011 Let t = 27 + -1279. Let q be -52(2 + -4 - t). What is q rounded to the nearest ten thousand? -70000 Suppose x = 2 + 1. Suppose -xk + 2k = 3300. Round k to the nearest 1000. -3000 Let j = -49.13 - -49. What is j rounded to 0 dps? 0 Let p = -0.05 + 0.049898. Round p to five dps. -0.0001 Let s = 160.98 + -163. Round s to one decimal place. -2 Suppose 0 = -0f - 5f - 455. Let h be f - 6/(-8)-4. What is h rounded to the nearest ten? -90 Let u = 0 - 0. Let o = 2 + u. Let h be o/2 - -1 - 84. What is h rounded to the nearest 10? -80 Let x = -9.81 - 0.19. Let h = x - -25. Let w = h + -14.58. What is w rounded to 1 dp? 0.4 Let o = -2.9136 - -2.9. What is o rounded to three dps? -0.014 Let u = -51.043 - -51. Let o = -0.105 - u. Let p = o + 0.062062. What is p rounded to five decimal places? 0.00006 Let c = -1.3 - 4.3. Let s = -3 - c. Round s to zero decimal places. 3 Let o = 0.075 - -57.925. Let g = 5977714457.99999946 - 5977714400. Let k = o - g. What is k rounded to 7 dps? 0.0000005 Let l = 111446394571 - 111446016124.800056. Let v = 378448 - l. Let k = -1.8 + v. Round k to 5 dps. 0.00006 Let l = 1450800 + -2800986. Let s = 1350308.00083 + l. Let k = s - 122. Round k to four decimal places. 0.0008 Let t = -34.836 - -35. What is t rounded to 2 dps? 0.16 Let h = 764 + -522. What is h rounded to the nearest 10? 240 Let k = -15 - -15.013. Let t = 2.1406 + -2.127653. Let l = k - t. Round l to 5 decimal places. 0.00005 Let t = 4835 + -3183. Let p = 1647.837 - t. Let x = -0.037 + p. What is x rounded to the nearest integer? -4 Suppose f + 2f + 1 = 2m, 4f = m + 2. Suppose 3c + 2c = -5s + 5, -m = 2s - 2c. Suppose si = 2i - 304. Round i to the nearest ten. 150 Let s = -11.6 - -11.599931. What is s rounded to five decimal places? -0.00007 Let l = -16 - -15.99994. Round l to 5 decimal places. -0.00006 Let s(z) = 172221z2 + 15z - 34. Let b be s(3). What is b rounded to the nearest 100000? 1600000 Let y = -1.25705 + -106.79595. Let f = y - -108. Round f to two dps. -0.05 Let p = -1328422 + -8580775. Let s = p - -6509197. What is s rounded to the nearest one million? -3000000 Let t(p) = -54p - 1. Let q(h) = -h3. Let c be q(1). Let b be t(c). What is b rounded to the nearest 10? 50 Let z = 159737.9978 + -159725. Let l = 13 - z. What is l rounded to three decimal places? 0.002 Let f = 0.04084 - -724.35916. Let x = f + -672.77. Let p = 52 - x. Round p to one decimal place. 0.4 Let s = 16197627 + -16197627.7000009. Let u = 0.7 + s. Round u to 6 dps. -0.000001 Suppose -4h = 17180 + 15620. What is h rounded to the nearest 1000? -8000 Let k = -0.0465 + -3.9235. What is k rounded to one dp? -4 Let x = 0.028654438 - -9.118305962. Let j = -9.48695 + x. Let y = 0.34 + j. Round y to six decimal places. 0.00001 Suppose -4f + 16 = -0. Suppose -3499998 = 5t - 2d, 0t + 2t + fd = -1400004. What is t rounded to the nearest 1000000? -1000000 Let k = -46254 - -67054. Round k to the nearest 1000. 21000 Let o be (1/1)/1 - 1460. Let j be o1(421 - 0). Let a = j - 105761. Round a to the nearest 100000. -700000 Let m = 40.95 - 40. Let b = 0.741 - m. Let v = b - -0.22. What is v rounded to two decimal places? 0.01 Let t be ((-1)/(-1)6)/((-1)/(-95)). Round t to the nearest 100. 600 Let k = 0.015 - -4.785. What is k rounded to the nearest integer? 5 Suppose -m = 4v + 16, 5m - v = 4v + 20. Suppose m = 3i - 1883 - 310. Let r = i + -451. What is r rounded to the nearest 100? 300 Let r = -4 + 17. Let b = -17 - r. Let z = b - -30.0052. What is z rounded to 3 dps? 0.005 Let c = 15.9 - 17. Let z = c - -1.1000005. What is z rounded to seven decimal places? 0.0000005 Let h = 16 - 7.8. Let a = h + -1.1. Round a to the nearest integer. 7 Let j = -4298841 - -6198851. Let n = j - 1899991.000088. Let y = 19 - n. Round y to five decimal places. 0.00009 Suppose 3v - 6v - 14 = -5n, 4n - 24 = -4v. Let i = n - 4. Suppose i = s - 9145 + 41145. What is s rounded to the nearest ten thousand? -30000 Let k = -0.046 - -21.146. Round k to zero decimal places. 21 Let t = 2 + 0. Suppose 3b = ty - 15216691, 3b - y + 3y = -15216671. Let n = 9272227 + b. What is n rounded to the nearest one million? 4000000 Suppose -10200002 = -3d + p, 2d + 0p - 3p = 6800006. What is d rounded to the nearest 1000000? 3000000 Let d = -532019 - -750508. Suppose 0 = -3q - d - 1161511. What is q rounded to the nearest 100000? -500000 Suppose -2b + 4 = -0. Suppose d = -d - b. Let s be -1512d. What is s rounded to the nearest one hundred? 0 Let i(b) = -37b. Let o be i(10). What is o rounded to the nearest 100? -400 Let c = -0.14 + -0.54. Round c to 1 decimal place. -0.7 Let d = -2686459.20000004 + 2686459. Let r = 0.8 - 0.6. Let k = d + r. What is k rounded to seven dps? 0 Let x be 0 - 5346/(-2 + 0). Suppose 46673 - x = -y. Let l be y/((-46)/50 + 1). What is l rounded to the nearest 100000? -600000 Let o = 23.9 + -23. Let y = o + -1.1. Let f = -0.1999 - y. What is f rounded to 4 decimal places? 0.0001 Let y = -135 - -71. Let g = y - -63.99957. Round g to 4 dps. -0.0004 Let u be (368895/(-4))/((-4)/16). Let p = 236895 - u. What is p rounded to the nearest ten thousand? -130000 Let h = -748 - -748.269974. Let a = 0.24 - -0.03. Let b = h - a. Round b to 5 decimal places. -0.00003 Suppose -90 = 5b - 0b. Let j(t) = 1443t - 26. Let k be j(b). Round k to the nearest ten thousand. -30000 Let r = -2037717 + 2037729.000005. Let h = -12 + r. What is h rounded to six dps? 0.000005 Let l = -2 - -6. Suppose -lx = -2x. Let y be -2 + x - (-2301 + -1). What is y rounded to the nearest 1000? 2000 Let i = -6.458 + 6.4. Let h = i - 7.742. What is h rounded to the nearest integer? -8 Let w = -0.24 - -0.352. Let d = 1.4 + -1.225. Let i = d - w. Round i to two decimal places. 0.06 Let f = -569.285 - -561. Let a = f - 27.698. Let x = a - -36. What is x rounded to two dps? 0.02 Let p = 4.9 + -2.6. What is p rounded to zero dps? 2 Suppose -2a - 10 = -0a. Let y(o) = 13o - 5 - 7o - 13o. Let u be y(a). Round u to the nearest 10. 30 Let d = 0.0432962 - 0.1122825. Let o = -72 + 71.931. Let h = o - d. Round h to 6 decimal places. -0.000014 Let m = -1 - -1.7. Round m to the nearest integer. 1 Let t = -13 + 7. What is t rounded to the nearest ten? -10 Let z = 0.27 + -1.57. Let u = z - 11.1. Let y = -12.39919 - u. What is y rounded to 4 dps? 0.0008 Let c = -0.0219 + 0.021899558. Round c to 7 decimal places. -0.0000004 Suppose -5o + 227 = 8467. Let a = o - 6452. Round a to the nearest 1000. -8000 Let d be (-83)/(-1 - (-1 + 1)). Let b = d + -123. What is b rounded to the nearest one hundred? 0 Let i be 2/(-6) - 34/6. Let r(o) = -6167o - 2. Let j be r(i). What is j rounded to the nearest ten thousand? 40000 Let x = 7 + -4. Suppose 0 = -v + xw + 30, 202 = 5v - 4w + 2w. Round v to the nearest 10. 40 Let w = -21417836518335.03599895 - -21417835505267. Let d = w - -1013068. Let f = -0.036 - d. What is f rounded to 7 dps? -0.0000011 Let g = -14968078 + 24990708. Suppose 6777370 = -4q - g. What is q rounded to the nearest one million? -4000000 Let f = -26.0025 - -26. Round f to 3 decimal places. -0.003 Let x(j) = j. Let p be x(3). Suppose -pl = -3d - 2d + 23400000, 0 = 5*d. Round l to the nearest one million. -8000000
Let c(f) be the first derivative of -81f5/100 + 9f*4/10 - 2f*3/5 - 7f*2 - 15. Let r(l) be the second derivative of c(l). Factor r(y). -3(9y - 2)2/5 Let a(n) = 5n*4 - 45n*3 - 243n*2 - 197n - 2. Let u(w) = 25w4 - 225w*3 - 1214w*2 - 986w - 11. Let i(y) = 11a(y) - 2u(y). Factor i(r). 5r(r - 13)(r + 1)(r + 3) Suppose 0 = 4j - 111 + 103. Suppose i - 1/2 - 1/2i*j = 0. Calculate i. 1 Let x(m) be the first derivative of 5m*4/4 + 25m*3 - 40m2 - 825. What is g in x(g) = 0? -16, 0, 1 Let o(x) be the third derivative of -x10/6048 + x8/1344 + x4/6 + 2x2. Let r(f) be the second derivative of o(f). Factor r(k). -5k*3(k - 1)(k + 1) Factor 54c - 4c4 - 5c*4 + 24 - 66c*2 + 99c*2 + 6c*4. -3(c - 4)(c + 1)2(c + 2) Let t(o) be the second derivative of -o4/4 + o3 + 36o2 + 4o + 6. Factor t(j). -3(j - 6)(j + 4) Let w(l) be the third derivative of 2l7/105 + l6/6 - 22l*5/15 - 28l4/3 + l2 + 16l. Factor w(y). 4y(y - 4)(y + 2)(y + 7) Let y(t) = t2 + 20t + 5. Let h be y(-20). Suppose h + 15p2 - 6p - 2 + 12p3 - 36p*4 - 3 = 0. What is p? -2/3, 0, 1/2 Suppose 150 = 17f - 15f. Factor 75 + 5t - ft - 5t*2 + 0t*2. -5(t - 1)(t + 15) Let z = 270798 + -2981647/11. Let m = z + 261. Suppose -4/11q*3 - 2/11q*5 + 6/11q*4 - m + 6/11q - 4/11q2 = 0. Calculate q. -1, 1 Factor 1/2p*4 + 0p - 2p2 + 15/4p3 + 0. p2(p + 8)(2p - 1)/4 Let y(p) = -2p*2 + p + 3. Let v(x) = -2x - 1. Let w be v(-2). Let t(k) = -3k2 + 4. Let a(c) = wt(c) - 4y(c). Suppose a(s) = 0. Calculate s. -4, 0 Let f = 1 + -1. Let i = f - -2. Find y such that y2 - y2 + 4y - iy2 = 0. 0, 2 Let j(n) be the second derivative of -2/3n*3 + 1/12n*4 + 11n + 3/2n2 + 0. Let j(z) = 0. Calculate z. 1, 3 Let n(y) be the first derivative of y4/3 + 40y*3/3 - 62y*2/3 + 318. Factor n(g). 4g(g - 1)(g + 31)/3 Let g(p) = p*3 - 9p*2. Let l be g(9). Suppose -6a + l = -12. Solve -1/2 - 1/2ha + h = 0 for h. 1 Suppose 1/3z*3 + 16/3z*2 + 0 + 20z = 0. What is z? -10, -6, 0 Suppose -10y + 5y = 2d - 31, -4d + 7 = -y. Determine t, given that -6t4 + 0 - 9/5t*5 + 0t*2 + 0t - 9/5td = 0. -3, -1/3, 0 Suppose 0 = -7c - 25 - 17. Let s = -6 - c. Suppose sn + 0 + 4/11n*4 + 0n*2 + 2/11n*5 + 2/11n3 = 0. What is n? -1, 0 Let x(t) be the third derivative of -t6/60 + t*4/12 - 4t*2 - t. Factor x(c). -2c(c - 1)(c + 1) Let i(k) be the third derivative of k*8/224 + 17k*7/105 + 467k*6/240 + 157k*5/20 + 185k*4/12 + 50k*3/3 + 153k*2. Solve i(p) = 0 for p. -10, -1, -2/3 Let h(b) be the third derivative of 0 + 3/10b*5 - 13b*2 - 9/4b*4 + 9b*3 - 1/60b*6 + 0b. Let h(l) = 0. What is l? 3 Let y(r) be the second derivative of -23r + 0 - 27/5r*5 + 10/3r*3 + 8r*4 - 4r2. Suppose y(s) = 0. What is s? -1/3, 2/9, 1 Let i = 187/54 + -80/27. Solve -n4 + 0 - 1/2n3 + n2 + in = 0. -1, -1/2, 0, 1 Let a be (-141)/4 + (-12)/(-48). Let w = 247/7 + a. Factor -ws2 + 0 + 0s. -2s2/7 Let h be 1 + 14409/33 + (-2 - -4). Let m = 440 - h. Find i such that 2/11i*2 - mi + 0 = 0. 0, 2 Let x(h) be the first derivative of h*6/11 - 6h*5/11 + 80h*3/11 - 240h*2/11 + 288h/11 + 23. Let x(d) = 0. What is d? -3, 2 Let m(j) be the third derivative of 0 + 10j2 + 0j*3 + 0j*4 + 0j - 1/45j5 - 1/180j*6. Factor m(d). -2d*2(d + 2)/3 Let r(p) = 3p - 100. Let f be r(35). Suppose -2j - 5 = -fv, 1 = 5j - 4v + 5. Determine a so that 2/3a*3 + j + 4/3a*2 + 0a = 0. -2, 0 Let t be -1 + (-3 - -2) + 5385/33. Let y = t - 161. Factor -2/11j2 - y + 4/11j. -2(j - 1)2/11 Let x = -377/5 + 379/5. Let g(c) be the second derivative of -8c + 1/25c5 + 0 - 1/5c*3 + xc*2 - 1/10c*4. Factor g(u). 2(u - 2)(u + 1)(2u - 1)/5 Let d(k) be the second derivative of k4/42 + 4k*3/21 + 3k*2/7 + 67k. Let d(p) = 0. Calculate p. -3, -1 Factor -24/5 - 2/5z2 + 16/5z. -2(z - 6)(z - 2)/5 Let g(l) be the first derivative of -5l4/4 + 10l*3 - 25l*2/2 - 312. Factor g(b). -5b(b - 5)(b - 1) Let n(x) be the first derivative of 5x6/14 + 81x*5/35 + 30x*4/7 + 12x*3/7 + 465. Let n(k) = 0. Calculate k. -3, -2, -2/5, 0 Let h = -173/2 + 87. Let o(i) = -5i*2 + 41i - 5. Let s be o(8). Factor 1/2t4 + t - ts + 0 - ht*2. t(t - 2)(t - 1)(t + 1)/2 Let v(l) be the first derivative of -l5/35 + l4/28 + 2l3/7 + 233. Let v(f) = 0. Calculate f. -2, 0, 3 Suppose -6z - 2f + 4 = -8z, 4z - 28 = -5f. Find s such that z + 7/2s2 + 8s = 0. -2, -2/7 Factor 14b3 - 36b*3 + 20b*2 - 24b*2 + 152b*4. 2b*2(4b - 1)(19b + 2) Let k be (2/5)/(5/(-25)). Let v be (-15)/20((-80)/(-135))/k. Let 2/9y + 0y*2 - vy*3 + 0 = 0. Calculate y. -1, 0, 1 Let v be 42/(-28)(1 - 3). Let m = v + -5/21. Determine f so that 0f - 1/3 + mf2 = 0. -1, 1 Suppose 0 = 4l + 2k - 260, 2l - 110 = -0l + 4k. Let i be 11/(385/(-10)) + 32/l. Factor ip2 + 0p + 0. 2p2/9 Suppose 0 = 4n - z - 24 + 22, 0 = -5n - 3z - 6. Factor -2/7j2 + nj + 0 - 2/7j3. -2j*2(j + 1)/7 Let i(v) be the third derivative of 1/140v5 + 0 + 7v*2 - 1/840v*6 - 1/56v*4 + 0v + 1/42v3. Factor i(d). -(d - 1)3/7 Factor 44o*2 - 54o2 + o4 + 4o + 24 - o3 + 0o*3. (o - 3)(o - 2)(o + 2)2 Let t be (-2232)/(-2976) + ((-1)/1 - -1). What is w in -tw*3 + 7/2w*4 - 1/2w*2 + 0w + 0 = 0? -2/7, 0, 1/2 Suppose 3y - 69 = -30. Let v = -11 + y. Solve -4/7 + 4/7f*2 + vf - 2f3 = 0 for f. -1, 2/7, 1 Let h(b) be the first derivative of -2/5b*5 + 8/3b*3 - 20 + 0b*2 + 4/3b*6 - 8b*4 + 0b. Let h(f) = 0. Calculate f. -2, 0, 1/4, 2 Let n(z) be the third derivative of 4z2 + 0z + 0z3 + 1/90z*5 + 0 + 1/108z*4 + 1/180z*6 + 1/945z*7. Determine w so that n(w) = 0. -1, 0 Let u be (-1)/(4/20-1). Factor -2d2 + 2d2 - d4 - ud3 - 9d*4. -5d*3(2d + 1) Let t(a) = a2 + 4a - 2. Let z be t(-5). Let f be 2/8 - z/12. Let 0 + 1/4d2 + fd = 0. What is d? 0 Let x be 1/3(13 - 4). Suppose -5p + 7 = -x. Solve -2q - 4q*p + 2q*2 + 2q*3 - 4 + 3 + 3 = 0. -1, 1 Suppose -5f - 25 = 0, -5r - 2f = -0r - 5. Let a be (80/56 - r/7)/5. Factor 1/5w*3 - aw*4 + 1/5w*2 + 0 - 1/5w. -w(w - 1)2(w + 1)/5 Let o be (84/168)/((-7)/52) - 4-1. What is v in -6/7v*2 + 4/7 + ov*4 + 2/7v - 2/7v3 = 0? -1, 1, 2 Let i(r) be the third derivative of -1/3r*3 + 0 - 19r*2 - 1/60r*6 + 0r - 1/10r5 - 1/4r*4. What is x in i(x) = 0? -1 Let x = -22959/5 - -4595. Let r(f) = f + 7. Let u be r(-5). Factor -4/5z*u - 16/5 + xz. -4(z - 2)2/5 Let u be (429/(-352))/((-60)/16). Let i(k) be the second derivative of -3k + 0 + 9/16k4 + 1/6k*3 + 7/120k*6 + uk*5 - 1/2k2. Factor i(q). (q + 1)2(q + 2)(7q - 2)/4 Let l(f) be the first derivative of f7/420 - f6/15 + 4f*5/5 - 16f*4/3 + 3f*3 + 8. Let g(x) be the third derivative of l(x). Let g(d) = 0. What is d? 4 Suppose -2j - 37 + 43 = 0. Let s(u) be the second derivative of -4u + 0 - 1/24u*j + 1/6u*4 - 1/4u*2 - 1/16u5. Factor s(b). -(b - 1)2(5b + 2)/4 Let h(b) be the third derivative of -b*8/84 + 2b7/105 + b6/6 - b*5/15 - 4b*4/3 - 8b*3/3 - 49b*2. Factor h(a). -4(a - 2)*2(a + 1)3 Let y(p) be the second derivative of p6/70 - 3p5/70 - p4/28 + p3/7 + 51p. Find m such that y(m) = 0. -1, 0, 1, 2 Let b(r) be the second derivative of r8/7840 - r7/840 + r6/420 + r5/70 + 3r4/2 - 17r. Let d(q) be the third derivative of b(q). Factor d(h). 3(h - 2)2(2h + 1)/7 Let j(g) be the third derivative of g6/80 + 9g*5/40 - 21g*4/16 + 11g*3/4 - 7g*2 + 4g. Factor j(f). 3(f - 1)2(f + 11)/2 Let n(b) be the first derivative of 9/2b2 + 27 - 1/6b*3 - 81/2b. Factor n(j). -(j - 9)2/2 Let m(p) be the third derivative of -p8/2184 - 8p7/1365 - 23p*6/780 - 14p5/195 - p4/13 - 101p2. What is o in m(o) = 0? -3, -2, -1, 0 Let s(j) be the second derivative of -2/5j*2 - 1/15j*3 + 0 + 1/30j*4 + 4j. Factor s(i). 2(i - 2)(i + 1)/5 Factor 48p4 + 11p*3 - 31p*3 - 186p*2 + 174p*2. 4p*2(3p + 1)(4p - 3) Let b = -35 + 69. Suppose -17j - 15j - 2j*3 + bj = 0. What is j? -1, 0, 1 Let j be (10 - 8)1/2. Let t be (-15)/(-9)j/5. Factor 0 + 0g2 + tg*3 + 0g. g3/3 Let l(n) be the second derivative of n5/270 - 7n4/108 - 8n*3/27 + 13n*2 - 41n. Let s(j) be the first derivative of l(j). Find z, given that s(z) = 0. -1, 8
Suppose r - 6 + 2 = 0. Let s(k) = -2 + k*3 - 1 - rk*2 + 5. Is s(7) composite? False Suppose 4u = -16, -2i = -4i - 2u - 32. Let w = i - -10. Is (87/w)/(12/(-24)) a composite number? True Let f = -44 + 50. Suppose fk = 4k + 826. Is k a prime number? False Let g = -769 - -2180. Is 2/9 - g/(-9) a composite number? False Suppose -2d - l - 66 = -19, -3l = -5d - 90. Is (d + 20)(-2522)/2 a prime number? False Let q = -15 - -11. Let r = -1 - q. Suppose -3g + 1162 = -g - rd, 5d - 607 = -g. Is g a prime number? True Let x = -1588 - -2987. Is x composite? False Let y(v) = 201v - 50. Is y(11) a prime number? True Let a(v) = -v + 10. Let u be a(5). Let b be 2/u - (-34416)/60. Let n = 891 - b. Is n composite? False Suppose 0 = 2u - 2k - 8306, 3u = -u - 4k + 16572. Suppose 3w + 5l - u = 0, 0 = -2w - 5l + 1896 + 871. Is w a prime number? True Let i(p) = 7p*2 + 7p - 1. Suppose 0 = -5q - 0q. Let o(s) = -s + 6. Let a be o(q). Is i(a) a composite number? False Suppose 15u + 2039 = 16u. Is u a prime number? True Let s(f) = -f*3 - 8f*2 - f - 140. Is s(-18) a composite number? True Let a(z) = 885z*2 + 25z - 1. Is a(3) prime? True Suppose 0 = x - b - 9, -x - 4b + 47 - 13 = 0. Let d(i) = 4i - 7. Let r(g) = g. Let l(n) = d(n) + 2r(n). Is l(x) composite? True Let y(u) = -992u + 171. Is y(-7) a prime number? False Suppose 0 = 3r - r. Let s(f) = -f + 10. Let o be s(r). Let g(w) = 11w + 3. Is g(o) composite? False Let w = 9039 + -2497. Is w a prime number? False Let k be (-1458)/13 + 2/262. Is 62086/14 + -84/k a prime number? False Let p = -7759 + 19836. Is p prime? False Let k = -51440 + 89701. Is k a composite number? False Let s = -1 - -5. Suppose 0 = sj - 5x + x + 64, j = -5x - 34. Is (3 - (j - -3)) + 0 a composite number? False Suppose 2d - 10 = -3d. Suppose ds - 1673 = -315. Is s prime? False Let k = 11550 - 6169. Is k a prime number? True Suppose -7z + 11z - 2y + 14 = 0, z + y = -11. Let w(t) = -3t3 - 1 + 7 - t2 - 4t - 1. Is w(z) a composite number? False Is 2/17 + 25107/17 composite? True Let l = 1984 - -451. Is l a prime number? False Suppose -29 + 5 = -4b. Suppose -a - a + b = 0. Suppose 0 = -2c - 3c + 3g + 491, 4g - 283 = -ac. Is c a composite number? False Let k(z) be the second derivative of z4/12 + z3/3 - 3z*2/2 - 3z. Let r be (1/3)/(1/12). Is k(r) a prime number? False Let f(i) = 354i2 + 14i - 17. Is f(-7) a prime number? True Let v(s) = s - 1. Let j be v(-9). Let q = j - -3. Let r(y) = -y*3 - 4y*2 - y + 9. Is r(q) prime? True Let r(w) = -3061w + 79. Is r(-4) prime? True Let w be 101/2 + 15/10. Suppose -3t + 2r = w, 2r = -4t - 0r - 46. Is (-2)/(-4) + (-4627)/t a prime number? True Let v(y) = y2 + 30y + 138. Is v(-26) composite? True Let c be ((-6)/(-8))/((-4)/(-16)). Suppose cj = 4d - 22, -5d = -4j + 3j - 11. Let g(k) = -k3 - 4k*2 - 2k - 5. Is g(j) prime? True Let x = -40 + 42. Suppose -6q + xq - 3w = -1577, -q + w = -396. Is q composite? True Let f(p) = -p3 + 10p*2 - 8p + 12. Let h be f(9). Let b be (36/h)/((-4)/(-14)). Suppose -g + 2i = -bg + 271, -g - 5i + 68 = 0. Is g composite? False Suppose 0 = -5v + 19v - 189602. Is v composite? True Let a be 53/((4/5)/4). Suppose z - 6z = -5q - a, q = -3z + 143. Is z composite? True Suppose 0 = -3w + 15, -2a + 883 = a + 5w. Let b = a - 193. Is b composite? True Suppose -327d = -332d + 432545. Is d prime? True Let m = -1 - 0. Suppose -21 = 3p - 12. Is -13m/(-1)p prime? False Let h(y) = -3y3 + 10y*2 + 18y - 8. Let j be h(10). Let o = j - -3549. Is o composite? False Let g = 6013 + 3090. Is g a prime number? True Suppose -2c - 18b + 754 = -15b, 2b - 1508 = -4c. Is c prime? False Suppose 0 = -23r + 21r + 4. Suppose 578 - 1464 = -rn. Is n composite? False Let b(i) = i*3 - i. Let g(c) = 55c*3 - c - 1. Let h(t) = -2b(t) + g(t). Is h(1) a composite number? False Suppose 0 = 6o - o. Suppose o = t - c + 6c + 5, 2c = -6. Is 422(-2 - t/(-4)) a composite number? False Suppose 2b = 4f + 33410, -b + 44f = 45f - 16720. Is b prime? False Let w = 18818 - 11053. Is w a composite number? True Let p(h) = -h + 7. Suppose 2i = 10 - 2. Let d be p(i). Suppose da + 573 = 6a. Is a a composite number? False Let h = 5 + 3084. Is h composite? False Let a be 716(1 + 2/(-8)-4). Let x = a - -45. Is x a prime number? False Is 8 - (-5)/1510167 composite? True Let x(o) = o*2 - 6o - 5. Let f be x(5). Is ((-358)/f)/((2/5)/2) a composite number? False Let d be (56/(-6))/(2/6). Let c = -26 - d. Suppose -n - 253 = -cn. Is n prime? False Let k = -1118 + 527. Let n = 1496 + k. Is n a prime number? False Suppose -12 = -4h, 0j + h = -4j - 21. Let b be (j - -5)/((-1)/(-137)). Let l = 214 + b. Is l composite? True Let y(x) = 7x2 + 4x + 2. Let v be (-3)/12 - 58/(-8). Is y(v) a prime number? True Suppose -2y + 110 = q, -3y = q - 0q - 167. Let a(i) = 28i + 10. Let d be a(-5). Let l = y - d. Is l composite? True Let p(g) = 35g + 3. Let w be (-16)/(-6) + (-4)/(-12). Let f be (w - 19)/4 + 8. Is p(f) prime? False Let c = 6747 - 3968. Suppose 3x + c = 10x. Is x a composite number? False Let d(r) = -802r - 115. Is d(-14) a prime number? True Let r = 11 + -5. Suppose 0 = 4z - rz. Suppose z = -0v - v - 5u + 74, 3v - 168 = 3u. Is v composite? False Let u be 4/3 - (-22)/6. Suppose -um + 3s + 5612 = 0, 3m + 2s - 3372 = -s. Is m a composite number? False Let r = 26 - 23. Let f be (r/6)/(6/1812). Suppose -5s = 3c - s - f, 4c - 3s = 218. Is c a composite number? False Let k(y) = 2502y - 55. Is k(3) a composite number? False Suppose -4t + 2r + 3 = -3, -5r = -15. Suppose 0 = u - 1, 582 = p + tu + 74. Is p a composite number? True Suppose 3a = 4x - 115, 4x = 8x + 5a - 139. Let z = x - 2. Let k = 4 + z. Is k a prime number? False Let g = 214 + -143. Suppose -y = 4w - 149, g = 4w + 4y - 81. Is w composite? False Let z be (-2)/10 - (-55)/25. Suppose 2148 = -zl + 6l. Is l a composite number? True Let d(s) = 7s - 4s2 + 15 - 9 - 4s*2 - 2s + s*3. Let j be d(7). Is (-110)/(-2) + j/(-4) composite? True Let d(n) = 20n*2 - 2n - 1. Is d(-7) a composite number? True Let q(m) = 30m + 227. Is q(12) a prime number? True Suppose -91 + 190 = a. Suppose 3k + a = 3c, -3c + 99 = 3k - 5k. Is c composite? True Let w(c) = 135c2 + 9c + 9. Let x(p) = 136p2 + 8p + 8. Let q(y) = -3w(y) + 4x(y). Is q(5) a prime number? False Let b(w) = -w*3 - 9 - 7w + 0w3 - 6w*2 + 16w*2. Is b(6) prime? False Suppose 0 = -3a - 5t + 14398, 50t = 3a + 53t - 14400. Is a composite? False Let v = -32 - -36. Suppose -k + 3355 = 3s - 0s, vs - 4488 = -5k. Is s a composite number? False Let y(v) = 113v2 - 2v + 1. Let f be y(1). Let s be f/(-20) + 2/(-5). Let c(z) = -z*2 - 9z - 7. Is c(s) prime? True Let r = 31946 + -5349. Is r prime? True Let j = 864 - 197. Is j a composite number? True Let w(u) = u*2 - 19u - 17. Let n be w(22). Let v = n + -42. Is v composite? False Suppose -7w + 0w = -w. Suppose -10x + 25x - 84945 = w. Is x a prime number? False Let s(x) = 1119x + 7. Is s(2) composite? True Suppose -3t - 4h - 57084 = -7t, -4h + 57100 = 4t. Is t prime? False Let x = -17 + 19. Suppose -z + xn = -114, z + 4n - 62 - 40 = 0. Let v = z - -21. Is v composite? False Is -3 - -7 - (-16 - 36273) composite? False Let c = 3739 + -1790. Is c a prime number? True Let k(p) = 25p2 - 7p + 1. Let i be 1/(-5) + (-32)/(-10). Let x(y) = y*2 + y. Let w(t) = ix(t) + k(t). Is w(-3) a prime number? False Let l(p) be the second derivative of p5/20 - p4 + p*3/2 - 3p*2 + 4p. Let a be l(5). Let u = 397 - a. Is u composite? False Let t = 9830 - 5244. Is t a composite number? True Let q = -22 - -26. Suppose 2i = 3m - q, -2m + m = 3i - 16. Suppose 4s - 797 = -3x, -2x - is = -757 + 223. Is x composite? False Let y(u) = -23u - 7. Let j(z) = -23z - 6. Let h(s) = -2j(s) + 3y(s). Let v be h(-4). Suppose v = 5t - 352. Is t a prime number? False Let t be (2 - -15)(-3 + 4). Suppose 12m + 435 = tm. Is m a prime number? False Is (-9)/(8 - 17) + 3958 a prime number? False Let c(x) = 89x - 9. Let p be 7 + (4 + -5 - 1). Suppose -pf = -3 - 37. Is c(f) composite? True Let l(v) = -v*3 - 11v*2 - 6v + 13. Suppose 3w - 5w = 28. Is l(w) prime? False Let v = -3227 - -7798. Is v a composite number? True Suppose -3c - 11 = 16. Let a = -5 - c. Suppose 93 = ap - 0p - k, -p = -5k - 28. Is p a prime number? True
Suppose -4l + 3l - 11 = 0. Let b = -10 - l. Let i(k) = 4k3 + k. What is i(b)? 5 Let w(j) = -j - 6. Let u be w(0). Let b(c) = -c - 2c + 11c - 7c + 10. Give b(u). 4 Let h(g) = -6g3 + 2g - 4g3 - 2 + 11g*3 - 5g*2. Suppose -z + 14 = 5p, 4p + 1 - 5 = z. Suppose -v = -f + 8 - 1, -4f - pv = -16. Determine h(f). 8 Let q(m) = m3 - 4m2 - m. Let i be (28/6)/(8/(-12)). Let d = -3 - i. Give q(d). -4 Let a be (-5)/(-3) - (-3)/9. Let i(y) = y3 + 0y + 2y + 13ya - 11y*2. What is i(-2)? -4 Suppose 0 = 9k - 6k + 300. Let t be (k/(-30))/(4/6). Let b(p) = -p2 + 5p + 4. Determine b(t). 4 Let h(s) = s - 5. Let q be h(5). Let o(l) = -8 + q - l + 15. Calculate o(4). 3 Let m(i) = -i*2 - 6i - 4. Suppose 3o = -11 - 1. Calculate m(o). 4 Let u(y) = -11y - 78. Let r be u(-7). Let i(m) be the third derivative of m*6/20 - 2m*2. Determine i(r). -6 Let b = -1 + -1. Let n be b/(-21)97. Let t(w) = -2w + 9. Give t(n). -3 Let k(p) be the second derivative of p5/20 + p4/2 + p*3/2 + p. Suppose i = j + 6, i = 5i - 4. What is k(j)? 10 Let t(s) = 11s - 8. Let q(l) = -10l + 7. Let w(k) = 7q(k) + 6t(k). Determine w(-1). 5 Let n(k) = -k - 9. Let c be -101(0 - (-2)/4). Determine n(c). -4 Suppose 0 = 3n - n - 5h + 8, 4n - 4h - 8 = 0. Let i(v) = -v*3 + 6v*2 - 6. Calculate i(n). -6 Suppose 2d - 7 = -3. Let g(w) = -w + 1. What is g(d)? -1 Let u = -13 + 9. Let k = 5 + u. Let c(d) = -d*3. Determine c(k). -1 Let z(s) = 2 + 4s - 19s + 9s + s*2. Give z(5). -3 Let j(v) = -5v*2 + 5v - 2. Let q(c) = -4c2 + 1. Let h be q(1). Let k(d) = -6d*2 + 6d - 2. Let w(s) = hk(s) + 4j(s). Give w(2). -6 Let s be (-8)/6(-24)/(-16). Let z(c) = 3c*2 + 17c - 2. Let w(y) = y*2 + 6y - 1. Let p(k) = -11w(k) + 4z(k). Determine p(s). 3 Let s(y) = -y*3 - 12y*2 + 6y - 8. Let a(g) = g*3 + 11g*2 - 5g + 7. Let j(w) = 6a(w) + 5s(w). Give j(-6). 2 Let w(f) = f*2 - 4f + 1. Let m be w(3). Let r(g) be the second derivative of -g4/12 - g3/3 - g. Determine r(m). 0 Let g(z) = z*2 + 6z + 2. Let x = -44 - -41. Determine g(x). -7 Let g(b) be the first derivative of b4/4 + b3 + 2b2 + b - 28. Determine g(-3). -11 Let o(z) be the second derivative of -2z*3/3 + z. Suppose 4q + 1 = 3q. What is o(q)? 4 Let t(d) = -d2 + 2d + 1. Let k = 0 - 3. Let z be -41(k + (1 - -1)). Suppose -4w - o = w - 25, 4w + 5o - z = 0. Give t(w). -7 Suppose -3h + 7h = 12. Suppose h - 9 = -3n. Let g(x) = -x2 + 0x*3 + 3x*3 - 1 - x - nx*3 - 5x*3. Determine g(-1). 3 Suppose -h + 4w = 4h - 35, -25 = -5h + 2w. Suppose -f + h = -q - 3, f = 5q + 10. Let o(c) = -3c3 - c. What is o(q)? 4 Let f(y) = y3 - 23y*2 + 21y + 18. Let r be f(22). Let x(m) = m*3 + 4m*2 - 2m - 5. What is x(r)? 3 Let s(m) = 2m2 + 2m + 1. Let x be s(-1). Let o(u) = u*3. What is o(x)? 1 Let p(s) = 9s - 13s + 5 + s + 2s. Determine p(5). 0 Let r(t) = 2t. Let b(i) = i2 - 14i + 36. Let n be b(11). Calculate r(n). 6 Let a(n) = -n*2 + 2n - 10. Let i(z) = -z + 1. Let d(q) = a(q) + 6i(q). Suppose -2p = -10p - 32. Give d(p). -4 Let l(f) = 3f3 + f2 + 9f + 6. Let v(k) = 8k*3 + 4k*2 + 26k + 17. Let h(w) = -11l(w) + 4v(w). What is h(6)? -4 Let x(m) = -51m - 7 + 15m + 22m + 15m. What is x(0)? -7 Let r(s) = -5 + 3 + 3 + 3s. Let c be (-1)/(-2) - 3/(-6). Determine r(c). 4 Let j(w) = -6w*3 - 12w*2 - 5w - 1. Let z(f) = -5f3 - 11f*2 - 4f - 1. Let r(m) = 6j(m) - 7z(m). Determine r(4). 9 Suppose -3u + 12 = -0u. Let n(g) be the second derivative of -g*4/24 + 4g3/3 + g2 + 5g. Let r(o) be the first derivative of n(o). What is r(u)? 4 Let g be (-2)/(-3) - (-315)/(-27). Let w = 29 + g. Suppose 5t - t - w = -3v, -5 = -t - v. Let l(k) = -k3 + 3k*2 - 4k + 4. Give l(t). -8 Let m(h) = -h*2 + 3h - 1. Suppose -5b + 3f + 32 = -0b, 5b = -2f + 12. Calculate m(b). -5 Let y(o) = o. Let x(m) = 3m + 7. Let i(t) = -t*3 + 4t*2 + 4t + 4. Let l be i(5). Let p(w) = lx(w) + 4y(w). Suppose -4v = -2v - 8. Calculate p(v). -3 Let r(g) = -3g3 + 11g*2 + g + 2. Let j(m) = -5m*3 + 17m*2 + m + 3. Let c(q) = 5j(q) - 8r(q). Suppose 0 = p - 1 + 3. Calculate c(p). 1 Let k(m) = -m2 + 3m - 2. Suppose -5i + 60 = -i. Suppose -6f + i = -f. Let b be f/((-9)/(-4))3. What is k(b)? -6 Suppose -n = 5g + 6, -n - 3n = -4g. Let f(x) = 2x2 + 5x - 1. Let m(q) = q*2 + q - 1. Let u(s) = nm(s) + f(s). Determine u(-4). 0 Let g(z) = -3z. Let l be g(-1). Let p = 3 - -1. Let k(n) = n3 + pn - 5n - 1 + ln3 - n3. Calculate k(-1). -3 Let p(g) = -3g - 2. Let n(j) = -2j - 1. Let a(v) = -8n(v) + 5p(v). Let k(o) = 0 - 11o2 - 2o + 9o2 + 1. Let d be k(-2). Determine a(d). -5 Let y(d) = -7d. Let o(b) = b*3 + 8b*2 + 5b - 6. Let h be o(-7). Suppose -4v = -4 + h. What is y(v)? 7 Let k(l) = -2l + 19. Let s(c) = -c + 9. Let a(z) = 2k(z) - 5s(z). Give a(4). -3 Let s be ((-1)/7)/(360/(-21)). Let t(v) be the third derivative of -1/15v5 + 7/24v*4 + 0v + 5/6v3 - sv6 + 0 + v2. Determine t(-5). -5 Let w(n) = -n. Let d(y) = y. Let a(z) = 3d(z) + 4w(z). Calculate a(-2). 2 Suppose -4m - 12 = 8. Let y(k) = k - k + k + 10. What is y(m)? 5 Let x be (-21 + 2)-1. Let i(b) = 5b - 11. Let v(c) = c - 3. Let s(d) = 2i(d) - 9v(d). Determine s(x). 5 Let g(y) = -y*2 + 2y - 1. Suppose 0 = 2z - 4, 0 = 2h - z - 3z + 16. Let w be 22/h - 3. Let r be (-1 - w) + (-7 - -7). Determine g(r). -4 Let g(j) be the third derivative of 0 + 1/3j3 - 4j*2 + 0j - 1/24j4. What is g(-2)? 4 Let h(j) be the first derivative of -j5/60 + j4/24 - j3/6 + 2j*2 + 2. Let d(u) be the second derivative of h(u). What is d(2)? -3 Suppose 0y - 4 = -4y. Let l(t) = y + t + 5t*2 + 0t*2 - 3t*2. Give l(-2). 7 Suppose 4 = 5h - 1. Suppose -j + 3 - h = 0. Suppose 2p = 3g + p, -jp = -5g. Let q(b) = b - 1. Calculate q(g). -1 Let o(m) = m*2 + 6m + 3. Suppose 4c + 4 = 2c. Give o(c). -5 Suppose 75 = 2l + 3l. Suppose -4u - l = -9u + p, 4u = 5p - 9. Let d(y) = -y + 1. What is d(u)? -3 Let d(x) = -3 + x*2 + x + 14x + 1 - 6x. Calculate d(-9). -2 Let n(g) = g3 - 3g*2 - 4g - 3. Let z be n(4). Let o(y) be the third derivative of 0y + 1/12y*4 + 0 - 8y*2 + 2/3y*3. Calculate o(z). -2 Let i(l) = 16l + 6. Let f(c) = -3c - 1. Let x(q) = 33f(q) + 6i(q). Let d = -3 - -2. Let n = d + 3. Determine x(n). -3 Let h(g) = -11g*3 - 7g*2 + 9g - 9. Let o(v) = -5v3 - 3v*2 + 4v - 4. Let k(t) = 4h(t) - 9o(t). Calculate k(-1). -2 Let g(h) = -h*3 + 5h*2 - 4h. Let i be 2 + (0 - (-4 - -3)). What is g(i)? 6 Let c(m) = m + 2. Let u(i) = -3i + 43. Let b be u(13). Determine c(b). 6 Let s(p) be the third derivative of -1/24p*4 - 1/60p*5 + 0 + 0p + 4p2 - 4/3p*3. Determine s(0). -8 Let o(h) = -8h + 4h + h2 + 3 + 9h. Give o(-3). -3 Let t(r) = 6r3 - 2r + 1. Suppose c - 8 = 2. Let x = 11 - c. Calculate t(x). 5 Let h(j) = -2j - 2. Let c = -2 - -4. What is h(c)? -6 Let m(u) = -5u*2 + u. Let o be m(1). Suppose -5z - 5d = 5, -5z + 1 = d - 6. Let c(q) = 2qz - q2 + 0q*2 + 2q - 1. Give c(o). 7 Let c = 4 - 2. Let a = 5 - c. Let w(h) = h*3 - 2h*2 - h + 1. Determine w(a). 7 Suppose -t = 3p - 5p - 2, p - 1 = 0. Let j(v) = -1 + 3 + v2 - 3v + 0v2. What is j(t)? 6 Let s(q) = -q - 3. Let m = 11 - 19. Calculate s(m). 5 Let a(c) = c3 - 3c*2 - 2c + 3. Let d(r) be the second derivative of -r*4/12 + 4r*3/3 + 3r*2/2 - 3r. Let k be d(8). Give a(k). -3 Let n(g) be the third derivative of -g5/60 + g4/4 - g*3/6 - 2g2 + 8. Calculate n(5). 4 Let z(x) = -x2 + 5 - 4 - 4 + 4 + 4x. Suppose 8 = 2w - 0w. Calculate z(w). 1 Let h = 15 - 20. Let c(p) = 2 - 6p*2 + 0p3 - p3 - p - 4p. What is c(h)? 2 Let x(l) be the first derivative of l4/4 + 5l*3/3 + 5l - 2. Let h = 3 + -1. Suppose 21 = -5y + z, y = -hy + 5z + 5. Give x(y). 5 Let f(b) be the third derivative of -1/60b*5 - 1/6b*3 - 13/120b*6 + 0b - 3b2 + 1/24b*4 + 0. Give f(1). -14 Let v(s) = 4s*3 + 0s*3 - 2s*3 - 3s*3 + 2s - 2s2. What is v(2)? -12 Let r(h) = -h + 3. Let g be r(0). Let c(m) = m2 - 3. Calculate c(g). 6 Let v(m) = 5m*2 + 4m + 8. Let d(l) = 4l2 + 3l + 7. Let f(a) = 6d(a) - 5v(a). What is f(2)? -6 Let i(m) = m*2 - 5m. Let o be ((-35)/10 + 3)-10. Give i(o). 0 Let s(x) = x3 - 3x*2 + 2x. Let h be s(2). Suppose 12 + 23 = 7f. Let m(v) = 1 + fv - 1 + h. What is m(1)? 5
Let g(c) = -4c + 12 + 5c + 0c + c2 + 4c. Is 6 a factor of g(-6)? True Let r be -11(1 - 0 - 2). Suppose -r - 7 = -3g. Suppose 0 = -3h - g, -4h + h = 3a - 33. Is 7 a factor of a? False Let y = -64 + 124. Suppose 3l = y + 300. Suppose 3j + j - l = 0. Does 15 divide j? True Suppose -5d + 4 - 9 = 0. Let r = -5 + d. Is 8 a factor of (-1)/(-3) - 100/r? False Let o = -7 - -12. Suppose b + 3b - 5t - 172 = 0, 0 = ot. Is b a multiple of 22? False Suppose -2h - 3u = -1 - 38, -4h = 5u - 73. Is h a multiple of 10? False Let v(j) = j2 - 7j + 5. Is v(-6) a multiple of 12? False Let u be 2(-3 - 27/(-6)). Does 17 divide (-24)/(-10)40/u? False Suppose -5h + 705 = 5d, 3d = 3h - 0h + 393. Is 34 a factor of d? True Let y(f) = -f - 1. Let r(n) = -2 + 8 - 4n - 2. Let l(a) = r(a) + y(a). Is l(-7) a multiple of 13? False Suppose 5g = -r - 18 - 9, -18 = 2g - 2r. Suppose f + s + 0 = -9, 51 = -5f - 3s. Let t = g - f. Does 6 divide t? True Suppose -795 = -l - 2l. Let r = l - 163. Is r a multiple of 28? False Let y(r) = 7r - 7 - 4r - 1. Is y(7) a multiple of 7? False Suppose -3l = 2l - 70. Let p = -10 + l. Does 3 divide p? False Let a = -3 - -9. Suppose -a = -4w + 18. Does 6 divide w? True Let b = 113 - 65. Does 16 divide b? True Let c(t) = 2t*3 - 8t*2 - 3. Let x(m) = -3m*3 + 15m*2 + 6. Let b(u) = 5c(u) + 3x(u). Let g be b(-5). Is 7 a factor of (6/(-4))/(g/(-16))? False Suppose 2d + 4s = 22 - 2, s + 85 = 4d. Is d a multiple of 20? True Let c = 4 + -2. Suppose -cf = -f - 96. Suppose 6r - 3r + 160 = 5z, -r = 3z - f. Is z a multiple of 16? True Is (-3)/9 + 1400/15 a multiple of 21? False Let f(g) = -g - 1. Suppose -d - 12 = 2d. Is 3 a factor of f(d)? True Suppose 3q + 2q - 5 = 0. Is 55 + 4/(q + 1) a multiple of 22? False Suppose -5t = -2i - 0i + 164, -5i + 4t = -427. Is i a multiple of 29? True Let n = -37 + 62. Let d = -4 - 8. Let w = d + n. Is w a multiple of 12? False Suppose -f = -16 - 1. Is f a multiple of 17? True Let q(v) = v3 + v + 110. Does 43 divide q(0)? False Suppose -4j + 2j - 236 = -4d, 0 = -3d - j + 187. Let i = -13 + d. Is 24 a factor of i? True Suppose 5t = 8 + 22. Suppose 0 = -5l + 3h + 20, -2h = l + 2 - t. Does 5 divide (9/l)/((-3)/(-8))? False Let b be 8/(-3 - (0 + -2)). Does 26 divide 65(b/(-5))/2? True Suppose 4k - 4r + 2 = -42, 43 = -3k + 5r. Is 6 - 2k/4 a multiple of 4? False Suppose -48 = -4c - 4j, -5c + 4j + 60 = -0c. Let z be (-9)/(-4) - c/(-16). Let h(s) = 4s2 - 3s - 3. Is 12 a factor of h(z)? True Suppose -2b + 485 - 159 = 0. Is b a multiple of 34? False Let z be 54/21 - 6/(-14). Let r = 10 - z. Is r even? False Let u be (-4)/(-2(5 + -4)). Suppose 2a - j - 134 = -a, 3a = uj + 130. Does 23 divide a? True Let j be 0/(-21) - -9. Let p be (j/2)/((-3)/(-4)). Does 11 divide p/(-15) + (-396)/(-15)? False Suppose 3j + 34 = 5c, 0 = -j - j + 4. Suppose -3v + v = -c. Does 15 divide (2/v)/((-1)/(-60))? True Let k = 27 - 24. Let b = 17 + k. Does 10 divide b? True Let h(n) = -2n - 2. Let r be h(-6). Let q(f) = f*2 - 9f - 5. Let t be q(r). Suppose 3l - 4i - 41 = -0l, ti = 5l - 65. Does 11 divide l? True Let h(g) = -g3 + 14g*2 + 19g + 31. Is h(15) a multiple of 13? True Is 6/4 - 15/(-2) a multiple of 5? False Suppose -5u + 16 = 4d - 12, -4u = 4d - 24. Does 4 divide u? True Does 2 divide 8 - (9/3 - 6)? False Suppose 0 = -5l + 12l - 840. Does 13 divide l? False Is (-20)/(-2) - (-1 + 3) a multiple of 2? True Let f = 346 - 241. Is 22 a factor of f? False Suppose 0k + 10 = 2k. Let v = k + -5. Suppose -5b + 26 + 19 = v. Does 4 divide b? False Let w(r) = -2r - 11. Let q be w(-8). Let d be 12/(-15)q/2. Does 2 divide (-4 - (-3)/1)d? True Suppose 5q - 162 = -2. Is 32 a factor of q? True Is 30 a factor of 2/(6/(-9))-20? True Let u(s) = 3s - 3s + 2s - 4s + 4. Does 12 divide u(-8)? False Let z = -9 + 2. Let v = 9 + z. Suppose -x + vx - 41 = 0. Does 14 divide x? False Suppose 2j = 2l + 32, -4l + 8l = 3j - 52. Suppose 6n - 2n - j = 0. Does 8 divide 46/n - 2/(-3)? True Let i = -256 - -419. Suppose 30 = a + 2v, -33 = 4a + 3v - i. Does 17 divide a? True Let p = -46 + 32. Let x = -8 - p. Suppose j + 1 - x = 0. Is 5 a factor of j? True Is (-41(-2)/6)/((-3)/(-9)) a multiple of 16? False Let x(c) = c*3 - 3c*2 - 6c + 7. Is x(6) a multiple of 14? False Suppose 0q + 7 = 2t - 5q, -4t - 1 = -5q. Let l = -1077 - -756. Is 10 a factor of (-1)/t - l/12? False Suppose 0 = n - 0n - 3. Suppose -nd - 32 = 3g - 110, -d = -g + 24. Is g a multiple of 14? False Let y(c) = c*3 - 10c*2 + 14c - 7. Let f be y(9). Suppose 4z = 4i - 3i - 19, 0 = 5i - z - f. Is i a multiple of 7? True Let z be (-15)/2(-108)/(-45). Does 10 divide z/6 + 19/1? False Suppose 5f - 3u - 159 = 0, 0f - 3f = -3u - 93. Let b = 92 - 46. Let w = b - f. Is 13 a factor of w? True Does 11 divide (267/(-6) + 1)/(2/(-4))? False Suppose 0 = 4h + 5x + 21 + 19, 0 = -4h + 5x. Let g(t) = -2t - 5t - 2 + 4t. Is 13 a factor of g(h)? True Is 40 a factor of (-221/24)/((-3)/132)? False Let t be 134/(-3)(-9)/6. Let r = t + -46. Does 7 divide r? True Suppose b + 26 = 5j, -14 = 4j - 6j + 4b. Suppose 0 = -4a + ja. Suppose -4c - 8 = -f - 5c, a = -5f + 5c. Is 3 a factor of f? False Suppose -3h + 20 = -2q, 32 = -6q + 3q + 5h. Let c = q - -7. Is 3 a factor of c? True Suppose -4 = 4f - 3u, f - 6 = -0f - u. Suppose 4j - 103 = 3s + 1, fj - 52 = 2s. Does 13 divide j? True Is ((-1150)/(-25))/(1/4) a multiple of 23? True Suppose 4o = -3c + 324, -3o + 178 = -4c - 40. Is 20 a factor of o? False Suppose 0a = -3q + 4a + 4, 3q + 4a = 20. Suppose i + 44 = qu, 4u + 3i - 2i - 52 = 0. Does 12 divide u? True Let f = -27 + 27. Suppose 5l - 26 + 6 = 0. Suppose -5o + 3y = -17 - 3, -o - ly + 27 = f. Is o a multiple of 7? True Let n be 16/(-28)(-14)/4. Let u(c) = 2c3 - 2. Does 7 divide u(n)? True Let j(q) = q3 + 9q2 - 7q - 19. Is 22 a factor of j(-9)? True Let q = -9 + 11. Suppose 0 = 4c + y + 11, -qc + 2 = -3c - y. Let n = 8 - c. Is n a multiple of 10? False Suppose -2c = 3n - 69, 7n - 4n = -9. Is 6 a factor of c? False Let i = -67 - -121. Does 7 divide i? False Let l(a) = -2a*3 - 5a*2 - 4a + 2. Does 11 divide l(-4)? True Let l be 44/10 + (-4)/10. Suppose -5d = lh - 126, -h = -3d - 12 - 11. Is 15 a factor of h? False Let o(a) = -2 + 7a - 6a2 + 0a3 - a + a3. Let x be o(5). Suppose -5m + 66 = 4u - 2, -xu - m + 51 = 0. Is 14 a factor of u? False Suppose 177 = 6o - 3o. Let f = o + -84. Is (-290)/f + (-2)/(-5) a multiple of 9? False Suppose 5 = g, 5d - 64 + 24 = -4g. Suppose 0 = dt + 4l - 308, -5t + l + 34 + 357 = 0. Does 12 divide t? False Let u = 13 - 8. Suppose -5p - 43 = -2c, -up - 41 + 7 = -c. Does 8 divide c? False Suppose -7g = -45 + 297. Let s = -20 - g. Is s a multiple of 13? False Is 4 a factor of (2/(-4))/((-2)/176)? True Let q = 1 - -1. Suppose -9 = -qj + 1. Does 4 divide j? False Suppose 4k + s - 18 = -3, -35 = -4k + 3s. Let u = k - -68. Suppose -5l + u = 2n, n = 5n - 5l - 191. Does 22 divide n? True Let h = -43 + 88. Is 7 a factor of h? False Let t = 6 + -4. Is (28/(-3))/(t/(-3)) a multiple of 7? True Let b be (-3 - (2 + 99)) + -1. Let n = -54 - b. Does 18 divide n? False Let x(z) = 7z2 + 2. Suppose -t = -1 - 1. Is x(t) a multiple of 10? True Let v = -1 - -1. Suppose -j + 3j = v. Suppose j = -2w + w + 11. Is w a multiple of 7? False Let f = -8 + 5. Let j(q) = 3q*2 - 4q + 1. Is j(f) a multiple of 10? True Let h = -43 + 123. Is 19 a factor of h? False Let x = 22 - 58. Let v = -24 - x. Is v a multiple of 6? True Let r(v) = -3v - 2v*2 + 2 + 6v*2 + 0 - 3v*2. Is 15 a factor of r(-4)? True Let r be (-1 + 0)(1 + -1). Let p(h) = h*2 + 19. Is 17 a factor of p(r)? False Let o(x) = -10x + 41. Let z(b) = -2b + 8. Let h(m) = -2o(m) + 11z(m). Let j be h(7). Let d(p) = p2 + 5p + 8. Is d(j) a multiple of 16? True Suppose 2o - 5m = 71, 3m - 2m = 5o - 212. Does 43 divide o? True Suppose -5c = 4i - 100, 4c + 0i + 4i = 76. Suppose -u + 3u + c = 0. Let k = 2 - u. Does 5 divide k? False Suppose 0 = -4z + 4g + 32, 5g = 4z - 41 + 13. Let p = -5 + z. Let i = 18 - p. Is i a multiple of 11? True Let l(r) = -r2 - r - 1. Let u be l(3). Suppose 4k - 3t - 76 = 0, -3k - 5t = -75 + 18. Let m = u + k. Is 3 a factor of m? True Suppose -12x - 112 = -8*x. Let l = x - -42. Does 11 divide l? False
Suppose -2k - 49 = -5f, -f + 15 = 2f. Let y = 4 - k. Is y a multiple of 10? False Suppose -39o + 35o + 444 = 0. Suppose f + i + 1 = 0, i + 6 = -f - i. Suppose 3g - o = -3s + fg, -2g + 196 = 5s. Is s a multiple of 20? False Let h be 84/2 + 12/4. Suppose -7w = -2w - h. Is 3 a factor of w? True Let p(s) = s*3 - 7s*2 + 7s. Let a be ((-12)/(-15))/(8/60). Is 3 a factor of p(a)? True Suppose 4c - 6c = -80. Is 10 a factor of c? True Suppose 0 = -4w + 7w - 9. Is 3 a factor of w? True Let d(n) = -n*3 + 12n*2 + 19n + 15. Is d(13) a multiple of 10? False Suppose 2s + 2s = 0. Let w(v) = 1 + v - v*2 + sv - 5v. Is w(-3) even? True Let u(t) = 4t*2 + 6t + 6. Is u(-3) a multiple of 5? False Let d be -3 - (-118 + 1 + 2). Suppose 5n = n + d. Does 6 divide n? False Let b(p) = 62p - 10. Is 36 a factor of b(4)? False Let u(o) = 3 - o + o*3 - 3 + 4o*2 - 2. Let c be u(-2). Does 10 divide ((-21)/4)/((-2)/c)? False Let g(w) = 2w*2 - 3w - 7. Does 3 divide g(-3)? False Suppose -i - v + 54 = 0, -3i + 8v = 3v - 186. Is i a multiple of 13? False Let u(h) = -4 - 1 - 14h2 - h3 - 13h - 4 + 5h*2. Let j be u(-9). Suppose -3i + j = -0i. Does 18 divide i? True Suppose -45 = -3a - 3q, -5q = 4a - 66 + 4. Is a a multiple of 5? False Suppose -3l + 2u = 2l - 549, 5l - u = 552. Suppose 4o = -2i + 86 - 20, -3i + l = 2o. Is i a multiple of 13? True Suppose -5h + 4v = -0 - 25, -4h = -3v - 20. Let d(j) = 2j*2 - 17j + 17. Let k(y) = -y*2 + 8y - 8. Let u(t) = -4d(t) - 9k(t). Is 4 a factor of u(h)? False Suppose 5x + 2 + 18 = 0. Let j = 4 + x. Suppose h - 43 = -2y, j = 4h - 15 - 5. Is y a multiple of 19? True Let x(a) = -a2 + 21a + 56. Is 5 a factor of x(23)? True Let u(z) be the second derivative of z*3/6 + 5z*2/2 + 3z. Let h be u(-5). Suppose 123 = 4x - n, -2n + 54 = 2x - hx. Is x a multiple of 10? True Let v be (-2)/10 + 16/5. Suppose 0u + vu = 9. Is ((u - -7)/(-1))/(-2) even? False Suppose 2o = 6o - 140. Let t(h) = 4h - 1. Let s be t(5). Let u = s + o. Does 19 divide u? False Let z = -1 - 0. Let v be 9 + 2 + z/1. Let a = v + -2. Does 8 divide a? True Let o(b) = 2b*2 - 3b - 1. Let w = -6 + 4. Is 12 a factor of o(w)? False Let q(o) = -o*3 - 5o*2 - 4o - 4. Let m be q(-5). Let l = m - 11. Let d(t) = -t*2 + 7t + 2. Is d(l) a multiple of 6? True Let h(s) be the second derivative of s3/6 - s2/2 - 2s. Let o be h(-1). Is 2 + 34/((-2)/o) a multiple of 18? True Let m(l) = -l + 2. Let n(d) be the second derivative of d3/6 - d2 + 3d. Let z(y) = -3m(y) - 4n(y). Does 7 divide z(-5)? True Let a(o) = 3o + 3 - 2o*2 - 5o2 + 0 + o. Let b be a(-2). Does 3 divide b/(-4) + (-4)/16? False Let o(c) = c2 - 2c + 84. Is 12 a factor of o(0)? True Let c be 28/(-2)(-1)/(-2). Is 18 a factor of (0 + c)18/(-7)? True Suppose 0 = 5x - 353 - 27. Is 35 a factor of x? False Does 4 divide ((-68)/(-6))/(14/21)? False Suppose 5l - 25 = 0, 2d + d - 91 = l. Let x = -19 + d. Is 7 a factor of x? False Let p be 1/4 + (-2)/8. Suppose 2z - 5z + 72 = p. Is 12 a factor of z? True Let t be 32(-36)/(-8). Let f = -34 - -15. Let y = f + t. Is 8 a factor of y? True Suppose 40 = t + 5s, -5t + s + 3s = -200. Is 16 a factor of t? False Does 12 divide (-560)/(-12) + (-8)/(-6)? True Let w be (-33)/(-55) + (-6)/10. Let b = -60 + 157. Suppose -4k - q = -wq - 117, 0 = 4k - 3q - b. Does 9 divide k? False Let m(z) = z + 2z - 7 - 5z. Let q be m(-6). Suppose u + 100 = qu. Is u a multiple of 15? False Suppose -8 = -5f + 12. Suppose 0 = fr - 9 - 11. Let u(o) = 2o + 1. Is 5 a factor of u(r)? False Let u(w) = -6w*2 - 7w + 4. Let l(r) = r*2 - 6r + 5. Let m be l(6). Let k(f) = 6f2 + 6f - 3. Let g(q) = mu(q) + 6k(q). Is 10 a factor of g(-2)? False Suppose -4o + o = 18. Is 3 a factor of o/(-10) - (-12)/5? True Suppose 0 = 8g - 7g - 15. Is g/(-4)32/(-12) a multiple of 10? True Let p be 4/6 + (-40)/6. Is 5 a factor of (-4)/p - (-93)/9? False Does 16 divide (8 + -10)/((-2)/16)? True Let j be -1 + 21 + (5 - 5). Suppose 5l = -w - j, -5w + 3 = -5l - 17. Suppose 4a - 21 - 67 = w. Does 11 divide a? True Let g = -1 - -1. Suppose g = -r + 4r + 12. Does 6 divide (26/r)/(1/(-2))? False Suppose -2j = f - 33, -2j = -3f - 3j + 99. Does 11 divide f? True Suppose 4a - 6a - 8 = -2q, -5q + 4a + 19 = 0. Let o be -1 + q - 4/2. Suppose 4f + o - 22 = 2v, 5v - 1 = 3f. Is f a multiple of 8? True Suppose -c - 4c - 600 = -5m, m + 3c = 140. Does 25 divide m? True Let h(j) = -j2 - 5j + 3. Suppose b - 5 = 2b. Let f be h(b). Suppose -ft + 26 = -t. Is t a multiple of 6? False Suppose -17p + 460 = -13p. Is p a multiple of 42? False Let p be 6 - (1 + (-6)/(-2)). Suppose 0 = -h + 4, -h = -pr + 4h + 50. Is 35 a factor of r? True Let r(a) = -5a. Suppose -6i + i - 10 = 0. Is r(i) a multiple of 4? False Let z be 2/6 + 4/(-12). Suppose -7 = -r - z. Is r even? False Let k be 10 + (-2)/60. Suppose 2i = -3i + k. Let j = i - -3. Is 3 a factor of j? False Let l(o) = 2o - 15. Is l(11) a multiple of 3? False Let n = 6 - 1. Is 2 a factor of n? False Suppose -4i + 205 = 5o - 9i, 0 = -5o + 2i + 190. Let p(x) = -x2 - 2x + 2. Let c be p(-5). Let q = c + o. Is 11 a factor of q? False Suppose -3j + 15 = -0. Does 5 divide j? True Suppose 0h = -3h + 366. Does 21 divide h? False Let y = -7 + 3. Let s(b) = -b3 - 2b*2 + 3b + 2. Does 11 divide s(y)? True Let m(u) = -u*3 - 2u*2 + 7u + 2. Let t be m(-5). Let g be t/8 + 2/(-8). Suppose -7 = -d + gx + 31, 4d = -3x + 37. Does 13 divide d? True Suppose -3d + 3 = -6. Suppose 0 = -3u + 9 + d. Suppose 30 + 3 = 3c + ut, 3t = -c + 11. Does 11 divide c? True Let m(v) = 3v + 2 - 4v - 3 - v. Let y be m(-4). Does 5 divide 2/y - 660/(-42)? False Let j be (-96)/(-40) - (-2)/(-5). Suppose -jt + 5l = 12 + 27, -t = l + 30. Is (t - (-1)/1)-1 a multiple of 13? True Let r(w) = -8w - 7. Does 6 divide r(-4)? False Suppose -4d = d - 4p - 72, -5p - 22 = -2d. Does 4 divide d? True Does 7 divide (1 + 0)/(4/84) - -4? False Suppose 4w = 2w - 64. Let r = w + 102. Suppose 4j - i = 2i + 139, -2i = -2j + r. Does 13 divide j? False Suppose 7 = 5u - 8. Suppose -5s - 4x + 46 = 0, -x - 13 = -5s + 38. Suppose -25 = -ui + 2m, -3i - 2m + m = -s. Is i a multiple of 2? False Let v(f) = f*3 - 8f*2 + 9f - 8. Let m be v(7). Let d = m - 4. Let t(b) = 3b + 2. Is t(d) a multiple of 3? False Let x be 28 + -4 + 6/2. Let w = x + -13. Does 7 divide w? True Let c(d) = d3 - 4d2 + d. Let t be c(4). Let b be (t/3)/((-2)/69). Let a = 84 + b. Is a a multiple of 19? True Let w(z) = -z3 + 5z2 - 3z. Let x be w(4). Suppose 0 = -2f - 5a + 33 + x, -4f = 5a - 49. Is f a multiple of 6? True Let t(b) = -b*3 + 4b*2 + 5b + 1. Let r be t(5). Let h be -4 + r + -5 + 27. Suppose -3z + h = -2z. Is z a multiple of 13? False Suppose 2m - 15m = -416. Is m a multiple of 8? True Let s be 12 - -62/(-4). Let h = 5 + 1. Is (-2)/h + 156/s a multiple of 16? False Suppose -10 = -4q + 5l, -5l + 1 = -3q + 6. Suppose -3c + 5u + 14 + 35 = 0, -qc + 2u + 107 = 0. Does 6 divide c? False Let d(z) = z2 - 6. Is d(6) a multiple of 5? True Let p(g) be the third derivative of -g6/240 + g4/12 + 2g*2. Let h(c) be the second derivative of p(c). Is h(-5) a multiple of 15? True Is (-237)/(-9) - 2/6 a multiple of 26? True Let a = -4 + 3. Suppose 81 = -0n + 3n. Let b = a + n. Is 10 a factor of b? False Let k be 218/4 + 2. Let g = 11 + k. Is 9 a factor of g? False Let x(i) = -i + 1. Suppose h + 6 = -0h + a, 0 = -h + 2a - 8. Let o be x(h). Let b = 13 + o. Is b a multiple of 6? True Let f(l) = 1 + 0l + 6l - 7l - 19l*3. Let s be f(1). Let m = 30 + s. Does 11 divide m? True Let h(j) = 3j*3 + 21j*2 - 6j - 21. Let a(b) = -2b3 - 14b*2 + 4b + 14. Let d(l) = -8a(l) - 5h(l). Does 14 divide d(-6)? False Let q = 31 + -43. Let w = q + 28. Does 9 divide w? False Suppose -x - 1 + 4 = l, 2 = 2l - 2x. Suppose 4 + 4 = -4n. Is 4 a factor of (-1)/n44/l? False Let i(x) = 9x2 - 11x + 36. Does 20 divide i(7)? True Let m(n) be the third derivative of -n6/360 + n5/20 + n4/6 - n3/6 - 3n2. Let o(v) be the first derivative of m(v). Is 5 a factor of o(3)? False Is 2 a factor of (-3)/(12/(-152)2) + 3? True Let j(r) = -2r - 3r + 3 - 6. Does 17 divide j(-4)? True Suppose -4h - 5u = -223, 366 - 140 = 4h + 2u. Let v be (11 - 13)*(-31)/(-2). Let w = h + v. Does 10 divide w? False
Find the third derivative of 4314im*3z*2 + 11im3 + 780im2z*2 - 3im2 + 3imz*2 wrt m. 25884iz2 + 66i Find the first derivative of 75k4v*3 + 416k*2v*3 + 2v*3 + 2v*2 - 29657 wrt k. 300k*3v*3 + 832kv3 What is the second derivative of -3892m*3x + 195m2x*3 - 114219mx3 + x3 wrt m? -23352mx + 390x*3 What is the first derivative of 47h*2m - 12hm + 8h - 132m - 122 wrt h? 94hm - 12m + 8 Find the second derivative of -d2j*3 + 14035d*2js + 3dj3s + 134dj*3 + 5j*2s wrt d. -2j3 + 28070js What is the derivative of 6572496p*2 - 2430583? 13144992p What is the third derivative of -20167h4 - 2h*3 + 197977h*2 wrt h? -484008h - 12 What is the third derivative of -291c4 + 788c*3 - 1353897c*2 wrt c? -6984c + 4728 Find the third derivative of 47238d2v*5 + 20d*2v*2 + 5d*2v + 3d - 2v*5 - 3v*2 wrt v. 2834280d*2v*2 - 120v*2 What is the second derivative of 6m*5 - 9687m*4 - 100365m wrt m? 120m3 - 116244m*2 What is the second derivative of -37163r*2 + 76511r wrt r? -74326 Find the second derivative of 154721r3 + 108040r wrt r. 928326r Find the second derivative of -2v*5 + 29249v*4 - 8v - 1742. -40v3 + 350988v*2 Find the second derivative of -54l*2w*3 - 3317l*2w*2 - 13lw3 + 3lw - 47l + w*3 - w wrt l. -108w*3 - 6634w*2 Differentiate -19g*2o*2 - 2g*2ot + 6g*2t + 2g2 + 16gt - 3o*2t + 8t with respect to o. -38g*2o - 2g2t - 6ot What is the first derivative of -35143g4 + 107783? -140572g*3 What is the second derivative of -3041739q*2 + 36044q + 14? -6083478 Differentiate 2720337r - 2668426 wrt r. 2720337 What is the second derivative of -22640v*2 - 126v + 2 wrt v? -45280 Find the second derivative of -2405118d2q + dq - 72d + 20q - 161 wrt d. -4810236q What is the first derivative of 1358353w2 - 3009042 wrt w? 2716706w What is the first derivative of y*2 + 69328y + 734660? 2y + 69328 Differentiate -479f*2 - 149f + 1505911. -958f - 149 Differentiate 1994c*3 - 7c + 19926 with respect to c. 5982c2 - 7 Find the first derivative of 279m*4n - 6m3 + 17m*2 + 142761n - 5 wrt m. 1116m3n - 18m2 + 34m Differentiate 140c2 - 98c + 10208. 280c - 98 Differentiate -4608791d + 2275958 wrt d. -4608791 Find the first derivative of -41514ah*3 - 20767h*3 - h wrt a. -41514h*3 Find the third derivative of -17379u*3 + 11193u*2. -104274 Differentiate -16287l - 14331. -16287 What is the third derivative of 7m6y + 4038m3y*2 + 6m*2y2 + m2 - 1973my*2 wrt m? 840m*3y + 24228y2 What is the second derivative of 476592p*2v*5 + 8p*2v - 16343pv - 4v4 + 3 wrt v? 9531840p*2v*3 - 48v*2 What is the third derivative of 1220u*6 - 10u*5 - 2u*4 + 881913u*2 wrt u? 146400u*3 - 600u*2 - 48u Find the third derivative of 5q4 - 113455q*3 + 1135q*2 + 24q + 11. 120q - 680730 Find the second derivative of -2y*4 + 59085y*2 + y + 56096. -24y*2 + 118170 Find the third derivative of 551088z*4 - 2z*2 + 12z - 1313. 13226112z Find the second derivative of -104076b*2 + 599b + 35. -208152 Differentiate -5y2 - 64679y + 657058. -10y - 64679 What is the second derivative of 69901k*2 - 126k + 113? 139802 Find the third derivative of -1388008b2k*3 + 2b*2k*2 + 5953b*2k - 2bk*2 + 12b wrt k. -8328048b2 Differentiate 77458h*2n*2 - 84n*2 - 4n - 1 wrt h. 154916hn*2 What is the third derivative of -99317f*6 - 416340f*2? -11918040f*3 Differentiate 4466j*4s + 13j3s + 50915s + 3 with respect to j. 17864j*3s + 39j2s Find the second derivative of g*3s - 4997g2s*2 - 33g*2 + 558gs - 63s*2 - s wrt g. 6gs - 9994s*2 - 66 Find the third derivative of -108864b*6 - 129b*2 + 457b wrt b. -13063680b3 Find the third derivative of 2162133w*3 - 4228w*2 - 2w + 10 wrt w. 12972798 Find the third derivative of 87654ht*3 + 650ht2 + 7ht - 13t*2 - 2t wrt t. 525924h Differentiate 4a*2i + 131485a2 + 29ai - 20i wrt i. 4a2 + 29a - 20 What is the third derivative of -n*4q - 8n3q*2 + 245n*3 - 2n*2q*2 + 2095n*2q - nq2 + 10q*2 wrt n? -24nq - 48q2 + 1470 Find the first derivative of -t3 + 7t2 + t + 64744 wrt t. -3t*2 + 14t + 1 Find the third derivative of -22u4 + 7313u*3 - 44512u*2. -528u + 43878 What is the third derivative of 3780766o5 - 34117o*2 + 3o - 2 wrt o? 226845960o2 Find the third derivative of 23266y3 - y2 + 714y + 5. 139596 What is the third derivative of -45895k*4 - 23436k*2 - 1? -1101480k What is the derivative of -299438d2 - 298910 wrt d? -598876d Find the third derivative of -172437j3 + 181786j*2 wrt j. -1034622 Find the third derivative of -244f*5s + 17f4 - 3f*3 + 11309f*2 - 2s wrt f. -14640f2s + 408f - 18 What is the second derivative of -2uw3 + uw*2 - 27uw - u - 34w3 + w2 - w - 52 wrt w? -12uw + 2u - 204w + 2 Find the second derivative of 32393dj*2l - 20dj + 88dl*2 + 25j*2l*2 + 40j wrt j. 64786dl + 50l2 What is the first derivative of -16792s3 + s2 - 39110 wrt s? -50376s2 + 2s Find the third derivative of 8687r4 + 507r*2 + 3r + 3 wrt r. 208488r Find the third derivative of -165z*6 + 18z*5 - 11z3 + z2 + 54726z. -19800z*3 + 1080z*2 - 66 Differentiate 74409j - 72117 with respect to j. 74409 Differentiate -51581z2 + 29768 with respect to z. -103162z What is the first derivative of -4x3 - x2 + 717x + 320338 wrt x? -12x2 - 2x + 717 What is the third derivative of -4011080c3j3 - c3j2 + 187c*2j*2 + 167cj - 1 wrt j? -24066480c*3 What is the third derivative of -275h*3q*2z*3 + 320h*3qz3 + 1182h*3z*2 + 3q*2 + 2qz2 + 3z wrt z? -1650h3q*2 + 1920h*3q Find the second derivative of 4a4y*2 + 3579a*4y - 5ay*2 + 816y*2 wrt a. 48a*2y*2 + 42948a*2y Differentiate 3j2 - 29810j + 40326 with respect to j. 6j - 29810 Differentiate 948033u + 742931. 948033 What is the first derivative of -2u2wz2 + 9764u*2wz - 801u*2z - 2u2 - 9uz2 wrt w? -2u*2z*2 + 9764u*2z What is the third derivative of 833407y3 + 158y*2 - 73y + 2 wrt y? 5000442 Find the second derivative of 2f4 + 15f*3 + 233f*2 - 2036f + 1. 24f2 + 90f + 466 What is the third derivative of -97615iy*3 - 5iy2 - 3i - 3y4 + 60y + 15 wrt y? -585690i - 72y Find the first derivative of 269380o2x + 142o2 + 2o - 19 wrt x. 269380o2 Find the first derivative of 8231uvx*2 - uv + 57ux*2 + 274vx - 28v + x*2 + 2 wrt u. 8231vx2 - v + 57x*2 What is the first derivative of 9g*2h*2 - 27g*2 + 217gh4 - 6gh - 499 wrt h? 18g*2h + 868gh*3 - 6g Find the second derivative of -34596t3 + 3t*2 - 6t + 8845. -207576t + 6 What is the second derivative of 500381w*2 + 543269w? 1000762 Find the third derivative of -60026n4 - 104700n*2 wrt n. -1440624n What is the derivative of 190j3 + 134j - 20711? 570j2 + 134 Find the third derivative of 14n*5 + 2n*4 + 797n*3 - 18n*2 + 709n wrt n. 840n2 + 48n + 4782 Find the second derivative of 16864m3 + m2 - m + 3797. 101184m + 2 What is the second derivative of -254n3y*2 - 2n*3y + 37n2y*2 + 4n*2y - 9n2 + 13y*2 + 14 wrt y? -508n*3 + 74n*2 + 26 Find the second derivative of 73131m*4 + 12697m - 2. 877572m2 Differentiate -16898hp2 + 2p*2 - 5034p wrt h. -16898p2 Find the second derivative of -148048p*3 + 620p + 45. -888288p What is the second derivative of -13778l*2 - 3110l - 1? -27556 Find the second derivative of -1176f3m*2 - 99324f*3m + f*3 + 176f*2m2 + f2m + m2 + 2m wrt m. -2352f3 + 352f*2 + 2 What is the first derivative of 53701c*2r + 2678c2 + 3c - 9 wrt r? 53701c2 Find the third derivative of -2656384j*5w + 2j4w*2 - 2983j*2w*2 + 49j*2w wrt j. -159383040j2w + 48jw*2 Find the third derivative of 5942h*3q*2t*3 + 3h*3t - 33h2qt2 + 2ht3 - 77q*2t wrt t. 35652h3q*2 + 12h What is the second derivative of j*3k*3 + 40j*3 + 20j*2k*3 - 2j*2 - 2jk3 + 16jk2 + 53k*3 - 2 wrt j? 6jk3 + 240j + 40k3 - 4 What is the third derivative of 2203663j*3 - 8761j**2 + 4 wrt j? 13221978
Is 28123 prime? True Is 94747 composite? False Is 48311 composite? False Is 51407 prime? True Is 16921 a prime number? True Is 300389 composite? True Is 1208927 prime? True Is 66223 composite? True Is 23487 a composite number? True Is 28257 a composite number? True Is 641077 prime? True Is 205237 composite? False Is 370759 a prime number? True Is 991 composite? False Is 317451 a composite number? True Is 711609 prime? False Is 5583 prime? False Is 6158 a prime number? False Is 2982767 a prime number? False Is 3687559 composite? True Is 7699 a composite number? False Is 9923 composite? False Is 26989 a prime number? False Is 401543 prime? False Is 16253 a prime number? True Is 91433 composite? False Is 2427053 a prime number? True Is 12706 composite? True Is 5303 composite? False Is 16673 prime? True Is 5833 a prime number? False Is 236699 a prime number? True Is 248351 a composite number? False Is 859 composite? False Is 2219 a prime number? False Is 7069 a composite number? False Is 2858 composite? True Is 57703 a prime number? False Is 210529 composite? True Is 87011 prime? True Is 84259 composite? True Is 33479 composite? False Is 521981 a composite number? False Is 4903 composite? False Is 337397 a prime number? True Is 38011 a prime number? True Is 4148473 composite? True Is 60035 a prime number? False Is 21713 prime? True Is 4289 a prime number? True Is 111373 prime? True Is 7741 prime? True Is 537271 a composite number? True Is 3793 composite? False Is 34691 composite? True Is 319187 a prime number? False Is 427781 a prime number? True Is 225389 composite? True Is 16787 prime? True Is 670987 composite? False Is 22769 a composite number? False Is 287047 a composite number? False Is 13683 composite? True Is 5173 prime? False Is 148573 a prime number? True Is 212479 a composite number? False Is 43243 composite? True Is 2159 composite? True Is 91733 a prime number? True Is 1811 composite? False Is 48629 a composite number? True Is 130937 a prime number? False Is 134639 a composite number? False Is 84047 prime? True Is 354481 composite? True Is 16293 prime? False Is 12643 prime? False Is 540101 composite? False Is 427 a prime number? False Is 9629 composite? False Is 98545 prime? False Is 250253 composite? False Is 1507 prime? False Is 54533 a prime number? False Is 55723 a prime number? False Is 13045 a prime number? False Is 1018717 composite? True Is 75291 a prime number? False Is 610957 prime? True Is 61689 prime? False Is 409579 a prime number? True Is 16123 composite? True Is 42989 a prime number? True Is 366469 a prime number? False Is 49813 a prime number? False Is 13011 a composite number? True Is 79313 composite? True Is 50689 a prime number? False Is 1014677 a composite number? False Is 5731 composite? True Is 37951 a prime number? True Is 4967 a prime number? True Is 7849 a composite number? True Is 1494263 a prime number? True Is 546919 a prime number? True Is 51031 prime? True Is 4597 composite? False Is 2579 composite? False Is 4847 prime? False Is 144299 prime? True Is 49262 a prime number? False Is 547251 composite? True Is 1217 composite? False Is 13669 prime? True Is 7963 a composite number? False Is 1817741 composite? True Is 12761 prime? False Is 15959 prime? True Is 302399 prime? True Is 5963 prime? False Is 905 prime? False Is 4111 a prime number? True Is 200483 a composite number? False Is 52879 composite? False Is 9731 a prime number? False Is 3197 a prime number? False Is 283303 a composite number? False Is 158 a composite number? True Is 449057 a composite number? True Is 8689 composite? False Is 19769 a composite number? True Is 38543 composite? False Is 1753 a composite number? False Is 71243 composite? True Is 165287 prime? True Is 36739 prime? True Is 5079 composite? True Is 777097 a prime number? True Is 2761 a composite number? True Is 4601969 composite? False Is 579974 a composite number? True Is 1513381 a composite number? False Is 4391 a prime number? True Is 24653 composite? True Is 191647 composite? True Is 8114 prime? False Is 22181 a composite number? True Is 4714 prime? False Is 208723 prime? False Is 21143 composite? False Is 11081 a composite number? True Is 290354 composite? True Is 163937 a composite number? True Is 1101 a prime number? False Is 3749 composite? True Is 39779 prime? True Is 1824685 a prime number? False Is 3292969 composite? False Is 1186463 a prime number? False Is 872147 composite? True Is 17417 prime? True Is 176699 a composite number? False Is 1177 a prime number? False Is 1444043 a composite number? False Is 139813 composite? False Is 72299 composite? True Is 10243 prime? True Is 857881 prime? False Is 16201 a prime number? False Is 53002 a prime number? False Is 108938 prime? False Is 116771 prime? False Is 172969 a composite number? False Is 55343 a composite number? False Is 5777 a prime number? False Is 122381 a composite number? True Is 6469 a composite number? False Is 7349 prime? True Is 241747 a prime number? False Is 14783 composite? False Is 2749 composite? False Is 2330623 composite? True Is 8654 a composite number? True Is 206993 a composite number? False Is 994937 prime? False Is 103561 a prime number? True Is 200569 a prime number? True Is 57415 composite? True Is 79 prime? True Is 96533 a prime number? False Is 27011 composite? False Is 52237 a composite number? False Is 4673893 composite? True Is 182159 a composite number? False Is 36362 a composite number? True Is 21701 composite? False Is 257921 a composite number? False Is 43661 composite? False Is 7522 prime? False Is 756205 a prime number? False Is 70199 prime? True Is 33739 prime? True Is 480079 composite? True Is 24545 a composite number? True Is 49871 a composite number? False Is 2519329 a composite number? False Is 933299 a prime number? False Is 344321 a composite number? False Is 818813 composite? False Is 338627 a prime number? False Is 1582697 composite? False Is 205271 a prime number? False Is 11927 prime? True Is 1973005 a composite number? True Is 55073 prime? True Is 227407 composite? False Is 2609 composite? False Is 1943 composite? True Is 11243 a composite number? False Is 470329 a composite number? True Is 22199 a prime number? False Is 1535 a prime number? False Is 50663 composite? True Is 1196003 prime? True Is 1361 prime? True Is 293003 prime? False Is 22873 prime? False Is 16921 a composite number? False Is 301367 composite? True Is 6031 a composite number? True Is 10133 a prime number? True Is 104987 composite? False Is 963959 prime? False Is 116141 a prime number? True Is 47131 prime? False Is 6353 prime? True Is 61514 a composite number? True Is 43451 a composite number? False Is 11967 a prime number? False Is 64393 a composite number? True Is 473633 composite? False Is 11423 a composite number? False Is 2149 a composite number? True Is 23251 composite? False Is 60377 a prime number? False Is 27479 composite? False Is 829019 a composite number? True Is 164663 a composite number? False Is 137239 prime? True Is 78667 prime? False Is 1090639 prime? False Is 11015 prime? False Is 915391 a prime number? True Is 352967 a prime number? False Is 9274 composite? True Is 614 a prime number? False Is 4373 prime? True Is 130079 prime? True Is 1193 prime? True Is 138221 prime? False Is 10223 a prime number? True Is 1734541 a prime number? False Is 661987 a composite number? False Is 5303 prime? True Is 2507 a prime number? False Is 487889 a composite number? False Is 13799 prime? True Is 435467 composite? True Is 494191 prime? True Is 149735 prime? False Is 28961 composite? False Is 58537 a composite number? False Is 188677 a composite number? False Is 53113 prime? True Is 19561 a composite number? True Is 69086 composite? True Is 265781 a composite number? False Is 61127 a composite number? True Is 66617 a composite number? False Is 96953 a prime number? True Is 6731 a composite number? True Is 135631 prime? False Is 174223 prime? False Is 36493 prime? True Is 121405 a composite number? True Is 16847 composite? True Is 634943 prime? True Is 3127 a prime number? False Is 505889 a composite number? True Is 496049 prime? False Is 6131 a composite number? False Is 72683 a composite number? True Is 1115 composite? True Is 9221 a prime number? True Is 1409 a prime number? True Is 125591 a prime number? True Is 203117 a composite number? False Is 1253 composite? True Is 12187 prime? False Is 1901 a composite number? False Is 77711 composite? False Is 9533 a prime number? True Is 13235 composite? True Is 2617567 a prime number? True Is 25663 a composite number? True Is 1762489 a composite number? True Is 37747 prime? True Is 706 a composite number? True Is 10063 prime? False Is 17707 composite? False Is 20287 a composite number? False Is 743 composite? False Is 25073 composite? False Is 213069 a prime number? False
Suppose 2r + 0 - 6 = 0. Suppose 35 = 2p + rp. What is the remainder when 20 is divided by p? 6 Let f = 6 + -9. Calculate the remainder when (3 - 2)/(f/(-36)) is divided by 5. 2 Let s be (7 + 9)(-1)/(-2). Calculate the remainder when (-1065)/(-20) - 2/s is divided by 19. 15 Suppose -5u - 3y - 2 = 0, 3u - 5u - 5y - 16 = 0. Calculate the remainder when 5 is divided by u. 1 Suppose 2p - 6 = -4. Suppose i + 4j = -0j - 7, -j = -2i + 13. Calculate the remainder when i is divided by 3 + -7 + p + 6. 2 Suppose -50 = 5t + 10. Calculate the remainder when 17 is divided by 8/10(-90)/t. 5 Calculate the remainder when 27 is divided by 24/(-16)40/(-6). 7 Suppose -3p = -7p + 16. Suppose -pa - 15 = -3r, 3r + 2 = -a + 2r. Calculate the remainder when 17 is divided by ((-6)/a)/(2/9). 8 Suppose -4x + 3o + 26 = x, -5o = 5x - 10. Suppose -q + 5 = -4. Calculate the remainder when x/18 + 88/q is divided by 4. 2 Let k = 16 - 7. Let x = k - -8. Calculate the remainder when x is divided by 9. 8 Suppose -5k = 2k - 42. What is the remainder when (-2)/7 - 312/(-14) is divided by k? 4 Let n(k) = 8k3 + k2 - 2k*3 - 5k*3 - 1 - 3k. What is the remainder when n(3) is divided by 9? 8 Let k(f) = -3f + 6. Calculate the remainder when 17 is divided by k(-1). 8 Calculate the remainder when 19 + 3 + 0/(-2) is divided by 13. 9 Let o = -6 - -31. Suppose -x - 5w = -93, -2w + 6w = -5x + 381. Calculate the remainder when x is divided by o. 23 What is the remainder when (-3)/((-1)/((-220)/(-12))) is divided by 20? 15 Suppose -5h - 54 = -4t, 4t = 2h + 55 - 7. Let f(x) = 7x + 6. Calculate the remainder when f(5) is divided by t. 8 Let x(c) = -c + 18. What is the remainder when 1 is divided by x(17)? 0 Suppose 0 = -0g + g - 16. Let i = -2 + 7. Suppose -ik - 30 = -185. What is the remainder when k is divided by g? 15 Let z = 0 - 11. Let a(k) = k*2 + 8k - 15. Calculate the remainder when 33 is divided by a(z). 15 Let h = 16 - 12. Let s = h + 5. What is the remainder when 25 is divided by s? 7 Suppose 2o = -8 - 0. Let x = -5 - o. What is the remainder when x - (0 - 11) - 1 is divided by 5? 4 Let i(g) = g2 + 17g + 37. What is the remainder when 41 is divided by i(-15)? 6 Suppose -w = 4a - 68 + 15, w = a + 33. What is the remainder when w is divided by 11? 4 Let m = 5 - 2. Calculate the remainder when 7 is divided by m. 1 Let v(c) = c3 + 5c*2 + 2. Let n be v(-5). Suppose -nj + 31 = 13. What is the remainder when j is divided by 4? 1 Let b be 2 + (-1 - 0)0. Suppose -o + 3 = b. Calculate the remainder when 2 is divided by o. 0 Let v = -172 + 208. Suppose 13 - 1 = 3m. Suppose -41 = -3w + l, -4l - 21 = -mw + 3w. What is the remainder when v is divided by w? 10 Let k(x) = -x*2 - 4x + 7. Let b be k(-5). Suppose 2p = -s + bs + 33, -p - 5s + 44 = 0. What is the remainder when 54 is divided by p? 16 Let o(h) = 0h*3 + 2h*3 - 3h*3 + 2 - 6h*2. Let t be o(-6). Suppose 3n + tn = 55. What is the remainder when 32 is divided by n? 10 Let k(j) = 4j + 1. Let n be k(1). Suppose 0 = np - 3p - 2. What is the remainder when 1 is divided by p? 0 Let t = -27 + 18. Let o = t - -16. Calculate the remainder when 13 is divided by o. 6 Let o = 26 - 8. Let y = -1 - -3. What is the remainder when 7/((-7)/y)-26 is divided by o? 16 Let l = 3 - -4. Suppose -3b + 34 = 2q, 2b + q - l = 14. Calculate the remainder when 29 is divided by b. 5 Let r(f) = -19f - 86. What is the remainder when r(-8) is divided by 28? 10 Suppose 0 = 6n - 12 - 834. Calculate the remainder when n is divided by 36. 33 Suppose -3q + 40 + 146 = 0. What is the remainder when q is divided by (2/(-4))/((-11)/22) + 20? 20 Let b be 0/(-1) + 2 + 2. Suppose -3m + bm - 4s - 12 = 0, 3m + 2s + 34 = 0. Let h = m - -20. Calculate the remainder when 23 is divided by h. 11 Suppose 4w - 9w = -10. Suppose z - 63 = -wz. Suppose 2y = 5x - 22, 4y + 0y = 16. Calculate the remainder when z is divided by x. 3 Suppose 2p - 1 + 3 = 0. What is the remainder when (-5 + 3)p + 77 is divided by 20? 19 Let t = 3 - 14. Suppose 32 = 3m - 0z + 4z, z = -4. Let f = m + t. Calculate the remainder when f is divided by 2. 1 Suppose 7u + 5 = 2u. Let l = u + 12. Let v = 49 + -18. What is the remainder when v is divided by l? 9 Suppose -i = -6i + 135. Suppose -4y + 3y - 16 = -3h, -3y = h - 22. Calculate the remainder when i is divided by h. 6 Suppose -2s + x + 2x = -27, -5s + 72 = -3x. Let p(o) = o2 + 2o - 4. Let g be 13/(-1) + -1. Calculate the remainder when s is divided by p(g). 3 Let a(k) = -4k - 9. Let u be a(-7). Suppose 0 = -2l + u + 3. Let z = -22 - -42. Calculate the remainder when z is divided by l. 9 Let m = -5 - -13. Let d(r) = 3r - 2r - 5 + 2r. What is the remainder when d(m) is divided by 10? 9 Let t(r) = -r*3 - 6r*2 + 7r + 10. Let m be t(-7). Let g(n) = n*2 - 13n - 4. Let a be g(m). Calculate the remainder when -3 + 1 + 1 - a is divided by 9. 6 Suppose 2b = 7b - 105. Calculate the remainder when 60 is divided by b. 18 Let d(i) = 2i2 + 4i + 1. Let w be 1(-4)/(-2) - 0. What is the remainder when 2 - (-35 + w + 2) is divided by d(-4)? 16 Calculate the remainder when ((-15)/(-6))/(3/66) is divided by 14. 13 Let f = -132 - -153. What is the remainder when 34 is divided by f? 13 Let x = -92 - -132. Calculate the remainder when x is divided by 14. 12 Let d = -69 - 84. What is the remainder when (d/(-36))/(2/8) is divided by 6? 5 Let z = -45 - -31. Let o(t) = t3 + 3t*2 + 6t + 6. Let c be o(-4). Let q = z - c. What is the remainder when q is divided by 11? 9 Suppose -3g + 111 = 3w, -2w = -w - 2g - 52. Calculate the remainder when 121 is divided by w. 37 Let x = 4 + 17. Let o(t) = 13t - 82. What is the remainder when o(11) is divided by x? 19 Let l = 75 - 46. Calculate the remainder when 83 is divided by l. 25 Let c be (-29)/(-3) - (-1)/3. Suppose c = f + 43. Let a = f + 54. What is the remainder when a is divided by 11? 10 Let w = -13 - -17. What is the remainder when 11 is divided by w? 3 What is the remainder when 79 is divided by ((-9)/2 + 3)(-21 - -3)? 25 Let u = 47 + -15. What is the remainder when 63 is divided by u? 31 Let h(o) = -5o + 3. Suppose 0 = 4y - 29 - 23. What is the remainder when h(-4) is divided by y? 10 Let v(w) = -w*2 + w - 1. Let g = -2 + 2. Let j be v(g). Calculate the remainder when j2 - -229 is divided by 19. 18 Suppose -2s + 3d + 42 = -d, -5d - 100 = -5s. Let a(v) = v3 + 7v*2 + 4. Calculate the remainder when a(-5) is divided by s. 16 Let n(x) = -5x + 5x + x - 2. Let d be n(4). Suppose -2 = -dt + 14. Calculate the remainder when t is divided by 3. 2 Let a(x) = 2x - 2. Let g be a(2). Suppose 2f = -gf + 260. What is the remainder when f is divided by 22? 21 Suppose 95 = 2b - 189. Calculate the remainder when b is divided by 29. 26 Suppose -q - 10 = -6q - t, 5q = 3t + 30. Suppose 2g - p - 9 = 0, g - qp - 24 = -4g. What is the remainder when 8 is divided by g? 2 Calculate the remainder when 78 is divided by (162/(-12))/((-2)/4). 24 Suppose -4t + 10 = -2i - 2, -3t + 3i = -9. Calculate the remainder when 8 is divided by t. 2 Suppose -3o + 4u = -83, 3o + 4u - u - 48 = 0. What is the remainder when o is divided by 11? 10 Let g = 22 + -13. Suppose 5v + t = -0v - g, -2v = t + 6. What is the remainder when 2/1 - 7/v is divided by 5? 4 Let z = -121 - -141. What is the remainder when 74 is divided by z? 14 Suppose 3f - 237 = 3w, 5f + 3w = w + 388. Calculate the remainder when f is divided by 27. 24 Suppose -w = -4c + 3w + 12, -4c - 4w + 28 = 0. What is the remainder when 8 is divided by c? 3 Let b = 121 + -69. Suppose 24 = i + 4k, i = 5i + 5k - b. Let t = -1 + 15. Calculate the remainder when t is divided by i. 6 Suppose -3v + 3s = -21, -3s - 11 = 2v - 0s. Suppose -5b + 2x + 2x = -54, 0 = -5b + vx + 62. Calculate the remainder when b is divided by 4. 2 Suppose 0q = -k - 5q + 8, k - 2q = 8. Suppose 16 = -4b, 0 = 2m - 0m + 5b + 18. What is the remainder when -3 - (m/1 + -27) is divided by k? 7 Suppose 0r = 4r. Suppose 3g = s + 21, r = 5g + 2s - 4s - 36. Calculate the remainder when g is divided by 4. 2 Let p(c) = -c3 + c2 + 11. Suppose 0 = -4h + 98 + 26. Calculate the remainder when h is divided by p(0). 9 Suppose 4b - 29 = -3i + 12, 0 = -3i - 3. What is the remainder when 64 is divided by b? 9 Let s(i) = 2i*2 - 5i - 2. Let g(a) = -a - a*3 - 2a - 5a*2 + 2 + a. Calculate the remainder when s(5) is divided by g(-5). 11
Expand (0s2 - s2 + 0s*2)(-s*2 + 3s2 - s2) - s*4 - 2s*4 + 2s*4 + (5s + 3s2 - 5s)(-6s*2 + 3s2 + s2). -8s4 Expand (0x*2 + 0x*2 - 4x*4)(0 + 2 - 1 - 5 + 2 + 5 + (-1 + 4 - 2)(1 + 5 - 4)). -20x*4 Expand (3q*3 - 3q*3 + 3q*3)(-1 + 1 + 2q) + q + 2q*4 - q + (2q*3 + 1 - 1)(-4 + q + 4). 10q4 Expand -3t5 + t5 + 3t5 + (-3t + 4t + t)(4t4 - 2t + 3t - 3t*4 + 2t*2). 3t*5 + 4t*3 + 2t*2 Expand (-2i - 7i + 2i)(-i + 0i + 0i). 7i2 Expand (-t4 + 0 + 0)(-4t + t - 2t). 5t*5 Expand (6 - 5 + 6)(5z3 + 2z*3 + 10z*2 - 8z*2). 49z*3 + 14z*2 Expand (0 + d + 0)(d3 + d2 - d*2)(4d + 0d + 2d). 6d*5 Expand (0 - p + 0)(2 + 0p + p4 + 0p). -p*5 - 2p Expand ((0 - 2r + 0)(3 - 3 - r) + 0r2 + 2r*2 + 0r*2 + 3r*2 - 4r*2 + 4r*2)(92r3 - 404r + 404r) + (-2r*5 + 2r - 2r)(4 - 4 + 2). 640r5 Expand (-c + 2c + 0c - 4c - 4c + c + (-1 - 1 + 1)(c + 2c - 2c) - 3 + 3 - c)(0c*4 + 0 + 1 - 2c*4). 16c*5 - 8c Expand -2 + o + 2 + (0 + 0 - 2o)(-1 + 1 + 1) + (-4o + o + o)(-4 + 7 - 10). 13o Expand (-2 + 4 - 1)(5h - 5h - h) + 1 + 2h - 1 + 4h + 3h - 3h. 5h Expand -z4 + z2 - z2 + (-4 + 4 - 2 + (3 - 4 + 0)(3 - 1 - 4) + 1 - 3 + 1)(-z4 + 0z*4 + 2z*4). -2z4 Expand (-x2 - x*2 + 0x*2)(4 + 1 - 4)(3x - 4x + 4x) + 1 - 1 - 2x3. -8x*3 Expand (1 + 1 + 0)(-2 + 0 + 4)(-1 + 2 + 2)(3w + w - 3w). 12w Expand (4 - 6 + r + 1)(0 - 32r4 + 30r*4 + 3). -2r*5 + 2r*4 + 3r - 3 Expand 6u - u - 3u + (-2u - 2u - 1 + 6u)(4 + 0 - 3). 4u - 1 Expand (-2p + 0p + 5p)(p3 - p + 0p*3 + 0p). 3p4 - 3p*2 Expand -1 + 1 - d + (d - 3d + d)(-2 - 4 + 1). 4d Expand (0 + 2f + 0)(2f2 + 0f*2 - 21f*2). -38f*3 Expand (-6o + 4o + o)(1 + 0 + 1)(-5o + 6o + 0o). -2o2 Expand (-24z*2 - 2z - 2z + 26z*2)(3z3 - 3z*3 + 2z*3). 4z*5 - 8z*4 Expand (-2b + 3 - 3)(-4b*3 + 6b*3 - 15b*3). 26b4 Expand (0 - g3 + 0)(2g + 0 + 0) + (-g + 4g + 0g)(-3g*2 - 2g2 + g3 + 6g2). g4 + 3g*3 Expand (l - 2l + 0l)(3 - 1 + 0)(5 - 5 + 3l). -6l2 Expand (-122h + 60h + 14 + 58h)(-1 + 1 - h2). 4h*3 - 14h*2 Expand (30x - 3 - 6 + 8)(-4x + 3x - x). -60x*2 + 2x Expand (3r3 - 4r3 - r3)(3 - 9 - 3)(0 + 0 - 2r2). -36r*5 Expand (2u - 2u + 2u)(-6u - 3u + u). -16u*2 Expand (-6 + 0 + 3)(0p + 2p - 4p) + (1 - 1 + p)(7 - 1 - 2) - 3p + p + 4p. 12p Expand 10 - 3 + 5h - 6 + (-2h + 3h - 2h)(2 - 1 - 3). 7h + 1 Expand (-2z*2 + 3z2 + z2)(4z - 4z + 3z) - z3 + z3 - 5 - 2z3. 4z*3 - 5 Expand ((4 - 1 - 2)(-2t + 2 - 2) + 2 + t - 2 + 6t - 2t - 2t - 3t - 3t + 4t + (-1 + 1 + 2t)(-1 + 0 - 1))(-1 + 3 + 0). -10t Expand (4g - 17g + 37g)(g3 + 0g*3 + 2g*3). 72g*4 Expand (5d - 2d - 2d)(-193 + 10d + 193) + (-3d + 3d + d)(-d + 0d - d) - 2d2 + 3d*2 - 3d*2. 6d*2 Expand (-160 + 28v*3 + 160)(3v - 2v - 2v)(v - 3 + 3). -28v5 Expand -2b*5 - 3b + 3b + (-3 + 5 - 4)(b*5 + 0b*5 + 0b5) - b5 + 2 - 2 + (0b4 + b4 + b4)(-7 + 7 + 7b) - 4b*5 + 5b*5 + 0b*5. 10b*5 Expand (1 - 2 - 5)((4 - 2c - 4)(-2 + 0 + 4) - 2c + 0 + 0). 36c Expand (-s*2 + 17s3 + s2)(-3 - 1 + 8). 68s3 Expand d5 - 3d5 + 5d*5 + (2d3 - d2 + d*2)(0d2 + d2 + d2)(1 - 5 + 3). -d*5 Expand (0 + 1 + 1)(-8r - 26r - 26r) - 3r - 3r + 4r. -122r Expand -f4 - f4 + 6f*4 + (2f2 + f2 - 4f2)(-f*2 - 5f*2 + 5f*2). 5f4 Expand -a4 + 0a4 + 0a*4 - 2a*4 + 2a - 2a - 4 + 4 - a4 + (2 + a2 - 2)(2a2 + 2a - 2a) - a3 + 4a4 + a2 + 11 - 11. 2a4 - a3 + a2 Expand (j3 + 3j3 - j3)(-2j + 6j - 2j + (0 + 0 - 1)(j - 2j - j) - j - j + 3j). 15j*4 Expand (3 - u - 3)(1 - 1 - u*2) + (-6 + 6 - 3u*2)(2u - 1 + 1) + 3u*2 - 3u*2 - 8u*3. -13u*3 Expand -2r*2 + 5r*2 + 4r2 + 1 + r2 - 1 + (-r + 2r - 2r)(3r + 3r - 4r). 6r2 Expand 0f2 - f2 - f*2 - 2f*2 - f + f + (-4f + f + 2f)(2f + 2 - 2). -6f*2 Expand (-3j*2 + 0j*2 + 5j*2)(2j + 3j - 4j)(-3j - 2j - 4j). -18j*4 Expand (2n - 6n + 3n)(-3n - n + 2n) - 19n*2 + 17n - 2n2 + 1 + 18n2. -n2 + 17n + 1 Expand (-2h + 7h2 - 12h*2 + 2h*2)(h*2 + 0h*2 + 0h*2). -3h*4 - 2h*3 Expand (-4 + 2j*2 + 4)(-132j + 1 + 129j + 1). -6j3 + 4j*2 Expand (-c - 4 + 4 + (2c - 3 + 3)(-1 - 1 + 3) + 29 - 29 - 4c)(-3c + 0c - 3c). 18c2 Expand 24q*3 + 12q*5 - 24q3 + q5 + 0q2 + 0q*2 + 0 + 2q*5 + 0 + (4q - 2q - 3q)(q3 - q3 + q4). 14q*5 Expand (7i + 6i + 3i)(-5 + 0 + 3)(6 - 4 - 5) + i + 2i - 4i. 95i Expand (-j + 2j - 3j)((-3 + 0 + 2)(-2 + 2 - 1) + 3 + 0 + 0). -8j Expand (3 + 3m - 3)(-3m - 2m + 2m). -9m*2 Expand -2k - 4k + 4k + (2 + 4k - 2)(-4 + 0 + 2). -10k Expand (-5q + 4q - 2q)((3q*3 + 0q*3 - 6q*3)(3 + 0 - 1) + 2q3 + 2q3 + q3). 3q4 Expand (3x*4 + 0x*4 + 0x*4)(-7 - 2x + 5x - 4x). -3x*5 - 21x*4 Expand 1 - 2c - 1 + c + 2c - 2c - 4c - 2c + 7c + (-2c + 4c + 0c)(-1 - 1 + 0) - 786 + 786 - 11c. -15c Expand -4i3 - i2 + i*2 + (3i - i - 4i)(4i2 + 3i*2 - 5i*2) + (-2i*2 + 2i*2 - 2i*2)(1 + 2i - 1) + 3i*3 + 3i*3 - 4i*3. -10i*3 Expand -4 + 2f + 4 + (0 + 1 + 0)(-f - 2f + 2f) - 3f + f + 4f - 3f + f + 0f - 2 + 2 + 2f + 0f - f + 4f - 5 - 2f + 3 + 4. 4f + 2 Expand (2x3 - 6x*3 + 2x*3)(-2x + 3x - 3x)(3x - 2x + x)(0 + 4 - 1). 24x5 Expand -r3 + 2r5 + r3 - 2r*5 - 2r*4 + 2r*4 + (1 + 0 + 0)(2r5 - r5 - 2r5). -r5 Expand (0 - 4 - n + 6)(n4 + 3n*4 - 5n4). n5 - 2n4 Expand 2q*2 - q - 2q - 3q2 + (-4q - q + 2q)(3q + 2q - 6q). 2q*2 - 3q Expand (-1 + 2 + 1)(0m + 5m - 3m) + (-2 + 2 + 2m)(-10 + 2 - 12). -36m Expand (-5b3 - b3 + 5b3)(-5b - 10b + b). 14b4 Expand (-7z + 7z + 3z*3)(z - 3z + 0z)(-5 + 5 - 6)(-5 + 2 + 0). -108z4 Expand ((0x + x + 0x)(0 + 1 - 3) + 1 + x - 1)(4x*3 - 3x*3 - 2x3). x4 Expand (5w - 2w - w)(2w - 1 + 1) - 2 + 2 - 2w2 + (3w + w - 3w)(w + w - 4w) - 2w*2 - 2w + 2w - 5w*2 - 2w*2 + 0w*2. -9w*2 Expand -4s + 3s + 0s - 6s + 3s + 2s + (-3 + 1 + 0)(-2 + s + 2) + s + 0s - 3s + s - 3s + 0s - s + 1 - 1 + (2s + 12s - 3s)(-5 + 4 + 0). -20s Expand (3 + 0 + 0)(-2r + 2r + r). 3r Expand 3 - 3 - 5w*2 + (-6w2 - w2 + 2w2)(0 + 4 - 2). -15w2 Expand (-3 + 14x + 3)(0x + x + x) - 4x2 + 3x - 3x. 24x*2 Expand u - u - 2u + (-2u + 2u - 2u)(3 - 1 - 4) + u + 5 - 5 - 11u - u + u. -8u Expand x*2 - 2x5 - x2 - x - x4 + x4 + x5 + (7 + x2 - 7)(2x3 + x3 - x3). x5 - x Expand (-3r + 3r + 2r)(2 - 2 + 1)(-2 + 5 + 1)(3 - 3 - 2r4). -16r*5 Expand -2u*5 + 2u*5 - 2u*5 + (-3 + 3 - 1)(0u2 + 0u2 + u5) + 0u3 + 0u3 - u5 + 0u3 + 2u*5 + 0u*3 - 3u*5 + 2u5 - u5. -4u5 Expand (-2 - 1 - 5)(5i - i - 5i). 8i Expand (4 - 4 + q)(3 - 5 + 1) + (3q - 5q + 3q + 3 + 2q - 3 + (4q - 5q + 3q)(4 - 4 + 2))(4 + 0 - 1). 20q Expand (0 + 1 - 2)(4s*4 - 3s*4 - 3s*4) - 2s*2 + 2s*2 + 2s4 + s4 + 2 - 2 + s*4 - 3s + 3s + (3 - 2 + 1)(-11s + 7s*4 + 11s). 20s4 Expand (-s + 0s + 0s - 4s + s + 0s + (-3 + 2 + 0)(-4 + 4 + s))(2s - 5 + 5). -10s2 Expand -k3 - k4 + k3 + (3k*4 - 4k*4 + 3k*4)(-5 + 2 + 2) + k2 - k2 - k4 + (-k3 + k*3 - 2k*3)(3k + 3k - k). -14k4 Expand -3i + 3i - 2i*2 + (8 - 4 + 0 + (-2 - 1 + 2)(-1 - 2 + 2) - 5 + 2 + 4)(-2i*2 + 0i*2 + 4i*2). 10i*2 Expand (f + 0f - 3f)(-5 + 5 + 3) - 2 + 2 + f + f - 2f + 3f + (4f - f - f)(1 + 1 + 0). f Expand n*5 + 2n*2 - 2n*2 + 2n*5 + 3n*5 - 3n5 - n5 + 6n5 - 4n*5 + (-2n - 2n2 + 2n)(2n*3 - 1 + 1) + 8n*5 - 3n5 - n5. 4n5 Expand (-4m + 5m - 2m)(1 - 1 - 2m3) - m4 - m4 + m4 + (-1 - 2m2 + 1)(3m - 3m - 6m2). 13m*4 Expand (-4 + 2j + 4)(1 + 4 - 2). 6j Expand 2 - 2m2 - 2 + (m + 2m - m)(1 + 1 - 1)(-6 + 6 - 9m)(-1 + 1 - 1). 16m2 Expand (4m - 2m - 3m)(2m*4 + m - 3m + 0m4) + m5 - 8m*5 - 14m*5. -23m*5 + 2m*2 Expand (-2v4 + v4 + 2v4)(-2 + 1 + 0) + 0v4 + 2v4 + 13 - 8. v4 + 5 Expand (2m + m - 5m - 4m + 4m + m + 0m + 0m - m - m + 4m - m + (1 - 4 + 5)(2m + m - 2m) + 4m - m - 2m + 1 - 2m - 1)(2m + 2m - 3m). m*2
Let k(a) = 20a - 272. Give k(15). 28 Let c(i) = i3 - 4i*2 + 2i - 3. Give c(3). -6 Let z(l) = -3l - 116. Determine z(-37). -5 Let m(f) = 2f + 16. Calculate m(-2). 12 Let u(v) = v - 10. Determine u(14). 4 Let z(r) = 3r3 + 22r*2 - 45r + 11. Calculate z(-9). 11 Let n(d) = -2d3 + 14d*2 - 7d + 15. Determine n(6). 45 Let o(g) = g*3 - 18g*2 - 22g - 364. Determine o(20). -4 Let b(m) = m*3 + 29m*2 + 52m - 47. What is b(-27)? 7 Let q(l) = -l2 + l + 26. Calculate q(5). 6 Let p(y) = -y3 + 25y2 - 2y + 48. What is p(25)? -2 Let x(m) = -3m2 - 27m + 2. Give x(-10). -28 Let p(s) = s*3 - 14s*2 + 45s. Give p(5). 0 Let h(w) = w*3 + 6w*2 - 72w - 5. Give h(-12). -5 Let m(f) = f*3 + 5f*2 + 2f + 6. Determine m(-5). -4 Let i(n) = -n*3 + 3n - 4. Determine i(3). -22 Let b(r) = r*2 - 5r - 8. Give b(6). -2 Let v(s) = -2s3 + 2s*2 + 4s - 6. Give v(3). -30 Let t(p) = -4p - 28. Determine t(-4). -12 Let x(o) = -o2 + o + 267. Determine x(-16). -5 Let v(m) = m3 - 5m*2 - 14m - 8. Determine v(7). -8 Let a(f) = f*2 - 15f + 47. Determine a(11). 3 Let h(z) = -z - 9. Give h(-12). 3 Let v(u) = -u*3 - 12u*2 - 26u + 6. Give v(-9). -3 Let l(j) = 2j3 - 9j2 + 12. What is l(3)? -15 Let a(f) = -f3 - 10f2 + f + 5. Give a(-10). -5 Let a(d) = 4d*3 + 2d*2 - 4d + 2. Determine a(2). 34 Let h(p) = p*3 - 6p*2 + 6p + 8. Determine h(4). 0 Let d(o) = -o*3 + 7o*2 - 5o - 2. What is d(6)? 4 Let f(k) = -4k2 - 2k + 2. Give f(-3). -28 Let c(f) = f*3 - 13f*2 + 16f - 5. What is c(12)? 43 Let l(k) = -82k2 - 4k - 3. Calculate l(-1). -81 Let i(d) = 2d3 - 7d*2 + 4d - 2. Calculate i(3). 1 Let q(c) = -8c - 7. Give q(-5). 33 Let a(s) = 33s - 496. Determine a(15). -1 Let j(s) = -s*3 - 5s*2 - 4s - 5. What is j(-3)? -11 Let t(h) = h*3 - 6h*2 - 2h + 11. Give t(6). -1 Let a(u) = -9u3 - 5u*2 - 3u - 3. Give a(-2). 55 Let s(y) = -y*3 - 19y*2 - 49y - 5. Give s(-3). -2 Let n(q) = -q*3 - 15q*2 - 14q - 11. Determine n(-14). -11 Let i(n) = n + 43. Give i(-16). 27 Let r(g) = -2g. Determine r(-12). 24 Let f(w) = w3 - 9w*2 + 11w - 98. Give f(9). 1 Let n(c) = c*3 - 4c*2 - 6c + 3. Calculate n(5). -2 Let j(q) = -q*3 - 5q*2 + 3q + 10. What is j(-4)? -18 Let g(w) = w*2 + 32w + 39. Calculate g(-19). -208 Let g(z) = 7z3 + 2z*2 + 4z. Determine g(-2). -56 Let i(j) = -j*2 + 11j + 3. What is i(11)? 3 Let b(c) = -10c - 10. Calculate b(-9). 80 Let h(b) = 3b - 31. Determine h(11). 2 Let p(i) = 4i2 - 31i - 10. What is p(8)? -2 Let j(x) = -44x + 250. Calculate j(6). -14 Let j(v) = v3 - v2 - v + 8. Give j(0). 8 Let r(i) = -i3 - 3i*2 + 3i - 4. Determine r(-4). 0 Let a(t) = -t*3 + 3t*2 + 2t + 3. Calculate a(4). -5 Let r(p) = p*3 - 21p*2 - p - 12. What is r(21)? -33 Let z(u) = 2u*2 - 42u + 4. Give z(21). 4 Let f(c) = c*3 - 4c*2 - 13c + 32. What is f(6)? 26 Let o(h) = -6h - 2. Give o(4). -26 Let r(l) = -49l*2 + 3l + 5. What is r(-1)? -47 Let l(q) = -4q + 31. Determine l(9). -5 Let d(l) = -l + 7. Calculate d(10). -3 Let p(l) = l2 - 25l + 102. Calculate p(19). -12 Let y(w) = 3w + 2. What is y(6)? 20 Let h(y) = 2y*3 - 12y*2 + 2y - 12. Determine h(6). 0 Let t(k) = -9k - 57. Determine t(-8). 15 Let c(i) = -i2 + 12i + 248. What is c(-11)? -5 Let n(g) = g*3 + 5g*2 - 3g - 11. What is n(-6)? -29 Let d(u) = u*2 + 6u - 8. What is d(-7)? -1 Let n(r) = -r + 14. Determine n(22). -8 Let b(v) = 3v3 + 32v*2 - 9v + 16. Determine b(-11). -6 Let p(v) = v*3 - 4v*2 - 18v + 4. Determine p(7). 25 Let b(m) = m*3 + 8m*2 - 8m + 10. Calculate b(-9). 1 Let x(p) = -10p - 13. What is x(-3)? 17 Let n(g) = -3g + 106. Determine n(36). -2 Let m(t) = -t*3 - 16t*2 - 29t - 29. Calculate m(-14). -15 Let t(l) = -2l3 + 11l*2 - 25l + 45. Give t(4). -7 Let z(a) = a*2 + 7a + 3. What is z(-6)? -3 Let h(c) = 15c2 - 3c + 1. Calculate h(1). 13 Let k(i) = -i*3 - 7i*2 + 10i + 15. Calculate k(-8). -1 Let j(y) = y*3 + 17y*2 + 38y + 16. Give j(-15). -104 Let o(j) = -j*3 - 22j*2 - 24j - 49. Give o(-21). 14 Let p(a) = a*3 + 33a*2 + 3a + 106. Give p(-33). 7 Let r(l) = 5l + 190. What is r(-35)? 15 Let q(a) = -2a*2 - 17a + 13. What is q(-8)? 21 Let r(t) = t*2 + 7t + 12. Give r(-7). 12 Let t(h) = -3h - 9. Determine t(-5). 6 Let r(l) = -3l*2 + 6l - 2. Give r(4). -26 Let m(s) = -s*2 + 17s + 11. Determine m(10). 81 Let a(p) = -24p + 16. Calculate a(5). -104 Let p(r) = -r2 + 12r - 25. What is p(8)? 7 Let n(c) = c*3 + 2c*2 - 4c + 1. What is n(-4)? -15 Let o(w) = 2w3 + 32w2 + w + 21. What is o(-16)? 5 Let p(o) = o2 + 12o - 128. What is p(7)? 5 Let g(f) = f3 - 19f*2 + 34f + 9. What is g(17)? 9 Let i(v) = v*2. Determine i(1). 1 Let x(p) = -2p*3 + 9p*2 - 11p + 37. What is x(4)? 9 Let t(b) = -b - 7. What is t(-6)? -1 Let h(j) = j*2 - j + 1. What is h(3)? 7 Let b(p) = 12p*2 + 4p - 4. Give b(1). 12 Let f(o) = -o*3 - 3o*2 + 5o - 5. Determine f(-5). 20 Let r(d) = -d*2 - 5d + 16. Calculate r(-7). 2 Let s(h) = 2h2 + 4h - 5. Determine s(-4). 11 Let w(j) = j*2 - 19j - 24. Give w(19). -24 Let k(l) = l - 7. Give k(-5). -12 Let b(m) = -2m2 - 2m + 4. Determine b(-3). -8 Let n(s) = -s - 4. Give n(9). -13 Let q(d) = -d*2 - 6d + 14. Calculate q(-10). -26 Let j(f) = 2f + 1. Give j(-2). -3 Let h(t) = -t3 + 20t*2 - 21t + 39. Calculate h(19). 1 Let n(d) = -d*2 - 7d - 8. What is n(-3)? 4 Let z(c) = 13c + 73. What is z(-7)? -18 Let d(n) = 14n - 120. Calculate d(9). 6 Let q(a) = a*2 + 23a + 2. Determine q(-23). 2 Let t(s) = 22s2 + s - 1. Calculate t(1). 22 Let w(y) = 11y - 17. Give w(2). 5 Let z(h) = h*3 - 4h*2 - 6h - 6. Give z(6). 30 Let l(c) = -c*3 + 14c*2 + 3. Calculate l(14). 3 Let f(r) = -43r - 466. What is f(-11)? 7 Let v(k) = -k*3 + 41k*2 + 36k + 258. Determine v(42). 6 Let i(a) = a*2 - 26a + 136. Calculate i(13). -33 Let l(t) = -t2 - t - 3. What is l(0)? -3 Let g(r) = r2 + 8r - 2. What is g(-8)? -2 Let g(l) = -l3 + 7l*2 - 5l - 12. Give g(6). -6 Let c(n) = -7n + 229. Determine c(33). -2 Let a(m) = m3 - 2m*2 + 7m - 5. Determine a(4). 55 Let b(f) = 6f2 + 43f + 1. Give b(-7). -6 Let w(n) = -2n - 1. Determine w(0). -1 Let h(g) = -g3 + 6g*2 - 5g + 2. Determine h(5). 2 Let y(f) = -10f + 20. Give y(2). 0 Let t(f) = f3 + 2f*2 - 11f - 8. Determine t(-4). 4 Let v(h) = -11h - 2. Determine v(4). -46 Let h(m) = -m3 + 3m*2 + 6m - 2. Calculate h(4). 6 Let y(f) = 7f3 - 3f*2 + 2f - 1. Calculate y(-3). -223 Let u(m) = 14m + 69. Determine u(-5). -1 Let r(w) = w3 + 2w*2 - 11w - 6. Give r(-4). 6 Let c(l) = -l*2 + 9l - 24. Determine c(7). -10 Let t(y) = -2y2 + 14y - 27. What is t(5)? -7 Let a(n) = -7n - 5. Determine a(3). -26 Let p(s) = s2 + 31s + 157. What is p(-6)? 7 Let o(x) = -2x2 + x - 16. Determine o(3). -31 Let b(x) = -x3 - 13x + 23. Determine b(2). -11 Let c(w) = 5w3 + w2 - 2w + 2. Give c(1). 6 Let f(s) = -s*2 + 42s - 5. What is f(42)? -5 Let n(q) = -q*3 - 25q*2 + 27q + 17. Determine n(-26). -9 Let f(c) = 64c - 409. Calculate f(6). -25 Let q(i) = i3 - 7i*2 - 2i + 12. What is q(7)? -2 Let d(i) = i*3 + 10i*2 + 3i + 4. Determine d(-10). -26 Let u(a) = -15a3 - 2a*2 - 2a + 3. Calculate u(1). -16 Let j(r) = 14r3 + r2 - 6r - 5. Calculate j(-2). -101 Let z(i) = i*2 + 9i - 12. Give z(-9). -12 Let s(h) = -h - 53. Determine s(-25). -28 Let j(u) = 20u - 25. What is j(0)? -25 Let l(n) = n3 - 6n*2 - 6n. Calculate l(7). 7 Let k(b) = b + 22. Determine k(4). 26 Let b(x) = -x3 + x2 + 4x - 3. Determine b(2). 1 Let r(y) = 3y*2 + 12y + 25. Calculate r(-2). 13 Let q(n) = -2n - 4. Determine q(-8). 12 Let m(j) = -j - 8. Determine m(1). -9 Let j(q) = -q3 - 13q*2 - 11q + 7. Give j(-12). -5 Let b(l) = -l*2 + 7l - 9. Determine b(5). 1 Let p(b) = 3b3 + 2b2 - b + 4. What is p(2)? 34 Let v(d) = d3 + 6d2 - 7d + 4. Calculate v(-6). 46 Let c(n) = n*3 - 10n*2 + 14n + 7. Calculate c(8). -9 Let i(a) = -2a - 13. Give i(7). -27 Let x(t) = 2t*2 + 35t - 15. Calculate x(-16). -63 Let w(n) = -n*3 - 14n*2 + 13n - 31. Calculate w(-15). -1 Let h(j) = -j + 5. What is h(-7)? 12 Let k(n) = -2n + 9. Give k(6). -3 Let l(t) = t - 12. Calculate l(-10). -22 Let s(d) = -2d + 27. What is s(15)? -3 Let d(m) = -m*2 + 12m - 5. Determine d(8). 27 Let n(l) = 4l3 + 3l*2 + 4l - 3. Determine n(-2). -31 Let b(l) = -2l2 - 3l - 1. What is b(-2)? -3 Let q(l) = 5l + 107. Calculate q(-24). -13 Let g(i) = 4i*2 - 19i + 52. Give g(3). 31 Let w(y) = -y**3 + y. Determine w(2). -6
Let g be ((-35)/151)/((-14)/36). Solve 21 = -d + gy - 3y, 5d - 4y = -28 for d. 0 Suppose -3z = -4u - 33 + 34, -9 = -5z + 4u. Solve -2b + b = -zc + 2, -5b = -15 for c. 1 Suppose 0 = 10o - 5o - 50. Suppose 5b - o = 4u, 4b = -3u - u + 8. Solve 5c + w - 13 = u, -3w + 11 = -2c + 2w for c. 2 Suppose 6r = -4t + 2r + 12, -4t - 20 = -4r. Let x(d) = -5d*3. Let v be x(t). Suppose 4i = vi. Solve 5z + 4u - 4 = i, 6 = 5z + 5u + 1 for z. 0 Suppose 3g - 4 - 2 = 0. Suppose -4x - 24 = -gs, 8x - 5x = -15. Solve -5n = -u + 23, -sn = -3n + 5u - 19 for n. -4 Let m(t) = t*2 - 13. Let k be m(-4). Let v(r) = -15r - 2 - r*k - 5r*2 + 16r - 10r. Let f be v(-2). Solve fy - 13 = -d, 4d - 39 = -2y - 15 for d. 5 Suppose -2o = 6 - 18. Suppose 225 = -ou + 11u. Let m = u + -41. Solve 4k = -n - 24, -mk + 2n = 4 + 8 for k. -5 Let f(m) = 4m - 18. Let k be (-164)/(-20) - (-1)/(-5). Let j be f(k). Let i = j + -9. Solve it - 2v + 28 = 0, 4t - 4v = 7t - 4 for t. -4 Let q = 192 - 414. Let o = q - -225. Solve j + 3j - oa = 13, j - 5a + 1 = 0 for j. 4 Let a = 33 - 35. Let d be 56/98(-7)/a. Suppose 6w = 2w + dy + 16, 0 = y + 4. Solve 4q + wc = 0, -3 = -5q - c - 0 for q. 1 Let x(c) = 2c2 - 55c + 371. Let f be x(16). Solve fp + 10 = 7n - 5n, -p - 9 = 5n for n. -1 Let b be 0(4/84 - 6/(-21)). Suppose -8d + 11 + 29 = b. Solve -2h = du - 33, 18 = 4h + 2 for u. 5 Suppose 16t = -28t + 13508. Suppose -314r + tr = -7. Solve -m - 6 = -4l + r, -4l + 11 = 3m for m. 1 Let x(w) = 2w3 - 12w*2 - 40w + 242. Let n be x(6). Solve -ns + 5t - 14 = 0, 103s - 108s - 2t = -23 for s. 3 Let h = -12552 + 12554. Solve -hz - 3q + 20 = 0, 16z - 3q + 32 = 21z for z. 4 Let c be (-42)/63-31. Suppose 2 = 4f - cf. Let r be -1f(-6 - (-24)/4). Solve -3x - 8 = -0s + s, 4x - 4s + 32 = r for x. -4 Suppose -13l - 89 = -16l - 44. Let g = 11 + -6. Solve 2p - l = -3p + 5b, gp - 13 = 4b for p. 1 Suppose -6c - 25c = -1302. Suppose 3p = d + c, p = 2d + 3d. Solve -5v - p - 2 = 2g, 0 = -4g - 5v - 9 for g. 4 Let t(a) = -a*3 + 11a*2 - 28a + 34. Let o be t(8). Solve 0 = -5r - h - 15, oh + 20 = -6r + r for r. -2 Suppose 4f = 92 + 80. Let x be (38 - f)/(-11). Solve l - r - 9 = -2l, -3l = xr - 27 for l. 4 Suppose 0 = 29c - 25c + 140. Let u be c/(-15)(-24)/(-56). Solve -m = 3o + u, 0o - 3m - 3 = 4o for o. 0 Let m(b) = 27b + 676. Let v be m(-25). Solve 4g + 11 = 3, 4g - v = 3j for j. -3 Let r = -674 - -699. Solve -4c + r = -u, 2u + 6c + 5 = 5c for u. -5 Let t = -3424 + 3429. Solve 4b + tv + 3 - 13 = 0, -3b + 5v - 10 = 0 for b. 0 Suppose -5o = -2o + 324. Let x = 78 + o. Let n be 53/6(-36)/x. Solve 2v - nk + 11 = 0, -3k + 5 = 5v + 22 for v. -4 Let b = -10895 - -10905. Solve -j = -2y + 4j - 2, 2y - b = -j for y. 4 Let w(n) = 20n2 + 14 - 39n - 22n + 154n + 128n. Let a be w(-11). Solve -p + 2 = -2d, 0 = -d + ad for p. 2 Let g = 3747 - 3723. Solve 5i - 19 - 11 = -3f, -3i = 3f - g for i. 3 Let g = -32 + 32. Let x = -43 - g. Let n = -38 - x. Solve -2d = -2 + 6, -10 = -2b + nd for b. 0 Suppose -r - 40u + 38u = -81, 5u - 99 = -r. Solve 4f + rq = 64q + 20, 0 = 4f + 3q - 20 for f. 5 Let b(r) = -r + 15. Let a be b(15). Suppose -4d = -t - 30 + 22, 0 = 4d + 4t - 28. Solve -o - 5c + 0 = 25, a = -4o - dc - 32 for o. -5 Suppose 4k - 4j - 4 = 0, 5k - 57j = -55j + 14. Solve kd - 2u - 2 - 14 = 0, 2 = 3d + u for d. 2 Suppose -1449 + 2415 = 22i - i. Solve 49f = 5s + if + 1, -s - 3 = -2f for s. 1 Suppose 178x + 1940 - 20699 = 10967. Solve 0 = xm - 171m - 2f + 14, -4m + 21 = -5f for m. 4 Let j be ((-213)/(-6))/((-3)/(-6)). Suppose -s + 19 + j = 0. Let b = s + -87. Solve -3k + 3q + 9 = -k, 0 = -bk + 4q + 13 for k. 3 Let z(t) = -2t*3 + 25t*2 - 306t + 3528. Let y be z(12). Solve y = -6f - 5a - 17, -9f + 6f = a + 7 for f. -2 Let t be 8/3 + 1700/(-2550). Solve -5p = -3a + ta + 5, -3a + 2p = -2 for a. 0 Let k(r) = 15r - 58. Let v = 36 + -32. Let q be k(v). Solve -x + h + q = 0, -3x + h = -4 - 4 for x. 3 Let k = -79 + 71. Let n be (35/(-14))/(1/(-2)). Let u be 20/k((-9)/n - -1). Solve -5f - 3 = -h - 3f, 0 = uh + f - 6 for h. 3 Suppose 3p + 5h + 150 = -73, -4p - 3h = 290. Let c = 74 + p. Solve 2b + cq + 11 - 2 = 0, -5q = 3b + 15 for b. 0 Let s(a) = 2a*3 + 4a*2 - 11a + 15. Let c be s(2). Suppose 0 = cv + 26 - 126. Solve k + 2x = 3, 0 = 4k - 0x + vx - 16 for k. 5 Let k(w) = 2w*2 - 7w + 4. Let p be k(4). Let m(l) = -2l2 - 18l - 4. Let y be m(-8). Let h = y - p. Solve -2g - 10 + 34 = -ht, 2t + 3g = 4 for t. -4 Let v = -8507 - -8511. Solve -vc - h - 16 = -2, -2c - 2h = 10 for c. -3 Let h(s) = -s2 - s + 5. Let l be h(0). Let z be (-28)/10 + 4/(-20). Let p(d) = 5d + 16. Let y be p(z). Solve 1 + y = -2m - 2v, -15 = lv for m. 2 Let f(p) = -120 + 5p + 70 + p*2 + p + 62. Let c be f(-3). Solve -ci - h - 9 = 0, 2h + h = i - 7 for i. -2 Let a = -8 - -22. Let b(g) be the first derivative of g4/4 - 13g*3/3 - 7g*2 + 4g - 196. Let p be b(a). Solve 31 = -3w + 4v, -3v + p = -2v for w. -5 Let x = 17855 - 17830. Solve xt - 28t + 9 = 0, -5v - 7 = t for v. -2 Let k(s) = -2s*2 - 82s + 4. Let c be k(-41). Solve -20 = -4l + 4r, -l - r - 3 = -c for l. 3 Suppose -26 = -4j - 2k, -j = -4j - 4k + 17. Suppose n + h - 1 = 11, 95 = 5n - 2h. Suppose 21x = nx. Solve -3w - j = -4b, b + xb = -w + 7 for w. 3 Suppose 0 = 4m + m, -4k - 4m = -12. Suppose 0 = a - 4x - 15, kx = 2a + 5x. Solve -t - 15 = -2t - 4g, 0 = -3t + 2g + a for t. 3 Let t = 3511 - 3508. Solve -z = -2c + 6 - 15, 23 = -5c + tz for c. -4 Suppose 20 + 4 = 12k. Suppose -64v = -65v + 2. Solve -kr + 7 = -4x - 1, -vx - r - 12 = 0 for x. -4 Suppose 6u - 4u - 6 = 0. Suppose 0 = 3i + 8i + 957. Let k = -85 - i. Solve -f + 8 = kq, uf = -2q + q + 4 for f. 0 Let f(b) = -3b3 + 39b*2 - 8b + 106. Let j be f(13). Solve 2n + jp = -4, n + 5p + 19 = 5n for n. 1 Let k be -1 - 723/(-15) - (-41)/(-205). Suppose -k = -12t - 11. Solve -tw + 0 = -2a - 1, -3w - 9 = 3a for w. -1 Let t(o) = 7o*2 - 32o + 28. Let g(p) = -4p2 + 17p - 14. Let q(b) = 5g(b) + 3t(b). Let z be q(13). Solve 5n = 5l - z, -5l - 19 = 5n - 3l for n. -5 Suppose 9p + 170p = -159p + 12844. Solve -3j = -4l + 13, -43j = -l - pj + 16 for l. 1 Suppose -55f + 50f = -25. Suppose c + 8i - fi + 2 = 0, -5c = -5i - 10. Solve q + c = -4w + 4, 0 = 5w - 2q + 6 for w. 0 Let t be (-3)/(-5)9375/225. Suppose -7x + 5b - 17 = -6x, -3x - 4b = -t. Solve -2z + 10 = 0, -5r - xz + 4z = 15 for r. -2 Let s be 3/15163 + 48/(-80). Let a be (-3)/((-8)/(s/3)). Solve ay + 4g = 8, -3y - 5g = -5 + 1 for y. 3 Suppose -2104 = -22d + 14d. Let t = 264 - d. Solve -5j = -0r + 2r + 17, -5r + 2j + t = 0 for r. -1 Let q be ((-3)/(-2))/((-11)/((-264)/9)). Suppose z - 3p - 5 - 3 = 0, -2 = -z + 5p. Let h = -17 + z. Solve 3j = -hj - 3c - 24, qc = 5j - 5 for j. -3 Suppose -27x + 48 = 34x - 49x. Solve y + 214 - 198 = 4c, 5y + c = x for y. 0 Let l be ((-2)/7 - (-1105)/119) + -5. Solve s + 5m = -13, -2s + m - l = -11 for s. 2 Suppose -4q = -3h + 1960, -3q = 3h - q - 1990. Suppose 12j - 2j - h = 0. Let a = j - 46. Solve 20 = 7x - 3x, 5v - a = x for v. 5 Suppose 0 = -4o + 8. Suppose -o = -7h + 19. Let g be (h/(-6))/(4/(-16)). Solve -4d = -gr - 22, -2d + 1 = 5r + 2d for r. -3 Let t = 4 - -1. Let o(i) = i3 - 49i*2 + 10i + 66. Let g be o(49). Let h = -546 + g. Solve 5q - 2u - 2 = -u, q - h = tu for q. 0 Suppose 9 - 64 - 193 = -62d. Solve 20o = 24o - 4n + d, 3n - 3 = 2o for o. 0 Let b = -4638 + 4652. Solve o + 0h + b = 2h, -5o + h - 34 = 0 for o. -6 Let j(k) = k*2 + 4k - 6. Let s be j(-6). Let a be (-3)/s - (3/6 + -1). Solve -25 = -p - 5h, 29 = 5p + h - ah for p. 5 Let o(w) = 454w - 2724. Let i be o(6). Solve 3r - 7r + 8 = 0, i = -2b - 5r + 10 for b. 0 Let t = -5240 + 5240. Solve 32v - 28v + 4 = 3d, -4d + 4v + 4 = t for d. 0 Suppose r + 5l + 96 = 0, -5r - 308 = 2l + 241. Let g = -107 - r. Solve -5x + 21 = 4w, -g = -0w + 4w for x. 5 Let n be (18/3 - 1020/165)-22. Solve 0 = -2l + 3z + 2z - 13, 5l + nz = -16 for l. -4 Let s be 61/4 - (-23)/(-92). Suppose -11i + 4i = si. Solve m = 5q - im + 15, 3 = -q + 4m for q. -3 Let l = -20 - -28. Let o be (-3)/(-6) - 3028/l. Let p be 2/(-5) + o/(-70). Solve pc + 20 = -0c - t, 20 = -5c + 4t for c. -4
Let q(s) = 8s - 1 + 17s + 13s - 2s + 0s. Let m(v) = -v. Let w = -13 - -16. Let p(k) = wm(k) + q(k). Differentiate p(h) wrt h. 33 Let l(i) = 2900i + 1451. Let h(n) = 1458n + 726. Let z(v) = 5h(v) - 3l(v). Find the first derivative of z(c) wrt c. -1410 Let b(k) = 6k + 45. Let f be b(-7). What is the third derivative of -21z*3 + 4z*2 + fz*3 - 11z*2 - 41z*3 wrt z? -354 Let o(i) be the third derivative of 11i6/120 - i5/15 - 623i3/2 - 1205i*2. Differentiate o(z) with respect to z. 33z*2 - 8z Let v be (03/(-12))/2. What is the third derivative of vu - u*2 + 6u + 5u2 - 193u3 + u2 - 3u2 wrt u? -1158 Let y be ((-2574)/(-66))/((-1)/(-1)). Find the second derivative of -59a*3 - 28a*3 - 17 - 12 - 2a - ya3 wrt a. -756a Let f(l) be the first derivative of 158l5/5 + 17l*4/4 + 1389l3 - l2/2 - 6296. What is the third derivative of f(j) wrt j? 3792j + 102 Let s(a) = 2a*2 + 3a + 1. Let f be s(-2). Suppose h - 18 = -f. What is the second derivative of -hn + 3n + 16n3 - 11n*3 wrt n? 30n Let y(x) = 2801x2 - 590x + 21. Let g(v) = 1400v2 - 298v + 9. Let k(d) = -7g(d) + 3y(d). What is the second derivative of k(u) wrt u? -2794 Let m(d) = d4 - d2 - 2d + 1. Let k(s) = 283s*4 - 4622s*2 - 18s + 9. Let a(f) = -k(f) + 9m(f). What is the third derivative of a(i) wrt i? -6576i Let m(w) = -7w + 44. Let n be m(6). Differentiate 109j*2 - 62 + 12j - 54j2 - 57j*n with respect to j. -4j + 12 Suppose 0 = -5o - 2i + 65, 3o = -i - 0i + 40. What is the derivative of -153a2 - o - 12 + 93a*2 wrt a? -120a Let h(t) = -3234t3 - 5t*2 - 3085. Let j(v) = -9696v*3 - 16v*2 - 9256. Let k(f) = -16h(f) + 5j(f). Find the first derivative of k(a) wrt a. 9792a*2 Let j = -514 + 517. Let m(r) be the first derivative of 0r - 4/3rj + 5 - 1/2r*2. Find the second derivative of m(o) wrt o. -8 Find the second derivative of 20 - 20 + 2233h - 236095h2 + 236068h*2 wrt h. -54 Let y be (2 + (-4 - -4))1. What is the second derivative of q + 22q4 - 185q*2 - 185q*2 + 370q*y wrt q? 264q*2 Let c(k) = 21k*4 - 84k*3 - 6k*2 - 6k + 2441. Let g(n) = 24n4 - 84n*3 - 7n*2 - 7n + 2439. Let f(y) = 7c(y) - 6g(y). Differentiate f(a) wrt a. 12a3 - 252a*2 Let t = -283 + 326. What is the first derivative of 5w*4 - 54w*4 - 41 - t wrt w? -196w*3 Let y(w) = 2w*2 + 12w + 15. Let k be y(-5). Let b(f) = -2f - 9. Let c be b(-6). What is the second derivative of -3u*5 + ku*5 + 8u - cu5 wrt u? -20u*3 Let u(d) = 3d*4 + 2d*2 + d - 2. Let s(o) = -190o*4 + 2o*3 - 4o*2 - 22o + 65. Let j(q) = -s(q) - 2u(q). What is the second derivative of j(x) wrt x? 2208x*2 - 12x Suppose 3x = -h - 0 + 10, -5h + 18 = -x. What is the first derivative of -195ax - 94 + 126 - 71 - 3a + 3a wrt a? -390a Suppose -5h + 27 = -18. Let s(c) = -c2 + 10c - 3. Let f be s(h). What is the derivative of 14 - 6 + fj - 8j + 5 wrt j? -2 Let g = 178 - 172. Find the third derivative of 21o4 - 191o*2 + 41o*4 + 8o*g + 72o*2 - 56o*4 wrt o. 960o*3 + 144o What is the third derivative of -b*3 - 2b*6 + 149b*4 + 319b*4 + 11828b*2 - 119b*4 + 62b*4 + 185b*4 wrt b? -240b*3 + 14304b - 6 Let m(x) be the first derivative of -x*6/2 + 168x5 + x4/2 + 4063x3 + 8246. Find the third derivative of m(s) wrt s. -180s*2 + 20160s + 12 Let z = 81 + -153. Let k = z - -286. What is the third derivative of -435g + kg + 221g + 20g*2 + 4g*5 wrt g? 240g*2 What is the third derivative of 2 - 207f*5 + 47f*4 - 49f*4 + 39f*2 + 91f*2 wrt f? -12420f*2 - 48f Let c(v) be the second derivative of 14v6/15 + 11v*5/20 + 67v*4/3 + 325v + 2. What is the third derivative of c(w) wrt w? 672w + 66 Let p(u) = 146u2 - u + 240. Let l(o) = -o3 + 146o2 - o + 240. Let r(q) = 6l(q) - 5p(q). Find the second derivative of r(c) wrt c. -36c + 292 Let t(c) = -3c4 + 2c*2 - 4c - 1228. Let p(m) = -14m4 + 11m*2 - 22m - 6140. Let a(o) = 2p(o) - 11t(o). What is the first derivative of a(f) wrt f? 20f3 Let q(m) = -4354m*3 - 9m*2 + 211m + 3. Let u(v) = -4354v3 - 6v*2 + 213v + 2. Let r(z) = 2q(z) - 3u(z). Find the second derivative of r(j) wrt j. 26124j Let d(j) be the second derivative of 167j*3/3 - 3771j*2/2 - 10j + 146. What is the derivative of d(k) wrt k? 334 Let c(v) be the first derivative of 7/4v4 + 2v + 0v3 - 130 - 2/5v*5 - 12v*2. What is the second derivative of c(q) wrt q? -24q*2 + 42q Suppose i = 5o - 65, -4i - 8 = o - 0i. What is the derivative of 62 + t - ot + 60t wrt t? 49 Let w(a) = -a3 + 2a*2 - 6a - 7. Let p be w(-1). Find the third derivative of 78np + n - 4n*6 - 2n - 17n2 - 3n*2 + 6n*5 wrt n. -480n*3 + 360n*2 Let u be 4 - ((-3)/(-6) + (-57)/(-2)). Let y be (-5)/(u/15) - -4. Differentiate 2q*2 + 462 + yq*2 - 456 wrt q. 18q Let i(t) be the first derivative of 747t4/2 - 100t*3/3 - 3t*2/2 - 6t + 8653. Find the third derivative of i(w) wrt w. 8964 Find the third derivative of -695a3 + 14a*2 - 21a*2 - 44a*3 - 8a*2 + 13a*2 + 116a wrt a. -4434 Let m be ((-16)/(-24))/((-1)/(-6)). What is the second derivative of 8f2 + 6 - 2 - 3f - mf3 + 1 + 14f wrt f? -24f + 16 Let z be (-40)/(-2)((-12)/16 - -1). Find the second derivative of -6q5 + 177q + 8q2 - 25q*5 + 2q*5 + 37q*z wrt q. 160q*3 + 16 Let y(o) = -3o*2 - 6o. Let x be (-2)/(-3)(-78)/(-13). Let b(v) = v2 + 6v. Let k(p) = xy(p) + 5b(p). What is the second derivative of k(i) wrt i? -14 Let q be (-3 + 0)/(3/(-2))14. Let x be (0 - 1)/((-14)/q). Find the third derivative of 4k*5 + 7k5 - kx - 5k5 wrt k. 360k*2 Find the second derivative of -212 + 18k*4 - 7k*2 - 197k - 516 + 40k4 + 45 + 195k wrt k. 696k2 - 14 Suppose 3n + 6m - 4m = 281, -2n + 4m = -166. What is the second derivative of -234w + nw + 65w - 123w*3 wrt w? -738w Let h(k) be the second derivative of 2 - 3/20k5 - k - 61/2k*2 + 0k*4 + 7/2k*3. Differentiate h(g) with respect to g. -9g*2 + 21 Suppose 0 = x - 2x + 5q + 12, -3q - 9 = 0. Let c be -610/15x/4. What is the third derivative of -13y3 - 7y*c + 3y*3 - 9y2 wrt y? -102 Let k(l) = -l3 + 2l2 + l. Let g(f) = 28f*3 - 13f*2 - 13f + 63. Let o(t) = g(t) + 13k(t). Find the first derivative of o(u) wrt u. 45u*2 + 26u Let l(q) be the second derivative of 56/3q4 + 0q*2 - 19 - 119/3q*3 - 8q. What is the second derivative of l(d) wrt d? 448 Let s(l) be the first derivative of -4786l5/5 + 1256l*3/3 - 1299. What is the third derivative of s(u) wrt u? -114864u Let w(k) = -69k + 110. Let g(m) = -m + 14. Let b(s) = -s + 23. Let i(n) = -3b(n) + 5g(n). Let y(x) = -4i(x) - 2w(x). What is the derivative of y(o) wrt o? 146 Let u(j) be the third derivative of -148j*2 + 1/60j*5 + 0 + 0j*6 + 0j + 0j4 - 1/3j*3 + 5/42j*7. Find the third derivative of u(a) wrt a. 600a Let p = 2899 + -2899. Let l(x) be the third derivative of 0 + px + 6x*2 - 1/10x*5 - 1/2x*3 + 0x*4. Differentiate l(s) with respect to s. -12s Let q be 11/24 + (-252)/(-672). Let u(d) be the third derivative of 17/60d5 + 19d*2 + 0d + 0 + 0d4 + qd*3. Differentiate u(a) wrt a. 34a Let t(z) be the second derivative of 0 - 64z + 0z*3 + 1/3z*6 + 0z5 + z2 - 4/3z4. What is the third derivative of t(n) wrt n? 240n Let g(y) = 2 - 67y2 + 17y + 9 + 68y2 + 13. Let d be g(-17). Differentiate -2s + 2s + ds*3 + 140 - 156 wrt s. 72s2 Let i(b) = b4 - 3b3 + 506b*2 - 47b + 40. Let x(n) = n4 - n3 - n + 11. Let v(c) = -i(c) + 3x(c). What is the second derivative of v(u) wrt u? 24u*2 - 1012 Let l(t) = -37t*5 + 18t. Let o(y) = -12y + 1903 - 1903 + 25y*5. Let m = 10 + -15. Let p(v) = ml(v) - 7o(v). What is the second derivative of p(u) wrt u? 200u*3 Let u(p) = 9p + 457. Let l be u(-49). Let k(t) be the first derivative of 0t2 + 0t - 2t4 - 8/3t*3 + l. What is the third derivative of k(v) wrt v? -48 Let n(z) be the third derivative of -2z*7/105 - 877z*6/120 - 3z*5/20 + 75z3/2 + z2 - 4z + 81. Find the third derivative of n(f) wrt f. -96f - 5262 Let s(b) be the first derivative of -75 + 7/2b2 - 16b. What is the derivative of s(p) wrt p? 7 Suppose w = -5z + 73, 4w - 5z = 3w + 53. Differentiate -413v - 91 + 158v - 113 + w with respect to v. -255
Let -v*2 + 127724v/3 - 127721/3 = 0. Calculate v. 1, 127721/3 Determine h so that 125h3 + 787365175h*2 - 1259784520h + 503913840 = 0. -6298923, 4/5 Factor 4j2 + 352236j + 30262712. 4(j + 86)(j + 87973) Suppose -4c2 + 36648c + 125901952 = 0. What is c? -2662, 11824 Let -j*3/9 - 21950j*2/9 + 978868j - 97339176 = 0. Calculate j. -22346, 198 Determine c, given that -3c4 + 29592c*3 - 944139c*2 + 2625318c - 1710768 = 0. 1, 2, 29, 9832 Suppose 3s2/2 - 35316s - 18061923/2 = 0. Calculate s. -253, 23797 Find h, given that 6h5/5 + 18078h*4 + 271128h*3/5 + 180744h*2/5 = 0. -15062, -2, -1, 0 Determine d so that -3d*2/5 + 108119772d/5 - 974157091444332/5 = 0. 18019962 Determine v so that v*2 + 13311778v + 44300858380321 = 0. -6655889 Factor 2t3 + 310532t*2 - 28581640t + 657475056. 2(t - 46)2(t + 155358) Suppose -3z4/7 - 14643z*3/7 - 12999465z*2/7 + 1806122721z + 14566764744 = 0. What is z? -2723, -8, 573 Suppose -3w2 + 9303w + 1442556 = 0. Calculate w. -148, 3249 Determine d so that 2d3/21 - 5962d*2/21 + 281662d/21 - 39386/3 = 0. 1, 47, 2933 Determine d, given that -3d2 + 2198241d = 0. 0, 732747 Factor -4h3/5 - 4608872h*2/5 - 1327620146032h/5 - 7965554957664/5. -4(h + 6)(h + 576106)2/5 Factor -o3 + 37540o2 + 3047067o + 8803314. -(o - 37621)(o + 3)(o + 78) Find f, given that 20765f3 - 5357375f*2 + 345551655f - 83205 = 0. 1/4153, 129 Factor 5o2 + 13473370o - 40420155. 5(o - 3)(o + 2694677) What is v in v*4/7 - 9v*3/7 - 13731v*2/7 - 261991v/7 + 39390 = 0? -101, -21, 1, 130 Find s, given that 2s3 - 55824s*2 - 6552026s - 189476040 = 0. -65, -52, 28029 Solve 2n4/9 + 1664n*3/9 - 930n2 = 0 for n. -837, 0, 5 Factor m2 + 10289158m + 20578312. (m + 2)(m + 10289156) Solve 4t5 - 45736t*4 + 155142616t*3 - 132176512544t*2 - 264818635900t - 132486935000 = 0. -1, 1286, 5075 Find r such that -4r3 - 22868r*2 - 5785484r - 374453020 = 0. -5455, -131 Let -110n4 - 28338n*3 + 150356n*2 + 147048n - 31536 = 0. What is n? -1314/5, -1, 2/11, 6 Solve a*3/7 + 118585a*2/7 - 152476a + 237188 = 0 for a. -118594, 2, 7 Solve -3a2 - 52962a - 136619487 = 0 for a. -14517, -3137 Let 2s2/7 + 82s - 1204 = 0. What is s? -301, 14 Find q, given that -q*5/4 + 699q*4/2 - 240001q*3/2 - 1527405q*2 + 51320475q/4 - 22366125/2 = 0. -18, 1, 5, 705 Let 3j2 + 309608196j/5 + 123843276/5 = 0. What is j? -20640546, -2/5 Determine u so that -3u4/2 - 2018u*3 + 243937u*2 - 161054u - 161727/2 = 0. -1457, -1/3, 1, 111 What is m in -4m2/5 + 1620264m/5 - 16524612 = 0? 51, 405015 Factor -2z2 - 39386432z - 193911378211328. -2(z + 9846608)2 Factor -2c*2 + 389112c + 9339840. -2(c - 194580)(c + 24) Determine c, given that -c*3/2 - 171830c*2 + 58443875c/2 - 1242085875 = 0. -343830, 85 Let -15842h5/7 + 775546h*4/7 - 2816680h*3/7 - 127768h*2/7 - 1440h/7 = 0. Calculate h. -2/89, 0, 4, 45 Suppose k*4 + 6325767k*3 + 10003822545917k*2 - 30011511918135k + 20007683046450 = 0. What is k? -3162885, 1, 2 Suppose -5z4 + 1030z*3 + 324945z*2 - 983970z = 0. What is z? -174, 0, 3, 377 Factor 3l2 + 1312371l + 5249436. 3(l + 4)(l + 437453) Factor -t*2/7 - 1473184t - 3797974421248. -(t + 5156144)*2/7 What is n in -4n*5/7 + 4628n*4 - 65512744n*3/7 - 328309216n*2/7 - 18801280n + 525398528/7 = 0? -4, -2, 1, 4052 Factor 3x2/4 + 23347713x/2 + 181705234110123/4. 3(x + 7782571)2/4 Find m such that -m4 - 77m*3 - 1439m*2 + 1517m = 0. -41, -37, 0, 1 Determine i so that -i*4/2 + 19420i*3 - 5628008i2 = 0. 0, 292, 38548 What is r in -r4/4 + 3864575r3/4 - 933431330300r*2 - 4667180805125r = 0? -5, 0, 1932290 Suppose -2k5/5 + 1688k*4/5 + 13166k*3 - 559468k*2/5 - 748496k/5 + 1240448/5 = 0. What is k? -44, -2, 1, 8, 881 Factor 3h3/8 - 4605h*2/2 - 9652350h + 60405165000. 3(h - 5620)2(h + 5100)/8 Factor 2d2/3 + 20089728d + 60269182/3. 2(d + 1)(d + 30134591)/3 Determine b so that 3b4 - 2616981b*3 - 7850961b*2 - 7850967b - 2616990 = 0. -1, 872330 Solve 3n4 - 231666n*3 + 4463844219n*2 + 331577346864n + 327113270976 = 0 for n. -73, -1, 38648 What is j in -j*5/2 - 210j*4 - 41357j*3/2 + 304251j*2 + 2455920j - 24494400 = 0? -216, -10, 7, 15 Suppose 3y3 + 943110y*2 + 74120429556y - 148244631576 = 0. Calculate y. -157186, 2 Factor -36s2 + 22167s + 7393. -(3s + 1)(12s - 7393) Suppose w4/2 - 61w*3 + 1797w*2/2 + 9904w - 171392 = 0. Calculate w. -13, 16, 103 Solve 21v5/4 - 24513v*4 + 38258517v*3 - 20125490160v*2 + 259135602432v - 616820920320 = 0 for v. 22/7, 10, 1552 Suppose -2r4/11 + 142864r*3/11 - 2553264174r*2/11 + 71375295592r/11 + 73928702632/11 = 0. Calculate r. -1, 29, 35702 Determine i so that -147i2/2 + 1354755i/4 - 3456 = 0. 1/98, 4608 Factor 3o2 - 267231o + 84941406. 3(o - 88758)(o - 319) Find x such that 3x4 + 768x*3 + 7476x*2 + 23712x + 23616 = 0. -246, -4, -2 Factor -2r2/5 + 20118r/5 + 1867784/5. -2(r - 10151)(r + 92)/5 Determine f, given that -f*4 + 1775f*3/3 - 17839f*2/3 - 253725f - 1363986 = 0. -9, 29, 1742/3 Factor z*3/8 + 2547z*2/4 + 1272z - 5092. (z - 2)(z + 4)(z + 5092)/8 Factor -25c3 + 642340c*2 - 57658725c + 1296182250. -5(c - 45)2(5c - 128018) Suppose -n2/5 + 24535169n/5 - 24535168/5 = 0. Calculate n. 1, 24535168 Let 5o4 + 367330o*3 + 7345240o*2 + 47006720o + 94010880 = 0. What is o? -73446, -8, -4 Suppose 5w5 + 683975w*4 - 2051975w*3 - 683975w*2 + 2051970w = 0. Calculate w. -136798, -1, 0, 1, 3 Let 4u2/3 + 10220u/3 - 92952 = 0. Calculate u. -2582, 27 Let 27i2 + 76437006i + 16986000 = 0. What is i? -2831000, -2/9 Solve j*2/6 + 967241j/3 + 1289652 = 0. -1934478, -4 What is r in r*2/2 + 2259225r/2 - 1129613 = 0? -2259226, 1 Find k such that -k*3 - 10930k*2 - 641953k - 6131244 = 0. -10871, -47, -12 Suppose 2o4/11 - 32886o*3 - 2532400o*2/11 + 14470488o/11 - 1447040 = 0. Calculate o. -11, 2, 180880 Solve a*4 - 5831a*3 + 8503053a*2 - 8485565a - 16994450 = 0 for a. -1, 2, 2915 Factor -z*5/8 + 1536127z*4/8 - 393281282709z*3/4 + 33562886853651845z*2/2 - 16781345106697261z. -z(z - 512042)3(z - 1)/8 Suppose 3p5 + 459707p*4/2 - 498041p*3 - 842794p*2 + 1992116p - 306480 = 0. Calculate p. -76620, -2, 1/6, 2 Factor 258f3 + 164251f*2 - 60512f + 1911. (f + 637)(3f - 1)(86f - 3) Find a such that -a*3 - 10024a*2 + 2632985a + 13415400 = 0. -10280, -5, 261 Factor 2o3/7 - 67652o*2/7 + 573247488o/7 - 19412287488/7. 2(o - 16896)2(o - 34)/7 Suppose -9483o3 + 16191o*2 - 3933o - 2775 = 0. Calculate o. -925/3161, 1 Factor -2a2 - 89083608a - 991986151787208. -2(a + 22270902)2 Factor -12848k*2/9 + 89954k/9 - 14. -2(k - 7)(6424k - 9)/9 Let -4f*5/5 - 9018f*4/5 + 231838f*3/5 - 1645248f*2/5 + 2079072f/5 - 131328 = 0. Calculate f. -2280, 1/2, 1, 12 Factor m*2/2 - 34132587m/2. m(m - 34132587)/2 Factor 132z*2 + 1769492z + 1608520. 4(3z + 40213)(11z + 10) Factor 2w2/11 - 1194w/11 + 16184. 2(w - 308)(w - 289)/11 Solve -5k2 + 214301700k - 2296260931144500 = 0 for k. 21430170 Solve -1562m2/7 - 81414m/7 + 22320/7 = 0 for m. -3720/71, 3/11 Let -3r4 + 5250r*3 - 2139579r*2 - 137634000r - 2061835968 = 0. Calculate r. -29, 904 Factor 2b3/9 - 15608b*2/9 + 1734b. 2b(b - 7803)(b - 1)/9 Suppose -813m*4 + 264207m*3 - 22357341m*2 + 143379045m + 3185406 = 0. What is m? -6/271, 7, 159 Determine y, given that 3y2 + 6018114y - 18054369 = 0. -2006041, 3 Factor -365t2 + 2403440t + 559725. -5(t - 6585)(73t + 17) Find h, given that h2/4 - 36499755h/2 = 0. 0, 72999510 Factor -c*3/6 + 70895c*2 - 7540356608c + 768870529808/3. -(c - 212668)*2(c - 34)/6 Suppose -i*3/4 - 6795243i*2/2 + 27180975i/4 - 3397622 = 0. Calculate i. -13590488, 1 Find i such that -2i4/7 - 1370030i*3/7 - 234622090092i*2/7 + 234626200192i/7 + 469246920256/7 = 0. -342508, -1, 2 Factor -2q3/7 - 16487942q*2/7 - 32975878q/7 - 16487938/7. -2(q + 1)2(q + 8243969)/7 Factor -u*2/5 + 2049u/5 - 991278/5. -(u - 1266)(u - 783)/5 What is i in -16i*4/3 + 674188i*3 - 63926547512i*2/3 + 175753469932i - 42606574944 = 0? 1/4, 8, 63201 Let u*5/7 - 5039u*4/7 - 5049u*3/7 + 45351u*2/7 + 6480u = 0. Calculate u. -3, -1, 0, 3, 5040
Let a be 3 + (-7 + 2 - 2). Let c be 2/(a/28-2). Solve -4y = 27 - c for y. -5 Let w(p) = -p*3 - 7p*2 + 9p - 1. Let k be w(-8). Let v = 8 + k. Let f be (-2 - -2) + 3 - v. Solve -fz - z = 15 for z. -3 Let s = -27 - -39. Solve 0 = 4d + s for d. -3 Let t = -2 - -5. Let n be (-5)/t99/(-11). Solve -3c + 8c - n = 0 for c. 3 Suppose 0 = 2t + 2t. Suppose k + 4k - 65 = t. Let a = 41 - 36. Solve 3 = -ao + k for o. 2 Let h be ((-4)/(-7))/(10/35). Suppose -5m - h = -m - 2q, -5 = 5m - 3q. Solve z = m + 1 for z. 3 Suppose -2l = 5f - 10 - 4, f + 8 = 5l. Solve -p = -lp - 2 for p. -2 Suppose 2v - 31 = 5. Solve -2 - v = -5u for u. 4 Let u(r) = r3 + 6r*2 + 5r + 4. Let t be u(-5). Suppose tx - 9x = 0. Let j = 16 + -15. Solve x = v + j + 1 for v. -2 Let n = 119 - 115. Solve 0 = 2v + 2 - n for v. 1 Suppose -3j + 9 = -4p - 3, 2p + j - 4 = 0. Let s be 6 + -3 + p - 1. Solve 2l = l - s for l. -2 Let r = -52 - -57. Solve r = c - 0c for c. 5 Suppose 3v + z = 28, -2v + 0z - 3 = 5z. Let l = v - 11. Solve 3y + y = l for y. 0 Let s(t) = t2 + 2t + 13. Let o be s(0). Let w = -10 + o. Solve -4c - w = -3c for c. -3 Let x = 104 + -60. Let p be x/6 + 2/3. Let a = -22 + 23. Solve -3v + a + p = 0 for v. 3 Let s = 5 + -4. Suppose s = 3a - 2m, -a + 3m = -5a + 7. Solve 0 = t - 5 + a for t. 4 Let d = -69 - -71. Solve 1 = -do - 3 for o. -2 Suppose -3z + 32 = a, 4z + 0a = 3a + 21. Solve -5 = 4s - zs for s. 1 Suppose 5x = 5k + 15, 2x - x = 4k + 3. Solve -c + xc + 8 = 0 for c. -4 Suppose 23d = 27d. Solve 0 = w - dw + 4 for w. -4 Suppose 0 = w - 11w + 150. Solve 5f - 2f = -w for f. -5 Let f be (-1)/((-1)/3) - 0. Suppose 0 = 4i + 3t + 12, fi + 38 = 6t - t. Let p be 4 + -6 - i/1. Solve -p = -4s - 0s for s. 1 Suppose 0 = -6l + l + 15. Let b be 4 + 0/l-1. Suppose bw + 3j - 28 = 0, -w + 6j - j = 16. Solve 2t + 0 = -w for t. -2 Let r(h) = h + 2. Let v be r(-3). Let k = 3 + v. Let w be ((-7)/2)/(3/(-6)). Solve 3 = kg + w for g. -2 Suppose 3m + 3d - 9 = 0, -3 = -4m + 2d + 3. Let i be (1 - -1)5/m. Let a = 2 + -2. Solve a = t + i for t. -5 Let i be -2 - (-2 - 0)1. Let u be (2 - -1) + i/5. Solve 0 = 2y - 7 - u for y. 5 Let o(d) = 1 + d2 + 1 - 5d + 1. Let v be o(5). Solve 2 = 5i - vi for i. 1 Let d be 9/((-2)/6-3). Solve -2q + d = q for q. 3 Let m(b) = 2b - 5. Let l(r) = 5r - 1. Let h be l(-1). Let f = -1 - h. Let u be m(f). Solve u = 4g - 3g for g. 5 Let y be 384/(-16)(-4)/6. Let h be 1/3 - y/(-6). Let j = 4 - 3. Solve z + h = j for z. -2 Suppose -3k + 230 = 5t, -k - 43 = -2t + 49. Let q be t1/63. Suppose 0 = -4r + 63 - q. Solve 0 = 5d - r for d. 2 Let i be (-24)/(-11) + (-16)/88. Solve -2o - i = -0o for o. -1 Let u be 16/5 - 48/(-60). Solve 0 = -3b - u - 2 for b. -2 Let g(f) = -f3 + f2 - 2f + 3. Let t be g(2). Let p be (-8)/(-20) - (-2)/t. Solve 2w + 3 - 1 = p for w. -1 Let d = -3 - -8. Suppose 3i + 5z - 12 = 2i, dz = -4i + 33. Solve -2l + i = 1 for l. 3 Let f be (-8 + 8)/(0 + -1). Let t(j) = -j. Let g be t(-4). Solve fp - g = -2p for p. 2 Let t(g) = 2g*2 + g + 2. Let p be t(-2). Solve 2x + p + 2 = 0 for x. -5 Let g = -30 + 32. Solve -gz - 4 = 2z for z. -1 Let l be (9/6)/(6/40). Suppose -5n = 5w - 10, 4w + 11n - 6n = 4. Suppose -t + w = 2t. Solve -tf + l = -0f for f. 5 Suppose 0 = 2s + g - 6, 3g = -4s - g + 12. Let w(r) = r3 + 3r*2 - 3r + 4. Let i be w(-4). Solve i = sb + 7 + 5 for b. -4 Let h(b) be the second derivative of b5/20 - b4/2 - 7b*3/6 + 3b*2/2 - b. Let c be h(7). Solve 3q - 9 = -c for q. 2 Suppose 4o + o = -3b - 14, 0 = -b + 4o + 1. Let h = b + 7. Solve m = 3m - h for m. 2 Let j be (6 + 3)(-1)/(-3). Solve -jg - 4 = -g for g. -2 Suppose -5n - 6 = -21. Suppose 0 = 2u + u - n, 0 = -2f + u + 23. Solve f = 3d + d for d. 3 Let h = -83 + 85. Solve 12 = m + hm for m. 4 Suppose 4r - 14 = -5s, s - 4 = 2r - 3r. Suppose -1 = -a + 2. Solve ay = -0 - r for y. -2 Suppose 0x + 4x + 2 = 5o, 6 = 3x. Suppose ol = -3t + 15, 4l + 4t - 21 = l. Solve -4 = -lg + 8 for g. 4 Let z(t) = 2t*2 - t - 2. Let v be z(-1). Solve v = -0s - s for s. -1 Let n = 38 + -23. Let p be n/25 + 201/15. Let j(k) = 2k2 + 5k + 2. Let s be j(-3). Solve sg = -1 - p for g. -3 Let o(i) = 3i - 1. Let d be o(2). Suppose -dg - n + 22 - 8 = 0, -4n = 2g - 2. Solve 0 = -gt + 5t - 10 for t. 5 Let d = 0 - -2. Let u(w) = -3w - 3. Let z be u(-2). Suppose 0 = -2v - dh + 10, -zv + 25 = -v + 5h. Solve -6l + 2l - 12 = v for l. -3 Let b = 9 + -18. Let n(k) = 3k + 6k - 8k2 - 3k*3 + 3k3 + 3 - k3. Let u be n(b). Solve 0s - us = 9 for s. -3 Suppose -l - 3g = -3l + 11, l + 5g + 1 = 0. Solve f = -l + 9 for f. 5 Let o = 0 + 2. Let v = 6 - o. Let h be v + 2 + -2 - 1. Solve hy = 5 + 1 for y. 2 Let g be 1/(-1 - 16/(-12)). Solve -p - gp = 0 for p. 0 Let k = -5 + 6. Suppose -l = k - 2. Solve d - 1 = l for d. 2 Let w(l) = 3l*2 + 4l + 1. Let s be w(-3). Solve 4a = -0a + s for a. 4 Let a = -30 - -36. Suppose -2y + 0y = -4. Solve yu = au + 4 for u. -1 Let q = 17 - 1. Solve 3o = -o + q for o. 4 Let p(m) = -m3 + 4m*2 + m - 1. Let j be p(4). Solve jx = -x - 8 for x. -2 Suppose -2v - 6 = -4d, 0 = -2d + 2v - 4v - 6. Solve 5z + 0z = d for z. 0 Suppose -2 = -0p - p - 2i, 2p - i = 24. Solve x - p = -x for x. 5 Suppose -30 - 12 = -5c + p, c - 3 = 2p. Let l be 1/(-3)c/(-1). Let o be 47/7 + ((-10)/(-7))/5. Solve -16 = -ln + on for n. -4 Let s = 0 - 6. Let q = s - -4. Let g = 9 + q. Solve -4k = -g + 3 for k. 1 Suppose 5b - 6b = -3v - 6, 0 = -4b + 5v + 24. Solve b = d + 2d for d. 2 Let y be 30/(-40)4-1. Let x(z) = z - 1. Let q be x(11). Solve q = -yt + t for t. -5 Let o(a) = a2 + 2a - 5. Let z be 10/(-15) + (-20)/6. Let j be o(z). Suppose 9 = -3h + 39. Solve -jx = -x - h for x. 5 Suppose -18 = -4t - 2. Solve -4 = tu - 0u for u. -1 Suppose -4i - 3n = -35, 4i + 0n = 3n + 5. Solve -4m = -im + 4 for m. 4 Let n(j) be the third derivative of -j*5/60 - 7j4/24 + j3/3 + 2j2. Let h be n(-5). Solve f + 2f - h = 0 for f. 4 Let v be (-2)/4 + 66/12. Let m = 3 + 0. Solve 17 - v = mp for p. 4 Suppose -b + 9 = a - 5b, 5a = 5b + 105. Suppose -3o + 5c + a = 0, 5 + 0 = -o - c. Solve od = -5d for d. 0 Suppose -5d = 2z + 17, -2d = z - d + 1. Solve zl = 3 + 13 for l. 4 Let k = -17 - -21. Solve -km + 6 = -m for m. 2 Suppose -8 = 4r - 0r - 2b, 0 = -5b - 10. Let z be r/(-21/10). Suppose 5o - i + 2 = 29, -5i + z = 0. Solve 2a - 4a + o = 0 for a. 3 Suppose -6 = -3u, -5m - 4 = -3m + u. Let o(k) = -k2 - 4k. Let i be o(m). Solve 0 = iy - 13 - 2 for y. 5 Let g be -1 + -2 - (-2)/(-2). Let t be ((-6)/g)/((-27)/(-198)). Solve -6n + tn = 15 for n. 3 Let y(d) = 4d*2 + 1. Let r be y(1). Let v(s) = -s + 0s*3 + 8 + rs*3 - 2s*3 - 2s*3 + 7s*2. Let h be v(-7). Solve 9m = 4m - h for m. -3 Let o(u) = -20u*2 - 12 - 9u + 4 + 12u2 - u3. Let w = -18 + 11. Let a be o(w). Solve 0z = 3z + a for z. -2 Suppose 4i = 5s - 7, 4s - 2s - 8 = -i. Let v(q) = -2q + 3. Let w be v(i). Let x be w - (0 - -1) - -7. Solve -xb = -b + 12 for b. -3 Let q be (4 + -1 + -2)/1 - -1. Solve -c = -3c + q for c. 1 Let u(z) = -7z3 - 2z*2 + 2z + 3. Let j be u(-1). Solve h - 5 = jh for h. -1 Let w = -56 + 60. Solve 0 = wc - c - 3 for c. 1 Suppose 0i = 5i. Suppose -2a - 17 + 3 = -2r, -4a = r - 22. Solve 5y + iy - r = 0 for y. 2 Let s(y) = y2 + 0y*2 - 5y + y*2 + 2. Let f be s(3). Solve -ft + 23 = -2 for t. 5 Let r be (-6)/4 + (-407)/(-22). Solve -r = 3y - 2 for y. -5 Let r be ((-1)/(1/6))/2. Let s(q) = -q3 - 3q*2 - q - 2. Let z be s(r). Let n = 3 - -1. Solve -z + n = -x for x. -3 Suppose p + p - 4p = 0. Let m = 6 - 4. Solve p = -3d - m - 4 for d. -2 Let c be (-3)/2 + 16/(-32) + 2. Suppose -a + 0a = 3m + 1, -3m = -4a + 26. Solve c = -4p + ap for p. 0 Let z(n) = 4n - 2. Let f be z(2). Let a = f - 1. Suppose ac + 7j - 2j = 40, j + 10 = 2c. Solve -20 = -o + co for o. -4 Suppose 2g - i + 9 = 38, g - 17 = i. Solve -g = 3f - 0 for f. -4 Suppose 0 = 6r - 2r - 16. Solve -n = r - 3 for n. -1 Let w(s) = 13s*3 - 32s*2 - 32s - 27. Let r(y) = 3y3 - 8y*2 - 8y - 7. Let m(h) = -9r(h) + 2w(h). Let z be m(9). Solve g - 1 + 6 = z for g. -5 Let n(j) = -2j3 + 9j*2 + 8j - 12. Let x be n(5). Solve q = xq for q. 0 Let a be (1 - 1) + 20/5. Let k = -13 - -15. Solve 0 = kh - h - a for h. 4
Let r = -42.4 - -76.4. Which is the third smallest value? (a) 4 (b) r (c) 0.4 (d) 2/15 a Let t = -0.022 - 0.017. Let d = t + -0.361. Suppose 2q + 3 + 7 = 0. What is the smallest value in q, 1/6, d? q Let o be (-33 + 1)2/870. Let p = o - -6/29. Let v = 94 - 93.6. Which is the smallest value? (a) -0.3 (b) v (c) p a Let c be (64/(-270))/2 + (-16)/80. Let x = c - 2/135. What is the second smallest value in 0.3, 4/3, 0.4, x? 0.3 Suppose 0 = 22j - 123j + 505. Which is the smallest value? (a) 3/4 (b) j (c) -29/3 (d) -0.3 c Suppose 0 = 4u - 0h + h + 3, -2h = -2. Let i be 3/9 - (10/(-6))/u. What is the biggest value in -2, i, 1? 1 Let b = -1.1 - -8.1. Let v = 6.7 + -7. What is the third biggest value in b, 5, v? v Let d = -5.4 + -0.6. Let p = -0.0548 - -0.4548. Let w(v) = -2v + 5. Let h be w(4). What is the second smallest value in h, d, p? h Let i = 13.0222 - 0.0222. Which is the third smallest value? (a) -5 (b) i (c) -0.1 b Let y = 5.15 - 5.21. Which is the second smallest value? (a) -0.1 (b) 5 (c) -1 (d) y a Let u be (-60)/36((-3)/(-4) + 0). Let f = -0.4 - -0.2. Which is the biggest value? (a) -0.3 (b) f (c) u (d) -2/15 d Let s = -19.32 - -19.32. Suppose -3r + 4 = -r. Which is the third biggest value? (a) r (b) s (c) 3/4 b Let x = 0.256 + -7.496. Let k = x + 0.44. Let y = -7 - k. Which is the third biggest value? (a) 1/2 (b) 3/11 (c) y c Let x = -236.3 + 236. What is the third smallest value in -2, 0.3, x, 0.04? 0.04 Let l = -1.9 + 1.7. Let g = -21.7 - -23. Let q = g - 1.1. What is the third smallest value in l, q, -3? q Let s = 354.6 - 354. Which is the fourth biggest value? (a) s (b) 0.5 (c) -8 (d) 5 c Let f = 218.9 + -219.5. Which is the fourth smallest value? (a) 2/5 (b) 0.3 (c) f (d) -1 a Let o be 40/12 - 1/3. Suppose -w - m + om = 1, 4m - 8 = 0. Let i be (0 + w)/((-12)/(-8)). Which is the third smallest value? (a) 4 (b) i (c) 1/2 a Let g = 324/1379 - -10/197. What is the fourth smallest value in -0.3, 303, 2, g? 303 Let t be (50/26 - 2)/((-1)/(-2)). Which is the second biggest value? (a) t (b) -3 (c) 6 a Let g = 9.11 + -0.11. Let v = 10 - g. Let t(f) = f*3 + 9f*2 - 13f - 25. Let r be t(-10). What is the third smallest value in r, v, 0? r Let v = 83 + -70. Let u = 13 - v. Which is the biggest value? (a) 5 (b) 1/4 (c) u (d) -0.2 a Let h be 1/1 - (22 + 6). Let z = 205/474 - 21/79. What is the smallest value in z, 1/4, h? h Let x = 0.03921 + -0.33921. Let o = -8.93 + 9. Which is the fourth biggest value? (a) x (b) 5 (c) o (d) 2 a Let n = 7 - 22. Let g = 15.4 + n. Let v = 0.39 - 0.09. Which is the third biggest value? (a) v (b) -1/4 (c) g b Let o(w) = -w*3 - 6w*2 + 6w - 4. Let x be o(-7). Let r be 1/x + 22/(-30). Let m be ((-15)/(-12)6/(-15))/1. What is the third smallest value in 2/5, r, m? 2/5 Let o = -10 + 24. Let n = -18 + o. Which is the third smallest value? (a) 7 (b) 1/9 (c) n a Let g = 12.97 - -0.03. Let p = 12.4 - g. Let o = 1 + p. What is the third smallest value in 0, -2/7, o? o Let a = 10 + -3. Let d = 27 + -26.95. Let s = d - -0.45. What is the third smallest value in s, a, -3? a Let w = -1390 - -1385. What is the biggest value in w, -1/11, -0.5? -1/11 Let t = -1/321 + -631/3531. Let g be ((-568)/(-286) - 2)-1. Let p = g - -131/858. Which is the biggest value? (a) p (b) t (c) 0.5 c Let f be (-2 + 30/36)4/(-14). Let l = 1/4 - 1/20. What is the third biggest value in l, 2, f? l Let q = -4.7 - -5. Let h = -10.15 - -9.85. Which is the second biggest value? (a) h (b) q (c) 1 b Let w(u) = u3 - 9u*2 - 9u - 12. Suppose 47 = -5o + 97. Let p be w(o). Which is the biggest value? (a) 0 (b) 0.5 (c) p b Let t = -0.5551 - -0.0551. What is the second biggest value in 2/3, -3, t, -0.12? -0.12 Let l = 5/98 - 417/490. What is the second smallest value in l, 0.5, -4? l Suppose 4g = -5n + 7, -2g = 9n - 7n - 4. Which is the second smallest value? (a) g (b) -4/7 (c) -0.2 (d) 0.2 c Let a = -0.059 - -3.859. Let h = a + -3.9. Let b be 1 + (-1)/((-6)/(-8)). What is the third smallest value in 4, b, h? 4 Let j = 30.1 + -30. Let s be (1 - 0)/(5/(-3)). Let w = -0.537 - -0.837. Which is the second biggest value? (a) s (b) j (c) w b Let h be 6/4 + 105/14. Suppose hk - 6k = -15. Let g = -0.4 - -0.1. Which is the biggest value? (a) g (b) k (c) 0 c Let h(k) = k*3 + 5k*2 - 5k - 23. Let d be h(-4). Let u = -2.3 + 3.3. Which is the second smallest value? (a) -0.3 (b) d (c) u c Let f = 0.69 + -4.59. Let v = -0.9 - f. Let l = -5 + v. Which is the second biggest value? (a) l (b) 0.3 (c) 3 b Let o be ((-27)/(-15) + -3)/(22/10). Which is the third biggest value? (a) o (b) 25 (c) -3 c Let w = 24 + 6. Let x = w + -30.03. Let y = 0.23 + x. What is the third smallest value in y, 1, 3? 3 Suppose -48m - 159 = 81. Let x = -2 - 9. What is the second smallest value in 4, m, x, 2/5? m Let z be (-3)/12 + 9/4. Let p be ((-6 - -2) + z)/2. Let i = 0.19 - 0.49. Which is the smallest value? (a) p (b) i (c) 2/11 a Suppose 0 = -3r + 5p + 4, -4p = 5r - 19. Let g = 1.97 - -0.03. What is the third biggest value in g, -1, r? -1 Let k = -0.56 - -0.16. Suppose 2p + 3p = -u + 4, 2u + 6 = 4p. Which is the third smallest value? (a) k (b) u (c) -0.2 c Let v(n) = -127n - 2029. Let g be v(-16). Let s(o) = 8o3. Let u be s(-1). Which is the smallest value? (a) u (b) g (c) 2 (d) 4 a Let d = -290 + 294. What is the second smallest value in -4, 3/7, d? 3/7 Let x = -2816 - -2815. Which is the smallest value? (a) -0.3 (b) 59 (c) -0.5 (d) x d Let w = 6.09 - -2.86. Let o = w - 9. Which is the smallest value? (a) 1 (b) o (c) -2 c Let k(p) = 8p*2 - 128p - 5. Let n be k(16). Which is the smallest value? (a) 15 (b) n (c) -9 c Let s = 13.9 - -0.1. Let c = 13.1 - s. Let r = -0.05 - 3.95. What is the third biggest value in r, c, 1/5? r Let r = 1.29 - -72.71. Let g = -122 + r. Let u = 34 + g. Which is the second biggest value? (a) u (b) -0.5 (c) 4 b Let q = 480.135 + -478. Let g = -0.135 + q. Which is the second smallest value? (a) 2/55 (b) g (c) -4 (d) -0.2 d Let v = -6 - -5.5. What is the fourth biggest value in 2/7, -1, 0, v? -1 Let h = 2001 - 2001.5. Which is the second smallest value? (a) h (b) -2/39 (c) 0.17 b Let u = -3 - -6. Let t be u/(-4) + 14/28. What is the third biggest value in t, 0.1, -3? -3 Let m = 59.8 + -60. Let r = 2 + 10. Let k = r + -7. Which is the biggest value? (a) k (b) m (c) -5 a Let z = -0.035 - -0.024. Let x = 13.989 - z. Which is the second biggest value? (a) 3/5 (b) x (c) 0.5 a Let j = 31 - 50. Let n = -21 - j. Which is the biggest value? (a) 0.3 (b) -1 (c) 4 (d) n c Let q be 2/6 + -2 - -1. Let w = -0.8 - -0.98. Let s = w - -3.82. Which is the biggest value? (a) q (b) -1 (c) s c Let o = 4.13 - 4.43. What is the third biggest value in 2/15, o, -257, -0.5? -0.5 Let l be (-65)/39 + -11. Which is the third smallest value? (a) 5 (b) -1/5 (c) 4 (d) l c Let v = -4.68 + 1.64. Let s = v + 6. Let u = 0.04 + s. Which is the smallest value? (a) 0.2 (b) u (c) 1 a Let v = 5 + -4. Let h = 3 - -6. Let k = 8.8 - h. Which is the biggest value? (a) v (b) k (c) 2 c Suppose -41 + 10 = -3p + 5g, -2p + 16 = -g. What is the third biggest value in p, 0.1, 0? 0 Let h = -8 + 12. Let n = -40 + 39.8. Which is the smallest value? (a) -4 (b) h (c) n a Let q = 5.9 - 5.8. Suppose -268z + 264z + 16 = 0. Which is the second smallest value? (a) -2/19 (b) z (c) q (d) 1 c Let c = 263 + -262.99. What is the second smallest value in -3, c, 4? c Let z = 82.1 + -80.1. Let o be (-5)/7 + (1 - 0). Which is the second biggest value? (a) -1/3 (b) z (c) 0 (d) o d Let d be (2(-3 + 5))/2. Suppose 2s + 20 = -ds. What is the third smallest value in s, 2/73, -1/4? 2/73 Let o = -1.206 - -0.206. What is the biggest value in -22, o, -5, 3/7? 3/7 Let x = -0.783 - -0.193. Let z = 0.89 + x. Let f = 0 - 2. What is the biggest value in f, 0.1, z? z Let c = 964 - 965. What is the third biggest value in 0, -0.4, c, -11? c Let k(p) = -6p + 26. Let h be k(6). Let o be (3 + 172/(-60))h. Let j = -205/2 - -105. What is the third smallest value in o, j, -3? j Let f = 12.74 + -1.34. Let w = f - 11.3. Let x = -0.08 + -0.22. Which is the second biggest value? (a) x (b) w (c) 3/2 b Let s be 309/54((-85)/(-25) - 3). Let f = -3.3 - -3. What is the fourth smallest value in -5, s, f, 4/5? s Let j be -1((-2)/(-2) - -2). Let q be (-18)/66*(-2)/(-6). Which is the second smallest value? (a) -5/3 (b) q (c) j a
Suppose 2d = 7d - 20. Let s(z) = -dz2 + 5z2 + z2. Let b = 0 - -2. Calculate s(b). 8 Let v = 858 + -868. Let p(q) = -q*3 - 10q*2 + q + 9. Determine p(v). -1 Let w be 12/54 - 100/(-36). Let m(r) = -10r + 7. Give m(w). -23 Let l be 4(-6)/(-120)(-175)/(-21). Let d(s) be the second derivative of 11s + ls*3 + 0 + 0s*2. Determine d(1). 10 Suppose 5a - 3a = -5n + 12, -20 = 5a. Let c = -29 - -40. Let f(w) = cw + 1 - 2 - 9w - 2. What is f(n)? 5 Let k be 9/(-15)(-1900)/(-285). Let t(z) = -3z2 - 12z - 1. Give t(k). -1 Let v(n) = -3n3 + 3n2 + n. Let q = -142 - -140. What is v(q)? 34 Let z(a) = -a3 - 4a - 3. Let x = -64 - -62. Calculate z(x). 13 Let l(a) = a2 - 24a + 45. Let f(t) = t*2 - 23t + 44. Let x(b) = 6f(b) - 5l(b). Let z be x(15). Let q(i) = -3i - 2. Determine q(z). 16 Suppose -55s + 33 = -44s. Let r(u) = -u3 - u2 - 2u + 1. Calculate r(s). -41 Let c(t) = t*3 - 6t*2 + 3t - 8. Let x(z) = z*3 - 25z*2 + 23z + 33. Let d be x(24). Let j be 51/d - 3/(-9). Give c(j). 10 Let k(p) be the second derivative of p6/120 + p5/120 + 2p4 + 12p. Let c(h) be the third derivative of k(h). What is c(-2)? -11 Let l(a) = a*2 - 2a - 1. Let u(p) = -7p - 87. Let c be u(-12). Let h(q) = 2q*2 - 2q - 1. Let b(r) = cl(r) + 2h(r). Give b(-3). 4 Suppose 10s - 6s = 28. Suppose -s - 2 = z. Let o be 1 + 0 + 6 + z. Let n(u) = u*3 - 2u2 - u. Give n(o). -14 Let g(z) be the first derivative of z6/360 + z*5/20 - 7z*4/24 + 2z*3/3 - 9. Let p(q) be the third derivative of g(q). Let i = 12 + -19. What is p(i)? 0 Let o(h) be the first derivative of 2h*3/3 + 6h*2 + 6h - 510. What is o(-6)? 6 Let m(z) = -29 + 66 - z + z*3 + 3z - 33 - 6z2. Determine m(5). -11 Suppose -2n - 408 = -404. Let f(i) be the third derivative of -1/6i4 + 0 + 0i - i*2 + 1/6i*3. Calculate f(n). 9 Suppose 3f = -2f - 35. Let o(q) = -120q*2 + 8q - 126q2 + 247q2. Determine o(f). -7 Let i(d) = d3 - 8d2 + 8d - 5. Let s be 24/14 - 16/(-56). Let x(l) = l*3 - 2l + 3. Let u be x(s). Determine i(u). 2 Suppose -10 = 2r, 0q + 5r = 2q - 13. Let g(n) = n*2 + 7n + 9. Give g(q). 3 Let n = -20 - -16. Let v be (-70)/(-21)(24/(-5))/n. Let c(x) = x2 - 6x + 5. Calculate c(v). -3 Suppose 6i - 50 + 98 = 0. Let p(w) be the first derivative of -w4/4 - 3w*3 - 4w*2 - 8w - 7. Determine p(i). -8 Let x(w) be the first derivative of w*2/2 - w + 1. Suppose s + 232 = 3s - 4v, 3s = v + 358. Let y be (-48)/s - 46/10. Give x(y). -6 Let h(r) = -r*2 + 3r. Let g = 66 + -58. Suppose k + 20 = 6k - 5i, -4i = -2k + g. Calculate h(k). -4 Let n(d) = -5d + 7. Let m be n(-1). Let s(z) = -z3 + 11z*2 + 12z + 17. Give s(m). 17 Let l(s) be the third derivative of s5/20 + s3/6 - 18s2. Let x = -7 - -11. Let z be 2/x(-6)/3. Determine l(z). 4 Let c(x) = x - 3. Suppose -4p = 22p - 104. What is c(p)? 1 Let o(a) be the third derivative of -a6/20 - a3/6 - 148a2. Calculate o(1). -7 Let h(d) = 7d + 8. Let v(l) = -11l - 10. Let r(j) = 3h(j) + 2v(j). What is r(-4)? 8 Let j(w) = 2w + 1. Let u(b) = b. Let d(o) = 6o + 5. Let g(f) = -d(f) - 2u(f). Let n(z) = 2g(z) + 9j(z). Suppose 2v + 18 = -v. What is n(v)? -13 Suppose -5 = r - 0. Let j(k) = 0 - k3 + 20k*2 + 0 - 47k*2 - 1 + 22k*2. Give j(r). -1 Let a(w) = 3w*2 + w - 4. Suppose -u - 7j + 17 = -3j, -5u + j - 20 = 0. Determine a(u). 20 Let v(n) = 237 - n + 222 - 460 - n*3 - 3n*2 + 0n3. What is v(-2)? -3 Let i(p) = -p2 + 2p + 8. Let n = 94 - 88. Calculate i(n). -16 Let h = 91 + -90. Let y(b) be the third derivative of -b4/8 + b3/6 - 21b2. What is y(h)? -2 Let z(c) = -c2 - 18c - 14. Suppose 2o - o + 17 = 0. Let a be z(o). Let k(r) = r3 - r2 - 4r + 4. What is k(a)? 10 Let j(f) = -20f - 3. Let v(k) = 25k + 3. Let p(a) = -7j(a) - 6v(a). Calculate p(1). -7 Let b(w) = 2w - 12. Let k be b(9). Suppose 5l + 10 = -4i, -3l = 4i - i + k. Let m(r) = -r - 1. Determine m(i). -1 Let s(v) = -3v2 - v - 22. Let j(o) = o2 + 8. Let n(t) = 17j(t) + 6s(t). What is n(-4)? 12 Let h be (3 - -8) + (-126)/14. Let i(g) = 2g*3 + g - 1. Determine i(h). 17 Suppose 3l - 4u - 10 = 0, -48l + 4u + 20 = -50l. Let z(w) = -4 + 5 + w + 1. What is z(l)? 0 Let l be (2/5)/((-5)/(-675)). Let n(c) = 5c + 0c2 - l + 52 - c3 - 3c2. Let w = 1 - 5. Determine n(w). -6 Let h = 18 - 10. Let p(l) = h + 4 - 1 + l. Let m be (0 - 0)/(54/9 + -8). Calculate p(m). 11 Let n be (4 - 2-3) + -3. Let q(z) = z*3 - 6z*2 - 6z - 14. Let r be q(n). Let w(c) = c - 1. Give w(r). -8 Let j(f) = 10f - 8f - 9 - 6f. Calculate j(-8). 23 Suppose -3t - 3 + 9 = 0. Let i(g) = 4 - 2g - g + 4g - tg. Let m(x) = -6x3 + x2 + 2x + 1. Let w be m(-1). What is i(w)? -2 Suppose l + 8 = 3l - g, 2 = -g. Let w(z) = -3z2 - 6z + 3zl - z2 - 2 - 2z*3 + 0z. What is w(5)? -7 Let h = 26 - 33. Let v = -20 - -11. Let f = h - v. Let o(c) = -c*3. Calculate o(f). -8 Let s(b) = -1. Let c(q) = q + 10. Let z(h) = c(h) + 5s(h). Let i = 171 + -171. Give z(i). 5 Let u(x) be the first derivative of 8x3/3 - x2/2 - 667. Calculate u(-1). 9 Let y(m) = m - 4. Let z(k) = 1 - k2 + k2 + k3 + 2k*2 - 24k + 23k. Let w be z(-2). Calculate y(w). -1 Let q(z) be the third derivative of 11z*8/6720 + 31z*4/24 - 33z*2. Let n(a) be the second derivative of q(a). Determine n(-1). -11 Let f(y) = 9y*3 + 11y*2 + 5y - 15. Let l(t) = 7t3 + 10t*2 + 5t - 13. Let o(x) = -4f(x) + 5l(x). Calculate o(5). 45 Let u(t) = 2 + 9t2 - 17t*2 - 9t*3 + 10t*2 + 10t*3 - 6t + 3t. Let x = -2 - 2. Determine u(x). -18 Let f(l) = 4l + 1. Let q be f(1). Suppose -5o + q = 15. Let a(u) = u2 - 2u. Calculate a(o). 8 Let a be 102/164. Suppose -as = -s - 12. Let p(o) = so + 1 + 4 + o*3 + 2o2 - 2. Determine p(-2). -3 Let m(a) be the third derivative of a6/120 + a*5/30 - 5a*4/24 - 2a*3/3 - 78a*2. Calculate m(-3). 2 Let p(h) = 25 - 4h + 34 + 0h - 67. Calculate p(11). -52 Let m(k) = 2k + 15k + 12k + 22 - 21 - 6k. Calculate m(2). 47 Let c(t) = 19t + 7t + 11t - 36t + 10. Determine c(-8). 2 Let f(p) be the first derivative of p2/2 + p - 4. Let u = -28 - -16. Let a be 56/u - (-4)/(-12). Calculate f(a). -4 Suppose v + 5y + 0y + 17 = 0, 0 = -5v + 5y + 35. Let n(h) = h + v - 2 - 1. Determine n(-6). -6 Let l be (-1446)/(-6266)(-52)/(-6). Let b(t) be the second derivative of -2t3/3 + t. Determine b(l). -8 Let c(d) = -3d + 4d - 3 - 4d - 3d2 + 5d + d3. Let y = 420 + -417. Give c(y). 3 Let t(p) be the third derivative of p6/120 + 11p5/60 + 3p4/8 + p3/3 - p2 + p. Determine t(-10). 12 Let y(u) = -u3 + 3u2 - u - 3. Let l(m) = 43m - 170. Let t be l(4). Give y(t). -1 Let m(v) = -13v - 1. Let d(z) = -22z - 64. Let t be d(-3). What is m(t)? -27 Suppose 0 = 74d - 67d - 14. Let j be (-1)/(-3) + (-2)/6. Let w(c) = 4 + 2 + jcd + c2 + 4c - 3. What is w(-3)? 0 Let a(t) = -t + 9. Let m be a(7). Let c be 29 - m(-1)/(-2). Let u = c - 23. Let q(p) = p3 - 4p*2 - 6p + 6. Determine q(u). 1 Let f(z) = -8z - 42. Let c(r) = 17r + 90. Let m(q) = -6c(q) - 13f(q). Give m(0). 6 Let r(q) = 5q + 3. Let a(o) = -12o - 7. Let m(d) = 2a(d) + 5r(d). Let u be -21/7 + (-5)/7. What is m(u)? 0 Let k = -61 - -56. Let v(m) be the second derivative of -m3/6 - 3m*2 - 4m. What is v(k)? -1 Let o be (-25)/(-10) + 2/(8/2). Let x(q) = 8q - 8q + o - 3q - 5. Let t = 2 + -4. What is x(t)? 4 Let v = 19 - 17. Suppose 20 - 10 = vz. Let g(d) = d + 7. Give g(z). 12 Suppose -4z + 3a + 28 = 0, -2z + 5a + 20 = 2a. Let x(l) = 6l + 3. Let i(d) = -7d - 4. Let h(b) = zi(b) + 5x(b). Give h(-2). -5 Let a(p) = p + 1. Let j(c) = c + 2. Let b(q) = 2a(q) - 3j(q). Let g be (-21 - -12) + -2 + 5. What is b(g)? 2 Let b be (24/(-14))/((-6)/21). Let u(q) be the second derivative of -1/20q*5 + 7/6q*3 + 5/12q*4 + 0 - 2q*2 + 15q. Give u(b). 2 Let h(l) = 4 - 77l + 6 - 20 + 73l. Determine h(-2). -2 Let q(j) = -j*3 - 4j*2 + 8j + 9. Let v be q(-5). Let b(u) = -7u - 35. Give b(v). 7 Let a = 690 - 690. Let p(n) be the first derivative of -13 + 1/2n*4 + 0n + an2 + 2/3n3. Give p(-2). -8 Let k(u) = -u2 - 10u + 7. Let n be k(-5). Let c(j) = 33 - n - 3j - 4j. Let s be (5/25)/((-1)/(-5)). Calculate c(s). -6 Let a(l) = 122770 - 18l - 122770. Let v = 9 + -10. Calculate a(v). 18 Let q = -1094 - -1096. Let g(s) = -11*s + 3. Give g(q). -19
What is the closest to -3/62 in 1/5, 4/3, 0.5? 1/5 Which is the closest to -0.2? (a) 1.48 (b) 1 (c) -1/6 c Which is the nearest to 0? (a) -8689 (b) -2 (c) -0.4 c What is the nearest to -2585 in -1, 1, 2/5? -1 What is the closest to 16/323 in 4, -2, 2/9, -4, -2.1? 2/9 What is the closest to 230 in -0.2, 2, 1/3, 0.5? 2 What is the closest to 1 in 2/3, 1/10, -25, 16? 2/3 What is the nearest to 0 in 4, 6/7, -7.8, -29? 6/7 Which is the nearest to -39.7? (a) -44 (b) 1/9 (c) 0.02 a What is the closest to 0.1 in -1/103, 0, 0.012, -0.2? 0.012 What is the nearest to -3 in 4, -3, 5, 1, 11? -3 Which is the closest to 11? (a) -2/11 (b) 17 (c) -148 b Which is the closest to 0.7? (a) 1 (b) 18/7 (c) 0.1 (d) 3 (e) -0.3 a What is the nearest to 2/3 in -47, -1/5, 95? -1/5 What is the closest to -1/35 in -87, -0.3, 0.2? 0.2 Which is the nearest to 2? (a) -8 (b) -3/115 (c) 2 (d) 5 (e) 0.5 c What is the closest to -0.1 in 1/71, -10, 0.01, -9? 0.01 Which is the nearest to 0? (a) -2/3 (b) 0.09 (c) 5 (d) 21 (e) -1/2 b Which is the closest to 0.48? (a) -2/5 (b) 356 (c) -0.3 (d) 2/3 d Which is the nearest to 0.1? (a) -5 (b) -1/3 (c) 1/2 (d) -1 c What is the nearest to 18 in -5, -4, -0.71, 0.1, 3/5? 3/5 Which is the nearest to 3? (a) -5890 (b) 2/5 (c) 0.2 (d) -1/4 b Which is the closest to -17? (a) 0.1 (b) -0.02 (c) -0.1 (d) -60 (e) 2 c What is the nearest to -0.2 in -31, 1.7, 5/8? 5/8 What is the nearest to 1 in 4, 4/3, 137, 3/13? 4/3 What is the closest to 10 in -1/32, 1.6, 4/5? 1.6 Which is the nearest to 3? (a) 137 (b) -2/13 (c) -4 (d) -1/2 b Which is the nearest to -1? (a) -0.3 (b) 5 (c) 169 a Which is the nearest to -0.3? (a) -4.7 (b) -1/3 (c) 1/6 b Which is the closest to -27? (a) -8/49 (b) 2/11 (c) 0.4 a Which is the closest to 2398? (a) 2 (b) 1/18 (c) 0 (d) 0.1 a What is the closest to 0.1 in 1, 10, -165, -0.37? -0.37 What is the nearest to -0.1 in -34, 0.05, 13/5? 0.05 Which is the closest to 0.2? (a) -0.01 (b) -0.045 (c) -1 (d) 0.3 (e) -3 d What is the nearest to 3/4 in -4/7, 2/23, -2, 0.2? 0.2 Which is the nearest to 8? (a) 0.007 (b) -3 (c) 1/8 (d) 0.129 d What is the nearest to 1 in 0, -0.16, -5, 28? 0 What is the closest to -0.03 in 10, 0.01, -0.4, -2, 0? 0 What is the nearest to 101 in 2/3, 4, 15/2, 2/7? 15/2 Which is the closest to -916? (a) -3 (b) 30 (c) -0.4 (d) 15 a What is the nearest to -12 in 28, 2, 1? 1 What is the nearest to 34 in 24, -2/3, -169? 24 Which is the nearest to 1/4? (a) 1 (b) -13 (c) -188 a What is the nearest to 1 in 6, -1/6, 0.55? 0.55 Which is the closest to -2/203? (a) -5 (b) -25 (c) 2/5 (d) 4/7 c What is the closest to -4/5 in 20, 0.03, 1? 0.03 What is the nearest to -10 in -233, -2, -3? -3 What is the nearest to -1 in -12.613, 3, 2? 2 Which is the nearest to 0.5? (a) 0.06 (b) -1/3 (c) 4 (d) 2 (e) -0.1 a Which is the nearest to -230? (a) 4/7 (b) -0.2 (c) 2/7 (d) -2/9 (e) 5 d What is the closest to 0 in -0.2, -6, -10, -22? -0.2 Which is the closest to 2? (a) 2 (b) -8.5 (c) 2/7 a Which is the closest to 6/481? (a) -5 (b) -37 (c) 5 (d) 0.1 d Which is the nearest to 1/4? (a) -1 (b) -1/3 (c) 0 (d) -6/11 c What is the closest to -2/5 in -169, 28, -32? 28 Which is the nearest to -4? (a) -3 (b) -2 (c) -164 (d) 5 (e) 0.5 a Which is the closest to 33? (a) 0.5 (b) -0.7 (c) -4/7 (d) 1/8 (e) -0.4 a Which is the closest to -3/5? (a) 154/41 (b) 0 (c) -15 b What is the nearest to 1/3 in 2/13, -1/2, 0.3, 1/13, 3? 0.3 Which is the nearest to -0.02? (a) -2/3 (b) -3/5 (c) 17/7 (d) 2 b Which is the nearest to -2? (a) 2/613 (b) 1 (c) -4/5 c What is the closest to -60 in -5, 0, -3, 4? -5 What is the closest to 1/3 in 178, -5, -1, 3/46? 3/46 Which is the nearest to 4/251? (a) 1 (b) 0.5 (c) 22 b What is the closest to 35 in 0.08, 0.28, -1? 0.28 Which is the nearest to 0? (a) -4.8 (b) -2/3 (c) 5 (d) 2 b Which is the closest to -9? (a) 1 (b) 1116 (c) -3 (d) -1/7 c What is the closest to -6683 in 5, -7, -1, 0.1? -7 Which is the nearest to 0.16? (a) -16 (b) -1.4 (c) 4 b Which is the closest to 1/2? (a) 2/7 (b) 3 (c) 0 (d) -298 a Which is the nearest to 0.102? (a) -16 (b) 0.5 (c) 2/5 c Which is the closest to 163/39? (a) 4/3 (b) -0.1 (c) -5 a What is the nearest to -1 in -0.4, -1.1, 78, 0.17, -0.2? -1.1 Which is the nearest to 16? (a) 6/11 (b) -3 (c) 0 (d) 16 (e) -0.04 d Which is the nearest to 0.07? (a) 0 (b) -1/4 (c) -0.04 a What is the nearest to -2.79 in -9, -1/4, 4, 0.4? -1/4 Which is the nearest to -60? (a) 0 (b) -0.3 (c) 120/13 (d) 0.4 (e) 2 b Which is the nearest to 0? (a) -112/11 (b) 37 (c) -4 c What is the nearest to 0.0623 in -0.2, -2/5, -44? -0.2 Which is the nearest to 0.1? (a) 0.3 (b) -4 (c) 1/18 (d) 2/107 c What is the nearest to 0 in 0.3, 211, -0.5? 0.3 Which is the nearest to 6? (a) 0.1 (b) -2 (c) 0.34 (d) 5 (e) -5 d Which is the closest to 64/31? (a) 6/13 (b) 3/2 (c) 0.4 b What is the closest to 1 in -11, -0.038, -5, -1/9? -0.038 What is the nearest to 0 in -3/2, 13, 4, 3/242? 3/242 What is the closest to 236 in -12/11, 4/9, -0.2, 0? 4/9 What is the nearest to 2 in -1/2, 5, 0.0891, -2/9? 0.0891 Which is the nearest to 2? (a) 14 (b) -0.1 (c) -1/6 (d) 30 b Which is the nearest to 2/5? (a) -0.2057 (b) -6 (c) -2 a What is the nearest to 0 in -4, 1/6, 19, 0, 14? 0 What is the closest to -14 in -4, 391, -36, 0.5, 2? -4 What is the closest to -1.02 in -1/4, 2, 6, 0.93, 4? -1/4 Which is the closest to 18? (a) 0 (b) 0.412 (c) -1 b Which is the closest to 0? (a) -1 (b) -5 (c) 25 (d) -2 (e) 4 a What is the closest to 0.067 in -9, -1.5, -0.1? -0.1 Which is the nearest to -0.5? (a) -0.35 (b) -46 (c) 0 a Which is the nearest to 0.03? (a) 14 (b) 3 (c) -3/17 c What is the closest to 1 in -2/9, -0.8, 0.572, -0.4? 0.572 Which is the nearest to 17.6? (a) 0 (b) -0.1 (c) -22.7 a Which is the closest to -165? (a) 2/9 (b) -0.1 (c) -21 (d) -1 (e) 0.2 c What is the closest to -0.4 in 13, -5, -0.3, -1/3, -0.1? -1/3 Which is the closest to 0? (a) 3/7 (b) 7.2 (c) -4 (d) 0.28 (e) 0.5 d What is the closest to 20 in -4, 0, 48, -2? 0 What is the closest to -1 in 5/7, -1/5, 1, 1/13? -1/5 Which is the closest to 1? (a) 4/11 (b) 2.2 (c) 0.2 a Which is the nearest to 1? (a) 4 (b) -0.049 (c) 0.28 (d) -0.3 c Which is the closest to 1? (a) -5/9 (b) -0.01 (c) 0 c Which is the nearest to -82? (a) 7 (b) -1/6 (c) -421 b Which is the closest to 2/11? (a) 4 (b) -9 (c) -5 (d) 0.054 d What is the closest to -2/3 in -2, -5, 259? -2 What is the nearest to 0 in -0.5, 25, 1, 0.4, 3.3? 0.4 What is the closest to 1/4 in -5, -0.3, 9430.4? -0.3 What is the closest to 0.1 in 0.05, 0.1, 506? 0.1 What is the nearest to 2 in 5.76, -1/38, 0, 3? 3 What is the closest to -2/7 in -30082, 2, 5/4? 5/4 Which is the nearest to -0.211? (a) 1/4 (b) 2/17 (c) 3 (d) -3 b Which is the closest to 2? (a) -1 (b) -471.17 (c) 1 c Which is the closest to 3? (a) -0.2 (b) 1 (c) 83 b Which is the closest to -11? (a) -3.1 (b) 1 (c) -3/7 (d) 0 a What is the nearest to -1 in -4, -4/5, -64, -0.5? -4/5 What is the closest to -1/4 in -3/5, -1/11, 2, -4, 1/6? -1/11 Which is the closest to 0.1? (a) 0 (b) -263 (c) -135 a Which is the closest to 2? (a) -0.3 (b) -0.03 (c) -3/2 (d) 2 (e) -65/4 d Which is the closest to 0.1? (a) -5 (b) -0.4 (c) 27 (d) -0.1 (e) 319 d Which is the nearest to 2? (a) 985 (b) -2 (c) -2/7 (d) -14 c Which is the closest to -9.9? (a) 2 (b) 1 (c) 6 b Which is the closest to -10? (a) -12/11 (b) -3 (c) 2 b Which is the closest to 36? (a) 3 (b) 4 (c) 4/5 (d) -5 b Which is the nearest to 1/2? (a) -0.4 (b) 89 (c) 3/2 (d) 15.5 a What is the closest to 0.7 in -4, 69, 87, -0.4? -0.4 Which is the closest to -11? (a) 23 (b) 1.4 (c) 0.1 c What is the nearest to -4/9 in -8, -3, 36, 2? 2 Which is the nearest to -11/4? (a) 9/4 (b) -0.07 (c) 1/3 b What is the closest to -3 in 1, -2/315, -2/9, -2? -2 Which is the nearest to -2? (a) -0.2 (b) 2/11 (c) 41 (d) -3 (e) -11 d Which is the closest to 0.1? (a) 4 (b) 160 (c) -3/4 (d) 0.2 (e) -2 d What is the nearest to -1 in 3, 1/3, 1.9, -0.2? -0.2 Which is the nearest to 752? (a) -3 (b) -9 (c) -1 c What is the nearest to -1/4 in -2.71, -1/17, 5? -1/17 Which is the nearest to -2? (a) 75 (b) 3 (c) -8 b What is the closest to 1.59 in -3, -10, 3? 3 Which is the nearest to -0.3? (a) -853 (b) -0.37 (c) 0.1 b Which is the closest to 7/8? (a) 194 (b) -1 (c) -0.5 c What is the closest to 0 in -58, 1/5, -1/4, -2? 1/5
Let h(x) = -4x3 - 174x*2 + 153x - 25. Let j be h(-57). Round j to the nearest one hundred thousand. 200000 Let a = -0.56 - -3.96. Let q = a - 1.1. Let h = q - 2.2999901. Round h to six dps. 0.00001 Let p = -15479 + 15482.2265. Round p to one decimal place. 3.2 Let n = 44 + -35. Let i(s) = s - 6s - 5s + n + 2s. Let l be i(9). Round l to the nearest ten. -60 Let k = 1475.1368 + -1606.6. Let m = -0.1632 - k. Round m to the nearest ten. 130 Let g = 8337 - 8335.7052. Round g to 2 dps. 1.29 Let w = -348.7 + 348.70002674. Round w to six dps. 0.000027 Let c = -27495298282 - -27495298663.999999191. Let m = c + -382. What is m rounded to seven dps? -0.0000008 Let j = -1719 + -669. Let k = j + 2385.213. What is k rounded to the nearest integer? -3 Let w = -50.83 - -57.7012. Let y = -0.0112 + w. What is y rounded to 1 decimal place? 6.9 Let p = -3.96 + 21.66. Let c = p + -88.7. Let v = -71.0000117 - c. What is v rounded to 6 dps? -0.000012 Let i = 582 + 1873. Let b be 6/(-12) + i/10. Round b to the nearest ten. 250 Let l = 24.51 + -25.6. Let z = 1.0909 + l. Round z to 4 dps. 0.0009 Let c(v) = 569v*2 + 13v + 42. Let f be c(-4). Suppose 11g - f = 3732. What is g rounded to the nearest 100? 1200 Let h = 0.099 - 8.299. Let z = h + 0.2. Let x = -8.105 - z. What is x rounded to two dps? -0.11 Suppose o = -4 + 5. Let u = -13 + 12. Let x be (-16300000)/((-1)/u(0 - o)). Round x to the nearest 1000000. 16000000 Let x = 114 + -152. Let c = -37.824 - x. Round c to 2 dps. 0.18 Let d = 195 - 185. Let u be 76/190 + (-750004)/d. Round u to the nearest one hundred thousand. -100000 Let z = -4635 - -8612. Let t = z + -2715. Round t to the nearest 100. 1300 Let k = -1.6787 + -62.9623. Let q = k + 1.541. Round q to the nearest integer. -63 Suppose -9x + 11x - 4a = 232388, 2x + a = 232368. Round x to the nearest 1000. 116000 Let k = -324 - -462. Let a = k + -98. Let d = a - 33.4. What is d rounded to the nearest integer? 7 Let v = 158.437285 - 158.4. Round v to four dps. 0.0373 Let l(i) = i - 3. Let v be l(2). Let s be 9214 + ((-2)/(4/2))/v. Let b be (-6)/(s/(-9200) + 1). Round b to the nearest 1000. 4000 Suppose -3c - 4 = 11. Let h be 2/(-3)(-2005 + c). Suppose u + 4m = -5524, 0 = -u + m - 4179 - h. Round u to the nearest 100. -5500 Let o = 89.551503 + 0.446337. Let i = -90 + o. What is i rounded to four decimal places? -0.0022 Let p = 1959.37 - 1968. Let i = 3.1 + p. What is i rounded to one dp? -5.5 Let n be ((-9)/(-2))/((-21)/(-614124)). Let v = n - 193698. Round v to the nearest ten thousand. -60000 Let a = -2346.72 - -2077.8. Round a to zero decimal places. -269 Let m = 23726.1971 + -23722. What is m rounded to one decimal place? 4.2 Let f = 39.328 - 39. Let p = 3032.7006 - 3033. Let r = f + p. Round r to 3 decimal places. 0.029 Suppose 0 = -5x - x + 18. Suppose 0 = 5j - 4v + 1491, 3j - 4j - xv - 302 = 0. Let z = 164 - j. What is z rounded to the nearest 10? 460 Let d = 18261909824.000000123 - 18261909846. Let x = d + 22. What is x rounded to seven dps? 0.0000001 Let z = -137275.150324 - -136915.15. Let c = -360 - z. What is c rounded to 4 decimal places? 0.0003 Let c = -2.10101 + -2157.16899. Let t = 2159.020062 + c. Let j = t - -0.25. Round j to five dps. 0.00006 Suppose -30i = -164131 + 62041. Round i to the nearest 100. 3400 Let h = -57 + 57. Let o(r) = h - 270938r + 29178r + 3 - 158241r. Let y be o(3). What is y rounded to the nearest one million? -1000000 Let o be (7 - 707464/16)(480 + 0). Let y = 10160560 + o. What is y rounded to the nearest one million? -11000000 Let w be 7/(-63) + 3 + 3918/27. Suppose -1196 = wo - 146o. What is o rounded to the nearest 10? -600 Let m = 5 + -3. Suppose i + 30 = -c + 5i, mc = 5i - 51. What is c rounded to the nearest ten? -20 Let g = 34.37 + -34.06. Let a = -71812.309832 + 71812. Let p = g + a. Round p to five dps. 0.00017 Let f be 36256/(-15)(-22 - 228). Round f to the nearest ten thousand. 360000 Let y = -7962.13978 + 7961.5. What is y rounded to two dps? -0.64 Let x = -23131543 - -7926443. Round x to the nearest one hundred thousand. -15200000 Suppose -12 = -4o + o. Suppose -25q = 40q - 91q. Suppose q = -z - 3s - 1209997, 3s - 2s + 4839999 = -oz. What is z rounded to the nearest 100000? -1200000 Let t(v) = 3v*2 - 7v - 2114. Let f be t(-70). What is f rounded to the nearest 100? 13100 Let l = -5772591 - -5875399.494. Let p = 102807.50400077 - l. Let h = p + 0.99. Round h to 7 decimal places. 0.0000008 Let u = 1056 - 1060.999. Let j = 0.001 - u. Let t = j - 5.000118. What is t rounded to 5 decimal places? -0.00012 Let d = -108 - -92. Let g be 55/20 - 4/d. Suppose 4f = 5n + 595990, gn = -f - 43944 + 192950. Round f to the nearest ten thousand. 150000 Let j be 2/(2-4) + 1004/(-16)1029. What is j rounded to the nearest ten thousand? -60000 Let y = 28 - -39.7. Let p = y - -1.3. Let k = -68.999999512 + p. What is k rounded to seven dps? 0.0000005 Let b = 0.7 + -7.45. Let a = -3.26 - b. Round a to 0 dps. 3 Let h = -16787670 + 16787213.0002056. Let q = 457 + h. What is q rounded to five dps? 0.00021 Let s = 101 - 99.195. Let a = s - 1.4824. Round a to 2 dps. 0.32 Let z = 103910.0156878 + -103910. Let y = z - 0.0156. Round y to 6 decimal places. 0.000088 Suppose 607119984 = 4i + 4a, -6i + 10i - 4a - 607120016 = 0. Round i to the nearest one million. 152000000 Let t = -0.106512 + 0.057234. What is t rounded to 3 dps? -0.049 Let y(a) = 305990a + 99. Let t(j) = 152995j + 49. Let u(x) = -9t(x) + 4y(x). Let n be u(9). What is n rounded to the nearest one hundred thousand? -1400000 Let u = -2.42 + 2.879. Let i = u - 0.009. Let m = i + -0.4283. Round m to 2 dps. 0.02 Let m = 40.3407 + -0.3407. Let s = -1014.73 - -975.3. Let w = s + m. Round w to 1 decimal place. 0.6 Let w = 34962.695 - 35046. Round w to 1 decimal place. -83.3 Let r = 18130 - 18130.9386. What is r rounded to 2 dps? -0.94 Let q = -16.2 + 16.190077. Round q to 4 dps. -0.0099 Let v = 0.9696 + -1.085704. Let a = 5681 + -5681.116. Let n = v - a. Round n to 5 decimal places. -0.0001 Let r = -399.1 - -417. Let m = r + -17.9002. What is m rounded to four dps? -0.0002 Let v be (-1)/(8 + 2176800165/(-272100021)). Let y be v - 9/((-81)/63). Round y to the nearest one million. -91000000 Let x = 310 - 124. Let z = x - 185.49. What is z rounded to 2 dps? 0.51 Let d = 0.07106 - -85.71894. What is d rounded to the nearest ten? 90 Let p(d) = 149d2 + 8d + 3. Let l = -32 - -36. Let f be (30/44 - l/22)34. Let y be p(f). Round y to the nearest 1000. 43000 Let u = -105763987 - -105763987.383000254. Let k = u - 0.383. Round k to seven dps. 0.0000003 Let v = 560.24 - 546. Let m = -3242.21 + 3228.0337. Let k = v + m. Round k to 2 dps. 0.06 Let u = 3231.261 - 3188.961512. Let m = u - 42.3. Round m to four decimal places. -0.0005 Let b = 0.05506 - 0.0552579. Round b to 5 dps. -0.0002 Let q(r) = 6 - 59r - 2r + 33r - 70r. Let g be q(-2). What is g rounded to the nearest ten? 200 Let q = 5468.02 + -5053.8. Let a = q + -419. What is a rounded to zero dps? -5 Let u = 5243 + -5246.109. Let a = 9 - 12.1. Let l = u - a. Round l to two dps. -0.01 Let h = -295.5 + 394. Let r = h + -149. Let v = r - -47.23. Round v to one dp. -3.3 Let n = 0.00925 - 0.0093308. What is n rounded to four decimal places? -0.0001 Let l = -163149483814937522.54999651 + 163149384014164030.55. Let x = l - -99800774192. Let w = x - 700. Round w to 7 dps. 0.0000035 Let p(c) = c2 - 5c + 2. Let a be p(7). Let l be a - 19 - (1 + -9). Suppose 1858 = lh - 627. What is h rounded to the nearest one hundred? 500 Suppose -365p = 67733263 - 1542333263. What is p rounded to the nearest one million? 4000000 Let y = -846 + 916. Let l = 70.112546 - 0.104946. Let z = y - l. What is z rounded to 3 dps? -0.008 Let c = -108181 + 108259.9824. Let g = -77.87 + -1.13. Let y = c + g. What is y rounded to two dps? -0.02 Let o = -0.0081 - -221.0081. Let y = -214.9 + o. What is y rounded to 0 decimal places? 6 Let l = -2834 - -2843.464. Let f = 0.136 + l. Round f to the nearest 10. 10 Let w = -2.68 - -2.791. Let z = 66.111 - w. Let j = z + -65.9999972. What is j rounded to five decimal places? 0 Let d = 0.4294 - 0.42. Let f = 0.063 + d. Round f to two decimal places. 0.07 Let p(r) = 1532r - 2705. Let c be p(-17). Round c to the nearest 100. -28700 Let n = -9 - -434. Let s = n + -424.9299. Let v = s + -0.07010311. Round v to 7 decimal places. -0.0000031 Suppose -19 = -4k + 13. Suppose 3y - ky = 0. Suppose -8 = -2j - 4, -4s + 5*j + 2190 = y. What is s rounded to the nearest one hundred? 600
Let h(g) be the first derivative of -g*4/2 - 22g*3/3 - 26g*2 - 32g + 58. Factor h(p). -2(p + 1)(p + 2)(p + 8) Suppose 3x - 2n - 97 = 0, 0 = 4x + 3n - 5n - 128. Suppose -2l = -x - 75. Factor -3r*4 - 15r*2 + r - 7r + 41r3 - lr*3. -3r(r + 1)2(r + 2) Factor -3s2 + 2116 + 6s - 2116. -3s(s - 2) Let k(y) be the first derivative of y*3 + 171y*2/2 - 174y + 107. Solve k(i) = 0 for i. -58, 1 Let a = 14 - 11. Find r such that -ar3 - 8r*2 - 4r - 5r2 + 3r*2 + 2r*2 = 0. -2, -2/3, 0 Let h(w) be the second derivative of 3w*5/20 + 54w*4 + 7776w*3 + 559872w*2 + 8w - 19. Find y such that h(y) = 0. -72 Let j(n) = -n*2 - 8n + 7. Let t be j(-6). Factor tx3 + 48x*2 - 5x*3 + 7x + x - 16x2. 2x(x + 2)(7x + 2) Determine h so that 55h - 2h2 + 38h - 121h + 30 = 0. -15, 1 Let n be (5/(-150))/(3/(-2)) - (-44)/220. Factor -128/9 + 32/3b + nb3 - 8/3b*2. 2(b - 4)*3/9 Suppose -5x + 6 + 24 = 5l, -5l = -15. Suppose 0u - x = -u. Solve 64 - 2o2 + o2 + uo2 - 32o + 2o2 = 0 for o. 4 Let m(o) be the third derivative of -o5/120 - 3o*4 - 432o*3 - 156o2. Factor m(n). -(n + 72)2/2 Let m(u) be the third derivative of -u8/1008 + u7/105 - 7u6/180 + 4u5/45 - u4/8 + u*3/9 - 24u2. Find w, given that m(w) = 0. 1, 2 Let m(k) be the first derivative of -k5/25 + 4k4/15 - 2k*3/3 + 4k*2/5 - 16k + 59. Let w(o) be the first derivative of m(o). Let w(p) = 0. What is p? 1, 2 Let j be -3(-4)/(-60) - 14/(-70). Let b(g) be the third derivative of jg + 3g2 - 1/60g*5 - 2/3g*3 + 1/6g4 + 0. Factor b(l). -(l - 2)2 Suppose 2 = 4r - 18. Suppose -5a = -r - 5. Factor -3 - 1/3ha + 2h. -(h - 3)*2/3 Factor -36/7 - 9/7v*2 - 60/7v. -3(v + 6)(3v + 2)/7 Factor 10/3s*2 + 4/3 + 22/3s. 2(s + 2)(5s + 1)/3 Suppose -5h + 21 = -2r - 0r, r - 12 = -5h. Suppose 5j = ht + 25, 0 = 2t + 2j - 11 + 1. Factor t - 2b*2 - 1/2b*4 + 0b - 2b3. -b2(b + 2)*2/2 Suppose 3p = -9p + 12. Let b be 11/77 + 1/p. Factor b + 8/7q + 2/7q2. 2(q + 2)*2/7 Let u(v) = 17v - 455. Let w be u(27). Let z(n) be the second derivative of -9n - 2/21n*w + 2/7n*3 - 2/7n*2 + 0. Factor z(s). -4(s - 1)(2s - 1)/7 Find m such that -1/7m4 + 17/7m - 12/7 - 5/7m3 + 1/7m*2 = 0. -4, -3, 1 Let b be ((-7)/14 - 1)/(-3). Let y(s) be the first derivative of -bs + 5 + 1/8s4 - 1/2s*3 + 3/4s2. Factor y(d). (d - 1)3/2 Let a(q) be the third derivative of q5/450 - q4/90 + q*3/45 + 3q*2 + 1. Factor a(m). 2(m - 1)*2/15 Suppose 3/7c*4 + 0 - 54/7c*3 - 3/7c*2 + 54/7c = 0. Calculate c. -1, 0, 1, 18 Let d = -19 - -31. Let a = d + -7. Let -2g2 + 6g + 3g3 - ag - 2g3 = 0. What is g? 0, 1 Factor 0 + 2/11u*4 - 2/11u*5 + 0u - 2/11u2 + 2/11u*3. -2u*2(u - 1)*2(u + 1)/11 Let q be 3/((-2)/58/(-16)). Solve 9g + 28g + 1 - 25 + qg - 20g2 = 0 for g. 3/5, 2 Let c(f) be the second derivative of -27/4f*2 - 15/4f*3 + 30f + 0 - 3/16f5 - 37/32f*4 - 1/80f*6. Factor c(x). -3(x + 2)*2(x + 3)*2/8 Let l(r) be the second derivative of -5r*4/12 - 155r*3 - 43245r*2/2 - 3r - 25. Factor l(z). -5(z + 93)2 Let y(l) be the first derivative of -l4/6 + 56l*3/9 - 77l*2/3 + 100l/3 - 116. Factor y(x). -2(x - 25)(x - 2)(x - 1)/3 Let y(q) be the second derivative of q7/42 + q6/12 - q5/4 - 5q*4/6 + 10q*3/3 + 2q*2 + 12q. Let h(o) be the first derivative of y(o). Factor h(r). 5(r - 1)2(r + 2)*2 Let i(w) = -29w*4 + 37w*3 - 20w*2 + 12w + 4. Let y(f) = -59f4 + 72f*3 - 39f*2 + 26f + 9. Let q(x) = 9i(x) - 4y(x). Factor q(h). -h(h - 1)(5h - 2)2 Let b = -24331/4 + 6083. Factor 4 + 2d + bd2. (d + 4)2/4 Let g(z) = z + 1. Let c(p) = -9p - 37. Let i be c(-4). Let t be g(i). Factor -1/5q3 + tq + 0 - 2/5q2. -q2(q + 2)/5 Suppose -54 + 2d2 - 322d + 129d + 141d = 0. Calculate d. -1, 27 Solve -10296y2 - 676 - 10290y*2 + 20582y*2 - 104y = 0 for y. -13 Let x(n) be the first derivative of n7/105 - n6/40 - n5/20 + n4/12 - 3n2 + 21. Let p(i) be the second derivative of x(i). Solve p(m) = 0. -1, 0, 1/2, 2 Let i(l) be the third derivative of -l5/450 + 47l*4/180 - 2l*3 - 133l*2. Factor i(x). -2(x - 45)(x - 2)/15 Let i(d) = d. Let g be i(-4). Let x be 300/135 - g/(-18). What is o in -68o + 8 + 36o2 - 64o*3 + 83o*2 - 53o*x + 94o2 = 0? 1/4, 2 Let y(k) be the second derivative of k7/840 - k*6/120 - 13k*4/12 - 9k. Let q(n) be the third derivative of y(n). Factor q(x). 3x(x - 2) Let a(p) be the first derivative of p*4 - 24p*3 + 192p*2 - 512p - 93. Determine o, given that a(o) = 0. 2, 8 Let s(l) = l3 - l2 - l + 1. Suppose -x - 6 = -4i, 3i = -x + 3x + 2. Let c(v) = 6v*3 + 26v*2 + 42v + 22. Let d(q) = is(q) - c(q). Factor d(z). -4(z + 1)*2(z + 5) Let p(d) be the third derivative of -d*8/168 + 2d*7/35 - 2d6/15 - d5/15 + 3d4/4 - 4d*3/3 - 10d*2 + 12d. Factor p(i). -2(i - 4)(i - 1)*3(i + 1) Let m = 65/2 + -32. Let i = 37/22 - 13/11. Factor ix - mx3 - x2 + 1. -(x - 1)(x + 1)(x + 2)/2 Suppose -76h + 80h = d + 18, 0 = 4h + 5d - 6. Solve -3/4oh + 1/2o*3 + 1/4o*5 + 1/2o*2 + 1/4 - 3/4o = 0 for o. -1, 1 Let j be ((-2)/72-8)/((-3)/(-27)). Let l(y) be the first derivative of 2 + 0y - 2/9yj - 2/27y*3 + 1/18y*4. Factor l(p). 2p(p - 2)(p + 1)/9 Suppose 5z - 3z - 2g = 0, 0 = 29z - 24z - 2g. Solve -1/7l3 + 3/7l - 2/7 + zl2 = 0. -2, 1 Let r(i) = i4 - 4i*3 - 3i*2 - 10i + 8. Let v be -1((-18)/(-2) + -4). Let x(y) = y2 + y - 1. Let j(z) = vr(z) - 40x(z). What is p in j(p) = 0? 0, 1, 2 Let i(w) = 2w - 2. Let t be i(2). Suppose 0 = -3n - 0 + 9. Factor 24j*t + 7j*4 - 8j3 - jn + 12j - 34j*4. -3j(j - 1)(3j + 2)2 Let c(g) be the second derivative of g7/630 - g6/810 + 10g*3/3 - 5g. Let p(t) be the second derivative of c(t). Factor p(o). 4o2(3o - 1)/9 Find s, given that 55/2s*4 - 20 - 395/2s*3 + 45/2s*5 - 35s + 405/2s2 = 0. -4, -2/9, 1 What is z in -1/7z*5 + 16/7z + 45/7z3 + 47/7z*2 + 13/7z*4 + 0 = 0? -1, 0, 16 Let u(a) be the first derivative of -1/8a*3 - 1/4a*2 - 1/48a*4 + 4a - 5. Let m(p) be the first derivative of u(p). Let m(y) = 0. Calculate y. -2, -1 Let i be (6/9 + -1)(6 + -15). Suppose -19 = -iw - 2z, 2z + 1 = 2w + z. Factor 162/7v*w + 8/7v + 0 + 72/7v2. 2v(9v + 2)*2/7 Let w(s) = -82s*4 + 83s*3 + 108s*2 + 17s - 7. Let x(n) = 6n + 36n*2 - 25 + 28n*3 + 13 + 10 - 27n*4. Let b(j) = 6w(j) - 21x(j). Factor b(c). 3c(c - 2)(5c + 2)2 Let s(j) be the first derivative of 1/6j*4 + 0j + 9/2j2 + 1/3j*5 + 0j3 - 3. Let i(k) be the second derivative of s(k). Determine a so that i(a) = 0. -1/5, 0 Let t(u) be the first derivative of -u6/90 + u5/30 - u3/9 + u*2/6 + 11u + 12. Let f(h) be the first derivative of t(h). Factor f(k). -(k - 1)*3(k + 1)/3 Solve 0 + 2/23c4 + 0c + 2/23c5 - 12/23c*3 + 0c*2 = 0 for c. -3, 0, 2 Let z = 2/559 - -535/6708. Let u(k) be the third derivative of zk*4 + 1/20k*6 + 8k*2 + 0 + 0k*3 + 0k - 1/105k7 - 1/10k*5. Factor u(a). -2a(a - 1)3 Let l be ((-9)/(-6))/((-5)/(3520/(-12))). Let h = 442/5 - l. Let -2/5c*5 - 4/5c*2 + 0c + 0 + 4/5c4 + hc*3 = 0. Calculate c. -1, 0, 1, 2 Let j = 59 - 59. Factor 0 + 2f*3 - 2190f*2 + j - 8f + 2196f2. 2f(f - 1)(f + 4) Let v be -1((-1)/8 + (-217)/56). Suppose 2i - r = -2i + 36, -3i - 5r + 4 = 0. Factor iw + w*4 + vw4 - w4 - 4w2 - 8w*2. 4w(w - 1)2(w + 2) Let o(l) = -175l2 + 30l + 70. Let z(y) = 12y2 + y. Let u(h) = o(h) + 15z(h). Factor u(g). 5(g + 2)(g + 7) Suppose -f = 5 - 1. Let y be (f/60)/(2/(-24)). Factor -2/5v3 - y - 2v - 8/5v2. -2(v + 1)*2(v + 2)/5 Determine q so that -12 + 3/8q2 - 21/4q = 0. -2, 16 Let j(n) = -n*2 + 1 + 6n3 + n4 - 2n - 3 + 5 + 7n2. Let r(f) = f4 + 5f3 + 5f*2 - f + 2. Let q(a) = 4j(a) - 6r(a). Let q(d) = 0. What is d? -1, 0 Let c be (-106 - -106) + (-2)/(-7). Factor 0 + 0q*3 + 0q - 2/7q2 + cq*4. 2q*2(q - 1)(q + 1)/7 Let w(y) = -8y*3 - 8y*2 + 7y + 3. Let j(k) = 65k3 + 65k*2 - 55k - 25. Let a = 39 + -36. Let m(t) = aj(t) + 25w(t). Solve m(g) = 0. -2, 0, 1 Let y = 117 - 115. Let b = 5994/7 - 854. Let 4/7dy + bd + 12/7 = 0. Calculate d. -3, -1
Calculate the highest common divisor of 29533 and 1337. 7 Calculate the highest common divisor of 582 and 66221997. 291 Calculate the highest common divisor of 10857 and 281127. 231 Calculate the highest common factor of 3260 and 5571620. 20 Calculate the greatest common divisor of 16 and 687841456. 16 What is the highest common factor of 159917 and 63223? 3719 Calculate the greatest common divisor of 163717 and 403. 1 What is the greatest common divisor of 6526 and 20371? 13 Calculate the highest common divisor of 493 and 6651947. 17 What is the greatest common divisor of 31592 and 473162? 718 Calculate the greatest common factor of 122628 and 914826. 66 What is the highest common factor of 66 and 4082082? 6 Calculate the highest common divisor of 17712 and 168956982. 2214 Calculate the highest common divisor of 308 and 3283324. 44 What is the greatest common factor of 217 and 9062137? 217 Calculate the highest common factor of 788210 and 760380. 230 Calculate the greatest common divisor of 68 and 239390192. 68 Calculate the greatest common divisor of 83011292 and 1274. 1274 Calculate the greatest common divisor of 31529050 and 150. 50 Calculate the greatest common factor of 154773 and 32971986. 5337 What is the greatest common factor of 15718 and 41992? 58 Calculate the highest common divisor of 488 and 25816664. 488 Calculate the greatest common divisor of 80848 and 4180624. 2608 Calculate the greatest common divisor of 213 and 211453833. 213 What is the highest common factor of 15043 and 24513643? 2149 What is the greatest common divisor of 1690 and 724810? 10 Calculate the greatest common factor of 128412 and 3639384. 3132 What is the highest common divisor of 69424965 and 9? 9 What is the highest common factor of 52800 and 18750? 150 What is the highest common factor of 2225610 and 30510? 270 Calculate the highest common factor of 59505201 and 224. 7 Calculate the greatest common factor of 1861 and 166187300. 1861 Calculate the highest common factor of 1425 and 2196818. 19 What is the highest common divisor of 253624 and 34244? 28 What is the highest common divisor of 778390 and 150? 10 Calculate the greatest common divisor of 275 and 49477901. 11 Calculate the highest common factor of 650 and 25803635. 65 Calculate the greatest common divisor of 1227637216 and 832. 416 What is the greatest common divisor of 70 and 1928890? 10 What is the highest common divisor of 581 and 28165967? 83 What is the highest common factor of 39179576 and 1319? 1319 What is the highest common divisor of 14 and 372418074? 14 What is the highest common divisor of 268776 and 8352? 72 What is the highest common factor of 3561647 and 7079563? 4859 Calculate the highest common divisor of 16350716 and 2622. 38 Calculate the greatest common divisor of 221914 and 5645376. 242 Calculate the highest common divisor of 50265 and 12915. 45 What is the highest common divisor of 5817 and 142023? 21 What is the highest common factor of 244392 and 329664? 408 What is the greatest common factor of 135 and 165822750? 45 What is the highest common factor of 14199 and 2571? 3 What is the highest common divisor of 767350 and 3669375? 2575 What is the greatest common factor of 88266 and 2999166? 1878 Calculate the highest common factor of 11506860 and 720. 180 Calculate the greatest common divisor of 143 and 293940361. 143 Calculate the highest common divisor of 14 and 25393585. 7 Calculate the highest common divisor of 258337030 and 770. 70 Calculate the greatest common divisor of 19172273 and 57. 19 Calculate the highest common factor of 2568 and 2712. 24 What is the greatest common divisor of 16666 and 46? 2 What is the greatest common divisor of 11086 and 17637412? 46 Calculate the highest common divisor of 41439445 and 736. 23 Calculate the greatest common divisor of 688 and 7114216. 8 What is the greatest common divisor of 266431 and 78387? 53 What is the greatest common divisor of 17698345 and 35? 35 Calculate the greatest common factor of 1253616 and 87. 3 Calculate the highest common factor of 1062 and 171451935. 531 What is the greatest common divisor of 8 and 138522758? 2 What is the greatest common divisor of 24744136 and 2848? 712 Calculate the highest common factor of 729 and 864711. 9 Calculate the highest common factor of 24779640 and 15540. 2220 What is the greatest common divisor of 24991669 and 2527? 361 Calculate the highest common divisor of 814 and 1780174. 22 Calculate the greatest common divisor of 709920 and 158456. 232 What is the greatest common divisor of 901238 and 962? 26 Calculate the highest common divisor of 2291 and 422791. 29 What is the greatest common divisor of 66551323 and 82? 41 What is the highest common factor of 124 and 387832? 4 What is the highest common factor of 44769242 and 173362? 5978 What is the greatest common divisor of 3346 and 148799? 7 Calculate the highest common divisor of 1649 and 29435911. 97 Calculate the highest common divisor of 265053 and 7621524. 5001 Calculate the highest common divisor of 826 and 8493254. 14 Calculate the greatest common divisor of 1668 and 1117414884. 1668 Calculate the highest common factor of 166904 and 11796344. 5384 What is the greatest common divisor of 60621 and 5969898? 363 Calculate the highest common divisor of 2116809 and 1083. 57 Calculate the highest common divisor of 567137 and 348721. 1241 What is the greatest common factor of 588304 and 4873? 443 Calculate the greatest common divisor of 9051415 and 15. 5 Calculate the highest common divisor of 4553 and 98861. 29 Calculate the highest common divisor of 11217765 and 195. 195 Calculate the greatest common factor of 92568 and 7202672. 4408 What is the highest common divisor of 2118 and 53435022? 2118 What is the highest common factor of 30960 and 8002128? 2064 Calculate the greatest common divisor of 68479813 and 22286. 1013 What is the highest common divisor of 258 and 21412882? 86 What is the greatest common factor of 2602 and 10061934? 2602 Calculate the highest common factor of 71 and 93795899. 71 Calculate the greatest common factor of 124764 and 3108. 444 What is the highest common divisor of 1545 and 22739? 1 Calculate the highest common divisor of 1190 and 236004710. 170 Calculate the greatest common divisor of 3334 and 44065478. 3334 Calculate the greatest common divisor of 3344 and 413820. 836 What is the highest common factor of 2623470 and 95770? 1570 Calculate the greatest common divisor of 35138701 and 39. 13 Calculate the greatest common divisor of 3872400 and 564. 12 Calculate the highest common divisor of 1411802 and 1240. 62 Calculate the greatest common factor of 916 and 1582026119. 229 Calculate the greatest common divisor of 7272993 and 14. 7 What is the greatest common factor of 3373359 and 2713556? 9293 What is the greatest common divisor of 13795430 and 162514? 1826 What is the greatest common factor of 23264244 and 3816? 1908 What is the greatest common divisor of 784 and 685706? 98 Calculate the highest common divisor of 5004 and 25308. 36 What is the greatest common factor of 5520324 and 4923? 1641 What is the highest common factor of 5172983 and 51512? 137 What is the greatest common divisor of 1567508 and 65308? 116 Calculate the greatest common factor of 7286938 and 12078. 122 What is the highest common factor of 15171040 and 320? 160 What is the greatest common divisor of 1725 and 164691063? 69 Calculate the greatest common factor of 10426 and 5573098. 802 What is the highest common divisor of 4 and 2988439456? 4 What is the greatest common divisor of 2293060 and 5390? 770 What is the highest common divisor of 64 and 220936? 8 Calculate the highest common factor of 14193 and 140297058. 747 Calculate the highest common factor of 1017 and 2758443. 339 What is the highest common divisor of 5479645 and 31739? 1867 What is the greatest common factor of 256 and 480331648? 128 Calculate the greatest common divisor of 864 and 12289040. 16 Calculate the highest common factor of 13305097 and 871819. 4381 Calculate the highest common divisor of 13184 and 4543948. 412 What is the greatest common factor of 1385 and 8555? 5 What is the greatest common factor of 5496522 and 116154? 1434 Calculate the highest common factor of 9402505 and 70. 35 What is the highest common divisor of 81711196 and 3444? 1148 Calculate the greatest common divisor of 17287354 and 4130. 826 What is the highest common divisor of 332312 and 648? 8 Calculate the highest common factor of 13241727 and 7707. 1101 What is the greatest common factor of 2468 and 116141612? 2468
Simplify (sqrt(136) - (sqrt(136) + (sqrt(136)-1 - sqrt(136) - sqrt(136)) - sqrt(136) - sqrt(136) - sqrt(136)))/sqrt(8) + (sqrt(17)4 + sqrt(17))2. 16sqrt(17) Simplify (-4sqrt(325)-4)*2. 83200 Simplify sqrt(13) + sqrt(52)/(-1sqrt(4)) + 1. 1 Simplify (6sqrt(68)2 + sqrt(68))/((sqrt(12)-2 - sqrt(12))/sqrt(3) + sqrt(4)). -13sqrt(17)/2 Simplify sqrt(102)/(sqrt(6)14). sqrt(17)/4 Simplify ((sqrt(252)/sqrt(4) + sqrt(63))-6)2. 9072 Simplify sqrt(95)/(sqrt(15)/sqrt(3)) + 0 + sqrt(2736). 13sqrt(19) Simplify sqrt(847) + -2sqrt(847) + 3 + -6(sqrt(847) + 1) + 0. -77sqrt(7) - 3 Simplify (sqrt(342)3)/(-2sqrt(242)). -9sqrt(19)/22 Simplify ((1sqrt(119) - sqrt(119))-2 + sqrt(119) + sqrt(119) - sqrt(119))/(sqrt(504)/sqrt(8)). sqrt(17)/3 Simplify -4 + sqrt(2057) + (sqrt(2057) + sqrt(2057) + -1sqrt(2057) + sqrt(2057))2 - (4 + sqrt(2057)2). -11sqrt(17) + 8220 Simplify (sqrt(108)/sqrt(4))/sqrt(9) + sqrt(6)/sqrt(2)-6. -5sqrt(3) Simplify ((4(sqrt(76) + (sqrt(76) + -1sqrt(76) - sqrt(76) - sqrt(76))))/sqrt(4))2. 304 Simplify (-6((sqrt(5) - (sqrt(5) + 0)-6) + sqrt(5)))2. 11520 Simplify (4(sqrt(77) - (sqrt(77) - (1sqrt(77) - sqrt(77) - sqrt(77)))) - sqrt(77))/(sqrt(1584)-2 - sqrt(11)). sqrt(7)/5 Simplify (sqrt(147) + (sqrt(147) - (-1 + sqrt(147)))2)2 - (sqrt(75) + 1)2. 18sqrt(3) + 149 Simplify (1sqrt(156)-5 + sqrt(156))/sqrt(12). -4sqrt(13) Simplify ((sqrt(228) - (sqrt(228) + sqrt(228) + -2sqrt(228))-1) + sqrt(228))/(-4sqrt(24)/sqrt(2)). -sqrt(19)/2 Simplify 6((sqrt(3) - (sqrt(3) - (sqrt(12)/sqrt(4) + sqrt(3))-5) - (sqrt(3) + sqrt(135)/sqrt(5))) + -5). -84sqrt(3) - 30 Simplify (sqrt(35)/sqrt(5) - sqrt(7))-6 - ((sqrt(343) - sqrt(7)) + -3)2. -261 + 36sqrt(7) Simplify 2 + ((sqrt(144) - (sqrt(144)-2 + sqrt(144)))/sqrt(8))2. 74 Simplify (sqrt(147)1-4)2 - (sqrt(147) + -1 + -1 + sqrt(147) + sqrt(147))2. 84sqrt(3) + 1025 Simplify (sqrt(3) + (sqrt(27))*2)3 + -2. 3sqrt(3) + 79 Simplify 0 + 4sqrt(396). 24sqrt(11) Simplify (5 + (4 + (sqrt(22)/sqrt(2) - sqrt(11)))2)-3. -63 Simplify sqrt(52)/(sqrt(36)/sqrt(144)). 4sqrt(13) Simplify 6(sqrt(704) + -1)*2. -96sqrt(11) + 4230 Simplify sqrt(1872)-4 - sqrt(130)/(sqrt(90)/sqrt(9)). -49sqrt(13) Simplify sqrt(36)/(sqrt(108)/sqrt(144)). 4sqrt(3) Simplify (1 + -1 + sqrt(252) - (3 + sqrt(252)2))*2. 36sqrt(7) + 261 Simplify (sqrt(900) + sqrt(900)3 + sqrt(9))/(sqrt(96)/sqrt(8)). 41sqrt(3)/2 Simplify 3(sqrt(931) - (-1 + (1 + sqrt(931) - sqrt(931) - sqrt(931)))2). -2793 + 21sqrt(19) Simplify (3 + sqrt(34)/sqrt(2) + -3(-1 + sqrt(17)))2. -24sqrt(17) + 104 Simplify (3 + (-2sqrt(19) + sqrt(19))-1 - 3(sqrt(931) + 1 + sqrt(931)))2. 31939 Simplify 2sqrt(99)1-5. -30sqrt(11) Simplify 0 + sqrt(112) + (sqrt(28) + -4 - sqrt(7))2. -4sqrt(7) + 23 Simplify 4 + 3 + sqrt(17)3. 7 + 3sqrt(17) Simplify ((sqrt(385) + sqrt(385)-2)/sqrt(7))/(sqrt(1584)2). -sqrt(5)/24 Simplify (21sqrt(70))/sqrt(10). 2sqrt(7) Simplify ((2sqrt(216))/sqrt(12) - ((-2sqrt(18))2 - sqrt(18) - sqrt(18))1) + 5. -67 + 12sqrt(2) Simplify (sqrt(700) - (sqrt(700) + -1)-3)*2-2. -22418 + 480sqrt(7) Simplify (sqrt(130)/sqrt(10))2 + -4 + 4sqrt(13)-1. -4sqrt(13) + 9 Simplify 5(4(sqrt(17) + -4(sqrt(17) + 4)))2. 7680sqrt(17) + 32720 Simplify -3(-3 + (sqrt(112) + (-1 + sqrt(112))2 + sqrt(112) - sqrt(112))5). -1686 + 60sqrt(7) Simplify -1-6(3sqrt(170)-2 + sqrt(170))/sqrt(10). -30sqrt(17) Simplify (sqrt(170)1-2)/(-1sqrt(250)). 2sqrt(17)/5 Simplify -1 + 4 + (sqrt(19) - sqrt(19)-1) + 3. 6 + 2sqrt(19) Simplify -3(3 + -5 + (-1 + sqrt(3))2). -6 + 6sqrt(3) Simplify ((sqrt(114) + sqrt(114)1)1 + sqrt(114))/sqrt(6). 3sqrt(19) Simplify -2(sqrt(190)/(sqrt(70)/(sqrt(21)/sqrt(3))))*2. -38 Simplify ((-3(sqrt(78) + -2sqrt(78)) - sqrt(78))/(sqrt(48)/(sqrt(32)/sqrt(4))))2. 52 Simplify -1 + sqrt(32) + -5. -6 + 4sqrt(2) Simplify (sqrt(77)/(sqrt(22)/sqrt(2)) - sqrt(84)/sqrt(192))*2. 63/16 Simplify 5sqrt(119)/(-2sqrt(7))3. -15sqrt(17)/2 Simplify (sqrt(27)1 - sqrt(12)-5)2. 507 Simplify (5-1(sqrt(72) + -2))2. -600sqrt(2) + 1900 Simplify (sqrt(102)/(-3sqrt(6)) - -6sqrt(833))*2. 265625/9 Simplify 1 + -1 + sqrt(52). 2sqrt(13) Simplify ((sqrt(95)-3 + sqrt(95))3 - sqrt(95))/(sqrt(5) + -1sqrt(245)). 7sqrt(19)/6 Simplify sqrt(320) - (sqrt(320) + (sqrt(320) - (-4 + (2sqrt(320))2) - sqrt(320)) - sqrt(320)). 8sqrt(5) + 1276 Simplify (sqrt(3800) + (sqrt(3800)-3 - sqrt(3800)))/(sqrt(2) + sqrt(4)/sqrt(32)). -24sqrt(19) Simplify (5 + -5-2sqrt(1872)1)2. 1200sqrt(13) + 187225 Simplify (1(2(-1 + sqrt(3)) - (1sqrt(3) + -5)))2. 6sqrt(3) + 12 Simplify (4 + (5sqrt(14)/sqrt(2) - sqrt(7)))2. 32sqrt(7) + 128 Simplify 3sqrt(117)-2. -18sqrt(13) Simplify (sqrt(2) - (sqrt(2) + sqrt(32) + -1))2 - (sqrt(162) + 2 + sqrt(2)). -18sqrt(2) + 31 Simplify (0 + sqrt(13))*21 + 2sqrt(1053). 13 + 18sqrt(13) Simplify (-1sqrt(108) + -4)2. 48sqrt(3) + 124 Simplify ((-4 + -1sqrt(11))1)*2 + -4. 23 + 8sqrt(11) Simplify sqrt(22)/(sqrt(22)/sqrt(99)). 3sqrt(11) Simplify (sqrt(2299) + 0)2 - (sqrt(304) + 0). -4sqrt(19) + 2299 Simplify (-4(sqrt(7) + -3)1)*2. -96sqrt(7) + 256 Simplify ((sqrt(156) - sqrt(156)2) + sqrt(156))/sqrt(12) - sqrt(13) - ((0 + sqrt(637) - sqrt(637)) + sqrt(637))2. -637 - sqrt(13) Simplify sqrt(44) - sqrt(44)2 - (sqrt(11) - sqrt(132)/sqrt(48)). -5sqrt(11)/2 Simplify ((sqrt(1100) + sqrt(1100)2)6)2. 356400 Simplify 2(sqrt(5) + (1 + sqrt(5))1) + 0. 2 + 4sqrt(5) Simplify (((-1sqrt(156))/sqrt(12))2 + (sqrt(13) - sqrt(39)/sqrt(3)-6))4. 52 + 28sqrt(13) Simplify (3-3(3 + -4sqrt(112)))2. -7776sqrt(7) + 145881 Simplify (-1(-1 + sqrt(1088) + 1))2. 1088 Simplify (2(3 + (sqrt(112) - (sqrt(112) + 1))))2. 16 Simplify ((sqrt(80)/(sqrt(30)/sqrt(3)))/sqrt(4))2. 2 Simplify ((-3sqrt(2) + sqrt(2) - sqrt(2))-2)*25-1. -360 Simplify (sqrt(98) + 0 + sqrt(98)2)*2. 882 Simplify -1sqrt(19)-4 - -5sqrt(19)-2. -6sqrt(19) Simplify -1(6(1sqrt(9))/sqrt(3))2. -108 Simplify (-2sqrt(17)5 - (sqrt(1088) + (sqrt(1088) - (-1sqrt(1088) + sqrt(1088))))) + -5. -26sqrt(17) - 5 Simplify ((-2sqrt(396) + sqrt(396))/sqrt(12))/sqrt(3). -sqrt(11) Simplify sqrt(32) + 1sqrt(128). 12sqrt(2) Simplify -3 + (sqrt(95) + (-1sqrt(95) - sqrt(95))-1)/sqrt(180). -3 + sqrt(19)/2 Simplify sqrt(175)2 - (sqrt(7) - (-4 + sqrt(7)-2 + sqrt(7)) - sqrt(7))*2 - (sqrt(126) - 2sqrt(126) - sqrt(126))/sqrt(2). -23 + 8sqrt(7) Simplify 1 + 2 + sqrt(128) + sqrt(128) + sqrt(128). 3 + 24sqrt(2) Simplify (sqrt(112) - sqrt(7))*26 - -42sqrt(7). 8sqrt(7) + 378 Simplify 3(sqrt(304))*22 + (sqrt(19) - (1 + sqrt(684)) - sqrt(38)/sqrt(2)-1)2. 8sqrt(19) + 2129 Simplify (4(2 + sqrt(720)))2 + -1. 768sqrt(5) + 11583 Simplify sqrt(192) + (sqrt(192) + (sqrt(192) + 2 + sqrt(192) - sqrt(192))-2 + sqrt(192))2. 8sqrt(3) + 16 Simplify (sqrt(120)/sqrt(6) + sqrt(5) + -1)-3. -9sqrt(5) + 3 Simplify -1 + sqrt(52) + 2. 1 + 2sqrt(13) Simplify (sqrt(143) + (sqrt(143) - (sqrt(143) + (sqrt(143)-2 - sqrt(143))))-4)/(sqrt(22)/(sqrt(2)2)). -22sqrt(13) Simplify (sqrt(18)/sqrt(54) + 2)2. 4sqrt(3)/3 + 13/3 Simplify sqrt(192) + (sqrt(33)/(sqrt(110)/sqrt(10)) - sqrt(3)). 8sqrt(3) Simplify (6-2sqrt(95))/sqrt(5). -12sqrt(19) Simplify (5 + 6(sqrt(5) - (sqrt(5) - sqrt(10)/sqrt(2))))5. 25 + 30sqrt(5) Simplify 1 + sqrt(2187) + sqrt(27). 1 + 30sqrt(3) Simplify (-1sqrt(162))2-6 - (5 + sqrt(162) + -1 - sqrt(162)). -976 Simplify ((-2 + -1 + sqrt(72))4)2. -576sqrt(2) + 1296 Simplify -3 + 5 + 4sqrt(1872). 2 + 48sqrt(13) Simplify 1sqrt(2736) + 0. 12sqrt(19) Simplify sqrt(15)/sqrt(3) + 2 - sqrt(50)/(sqrt(90) + sqrt(10)). 3sqrt(5)/4 + 2 Simplify (sqrt(243)3 + 4 - (1 + sqrt(243) + sqrt(243) + -1))*2. 72sqrt(3) + 259 Simplify ((sqrt(15) - ((sqrt(135) + sqrt(15))-5 + sqrt(15)))/sqrt(3) - -4(sqrt(40)/sqrt(4))/sqrt(2))*2. 2880 Simplify (3(sqrt(567) - -3sqrt(567)1))*2. 81648 Simplify sqrt(36)/(sqrt(216)/sqrt(2)). sqrt(3)/3 Simplify (sqrt(6) + (-4sqrt(864) - sqrt(864)))/(sqrt(288)/sqrt(6)). -59sqrt(2)/4 Simplify (42sqrt(15))/(sqrt(9)/sqrt(3)-5). -8sqrt(5)/5 Simplify (0 + sqrt(208) + sqrt(208) + 1 + sqrt(208) - sqrt(208)) + (-1sqrt(208) + sqrt(208))-3. 1 + 8sqrt(13) Simplify -3 + sqrt(13)2 + -4. -7 + 2sqrt(13) Simplify (-6sqrt(175)-5)*2 + 0. 157500 Simplify -3(1 + sqrt(13) + -1 - sqrt(143)/(sqrt(11)4)). -9sqrt(13)/4 Simplify sqrt(14)/(sqrt(7) - (sqrt(7) + 2*sqrt(567))). -sqrt(2)/18
Suppose -50b + 5508 = -16b. Calculate the remainder when b is divided by 82. 80 Let o(t) = -t*3 + 9t*2 - 19t + 16. What is the remainder when o(6) is divided by (12/(-4))/(6/(-8))? 2 Let s(u) = 4u2 + 55u + 11. What is the remainder when s(-14) is divided by 9? 7 Let p(u) be the third derivative of u5/30 - u4/24 + u2. Let k(j) = -j2 - 17j - 8. What is the remainder when k(-7) is divided by p(-3)? 20 What is the remainder when 118 is divided by (-3 - 1) + 0 + 21 + -2? 13 Let u = 39 + 62. Let z = u - 88. Calculate the remainder when z is divided by 7. 6 Suppose 5d + 205 = -5p, 0 = -p - 0p + 3d - 37. Let z = p - -55. Calculate the remainder when 72 is divided by z. 12 Suppose -3j + 15 + 39 = 0. Let y = j + -10. What is the remainder when 13/1(0 - -1) is divided by y? 5 Suppose 5q - 192 + 12 = 0. Let g be 3-3(0 + -10 + 1). Let u = g + -68. What is the remainder when q is divided by u? 10 Let l(i) = 31i2. Calculate the remainder when l(1) is divided by 19. 12 Suppose 4 + 4 = -4t. Let z(i) = 5i2 + 3i. What is the remainder when (16/5)/(t/(-25)) is divided by z(-2)? 12 Let k = 54 - 34. Suppose p = 2 + 17. What is the remainder when p is divided by (1/2)/(2/k)? 4 Calculate the remainder when 24 is divided by -20(-6)/8 + 6/(-2). 0 Let a(z) = -17z3 - z2 - 2z. What is the remainder when 68 is divided by a(-1)? 14 Let h(c) = 23c + 19. Let g be h(13). Suppose -g = -5v + 2k, -2v + 2k = -0v - 126. What is the remainder when v is divided by 34? 30 Suppose -2b - 772 = -5r, 3b + 294 = 2r - 6. Suppose 3w + r = 4j + 2w, -2w = -4j + 160. Calculate the remainder when j is divided by 20. 18 Let n = -43 - -77. Suppose -3 = -4d - 3g + 18, -4d = -5g - 29. Calculate the remainder when n is divided by (-26 - 1)(-2)/d. 7 Let f(n) = n2 - 5n - 5. Let h(b) = -3b + 10. Let a be h(4). Let r be (a/(-3))/(4/(-36)). Calculate the remainder when f(r) is divided by 16. 13 Let u(n) = -n3 - 4n*2 + 3n. Let c(a) = -a*3 - 4a*2 + 4a - 1. Let j(h) = -3c(h) + 4u(h). Calculate the remainder when j(-6) is divided by 38. 37 Suppose 0 = -9t + 120 - 30. Calculate the remainder when 29 is divided by t. 9 Let p(u) = u3 + 27u*2 + 50u + 30. Calculate the remainder when 118 is divided by p(-25). 28 Let c = 56 - 33. Let f(a) = 2a3 - 2a*2 + a. Let v be f(3). Suppose -q + 65 = 2m, -v - 29 = -q + m. What is the remainder when q is divided by c? 21 Let d(y) = 3y3 + 7 - 2y*3 - 18 - 9y*2 - 8y. Let t be 9 + -2 + (-6)/(-2). Calculate the remainder when d(t) is divided by 6. 3 Let a(m) = -3m2 - 58m - 60. Calculate the remainder when 694 is divided by a(-18). 10 Suppose -n - 314 = -5h + 196, 204 = 2h - 2n. Suppose 4x = x + h. What is the remainder when 135 is divided by x? 33 Suppose -106 = -4l + 150. What is the remainder when l is divided by 11? 9 Let x = -92 + 105. What is the remainder when 57 is divided by x? 5 Suppose 99 + 189 = 12l. Let p = 7 + l. What is the remainder when 60 is divided by p? 29 Suppose -4g + 615 = i, -174 - 132 = -2g - 2i. Calculate the remainder when g is divided by -2155/(-8) - 10/(-40). 37 Let l(s) = 2s3 - 4s*2 + 3s + 1. Suppose 1 = 5i - 9. What is the remainder when 14 is divided by l(i)? 0 Suppose 10 = -l - 2n, 2n + 12 = -2l - 0n. Calculate the remainder when (3/l)/((-6)/4) is divided by (1(0 + 1))/1. 0 Let v(o) = o*2 + o - 33. Calculate the remainder when 54 is divided by v(-8). 8 Suppose -1113 = -16h + 695. Let w = h - 102. Calculate the remainder when 31 is divided by w. 9 Suppose 2v + 5r + 75 = 107, 0 = 3v + 5r - 43. What is the remainder when v is divided by 8? 3 Let o be 0 - (-7 - (3 - 5)). Suppose -5j = -0 - o. Calculate the remainder when 3 is divided by j. 0 Let q = -12 - 3. What is the remainder when 2 is divided by -531/q? 0 Let v be 2/17 + 234/34. What is the remainder when 24 is divided by 2/v + (-267)/(-21)? 11 Suppose i - 847 = -773. What is the remainder when 514 is divided by i? 70 Suppose -5y + 225 = 4t, y + 3t = 76 - 20. What is the remainder when 245 is divided by y? 40 Let b be 7/21 + (-22)/(-6). Let k be 60/((-8)/b) - -3. Let w = 40 + k. Calculate the remainder when 37 is divided by w. 11 Suppose 0s + k = -2s + 13, -3k + 15 = 0. Let c be 2-2 + (s - 2). Calculate the remainder when (-6)/c + (2 - -1) is divided by 5. 1 Let p be (-1)/((12/4)/(-801)). Suppose p = 2d + d. What is the remainder when d is divided by 18? 17 Suppose -35z - 37 = -36z. Suppose -2f - 4f = -78. Calculate the remainder when z is divided by f. 11 Let r = 204 + 21. Calculate the remainder when r is divided by 23. 18 Let o(x) = -577x3 + x2 + x. What is the remainder when o(-1) is divided by 29? 26 Let a be -91 - (0 + -3 - -6). Let b = a - -192. Suppose 4d - 51 = 49. What is the remainder when b is divided by d? 23 Let s = 1036 - 983. Calculate the remainder when 178 is divided by s. 19 Let q be ((-4)/8)/((-1)/(-10)). What is the remainder when 35 is divided by 1/5 - 49/q? 5 Let l = -9 + 31. Calculate the remainder when l is divided by 19 - (-7 - -16 - 2). 10 Let i(y) = 4y*2 - 97y - 25. Calculate the remainder when i(32) is divided by 11. 10 Let v be (16/28)/(4/14). Suppose 5y - 25 = -5r, 0 = -y + 5r + 9 + v. Let p = 9 - -11. What is the remainder when p is divided by y? 2 Let g = -1055 - -1156. Calculate the remainder when g is divided by 98. 3 Let x(o) = -o3 - 7o*2 - 5o + 912. Calculate the remainder when x(0) is divided by 11. 10 What is the remainder when 45 is divided by 6((-25)/(-15) + -2) + 15? 6 Let y(i) = 82i*2 - 8i. What is the remainder when 279 is divided by y(1)? 57 Let c = -29 - -25. Let g = 8 - -16. Calculate the remainder when g is divided by 53/5 - c. 3 Suppose 2b - 652 = -m, -3216 = -13m + 8m + b. Calculate the remainder when m is divided by 129. 128 Let j = 105 - 89. What is the remainder when 59 is divided by j? 11 Let s(n) = n*3 + 18n*2 - 8n - 90. Calculate the remainder when s(-18) is divided by 3. 0 Let n = 1037 - 901. Calculate the remainder when n is divided by 121. 15 Let q(u) = u - 4. Let b be q(7). Suppose 0 = 2j + 3j. Calculate the remainder when (51 + b)/(2 + j) is divided by 14. 13 Suppose -2x - 3 = -13. Suppose i + 2r + 0 = 19, xi + 2r - 119 = 0. What is the remainder when 146 is divided by i? 21 Let b(h) = -h - 10. Let l be b(-7). What is the remainder when -5 - l - (-28 + 0) is divided by 6? 2 Let o be 3 + -10 - (-1 - -1). Let y(m) be the first derivative of -3m2/2 - m - 3. What is the remainder when y(o) is divided by 11? 9 Let w be (2 - -13)(-4 - -3). Let v = -6 - w. Calculate the remainder when 35 is divided by v. 8 Suppose 0 = -29y + 27y + 90. Calculate the remainder when 141 is divided by y. 6 Let b(n) = 17n2 + n. Let z be b(1). Suppose -23k + zk = -105. What is the remainder when 61 is divided by k? 19 Suppose 44j + 4 = 46j. Suppose -2k = -5n + 199 + 226, jk = 2n - 170. Calculate the remainder when n is divided by 8. 5 Suppose -s + 16 = h, -74 = -5h - 4s + 6. What is the remainder when 45 is divided by h? 13 Suppose -2o = -0o - 60. Suppose x = 4p - 28, 2p = 5p - 3x - o. Suppose pz + 15 = 99. What is the remainder when z is divided by 8? 6 Suppose 0 = 5t - 5, -2t + t = -3u + 179. Suppose -7y = -u - 59. What is the remainder when 45 is divided by y? 11 Let r = -415 + 523. What is the remainder when 212 is divided by r? 104 Let y(i) = 2i - 5i + 1 - 1 - 4. Let s be y(-2). Suppose -5k + 23 = w, -sk - w = 2 - 10. What is the remainder when 17 is divided by k? 2 Let a(d) = 3d + 12. Let o = 0 - 4. Let t be a(o). Suppose c = 4w - 0c - 268, t = 4w + 4c - 268. What is the remainder when w is divided by 14? 11 Suppose 0 = 5v - 290 - 370. Calculate the remainder when v is divided by 7. 6 Suppose 179 = 4f + 15. What is the remainder when f is divided by (1 - (-8 + 3)) + 8? 13 Let y(o) = 10o - 152. What is the remainder when y(19) is divided by 3? 2 Let u(m) = 5m2 + 6m - 20. Calculate the remainder when u(3) is divided by 26. 17 Let f(g) = 4g2 + g3 + 4g*2 - 2g + 21 - 29. What is the remainder when 23 is divided by f(-8)? 7 Let w = 497 - 479. What is the remainder when 39 is divided by w? 3 Let o(d) = -3d - 7. Let u be (-3 - -5 - 4) + 4. Suppose s - 212 = -5y, 0 = 4y + 3s + us - 157. Calculate the remainder when y is divided by o(-6). 10 Suppose 762 = 6u + 30. Calculate the remainder when u is divided by 23. 7
What are the prime factors of 926168787? 3, 43, 271, 8831 What are the prime factors of 34184867? 71, 467, 1031 List the prime factors of 2290494926. 2, 1145247463 List the prime factors of 431299133. 431299133 List the prime factors of 626227409. 463, 1352543 List the prime factors of 58877355. 3, 5, 23, 157, 1087 List the prime factors of 3861219. 3, 479, 2687 What are the prime factors of 31160835? 3, 5, 71, 3251 What are the prime factors of 346867600? 2, 5, 23, 37, 1019 What are the prime factors of 24035031? 3, 73, 36583 What are the prime factors of 151985073? 3, 41, 1235651 What are the prime factors of 84219541? 7, 659, 18257 What are the prime factors of 1131653461? 1131653461 What are the prime factors of 3182108146? 2, 7, 227293439 List the prime factors of 141672566. 2, 7, 1559, 6491 What are the prime factors of 654094923? 3, 218031641 List the prime factors of 266336320. 2, 5, 23, 36187 What are the prime factors of 766893089? 43, 241, 1721 List the prime factors of 2252427. 3, 750809 List the prime factors of 622016206. 2, 7, 937, 47417 List the prime factors of 34438682. 2, 23, 401, 1867 List the prime factors of 3071136687. 3, 19, 67, 797, 1009 List the prime factors of 34499721. 3, 11499907 What are the prime factors of 2276175234? 2, 3, 83, 4570633 List the prime factors of 95040904. 2, 7, 1697159 List the prime factors of 70743067. 70743067 What are the prime factors of 2121908400? 2, 3, 5, 79, 829 List the prime factors of 224086422. 2, 3, 7, 29, 183979 What are the prime factors of 49794607? 1399, 35593 What are the prime factors of 58074418? 2, 197, 147397 What are the prime factors of 2659694837? 2659694837 What are the prime factors of 1948748921? 7, 47, 521, 11369 List the prime factors of 42933353. 2531, 16963 List the prime factors of 918667. 167, 5501 What are the prime factors of 34047620? 2, 5, 19, 89599 List the prime factors of 1657529060. 2, 5, 11, 313, 24071 What are the prime factors of 232313706? 2, 3, 12906317 What are the prime factors of 64067859? 3, 179, 39769 List the prime factors of 78566531. 349, 225119 What are the prime factors of 2926824820? 2, 5, 3701, 39541 List the prime factors of 474657505. 5, 7, 173, 277, 283 List the prime factors of 168117896. 2, 17, 1236161 What are the prime factors of 97455521? 37, 1609, 1637 What are the prime factors of 323610952? 2, 7, 5778767 List the prime factors of 31437413. 7, 1009, 4451 What are the prime factors of 32192968? 2, 17, 236713 What are the prime factors of 2715649778? 2, 43, 31577323 What are the prime factors of 3593348248? 2, 7, 19, 3377207 List the prime factors of 174361035. 3, 5, 191, 60859 List the prime factors of 280622810. 2, 5, 13, 53, 241 List the prime factors of 744071957. 43, 17303999 What are the prime factors of 5593687868? 2, 34421, 40627 List the prime factors of 24166354. 2, 12083177 What are the prime factors of 250519466? 2, 641, 195413 What are the prime factors of 313451830? 2, 5, 113, 241, 1151 What are the prime factors of 25936609? 25936609 What are the prime factors of 3493017791? 163, 21429557 List the prime factors of 45353134. 2, 41, 61, 9067 List the prime factors of 51882424. 2, 11, 43, 13711 What are the prime factors of 111914773? 857, 130589 What are the prime factors of 799604948? 2, 31, 6448427 List the prime factors of 18226731. 3, 6075577 List the prime factors of 3949647. 3, 13, 101273 What are the prime factors of 420454276? 2, 11, 9555779 List the prime factors of 1255135293. 3, 139459477 List the prime factors of 3113618227. 3113618227 What are the prime factors of 47476622? 2, 23738311 List the prime factors of 36183892. 2, 137, 66029 What are the prime factors of 120966023? 443, 273061 What are the prime factors of 1523389302? 2, 3, 28210913 What are the prime factors of 85924230? 2, 3, 5, 7, 409163 What are the prime factors of 139967391? 3, 1103, 42299 What are the prime factors of 20655919? 20655919 List the prime factors of 24830279. 163, 347, 439 List the prime factors of 1262155210. 2, 5, 127, 993823 What are the prime factors of 654631914? 2, 3, 43, 127, 19979 What are the prime factors of 540888886? 2, 571, 473633 List the prime factors of 294157684. 2, 433, 169837 List the prime factors of 41779776. 2, 3, 23, 9461 List the prime factors of 458927656. 2, 11, 151, 34537 What are the prime factors of 247161700? 2, 5, 137, 18041 What are the prime factors of 75171622? 2, 2297, 16363 What are the prime factors of 817032460? 2, 5, 89, 459007 What are the prime factors of 131090651? 131090651 What are the prime factors of 260518887? 3, 37, 782339 What are the prime factors of 154451263? 199, 776137 List the prime factors of 177768319. 11279, 15761 List the prime factors of 186501037. 5987, 31151 List the prime factors of 164716200. 2, 3, 5, 11, 47, 59 List the prime factors of 51623931. 3, 19, 905683 List the prime factors of 34280553. 3, 107, 269, 397 List the prime factors of 1083152125. 5, 11, 787747 What are the prime factors of 398205687? 3, 11, 2389, 5051 What are the prime factors of 310270814? 2, 7, 103, 2089 List the prime factors of 32687457. 3, 11, 990529 List the prime factors of 209310877. 209310877 List the prime factors of 368133376. 2, 13, 67, 127 List the prime factors of 34757329. 83, 418763 What are the prime factors of 1745042259? 3, 29, 1873, 10709 What are the prime factors of 46312403? 17, 991, 2749 What are the prime factors of 696876873? 3, 7, 11, 29, 193 What are the prime factors of 43049895? 3, 5, 7, 409999 What are the prime factors of 588830202? 2, 3, 101, 107, 1009 What are the prime factors of 4217220211? 107, 313, 125921 List the prime factors of 1162571859. 3, 14352739 List the prime factors of 66891837. 3, 19, 1173541 What are the prime factors of 62681610? 2, 3, 5, 101, 137, 151 What are the prime factors of 164964583? 7, 17, 401, 3457 What are the prime factors of 2093346695? 5, 11, 38060849 List the prime factors of 430296424. 2, 281, 191413 What are the prime factors of 1106642335? 5, 113, 601, 3259 List the prime factors of 558152513. 43, 71, 182821 List the prime factors of 206948594. 2, 43, 2406379 What are the prime factors of 76953712? 2, 11, 437237 List the prime factors of 435754579. 13, 33519583 List the prime factors of 73536960. 2, 3, 5, 7, 31, 353 List the prime factors of 153070276. 2, 38267569 List the prime factors of 144811312. 2, 19, 23, 139, 149 What are the prime factors of 59584936? 2, 73, 257, 397 What are the prime factors of 93096090? 2, 3, 5, 29, 53, 673 List the prime factors of 101446195. 5, 1321, 15359 What are the prime factors of 480549815? 5, 96109963 What are the prime factors of 1687729989? 3, 11, 137, 241, 1549 List the prime factors of 64790616. 2, 3, 11, 245419 What are the prime factors of 42593345? 5, 19, 448351 List the prime factors of 47685088. 2, 11, 135469 What are the prime factors of 4632124481? 107, 43290883 What are the prime factors of 67928659? 281, 241739 What are the prime factors of 319808206? 2, 1453, 110051 List the prime factors of 45103621. 23, 1961027 List the prime factors of 16316155. 5, 19, 41, 59, 71 What are the prime factors of 264357839? 233, 1134583 What are the prime factors of 640612396? 2, 31, 1619, 3191 List the prime factors of 193118217. 3, 64372739 What are the prime factors of 822112278? 2, 3, 13, 2273, 4637 What are the prime factors of 242774510? 2, 5, 11, 61, 97, 373 List the prime factors of 33884327. 41, 199, 4153 List the prime factors of 337332228. 2, 3, 28111019 What are the prime factors of 1680042635? 5, 503, 668009 What are the prime factors of 9304537642? 2, 47, 53, 1867631 What are the prime factors of 5752828031? 5752828031 What are the prime factors of 237083384? 2, 331, 89533 List the prime factors of 168042561. 3, 59, 593, 1601 What are the prime factors of 974731383? 3, 29, 61, 61223 What are the prime factors of 2699002712? 2, 7, 23, 299357 What are the prime factors of 6083479537? 6083479537 What are the prime factors of 823699349? 11, 74881759 List the prime factors of 25595048. 2, 223, 14347 What are the prime factors of 659196256? 2, 61, 199, 1697 List the prime factors of 40122411. 3, 7, 647, 2953 What are the prime factors of 4089488? 2, 13, 19661 List the prime factors of 32200440. 2, 3, 5, 19, 29, 487 What are the prime factors of 381655310? 2, 5, 5399, 7069 List the prime factors of 45768944. 2, 13, 293, 751 List the prime factors of 136046733. 3, 17, 41, 65063 What are the prime factors of 124909365? 3, 5, 7, 1189613 What are the prime factors of 194688693? 3, 1493, 14489
Let j be 1 + 6/3 + 16. Let l = j - 5. Let b be 14/l(10 + 0). Which is bigger: b or 11? 11 Let h = -63.056 + 63. Let p = 2.944 - h. Which is smaller: p or -11? -11 Let b be 39/9 - 16/(-24). Suppose -2s - 78 = -bi, 0 = -3s + 3i - 0i - 135. Which is smaller: -50 or s? -50 Let y = -132/19 + 434/57. Let h = -3/11 + -7/55. Which is smaller: h or y? h Suppose 0 = 20r - 24r - 508. Let w = 128 + r. Is w equal to -3/44? False Let g = -2269.03 + 2269. Let m = -0.17 - 0. Let i = g + m. Which is greater: 1.5 or i? 1.5 Let u be -5 + ((-51)/8 + 1)/(-1). Which is smaller: u or -16? -16 Suppose o = -66 - 151. Is -217 <= o? True Let d = -701 + 399. Which is smaller: -305 or d? -305 Let x(j) = -17j + 240. Let s be x(0). Which is bigger: s or 239? s Suppose 3o + 0i - i + 2 = 0, o - 3i = -14. Suppose r = -o + 2. Are -3/11 and r non-equal? True Let g = 52.76 + -52. Let h = -0.738 + g. Which is greater: -1 or h? h Let f be (10/(-80))/(0 + 20). Is 0 at least as big as f? True Let o be -1 - (0 - -1 - 1). Let d be ((-170)/20 - -6)/(1/(-6)). Let n be 2448/(-10260) - (-2)/d. Do n and o have different values? True Suppose -3a + 16 = 1. Suppose -l = -5j + 2l + a, -4j - 2l = -26. Let s be 2/(-3) + 0/j. Which is bigger: s or -1? s Let s = -171 + 171.01. Do s and 4 have the same value? False Let w(f) = f3 - 4f*2 - 6. Let a be w(6). Let s = a + -68. Which is smaller: s or -0.1? s Let r = 25 + -16. Let f = 300 + -297. Is r at least f? True Let b be (-1 + 21/15)/(648/54). Is b less than -4.3? False Suppose 126 = 19k + 2k. Is 55/9 at least as big as k? True Let c be (2/(-6))/(2/(-102)). Suppose 2f - z = 7, 5f - c = f + z. Suppose -f - 19 = -4u. Is u at least as big as 6? True Suppose -27 + 69 = -3z. Let f = z + 23. Let j be (-36)/f(-2)/124. Is -1 > j? False Let d = 3 - 2. Let h be ((-24)/(-40))/((-42)/(-910)). Is d greater than or equal to h? False Let f be ((-2)/96)/(34/(-4)). Let m = f + -2455/2856. Suppose -8 + 38 = 3b, 49 = y + 5b. Which is greater: m or y? m Let l = 6 + -10. Let i be (-976)/336 - (24/63)/4. Which is greater: l or i? i Let c = -178 + 179. Suppose 0 = -4f + 17 - 1. Let g(w) = w - 6. Let i be g(f). Which is greater: i or c? c Let k be (-162)/(-144) - 4/32. Is k bigger than -14/383? True Suppose 5d - 15 = 4t, -12t = -3d - 7t + 22. Which is smaller: 12/65 or d? d Suppose -o - 4o = -25005865. Let p = o - 32872709524/6573. Let y = p + 1/313. Is -1 <= y? True Let i = -3 - -4. Let u be 161/98 - ((-4 - -1) + 5). Which is greater: i or u? i Let r be 1/(5/(-15)) - -5. Suppose -3 = -b - 2b - 3u, -3u = 0. Which is greater: r or b? r Let r = 12 - 1. Let x = -0.016 + 15.916. Let n = 16 - x. Which is greater: n or r? r Let z be 2/12-2 - 42406/195. Which is smaller: z or -217? z Let m = 7533/5 - 1507. Let h = 0 + -1. Which is smaller: h or m? h Let x = 6.9581 - -0.0419. Which is smaller: x or 4? 4 Let x be 4/12 + 2/3. Suppose -5 = -2k + x. Let a be k/((3 + -6)-1). Is a <= -1/10? False Let p be 2298/2555 + 30/(-50). Let n = -6971/2701 + 96/37. Let i = p - n. Do 7 and i have the same value? False Let x = 2876 + -2867.412. Let l = -8.6 + x. Which is greater: l or -0.2? l Suppose 4y - 5w = 238, -3y - 2w + 234 = 67. Suppose 919 + y = -4g. Let p be ((-6)/g)/((-9)/12). Is -1 < p? True Let y(u) = -u*3 + 14u*2 - 26u - 4. Let d be y(10). Does 135 = d? False Let m = -62.1 - -62. Let c = 54.91 - -0.09. Which is smaller: m or c? m Let p = 339 - 419. Do 2 and p have the same value? False Let r be 20/12(1 - -2). Let a be ((-4235)/(-3))/r - -3. Let z = a + -283. Which is greater: 2 or z? z Let i(w) = w - 13. Let d(v) = -13v - 27. Let j be d(-3). Let y be i(j). Let g = -144/35 + 26/7. Is g at most y? False Let z(h) = h*2 + 41h - 109. Let a be z(-44). Suppose -2c - 130 = -6y + y, 5y = -4c + 100. Is y greater than a? True Let h = -0.7 + -0.4. Let k = -1.03 + 0.03. Let g = k - h. Which is smaller: g or 10? g Let i = 619 + -8649/14. Let b = 19/7 - i. Which is greater: 4 or b? 4 Let f be 8/112016/98. Let a = 1378/5145 - f. Let n be (-2 - (1 - 3))/2. Which is smaller: n or a? n Suppose -4s + 3x = -45, -2s + 0x + 27 = 3x. Which is smaller: 138/13 or s? 138/13 Let s be 51/(-138) + -98/(-144). Is 0 > s? False Let r = -0.033 + 6.533. Let j = 6.7 - r. Let t = 1.4 + 6.6. Which is smaller: j or t? j Suppose 5y - 55 = -230. Let u = -2691 + 2656. Do y and u have different values? False Let z be (97 + 2)144/264. Is z >= 1? True Suppose 0 = 43j - 4025 - 834. Which is greater: 112 or j? j Let z = 10 + -10. Let l(o) = -o2 - o - 2. Let s be l(3). Let c = -29/2 - s. Is z at most as big as c? False Let u(r) = -r2 + 0r*2 + 2r2 + r2 - 2r. Let x be u(4). Let v = 614 - 589. Are v and x unequal? True Suppose 5q - 150 = -5v, 2q - 3v - 40 = -v. Let g = q + 7. Let i be ((-7)/(28/g))/(-1). Is 9 <= i? False Let d be 210 + 1 + -3. Let o be 130/(-39)d/5. Let p = 25/2 + o. Which is smaller: p or 0? 0 Let z be ((-129)/(-2))/(507/(-52)). Is z greater than -8? True Let k(z) = -z3 - 4z*2 + 4z - 4. Let g be k(-4). Let o = g - 25. Which is smaller: o or -44? o Let o = -286 + 2287/8. Is o >= 1? False Let k = 0.434 - 3.434. Is -0.212 less than k? False Let i = -24.982 + -0.018. Let m = i + 70. Is 1/4 equal to m? False Let s be (-12)/6-1 + 6/(-2). Let d be (6 - 0)(s + 6/1). Which is smaller: 29 or d? 29 Let i = 31 + -17. Suppose -67 = -3v + i. Let t be 8/v - 6/27. Which is greater: t or -1? t Let d = 606 - 670. Do d and -65 have different values? True Let p be ((-4)/(-7))/((-36)/(-42)). Suppose 4r = 3g + 12, 4g - 4r + 26 = -2r. Which is smaller: p or g? g Suppose y + 3820 = -5a + 112, 0 = 3a - 5y + 2208. Which is smaller: -742 or a? -742 Let b be (-1 - 0)/(8/72). Let j = 36 + -43. Which is smaller: j or b? b Let y(a) = 2a + 5. Let h be y(0). Suppose 21 = hj + 106. Which is greater: j or -2/5? -2/5 Let c(l) = 2l*3 + 21l*2 + 10l - 12. Let g be c(-10). Let i be ((-130)/(-4))/(-5)2. Are g and i unequal? True Suppose 4c = b - 5, -c - 3c - 27 = b. Let a be -32 + (-3)/1. Which is smaller: b or a? b Let a(b) = -2b2 + 8b - 2. Suppose 4r - 36 = -3d, 2r = -0r + 3d + 36. Let h = -9 + r. Let p be a(h). Is 7 greater than or equal to p? True Suppose 15p - 21p = -342. Let h = p + 1. Which is smaller: 57 or h? 57 Let w be -1(-5 - 0/(-2)). Suppose w = 9c - 8c. Suppose -l - 15 = -3l - ca, -4a = -3l - 12. Which is smaller: l or 9/8? l Let b = 0.048 - -0.682. Let o = b + -2.73. Is o <= 14? True Let i be -3 - 0 - (-7)/340146. Is i > -1? True Let f be 1/(-3 - -2) - -9. Suppose -o - 17 = 3c - 8c, 0 = 2c - f. Let n be -4(o + -4) + -2. Is 1 < n? True Suppose -35d = 7d + 3024. Is d bigger than -77? True Let t be (3/(-18))/(18/240) + 2. Let l be ((-16)/(-12))/((-4)/6). Which is greater: t or l? t Let h be -2-33/(-9). Let w = 231 - 230. Which is greater: w or h? w Suppose 0 = -6f + f. Suppose -w + f = -1. Let o = -26/9 + 188/63. Which is smaller: w or o? o Suppose 5m + 25 = 0, -t = t + m - 47. Let k(w) = -w3 - 8w*2 - 6w - 5. Let g be k(-5). Let j be g(3/(-6) - 0). Is t smaller than j? False Let x be 32/(-84)12/16. Let f = -1.09 + 0.09. Which is greater: x or f? x Let x(v) = v*3 + 4v*2 - 7v - 5. Let l be x(-5). Suppose -lz = -12z + 21. Is z < 13/3? True Suppose -4a - 4 = 0, 2n + 2a = -0 + 4. Suppose 0j + 3x - 3 = -nj, 0 = -2j + 2x + 6. Is 2 greater than or equal to j? True Let y be 51-1 + 1. Let u(z) = -6z + 68. Let b(g) = -g + 1. Let c(k) = 4b(k) - u(k). Let s be c(29). Which is bigger: s or y? y Let g = 249/2 + -129. Suppose -19l = l + 80. Which is greater: g or l? l Suppose 5q - 7 = 4q. Let l = q + -3. Let j(b) = -b - 8. Let a be j(-12). Is l smaller than a? False Let k = -20 + 21. Let c = 8 - 6. Which is smaller: k or c? k Let i(h) = -2h*3 - 12h*2 + 6h + 15. Let a be i(-8). Let d = -222 + a. Let s = -1641/266 + 43/7. Which is smaller: s or d? s Let x = 13.61 - 15.61. Does x = -46? False Let l = 68 + -73. Let b(w) = -w - 4. Let s be b(l). Let m = -242 - -2176/9. Which is smaller: s or m? m Suppose d + 5 = 2x, 2x = -2d - 0 + 2. Suppose b - xb - 2t = 10, 4b - 2t + 40 = 0. Let j be b/8 + 20/10. Which is smaller: j or 0? 0 Let k = -3 + 5. Suppose -4n - 3o - 3 + k = 0, 2o = -5n + 4. Suppose -4x = -g + 3, -g - 13 = nx + 2x. Is -5 bigger than g? False Let g = 409 + -441. Is -36 less than g? True Let k be ((-32)/12)/(8/(-36)). Suppose -k = 6*v + 18. Is v less than -4? True
What is the units digit of 2246? 6 What is the thousands digit of 9565? 9 What is the tens digit of 2867? 6 What is the tens digit of 105820? 2 What is the thousands digit of 9013? 9 What is the hundreds digit of 72215? 2 What is the thousands digit of 2914? 2 What is the units digit of 1199? 9 What is the units digit of 6894? 4 What is the units digit of 302? 2 What is the thousands digit of 2799? 2 What is the hundreds digit of 1106? 1 What is the units digit of 752? 2 What is the tens digit of 18017? 1 What is the units digit of 114611? 1 What is the units digit of 2290? 0 What is the units digit of 3627? 7 What is the hundreds digit of 1336? 3 What is the units digit of 862? 2 What is the hundreds digit of 1823? 8 What is the thousands digit of 5426? 5 What is the units digit of 6600? 0 What is the thousands digit of 9860? 9 What is the thousands digit of 44689? 4 What is the tens digit of 1228? 2 What is the ten thousands digit of 33052? 3 What is the hundreds digit of 2198? 1 What is the hundreds digit of 2778? 7 What is the hundreds digit of 32703? 7 What is the units digit of 1057? 7 What is the tens digit of 995? 9 What is the hundreds digit of 12821? 8 What is the thousands digit of 7960? 7 What is the tens digit of 38574? 7 What is the tens digit of 797? 9 What is the ten thousands digit of 15927? 1 What is the hundreds digit of 3516? 5 What is the thousands digit of 7991? 7 What is the thousands digit of 3229? 3 What is the hundreds digit of 2510? 5 What is the tens digit of 112106? 0 What is the hundreds digit of 769? 7 What is the tens digit of 43937? 3 What is the thousands digit of 3805? 3 What is the hundreds digit of 2815? 8 What is the hundreds digit of 1811? 8 What is the tens digit of 7477? 7 What is the tens digit of 10689? 8 What is the thousands digit of 3372? 3 What is the hundreds digit of 4000? 0 What is the ten thousands digit of 36757? 3 What is the thousands digit of 23719? 3 What is the ten thousands digit of 15039? 1 What is the tens digit of 84? 8 What is the tens digit of 124? 2 What is the units digit of 710? 0 What is the hundreds digit of 154? 1 What is the units digit of 18345? 5 What is the hundreds digit of 875? 8 What is the thousands digit of 10035? 0 What is the thousands digit of 3746? 3 What is the thousands digit of 57076? 7 What is the units digit of 19925? 5 What is the tens digit of 1128? 2 What is the tens digit of 12973? 7 What is the units digit of 863? 3 What is the tens digit of 352? 5 What is the hundreds digit of 618? 6 What is the ten thousands digit of 30725? 3 What is the tens digit of 18885? 8 What is the tens digit of 17505? 0 What is the ten thousands digit of 11207? 1 What is the tens digit of 24879? 7 What is the units digit of 1115? 5 What is the tens digit of 39578? 7 What is the ten thousands digit of 29759? 2 What is the thousands digit of 11589? 1 What is the ten thousands digit of 41046? 4 What is the units digit of 193? 3 What is the tens digit of 1302? 0 What is the hundreds digit of 1703? 7 What is the hundreds digit of 47926? 9 What is the units digit of 14467? 7 What is the units digit of 1682? 2 What is the tens digit of 49972? 7 What is the units digit of 87563? 3 What is the units digit of 1041? 1 What is the units digit of 7847? 7 What is the hundreds digit of 137? 1 What is the units digit of 14355? 5 What is the thousands digit of 80385? 0 What is the ten thousands digit of 18970? 1 What is the hundreds digit of 2906? 9 What is the units digit of 8174? 4 What is the hundreds digit of 9165? 1 What is the units digit of 5282? 2 What is the tens digit of 32008? 0 What is the hundreds digit of 357? 3 What is the tens digit of 961? 6 What is the hundreds digit of 2554? 5 What is the ten thousands digit of 17922? 1 What is the units digit of 855? 5 What is the ten thousands digit of 39804? 3 What is the tens digit of 14653? 5 What is the tens digit of 11949? 4 What is the thousands digit of 6538? 6 What is the units digit of 1286? 6 What is the tens digit of 745? 4 What is the units digit of 4345? 5 What is the hundreds digit of 200474? 4 What is the thousands digit of 3989? 3 What is the hundreds digit of 452? 4 What is the units digit of 3289? 9 What is the tens digit of 1202? 0 What is the thousands digit of 11440? 1 What is the units digit of 1751? 1 What is the tens digit of 4181? 8 What is the tens digit of 8383? 8 What is the tens digit of 5059? 5 What is the hundreds digit of 944? 9 What is the hundreds digit of 589? 5 What is the hundreds digit of 1280? 2 What is the ten thousands digit of 21516? 2 What is the hundreds digit of 769? 7 What is the hundreds digit of 7930? 9 What is the thousands digit of 13196? 3 What is the hundreds digit of 617? 6 What is the thousands digit of 14110? 4 What is the hundred thousands digit of 114479? 1 What is the units digit of 15106? 6 What is the thousands digit of 9989? 9 What is the thousands digit of 58915? 8 What is the hundreds digit of 6760? 7 What is the thousands digit of 9977? 9 What is the hundreds digit of 135? 1 What is the units digit of 5542? 2 What is the tens digit of 473? 7 What is the units digit of 185? 5 What is the thousands digit of 16669? 6 What is the units digit of 3370? 0 What is the thousands digit of 51152? 1 What is the hundreds digit of 5798? 7 What is the tens digit of 3049? 4 What is the tens digit of 7442? 4 What is the tens digit of 45506? 0 What is the hundreds digit of 923? 9 What is the thousands digit of 51604? 1 What is the hundreds digit of 798? 7 What is the tens digit of 1029? 2 What is the units digit of 2572? 2 What is the units digit of 1037? 7 What is the units digit of 2652? 2 What is the thousands digit of 4084? 4 What is the hundreds digit of 2041? 0 What is the tens digit of 16206? 0 What is the hundreds digit of 1860? 8 What is the tens digit of 31661? 6 What is the thousands digit of 1017? 1 What is the hundreds digit of 638? 6 What is the tens digit of 3166? 6 What is the units digit of 3194? 4 What is the units digit of 2130? 0 What is the hundreds digit of 361? 3 What is the hundreds digit of 7112? 1 What is the units digit of 3484? 4 What is the hundreds digit of 176? 1 What is the units digit of 552? 2 What is the units digit of 1533? 3 What is the units digit of 978? 8 What is the thousands digit of 3805? 3 What is the tens digit of 3357? 5 What is the hundreds digit of 1429? 4 What is the tens digit of 2474? 7 What is the tens digit of 338? 3 What is the thousands digit of 1097? 1 What is the hundreds digit of 59457? 4 What is the tens digit of 2395? 9 What is the hundreds digit of 3326? 3 What is the ten thousands digit of 46094? 4 What is the tens digit of 618? 1 What is the hundreds digit of 37217? 2 What is the hundreds digit of 5501? 5 What is the hundreds digit of 749? 7 What is the tens digit of 21849? 4 What is the tens digit of 2434? 3 What is the ten thousands digit of 18242? 1 What is the hundreds digit of 729? 7 What is the hundreds digit of 41382? 3 What is the hundreds digit of 18002? 0 What is the units digit of 3375? 5 What is the hundreds digit of 2674? 6 What is the hundreds digit of 9594? 5 What is the tens digit of 7284? 8 What is the thousands digit of 5119? 5 What is the thousands digit of 11945? 1 What is the hundreds digit of 64273? 2 What is the thousands digit of 38105? 8 What is the ten thousands digit of 55202? 5 What is the units digit of 2400? 0 What is the thousands digit of 6102? 6 What is the hundreds digit of 942? 9 What is the hundreds digit of 999? 9 What is the hundreds digit of 11419? 4 What is the units digit of 21838? 8 What is the ten thousands digit of 29390? 2 What is the thousands digit of 107336? 7 What is the thousands digit of 2076? 2 What is the hundreds digit of 705? 7 What is the units digit of 491? 1 What is the units digit of 22999? 9 What is the thousands digit of 1655? 1 What is the hundreds digit of 3922? 9 What is the tens digit of 62057? 5 What is the tens digit of 7068? 6 What is the units digit of 743? 3 What is the hundreds digit of 8184? 1 What is the hundreds digit of 1517? 5 What is the thousands digit of 1233? 1 What is the thousands digit of 6191? 6 What is the tens digit of 211? 1 What is the hundreds digit of 4000? 0 What is the thousands digit of 3919? 3 What is the units digit of 18234? 4 What is the units digit of 1323? 3 What is the hundreds digit of 883? 8 What is the tens digit of 3155? 5 What is the tens digit of 48541? 4 What is the tens digit of 44393? 9 What is the thousands digit of 1914? 1 What is the hundreds digit of 427? 4 What is the ten thousands digit of 15226? 1 What is the thousands digit of 10847? 0 What is the units digit of 1507? 7
Let g(j) = j. Let o(t) = -15t2 + t - 5. What is o(g(b))? -15b*2 + b - 5 Let s(q) = -5q - 4. Let g(b) = 14b + 11. Let a(z) = -4g(z) - 11s(z). Let m(v) = v. What is a(m(p))? -p Let k(m) = m. Let y(a) be the second derivative of 16a*3/3 + 29a. Give y(k(g)). 32g Let t(u) = 23u. Let f(a) = a - 130. What is t(f(b))? 23b - 2990 Let x(a) = -2a. Let d(j) be the first derivative of -4j3/3 - 14. Calculate d(x(u)). -16u*2 Let s(l) = 242l*2. Let t(h) = 3h*2. Determine t(s(u)). 175692u*4 Let j(u) = 24u. Let v(r) = 4r2 - 59 + 59 - 3r*2. Determine j(v(y)). 24y*2 Let p(k) be the first derivative of 2k*3/3 - 3. Let j(h) = -2h. What is j(p(z))? -4z2 Let f(b) = 3b. Let v(q) = q + 93. Calculate v(f(k)). 3k + 93 Let b(j) = 2j. Let v be (3/(1 - 2))/(-1). Suppose -5h + 9 = w, 2w + 0w = -4h + 6. Let u(f) = -hf + 4f + vf. Give b(u(a)). 10a Let i(t) = -920t2. Let c(r) = -r2. Give i(c(y)). -920y*4 Let o(v) = -3v*2 + 5v + 6. Let z(p) = 2p2 - 2p - 3. Let x(a) = 2o(a) + 5z(a). Let c(i) = i*2. Determine c(x(s)). 16s*4 - 24s*2 + 9 Let i(u) = 2u + 4u - 3u - u. Let j(s) = -3s. Let z(d) = -10i(d) - 6j(d). Let o(p) be the second derivative of p3/2 - p. What is o(z(r))? -6r Let i(q) = 2q2. Let a(b) be the first derivative of -3b5/20 + b2/2 + 1. Let o(x) be the second derivative of a(x). Determine o(i(j)). -36j4 Let a(l) = 2l. Let d(x) = x + 6. Let m(f) = f + 5. Let s be 18 + -1 + 2 + -4. Suppose -4v + 7v = s. Let n(g) = vd(g) - 6m(g). Give a(n(i)). -2i Let f(g) = -57g. Let u(q) = -3q2 + 32. Determine f(u(y)). 171y2 - 1824 Let u(s) = -s2 + 3s - 3. Let j(x) = 2x*2 - 8x + 8. Let k be ((-3)/9)/(2/(-48)). Let n(c) = ku(c) + 3j(c). Let r(v) = -2v. What is n(r(m))? -8m*2 Let p(m) = 3m*2 - 12. Let t(q) = 3192q - 3192q - 2q*2. Calculate t(p(b)). -18b*4 + 144b*2 - 288 Let o(u) = -5u. Let v(q) = 15q - 4. Determine v(o(f)). -75f - 4 Let l(t) = 2t2 + 9. Let g(c) = 2c*2. What is g(l(r))? 8r*4 + 72r*2 + 162 Let a(w) = -1554w*2. Let s(g) = 3g*2. Calculate s(a(n)). 7244748n*4 Let z(l) = 4l + 5l - 11l. Let v be ((-6)/(-4))/(3/4). Let r(q) = 3 - 3 + vq. Determine z(r(t)). -4t Let j(d) = 2d. Let h(x) = -100x. What is h(j(n))? -200n Let o(s) = 19s. Let d(h) = 16h2 + 6. Determine o(d(z)). 304z*2 + 114 Suppose 7t - 4t = 9. Let d(a) = 7a - 3a - 2a - ta. Let x(j) = j. What is x(d(g))? -g Let z(k) = -2k. Let f(t) = t*2 - 5t - 2. Let d be f(6). Suppose -r - 4 = 2c - 14, -31 = -dr - 5c. Let o(i) = ri + 2i2 - 4i. Determine o(z(s)). 8s2 Let k(o) be the third derivative of o5/20 - 22o*2. Let p(b) = -2b*2. Calculate k(p(i)). 12i*4 Let a(n) = 1885n. Let q(h) = -h. Calculate q(a(s)). -1885s Let z(d) be the third derivative of -d5/30 + 2d*2. Let j(a) be the second derivative of 0a*3 + 0 + 0a*2 - 1/6a*4 - 2a. Determine z(j(t)). -8t4 Let t(z) = 2z*2. Let b(n) be the first derivative of -9n*3 + 32. What is t(b(o))? 1458o*4 Let u(c) = -c - 2. Let n(s) = 2s + 3. Let p(o) = -4n(o) - 6u(o). Let i(f) be the first derivative of 2f3 - 1. Give p(i(b)). -12b*2 Suppose -5w = -92 + 17. Let d(a) = -4a - 13a + wa. Let b(x) = 0x2 + x2 + 4x2. Calculate d(b(v)). -10v*2 Let k(y) = -2y*2. Let f be (6/10)/((-2)/(-10)). Let z(s) = 0s - 2s + 3s + fs. Give z(k(p)). -8p*2 Let f(p) = -9p*2. Let c(y) = -231y*2. Determine f(c(s)). -480249s*4 Let t(n) = 3n2 + 1 + 1 - 2. Let z(c) be the second derivative of -c3/6 - 2c2 - c. Let v(i) = -2i - 7. Let g(u) = 4v(u) - 7z(u). Give g(t(o)). -3o2 Let r(x) = -2x. Suppose -1 = c - 2. Let a be 2 - 0/((-2)/c). Let i(b) = 6b - 3b*a - 6b. Determine r(i(o)). 6o2 Let w(i) = -i2 + 4i + 2. Let f be w(5). Let o(b) = b. Let s(t) = -t. Let q(d) = fs(d) - 2o(d). Let z(j) = -4j2. What is q(z(y))? -4y*2 Let q(h) = 6h. Let l(k) = 238k. What is q(l(n))? 1428n Let g(r) = -10r. Let n(i) be the first derivative of -1/2i*2 + 1 + 0i. Calculate g(n(f)). 10f Let v(y) = 5487y. Let h(c) = 2c. Determine h(v(l)). 10974l Let p(d) = -d*2. Let r(q) = -1184 + 1184 + 5q*2. Give p(r(y)). -25y*4 Let r(u) = 4u*2. Let j(x) be the second derivative of -2x - 1/12x4 + 0 + 0x*2 + 0x*3. Determine j(r(m)). -16m*4 Let o(v) = 7v*2. Let u(d) be the second derivative of 0 + 1/3d*3 + 0d*2 - 7d. Calculate u(o(i)). 14i2 Let h(g) = -6g2 + 5. Let l(q) = 6 + q2 - 3q2 - 5q*2. Suppose -5i - 27 = 3. Let z(m) = ih(m) + 5l(m). Let n(x) = -3x. What is n(z(r))? -3r*2 Let h(j) = -3j*2. Let c(y) be the first derivative of 4y*3/3 - 2. Calculate h(c(z)). -48z*4 Let c(s) = -3s + s + 5s. Let f(v) be the first derivative of -2v*3/3 + 6. What is f(c(a))? -18a*2 Let s(o) = 4o*2 + 2o. Let c(j) = 4j2 + 3j. Let f(r) = -2c(r) + 3s(r). Let k(z) = z*2 + 0z + 0z + 0z*2. Determine f(k(l)). 4l*4 Let h(t) = 2t. Let z(g) = -6g + 5g - 13g + 1 - 16g. Give h(z(l)). -60l + 2 Let u(a) = -393a*2. Let y(v) = -2v. Give u(y(p)). -1572p2 Let c be (-36)/(-21) - 4/(-14). Let p(x) = 5 + xc - 5. Let v(y) = 1. Let a(b) = b + 1. Let r(k) = -a(k) + v(k). Give r(p(h)). -h2 Let i(r) = -r. Let w(g) = -5g. Let q(v) = 6i(v) - w(v). Let h(s) = 6s + 0s + s. Let x(t) = -140t. Let n(d) = -119h(d) - 6x(d). Give n(q(p)). -7p Let v(j) = 12j - 8. Let d(p) = 12p2. Determine d(v(y)). 1728y*2 - 2304y + 768 Let f(h) = 7h. Let b(z) = 2z*2 + 29 - 29. What is f(b(u))? 14u*2 Let w(p) = 10p*2 - 3p. Let t(b) = -11b2 + 2b. Let q(o) = 3t(o) + 2w(o). Let s(d) = -d - 2d - 2d + 4d. What is q(s(n))? -13n*2 Let p = 8 + -6. Let n(f) = -5f*2 + 6f*2 + 0f*p. Let i(q) = -3q*2. Give n(i(z)). 9z*4 Let z(l) = -2l2. Let a(q) be the second derivative of -q3/6 - 6q. Give z(a(v)). -2v*2 Let t(l) = -7l*2. Let i(c) = c + 5. Let w(o) = 7o - 11o + 8 + 7o + 10. Let r(b) = 18i(b) - 5w(b). Determine r(t(y)). -21y2 Let z(s) = 5s. Let j(o) = o + 13. Calculate j(z(t)). 5t + 13 Let f(i) be the first derivative of -i2 - 8. Let n(t) be the third derivative of t4/12 + t2. Give f(n(c)). -4c Let o(q) = 3q2. Let h(f) = -9f*2 - 13. Let l(y) = 0y*2 + 6y*2 - 4y*2 - 3 + 6. Let d(r) = -6h(r) - 26l(r). Give o(d(b)). 12b*4 Let b(a) = 0a*3 + 8a - 8a2 - 2 - 1 + a3. Let z be b(7). Let s(f) = zf - 4f + 2f. Let m(k) = -k. What is m(s(y))? -2y Let a(h) = -3h. Let j(s) = 11s. Calculate a(j(c)). -33c Let l(d) = 4d - 7. Let n(m) = -5m. What is n(l(z))? -20z + 35 Let j(l) = -661l. Let d(f) = 2f. Determine d(j(x)). -1322x Let u(f) = -2f2. Let v(i) = i + 14. Let x be v(0). Suppose 3h - 4 - x = 0. Let r(n) = n - hn + n. Give u(r(w)). -32w*2 Let a(s) = 422s. Let b(m) = 12m. Give a(b(o)). 5064o Let k(i) = -2i2. Let u(s) be the third derivative of 11s*5/30 - 56s*2. Calculate u(k(x)). 88x*4 Let j(l) = 5l*2. Let n(b) = 169b. Calculate j(n(p)). 142805p2 Let v(i) = -13 - 4i*2 + 13. Let j(b) = -4b. Let m(d) = 4d. Let s(p) = -5j(p) - 4m(p). Determine v(s(w)). -64w*2 Let x(w) = 21w*2 - 2w. Let z(b) = -41b. What is x(z(n))? 35301n*2 + 82n Let n(u) be the second derivative of -u*3/2 + 30u. Suppose 2t + 15 = -3x + 4, -5x - 33 = -4t. Let d(a) = -ta + a - a. Determine d(n(q)). 6q Let x(q) be the first derivative of 3q2/2 + 2. Let g(l) be the second derivative of 0l*2 + 0l*3 - 4l - 1/4l4 + 0. Determine x(g(h)). -9h*2 Let i(b) = -11b + 9. Let a(n) = 7n. What is i(a(w))? -77w + 9 Let y = 9 - 5. Let g(u) = 3u2 - yu*2 + 3u*2 - 4u*2. Let s(h) = -6h*2. Calculate s(g(w)). -24w4 Let w(u) be the third derivative of -u5/30 - 35u2. Let o(z) be the second derivative of -z4/4 - z. Give w(o(m)). -18m4 Let g(o) = o2. Let t(h) be the third derivative of -13h4/24 - h3/3 - 18h*2. Give t(g(n)). -13n2 - 2 Let u(h) = h2. Let s = 25 - 17. Let i(a) = a + s - 8. Determine u(i(j)). j2 Let q(p) = p2. Suppose 0 = 4n - 7m + 5m - 14, -25 = -5n + 5m. Suppose -5b + 2 = -4b. Let w(o) = -ob - 3o*2 + 0o*n. Give w(q(y)). -4y4 Let g(o) be the second derivative of o3/2 - o. Let d(h) be the third derivative of h*4/24 + 11h*2. Determine d(g(z)). 3z Let n(p) be the third derivative of -7p5/60 + 25p*2. Let w(v) = v. What is w(n(q))? -7q*2 Let s(l) = -l. Let o(q) = 3q*2 - 31q. Determine o(s(a)). 3a2 + 31a
Let g(l) = -l*3 + 47l*2 - 30l - 365. Calculate the remainder when g(45) is divided by 156. 151 Suppose -204d + 1544 - 16304 = -216d. What is the remainder when d is divided by 204? 6 Let h be (-12)/1015/(-9). Suppose x - ha = 35, 2x = -3x + 5a + 160. Calculate the remainder when 112 is divided by x. 25 Let c be 12/(-21) + 416/91. Suppose 30 = 2v - 2q, 4v + 6q = cq + 30. What is the remainder when 19 is divided by v? 9 Suppose -12d + 99 - 1023 = 0. What is the remainder when (-722)/(-14) + 44/d is divided by 98/8 - (-3)/4? 12 Suppose -172k + 2197 + 365 = 11k. What is the remainder when 3804 is divided by k? 10 Let i = -224 + 259. Calculate the remainder when 5281 is divided by i. 31 Suppose -6s + 10s - 46 = -3w, 4w = 5s + 113. What is the remainder when 345 is divided by w? 15 Suppose -3j + 3 = -54z + 58z, 3j - 27 = 4z. Suppose -3f = 6, 4r + jf - f - 116 = 0. Calculate the remainder when 65 is divided by r. 3 Let g = 5 - -4. Let a be ((-4)/(-6) - (-14)/6) + 53. Let c = -39 + a. What is the remainder when c is divided by g? 8 Let t = -1484 - -1490. Calculate the remainder when 49 is divided by t. 1 Suppose 5h + 25 = 0, -3805 = -5f + 3h - h. Suppose 10k - f = 151. What is the remainder when 272 is divided by k? 90 Let f(g) = 3g2 + 8g - 15. Let h be f(2). Suppose -hk + 14k - 52 = 0. Calculate the remainder when k is divided by 9. 7 Let o(a) = -a*2 - 56a - 446. What is the remainder when 606/4 + 1/(-2) is divided by o(-10)? 11 Let c = -134 + 126. Let z be ((-14)/4c)/(7/28). Suppose -5p + 560 = -5o, -3o + z = p - 0p. What is the remainder when p is divided by 38? 36 Let d(v) = 1139v*2 - v - 9. What is the remainder when d(-2) is divided by 111? 109 Let y(n) = 17n + 35. Let u(a) = -14a - 34. Let g(c) = -5u(c) - 4y(c). Let q be ((-9)/2)/(4/8). What is the remainder when 26 is divided by g(q)? 2 Let n(p) = 6p*3 - 147p*2 + 72p + 13. What is the remainder when 234 is divided by n(24)? 0 Suppose 35 = 2i - 5b, 5i - 6b - 355 = -287. Suppose -k + 167 = g, -4g = -0g + 4. Calculate the remainder when k is divided by i. 8 Let b(u) = -347u + 2333. What is the remainder when 828 is divided by b(6)? 75 Suppose -5r = -2g + 56, 4g + 0g - 4r - 88 = 0. Let b be 1090/(-7) + 10/(-35). Let j = b + 188. What is the remainder when j is divided by g? 14 Let o = 27037 + -26684. What is the remainder when o is divided by 8? 1 Suppose -z - 259d + 262d = -822, -z + 787 = 4d. Calculate the remainder when z is divided by 203. 198 Suppose 96 = 9q - 120. Suppose 5o + 5p = 170, -qp + 25p - 64 = -2o. Let n = 3 + 9. What is the remainder when o is divided by n? 6 Let o be 159/(-23) + (-26)/299. What is the remainder when 23 is divided by ((-154)/(-33))/(3 + o/3)? 2 Suppose 19365f - 19382f + 2941 = 0. Calculate the remainder when 715 is divided by f. 23 Let n = -17012 + 17033. Let w(i) = 14i + 10. Calculate the remainder when w(11) is divided by n. 17 What is the remainder when -842(-2 - (19/(-10) + (-80)/(-200))) is divided by 162? 97 Let m be (6/4)/(17580/1952 - 9). Suppose 3q + q = m. Suppose 0 = 3a - 43 - 8. What is the remainder when q is divided by a? 10 Let u(z) = -12 - 7 + 2 + 2z + 0z. What is the remainder when 41 - (4 - (2 + 0)) is divided by u(12)? 4 Let s = -19440 - -19582. Let u(b) = b3 + 9b*2 + 10b + 8. What is the remainder when s is divided by u(-7)? 34 Suppose 41283 = -90c + 189c. Calculate the remainder when c is divided by 18. 3 Suppose 0 = 2b + 4w - 570, 5b - 263 - 1120 = 4w. Suppose -6x + 290 = -4g, -g - 47 = -x + 2. What is the remainder when b is divided by x? 44 Suppose 4m + v = 5544, -2v + 4158 = -16m + 19m. What is the remainder when m is divided by 16? 10 Suppose 283d = 265d + 1008. Calculate the remainder when d is divided by 21. 14 Suppose -6z - 4j = -2z - 1472, -2z = -3j - 721. Suppose z = 6t - 13. Let o = 69 - t. What is the remainder when 22 is divided by o? 4 Calculate the remainder when 412 is divided by (34/(-51))/((-4)/(-54)-1). 7 Suppose 287o + 2206 = 30045. Calculate the remainder when o is divided by 11. 9 Suppose 77c - 1119 - 1227 + 806 = 0. What is the remainder when 318 is divided by c? 18 Let f(y) = y3 + 4y*2 + 17. Let r be f(-5). Let u = 15 + r. Suppose -20 = -5v, v - 16 = 2k - 5k. Calculate the remainder when u is divided by k. 3 Suppose -41m = -8m - 68211. What is the remainder when m is divided by 23? 20 Let a = 123 + -210. Let m = a - -152. What is the remainder when 257 is divided by m? 62 Suppose -3v + 60 = -99. What is the remainder when v is divided by (12 + -32 + -9)/(8/(-8))? 24 Suppose s + 72 = 2j + 2j, -4j + 3s + 80 = 0. Let u be -6((-6)/(-15))/((-204)/425). What is the remainder when j is divided by 20/(-10) + u + (6 - -1)? 7 Let i(x) = 3x + 9. Let o = -7 + 26. Suppose 2p = 5b - o, 2b + 16 = -2p + 6b. Calculate the remainder when 42 is divided by i(p). 0 Suppose 2u + 469 = 20y - 19y, -5u = -y + 451. Calculate the remainder when y is divided by 463. 18 Let w(j) = -10j2 - 423j - 67. Let z(m) = 9m + 13. Let t(b) = 13b + 19. Let v(o) = 5t(o) - 7z(o). What is the remainder when w(-42) is divided by v(4)? 11 Let r(m) = -m*3 + 2m*2 + 6m - 1. Let k be r(-3). Suppose -kb + 17b + 747 = 0. What is the remainder when b is divided by 76? 7 Suppose 68g - 43809 - 19091 = 0. What is the remainder when g is divided by 249? 178 Suppose 42y - 34y - 6096 = 0. Let w = -752 + y. What is the remainder when 18 is divided by w? 8 What is the remainder when 95 is divided by 34 - 0 - ((-660)/(-594) - (-52)/18)? 5 Let k = -19594 + 19656. Calculate the remainder when 1359 is divided by k. 57 Let g be 1 + (-1 + 0)/(-1). What is the remainder when (-2660)/(-21280) + (359/(-8))/(-1) is divided by -2 - (g - 210)? 13 Suppose 5l + 0v - 175 = -5v, -3l - 4v = -102. Let s = l + -14. What is the remainder when s is divided by 14? 10 Suppose 5a + 2o = 84, 74o - 56 = -3a + 70o. What is the remainder when 3742 is divided by a? 14 Calculate the remainder when ((-492)/14)/((-3)/14) is divided by 150. 14 Let g(d) = -d*3 - 8d*2 - 6d + 10. Let v be g(-7). Let o(q) = 2 + q*2 - 3q*2 - 27q*v - 1 + 1. Calculate the remainder when 49 is divided by o(-1). 22 Let o be 22/6 + 2/(-3). Suppose 17f + of - 3580 = 0. What is the remainder when f is divided by 14? 11 Let f be ((-1)/3)/(-2 + 58/30). Suppose 0 = fv - 39v + 2448. Calculate the remainder when 153 is divided by v. 9 Let h(x) = -x3 - 12x*2 + 28x + 1. Let w be h(-14). Calculate the remainder when 110 is divided by 23w + (21/3)/7. 14 Let h = -58 - -81. Suppose h = i + 23. Suppose i = -25j + 26j - 26. Calculate the remainder when j is divided by 15. 11 Suppose -5z = -5t - 1935, -95z + 97z + 3t - 804 = 0. What is the remainder when 1183 is divided by z? 4 Suppose 7x - 442 + 15 = 0. Let g(s) = -s3 + 17s*2 + 18s + 7. What is the remainder when x is divided by g(18)? 5 Let u(l) = 6l2 + 2l - 2. Let j be u(4). Suppose j = 5r - z, 3r - r + 5z - 57 = 0. What is the remainder when r is divided by (-1 + -8)(-2)/6? 0 What is the remainder when ((-50)/(-30))/((-25)/30) - -56 is divided by (12/(-14))/((-2)/28)? 6 Let g(u) = 21u - 24 + 0u*2 - 2u2 + u2 + 2u2. Let x be g(-22). What is the remainder when 10 is divided by (-18)/(-8) + 11/4 + x? 1 Let x = 18642 + -18486. Calculate the remainder when 275 is divided by x. 119 Let q(j) = j + 46. Let x be q(21). Suppose -2y - 8d = -10d - 46, -x = -3y + 4d. What is the remainder when 65 is divided by y? 15 Suppose 3i - 291 = -57. Let u = 219 - i. What is the remainder when u is divided by 43? 12 Let u be (-11)/(-2) + 2/4. What is the remainder when -2((-615)/30)/(-41)-311 is divided by (-2)/(-6) + 100/u? 14 Let t = 130 - -66. Let h be 7/(t/(-8)) + 46/14. Suppose -56 + 53 = -hx. Calculate the remainder when 1 is divided by x. 0 Let c(p) = 3p*2 - 4p - 3 + 3p - 3p. Let k(s) = -1002s2 - 3022s + 2. What is the remainder when k(-3) is divided by c(-2)? 16 Let o = -276 - -296. Suppose -5z + 3k + 590 = 0, -2k = z - 76 - 29. Suppose -z = -2i + 43. What is the remainder when i is divided by o? 19 Suppose 0 = -5m + 5 + 30. Let r(y) = -y3 + 7y*2 + 5y - 10. What is the remainder when (3/(-2))/(1/(-37))960/720 is divided by r(m)? 24 Suppose 113o - 3m + 414 = 116o, -5o - 2m + 711 = 0. Let u(x) = -6x3 - 2x*2 + 2x + 1. What is the remainder when o is divided by u(-2)? 34
What is the z'th term of -11588919, -11588918, -11588917, -11588916? z - 11588920 What is the k'th term of 64, 61, 58, 55, 52, 49? -3k + 67 What is the r'th term of 367, 692, 1233, 1990, 2963? 108r*2 + r + 258 What is the x'th term of -58, -345, -1110, -2593, -5034, -8673? -40x3 + x2 - 10x - 9 What is the k'th term of 9335, 18717, 28099, 37481, 46863, 56245? 9382k - 47 What is the s'th term of 12630, 25279, 37928, 50577, 63226? 12649s - 19 What is the s'th term of 1245, 1501, 1757, 2013, 2269, 2525? 256s + 989 What is the a'th term of -32090, -64198, -96306, -128414? -32108a + 18 What is the v'th term of 714, 691, 654, 597, 514, 399, 246? -v3 - v2 - 13v + 729 What is the f'th term of 53, -7, -115, -277, -499, -787, -1147, -1585? -f*3 - 18f*2 + f + 71 What is the j'th term of -77041, -77005, -76945, -76861, -76753, -76621, -76465? 12j*2 - 77053 What is the u'th term of 4244, 4235, 4222, 4205, 4184, 4159, 4130? -2u*2 - 3u + 4249 What is the n'th term of -81, -240, -571, -1158, -2085, -3436, -5295, -7746? -14n3 - 2n*2 - 55n - 10 What is the m'th term of -1908, -1882, -1842, -1782, -1696, -1578, -1422, -1222? m3 + m2 + 16m - 1926 What is the p'th term of -417, -1736, -3947, -7056, -11069? -p3 - 440p*2 + 8p + 16 What is the b'th term of -30, 567, 2186, 5337, 10530? 85b3 + b2 - b - 115 What is the c'th term of 5205, 10409, 15613, 20817, 26021, 31225? 5204c + 1 What is the j'th term of -2894, -2933, -2972, -3011, -3050? -39j - 2855 What is the t'th term of 53389, 106784, 160179, 213574? 53395t - 6 What is the x'th term of -456415, -456414, -456413, -456412, -456411, -456410? x - 456416 What is the r'th term of 6396, 12966, 19536, 26106, 32676? 6570r - 174 What is the y'th term of 10727, 10738, 10751, 10766? y2 + 8y + 10718 What is the p'th term of -1626, -13113, -44302, -105045, -205194? -1642p3 + p2 + 4p + 11 What is the c'th term of 615, 620, 629, 642? 2c2 - c + 614 What is the d'th term of -2215, -8862, -19939, -35446, -55383, -79750, -108547? -2215d*2 - 2d + 2 What is the u'th term of -454911, -454912, -454913, -454914, -454915, -454916? -u - 454910 What is the x'th term of -1226, -2443, -3660, -4877? -1217x - 9 What is the c'th term of 267, 394, 613, 930, 1351? c3 + 40c*2 + 226 What is the o'th term of 352, 290, 228? -62o + 414 What is the h'th term of 1333, 2581, 3827, 5071? -h*2 + 1251h + 83 What is the k'th term of -8383, -8531, -8679, -8827? -148k - 8235 What is the f'th term of 1064, 1032, 972, 878, 744, 564, 332, 42? -f3 - 8f2 - f + 1074 What is the o'th term of 1574, 1509, 1442, 1373, 1302, 1229, 1154? -o2 - 62o + 1637 What is the u'th term of -408, -833, -1264, -1695, -2120, -2533? u3 - 9u*2 - 405u + 5 What is the q'th term of 460, 360, 274, 208, 168? q3 + q2 - 110q + 568 What is the h'th term of 3941, 3935, 3929, 3923, 3917, 3911? -6h + 3947 What is the d'th term of 168, 158, 162, 180, 212? 7d2 - 31d + 192 What is the h'th term of 8560, 8499, 8438, 8377, 8316? -61h + 8621 What is the j'th term of -17998, -36016, -54034, -72052? -18018j + 20 What is the c'th term of 57, 474, 1573, 3684, 7137, 12262, 19389? 55c3 + 11c*2 - c - 8 What is the a'th term of 67, -5, -77, -149? -72a + 139 What is the p'th term of 6267, 12578, 18963, 25458, 32099, 38922? 6p3 + p2 + 6266p - 6 What is the t'th term of 22, -66, -202, -380, -594, -838, -1106? t*3 - 30t*2 - 5t + 56 What is the l'th term of 56592, 113210, 169828, 226446? 56618l - 26 What is the d'th term of -656998, -656997, -656996, -656995? d - 656999 What is the r'th term of -187, -363, -517, -643, -735, -787? r3 + 5r*2 - 198r + 5 What is the t'th term of -2236, -17899, -60408, -143185, -279652, -483231, -767344? -2237t3 - t2 - t + 3 What is the l'th term of -88, 146, 774, 1994, 4004? 33l3 - l2 + 6l - 126 What is the n'th term of 42507, 42492, 42463, 42414, 42339? -n3 - n2 - 5n + 42514 What is the u'th term of -160, -560, -1232, -2176, -3392, -4880, -6640? -136u2 + 8u - 32 What is the q'th term of 77791, 155599, 233403, 311203, 388999? -2q2 + 77814q - 21 What is the d'th term of 245, 358, 457, 536, 589? -d3 - d2 + 123d + 124 What is the m'th term of 577356, 1154712, 1732068? 577356m What is the z'th term of 1135, 4584, 10331, 18376, 28719, 41360? 1149z2 + 2z - 16 What is the g'th term of -711091, -711090, -711089, -711088, -711087, -711086? g - 711092 What is the b'th term of -227913, -227918, -227925, -227934? -b*2 - 2b - 227910 What is the q'th term of -2451, -4950, -7449, -9948, -12447? -2499q + 48 What is the y'th term of -77948, -77946, -77944, -77942? 2y - 77950 What is the y'th term of 5447406, 5447400, 5447384, 5447352, 5447298? -y3 + y2 - 2y + 5447408 What is the o'th term of 5703, 22825, 51363, 91317? 5708o*2 - 2o - 3 What is the q'th term of -253, -1109, -2557, -4603, -7253? -q*3 - 290q*2 + 21q + 17 What is the p'th term of -187, 242, 673, 1106? p*2 + 426p - 614 What is the o'th term of -308, -651, -1244, -2105, -3252? -3o3 - 107o*2 - o - 197 What is the d'th term of -1285, -5406, -12277, -21898, -34269? -1375d*2 + 4d + 86 What is the n'th term of 490, 474, 458, 442, 426? -16n + 506 What is the o'th term of -22735, -22722, -22711, -22702, -22695, -22690? -o2 + 16o - 22750 What is the i'th term of -1214782, -1214781, -1214780, -1214779, -1214778? i - 1214783 What is the i'th term of 301, 367, 435, 511, 601? i*3 - 5i*2 + 74i + 231 What is the k'th term of 795, 1593, 2393, 3195? k*2 + 795k - 1 What is the l'th term of -1533, -2758, -3983, -5208, -6433? -1225l - 308 What is the y'th term of -132227, -132226, -132225? y - 132228 What is the q'th term of -26020, -25880, -25740? 140q - 26160 What is the n'th term of 12865, 25717, 38569, 51421, 64273? 12852n + 13 What is the f'th term of -145, 0, 145? 145f - 290 What is the k'th term of 17781, 17813, 17831, 17829, 17801, 17741, 17643? -k3 - k2 + 42k + 17741 What is the o'th term of -281, -277, -299, -359, -469, -641, -887, -1219? -2o3 - o2 + 21o - 299 What is the g'th term of 19255, 77021, 173297, 308083? 19255g*2 + g - 1 What is the p'th term of -364113, -728228, -1092343, -1456458, -1820573? -364115p + 2 What is the z'th term of -239315, -239317, -239319, -239321, -239323, -239325? -2z - 239313 What is the r'th term of 12573, 25144, 37715? 12571r + 2 What is the d'th term of -298, -607, -926, -1255, -1594, -1943, -2302? -5d2 - 294d + 1 What is the s'th term of -443, -4779, -16551, -39479, -77283, -133683? -620s3 + 2s*2 - 2s + 177 What is the t'th term of -78, -178, -278, -378, -478, -578? -100t + 22 What is the o'th term of -30, 0, 86, 258, 546? 5o*3 - 2o*2 + o - 34 What is the z'th term of 3998, 8024, 12058, 16100? 4z*2 + 4014z - 20 What is the j'th term of 17464, 17378, 17294, 17212, 17132, 17054? j*2 - 89j + 17552 What is the q'th term of 74158, 148314, 222470? 74156q + 2 What is the f'th term of 236, 1027, 2376, 4283, 6748, 9771? 279f*2 - 46f + 3 What is the x'th term of -859, -3496, -7891, -14044, -21955? -879x2 + 20 What is the h'th term of 580, 2308, 5188, 9220, 14404? 576h*2 + 4 What is the y'th term of -2225, -3678, -5131, -6584, -8037? -1453y - 772 What is the h'th term of 4120, 4137, 4148, 4141, 4104, 4025, 3892, 3693? -2h3 + 9h*2 + 4h + 4109 What is the k'th term of -75236, -75165, -75080, -74975, -74844, -74681? k3 + k2 + 61k - 75299 What is the w'th term of 448, 989, 1530? 541w - 93 What is the m'th term of 2942, 11760, 26464, 47060, 73554, 105952, 144260? m*3 + 2937m*2 + 4 What is the d'th term of 4709, 4573, 4445, 4325, 4213, 4109, 4013? 4d*2 - 148d + 4853 What is the g'th term of 1342, 5338, 11996, 21316, 33298, 47942, 65248? 1331g2 + 3g + 8 What is the w'th term of -31926, -127691, -287298, -510747? -31921w2 - 2w - 3 What is the n'th term of 2497, 2977, 3457? 480n + 2017 What is the z'th term of -100618, -100620, -100624, -100630, -100638? -z2 + z - 100618 What is the f'th term of -25954, -25990, -26026, -26062? -36f - 25918 What is the i'th term of 11382, 11731, 12078, 12423, 12766, 13107? -i*2 + 352i + 11031 What is the y'th term of -3544, -3538, -3532? 6y - 3550 What is the p'th term of -1692, -1660, -1616, -1554, -1468, -1352, -1200? p3 + 25p - 1718 What is the v'th term of 772, 739, 700, 655, 604, 547, 484? -3v2 - 24v + 799 What is the u'th term of -272, -400, -618, -926, -1324, -1812, -2390? -45u2 + 7u - 234
Put 1, 33, 8 in ascending order. 1, 8, 33 Sort 0, 5, -5, 2806 in ascending order. -5, 0, 5, 2806 Put 2, -17, 4, 5 in increasing order. -17, 2, 4, 5 Put -2/7, 2, -2/5, 8/9 in increasing order. -2/5, -2/7, 8/9, 2 Sort 6, 5, 3, 15 in increasing order. 3, 5, 6, 15 Sort 1/9, -2/11, 1.9. -2/11, 1/9, 1.9 Sort -5, -16, 2/17, -2/21 in decreasing order. 2/17, -2/21, -5, -16 Put -39, 4, -4, -2 in descending order. 4, -2, -4, -39 Sort 48, 2, -1. -1, 2, 48 Sort -1, 3, 4, -59 in increasing order. -59, -1, 3, 4 Put 0, -88, 5 in increasing order. -88, 0, 5 Sort -5, 0, -394. -394, -5, 0 Sort -2, 4, -1 in ascending order. -2, -1, 4 Sort 8/7, -1/9, 0.3 in increasing order. -1/9, 0.3, 8/7 Sort 2, 3/2, 0.4, 6, 7/4 in decreasing order. 6, 2, 7/4, 3/2, 0.4 Sort -4, 5, -10. -10, -4, 5 Sort -45, 5, -3, 4, -1 in ascending order. -45, -3, -1, 4, 5 Sort -10, 787, 3 in descending order. 787, 3, -10 Put -0.003, -3, -5, 1/3 in descending order. 1/3, -0.003, -3, -5 Sort -5, -0.5, -0.029 in increasing order. -5, -0.5, -0.029 Put 38, -10, -1 in descending order. 38, -1, -10 Sort -14, -5, -2, -30, -1 in decreasing order. -1, -2, -5, -14, -30 Sort 5, 21, 0.4, -4, -3 in increasing order. -4, -3, 0.4, 5, 21 Sort -2, -0.121, 3, -1/3. -2, -1/3, -0.121, 3 Put -2, -0.4, 7, 4, -5/3 in descending order. 7, 4, -0.4, -5/3, -2 Sort -2, -3, 3, -1. -3, -2, -1, 3 Sort 0, 107, 5. 0, 5, 107 Sort 9, 3, 4, -5 in ascending order. -5, 3, 4, 9 Sort 0.4, -0.2, -0.3, -155 in descending order. 0.4, -0.2, -0.3, -155 Put -3, -71, 1 in ascending order. -71, -3, 1 Put -0.03, 6, -3 in descending order. 6, -0.03, -3 Sort -1534, -3, 1 in descending order. 1, -3, -1534 Sort -2, 1, -5, 10. -5, -2, 1, 10 Put -2, -33, 3, 0, 1 in ascending order. -33, -2, 0, 1, 3 Sort 23, -5/6, -5. -5, -5/6, 23 Put -3, -2, -5 in descending order. -2, -3, -5 Put 1/4, -1, -2/9, 0.5 in increasing order. -1, -2/9, 1/4, 0.5 Sort -4, 1525, -1 in increasing order. -4, -1, 1525 Sort -0.2, 0, 20, 5 in ascending order. -0.2, 0, 5, 20 Put -4, 23, 14 in increasing order. -4, 14, 23 Sort 3, -1/11, 0.882 in ascending order. -1/11, 0.882, 3 Sort 1, 3, -2/11, -3/5, 46. -3/5, -2/11, 1, 3, 46 Put 1, 6, -565 in decreasing order. 6, 1, -565 Sort -0.1, 0, 5, -0.2, -72. -72, -0.2, -0.1, 0, 5 Sort 5, 1, -3, 9/2, -0.02 in descending order. 5, 9/2, 1, -0.02, -3 Put -4/5, 3, 0.1, -2/17 in decreasing order. 3, 0.1, -2/17, -4/5 Sort -4, -6, -11. -11, -6, -4 Sort -5, -1, 1493 in increasing order. -5, -1, 1493 Put -4, 22, -1 in decreasing order. 22, -1, -4 Sort 2, 210, -3 in descending order. 210, 2, -3 Sort 1, 2385, -5, 3 in increasing order. -5, 1, 3, 2385 Sort 77, -8, 2, 0 in descending order. 77, 2, 0, -8 Sort -9, 5, 25. -9, 5, 25 Sort -1, 5, -3, 2. -3, -1, 2, 5 Sort -3, -1, -9. -9, -3, -1 Sort -18, 4, -1 in descending order. 4, -1, -18 Sort -2, 2, -5 in ascending order. -5, -2, 2 Sort 4, 1, 3, 2. 1, 2, 3, 4 Put -5, 60, -1, 1, -2 in increasing order. -5, -2, -1, 1, 60 Sort -12, -4, -34, 3, -5 in decreasing order. 3, -4, -5, -12, -34 Put -3, -4, -7, 1 in descending order. 1, -3, -4, -7 Put 4, -1, 2, -10, -3 in ascending order. -10, -3, -1, 2, 4 Put -1/6, -5, -0.2, 9, 35/4 in increasing order. -5, -0.2, -1/6, 35/4, 9 Sort 2/7, -5, 7/2. -5, 2/7, 7/2 Put -14, -1, -4, -2 in ascending order. -14, -4, -2, -1 Sort 1, -5, 408 in descending order. 408, 1, -5 Sort -16, 4, 3 in increasing order. -16, 3, 4 Put 89, -4, 1, 5, 4 in ascending order. -4, 1, 4, 5, 89 Put -0.4, -2/7, 63/2 in decreasing order. 63/2, -2/7, -0.4 Sort -22, -4, 4, -3 in increasing order. -22, -4, -3, 4 Put -33, 5, 7 in increasing order. -33, 5, 7 Put 130, -1, 3 in decreasing order. 130, 3, -1 Put -0.3, 7, -0.18, 3, -7 in increasing order. -7, -0.3, -0.18, 3, 7 Put -2, 23, 12, 5, 3 in decreasing order. 23, 12, 5, 3, -2 Put 0, -4/7, 2037 in increasing order. -4/7, 0, 2037 Sort -2, 24, -4 in decreasing order. 24, -2, -4 Sort -1.9, 0, 5, 8 in decreasing order. 8, 5, 0, -1.9 Put -4/9, -2/3, 2/3 in decreasing order. 2/3, -4/9, -2/3 Sort -5, -26, 4, -4. -26, -5, -4, 4 Sort 62, -4, -1, -2. -4, -2, -1, 62 Put 15.6, -3, -4 in increasing order. -4, -3, 15.6 Put 5/27, -5, -1/7 in descending order. 5/27, -1/7, -5 Sort 5, 11, -5, -49. -49, -5, 5, 11 Sort -25/4, -2, 0.5. -25/4, -2, 0.5 Sort -1, -126, 10 in descending order. 10, -1, -126 Sort -5, 1, 3, 4, 5 in ascending order. -5, 1, 3, 4, 5 Sort 7, -187, -5, 5 in increasing order. -187, -5, 5, 7 Put 0, 5, -2, 26, 4 in increasing order. -2, 0, 4, 5, 26 Put -1, -57, -6 in descending order. -1, -6, -57 Sort -6, -5, 4, 7. -6, -5, 4, 7 Sort -0.5, -2, -16, 17, 2 in descending order. 17, 2, -0.5, -2, -16 Put -4/19, -0.01, -5 in decreasing order. -0.01, -4/19, -5 Sort 3, -1, 7, -230 in decreasing order. 7, 3, -1, -230 Put -2/11, -3.8, -1/3 in decreasing order. -2/11, -1/3, -3.8 Sort 0, -16, -3/7, -0.305 in ascending order. -16, -3/7, -0.305, 0 Sort 2/13, 833, -3/4, -4, -5. -5, -4, -3/4, 2/13, 833 Put -10, 2, 1, 23 in decreasing order. 23, 2, 1, -10 Sort 2/25, 2/11, -43/10 in decreasing order. 2/11, 2/25, -43/10 Sort 0.3, -2/15, 2/5, -4/9, -8 in increasing order. -8, -4/9, -2/15, 0.3, 2/5 Sort 0.4, 654, -0.1. -0.1, 0.4, 654 Sort 5, -38, 4, 1 in decreasing order. 5, 4, 1, -38 Put -11, 8, 2, 3 in descending order. 8, 3, 2, -11 Sort -2/11, -3/5, 9, 0.1. -3/5, -2/11, 0.1, 9 Sort 0.1, 0.04, 8, 4 in decreasing order. 8, 4, 0.1, 0.04 Sort -1, 1, -3, -144. -144, -3, -1, 1 Sort -4, -100, 3, 2. -100, -4, 2, 3 Sort 0.34, 2/17, 1, -0.2 in decreasing order. 1, 0.34, 2/17, -0.2 Put -5, 4, 17 in decreasing order. 17, 4, -5 Sort -7, 2, -4, -3, -2 in descending order. 2, -2, -3, -4, -7 Sort -5, 15, -0.36. -5, -0.36, 15 Sort 5, -0.4, 1/9, 1/7. -0.4, 1/9, 1/7, 5 Put 2/5, 2, 1577, -0.2 in descending order. 1577, 2, 2/5, -0.2 Sort 3, 5, 742, 4. 3, 4, 5, 742 Put -3, -1, -10, 3 in ascending order. -10, -3, -1, 3 Sort 0.6, -1/4, 2, 3. -1/4, 0.6, 2, 3 Sort 2, 1, 9 in descending order. 9, 2, 1 Sort 6, -3, -0.3, 3/4 in descending order. 6, 3/4, -0.3, -3 Put 3, -5, 0 in descending order. 3, 0, -5 Put 0.5, -3/2, -0.04, -0.01 in increasing order. -3/2, -0.04, -0.01, 0.5 Sort 0, 45, 11, -5, -0.3. -5, -0.3, 0, 11, 45 Sort 7, 0, -5, 1, 4 in descending order. 7, 4, 1, 0, -5 Sort -5, 3/7, -104. -104, -5, 3/7 Put 0, 1, 12 in increasing order. 0, 1, 12 Sort 2/11, -6, -0.4, -1 in descending order. 2/11, -0.4, -1, -6 Sort 10, 5, -2, -24 in increasing order. -24, -2, 5, 10 Put -2, -17, 2, -10 in descending order. 2, -2, -10, -17 Sort -1, -11, 3 in descending order. 3, -1, -11 Sort -0.02, 2/11, -15. -15, -0.02, 2/11 Sort 2/5, 6, -0.02 in descending order. 6, 2/5, -0.02 Sort 3/5, -11/17, -3 in descending order. 3/5, -11/17, -3 Put 15, -0.26, -25 in ascending order. -25, -0.26, 15 Put -5, -4, 1, 4, 20 in increasing order. -5, -4, 1, 4, 20 Put -2, 21, -4 in decreasing order. 21, -2, -4 Sort -0.1, -0.112, 2 in increasing order. -0.112, -0.1, 2 Put -5, 25, -1, 1 in decreasing order. 25, 1, -1, -5 Put 1, 6, -2, 14 in ascending order. -2, 1, 6, 14 Sort 40/3, 2, 2/5. 2/5, 2, 40/3 Put -7, -2, 1, 5 in increasing order. -7, -2, 1, 5 Put 1/3, -2/45, -1/12, 7.8, -3 in descending order. 7.8, 1/3, -2/45, -1/12, -3 Sort -67, 4, -3, -2. -67, -3, -2, 4 Put 0, -157, 0.2 in decreasing order. 0.2, 0, -157 Sort 2/15, 0.06, -6 in ascending order. -6, 0.06, 2/15 Sort -2/7, -0.012, -0.5, -3 in increasing order. -3, -0.5, -2/7, -0.012 Put 12, 2, 3 in decreasing order. 12, 3, 2 Put 0.43, 4, -0.5, 0.05 in ascending order. -0.5, 0.05, 0.43, 4 Put 4, -20, -1, -4 in decreasing order. 4, -1, -4, -20 Put 344/3, -0.4, 0.5, 1, -1/3 in decreasing order. 344/3, 1, 0.5, -1/3, -0.4 Sort 3, -10, 7 in decreasing order. 7, 3, -10 Put -14, 56, -5 in descending order. 56, -5, -14 Sort -1, 10, -3, 19, 4 in increasing order. -3, -1, 4, 10, 19 Sort 3, -15, -2 in increasing order. -15, -2, 3 Sort -4, 10, -2/5, 2/73 in descending order. 10, 2/73, -2/5, -4 Put 1, -11, -623 in increasing order. -623, -11, 1 Sort -7, 1/5, 2/5, 2/15, -2. -7, -2, 2/15, 1/5, 2/5 Put -0.59, 2.4, 0.1, 0.3 in ascending order. -0.59, 0.1, 0.3, 2.4 Put 1, -0.5, 2, -3/14, -0.2 in ascending order. -0.5, -3/14, -0.2, 1, 2 Put -1/71, 0.4, -1/2 in decreasing order. 0.4, -1/71, -1/2 Put -1/2, -22, 5 in increasing order. -22, -1/2, 5 Sort -5, 5, 9, -3, -2 in ascending order. -5, -3, -2, 5, 9 Put -5, 0, 2225, 4 in descending order. 2225, 4, 0, -5 Sort -2, 0.3, -44. -44, -2, 0.3 Sort 4, 2, -5. -5, 2, 4 Sort -3, -0.5, 65, 0.2 in descending order. 65, 0.2, -0.5, -3 Sort 0.7, 0.07, -0.3 in decreasing order. 0.7, 0.07, -0.3 Put 1, -2, 35 in decreasing order. 35, 1, -2 Put -87, -2/5, -2/11, 0.4, -5 in descending order. 0.4, -2/11, -2/5, -5, -87
Let w(r) be the second derivative of -2r4/3 + 2r3/3 + r2/2 + 7r. Let q(c) = c2 - c. Let v be ((-264)/(-20) + -12)5/(-1). Give vq(o) - w(o). 2o*2 + 2o - 1 Let q(a) = 4a - 1241a*2 + 1243a*2 - 5 - 1 + 1 + 0a. Let j(x) = x*3 - 9x*2 - 16x + 21. What is 2j(l) + 9q(l)? 2l3 + 4l - 3 Let q(w) = 58w - 236. Let j(t) = 12t + 1. Determine -5j(r) + q(r). -2r - 241 Let p(x) = -320x - 4. Let v(d) = 3d + 1. Determine -p(b) - 3v(b). 311b + 1 Let k(z) = z - 1. Suppose 5o - 80 = -2j + 4j, -3j - 2o - 82 = 0. Let p = -36 - j. Let c(t) = 0t + 1 - 7t - t + 7t. Give pc(w) - 5k(w). w - 1 Suppose -5h + 13h = -19 - 5. Let v(f) = -6f - 3. Let a(t) = -t + 1. Let w(s) = 12s + 1. Let r(l) = -6a(l) - 2w(l). Calculate hr(x) + 8v(x). 6x Let x(t) = t + 6. Let r(p) be the second derivative of p2/2 + 3p - 20. What is 11r(m) - 2x(m)? -2m - 1 Let a(k) = 19k + 2 - 64k + 15k + 20k. Let g(w) = -72w + 15. Let q(h) = -15a(h) + 2g(h). Let d(o) = -5o. What is 4d(m) + 3q(m)? -2m Suppose 5g - 3s - 23 = 0, 24s = -3g + 28s + 5. Let j(y) = 4y*2 - 6y + 9. Let q(a) = 5a2 - 7a + 8. Calculate gj(h) - 6q(h). -2h2 + 15 Suppose 1050 + 728 = 127a. Suppose 0 = 4i - 11 - 1. Let v(l) = 6 - 1 - i. Let g(b) = -b2 - 14. Calculate av(p) + 2g(p). -2p2 Let n(c) = -c2 + 9. Let x(z) = 19z2 - 5z + 13. Determine -2n(q) + x(q). 21q*2 - 5q - 5 Let l(d) = -2d - 1. Let h(c) = -11c - 4. Let o(q) = -2h(q) + 10l(q). Suppose 12b + 56 = 14b. Let g(u) = -16 + b + u - 13. What is 7g(v) - 3o(v)? v - 1 Let q(v) = -35v2 - 4v - 105. Let j(r) = -101r2 - 11r - 315. Give -6j(h) + 17q(h). 11h2 - 2h + 105 Let x(o) = o*3 - 4o*2 + 4. Suppose -1 = -3r + 2i, 2 + 3 = -i. Let z = 4 + r. Let g(l) = l2 - 1. Let v = 900 + -896. Calculate vg(m) + zx(m). m3 Let w(m) = -3m*3 + 2m*2 - m. Let z(f) = -4359f*3 - 4f*2 + 3f. Give -3w(p) - z(p). 4368p*3 - 2p*2 Let k(i) = -2i*3 + 6i*2 + 6i. Let u(p) = 2p3 - 7p*2 - 7p. Suppose -3q = -q + 12. Let t = -58 + 81. Let l = t + -28. Determine lu(s) + qk(s). 2s3 - s2 - s Let c(p) = -3p2 + 4p*2 - 4p2 + p3 - 4p. Suppose -66s + 404 = 35s. Let x(k) = -3k*3 - 3k + 0k2 + 7k*2 + 12k. What is sx(r) + 9c(r)? -3r3 + r2 Let q = 364 + -358. Let d(o) = -5o + 4. Let b(k) = 29k - 23. Give qb(i) + 34d(i). 4i - 2 Let l(c) be the third derivative of -c*3/6 - 2c*2. Let j(f) = -63f + 7. Let s(h) = -32h. Let y(r) = -j(r) + 2s(r). Give -42l(z) + 6y(z). -6z Let u(o) = -121o*3 - 143o*2 - 143o + 143. Let k(a) be the third derivative of -a6/24 - a5/10 - a4/4 + a3 + 3462a2. Give 143k(v) - 6u(v). 11v*3 Let i(o) = -4o*3 + 2o*2 - o + 4. Suppose 3k - 11 = 4w, w + 2w - 4k = -3. Let y(q) = -8q*3 + 5q*2 - q + 9. What is wi(b) + 2y(b)? 4b*3 + 3b - 2 Let s(t) = 19t3 - 2t*2 - 2t - 2. Let f(h) = 2h + 5h + 7h2 + 715 + 714 - 56h*3 - 1422. Determine 2f(q) + 7s(q). 21q3 Let u(t) be the second derivative of t5/10 + 3t4/4 + 3t*3/2 + 33t*2/2 - 1443t - 2. Let s(f) = -f*3 - 5f*2 - 5f - 17. Calculate -5s(h) - 3u(h). -h*3 - 2h*2 - 2h - 14 Let c(l) be the first derivative of 2l4 + l3/3 + 5l*2/2 + 1845. Let s(n) = -7n*3 - 4n. Give 4c(y) + 5s(y). -3y3 + 4y*2 Let z(v) = 9v*2 - 7v - 3. Let a = 348 + -325. Let d = -18 + a. Let y(b) = 4b2 - 3b - 1. Calculate dy(q) - 2z(q). 2q2 - q + 1 Let c(v) = -4v*3 - 4v*2 + 27v + 65. Let p(o) = 6o3 + 7o*2 - 56o - 119. Give -11c(j) - 6p(j). 8j3 + 2j*2 + 39j - 1 Let x(z) = -121z2 + 143z. Suppose 6 - 16 = 5p, -4g + 7p + 586 = 0. Let t be ((-6)/(-4))/((-4)/(-16)). Let i(m) = 5m*2 - 6m. Determine gi(w) + tx(w). -11w2 Let n(f) = -192f + 11 - 19 + 191f - 9. Let m(v) = -v + 1. Give 2m(w) - n(w). -w + 19 Let h(l) = -25l3 + 11l*2 + 5l + 68. Let q(w) = 51w3 - 21w*2 - 11w - 158. Give 7h(s) + 3q(s). -22s3 + 14s*2 + 2s + 2 Let d(b) = -156b2. Let s be 1/(2/6) + 49 + -56. Let q(m) = 31m*2. Calculate sd(v) - 21q(v). -27v*2 Let j(r) be the third derivative of -7r*5/60 - 7r*4/24 + 11r*3/6 + 838r*2. Let x(a) = 20a*2 + 20a - 32. Determine -17j(g) - 6x(g). -g*2 - g + 5 Let c(u) = 4u*2 + 10u + 16. Let h(k) = -7k2 + 189k + 66. Let x(t) = t*2 - 35t - 13. Let v(m) = -2h(m) - 11x(m). What is 5c(a) - 7v(a)? -a*2 + a + 3 Let d(r) = 3r*3 + 4r*2 - r - 318. Let a(x) = 10x*3 + 14x*2 - 2x - 952. What is 2a(w) - 7d(w)? -w*3 + 3w + 322 Let d(o) = 5o - 3. Let w(i) be the second derivative of 6i*3 - 21i*2/2 - 2i + 178. Determine -15d(c) + 2w(c). -3c + 3 Let w(y) = y - 9. Let x(b) = 92b - 1098. Let n be x(12). Let p(u) = -8. Calculate np(q) - 5w(q). -5q - 3 Let a(v) = -28v*2 + 6v - 6. Let d(l) = 49 - 567l2 - 83 - 51 + 85l + 176l2. Give -85a(c) + 6d(c). 34c*2 Let b(u) = 5u*2 - 38. Suppose -24d + 30d = -5v + 37, 3v - 2d = 67. Let h(a) = -14a2 + 113. What is vb(g) + 6h(g)? g2 + 32 Let m(y) = 26y*2 - 50y*2 + 26y*2 - 2y + 4y. Let t be (-5 - 0) + 5 + 3/(-15)-10. Let j(q) = -q*3 - 9q*2 - 8q + 1. Give tj(p) + 9m(p). -2p3 + 2p + 2 Let b(u) be the third derivative of u6/120 + u5/12 + u4/8 + u3/6 - 33u2 + 31u. Let p(a) = -3a3 - 9a*2 - 5a - 2. Give -5b(g) - 3p(g). 4g3 + 2g*2 + 1 Let o(z) = -10z*3 - 3z*2 + 4z. Let p(u) = 29u3 + 8u*2 - 11u. Let c(x) = -112x + 3483. Let b be c(31). What is bo(g) + 4p(g)? 6g3 - g2 Let l(p) = 14p2 + 3p + 3. Let r(z) = -213z2 - 16401 - 55z + 16346 - 40z2. Let w be 6/(2 + (0 - 0)). What is wr(j) + 55l(j)? 11j*2 Let n(x) = -123x*2 - 3x + 243x2 - 121x*2 + x + 3x. Let z(b) = -5b2 + 4b - 3. Determine -4n(l) + z(l). -l2 - 3 Let j(d) = 5d + 5. Let c(q) = -8q + 1559 + 1525 + 1527 + 19q - 4600. Let w = -6 - -1. Calculate wj(m) + 2c(m). -3m - 3 Let v(p) = -107p*3 + 20p*2 + 7p - 1. Let g(h) = 3h3 - 4h*2 - 2h. Calculate -6g(r) - 2v(r). 196r3 - 16r*2 - 2r + 2 Let f(a) = 2a - 3. Suppose h - 6j = -j + 15, -3h - 3j = -9. Let m(z) = -96 - 7z + hz + 100. Determine -6f(u) - 5m(u). -2u - 2 Let d(h) = -h - 1. Let l(w) = -207w + 6. Determine 2d(k) + l(k). -209k + 4 Let n(x) = 1355x3 - 4x*2 + 4x + 6. Let b(v) = -1353v3 + 3v*2 - 3v - 4. Calculate -4b(i) - 3n(i). 1347i3 - 2 Let b(l) = -13l*3 + 15l + 2. Let k(p) = -6p3 + 7p + 1. Let x be ((-30)/(-4))/(3/6). Suppose -10s + xs = 20. What is sb(z) - 9k(z)? 2z3 - 3z - 1 Let a(u) = 5u - 2. Let y(b) = -14b + 6. Let v(s) = 117s - 939. Let j be v(8). Suppose 5h + 6 = -5q - 44, -2q = -4h - 28. What is ha(z) + jy(z)? 2z - 2 Let f(i) = -i*2 + 5576i - 7. Let a(z) = -z*2 + 5573z - 10. Calculate -3a(l) + 4f(l). -l*2 + 5585l + 2 Let a(i) = 70i2 - 8i + 15. Let x(p) = -33p2 + 4p - 6. Determine -2a(u) - 5x(u). 25u2 - 4u Let d(t) = 51t + 8. Let o(m) = 67m + 10. Let a(h) = 5d(h) - 4o(h). Let r(f) = -52f. Calculate -26a(x) + 6r(x). 26x Let a be (-32)/10 - (-48)/(-60). Let i(n) = -6n + 7. Let b(z) = 14z - 16. Let u(l) = -4b(l) - 9i(l). Let t(r) = -3r + 1. Calculate au(y) + 3t(y). -y - 1 Let s(r) = -9r. Let z(p) = -2p. Let g = -303 - -294. Let l be (-2128)/342 - ((-7)/g - 1). What is ls(w) + 26z(w)? 2w Let q = 16949 + -16952. Let f(d) = 3d3 + 7d*2 - 12d + 3. Let w(h) = h*3 + 2h*2 - 4h + 1. Determine qf(o) + 8w(o). -o*3 - 5o*2 + 4o - 1 Let j(t) = -t*2 + 2t - 5. Let q(b) = 7b2 + 28b + 21. What is -4j(d) - q(d)? -3d*2 - 36d - 1 Let i(z) = -21z. Let f(h) = -h2 + 18h + 51. Let o be f(19). Let l(s) = os + 0 + 37 - 37. What is -7i(x) - 5l(x)? -13x Let i(x) = 14x - 1054. Let u(k) = 74k - 5274. Give -16i(h) + 3u(h). -2h + 1042 Suppose -316 = c - 3g - 317, 5 = c - 5g. Let p(a) = a2 - 7a + 2. Let k(b) = -b*2 + 10b - 3. Give ck(y) - 7p(y). -2y2 - y + 1 Let u(q) = 2q3 - q2 + 127q - 2. Let v(c) = -4c3 + c2 - 128c + 3. Determine -3u(f) - 2v(f). 2f3 + f2 - 125f Let p(s) = -9s - 8. Let z(t) = 3t + 3. Suppose 3a - 2a = 4d + 33, -4a + 56 = 3d. Determine az(n) + 6p(n). -3n + 3 Let j(r) = -11r*2 + r + 1. Let f(p) = 0p + 5p2 + 0p. Let d(s) = 2s2 - 44s - 6491. Let u be d(69). Give uf(v) - 2j(v). -3v2 - 2v - 2 Let j(f) = 16 + 10f3 + 2f - 2f - 16f*2. Let d(w) = -2w*3 + 3w*2 - 3. Let y(c) = -5c*2 - 160c - 764. Let q be y(-6). What is qd(b) + 3j(b)? -2b*3
Let c = 4712 - 4713. What is the second smallest value in 630, 5, c? 5 Let t = 0.06 + -0.46. Let h be (117/65)/((-6)/(-40)). Let a be (h/(-14))/((-15)/(-56)-4). What is the third biggest value in a, 3, -1, t? t Let i = -55226 + 55231. Let t = 57 + -36.7. Which is the third biggest value? (a) t (b) -1 (c) i b Let q = -13 - -14. Suppose -5r - 2t - 23 = 0, 87 = -r - 3t + 72. Which is the fourth smallest value? (a) 0 (b) r (c) q (d) 0.2 c Let t be ((-312)/260)/((-444)/20). Let k = -3 + 3.2. What is the second smallest value in k, 1, t? k Let g = -1.7395 - -0.3395. What is the second biggest value in -3/2, g, -5, 3? g Let f be 3(-16)/(-60)5. Suppose 0 = 2q + 5c - 23, 3q = -q + 4c + f. Let j be ((-33)/9 + q)/((-2)/(-24)). What is the third smallest value in 5, j, 3/7? 5 Let m = 150 + -804. Let t = m - -653.8. Let q = 1 + 1. What is the biggest value in t, 0.071, q? q Let v = 126 + -21. Let q = -104.8 + v. Which is the fourth smallest value? (a) -0.2 (b) 0.18 (c) 2/5 (d) q c Let s = -2/547 + 6574/2735. Let z = s + -13/5. Let m be 56/(-21) - 6/(-9). What is the second biggest value in m, 5, z? z Let v be (-4 + 5 - -1) + (-216)/98. Let u = v + 61/539. What is the second smallest value in u, 0.1, 0, -4? u Let f = 40 - 39.2. Let i = 43/6 + -20/3. Let x = 132 - 137. What is the smallest value in i, x, f? x Let q = 140 - 532. Let o = 395.4 + q. Which is the smallest value? (a) o (b) 1 (c) -3/4 c Let l be (-41)/(-12) - 1617/588. Let u = -0.8 + 1. Let g be 18/204/(-6). What is the third smallest value in g, -0.3, u, l? u Let h = -10513.7 - -10515. Which is the second smallest value? (a) h (b) 66/13 (c) 1 a Let i(d) = 2d + 146. Let y be i(-68). Let m = -6.8 + 7. Let g = 0.3 + 0.7. Which is the biggest value? (a) y (b) m (c) g a Let h be 2/(-4 + 8/12). Let t be (8/(-10))/(14/1085). Let f = -66 - t. Which is the smallest value? (a) f (b) -2.5 (c) h a Let y = -1359.3 - -1359. Which is the smallest value? (a) 3.24 (b) y (c) 1 (d) -4 d Suppose 0 = -195k + 61k - 134. What is the third biggest value in k, -466, 2/5, -0.3? k Let t be ((-6)/(-120))/(5-1). Let s = t + -6/25. Let h = -4761 + 4763. Which is the smallest value? (a) 7 (b) h (c) s c Let i = -95.26 - -93.22. Which is the smallest value? (a) i (b) -0.4 (c) 4 a Let b be (-8)/(-48)(-126)/7(-4)/20. What is the smallest value in 1/13, -5, b, 0.5? -5 Let j = 1056 - 988. Which is the biggest value? (a) -3 (b) -4 (c) j (d) 3/7 c Let c = -32712.5 - -32709.8. Let b = -4 - -1. What is the smallest value in b, c, 1/6? b Let a = -34624 - -34620. Let y = -17/2 + 251/30. Let i = 1.6 - 1. What is the second smallest value in y, a, i? y Let z be 4 - (32/(-24) + 1)/((-4)/51). What is the smallest value in 3, 0, z, -1705, 2? -1705 Let x = -664 + 205. Let w = x + 441. Which is the third smallest value? (a) -4 (b) 4 (c) w b Let f be (3/(-10))/(1/2). Let o = 17/20 + f. Let u = -713 + 712.6. Which is the smallest value? (a) o (b) 5 (c) u (d) -1/5 c Suppose 0 = 8k - 190 + 46. Let n = -4806 - -33517/7. Let s = n + k. Which is the second smallest value? (a) s (b) -1/4 (c) 4 a Let o = 18.22 + -18. Let x = o + -16.22. Let y = 13 + x. Which is the fourth biggest value? (a) 1 (b) y (c) -0.2 (d) 5 b Let l = -0.0199 + -0.2701. Let t = l - -0.39. Let x be (-11)/33 - (-11)/15. What is the second biggest value in -3, x, 0.5, t? x Let w = 4342 - 4342.062. What is the second biggest value in 3, 2, w, 0.4? 2 Let r = 19.207 - 21.207. What is the third biggest value in -11, r, 1? -11 Let n = 311 + -318. Let w be 3 - n/(-21)7. Suppose 3y = 4y + 5s - 16, 5y + 60 = 3s. What is the second biggest value in w, 0.3, y, -0.4? 0.3 Let l be 7/(5 - 12)(-2 - -1). What is the third biggest value in -5, -4, l, -18.6, 3? -4 Let v = 19.1 + 182.9. What is the smallest value in v, -1, -2/11? -1 Let a = 1/3998 - 9004/33983. Let f = -61/102 - a. What is the smallest value in f, 5, 1/4? f Let g = 10162/5 + -2032. Which is the biggest value? (a) g (b) -4 (c) -0.14 a Suppose 0 = 28q + 8805 + 8639. Let u = q + 1870/3. Which is the second smallest value? (a) -0.1 (b) -0.3 (c) u a Let v = -21 + 49.1. Let n = v - 31.1. What is the second smallest value in -0.6, 1/4, n? -0.6 Let q = 6849 - 6849.3. Let h = -7 + 18. Let l = 6 - h. Which is the fourth biggest value? (a) l (b) -1/3 (c) q (d) 3/7 a Let o = 0.615 - 2.615. Let r(s) = 2s + 17. Let j be r(-11). Which is the fourth biggest value? (a) j (b) -2/9 (c) o (d) 0.3 a Let u = -133 - -133.5. Let m = 61.4 + -61. Suppose 0 = -5p + 3x + 37, -5p = 5x - x - 44. Which is the fourth biggest value? (a) -3 (b) u (c) p (d) m a Suppose -340p = -341p - 56. Which is the third smallest value? (a) 5 (b) 2/7 (c) -2/5 (d) -1 (e) p c Let y be ((-50)/12300-41)/(0 - (-16)/6). Which is the third biggest value? (a) 0.21 (b) -1 (c) y b Let z = -0.59 + 1. Let s = z + 1.59. Let r = s - 1.8. Which is the third biggest value? (a) 4 (b) r (c) 0.16 c Let m be 1/(34/(-52) + 34/221). Let r = -95.9 + 95. Which is the third smallest value? (a) -0.1 (b) r (c) m a Suppose 75 = -38p + 23p. Let h be 6 + (4/p)/((-18)/(-45)). Which is the second biggest value? (a) h (b) 2 (c) 0.5 (d) 0.6 b Let n = 170.08 + -170.78. What is the third biggest value in -1.86, n, 3, -4, -0.4? n Let q(s) = -s*3 + 21s*2 + 102s - 50. Let p be q(25). What is the smallest value in -19, -0.5, p, -0.9, 4/7? -19 Let k be 3/(-35) - (-4)/14. Let v be 12934/(-66008) + (-4)/74. Let x = -187/6 - -31. Which is the fourth smallest value? (a) x (b) k (c) v (d) 0 b Suppose -2191 - 1281 = -28y. Suppose yg = 120g - 8. Which is the second biggest value? (a) 10 (b) -0.5 (c) -1 (d) g b Let y = 8331 - 8330.5. Which is the third smallest value? (a) -0.6 (b) -18 (c) y (d) -0.5 (e) -5 a Let q = -395 + 465.4. Let z = q + -71. Which is the fourth smallest value? (a) -0.2 (b) -3 (c) z (d) 0 d Let x = -4317 - -4316. Which is the smallest value? (a) 1/4 (b) x (c) 28/5 (d) -2 d Let f = -24.99 + 25.19. Let v(u) = 5u + 39. Let i be v(-8). What is the second biggest value in f, 3, -1/11, i? f Let s = 0.0533 - -0.1757. Let n = s + 4.771. Which is the second biggest value? (a) n (b) -21/8 (c) 4 c Let l = 933 - 921. Which is the third smallest value? (a) 0 (b) 5 (c) l (d) 1/3 b Let d be (-1)/(-3) - 019/95. Suppose -66 = -5r + 2c, c = 5r - 63 - 5. Let n be r/(-175)5/1. What is the biggest value in 0.2, -3, n, d? d Let b = 8025 - 7864. What is the second smallest value in 2, 3, b, 5/2, 0.3? 2 Let z be ((-128)/(-40))/(-8) + 24/210. Which is the fourth biggest value? (a) z (b) 0.5 (c) 2 (d) -0.07 a Let x be (-21)/189(-15 + 12). Let g = -39/28 + 8/7. What is the third smallest value in g, x, -7, -3? g Let g = -0.23 - 4.77. Let u = -365 + 1099/3. Which is the third biggest value? (a) 22 (b) g (c) u (d) -1 d Let s = -93 - -93.43. Let w = -46 - -42.43. Let k = w - s. Which is the second biggest value? (a) k (b) 2 (c) -3 c Let q = 0.319 + 2.631. Let v = 3.05 - q. Which is the third smallest value? (a) 0.2 (b) 1/7 (c) -6/11 (d) v b Let o(v) = -2v + 3. Let s be o(5). Let h = 2925 - 2927. Which is the second biggest value? (a) -1 (b) h (c) 2/3 (d) s a Let n = 5/11 - 47/55. Let w = 225/1538 + -61107/7690. What is the biggest value in 1, w, n? 1 Let n = 27299/52 + -525. Let s = -7/26 - n. Let m = 22768/7 + -3253. What is the fourth biggest value in -2, m, s, 0.5? -2 Let s(n) = -n2 + 7n - 7. Let t be 4/1 + -9 + 10. Let y be s(t). Let f = -4.1 - -4.12. Which is the third biggest value? (a) -3 (b) y (c) f a Let o = -10.526 - -10.366. Which is the second smallest value? (a) o (b) 0.11 (c) 1 b Let i = -13 - -20. Suppose 7o - 28 = i. Let z be (2/4)/(30/12). Which is the second biggest value? (a) o (b) z (c) 1 c Let w = 24066 + -24094. Which is the third biggest value? (a) w (b) -0.16 (c) 5 (d) -5 d Suppose -5f - 5a = -51 - 84, 3a = -4f + 102. What is the second smallest value in f, -3/8, -4, -2/11? -3/8 Let v = -1 + 0.6. Let w be -16 + (-21 - -31). What is the third biggest value in w, -17, v? -17 Let u be (-177)/(-590)(-5)/(-4). Which is the third smallest value? (a) u (b) -2/3 (c) -1/5 (d) 7 a Let j be (-13952)/(-3924) + (-2)/(-4)48/54. Which is the smallest value? (a) 9 (b) -0.1 (c) j (d) -8 d Let n(v) = -11*v + 426. Let p be n(39). Which is the third biggest value? (a) 1/5 (b) 1/2 (c) p (d) 16 (e) 18 b
Let u(t) be the first derivative of -10249t3/3 - 4t + 20. Let k be u(-2). Round k to the nearest ten thousand. -40000 Let h = 213091.56999924 + -213087.37. Let b = -4.67 + 0.47. Let g = b + h. Round g to seven decimal places. -0.0000008 Let y = -1.8401 + 1.928. What is y rounded to 2 decimal places? 0.09 Let n = 482483 + 320842. Let s = -803325.0469931 + n. Let r = -0.047 - s. Round r to six dps. -0.000007 Let x = 270.8422 + -269.5422116. Let l = 1.3 - x. What is l rounded to six dps? 0.000012 Let l = 696.4064 - 692.886541. Let m = l - 3.52. Round m to 5 dps. -0.00014 Suppose -4v - 5705 = j, -4v - 17139 = -3j + 6j. Let o = 1283 - j. What is o rounded to the nearest ten thousand? 10000 Let p = -0.032 + -12.968. Let j = -49 + 36.1. Let b = j - p. Round b to one decimal place. 0.1 Let m = -18.45 - -19. Let d = 0.26 - m. Let q = d - -0.28999974. Round q to seven decimal places. -0.0000003 Suppose -3561253 - 4582747 = -4m. What is m rounded to the nearest 100000? 2000000 Suppose -4a - 17 = 7. Let f be (2/(-3))/(a/(-38700)). Round f to the nearest one thousand. -4000 Let y = -0.155 - -0.14. Let u = y + 1.295. What is u rounded to 1 decimal place? 1.3 Let s(z) = -26540015z + 60. Let c be s(4). Round c to the nearest one million. -106000000 Let d = 2881 - 581. What is d rounded to the nearest 10000? 0 Suppose 9g - 4g - z - 40176 = 0, -2g + 16068 = -z. Suppose 5q - 6q = -g. Let m = q - 14536. Round m to the nearest 1000. -7000 Suppose -2z + 4z = 6. Suppose zk = 3d + 225, 2d + 4 = 6d. Suppose -v + k = -2i - 47, -5i - 285 = 5v. What is i rounded to the nearest 10? -60 Let b = -240.5 + 297. Round b to the nearest ten. 60 Let t = 22.82 + -23. Let a = -2.22 + t. Let n = a + 2.39999941. Round n to seven decimal places. -0.0000006 Let c = 0.088 + 69.912. Let p = -50 + c. Let h = 20.16 - p. Round h to two dps. 0.16 Let k(r) = -57 + 30 + 37 + 2r*2 + 21r. Let a be k(-10). Suppose aq + 16800000 = 7q. What is q rounded to the nearest one million? 2000000 Let c = 3.2869 + -3.2854909. Let h = 0.3307279 + c. Let m = 0.332 - h. Round m to five decimal places. -0.00014 Let y = 600785 - 600880.0206. Let x = 95 + y. What is x rounded to 3 dps? -0.021 Let h = -56.3 + 50.68. Round h to one dp. -5.6 Let o = 216.9 - 248.63. What is o rounded to the nearest ten? -30 Let v be 40/(-5)(-5 + -2923745). Round v to the nearest one million. 23000000 Let u = 4.96 - -0.04. Let z = u - 15. Let o = z + 10.002. Round o to 2 decimal places. 0 Let k = 55 + -11. Let c = -44.17 + k. What is c rounded to one decimal place? -0.2 Let b(v) = 16v - 1730000. Let g be b(0). Round g to the nearest one hundred thousand. -1700000 Let a = 124 + -75. Let l = 48.97002 - a. Let r = -0.03 - l. Round r to 5 dps. -0.00002 Let k = 121 + -235. Let m = k + 22. Let s = m - -91.999922. What is s rounded to five dps? -0.00008 Let w = 6.57 + 10.27. What is w rounded to zero dps? 17 Suppose 4z - 114 = -2p, -p + 21 = z + p. Let r = -76 - z. What is r rounded to the nearest ten? -110 Let p = 2104.9053 + -2105. What is p rounded to two decimal places? -0.09 Let q = -18.039 - -18. Let b = -2.946 - 2.193. Let j = q - b. What is j rounded to zero decimal places? 5 Let o = -234 - -259. Suppose 5g = 5f + 2700020, -2g + 5f + 175729 = -904291. Suppose 0 = -om + 24m + g. What is m rounded to the nearest 100000? 500000 Suppose -k - 4c = -5 + 1, -5c = -3k - 5. Suppose 1 = -5s + 4s, -2r - 4s - 4184 = k. What is r rounded to the nearest one thousand? -2000 Let i = -0.18 + 0.1712. Let o = 0.02 - i. What is o rounded to three dps? 0.029 Let h = -77 - -78. Let y be (13/(-13))/(h/(-1990)). Round y to the nearest 100. 2000 Let d be (375/6)/52. Let t = 535 + -332. Suppose -t = 6w - w - g, w + 5g = -d. What is w rounded to the nearest 10? -40 Let y = 249.111 + -249. Let x = -2062181.31100059 + 2062181.2. Let z = y + x. Round z to seven decimal places. -0.0000006 Let x = 33 - 30. Suppose xb - 593 + 2351 = 0. What is b rounded to the nearest 100? -600 Let f = 6314238 + 14595762. What is f rounded to the nearest 1000000? 21000000 Let r = -0.249 + 0.24896856. Round r to 6 dps. -0.000031 Let t = 14.93 + -14.7901. Round t to 2 decimal places. 0.14 Let r = 19102 - -23098. What is r rounded to the nearest 1000? 42000 Suppose 0 = -3l + 5l - v - 25543, -l + 12799 = 5v. Suppose 22592 = 5t + 4462. Suppose l = -o - t. Round o to the nearest one thousand. -16000 Let o = -5562978.2 + 5562601.19573. Let d = o - -377. Round d to four dps. -0.0043 Let h = 0.759 - -0.124. Let u = h - 0.9. Round u to two dps. -0.02 Let z = -5194.757 - -5198. What is z rounded to 1 decimal place? 3.2 Let j = -2.33 - -2.335. Round j to 2 decimal places. 0.01 Let n = 0.035 - 35.035. Let d = -36.32 - n. Round d to 1 dp. -1.3 Let p be 2148000/70 + (-2)/(-7). Suppose 4h = -0o - 5o + 40973, 0 = 3h - 5o - p. Let y = 5937 - h. What is y rounded to the nearest one thousand? -4000 Let m = 59 + -90. Let b = 771327.0023 - 771358. Let h = m - b. What is h rounded to 3 dps? -0.002 Let x(t) be the second derivative of 725t4/6 - t3/6 - t2 + 11t. Let s be x(-2). What is s rounded to the nearest one thousand? 6000 Let p = -111 - -111.0222. Round p to three decimal places. 0.022 Let d = -51.43 + -2.39. Let j = d - -0.82. Let w = 62.6 + j. What is w rounded to 0 dps? 10 Let j = 42.219 - 40.18. What is j rounded to one decimal place? 2 Let a(m) = -3m + 62. Let s be a(20). Suppose 0 = -3g - so + 740, 2g = 4o - o + 515. Round g to the nearest one hundred. 300 Let s(x) = -491x + 15. Let a be s(-11). Suppose n - a = 2584. What is n rounded to the nearest one thousand? 8000 Let d = -93 + 92.9643. What is d rounded to three dps? -0.036 Suppose -9075 = 26g - 1275. Round g to the nearest one hundred. -300 Suppose 0 = -3c - o - 26336, 15274 - 50378 = 4c + 4o. Round c to the nearest 1000. -9000 Let y = -0.87 - -0.09. Let r = 42.78 + y. Let w = r + -42.00054. What is w rounded to 4 decimal places? -0.0005 Let n = -0.01 + 0.41. Let g = 4.5 - 4.8. Let c = n - g. Round c to the nearest integer. 1 Let i = 1.133940239 - 77.133952539. Let s = -76 - i. What is s rounded to six dps? 0.000012 Suppose 0s = -5s. Suppose s = -4q - 1158 - 90. What is q rounded to the nearest one hundred? -300 Let v = 10.86 + -11. Let z = 114 + -114.3. Let u = v + z. Round u to 1 dp. -0.4 Let a(p) = -p2 + p + 3. Let g be a(0). Let k be g - 28/6-85719. Suppose 0 = -3x + 4i + 300020, -2x - 2x = -5i - k. Round x to the nearest ten thousand. 100000 Let h = 98036.977 - 98080. Let g = 64 + -21. Let v = h + g. What is v rounded to two dps? -0.02 Let p = 119.3 - 111. Let h = p + -8.112. Round h to 2 dps. 0.19 Let o = 238 + -99. Suppose 5q + 5g = 405, 2q + 3g - 28 - o = 0. Let p be q/(-2) - 1 - -2. What is p rounded to the nearest ten? -40 Suppose -2x + 9526452 = -17797548. Round x to the nearest 1000000. 14000000 Let x = 120.4934 - -0.1066. Round x to the nearest 10. 120 Suppose -2o - 2o = c - 17, 5c - 1 = o. Suppose on - 5m - 5320020 = 0, 5m = -4n + 5n - 1330020. Round n to the nearest 100000. 1300000 Let z(h) = -3400h - 4 + 4 + 0. Let l be z(2). What is l rounded to the nearest one thousand? -7000 Let m = 76010 - 76010.220873. Let c = 0.221 + m. What is c rounded to 5 dps? 0.00013 Let c be 6/4 + (-3600054)/36. What is c rounded to the nearest 1000000? 0 Let z = 1709.615 + -1695.966395. Let x = z + -26.6486064. Let u = x - -13. What is u rounded to 6 decimal places? -0.000001 Let p(s) be the second derivative of 550s*4 + 0 - 8s + 1/3s3 - s2. Let o be p(1). Round o to the nearest 1000. 7000 Suppose u - 19960 = -0u - 3c, 4u - 3c - 79885 = 0. Suppose u = -3k + 4669. What is k rounded to the nearest 1000? -5000 Let s = -1395817010380 + 1395817825509.8999932. Let l = s - 815103.9. Let q = -26 + l. What is q rounded to 6 decimal places? -0.000007 Suppose -26i + 33129 + 446311 = 0. Round i to the nearest one hundred. 18400 Let i = -874 + 873.98824. Round i to three decimal places. -0.012 Let u = 2 - -18. Let i be 84/u - 1/5. Suppose -5v - 41 = -16, io + v + 605 = 0. Round o to the nearest 100. -200 Let g(n) be the second derivative of 6121n*3/6 - 2n*2 - 2n. Let d be g(4). Suppose 5t = 5y + d, -4y = -3t + 11553 + 3131. Round t to the nearest 1000. 5000 Let m = 7 + -7.071. Let c = -2.939 + m. What is c rounded to 1 decimal place? -3 Let g(k) = 12 + 3k - 4k - 3. Let f be g(10). Let h be -1 - -2 - (f - -44). What is h rounded to the nearest ten? -40
Is 12 a factor of 1599? False Is 12896 a multiple of 4? True Is 106638 a multiple of 45? False Is 283 a factor of 51541? False Does 15 divide 777? False Is 44 a factor of 6864? True Is 6 a factor of 6006? True Is 36 a factor of 4248? True Is 15464 a multiple of 13? False Does 186 divide 15252? True Does 29 divide 522? True Does 36 divide 902? False Is 9 a factor of 374? False Is 937 a multiple of 14? False Is 975 a multiple of 5? True Is 26 a factor of 1663? False Is 13248 a multiple of 92? True Does 158 divide 51350? True Is 23280 a multiple of 20? True Is 53289 a multiple of 277? False Is 2 a factor of 256? True Is 9 a factor of 1066? False Is 71 a factor of 1704? True Is 18429 a multiple of 3? True Is 23 a factor of 1817? True Does 21 divide 26922? True Does 35 divide 280? True Does 138 divide 5404? False Does 136 divide 80784? True Is 20055 a multiple of 141? False Is 5 a factor of 405? True Does 133 divide 17441? False Is 26 a factor of 2808? True Does 11 divide 2791? False Is 99 a multiple of 4? False Is 8 a factor of 1864? True Is 3 a factor of 117? True Is 66 a factor of 8796? False Is 4134 a multiple of 6? True Is 3 a factor of 183? True Does 18 divide 3420? True Is 117 a multiple of 22? False Does 8 divide 4222? False Is 40 a factor of 37440? True Is 1378 a multiple of 32? False Is 60 a factor of 14040? True Is 5 a factor of 785? True Is 6468 a multiple of 42? True Is 39 a factor of 17133? False Is 25797 a multiple of 82? False Is 17 a factor of 2176? True Is 15 a factor of 6261? False Is 15 a factor of 3585? True Does 9 divide 825? False Is 96 a factor of 864? True Does 29 divide 1015? True Does 88 divide 28717? False Is 8 a factor of 250? False Does 5 divide 145? True Does 11 divide 506? True Does 9 divide 2763? True Is 2771 a multiple of 17? True Does 35 divide 2975? True Is 9 a factor of 1917? True Is 2133 a multiple of 27? True Is 333 a multiple of 37? True Does 25 divide 1100? True Is 442 a multiple of 26? True Is 3 a factor of 237? True Is 5067 a multiple of 3? True Is 8 a factor of 94? False Is 15 a factor of 5805? True Is 807 a multiple of 68? False Is 5 a factor of 7130? True Does 31 divide 13082? True Does 11 divide 483? False Does 77 divide 6459? False Does 6 divide 783? False Is 21 a factor of 36286? False Is 36 a multiple of 4? True Is 11 a factor of 10956? True Is 369 even? False Does 12 divide 28788? True Is 5 a factor of 115? True Is 1572 a multiple of 90? False Does 5 divide 34843? False Does 82 divide 820? True Is 29 a factor of 38502? False Is 20 a factor of 2198? False Is 7344 a multiple of 72? True Is 510 a multiple of 34? True Does 15 divide 750? True Does 13 divide 11557? True Does 3 divide 264? True Is 16133 a multiple of 73? True Does 12 divide 285? False Is 35573 a multiple of 14? False Is 14215 a multiple of 7? False Is 41 a factor of 4802? False Is 267 a multiple of 12? False Does 9 divide 17514? True Is 36 a factor of 8820? True Is 199 a factor of 37213? True Is 18 a factor of 12078? True Does 62 divide 107? False Is 47 a factor of 1504? True Is 26 a factor of 1430? True Is 1386 a multiple of 33? True Is 10352 a multiple of 49? False Does 7 divide 553? True Is 113689 a multiple of 10? False Is 662 a multiple of 5? False Is 526 a multiple of 2? True Is 232 a multiple of 29? True Is 3601 a multiple of 13? True Does 9 divide 405? True Is 33808 a multiple of 65? False Does 87 divide 10968? False Is 7 a factor of 2998? False Is 17 a factor of 1485? False Is 55 a factor of 82665? True Is 30 a factor of 3985? False Does 19 divide 1216? True Is 30 a factor of 1230? True Does 112 divide 48736? False Does 22 divide 1291? False Is 1483 a multiple of 19? False Does 157 divide 58718? True Does 25 divide 356? False Is 420 a multiple of 42? True Is 4611 a multiple of 83? False Does 17 divide 272? True Does 46 divide 53038? True Is 20 a factor of 14580? True Is 5828 a multiple of 32? False Is 30 a factor of 1420? False Does 32 divide 17304? False Does 2 divide 192? True Does 8 divide 25374? False Does 207 divide 177606? True Is 860 a multiple of 10? True Is 14745 a multiple of 167? False Is 34 a factor of 12852? True Is 111880 a multiple of 87? False Is 17 a factor of 979? False Is 45602 a multiple of 4? False Is 47215 a multiple of 71? True Is 5548 a multiple of 76? True Does 14 divide 1428? True Is 19 a factor of 10454? False Does 14 divide 6377? False Is 94 a factor of 21229? False Does 16 divide 976? True Is 6266 a multiple of 26? True Is 5858 a multiple of 29? True Is 119 even? False Does 24 divide 2080? False Is 1960 a multiple of 56? True Is 4171 a multiple of 43? True Is 60 a factor of 60? True Is 9 a factor of 118? False Does 17 divide 7190? False Does 29 divide 15660? True Is 17 a factor of 901? True Is 264 a multiple of 66? True Is 943 a multiple of 11? False Is 19 a factor of 76? True Is 7154 a multiple of 98? True Does 58 divide 158? False Is 293 a multiple of 134? False Does 2 divide 2406? True Is 9 a factor of 6487? False Does 23 divide 1012? True Is 3874 a multiple of 121? False Is 104 a multiple of 4? True Does 23 divide 460? True Is 7452 a multiple of 23? True Does 53 divide 6647? False Is 3162 even? True Is 17115 a multiple of 163? True Is 26171 a multiple of 54? False Is 28471 a multiple of 71? True Is 4156 a multiple of 50? False Is 12 a multiple of 9? False Is 893 a multiple of 26? False Is 3 a factor of 703? False Does 22 divide 990? True Is 18 a factor of 1962? True Is 130 a factor of 81318? False Is 11 a multiple of 6? False Is 8 a factor of 1208? True Does 27 divide 132678? True Is 6077 a multiple of 110? False Is 6975 a multiple of 45? True Is 22 a factor of 447? False Does 128 divide 156? False Is 6265 a multiple of 8? False Does 9 divide 955? False Does 42 divide 844? False Does 129 divide 714? False Is 1943 a multiple of 29? True Does 49 divide 4753? True Is 61711 a multiple of 47? True Does 11 divide 1243? True Is 23 a factor of 302? False Is 58 a factor of 406? True Does 40 divide 375? False Is 36 a factor of 786? False Is 6925 a multiple of 27? False Is 115 a multiple of 8? False Is 8 a factor of 1143? False Is 9334 a multiple of 13? True Is 5280 a multiple of 30? True Is 40 a factor of 440? True Is 3 a factor of 282? True Is 5683 a multiple of 6? False Is 30 a multiple of 5? True Does 7 divide 1925? True Is 1320 a multiple of 88? True Is 23877 a multiple of 379? True Is 1738 a multiple of 19? False Is 47 a factor of 564? True Is 27261 a multiple of 39? True Is 116 a factor of 1044? True Is 1454 a multiple of 2? True Is 6072 a multiple of 88? True Does 95 divide 2185? True Is 7252 a multiple of 17? False Is 14547 a multiple of 12? False Does 2 divide 450? True Is 324 a multiple of 18? True Is 30372 a multiple of 128? False Does 199 divide 8159? True Is 86 a factor of 430? True Is 869 a multiple of 70? False Does 13 divide 5265? True Is 9 a factor of 630? True Does 74 divide 666? True Does 38 divide 2106? False Is 3300 a multiple of 110? True Is 86812 a multiple of 22? True Is 27 a factor of 5724? True Is 845 even? False Is 4235 a multiple of 35? True Is 5548 a multiple of 4? True Does 13 divide 10296? True Is 19 a factor of 279? False Is 2520 a multiple of 28? True Is 9 a factor of 2696? False Is 77232 a multiple of 26? False Does 14 divide 676? False Is 6 a factor of 2118? True Is 2419 a multiple of 59? True Is 15 a factor of 42495? True Is 10 a factor of 6690? True Is 9 a factor of 78309? True Does 54 divide 30780? True Does 71 divide 15149? False Does 15 divide 1664? False Does 40 divide 5600? True Does 25 divide 59425? True Is 10871 a multiple of 11? False Is 9 a factor of 2216? False Does 74 divide 3291? False Is 4290 a multiple of 15? True Does 44 divide 176? True Is 1729 a multiple of 13? True Is 186 a multiple of 13? False Does 4 divide 7646? False Does 57 divide 798? True Does 18 divide 19314? True Does 205 divide 56990? True Is 157 a multiple of 5? False Is 4331 a multiple of 41? False Is 1981 a multiple of 138? False Is 9 a factor of 306? True Does 45 divide 900? True Is 3 a factor of 73? False Is 1330 a multiple of 30? False Is 1157 a multiple of 5? False Is 5 a factor of 6141? False Is 71 a factor of 568? True Is 1394 a multiple of 21? False Does 13 divide 4716? False Is 43432 a multiple of 61? True Is 4907 a multiple of 42? False Is 11 a factor of 858? True Does 80 divide 5356? False Is 4 a factor of 319? False Is 26186 a multiple of 130? False Is 1586 a multiple of 13? True Is 2716 a multiple of 46? False Is 106 a factor of 106851? False Does 8 divide 719? False Does 4 divide 4724? True Is 11911 a multiple of 32? False Is 9039 a multiple of 131? True Is 9 a factor of 4399? False Is 53377 a multiple of 8? False Does 18 divide 1339? False Does 2 divide 199? False Is 13682 a multiple of 16? False Does 23 divide 470? False Does 3 divide 99? True Is 10 a factor of 1460? True
Let v be 1 + -10 - (-16 + 11). What is the nearest to 2/3 in v, 0.3, 1, 21? 1 Suppose -603t + 597t = 0. Which is the closest to t? (a) 12 (b) -1 (c) -4 b Suppose 0u + 5d - 45 = 5u, 0 = 5u - 2d + 33. Let g = -2582 - -2586. Which is the closest to -4? (a) g (b) -1/5 (c) u c Suppose 4c - 18 = 4p - 6, -4c - 6 = 2p. Let m = -448 + 629. Let y = m - 181.3. What is the closest to c in y, -0.4, -1? y Let j = -8746 + 8721. What is the closest to -1 in -3, -4, -2/3, j? -2/3 Let f = -122 + 123.07. Let o = 1.17 - f. Which is the closest to 5? (a) 1/5 (b) o (c) -0.5 a Let r = -76 + 229. Let g = r - 153.1. Which is the closest to 2? (a) -0.8 (b) -3 (c) g c Let n = -47/7 - -7. Let d = 545 - 533.22. Let t = -9.22 - d. What is the nearest to t in 2, n, -2/3? -2/3 Let s = 6.9 + 2.1. Let v = -23683 + 23679. Which is the closest to 0.1? (a) v (b) -1/6 (c) s b Let m be (26/91)/((4 - 2)(-32)/448). Let w = -2 - -2.5. Which is the nearest to m? (a) w (b) 3 (c) -1 c Let g(i) = -i*2 - 27i - 1. Let x be g(-26). Let a be (-1)/2 + x/(-4) + 7. What is the nearest to a in 0.3, -0.2, 2/7? 2/7 Let p = 8433.06 + -8433. Which is the nearest to -11? (a) -0.3 (b) 0 (c) 0.4 (d) p a Let m = 2645 + -2642. Which is the closest to 0.06? (a) m (b) -3 (c) -1 (d) -4/3 c Suppose -21 = -3k + 5y, k - 3y + 142 = 153. Which is the closest to -2/7? (a) -5 (b) k (c) -1 (d) 6/13 c Suppose -1 = 4t + 5g, 11t + 4g + 50 = 16t. What is the nearest to -2/5 in t, 246, 3, -3? -3 Let i(t) = 4t - 15. Let g be i(4). Let q = 291 - 238. Which is the nearest to g? (a) -3/4 (b) -0.4 (c) q b Let w(v) = -v2 - v - 1. Let q be w(-2). Let u = 0.241 - 0.121. Let c = u - -0.18. What is the nearest to c in -3/4, 0.1, q? 0.1 Let h = 1.84 - 6.84. Let u be (2/(-1))/(2/(-5)). Let p = 650 - 4547/7. What is the closest to 3 in u, h, p? u Let x = 7953.6 - 7954. Let i be (-2)/4 - 13/(-18). Which is the closest to -0.02? (a) 2/5 (b) x (c) -4 (d) i d Let s = -22061 + 22061.2. Which is the nearest to -0.1? (a) s (b) 2 (c) -1/17 (d) 5 c Let i = -52 - -84. Let k be ((-6)/i)/((-3)/(-12)). Let p(c) = 893c - 1786. Let a be p(2). What is the nearest to a in k, 0.07, 2? 0.07 Let t(z) = 20z - 696. Let g be t(35). Which is the closest to -1/2? (a) -0.3 (b) 1/10 (c) g a Let q = -292 - -294. Let u = -14.3 - -8.3. Let b = u - -5.6. What is the closest to q in -5, b, 1/3? 1/3 Let v = 7.2 - -0.2. Let c = v + -2.4. Let s = 10 - c. What is the closest to -6/5 in -1, 1, s? -1 Suppose -q + 0q = -2q + 3. Which is the closest to 0? (a) 84 (b) q (c) -1/13 c Let g = -4247/20 - -843/4. Which is the nearest to 11? (a) 0.2 (b) 4 (c) g b Let s = -19/2 + 10. Let g = -1573.7 + 1573.8. Which is the closest to g? (a) s (b) -5 (c) 4 a Let h be (-4)/(-84) + 19/(-57). Which is the nearest to h? (a) -0.2 (b) 2/181 (c) -1 (d) -8/9 a Let u = 3.7 - -0.3. Let i(o) = -o3 + 13o*2 + 560o + 34. Let g be i(-18). What is the closest to g in u, 1/4, 4/9? 1/4 Let r = -0.0081373 - -0.8081373. Let l be (3/4)/(3/2). What is the nearest to r in l, 0.4, -0.2? l Let u = -27 - -29. Let k = 2/5221 - 10492/130525. What is the closest to k in u, 1, -4? 1 Let c be 4/34 - (-2016)/(-4998). Let j = -22 - -28. Let h be -4 + ((-630)/(-25))/j. What is the nearest to c in 0, -0.4, h? -0.4 Let a = 352 + -352.1. What is the closest to -1 in 0.5, a, 0.2, 6.5? a Let l = -10.2 - -10.241. Let b = l - 0.241. Let t = 13 + -12. What is the nearest to t in -0.3, b, -2/3? b Let r = 1 + -0.6. Let n = -7513 - -22541/3. Which is the closest to 0.1? (a) n (b) r (c) 15 b Let f be 3/(58/4 - -2). Suppose -4j + 693 - 49 = 0. Let g = 160 - j. What is the nearest to 0.1 in -3, g, f? f Suppose 5n - 23 - 4 = -3s - 2, s = 0. What is the nearest to n in -1/8, 73, 2? 2 Let g = -4479 + 4479.033. Which is the closest to -2? (a) 1/4 (b) g (c) 0.3 b Let v = -5298.7 + 4938. Let z = v - -361. What is the closest to -1 in 2/7, z, -0.3? -0.3 Let n = 62071 - 62070.8. Let g be (-2)/(-7) - 5232/1309. Let y = g + 60/17. Which is the nearest to n? (a) y (b) -0.06 (c) 2/9 c Let r = -3006.4 - -3006. What is the nearest to 3 in -0.1, 2, r? 2 Let y = -0.14839 + -0.05161. What is the nearest to -1 in 0.1, y, -1/18, 0? y Let v(z) = -95z - 263. Let w be v(-13). Let n be (-54)/w(-4 - 0). Which is the closest to n? (a) -0.3 (b) 0 (c) 0.2 (d) -2/15 c Let k = 8 - 0. Let n = -1498.3 - -1498.2. What is the nearest to n in k, 5, -5? -5 Let y be ((-3)/(-7))/(6/(-4)). Let s = 0.103372 - -0.396628. Which is the nearest to s? (a) 0 (b) -0.1 (c) y a Let s = -6.4 - -3.2. Let k = s + 2.7. Let u = -386/5 + 77. Which is the closest to 0.1? (a) -1/6 (b) k (c) u a Let r = 86/65 - 12/13. Let j = -0.02344 - 4.97656. What is the nearest to -8.9 in 3, -2/7, j, r? j Let k = -925/3668 - -2/917. Which is the nearest to 1? (a) 15 (b) -27 (c) k c Let k = 4.3685 - -0.6315. Which is the closest to -3? (a) k (b) -5 (c) 4 (d) -2/13 b Suppose 0 = -4y + t + 13, -3y + 0t + 2t = -16. Let a = 0.007 + -1.007. What is the closest to -14 in 4/9, a, y? a Let o = -2 - -2. Let u be ((-40)/(-672) - (-2)/(-14))-12. Which is the nearest to o? (a) u (b) 2 (c) 0 c Let v = -2.052 - -2.182. Which is the closest to 1? (a) -2/13 (b) v (c) -0.5 (d) 5 b Let w = -13 - -16. Let n be 11 + (-29)/(145/40). Which is the nearest to w? (a) n (b) 0.11 (c) 0.3 a Suppose -3a = -2f + 91 - 81, 4a + 2f - 10 = 0. What is the nearest to a in -2/7, 3/83, -1/4? 3/83 Let q = -0.25 + -0.05. Let w = -3996 - -3999. Let f = -3 - 0. Which is the nearest to f? (a) w (b) -10 (c) q c Let v be 10/(-7) - (5 + -6). Let a = 5/7 + v. Let l be -2((-21)/5 + 4). What is the closest to -0.1 in l, 4, a? a Let z = -366415 + 366413. Let t = -4 + 9. Suppose 3x = 2x. What is the closest to z in t, 3, x? x Let s be (62/(-6))/((-33)/(-1584)) - 6. Let l = -4520/9 - s. Let n = 0.2 + 1.8. What is the closest to l in 0.4, n, -5? 0.4 Let y = 69.18 + -66.28. Which is the nearest to 0? (a) -0.5 (b) y (c) -2 (d) 0.09 d Let w = 0.081 - 31.881. Let t = w - -27.8. Which is the nearest to 33? (a) -0.1 (b) 0.5 (c) t b Let l = 92 + -90. Let t(i) = 3i*2 - 4. Let u be t(2). Let s be 20/u(-8)/50. What is the closest to 1/2 in s, l, -3? s Let m = -1555/1974 - 15/329. Which is the closest to m? (a) 3 (b) -2 (c) -3 b Let v = -4703 - -4703.5. What is the nearest to 1 in 28, v, -0.05? v Let o = 546 - 545.7. Which is the closest to o? (a) -2.6 (b) 3 (c) -2/9 c Let h(f) = -f*2 - 33f - 48. Let n be h(-14). Suppose -26w = n - 10. What is the nearest to -0.1 in 0, 3/4, -1, w? 0 Let p = -4/97 - -521/873. Let g = -1/9 - p. Which is the closest to 2/5? (a) g (b) 1/2 (c) 5 b Let f(t) = 732t - 4397. Let h be f(6). What is the nearest to h in 3, 0.2, -1/4, -14? -1/4 Let l = -5.845 + 5.445. Let k = -870 + 35668/41. Let a = 88/123 + k. What is the closest to 0 in a, l, -3? l Let r = -0.2 - 1.6. Let o = 0.096 - -1.904. Let g = o + r. Which is the closest to g? (a) 3 (b) -0.2 (c) -7/2 b Let q = -2 + 5. Let y = -16.1 + 11.1. Let u = 122 + -122.1. Which is the closest to q? (a) y (b) u (c) 2/9 c Let s = -165 + 160. Let c = 4.6 + s. What is the closest to -0.1 in c, -9.7, -3/4, 1/4? c Let o = -0.6 + 0.3. Let n = -0.28281 + -4.71719. Which is the closest to -0.2? (a) n (b) o (c) -11/2 b Let y = 5/279 + 121/279. Which is the nearest to 1? (a) -0.1 (b) y (c) 2/3 c Let z be (-56)/(-8)(-3 - (-149)/49). Let h = -1345 + 1351. Which is the closest to h? (a) -4 (b) z (c) 0.3 c Let p = 1977 - 1980. What is the closest to -27/4 in 5, 1/6, p? p Let x = -20.688 - -20.6. Let o = -0.012 + x. Suppose -a - 9 = -z, 0 = 3a + 3z + 2z - 13. What is the nearest to o in 5, a, 0.1? 0.1 Let t = 166.8 - 86.9. Let g = -80 + t. Let f = 8/15 + -1/5. What is the nearest to f in 3, g, -1.8? g Let a be (0 - -1)4-1. Let j = -64.76 - -64.82. What is the nearest to 0 in 0.4, j, a? j Let c = 5 - 8. Let s be (-1185)/316(0 + (-6)/15). What is the closest to -1 in s, c, 0.4? 0.4 Suppose 2 = -4k - 2u, -9 = -4k + 4*u + 19. Which is the closest to -0.2? (a) 0 (b) 1/2 (c) k a Let d = 0.06552 + 105.93448. What is the closest to 0.06 in d, -1, 0.4, -2? 0.4 Let v be (-1)/((-13)/(-2)) + 27708/624. Let k = v + -1247/28. Which is the nearest to 2/3? (a) 0.05 (b) k (c) -4 a Let q = 5 - 14/3. Let o = -8.6 + 188.4. Let s = 180 - o. Which is the nearest to 0? (a) s (b) -3 (c) q a
What is the b'th term of -163369, -163370, -163371, -163372? -b - 163368 What is the t'th term of -841415, -841418, -841421, -841424, -841427, -841430? -3t - 841412 What is the m'th term of 74041, 74047, 74053, 74059? 6m + 74035 What is the l'th term of 6413, 6028, 4995, 2990, -311, -5232? -54l3 - 7l + 6474 What is the k'th term of -178982, -357957, -536932, -715907, -894882, -1073857? -178975k - 7 What is the k'th term of -3206, -12858, -28954, -51494, -80478, -115906? -3222k*2 + 14k + 2 What is the c'th term of -300, -255, -166, -21, 192, 485, 870, 1359? 2c3 + 10c*2 + c - 313 What is the c'th term of 117, 183, 287, 429, 609? 19c*2 + 9c + 89 What is the o'th term of 3631, 3621, 3611, 3601? -10o + 3641 What is the m'th term of -469594, -939164, -1408722, -1878262, -2347778, -2817264? m3 - 469577m - 18 What is the b'th term of -625, -557, -489? 68b - 693 What is the w'th term of -121, -420, -897, -1552, -2385, -3396? -89w*2 - 32w What is the s'th term of 1479, 2723, 3967? 1244s + 235 What is the f'th term of -1269, -4848, -10739, -18948, -29481, -42344, -57543, -75084? -f3 - 1150f*2 - 122f + 4 What is the g'th term of -3820, -3872, -3914, -3946? 5g2 - 67g - 3758 What is the t'th term of -1173, -1188, -1207, -1230? -2t2 - 9t - 1162 What is the n'th term of 4238, 4202, 4166, 4130? -36n + 4274 What is the k'th term of 2200, 2226, 2298, 2440, 2676, 3030, 3526? 4k3 - k2 + k + 2196 What is the y'th term of -166, -643, -1388, -2401, -3682, -5231, -7048? -134y2 - 75y + 43 What is the o'th term of 1014, 1104, 1198, 1296, 1398? 2o2 + 84o + 928 What is the u'th term of -1799, -3591, -5357, -7079, -8739? 3u3 - 5u*2 - 1798u + 1 What is the g'th term of 467740, 467677, 467604, 467515, 467404, 467265, 467092, 466879? -g3 + g2 - 59g + 467799 What is the j'th term of 506267, 506266, 506265? -j + 506268 What is the r'th term of 114, 921, 3120, 7407, 14478? 116r*3 - 5r + 3 What is the i'th term of -10913, -10909, -10903, -10895, -10885? i*2 + i - 10915 What is the g'th term of -190554, -190553, -190552, -190551? g - 190555 What is the g'th term of 470, -449, -1978, -4117, -6866, -10225, -14194? -305g*2 - 4g + 779 What is the j'th term of -19727, -19670, -19613, -19556, -19499? 57j - 19784 What is the s'th term of 113, 1268, 4405, 10514, 20585, 35608? 165s3 + s2 - 3s - 50 What is the w'th term of 39598, 39596, 39594, 39592, 39590, 39588? -2w + 39600 What is the k'th term of 764, 809, 854, 899? 45k + 719 What is the w'th term of -72, -166, -320, -564, -928, -1442, -2136? -5w*3 - 59w - 8 What is the z'th term of 8459, 16884, 25289, 33668, 42015? -z*3 - 4z*2 + 8444z + 20 What is the q'th term of -5163, -5164, -5165, -5166, -5167? -q - 5162 What is the m'th term of -4707, -18883, -42481, -75477, -117847, -169567? 4m3 - 4735m*2 + m + 23 What is the g'th term of -21, -88, -169, -234, -253, -196, -33? 5g*3 - 37g*2 + 9g + 2 What is the c'th term of 7260, 7281, 7316, 7365, 7428? 7c2 + 7253 What is the i'th term of -3192, -12769, -28728, -51069? -3191i*2 - 4i + 3 What is the s'th term of 14622, 29264, 43906, 58548? 14642s - 20 What is the h'th term of -847, -3393, -7633, -13567, -21195, -30517, -41533? -847h*2 - 5h + 5 What is the z'th term of 15392, 15448, 15502, 15554, 15604, 15652? -z*2 + 59z + 15334 What is the r'th term of -30, 39, 108, 177? 69r - 99 What is the l'th term of -1687, -2616, -3545, -4474, -5403? -929l - 758 What is the l'th term of -158, -334, -510? -176l + 18 What is the j'th term of 1095, 1090, 1027, 876, 607? -5j3 + j2 + 27j + 1072 What is the n'th term of -44, -23, 16, 79, 172, 301? n3 + 3n*2 + 5n - 53 What is the h'th term of 6578, 6586, 6594, 6602, 6610, 6618? 8h + 6570 What is the i'th term of 24893, 24899, 24907, 24917, 24929, 24943, 24959? i2 + 3i + 24889 What is the d'th term of 1031, 2020, 3009, 3998, 4987, 5976? 989d + 42 What is the l'th term of -454, -908, -1362, -1816? -454l What is the n'th term of -70, -121, -226, -409, -694, -1105, -1666, -2401? -4n3 - 3n*2 - 14n - 49 What is the m'th term of 637, 981, 1561, 2383, 3453, 4777, 6361, 8211? m*3 + 112m*2 + m + 523 What is the y'th term of -457, -959, -1511, -2113, -2765, -3467, -4219? -25y*2 - 427y - 5 What is the s'th term of 207, 878, 2013, 3612? 232s2 - 25s What is the p'th term of 77856, 77873, 77890, 77907, 77924, 77941? 17p + 77839 What is the v'th term of -124, 99, 470, 989, 1656? 74v*2 + v - 199 What is the u'th term of 10980950, 10980948, 10980946? -2u + 10980952 What is the p'th term of 20589, 20696, 20803, 20910, 21017? 107p + 20482 What is the b'th term of 82384, 164750, 247120, 329494, 411872, 494254? 2b*2 + 82360b + 22 What is the b'th term of 30, 41, 34, 15, -10, -35, -54? b*3 - 15b*2 + 49b - 5 What is the f'th term of 889, 1005, 1121, 1237, 1353? 116f + 773 What is the r'th term of -138, -514, -1136, -2004? -123r*2 - 7r - 8 What is the q'th term of -37335, -74651, -111967, -149283? -37316q - 19 What is the y'th term of -4212, -4801, -5776, -7131, -8860, -10957, -13416? y3 - 199y*2 + y - 4015 What is the u'th term of -1777, -1779, -1781, -1783, -1785? -2u - 1775 What is the x'th term of 856, 1500, 2144, 2788, 3432? 644x + 212 What is the b'th term of 28624, 28620, 28616, 28612, 28608? -4b + 28628 What is the p'th term of -1054, -2392, -3730, -5068, -6406? -1338p + 284 What is the p'th term of -465, -935, -1421, -1923? -8p*2 - 446p - 11 What is the i'th term of 100, 193, 276, 343, 388, 405? -i3 + i2 + 97i + 3 What is the n'th term of -773, -1569, -2365, -3161, -3957? -796n + 23 What is the r'th term of -65036, -65069, -65104, -65141, -65180, -65221? -r*2 - 30r - 65005 What is the z'th term of 1960, 2272, 2584? 312z + 1648 What is the b'th term of 44, 158, 440, 974, 1844? 14b*3 + 16b + 14 What is the q'th term of -253, -575, -893, -1207, -1517, -1823? 2q2 - 328q + 73 What is the r'th term of -335, -609, -887, -1169? -2r2 - 268r - 65 What is the x'th term of 84, 253, 508, 837, 1228? -2x3 + 55x*2 + 18x + 13 What is the v'th term of 60487, 121015, 181543? 60528v - 41 What is the y'th term of 2453, 4929, 7403, 9875, 12345, 14813? -y2 + 2479y - 25 What is the w'th term of -974, -483, 328, 1453, 2886, 4621? -w*3 + 166w*2 - 1139 What is the z'th term of -96873, -96863, -96853, -96843, -96833, -96823? 10z - 96883 What is the a'th term of -13790, -13792, -13796, -13802, -13810? -a2 + a - 13790 What is the b'th term of 705, 1412, 2105, 2778, 3425, 4040, 4617, 5150? -b3 - b*2 + 717b - 10 What is the q'th term of 10, 145, 568, 1423, 2854? 24q3 - 33q + 19 What is the n'th term of 1228, 2472, 3718, 4966, 6216, 7468, 8722? n*2 + 1241n - 14 What is the h'th term of 152, 283, 396, 491? -9h2 + 158h + 3 What is the n'th term of 447, 875, 1297, 1713, 2123? -3n2 + 437n + 13 What is the j'th term of -2539, -21558, -73183, -173716, -339459, -586714, -931783? -2717j3 - j2 + 3j + 176 What is the n'th term of 632, 753, 1074, 1691, 2700, 4197, 6278, 9039? 16n3 + 4n*2 - 3n + 615 What is the l'th term of -423, -797, -1171, -1545, -1919, -2293? -374l - 49 What is the l'th term of 188395, 376790, 565187, 753586, 941987, 1130390? l2 + 188392l + 2 What is the i'th term of 331, 263, 149, -11? -23i2 + i + 353 What is the c'th term of -11113, -10966, -10715, -10354, -9877, -9278? c3 + 46c*2 + 2c - 11162 What is the s'th term of 616, 604, 582, 544, 484, 396? -s3 + s2 - 8s + 624 What is the d'th term of 1088064, 1088066, 1088068? 2d + 1088062 What is the l'th term of -11681, -46657, -104951, -186563, -291493? -11659l2 + l - 23 What is the i'th term of -282, -2183, -7326, -17331, -33818, -58407, -92718? -270i3 - i2 - 8i - 3 What is the o'th term of -12052, -12054, -12070, -12106, -12168? -o3 - o2 + 8o - 12058 What is the r'th term of -342, -231, 56, 609, 1518? 15r3 - 2r*2 + 12r - 367 What is the l'th term of -37844, -75686, -113528? -37842l - 2 What is the i'th term of -560, -1119, -1678? -559i - 1 What is the j'th term of 2466, 2444, 2422, 2400? -22j + 2488 What is the k'th term of -20964, -20944, -20920, -20892, -20860? 2k*2 + 14k - 20980 What is the o'th term of -6338, -12684, -19028, -25370? o*2 - 6349o + 10 What is the k'th term of 71, 75, 97, 143, 219, 331, 485? k*3 + 3k*2 - 12k + 79 What is the c'th term of -9, -114, -225, -336, -441? c*3 - 9c*2 - 85c + 84
What is next in -178, -807, -1964, -3739, -6222, -9503, -13672? -18819 What comes next: 3984, 15899, 35758, 63561, 99308, 142999? 194634 What is next in -76, -156, -254, -376, -528, -716, -946? -1224 What is the next term in 25, 16, -13, -56, -107, -160, -209, -248? -271 What is next in 11421, 11422, 11413, 11388, 11341, 11266? 11157 What is next in 195998, 196000, 196002, 196004, 196006? 196008 What comes next: -322, -1297, -2892, -5083, -7846, -11157, -14992, -19327? -24138 What is the next term in -4, -87, -234, -445? -720 What comes next: 19449, 38906, 58399, 77946, 97565, 117274, 137091? 157034 What comes next: -4, -80, -216, -412? -668 What is the next term in -67, 727, 2879, 7067, 13969, 24263, 38627? 57739 What is the next term in -132, -272, -578, -1134, -2024, -3332, -5142, -7538? -10604 What is the next term in 361, 1400, 3133, 5560, 8681, 12496, 17005? 22208 What is the next term in 110, 345, 580, 815, 1050, 1285? 1520 What is next in -1936, -3742, -5550, -7360? -9172 What comes next: 1843, 3150, 4459, 5770? 7083 What is the next term in -19322, -19237, -19152, -19067, -18982? -18897 What comes next: -102730, -102761, -102792, -102823, -102854, -102885? -102916 What is next in -55357, -55355, -55351, -55345, -55337? -55327 What comes next: -614827, -614826, -614825? -614824 What is next in -17783, -71195, -160233, -284897, -445187, -641103? -872645 What is next in 75, 120, 193, 294, 423? 580 What is next in -490058, -980114, -1470170? -1960226 What is the next term in -61, -166, -273, -382, -493? -606 What comes next: 518, 502, 482, 464, 454, 458, 482, 532? 614 What comes next: -866, -1041, -1232, -1445, -1686, -1961, -2276? -2637 What is the next term in 60142, 120282, 180422, 240562? 300702 What is next in -12034, -24068, -36102, -48136, -60170, -72204? -84238 What is the next term in 17738, 17746, 17754, 17762? 17770 What is the next term in -7880, -15760, -23628, -31478, -39304, -47100, -54860, -62578? -70248 What is next in -5055, -9649, -14233, -18801, -23347? -27865 What is the next term in 94265, 188502, 282739, 376976? 471213 What is the next term in 130, 183, 182, 127, 18, -145, -362? -633 What is the next term in -85419, -170845, -256271, -341697, -427123, -512549? -597975 What is next in 313, 689, 1053, 1393, 1697, 1953? 2149 What comes next: -3805, -3923, -4043, -4165, -4289? -4415 What is the next term in -1702, -1707, -1712, -1717, -1722? -1727 What is next in 359, 82, -155, -334, -437, -446? -343 What is the next term in -34, -73, -134, -211, -298, -389, -478? -559 What comes next: 122, 344, 570, 800, 1034, 1272? 1514 What comes next: -4640, -4626, -4596, -4544, -4464, -4350, -4196, -3996? -3744 What is next in -4991, -4936, -4845, -4718, -4555, -4356? -4121 What comes next: 1164306, 2328608, 3492910, 4657212? 5821514 What is the next term in -334, -562, -794, -1030, -1270, -1514? -1762 What is the next term in -19003, -19017, -19031, -19045, -19059, -19073? -19087 What is the next term in 5368, 5359, 5346, 5335, 5332, 5343, 5374? 5431 What comes next: 247, 249, 229, 193, 147, 97? 49 What is the next term in 514748, 1029500, 1544252? 2059004 What is next in -7968, -15626, -23284? -30942 What is the next term in 7214, 14360, 21506, 28652? 35798 What is the next term in -4652, -9722, -14792, -19862? -24932 What is next in -77091, -77084, -77065, -77028, -76967, -76876, -76749? -76580 What comes next: 29469, 58959, 88467, 117993, 147537? 177099 What comes next: -306, -418, -534, -654? -778 What comes next: 88807, 177676, 266541, 355396, 444235, 533052, 621841? 710596 What comes next: 515, 2407, 5671, 10313, 16339, 23755, 32567, 42781? 54403 What comes next: -40586, -40582, -40582, -40586, -40594, -40606, -40622? -40642 What is the next term in 555, 1003, 1453, 1905? 2359 What is next in 136087, 136089, 136091? 136093 What is next in 478, 837, 1198, 1561, 1926, 2293? 2662 What is the next term in -1733, -1571, -1407, -1241? -1073 What comes next: -2230, -2013, -1796, -1579, -1362, -1145? -928 What is next in -88356, -176716, -265076, -353436? -441796 What is the next term in -540, -1120, -1710, -2316, -2944, -3600, -4290, -5020? -5796 What is the next term in 223464, 223465, 223466, 223467, 223468, 223469? 223470 What is next in -116598, -116526, -116440, -116334, -116202? -116038 What is the next term in 157, 125, 85, 37? -19 What is next in 3416, 3398, 3368, 3326? 3272 What comes next: -336389, -672777, -1009167, -1345559? -1681953 What comes next: 670, 663, 646, 619, 582? 535 What is the next term in 1107, 1243, 1379? 1515 What is next in 1334, 2630, 3926, 5222, 6518, 7814? 9110 What comes next: -691, -2930, -6661, -11884, -18599? -26806 What is the next term in -17759, -17757, -17755, -17753? -17751 What is the next term in 156, -12, -292, -684, -1188? -1804 What comes next: -71092, -142184, -213276, -284368, -355460? -426552 What comes next: 283106, 283109, 283112, 283115, 283118, 283121? 283124 What is the next term in -315, -264, -211, -156? -99 What is next in -20834, -20842, -20850, -20858? -20866 What is next in -671574, -1343142, -2014710, -2686278, -3357846, -4029414? -4700982 What comes next: -367, -1579, -3607, -6451, -10111? -14587 What is the next term in -799, -1242, -1681, -2116, -2547, -2974, -3397? -3816 What is next in 841, 1809, 2903, 4123, 5469, 6941, 8539? 10263 What comes next: -3250, -3348, -3420, -3454, -3438, -3360, -3208, -2970? -2634 What comes next: 246, 992, 2232, 3966, 6194? 8916 What is the next term in 121, 486, 1079, 1888, 2901? 4106 What is the next term in -414651, -414652, -414655, -414660, -414667, -414676? -414687 What is next in -9157, -9176, -9195, -9214, -9233, -9252? -9271 What is next in 25270, 101046, 227332, 404122, 631410? 909190 What is the next term in 117541, 117533, 117521, 117505, 117485? 117461 What is next in -266, -1042, -2356, -4226, -6670, -9706? -13352 What is the next term in 32, -11, -54, -97? -140 What is next in -124793, -124730, -124669, -124610, -124553, -124498? -124445 What is the next term in -1010, -2041, -3082, -4139, -5218, -6325, -7466? -8647 What comes next: 2499, 4987, 7463, 9921, 12355, 14759, 17127? 19453 What is the next term in -130, -229, -298, -319, -274, -145, 86, 437? 926 What comes next: -123, 17, 397, 1137, 2357, 4177, 6717, 10097? 14437 What is the next term in -405, -809, -1213, -1617, -2021? -2425 What is next in 36, 479, 1216, 2247? 3572 What comes next: -24315, -24293, -24271, -24249, -24227, -24205? -24183 What is the next term in 1417, 5545, 12375, 21895, 34093, 48957, 66475? 86635 What is the next term in -464, -3904, -13238, -31412, -61372, -106064, -168434? -251428 What is the next term in -373, -616, -873, -1150, -1453, -1788, -2161, -2578? -3045 What comes next: 50, 180, 514, 1154, 2202, 3760, 5930, 8814? 12514 What comes next: -183, -689, -1509, -2637, -4067, -5793, -7809? -10109 What is the next term in 306, 811, 1316, 1821? 2326 What is next in 2260, 4701, 7142? 9583 What comes next: 190, 370, 550, 730? 910 What is the next term in -99, -243, -429, -657, -927, -1239, -1593? -1989 What is next in -199, -1289, -4007, -9085, -17255, -29249, -45799, -67637? -95495 What is next in -3532, -3574, -3688, -3910, -4276? -4822 What is next in 1227, 9799, 33061, 78357, 153031, 264427, 419889, 626761? 892387 What is next in -1496939, -1496947, -1496957, -1496969? -1496983 What is next in 21616, 43220, 64812, 86386, 107936, 129456? 150940 What is the next term in -8590, -17188, -25786, -34384? -42982 What is the next term in -313, -384, -455, -526? -597 What comes next: 57056, 57052, 57046, 57038, 57028? 57016 What is next in 322, 310, 298, 286, 274, 262? 250 What is next in 422, 684, 946, 1208, 1470, 1732? 1994 What is the next term in 379, 720, 1023, 1282, 1491, 1644, 1735? 1758 What comes next: 7017, 7055, 7093, 7131, 7169, 7207? 7245 What comes next: 78, 204, 382, 624, 942? 1348 What comes next: 1875, 7493, 16855, 29961? 46811 What comes next: 7815, 31319, 70493, 125337, 195851, 282035, 383889? 501413 What comes next: 3117, 6442, 9765, 13086, 16405, 19722? 23037 What is the next term in 5289, 5277, 5255, 5217, 5157, 5069? 4947 What is the next term in -219, -561, -1017, -1581, -2247, -3009? -3861 What is the next term in -1091, -2220, -3395, -4616, -5883, -7196? -8555 What is the next term in -3, -69, -269, -669, -1335, -2333? -3729 What is next in -1652781, -1652780, -1652779, -1652778? -1652777 What is the next term in -8693, -8702, -8717, -8738, -8765, -8798, -8837? -8882 What is next in 145, 555, 1237, 2191, 3417, 4915? 6685
Suppose 0 = -5v - 2l + 237, -4v + 4l + 185 = -27. Let j = v - 39. What is the least common multiple of j and -2 - -23 - 1/(-1)? 110 Let l = 14 - 234/17. Suppose -2v - 109 - 35 = 0. Find the common denominator of (1(-9)/12)/(15/v) and l. 85 Suppose 0h + 2y + 82 = -h, -2y = 2h + 166. Calculate the common denominator of (-21)/27384/h and 15/7. 63 Let w(d) = d2 - 31d - 338. Calculate the smallest common multiple of w(-9) and 12. 132 Let v = -239 - -243. Suppose -vg + 70 = -2. What is the smallest common multiple of g and 54? 54 Suppose 4i - 5 = 3t + 5, -i = -t - 1. What is the least common multiple of 4995 and t? 9990 Suppose -x + 1740 = 173x. Calculate the lowest common multiple of x and 60. 60 Let p = -310 + 425. What is the smallest common multiple of p and ((-75)/(-9))/(-1 - (-7)/6)? 1150 Let n be -1 + -2(-1)/2 + -16. Let f(o) = -o - 7. Let r be f(n). What is the smallest common multiple of (-81)/(-7) + (r/(-7))/(-3) and 14? 84 Suppose -j + 435 = 4n, 4n - 31j = -35j + 420. Let t = n + -106. What is the smallest common multiple of t and 8? 8 Let a(i) = 56i + 1853. Calculate the smallest common multiple of 128 and a(-33). 640 Let k be (-4)/(-30) - 78871130/8100. Let q = 9737 + k. Let s = 15729 - 314497/20. Calculate the common denominator of q and s. 1620 Let n = -318 + 1895/6. Let a = -58313 + 2973932/51. Calculate the common denominator of a and n. 102 Let y(k) = -4k - 2. Let v be y(-2). Suppose -vs = -0s - 18. What is the lowest common multiple of 1 and 39/s2 - (-18)/(-6)? 23 Let s be (-1632860)/50-2(-2)/(-189840). Let b = 368/791 + s. Find the common denominator of b and -39/55. 1650 Let b(q) = 758q - 6039. Let z = -22 - -42. Calculate the lowest common multiple of z and b(8). 100 Suppose -2n = 5c - 20 - 15, -4n + 78 = 2c. Let u be 1150/n + (-1)/(-2). Let f = u - 38. What is the lowest common multiple of f and 20? 20 Let f(a) = -8a*2 + 48a + 157. Let d be f(34). Let i = 44867/6 + d. What is the common denominator of (146/(-22))/(5 - 3) and i? 66 Let n = -33585 - -1276159/38. Find the common denominator of (3 - (517/88 + -3))(-1090)/15 and n. 228 Suppose 0 = -72x + 76x - 12. What is the least common multiple of ((x - 5) + -8)6/(-5) and 24? 24 Let p = 3/124906 + -46246454/312265. Let m = p + 149. What is the common denominator of 1 + 0 - (-59)/10 and m? 10 Let p = 1685695/3559872 + 8/18541. What is the common denominator of -113/28 and p? 1344 Let j = -924 - -927. Let n(u) = -3u3 + 4u*2 + 3u - 1. Calculate the lowest common multiple of n(-2) and j. 33 Suppose -426a = -360a + 435a - 171342. Calculate the smallest common multiple of a and 10. 1710 Let v = -721957/8 + 90251. What is the common denominator of v and (2/(-3) + 1)41? 24 Let a = 5246503 - 152204249/29. Let y = a - -5756/3. Find the common denominator of -65/9 and y. 261 Let f = -157948439/1204 - -262373/2. Find the common denominator of -17/258 and f. 3612 Suppose 2a - 295 + 291 = 0. Suppose -ah - 5m = -m, -5m - 15 = 0. What is the smallest common multiple of 198 and h? 198 Calculate the common denominator of 6 + 2 + (-318)/39 - 7460/(-68432) and -1/1974. 3948 Let s = -143/59 + 8991/3953. Let h = s - 383/1474. Find the common denominator of 5/458 and h. 5038 Let g(v) = v*3 + 129v*2 + 242v + 826. What is the smallest common multiple of g(-127) and 282? 7050 Let b(x) = 2x2 - 7x - 45. Let t = -831 - -826. What is the least common multiple of 56 and b(t)? 280 Suppose -22g = 54792 - 61128. Calculate the least common multiple of g and 11. 3168 Let d(j) = -2j*2 + 13. Let h be d(-3). What is the smallest common multiple of 26 and 2 - 3/2 - h/10? 26 What is the lowest common multiple of (1 - (-32)/(-30))(-171 + 99)20 and (0 + (-18)/5)-5? 288 Let l = -27/29 + 457/493. Let o = l - -8389/1972. Let k = 1021/588 + 2/147. Calculate the common denominator of k and o. 4 Let o = -45803527/53 + 864217. Let n = -2800/559 - -93/43. What is the common denominator of n and o? 689 Calculate the lowest common multiple of 15 and (4/(-56) + (-702)/(-273))/(1/36). 90 Let z(y) = 2y2 + 4y. Let s be z(2). Suppose 4a + 0a - s = 0. Suppose 2b - 2 - 14 = 4r, ab - 17 = 3r. Calculate the lowest common multiple of 22 and b. 22 What is the least common multiple of 120 and (1/(-5))/(-1) + -3297(-13)/195? 1320 Suppose -3i + 5j = -13, 2i - 13 = -3j + 2j. Calculate the smallest common multiple of i and ((-6)/(-15))/((-1)/(-55)). 66 Let n = 2400733/70 + -34297. What is the common denominator of 143/96 and n? 3360 Let d(i) = i - 3. Let t be d(-12). Let v = t + 81. Calculate the lowest common multiple of v and 180. 1980 What is the smallest common multiple of 604 and (-62)/(-248)16 - 8/(-16)? 604 Calculate the common denominator of (142/36)/(26/(-1755)-15-150) and 63/200. 600 Suppose 2i + 4f + 34 = 0, 0f = -4i - 3f - 93. Let z be 1463/63 - (-6)/i. Suppose 0 = za - 29a + 252. Calculate the least common multiple of a and 42. 42 Suppose 39 = a + 3t, -2t + 97 - 181 = -3a. What is the lowest common multiple of a and 72? 360 What is the smallest common multiple of 145/5 + -217/21 and 638? 638 Let d(t) = -t3 - 33t*2 - 216t + 18. Let k(s) = s*3 - 5s. What is the least common multiple of k(3) and d(-9)? 36 What is the lowest common multiple of 735 and (-13 + 42 + -19)9? 4410 Let h = 52 + -5. What is the common denominator of 19/78 and 28 + -24 + 6/(-40)h? 780 What is the least common multiple of 711 and -1((15 - 30) + -60)? 17775 Let i be -1 + -1 + 7 + -3. Suppose -5j = -3j - ih + 68, 2h = j + 34. Let n = j - -54. What is the lowest common multiple of n and 6? 60 What is the common denominator of 2/6 + (-579)/144 and (-9)/(-12) + 452/(-64)? 16 Let l = 54884/33 - 1663. Find the common denominator of l and (5/(-126))/((-176670)/508417). 3564 Let g = -10 + 20. Calculate the least common multiple of g and ((-77)/231 + 79/(-33))/(21/(-154)). 20 Let f(b) = -8b*3 - 9b*3 - 2 - 11b + 6b3 - 4b2 - 15. Calculate the smallest common multiple of f(-2) and 14. 154 Let t(d) = -d3 - 48d2 - 42d + 240. What is the least common multiple of (-4)/(-12) + (-20)/(-3) and t(-47)? 35 Let j = -2/11967 - 562433/95736. Find the common denominator of j and (-150)/3625/20. 24 Let b be ((-2408)/609 + 4)/(101/(-9)). Let v = 225749/52722 + b. Let g = -283 - -5972/21. What is the common denominator of v and g? 126 Suppose -k = -94 - 124. Let t = -1727/8 + k. Let q = -11741/4 + 2931. Find the common denominator of t and q. 8 Let l = 20409266 - 489742993/24. Let z be (4412/12)/(2/18). Let m = l - z. Find the common denominator of m and -89/18. 72 Let h = -201 + 321. Let m = 138 - h. Calculate the smallest common multiple of 14 and m. 126 Let y = 77939/33558 + 1/987. Let c be 0 + 3 + -6 + 9 + -2. Find the common denominator of c + 35/112 + 2 and y. 272 Let y(n) = 16n + 1651. Suppose 4 + 28 = 8j. What is the lowest common multiple of y(-103) and j? 12 Suppose 0 = -4v - 2v - 198. Find the common denominator of 22/v(-267)/16 and 51/4. 8 Let b = 23 - 16. Suppose bq - 3165 = -8q. Calculate the least common multiple of 7 and q. 1477 Find the common denominator of (-42 - (-10810)/184)4/(-21) and -95/12. 84 Suppose -149265 = 14u + 109427. Let m = -1995647/108 - u. Calculate the common denominator of -133/6 and m. 108 Let g = 246178 + -392900225/1596. Find the common denominator of -83/304 and g. 6384 Let o = -29/90 - 2437/630. Let j = -123214 + 6899943/56. Calculate the common denominator of o and j. 168 Let h(g) = 2g + 29g*2 + 3g + 3g + 5g - 2. What is the least common multiple of h(1) and 50? 200 Calculate the common denominator of 113/160 and 3066/(-532) - ((-1 - -1) + -6). 3040 Let u = 116 - -74. Suppose 4d = -y + d + 34, -5y - 5d + u = 0. What is the least common multiple of 4 and y? 40 Let f(m) = -23m - 24. Let p be f(-2). Suppose 2r + l = 2l + p, l - 22 = -2r. What is the smallest common multiple of 1/(-3) + (-539)/(-33) and r? 176 Suppose 98 - 503 = 3s. Let a = 168 + s. What is the least common multiple of 5 and a? 165 What is the common denominator of 8 - (-8 + 1307/88) and -29/864? 9504 Let k(r) = -11r3 + 11r*2 + 19r - 9. Let c be k(-3). Let p = c - 320. What is the least common multiple of p and 3? 30 Suppose -323 - 293 = -11n. Suppose 72d - 768 = nd. Calculate the smallest common multiple of d and 42. 336 Suppose -32s - 28*s = -547 + 67. Let q be 2 + -1 + 2 + 0. Calculate the least common multiple of q/(-4) + 35/4 and s. 8
What comes next: 1048, 2199, 3552, 5209, 7272, 9843, 13024, 16917? 21624 What is next in -10804, -21616, -32428, -43240, -54052, -64864? -75676 What is next in -3323, -6741, -10159, -13577? -16995 What is next in -439, -3594, -12161, -28846, -56355, -97394? -154669 What is the next term in 435, 683, 1109, 1713? 2495 What comes next: 649044, 649043, 649042, 649041, 649040, 649039? 649038 What comes next: 655, 5134, 17291, 40966, 79999? 138230 What is next in -1476, -1676, -1852, -1992, -2084? -2116 What is next in -1629, -1519, -1231, -675, 239, 1601? 3501 What is the next term in -226, -344, -426, -454, -410, -276, -34, 334? 846 What is the next term in -126, -254, -384, -516, -650, -786, -924? -1064 What comes next: -31, 34, 157, 332, 553, 814, 1109? 1432 What comes next: -321279, -321275, -321267, -321255? -321239 What is next in 438, 437, 444, 465, 506, 573, 672, 809? 990 What comes next: -471, -513, -555, -597? -639 What is the next term in -5988, -24008, -54030, -96048, -150056, -216048, -294018, -383960? -485868 What is next in 1193, 4662, 10447, 18548? 28965 What comes next: 370, 1453, 3292, 5911, 9334, 13585? 18688 What comes next: 191082, 382167, 573254, 764343, 955434, 1146527? 1337622 What is next in -20, 374, 1030, 1948, 3128, 4570? 6274 What is the next term in -13111, -52371, -117783, -209347, -327063? -470931 What comes next: -59692, -119383, -179076, -238771, -298468, -358167? -417868 What comes next: 5574, 5527, 5440, 5307, 5122, 4879? 4572 What is the next term in -2471, -4943, -7415, -9887, -12359, -14831? -17303 What comes next: -1764, -1710, -1656, -1602, -1548? -1494 What is next in 5524, 11082, 16652, 22240, 27852? 33494 What is next in -2614, -5270, -7926, -10582, -13238, -15894? -18550 What is next in 2548, 1691, 834, -23, -880, -1737? -2594 What is the next term in 35, 394, 989, 1820, 2887, 4190, 5729? 7504 What is the next term in -89891, -179781, -269671, -359561? -449451 What comes next: -16918, -33840, -50762, -67684, -84606? -101528 What comes next: -258, -453, -578, -627, -594? -473 What is the next term in 3498, 14053, 31634, 56235, 87850, 126473? 172098 What is next in -298, -1017, -1736, -2455, -3174, -3893? -4612 What is the next term in -5795, -11549, -17303? -23057 What is the next term in -82413, -164828, -247243, -329658, -412073, -494488? -576903 What comes next: -39, -153, -363, -681, -1119, -1689, -2403, -3273? -4311 What is next in -8035, -8032, -8019, -7990, -7939? -7860 What is next in 82, 207, 502, 1045, 1914, 3187, 4942, 7257? 10210 What is next in 4926, 9853, 14780? 19707 What is next in -42, -11, 142, 477, 1054, 1933, 3174? 4837 What is the next term in 28139, 28140, 28141, 28142? 28143 What is next in 354, 271, 188, 105, 22, -61? -144 What is next in 6959, 13936, 20933, 27956, 35011, 42104? 49241 What is the next term in -1002, -1069, -1180, -1335, -1534, -1777, -2064? -2395 What comes next: -1115, -1117, -1133, -1169, -1231, -1325, -1457, -1633? -1859 What is next in -10605, -21203, -31801? -42399 What comes next: 372, 1096, 2174, 3600, 5368, 7472, 9906? 12664 What is next in 4226, 8484, 12724, 16940, 21126, 25276? 29384 What is next in 1274, 1335, 1406, 1487? 1578 What is the next term in -1188, -2453, -3720, -4989, -6260? -7533 What comes next: 122, 120, 106, 74, 18, -68, -190, -354? -566 What is the next term in -139618, -139616, -139614, -139612, -139610, -139608? -139606 What comes next: -9327, -9321, -9315, -9309, -9303, -9297? -9291 What comes next: -1046, -1121, -1238, -1391, -1574, -1781? -2006 What is the next term in 3041118, 3041120, 3041120, 3041118, 3041114, 3041108? 3041100 What is next in 2079, 8128, 18215, 32346, 50527, 72764? 99063 What comes next: -115, -391, -851, -1495? -2323 What is next in 115407, 230809, 346211, 461613? 577015 What comes next: -959, -989, -1071, -1229, -1487, -1869? -2399 What is the next term in 1775, 1791, 1807, 1823, 1839? 1855 What is the next term in 3035, 5662, 8289, 10916, 13543? 16170 What comes next: 198, 203, 230, 291, 398? 563 What comes next: -13410, -26813, -40216, -53619? -67022 What is next in 8296, 8288, 8280, 8272? 8264 What is next in 251, 223, 181, 119, 31? -89 What comes next: -3972607, -3972599, -3972577, -3972535, -3972467? -3972367 What is the next term in 408, 835, 1252, 1659, 2056? 2443 What is the next term in -578, -615, -652, -689? -726 What is the next term in -602855, -602855, -602853, -602849, -602843, -602835? -602825 What is the next term in -6096847, -12193696, -18290545, -24387394, -30484243, -36581092? -42677941 What is next in 1647324, 1647322, 1647320, 1647318? 1647316 What comes next: -141, -930, -2245, -4086, -6453? -9346 What is the next term in -28, -147, -348, -625, -972, -1383, -1852? -2373 What comes next: 103937, 103936, 103935, 103934, 103933, 103932? 103931 What is the next term in -37355, -37358, -37361, -37364? -37367 What is the next term in 95, 106, 113, 116, 115, 110? 101 What is next in 23, -2, -73, -214, -449, -802? -1297 What comes next: -780, -3314, -7590, -13608, -21368? -30870 What is next in 280, 346, 470, 670, 964, 1370? 1906 What is next in 76553, 76557, 76561, 76565, 76569, 76573? 76577 What comes next: 6620, 13242, 19864, 26486, 33108? 39730 What is the next term in -222, -124, -26, 72, 170? 268 What comes next: -556, 405, 1356, 2291, 3204, 4089, 4940? 5751 What is the next term in 66, 101, 150, 219, 314, 441, 606, 815? 1074 What is the next term in 31565, 31600, 31637, 31676, 31717, 31760? 31805 What comes next: -10587, -10594, -10603, -10614, -10627, -10642? -10659 What comes next: 5594, 11192, 16780, 22352, 27902? 33424 What comes next: 19, 30, 69, 154, 303, 534, 865? 1314 What comes next: -1450, -1473, -1496, -1519? -1542 What comes next: -85, -101, -97, -61, 19, 155, 359, 643? 1019 What is the next term in -4961, -9942, -14923? -19904 What is the next term in 38, -88, -424, -1072, -2134, -3712, -5908, -8824? -12562 What is the next term in 558, 782, 1006, 1230, 1454? 1678 What is next in -178017, -178046, -178075, -178104, -178133? -178162 What is next in -30697, -30732, -30791, -30874, -30981, -31112? -31267 What is next in 94789, 189594, 284399, 379204, 474009? 568814 What is the next term in -9062, -8909, -8754, -8597, -8438, -8277, -8114? -7949 What is the next term in -2418, -2367, -2316, -2265, -2214, -2163? -2112 What is the next term in -3598, -7225, -10850, -14473, -18094, -21713? -25330 What is next in 3075, 6144, 9213? 12282 What comes next: 116, 578, 1378, 2516? 3992 What comes next: 76, 90, 104, 112, 108, 86, 40? -36 What is next in -284095, -568190, -852285, -1136380? -1420475 What comes next: 2594223, 2594221, 2594219, 2594217, 2594215, 2594213? 2594211 What comes next: -3607, -6955, -10303, -13651? -16999 What comes next: -17, -35, -77, -155, -281, -467? -725 What comes next: -552537, -552535, -552533, -552531, -552529, -552527? -552525 What is next in 48404, 96771, 145138, 193505, 241872, 290239? 338606 What is next in 22203, 44462, 66735, 89028, 111347, 133698? 156087 What is the next term in 66, 163, 260, 357? 454 What is next in -4083, -4096, -4117, -4146, -4183, -4228? -4281 What is the next term in -140, -113, -96, -95, -116? -165 What comes next: -62917, -62948, -62979, -63010, -63041? -63072 What is next in -388, -1537, -3452, -6133, -9580, -13793? -18772 What is next in 321, 84, -321, -900, -1659, -2604? -3741 What is next in 296, 1321, 3796, 8447, 16000? 27181 What is the next term in -34631, -34625, -34617, -34607, -34595? -34581 What is the next term in -8181, -33091, -74607, -132729? -207457 What is next in -3811, -15392, -34695, -61720? -96467 What is the next term in -23, -60, -159, -350, -663, -1128, -1775, -2634? -3735 What is next in 1074, 2168, 3264, 4362? 5462 What is next in 1875, 7593, 17119, 30453, 47595? 68545 What is next in -60, -56, -52, -48? -44 What is next in 15654, 15630, 15608, 15588, 15570? 15554 What is next in 16036, 64153, 144348, 256621, 400972? 577401 What is next in 3166, 5737, 8308, 10879, 13450, 16021? 18592 What comes next: -440404, -880807, -1321210, -1761613, -2202016? -2642419 What is the next term in 71, 172, 409, 848, 1555, 2596? 4037 What is the next term in 10132, 20189, 30226, 40231, 50192? 60097 What is next in -408, -600, -794, -990, -1188, -1388, -1590? -1794 What is the next term in 107, -132, -371, -610, -849, -1088? -1327 What is next in -52, -130, -168, -94, 164, 678? 1520 What is next in 337, 2983, 7387, 13543, 21445, 31087? 42463 What comes next: -10480, -20981, -31480, -41977, -52472, -62965? -73456
Let f = -732559/4 + 185468. Let j = 2317 - f. Calculate the common denominator of j and 2/8 + (-214)/(-24). 12 Let g = -53/10 + 321/70. Find the common denominator of -19/5 and g. 35 Calculate the common denominator of (-10)/(-4)(-93)/775 and 71/(-18) - (2 + -2). 90 Suppose 3h = 5q - 3q + 36, 0 = 4h - 2q - 46. Calculate the lowest common multiple of h and 2. 10 Let y = 7497/11 - 682. Find the common denominator of -15/4 and y. 44 Suppose 9k - 121 = 95. What is the smallest common multiple of k and 21? 168 Let x(o) = -o3 - 14o*2 - o - 6. What is the least common multiple of x(-14) and 10? 40 Let n = -13836655/18 - -768954. Let z = 251 - n. Calculate the common denominator of (2 - 1) + (-393)/(-36) and z. 36 Suppose 0f - 104 = -5f - 4i, -2f + 2i = -38. Suppose d = 3, -2u = -2d - 2 - 8. Calculate the lowest common multiple of u and f. 40 Find the common denominator of -19/22 and (2 - (-134)/(-72))/((-8)/(-6)). 528 Suppose m + 9s - 65 = 4s, -2s = 2m - 122. What is the smallest common multiple of 18 and m? 180 Let v(n) = n*3 + 5n*2 + 4n + 5. Let j be v(-4). Suppose jk = 15, 5l - 2k + 5k - 39 = 0. What is the least common multiple of l and 8? 24 Let i(d) = 7d + 5d + 4 - d*3 + 1 + 2d - 13d2. What is the smallest common multiple of -1(5 + -1)-2 and i(-14)? 40 Suppose -4x + 10 = x. Suppose xt = 119 - 35. Calculate the least common multiple of 10 and t. 210 Suppose i - 10 = -0i - 3n, 4n = -8. Suppose -5s = -x + 12, -4x = -0x - 8. Let q = s + i. Calculate the smallest common multiple of q and 4. 28 Let g(z) = 9z3 + z2 - z + 1. Calculate the smallest common multiple of 5 and g(1). 10 Let x = 46/17 - 662/119. What is the common denominator of x and -19/6? 42 Suppose o - 2o - 7 = 0. Let r = 17 + o. Suppose 0 = n - 4n + 21. What is the smallest common multiple of r and n? 70 Suppose -24s = -20s - 88. What is the least common multiple of s and 22? 22 Let m be 10/(-21)9/254. Let n be 2 - (161498/17780)/1. Let d = m + n. Calculate the common denominator of d and 23/16. 80 Let q(i) = -3i2 - i + 1. Let r(k) = k2 + k. Let h(b) = -q(b) - 2r(b). Let c be h(1). Calculate the least common multiple of 4 and 4 + 3 - (c + 1). 28 Let l = 112/168159 + 146750671774/8912427. Let i = 16465 - l. Let g = -2523/212 + i. Calculate the common denominator of g and 3/2. 4 Suppose 0 = w + t + t - 59, 0 = w + 4t - 65. Let k be 26/w(-3)/42. Let y = -39827/3710 - k. What is the common denominator of 27/8 and y? 40 What is the least common multiple of (46 - (4 - 3)) + 0 and 36? 180 Suppose -3c + 5 = k, -4c = -k - k - 10. Suppose 3426 = -cl + 4l. Let b = l - 30853/18. What is the common denominator of 95/18 and b? 18 Let c(x) = 4x - 2x + 0 + 4. Let m be c(-3). Let w(u) = -2u. What is the lowest common multiple of w(m) and 7? 28 Let d = -15502/7 - -2210. Let q be (9165/18 - 2) + 2. Let v = -497 + q. Calculate the common denominator of v and d. 42 Calculate the smallest common multiple of 6 and 8/6 + 8/3. 12 Suppose -g - 5x + 0x = -20, -4g = 2x - 44. Suppose -2w + 8 = 2w. What is the least common multiple of w and g? 10 Let a = 2379863597/941137450 - 4/2251525. Let x = -23/19 + a. Find the common denominator of (-218)/28 + 6/42 and x. 154 Suppose 0q + 27 = 3q. Calculate the least common multiple of 12 and (-48)/q18/(-8). 12 Let u(v) = -v3 - v2 + v - 7. What is the lowest common multiple of 14 and u(-3)? 56 Let v be (8/6)/(-2)-18. Suppose -3y - 20 = 4. Let n = y + v. Calculate the smallest common multiple of 14 and n. 28 Suppose 3f + f - k = 7, 0 = -3f - 5k - 12. Calculate the lowest common multiple of 6 and f(-2 + (-6)/(-2)). 6 Let a(b) = b2 + 4b - 4. Suppose -4u - 21 = 7. Let q be a(u). Let j = -6 + q. What is the least common multiple of 11 and j? 11 Let t = -32249/6 + 5352. Let z = -48705587/2356 - -20673. Let b = -117793/16492 - z. What is the common denominator of b and t? 42 Suppose c = -0c - 4l - 5, -5l - 5 = c. Let k = 4 + c. Calculate the smallest common multiple of 3 and 3((-20)/6)/k. 30 Let o = 11917/6 + -1981. Find the common denominator of o and -75/14. 42 Let i(g) = 5g - 1. Suppose -7 + 2 = -5u, -2u = -j. Let r be i(j). Suppose v + 3 = r. What is the smallest common multiple of 18 and v? 18 Calculate the lowest common multiple of 70 and (4 - 1)((-28)/(-6) + 0). 70 Suppose 5k - 70 + 15 = 0. Suppose -u + 0u + k = -3o, 5u + 4o + 40 = 0. Find the common denominator of 79/6 and 13/228/u. 66 Let f = -16 + 26. Calculate the least common multiple of f and 8. 40 Suppose 180 = 4h + 5h. What is the smallest common multiple of h and 12? 60 Let b(g) = g3 + 8g*2 + g - 7. Let s be b(-7). Suppose -s = -3v - 2v. Let p = 12 + -4. What is the least common multiple of p and v? 56 Let f = 133131/10 + -13324. Find the common denominator of f and 87/2. 10 Let i = 193 + -613. What is the common denominator of 1989/i + 2/7 and -87/46? 460 Let w = 17761 + -390647/22. Let s be ((-490)/21)/(4/(-1758)). Let r = 205151/20 - s. Calculate the common denominator of r and w. 220 Let u(c) = -c + 7. Suppose -32 = -5i - 4w, 0 = -4i + w - 0w + 34. Calculate the smallest common multiple of i and u(0). 56 Calculate the common denominator of (-40)/16(-26)/(-4) and 9/22. 44 Let o = -3 - -9. Find the common denominator of 287/66 + 2/o and -71/8. 88 Let a = 10788604234/429 - 25148282. Let y = 7/143 + a. Find the common denominator of (1/9)/(3/(-9)) and y. 3 Suppose -4m = 4g - 24, 10 = 5g + 4m - 9m. What is the lowest common multiple of g and 6? 12 Suppose -5z - 65 = -0z. Find the common denominator of -79/6 and (z/15)/((-36)/(-150)). 18 Let b = 28 + -56. Let g be b/(-3)(-3)/2. Let j = g - -30. Calculate the lowest common multiple of 2 and j. 16 Suppose 3l = 2s - 0s - 1, -3l - 6 = 3s. What is the common denominator of 156/16(-7)/(-12) and (-417)/(-66) - (-2)/l? 176 Calculate the common denominator of -91/12 and (-4)/(-14 + 2)11/(-3). 36 Let p(z) = 3z*2 - 2z - 1. Let j be p(2). Suppose j = -5s + 2. What is the lowest common multiple of 8 and (-19 + 1)s - 2? 16 Let d = 540/11 + -5873/110. Calculate the common denominator of 9/(-22)24/12 and d. 110 Calculate the smallest common multiple of 1 and 172/22 - 16/(-88). 8 Suppose 16j - 186 = 15j. What is the lowest common multiple of j and 20? 1860 Suppose -10 = -4w - 26. Let m be (-1942)/w(-11 + -1). Let d = 46703/8 + m. What is the common denominator of d and -17/14? 56 Let x = 6 + -3. Suppose 3y - 8416 = -4o, 0 = -xo - y - 200 + 6517. Let w = o + -12709/6. What is the common denominator of w and -1/10? 30 Let j = 11 - 13. Let k(s) = 3s2 + 4s + 2. What is the least common multiple of 20 and k(j)? 60 Find the common denominator of (-3)/(-9) - (-2)/(-42) and -53/8. 56 Let p(t) = t*2 + 8t + 8. Suppose 0y = 4y - 64. What is the lowest common multiple of p(-8) and y? 16 Let z(o) = -5o2 - 1 + 2o*2 + 7o - 12 + 4o2. Let q be z(-9). Suppose -qm = -3m - 16. What is the lowest common multiple of 2 and m? 8 Let p(x) = -2x*3 - 4x*2 - 3x - 2. What is the least common multiple of p(-2) and 4? 4 Let g = 14 + -3. Calculate the lowest common multiple of 4 and g. 44 Let r be (-7 + 13)/((-1)/49). Let f = r + 2046/7. Calculate the common denominator of -101/6 and f. 42 Let s = -8943909/205 - -43629. Let h = 18921/820 + s. Calculate the common denominator of h and (10/150)/(4/438). 20 Let z(t) = t*3 + 8t*2 - 7t. Let n be z(-9). Let a be (141/n)/((-25)/3). Let i = -1258/75 + a. What is the common denominator of 58/9 and i? 18 Calculate the smallest common multiple of ((-2)/1)/(1 - 2) + 51 and 10. 530 Let t = 12447 - 522749/42. What is the common denominator of 73/66 and t? 462 Let a(y) = -y*3 + y + 5. Suppose 0 = 3v - 2o - 12, 0v = v + 4o + 10. Suppose 0 = 2g - v - 2. What is the smallest common multiple of g and a(0)? 10 What is the common denominator of -71/2 and 1/4 - 222/(-60)? 20 Let b = -3700952 - -40762166/11. Let y = -4704 + b. Calculate the common denominator of y and ((-114)/40)/((-1)/4). 55 Let r = 76/3 + -23. Suppose -c = -3c + 5h - 63, c + 3h + 48 = 0. Find the common denominator of r and c. 3 Suppose 6a - a - 60 = 0. What is the smallest common multiple of a and 56? 168 Let m(u) = u*2 + 8u - 12. Let v(o) = 3o3 + o2 - 2o + 1. Calculate the lowest common multiple of v(1) and m(-10). 24 Suppose 0 = -5*a + 16 + 14. Calculate the smallest common multiple of 19 and a. 114
Suppose -3a + 4 = 8l - 3l, 0 = 4l + a - 6. Suppose 90 = 12g - lg. Solve 0 = 5x - 1 - g for x. 2 Let v be (-3007577)/(-66867) - 4/(-186). Solve -35 = vy - 40y for y. -7 Suppose -5b + 10 = -k - 2k, -4k - 8 = -4b. Suppose -2w - 2z = -kw - 12, 0 = -z + 2. Solve -6 = 2i - w for i. -1 Let m(v) = -v2 + 9v + 59. Let r(d) = -2d3 - 19d*2 + 8d - 24. Let a be r(-10). Let x be m(a). Solve 8z - x = z for z. 1 Suppose 9z = -6407 + 6551. Solve 17j + 66 = -zj for j. -2 Let n = 1250 - 1216. Suppose v = 24t - 27t + 68, 0 = -5t - 4v + 118. Solve -4f + t = n for f. -3 Suppose 3h + 4p + 1201 = 0, -5h = -h + p + 1623. Let g = h - -412. Solve -35 = 2x + gx for x. -5 Let u = 64 - 28. Let t be 10(u/20)/3. Let o(b) = -b + 7. Let h be o(t). Solve 2g + 5 = -h for g. -3 Let q be 1 + -2 - 320/10. Let u be (-5)/(-30)-4q. Suppose 0z = -z + 2. Solve -z + u = -4r for r. -5 Suppose 13m + 6 = 2x + 17m, 4x + 4m = 12. Solve -11 = xh - 17 for h. 2 Suppose -9z = -1949 + 1661. Solve zh + 8 = -56 for h. -2 Suppose -5h - 21j = -25j - 542, 0 = -2h - j + 196. Solve -62 = hs - 71s for s. -2 Suppose -4s - 5g = -20, -4g + 10 = -4s - 6. Let a(i) = i*2 - 1. Let l be a(2). Suppose 12 = -t - lo, so + 21 = 2t - 3o. Solve -t = -2d + 7 for d. 5 Let o = -203 - -216. Let q be (-1)/(3 + 38/(-13)). Let x = q + o. Solve 0 = -j - x - 5 for j. -5 Let g(a) = a*3 + 10a*2 + 7a - 13. Let t be g(-9). Suppose h - 5z = -3, 2h - 11 = -tz - 2. Suppose 22f - 21f - 3 = 0. Solve s + f - h = 0 for s. -1 Suppose 390 = -19a + 16a. Let c = a + 153. Solve -3o - c = -8 for o. -5 Let b = 2369 + -2367. Solve -5y + by = -7y for y. 0 Let r = 2212 + -2212. Solve -8q - 25 - 7 = r for q. -4 Let b(w) = -w*3 + 13w*2 - 19w + 13. Let y be b(8). Let z = y + -147. Solve -4t - z + 18 = 0 for t. -4 Let j = -38 + 38. Suppose 0 = 2w - 2t, 3t + 7 - 22 = 0. Solve -m = -j - w for m. 5 Suppose 3 = 2o - 3o, -2i - 2o = -40. Suppose -u + 20 = 4a, 2u - 4a + 7 - i = 0. Solve 5k + u + 8 = 0 for k. -4 Let d(o) = o*3 + 10o*2 + 74o + 648. Let u be d(-9). Solve 50i - 41i + u = 0 for i. -7 Let l(j) = -j*2 - 8j - 4. Let q be l(-5). Suppose -3b + 4m + q = 0, -3b + 0b - 4 = -m. Let x be (11 + b)/(0 - -1). Solve d + 3d = -x for d. -2 Let h be (3552/814)/(-512/(-330)). Solve -9t - h = 3t for t. -2 Let v = 25 - -19. Suppose 31t = 42t - v. Solve 7k + 10 + t = 0 for k. -2 Suppose 2p + 0t = 5t + 67, 15 = 3t. Suppose 3g - p = -22. Suppose 0 = -7c + 29 - g. Solve 0f + c = f for f. 3 Suppose -3z - 5o = -9, 42o - 15 = -5z + 37o. Suppose 3t - z = -4y, -21 = -10y + 6y + 3t. Solve yx + 7 = -8 for x. -5 Let v = 503 + -867. Let r = v + 369. Solve 40 - 50 = -rb for b. 2 Suppose -5p - f = -39, -f + 25 = 3p - 2f. Let x = -18 - 12. Let d = -27 - x. Solve t - p = dt for t. -4 Suppose 0 = f - 5l - 44, 2f + 3l = 6l + 81. Suppose -32c - 28 = -fc. Solve -5g + c = -9g for g. -1 Let z(y) = 7y + 262. Let o be z(-36). Suppose 0 = -4m + 2j + 40, m - 11 = -4j - o. Solve 16a - 7 = ma for a. 1 Let l = -2787 + 2787. Solve l = 66r - 61r - 5 for r. 1 Suppose -8p + 9p = -4o + 304, -5p - 5o = -1550. Let c = -296 + p. Solve -cy = -5y for y. 0 Let f be (3 - 1)1/(-2) + 23. Suppose -235 = -17w + fw. Let c = w - -49. Solve 0 = j - c for j. 2 Suppose -8 + 9 = -7h + 1. Solve 72g - 76g - 12 = h for g. -3 Suppose 0m + 2m - 20 = 0. Let a(l) = -3l - ml + 17l + 35. Let v be a(-8). Solve -2 = -5o + v for o. 1 Let d(v) = 2v*2 + 62v - 430. Let m be d(-37). Solve 0 = -mf - 4f - 7f for f. 0 Suppose -26i = -21i. Suppose i = 8q + 3q + 374. Let f = -30 - q. Solve 3u - f + 1 = 0 for u. 1 Let o be (-43 - -53) + (-4 - -1). Solve -1028 = or - 1056 for r. 4 Let n be (4 + -5 + 1)-1. Suppose 21 = t + 5i, 5t + 5i = -ni + 85. Solve -4b = -t - 4 for b. 5 Let y be (-5)/(-2 + (-3 - -4)). Suppose -222 - 283 = yn. Let r = n - -104. Solve 2z = -rz + 15 for z. 3 Suppose -54t = 43t - 1843. Solve tw + 186 - 15 = 0 for w. -9 Suppose -f = 4 - 7. Let q be 141/15 - f/(-5). Let p be (-5)/(-1 + 26) + 52/q. Solve 0 = -po + 6 - 1 for o. 1 Suppose -166 = -9t + 5t - d, d = -3t + 124. Solve 17i + 9 = -t for i. -3 Let i(p) = -p*3 - p. Let f be i(-1). Suppose 4q - 2q - 2r = f, 0 = 3r - 12. Suppose -2z = d + 2z - 9, -2z - 1 = -qd. Solve -d = k + 1 for k. -2 Let d = 22768 - 22617. Solve do + 75 = 166o for o. 5 Let w(r) = -r3 - 123r*2 + 125r + 264. Let x be w(-124). Solve -35u + 0 = -x for u. 4 Let i(o) = 173o + 6823. Let p be i(-37). Solve 421q + 5 = pq for q. 5 Let x be -8 + (310 + -9)/7. Let y be (-62)/(-8) + x/140. Solve -2j + y = -0j for j. 4 Let t be 2142/162 - 4/18. Suppose 0n - n = 5x + t, -3n = 2x. Let h be n - 13/((-52)/24). Solve 0 = -2i - h for i. -4 Suppose -v + 5v = 16. Suppose -16g + 17g - 3 = 0. Let u = -2 + g. Solve u = vj - 11 for j. 3 Suppose -4f + 0 = -4. Let g(a) = a*2 + 4a - 30. Suppose 4b + 33 = 1. Let s be g(b). Solve l - f = sl for l. -1 Let z = 187 - 185. Let b(k) = -12k - 77. Let x be b(-7). Solve -zf + xf + 10 = 0 for f. -2 Suppose 24o + 35555 = 35651. Solve -8b - 12 = o for b. -2 Suppose 3i + 2m = 65, 27m = 3i + 25m - 85. Let j be ((-30)/i)/(9/30)-1. Solve -jc = -c + 12 for c. -4 Suppose 70d - 149d + 47d + 224 = 0. Solve -ds + 18 - 32 = 0 for s. -2 Suppose 5b = 4f + 79, -3f - 22 = -5b + 61. Suppose -3x - 3h + 21 = 0, 4h - b = -x - 0x. Solve -3q + x = -4q for q. -3 Suppose -67 + 110 = h. Let s = h - 73. Let r be (-9)/(-4)(-160)/s. Solve -4l + 0l = -r for l. 3 Suppose 6 + 14 = 4p. Suppose -3v + pj - 19 = 0, -4v + 32 = 5j - 1. Solve -vt = t + 15 for t. -5 Suppose 14t - 13t + 189 = 5u, -4t = 4u - 132. Suppose -uz = -17z - 40. Suppose 2 + 4 = 2r. Solve 3 = -zq - r for q. -3 Suppose 40 = 5o - 20. Suppose -3y + 5b = 8, -3b = -0y + 3y - 24. Suppose 24 = yc + o. Solve 0 = -cp + 20 - 5 for p. 5 Let k(x) = -30x + 17 - 2x*2 + 5x*2 - 26x + 0x2. Let p be k(19). Solve -pc = -35c - 3 for c. 3 Let t be (-28)/(-1)9/6. Let i = t - 10. Let w = -32 + i. Solve w = -4n + 3n for n. 0 Let d be (-189)/(-7) - (4 - 1). Let y be d/(-16)16/(-6). Suppose 0t + yt = 2q - 16, -q + 7 = -t. Solve -2v - v - q = 0 for v. -2 Let g = 32 + -11. Suppose 5m = m + 4q + 20, -5q = 4m - 56. Suppose 5o - 11 = m. Solve -5b + o + g = 0 for b. 5 Suppose 5l = -4x + 35 - 105, 39 = -3x + 3l. Suppose -4r = 20 + 24. Let v = r - x. Solve f - v = 2f for f. -4 Let l(s) = -4s*2 - 123s + 163. Let z be l(-31). Solve 32q = z + 124 for q. 8 Let w(q) = q2 - q - 21. Let z be w(6). Suppose -2h - z = 7h. Let f be 2 + h + 0 - -1. Solve -t - 3 = f for t. -5 Suppose -5j - 181f = -179f - 26, 0 = -2f + 6. Solve -jb + 39 = 43 for b. -1 Let q(s) = 23s + 2324. Let j be q(-101). Let l = -5 + 8. Solve 5 = lf - j for f. 2 Suppose -19 = -4m - i, i + 1 + 0 = m. Suppose 0 = 4c, -mc = -0s + 4s - 24. Let x(l) = -4l + 1. Let j be x(-6). Solve a - j = sa for a. -5 Suppose 0 = -276p + 291p + 2340. Let m(l) = l3 - 10l*2 - 7. Let y be m(6). Let a = y - p. Solve -3s - 4 = -as for s. 2 Let p = 373 - 231. Let u = p + -141. Solve -26 = -5b - u for b. 5 Let d(u) = 40u - 189. Let z be d(7). Solve -70i + zi + 105 = 0 for i. -5 Let t(j) = 2j - 29. Let l be t(17). Suppose lx - 629 = 51. Let n = 136 - x. Solve -2c + c = n for c. 0 Suppose 0 = 5u - 3u - 10. Let z(y) be the first derivative of y*4/4 + 6y*3 - 10y*2 - 16y + 5. Let a be z(-19). Solve uq = a + 12 for q. 3 Let a be (-143 + -2)(-4)/(-10). Let l be (a/(-8))/(-1 + 5/4). Solve 10 = ld - 34d for d. -2 Let j be (10/12)/((-22 + 12)/(-180)). Suppose n = 22 - j. Solve -2p - np + 18 = 0 for p. 2 Suppose -32r + 43r - 242 = 0. Solve -ro + 6 = -20o for o. 3 Let m(w) = 4w + 31. Let t be m(-7). Suppose -10 - 18 = -4o + 5j, 0 = -to + 4j + 22. Solve -oc + 10 = 3c for c. 2 Let s = 8541 - 8532. Solve -17a = -sa for a. 0 Let n(m) = 4 + 203m + 206m - 402m. Let w be n(0). Solve -w = -3g - 1 for g. 1 Suppose 4y + 60 = 24y. Suppose -5z - 11 = -31. Let i = z - 2. Solve yu = 4u - i for u. 2 Let n be 102/(-68) - (-963)/(-2). Let m = n - -483. Solve 0 = -ms + s + 3 for s. -3 Suppose 2d + 8 = 0, 4d + 8 = -4x + 5d. Let l be (-27)/(4/12x). Let n = 40 - l. Solve -5k = -n - 12 for k. 5 Let n be 12 + -283/(-2). Solve 27p - 9p + n = 0 for p. -3 Let v be (-64)/8 + 11 - 319. Suppose 5n = 3s + 293, -n + 5n - 233 = s. Let j = v + n. Solve j*x + 9 = x for x. -3
Convert 834713.3t to kilograms. 834713300 What is 3/25 of a millimeter in micrometers? 120 How many centuries are there in 1126.9965 months? 0.93916375 How many meters are there in 21/8 of a kilometer? 2625 What is ninety-seven halves of a century in decades? 485 What is twenty-five quarters of a meter in millimeters? 6250 How many grams are there in nineteen tenths of a kilogram? 1900 How many kilograms are there in seven quarters of a tonne? 1750 How many years are there in eleven eighths of a millennium? 1375 What is 1/4 of a microgram in nanograms? 250 How many months are there in 797590.4 years? 9571084.8 How many minutes are there in 3/7 of a week? 4320 How many seconds are there in 28/9 of a hour? 11200 How many millimeters are there in 296.625 centimeters? 2966.25 How many months are there in three eighths of a century? 450 How many millennia are there in 26.92146 months? 0.002243455 How many hours are there in 66537.252 nanoseconds? 0.00000001848257 What is 0.7755625 litres in millilitres? 775.5625 How many millilitres are there in seven halves of a litre? 3500 How many years are there in 7/8 of a millennium? 875 Convert 52.4842 centuries to decades. 524.842 What is 65.56741t in kilograms? 65567.41 How many months are there in 0.4986271 millennia? 5983.5252 How many micrograms are there in twenty-five quarters of a milligram? 6250 What is 0.237074cm in millimeters? 2.37074 How many millimeters are there in 13/5 of a centimeter? 26 How many micrometers are there in 903.9769nm? 0.9039769 Convert 2.774134 millilitres to litres. 0.002774134 What is 1873.84kg in milligrams? 1873840000 What is 907826.9 tonnes in grams? 907826900000 What is seventeen halves of a decade in years? 85 How many millilitres are there in 7/2 of a litre? 3500 How many millilitres are there in 34/5 of a litre? 6800 What is 1.359735 seconds in minutes? 0.02266225 What is one tenth of a litre in millilitres? 100 How many centimeters are there in 75272.12 kilometers? 7527212000 How many meters are there in one tenth of a kilometer? 100 How many millilitres are there in 5.213053l? 5213.053 How many litres are there in 2.001387ml? 0.002001387 How many months are there in one twentieth of a century? 60 What is 1/72 of a day in seconds? 1200 Convert 0.384995ns to microseconds. 0.000384995 How many months are there in 42750.69 millennia? 513008280 Convert 0.8129325 meters to micrometers. 812932.5 How many grams are there in 18.54582ng? 0.00000001854582 How many centimeters are there in 0.6763978 kilometers? 67639.78 What is 9.355322 micrograms in tonnes? 0.000000000009355322 How many years are there in 0.1917323 millennia? 191.7323 Convert 14989.96 nanograms to tonnes. 0.00000000001498996 What is one tenth of a millennium in years? 100 What is 6/25 of a micrometer in nanometers? 240 How many millilitres are there in 34/5 of a litre? 6800 How many months are there in thirty-seven fifths of a decade? 888 What is 6/25 of a meter in centimeters? 24 What is seventeen quarters of a millennium in years? 4250 Convert 6.199194 centuries to years. 619.9194 Convert 6.258967 micrograms to milligrams. 0.006258967 Convert 0.4927461 litres to millilitres. 492.7461 What is one quarter of a millisecond in microseconds? 250 How many millilitres are there in three fifths of a litre? 600 What is 34.874cm in nanometers? 348740000 What is 8.049973 centuries in decades? 80.49973 What is seventy-four fifths of a kilometer in meters? 14800 Convert 27997.254 months to decades. 233.31045 How many weeks are there in 12348063.63 nanoseconds? 0.000000020416771875 What is 9192.227 meters in kilometers? 9.192227 How many micrograms are there in 4468.728 milligrams? 4468728 Convert 0.3407337g to nanograms. 340733700 How many grams are there in 31/2 of a kilogram? 15500 What is three tenths of a kilogram in grams? 300 Convert 3531.546 decades to months. 423785.52 How many millilitres are there in fourty-eight fifths of a litre? 9600 Convert 0.5788499 kilometers to micrometers. 578849900 What is 1/16 of a milligram in nanograms? 62500 What is 154.5675 micrometers in centimeters? 0.01545675 How many grams are there in 27/5 of a kilogram? 5400 What is 3/32 of a gram in micrograms? 93750 What is 21/2 of a kilogram in grams? 10500 How many months are there in 1313.039 decades? 157564.68 How many kilograms are there in 21/2 of a tonne? 10500 How many centimeters are there in three fifths of a meter? 60 How many hours are there in 26800.71 weeks? 4502519.28 How many seconds are there in 10.66433ms? 0.01066433 What is 25/4 of a millennium in decades? 625 How many decades are there in 5/4 of a millennium? 125 What is 55/2 of a litre in millilitres? 27500 What is twenty-one quarters of a gram in milligrams? 5250 How many nanometers are there in fifty-two fifths of a micrometer? 10400 How many micrograms are there in five quarters of a milligram? 1250 What is four thirds of a week in hours? 224 Convert 1405.806 days to minutes. 2024360.64 What is one fifth of a litre in millilitres? 200 What is 90.95182 micrograms in milligrams? 0.09095182 What is 0.2896535 millilitres in litres? 0.0002896535 How many millimeters are there in 0.3041312 micrometers? 0.0003041312 How many months are there in 290.714 years? 3488.568 What is 17/2 of a year in months? 102 How many grams are there in 379065.9 nanograms? 0.0003790659 What is 83188.3cm in nanometers? 831883000000 How many decades are there in 67/5 of a millennium? 1340 What is 57355.17ml in litres? 57.35517 What is three tenths of a millennium in months? 3600 How many centuries are there in 929605.8 months? 774.6715 What is 7/2 of a millennium in decades? 350 What is 15/4 of a week in minutes? 37800 What is 1/4 of a litre in millilitres? 250 How many microseconds are there in one tenth of a second? 100000 Convert 1768.614ug to milligrams. 1.768614 What is 1/4 of a litre in millilitres? 250 What is 8/25 of a milligram in micrograms? 320 How many years are there in 21/8 of a millennium? 2625 How many millimeters are there in 18/5 of a centimeter? 36 How many nanograms are there in 27/2 of a microgram? 13500 Convert 4.981473 minutes to milliseconds. 298888.38 Convert 529.6814ml to litres. 0.5296814 How many millilitres are there in 21/8 of a litre? 2625 What is 61605.53 grams in nanograms? 61605530000000 What is 87/5 of a litre in millilitres? 17400 How many microseconds are there in 3/50 of a second? 60000 What is fourty-three quarters of a litre in millilitres? 10750 What is 933.5082kg in grams? 933508.2 Convert 0.5262659 decades to centuries. 0.05262659 Convert 50246.24um to millimeters. 50.24624 How many micrometers are there in sixty-seven quarters of a millimeter? 16750 How many litres are there in 0.5433922 millilitres? 0.0005433922 How many litres are there in 8.586244ml? 0.008586244 How many months are there in 97.23704 millennia? 1166844.48 How many millilitres are there in three fifths of a litre? 600 Convert 30.42735 litres to millilitres. 30427.35 How many micrometers are there in 0.6497225 millimeters? 649.7225 Convert 0.6670609ng to micrograms. 0.0006670609 Convert 46347.39 weeks to microseconds. 28030901472000000 Convert 1193.293 meters to millimeters. 1193293 How many micrograms are there in one twentieth of a milligram? 50 Convert 917.5762 minutes to seconds. 55054.572 What is thirty-four fifths of a day in minutes? 9792 How many micrometers are there in 1/5 of a centimeter? 2000 What is 34/5 of a litre in millilitres? 6800 How many millennia are there in 5981.256 months? 0.498438 What is 0.7558689 millilitres in litres? 0.0007558689 How many millilitres are there in 3/5 of a litre? 600 What is 9694.265mg in kilograms? 0.009694265 What is one quarter of a meter in centimeters? 25 Convert 445.9291 nanometers to centimeters. 0.00004459291 Convert 24.745692 months to millennia. 0.002062141 What is twenty-one halves of a millimeter in micrometers? 10500 How many months are there in 27/5 of a century? 6480 What is 1/16 of a hour in seconds? 225 Convert 0.5691805m to kilometers. 0.0005691805 Convert 199.1196 seconds to hours. 0.055311 Convert 8281.593 grams to tonnes. 0.008281593 Convert 9.943732 millilitres to litres. 0.009943732 How many millennia are there in 3597.846 centuries? 359.7846 Convert 4699.723 centimeters to meters. 46.99723 How many days are there in 0.9318843 hours? 0.0388285125 How many centimeters are there in one fifth of a kilometer? 20000 How many kilograms are there in 736761.4mg? 0.7367614 How many millilitres are there in 2/125 of a litre? 16 How many micrometers are there in fourty-two fifths of a millimeter? 8400
Let v = -4 + 6. Let t = 41.221 + -40.821. Which is the third biggest value? (a) v (b) 4 (c) 1/2 (d) t c Suppose -18h = -15h - 129. Suppose 0 = -6j + h - 73. Which is the third biggest value? (a) j (b) -4 (c) -2/5 a Let r = -1153 - -1152.7. Which is the second smallest value? (a) r (b) -115 (c) -4 c Let k be (-1)/2 - 63/(-102). Let r = -0.011129 - -0.411129. Which is the fourth smallest value? (a) -4 (b) k (c) r (d) 5/6 d Let f = 97/7 + -471/35. Suppose -6i + i = -5v - 40, 3i + 16 = -5v. Suppose z = -i + 1. Which is the third biggest value? (a) -2/13 (b) z (c) f b Let m = -63/8 + 535/72. Let b = -0.46 + 0.06. Let h = 4/103 - -499/412. What is the third smallest value in m, b, 1, h? 1 Let i = 16846.9 + -16847. What is the smallest value in i, 27, -3? -3 Let p be 6/4(-8)/28. Let h = 4.48 - 5.18. Which is the smallest value? (a) p (b) -4 (c) -3 (d) h b Let p = -107.882 + 108. Let w = 0.308 - p. Which is the biggest value? (a) -4/5 (b) -4/9 (c) w c Let x = -0.6145 + 1.0145. Which is the third smallest value? (a) x (b) 6/13 (c) 5 (d) -3/10 b Let q = -4.019 + 9.019. Which is the second smallest value? (a) -20 (b) q (c) 3 c Let a = -2 - -2. Let g be a-24/(-8). Suppose 0m - 3m + 2n - 10 = g, 5m + 23 = -3n. What is the biggest value in 3, -2/5, m? 3 Let z = 7652 - 7626. Which is the second smallest value? (a) -5/2 (b) 0.2 (c) z b Let b = -49 - -49. Let i be (-570)/(-220) - (b + 3). Let p = i - 69/154. What is the biggest value in 5, p, 0.3, 2? 5 Let p(w) = w2 - 4w - 3. Let c be p(6). Let o = -136 - -136.06. Suppose -u = 4x + 7, -5u + 30 = -5x - 10. What is the second smallest value in x, c, o? o Let x be (-6)/33 - (-73)/99. Let t = -344.0298 - -0.0298. Let o = t + 340. What is the smallest value in o, 2, x? o Let l = -0.237 + 106.237. Let h = -129.43 + 129.73. Which is the second smallest value? (a) -2/9 (b) -0.2 (c) l (d) h b Let g = -1141 + 1050. What is the second biggest value in -0.4, g, -4? -4 Let u be (1/12)/((-10 - 11)/168). What is the third biggest value in 571, u, -1, -2/5? u Let i = -3.602 + -0.398. Let t = 77/58 + 1/174. Let p = -258 + 257.6. What is the second biggest value in t, i, p? p Let d = 1.09 + -187.09. Let k = d + 187. What is the smallest value in -0.3, -8, k? -8 Let k = -558 - -558.4. Let g = -0.12 + 0.12. Which is the third smallest value? (a) k (b) 5 (c) -1/5 (d) g a Let o = 2.18 - -18.22. Let w = 3.6 + o. Let k = w + -21. Which is the smallest value? (a) 0.3 (b) -0.3 (c) k b Let f be 6 + (-5)/((-15)/(-6)) + 0. Let y = 16 + -15.9. Which is the third smallest value? (a) 2/3 (b) 1 (c) f (d) y b Let j be 4/(-3)618/(-3296). Let x = 2.97 - -0.03. What is the third biggest value in -4, x, j? -4 Let b = -0.049 - -24.849. Let t = b - 24.3. What is the fourth smallest value in t, -3/2, 0.4, 0.03? t Suppose -20x = -15x. Let t = 40 + -35. Which is the biggest value? (a) -0.3 (b) t (c) -5 (d) x b Let h = -7797.9 - -7798. Which is the third smallest value? (a) 4/7 (b) -98 (c) h a Let r = 1.2 + 2.8. Let u = 101/21 + -110/21. Which is the third smallest value? (a) -21/5 (b) r (c) u b Let q = 9851 - 285683/29. Which is the third smallest value? (a) q (b) -17 (c) -1/4 a Let v be (84/210)/((-160)/75). Which is the biggest value? (a) -3 (b) v (c) -1 b Suppose -5k - 2y + 35 = 0, 0 = -3y - 15 - 0. Let g = -1198 + 1203. Which is the second biggest value? (a) g (b) 2 (c) k a Let g(x) = -2x - 11. Let n(c) = c*3 + 6c*2 + 8c + 8. Let a be n(-5). Let h be g(a). What is the second biggest value in -14, -2/9, h? -2/9 Let f = -15.578 + 15.878. Let z = 8 + -5. What is the smallest value in z, 59, f? f Let p = -166 - -171. Let u = 103/8 + -349/24. What is the second smallest value in 3, u, -7, p? u Let o be (-228)/10 - (-8832)/384. Which is the fourth smallest value? (a) 4 (b) -35 (c) -5 (d) o a Suppose o - 6z - 12 = -4z, 5o + 5z = -60. Let p = 1 + -1. Which is the third biggest value? (a) o (b) 3/8 (c) p a Let b = 15/8 + -113/56. Let d be (21/2)/((-35)/30 - -1). Let x = -61 - d. What is the third biggest value in b, x, 1/9? b Let n = -9709 - -9707. Which is the biggest value? (a) n (b) -2/11 (c) 2.3 (d) 1/2 c Let n = -215371 + 215369. Let o = 2 + -1. Which is the third biggest value? (a) o (b) 2/13 (c) 1/6 (d) n b Let h = -1002.01 - -1002. Which is the fourth smallest value? (a) 1/3 (b) -0.3 (c) h (d) -2/17 a Let b = 20 - 32. Let q = b - -7. Suppose 2l - 3k + 15 = 24, -2 = l + 5k. What is the second smallest value in q, -8, l? q Let o be (-732)/(-610) + (-2)/(-15). Which is the second smallest value? (a) 1/5 (b) -5 (c) -718 (d) o (e) 1 b Let z = 231.265 - 231. Let n = 1.265 - z. Let i = -11 + 23/2. What is the second biggest value in i, 0.2, n, 3/7? i Let g = 38.021 + -10.331. Which is the second smallest value? (a) g (b) -0.5 (c) 4/3 c Let y(m) = -119m + 1665. Let v be y(14). What is the smallest value in 6.7, -4/5, v? v Let v = -0.689 + 0.449. Which is the third smallest value? (a) -0.15 (b) v (c) -2 (d) -0.7 b Let b = -2.4252 - -2.1252. What is the fourth biggest value in -4, 226, b, -2/23, -0.5? -0.5 Let r = 53/2 - 26. Let z = 99.565 + -0.165. Let l = -99 + z. What is the third biggest value in l, 0, r? 0 Let q(h) = -h*3 + 4h*2 + 2h + 1. Let l be q(4). Let f = -6 + l. Which is the third biggest value? (a) -1 (b) -7 (c) f b Suppose -5t - 4r = -25, 22 = 2t - 292r + 296r. Which is the second biggest value? (a) -1.2 (b) -2 (c) -35 (d) t a Let v = -113.7 - -111. Let l = v + 6.7. Suppose 4t + 5m + 8 + 0 = 0, 5m - 2 = t. What is the second biggest value in t, l, -14/3? t Let j = 0.09955 + 3.90045. What is the fourth smallest value in 2, 5, j, -0.3? 5 Let s = 49 + -46. Let h = -6227 - -6227.5. Which is the third smallest value? (a) 34 (b) h (c) s (d) -1/7 c Let s = 4770 + -4769. Which is the third biggest value? (a) s (b) -0.65 (c) 5/6 b Let g = 3307 + -3306.1. What is the second biggest value in 0.1, -2, g, -9, -5? 0.1 Suppose 264 + 60 = -81z. What is the second biggest value in 0.06, 0.1, -6, z? 0.06 Let l = -82 + 1398/17. Let w = -0.025 - -0.07. Let d = -3.045 + w. Which is the second smallest value? (a) 0.1 (b) d (c) l a Let d = 4.7 + -4.51. Let h = 500 + -500.23. Let n = d + h. Which is the second smallest value? (a) n (b) 1 (c) 0.2 c Let n = 0.5678 - 0.6278. What is the third biggest value in 21, 0.3, n? n Let i be 2/((-20)/(-2))3. Let v = -51689 + 51685. What is the third biggest value in -1.7, i, 0.4, v? -1.7 Suppose 13g - 33g = -g + 95. Let l = -15.7 + 17. Let o = l + -0.6. Which is the biggest value? (a) o (b) g (c) -1 (d) 2/11 a Suppose 5q - 54 - 41 = 0. Suppose 13n - q = 7. Which is the biggest value? (a) -1 (b) n (c) 4 c Suppose -r - 3j - 209 = -195, 26 = -5r - 4j. What is the third biggest value in 39, -5, 9, 1/2, r? 1/2 Let j = 34.47 - 35. Let v = 0.87 + j. What is the second biggest value in 3, 1/2, v, -0.4? 1/2 Suppose -y = -2v - 5y - 10, 4v = -4y - 8. Let z = v - 3. Let p be (z - 10/(-7))/1. Which is the third biggest value? (a) 5 (b) -3 (c) p b Let c be 3/(-2) - (-12)/(-24). Suppose 3t + 8 = -4r, -13r - 3t + 37 = -18r. What is the third smallest value in 13, r, c? 13 Let v = 743/1119 + 1/373. Let o = -41.6 + 38.6. Which is the third biggest value? (a) o (b) -7 (c) v b Let t = 28714 + -28713.8. Which is the smallest value? (a) -5 (b) -2278 (c) t (d) 3 b Let u = 0.1651 + 0.0349. Suppose -14m + 19m = -q + 7, 4m - 8 = 0. Which is the biggest value? (a) q (b) u (c) 4 (d) 2 c Let l = 2874 - 2874.3. What is the smallest value in -4, l, -2, 0.1, 0.2? -4 Let m(z) = 2z - 2. Let o be m(3). Let f = 51 + -19. Suppose -f = 5i - 2. What is the second biggest value in o, i, -0.5? -0.5 Let u be 3876/(-255) + (-128)/(-8). What is the fifth biggest value in -3, -2/11, 20, 4, u? -3 Let u = 1207 + -1207.4. Let m be (2 + -3)/(2/4). Let s be 3 - m/(-26)45. Which is the smallest value? (a) u (b) s (c) 0.3 (d) 3 b Let o = 506.791 - 507. Let y = -1.791 + o. What is the biggest value in -15, -5, y? y Let x = -13 + 7. Let n = x + 10. Suppose 26*t - 2 + 200 = -10. Which is the third biggest value? (a) n (b) t (c) -2 (d) 1 c Let i be (((-32)/30)/(-4))/(65/15 - 5). Which is the smallest value? (a) -1/12 (b) 1/6 (c) -41 (d) i (e) 3/7 c Let n = 10/17 - 277/442. Let l = n - 21/130. Let t be (-2)/(-3) + (-11)/12. What is the second biggest value in t, 4, l? l
Let s(b) = 4b3 + 4b*2 - 27b - 1208. Let z(j) = 2j3 + 2j*2 - 15j - 605. What is -5s(k) + 9z(k)? -2k3 - 2k*2 + 595 Let g(s) = -73s*2 - 5s + 7. Let j(d) = -d*2 - 2d - 2. What is g(m) - 4j(m)? -69m*2 + 3m + 15 Let d = -5 + -1. Let k(t) = -3t + 5. Let w(i) be the third derivative of 7/3i*3 - 3/8i*4 + 22 + 2i*2 + 0i. Give dw(y) + 17k(y). 3y + 1 Let t be 1/(4/(-2))6. Let f(n) be the second derivative of -n*3/2 - 2n - 11. Let r(q) = 69q. Calculate tr(h) - 72f(h). 9h Let u(j) = 8j + 5. Let q(k) = -129k - 81. Suppose -147n - 1056 = -256n + 141n. Determine nu(s) - 2q(s). -6s - 3 Let v(r) = -9r - 2. Let y(t) = -33t - 25. Let m(w) = 2w + 3. Let a(s) = 7m(s) + y(s). Determine -6a(f) + 13v(f). -3f - 2 Let v(a) = -29a + 51a + 3 - 10a - 6a - 13a. Let k be (-4)/18 + (-310)/(-18). Let p(i) = 20i - 8. Give kv(n) + 6p(n). n + 3 Let s(z) = 17z*2 + 9z - 3. Let o(g) = -8g2 - 5g + 2. Suppose 3k - 4n = -57, 0 = -2k - 2n + 37 - 33. Determine ko(c) - 4s(c). -12c2 - c - 2 Let r(y) = -6y*2 - 9y - 262. Let f(d) = -6d2 - 8d - 219. Let u(x) = 6f(x) - 5r(x). Let b(c) = -2c2 - c - 1. Determine 14b(n) - 4u(n). -4n*2 - 2n + 2 Let y(q) = -1864q + 4. Let w(a) = 1246a - 3. Give 7w(u) + 5y(u). -598u - 1 Let t(c) = -381c + 61. Let z(b) = -128b + 22. Determine 4t(a) - 11z(a). -116a + 2 Let s = -46 + 47. Let n(u) = 3u2 + 5. Let v(q) = 2q*2 + 3. Let r(c) = 3n(c) - 5v(c). Let h(m) = 10m*2. Determine sh(t) + 5r(t). 5t*2 Let s(j) = -896j*3 + 5j*2 + 4j - 10. Let i(a) = -447a3 + 3a*2 + a - 6. Calculate 5i(r) - 3s(r). 453r*3 - 7r Let y(f) = f3 + f2 + 1. Let r(l) = 13l + 196. Let k be r(-15). Let s(x) = -6x*3 - 4x*2 - 2x - 10. Suppose 29c = 22 + 94. What is cy(o) + ks(o)? -2o*3 - 2o - 6 Let u(l) = -23l2 + 12l - 12. Let t(v) = 49v2 - 22v + 25. Determine 6t(h) + 11u(h). 41h2 + 18 Let u(p) = -30p*2 - 50p + 12. Let y(j) = 6j2 + 10j - 2. Give 2u(x) + 11y(x). 6x2 + 10x + 2 Let x = -5497 - -5499. Let z(h) = -15h3 - 105h - 105. Let r(y) = y + 1. Calculate xz(o) + 210r(o). -30o3 Let z = 3 - 2. Let m(k) = -4k*3 + 3k*2 - 3k - 3. Let w(u) = -u*2 + u + 1. Suppose -10 = -2g, 0 = -q + 164g - 161g - 12. Calculate qw(p) + zm(p). -4p3 Let f(o) = o3 - 27o*2 - 14o + 2. Let i(u) = -u*3 - 23u*2 - 11u + 1. Give -4f(x) + 5i(x). -9x3 - 7x*2 + x - 3 Let v(a) = 2a*2 + 14a*2 - 12a*2 + 6a + 0a. Let r(k) = k2 - 2k - 57. Let j be r(9). Let h(n) = n*2 + n. Calculate jh(u) - v(u). 2u2 Let t = 111 - 101. Let d be t + (-2662)/77 + 8/14. Let q(j) = -8j*3 + 5j*2 - 5j - 5. Let r(a) = -39a3 + 24a*2 - 24a - 24. Determine dq(m) + 5r(m). -3m3 Let v(f) = -17f - 96. Let q(y) = 13y + 72. Let g(n) = 4q(n) + 3v(n). Let m(w) = 13w + 2. What is -3g(k) - m(k)? -16k - 2 Let u(j) be the third derivative of 1407j6/40 - 14j*5/5 + 7j*4 + 61j*2 + 6j. Let k(p) = -126p3 + 5p*2 - 5p. Give -168k(g) - 5u(g). 63g3 Let b(j) = -34j*2 - 3j - 207. Let k(w) = -14w2 - 2w - 104. Determine 2b(y) - 5k(y). 2y2 + 4y + 106 Suppose -3k - 4y = -27, 3y = 4k + 2y - 17. Let c(g) = -22041g + 1 + 458g2 - 460g*2 + 22045g. Let l(w) = -3w2 + 7w + 2. What is kc(p) - 3l(p)? -p*2 - p - 1 Let k(d) = -1300d*3 - 9d*2 + 16d. Let w(b) = 653b3 + 5b*2 - 9b. Calculate 4k(l) + 7w(l). -629l3 - l2 + l Let q(n) = -96n + 1 + 61n + 10n*2 - 21n*2 + 36n + 12n2. Let o(b) = 2b*3 + 5b - b + 4 + b*3 + 4b*2. Calculate -o(h) + 4q(h). -3h3 Let k(x) = 17x*3 - 2x*2 - 5x - 2. Let l(j) = -84j3 + 11j*2 + 25j + 11. Give 22k(c) + 4l(c). 38c3 - 10c Let d(q) = 1. Let p(x) = -6x - 1. Let n(v) = -31v - 8. Let i(o) = -n(o) + 4p(o). Calculate -6d(g) + i(g). 7g - 2 Suppose 8n - 252 + 152 = -124. Let x(u) = -1. Let f(b) be the first derivative of b*2/2 - 2b - 2. Calculate nx(v) + 2f(v). 2v - 1 Let w(f) = 7f2 + f3 + 7f3 + 3 - 3f - 4f2. Let p(x) = 21x + 21x3 - 3x - 27x + 19x*3 + 16 + 16x*2 - 2x - 5x. Calculate -3p(m) + 16w(m). 8m*3 Suppose 0 = -l - 4. Let z(m) = -2m*3 - 34m - 10. Let v(k) = -k*3 - 12k - 4. Let f(c) = 11v(c) - 4z(c). Let n(d) = d*3 - d + 1. What is ln(t) - f(t)? -t*3 Let o(k) = 5k*3 + 8k*2 + 5k + 32. Let g(j) = 7j3 - j2 + 3j + 1. What is g(m) - o(m)? 2m3 - 9m*2 - 2m - 31 Let k(t) = -2t3 + 3t*2 + 3. Suppose 0 = 2q + 78 - 118. Let l(y) = 15y3 - 20y*2 - 20. What is qk(w) + 3l(w)? 5w*3 Let c(z) = 6z - 18. Let m(q) = -16q - 24. Let k(g) = -35g - 51. Let s(f) = 6k(f) - 13m(f). Determine 3c(n) + 8s(n). 2n - 6 Let q(s) = 730s*3 - 6s*2 - 3. Let m(c) = -5c*3 - 2c*2 - c - 1. Determine -3m(u) + q(u). 745u3 + 3u Let c be 56/(-12)(-105)/49. Let z(b) = -6b + 8. Let y(p) = -p - 1 - 2 + 4. Determine cy(q) - 2z(q). 2q - 6 Let l(r) = -13r - 165. Let n(o) = 2o + 8. What is l(v) + 6n(v)? -v - 117 Let a(i) = -239i - 1 - 272i - 267i + 779i. Let t(r) = -2r + 5. Determine -12a(z) - 4t(z). -4z - 8 Let r(y) = 433y + 4665. Let z(q) = 79q + 933. Determine 2r(u) - 11z(u). -3u - 933 Let w(v) = -7v. Suppose 34z - 35z = -6675. Let l(i) = 6675 - 4i - z. Determine 7l(f) - 3w(f). -7f Let t = -11012 - -11014. Let n(s) = -5s2 - s - 5. Let z(o) = 3o*2 + 2. Determine tn(f) + 5z(f). 5f*2 - 2f Let r(g) = -182154g2 + 105g - 945. Let w(q) = 3503q2 - 2q + 18. Calculate -2r(k) - 105w(k). -3507k2 Let a(u) = -23u + 72. Let f(y) = -9y + 29. Let j(l) = -2a(l) + 5f(l). Let w(r) = 10r - 5. What is -5j(m) - w(m)? -15m Let h be (-2 - -3)/(-1)-1. Let o(p) be the second derivative of 33p + 0 - 1/2p2 + 1/6p*3. Let k(g) = -9g + 8. Determine hk(a) + 6o(a). -3a + 2 Let f = 228 + -221. Let d(x) = -2 - 5 + 0 + 14x. Let g(m) = -5m + 2. What is fg(u) + 2d(u)? -7u Let b(n) be the first derivative of 1/2n2 + 32 + 3n - 7/3n3. Let s(j) = j2. What is -b(h) - 5s(h)? 2h2 - h - 3 Let v(w) = -2w + 4. Let x(i) = -10i + 137. Let k(z) = 29z - 380. Let d(p) = -4k(p) - 11x(p). Calculate 4d(u) - 14v(u). 4u - 4 Let l(c) = -2c + 12. Let g = -172 + 177. Let h(b) = g + 0 - 6. What is -12h(o) - l(o)? 2o Let t(w) = -3w - 1. Let d(v) = 155v + 133v - 439v + 150v. What is -3d(j) - t(j)? 6j + 1 Let q(n) = -5n + 20. Let v(f) = -479f + 1446f - 486f - 470f - 39. Give 13q(d) + 6v(d). d + 26 Let c be ((-690)/23 - -4) + 29. Let v(x) = -2x2 + 6x + 2. Let y(g) = -g*3 - 3g*2 + 6g + 3. Give cv(u) - 2y(u). 2u3 + 6u Let m(d) = 5d3 + 2d*2 + 2d - 3239. Let j(o) = 8o3 + 3o*2 + 3o - 3238. What is 2j(y) - 3m(y)? y*3 + 3241 Let u(t) = 2t*2 + t + 3. Let v be 6/(4 - 40/12) - 5. Suppose -16g = -15g - 5z, -4z = v. Let s(l) = -3l*2 - l - 3. What is gu(c) - 4s(c)? 2c*2 - c - 3 Let t(v) = -2 - 5v*2 + 2v*2 + 0v*2. Let g be (-1)/((-4)/120) + -34. Let i(r) = 8r*2 + 6. Determine gi(m) - 11t(m). m2 - 2 Let u = 590 - 588. Let k(h) = -5 + 10h - 4hu - 21h*2 + 15h*2 + 1. Let o(d) = -2d*2 + 2d - 1. Determine 3k(n) - 16o(n). 2n2 - 2n + 4 Let n(t) = -23t2 - 73t - 7. Let r(g) = 24g2 + 69g + 8. What is 7n(f) + 6r(f)? -17f2 - 97f - 1 Let c(l) = -l2. Let i(s) be the second derivative of -s4/6 + s3/2 + s2/2 + 706s - 5. Determine -4c(t) + i(t). 2t2 + 3t + 1 Let g(n) = -25n2 - n + 123. Let x(a) = 31a*2 + 2a - 122. Give -5g(f) - 4x(f). f*2 - 3f - 127 Let u(b) = -3b3 - 8b*2 - 18b - 31. Let d be u(-2). Let p(z) = 50z - 5. Let c(a) = -25a + 2. Give dp(j) - 7c(j). 25j + 1 Let j(v) = -11561v*2 + 9v - 9. Let b(q) = -5780q2 + 5q - 5. Determine -9b(d) + 5j(d). -5785d2 Let h(z) = -3856z*2 - 60z - 1. Let r(f) = -3856f2 - 45f - 1. Give 3h(x) - 4r(x). 3856x2 + 1 Let u(v) = -8v*3 - 6v*2 + 6v + 3. Let h be (-14)/(-161) - (-117)/(-23). Let m(j) = 7j3 + 5j*2 - 5j - 3. Give hu(f) - 6m(f). -2f3 + 3 Let f(o) = -o3 + 139o*2 + 10o - 4. Let m(t) = 3t3 - 277t*2 - 22t + 9. Calculate -9f(y) - 4m(y). -3y3 - 143y*2 - 2y Let a(s) = -56s - 8. Let f(m) = 113m + 14. Determine -5a(h) - 3f(h). -59h - 2 Let s(l) = -l3 - 9l - 4. Let z(t) = t3 - t2 + 10t + 4. Determine -2s(u) - 3z(u). -u3 + 3u*2 - 12u - 4 Let b(n) = -317n - 12. Let m(j) = 622j + 26. Give -13b(i) - 6m(i). 389*i
-1e (base 16) to base 15 -20 30 (base 4) to base 7 15 Convert 100 (base 2) to base 12. 4 What is 11011 (base 2) in base 5? 102 Convert -206 (base 10) to base 8. -316 What is 302 (base 6) in base 11? a0 Convert 111 (base 2) to base 10. 7 Convert 9 (base 10) to base 15. 9 103 (base 11) to base 13 97 What is -21 (base 4) in base 3? -100 -240 (base 5) to base 13 -55 Convert -222 (base 3) to base 16. -1a -20 (base 3) to base 11 -6 Convert 19 (base 13) to base 10. 22 -10 (base 7) to base 8 -7 53 (base 6) to base 3 1020 a6 (base 15) to base 13 c0 What is 1011 (base 2) in base 10? 11 What is 7 (base 13) in base 16? 7 21 (base 4) to base 5 14 1 (base 5) to base 7 1 What is 15 (base 13) in base 12? 16 What is -10 (base 16) in base 11? -15 What is 69 (base 12) in base 2? 1010001 Convert 10011 (base 2) to base 3. 201 -1 (base 5) to base 16 -1 Convert -2b (base 14) to base 9. -43 Convert 5 (base 13) to base 2. 101 What is -171 (base 9) in base 6? -401 Convert -8c (base 16) to base 9. -165 -2 (base 6) to base 16 -2 What is -3 (base 14) in base 8? -3 Convert 31 (base 5) to base 4. 100 -222 (base 7) to base 12 -96 What is 322 (base 4) in base 10? 58 Convert 4 (base 8) to base 15. 4 Convert 36 (base 8) to base 5. 110 What is -3 (base 10) in base 4? -3 What is -46 (base 7) in base 12? -2a What is 0 (base 13) in base 10? 0 What is -3 (base 12) in base 8? -3 1 (base 3) to base 13 1 Convert -4 (base 7) to base 13. -4 3 (base 7) to base 12 3 What is 1 (base 13) in base 6? 1 Convert 111 (base 4) to base 9. 23 Convert -37 (base 10) to base 8. -45 Convert -50 (base 8) to base 3. -1111 What is 7 (base 13) in base 12? 7 4 (base 10) to base 5 4 What is a (base 14) in base 11? a What is -27 (base 10) in base 9? -30 Convert 0 (base 6) to base 15. 0 What is 18 (base 11) in base 6? 31 Convert -4 (base 7) to base 2. -100 What is 202 (base 7) in base 2? 1100100 What is -126 (base 8) in base 9? -105 What is -17 (base 14) in base 7? -30 Convert 10 (base 2) to base 3. 2 Convert -17 (base 9) to base 8. -20 3 (base 4) to base 11 3 Convert 400 (base 5) to base 9. 121 What is -30 (base 5) in base 11? -14 -2 (base 13) to base 7 -2 -1 (base 13) to base 6 -1 41 (base 14) to base 8 71 Convert 6 (base 12) to base 6. 10 Convert 26 (base 14) to base 6. 54 Convert -201 (base 3) to base 11. -18 Convert -3 (base 12) to base 16. -3 Convert b (base 12) to base 9. 12 -133 (base 9) to base 3 -11010 Convert 232 (base 5) to base 10. 67 Convert 39 (base 14) to base 4. 303 Convert -10 (base 6) to base 12. -6 -32 (base 10) to base 9 -35 What is 0 (base 8) in base 12? 0 What is -30 (base 5) in base 4? -33 425 (base 6) to base 14 b7 What is -1 (base 6) in base 7? -1 What is 4 (base 10) in base 4? 10 Convert -3 (base 8) to base 4. -3 Convert -7 (base 10) to base 9. -7 Convert 101 (base 7) to base 10. 50 Convert 3 (base 12) to base 10. 3 1 (base 6) to base 5 1 Convert -1011 (base 2) to base 11. -10 Convert 6b (base 14) to base 2. 1011111 -45 (base 15) to base 12 -55 23 (base 4) to base 8 13 -60 (base 7) to base 8 -52 What is 5 (base 11) in base 9? 5 -2 (base 16) to base 15 -2 Convert 1d (base 14) to base 3. 1000 Convert -2102 (base 3) to base 8. -101 -8 (base 9) to base 6 -12 What is -13f (base 16) in base 15? -164 Convert 24 (base 10) to base 7. 33 What is -65 (base 9) in base 6? -135 What is -543 (base 8) in base 10? -355 33 (base 4) to base 15 10 What is 3 (base 12) in base 10? 3 -1 (base 8) to base 11 -1 1310 (base 4) to base 15 7b -22 (base 15) to base 7 -44 0 (base 3) to base 10 0 What is -16 (base 13) in base 10? -19 What is -2 (base 8) in base 3? -2 151 (base 6) to base 16 43 Convert -293 (base 10) to base 12. -205 Convert 4a (base 12) to base 16. 3a Convert -1 (base 4) to base 14. -1 Convert 12 (base 11) to base 13. 10 What is -103 (base 6) in base 12? -33 Convert 233 (base 7) to base 8. 172 Convert 7 (base 9) to base 10. 7 What is -32 (base 13) in base 15? -2b Convert -3 (base 13) to base 15. -3 Convert 1011 (base 3) to base 11. 29 Convert -57 (base 9) to base 4. -310 Convert -7 (base 15) to base 16. -7 What is -3 (base 4) in base 16? -3 What is 32 (base 6) in base 10? 20 What is -21 (base 7) in base 11? -14 What is 144 (base 12) in base 5? 1241 What is -1 (base 6) in base 11? -1 11 (base 4) to base 16 5 -5 (base 12) to base 7 -5 What is -33 (base 10) in base 6? -53 Convert 65 (base 14) to base 15. 5e What is 14 (base 11) in base 6? 23 What is a8 (base 14) in base 4? 2110 What is 24 (base 10) in base 15? 19 -2404 (base 5) to base 16 -162 What is -2113 (base 4) in base 5? -1101 Convert -98 (base 14) to base 4. -2012 Convert -1033 (base 5) to base 16. -8f Convert -4 (base 10) to base 4. -10 73 (base 13) to base 3 10111 What is 11 (base 7) in base 4? 20 -121 (base 4) to base 15 -1a c5 (base 13) to base 6 425 20 (base 8) to base 11 15 Convert 2 (base 4) to base 2. 10 Convert 1042 (base 5) to base 7. 300 -16 (base 16) to base 4 -112 Convert -11 (base 10) to base 14. -b Convert 12 (base 9) to base 14. b Convert -37 (base 11) to base 7. -55 What is 111 (base 2) in base 15? 7 -1f (base 16) to base 11 -29 What is -18 (base 12) in base 16? -14 What is 0 (base 9) in base 11? 0 -77 (base 9) to base 5 -240 20 (base 7) to base 3 112 -302 (base 4) to base 5 -200 Convert 6 (base 16) to base 14. 6 Convert 2041 (base 5) to base 8. 417 Convert -71 (base 12) to base 11. -78 -12 (base 8) to base 14 -a -20 (base 16) to base 14 -24 16 (base 15) to base 11 1a Convert 123 (base 4) to base 3. 1000 14 (base 5) to base 15 9 Convert -4 (base 13) to base 16. -4 -35 (base 15) to base 10 -50 -2 (base 14) to base 11 -2 What is 10 (base 2) in base 11? 2 What is 1 (base 15) in base 8? 1 Convert 10 (base 11) to base 6. 15 What is 120 (base 3) in base 8? 17 Convert 3 (base 13) to base 5. 3 What is -33 (base 7) in base 2? -11000 124 (base 14) to base 15 103 What is -2 (base 4) in base 13? -2 Convert -102 (base 8) to base 16. -42 2 (base 12) to base 6 2 Convert -100101010 (base 2) to base 15. -14d 29 (base 10) to base 8 35 What is -5 (base 12) in base 6? -5 What is 0 (base 11) in base 15? 0 -4 (base 11) to base 9 -4 23 (base 14) to base 9 34 -2 (base 14) to base 2 -10 12 (base 16) to base 6 30 What is 13 (base 12) in base 3? 120 220 (base 3) to base 9 26 21 (base 4) to base 9 10 11 (base 5) to base 13 6 -132 (base 4) to base 16 -1e 15 (base 11) to base 14 12 9 (base 13) to base 3 100 -32 (base 4) to base 8 -16 What is -1 (base 12) in base 2? -1 205 (base 8) to base 16 85 Convert 0 (base 15) to base 5. 0 Convert -5 (base 14) to base 12. -5 -1 (base 5) to base 3 -1 -511 (base 6) to base 3 -20221 Convert -3 (base 8) to base 12. -3 -67 (base 13) to base 8 -125 What is 7 (base 16) in base 5? 12 Convert -c (base 14) to base 9. -13 1001100 (base 2) to base 10 76 Convert 1010 (base 3) to base 16. 1e Convert -131 (base 7) to base 8. -107 -4 (base 15) to base 3 -11 What is -2103 (base 4) in base 8? -223 Convert 101 (base 2) to base 13. 5 What is -151 (base 8) in base 12? -89 What is -22 (base 3) in base 10? -8 -1 (base 15) to base 3 -1 What is 4 (base 16) in base 7? 4 11 (base 2) to base 4 3 What is 2 (base 9) in base 7? 2 7 (base 15) to base 4 13 Convert -2 (base 13) to base 5. -2 2 (base 10) to base 14 2 What is -33 (base 11) in base 16? -24 What is 1 (base 4) in base 16? 1 What is -110 (base 2) in base 16? -6 What is 114 (base 6) in base 5? 141 Convert 3 (base 10) to base 14. 3 What is 41 (base 6) in base 15? 1a Convert 1110 (base 2) to base 5. 24 Convert -5 (base 9) to base 16. -5 Convert 3 (base 14) to base 13. 3 What is 4 (base 8) in base 14? 4 What is -2a (base 11) in base 15? -22 -2 (base 7) to base 2 -10 What is 6 (base 13) in base 11? 6 431 (base 7) to base 16 da 35 (base 8) to base 4 131 9 (base 16) to base 14 9 20 (base 7) to base 10 14 What is 5 (base 12) in base 5? 10 11 (base 4) to base 6 5 Convert 10 (base 4) to base 12. 4 281 (base 10) to base 12 1b5 -2 (base 8) to base 4 -2 Convert 110100 (base 2) to base 13. 40 Convert -206 (base 8) to base 7. -251 What is 41 (base 16) in base 4? 1001 Convert -1 (base 16) to base 15. -1 What is 113 (base 8) in base 7? 135 134 (base 5) to base 14 32 b (base 13) to base 15 b Convert -11 (base 4) to base 13. -5 What is 1 (base 4) in base 8? 1 What is -3 (base 7) in base 3? -10 85 (base 14) to base 13 90 What is 0 (base 5) in base 4? 0 Convert -17 (base 13) to base 16. -14 What is 0 (base 2) in base 15? 0 What is 0 (base 12) in base 15? 0 Convert -9 (base 11) to base 10. -9 Convert -122 (base 3) to base 9. -18 What is 21 (base 13) in base 7? 36 What is -329 (base 10) in base 5? -2304 Convert -70 (base 10) to base 13. -55 3 (base 13) to base 6 3 5 (base 7) to base 13 5 What is -21 (base 4) in base 16? -9 What is -18 (base 11) in base 8? -23 Convert -11 (base 2) to base 13. -3 What is -70 (base 15) in base 10? -105
Suppose 0 = 2l + 2l. Suppose -4c = -2c. Suppose ch = 4h. Is h less than l? False Suppose -11 = 5o + 3i + 1, 2o = -4i - 16. Let f = 1 - o. Let q be (f(0 + -1))/(-4). Which is bigger: q or 1? 1 Let y = 23.8 + -24. Which is smaller: -12/11 or y? -12/11 Let j be ((-2)/4)/(2/8). Let d = 111 - 109. Let f = j + d. Is -3/8 <= f? True Let v(q) = 2 + 8 - 2q - q*2 + 0q + 10q. Let i be v(9). Which is smaller: i or 1/25? 1/25 Suppose 6 + 6 = -2a. Which is smaller: -5 or a? a Let w = -3569985/196 + 18211. Let a = 2/49 - w. Is a <= 4? True Let t = -60 + 58. Which is greater: t or -7/11? -7/11 Let r(w) = w*3 - 5w*2 - 6w - 1. Let k be r(6). Is 1/13 less than k? False Let i = 981400/9 - 109224. Let l = i + 180. Let x = -8/9 - l. Is x greater than 0? False Suppose -2w = w. Suppose 2p - 9 + 3 = w. Suppose 0 = -3u - pb - 1 - 5, -4u + 1 = -5b. Does u = 0? False Let l = 88 + -262/3. Let n = -8 - -9.2. Is l less than n? True Suppose 0q + 2 = -2q. Is 6/13 less than or equal to q? False Let h(w) = -w*3 + 6w*2 - 4w - 1. Let u be h(5). Suppose 9 = 2l - ux + 37, 2l = 2x - 26. Let s be ((-10)/4)/(l/(-8)). Is s at least as big as -2? True Let i be (-4)/(-3) - 14/(-21). Let g be 1/(-1)22/i. Let m be (-5)/(-20) - g/(-12). Which is greater: -6 or m? m Let m = -1238.04 + 1197. Let s = m + 39. Let w = s + 0.04. Which is smaller: 0.1 or w? w Let h be 0/(-2) - 4/(-6). Let m = 0.07 + 0.23. Let b = -0.1 + m. Is h <= b? False Suppose -8 + 4 = v. Are -5 and v equal? False Let g = -68 + 37. Let k be (-1)/5 + g/(-5). Let l = 4 - k. Is -3/2 < l? False Suppose 4p = 534 + 210. Let v be (-1)/2 - p/18. Let k = 11 + v. Is k < -1? False Let v = -465 + 733. Let w be (-1 - 7)-11/2. Let x be v/(-52) - w/(-26). Which is smaller: -4 or x? x Let y be 29/6 + 2. Let m = y - 8. Let g be 6 - (1 + (m - -3)). Is -1/4 >= g? False Let u = -8 - -23. Let q be -1 + 3 + (-36)/u. Suppose -2n = -0n + 2. Which is smaller: n or q? n Let g = -1.75 + -0.25. Let r = -4 + 4. Which is bigger: g or r? r Let r(n) = -n3 + 7n2 + n - 6. Let l be r(6). Which is greater: l or 35? l Let h = 32 - 31. Which is smaller: h or 4? h Let z(o) = -o3 + 22o2 + 26o - 79. Let a be z(23). Let n(q) = 6q + 3. Let v be n(-2). Is a at most as big as v? True Let p be (-6)/21 - 54/56. Suppose 0k - 3k = 0. Does p = k? False Suppose -57b - 12 = -53b. Which is greater: b or 0? 0 Let m be -280 + (-2 - (-1 + 1)). Let w be 1/(-2) + (-171)/m. Let h = w + 153/329. Which is smaller: h or 1? h Let h = 10 - 6. Let p = 2 + 6. Let v be (-6)/hp/42. Which is smaller: v or 1? v Let l be 12(-4)/((-8)/(-1)). Is -33/5 greater than l? False Let l be ((-50)/40)/(2/16). Does -10 = l? True Let w(f) = f2 - 2f - 32. Let n be w(8). Which is smaller: n or 2? 2 Let y = -9 - -14. Suppose 4i - 4r + 4 = 0, 3r = i + yr + 7. Which is greater: -2 or i? -2 Let b be -9((-26)/8 + 3) + -2. Is b smaller than 2/3? True Let j be (-4)/(4/3) + 2. Let u be 7/12 - j/(-3). Is u != 1? True Let f(h) = -h2 - 6h - 10. Let y be f(-3). Do y and 1/33 have the same value? False Suppose 0 = -u + 2u - 1. Suppose -4v + 20 = -4. Let a be 8/12v/34. Are u and a nonequal? True Let p = 114 - 113. Which is smaller: p or 3/26? 3/26 Suppose -5l + k - 1 = 0, -3l - 2l = 5k + 25. Suppose 0 = -2w - 5 + 1. Is w at most as big as l? True Let v = 7/39 - -2/13. Suppose -20 = -2m - 4g, -4m + 2g = 6g - 20. Let p(s) = -s3 - s2 - 3. Let o be p(m). Which is bigger: o or v? v Let h = 36 - 59. Which is smaller: h or -24? -24 Let b = 40 - 50. Is b less than -1? True Let l(n) = -n + 8. Let g be l(8). Suppose 5a + 15 = -0a. Let v = a + g. Is v > -4? True Let m = 14 - 17. Let i(w) = 2w + 3. Let y be i(-3). Is y greater than m? False Let d = -26/81 + 2398/405. Let b = -21/10 + d. Is b greater than 3? True Let t = -0.09 - -6.09. Let c = 7 - t. Let d be 1/2(-2)/(-5). Are c and d non-equal? True Suppose u - 1 = -0u. Let j be (u/4)/(6/(-8)). Which is bigger: 1 or j? 1 Let q be (-3 + (-114)/(-39))/1. Which is smaller: 1 or q? q Let y = 111 - 112. Which is greater: -14 or y? y Suppose -9z = -z - 16. Is 37 less than z? False Suppose 5 = -4j + 29. Suppose -2s - j = -5c, -2c + 3 = -c - s. Which is bigger: c or 1? 1 Let q be 12/9 + (-4)/6. Let f = -3 + 6.1. Let i = f + -3. Is q equal to i? False Let q be 0 + 1 - (-13 + 2). Is 11 at least as big as q? False Let d = -3 - -9. Is d not equal to 6? False Let y = 0.8 - 0.88. Let o = 0.52 - y. Let v = o - 0.5. Is -0.1 < v? True Let m be (12 - 10)(-1)/2. Let f = 1022/15 - 474/5. Let b = f + 26. Is b greater than or equal to m? True Suppose -5g = -g - 24. Let n = g + -9. Let q be 0 - (-1 - n) - 0. Is q at most -2? True Suppose -13o + 10 = -15o. Is 0.7 greater than or equal to o? True Suppose -5g + 2i = -g - 54, -g - 4i - 9 = 0. Suppose a + 2 = m, -5m - a - g = a. Let r(u) = -u + 5. Let y be r(4). Is y at least m? True Let n = 2 + 0. Suppose -2k - 2 = -k. Let s = n + k. Do s and -2/7 have the same value? False Let t = 0.09 - 0.06. Let p = -5.97 - t. Is 1 bigger than p? True Let q be 7(-2 + 2 + -1). Let y be 94/(-14) + (-2)/7. Is y less than q? False Let n be (-6)/18 + 14/96. Do n and 1 have different values? True Let b(i) = 5i*2 + 8i + 13. Let w be 211(-1)/(-3). Let a(p) = -2p2 - 4p - 6. Let k(h) = wa(h) + 3b(h). Let l be k(5). Which is greater: l or -1? l Let q = 1 - 3. Let x = -0.1 + -7.9. Let s = 8.1 + x. Which is smaller: q or s? q Let o = 3343/13 + -257. Let k be 6/4 - (-2)/(-4). Let f(a) = -a. Let p be f(k). Which is greater: o or p? o Let j = -3.36 - 0.44. Let h = 4 + j. Let u = h - 0. Which is smaller: -1 or u? -1 Let o = -14 - -15. Is o at most as big as 2/51? False Suppose -3n + 0n = -15. Suppose nt + 1 = 11. Let m = -14 + 16. Is t > m? False Let q(r) = r3 - 7r*2 - 8r - 3. Suppose -5o = 2t - 38, o = -2o - 4t + 20. Let n be q(o). Which is greater: n or -4? n Let q = 99/5 - 20. Is q != -1? True Let q = -1/7 + -1/7. Suppose -5n = -0n. Let k = n + 0. Which is smaller: k or q? q Let i = 34 - 39.7. Let y = i - 1.3. Is y greater than 2/5? False Let y be 3(138/(-18) - -1). Is -2 bigger than y? True Suppose -3 - 3 = -2m. Suppose -mz - 4 = -1. Which is bigger: z or 4? 4 Let h = -20.991 - 0.209. Let p = h + 20. Is p smaller than -1? True Let d be 1 - 1 - 11/4. Which is greater: d or 8/9? 8/9 Suppose -4b - 20 = -2u, b = 5u - 3u - 5. Suppose k = -3r + 17, -2k - 2r = -22 + 8. Suppose u = a + g + 5, -4g - 10 = -ka + a. Is -1 at least a? True Suppose 3u = 5f - 14, -5f + 20 = -u - 4u. Let m be 0 + (-3)/6-10. Suppose -z + mz = 0. Which is smaller: z or f? z Suppose -5x = 4k + 2, -4k = -3k + 3x - 3. Let h be (9/(-3))/(k/4). Is -1/2 bigger than h? False Suppose 0 = -2f - 4 + 6. Let x be f - (-2 + 1) - -2. Suppose 0 = -5h + h + 20. Do h and x have the same value? False Let k = -1.4 - -7.3. Let d = -6 + k. Is 6 less than or equal to d? False Suppose 5z = -0y + 4y - 53, y = 4z + 38. Let v be ((-11)/33)/(1/6). Let n be (-2 - z/3) + v. Which is smaller: n or -3? -3 Let a = 48 + -45. Which is bigger: a or 5? 5 Let w(b) = b + 8. Let i be w(-6). Suppose ip = 2l + 4p + 2, 4p + 7 = -3l. Which is smaller: 2 or l? 2 Let v be (0 - -2) + 399/(-196). Which is bigger: v or -1? v Let c be -7 - 3 - (-4)/2. Is -11 less than c? True Let l(x) = -2x - 3. Let t(d) = -3d - 6. Let p(o) = 5l(o) - 3t(o). Let j be p(-8). Suppose jk = 7k. Which is smaller: k or -1/7? -1/7 Let g be (-108)/135 + (-56)/55. Which is smaller: g or -3? -3 Let m be (4/(-5))/((-4)/100). Suppose 2u - m + 0 = 0. Let z be 0 + (16/u - 1). Do z and 2 have the same value? False Suppose 0 = 2h + 3h - 90. Let z be -2(-3)/h-3. Let c = 0 + 2. Is c greater than or equal to z? True Let x(j) = j*3 + 15j*2 + 14j + 19. Let o be x(-14). Which is bigger: o or -0.2? o Suppose r = -0r - 1. Let v = r - -1. Which is smaller: -10/7 or v? -10/7 Suppose -4m + 22 + 2 = 0. Let h = m - 5. Which is bigger: 0.1 or h? h Let o = 99/2 + -48. Suppose 4s = 3s + 21. Let d be 2/(-14) - (-66)/s. Are o and d equal? False Let x = -34.9 + 32. Let m = 33.9 - 34. Let p = m + x. Which is bigger: p or 2? 2 Let z(d) = d*3 + 8d*2 - 2d - 12. Let v be z(-8). Suppose -vw - u - 21 = 0, w - 5 - 1 = 2u. Is w at least -4? True Suppose -146 = -7k + 8. Which is smaller: k or 24? k Suppose -4 = -p - 1. Suppose pb = 2 + 1. Suppose d - b = -3. Which is smaller: -4 or d? -4 Suppose 18b - 9b = -54. Is b < 3? True Let x = -0.9859 - 0.0141. Let m be (-10)/48 - 2/(-6). Is x at most as big as m? True
Let n(w) = 18w2. Let l(c) = 2c. Let v(d) be the first derivative of -5d2/2 - 15. Let y(b) = 15l(b) + 5v(b). Calculate y(n(t)). 90t*2 Let u(r) = -1. Let f(l) = l + 5. Let z(o) = f(o) + 5u(o). Let k(d) = -174492d2 + 43629d*2 + 43565d*2 + 43616d*2 + 43569d*2. Determine z(k(n)). -113n*2 Let m(t) = -t - 111. Let u(h) = 4h*2 + h + 641. Calculate m(u(l)). -4l*2 - l - 752 Let w(m) = -16m*2. Let c(p) = -105p. Let i(v) = -8v. Suppose -1 = 50b + 99. Let f(y) = bc(y) + 27i(y). Determine w(f(d)). -576d2 Let h(a) = -157a + 15. Let v(n) = -2160n. What is h(v(w))? 339120w + 15 Let u(g) be the second derivative of -49g3/6 - g2 + 17g - 14. Let l(d) = 20d. Give u(l(a)). -980a - 2 Let z(o) = -8o2 + 2o. Let d(p) = -p*2 + 4p + 11. Suppose 0 = 4t - 19 - 1. Let n be d(t). Let f(u) = 4u + 0u + u - nu. What is z(f(g))? -8g2 - 2g Let w(f) = -2f - 1796. Let x(g) = 6119g. Calculate x(w(d)). -12238d - 10989724 Let c(h) = 46h - 331h + 273h. Let j(u) = -24u2. Determine j(c(y)). -3456y*2 Let x(b) = 5b. Let o(k) = 12942k + 78. What is o(x(y))? 64710y + 78 Let s(t) = 3280t. Let o(q) be the third derivative of q5/30 + 119q*2 + q. Determine o(s(k)). 21516800k*2 Let i(w) = -6w*2 + 2w. Let f(h) = 15h + 4. Let d(m) = 17m + 3. Let s(y) = -4d(y) + 3f(y). What is s(i(c))? 138c2 - 46c Let u(w) be the first derivative of -w*5/60 - 92w*3/3 - 152. Let x(k) be the third derivative of u(k). Let h(p) = -398p*2. What is x(h(n))? 796n*2 Let k(c) = 55c*2 - 6c - 6. Let f(a) = -65a2 + 7a + 7. Let x(b) = -6f(b) - 7k(b). Let z(p) = -468p - 2. Give x(z(j)). 1095120j*2 + 9360j + 20 Let n(v) = -4v2 - 3v + 2. Let w(p) = 593p2 + 30p - 14. Let u(f) = -7n(f) - w(f). Let j(z) = -z. What is u(j(s))? -565s*2 + 9s Let x(k) = 108k2 - 511k*2 - 393607 + 393607. Let g(j) = 6j. Give x(g(h)). -14508h2 Let j(z) = -z. Let w(o) = o2 + 10. Let x(c) = -2c*2 - 21. Suppose 0 = 8r - 22r - 98. Let d(y) = rw(y) - 3x(y). Calculate j(d(v)). v2 + 7 Let g(v) = 6713326v. Let w(s) = -30s. Determine w(g(j)). -201399780j Let k(x) = x + 8. Let j(b) = 478309b2. Determine k(j(o)). 478309o*2 + 8 Let x(i) = -2i + 5i + i. Let k(u) be the first derivative of 16201u - 128 - 16201u - 3u*3. What is k(x(a))? -144a*2 Let x(m) = 2096m. Let i(d) = -d*2 + 224538d. Give i(x(g)). -4393216g2 + 470631648g Let t(d) = -4633d. Let x(u) = 1216u + 11. Let m(z) = -221z - 2. Let j(k) = 11m(k) + 2x(k). Determine j(t(h)). -4633h Let j(u) = u*2. Let c(t) be the first derivative of 19t5/60 - t3/6 - 21t2 - t - 249. Let v(x) be the second derivative of c(x). Give v(j(n)). 19n*4 - 1 Suppose 3p = -0p. Let f(h) = 2h + ph - 7h - 9h2 + 4h*2. Let u(j) = -101j*2 - 103j*2 + 203j*2. What is u(f(m))? -25m*4 - 50m*3 - 25m*2 Let b(t) = 44t*2 + 39 - 73 - 13t*2 + 34. Let a(v) = 55v. Determine a(b(j)). 1705j2 Let m(w) = -2w*2 + 3w - 3. Let t(g) = g*2 - g + 1. Let i(l) = -2m(l) - 6t(l). Let q(p) be the second derivative of -13p*3/3 - 7p + 17. What is i(q(k))? -1352k2 Let p(u) = 7u + 14u - 30u + 3u2 + 9. Let c(v) = -v2 + 4v - 4. Let a(w) = -9c(w) - 4p(w). Let i(g) = -7g + 1. Determine a(i(y)). -147y*2 + 42y - 3 Let d(t) = -t*2 - 43t + 30. Let z be d(-39). Let a(s) = 3s2 - zs + 186s. Let q(n) be the first derivative of -2n*2 - 1. Calculate q(a(h)). -12h*2 Let s(g) = 0g + 4g - 3g. Suppose 0 = 6r - 336 - 702. Let n(b) = 173 - r - 2b. Calculate s(n(t)). -2t Let f(q) = 4262q - 8. Let s(k) = 26k - 1. Let c(d) = -f(d) + 8s(d). Let t(w) = w*2. Give c(t(r)). -4054r*2 Let f(g) = 28897g + 28883g - 57797g + 6. Let n(d) = -7d. Calculate f(n(p)). 119p + 6 Let t(l) = 2l2 - 17l + 6. Let r(q) = 2279q2. What is t(r(u))? 10387682u*4 - 38743u*2 + 6 Let v(p) be the first derivative of -15p*3 - 2. Let o(t) = -98t3 - t2 + 2t + 2. Let d be o(-1). Let n(j) = -dj + 185j - 87j. Determine v(n(y)). -45y2 Let b(a) = 143a*2. Let v(i) = -46 + 516i + 6i2 - 516i + 44. Calculate v(b(k)). 122694k4 - 2 Let h(d) = -169d*2. Let m(x) = 101x*2 + 236x - 2. Calculate m(h(p)). 2884661p4 - 39884p*2 - 2 Let n(a) = -2a. Let q(i) be the second derivative of 55i3/6 - 13i*2/2 + 151i. Let m(f) = 109f - 22. Let g(w) = -3m(w) + 5q(w). Determine n(g(h)). 104h - 2 Let y(x) be the second derivative of 4x3/3 + 11x - 5. Let r(v) be the second derivative of 0v2 + 0 - 1/6v*3 + 17v. What is y(r(t))? -8t Let u(b) = 3b. Let w(a) = -3271213a. Calculate w(u(z)). -9813639z Let b(u) = -18u2 - 18u + 88. Let l(p) = -66p. Give l(b(f)). 1188f*2 + 1188f - 5808 Let b(h) = -h*2 + 4h*2 + 14 - 14 - 6h*2. Let v(y) = 2607y. Determine v(b(m)). -7821m2 Let f(g) = g - 58. Let h(t) = 138t + 187t - 327t. What is h(f(n))? -2n + 116 Let p(y) = -817y*2 + 452y*2 + 450y*2. Let c(r) = -50r*2. Give c(p(w)). -361250w*4 Let u(n) = -11n2. Let g(l) = -l2 + 44. Let t(k) = 2k2 - 87. Let f(m) = 13g(m) + 6t(m). Calculate f(u(q)). -121q4 + 50 Let s(n) = -n. Let l(m) = m2 - 3m. Let h be l(4). Suppose -w = w - h. Let j(f) = 22f*w + 49f - 23f - 26f. Calculate j(s(g)). 22g2 Suppose w = 2 - 5. Let y(k) = 3k*2 + 4k + 4. Suppose -21n = -16n + 60. Let h(v) = -v - 1. Let i(f) = nh(f) + wy(f). Let q(s) = s*2. What is q(i(t))? 81t4 Let k(a) be the first derivative of a3/3 + 6a + 6. Let u(t) be the first derivative of -t3 + 136. Determine k(u(q)). 9q*4 + 6 Let k(u) = -3u*2. Let t(h) be the first derivative of 9h*2 - 8h - 41. Let d(y) = 23y - 9. Let j(o) = -6d(o) + 7t(o). Give k(j(b)). -432b*2 - 144b - 12 Let t(q) = 135q. Let h(w) be the first derivative of w2/2 + 14w - 2972. What is t(h(k))? 135k + 1890 Let z(b) = -376b. Let n(t) be the third derivative of -t*4/6 + 1016t*2. Give n(z(f)). 1504f Let u(g) = 21g + 2. Let i(w) = -233w. Give u(i(r)). -4893r + 2 Let a(h) = 26h - 2. Let z(w) = 6773w2 + 45. What is a(z(b))? 176098b*2 + 1168 Let t(i) = 3i*2. Let x(m) be the second derivative of -3m*3/2 - m + 245. Give t(x(q)). 243q*2 Let p(s) = 2101s. Let q(j) = 21180j. Determine p(q(y)). 44499180y Let l(q) = q*3 + 2q*2 + 4q + 5. Let r be l(-3). Let m = 20 + r. Let o(u) = mu - 4u - 4u. Let g(k) = 2k*2. What is g(o(d))? 32d*2 Let c be -1452/(-10) + -5. Let p(t) = 89t + 80t - 169t + ct*2. Let m(h) = -1 + 1 - h. Determine p(m(u)). 24u*2 Let f(t) be the second derivative of 0 + 0t*2 - 1/2t*3 - 90t. Let a(d) = 15d2. Determine a(f(u)). 135u*2 Let h(l) = 86802333l*2. Let t(c) = c. Determine h(t(u)). 86802333u*2 Let p(u) = -u. Let j(i) be the first derivative of 0i*2 - 276 + 0i + 34/3i3. Calculate p(j(y)). -34y*2 Let r(n) = 50n - 7. Let b(u) = -u + 1. Let o(w) = 5b(w) + r(w). Let s(l) be the third derivative of -l5/30 + 241l*2. Determine o(s(i)). -90i*2 - 2 Let b(c) be the third derivative of 6c*4 + 2c*2 - 1264. Let r(n) = 8n*2. Calculate b(r(s)). 1152s*2 Let g(b) be the first derivative of 4b*2 - 7. Let q(x) = -7x - 6x2 - 24x - 15x + 46x. Give q(g(y)). -384y2 Let w(r) = -r - 114. Let i(x) = -138x - 19 + 130x + 24. Let y(a) = a - 1. Let o(t) = -i(t) - 5y(t). Determine w(o(n)). -3n - 114 Let g(q) = 108q - 2. Let y(v) = 314v2 - 5v + 4v + v - 322v*2. Calculate g(y(t)). -864t*2 - 2 Let j(q) = -15q. Let i(u) = 35u + 496 - 991 + 495. Give i(j(a)). -525a Let q(u) = 3350u + 3347u - 6702u. Let v(o) = 80o. Give v(q(g)). -400g Suppose -11w + 13w = 4. Let s(d) = -7d*2 + 3d*2 + 7d*w. Let t(x) be the first derivative of 6x*2 - 1792. Give s(t(h)). 432h2 Let x(w) = w2 + 11029809. Let r(b) = b. What is r(x(v))? v*2 + 11029809 Let k(r) be the first derivative of -4r*2 + 7927. Let o(g) = -2 - 5g + 2. Calculate o(k(m)). 40m Let f(m) = 11m - 2. Let y(k) = -34k + 6. Let b(d) = -10f(d) - 3y(d). Let g(r) = 9r. Give g(b(h)). -72h + 18 Let i(y) = -2y*2. Suppose 89o - 102o = 0. Let l(f) be the third derivative of 0f*3 + 31/12f*4 + of - 22f2 + 0. Give i(l(k)). -7688k*2 Let h(c) = -245241c. Let u(m) = -750m2. Determine h(u(q)). 183930750q*2 Let r(k) = 35 - k - 150 + 98 + 3k. Let m(l) = 32l2. Determine m(r(j)). 128j*2 - 2176j + 9248 Suppose 26o - 22o = 28. Let x(m) = -7m + om + 1 + 11m - 8m. Let h(a) = -5a2. Give x(h(d)). -15d**2 + 1
Let g(h) = 12h + 4. What is g(0)? 4 Let h(c) = -6c + 13. Calculate h(6). -23 Let d(t) = 20t + 123. What is d(-6)? 3 Let c(q) = q2 + q - 8. Calculate c(-4). 4 Let m(z) = 5z - 13. Calculate m(-2). -23 Let r(j) = -j*3 - 12j*2 + j - 17. Determine r(-12). -29 Let u(q) = 8q - 42. Determine u(8). 22 Let p(w) = -w*3 + 5w*2 + 19w - 26. What is p(7)? 9 Let b(h) = 2h2 + 4h - 5. What is b(-5)? 25 Let f(c) = 13c - 35. Give f(3). 4 Let w(x) = -4x + 2. Calculate w(-5). 22 Let u(c) = 4c - 4. Give u(-2). -12 Let g(k) = -14k - 601. Calculate g(-43). 1 Let n(p) = -2p3 + 5p + 2. Determine n(3). -37 Let m(w) = 3w2 + 14w + 10. Determine m(-7). 59 Let o(h) = 75h3 + 2h2. Give o(-1). -73 Let k(m) = -m3 - 2m2 - m + 9. Calculate k(-2). 11 Let z(x) = x3 + 3x*2 - 10x - 8. What is z(-6)? -56 Let k(y) = 17y + 21. What is k(-1)? 4 Let p(m) = -42m - 418. Give p(-10). 2 Let w(x) = x*2 - 31x - 12. What is w(33)? 54 Let q(l) = l*3 - 7l*2 + 3l + 6. Give q(6). -12 Let j(u) = u*3 + 4u*2 + 8. Give j(-4). 8 Let m(i) = -3i - 85. Determine m(-31). 8 Let a(o) = 8o - 52. Calculate a(5). -12 Let x(k) = 16k*2 + k. Determine x(1). 17 Let c(w) = -31w - 183. Determine c(-6). 3 Let r(a) = a*2 + 21a - 16. Determine r(-22). 6 Let w(h) = 25h2 + h. What is w(1)? 26 Let c(t) = -3t + 45. Calculate c(17). -6 Let y(j) = j*2 - 17j + 1. Give y(4). -51 Let z(j) = 2j - 27. What is z(14)? 1 Let g(f) = -f3 - 3f*2 - 10f - 9. Calculate g(-6). 159 Let x(q) = -q*3 - 11q*2 + 8. Calculate x(-11). 8 Let l(t) = 4t - 31. Give l(8). 1 Let v(p) = -7p + 4. Calculate v(-2). 18 Let m(a) = -2a*3 - 21a*2 - 27a - 9. Determine m(-9). -9 Let s(d) = 8d + 6. Calculate s(3). 30 Let o(f) = f2 - 4f + 9. Give o(4). 9 Let f(j) = 5j3 + j2. Determine f(-2). -36 Let h(g) = g3 + 2g*2 - 3g - 4. Calculate h(-3). -4 Let n(s) = -s*3 + 9s*2 + 9s - 5. Determine n(6). 157 Let l(r) = -27r + 335. Determine l(12). 11 Let t(q) = -q2 - 6q + 11. Determine t(-5). 16 Let j(v) = 14v2 - 14v. What is j(1)? 0 Let s(b) = 6b - 23. What is s(5)? 7 Let b(p) = p3 - 10p*2 - 12p + 1. Calculate b(11). -10 Let f(z) = -z*2 - 3z - 7. Calculate f(-5). -17 Let h(z) = -z*2 - 7z + 27. Give h(-11). -17 Let k(x) = 3x - 22. Determine k(10). 8 Let a(b) = 5b*2 - 30b. Determine a(6). 0 Let c(k) = -20k + 13. Give c(1). -7 Let l(h) = -h2 - 12h + 15. Calculate l(8). -145 Let h(b) = -b*3 - 2b*2 + 2b - 1. Determine h(1). -2 Let c(b) = b*3 - 15b*2 + 10b + 11. Determine c(14). -45 Let y(k) = -2k2 + k - 2. Determine y(0). -2 Let r(a) = 32a*2 + 2a + 1. Determine r(-1). 31 Let k(y) = -y*3 - 6y*2 - 19y - 85. Determine k(-5). -15 Let t(l) = l*2 + 5l - 9. Give t(-7). 5 Let g(v) = -v*3 - 32v*2 - 58v + 62. Give g(-30). 2 Let c(w) = -2w - 6. Determine c(-3). 0 Let v(b) = -b3 - 21b*2 + 44b - 44. Give v(-23). 2 Let j(v) = v*3 + 5v*2 + 5v + 1. What is j(-4)? -3 Let g(l) = 11l + 5. Calculate g(-5). -50 Let x(f) = -f3 - 5f*2 - 8f. Calculate x(-7). 154 Let c(r) = -3r2 + r - 2. Determine c(3). -26 Let g(a) = a2 + 12a + 16. Calculate g(-11). 5 Let a(q) = -2q2 + 2q + 2. What is a(2)? -2 Let h(g) = -g*3 - 21g*2 + 46g + 1. Determine h(-23). 1 Let n(p) = -p - 31. Calculate n(0). -31 Let m(q) = 34q - 1. Give m(1). 33 Let l(q) = -q3 - 31q*2 + 30q - 58. Calculate l(-32). 6 Let l(t) = -4t + 37. Calculate l(12). -11 Let g(v) = v3 - 8v*2 + 24v - 14. Give g(8). 178 Let s(g) = -g - 7. Determine s(-5). -2 Let k(t) = -39t - 40. Determine k(-1). -1 Let f(y) = -y2 + 53y - 274. What is f(47)? 8 Let h(k) = -k*2 + 9k - 3. What is h(6)? 15 Let h(o) = 2o2 + 16o + 32. Calculate h(-4). 0 Let a(b) = -10b + 196. Give a(19). 6 Let z(y) = -5y3 + y2 + 3y + 2. Calculate z(-1). 5 Let f(c) = 4c*2 - 3c + 3. What is f(2)? 13 Let w(m) = -38m2 + 3m + 1. Determine w(-1). -40 Let h(z) = -5z - 67. Determine h(-12). -7 Let c(s) = -s2 + 3s + 4. What is c(3)? 4 Let o(k) = -k*3 + 10k*2 - 4k - 38. Give o(9). 7 Let r(p) = 4p - 4. Calculate r(5). 16 Let o(r) = -r + 6. Give o(7). -1 Let z(i) = -i2 - 13i - 13. Calculate z(-12). -1 Let m(b) = 7b - 7. Give m(5). 28 Let r(n) = n2 - 23n + 16. Determine r(22). -6 Let d(z) = -9z2 + 32z - 23. What is d(3)? -8 Let t(q) = -q*2 - 3q + 14. What is t(-6)? -4 Let u(f) = -f + 2. What is u(4)? -2 Let y(k) = -k*2 + 2k + 116. Give y(12). -4 Let a(o) = o*2 + 25o + 20. What is a(-24)? -4 Let t(d) = -5d - 23. Determine t(3). -38 Let w(b) = -b3 - 3b*2 + 17b - 10. Calculate w(-6). -4 Let o(a) = -10a + 8. Calculate o(7). -62 Let x(z) = z3 + 9z2 - 6. Give x(-9). -6 Let b(p) = p2 + 8p. What is b(-7)? -7 Let j(l) = 8l - 26. Calculate j(4). 6 Let a(h) = -h - 17. Give a(0). -17 Let m(s) = s*3 + 19s*2 + 15s + 43. Calculate m(-18). 97 Let q(v) = -4v2 - 4v + 4. What is q(1)? -4 Let b(a) = -a*2 + 29a - 8. Calculate b(26). 70 Let z(m) = 5m + 10. Determine z(3). 25 Let p(n) = -26n + 24. What is p(1)? -2 Let o(w) = -3w3 + 6w - 8. Give o(2). -20 Let a(u) = 4u2 - u. Give a(-1). 5 Let h(j) = -8j - 26. What is h(-12)? 70 Let l(t) = 32t3 + 2t*2 + 4t + 3. Calculate l(-1). -31 Let k(n) = n*2 - 4n - 19. Determine k(-3). 2 Let a(d) = -9d3 - 3d*2 + 4d - 2. Calculate a(1). -10 Let k(o) = o*2 - 8o - 21. Calculate k(7). -28 Let z(t) = t*3 - 14t*2 + 12t + 10. Give z(13). -3 Let b(u) = u*2 + u - 16. What is b(0)? -16 Let o(s) = -5s*2 - 21s + 1. Determine o(-8). -151 Let d(c) = 2c3 + 27c*2 + 13c - 5. Calculate d(-13). -5 Let o(g) = -4g - 2. Give o(-4). 14 Let c(p) = -p3 - 10p*2 - 2p. What is c(-4)? -88 Let p(c) = -c*3 + 31c*2 + 222c + 2. Determine p(37). 2 Let m(y) = -y2 - y + 2. Give m(-3). -4 Let c(y) = -y3 - 3y2 + 1. What is c(-3)? 1 Let r(f) = -3f*2 + 21f - 9. What is r(8)? -33 Let m(d) = 4d2 + 22d + 18. What is m(-10)? 198 Let a(j) = j*2 - 2j + 6. What is a(-3)? 21 Let h(p) = p*2 - 18p + 11. Give h(17). -6 Let f(a) = a - 4. What is f(3)? -1 Let b(a) = a*3 - 6a2 + a - 1. Determine b(6). 5 Let p(s) = -s3 - 8s2 - 5s. Give p(-7). -14 Let z(u) = -37u - 257. What is z(-7)? 2 Let n(l) = 25l - 8. What is n(3)? 67 Let c(f) = 3f + 11. What is c(-9)? -16 Let k(m) = -2m*2 - 6m - 4. Determine k(-2). 0 Let k(s) = 3s2 - 14s - 4. Calculate k(5). 1 Let m(q) = -14q + 4. Determine m(4). -52 Let y(b) = 2b + 43. Calculate y(-11). 21 Let d(k) = k*3 + 7k*2 + 6k - 8. Give d(-6). -8 Let h(m) = -6m - 2. Calculate h(3). -20 Let p(l) = -l2 - 22l - 39. Give p(-20). 1 Let g(f) = f*2 + 2f - 20. Give g(5). 15 Let k(x) = 17x - 3. Calculate k(-2). -37 Let a(f) = f3 - 16f*2 - 16f - 11. Calculate a(17). 6 Let a(k) = k*3 + 3k*2 - 6k + 21. Calculate a(-5). 1 Let x(u) = -u*2 + 24u - 78. Determine x(23). -55 Let g(f) = f*2 - 15f + 21. Calculate g(11). -23 Let r(h) = -3h + 1. Determine r(-3). 10 Let t(b) = 2b - 22. Calculate t(7). -8 Let o(v) = 2v2 + 25v - 51. Calculate o(-14). -9 Let h(i) = -4i - 2. Calculate h(5). -22 Let i(k) = 4k - 47. Give i(9). -11 Let r(c) = -20c + 1. Give r(1). -19 Let t(d) = -d3 + d2 - 2d. What is t(0)? 0 Let f(r) = 6r + 10. What is f(-7)? -32 Let f(l) = l2 + l + 5. Determine f(-6). 35 Let r(v) = -v3 - 8v*2 - 10v - 6. Determine r(-6). -18 Let q(b) = -b*2 + 111b - 423. What is q(4)? 5 Let o(h) = 14h + 289. Give o(-20). 9 Let w(t) = -2t + 75. What is w(12)? 51 Let d(u) = -u*2 - 15u - 53. Calculate d(-11). -9 Let a(d) = d*3 - 6d*2 + 5d - 24. Give a(6). 6 Let j(y) = -7y - 38. Give j(-5). -3 Let u(o) = -19o*3 - 3o*2 + 10o - 8. Give u(1). -20 Let p(r) = 28r2 + 3r. What is p(1)? 31 Let w(q) = -q*3 + 11q*2 - 9q - 7. Determine w(10). 3 Let z(b) = -b*2 + 16b - 9. Give z(14). 19 Let s(r) = -r*3 - 8r*2 - 7r - 12. Determine s(-7). -12 Let r(o) = o*2 - 17o - 36. Calculate r(18). -18 Let x(y) = y*3 + 53y*2 - 110y + 5. What is x(-55)? 5 Let j(s) = s*2 - 19s + 75. What is j(12)? -9 Let s(v) = 6v2 - 24v - 48. Calculate s(-2). 24 Let o(t) = -t*3 - 12t*2 - 38t - 18. Determine o(-7). 3 Let k(m) = -3m2 - 9m + 1. Give k(-3). 1 Let l(u) = 4u + 1. Determine l(1). 5 Let j(u) = u2 - u + 5. Give j(9). 77 Let o(b) = -4b*2 - 15b - 24. Calculate o(-2). -10 Let q(y) = -y*3 - 8y2 - y - 16. Give q(-9). 74 Let l(x) = -x2 - 12x - 2. Calculate l(-8). 30 Let g(d) = -14d*2 + 3d - 1. Give g(2). -51 Let f(d) = d2 + 8. Determine f(0). 8 Let d(w) = -w2 - 12w + 3. Calculate d(-12). 3 Let c(u) = -u2 + 61. Give c(8). -3 Let r(q) = 19q + 107. What is r(-6)? -7 Let d(g) = -2*g - 61. Calculate d(-13). -35
What is -1 + (13 - 0) - (-25 + 21 + 2)? 14 Calculate -2 - ((3 - 7) + 7) - (13 + -6). -12 Calculate -19 + (5 - -14) - (16 - (0 + -2)). -18 22 + -10 + -10 - -7 9 Calculate 11 - (21 + -11 + 0 + -14). 15 -9 - (-24 + 20) - (1 - 2) -4 (-18 - -3 - 22) + 25 -12 Evaluate (-30 + 62 + -28 - (4 + -1)) + 8. 9 What is the value of -8 - (-6 + 0 + 98 + -105)? 5 Evaluate (8 - (4 - 1)) + (-4 - (-13 + -5)). 19 -2 - (8 + -1 - (-5 - -9)) - -17 12 Evaluate -42 + 15 + (13 - (0 - -5)). -19 Calculate 12 + 17 + -34 - (-8 + (2 - 2)). 3 What is the value of 3 + 9 - (4 - 4)? 12 What is the value of -2 + -10 + 4 + (29 - 25)? -4 Calculate (-9 - -19) + -7 - -11. 14 Evaluate 17 + -11 + -13 + -8 + 8. -7 Evaluate (1 - -31) + (-13 - -5) + -4. 20 What is 31 - 8 - ((9 + 6 - 10) + 0)? 18 Calculate 46 - 81 - (-24 + 3). -14 Calculate 1 + -51 + (7 - -26). -17 What is -36 - ((-14 - -10) + -12)? -20 Calculate (3 - 3) + 1 + -15 + 32 + -26. -8 What is 4 - (73 + -68 - (-1 - 2))? -4 (13 - -6) + 0 + -13 + 7 13 Evaluate -43 + 23 - (1 + -1 + -7). -13 What is the value of 7 - ((-5 - 2) + 2 + -7 - 11)? 30 Calculate (-25 - -21) + (34 - 12). 18 Evaluate 3 - (25 - 31 - (-4 - 0)). 5 What is (13 + -11 - 4 - 1) + -10? -13 (1 - 39) + -3 + 44 3 What is the value of -27 - (35 - 68) - (-2 + 20 + -1)? -11 What is 31 + -38 + -9 + 4 + 17? 5 -16 + (29 - 33 - (0 + -1)) -19 Evaluate (14 - 0) + -33 + 14 - -4. -1 (28 - (1 + 13)) + -6 8 What is the value of (6 - 2 - 5) + 7? 6 What is -1 - 24 - (-9 - -6 - 6)? -16 What is -10 + 4 + (1 - -2 - -3 - 9)? -9 What is 12 - (23 + 0 - ((17 - 23) + 7))? -10 Evaluate (-4 - 3) + 17 + (-2 + 13 - 13). 8 (0 - 6) + -6 + 6 - (-12 + 25) -19 What is the value of -1 + -9 - (43 + -33 + -20)? 0 5 + (91 - 93 - (9 + 0)) -6 What is the value of -16 - (2 + 1 - (109 - 107))? -17 Calculate (30 - (1 - -1)) + -1 + -10. 17 (-8 - -16) + 20 + (9 - 24) 13 What is the value of (-2 - -28) + (-50 - -15)? -9 Evaluate 22 + 8 + -19 + -10. 1 What is the value of -20 - -47 - (9 - 1)? 19 What is -13 - (-24 - -13 - -3)? -5 Calculate -4 - (-8 + 7) - (30 - 42). 9 Calculate -1 + -3 - (-86 + (3 - -70)). 9 What is the value of -11 + (24 - (-11 + 21))? 3 Calculate -8 - 7 - (10 + -9 + (-5 - -7)). -18 What is 28 - (0 - (-6 + (-1 - (10 + -6))))? 17 What is the value of (-1 - 6) + (62 - 44)? 11 Evaluate (0 - -20) + (-34 - -6 - -18). 10 What is 46 - (15 + 11 + -4)? 24 Calculate (-271 - -274) + (2 - 0 - 3 - 2). 0 What is -212 - -185 - (2 + (-2 - 11))? -16 What is the value of -4 + -3 - (2 + 6 - 10)? -5 Calculate -8 + 28 + -30 - -17. 7 Calculate -26 - (-79 - -52) - (0 + (1 - -3)). -3 What is the value of (-1 - 13) + 81 + -88 + 5 + 0? -16 Calculate (3 - 8) + -3 - -4 - (0 + -8). 4 -14 + 22 + -4 - (1 - -13 - -2) -12 Calculate (3 - (1 - 20)) + -23. -1 Calculate 3 + (-22 + 13 + -11 + 6 - 6). -17 What is the value of -969 + 951 - (-1 - (-2 + 55))? 36 Evaluate 4 - (0 + (-16 - -13)). 7 What is the value of 13 + (-14 - -5) - (-15 + 40)? -21 14 + 0 - 0 - (36 - 0) -22 What is (-11 + -2 - (-212 + 225)) + 18? -8 Evaluate 73 + (104 - 186) - (5 - (-1 - -1)). -14 Evaluate -4 - -11 - ((0 - (-1 - 1)) + 1). 4 What is -67 + 65 + (18 - -3)? 19 What is (2 - 4) + -6 + 4 - (11 + -15)? 0 -27 + (-22 - 9 - -41) -17 What is the value of (37 - 1) + -28 + (-8 - 1)? -1 Calculate -20 + 2 + 13 + 20. 15 13 + -25 + (10 - 0) -2 4 + (6 - (-2 + 1 + -62 + 67)) 6 Calculate 50 + -49 + 0 + -2. -1 Evaluate (-2 - (2 + 2)) + 21 + (-39 - -23). -1 What is the value of 10 + 2 - 2 - 22 - (-34 - 1)? 23 Evaluate (11 - (-15 + 20)) + (-34 - -2). -26 4 + (-2 - 17) + (18 - 3) + -11 -11 What is 1092 + -1090 - (1 - (0 + 26))? 27 What is the value of -3 - (10 + -6 + -1) - -15 - -2? 11 221 - 216 - (1 + 28) -24 Calculate 5 + 3 - ((76 - 64) + (1 - 12)). 7 Calculate 1 - -1 - ((-45 - 0) + 52). -5 0 - -3 - (-6 + 4 - -25) -20 What is the value of (0 + 1 - (21 + -54 + 44)) + 14? 4 Evaluate -1 - (-12 + (25 - 4)). -10 What is the value of 25 + (7 - -18 - 27)? 23 What is the value of (186 - 172) + 3 + -15? 2 (2 - 7) + 6 - -3 4 What is the value of -17 + 11 - -21 - (1 + -4 + 6)? 12 Calculate 1 - (7 + -3 + (6 - (15 - 1))). 5 What is 1 + 35 + -1 + -18 + -33? -16 What is the value of 5 - (0 - (11 - 25)) - 19? -28 What is the value of 100 - 94 - (-8 - (-1 + 2 + 1))? 16 Calculate 19 - 2 - (6 + 1 - (1 - -2)). 13 Calculate -23 + -1 - (-473 + 461). -12 Calculate 1 - 12 - (19 + (-23 - -4)). -11 What is 9 + 4 + -24 + 7 + (-1 - -4)? -1 -7 + -1 + (0 - 9) + (29 - 15) -3 -16 + 21 + 19 - 20 4 What is -21 - ((-27 - -14) + 4)? -12 -14 - ((-4 - -10) + -15) -5 -345 + 358 + -1 + 0 12 Evaluate 10 + (3 - -8) + (-50 - -40). 11 What is 11 + -13 - (3 + 0 - (7 - -9))? 11 Evaluate 2 + (-2 - 0) + (0 + -24 - -20). -4 What is -28 + (34 - 12) + -7? -13 Calculate (13 + -25 - -46) + -4 - 11. 19 (-74 - -66) + (9 - (2 - 1)) 0 What is 3 + 2 - (94 + -87)? -2 Evaluate -2 + 10 - 1 - (64 - (65 + -32)). -24 Evaluate 18 - (20 - -10) - (5 + 1). -18 Calculate 7 - ((-8 - (-6 + -8)) + 14). -13 What is the value of -14 + (4 - -1) - (-20 + 7)? 4 What is the value of -3 + 2 - (20 + (-47 - -9))? 17 Calculate (-24 - ((14 - 15) + (3 - -1))) + 1. -26 28 - 4 - (15 + 0) 9 What is the value of 16 - (-20 + (91 - 42))? -13 Evaluate -34 - (-16 - (33 - 25)). -10 What is 56 - 59 - (4 + -7)? 0 What is 1 + 6 - (0 + (32 - 15))? -10 What is the value of 5 + (-36 - (6 - 19)) + -1? -19 What is the value of 5 - (13 - ((-6 - -13) + -6 - 2))? -9 Calculate -10 + 3 + 3 - (96 - 105) - 29. -24 What is the value of -18 + (13 - (1 + -1))? -5 Evaluate -3 + 1 + -5 - -7 - 2. -2 Evaluate (1 - 21) + (-8 - -14 - 19) + 10. -23 What is the value of 25 + (11 - (-11 - -34))? 13 Calculate -10 - (0 + 3) - -11. -2 What is the value of -25 + (-11 - (-56 + 9))? 11 Evaluate -29 + 47 - (17 - 12). 13 What is (-19 + 16 - -1) + 17? 15 -5 + (71 - 64) + (-1 - 26) -25 What is (0 - -9 - 6) + (1 - 16) + 4? -8 (16 - (-5 - -13) - -5) + 3 16 What is the value of 12 - 1 - (-52 + 63)? 0 What is -18 + 2 + (-8 + 9 - 2) + -11? -28 What is (17 - (30 - 9)) + 21? 17 What is the value of 9 - (7 - -1 - -4)? -3 Evaluate -8 - 0 - (12 - (16 + -12)). -16 4 + (-12 - (9 + -14 - -13)) -16 What is 18 + 0 - (-27 - -24 - -6)? 15 What is (-3 - 1 - (-4 + 1)) + -6? -7 What is -4 + -6 + (58 - 49)? -1 What is (-5 - (-4 - 11)) + -4 - 22? -16 Evaluate -36 + (5 - (-2 + -7)). -22 20 - (12 - 17 - 0 - (-6 - 4)) 15 Calculate -1 - ((-1 + -1 - -7) + -8). 2 (-1 - -2) + -3 - (-26 + 29) -5 Calculate 335 + -390 - (0 + -14) - -15. -26 Calculate (11 - 23 - -15) + -2 + 13. 14 What is the value of (-18 - -4) + 12 + -9? -11 What is (-12 - -6) + 17 + -5 + 3? 9 Calculate -46 - (-75 - -9) - ((7 - 1) + 2). 12 Evaluate (-7 + 2 - (25 + -23)) + -5. -12 What is the value of (-3 - -9) + (-31 - (-5 - 11))? -9 What is the value of -29 + -36 + 66 - -9? 10 Evaluate -5 + 3 - (-11 + (2 - 2) + 6). 3 (7 - 6 - 3) + 10 + -5 + -2 1 (15 - 23) + 1 - (-20 - -1) 12 What is (4 - 0) + 4 + -7 + -5 + 7? 3 11 - (-3 - (-9 + 8)) 13 Calculate (12 - 19) + -9 + (1 - -2). -13 What is the value of -1 + -1 - (0 - (1 + 1 + -7))? -7 What is the value of 3 + 7 + -35 + 39? 14 Evaluate 20 - (12 + -2 - -1). 9 Calculate 0 + 9 + -32 + 0 + -3. -26 What is the value of (-19 - (-39 - -20)) + 14? 14 What is 11 + -28 - (-3 + -6)? -8 Calculate 12 - (32 - 29) - -10. 19 Evaluate (136 - 114 - (2 + -4 + -1)) + -4. 21 (-4 - 1) + -27 + (8 - -2) - -8 -14 Evaluate -14 - (8 + (-8 - -2)) - -7. -9 What is 13 + -2 - (27 - 17 - 6)? 7 What is 2 + 13 + 4 + -16? 3 What is (25 - (19 - -14)) + -3 + -1? -12 What is the value of -5 + 8 + 3 + 2 + -2 + 2? 8 What is -7 + (21 - 10) - 10? -6 1 + 5 + (27 - 13) + (-1 - 6) 13 What is the value of (-5 - (10 + -17)) + -4 - 2? -4 What is the value of -21 - (-46 - (-18 + -1))? 6 Evaluate -2 + -6 - (-83 - -68). 7 What is -3 + 15 + 37 + -48 + 7? 8 Calculate 2 - (56 - 18) - -20. -16 26 + (-2 - -3) - (1037 + -1018) 8 Calculate (-13 - 9) + (2 - -10). -10 What is 39 + 1 + -13 + -18 + -10? -1 Calculate -23 + 16 + 32 + -13. 12 Evaluate (18 - 8) + -3 + (-2 - -1) + -12. -6 Evaluate -5 - ((0 + 5 - 12) + 10). -8 19 + (-29 - 14) - -30 6 Evaluate 56 + -15 + -21 + -10. 10 What is (-2 - (-25 + 0)) + 1947 + -1934? 36 Calculate 11 + (15 + -8 - (15 + 2)). 1 -9 - 5 - -17 - 2 1 What is 7 - -1 - (-4 + 14 + -6 + 25)? -21 What is the value of 18 + 17 + (5 - 23)? 17 What is 5 + 6 + (6 + -14 - -2)? 5 What is the value of (5 - 4) + (-3 - 4) + (1 - -2)? -3 What is (-8 - (-9 + -4 - -5)) + -5? -5 Calculate (-33 - -11 - (2 + 1)) + 7 + 4. -14 Calculate (4 - (-2 + -2)) + (6 - 9) + 1. 6 Evaluate 14 - (11 + 3) - -7. 7 Evaluate (6 - (-5 - ((0 - -6) + -16))) + 12. 13 What is (-21 + 18 - 44) + 35? -12 What is (1 + 1 + 2 - -1) + -188 + 190? 7 Evaluate -10 + -15 + 14 + -3 + 2 + 4. -8 Calculate -8 - (3 - 1 - (21 - 18)). -7 Evaluate 207 + -221 + 24 + -1. 9
Let m be 20/(2 - -2) - (-1 + -116). Let s = m - 78. Which is greater: s or 0? s Let j be ((-16)/(-6))/((-44)/(-4782)). Let x = j + -290. Let i = 6748 + -101222/15. Which is smaller: x or i? x Let z(q) = 370q + 1916. Let f be z(-5). Is f equal to 0.64? False Let t be (-18)/(-99) + 1624/22 - 2. Let l be (-7764)/t - (-1)/(-6). Which is smaller: -107 or l? l Let n = 12204 + -12168. Which is smaller: 18 or n? 18 Suppose y - z = -63, 0y + z = 5y + 299. Let d(b) = b2 - 14b - 10. Let p be d(11). Let q = y - p. Is q greater than -3? False Suppose -6s - 8s + 28 = 0. Suppose -3t - 102 = 5y, 0 = -sy - 2t - 26 - 14. Is -4 >= y? True Suppose 27 + 39 = -6q. Let f be (-4)/(-22) - (-211)/q. Let o = f - -97/5. Which is greater: -8 or o? o Suppose -2h - h = 0. Suppose 4v + 2g + 8 = h, g = -3v + 3 - 10. Let t = 63024 - 63022. Which is greater: t or v? t Let w be ((-345)/(-25))/(-23) - 137/30. Suppose 0 = 3u - 4u, -j - 3u - 4 = 0. Which is greater: w or j? j Let i = -198 - -177. Let o = -0.2 - 1.4. Let l = o - -1.6. Which is greater: i or l? l Let g = 10994/19 - 25197/95. Which is bigger: 312 or g? g Let a(z) = z*2 + 4z - 1. Let r be a(3). Suppose 0 = -3o - 4c + 112, -2o + c - 38 = -3o. Let k = -22 + o. Does k = r? False Let x(w) = w*3 - 7w*2 + 6w + 5. Let o be x(5). Let r be (-2)/(-4) - o(-1)/6. Let i be r2 + 135/5. Is i at most as big as 23? True Let s(n) be the second derivative of 5/6n3 + 3/2n*2 + 22n + 0. Let y be s(-1). Which is greater: y or 0? 0 Let j be 6(1 - 3)/(-2). Let h(w) = w3 + 7w*2 - 63w - 398. Let u be h(-9). Suppose 41 + u = -jz. Which is smaller: z or -10? -10 Let c = -3/2 + 2. Let t = 444859 + -444773. Which is bigger: t or c? t Let j = -11439.9 + 11440. Which is smaller: 3599 or j? j Let i = -1/71759 - 142915/43270677. Let w(n) = n2 + 3n - 4. Let y be w(-4). Is i bigger than y? False Let y be (4 + 44382/(-11100))(-4)/(-21). Which is bigger: -1 or y? y Suppose 4t - 49 + 5 = -2k, 3t - 47 = -2k. Suppose 17 = 9d - k. Suppose 185 = -di + 5f, 0 = 5i + 5f - f + 194. Are i and -36 equal? False Suppose -2y + 3c = 780, 2y - 4c + 788 = -3c. Suppose -5d - 1970 = -5p, -2p - 1977 = -13d + 18d. Which is bigger: d or y? d Let s(u) = 3u2 + 8 + 3u*2 - 5u*2 - 7u + 5u2 + u3. Let o be s(-7). Is 9 > o? True Suppose -3g + 12g + 27 = 0. Let m = -467 + 466. Do m and g have the same value? False Let j = 9943 - 10505. Is j < -562? False Let x = -7620.8 - -7540.597. Let t = -0.203 - x. Is 0 less than or equal to t? True Let t = -646759/760 - -851. Is t less than or equal to -0.1? False Let p = -10797 + 10863. Which is smaller: 154 or p? p Let r(i) = -78i + 114. Let z be r(6). Let k = 354 + z. Is 4/211 less than or equal to k? False Let a = -6571 + 6198.1. Let q = a - -405. Let v = q - 32. Is -21 != v? True Let q = -1.42 - 2.27. Let j = q + -0.31. Is j greater than 0.7? False Let j(f) = -780f3 - 2f*2 - 2f. Let b be j(-1). Let v be -4 + (2/(-13) - (-3006)/b). Let t = -3 + 2. Which is bigger: t or v? v Let d be (-22 + 16 - (1098/(-39))/3) + 0. Suppose 0x = -2x + 6. Which is greater: x or d? d Let r = 0.014 - -49.986. Let u = 57 - r. Let t = u + -7. Which is smaller: 33 or t? t Let i be -15(2100/(-18) + 6). Suppose -3d + i = 17d. Which is smaller: 85 or d? d Let r be (10726 - -11) + ((-4)/10)/(18/(-180)). Is r less than 10741? False Suppose s = -2o + 5s - 4, -4s + 40 = 4o. Let u = -35.054 + 0.054. Let d = u + 34.7. Is o bigger than d? True Let f be 0 - (-6 + ((-1)/1)/(-1)). Suppose -5z + 4q - q = 112, -fq = -4z - 100. Which is greater: z or -19? -19 Let b = -99 - -100. Suppose -1 - 2 = -s - 2x, 24 = 5s + x. Suppose -3v + 3t - 15 = 0, 3v + 3t = 20 - s. Do v and b have the same value? False Let n = 335/25341 - 57231002/21919965. Let p = 2/865 - n. Let b = -3 + p. Which is bigger: -2/9 or b? -2/9 Let d be (-214)/(-14) + 12/(-42). Suppose -99 + d = -6g. Let u be g/(-56) - 42/8. Is u less than -7? False Suppose -2t - 9 = 15. Let s = t + 27/2. Suppose -2w - x = -1, 7x = 5w + 4x - 30. Which is smaller: s or w? s Suppose -2w + 2 = 5s, -22 = -3s + 5w - 27. Suppose s = -4d - 22 + 18. Let a = -272 + 1900/7. Which is bigger: d or a? a Let c = 135/1817 + -2/23. Let l be 6/1 + (-28 - -23). Is l less than or equal to c? False Suppose 3 + 24 = 3z. Let c = -39 + 18. Let b = -19 - c. Which is bigger: z or b? z Let f be 2 + (3 - (-1 - -2)). Let d(y) = -22 - f + 3y - y - 21. Let s be d(20). Are s and -4 unequal? True Suppose 2r - 5b - 25 + 5 = 0, 5r = 4b + 16. Suppose -44i + 2736 = -38i. Let t be (10/14)/(i/(-84) - -6). Which is bigger: t or r? t Let f be ((-2)/(-7 + 5699/814))/1. Is f smaller than 0? True Let p = -56 + 61. Suppose pa = -157 + 137. Is -0.2 greater than a? True Let j = 1.2 + -1. Let o = 60689/3 - 20238. Which is smaller: o or j? o Let o be (95/(-15))/((-1)/6). Let r be (-157275)/16206/(-15). Which is bigger: r or o? r Let a be 1 - (32850/(-3295))/(-10). Which is bigger: a or 0? a Let y = 108 + 214. Let w = y + -323.936. Let h = -0.064 + w. Which is smaller: h or 9/4? h Let n(t) = -t*2 + 4t - 5. Let g be n(3). Let f(s) = -150s3 - 2s*2 + 5s - 4. Let o be f(1). Let a = o - -152. Which is greater: a or g? a Suppose -15y = 36498 - 213. Which is smaller: -2421 or y? -2421 Let j = -3343/6 - -8116807/14568. Are -1 and j equal? False Let p be 75/3012/(-90). Are p and 648 nonequal? True Let z(w) = -w - 7. Let k be z(-3). Let y = k + 27. Suppose 9 = -5v + 5s + 34, 3v = 5s + y. Does -2/25 = v? False Suppose 20w - 2x = 4950, -1260 = 48w - 53w - 4x. Which is greater: 249 or w? 249 Suppose -3u + 12 = 4t + 13, 0 = -4u - 4t. Is 1/69 at least as big as u? False Let k = 106.06 + -112.06. Which is bigger: 99 or k? 99 Suppose 0 = -5v - 4m + 28, -3v + 0v = 3m - 15. Let t be -4(14/v)/(-7) + 3. Let k be (t/(-2))/(-89 - 4). Which is greater: 1 or k? 1 Suppose 4m + u = 2274, -5m - u = -7m + 1140. Suppose mf + 3 = 572f. Which is smaller: f or 8/37? 8/37 Let m be 2/(-4) + 27738/(-528) - 1/11. Which is bigger: 1/3 or m? 1/3 Suppose 138 = 5i + 3r, 2i + i + 4r = 85. Is -12 at most i? True Let k be 30/80 + 335/(-40). Which is smaller: k or -61? -61 Suppose -2o + 5t = -1044, -2t - 941 = 39o - 21896. Let s be -1 - -1 - (-538 - -1). Is s < o? False Suppose 51j + 4 = 7 + 48. Is j at least as big as 33/326? True Let r = 541 - 509. Let d(s) = 4s*2 - 3s + 6. Let c be d(6). Suppose -c = -15y + 11y. Which is greater: y or r? y Suppose -x + m - 10 = 0, -15x - 19m = -11x - 98. Is x smaller than -2? True Let q = 4401.1 + -4402. Is q equal to 148? False Let a = -3004 + 3006. Which is bigger: -192.3 or a? a Suppose 13931 + 34598 = 169w - 68757. Which is bigger: 3466/5 or w? w Let w = 1.1241 - 1.2241. Let n be (234/297)/(16/(-14)). Let o = 2/33 - n. Is o < w? False Let g = 12417/2 - 6041. Are 167 and g unequal? True Suppose -3k + 50 = 2a + 146, 0 = 3a - k + 155. Suppose -1150 = 5q + 18q. Which is bigger: a or q? q Let r be (-510)/171 + (608/(-12))/(-19). Is r != -11.2? True Suppose 385 - 1031 = -19z. Suppose 3103 - 485 = -zn. Is n bigger than 2? False Let l(y) = -24y*2 - 6y - 12. Let q be l(-3). Let a = q - -7. Which is bigger: a or -204? a Suppose 2n + 3704 - 45465 = 5c, -2n - 25047 = 3c. Let l = c + 42072/5. Let v = 63 - l. Is v less than -0.07? True Let m = -8346 + 8218. Which is greater: -116 or m? -116 Let o = 2676213078984801243/24655073442746 + -26316614639/242446. Let s = o - 1088/22909. Let i = s + 5/193. Which is smaller: i or -1? -1 Let s = -16 + 49. Suppose -14590 + 14942 = 11c. Are s and c nonequal? True Let y(p) = -4 + 3p*2 - 5p*2 - 9 - 12 + 15p. Let r = -1479 - -1488. Let z be y(r). Is -53 at most as big as z? True Let v = -22 + 5. Let y be -3 + 3 + -3 - (v + 1). Suppose -19 = -p - y. Are 7 and p nonequal? True Let u be (-1 - -2) + 333/(-335). Let p = -57814 + 57814.1. Is p < u? False Let i = 635 + -7615/12. Suppose -35k - 15 = -40k. Suppose -h + 3s - 3 = -2, -2s = 3h + k. Which is smaller: h or i? h Let a = -175486 + 2278606/13. Are -208 and a equal? False Let a be 319((5 - 0) + -4). Suppose -37j + a = -8j. Which is smaller: 14 or j? j Suppose -164543 - 104344 = -277y - 69447. Is 2156/3 at most as big as y? True Let s be (-6)/76230/(-1725). Let c(z) = z*2 + 9z - 9. Let u(n) = -n*3 + 10n*2 - 11n + 8. Let p be u(9). Let w be c(p). Are s and w unequal? True Let v = 45 + -61. Let i be 1 + (-6)/3 - -2. Let b be i/6 - v/(-24). Which is bigger: b or -2/3? b
Factor 0 - 3/5s + 3/5s*2. 3s(s - 1)/5 Suppose -5t + r + 1168 + 300 = 0, 1181 = 4t - 3r. Let n = t + -2043/7. Factor n - 16/7w - 10/7w*2. -2(w + 2)(5w - 2)/7 Let l(p) = p*2 - 5p + 6. Let n be l(4). Suppose nc + 12 = 6c. Factor -r*2 - 2r*c - 2r*4 + 3r*2 + 2r + 4r3 - 4r*3. -2r(r - 1)(r + 1)*2 Suppose -44y + 39y + 10 = 0. Determine k, given that 0k - 7/2k3 + 0 - ky = 0. -2/7, 0 Let z(c) be the first derivative of -c + 1/30c*4 - 4 + 1/5c*2 - 2/15c*3. Let q(k) be the first derivative of z(k). Factor q(l). 2(l - 1)*2/5 Suppose 2x + 232 + 92 = 0. Let m be (-36)/x(-18)/(-10). Factor 0 + mp*3 + 4/5p*2 + 2/5p. 2p(p + 1)*2/5 Suppose 3g + 4r = 2, 0 = 3g + 3r + 3 - 0. Let f be 6/9 + (-20)/g. Factor -15x + 13x + 2x*3 - 2x*2 + 2x*4 + 0x*f. 2x(x - 1)(x + 1)*2 Factor 22a*2 + 4a*4 + 5a*3 - 6a*2 - 7a*3 - 14a*3. 4a*2(a - 2)*2 Let j(h) = 16h*4 + 17h*3 - 12h*2 - 17h - 7. Let d(y) = 48y4 + 52y*3 - 36y*2 - 52y - 20. Let v = -3 + 6. Let r(x) = vd(x) - 8j(x). Factor r(w). 4(w - 1)(w + 1)*2(4w + 1) Let v be (0 + 1)/((1/(-5))/(-1)). Let f(j) be the third derivative of 0j + 0 + 5/8j4 - 4j2 + j3 - 7/20jv. Factor f(u). -3(u - 1)(7u + 2) Let z(p) be the third derivative of -p7/735 + p5/70 - p*4/42 + 4p*2 - 3. Factor z(g). -2g(g - 1)2(g + 2)/7 Let j(h) be the first derivative of 4h3/9 + 8h*2/3 + 16h/3 + 38. Factor j(x). 4(x + 2)2/3 Solve u + 2u*4 + 4u + 0u - 3u + 6u2 + 6u*3 = 0. -1, 0 Let d(o) = 5o*3 - 30o*2 + 20o + 5. Let j(t) = -t*2 + t. Let a(u) = d(u) - 25j(u). Find l, given that a(l) = 0. -1, 1 Let s(o) be the first derivative of -4/5o4 + 7/25o*5 - 1 + 0o + 11/15o3 - 1/5o*2. Factor s(u). u(u - 1)*2(7u - 2)/5 Let g(x) = -x - 2x*2 - 2x*2 + 5 + 5x*2 - 2 + 4x*3 + 2x4. Let f(y) = -y4 - y*3 - 1. Let c(i) = -3f(i) - g(i). Determine r so that c(r) = 0. -1, 0, 1 Factor -4/11g + 10/11g*4 + 0 + 14/11g*2 - 2/11g*5 - 18/11g*3. -2g(g - 2)(g - 1)*3/11 Let v(a) = -a - 2. Let s be v(-6). Suppose 0 = 5c - o - 0o - 18, sc - 18 = 2o. Factor 2/5x*4 + 0x*2 + 0x + 2/5x5 + 0x*c + 0. 2x*4(x + 1)/5 Factor 36/11 - 6/11t3 - 78/11t + 40/11t2. -2(t - 3)*2(3t - 2)/11 Let h(q) be the first derivative of 2 + 54q*3 + 3/5q*5 + 162q*2 + 9q*4 + 243q. Factor h(j). 3(j + 3)4 Let k be (2/40)/(-1). Let n = 3 - k. Factor -j - 2j4 - 4j*2 - 2j4 - j5 - 7j3 + jn. -j(j + 1)*4 Suppose -3y - 2y = -10. Let i(v) be the second derivative of 1/3v*y - 1/45v*6 + 0v*4 - 2/9v*3 + 0 + 2v + 1/15v5. Factor i(c). -2(c - 1)*3(c + 1)/3 Let c(k) be the second derivative of k*4/6 - 2k3/3 + k2 + 6k. Let c(r) = 0. What is r? 1 Let a(v) be the third derivative of -v6/30 - 2v*5/5 - 11v*4/6 - 4v*3 + 3v*2 - 17. Determine t, given that a(t) = 0. -3, -2, -1 Let n(o) = 26o*5 + 14o*4 + 46o*3 + 26o*2. Let q(g) = -5g*5 - 3g*4 - 9g*3 - 5g*2. Let d be 42/24. Let v(r) = dq(r) + 3n(r). Factor v(t). -2t*2(t + 1)*3 Factor -33 + 19 + 12n + 32 + 3n2 - n2. 2(n + 3)*2 Factor 3m*2 - m - 2m*2 + 5m - 6 - 3m. (m - 2)(m + 3) Let x(o) be the second derivative of -o*9/1890 - 13o*8/3360 - 11o7/1260 - o6/180 - o*4/3 - 2o. Let l(a) be the third derivative of x(a). Factor l(q). -2q(q + 1)(q + 2)(4q + 1) Let n = 647 - 647. Find d, given that nd + 0 + 0d2 - 1/6d*3 = 0. 0 Let q be 5 - (-10)/(8/(-4)). Let j(d) be the second derivative of -1/48d*4 - 2d - 1/8d2 + 1/12d3 + q. Find b, given that j(b) = 0. 1 Let l(t) = t3 - 19t2 - 41t + 1. Let w(x) = 2 + 8x + 5x2 - 2 - x2. Let k(o) = 2l(o) + 11w(o). Suppose k(i) = 0. Calculate i. -1 Let b(v) be the first derivative of -5v3/3 - 15v*2/2 + 10. Find o, given that b(o) = 0. -3, 0 Let j be 16/(-12)(-3)/111. Factor 6/11y + 0y2 - 2/11y*3 + j. -2(y - 2)(y + 1)2/11 Let a(x) be the first derivative of -3x5/20 - x4 - 2x3 - x + 1. Let f(h) be the first derivative of a(h). Factor f(j). -3j(j + 2)2 Let r(i) be the first derivative of 0i*5 - 4 + 1/7i*4 + 0i*3 + 0i - 1/7i2 - 1/21i*6. Determine f so that r(f) = 0. -1, 0, 1 Factor 0 - 1/2x - 1/2x3 - x2. -x(x + 1)*2/2 Let k(m) be the third derivative of -1/6m*3 - 1/1980m*6 + 0m - m*2 + 0 - 1/132m*4 - 1/330m*5. Let j(t) be the first derivative of k(t). Factor j(z). -2(z + 1)*2/11 Determine h so that 68h - 14h + 2h*4 + 21h*3 + 54h*2 - 5h*3 + 2h3 = 0. -3, 0 Let x(y) = y2 + 45y + 147. Let i(o) = -o2 - o + 1. Let a(q) = 3i(q) - x(q). Factor a(u). -4(u + 6)2 Let a(g) = g2 + 5g - 5. Let z be a(2). Suppose -4k = -zk. Find f such that kf3 + 0 + 2/9f*5 - 2/9f + 4/9f2 - 4/9f4 = 0. -1, 0, 1 Let q(g) be the third derivative of -g9/30240 - g8/5040 - g7/2520 + g5/720 + g4/3 + 4g2. Let l(j) be the second derivative of q(j). Factor l(x). -(x + 1)3(3x - 1)/6 Let x(k) be the first derivative of -k6/24 + k5/10 + 3k4/16 - 41. Factor x(j). -j3(j - 3)(j + 1)/4 Let n be 2/(-8) - 1/(-4). Let p be 3/2(n + 2). Let 2/5k*4 + 2/5 - 4/5k*2 + 0k*p + 0k = 0. What is k? -1, 1 Let 0 - 4/3o - 2/3o*2 = 0. Calculate o. -2, 0 Let l = -12441/5 - -1605137/645. Let k = l - -2/129. Find q, given that k + 8/5q*2 + 2q = 0. -1, -1/4 Suppose 33 = 4w + 9. Let l(z) = 2z - 8. Let r be l(w). Find c, given that -c*3 - 4c4 + c5 - c4 + c2 + rc4 = 0. -1, 0, 1 Let o be (-21)/(-70) + 68/40. Find a such that -4/5a + 4/5 + 1/5ao = 0. 2 Let r(t) be the third derivative of t8/672 + t7/105 + t6/40 + t5/30 + t4/48 + 7t*2. Find y, given that r(y) = 0. -1, 0 Let v be ((-5055)/100)/((-3)/4). Let k = v + -67. Factor -kd*2 + 0d + 0d3 + 1/5d4 + 1/5. (d - 1)2(d + 1)2/5 Let m(r) be the first derivative of -2r*3/27 + 5r*2/9 - 18. Factor m(q). -2q(q - 5)/9 Let k(h) = -7h*4 - 9h*3 - 3h2 + h + 6. Let i(j) = j3 - 3 + j + j4 + j2 + 4 - 3 + 1. Let d(q) = 4i(q) + k(q). Factor d(o). -(o - 1)(o + 1)*2(3o + 2) Let i(n) be the third derivative of -n7/350 + n6/600 + n5/100 - n4/120 - 4n*2. Factor i(y). -y(y - 1)(y + 1)(3y - 1)/5 Suppose -j - 2 = 5a, -4 = -2j - a - a. Let f = 5 - j. Factor 0n*3 + 0n*3 - f - 7n - n*2 + 2n + 2n3. (n - 2)(n + 1)(2n + 1) Let u be -2 + 2 + (-1)/(-20). Let o(v) be the first derivative of uv4 - 1 + 0v - 1/15v3 + 0v2. Factor o(x). x2(x - 1)/5 Suppose -112t = -106t. Factor -4/3j*2 + t + 2/3j + 2/3j3. 2j(j - 1)2/3 Let -54/7 - 18/7q + 6/7q2 + 2/7q3 = 0. What is q? -3, 3 Factor -z2 + 2z2 + z2 - z2 + z3. z2(z + 1) Let o(n) be the third derivative of n5/100 + n4/4 + 9n3/10 - 9n2 + 5. Find l such that o(l) = 0. -9, -1 Let r(m) = m3 + m*2 - 3m - 2. Let i be r(-2). Let u = i + 2. Factor -2w2 - 2 + uw + 2. -2w(w - 1) Let c(a) = 5a4 - 17a*2 + 6. Let f(d) = -14d4 - d3 + 50d2 - d - 17. Let g(p) = 17c(p) + 6f(p). Factor g(n). n(n - 3)(n - 2)(n - 1) Let r be -1 + 2 + (-3)/5. Let n be 24/96/10. Factor -rc*2 - nc*5 - 18/5c*3 + 0 + 2/5c - 22/5c4. -2c(c + 1)3(4c - 1)/5 Let m(s) be the first derivative of -s4/32 - s3/3 - s2 + 14. Factor m(y). -y(y + 4)*2/8 Suppose 0l = -l + 3i + 93, 0 = 4i + 12. Let f be 2/8 + 75/l. What is r in 4/7r + fr*3 - 2/7r*4 + 0 - 10/7r2 = 0? 0, 1, 2 Let w(u) be the first derivative of -u6/6 - 7u5/5 - 19u*4/4 - 25u*3/3 - 8u*2 - 4u + 10. Let w(d) = 0. What is d? -2, -1 Let v(j) be the second derivative of j*4/14 + 8j*3/21 + 16j*2/21 - j. Determine m, given that v(m) = 0. -4/3 Let l = 19/26 + -3/13. Factor lx2 + 1/2 + x. (x + 1)2/2 Let g(c) be the second derivative of -c*8/1176 - 2c7/735 - c6/420 - c*2/2 + 3c. Let k(u) be the first derivative of g(u). Find t, given that k(t) = 0. -1, 0 Let u(p) be the first derivative of -2p3/3 - p2 - 9. Factor u(k). -2k(k + 1) Let t(d) = -d + 11. Let v be t(9). Suppose -18 + o3 + 18 - 2o*v = 0. Calculate o. 0, 2 Suppose 2c + 8 = 4c. Suppose 0 = cp + 2n - 4, 2p - 4p = 4n - 8. Factor 1/3m + 1/3m*2 + p. m(m + 1)/3 Let v(i) = 21i3 - 27i*2 + 24i. Let m(s) = 5s3 - 7s*2 + 6s. Let j(l) = 9m(l) - 2v(l). Factor j(g). 3g(g - 2)(g - 1) Let j(q) be the second derivative of -q6/1620 - q3/3 - 3q. Let s(t) be the second derivative of j(t). Factor s(a). -2a*2/9
Simplify (0 + (-3 + (sqrt(1053) - (sqrt(1053) - (1 + sqrt(1053) + sqrt(1053) - sqrt(1053)))) + sqrt(1053) + 3 - (4sqrt(1053)1 - sqrt(1053)-11)))*2-2. -18956 + 108sqrt(13) Simplify (-2(-2 + -6sqrt(272)-1 + (1 + sqrt(272) + 2 - sqrt(272)) - (-2 + -6(-1 + (sqrt(272)1 - sqrt(272) - sqrt(272))))))*2. 36 Simplify ((0 + sqrt(208) + 0 + sqrt(208))-65-1-3)2-4. -26956800 Simplify (-1-3(sqrt(165) - sqrt(165)1)/sqrt(11))/(4(sqrt(5) - -2(sqrt(5)2 - sqrt(5)) - sqrt(55)/(sqrt(11)-1))). 0 Simplify (((sqrt(484) - (sqrt(484) + -1sqrt(484) - sqrt(484))-1)-2)/(-3sqrt(66)/sqrt(150)))24. 0 Simplify (3 + (((sqrt(1872) - (-1 + sqrt(1872)1)) + -3)-3 - (-4 + 0 + sqrt(1872) + 1(sqrt(1872) - sqrt(1872)2))))*2. 169 Simplify 0 + (((sqrt(154) - -5(sqrt(154)2 - sqrt(154)))/((sqrt(567) - (sqrt(567) + sqrt(567)-1)) + sqrt(567)))/(-2-2sqrt(44)-5))2. 1/7200 Simplify (3(-2sqrt(960) - sqrt(960) - sqrt(960) - sqrt(960)) - -51sqrt(960))/((sqrt(126)/sqrt(150) + sqrt(21))/(sqrt(175) + sqrt(175)2)). -1000sqrt(5) Simplify (3 + -6(sqrt(68) + sqrt(68)-2-2)/(2sqrt(484) + sqrt(484) + sqrt(484)))26. -270sqrt(17)/11 + 24543/242 Simplify ((3 + ((sqrt(500) + 0 + sqrt(500) + sqrt(500))-3-3)2)-5 + 5)-1. 1822510 Simplify (-5 + (3 + sqrt(833))-1)*2 - (((sqrt(374) - -1sqrt(374))/sqrt(11))/((sqrt(2) - sqrt(50))-5))2. 112sqrt(17) + 89683/100 Simplify ((((sqrt(76) - (sqrt(76)-2 + sqrt(76)) - sqrt(76))2 + -2sqrt(76)-1 + sqrt(76))-1)/(4sqrt(28)/(sqrt(784)/sqrt(7))))*2. 475 Simplify (5 + (((sqrt(85)-2 + sqrt(85) + sqrt(85))5 + sqrt(85) - sqrt(85)) + -51sqrt(85))/((sqrt(70)/sqrt(7)6)/sqrt(2)))*2. -25sqrt(17)/3 + 1325/36 Simplify (5((5(2 + sqrt(320)) - (2 + sqrt(320) + 1)) + -1 + sqrt(320) + -1 + sqrt(320) + -5 + 5))*2. 12000sqrt(5) + 288625 Simplify ((5sqrt(14)-2 + sqrt(14))/(-2sqrt(72)) + (sqrt(56) - sqrt(336)/(1sqrt(6)))/(sqrt(8) + (sqrt(968) - sqrt(968)-2)))2. 63/16 Simplify ((sqrt(228) - -1sqrt(228)-5)2-1)/((sqrt(108)-4)/sqrt(9) - -3sqrt(432)). 4sqrt(19)/7 Simplify (2 + ((-3 + sqrt(1152) + 3)4)2 + -4)-2. -36860 Simplify 3(sqrt(343)1-3 - sqrt(343))2 + 1 + (sqrt(420)/(sqrt(70)/sqrt(7)) - sqrt(42))/(3sqrt(600)). 16465 Simplify 1(5(-2 + (0 + (sqrt(720) - -2sqrt(720)-1))-3))2. -3600sqrt(5) + 162100 Simplify -4 + ((sqrt(810)2)/sqrt(2) - (-1(-2 + sqrt(45)))*2). -53 + 30sqrt(5) Simplify (sqrt(972) + sqrt(972)1)/(sqrt(16)/sqrt(4)4) + (sqrt(12)/sqrt(4)-1 + -1 + sqrt(3) + -2)2. 9sqrt(3)/2 + 9 Simplify ((sqrt(1573) + sqrt(1573)3 + 2)2 + 4)*2 + (-2sqrt(65)-4)/((sqrt(120)/sqrt(3))/sqrt(8)). 1416sqrt(13) + 100736 Simplify 5(-5 + sqrt(300) + -2)2 + (4(sqrt(30) + sqrt(750)))/sqrt(10) + 3. -676sqrt(3) + 1748 Simplify (-3(-1-6sqrt(153) + 2 + (-3sqrt(119))/sqrt(7)))2. 540sqrt(17) + 34461 Simplify (1(3(1 + sqrt(3) + sqrt(3)) + sqrt(75)1))2 - (-5 + sqrt(27)/(sqrt(9) + sqrt(36)/sqrt(4)) + (-1sqrt(12)/sqrt(4) - sqrt(3))). 135sqrt(3)/2 + 377 Simplify ((sqrt(76) - (sqrt(76) - (-2sqrt(76) - sqrt(76))))2 - sqrt(76) - (sqrt(76)2 + sqrt(76))1)/(sqrt(36)/(-2sqrt(1089))) + -5 + -2. -7 + 220sqrt(19) Simplify -4 + -6((sqrt(245)2)25 - (sqrt(245) + 0)5)5. -147004 + 1050sqrt(5) Simplify (sqrt(1694) - 3sqrt(1694) - (sqrt(14) - (-2sqrt(2016) + sqrt(2016) - sqrt(14) - sqrt(14))))/(1(sqrt(70)/sqrt(40) - sqrt(49)/sqrt(63))). -222sqrt(2) Simplify (4 + (sqrt(432) - -2sqrt(432))*2)4 + -1 + 4 + sqrt(432) + (-3((-1 + sqrt(432) - sqrt(432)) + sqrt(432)))2 + -4 + (sqrt(432) + 1)2. -180sqrt(3) + 19897 Simplify -2 + (sqrt(209)-11 - -3(sqrt(209) - sqrt(209)-2 - sqrt(209)))/((sqrt(66) + (sqrt(66) - -1sqrt(66))-5)/sqrt(6)). -5sqrt(19)/9 - 2 Simplify (sqrt(242) + 5sqrt(242)-1 + sqrt(242) - (sqrt(242)2 + 1)) + (12sqrt(98)2)2 + 5. -55sqrt(2) + 1572 Simplify ((sqrt(170) - (sqrt(170)-4-6 + sqrt(170))) + 61sqrt(170))/(6-4-2sqrt(10)-2). 3sqrt(17)/16 Simplify -5(6sqrt(4)/sqrt(32))2 + 2 + (-1 + sqrt(450) + sqrt(450))2 + -2. -60sqrt(2) + 3557/2 Simplify ((-63(sqrt(117) + -3) + 3 + (sqrt(52) - (sqrt(468) + sqrt(52))6))3)*2. -102600sqrt(13) + 1199241 Simplify ((0 + -3sqrt(1300) - sqrt(1300)) + (sqrt(1300) + 3)3 + sqrt(1300) - ((sqrt(1300) + 0)-2 - sqrt(1300) - -1sqrt(1300)3))2. 81 Simplify ((sqrt(88) + sqrt(88) + -1(2sqrt(88) + sqrt(88)) + 1(-3sqrt(88) + sqrt(88)))/(sqrt(392)1-5 - (sqrt(392) + 1sqrt(392)-3 + sqrt(392))))2. 99/784 Simplify (4-4sqrt(1944))/(sqrt(60)/sqrt(5)5 - sqrt(132)/(-2sqrt(11)))-4. 1152sqrt(2)/11 Simplify 32(4-1(-5sqrt(1088)-2 - -4(sqrt(1088) + sqrt(1088) + 3)))*2. 331776sqrt(17) + 33854976 Simplify ((sqrt(135)/(sqrt(9)2) - sqrt(15)) + (sqrt(15) - (sqrt(45)3)/sqrt(3)))/(sqrt(300)2 - 4sqrt(36)/sqrt(12)). -5sqrt(5)/32 Simplify -3(-6((1sqrt(90))/sqrt(2) + -4 + 1) + -4)*2. -5448 + 1512sqrt(5) Simplify 1(-4 + 4 + (6(sqrt(2057) - (sqrt(2057) + -1)) + -2 + 5)*2 + 0). 81 Simplify 1(sqrt(612) + sqrt(612) + 2)-6 + (4sqrt(102)-2)/(2sqrt(24)/sqrt(4)). -76sqrt(17) - 12 Simplify (4sqrt(2695)-4-1)/(4sqrt(1100)-2 - 2(sqrt(1100) - sqrt(1100)-1)). -14sqrt(5)/15 Simplify 4(-4-5((sqrt(176) - sqrt(176)-4) + sqrt(176)) + (6sqrt(176)/sqrt(4))/((sqrt(240)/sqrt(5))/sqrt(12)))2. 10392624 Simplify -5 + (sqrt(252) - (-2 + sqrt(252))2-3 - sqrt(252) - ((sqrt(252) + -2)2 + 0)) + -4 + sqrt(252) + 0 + 2 + 2. -42sqrt(7) + 507 Simplify ((sqrt(1215) - -2sqrt(1215))/(sqrt(720) + 1sqrt(720)) + -5 + sqrt(4800) + 2)*2. -987sqrt(3)/4 + 325299/64 Simplify (-4(-5 + (sqrt(475)1 + -5 - (2 + sqrt(475) + -3))))*2 + 2. 1298 Simplify (sqrt(204)/(-2sqrt(294))5)/((sqrt(256)2)/(sqrt(18)5)). -75sqrt(17)/224 Simplify (-4 + ((sqrt(833) + (sqrt(833) - (1 + sqrt(833) + -1)))6 + (sqrt(833) + -1)2 + ((sqrt(833) - (sqrt(833) + -1)) + sqrt(833))-4)-1)*2. -112sqrt(17) + 13332 Simplify 3(1(sqrt(130) - (sqrt(130) - sqrt(130)-1) - sqrt(130)) + 2sqrt(130)-4)/((sqrt(80)2)/sqrt(8) + (1sqrt(60))/sqrt(6)) + 5. -10sqrt(13) + 5 Simplify -2 + 3(sqrt(245) + 1)3 + 1 + sqrt(245) + 4(-1sqrt(245))*2 + -5. 70sqrt(5) + 983 Simplify -3 + ((4(sqrt(1300) - -3sqrt(1300)))2 + 0 - (-1 + (sqrt(1300) - (sqrt(1300) - (3 + -2 + sqrt(1300) + sqrt(1300)))2)))5. 50sqrt(13) + 1670507 Simplify (4sqrt(30)/sqrt(10) - (2 + sqrt(6)/sqrt(2))) + -4sqrt(27) + sqrt(30)/sqrt(10) + -1. -8sqrt(3) - 3 Simplify -5(1((0 + sqrt(1216) + 5)1 + -2))*2. -6125 - 240sqrt(19) Simplify 6(-1sqrt(320) + sqrt(40)/(-1sqrt(2)))/(((sqrt(110) - (sqrt(110) - sqrt(110)1)) + sqrt(110))/sqrt(11)1). -15sqrt(2) Simplify (((2sqrt(85)-3 + sqrt(85))-35)/((sqrt(50)/sqrt(45))/(sqrt(2)11)))*2. 860625 Simplify 3 + (1(sqrt(8) - sqrt(40)/sqrt(5)))/sqrt(4) + -1 - -5((sqrt(16)/sqrt(2) + sqrt(8))/sqrt(4) - (1sqrt(12))/sqrt(6))1. 2 + 5sqrt(2) Simplify (4 + ((sqrt(300)-3 - (sqrt(243) - (sqrt(243) + -5sqrt(243))))-1)2)3. 50637 Simplify 3 + sqrt(48) + sqrt(48) + (sqrt(48) - (sqrt(768))*2) + 2 - (2 + ((0 + -2sqrt(3))-2)2). -813 + 12sqrt(3) Simplify (-1(sqrt(704) + -2 + -4) + 2 + sqrt(704) + 1 + sqrt(704) + 0)2-2. -1570 - 288sqrt(11) Simplify (((2 + sqrt(637) - sqrt(637) - sqrt(637))-4 - (sqrt(637) - (0 + sqrt(637)-3))) + -3 + -6-5(1 + sqrt(637)) + 5)2. 10080sqrt(13) + 573876 Simplify (5 + 2(-4(sqrt(448) - ((sqrt(448)-2 - sqrt(448) - sqrt(448)) + sqrt(448)))-6 + 0))*2. 15360sqrt(7) + 16515097 Simplify -5 + (sqrt(1573) + 5 + sqrt(1573)2)-3 + 1 + 5sqrt(1872)-2. -219sqrt(13) - 19 Simplify 1 + 3 + (sqrt(16) - (-1sqrt(128) + sqrt(128) - sqrt(128))/sqrt(8))/(sqrt(288)/sqrt(4) + sqrt(8)) + 2. sqrt(2)/2 + 6 Simplify ((-2(0 + sqrt(125)) - sqrt(125)) + 0 - 3((0 + sqrt(125))*2 - sqrt(125))1)-51. 1875 Simplify (5 + sqrt(800)-1)2 + ((sqrt(72)-1)/sqrt(12))/((sqrt(81)/sqrt(3))/sqrt(9) + sqrt(3)). -401sqrt(2)/2 + 825 Simplify -65(3 + ((2sqrt(1944))/sqrt(8) - -1(2 + sqrt(300))))2. -71310 - 8400sqrt(3) Simplify (6(sqrt(98) - sqrt(98)-2)6 + 1)2 + (4 + sqrt(98) + 2 - 1sqrt(98)-2)2. 1764sqrt(2) + 1143991 Simplify (415sqrt(132)-1)/(sqrt(108) + sqrt(108)4 - sqrt(1200)-5). -4sqrt(11)/13 Simplify 4(4(-4 + (2(sqrt(192) + (sqrt(192) + -1 - sqrt(192))) + (1sqrt(192) + sqrt(192))3)*2) + -3). -4096sqrt(3) + 196596 Simplify (sqrt(190) + 1sqrt(190)-5 + (sqrt(190) + 1sqrt(190))-4)/((sqrt(490) + sqrt(490)-2)-3)-5. 20sqrt(19)/7
Suppose -3 = -5j + 2m + 17, 29 = 2j - 5m. Let f(d) = -d*3 + 3d*2 - 2. Let g be f(j). Suppose -18 - 4 = -gn. Is n a multiple of 6? False Let r = 127 - 124. Is -1 + (102 - 5) - (-3)/r a multiple of 7? False Let w(z) = 2z + 11. Let o be w(19). Suppose oa + 552 = 53a. Is 6 a factor of a? True Suppose 0k = -5b - 3k + 290, -2k + 65 = b. Let p = 85 - b. Let q = -1 + p. Is q a multiple of 10? False Let v = -27 - -32. Suppose -g + 186 = vg. Is 3 a factor of g? False Let s = 500 - -434. Is 18 a factor of s? False Let y be 126/(-27)(-9)/6. Suppose -yo + 4o + 753 = 0. Does 30 divide o? False Suppose 2c + 2c + 64 = -4n, c = 5n - 40. Let u be 2/c4-620. Suppose 6b = 76 + u. Is b a multiple of 18? True Suppose -12j = -6478 + 250. Is 23 a factor of j? False Let v(j) = 36j + 11j2 - 9j - 5 - 22j. Is 18 a factor of v(-3)? False Let n be 5 + 48/(-9) + 2/6. Suppose nj = -j + 175. Is 35 a factor of j? True Let l(n) = 8n - 28 + 3n - 16n. Is l(-16) a multiple of 26? True Let m be 3 + 0 + 0/(-3). Suppose 0 = mx - 21 - 15. Is x a multiple of 6? True Is 19 a factor of (-19)/((-5)/(168 + -3))? True Suppose 0 = -93j + 42702 + 15981. Is 120 a factor of j? False Suppose 3a - 3 = k + 1, -5a + 35 = 4k. Suppose -5h - 21 = 4v - 215, kv - 5 = 0. Suppose -17 = -5g + h. Is 2 a factor of g? False Suppose 3r = 7r - 544. Suppose -3j - r = -1. Let y = -23 - j. Is 11 a factor of y? True Suppose 3i = 27 + 3. Suppose -t - m - i = -4t, 4 = 2m. Suppose -2d = 3d - 4w - 450, -td + 360 = -4w. Is 18 a factor of d? True Let s = -1618 + 3620. Is 91 a factor of s? True Let v = -13 + 20. Let g(p) = 6p + 16. Does 31 divide g(v)? False Let f = -2 + 0. Suppose 110j - 112 = 103j. Let k = j + f. Is 8 a factor of k? False Let h be -123/(0 + 3). Suppose 9t - 11t = -44. Let v = h + t. Is 10 a factor of v? True Let c = -57 - 18. Let t = c - -53. Is 10 a factor of 392/22 + (-4)/t? False Let q be (14/(-5))/((-3)/90). Suppose 4x = 2h + 172, x + 5h + 3 = 24. Let n = q - x. Is n a multiple of 21? False Suppose 0 = 7o - 8848 - 1470. Is o a multiple of 24? False Suppose -2g + c = 1 + 2, 4g - c = -7. Is 3 a factor of g/618/(1 - 2)? True Let j(w) = -62w - 18. Let n be j(-5). Suppose -2p = -4v - 124, -8v + 7v = -5p + n. Does 11 divide p? False Suppose 6o - 9 = -21. Is 12 a factor of ((-52)/o)/2 - 1? True Let d = -268 - -262. Let a(m) = m2 + 2m - 9. Let u(r) = -3r2 - 6r + 26. Let f(z) = 7a(z) + 2u(z). Does 7 divide f(d)? False Let y = -402 + 731. Let x = y - 191. Does 46 divide x? True Does 22 divide (3 - 7) + (-2016)/(-9)? True Is 289 + 24 - ((-12)/3 + 2) a multiple of 2? False Suppose -2q = -4q + 84. Let z = 74 - q. Is 4 a factor of z? True Let f(s) = -s*3 - 22s*2 - 27s - 14. Let o = -61 + 40. Is f(o) a multiple of 7? True Is 135/(-54) - (-3)/(6/725) a multiple of 18? True Suppose -5j + 5w - 2709 = -15299, -w = 4j - 10097. Is j a multiple of 28? False Let q be (-66)/(-2)(-15)/9. Suppose 2g + 112 = 2s - 54, -s = -5g - 99. Let v = s + q. Does 12 divide v? True Let r be ((-2)/1 - -31) + 0. Suppose 3y - r - 109 = 0. Suppose 3a + 4b - y = 0, -a + 5a + 5b = 61. Does 7 divide a? True Let g(v) = v + 50. Let y be g(0). Let i = y - 22. Is i a multiple of 7? True Is 41 a factor of (225/27 - 10) + (-4353)/(-9)? False Let r be 2428/12-1. Let l = r - -69. Is 2 a factor of l? False Let a(l) = 4l + 7. Let s(t) = -t3 + 50 - 52 - 8t*2 + 3t*2 - 2t. Let n be s(-5). Is 8 a factor of a(n)? False Let a be (-2886)/(-36) + (-1)/6. Suppose -4i - a = -4b, -b + 5b - 81 = 3i. Does 3 divide b? True Suppose 0 = 3q + 2c - 327, -4q + 196 = -c - 251. Suppose i = 49 + q. Suppose 11h - i = 6h. Is h a multiple of 12? False Let q(i) = 4i - 7. Let w be q(3). Suppose -d + 0g = g - 24, 0 = wd + 4g - 116. Is 10 a factor of d? True Does 11 divide (4 + (-438)/4)-2? False Let c = 817 + -419. Does 7 divide c? False Is 1/3 + (-65569)/(-87) a multiple of 58? True Let o(i) = i*3 - 4i*2 - 5i - 2. Let g be o(6). Suppose -v + 3z = -47, 0 = 5v + 5z + 34 - 169. Suppose -v - g = -l. Does 18 divide l? True Let q(v) = -v3 + 6v*2 + v + 5. Suppose 5g - 23 = 7. Let r be q(g). Let k = 16 - r. Is 2 a factor of k? False Suppose 51 = 4d - 521. Let a = d + -103. Is 23 a factor of a? False Suppose -5t = -3i - 8 - 9, -3i + 3 = 0. Suppose 0 = m + 5q - 17, -tq = -3m - 4 - 2. Does 20 divide 115 + -1 + 4/m? False Suppose 4l - 2t + 5 = 11, -5l - t = 3. Suppose 3j + 2 = -y + 4, -j + 2y + 10 = l. Let k(b) = 22b - 3. Is k(j) a multiple of 8? False Let b(k) = -24k + 383. Is b(-18) a multiple of 12? False Suppose -2d = 3d - 5z, -5d + 3z = -4. Let s be (-3)/6(2 + d). Is 17s(-2)/4 a multiple of 5? False Let k(q) = q + 94. Let x be k(-22). Suppose 4i - 20 = -0i. Suppose -ia + x = -a. Is a a multiple of 4? False Let r = -199 - -274. Does 31 divide r? False Let c(v) = -4v*3 + 57v*2 - 97v - 45. Let z(a) = -a*3 + 19a*2 - 32a - 15. Let j(d) = -2c(d) + 7z(d). Is 14 a factor of j(-20)? False Let j(w) = -w2 + w - 1. Let h(t) = -t2 - 5t - 5. Let m be h(-4). Let v(i) = -2i*2 - 12i + 14. Let d(z) = mj(z) + v(z). Is 27 a factor of d(-12)? True Let o = -1335 - -2675. Does 13 divide o? False Let z = -14 + 18. Let j be (-2)/(2/(-12)-4). Is 25 a factor of 2/z(j + 53)? True Suppose -244 = -4d - 4. Suppose -3p = 4f - 35, 2f = -2f + 4p. Suppose 0 = -fj + 2j + d. Is j a multiple of 20? True Let u = 12 - 3. Suppose ul - 169 = 200. Is l a multiple of 14? False Suppose 0 = -2l, -3n + 6 = l + 4l. Suppose -4b = -ng - 15 - 95, -5g = -3b + 65. Is 18 a factor of b? False Let b(w) = w2 + 9. Let d be b(0). Let u be 890/45 + 2/d. Suppose q + q = u. Is q a multiple of 10? True Suppose -4i = -6c + 1966, 0 = -4c + 28i - 25i + 1311. Does 29 divide c? False Let b be (1 - 1) + -7 + 15/3. Let j(s) = -10s - 6. Does 7 divide j(b)? True Let b be (1 + -160)/(12/(-8)). Is 5/(10/b) + -1 a multiple of 13? True Let s be ((-42)/6 - -5)(-1)/2. Let k = 61 - s. Does 30 divide k? True Suppose f + 1 = 5i, 2f - 4f + i = 2. Suppose -3y + 6y = -12. Does 3 divide f/2 + (-14)/y? True Let x = -1285 - -1803. Is x a multiple of 14? True Let t be (2/4)/((-7)/(-14)). Let f = -2 + t. Let l(v) = -8v + 1. Is 7 a factor of l(f)? False Let d be (24/(3/(-1)))/(-2). Suppose 5c - 2y = -dy + 30, -5y = 4c - 24. Is 10 a factor of ((-15)/c)/((-1)/4)? True Suppose 0 = 2t - 2, 2r = 3r + t - 4. Let o(s) = -5s + 2 + 3s + 3s + 6s*2. Is 17 a factor of o(r)? False Let x = 17 - -28. Let w = -21 + x. Is w a multiple of 14? False Let j = 94 + -57. Does 13 divide j? False Suppose -4m = 3t - 2m - 14, 2m = 4t - 14. Let b be 4 - t - -1 - -2. Suppose -3y + 4l + 116 = y, -by + 77 = -l. Does 4 divide y? True Does 7 divide (-56)/(-10)(1 + 66/4)? True Suppose -7u + 1014 = 657. Is u a multiple of 2? False Suppose -2l = -3l - 1, 0 = -5k - l + 5599. Does 33 divide k? False Let a(w) = -w*3 - 3w - 9 - 7w + 14w - 6w2. Is a(-7) a multiple of 6? True Suppose 4y = 6y + 58. Let p = y - -29. Suppose 5g - 215 - 325 = p. Does 36 divide g? True Let d(h) = -2h2 - 39h - 18. Let r be d(-19). Is (r + (-70)/(-6))/(10/195) a multiple of 19? True Let t(x) = 13x3 + 8x*2 + 9x - 4. Let r be t(-3). Is (2 - r) + 1-5 a multiple of 12? False Suppose -5x + 3515 = 4s, -22s + 3x = -20s - 1785. Is 16 a factor of s? False Suppose 14896 = 27r - 4382. Does 42 divide r? True Suppose 0 = -3u + 15, 100 = -8m + 3m + 5u. Let v(t) = -t3 - 15t*2 - 16t - 3. Let c be v(-14). Let b = c + m. Is 4 a factor of b? False Let d = -2350 + 3832. Suppose 4w - d = -9w. Is w a multiple of 17? False Let b be ((-12)/(-15))/(20/(-50)). Let z be (-1)/2 - 1/2. Does 9 divide (-3 + -6)/(b - z)? True Suppose 3a - 5k = 6458, k - 9577 + 951 = -4a. Does 14 divide a? True Is ((-5)/3)/(6 - 26043/4338) a multiple of 12? False Let c(p) = p2 + 12p + 28. Let b be c(-8). Let i(h) = 15h2 - 9h - 16. Is 52 a factor of i(b)? True Suppose -9 + 18 = 3i. Suppose 3g + 4k - 118 = 0, -3g = -0g - ik - 111. Is g a multiple of 14? False Suppose 0 = -7r + 311 - 143. Does 9 divide r? False Let v(o) = 16o*2 - 9o - 29. Is v(-5) a multiple of 13? True Suppose 3j + 2i - 105 = 3i, 2j - 80 = 4i. Is j even? True Suppose 2y + 50 = 530. Is 15 a factor of y? True Let v = 53 + -45. Let s(j) = 5j2 - 9j + 2j - 4j**2 + 10. Does 11 divide s(v)? False Let r = -35 + 51. Let s = 12 - r. Let y = s + 20. Does 12 divide y? False
Let b(n) = 8n - 43. What is the remainder when b(7) is divided by 8? 5 Let q(y) = -5y + 38. Let u = 2 + -1. Calculate the remainder when q(7) is divided by u. 0 Let r(n) = -n*3 + 6n*2 + 10n - 10. Calculate the remainder when 19 is divided by r(7). 8 Let x(w) = -36w + 3. Let r be x(-4). What is the remainder when (-1 + 3)/(6/r) is divided by 13? 10 Suppose 0 = -26l + 442 + 52. Suppose 2i - 7i = -3g - 295, -5g - 81 = -i. Calculate the remainder when i is divided by l. 18 Suppose 2l = l - 5, -5v + 3l = -45. Suppose 0 = g - vg + 65. What is the remainder when g is divided by 8? 5 Suppose -79 = 5j - 239. Let g = j + -18. What is the remainder when g is divided by 4? 2 Let r(b) = b3 + 6b*2 + 3. Let v be r(-6). Suppose -vz = z - 84. Suppose -3l + 6l = z. What is the remainder when l is divided by 3? 1 Let q = 153 + -62. What is the remainder when q is divided by 46? 45 Suppose 9 = 3w - 0w, 0 = q + w - 32. Calculate the remainder when q is divided by 15/((-6)/(-18)3). 14 Let g = 7 - 5. Let o be 20 + (-3)/6g. Let h = o + -11. What is the remainder when h is divided by 5? 3 Let w(g) = 25g2 - 1. Suppose 2i + 3 = -v, 0v = 4v - 3i + 1. What is the remainder when w(v) is divided by 13? 11 Suppose -z = z. Let f = z + 20. Suppose -y - f = -2y. Calculate the remainder when y is divided by 7. 6 Let o(g) = -6g + 3. Calculate the remainder when 105 is divided by o(-4). 24 Suppose -5p + 10 = -0p. Let g(k) = 0k + k - pk + 16. What is the remainder when 22 is divided by g(8)? 6 Let y(p) = -p3 + 10p*2 + 5p - 11. Calculate the remainder when y(10) is divided by 124/9 - (-2)/9. 11 Suppose i = -2i + 21. Suppose 5p = -0m - 3m + 17, m + 3p - i = 0. Calculate the remainder when (4/(-5))/(6/(-45)) is divided by m. 2 Let v(p) = -5 - 2p + 4 - 7. Let s = 8 + 2. Calculate the remainder when s is divided by v(-6). 2 Suppose -3h - 3t - 6 = 27, 5h - 2t = -34. Let f(c) = -6c - 4. What is the remainder when f(h) is divided by 15? 14 Let i(y) = -4y. Let x be i(-1). Let m = x - 2. Suppose -5c + h + 20 = 0, 0 = -2c - mh + 3h + 8. What is the remainder when 6 is divided by c? 2 Suppose -3g - g = -5n + 328, -2g + 6 = 0. Suppose -5p - n = -8. Let u = p + 21. What is the remainder when u is divided by 5? 4 Let u be ((-3)/5)/((-2)/10). Suppose -ut + 35 = 2t - g, 37 = 2t - 5g. What is the remainder when 17 is divided by t? 5 Let z = 60 + -39. Suppose l - 6 - 2 = 0. Calculate the remainder when z is divided by l. 5 Let v be (8 - 0/4) + -2. Calculate the remainder when 375/v + 3/(-6) is divided by 21. 20 Suppose -2t + 2n = -80, -2t + 31 + 50 = -n. What is the remainder when t is divided by 21? 20 Let q(h) = h2 + h - 3. Let k be q(3). Suppose k - 156 = -3g. Calculate the remainder when g is divided by 13. 10 Let p(n) = n*3 - 3n*2 - 2n - 1. Calculate the remainder when p(4) is divided by 3. 1 Let d = -9 - -5. Let j be d2/(-8)2. Suppose -jt + 0t = -12. What is the remainder when 10 is divided by t? 4 Suppose -4d = 2i - 16 - 128, 5d + 5i - 175 = 0. What is the remainder when d is divided by 14? 9 Let y = 10 + -5. Suppose 0 = -yu - 15, 4a - 4u - 92 = -a. What is the remainder when 30 is divided by a? 14 What is the remainder when (31 + -14)2/2 is divided by 9? 8 Suppose 2g = -0g + 10. Suppose 0 = v + 9v - 80. What is the remainder when v is divided by g? 3 Let s = 7 - -12. Calculate the remainder when 73 is divided by s. 16 Let o(q) = q3 - q2 + q. Let i be o(0). Suppose i = 3m - 2m - 63. Let u = -44 + m. What is the remainder when 36 is divided by u? 17 Let f(y) = -y3 - 5y*2 - 2y - 4. Calculate the remainder when 15 is divided by f(-5). 3 Suppose -3b + 4c = 1, -4b + c + 32 = 4c. Suppose -24 = -bm + m. Suppose -5r = 2y - 11 - 29, 16 = 2y - r. Calculate the remainder when y is divided by m. 4 Let t(c) = 2c3 - 12c*2 + 2c. Let a(o) = o*2 + o - 1. Let q(n) = 5a(n) + t(n). Calculate the remainder when q(4) is divided by 10. 9 Let m(j) = -j3 - j2 - 5j - 2. Let w = -5 - -2. Let u = -3 - -14. Calculate the remainder when m(w) is divided by u. 9 Let x be -10 - (-2)/(-2) - -1. Let o be 24/5 + (-2)/x. Suppose 4g = 3q - 101, -og + 25 = q - 2g. Calculate the remainder when q is divided by 16. 15 Let d = 83 + -59. Suppose -2b - 3s + s + 34 = 0, 0 = 4s - 8. Let k = d - b. Calculate the remainder when 25 is divided by k. 7 Let d = -2 - -19. Calculate the remainder when 48 is divided by d. 14 Suppose 5i + 53 - 138 = 0. Calculate the remainder when 66 is divided by i. 15 Let b = -8 + 12. Let x(m) = -5m + 2. Calculate the remainder when x(-1) is divided by b. 3 Suppose s = 2g - 3s - 16, -2g = 4s - 24. What is the remainder when 26 is divided by g? 6 Let l(u) be the first derivative of -u*4/4 - 4u*3/3 + 5u*2/2 - 7u + 3. What is the remainder when l(-6) is divided by 12? 11 Let y(o) = 4o2 + 4o + 8. What is the remainder when y(-4) is divided by 19? 18 Let o = -47 + 60. Calculate the remainder when (-1)/(-2)148/2 is divided by o. 11 Let k(f) = f3 - 3f*2 + f + 4. Calculate the remainder when k(4) is divided by 15. 9 What is the remainder when 70 is divided by (-111)/(-6) - (-3)/(-12)-2? 13 Let p(f) = -f*3 - 9f*2 + 10f + 10. Let q be 1/3 + (-186)/18. What is the remainder when 38 is divided by p(q)? 8 Let f(u) = -u + 29. What is the remainder when 40 is divided by f(7)? 18 Let g = 38 - 22. Let f = 25 - g. Calculate the remainder when 16 is divided by f. 7 Let z be -2 + 3 + (2 - 2). Calculate the remainder when 23 is divided by 16z(-3)/(-6). 7 Calculate the remainder when (128/40)/((-2)/(-50)) is divided by 28. 24 Let f = 127 - 101. Calculate the remainder when 126 is divided by f. 22 Suppose 2a - 5a + 33 = 0. Calculate the remainder when 13 - a - (0 - 0) is divided by 2. 0 Let u = -25 - -70. Calculate the remainder when 56 is divided by (-2)/(-3)u/2. 11 Let x = -54 + 63. What is the remainder when 23 is divided by x? 5 Let o = -26 + 95. Calculate the remainder when o is divided by 24. 21 Let q(m) = -m2 - 8m + 4. Let h = -21 - -34. Calculate the remainder when h is divided by q(-8). 1 Let c(g) = g*2 - 5g - 4. What is the remainder when c(-3) is divided by 3? 2 Suppose 0d + 5d = -20, 0 = 5r - 4d - 116. What is the remainder when 77 is divided by r? 17 Let i be -3 + ((-9)/(-3))/(-3). Let x = i + 6. What is the remainder when x is divided by 1? 0 What is the remainder when (-1328)/(-44) + (-8)/44 is divided by 8? 6 Suppose 0 = n + 5f + 16, 4f = -2n - 0f - 14. Calculate the remainder when 51 is divided by n(-10 + -3)1. 12 Let n = 75 + 1. Calculate the remainder when n is divided by 26. 24 Suppose -6u = -3u. Suppose -2c + uc + 34 = 0. Calculate the remainder when 65 is divided by c. 14 Suppose -5h - 3n + 40 = 0, 10 = 3h + 2n - 14. Suppose -hc + 39 = -3c + b, -5b + 20 = 0. What is the remainder when 20 is divided by c? 6 Suppose 0d + 5d - 30 = 0. Calculate the remainder when 32 is divided by 30/2068/d. 15 Suppose q = -4q + 75. Suppose f + 33 = -35. Let s = f + 112. Calculate the remainder when s is divided by q. 14 What is the remainder when 23 is divided by (21/35)/(1/15)? 5 Let n(w) = w2 + w - 8. Calculate the remainder when n(8) is divided by 17. 13 Let b = 31 + -21. What is the remainder when 17 is divided by b? 7 Let t(o) = 2o2 - o - 1. Calculate the remainder when t(3) is divided by 6. 2 Let x(j) = -j3 + 16j2 + 4. Let y = -3 + 14. What is the remainder when y is divided by x(16)? 3 Let w be 6/15 - 93/(-5). Suppose 3t + 5m = 16, 3t - 3m = 29 + w. Let b = t - 6. Calculate the remainder when 11 is divided by b. 5 Suppose 5f + 114 = 2k, 0 = 4k - 0k + 3f - 280. Calculate the remainder when k is divided by 14. 11 Suppose -20 = -20t + 18t. Calculate the remainder when 36 is divided by t. 6 Let t = 7 + -10. Calculate the remainder when 32 is divided by (-6 - t)(-33)/9. 10 Let b(a) = a2 - 2a + 1. Calculate the remainder when 35 is divided by b(-2). 8 Suppose 6u = 2u - 72. Let i = u - -40. Calculate the remainder when i is divided by 12. 10 Suppose -3t + 7 + 2 = 0. What is the remainder when t is divided by 3? 0 Let h = 21 + -16. What is the remainder when 13 is divided by h? 3 Let g be -1 - -5 - 21/7. Let i be g/2(-1 + 9). Suppose -5y - t + 23 = 0, 5y + 6t - it - 21 = 0. Calculate the remainder when 13 is divided by y. 3 Suppose -5d + 59 - 7 = -w, 4d + w - 47 = 0. Calculate the remainder when 52 is divided by d. 8
Let c(f) = -f*2 + 18f + 2. Let j be c(18). Let m(y) = yj + y3 + 12y2 + y2 - 13y + y*2 + 18 - 2y*2. What is m(-14)? 4 Suppose -4t - 2t = -72. Suppose 0 = -17f + tf - 15. Let d(y) = 2y - 6y2 + y2 + 8y*2 - 2 + 1. Give d(f). 20 Let t(z) = 2z3 + z2 - z - 1. Let w(i) = -3i3 - 18i*2 + 4i - 18. Let g(q) = -2t(q) - w(q). Give g(16). -12 Let i(y) = -y2 - 12y - 43. Suppose 13z = 842 - 946. Determine i(z). -11 Let c(k) be the second derivative of 4k*3/3 - 50k*2 - 192k - 1. Calculate c(12). -4 Let l(c) = c*3 - 3c*2 + 3. Suppose -99g - 28 = -101g. Suppose s - h = 6 - 2, s + 4h + 6 = 0. Suppose 0r + sr - 9 = -3f, 5r - f = g. Calculate l(r). 3 Let v(y) = y*3 - 8y*2 + 10. Suppose 4536 = -30u + 16356. Let b = 402 - u. What is v(b)? 10 Let d(u) be the third derivative of -u*4/8 - 38u*3/3 + 7u2 + 6. What is d(-23)? -7 Let h(u) be the second derivative of -u4 - 2u3/3 + 10u*2 + 9u + 3. Let y(n) = -n*2 - n + 3. Let m(z) = h(z) - 6y(z). Give m(2). -18 Let h = 216 - 219. Let n(l) = -2l2 - 4l - 14. Determine n(h). -20 Suppose a + 3 = -a - m, 5m - 9 = 2a. Suppose -108n + 102n + 12 = 0. Let t(h) = -177 - h3 + 179 - h2 + nh2 + 2h. Calculate t(a). 10 Let l = -81 - -41. Let v = l + 43. Let f be (5/(-10))/(v/6). Let n(u) = 5u2 - u. Calculate n(f). 6 Let p(x) = x2 + 8x - 5. Let s(c) = -188c + 1. Let f be s(1). Let w = 179 + f. Determine p(w). -5 Let b(a) = -a3 - 17a*2 - 13a + 47. Let y be b(-16). Let w(h) be the first derivative of -13h2/2 - h - 6. Determine w(y). 12 Let r(g) = -6g - 3. Let z(c) = c*3 - 5c*2 + 9c - 13. Let b be z(4). Suppose 72 = -a - ba. Let k(x) = x3 + 9x2 - 2. Let t be k(a). What is r(t)? 9 Let p = -53 + 48. Let x(l) = -l2 - 7l + 3. Let m(w) = w2 + 7w - 2. Let d(y) = -3m(y) - 2x(y). Determine d(p). 10 Let o(h) be the third derivative of h5/60 + h4/24 - h*3/2 + 295h*2. Let b = -460 - -462. Give o(b). 3 Let q = 1079057 + -1079059. Let f = -2 - -4. Let w(o) = 0o + o*f + 3 + 3o + o - o*3. Give w(q). 7 Suppose -2c - 3d + 118 = -39, 3c - 238 = -4d. Suppose -5y + c = -104. Let a(q) = 1 + yq2 - 47q2 - q + 0. What is a(1)? -9 Let z(p) = p3 - 25p2 - 30p + 91. Let t be ((-22)/(-44))/(-2 + (-315)/(-156)). Let g be z(t). Let m(a) = a*3 + 12a*2 - 12a. Determine m(g). -13 Let r(c) = -2c - 1. Let t(l) = 1. Let u(o) = 3o + 6. Let x(d) = 4t(d) + u(d). Let f be x(-11). Let m = f + 21. What is r(m)? 3 Let x(n) = -8n + 61. Let q(o) = 7o - 75. Let s(u) = -3q(u) - 4x(u). What is s(0)? -19 Let s(m) = -m3 + 8m*2 - 7m + 9. Let r = -429 - -450. Suppose -2z + 5v + 39 = 0, -rz = -26z - 5v + 10. Determine s(z). 9 Suppose -102 = 11m - 8m. Let o = -24 - m. Suppose -ok = -7k + 6. Let b(a) = 4a*2 + 2a + 3. Calculate b(k). 15 Let r be 4(2 + 0 + 0). Let p = -328 - -330. Let b(x) = 21x*2 - 3x - x*3 + 3x*2 - 17x*p - 1 + 11x. Determine b(r). -1 Let r be (1/2 + (-578)/204)/((-6)/(-18)). Let q(m) = -m*2 + 53. Give q(r). 4 Let d(x) = -12x*2 + 1. Suppose 3q + 75 - 224 = 2g, g + q + 72 = 0. Let r = g + 78. Suppose -3f + ry + 2 = 30, -2f - 3y + 13 = 0. Calculate d(f). -11 Let k(i) = i - 6. Suppose -461x + 42 = -440x. Give k(x). -4 Let p(c) be the third derivative of c9/60480 - c7/1680 - c6/360 + 31c5/20 - c2 + 9. Let o(z) be the third derivative of p(z). Calculate o(3). 16 Let a(v) be the third derivative of v6/120 - v5/60 + v*4/24 + 14v*3/3 + 1395v*2. Give a(0). 28 Let f(p) = -33 + 4p*2 + 5p*2 - 3 + 13p*2 - 21p2. Give f(-6). 0 Let v(r) = -r3 - 5r2 + 8r + 12. Let x = -213 - -191. Let p be (-320)/55 - (-4)/x. Give v(p). 0 Let f be ((-4 - -10) + -13)-1. Let b(l) = 0l2 + 0 + 4 + l2 - fl. Calculate b(5). -6 Let o(f) = -4f + 102. Let p be o(25). Suppose 3n = pt + 1, 0 = -0n - 3n - 9. Let v(x) = x*2 + 4x + 6. Give v(t). 11 Let p(k) = k*2 - 6k - 10. Suppose 5t - 9 = -4j, 214t = 218t + 12. Calculate p(j). -10 Let j(t) = -t*3 + 2t*2 - 10t + 13. Let x be j(4). Let g = 60 + x. Let i(y) = 12y2 - 1. Give i(g). 11 Let x(t) be the first derivative of -t4/4 + t3/3 - 3t*2/2 + 11t + 1442. Give x(0). 11 Let i(z) = -z*2 + 2z. Suppose -16h - 4 + 68 = 0. Suppose -hx = -22x + 108. Give i(x). -24 Let h(n) = 1510n*2 + 7n + 1509n2 - 3 - 3020n*2. Determine h(5). 7 Let b = 4 + -15. Let z = 18 + b. Let u(m) = 45 + 54 + 52 - 2m - 145. Calculate u(z). -8 Let u(h) = -18h + 12h + 4h + h2. Let v be (-3)/2-78/14. Determine u(v). 24 Let y(a) = -7a*2 - 35a - 3. Let c(o) = 4o2 + 22o + 2. Let r(k) = 8c(k) + 5y(k). Calculate r(-4). -51 Suppose -3s = 28 - 37. Suppose sa - a = 4. Suppose -4c + 2 = -3f + 1, af = -4c + 26. Let j(d) = -2d + 6. Calculate j(c). -2 Let v(q) be the first derivative of q5/60 - q4/4 - 11q3/6 - q2 + 19q - 14. Let u(j) be the second derivative of v(j). Give u(7). -4 Let b(i) = 9 + 31i*2 - 16i*2 + 11i + 2 + 3. Let m(y) = 4y - 3y*2 + 5 + 3y*2 + 5y*2. Let v(d) = -4b(d) + 11m(d). Determine v(-1). -6 Let d(f) = -f2 + f - 1. Suppose -15c + 69552 = 33c. Suppose -8y + c - 1409 = 0. Give d(y). -21 Let j(p) = -9728p3 + 4868p*3 + 7p*2 + 4861p*3 + 7p + 2. Let o be 21/(-2)6. Determine j(o). -4 Let s(f) = -20f2 - 480f + 96. Let x(n) = -4n2 - 92n + 19. Let v(q) = 2s(q) - 11x(q). Determine v(-13). -17 Let k(f) = -f*3 - 7f*2 + 12f + 8. Let n = 2326 + -2334. Calculate k(n). -24 Let s(o) = -o*2 + 3o - 1. Let w(l) = -l*2 - 9l - 14. Let x be w(-7). Suppose y = -y + 4a + 10, 2a + 2 = x. Let p be (0 - -2)5y/6. What is s(p)? -11 Let q(k) = 7k - 33. Let a(p) = -3p + 16. Let g(l) = 5a(l) + 2q(l). Let o be ((-66)/(-8) - 9)/(-31/32). Determine g(o). 6 Let n(j) = j + 3. Let y(f) = -f + 1. Let t be 24/(-56) + 8/(-14). Let i(h) = tn(h) - 2y(h). Give i(10). 5 Suppose 634 = 28r + 3574. Let z = r + 102. Let i(y) = -7y + 3. Give i(z). 24 Suppose -4g + 15g = 7g. Suppose -5k + 14 - 4 = g. Let u(d) be the second derivative of -d4/12 + d3/2 - d2 - d - 22. Give u(k). 0 Let g(m) = m2 - 4m - 24. Let o(j) = 10 - 76 - 29 - 17 + 10j. Let t be o(12). Determine g(t). 8 Let j(c) = -c2 - 6c - 4. Suppose 2a + 0 = -3q + 15, -4q = -3a - 3. Suppose -25 = 2z + 3u, 2z + 5 = qu - 2. Give j(z). -20 Let x(p) = p*2 + 8p. Suppose -4u = -3u - 4. Let q = 90 - 90. Suppose 3w - uw - 5 = q. Determine x(w). -15 Suppose 0 = -0p - 7p - 14. Let d be p - (-4(-6)/8 + -7). Let l(t) = 72 - 81 + 2t - dt + t. Calculate l(9). 0 Let c(w) be the first derivative of 29w*2/2 + 11w + 5907. Give c(-1). -18 Suppose 125d + 137d + 442d = 1408. Let j(a) = 2a*3 + 2a*2 + 2a - 1. What is j(d)? 27 Let n(c) = -2c2 - 20c - 45. Let p be 4250/(-221) - -12 - (-12)/52. Determine n(p). -3 Let z(u) = u*2 - 2u + 1. Let c(x) = 4x2 + x + 8. Let f(q) = -c(q) + 3z(q). Let y(m) = -3m - 27. Let o be y(-17). Let t = o + -28. Calculate f(t). 7 Let o(r) be the first derivative of 1/2r*2 + 3r + 13. Let w = 5 + -9. What is o(w)? -1 Suppose 4h + 8 = 4z, -3z + 0z + 5h + 6 = 0. Let w(s) = -33s*2 + 2 - 36s*2 + 68s*z. Let r be -3 + 1/(-1) - -2. Calculate w(r). -2 Let v(b) = 5b + 40b + 12b - 163 - 42 - 4b. Give v(4). 7 Let i = -322 + 325. Let o(k) = 2k*3 - 4k*2 - 2. Determine o(i). 16 Let i be ((-332)/249)/(8/(-18)). Let k(g) = 1 + 666g - 332g + ig*2 - 335g. Calculate k(2). 11 Suppose 21 = 3n + 3d, -4n - 5 + 3 = -2d. Let l(j) = -400j2 - 7 + 199j*2 + 206jn + j3. Let k be 5/(2(-2)/4). What is l(k)? -7 Let c(d) = -8d2 - d + 3. Let s(v) = v3 - 6v2 + 13v - 15. Let o(r) = -3c(r) + s(r). What is o(-17)? -7 Suppose 4f + 16 = -2w, w - 5 = 3f + 7. Suppose 3s - 4 = 2c - 24, -2s - 4c - 8 = w. Let a(n) = -n*3 - 7n*2 - 5n - 9. Determine a(s). -15 Let r(v) = 0v - 1 + 0v - 7v + 2v*2. Suppose 0 = 566i - 199i - 775 - 1060. Calculate r(i). 14 Let f(v) = -v3 + 5v*2 - 4v + 14. Let h be (-20)/(-6) - (480/(-72) - (-2 + -4)). Calculate f(h). 14 Let n(g) = 4g2 + 14g + 5. Let m(k) = -7k2 - 30k - 9. Let d(p) = p - 1. Let q(i) = -3d(i) - m(i). Let r(w) = -5n(w) + 3q(w). Give r(-8). -13 Let g(j) = -2 - 2j*3 + 6j*2 - 14j + j*3 + 15j. Let i(a) = -5a3 + 2a2 + a. Let f(h) = h2 - 5h + 5. Let q be f(2). Let p be i(q). Calculate g(p). 4 Let c(n) = -n - 16. Suppose -2q + 8 = -10. Suppose 2m - r = -16, -5r + 8 = -qm + 8m. What is c(m)? -8
Let p = -172 - -652. Is 15 a factor of p? True Let p(o) = o*2 + 7o - 10. Suppose -4v = 0, 4u + u = -3v + 20. Is p(u) a multiple of 9? False Suppose 0 = 8q - 3q - 3x - 4614, -5x + 3706 = 4q. Is 12 a factor of q? True Let n = -968 - -1526. Does 9 divide n? True Suppose -13 + 1 = -4x. Suppose xq - 406 = -2t, -3q + 3t = -t - 394. Is q a multiple of 33? False Let r(y) = -y3 - 6y2 + y - 1. Let l(o) = -o3 + o*2 + o - 1. Let w(q) = -2l(q) + r(q). Let j be w(6). Let c = 116 + j. Is c a multiple of 13? True Let y = 307 + -207. Let x = 105 + y. Is x a multiple of 20? False Let i be 3/1 - (-9 + 3)/(-6). Suppose -2y - y - 3g + 738 = 0, -iy + 492 = -2g. Is y a multiple of 41? True Let h = 78 + 410. Suppose 3x + 47 - h = 0. Does 34 divide x? False Suppose -189b + 163b = -30914. Does 74 divide b? False Let d(n) = -n2 + 2n - 1. Let q be d(3). Suppose -5 = m - 7. Is 6 a factor of 12 - q/(-2 - m)? False Let a(c) = -c*2 - 10c + 3. Suppose 2i - 16 = -5x, -5x + 0 + 10 = 0. Suppose -is + 57 = -5p - 0p, 5s = 5p + 65. Is a(p) a multiple of 2? True Does 5 divide ((-576)/27)/(6/(-9))? False Let r = 1055 + -639. Is r a multiple of 32? True Let t be (-18 - -18) + 0/2. Let g(y) = -3y2 - y + 140. Does 14 divide g(t)? True Let y(m) = -m2 - 8m + 9. Let q = 63 - 23. Suppose 10h - 5h + q = 0. Does 3 divide y(h)? True Let m = -25 - -27. Let a be 4/m - (13 - 15). Suppose 7g - 12 = ag. Does 4 divide g? True Let m(y) = -y*2 + 1. Let v(k) = -11k*2 + 7k - 2. Let w(t) = 6m(t) - v(t). Is w(4) a multiple of 15? True Suppose -4 = -2f - 6. Let g(r) = -55r3 - r2 + r + 2. Does 7 divide g(f)? False Let k(u) = -u2 + 6u + 7. Suppose -l = v - 9, 0v = -2l + 3v + 3. Let t be ((-18)/10)/(l/(-20)). Does 6 divide k(t)? False Suppose u + 5n = -22, 4n + 0 = -5u - 5. Suppose -2p = -up + 51. Does 17 divide p? True Let h = -29 - -40. Suppose ho = 9o. Suppose o = 2a - 28. Is 7 a factor of a? True Let h(s) = s2 + 2s - 10. Let j(f) = f*2 - 15f - 8. Let d be j(15). Let p be h(d). Let y = 63 - p. Is y a multiple of 13? False Suppose 12r = 4913 + 5131. Is 47 a factor of r? False Suppose 0 = d + 3, 4n = 2n + d + 9. Suppose nx - 64 = -19. Does 12 divide x? False Let s = 9 - 7. Suppose 9 = 2x + 3h - sh, 6 = 2x + 4h. Suppose 0 = -xa - 138 + 448. Is 31 a factor of a? True Let y(p) be the third derivative of p4/6 - p3/6 + 2p2. Suppose 2s - 3 = -s. Does 3 divide y(s)? True Let n(g) = 4g3 - 20g*2 + 13g - 17. Is 6 a factor of n(6)? False Suppose 0 = -5x + 4t - t + 2142, 0 = 4x + 4t - 1720. Does 11 divide x? True Let d(i) = -i2. Let p(l) = -l3 - 15l2 + 12l. Suppose 0 + 5 = -5b. Let o(c) = bp(c) + 6d(c). Is o(-10) a multiple of 16? False Let r be (860/(-7))/((-35)/245). Suppose -18q = -22q + r. Is q a multiple of 11? False Let q(j) = 15j*2 + 32j + 52. Is q(12) a multiple of 127? False Let a(i) = 30i + 186. Does 28 divide a(19)? True Let o(l) = 6l*3 + 4l*2 + 10l - 12. Let b be o(6). Suppose -6f + b = -3f. Suppose -k = 5a - 501, 0a + 5a = 4k + f. Is 20 a factor of a? True Let t = -36 - -34. Let a(l) = -3l3 - 4l*2 - l + 2. Is a(t) a multiple of 2? True Let o be ((-63)/14)/(6/8). Let d = 11 + o. Suppose 7 = -r - dh - 1, 5r - 23 = -4h. Does 7 divide r? True Suppose f - 2a - 12 + 2 = 0, 0 = 4f + 4a - 28. Let i = f + 8. Does 4 divide i? True Let r be (-102)/(-8) - (-2)/8. Suppose 2y - y + r = 0. Let s = 19 + y. Is s a multiple of 6? True Let k(z) = -z*3 - 3z*2 + 9z - 9. Let b be k(-7). Let v = -3 + b. Does 20 divide v? False Let o = 110 - 48. Let x = o - 28. Is 15 a factor of x? False Let d(g) = -g*3 + 2g*2 - 2g + 2. Let n be 156/60 + (-6)/10. Let w be d(n). Does 19 divide 1/((-111)/57 - w)? True Let m be -2 + 2 + 22 + -1. Suppose m - 46 = -5o. Suppose -69 = -z - 3s, 290 = 5z + os - 15. Is 15 a factor of z? False Let y(j) = 68j2 + 2j - 1. Is 10 a factor of y(1)? False Let c(d) = -3d + 20d - 6d + 59d - 10. Does 13 divide c(2)? True Let x = -1140 + 1921. Is x a multiple of 46? False Let w(p) be the second derivative of p*5/20 + 7p4/12 - p3/6 - 25p. Does 13 divide w(-6)? False Let l(g) = -27g + 4. Let s(z) = 80z - 13. Let m(q) = -7l(q) - 2s(q). Is m(2) a multiple of 14? True Let p = 56 + -55. Let m(u) = 19u - 3. Is 3 a factor of m(p)? False Let c(j) = 31j + 177. Is c(-3) a multiple of 14? True Suppose 5b - 487 = -3k + 224, -585 = -4b + 3k. Suppose -6r + b = -r - 4p, 0 = -2r - 3p + 53. Is 5 a factor of r? False Let c = 1 + -15. Let r be (-5 + 5 + -4)/(4/(-80)). Let w = c + r. Is w a multiple of 22? True Let v = 15 - 11. Let k(h) = -3h - v + 5h - 6 + 15h. Does 20 divide k(5)? False Let p = 3717 - 2596. Does 42 divide p? False Let y(x) = -89x + 7. Let d be y(-3). Let k = -194 + d. Does 20 divide k? True Let h(x) = 95x + 47. Let j be h(5). Suppose -9g + 18g - j = 0. Is 35 a factor of g? False Let n be 10(-6)/(-24)(-16)/(-10). Suppose 240 = 6w - nw. Is 7 a factor of w? False Suppose 2n + 11k - 336 = 7k, 0 = -4n + k + 672. Is n a multiple of 39? False Suppose z + 4 = 6. Suppose 0 = 2w, -3a = -za + 4w - 105. Suppose -4i - 196 = -4l, 48 + a = 3l + 3i. Is 10 a factor of l? True Let s(u) = -2 + 3 + 8u + 5 - 7u. Is s(-2) a multiple of 4? True Suppose c - 6c = 0. Let a be 4/(12/(-9)) - c. Does 24 divide (-7)/21 + (-145)/a? True Suppose -m = 3m + 24. Is (7/m)/(2/(-12)) a multiple of 2? False Let v be 3/12 + 323/4. Let g = 116 - v. Does 7 divide g? True Let j be -23/18-15. Suppose 908 = 3p + jq, 5p - 3q = q + 1464. Does 32 divide p? False Let d be ((-108)/(-10))/(33/110). Let o be 1/(-3) + (-24)/d. Is 7 a factor of 81/4 + o/4? False Let l(f) = 2f2 + 7f - 13. Suppose 4a + a + 25 = 4w, 0 = 2a + 2. Is 9 a factor of l(w)? True Let i(f) be the second derivative of -f8/6720 - f7/2520 + 11f5/40 - f4/2 + 6f. Let l(x) be the third derivative of i(x). Is 10 a factor of l(0)? False Suppose 11n - 5065 - 325 = 0. Is n a multiple of 12? False Let j = -287 - -578. Is 13 a factor of j? False Let f(j) be the third derivative of j*5/40 - 23j*4/24 + 3j*3/2 + 3j*2. Let w(t) be the first derivative of f(t). Is w(13) a multiple of 8? True Let i(z) = 3z*2 + 49z + 84. Is i(-18) a multiple of 4? False Let v(n) = -n*2 + 11n - 24. Let a be v(8). Suppose -4y + 77 + 327 = a. Is 10 a factor of y? False Let o = 45 + -41. Suppose -od = 6d - 180. Is 5 a factor of d? False Let m = -157 - -352. Suppose -m = -i - 46. Is i a multiple of 34? False Let n(r) = 5r*2 + 2r + 1. Let c = 9 + -10. Is 2 a factor of n(c)? True Let r(m) = -m*3 - 10m*2 - 9m + 8. Suppose -t + 3g = -2t - 11, 4t = -5g - 65. Let d = t - -11. Is r(d) a multiple of 2? True Suppose 5o + 5 = 0, -3j + 2 - 10 = -o. Let q(r) = -r*2 + 3r + 9. Let b be q(j). Does 8 divide (b + -1 + 2)/(-1)? True Does 4 divide (-1605)/(-20) - 9/36? True Let r = 74 - -418. Is 12 a factor of r? True Does 12 divide (-89 - 0)/((-57)/684)? True Suppose -18w + 212 = -130. Is 19 a factor of w? True Suppose -3w = 3b - 4 - 14, -4b + 21 = 3w. Suppose 3t - 378 = 5k - 1464, -bk = -2t - 652. Does 9 divide k? True Let r = -531 + 1064. Is r a multiple of 28? False Let u = 142 - -342. Is u a multiple of 20? False Let a(d) = d3 + 42d*2 - 234d + 65. Does 9 divide a(-47)? True Let l = -162 + -69. Let j = -135 - l. Is j a multiple of 12? True Suppose 2n = f + 7, 2f + 2n = f + 13. Suppose m - 12 = -fm. Suppose 357 = 5x + 2w + w, mw - 213 = -3x. Is x a multiple of 24? True Suppose -29r + 9072 = -2r. Is 84 a factor of r? True Suppose y - 4f = 15, -3y - 3f + 7f = -13. Is 7 a factor of ((-41)/(-2))/(y/(-2))? False Let l(d) = d*3 - 33d*2 + 47d - 81. Does 3 divide l(32)? True Suppose -83 = 12w - 1679. Does 19 divide w? True Let o = -45 + 48. Is 16 a factor of (1 + (-4)/o)/(1/(-81))? False Suppose q - 4w = 199, 22w = -3q + 21w + 558. Is q a multiple of 17? True Let d(c) = 1046c*2 - 2. Does 87 divide d(-1)? True Let x(k) = 3k - 14. Let w be x(6). Suppose 0 = -2v + w + 6. Does 5 divide v? True Suppose -2z + 147 = 2x - 257, 187 = x + 4z. Suppose 921 = 7y + x. Is y a multiple of 21? False Is 31 a factor of 1 + 558 - (5 - 0) - -4? True Let o(b) = -b3 - 5b*2 + 3b + 9. Suppose -4t + 8 = 0, -14 = 4i + 5t - 4. Let p be o(i). Let y = p + 13. Is 7 a factor of y? True Let c(w) = 203w*2 - w - 9. Does 66 divide c(2)? False Let c = 169 - 6. Suppose -2m - c - 101 = -2l, -4l = 2*m - 546. Is l a multiple of 27? True
Two letters picked without replacement from {x: 2, h: 10}. What is prob of picking 2 x? 1/66 Three letters picked without replacement from ajhjaqhjhhqjh. What is prob of picking 2 q and 1 h? 5/286 Four letters picked without replacement from {s: 5, q: 6, j: 4, u: 5}. Give prob of picking 1 s, 2 j, and 1 q. 12/323 Two letters picked without replacement from {v: 3, j: 2, x: 2, i: 13}. Give prob of picking 1 x and 1 j. 2/95 What is prob of picking 1 j and 1 a when two letters picked without replacement from ggjzggazg? 1/36 Four letters picked without replacement from gtgggngggggxgggxcgg. What is prob of picking 1 c, 1 t, 1 x, and 1 n? 1/1938 Three letters picked without replacement from hrlhnn. Give prob of picking 2 h and 1 r. 1/20 Two letters picked without replacement from aooaaaacaaeeaa. What is prob of picking 1 a and 1 c? 9/91 Four letters picked without replacement from {i: 3, m: 9}. What is prob of picking 2 m and 2 i? 12/55 What is prob of picking 1 x and 1 l when two letters picked without replacement from eleleeuexeeeeuxluel? 8/171 Four letters picked without replacement from szdgppd. What is prob of picking 1 s, 1 p, and 2 z? 0 Three letters picked without replacement from aaaaycyqacyyqqqaccq. Give prob of picking 1 y, 1 q, and 1 a. 40/323 Four letters picked without replacement from fysttts. What is prob of picking 1 y, 1 t, and 2 s? 3/35 Two letters picked without replacement from dbaad. Give prob of picking 2 a. 1/10 Calculate prob of picking 3 m and 1 j when four letters picked without replacement from mmmmmmjmmmmm. 1/3 Four letters picked without replacement from qqqqaaqaqqaa. What is prob of picking 4 a? 1/99 Two letters picked without replacement from bixxx. Give prob of picking 1 b and 1 i. 1/10 Calculate prob of picking 1 d and 2 u when three letters picked without replacement from {u: 4, d: 3}. 18/35 Two letters picked without replacement from {w: 3, s: 11}. What is prob of picking 2 s? 55/91 Four letters picked without replacement from kggkkgkkkgkkgkkkkg. Give prob of picking 4 g. 1/204 What is prob of picking 1 p, 2 b, and 1 h when four letters picked without replacement from {h: 1, p: 1, w: 3, z: 3, y: 1, b: 2}? 1/330 Calculate prob of picking 1 m and 1 e when two letters picked without replacement from {m: 18, e: 1}. 2/19 Calculate prob of picking 1 i and 1 t when two letters picked without replacement from vlidvxt. 1/21 Three letters picked without replacement from {m: 9, v: 11}. Give prob of picking 1 v and 2 m. 33/95 Two letters picked without replacement from kwjkkkkwkkjkkk. Give prob of picking 2 j. 1/91 What is prob of picking 1 e and 2 c when three letters picked without replacement from {c: 4, e: 4, l: 6, x: 1, p: 1}? 3/70 Two letters picked without replacement from wwwp. What is prob of picking 1 p and 1 w? 1/2 Two letters picked without replacement from dkksjdjdsjyp. Give prob of picking 1 d and 1 p. 1/22 Calculate prob of picking 1 n and 1 c when two letters picked without replacement from nnnncnnnnnnnnnnncnn. 34/171 Two letters picked without replacement from {d: 2, c: 2}. Give prob of picking 2 c. 1/6 Calculate prob of picking 1 z, 1 d, and 1 u when three letters picked without replacement from {q: 1, z: 1, d: 1, u: 2, h: 1, o: 1}. 2/35 Two letters picked without replacement from {c: 1, v: 3, w: 5, f: 1, q: 5, l: 3}. What is prob of picking 1 l and 1 q? 5/51 Four letters picked without replacement from ykkkdrkrprcyrrcdr. What is prob of picking 1 c, 2 r, and 1 d? 3/119 Calculate prob of picking 1 b and 1 k when two letters picked without replacement from {b: 1, v: 2, n: 2, k: 4}. 1/9 Calculate prob of picking 1 y, 1 r, and 2 b when four letters picked without replacement from {b: 3, o: 5, y: 1, r: 3}. 1/55 Three letters picked without replacement from {f: 1, q: 1, e: 1, z: 2}. What is prob of picking 1 e, 1 z, and 1 f? 1/5 What is prob of picking 1 t and 1 w when two letters picked without replacement from {v: 1, h: 2, t: 1, w: 1, z: 1, f: 1}? 1/21 Two letters picked without replacement from {k: 2, j: 1, n: 2, i: 1, c: 3, y: 3}. What is prob of picking 2 c? 1/22 Calculate prob of picking 3 v when three letters picked without replacement from vvvvvwvwwvvvlvv. 33/91 What is prob of picking 3 c when three letters picked without replacement from {c: 4, p: 8, k: 5, m: 2}? 4/969 Four letters picked without replacement from {f: 3, g: 2, m: 3}. Give prob of picking 2 g and 2 f. 3/70 Calculate prob of picking 2 k when two letters picked without replacement from kkhhhkkhkhkhkhhkkh. 4/17 Four letters picked without replacement from {f: 1, r: 3, p: 4, n: 3}. What is prob of picking 1 r, 1 n, and 2 p? 9/55 Two letters picked without replacement from saipjbisiiiiiiibia. Give prob of picking 1 p and 1 s. 2/153 What is prob of picking 1 k and 1 b when two letters picked without replacement from qrkwkbkbrwrqrqbobkbk? 5/38 Calculate prob of picking 2 d when two letters picked without replacement from {p: 1, d: 3}. 1/2 Two letters picked without replacement from gggggrglg. Give prob of picking 2 g. 7/12 Four letters picked without replacement from opkzzkpoowkokq. Give prob of picking 2 p and 2 o. 6/1001 Two letters picked without replacement from {h: 2, f: 1, s: 2, l: 1, u: 2}. What is prob of picking 1 f and 1 l? 1/28 What is prob of picking 2 y and 1 i when three letters picked without replacement from {y: 2, x: 1, w: 3, i: 6, l: 3}? 6/455 Calculate prob of picking 2 v and 1 h when three letters picked without replacement from hvhv. 1/2 Two letters picked without replacement from xrgxggxrxnnxrgnnrx. What is prob of picking 1 r and 1 x? 8/51 Two letters picked without replacement from {x: 2, z: 1, f: 7, o: 4}. Give prob of picking 2 o. 6/91 Two letters picked without replacement from {t: 1, w: 2, v: 1}. Give prob of picking 1 v and 1 w. 1/3 Calculate prob of picking 1 y and 1 b when two letters picked without replacement from yyyyyybbyyyy. 10/33 Two letters picked without replacement from kssnhssn. What is prob of picking 1 k and 1 s? 1/7 Calculate prob of picking 1 s and 1 j when two letters picked without replacement from scjttzjttctt. 1/33 Three letters picked without replacement from ggssssssss. Give prob of picking 1 g and 2 s. 7/15 Four letters picked without replacement from wowoowwowwooow. What is prob of picking 2 o and 2 w? 63/143 What is prob of picking 2 j when two letters picked without replacement from djdddjjdjddjjjjdddjj? 9/38 What is prob of picking 1 w, 1 c, and 1 r when three letters picked without replacement from rcczw? 1/5 What is prob of picking 2 t and 2 b when four letters picked without replacement from {b: 5, t: 5}? 10/21 Two letters picked without replacement from myyhhyhymy. What is prob of picking 1 h and 1 y? 1/3 Four letters picked without replacement from {i: 9, j: 10}. Give prob of picking 4 j. 35/646 Calculate prob of picking 1 h and 3 v when four letters picked without replacement from vkhhgkxgvgqxvgk. 2/1365 Three letters picked without replacement from {p: 7, v: 7}. What is prob of picking 1 v and 2 p? 21/52 Four letters picked without replacement from vvvvvvvvvnvynvy. Give prob of picking 3 v and 1 y. 22/91 Three letters picked without replacement from {p: 10, i: 2, f: 3}. Give prob of picking 2 p and 1 i. 18/91 Calculate prob of picking 1 b and 1 w when two letters picked without replacement from {w: 2, n: 4, e: 4, m: 2, o: 1, b: 1}. 2/91 Calculate prob of picking 2 j, 1 o, and 1 c when four letters picked without replacement from {n: 1, v: 2, j: 4, l: 2, o: 1, c: 2}. 4/165 Four letters picked without replacement from dudguuduudiquqgu. Give prob of picking 2 u, 1 i, and 1 d. 3/65 Two letters picked without replacement from {r: 1, i: 2, q: 1, v: 3, g: 6, y: 2}. Give prob of picking 1 v and 1 q. 1/35 What is prob of picking 2 m when two letters picked without replacement from {v: 7, m: 3}? 1/15 What is prob of picking 2 p and 1 f when three letters picked without replacement from fxppfxpppfxs? 3/22 Two letters picked without replacement from vvlvcvlclvvllllllll. What is prob of picking 1 c and 1 l? 22/171 What is prob of picking 3 n when three letters picked without replacement from {c: 5, p: 4, o: 3, n: 7}? 35/969 Four letters picked without replacement from kaaacnkacyyuauaa. Give prob of picking 1 n, 1 y, 1 c, and 1 u. 2/455 Calculate prob of picking 1 e and 1 k when two letters picked without replacement from {k: 2, e: 16}. 32/153 Three letters picked without replacement from {j: 4, b: 1, f: 2, e: 1}. What is prob of picking 1 f and 2 j? 3/14
Determine k, given that k*4 + 7175057k*3 + 17160457067493k*2 + 13680711064239634139k - 136808826695278157690 = 0. -2391689, 10 Let r*4 + 42868r*3 - 42869r*2 = 0. What is r? -42869, 0, 1 Factor -101v*3 + 5059v*2 - 63474v + 5616. -(v - 26)(v - 24)(101v - 9) Suppose -2w*3/13 + 22867068w*2/13 - 65362872731640w/13 + 130725653995024/13 = 0. What is w? 2, 5716766 Find k, given that -k*5/4 + 1084539k*4/2 + 10845415k*3/4 = 0. -5, 0, 2169083 Suppose 2f*2/7 - 64476428f/7 + 519651220954898/7 = 0. Calculate f. 16119107 Determine j so that -3j4/5 - 258j*3/5 - 1425j*2 - 61014j/5 + 13680 = 0. -38, -25, -24, 1 Suppose 3p5 + 129099p*4 - 2841570p*3 + 2583366p*2 + 2841567p - 2712465 = 0. What is p? -43055, -1, 1, 21 What is k in 2k4/11 + 264454k*3/11 + 795387044k*2 + 480379398344k/11 - 995757942288/11 = 0? -66086, -57, 2 Find p, given that -14p4/9 + 55166p*3/9 + 13157032p*2/9 + 255341608p/3 + 48160288 = 0. -114, -4/7, 4169 Factor 3j5 - 19161978j*4 + 40797946204920j*3 - 28954465613365445088j*2 + 57908768035099366272j. 3j(j - 2129108)*3(j - 2) Solve 5k3 - 62110k*2 - 62125k + 124230 = 0 for k. -2, 1, 12423 Suppose 8d3/11 - 24394d*2/11 + 15967682d/11 - 3990396/11 = 0. What is d? 1/4, 951, 2098 Determine l so that 3l5 - 255132l*4 - 5614920l*3 + 47978502l*2 - 108715131l + 66606678 = 0. -29, 1, 3, 85066 Suppose 5u2 - 61639715u + 616396650 = 0. What is u? 10, 12327933 Determine s so that 2s5/9 - 17786s*4/3 + 853336s*3/9 - 3199432s*2/9 - 379264s + 13651456/9 = 0. -2, 2, 8, 26663 Solve -2z4/17 + 25003588z*3/17 - 78147126565586z*2/17 - 1875541839137904z/17 - 11253272637968928/17 = 0 for z. -12, 6250909 Suppose -l*2/3 + 22847l/3 + 167706 = 0. Calculate l. -22, 22869 Find v, given that 5v2 + 59015v + 3581310 = 0. -11742, -61 Solve -16129r5 + 802005r*4 - 1348824r*3 + 664516r*2 - 101568r = 0 for r. 0, 46/127, 1, 48 Let 2h3/5 + 5554208h*2/5 + 16662606h/5 = 0. Calculate h. -2777101, -3, 0 Determine t, given that 9t4/4 + 19509t*3/4 + 129763t*2/4 + 222611t/4 + 15127 = 0. -2161, -4, -7/3, -1/3 Suppose -4c5 - 1280c*4 + 362216c*3 - 16372368c*2 - 895261572c + 56485801008 = 0. Calculate c. -511, -52, 81 What is l in -l*2/2 - 8220l + 777098 = 0? -16534, 94 Suppose -2g5 - 21122g*4 + 380754g*3 - 952118g*2 - 84512g + 1269480 = 0. What is g? -10579, -1, 2, 15 Find i, given that 5i3 - 14275i*2 - 522680i + 6649300 = 0. -46, 10, 2891 Let -35x3/2 - 32350x*2 + 287405x/2 + 176035 = 0. What is x? -1853, -1, 38/7 Solve -2l2 - 32873760l - 135085512067200 = 0 for l. -8218440 Suppose 36y3 + 18584y*2 - 8855568y + 793828512 = 0. Calculate y. -7562/9, 162 Find q, given that q*5 - 48q*4 - 2768q*3 + 39402q*2 + 136831q + 94710 = 0. -41, -2, -1, 15, 77 Factor o*2/2 + 740o - 1364250. (o - 1070)(o + 2550)/2 Let 3h*3 + 12278517h*2 - 24557043h + 12278523 = 0. Calculate h. -4092841, 1 Determine i so that -2i4/13 + 2160i*3/13 - 1674i*2/13 - 523196i/13 + 79680 = 0. -16, 2, 15, 1079 Factor t*5 + 1561t*4 + 805707t*3 + 137275803t2. t2(t + 427)(t + 567)*2 Suppose 628h*2/5 + 440664h/5 + 148960 = 0. What is h? -700, -266/157 Factor -u*3/5 + 2652u*2/5 - 1161216u/5 - 850445568/5. -(u - 1512)*2(u + 372)/5 Factor -2l3 - 17226l*2 + 519188l + 5254944. -2(l - 38)(l + 8)(l + 8643) Factor r2 + 5852r - 6836300. (r - 998)(r + 6850) What is n in -8n*2/11 + 337562n/11 - 6748040/11 = 0? 20, 168701/4 Factor 2h3/3 - 10724h*2/3 - 3220654h/3 + 19142050024. 2(h - 3719)2(h + 2076)/3 Let t*2/7 + 51689t/7 + 18631338/7 = 0. What is t? -51326, -363 Solve -o*3 - 933887o*2/2 - 1400827o/2 - 233471 = 0. -466942, -1, -1/2 Determine k so that -4k5 - 9720k*4 - 5713324k*3 + 237791352k*2 + 3915422768k + 6834128928 = 0. -1234, -11, -2, 51 Factor 3n2 + 25780296n + 55385305153968. 3(n + 4296716)2 Factor s2/4 - 1776s - 253540. (s - 7244)(s + 140)/4 Solve -4q*3 + 38207004q*2 - 114620976q = 0 for q. 0, 3, 9551748 Factor -2j2 + 573560j + 8603850. -2(j - 286795)(j + 15) Let -3o2 + 132186o - 12267351 = 0. Calculate o. 93, 43969 Suppose -2d5/17 + 6306d*4/17 - 256064d*3/17 + 2739360d*2/17 - 2489600d/17 = 0. Calculate d. 0, 1, 20, 3112 Let 5z4 + 22890z*3 + 23382585z*2 - 6443580780z + 396216880020 = 0. Calculate z. -2406, 117 Suppose k*5 - 438k*4 + 31229k*3 - 739644k*2 + 5179248k - 9688896 = 0. Calculate k. 3, 7, 36, 356 Let -2w3/5 + 7392w*2/5 + 74142w/5 - 81532/5 = 0. Calculate w. -11, 1, 3706 Factor 4y2/9 - 20020y/9 - 8781512/3. 4(y - 6087)(y + 1082)/9 Find i such that -6i4/7 - 2974i*3/7 - 48418i*2/7 - 35558i - 53648 = 0. -479, -7, -8/3 Factor 18i2/5 - 9238i/5 + 236304/5. 2(i - 27)(9i - 4376)/5 Find l, given that 3l*4 - 4389498l*3 + 1605680562663l*2 - 28901183488668l + 130053725746668 = 0. 9, 731574 Let 4t3 + 34714744t*2 + 75319486542256t - 451918168985184 = 0. What is t? -4339346, 6 Suppose r*3 - 9376846r*2 + 21981319603772r - 43962601700168 = 0. Calculate r. 2, 4688422 Factor -55n2 - 2927545n - 266140. -5(n + 53228)(11n + 1) Suppose 2m*3 - 30836m*2 - 215986m + 555300 = 0. What is m? -9, 2, 15425 What is i in 5i5 - 13720i*4 + 122150i*3 + 2536040i*2 - 16866475i + 14222000 = 0? -13, 1, 5, 16, 2735 What is p in -4p3 + 10348p*2 - 4360092p - 3246162444 = 0? -371, 1479 Suppose -2f2/5 - 711824f/5 - 284728 = 0. What is f? -355910, -2 Suppose 2t2/15 + 14713708t/15 - 34332018/5 = 0. Calculate t. -7356861, 7 Factor -l*3 + 1169l*2 - 152095l + 1007727. -(l - 1021)(l - 141)(l - 7) Factor -5y4 + 191420y*3 - 1838196020y*2 + 117057158400y - 1869783552000. -5(y - 19110)2(y - 32)*2 Let -2g*2/7 - 4398g + 61580/7 = 0. Calculate g. -15395, 2 Determine i so that -2i4/3 - 2606i*3/3 + 190064i*2/3 + 999704i/3 + 406112 = 0. -1372, -3, -2, 74 Factor -u*3 + 6562380u*2 - 10766201253717u - 21532428756962. -(u - 3281191)*2(u + 2) What is b in 32b3/17 - 49586b*2/17 - 71496b/17 + 232650/17 = 0? -3, 25/16, 1551 Find z, given that 10z5 + 375z*4 + 1525z*3 - 38850z*2 - 19760z = 0. -26, -19, -1/2, 0, 8 Solve -8d4 - 2892556d*3 - 24586176d*2 - 10123676d + 11569952 = 0 for d. -361561, -8, -1, 1/2 Suppose 3l3 - 216l*2 - 114195l + 925848 = 0. What is l? -167, 8, 231 Determine h so that -10h3/11 + 5564444h*2/11 + 25596674h/11 - 11128980/11 = 0. -5, 2/5, 556449 Solve 1102b5 + 584651b*4 + 11531051b*3 - 5487674b*2 - 297756b + 42840 = 0. -510, -21, -2/19, 2/29, 1/2 What is q in -2q2/15 - 15384q/5 - 1748414/3 = 0? -22885, -191 Let o*5/8 + 2333o*4/4 + 137425o*3/2 - 556701o*2/4 + 559035o/8 = 0. Calculate o. -4545, -123, 0, 1 Factor -2i2 + 64502i - 21510036. -2(i - 31914)(i - 337) Solve 2b3/21 - 217438b*2/21 - 62126b/3 - 217442/21 = 0. -1, 108721 What is r in -4r5/5 - 80r*4 - 11716r*3/5 - 17160r*2 = 0? -50, -39, -11, 0 Suppose 5p*4 + 1515p*3 + 91815p*2 + 1663025p + 9288240 = 0. What is p? -229, -48, -13 Factor -49b3/3 - 20429801b*2/3 + 5837089b/3 - 416935/3. -(b + 416935)(7b - 1)*2/3 Solve -85v*5 + 415v*4 + 39150v*3 - 231700v*2 + 286360v + 36960 = 0 for v. -22, -2/17, 2, 4, 21 Let -3j5/2 - 303153j*4/2 - 3829769703j*3 - 26802476742j*2 - 38287087260j = 0. Calculate j. -50522, -5, -2, 0 Determine r, given that 2r3 + 5478r*2 - 5492r - 32880 = 0. -2740, -2, 3 Determine a so that -2a5 - 82a*4 + 2228a*3 - 12524a*2 + 24654a - 14274 = 0. -61, 1, 3, 13 Let -4n3 + 2483400n*2 - 74499300n + 558738000 = 0. Calculate n. 15, 620820 Determine h so that -2h2/3 + 951746h = 0. 0, 1427619 Let 2h2 + 194607172h + 4733993924229698 = 0. Calculate h. -48651793 Solve -10b4 + 25895b*3 - 12855b*2 - 233055b + 116505 = 0. -3, 1/2, 3, 2589 Factor 19h2/8 - 349859h/4 - 64449. (h - 36828)(19h + 14)/8 Find n, given that -n*4/7 + 2088n*3/7 - 96578n*2/7 + 190128n - 642915 = 0. 5, 21, 2041 Factor -p*3 - 707p*2 - 44527p - 686925. -(p + 25)(p + 43)(p + 639) Let 2a2 - 886800a - 3547232 = 0. What is a? -4, 443404 Factor 2s2 + 3062354s + 18374052. 2(s + 6)(s + 1531171) Suppose 3v3/4 - 351v*2 - 2925v/4 + 24675/2 = 0. What is v? -7, 5, 470 Suppose -m*2 + 18688642m - 87316334951041 = 0. What is m? 9344321 Suppose -4q2 + 389148q - 1556528 = 0. Calculate q. 4, 97283
Which is bigger: 2589 or 2588? 2589 Are -123 and -122 unequal? True Do 83/4 and -2/7 have the same value? False Do 0 and -1/953 have the same value? False Is -111 less than -112? False Which is greater: 1 or 20673? 20673 Is -118 at most as big as -118? True Is 5315 at least 5315? True Is -4 equal to -55/17? False Which is bigger: 335 or 333? 335 Which is bigger: 70 or 622/9? 70 Is -921 less than or equal to -919? True Is 167/48 < 2? False Which is smaller: -2 or 3? -2 Which is bigger: 2/31 or -98? 2/31 Is 3 less than or equal to 1420? True Is 0.1 != -0.679? True Are -0.4 and 11/71 unequal? True Is -5/1262 < 0? True Which is smaller: -3/2026 or -1? -1 Is 57 > 81? False Is 1076 greater than 1075? True Is 0 at least -1/13345? True Which is smaller: 0.4 or 56? 0.4 Which is smaller: 2 or 60/79? 60/79 Which is bigger: 6 or 11? 11 Is 897/7 equal to 129? False Is 11 equal to 15? False Which is smaller: 1723/3 or 574? 574 Which is smaller: -6/505 or 0? -6/505 Which is smaller: 208 or 209? 208 Is 1431/11 at most as big as 130? False Is -46 at least as big as 53? False Which is smaller: 0.32 or -34? -34 Do -1908 and -1905 have the same value? False Is -24 not equal to -24? False Which is smaller: 2 or -23/107? -23/107 Which is bigger: 0 or 3/6505? 3/6505 Is -1 at least 51/434? False Which is greater: -37152 or -37151? -37151 Is 3/3293 <= 1? True Is 149 less than 157? True Which is smaller: -99/614 or -1? -1 Which is greater: -265 or -1055/4? -1055/4 Which is bigger: 295/146 or 2? 295/146 Which is greater: 4/7045 or -1? 4/7045 Which is bigger: 459/5 or 91? 459/5 Is -0.35 at most as big as 272? True Is -3 bigger than 0.1384? False Which is bigger: 1/3 or 1/319? 1/3 Do 0 and 1/4702 have the same value? False Which is bigger: -35 or -34? -34 Is -200 less than or equal to -200? True Is 1027 equal to 19488/19? False Which is greater: 5125 or 5123? 5125 Is -310 at most -308? True Which is greater: 134 or 127? 134 Is 118 smaller than 117? False Which is smaller: 1/3 or 5.33? 1/3 Is -11644 < 2/7? True Is -393 greater than -394? True Which is smaller: -2 or -52/19? -52/19 Is -38 greater than -30? False Which is bigger: 43 or 41? 43 Is -0.3 at most -2226? False Is 3/173 != -67? True Which is smaller: 961 or 954? 954 Do -14/33 and -1 have different values? True Is 24 > 18? True Which is bigger: -0.08 or 33? 33 Are -1664 and -1655 equal? False Which is greater: 1 or 2/1469? 1 Is 118 less than or equal to 102? False Which is smaller: -0.06 or 35? -0.06 Are 1/455 and 1 nonequal? True Is -1119/2 <= -561? False Which is smaller: 359 or 12? 12 Which is smaller: 1048 or 1050? 1048 Which is smaller: -1986 or -1984? -1986 Which is bigger: 0 or 4/435? 4/435 Which is greater: -38/9 or -4? -4 Do -13/14 and 0 have the same value? False Is 43/1577 less than 1? True Which is bigger: -10 or 1? 1 Which is smaller: 0 or 40/27? 0 Which is bigger: 5/2053 or 0? 5/2053 Which is bigger: 14 or 29/2? 29/2 Is 0 smaller than 194? True Is 2/795 at most as big as 0? False Is -3657 at least as big as -3657? True Which is smaller: 815/8 or 103? 815/8 Do 28 and -3 have different values? True Which is smaller: 508 or 506? 506 Is 943 less than or equal to 940? False Which is smaller: 1 or -9/235? -9/235 Is 0 >= -9/7? True Which is smaller: -14 or -534/35? -534/35 Which is smaller: -1212 or -1210? -1212 Is -1 < -16/211? True Which is smaller: -999 or -1000? -1000 Is -52 greater than or equal to -682/13? True Which is bigger: 174 or 2611/15? 2611/15 Which is smaller: -4/49 or 2/25? -4/49 Which is greater: 27 or -81? 27 Which is greater: -0.36 or -12? -0.36 Is -2 bigger than 98? False Is -60 at most -798/13? False Which is bigger: 226 or 2473/11? 226 Is 2/12899 at most as big as 1? True Which is bigger: -200 or -201? -200 Which is smaller: 2/178599 or 1? 2/178599 Which is bigger: -251/43 or -6? -251/43 Is -74 bigger than -35? False Which is smaller: 14 or 106/7? 14 Is 2 less than or equal to 120/133? False Which is smaller: 2/9953 or -0.3? -0.3 Is -51/79 at least -2? True Which is smaller: 1122 or -1? -1 Are -98/5 and -19 nonequal? True Are 11048 and 11048 non-equal? False Which is bigger: 1461 or -1? 1461 Is -448 smaller than -449? False Which is smaller: 0 or 1/7050? 0 Are -7 and 157 non-equal? True Is -105 smaller than 4? True Which is smaller: -1 or 8/17? -1 Is -1 >= 12? False Does -402 = -404? False Which is bigger: 72/13 or -1? 72/13 Are -0.4 and 85 nonequal? True Are -68 and 6 non-equal? True Are -8 and 21 equal? False Which is bigger: 4672 or 4673? 4673 Is -2/57697 less than 0? True Are 1 and -3/3517 unequal? True Which is bigger: 21/20 or 0? 21/20 Which is smaller: 0 or -9/2554? -9/2554 Is 1/765 greater than 0? True Which is smaller: -57/2 or -29? -29 Do 0 and -3/3065 have different values? True Which is greater: -2 or -4? -2 Is 39874/7 at least as big as 5696? True Are -37075 and -37076 nonequal? True Is -6/13 smaller than 3/2? True Is 714/5 > 144? False Which is greater: 20.06 or -2/7? 20.06 Which is smaller: -50 or -56? -56 Is 2 greater than 36/13? False Which is greater: -0.1 or -1255? -0.1 Is 256 at least 254? True Is 49 at least 20? True Which is bigger: 0.176 or 4.7? 4.7 Which is greater: 73/7 or 9? 73/7 Is -2 at most as big as 176? True Is 1 bigger than 3/442? True Which is smaller: 1 or -39/395? -39/395 Does -13 = -138/11? False Do 0.067 and 437/2 have different values? True Is -1 < 2/107503? True Is 6/19 bigger than 4? False Is 1810 > 1808? True Which is smaller: -96/911 or 1? -96/911 Which is smaller: -15700 or 0.2? -15700 Which is bigger: 2/5 or 1.1? 1.1 Are 4/1181 and -0.1 nonequal? True Are 1 and 33/85 non-equal? True Is 2/1159 bigger than 1? False Is 914 greater than 911? True Which is bigger: 4780/17 or 281? 4780/17 Is -883 bigger than -886? True Are -4193 and -8387/2 nonequal? True Is -212 smaller than -0.2? True Does 227 = 226? False Are -0.2 and 80 non-equal? True Is 797/5 at most 159? False Is -1 greater than or equal to -20.839? True Is 1/3 != -4.91? True Is -3719 < -3718? True Which is smaller: -79 or -85? -85 Which is greater: 0 or 36? 36 Which is greater: 4021 or 4022? 4022 Which is smaller: -1 or -1/8780? -1 Is -868 >= -845? False Which is smaller: -350/9 or -39? -39 Which is greater: 0 or -13.6? 0 Which is smaller: -7 or -682? -682 Which is smaller: -166 or 1? -166 Which is bigger: 1 or 29/283? 1 Do -13 and -16 have the same value? False Which is greater: 5654/15 or 376? 5654/15 Which is bigger: 10719 or 1/2? 10719 Which is smaller: -171 or -509/3? -171 Which is bigger: -1 or -46/355? -46/355 Which is bigger: -2/9 or 3815? 3815 Is 0 less than or equal to -41/864? False Is -17 <= -15? True Which is smaller: -378 or -377? -378 Is -2/1527 at most -1? False Is -107 >= -110? True Which is smaller: 2868/13 or 221? 2868/13 Is 0.25 less than -2? False Do 6/703 and 1 have the same value? False Is 1 at most as big as 9377? True Which is greater: 3.83 or -4/9? 3.83 Is -1278 at least as big as -8? False Is -1/3 at most as big as -12? False Which is smaller: 13 or -3/4? -3/4 Which is greater: 778 or 798? 798 Which is greater: 17054 or 17053? 17054 Is 262/211 > 1? True Is 0.0384 equal to -4? False Which is smaller: 1.21 or -2? -2 Which is greater: 612 or 6736/11? 6736/11 Is -1/1104 <= 0? True Does 85 = 60? False Which is greater: 16 or -0.6? 16 Which is greater: -17 or -25? -17 Which is smaller: -1/925 or 1? -1/925 Which is bigger: 12 or 9? 12 Which is bigger: -27/25 or 0? 0 Which is smaller: 1398 or 1397? 1397 Is 0 at most as big as -1.4? False Is -1/7 greater than or equal to -5.7? True Is 137 at most 954/7? False Is 0 < -9/1852? False Do 1/2 and 2.577 have the same value? False Are 1/114 and -1 equal? False Which is smaller: 1 or 9/46? 9/46 Is -141 greater than or equal to -142? True Is -3 at most as big as -1120? False Which is greater: -10 or 5? 5 Is -3/451 greater than or equal to 0.1? False Which is greater: -2975/2 or -1488? -2975/2 Is 22 at most as big as 190/9? False Are -5 and -36/7 non-equal? True Is -68 < -71? False Are 1/42 and -1 equal? False Which is bigger: 4/2161 or 1? 1 Which is smaller: -147 or -151? -151 Are -480 and -481 nonequal? True Which is smaller: 124 or 1606/13? 1606/13 Is -4036 at most -4036? True Is -2/9 < 15/59? True Which is greater: 46/25 or 1? 46/25 Which is smaller: 906/49 or 18? 18 Are 1 and -29/72 non-equal? True Do -1 and 16/1173 have different values? True Does 0.3 = 15/77? False Which is smaller: 0 or 29/22? 0 Are -3171 and -6343/2 non-equal? True Is -1 at least as big as 2/2357? False Which is smaller: -248 or -266? -266 Which is bigger: 23 or 10/7? 23 Is -429 at most -378? True Which is smaller: -2/81 or 333? -2/81 Which is smaller: -190 or 3/7? -190 Which is greater: 92 or 94? 94 Is 0.1 equal to 7350? False Which is bigger: 471 or 0.1? 471
What is the fifth smallest value in 1/772, -5, 0.1, 2/7, -2/15, -0.5, -0.1? 1/772 Which is the smallest value? (a) -579/4 (b) 5 (c) 2/209 (d) -0.3 (e) -9 a What is the third biggest value in 10/11, 2/15, 4, 2334? 10/11 What is the second biggest value in 0, 0.4, 5330.5, 5, 0.1? 5 What is the second biggest value in 0.0848367, 3/2, -5, 0.4? 0.4 Which is the second smallest value? (a) -4 (b) -30944/7 (c) -2/5 (d) 26 a Which is the third smallest value? (a) -0.5 (b) -0.02 (c) 0.4 (d) 2229 (e) -2/3 (f) -0.3 f What is the biggest value in 0.1, 0.2, -119686/61? 0.2 What is the smallest value in -2/25, -1/4, 67.94, 4.21? -1/4 What is the second smallest value in 473.2, 3/7, -341/12? 3/7 What is the third smallest value in -5, 0, -8/15741, -2591? -8/15741 What is the third smallest value in 0.5, -1/5, 4, -3/2, 7/4, -1030? -1/5 What is the smallest value in 2/11, -60, 138, 1/7, 0.07? -60 Which is the fourth smallest value? (a) -73 (b) 0 (c) -5 (d) 2638 (e) 4 (f) 2 f What is the second smallest value in 0.1, 1/3, -8/7, 1, 23.49, 0.46? 0.1 What is the biggest value in -2/3, 1/2, 726, -3, -0.4, -16, -15? 726 What is the fourth biggest value in 5, 5060, -3, 2, -4? -3 Which is the biggest value? (a) -2 (b) -1/2 (c) -4 (d) 0.01 (e) -3 (f) -14 d What is the third biggest value in 0.3, 7/6, 0.38, 13/12, -3, -0.9? 0.38 What is the smallest value in 6, -1, 3, 0.07, -3/7, -2/11? -1 What is the third biggest value in -0.4, 163, 3/4, 96, 2, -4? 2 Which is the seventh smallest value? (a) 1/5 (b) -4 (c) 61 (d) 0.09 (e) 1 (f) 12 (g) -2/7 c What is the third smallest value in -2/185, -6, -0.071, -1/2, -0.011? -0.071 What is the smallest value in -0.2, 152, 3, 16, -4, -1/42? -4 Which is the third biggest value? (a) -0.3 (b) 4/9 (c) -5.12 (d) -0.28 (e) 0.05 d What is the third biggest value in 6, -2/3, 2.9, 8618? 2.9 Which is the fourth biggest value? (a) -1334 (b) 5 (c) 2/3 (d) 1/4 a What is the biggest value in 450, 4, -15/79, 6? 450 What is the fourth biggest value in -1/245, 8, -8, 13/4, -0.5, -1, -2/7? -2/7 Which is the third smallest value? (a) 5 (b) -4/5 (c) -0.5 (d) 0.2 (e) -2 (f) -55698 (g) -6/5 g What is the fifth smallest value in -152, 0.8, 19/2, -1/10, -1? 19/2 Which is the fourth smallest value? (a) -0.2 (b) -4 (c) -3 (d) 1/2 (e) 8 (f) -0.5038 a What is the third biggest value in 0.5, 4, 25, -4, -13086/61? 0.5 What is the third smallest value in 5, 110, -2/7, -2, 1/5, -5.12? -2/7 Which is the smallest value? (a) 10 (b) -12 (c) 1 (d) -2820.6 d Which is the smallest value? (a) 2 (b) -0.8 (c) -110/5777 b What is the smallest value in 5, -1/4, 4, -1493, -101? -1493 Which is the third smallest value? (a) 2 (b) 5 (c) 21.54 (d) -2/5 (e) -1 a What is the second smallest value in 6, -0.06, 21, 2/23, -0.4, 0.2? -0.06 Which is the third biggest value? (a) 185165 (b) 5 (c) 0.4 (d) 0 (e) 2/55 c Which is the fifth smallest value? (a) 1/35 (b) -0.002 (c) 3 (d) 3/7 (e) -1 (f) 0.09 d What is the third smallest value in 4/7, 6/23, -50/3, 2/23, -3/7, 2, -6? -3/7 What is the second smallest value in -2, 2/13, 268, -0.2, -0.5, -0.1, -15/7? -2 Which is the fourth biggest value? (a) 8 (b) -419 (c) -2 (d) 48 (e) 1/5 (f) 1/33 f Which is the biggest value? (a) -5 (b) 36425521 (c) 2 b What is the third biggest value in 0.3, -69, 3, -1, 191, 1? 1 What is the third smallest value in -5953, 1/4, -414? 1/4 Which is the sixth smallest value? (a) 117 (b) -3 (c) 1 (d) -3/7 (e) 4 (f) 0 a What is the fourth biggest value in -6/37, -1, 340, 0.3, -2/7, 24? -6/37 What is the second biggest value in -5, -0.0717, 3, -14/3, -23? -0.0717 Which is the biggest value? (a) -2/3 (b) 327.18 (c) -0.9 b Which is the second biggest value? (a) 34/15 (b) -1/7 (c) -2/21 (d) 7 (e) -34/7 a Which is the seventh smallest value? (a) -6 (b) -107 (c) -1 (d) -4 (e) 3/16 (f) 0.1 (g) -0.5 e Which is the smallest value? (a) -6 (b) -0.3 (c) 1/6 (d) 1.79 (e) -9/14 (f) 1 (g) -0.5 a What is the sixth biggest value in 641, 0.4, -8/3, 1, -67, -2? -67 Which is the biggest value? (a) 1167751 (b) 7/6 (c) 24 a What is the third biggest value in -14/31, 0, 1/2, 3/5, -9/4, -2/9? 0 What is the fourth smallest value in 1/3, 0.06, 18/11, -0.4, -5, -988? 0.06 Which is the third smallest value? (a) 1 (b) -3/11 (c) -4089967 a What is the biggest value in 3.57095713, 1/5, 2/3? 3.57095713 What is the third biggest value in -2/19, 7, 1/101, -2/3, -1? -2/19 What is the fourth smallest value in 1, 0.1, 115.894, 2/3? 115.894 Which is the third biggest value? (a) 33 (b) -268 (c) -595 (d) 5 b Which is the fourth smallest value? (a) 75/74 (b) -0.4 (c) 11 (d) -14 (e) -2 a Which is the biggest value? (a) -16 (b) 0.4 (c) 0.3 (d) 7 (e) 3 (f) 0.02 (g) -1/55 d Which is the fourth smallest value? (a) 146/5 (b) -1/2 (c) 8 (d) 3 (e) -1.38 (f) -2 d What is the fifth biggest value in 2.3, -1/25, 2, -5/6, -10? -10 What is the fifth biggest value in -10, -0.15, -4/7, -0.193, -0.14, -1, 1? -4/7 Which is the biggest value? (a) 22356 (b) -599 (c) 3 a What is the biggest value in -0.4, -1.89, 46/3, 19, -3? 19 Which is the smallest value? (a) -0.0449 (b) -2 (c) -1 (d) -2452 d Which is the fourth smallest value? (a) 7 (b) -2 (c) -11/6845 (d) 0.3 a Which is the fifth smallest value? (a) 18 (b) 2/23 (c) 5 (d) -0.094 (e) -0.2 (f) -2/71 c What is the fourth smallest value in -0.1, -38.5, -4738, -24? -0.1 Which is the fifth smallest value? (a) 5 (b) -1/4 (c) -4952 (d) -13 (e) -2 (f) 2/3 (g) -3 b Which is the second smallest value? (a) -3688/59 (b) 0.4 (c) 180 (d) -0.3 d Which is the second biggest value? (a) 2 (b) -37.46844 (c) -0.1 c What is the biggest value in 112, -2/3, -8, -309? 112 What is the fourth biggest value in 4, 2, 0, 2/9, -163887? 0 Which is the biggest value? (a) -2 (b) -0.236 (c) 0.12 (d) -4489 c What is the smallest value in -10/3, 5353/2, -4? -4 Which is the sixth biggest value? (a) 2803 (b) 0.05 (c) 3 (d) 45 (e) -0.3 (f) -0.4 f What is the fourth biggest value in 5, 1, -72180/7, -0.0538? -72180/7 Which is the second biggest value? (a) 0.9 (b) -7/5 (c) 0.016792 c Which is the biggest value? (a) 11 (b) -7 (c) -6896/3 a What is the biggest value in 40, 4, -0.565, 0.718? 40 Which is the smallest value? (a) -0.14 (b) -5 (c) 97251.2 (d) 4/3 (e) -1 b What is the seventh biggest value in -0.0414, -0.5, 0.3, 37, -28/17, -5, -2/15? -5 Which is the fifth smallest value? (a) 3 (b) 33 (c) -2 (d) -11 (e) 1 (f) -1/28 a Which is the second smallest value? (a) 5 (b) 4 (c) -60 (d) -5565.6 (e) -2/17 c Which is the second biggest value? (a) -434/3 (b) 5/3 (c) 8/7 (d) -4 c What is the biggest value in -1, -5, 84, -6, 25.65? 84 What is the smallest value in 3/8, -58, -1, 5/2, 1.5, -4? -58 What is the second smallest value in -0.3, 2/3, -0.07, -1354.2, -4, 0.01? -4 Which is the fourth smallest value? (a) -5 (b) 17556363 (c) -1/7 (d) -2/3 b Which is the third smallest value? (a) 51/14 (b) 1/10 (c) 2/19 (d) 1 (e) -20 (f) -0.3 (g) -4 f Which is the sixth smallest value? (a) 54 (b) 0 (c) -27 (d) -6 (e) 2 (f) -0.127 a Which is the third smallest value? (a) -1.1 (b) 7 (c) 1 (d) 0.2 (e) -4/3 (f) 1/3 (g) -8 a Which is the third biggest value? (a) 4 (b) 0.5 (c) 0.1 (d) 2 (e) -1/253 (f) -38/13 b Which is the third smallest value? (a) -0.1 (b) -20/9 (c) 129 (d) 19 d Which is the second biggest value? (a) -2368 (b) -5 (c) 2 (d) -1/3 (e) -0.5 (f) 0 f Which is the fifth biggest value? (a) 93/4 (b) -405 (c) 2/5 (d) -3 (e) -433 e Which is the fourth biggest value? (a) 0 (b) -114 (c) 1/6 (d) 5/4 (e) -2/5 (f) 1/9820 a Which is the third smallest value? (a) 68.9 (b) 3/5 (c) 5 (d) -0.4 (e) -109 b What is the second smallest value in -150.689, 0.22, 4, 0, 2/11? 0 Which is the second biggest value? (a) 0.5 (b) -2/9421 (c) 256 (d) 2 d What is the third smallest value in 3/7, 2, -10672, 32? 2 Which is the third smallest value? (a) -9/2 (b) -2/9 (c) 4.3014 (d) -50 b What is the second smallest value in -3, -74, 13, -230? -74 Which is the third smallest value? (a) -2 (b) -2/9 (c) -6.071 (d) 0.2 (e) 9 (f) 20 b Which is the third biggest value? (a) -0.09 (b) -1/4 (c) -401826 c Which is the second biggest value? (a) 4/5 (b) -10/7 (c) 1/3416 (d) 0.2 (e) 2/7 e Which is the sixth smallest value? (a) 1/5 (b) 659 (c) 7 (d) 4 (e) -2/3 (f) -5 (g) 0.04 c
Let s = -1269 + 1294. What is the remainder when (9/(-2))/(1/(-22)) is divided by s? 24 Suppose 61 + 9 = 5i. Let f(v) = 3v*2 + 14v - 1. What is the remainder when i is divided by f(-5)? 2 Let r(u) = -u + 7. Let i be r(5). Suppose 45 = f + if. What is the remainder when 148 is divided by f? 13 Let v = -23 - -9. Let m = v - -24. Suppose -mi + 6i = -196. Calculate the remainder when i is divided by 26. 23 Suppose 3 + 18 = 3y. Suppose -4i = 3f - 47, -yf + 3f + 4i = -44. What is the remainder when ((-351)/(-45) - -6)/((-12)/(-20)) is divided by f? 10 Let w(h) = -h3 + 18h*2 - 14h + 12. What is the remainder when w(17) is divided by 17? 12 Let i = -83 - -103. Suppose 3a - p = 100, -3a + 80 = p - 6p. Suppose b - 1 = a. Calculate the remainder when b is divided by i. 16 Calculate the remainder when -13((-20)/4 - -4) is divided by 3. 1 Let s = 435 - 394. Calculate the remainder when 486/4 + (-3)/(-6) is divided by s. 40 Suppose 25v = 5g + 24v - 176, -5v - 52 = -2g. What is the remainder when 119 is divided by g? 11 Let h(d) = 29d + 236. Let i(v) = 2v - 5. Let p be i(4). Let l(w) = 2w*3 - 5w*2 + w + 2. Calculate the remainder when l(p) is divided by h(-8). 2 Suppose 2s = 3k + 3s - 416, -552 = -4k - 2s. Let l = k + -117. What is the remainder when 60 is divided by l? 14 Let n(p) = -6p2 + 76p - 37. What is the remainder when n(12) is divided by 8? 3 Suppose 340 + 52 = 5q + p, 5q - 5p = 380. Let c = 25 - 21. Suppose -cm - q = -10m. Calculate the remainder when m is divided by 8. 5 Suppose -6423 = -37v - 2279. What is the remainder when v is divided by 9? 4 Let t = -10 + 45. What is the remainder when 64 is divided by t? 29 Let y be 114 + 1(-1 - -1). Let n be (8/(-6))/((-6)/9). Suppose nr + y = 5r. Calculate the remainder when r is divided by 10. 8 Let f = 30 - 30. Suppose f = -5n + 55 + 145. What is the remainder when n is divided by 15? 10 Let u(h) = -h + 13. Let b be u(14). Let w be -41(b - 7). Suppose 5m + 3r = 3m + w, 2r = 0. Calculate the remainder when m is divided by 6. 4 Let d(z) = z*3 - 13z*2 - 50z + 37. What is the remainder when 16 is divided by d(16)? 1 Suppose 4k - 59 = 5u + 20, -5k + u = -83. Calculate the remainder when 396 is divided by k. 12 Let l = 147 + 165. What is the remainder when l is divided by 79? 75 Let q(n) = 4n*2 + n + 3. Calculate the remainder when 330 is divided by q(3). 36 Suppose 0 = -4c + 18 - 10. Let y be 3 + 1/c2. Suppose -2m = 8, 2m = -yl + 3 + 5. Calculate the remainder when 9 is divided by l. 1 Suppose 46u - 5579 = 125. Calculate the remainder when u is divided by 21. 19 Suppose 2v + 2n = -0n - 222, 2v - 5n + 229 = 0. Suppose -734z = -735z + 14. Calculate the remainder when v/(1 - 3) + -1 is divided by z. 13 Suppose -223 = -2q + t, 2t - 324 = 4q - 7q. Calculate the remainder when q is divided by 57. 53 Let m(l) = -l*3 + 17l*2 + 18l + 1. Let a be m(18). Let b = 24 - a. What is the remainder when b is divided by 4? 3 Suppose 4s + 3u - 20 = 0, -5s - 3u = -24 + 2. Let a(v) = 0 + 5v + 2v*3 - 7v + 0 - 2vs. Calculate the remainder when a(3) is divided by 11. 8 Suppose 3q + 5j = 776, -2j + 0 - 4 = 0. Suppose 0 = 3k - d - q, -304 = -3k + 4d - 48. What is the remainder when k is divided by 18? 16 Let u be 252/(-15) + 2/(-10). Let b = u - -29. Suppose 3i - b = -0i. Calculate the remainder when 6 is divided by i. 2 Suppose 972 = 31d - 25d. Calculate the remainder when d is divided by 15. 12 What is the remainder when 486 is divided by ((-70)/4)/(456/(-32) - -14)? 66 Let i(l) = -l3 - 2l*2 - 2l - 6. Let n be i(4). Let a = n - -202. Calculate the remainder when a is divided by 16. 12 Suppose 0 = 5q - 2i - 283, 6q - 3q + 2i = 173. What is the remainder when q is divided by 23? 11 Let x(c) be the second derivative of c5/10 + c4/12 + c3/3 - 3c*2/2 - 10c. What is the remainder when x(2) is divided by 12? 9 Let n(u) = -2 - u*3 + 4u - 4u2 - 2u*3 + 2u*3. Suppose -11y + 6y + 30 = -l, -2l = 2y. Calculate the remainder when y is divided by n(-5). 2 Suppose 13o = 54 + 180. Suppose -2k = 3k + 5. Let z = o - k. Calculate the remainder when 56 is divided by z. 18 Calculate the remainder when 1/6 + (-8077)/(-246) is divided by 14. 5 Let x be ((-2)/6)/((-2)/(-6)). Let t(s) be the second derivative of 7s4/6 - s3/3 - s2/2 - 4s. What is the remainder when t(x) is divided by 4? 3 Suppose -5x + 111 = 4v, -x = -3x - 2. Let h = -179 + 195. What is the remainder when v is divided by h? 13 Suppose -2u + 32 = 2p, 5p = 4p + 2u + 13. What is the remainder when p is divided by (9/(-12))/(2/(-24))? 6 Suppose -8p + 190 = -66. What is the remainder when p is divided by 50/3 + 3/9? 15 Let o be (40/60)/((-4)/(-18)). Suppose -208 = -ok - k. Calculate the remainder when k is divided by 14. 10 Let k(u) = 17u2 + u. Suppose 4 = -d - 0. Calculate the remainder when k(1) is divided by 10/(-40) + (-21)/d. 3 Let q be (-1)/(-3) + (-475)/57. Let w(n) = -n3 - 10n*2 - 19n - 10. Calculate the remainder when w(q) is divided by 8. 6 Suppose 0 = 4z + 3f + 56, 4f = -z - z - 28. Suppose -h + 13 = 5q - 22, 2h - 3q - 44 = 0. What is the remainder when 21/z94/(-3) is divided by h? 22 Suppose 0 = -3b - 1 + 7. Suppose 2c = 2x - 20, 2c = 2x + bx - 32. What is the remainder when 2/(((-15)/24)/(-5)) is divided by x? 4 Let i = 4 + -11. Calculate the remainder when 45 + i/(35/(-10)) is divided by 10. 7 Suppose -33 - 59 = -4t. Let p(m) = -m*2 + 7m + 6. Suppose c - 6c - 4n = -19, -25 = -3c + n. What is the remainder when t is divided by p(c)? 5 Let d = -978 + 1391. Suppose 21x = 406 + d. What is the remainder when 192 is divided by x? 36 Suppose -8u + 45 = b - 3u, -2b + 5u = -150. Calculate the remainder when 215 is divided by b. 20 Suppose 0 = -2y - s + 6s - 177, 0 = -3y - 4s - 300. Calculate the remainder when 99 is divided by 11/(-3) - 2432/y. 24 Let t = 19 - 66. Let w = -39 - t. Calculate the remainder when w is divided by 5. 3 Suppose 2d = d + 6. Let o = -27 + 41. What is the remainder when o is divided by d? 2 Suppose -44v - 591 = -47v. What is the remainder when v is divided by 20? 17 Suppose -277 = -3w + 4x - 0x, 2x = 5w - 443. Let b = -75 + w. Calculate the remainder when 23 is divided by b. 11 Let d(g) = g + 3. Let m = 126 - 117. Calculate the remainder when d(14) is divided by m. 8 Let w(f) = -f3 + 4f*2 - 3f + 4. Let y be w(3). Suppose 19 = 5z + y, -3z = 2k - 17. Calculate the remainder when 19 is divided by k. 3 Let t be (-5)/25 + (-3296)/20. Calculate the remainder when 7 is divided by t/(-60) + (-2)/(-8). 1 Let h(n) = n3 + 6n*2 - 10n - 17. Let u be h(-7). Suppose 3m = uv + m - 54, 5v + 4m = 74. What is the remainder when 96 is divided by v? 12 Suppose 0 = -40a + 34a + 234. Let h = 69 - a. Calculate the remainder when 148 is divided by h. 28 Suppose 4w + 5h = -12, 0h + 14 = 5w - h. Let i = 7 - 7. Suppose i = wp - 3n - 152, 0p = -p + 3n + 73. What is the remainder when p is divided by 20? 19 Suppose 4k + 4x = 18 + 10, -5k = -3x - 51. Let f = 1 + k. Let n = 3289 - 3272. Calculate the remainder when n is divided by f. 7 Let v(z) = z*3 + 8z*2 - 8z - 32. What is the remainder when v(-6) is divided by 27? 7 Suppose -10 = -4l + 5l. Let f = l - -17. What is the remainder when 17 is divided by f? 3 Let q(g) = g*3 - 4g*2 + 9g - 11. What is the remainder when q(6) is divided by -42(-2 + 1) - 3? 37 Suppose 4a + 48 = 2d - 0d, 108 = 4d - 4a. Let w = -30 + d. Suppose w = -7p + 8p - 24. Calculate the remainder when p is divided by 9. 6 Let u be -1 + 2 - (-18 - -19). What is the remainder when (-1 - u)/(((-21)/(-66))/(-7)) is divided by 8? 6 What is the remainder when 229 is divided by -4 + 3 - 4 - (-27 + 1)? 19 Let f = -145 + 100. What is the remainder when 166 is divided by ((-210)/f)/((-38)/(-18) + -2)? 40 Let q = -304 + 332. What is the remainder when q is divided by 3? 1 Suppose -25 = -2c + 3. Let z be -9 + 6 + 1 + 0 - -216. Suppose z - 6 = 8i. Calculate the remainder when i is divided by c. 12 Let x(o) = o3 - o2 - 5. What is the remainder when x(4) is divided by 17 + (7 + 3)((-2)/4 - -1)? 21 Let p = -31 + 38. Suppose -5h + 85 = -0h. What is the remainder when h is divided by (-100)/(-35)p/2? 7 Let v = -511 - -517. Calculate the remainder when 19 is divided by v. 1 Let d be 2/5 + (-69)/(-15). Suppose i - 497 = -dx, 1 = -3i - 8. Suppose -6y + x = -2y. Calculate the remainder when 49 is divided by y. 24
Calculate the remainder when 18 is divided by 18. 0 What is the remainder when 758 is divided by 24? 14 What is the remainder when 1216 is divided by 111? 106 What is the remainder when 111 is divided by 34? 9 Calculate the remainder when 1695 is divided by 16. 15 Calculate the remainder when 272 is divided by 21. 20 Calculate the remainder when 149 is divided by 19. 16 Calculate the remainder when 1258 is divided by 63. 61 Calculate the remainder when 73 is divided by 6. 1 Calculate the remainder when 1212 is divided by 23. 16 What is the remainder when 38308 is divided by 10? 8 What is the remainder when 543 is divided by 32? 31 Calculate the remainder when 190 is divided by 24. 22 What is the remainder when 34 is divided by 25? 9 What is the remainder when 103 is divided by 30? 13 Calculate the remainder when 3021 is divided by 121. 117 What is the remainder when 746 is divided by 108? 98 What is the remainder when 1825 is divided by 83? 82 Calculate the remainder when 116 is divided by 19. 2 What is the remainder when 4472 is divided by 2233? 6 What is the remainder when 151 is divided by 4? 3 Calculate the remainder when 611 is divided by 300. 11 Calculate the remainder when 3418 is divided by 681. 13 What is the remainder when 1759 is divided by 14? 9 Calculate the remainder when 67 is divided by 12. 7 Calculate the remainder when 2730 is divided by 94. 4 What is the remainder when 1435 is divided by 631? 173 Calculate the remainder when 1078 is divided by 31. 24 Calculate the remainder when 609 is divided by 60. 9 Calculate the remainder when 81 is divided by 21. 18 Calculate the remainder when 215 is divided by 196. 19 What is the remainder when 514 is divided by 37? 33 Calculate the remainder when 172 is divided by 23. 11 Calculate the remainder when 160 is divided by 48. 16 Calculate the remainder when 1594 is divided by 321. 310 What is the remainder when 797 is divided by 7? 6 What is the remainder when 427 is divided by 345? 82 Calculate the remainder when 124 is divided by 40. 4 What is the remainder when 765 is divided by 55? 50 Calculate the remainder when 3343 is divided by 124. 119 Calculate the remainder when 85 is divided by 22. 19 What is the remainder when 2781 is divided by 121? 119 Calculate the remainder when 171 is divided by 85. 1 What is the remainder when 53 is divided by 36? 17 What is the remainder when 167 is divided by 28? 27 Calculate the remainder when 1358 is divided by 90. 8 Calculate the remainder when 258 is divided by 24. 18 Calculate the remainder when 673 is divided by 3. 1 What is the remainder when 2393 is divided by 477? 8 Calculate the remainder when 7107 is divided by 4. 3 What is the remainder when 7 is divided by 1? 0 What is the remainder when 107 is divided by 16? 11 Calculate the remainder when 110 is divided by 105. 5 What is the remainder when 2131 is divided by 22? 19 What is the remainder when 99 is divided by 8? 3 Calculate the remainder when 652 is divided by 163. 0 What is the remainder when 2363 is divided by 472? 3 Calculate the remainder when 1122 is divided by 5. 2 What is the remainder when 315 is divided by 291? 24 What is the remainder when 55 is divided by 20? 15 Calculate the remainder when 121 is divided by 46. 29 Calculate the remainder when 17854 is divided by 48. 46 What is the remainder when 456 is divided by 125? 81 Calculate the remainder when 1741 is divided by 87. 1 What is the remainder when 671 is divided by 25? 21 What is the remainder when 2017 is divided by 58? 45 What is the remainder when 227 is divided by 57? 56 What is the remainder when 139 is divided by 5? 4 Calculate the remainder when 285 is divided by 22. 21 Calculate the remainder when 718 is divided by 181. 175 Calculate the remainder when 14 is divided by 8. 6 Calculate the remainder when 4114 is divided by 179. 176 What is the remainder when 271 is divided by 68? 67 What is the remainder when 312 is divided by 282? 30 What is the remainder when 270 is divided by 39? 36 Calculate the remainder when 137 is divided by 7. 4 What is the remainder when 57 is divided by 39? 18 What is the remainder when 246 is divided by 29? 14 What is the remainder when 159 is divided by 63? 33 Calculate the remainder when 6629 is divided by 30. 29 Calculate the remainder when 949 is divided by 122. 95 What is the remainder when 44 is divided by 17? 10 Calculate the remainder when 224 is divided by 41. 19 Calculate the remainder when 649 is divided by 81. 1 What is the remainder when 629 is divided by 36? 17 Calculate the remainder when 166 is divided by 66. 34 Calculate the remainder when 263 is divided by 47. 28 Calculate the remainder when 75 is divided by 8. 3 Calculate the remainder when 101 is divided by 37. 27 What is the remainder when 87 is divided by 11? 10 What is the remainder when 4839 is divided by 4815? 24 What is the remainder when 368 is divided by 13? 4 Calculate the remainder when 397 is divided by 31. 25 Calculate the remainder when 273 is divided by 94. 85 Calculate the remainder when 526 is divided by 134. 124 What is the remainder when 1698 is divided by 27? 24 Calculate the remainder when 256 is divided by 124. 8 What is the remainder when 8290 is divided by 2759? 13 Calculate the remainder when 37 is divided by 15. 7 What is the remainder when 752 is divided by 54? 50 What is the remainder when 197 is divided by 62? 11 Calculate the remainder when 22149 is divided by 156. 153 Calculate the remainder when 6524 is divided by 136. 132 Calculate the remainder when 822 is divided by 11. 8 Calculate the remainder when 11340 is divided by 667. 1 What is the remainder when 429 is divided by 89? 73 Calculate the remainder when 2865 is divided by 92. 13 Calculate the remainder when 360 is divided by 141. 78 What is the remainder when 419 is divided by 54? 41 What is the remainder when 4132 is divided by 6? 4 Calculate the remainder when 1234 is divided by 77. 2 Calculate the remainder when 112 is divided by 31. 19 What is the remainder when 202 is divided by 68? 66 What is the remainder when 1403 is divided by 38? 35 Calculate the remainder when 813 is divided by 51. 48 Calculate the remainder when 2911 is divided by 421. 385 Calculate the remainder when 381 is divided by 161. 59 What is the remainder when 3545 is divided by 52? 9 What is the remainder when 42 is divided by 17? 8 What is the remainder when 1278 is divided by 20? 18 Calculate the remainder when 487 is divided by 237. 13 What is the remainder when 134 is divided by 9? 8 What is the remainder when 82 is divided by 24? 10 What is the remainder when 271 is divided by 70? 61 Calculate the remainder when 210 is divided by 107. 103 Calculate the remainder when 293 is divided by 5. 3 Calculate the remainder when 108 is divided by 92. 16 What is the remainder when 447 is divided by 70? 27 Calculate the remainder when 339 is divided by 71. 55 Calculate the remainder when 504 is divided by 124. 8 Calculate the remainder when 428 is divided by 48. 44 What is the remainder when 69 is divided by 14? 13 What is the remainder when 1292 is divided by 36? 32 What is the remainder when 8423 is divided by 54? 53 Calculate the remainder when 105 is divided by 27. 24 What is the remainder when 972 is divided by 322? 6 What is the remainder when 391 is divided by 33? 28 Calculate the remainder when 79 is divided by 43. 36 Calculate the remainder when 2540 is divided by 23. 10 Calculate the remainder when 187 is divided by 28. 19 What is the remainder when 1063 is divided by 56? 55 Calculate the remainder when 3093 is divided by 18. 15 What is the remainder when 58 is divided by 31? 27 What is the remainder when 9004 is divided by 19? 17 What is the remainder when 554 is divided by 269? 16 What is the remainder when 486 is divided by 62? 52 Calculate the remainder when 966 is divided by 187. 31 Calculate the remainder when 186 is divided by 163. 23 What is the remainder when 66 is divided by 30? 6 What is the remainder when 48 is divided by 22? 4 Calculate the remainder when 5983 is divided by 95. 93 What is the remainder when 199 is divided by 36? 19 What is the remainder when 42633 is divided by 38? 35 Calculate the remainder when 26396 is divided by 197. 195 Calculate the remainder when 256 is divided by 137. 119 What is the remainder when 51 is divided by 23? 5 Calculate the remainder when 1951 is divided by 386. 21 Calculate the remainder when 891 is divided by 80. 11 Calculate the remainder when 3093 is divided by 1019. 36 What is the remainder when 534 is divided by 142? 108
Four letters picked without replacement from vcwvwxxxwuxqvvv. What is prob of picking 3 x and 1 c? 4/1365 Three letters picked without replacement from iuiuuueiiuu. What is prob of picking 2 u and 1 i? 4/11 What is prob of picking 4 t when four letters picked without replacement from {u: 1, t: 18}? 15/19 Three letters picked without replacement from qqlssqss. Give prob of picking 3 s. 1/14 Calculate prob of picking 2 o when two letters picked without replacement from toxko. 1/10 Four letters picked without replacement from eezeezeeee. What is prob of picking 2 e and 2 z? 2/15 What is prob of picking 2 s when two letters picked without replacement from {g: 5, w: 2, s: 2}? 1/36 Two letters picked without replacement from suxsslssfffss. What is prob of picking 1 s and 1 x? 7/78 Four letters picked without replacement from {v: 5, z: 5, i: 3}. What is prob of picking 2 v and 2 i? 6/143 Two letters picked without replacement from {i: 2, l: 1, q: 3, x: 3, u: 1}. What is prob of picking 1 l and 1 q? 1/15 What is prob of picking 1 o and 1 t when two letters picked without replacement from ozohzmotohhzoho? 2/35 Three letters picked without replacement from gdkd. What is prob of picking 2 d and 1 k? 1/4 Two letters picked without replacement from dkyd. Give prob of picking 2 d. 1/6 What is prob of picking 2 x and 1 m when three letters picked without replacement from {r: 1, m: 2, d: 1, x: 4, w: 1}? 1/7 What is prob of picking 2 i and 1 n when three letters picked without replacement from {h: 2, n: 1, i: 2}? 1/10 Two letters picked without replacement from {l: 1, o: 2, n: 5, q: 1}. What is prob of picking 1 l and 1 q? 1/36 What is prob of picking 1 t, 1 l, 1 e, and 1 o when four letters picked without replacement from floefto? 2/35 What is prob of picking 3 v when three letters picked without replacement from {b: 15, v: 4}? 4/969 Calculate prob of picking 2 f when two letters picked without replacement from {h: 3, c: 2, o: 1, f: 5, d: 1}. 5/33 Four letters picked without replacement from {m: 1, e: 9, q: 6, h: 2, t: 1}. What is prob of picking 2 q, 1 t, and 1 h? 5/646 Calculate prob of picking 1 n and 1 h when two letters picked without replacement from ahmamhhmhaasahnna. 5/68 Three letters picked without replacement from {g: 3, w: 2, j: 1, h: 1}. What is prob of picking 2 g and 1 h? 3/35 Three letters picked without replacement from {n: 1, q: 1, a: 1, p: 1, v: 2, z: 1}. What is prob of picking 1 n, 1 p, and 1 z? 1/35 Three letters picked without replacement from {d: 4, s: 4, m: 11}. Give prob of picking 3 m. 55/323 Calculate prob of picking 1 p, 1 i, and 1 s when three letters picked without replacement from {p: 1, i: 3, w: 1, d: 3, s: 11}. 11/323 Two letters picked without replacement from miujmu. Give prob of picking 1 i and 1 u. 2/15 Calculate prob of picking 2 j when two letters picked without replacement from {d: 9, g: 2, j: 5}. 1/12 Four letters picked without replacement from fvvvvfjufhf. What is prob of picking 1 v, 1 f, 1 u, and 1 j? 8/165 What is prob of picking 1 n and 1 q when two letters picked without replacement from izizinqzqz? 2/45 Calculate prob of picking 3 j when three letters picked without replacement from {j: 5, b: 1, e: 1, r: 1, c: 1}. 5/42 Two letters picked without replacement from nwcly. What is prob of picking 1 n and 1 w? 1/10 What is prob of picking 1 q and 1 x when two letters picked without replacement from pxqqxaxqxaxpaxaal? 9/68 Four letters picked without replacement from {j: 2, c: 7, w: 1, t: 3, z: 1}. What is prob of picking 1 w, 2 j, and 1 z? 1/1001 What is prob of picking 2 g when two letters picked without replacement from {w: 4, g: 16}? 12/19 Calculate prob of picking 2 p and 1 l when three letters picked without replacement from {l: 5, p: 11}. 55/112 Three letters picked without replacement from uuazaauzuuaaazzzuzu. What is prob of picking 1 z and 2 u? 42/323 Calculate prob of picking 2 f when two letters picked without replacement from {p: 1, c: 1, n: 1, e: 1, f: 2, z: 2}. 1/28 Two letters picked without replacement from mmxmmwybbm. Give prob of picking 1 m and 1 w. 1/9 Two letters picked without replacement from {w: 1, r: 2, d: 2, e: 8, l: 4, j: 3}. Give prob of picking 1 e and 1 l. 16/95 Four letters picked without replacement from ididiiiiidii. Give prob of picking 3 d and 1 i. 1/55 Calculate prob of picking 3 s and 1 u when four letters picked without replacement from wuswwss. 1/35 Calculate prob of picking 2 p when two letters picked without replacement from apyypafaypy. 3/55 Two letters picked without replacement from {c: 7, s: 5, t: 1, o: 6}. Give prob of picking 1 s and 1 t. 5/171 Two letters picked without replacement from vbbbbvvbvv. Give prob of picking 2 v. 2/9 Two letters picked without replacement from zedeeeeeeeeeeeeeeee. What is prob of picking 1 d and 1 e? 17/171 Two letters picked without replacement from {u: 1, r: 5, j: 1, x: 3, c: 1}. Give prob of picking 1 r and 1 u. 1/11 Two letters picked without replacement from {f: 4, o: 2, m: 4, i: 1}. Give prob of picking 1 i and 1 m. 4/55 What is prob of picking 1 a and 3 v when four letters picked without replacement from {a: 1, v: 18}? 4/19 Calculate prob of picking 1 t and 1 a when two letters picked without replacement from paeastet. 1/7 Two letters picked without replacement from ttttttt. What is prob of picking 2 t? 1 Four letters picked without replacement from bbzbddbdblbbbbbbbblo. What is prob of picking 3 b and 1 z? 286/4845 Two letters picked without replacement from zzzzzzzgzmeezzgz. What is prob of picking 1 z and 1 e? 11/60 What is prob of picking 2 k when two letters picked without replacement from {k: 10}? 1 Four letters picked without replacement from rvvbvbiviib. What is prob of picking 1 b, 2 v, and 1 i? 9/55 Calculate prob of picking 1 k and 1 n when two letters picked without replacement from {a: 7, n: 5, k: 7}. 35/171 Two letters picked without replacement from ubmmxggj. What is prob of picking 1 m and 1 g? 1/7 Four letters picked without replacement from bgzzbzbz. Give prob of picking 3 b and 1 z. 2/35 Two letters picked without replacement from wdwbdddbbdglbbdbld. Give prob of picking 1 g and 1 w. 2/153 What is prob of picking 2 r and 1 l when three letters picked without replacement from rqldqrdrrrrqrqrgq? 7/170 Calculate prob of picking 2 v and 1 p when three letters picked without replacement from {l: 5, p: 4, s: 4, v: 3}. 3/140 Calculate prob of picking 2 z when two letters picked without replacement from {x: 1, z: 5, o: 3, t: 4}. 5/39 What is prob of picking 1 y and 1 z when two letters picked without replacement from {h: 5, u: 1, y: 5, j: 4, z: 1}? 1/24 Calculate prob of picking 2 t when two letters picked without replacement from {r: 1, n: 5, q: 1, t: 3, k: 2}. 1/22 Calculate prob of picking 1 m and 1 y when two letters picked without replacement from {y: 6, r: 3, h: 2, m: 2, k: 3}. 1/10 Calculate prob of picking 1 p and 3 e when four letters picked without replacement from eeeereeeeeepepp. 33/91 What is prob of picking 1 y, 1 w, and 1 s when three letters picked without replacement from {m: 3, h: 3, w: 2, s: 2, y: 4, j: 2}? 1/35 Three letters picked without replacement from {j: 11, q: 2}. What is prob of picking 1 j and 2 q? 1/26 Calculate prob of picking 2 j and 1 l when three letters picked without replacement from lllllllllljlljlllll. 1/57 What is prob of picking 1 q, 1 j, 1 e, and 1 f when four letters picked without replacement from effjfffjyeqjyeeefyf? 35/1292 Two letters picked without replacement from {o: 6}. Give prob of picking 2 o. 1 Four letters picked without replacement from {m: 2, f: 2, c: 1, v: 3, j: 6}. What is prob of picking 2 v and 2 m? 3/1001 Four letters picked without replacement from bfzawwzhfwfw. What is prob of picking 1 w, 1 h, and 2 z? 4/495 Two letters picked without replacement from oioxivi. Give prob of picking 2 v. 0 Two letters picked without replacement from {n: 3, v: 13, a: 1, y: 3}. What is prob of picking 1 v and 1 a? 13/190 Calculate prob of picking 2 d and 1 f when three letters picked without replacement from fdddpdddfdfpdfdfdppf. 9/38 Two letters picked without replacement from zizizzi. What is prob of picking 2 i? 1/7 Four letters picked without replacement from {d: 1, h: 2, s: 2}. What is prob of picking 1 d, 1 s, and 2 h? 2/5 Two letters picked without replacement from {h: 1, s: 2, q: 4, v: 1, y: 2}. Give prob of picking 1 v and 1 q. 4/45
Let k = 1.5 - 2.3. Let i = k - -1.1. What is the second smallest value in 5/2, -2/13, i? i Let j be ((-7915547)/(-11922))/((-190)/(-18)). Let b = j + -2/188765. Let d = b - 63. What is the biggest value in d, -5, 1/4? 1/4 Let j be 1 - 2 - 24/(-9). Which is the second biggest value? (a) j (b) 0 (c) -4/5 b Suppose 5m = 4m + 15. Suppose 2j = 3j + 12. Let k be (2/(-12))/(m/j). Which is the third smallest value? (a) -1/5 (b) k (c) 3/5 c Let u = 23.845 + 0.255. Let h = u + -24. Which is the second biggest value? (a) 2/13 (b) -0.4 (c) h c Let t be ((-2)/5)/((-3)/30). Let p be ((-2)/12)/((-2)/6). Let b = 4.3 - -0.7. What is the second biggest value in b, p, t? t Let x = -6.4 - -6. Which is the third smallest value? (a) -0.1 (b) -9/2 (c) x a Let w = -78 - -74. What is the third smallest value in w, -0.2, 1/4, -2/3? -0.2 Suppose -27x = -29x + 2. What is the second smallest value in -2, x, -5/2? -2 Let m = -4.19 - -1.3. Let n = -0.11 + m. Let u = 0 - 2. Which is the third biggest value? (a) u (b) -0.3 (c) n c Let x be (-4)/6 + (-34)/(-6). Let u(h) = 7h2 - 5h - 2. Let v be u(x). Let s = 597/4 - v. Which is the second smallest value? (a) 1 (b) s (c) -0.1 a Suppose 5h - 5l = -25, l - 1 = -h - 4. What is the second biggest value in -0.08, h, 2/5? -0.08 Suppose -5c = -21c. What is the biggest value in -0.03, c, -5? c Let g = -96 + 83.4. Let y = g - -13. Which is the second biggest value? (a) -2/5 (b) -1 (c) y a Let z be (-75)/(-12) + 1/(-4). Suppose z = -0g - 3g. What is the second biggest value in 2/15, g, 1? 2/15 Suppose -5g = -2i + 21, g + 11 = -2i - i. Which is the smallest value? (a) i (b) 4 (c) -0.5 a Let n = 2 + 2. Let g be (-4)/18 - (-615)/945. Which is the second smallest value? (a) -0.4 (b) n (c) g c Let t be (1 + 21/6)(-4)/6. What is the fourth biggest value in 1, -0.5, t, 2? t Let o be 3/6-4 - -6. Let u be (-1 - o)(3 + -2). Which is the third biggest value? (a) u (b) 3 (c) -4 a Let t = 26 - 28. What is the second biggest value in 0, t, 1/8? 0 Suppose 5x - 8 - 7 = 0. Suppose xd - 10 = 5d. What is the second biggest value in d, -2, 0.3? -2 Let m = -26.1 - -26. Suppose 2v + 3o + 5 = 3, 3v - 7 = -2o. Which is the second biggest value? (a) m (b) 4 (c) v b Let g(o) = o + 1. Let b be g(-3). Let x = -8 - b. Let i be (2/18)/(x/(-18)). What is the second biggest value in -3, i, 4? i Let u be ((-2)/1332)/((-3)/417). Let n = -1/74 - u. What is the smallest value in -1/3, n, 0.2? -1/3 Let u = 312/5 - 62. Which is the biggest value? (a) u (b) -1/5 (c) 1.1 (d) -0.4 c Let n = 0.6 + -0.5. What is the second biggest value in n, -3, -1/3? -1/3 Let o = -1.4 - -1.2. Suppose -2n - 2 = -4. What is the third smallest value in n, 2/9, o? n Let s = 3.05 + 0.35. Let p = s + -3. Which is the third biggest value? (a) p (b) -0.3 (c) 5 b Let f = -19.4 + 18. Let s = f - -1.4. What is the second smallest value in -3, -2/5, s? -2/5 Let q = 0.15 + -0.08. Let p = -5.07 + q. Let s(c) = -c*3 + 14c*2 - 14c + 9. Let t be s(13). What is the second biggest value in t, p, 1/3? t Let y = 0.1 + -2.5. Let i = 0.6 - y. Let k = -1.1 - -5.1. Which is the second smallest value? (a) k (b) i (c) -0.3 b Let z = 0.1 + -5.1. Let o = 75 + -75.3. Which is the third smallest value? (a) o (b) 0.3 (c) z b Let t = 3.6 - -1.4. What is the second biggest value in 2, 0, t? 2 Let j = 0.17 + -0.47. Let i = 2.04 - 0.04. Which is the second smallest value? (a) j (b) i (c) -5 a Let r(p) = -p. Let y be r(-6). Let q be 16 + (-4)/y-3. Let v be 1/(-2) + q/60. Which is the smallest value? (a) v (b) 4 (c) -3/4 c Let c = 148/5 + -29. Let j = -5 + 3. What is the third biggest value in j, c, -4? -4 Suppose 4n + m + 493 = -155, 0 = 5n + 3m + 803. Let l = n + 2447/15. Let s be 0 + 3/(-24)-2. What is the third smallest value in s, 1/5, l? s Suppose 0 = 3q + 2q. Suppose qa = -5a + 25. What is the biggest value in a, 3, 2? a Let f = -0.2 + 0.6. Let r be 4-13/(-36). Which is the third biggest value? (a) -0.5 (b) f (c) r a Let f be (-84)/(-45) - 8/12. What is the third biggest value in -5, 0.05, 1/5, f? 0.05 Let x = -0.045 - 0.055. Which is the second biggest value? (a) -1/2 (b) -0.05 (c) x c Let w = -2 + 1.6. Let d = 0.27 + -1.27. Which is the second smallest value? (a) 1/7 (b) d (c) w c Let s = 2 + -2.2. Let j = 4 - 4.3. Which is the smallest value? (a) j (b) s (c) 1/2 a Let m be (8/(-7))/(30/45). What is the second biggest value in m, -0.1, 1? -0.1 Let h = 36 - 35. Which is the second smallest value? (a) -3 (b) 2 (c) h c Let j be (-1)/20(-4)/(-2). Let i = -3/20 + j. What is the biggest value in 5, -1/9, i? 5 Let q = 10 - 10. Which is the third biggest value? (a) -0.12 (b) q (c) -0.1 a Let r = 3 - -2. What is the second smallest value in 4, -1, r? 4 Let c = -37 - -39. What is the second smallest value in c, 1, 3? c Let o be -2 - 0/(-3) - -2. Suppose o = -u + 1 + 3. Let f = -82 + 161/2. Which is the third biggest value? (a) f (b) u (c) 1 a Let v(z) = z + 2. Let i be 63/(-12) - 1/(-4). Let f be v(i). Which is the smallest value? (a) -5 (b) f (c) 4 a Let v = 31 - 21. Let y = v + -7. Let f = y - 3.1. Which is the biggest value? (a) -1/3 (b) -4/7 (c) f c Let s = -0.38 - 0.02. Let a = -0.28 - -0.58. What is the biggest value in -3, a, s? a Let a = -1 - -8. Let q = -9 + a. What is the smallest value in 4, q, 1? q Let c = -3.7 - 0.3. What is the third smallest value in -5, c, 20? 20 Let g be (-5)/10 - (-14)/8. What is the third biggest value in 2, g, -1/4? -1/4 Let x = 0.2 + -0.3. Which is the second smallest value? (a) -2 (b) -3 (c) x a Let r = 29.7 + -30. Which is the third smallest value? (a) -1/2 (b) r (c) -7 b Let o = -23/6 - -10/3. Let q = 2/107 + 196/963. What is the third smallest value in -4, o, q? q Suppose 6o - 8o - 18 = 0. Let x(y) = y*2 + 10y - 3. Let p be x(o). Let n be (1/(-2))/(14/p). Which is the third smallest value? (a) n (b) 1/5 (c) 0.3 a Let o = 189 - 207.7. Let v = o + 18. Which is the second biggest value? (a) -4 (b) v (c) 1/3 b Suppose -5m = 2x - 10, 0 = 3m - 6m. Which is the biggest value? (a) x (b) 0.5 (c) -0.2 a Let s(u) = 3u2 + 6u - 4. Let y be s(-3). What is the third biggest value in 5/13, -5, y, 4? 5/13 Suppose 4i + 112 = 4k, k + 5i - 14 = 14. Let p be -2 - k/(-10) - 1. Let m = 2 - 1. Which is the second smallest value? (a) m (b) 3 (c) p a Suppose -n + 10 = r - 3n, 5r - 6 = -n. Let f(x) = x3 + x2 - x - 1. Let y be f(0). What is the smallest value in y, r, 0? y Let g be 2/(-1 - 0/(-3)). Let i be (3 + g)(-24)/(-6). Which is the smallest value? (a) i (b) -2 (c) -2/17 b Let m = 4 + -4.5. Let o be 2/(-5)4/(-8). What is the third smallest value in -5, o, m? o Let z be 2/6 - 1/6. Let k be 16/(-20) - 26/(-45). What is the third smallest value in 0.1, z, k? z Let r = 0.05 - 0.05. Suppose -2y = 3m - 4y + 23, 3m - 3y = -27. What is the second biggest value in m, r, 0.3? r Let x = 47/390 + 3/65. Which is the fourth smallest value? (a) 2 (b) x (c) 2/13 (d) 1/2 a Let r = 3.5 + -3. Let h = 4 + 0. Which is the third smallest value? (a) h (b) r (c) -2 a Let s = -0.027 - -0.027. Let x = 1.9 + -2. What is the biggest value in s, x, 4/9? 4/9 Let x = -2/7 - 11/35. What is the fourth biggest value in -1/4, x, 3, 0? x Let f = 11.3 + 1.7. Let x = f - 7. Let g = 6.3 - x. Which is the biggest value? (a) -0.2 (b) -1 (c) g c Let m be (15-1)/(1 + -18). Let g = m - 79/51. What is the second biggest value in -0.5, -4, g? g Suppose 2y = 6y - 8. Let f be y(9/(-2))/3. Which is the smallest value? (a) 0 (b) -4 (c) f b Let q be ((-1)/204)/((-1)/(-2)). Let m = q + 3/17. Suppose -120s = -123s + 3o, 2o = -4s + 18. Which is the biggest value? (a) 2/3 (b) s (c) m b Let m = 2 - 2.1. Let r = -11 + 14. Let g = -2 - r. Which is the third smallest value? (a) g (b) 4/5 (c) m b Let p = 0 + 0.2. Let r = p - 1.2. Let k = r - -0.9. What is the smallest value in -3/2, 0.5, k? -3/2 Let i = -2.1 + 2. Let q = 12 + -14.5. Let l = q - -0.5. What is the third biggest value in l, i, 0.3? l Let h = 0.09 - -4.91. Which is the second smallest value? (a) 0.05 (b) 2 (c) h b Let o(x) = -3x. Let n be o(1). Which is the third smallest value? (a) -0.2 (b) -3/7 (c) n a Let x(y) = -2y + 2. Let t be x(-8). Let l be (2/(-30))/((-6)/t). What is the second biggest value in 5, 0.5, l? 0.5 Suppose -36 = -6y + 9*y. What is the biggest value in 0.1, y, 1/5? 1/5
Evaluate (16/192)/((-45)/(-450)). 5/6 Evaluate (59139/13142)/((-18)/92). -23 Evaluate ((-162)/40014)/(8/48)(-312)/18. 8/19 What is the value of (5/(-8))/(1010/(-2424))(-252)/(-3969)? 2/21 What is the value of (((-3336375)/420)/(-155))/((-5)/(-4))? 41 What is the value of ((-24)/(-36))/((-405)/(-486)(-1)/20)? -16 Evaluate (15/(-36))/(((-36)/21840-7)/(30/(-125))). 26/3 (2421/(-336))/((126/(-644))/3) 23 What is -2(-357)/(-612)30? -35 ((-21)/6)/((-1554)/(1369/37)) 1/12 Calculate (-2193)/430025(-16)/6. 34 (-33)/(-22)(-440)/(-2046) 10/31 (12678/(-44373))/((-16)/42) 3/4 Calculate ((-5)/130)/((-513)/973674). 73 Calculate (8/252)/((-40)/112(-448)/280). 1/18 What is (-954756)/50631035/(-3)? 22 What is (-98368)/(-45792)(-81)/(-6)? 29 What is (-88)/6147/(-490)-5? -22 What is 14/(-2)(24050/(-1365))/185? 2/3 Evaluate ((-1302)/(-1519))/((-26)/((-6552)/(-81))). -8/3 Calculate (-1402198)/10655(-15)/42. 47 What is (156/4680)/(5/50)(-102)/(-2)? 17 What is 2332/371(-721)/412? -11 Calculate (46/(-1196))/(((-24)/(-18))/(156/(-36))). 1/8 What is 20/12(-7383)/535? -23 Evaluate ((-896)/2184)/81/(-6)54/12. 1/26 What is ((-5412)/(-15))/11(20/42)/((-1580)/2765)? -82/3 Calculate ((-1958)/(-356))/(5/40-4). -11 What is ((-172160)/12912)/(315)? -8/27 What is (2/10-68)/(-11462/(-1815))? -34/7 Evaluate ((-113)/(25425/(-90)))/(4284/(-105)). -1/102 What is the value of ((-69)/184)/((-2355)/20096)? 16/5 What is the value of (-12)/((17324/(-549))/71)? 27 Calculate 28/21(15912/(-16))/39. -34 What is 2037/(-1480)-3((-3416)/12)/(-7)? 61 (-2)/(38/(-95))-3(-4)/(-20) -3 Calculate (56/40)/(-49/1824). -38 What is the value of (-32)/(-680)(-95)/38(-408)/1560? 2/65 What is ((-646)/(-425))/(5/50-4)? -19/5 What is the value of 2046/((-1276)/(-696)9)? 124 Calculate ((-5250)/(-65625))/((-2)/(-100)). 4 What is ((1474/22)/26824/(-10))/(279/(-10))? 2/93 What is 19600/183750(-25)/(-12)? 2/9 3((-720)/(-72))/(-32/(-9)) 45 Evaluate -9(-51)/(-3)((-11)/1)/33. 51 Evaluate 400/(-60)(-12)/302/224. 64 Evaluate (1/(-9))/((-10)/((-15120)/(-8232))). 1/49 Evaluate (-115/84)/((-19875)/2120). 2/105 What is ((-91)/(-1183))/(2/(-1794)(-3)/1)? 23 231460/(-763818)(-22)/45 4/27 Evaluate 116(-6)/(-12)(-10)/(100/(-10)). 58 What is 9/(-21)119/(-102)6? 3 What is the value of (-7)/(7/68)((-8)/8)/(108/(-27))? -17 Evaluate ((-2)/11)/(33235/(-21505)). 2/17 Calculate (45/(-18))/(3650/(-219)). 3/20 -120141/47376(-21)/(-20) -3/8 What is the value of ((-88231)/47509)/((-2)/44/14)? 13 Evaluate (((-134208)/108)/233)/((-1)/(-24)). -128 What is the value of (-21)/94545(-3)/21? 1/7 30/(-5)1240/(-155) 48 (-110)/(-264)996/180-23 -33/4 What is the value of (-1)/((-4)/11)1/(-5)(-29880)/747? 22 Calculate ((12155/(-312))/85)/(((-9)/1)/36). 11/6 (-77)/11553019/(-1) 38 Evaluate (((-3)/24)/(-8(-6)/192))/1. -1/2 What is 18/(-6)(-4)/2480/(-18)? -20/9 ((1500/(-300))/(1/(-4(-5)/620)))/(-1) 5/31 (2/(-18))/(((-624)/(-130))/(-6)(-5)/(-78)) 13/6 What is (160/405)/(-8)5010/(-668)? 10/27 What is the value of ((-21)/(294/(-28)))/(-1497/7)? -2/71 What is the value of -7810/720-12? 13 What is the value of (22/385-5)/((51/(-84))/(-17))? -8 Evaluate (240/1248)/(51/(-4)). -2/13 Calculate 9/(15/5)(-8)/18(-2562)/(-244). -14 (-224)/(-16632)(-162)/(-36) 2/33 Calculate (3/(-2580)4)/((-57)/570). 2/43 What is the value of (20/714/(-7))/(64/(-560))? 50 What is the value of (19/((-14364)/21))/((-25)/((-900)/(-96)))? 1/96 Evaluate (((-1000)/75)/(-10))/((-96)/112). -14/9 Evaluate -3(-40)/(-76)(-209)/11. 30 What is 8/(159/(90/36(-9)/(-15)))? 4/53 Evaluate 248/5642261/(-10)14. -8/5 Evaluate (-23)/((-460)/8)20(-752)/(-128). 47 (-468)/(-26832)(32/72)/((-3)/18) -2/43 Calculate ((-816)/(-765))/((-16)/42). -14/5 Calculate -116(-11)/66((-12)/(-18))/(58/(-261)). -58 What is the value of ((-87)/(-8))/((380/(-2432))/((-75)/(-60)))? -87 Calculate (20/30(-1)/6)/((-23)/(-14352)26). -8/3 Calculate (257/12950)/(5/(-10)1). -1/37 What is (711/12)/((-693)/(-924))? 79 What is the value of -4018/3168(-4)/(-40)? -1/44 What is the value of (1155/(-147))/11-6((-8)/(-20))/2? 6/7 Calculate (153/(-10))/((-5)/(70/(-21))). -3 What is the value of 1/((-6)/152)(372/8)/(-31)? 38 What is the value of 540/1013455/(-10530)? -69 Evaluate ((-72)/(-1044)29(-2)/(-2))/1. 2 812/(-609)5/(-60) 1/9 Evaluate (-6)/29(-9405570)/(-17070). -114 Calculate 2/43/30/(-63). 0 What is (-17)/349900/110? -45 What is (96/(-896)28)/((-115)/(-207))? -27/5 Evaluate (-4256)/(-2394)(-51)/408. -2/9 What is the value of ((-172141)/4358)/(3/(18/(-3)))? 79 Calculate ((-75)/(-10))/(180/2376-2)-2. 99 What is the value of 2/30((-16)/(-96))/(((-42)/(-15))/(-14))? -1/18 What is (-63)/(-30)(-544)/(-1904)? 3/5 Evaluate (3432/(-96668))/(16/52). -3/26 Calculate (-1)/5(99/6)/(-33)16/44. 2/55 131646/(-19569)11/(-2) 37 What is 19/114120/(-10)? -2 Evaluate (-176)/4((-7)/42)/((-11)/(-66)). 44 What is (921/614)/((6/8)/(((-30)/(-954))/5))? 2/159 Evaluate 4576/(-1716)((-225)/(-12))/(-5). 10 What is the value of (-105)/(-6300)3042-4? -84 Evaluate (-130)/(-150)5(-42)/(-91). 2 What is ((-14)/2)/(17269/83878)? -34 What is the value of (((-3795)/10)/11)/((-18)/60(-60)/(-36))? 69 Calculate (-90)/(-145)206973/47580. 27/10 ((-1296)/12960)/((1(-3)/16)/(3/2)) 4/5 Evaluate 15-1((-25058)/2613)/(-187)26/24. -5/6 What is the value of 2/(-3)(-189135)/50436? 5/2 ((-6)/10)/((27/240)/(126/14)) -48 What is the value of 810/60((-10)/(-126))/((-90)/(-72))? 6/7 Evaluate (14(-86)/19264)/((-2)/(-16))-86. 43 Calculate (-24)/(-22)(108100/345)/235. 16/11 What is the value of (12/16)/((-30)/14840-1219)? 7/23 What is (246/738)/(6/1494)? 83 Calculate (-660)/48444/(-24). 5/2 ((-95)/10(-166)/1577)/(3/327) 109 19/(-285)108/180 -1/25 What is (-90)/54(-399)/(-380)? -7/4 (-98)/(-4116)843(-4)/138 -4/23 Calculate (-15)/21(323/285)/(-17)-162. -54/7 What is (9/6)/(80/132014(-15)/(-40))? 33/7 What is ((-10)/(-600)-4)/((280/(-48))/(-35))? -2/5 Evaluate 5/(-140)(-8)/(-22)(99/(-6))/(-3). -1/14 5/74/(-60)3600/50 -12/7 ((-329)/18812/(-14))/(((-567)/350)/27) -25 What is ((96/90)/8)/(2/(-30)9)? -2/9 What is 126/(42840/(-1105))(-18)/13? 9/2 Calculate (2066731/(-87946))/((-2)/8-21). -47 Evaluate ((4365/1261)/(117/26))/(6/1). 5/39 Calculate (70179/314)/(-149)-56. 84 (24/(-20))/((-24)/(-100)-20) 1/4 ((-78)/8)/(2061/8244) -39 What is (-15)/(-2235)(-7)/((-140)/40)? 2/149 What is the value of (-35)/(-2)(-79044)/(-28230)? 49 Calculate ((1092/294)/13)/(156/21-1). -1/26 Evaluate (1860/310(-4)/(-16))/((-2)/(-100)). 75 What is (-1)/(-1)-320/40? -3/2 What is the value of (((-7100)/(-840))/71)/((-30)/(-8))? 2/63 What is (-10(-26)/650)/((35/(-5))/770)? -44 What is (-1)/(177/3689)? -31 Evaluate ((-6282)/(-3490))/(78/(-10)). -3/13 What is the value of 1/(3/(-4))57660/1240? -62 ((-4176)/1392)/(3/116-2-2) -29 What is the value of 180/2525/75? 1/21 What is 663/5461-42? -51 What is the value of -185/((-1105)/(-286))? -22 What is (-25)/(-3)(-975)/26006/20? -15/16 Calculate (24/84)/((114/19)/(-168)). -8 What is the value of (3477/4636)/(3/(-49)1)? -49/4 (-2106)/2808(-304)/6 38 What is the value of 6/((-43362)/(8118/(-82)))? 1/73 Calculate 63/(-36)(308/294)/11. -1/6 What is ((-8957)/(-394797))/((-156)/72)? -2/191 ((-10)/(-6))/(32/1925/(-3)) -6 What is the value of (-3)/(-8)2-49116/1015-1? 21/5 Calculate 1(-1)/(2/5)(-188)/(-3055). -2/13 Evaluate 10/1851(-6)/30. -17/3 What is the value of (-21)/(-2)139612/(-22211)? -66 Calculate (-5)/2771/((-2130)/36)99. 22 What is (-534)/801(2835/795)/21? -6/53 Evaluate 202905/(-120240)(-28)/9. 21/4 Evaluate (9/451520/342)/((-2)/(-27)). 12 (-12)/13521(2645/46)/(-23) 14/3 Evaluate (-52246/1312)/((-1)/4). 39 Evaluate ((-29(-189)/(-63945))/(1/5))/(93/(-14)). 2/31 Calculate 28827/(18468/152). 64 What is 12/9(-116460)/10352? -15 (-96)/10((-945)/(-18))/(-105) 24/5 ((-48)/3)/(968/(-1980)-15) -24/11 Evaluate ((-72100)/(-36771))/((-2)/(-17)). 50/3 Evaluate ((-12)/8)/3(-269)/(-6994). -1/52 (-10012/(-1440))/(21/(-9)) -5/14 (-3)/((21384/(-66))/18) 1/6 What is (-350)/(-350)17/((-10744)/16)? -2/79 What is (((-18)/(-840))/((-6120)/1428))/((-3)/(15/(-2)))? -1/80 Evaluate 12/(-4)(-8)/(-84)215/3010. -1/49 What is (((-112)/66)/(-4))/(11753/10074)? 4/11 Calculate ((-372738)/(-283383))/(6/333). 73 ((-74736)/(-425061))/((-8)/(-7)) 2/13 What is the value of (-259)/(111370/16125)-21? 75 Evaluate -10(-31)/(-24490)(-4)/2. 2/79 (-11)/33044/(-528)32/4 1/45 What is the value of (16(-1)/(-70)490/(-1176))/((-40)/36)? 3/35 What is the value of (371((-230)/161)/(-2))/5? 53 What is (12118/(-1743))/146-196? 28/3
2418426 divided by 4633 522 202108860 divided by -5 -40421772 Divide 49 by -317184. -7/45312 What is 1 divided by -199819? -1/199819 Calculate -10659153 divided by 12. -3553051/4 -2808219 divided by -4 2808219/4 22572 divided by 17895 7524/5965 What is 20178024 divided by -2? -10089012 2539 divided by -6940 -2539/6940 Calculate -122555323 divided by 5. -122555323/5 Calculate 24310077 divided by -24310077. -1 What is 13470300 divided by -6? -2245050 Divide -150533652 by 1. -150533652 Calculate 10546543 divided by 10. 10546543/10 What is -3 divided by -27957597? 1/9319199 Divide -14771277 by 1641253. -9 -706 divided by 464550 -353/232275 -83583 divided by 7 -83583/7 What is -159142536 divided by -53047512? 3 Calculate 9 divided by 76927125. 3/25642375 Calculate 1039231 divided by 6. 1039231/6 Calculate 991 divided by 46020. 991/46020 Calculate -732807 divided by -51. 244269/17 What is 39478600 divided by -225592? -175 What is -838 divided by -32149? 838/32149 Calculate 13687347 divided by 6. 4562449/2 Calculate -2706923 divided by -52. 2706923/52 Divide -306095302 by -37. 8272846 147212190 divided by -3200265 -46 Divide -35303 by -139. 35303/139 -391344966 divided by 6 -65224161 Calculate -5717140 divided by 103948. -55 -342 divided by -32260 171/16130 What is -29417008 divided by 2? -14708504 Divide 2887638 by -1443819. -2 Divide 3 by 64197507. 1/21399169 Calculate -22107904 divided by 1456. -15184 Calculate -8714686 divided by 4078. -2137 What is 684456384 divided by -12? -57038032 Calculate 627848618 divided by -6338. -99061 What is 47032640 divided by -2? -23516320 Calculate -3739188 divided by 1869594. -2 7433115 divided by 681 10915 What is -99226674 divided by 18? -5512593 Divide -5117648 by -639706. 8 What is -90779 divided by -63? 90779/63 Calculate 0 divided by 4281244. 0 Calculate -3 divided by 434659448. -3/434659448 Divide -216364800 by 15280. -14160 What is -5 divided by -7973212? 5/7973212 -11311159 divided by 12839 -881 Divide -199462724 by 1102004. -181 -293610336 divided by -6116882 48 Divide -17 by 231219. -17/231219 Divide -5046020 by -95. 53116 What is 2813084 divided by 1406542? 2 What is 8338330 divided by -2618? -3185 Divide -27338960 by -5467792. 5 What is 47091825 divided by 3231? 14575 -4 divided by -71899977 4/71899977 What is -16908000 divided by 6? -2818000 Divide 203150 by 93. 203150/93 51 divided by -15067 -51/15067 Divide 1845063 by 615021. 3 Divide -5448 by -146262. 908/24377 Divide -2 by -4643160. 1/2321580 What is 1103719949 divided by -2? -1103719949/2 Divide 285120 by -5940. -48 Divide 231198624 by 605232. 382 4 divided by 7267692 1/1816923 Calculate 2099012 divided by 106. 19802 Divide -362 by -1626. 181/813 Divide 22904 by 77074. 11452/38537 Divide 2446 by -64598. -1223/32299 What is -5 divided by -24767915? 1/4953583 Calculate 28438864 divided by 1. 28438864 Calculate -151 divided by 3713960. -151/3713960 129408468 divided by 1135162 114 -17104158 divided by -6 2850693 -20518890 divided by 1367926 -15 46611525 divided by 445 104745 Divide -329203532 by 82300883. -4 What is -375661 divided by -71? 5291 Divide 18660 by 413. 18660/413 Calculate -177753455 divided by -95. 1871089 57430804 divided by -2 -28715402 1 divided by -419419 -1/419419 Calculate 6 divided by 834665. 6/834665 738224289 divided by -3 -246074763 -6097 divided by 956 -6097/956 What is -17013 divided by -1667? 17013/1667 Calculate -276739890 divided by -2635618. 105 -200075 divided by -1163 200075/1163 Calculate 125135375 divided by 775. 161465 What is -4711363 divided by 5? -4711363/5 -113620 divided by 738 -56810/369 Divide 4452887 by -67. -66461 What is 38787660 divided by 718290? 54 Divide -495463222 by 2. -247731611 Calculate -9072900 divided by 30. -302430 Calculate 9085 divided by -2487. -9085/2487 What is 52018594 divided by -26009297? -2 -4208254065 divided by 3 -1402751355 What is -238937363 divided by -7? 34133909 Calculate -1849 divided by -59781. 1849/59781 Divide -4575 by 138. -1525/46 Divide 3 by 168104589. 1/56034863 What is -6907520 divided by -2008? 3440 -105 divided by 3822 -5/182 10082842 divided by -65473 -154 Divide 70442478 by 2. 35221239 Calculate 9322080 divided by 2330520. 4 What is 161486790 divided by 1329? 121510 Divide -1000 by 33608. -125/4201 Calculate -129089716 divided by -18441388. 7 What is 25810012 divided by 2822? 9146 Divide -1061837 by -2. 1061837/2 296 divided by 2886242 148/1443121 Calculate 0 divided by 1741801. 0 Divide 1872639 by 6. 624213/2 What is 1701363 divided by -13? -1701363/13 Divide 3283 by -37380. -469/5340 -1033289 divided by -1 1033289 Calculate 136495020 divided by -22749170. -6 Calculate -1238430384 divided by -1779354. 696 96547376 divided by 578128 167 What is 110 divided by 47727? 110/47727 0 divided by -2958525 0 45869964 divided by 1092142 42 -15573 divided by 63 -5191/21 What is -32955388 divided by -2? 16477694 What is 20328280 divided by -2032828? -10 Calculate 23356514 divided by 5. 23356514/5 Calculate 87 divided by 123145. 87/123145 What is -8092 divided by -31929? 8092/31929 What is 5622000 divided by -5? -1124400 7670866 divided by 1095838 7 63395254 divided by -4876558 -13 Calculate 7655270 divided by 9190. 833 Divide -12259632 by -214. 57288 Calculate 1567 divided by 52989. 1567/52989 Divide -63 by -117520. 63/117520 What is 3 divided by -6351711? -1/2117237 148004784 divided by 1143 129488 What is 4582260 divided by -916452? -5 What is 197385877 divided by 5? 197385877/5 Divide -127323570 by -4244119. 30 65639322 divided by -147 -446526 15 divided by 332119 15/332119 52706409 divided by -3 -17568803 What is 40049540 divided by -10012385? -4 What is -18203 divided by 6786? -18203/6786 Calculate -5089 divided by -3816. 5089/3816 Calculate 447978109 divided by -409. -1095301 -1309824700 divided by 5 -261964940 -110065340 divided by -1429420 77 Divide 90571089 by 3123141. 29 Divide 1 by -161137. -1/161137 4010 divided by 2974 2005/1487 Calculate 588860 divided by 5. 117772 What is -13352523 divided by 8? -13352523/8 Divide 475377705 by -572055. -831 2192213 divided by -1 -2192213 Divide -92362 by 180. -46181/90 Calculate 18789140 divided by 3757828. 5 What is 27113352 divided by -68124? -398 What is -8499602 divided by -79? 8499602/79 Divide -198 by 58529. -198/58529 -4195425 divided by 325 -12909 Divide 14420088 by 252984. 57 Calculate 57111705 divided by -5. -11422341 Divide 40919 by 2264. 40919/2264 -3143940 divided by -859 3660 What is 3427 divided by 200371? 3427/200371 What is -744953252 divided by -158? 4714894 What is 31387680 divided by 355? 88416 What is -143666145 divided by 7? -20523735 Calculate 22112 divided by -119. -22112/119 What is -219436 divided by 3066? -15674/219 638995650 divided by -63899565 -10 Calculate 171462231 divided by 2414961. 71 Divide -79327584 by 43491. -1824 Calculate -705439 divided by 13. -705439/13 Divide 2 by 13424397. 2/13424397 Divide 189163 by -799. -189163/799 Divide -491749923 by -3. 163916641 Divide 2189113 by 3. 2189113/3 Divide -4 by -325614137. 4/325614137 Calculate 274118779 divided by -8083. -33913 What is 118647040 divided by -16? -7415440 -23063997 divided by 1 -23063997 42825011 divided by -23 -1861957 Divide -51 by 8402. -51/8402 Divide 63411744 by -360294. -176 What is 154005780 divided by 5? 30801156 Divide 61757 by 122. 61757/122 Calculate -17 divided by 63312. -17/63312 What is -146155 divided by 27? -146155/27 1255 divided by 9517 1255/9517 Calculate -7434504 divided by -324. 22946 Calculate -15559648 divided by 52. -299224 Divide 8731809 by -6. -2910603/2 Divide 37918232 by 16108. 2354 17217 divided by -26461 -17217/26461 131433054 divided by -1559 -84306 1193869118 divided by -1846 -646733 Divide -16484566 by -7. 2354938 -1 divided by 7364426 -1/7364426 Calculate -419990 divided by -10. 41999 Divide 274844863 by -6391741. -43 Calculate 1154400 divided by -1950. -592 Divide -20410296 by 3. -6803432 805075356 divided by -4 -201268839 What is 17366640 divided by 4304? 4035 43695410 divided by 397231 110 Divide -10443393 by -55. 10443393/55 What is -6548 divided by 1507? -6548/1507 Calculate -826360608 divided by -2334352. 354 Calculate 71 divided by -7075. -71/7075 -3944 divided by 2388 -986/597 Calculate -67289840 divided by -2170640. 31 Calculate 72 divided by -137451. -24/45817 What is 228185160 divided by -604? -377790 38016 divided by -371 -38016/371 Divide -7071285 by 471419. -15 15 divided by 5503692 5/1834564 Calculate 14872662 divided by 21. 708222 Divide 195299 by -35. -195299/35 Divide -2 by -398737. 2/398737 17879616 divided by -27 -662208 Calculate 13169966 divided by -34. -6584983/17 Calculate -104573482 divided by -1. 104573482 What is -30 divided by 280085? -6/56017
Let s(u) be the first derivative of -4u3/3 - 8u*2 - 465u - 393. Differentiate s(q) wrt q. -8q - 16 Let y(h) be the first derivative of -176h*5/5 - 374h - 618. What is the derivative of y(r) wrt r? -704r3 Let w(y) = -y3 + 7y*2 + 7y + 8. Let x be w(8). Let r = 12 + -8. Find the first derivative of xg + 2g - r + 0g + 4g wrt g. 6 Let y be 10/(-25) - 21/(-15). Suppose 0 = l - 4r + y, -r - 11 = -4l - 0r. What is the second derivative of -2q - 2ql + 9q - 3 + 3 wrt q? -12q Suppose g = 3q - 12, 6g - 5g = -5q + 20. Suppose x + 10 = qv, 0 = v - 3. What is the third derivative of -6ox - 5o*6 - 6o6 + o2 + 5o6 wrt o? -720o3 Let d(i) be the first derivative of i6/3 + 16i5/5 - 487i*3/3 + 344. Find the third derivative of d(n) wrt n. 120n*2 + 384n Let c(m) be the third derivative of 11m7/42 + 6m4 - m2 - 30. What is the second derivative of c(s) wrt s? 660s2 Let x(g) be the first derivative of -g6/10 + 3g*3/2 - 6g + 12. Let o(r) be the first derivative of x(r). What is the second derivative of o(w) wrt w? -36w2 Suppose -5l + 3r + 10 = -2r, l - 2 = -5r. Differentiate -15 + 0 - 4x*3 - l + 18x*3 with respect to x. 42x*2 Let u(k) = 183k*3 + 2k*2 - 79k + 4. Let w(p) = 184p3 + 3p*2 - 80p + 5. Let b(s) = 3u(s) - 2w(s). Find the second derivative of b(g) wrt g. 1086g Let o(v) be the first derivative of v5/5 - 11v*4/2 + 43v*2/2 + v - 607. Find the second derivative of o(l) wrt l. 12l*2 - 132l Suppose 3i + 2i - 5 = 0. What is the first derivative of -1 + 7y - i + 3 - 2 wrt y? 7 Let l(r) = -r3 + 3r*2 + r - 1. Let y(z) = 108z*3 - 12z*2 + 59z + 7. Let a(d) = 4l(d) + y(d). What is the second derivative of a(g) wrt g? 624g Let u(w) = -w*3 + 5w*2 - 3w + 5. Let k be u(4). What is the first derivative of 3 - 6 - k - 12j2 wrt j? -24j Let i(z) be the third derivative of -55z4/12 + 2z3/3 + z2 + 34. Find the first derivative of i(g) wrt g. -110 Let y be 14 - (0 - (0 + -1)). Suppose -4d + y + 3 = 0. What is the derivative of -6 + d - 4 + 6j wrt j? 6 Let v = -1149 + 22981/20. Let c(k) be the third derivative of 0k4 + 0k + 6k2 + 0 + vk*5 - 7/6k*3. Differentiate c(j) wrt j. 6j Let z(n) be the third derivative of 86n5/15 + 33n*4/4 - 139n*2 - n. What is the second derivative of z(m) wrt m? 688 Let q(p) = p - 3. Let w be q(4). Suppose -3x = -4r + 3, 10 = 3r + w. What is the second derivative of -6i2 + 3 - x + 14i*2 - 8i wrt i? 16 Find the second derivative of 17 + 4 + 680v5 - 753v*5 - v wrt v. -1460v*3 Let h(x) be the third derivative of 137x7/210 + x5/5 + x*4/2 - 202x*2. What is the third derivative of h(k) wrt k? 3288k Let j be (-9)/(-4)20/15. Differentiate -jd2 - d2 + d*2 - 1 - 11 wrt d. -6d Let k(h) = h - 11. Let a(o) = -11. Let n = 7 - 4. Let j(b) = na(b) - 2k(b). Differentiate j(x) with respect to x. -2 Let b = 1487/5 + -297. Let d(h) be the first derivative of 2h2 + bh*5 + 0h*3 + 0h + 0h4 + 1. Find the second derivative of d(i) wrt i. 24i*2 Let c = -6 + 8. Suppose -5m = 10, 7o - 14 = 4o + m. Find the first derivative of 2wc + 5 + 9 + 5w*2 - o wrt w. 14w Let z(r) = r*3. Let m(i) = 18i*3 - 10. Let f be (2/(-1) - -1)6. Let u(h) = fz(h) + m(h). What is the first derivative of u(w) wrt w? 36w2 Let g(v) be the second derivative of -v9/378 - v*5/120 - 2v*3/3 - 8v. Let s(l) be the second derivative of g(l). Find the second derivative of s(n) wrt n. -160n3 Let d be 23/(-3) + 1/(-3). Let k = d - -15. Find the third derivative of -f2 + 5f*3 + kf*3 - 11f*3 wrt f. 6 Suppose -14t + 5 = -19t. Let j be 4/1(0 - t). What is the first derivative of 1 - 25rj + 23r*4 + 6 wrt r? -8r*3 Differentiate 0 + 188h*3 + 2 - 18 + 29 with respect to h. 564h*2 Let r(h) be the first derivative of 397h*4/2 + 416h - 531. Differentiate r(d) wrt d. 2382d2 Let v(f) = f3 + 2f - 1. Let d(l) = 14l3 - 5l - 32. Let x(r) = -d(r) - 2v(r). What is the derivative of x(z) wrt z? -48z2 + 1 Let t(u) = u3 - 9u2 + 16u - 8. Let r be t(7). What is the first derivative of r + 6f - 3f - 5f wrt f? -2 Let u(h) be the third derivative of -349h6/120 + h4/6 + 19h3/2 + 350h*2. Find the second derivative of u(a) wrt a. -2094a Suppose 2z + 1 - 9 = 0. Find the first derivative of xz + 11 + 0x*4 + 9x*4 wrt x. 40x3 Let t(o) = -o3 + 6o2 + 3o - 14. Let s be t(5). What is the second derivative of -4 + 4 + 21g4 - sg + 12g wrt g? 252g*2 Suppose -4i - o + 3 = -2i, -i + 18 = -5o. Find the second derivative of -4 + 2 + 2 - 5c - 13c*i wrt c. -78c What is the third derivative of -13n3 - 23n*5 - 466n*2 - 7n*3 - 1164 + 1164 + 7n*3 wrt n? -1380n*2 - 78 Let k(s) be the third derivative of -79s*6/60 - 3s*5/2 + 61s*2. Find the third derivative of k(x) wrt x. -948 Let w(o) be the third derivative of 11o7/210 + o4/24 - 2o3 - 47o*2. Let h(x) be the first derivative of w(x). Differentiate h(r) with respect to r. 132r*2 Suppose 0 = -0l - 3l + 12. What is the third derivative of lg*5 + 2g*5 + 25g*2 - 12g*2 wrt g? 360g*2 Suppose 1 = 2u + 4x - 5x, 12 = 4x. What is the third derivative of 62p*3 + 5p*3 - 1 + 29p*3 - 47p*3 - 33pu wrt p? 294 Let w(x) = -x2 + 4x + 8. Let c be w(5). Let k = -10 + 26. What is the second derivative of -5r + kr - 8r*2 + cr*2 wrt r? -10 Suppose -2j + j + 4 = 0. Suppose -b - 2b + 48 = -4o, jb = 4o + 60. What is the derivative of -5 + b + m*2 + 0 wrt m? 2m What is the derivative of -5 - 411o3 + 14 + 401o*3 wrt o? -30o*2 Find the third derivative of 6q*3 + 32q*2 - 5 + 3q*3 - 7q*2 + 14q*4 - 2q*4 - 108q*2 wrt q. 288q + 54 Let w(f) = 965f3 - 501f. Let r(z) = 483z3 - 251z. Let h(v) = -7r(v) + 4w(v). What is the second derivative of h(k) wrt k? 2874k Find the second derivative of 16p - 4p + 24p + 245p2 - 90p2 wrt p. 310 Let i(w) = w2 - 10w - 12. Let k be i(12). What is the second derivative of -kp - 11p3 - 35 + 35 wrt p? -66p Let g = -29 - -31. Differentiate -gs + 5 - 1 - 2s + 0s with respect to s. -4 Let p(h) be the second derivative of -h6/30 + 329h*5/20 - 38h*4 + 215h. What is the third derivative of p(z) wrt z? -24z + 1974 Suppose 50 - 8 = 3q. What is the third derivative of 3f5 - 2f*5 + qf2 - f5 + 2f5 wrt f? 120f*2 Let d(r) be the third derivative of 0r + 13/60r5 + 0r*3 + 0 - 16r*2 - 1/3r*4. What is the second derivative of d(g) wrt g? 26 Let r(d) be the third derivative of -123d*4/8 + 305d*3/6 + 363d*2. What is the derivative of r(x) wrt x? -369 Let h(d) = -18d*3 + 6d + 37. Let t(z) = 7z3 + 7z*3 + 4z*3 - 8z + 3z - 38. Let v(s) = 5h(s) + 6t(s). What is the first derivative of v(a) wrt a? 54a*2 Let k(r) = 854r*3 + 11r - 498. Let t(j) = -171j3 - 2j + 100. Let d(z) = 2k(z) + 11t(z). What is the first derivative of d(y) wrt y? -519y2 Let r be 128/48(-9)/4. Let u(i) = 14i2. Let n(f) = 28f*2 + 1. Let p(q) = rn(q) + 13u(q). What is the first derivative of p(h) wrt h? 28h Let i(t) be the first derivative of -13t5/30 + 8t*3/3 + 8t*2 - 24. Let x(y) be the second derivative of i(y). What is the first derivative of x(m) wrt m? -52m Let c(m) be the second derivative of -m*5/10 + 5m4/12 + m3/6 - 4m2 - m - 18. Find the second derivative of c(y) wrt y. -12y + 10 Suppose -u = 2c + 7, -u + 5 = 4. Let h = -3 - 4. Let b(x) = -3x. Let l(f) = 6f - 1. Let r(n) = cl(n) + hb(n). Differentiate r(p) wrt p. -3 Let u(z) = 2z*2 - 6z + 1. Let w be (-10 + -2)(-1)/2. Let h(x) = 7 - 8 - x + 2x. Let c(p) = wh(p) + u(p). What is the derivative of c(f) wrt f? 4f Find the second derivative of -46z + 4z*2 - 46z*2 + 172z wrt z. -84 What is the first derivative of 10s + 2s*2 - 3s - 37 + s*2 + 0s*2 - 84 wrt s? 6s + 7 Let n(r) be the second derivative of -r*6/40 - 3r*5/40 + 5r*3/3 - 3r. Let k(w) be the second derivative of n(w). Find the second derivative of k(u) wrt u. -18 Let h(a) = -a4 - a3 + 2a2 + 2a + 1. Let o(x) = -13x4 + 2x*3 - 6x*2 - 4x + 140. Let k(l) = -2h(l) - o(l). Differentiate k(r) wrt r. 60r*3 + 4r Let n be 0 - (-2 + 2 - 16). Suppose -y - 3y + n = 0. What is the third derivative of -t2 - 11t*y + 0t*2 + 24t*4 wrt t? 312t
Let z(t) be the first derivative of 0t2 - 60 + 1/4t*4 + 8/3t*3 - 3t. Let y(m) = m*2 - m - 8. Let x be y(0). Give z(x). -3 Let n(y) be the second derivative of 1/40y*5 + 0y*4 + 0y*2 + 13y + 0 - 7/3y3. Let k(c) be the second derivative of n(c). What is k(-6)? -18 Let d(k) = -4k*2 + 48k + 56. Let w be d(13). Let y(m) = -m + wm2 + 2 + 3m + 12m - 5m*2. Give y(13). 15 Let d(w) = -9w*2 + 9w. Let b(i) = 30i + 269. Let r be b(-9). Let o(z) = -z2 + z + 1. Let q(m) = rd(m) + 6o(m). What is q(4)? 42 Suppose 0 = 708x - 695x - 13. Let b(m) = 3m*3 + 4m*2 - 7m + 4. What is b(x)? 4 Let i(g) be the third derivative of 1/12g4 + 0g - 1/120g5 + 0 + 11g*2 - 1/3g*3. Let z(r) be the first derivative of i(r). Calculate z(0). 2 Let x(z) = -27z + 17. Let m(w) = 8w + 1. Let c(i) = 3m(i) + x(i). Calculate c(-9). 47 Let v(k) = 7k - 1 + 3 - 2. Suppose 8t - 5 = 11. Give v(t). 14 Suppose -147c + 61 = 12c - 98. Let z(n) = -n*3 + 2n*2 - 2n. Give z(c). -1 Let u(x) = -7x2 - 3x - 7. Let c(m) = -27m2 - 11m - 25. Let z(j) = 6c(j) - 23u(j). Let a(s) = s*3 + 5s*2 + 5s + 2. Let g be a(-3). Calculate z(g). 1 Let s(r) = -2 - 4r2 - 2r + 16r2 - 16 + r3 - 4r*2. Let q(x) = 13x*2 - 650x - 8. Let d be q(50). Give s(d). -2 Let x(w) be the third derivative of -w*4/12 + 4w*3/3 + 1360w*2. Suppose 7u - 4u - 12 = 0. Suppose -uy = -9y + 35. Calculate x(y). -6 Let k(g) = -4091g + 30 - g*2 + 4056g - 26 + 74. What is k(-37)? 4 Let b(h) = 2h3 - 27h*2 + 17h - 7. Let v be b(13). Suppose v = -5l - 5t, -14t + 28 = -4l - 10t. Let z(k) = k2 + 7k - 7. Give z(l). 1 Let o(w) = w*2 + 12w + 7. Let i = 80 - 67. Suppose -2 = -b - i. Give o(b). -4 Let u(h) be the third derivative of h*4/24 - 5h*3/6 - 1231h*2. What is u(1)? -4 Suppose 4a = -8a - 7a. Let q(u) be the third derivative of 0u + 22u*2 - 7/6u*3 + a - 1/3u*4 - 1/60u5. What is q(-6)? 5 Let m(s) be the first derivative of -s2/2 + 5s + 15. Let p(d) = -43d - 784. Let a be p(-18). Calculate m(a). 15 Let q(g) = -g + 2 + 5 + 2. Suppose 5y - 10y + 60 = 0. What is q(y)? -3 Let v(y) = y*3 + 9y*2 + 10y - 2. Let r(g) = -54g - 223. Let p be r(-4). Give v(p). 26 Suppose 133 = d - 3p, 5p = -2d + 8p + 275. Let r = 143 - d. Let a = r + -2. Let w(o) = -o. Give w(a). 1 Let o(f) be the third derivative of -5/6f*3 - 1/12f*4 + 0 + 0f - 130f2. What is o(-4)? 3 Suppose -32p = -33p + 4g - 23, p + 2g - 7 = 0. Let r = 2 - -1. Let f(j) = -4j*r - 1 - 5j*2 + 4 + 3j3 + j2. What is f(p)? -6 Let v(p) = p*3 + 34p*2 - 658p - 4 - 10p2 + 174 - 10 + 688p. Calculate v(-23). -1 Suppose 0 = -2c + 3p - 2, -5p + 2 + 2 = -3c. Let v(z) = cz2 - 28 + 29 - 2z + 46z3 - 58z*3. Calculate v(1). -11 Let t = -587 + 599. Suppose 4s = 2z + t, 5z - 3s = -10 - 6. Let p(k) = 6k*2 + k - 2. Calculate p(z). 20 Suppose 23q + 27 = 14q. Let r(n) = 0 + 4 + n + 2 - 3. Let p(h) = 2h + 2. Let m(l) = qr(l) + 2p(l). Give m(6). 1 Let n(h) = h*3 - 16h*2 + 5h - 2. Let o(k) = k*3 - 17k*2 + 6k - 2. Let x(t) = -7n(t) + 6o(t). Suppose 0u = -4u + 40. Calculate x(u). 12 Let w = 1 - 2. Suppose 0c - 41 = -k - 5c, 2c - 146 = -4k. Let i(v) = 1 + 32v + 0 - kv. What is i(w)? 5 Let d(v) = -v*3 + 3v*2 + 4v + 2. Let n(r) = -2r2 - 7r + 3. Let s = -30 - -26. Let q be n(s). Let u be d(q). Let t(b) = -2b2 + 2b - 1. Give t(u). -5 Let x(v) = 418v - 26 - 1262v - v*2 + 420v + 415v. Give x(-8). -18 Let a = -16 + 16. Suppose 3u = -3 - a. Let m(s) = 3s + s - 216 + 217. Give m(u). -3 Let q(p) = -6p - 855865 + 427929 + 427936. Let n be (5 + 2/(-1))-1. What is q(n)? 18 Let b(g) = -2g*3 + 19g*2 - 14g + 2. Let m = -9535 + 9543. Determine b(m). 82 Let i(d) = 2 - 9 - 2d - 8d. Let h(o) = 62o - 14. Let u(c) = -15c + 3. Let r(s) = -4h(s) - 17u(s). Let p(n) = 5i(n) + 7r(n). Calculate p(-5). 5 Suppose 124 - 34 = -3s. Let w = s - -26. Let h(z) = z3 + 3z*2 - 3z - 6. Determine h(w). -10 Suppose -15d + 6 = -12d. Suppose d = t - 1. Let c(b) = -8 + 7b - 14b - 1 - b*t - 7b*2. What is c(-6)? -3 Let z(l) be the first derivative of -2l*3/3 + 2l*2 - 2l + 239. Let p(n) = -5n2 + 0n*2 + 0n*2 + 3 - 4n - n*3. Let m be p(-4). Determine z(m). -8 Let r(h) = -5h*2 - 3h - 26. Let g(f) = 115f + 11840. Let w be g(-103). Give r(w). -136 Let q(y) = 185y - 38y - 33y - 39y - 72y + 2. Give q(-2). -4 Let v(p) = -p*2 + 17p - 12. Let z be (-10 + (1 - -16))(-26)/(-14). Determine v(z). 40 Suppose 1152 - 264 = -222r. Let s(q) = 1 + 2 + 2q2 + 2q - 8. Calculate s(r). 19 Suppose 0 = 3y + p - 199, 0p - 61 = -y + p. Let c = -63 + y. Suppose -5l + 0x = -cx - 34, -x = -l + 8. Let u(z) = -z2 + 4z + 1. Determine u(l). -11 Let u(k) = 4k3 - k - 1. Let f be (2/3)/(36/54). Suppose -4r = 5c - 0 + 5, 4r = c + f. Give u(c). -4 Let a(c) = -14c2 + 99c - 12. Let u be a(7). Let j(w) = w*2 - 6 + 7w + 10w - 14w. Determine j(u). 4 Let r(z) = 8z3 - 77z*2 - 27z - 37. Let w be r(10). Let s(c) = 19c - 4. What is s(w)? -137 Let v(m) = 10m - 2. Let p be v(2). Let n = 42 - 65. Let o = p + n. Let y(j) = j*2 + 8j + 7. Determine y(o). -8 Let m(h) = -h*3 - 12h*2 - 30h + 22. Let p be m(-8). Let j(x) = -x*3 + 4x*2 + 15x - 14. Determine j(p). 4 Let h be 11/4 + -2 + (57 - (-5859)/(-84)). Let v(p) = 6p3 - 3p*3 - 2p*3 + 14p + 13p2 + 22. Calculate v(h). -2 Let l(f) = 4f - 14. Let b(d) = 4d - 10. Let j(x) = 5b(x) - 6l(x). Let y be (-237)/(-24) - ((-1)/8 + 0). Determine j(y). -6 Let c(t) = 12t + 61. Let s(l) = 73l + 1236. Let k be s(-17). Calculate c(k). 1 Let p(o) = o3 - 9o*2 + 17o + 16. Let c(y) = 8y2 - 32y + 7. Let x be c(0). What is p(x)? 37 Let u = -47995/33 - -16002/11. Let q(z) be the first derivative of -33 - z*2 + uz*3 + z. Determine q(1). 0 Let p(j) = -11609 - 2j3 + 11603 + j3 - j. What is p(-2)? 4 Let j(x) = -2x - 1. Let l(k) = -k3 + k + 2. Let b be l(0). Suppose 3o = bp - 173, -56 = 2o - p + 59. Let s = o - -60. Calculate j(s). -7 Let o be 118/12 + (-11)/(-330)5. Let g(v) = 28. Let y(f) = f - 55. Let x(q) = 5g(q) + 3y(q). Let a be x(o). Let h(r) = r2 - 6r - 6. What is h(a)? -11 Let i(d) = -2d + 1. Let h(b) = b2 - 17b + 7. Let t(q) = h(q) - 3i(q). Let g be ((-10)/10)/(2/(-24)). Suppose a + 2 - g = 0. Give t(a). -6 Let b(x) be the first derivative of -3x*2/2 - 10x + 2069. Give b(-11). 23 Let n(i) = -2i2 - 21i + 10i + 7 + 0i*2 + 5i - 17i. Give n(-12). -5 Let d(j) be the first derivative of 11j*2/2 - 123j - 2274. What is d(10)? -13 Let x(v) = 15 - 2v2 + 5v*2 - 4v*2 + 1 - 18v + 2v2. Calculate x(7). -61 Suppose 3s - 3 - 3 = 0. Suppose -4 - 8 = -sg. Let k(d) = 7 + 6d*2 - 3 + 88d - 90d - d3. Determine k(g). -8 Let g(b) = b2 + 8b + 10. Let m(d) = -2d2 + 16d - 30. Suppose -2h = 20h - 44. Let o be m(h). What is g(o)? -2 Let g(o) = o*2 + 6o - 3. Let b(u) = 2u2 + 5u - 4. Let j(i) = 2b(i) - 3g(i). Let d(h) = -h*3 - 12h*2 - 12h - 4. Let n be d(-11). What is j(n)? -6 Let u(a) = 3a2 - 10a + 18. Let z(w) = 7w2 - 20w + 49. Let r(i) = -5u(i) + 2z(i). Calculate r(6). 32 Let c(o) = o*2 + 49o + 182. Suppose 7r - 5r = 5q + 22, -4q = 4r + 12. Calculate c(q). 2 Let q(l) = 2l2 + l + 5. Let v = 142 + -136. Let z be ((-4)/v)/((-8)/(-48)). Calculate q(z). 33 Let v(z) = z2 - 14z + 19. Let g be -1 + 6 + 2 + -33. Let j be -4(91/g + (-1)/(-4)). Give v(j). 6 Let h(m) = -2m - 117. Let q(t) = 3t + 189. Let y(a) = -8h(a) - 5q(a). Determine y(0). -9 Suppose -2q + 6 = 3h, -q + 5q - 2h - 12 = 0. Let c(u) = -5 + 8 + 5u + 18 - qu. Determine c(-10). 1 Let a(t) = t*2 - 21t - 56. Let y be (-11 + -9)/((-4)/(-1) + -4 + -1). What is a(y)? -76 Let x(c) = -c*3 + 4c*2 - 2c + 2. Let m be x(4). Suppose -24 = -53l + 45l. Let f(v) = 8v - 4 - 2 - 7v - lv + 0v. What is f(m)? 6 Let h(l) = 11l - 14. Suppose -67a = -5g - 72a + 60, 0 = 5g - 4a - 6. Determine h(g). 52 Let s(n) = -5n2 - 15n - 7. Let g(f) = -17f2 - 45f - 25. Let q(p) = 3g(p) - 10s(p). Calculate q(6). 49 Let c(g) = -4g2 - 2348g - 2349g - 2 - 2343g + 7046g. Suppose -2w + 7 = 3. Calculate c(w). -6 Let m(a) = -a*2 + 7a - 30. Suppose 0 = 6p - 184 + 142. Calculate m(p). -30 Let j(p) be the third derivative of -p5/15 - p4/24 - p3/2 - 16p*2 + 9p. Give j(-2). -17
Collect the terms in 9i2 + 25i*2 - 11i*2 + 39i*2 + 3i. 62i2 + 3i Collect the terms in 8r + 5r + 2r - 17r + 3r. r Collect the terms in 0d*2 - 4d*2 + 5d2. d2 Collect the terms in o3 + 136 + 139 - 275. o3 Collect the terms in 8w - 2w - w - 6w. -w Collect the terms in 196 - 196 + 18r*3. 18r*3 Collect the terms in -356r*2 + 356r*2 + 2r*3. 2r*3 Collect the terms in -394c*2 - 11c + 200c2 + 197c*2 + 11c. 3c2 Collect the terms in 0u*2 + 9u*3 + 5 + 11 + 8u*2. 9u*3 + 8u*2 + 16 Collect the terms in -2 + 336c + 2 - 351c. -15c Collect the terms in -6 - 2f - 11f*2 + 6. -11f*2 - 2f Collect the terms in -4o2 - 12o*2 - 6o*3 + 16o*2. -6o*3 Collect the terms in 14z*2 - 12z*2 - 51z + 51z. 2z*2 Collect the terms in -6f + 7f3 - 22f + 28f. 7f*3 Collect the terms in -35o + 11o - 35o. -59o Collect the terms in 67s + 74s + s2 - 210s + 69s. s2 Collect the terms in 19a*3 - 18a*2 - 23a*3 - 17a*2 + 35a*2. -4a*3 Collect the terms in -24d*3 - 967 + 12d*3 + 14d*3 + 967. 2d*3 Collect the terms in 14 + 75h*2 - 8h*2 - 14. 67h*2 Collect the terms in 3u*2 - 2u*2 - 43u*3 + 2u*2. -43u*3 + 3u*2 Collect the terms in -8j*3 + 5j*3 - 8j*3. -11j*3 Collect the terms in 22y*3 - 2 + 2 + 0. 22y*3 Collect the terms in 5i + 7i - 11i. i Collect the terms in 5 + 14a3 - 5 - 3. 14a*3 - 3 Collect the terms in 6 + 57b - 9 + 4. 57b + 1 Collect the terms in 15 + 2y*3 + 18 - 53 + 20. 2y*3 Collect the terms in -2w*2 + 0 - 2 + 114. -2w*2 + 112 Collect the terms in -6f - 4f - 2 + 2. -10f Collect the terms in 9a2 - 7a*2 + 31a*2. 33a*2 Collect the terms in 2088r - 2088r + 8r*3. 8r*3 Collect the terms in 3b - 159 + 159. 3b Collect the terms in 66o - 32o - 30o. 4o Collect the terms in 4 + 2y + 17 - 1 - 20. 2y Collect the terms in 23z*2 - 21z*2 - 41z*2. -39z*2 Collect the terms in 4w*3 - 1 - 3w3 - 9 + 0. w3 - 10 Collect the terms in -1441k - 145k*2 + 148k*2 + 1441k. 3k2 Collect the terms in -513t*3 - 520t*3 + 1032t3. -t3 Collect the terms in -301z + 591z - 290z - 8z*2. -8z*2 Collect the terms in -747k + 747k - 6k*2. -6k*2 Collect the terms in -21k*2 + 0 - 1 + 1 + 5k. -21k2 + 5k Collect the terms in -16b3 + 49b*3 - 13b*3 - 19b3. b3 Collect the terms in -11z2 + 3 - 5 + 0. -11z*2 - 2 Collect the terms in 8 - 172b - 13 + 5. -172b Collect the terms in -18d*3 + 0d*3 + 0d*3. -18d*3 Collect the terms in 31i*2 + 22i*3 - 31i*2. 22i*3 Collect the terms in -10k + 11k3 + 2k + 8k. 11k*3 Collect the terms in -608c*3 + 1208c*3 - 598c*3. 2c*3 Collect the terms in 5m + 305m + 82m. 392m Collect the terms in -611j*2 - 2015j*2 + 481j*2. -2145j*2 Collect the terms in 2i*2 + 3i*2 - 10i*2 - 7i*2. -12i*2 Collect the terms in 19h + 34h - 18h. 35h Collect the terms in -69l + 12l3 + 69l. 12l3 Collect the terms in -1 - 11i - i + 1. -12i Collect the terms in -2g*3 - 2g*3 - 3g*3 + 2g*3 + 2g*3. -3g*3 Collect the terms in 0s*2 - 5s*2 - 620s + 4s2. -s2 - 620s Collect the terms in -1140r - 306r - 864r. -2310r Collect the terms in 19q - 14q + 161q. 166q Collect the terms in -d + 151d2 + 1015d*2 + d. 1166d*2 Collect the terms in 24q*2 + 21q*2 + 117q*2. 162q*2 Collect the terms in 12 + 17p*2 - 12. 17p*2 Collect the terms in 0l - 4l + 132 - 132 - 5l. -9l Collect the terms in 73m - 28 - 14 + 42. 73m Collect the terms in -44v*2 + 2635v - 2635v. -44v*2 Collect the terms in 9o*3 - 82o*2 + 82o*2. 9o*3 Collect the terms in 0 + 47m*3 - 4m*2 + 2 + 3m*2. 47m3 - m2 + 2 Collect the terms in 620 - 620 + 2n2. 2n*2 Collect the terms in 3k*3 - 9k*3 - 11k*3. -17k*3 Collect the terms in 111d*3 + 2d*3 - 6d*3. 107d*3 Collect the terms in -4 + 6c + 3 + 1. 6c Collect the terms in -12 - 27 + 9j + 39. 9j Collect the terms in z + 160z*3 + 2z - z. 160z3 + 2z Collect the terms in -16c3 + 6977c*2 - 6977c*2 + 0c + 0c. -16c*3 Collect the terms in -1 + 3 - 2 + 49k*2. 49k*2 Collect the terms in 2h - 27006 + 13498 + 13508. 2h Collect the terms in -1296839 + 1296839 + d2. d2 Collect the terms in 0h - 2h + 2811 - 2811. -2h Collect the terms in -21d2 + 284 - 570 + 286. -21d*2 Collect the terms in 106 + 75n - 106 - n*2 + 0n2. -n2 + 75n Collect the terms in 77k*2 + 73k*2 - 159k*2. -9k*2 Collect the terms in -5a*2 - 2 + 6a2 - 2. a2 - 4 Collect the terms in -10b2 + 6b*2 + 5b2. b2 Collect the terms in 41 + 4p - 41. 4p Collect the terms in 13q2 - 2532q*3 - 13q*2. -2532q*3 Collect the terms in -2 - 3 + 23t + 5. 23t Collect the terms in -34 + 7p*2 + 34. 7p*2 Collect the terms in 17r*2 + 10 - 10 + 20r. 17r2 + 20r Collect the terms in -16t2 - 895 + 895. -16t*2 Collect the terms in -3000 - 5q + 3000. -5q Collect the terms in -2s + 0s + 4s + 6s - 14. 8s - 14 Collect the terms in 27r2 - 3r*3 + 9r*2 + 28r*2 + 5r*3. 2r*3 + 64r*2 Collect the terms in 17v*2 - 56v - 34v2 + 16v2. -v2 - 56v Collect the terms in 1 + 30y*3 + 16y*3 - 7y*3. 39y*3 + 1 Collect the terms in -5c - 4c - 2c + 0c. -11c Collect the terms in 6 - 6 - 94y + 0. -94y Collect the terms in -23o + 11o + 11o2 - 65o*2 + 12o. -54o2 Collect the terms in 2 - 1775a + 1774a - 2. -a Collect the terms in -2r - 2566r2 + 1 + 663r*2 + 2. -1903r*2 - 2r + 3 Collect the terms in 18u2 + 18u*2 - 39u*2. -3u*2 Collect the terms in 0m - m + 4m - 3m - 3m. -3m Collect the terms in 2l2 + 9 + 3l*2 - 3l*2. 2l*2 + 9 Collect the terms in 5f*3 - 2f*3 - 4f*3 + 4f*3 + 3f*3. 6f*3 Collect the terms in -37r3 + r2 + 2r2 - 5r*3 - 2r*2. -42r3 + r2 Collect the terms in 8b3 + 12b*3 - 14b*3. 6b*3 Collect the terms in -5k - 6k + 1 + 4k - 5. -7k - 4 Collect the terms in -2u*2 + 3962 - 3962. -2u*2 Collect the terms in -67j + 131j - 62j. 2j Collect the terms in 2t*3 + 8t*3 - 67t*2 + 67t*2. 10t*3 Collect the terms in -53 + 0k + 422 - 2k + k. -k + 369 Collect the terms in 31b - 21b + 21b. 31b Collect the terms in 41d*2 - 83 + 83. 41d*2 Collect the terms in -1347 + 8g*3 + 1347. 8g*3 Collect the terms in 10i + 6i - 23i - 27i. -34i Collect the terms in p*3 + 5p*3 - 161p*2 + 162p*2. 6p3 + p2 Collect the terms in 481b2 + b - b. 481b*2 Collect the terms in -24i*3 + 11i*3 + 2i*3. -11i*3 Collect the terms in -470843g*2 + 470841g*2 - 3 + 3. -2g*2 Collect the terms in -2n + n - n. -2n Collect the terms in 487o - 990o + 493o. -10o Collect the terms in -28g - 35g + 0g + 4 - 5. -63g - 1 Collect the terms in -20o*2 + 29o*2 - 11o*2. -2o*2 Collect the terms in 248l + 226l - 472l. 2l Collect the terms in 0i3 + 1596 + i3 - 1596. i*3 Collect the terms in 154b*2 + 0b + 159b2 + 0b - 316b2. -3b*2 Collect the terms in 4y*2 - 2y*2 + 0 + 0. 2y*2 Collect the terms in -n + 8n - n - 4n2 + 2n. -4n2 + 8n Collect the terms in -5x - 16 + 9 + 7. -5x Collect the terms in -229f + 229f - 3f3. -3f*3 Collect the terms in -41 - 43 - 44 + 2w*3 + 128. 2w*3 Collect the terms in -4c*3 - 57c*2 + 3c*3 + 57c2. -c3 Collect the terms in 35z2 - 9z*2 + 1 - 1. 26z*2 Collect the terms in -160 + 160 + 5k + 15k. 20k Collect the terms in 9 + 22 + 21 + 3u2 - 52. 3u*2 Collect the terms in 344 - 344 + 2s. 2s Collect the terms in 2g*2 - 22g*2 + 8g*2. -12g*2 Collect the terms in 10w + 7w + w + 19w. 37w Collect the terms in 3i - i + 20i3 - 2i. 20i3 Collect the terms in 61701j - 30850j - 30853j. -2j Collect the terms in -288m + 288m + 4m*2. 4m*2 Collect the terms in -6b*2 + 50b - 54b - b2 + b2. -6b*2 - 4b Collect the terms in 2z2 - 8z*2 + 0z*2. -6z*2 Collect the terms in 16 + 5 + 5b*3 - 21. 5b*3 Collect the terms in -7o*2 + 1 + 12o*2 - 1. 5o*2 Collect the terms in -322a*2 + 609a*2 - 339a*2. -52a*2 Collect the terms in 435c*2 - 435c*2 + 17c*3 - 15c*3. 2c*3 Collect the terms in -5 - 6 - 10g + 13g. 3g - 11 Collect the terms in 39q3 - 76q*3 + 38q3 + 9 - 9. q3 Collect the terms in -20r - 46r + 35 - 35. -66r Collect the terms in -26w*2 + 6w*2 + 17w*2. -3w*2 Collect the terms in -75g + 13g + 23g. -39*g
Let u = 187 + -182. Let k(j) = j*2 - j + 3. Determine k(u). 23 Suppose 3g - 3 = 3v, -v - 4 = -5. Let r(m) = -m3 - 1 - 6m + 3m - 3m*g + 2m2. Let o = -7 - -5. Give r(o). 9 Let i(g) be the second derivative of g4/3 + g3/2 - g2 + 50g. Calculate i(1). 5 Let l(v) = 15v - 38. Let d be l(2). Let m(c) = -c*3 - 7c*2 + 8c - 6. Determine m(d). -6 Suppose -4w + 191 = x, -3w + 190 = 3x + 49. Let k be 4/(-10) + w/(-30). Let a = k - -3. Let y(q) = 7q - 1. Calculate y(a). 6 Let a be 6/(-12)(-5 - -15). Let w(o) = 2o*2 + 8o + 6. Give w(a). 16 Let z(f) = 2 - f - 7f + 5f + f. Let r be (-4)/3 + (-95)/(-15). What is z(r)? -8 Suppose -8o = -7o. Suppose -5b = -4l - 13, 3b - 4l - 11 = -o. Let y(a) = -2 + 1 + 0 + a. Determine y(b). 0 Suppose -5f + 15 = -125. Suppose -3l - 4 - 28 = -5n, 3l = 4n - f. Let c(k) = -5 + 5k - 2k + 10 - nk. Determine c(5). 0 Suppose 13i - 8i = 15. Suppose -ik - 2k - 4m - 26 = 0, -2m = k + 10. Let n(y) = y*2 - 1. Determine n(k). 3 Let u(m) = -2m*2 + 2m - 3. Let z be u(2). Let a = 13 + z. Let b(s) = -2s2 - 4s*2 + 3 + 0s*2 + as + 5s2. Give b(5). 8 Let c(o) = -o3 + 4o*2 + 6o - 5. Let q = -13 - -18. Suppose -p = -qp + 16. Calculate c(p). 19 Let k be (8/(-14))/((-4)/28). Let u(c) = -5c + 0 + 2 + 0 + kc. Suppose -2g - 3w = -15, 2w = 3g + 4w - 10. Calculate u(g). 2 Let w(o) = o*2 - 5o + 3. Let t = -25 - 23. Let c = t - -52. Determine w(c). -1 Let k(l) = -12l + 7. Let t(a) = a - 3. Let g(f) = k(f) + 5t(f). Calculate g(6). -50 Let y(o) be the first derivative of o2 + o - 5. Let k = 82 - 77. Give y(k). 11 Let j(v) = v2 - v. Let k(l) = 3l2 - 5l + 3. Let t(w) = 4j(w) - k(w). Suppose -3g + 29 + 13 = 0. Let x be (-1 + 1)/(g/(-14)). Give t(x). -3 Let n(c) be the third derivative of c*6/120 - 2c5/15 + c3/2 - 11c2 - 1. Determine n(8). 3 Let m(t) = -t3 + 7t*2 - 4t - 2. Let a be 104/28 + 2/7. Suppose 25 = 4w + 5i - ai, -w - i + 7 = 0. Give m(w). 10 Let m(d) = -2d*2 - 5d + 9. Let k(z) = z*2 - z. Let u(b) = -3k(b) - m(b). What is u(9)? -18 Let a = 10 - 3. Let q(p) = -2p2 + 11p + 12. Let s(x) = -3x2 + 17x + 16. Let v(h) = -7q(h) + 5s(h). Calculate v(a). 3 Let g(o) be the second derivative of o*5/20 + 5o4/12 + o3/2 - 2o2 + o. Suppose 5i + 50 = -2a - 15, 4i = -5a - 69. Let x = i + 8. Give g(x). 5 Let g = -9025 + 9022. Let l(i) = 0 + i + 7 - 1. What is l(g)? 3 Let u(v) be the second derivative of -v5/20 - v4/2 - v3 - v. Let w(q) = -6q2 + q + 2. Let b be (-2 - -4 - 5) + (-9 - -11). Let s be w(b). Give u(s). 5 Let j(p) = p2 + 3p - 4. Suppose -4z - 2z + 12 = 0. Suppose zt = -t - 9. What is j(t)? -4 Let a be ((-2)/(-2))/((-14)/(-406)). Let g(z) = z - 30. Give g(a). -1 Let r(x) be the first derivative of x*3/3 + 3x + 4. Suppose 3o - 10 = 5o - 2y, -3y = 3o - 15. Give r(o). 3 Let c(l) = 0l + l*2 + 3 - 2l*2 - 8l + 5l - l. Calculate c(-3). 6 Let x(l) be the third derivative of -l5/30 - l4/12 - l3/6 + 139l*2. Calculate x(2). -13 Let w be -920/12 - (5 + -10). Let y(c) = -c*3 - 11c*2 - 9c - 5. Calculate y(w). -15 Let q(m) = -m*3 + 21m*2 + 23m - 24. Let w = 1467 - 1445. Give q(w). -2 Let g(f) be the second derivative of -19f - 5/2f*2 + 0 + 1/6f*3. What is g(5)? 0 Let o(p) = 2p + 995p2 + 9 + 6p + 3 - 497p2 - 504p2 - p3. What is o(-5)? -53 Let r(o) = -7o2 + 5o + 7. Let b(u) = -2u + 33. Let i be b(19). Let p(c) = -11c*2 + 8c + 11. Let k(z) = ip(z) + 8r(z). Determine k(-2). -3 Let j(g) = 5g2 - 10g - 11. Let t(i) = -6i2 + 11i + 13. Let f(m) = -7j(m) - 6t(m). What is f(-4)? -1 Suppose 9n = 9 + 9. Let h(k) = -5k*2 - 4 + 3k*n - 2k*2 - 23k - k*3 + 19k. Determine h(-3). -1 Let o(j) be the first derivative of j*3/3 - 5j*2/2 - 7j + 8. Let q(x) = -3x - 1. Let i be q(1). Let m = 2 - i. Determine o(m). -1 Let q(m) = -18m - 37. Let v be q(-2). Let y(n) = 4n - 2. Give y(v). -6 Let s(r) = 12r*2 + 9. Let z(j) = 13j*2 + 11. Let v(c) = 6s(c) - 5z(c). Calculate v(-1). 6 Let s(r) = -r2 + 3. Let w be s(0). Suppose 3q + 42 = 3m - 45, 0 = m + wq - 25. Let y = m + -25. Let c(x) = x*3 - 3x*2 - x - 2. Calculate c(y). -5 Let v(o) = -183o + 67. Let f(k) = -42k + 17. Let n(s) = 9f(s) - 2v(s). Calculate n(6). -53 Let j(d) = 29d*3 - 9d - 11. Let g(t) = -14t3 + 4t + 5. Suppose -3i - 15 = -f, -5i - 3f = f + 8. Let a(k) = ij(k) - 9g(k). Let s = 0 + 1. Give a(s). 9 Let o(i) = -22 + 2i - 15 + 34. Let a(k) = -3k + 4. Let n(v) = 5a(v) + 7o(v). Let m(s) = s + 4. Let q be m(0). Determine n(q). -5 Suppose j - 5g - 7 = 0, 0j + 4g = -j - 2. Suppose -2p = 4d - j, -p = -d - 0 + 5. Let x(r) = 9r2 - 6r*d - 3r + r*3 + r - 2. Calculate x(-2). 6 Let l be (-5)/15 + (-46)/6. Let p = 11 + l. Let c(v) = 0 + 24v*p + 4 - 25v*3. What is c(0)? 4 Suppose -38 = -3q + 37. Let z(o) = -q + 16o + 56 - 3o - 29. Determine z(2). 28 Let o(f) = -367f2 + 4 + 175f*2 + 6f + 189f2. Give o(3). -5 Let x(o) = 7o*2 - 13o + 2. Let g(t) = -12t2 + 25t - 3. Let n(s) = -4g(s) - 7x(s). Let w = -6 + 0. Determine n(w). 16 Let l(u) = 3 - u*3 + 2 - 4. Let n = 0 - -2. Suppose 3 = -nh + 1. Give l(h). 2 Suppose -5j + 29 = -4r + 8r, -4j + 3r + 17 = 0. Suppose -386 = -jb - 71. Let y be 1/(b/15 + -4). Let l(v) = v*2 - 3v - 7. What is l(y)? 3 Let u(s) = s + 6. Suppose 423 = -2q - 45q. What is u(q)? -3 Let c(g) = -8g3 - g2 - g - 1. Suppose 15y - y = -1456. Let a = y - -103. Give c(a). 7 Let z(b) be the third derivative of b*4/4 - 8b*3/3 - 3b*2 - 9b. Determine z(3). 2 Let z(p) = p*3 - 3p*2 - p - 1. Let h(o) = 3o*3 - 5o*2 - o - 3. Let t(d) = -2h(d) + 5z(d). Give t(-4). -3 Let j(k) be the second derivative of -k6/180 + k5/30 - k4/8 - 4k*3/3 + 5k. Let f(a) be the second derivative of j(a). Calculate f(3). -9 Suppose 0 = 3q - 9 + 3. Let w(u) = 2u*2 + 3uq - 3 + u3 + 2u - 8u*2. Give w(2). -3 Let a(s) = s + 6. Let c be a(0). Suppose h + 7 + 3 = 4k, -3h + 9 = k. Let f(d) = -3d2 + dh + d*2 - 2 + 8d. Determine f(c). 10 Let p(y) be the first derivative of 13y2 + 336. Determine p(-1). -26 Let u(b) = -2b - 2109 + 5b + 7b + b*2 + 2115. Determine u(-9). -3 Suppose -4g + 3 = -13. Suppose gx = 5v + 15, 5x - 4x = -v - 3. Let d(t) = t*2 + t + 8. What is d(x)? 8 Let z(n) be the second derivative of 1/3n*4 + 1/6n*3 + 1/20n*5 - 1/2n*2 + 0 - 2n. Give z(-4). -5 Let w be (8 - 4)/(0 + -1). Let h(z) = -z*3 - 4z*2 + 2z + 2. Determine h(w). -6 Let q(s) = 2s2 - 20s - s*3 + 0 + 22s + 1 + 1. Let x be q(3). Let n(h) = 6h - 1. Calculate n(x). -7 Let u be 8/(-28) - 8/(224/(-540)). Let b(j) = 2j*2 - 2 + uj - j*2 - 26j + 3. Determine b(4). -11 Let s(n) = 8n + 34. Let c(z) = -3z - 17. Let x(y) = -5c(y) - 2s(y). Determine x(16). 1 Let y(o) = -o*2 - 5o + 6. Let j(k) be the third derivative of k*4/6 - 5k*3/6 + 24k*2. Let z(v) = 4j(v) + 3y(v). What is z(-2)? -16 Let t = -64 + 56. Let p be 90/(-27) + 0 + t/(-6). Let a(z) = 21z*2 - 6z + 1. Let w(v) = -4v2 + v. Let h(u) = 2a(u) + 11w(u). What is h(p)? -4 Let s(o) = -15o - 31o + o2 + 44o. Determine s(3). 3 Let n(b) = 11b + 8. Let l(j) be the third derivative of 5j*4/24 + 2j*3/3 + 2j*2. Let y(q) = -5l(q) + 2n(q). Let d = 77 - 80. What is y(d)? 5 Let a be -1((-260)/(-5) - 5). Let s = 52 + a. Let c(r) = r + 4. Calculate c(s). 9 Let o(s) = -7 + 4 + 8s + 3s*2 - 5s2. Calculate o(3). 3 Let r = 13 - 11. Let o(m) = m2 - m + 1. Let d(p) = 6p2 - 2p + 2. Let n(v) = d(v) - 3o(v). What is n(r)? 13 Let y(v) = 215v - 212v - 5 + 3v2 + v3 + 5v2. Give y(-8). -29 Let j be (-6)/4 - 42/28. Let d be 2/(-2) - j1. Let y(b) = 2b2 + 4b - 3. Give y(d). 13 Let o(y) = -14y + 17. Let u(g) = -g. Let m(p) = -1 + 2p - 1 + p + 1. Let t(d) = 6m(d) + 13u(d). Let v(n) = 6o(n) + 17t(n). Calculate v(3). 3 Let r(k) = 6k3 + 4k*2 + 3k - 4. Let v(w) = -7w3 - 4w*2 - 4w + 5. Let i(j) = -6r(j) - 5v(j). Suppose 2 + 2 = -x. Give i(x). -9 Suppose 2y - 24 = -2b, -y + 3b + 4 = 12. Let r(s) = -2s*2 + 9s + 1. Give r(y). -34 Let j(r) = r*3 - 59r*2 - 60r - 8. Let a be j(60). Let b(h) = -h*3 - 9h*2 - 3h - 6. Calculate b(a). -46 Let s(l) = 3l + 2. Let w(o) = o2 + 19o + 12. Let r(f) = 6s(f) - w(f). Let y be (15/10)/(6/(-8)). Give r(y). -2 Suppose 2f + m = f - 5, -f + 5m + 7 = 0. Let k = 8 - 4. Let b = f + k. Let x(q) = 5q3 + q2. Give x(b). 6
Let v = 39 - 41. Which is the second biggest value? (a) 0.1 (b) v (c) -3 (d) 3/7 a Suppose 0q + 10 = 2q. Suppose 8 = -3w - p, -20 = -w + 6w - 5p. Let y = 0 - w. Which is the biggest value? (a) y (b) q (c) 0.4 b Let x = -59/26 + 10/13. Which is the smallest value? (a) x (b) 0 (c) -0.3 a Let u(k) = k + 10. Let s be u(-10). Let z = -0.01 - -5.01. What is the biggest value in z, -1/8, s? z Let c = 0.48 - 0.67. Let y = 7.81 - c. Let r = -11 + y. What is the biggest value in -0.4, r, -0.2? -0.2 Let l = 7 + -4. Let j = -2 - -2.1. Let s = j + 0.3. What is the second smallest value in l, 0.3, s? s Let h = -0.5 - -0.34. Let q = h - 0.04. Let t(u) = -u - 1. Let i be t(4). What is the smallest value in q, i, 1/6? i Let v = 1.46 + -3.46. Which is the third smallest value? (a) 0.2 (b) v (c) -19 a Let w = 9 + -2. Let d = -4.849 - 0.071. Let x = -0.08 + d. Which is the third biggest value? (a) x (b) w (c) 3 a Let u = -5.7 + 6. Let d = u - 0.2. Which is the second biggest value? (a) 3 (b) d (c) -3/5 b Let t = -2.8 + 7.8. Which is the fourth biggest value? (a) 0.2 (b) 7 (c) 1 (d) t a Let m = -205 + 205. Which is the third biggest value? (a) -1/6 (b) -0.5 (c) m (d) 0.2 a Let h = 0.46 - -0.04. What is the third biggest value in -5, -2/3, h? -5 Let c = 10/57 - 16/19. Let o = -11 - -7.7. Let m = -3 - o. What is the third biggest value in m, c, 1/2? c Let d = 2.73 - -0.27. What is the second biggest value in d, 0, -4? 0 Let g = -4 + 6. Let f = 20 + -19.92. Let s = -0.02 - f. Which is the third smallest value? (a) s (b) g (c) -2 b Let k = -2.07 + 0.07. Let x be -1(2/(-8) + 0). What is the third smallest value in 2, k, x? 2 Let k = 11 + -5. Let n = 0.09 + -5.09. Let c = n + k. What is the second biggest value in 2, -2, c? c Let d be (-2 - (-200)/102)3. Let a = 27 + -13. Let u = a + -14. What is the second smallest value in d, -5, u? d Let g = -1.2 + -0.3. Let l = -1 - g. Let b = 1.5 - l. What is the second biggest value in 5, b, 2/19? b Let q(l) = l3 - 7l*2 + 7l - 5. Let y be q(4). Let p be (y - -3)(-1)/(-2). Let c = p - -21/2. What is the second biggest value in c, -3/2, -2/3? -2/3 Let g = -2 + 1. Let x = 0 + g. Let r = 1 + -0.9. Which is the third smallest value? (a) -0.3 (b) r (c) x b Let a = -18 - -19. What is the smallest value in 0.1, a, -5? -5 Let o = -3 + 1. Let q = -4 - o. What is the third smallest value in -1/4, q, 0.1? 0.1 Let q be (-12)/(-36)((-17)/7 - -2). Which is the smallest value? (a) 1 (b) 2 (c) -1/5 (d) q c Let s = 88.7 + -89. Which is the second smallest value? (a) s (b) 0.3 (c) -1/8 (d) -2/7 d Let z = -0.076 + 0.026. Let y = 0.4 - 5.4. Which is the second biggest value? (a) y (b) -4 (c) z b Let p = -6.6 - 0.4. Let z = 4 + p. Let n = z + 3.2. Which is the smallest value? (a) -1/2 (b) n (c) -2/21 a Let i(p) = -p - 9. Let v be i(0). Which is the second smallest value? (a) -2 (b) v (c) 5 a Let l be -4 + 1 - 245/(-77). Which is the second biggest value? (a) 1/11 (b) 2/7 (c) l c Let n = -3 - -5. Let z = -161/2 + 79. Let u = -5 + 3. What is the third biggest value in n, u, z? u Let z = 8 + -9. What is the smallest value in 1, 3, z, 1/3? z Let j = 86 + -95. What is the smallest value in -5, 3, j? j Suppose -l - 2s = -0 + 2, 10 = l - 2s. Suppose 5v - 4 = lm, -m + 4 = -2m + 2v. Which is the second biggest value? (a) m (b) -3 (c) -2 c Suppose 35 - 7 = 4g. Let w = g + -8. Which is the biggest value? (a) -4 (b) w (c) 5 c Let c = 29.2 - 29. Let x be (-2)/(-12)4/3. What is the biggest value in 1/8, c, x? x Suppose -4t = 2t - 18. What is the biggest value in 5, -2, t, 5/6? 5 Let w be 2/(-6) - (-14)/15. Let v be 10/(-20) + (-3)/(-14). Which is the second biggest value? (a) w (b) v (c) 2 a Let m = 8.24 + -8. Let v = m - -0.06. Which is the third biggest value? (a) v (b) 3 (c) -0.3 c Let z = 13 - 11.4. Let o = z - 1.6. Which is the second smallest value? (a) -5 (b) -0.5 (c) o b Let y be 3/(-3) + 10/9. Let t = -2.96 - -3. Which is the second biggest value? (a) t (b) 0.3 (c) y c Let l(t) = t*2 + 8t + 7. Let u be l(-7). Let w be 1/9(-5 - -3). What is the smallest value in w, u, 0.3? w Let g(b) = -b + 6b*2 + 3b - 2b3 + b3 - 3. Let n be g(6). Let a be (-8)/n - 4/(-4). What is the second biggest value in a, 0.1, -4? 0.1 Suppose 3s = 3h + 66, h + 2h + 5s = -50. Let z = h - -179/9. Let j = -0.3 - -0.1. Which is the third smallest value? (a) 0.2 (b) z (c) j a Let p = 5.26 - -0.34. Let i = p + -6. Which is the second biggest value? (a) 1 (b) i (c) -0.3 c Let v = -19 - -14. Let g = 0.1 + -0.2. Which is the second biggest value? (a) g (b) 1/4 (c) v a Let k = -0.01 - 0.49. Let f = 0.6 + k. Which is the smallest value? (a) -4 (b) f (c) -1/2 a Let v = 0.0385 - -3.8915. Let f = -0.77 - v. Let y = f + -0.3. What is the second biggest value in 3/5, y, 2? 3/5 Let d = 0.05 - -0.05. Which is the second smallest value? (a) -0.4 (b) d (c) -2/11 c Let o = 0.2 - -0.1. What is the second biggest value in o, 0.01, -3? 0.01 Let y = -3.2 - -3.1. Which is the fourth smallest value? (a) -1/2 (b) y (c) -5 (d) -4 b Let y = -4.5 + 1.5. Which is the biggest value? (a) -2/7 (b) 5 (c) y b Let b = -0.97 - 0.13. Let p = -0.99 - 0.01. Let m = b - p. What is the second smallest value in 1/2, m, -0.5? m Let x = 46 + -44. Let o = -2 - -1.8. Let t = o + 0.2. What is the second biggest value in -1, x, t? t Let p = 541/7 + -77. Which is the biggest value? (a) -0.1 (b) p (c) 2/5 c Let t be (-3)/12 - 50/(-8). Let u be (-32)/5 + t/15. Let n be 5/u + 1 + 0. What is the biggest value in n, 1/2, -3? 1/2 Let t be (-1(-3)/(-18))/1. What is the biggest value in 4, -1/3, t, 3? 4 Let z = 16.72 + 0.28. Let o = z - 24. Let l = 4 + o. Which is the third biggest value? (a) -4 (b) l (c) 1 a Let u = -2.8 + 2.2. Which is the second biggest value? (a) u (b) -4/5 (c) -1/3 a Suppose 0 = 3u + u. Let r be (1 - (3 - u)) + -2. Let f = -6 + 1. What is the second smallest value in 3, f, r? r Let w = -21 - -22.1. Let a = w - 0.1. What is the third biggest value in 5/3, a, 0? 0 Let t = 4.07 + -0.07. Let b = -22.3 + 22. Suppose 6y - y = 0. What is the second biggest value in y, t, b? y Let i = -6.7 - -3.77. Let r = 0.07 - i. Which is the third biggest value? (a) -1 (b) r (c) 5 a Let y = -2.12 + 0.12. Which is the biggest value? (a) 2 (b) 2/5 (c) y a Let o = 0.61 + 4.79. Let g = o - 5. Which is the second smallest value? (a) -2/19 (b) g (c) 5 b Let k(w) = -w*2 - 18w - 19. Let m be k(-17). Which is the biggest value? (a) 0.2 (b) 0.12 (c) m a Let s = -157 + 466/3. Let x = -1.1 - -0.8. Which is the third biggest value? (a) s (b) x (c) -1 a Let f = 6538/2043 - -5/227. Let h = f - 511/153. What is the third biggest value in 1, h, -0.4? -0.4 Let w = -0.09 - -2.09. Let h = -3 - -2.9. What is the biggest value in 3/7, w, h? w Let s = 55/18 - 14/9. Let k = 0.04 - -3.96. What is the biggest value in 2, k, s? k Let d = 0.2 + -0.2. Let f = 5 - d. Which is the third biggest value? (a) 2 (b) 1 (c) f b Let p = -7.4 + 7. What is the biggest value in -1, p, 0? 0 Let p = 12 - 9. What is the second smallest value in -5, p, -0.1? -0.1 Let w = -457/88 + 43/8. Which is the second smallest value? (a) 6/11 (b) -2 (c) w c Suppose 2k = -5d + 28, 0k + 5k - 4d = 37. Let l = 13 - k. Suppose 0 = -5r + 6 + l. Which is the third smallest value? (a) -2/17 (b) 0 (c) r c Let g = -0.9 - 1.1. Let p be 1/3(-54)/24. What is the third biggest value in p, g, 0.4? g Let c be 2/5 - 24/35. Let s = -2/425 - 247/37825. Let a = s - -269/178. What is the biggest value in c, a, 0.4? a Suppose -2 = -3t + 13. What is the biggest value in -1, 1/3, -0.1, t? t Let y = 91 + -89. What is the third biggest value in 0, 3, y, 1/11? 1/11 Let x = -3/23 + 124/69. What is the biggest value in x, -1/30, -3? x Suppose 0 = -2t + 3t - 75. Let r be t/27 + -2 - 1. What is the second biggest value in -0.5, r, -1/3? -1/3 Let n = -0.9 + -0.1. Let c = -13 - 2. Let w be ((-4)/c)/(2/3). What is the second smallest value in n, w, -2? n Let l = 0.25 - 0.45. What is the third biggest value in 1/6, 2/23, l? l Let y = 10107/4 - 2539. Let x = -12 - y. Let i = 3.99 + 0.01. What is the third biggest value in i, x, -4? -4 Let a = 5 - 7. Let w be (-9)/a - 1/2. Let t be (w/42)/(2/(-12)). What is the second biggest value in 5, t, -0.5? -0.5 Let p = -87 - -82. Which is the fourth smallest value? (a) -2/17 (b) 0 (c) p (d) -1 b
Multiply 0 and 60617484. 0 What is -866807 times 0.1? -86680.7 What is 18011 times -311? -5601421 -1 * 72560841 -72560841 Calculate -0.39-0.02798414. 0.0109138146 Product of -1893 and -544. 1029792 What is -638701 times 44? -28102844 What is -143933 times 911? -131122963 What is 199604265 times 0? 0 Product of -1444468 and -0.2. 288893.6 Calculate 283428.406-0.3. -85028.5218 What is -104 times 56847? -5912088 Multiply -0.5 and 94488789. -47244394.5 0 * 249957005 0 Multiply 5442 and -6621. -36031482 0.29-0.1946595 -0.056451255 Work out -56 -0.0046024. 0.2577344 Calculate 64-361953. -23164992 Multiply -11 and 565951. -6225461 Calculate -56388580.90.1. -5638858.09 Product of -2.6 and -36927445. 96011357 Product of 2 and 85490513. 170981026 What is the product of -34 and -458.8868? 15602.1512 Calculate 140.999783-0.4. -56.3999132 -59 -0.08184764 4.82901076 What is the product of 11 and -96247.19? -1058719.09 1483275 times 0.3 444982.5 Work out 169.8873 * -6. -1019.3238 What is -4.8 times 17205? -82584 What is the product of -3 and -11421526? 34264578 Multiply -2150 and 462. -993300 Multiply -33322 and 877. -29223394 Calculate -5-65601641. 328008205 Calculate -3590519-13. 46676747 4-0.119625 -0.4785 -258696 2.1 -543261.6 21 times 63294 1329174 Work out 13.8 * -0.02829. -0.390402 Product of -14380.2 and 292. -4199018.4 Multiply 2.61 and 0.56919. 1.4855859 What is the product of 6320 and 31385? 198353200 Product of -127.13 and 13. -1652.69 Calculate 53.324368. 16.62184 Product of 0.063 and 1.4718. 0.0927234 What is -336157 times -4? 1344628 Calculate -611-23069. 14095159 Work out 1 * -116013.7. -116013.7 Multiply 0.5897 and -33.4. -19.69598 3.116421.81 5.6407202 Calculate 9844-0.113. -1112.372 Multiply 1642964 and 0.3. 492889.2 Multiply 5 and -58541229. -292706145 -1006429982 * -0.3 301928994.6 What is -8657.37 times -0.5? 4328.685 Product of -6070200 and -0.1. 607020 What is 0.148399 times 2.57? 0.38138543 Work out 0.068 * -1330836. -90496.848 -773 * -558149 431449177 Multiply 9184 and 9608. 88239872 Calculate 340021.3-0.1. -34002.13 What is 4218.74 times -0.03? -126.5622 Calculate 1401.642.428. 3403.18192 Calculate 22.0214937. 328912.74 What is -4589588 times 31? -142277228 Calculate 21.84130.02. 0.436826 What is -0.08 times -459.91985? 36.793588 Multiply 16558668 and 0.3. 4967600.4 470759 * 68 32011612 What is the product of -0.44 and -21277.5? 9362.1 Calculate 1246714162. 249342832 -0.05765 -0.038864 0.0022405096 Work out -0.5 * -599816. 299908 Calculate -32709-0.015. 490.635 -17 225788 -3838396 -9-20308800 182779200 What is -254190 times -0.07? 17793.3 6-7098488 -42590928 Work out -0.25824 * 1372. -354.30528 Multiply 4 and -43143510. -172574040 Product of 201 and 6093. 1224693 What is 0.2473 times 3.27246? 0.809279358 -87873 -62984 12.5 12.4087 155.10875 Multiply -0.39849 and -3.7. 1.474413 Work out -17.3 * -8.4445. 146.08985 What is the product of 1.47 and 877? 1289.19 Product of -6751935 and 0.4. -2700774 What is 0.106 times -50.036? -5.303816 What is -5 times 3627376? -18136880 10 times 3647877 36478770 -1496.5954 * 0.3 -448.97862 Work out 58946 * 17055. 1005324030 Multiply 0.08595 and -5.372. -0.4617234 Calculate 371630.18. 6689.34 88361.9336 17085.2896 What is the product of 158 and -326748? -51626184 Calculate 5974458-3. -17923374 Multiply 0.18 and -885699.1. -159425.838 Calculate -463326-0.02. 9266.52 What is -5 times -0.2620095? 1.3100475 11.64 * 685 7973.4 What is 0.06 times -0.656867? -0.03941202 Calculate 6178060.97. 599271.82 What is -2207.19 times -0.0164? 36.197916 -15487-0.08623 1335.44401 Calculate -12504190.01. -12504.19 Product of 91313425 and -0.2. -18262685 Calculate 4.96154-227. -1126.26958 What is -18570 times 377? -7000890 69.550.0383 2.663765 Work out -48.19 -355203. 17117232.57 Product of -6.4849 and 1.3. -8.43037 What is the product of 1 and -27282617? -27282617 Product of -32861 and -65. 2135965 What is -157989 times 9.767? -1543078.563 Multiply -74839 and -192.2. 14384055.8 Calculate 21.35114087. 2435757.45 Multiply -0.074 and -155054. 11473.996 Work out -7493155 0.2. -1498631 Product of 68023 and -743. -50541089 Work out 0.029 * -40143. -1164.147 Product of -1193.6 and -743. 886844.8 79.033 times 0.3 23.7099 What is 1467 times -1.4283? -2095.3161 4893219 * 0.52 2544473.88 Multiply 2 and -75211. -150422 19.726-0.9798 -19.3275348 10757140 times -0.3 -3227142 Multiply 5687.2 and 21.9. 124549.68 Work out 70 3353324. 234732680 -4.16 times 53337 -221881.92 What is the product of 224.245 and 1.6? 358.792 Work out 0.1 * 410272.6. 41027.26 Multiply -2329.573 and -51. 118808.223 0.4-2588.63779 -1035.455116 Multiply -2 and -41960299. 83920598 What is the product of -11416821 and -3? 34250463 What is the product of -1.1 and -2482.27? 2730.497 Product of 2254 and 8653. 19503862 Calculate -0.465.1669. -26.06676 0.06638026 times 0.1 0.006638026 Multiply 5 and -16408.6369. -82043.1845 Calculate 2-1.02062. -2.04124 Calculate -14-2.347346. 32.862844 Work out -3.3 * -5294432. 17471625.6 Work out -1.4 * -157588.51. 220623.914 27914922-0.4 -11165968.8 444 times -2661.26 -1181599.44 What is the product of -133 and 82027? -10909591 0.26069327.7 1213865.54 Calculate -0.12527286. -252728.6 Work out -5.7008 -58. 330.6464 Work out 170929 * 132. 22562628 Work out 690 * 25201. 17388690 -390033 -117009 Calculate 119360-0.05. -5968 Product of -114996 and -4277. 491837892 Product of 0.1 and -95189880. -9518988 -4.68952-12 56.27424 Product of -23 and 739.238. -17002.474 Product of 105.01 and 8.89. 933.5389 -0.076 times 5364 -407.664 52 63735 3314220 Multiply 1677 and -0.933. -1564.641 0.365-6.22316 -2.2714534 Product of -49.37 and 0.37601. -18.5636137 -1-5869116.4 5869116.4 0.18 times -1.2630481 -0.227348658 Work out 440 * 50681. 22299640 -2605 times -124119 323329995 0.4253.463343 101.3853372 Product of -1.01299647 and 0.5. -0.506498235 -166 times 0.372612 -61.853592 Work out -280.3 -25814. 7235664.2 Multiply -91 and 2813.04. -255986.64 Multiply -2069.089 and 8. -16552.712 -3 times -1225634 3676902 234.5-0.16163 -37.902235 Work out -0.3 -1.896298. 0.5688894 0.2 times 412.365958 82.4731916 Product of 0.42 and 103.667. 43.54014 261030.336 8770.608 Product of -55 and 8375883. -460673565 9701436 -0.4 -3880574.4 Work out -0.3 * 199406038. -59821811.4 Multiply -0.2 and -8.7947517. 1.75895034 179110-3030 -542703300 283.458 times 26 7369.908 Work out 3653 7450. 27214850 Calculate -2.79436830.4. -1.11774732 Calculate -0.05680642-0.31. 0.0176099902 What is the product of 0.24757 and 1972? 488.20804 What is the product of 1 and -808.6356? -808.6356 Multiply 9476 and -538. -5098088 Multiply -22 and 425003. -9350066 Calculate -22159213. -3502686 Multiply 16067917 and -31. -498105427 Multiply -0.5 and 1046.9294. -523.4647 Product of -690 and -3393. 2341170 What is the product of 318 and -299.1? -95113.8 -13.38 -21586 288820.68 -35.11432.9 -15199.119 Calculate -26136416800. 0 0.537080512 1.07416102 Calculate -743-20777. 15437311 -44348060-0.02 886961.2 2570451.4 -7 -17993159.8 What is 79 times -92757? -7327803 Multiply 771.69 and 1262. 973872.78 What is -0.8 times 387163? -309730.4 What is -10.01469 times 386? -3865.67034 6467797 times -1.7 -10995254.9 Product of -0.185 and 5.4277. -1.0041245 Multiply 3.942876 and -0.5. -1.971438 Multiply -0.741948 and -6. 4.451688 Product of -1111912 and 1.4. -1556676.8 475.218-0.032 -15.206976 -52-550871 28645292 Product of -41261.551 and 4. -165046.204 What is the product of 29909218 and 51? 1525370118 -1 times 85962 -85962 What is the product of 142 and 60.28? 8559.76 What is 0.6 times 4.818697? 2.8912182 Work out 756091 * 65. 49145915 What is -0.07 times 4761743? -333322.01 Calculate 253-0.615973. -155.841169 3.5833157 118702.06 Work out -125 * -2172773. 271596625 Product of 175830 and -36. -6329880 Multiply -1.5 and 15.67744. -23.51616 Product of -0.285 and 1268. -361.38 Calculate 6.6-34.786. -229.5876 What is -454129.85 times 2? -908259.7 Work out -2599324 -1. 2599324 What is the product of 608 and 19112? 11620096 What is 0.31 times -1.2294184? -0.381119704 Product of 3 and 9144917. 27434751 Multiply -0.7 and -37578315. 26304820.5 Work out 0.1 * -6888754. -688875.4 What is 0.3 times 583340.1? 175002.03 What is 14 times 4489773? 62856822 -3 * -2088120 6264360 Multiply -2009 and -7109. 14281981 Calculate 34-7605154. -258575236 Calculate -2583.98070. -20852073 What is 113 times -9.16872? -1036.06536 What is -3 times 710.8143? -2132.4429 Calculate -4.6396215. -28831.385 0.09 -80.0624 -7.205616 755.23 times -19.53 -14749.6419 8728.86 7725.92 What is 11 times 7526796? 82794756 Calculate -73291523.6. -21281222.8 What is 4096813 times 0.9? 3687131.7
Solve s - 3f = -4s - 10, -2s = 3f + 25 for s. -5 Solve b + 12 = -4y, -4b = -2y - 15 - 9 for y. -4 Solve -3q = 4t - 9t - 17, -q = 3t - 1 for q. 4 Solve k - 3h = -16, -5k = -2h - 18 + 33 for k. -1 Solve 0 = -16f + 13f + 3, m = 4f - 2 for m. 2 Solve -r = 9b - 8b + 4, -14 = 2b + 5r for b. -2 Solve 5t - 6 = 2j, 0t - 8 = t - 5j for t. 2 Solve 5x + 22 = f + 6, -12 = 5x - 2f for x. -4 Solve 4b + 16 = 2y, 3b = 3y - 4 - 8 for y. 0 Solve -4k - 12 = 6v - 10v, 5k = 4v - 11 for k. 1 Solve -2o = 2t - 2, 2o + 5 = -5t + 16 for t. 3 Solve 3q - 2y = 5, -2q + 2 = -y - 2 for q. 3 Solve -5l + 5 = -2b + 5b, -4l + 2b = -26 for l. 4 Solve 8t + 6 - 22 = -5h, 4h = -4t + 8 for t. 2 Solve -7s = -12s - 3i - 11, 3s = -4i for s. -4 Solve 5y - d + 0d = -7, 0 = 2y + 4d - 6 for y. -1 Solve -2h = 3u - 18, 3u + 25 = 3h + 43 for h. 0 Solve 4y + 17 = 4u - 9u, 4y = 2u + 18 for y. 2 Solve -2f - 3t = -4, -3t + 141 = -4f + 113 for f. -4 Solve -3f + 3 = m, 0 = -2f + 5f - 4m - 3 for f. 1 Solve 5s - 3d - 2 = -13, 4d = 3s for s. -4 Solve -11z = -16z, -z = -3s - 9 for s. -3 Solve -3j + p + 5 = -0j, 5j - 5p = 15 for j. 1 Solve 1 = -h - 5i + 6, 0 = 3i for h. 5 Solve -4j + 2y - 5y - 4 = 0, -4j + 2y = 24 for j. -4 Solve 0 = -5c - 3k - 10, c + 7 = 2k - 8 for c. -5 Solve 3x = 2i + 4 - 6, 4x = 4i - 8 for x. 2 Solve 2w + 4n = 8, 5w + 4 = 22n - 20n for w. 0 Solve -n - 1 = 0, 4n + 0n + 14 = 2h for h. 5 Solve 2g - 12 = -2c, -309 = 2g - 319 for c. 1 Solve 5d - 31 = 5v - 1, -5v = 10 for d. 4 Solve 12a + 3x = 13a - 4, 2a - 2x = 8 for a. 4 Solve -28 = -5k - 2s, -8 = -k + 2s - 3s for k. 4 Solve -2z = 4g - z - 4, 5g + z = 5 for g. 1 Solve 3l = 25p - 21p - 3, -2l - 10 = 0 for p. -3 Solve -3p = 15, d + 4d + 15 = 2p for d. -5 Solve 2b - 3s = -7, 2s - 12 = 2b + 4s for b. -5 Solve -2a = -6, 3a + 6 = -4x + a for x. -3 Solve -18 = -4t + h - 7, 3t = -2h + 22 for t. 4 Solve 22 = d + 5f + 6, -4 = -2f for d. 6 Solve 2f = 3y + 1, -9y = -4f - 10y - 5 for f. -1 Solve -4a = -4h - 8, -2a = -5h + 2h - 6 for a. 0 Solve -3l - 3 = z - l, -21 = -5z - l for z. 5 Solve -5s + l + 22 = 17, 3l = 3s + 9 for s. 2 Solve h - 1 = 0, 2j - 8h = -6h - 8 for j. -3 Solve -5y - 51 + 19 = -4t, 3y + 3 = -3t for y. -4 Solve 2y - 4u = u + 9, -5u = -5y + 15 for y. 2 Solve 3u = v + 20, 2u = -v - 4v - 15 for v. -5 Solve 4m - 37 + 25 = -2a, -2m = -5a - 18 for a. -2 Solve 20 = -5n - t, 5n - t - 60 = -90 for n. -5 Solve -5 + 0 = 5a + 3w, a = 4w - 24 for a. -4 Solve 2v - 23 = 5d + 8, -4 = -3v - d for v. 3 Solve 0 = 3h - i - 9, 3h + 5i + 0 = -9 for h. 2 Solve 0 = v - f - 8, 0f - 4f - 20 = 0 for v. 3 Solve -4 = 4j + 4u, 4j - u - 14 = u for j. 2 Solve -2w - 2j - j = -3, -5j = 5w for w. -3 Solve m + 10 = -3f, -2f - m - 10 + 3 = 0 for f. -3 Solve -i + 5 = 2p - p, -3i = 5p - 25 for i. 0 Solve -w = -3f + 8, -3f + 5w + 30 = 2f for f. 1 Solve -5v = -j - 33, -7v = -8v + 6 for j. -3 Solve 14w - 5j = 9w, -4w + 3j = 5 for w. -5 Solve 3j = -4k - 5, 11 = 24j - 27j + 2k for j. -3 Solve -3x + 5d + 19 = -5x, -5x - 4d = 22 for x. -2 Solve 3k - y = 4, 3k - 7k + 3y + 7 = 0 for k. 1 Solve -4v = 5d - 8d - 2, -3d = -2v + 4 for d. -2 Solve -v + 9 = -s, -v + 6s + 25 = s for v. 5 Solve 0 = 6y - y + n - 2, 3n = -5y - 4 for y. 1 Solve -5c + 2k + 2 = 0, -2k - k - 3 = -5c for c. 0 Solve -5k = 2b - 21, k + 3 = 6 for b. 3 Solve 2 = -3c + 2c - 3j, -3j = 3c + 6 for c. -2 Solve 1 = 3o - 3i + 10, 3i + 23 = -5o for o. -4 Solve 2b + 3z = -11, -3b + 4z - 8 = -0b for b. -4 Solve 5k + 4 - 9 = -4a, 4a - 5k + 45 = 0 for a. -5 Solve -5i + 7 = -2l, i + 17 = 13l - 8l for l. 4 Solve 3n = -2v - 16 + 14, -3v - 4n - 4 = 0 for v. -4 Solve -2v - 4 = 3r, 5v - 5r + 32 = -3 for v. -5 Solve 6q - 3d = 4q - 7, -q + d = 3 for q. -2 Solve -2p = m - 3 - 3, -4p + 6 = 5m for m. -2 Solve 2j + 6 - 19 = 5y, 4y + 10 = 2j for j. -1 Solve -2k + 3f = -9, 2f - 2 = 5k + 3 for k. -3 Solve 2s + 16 = s + 3n, 4s - 3n + 19 = 0 for s. -1 Solve 4k - 24 = 5a, -2a - 41k - 5 = -38k for a. -4 Solve -c - 3s - 6 - 3 = 0, 0 = -5s - 10 for c. -3 Solve -3k + 25 = -5r, -5k - 3r + 1 = -18 for k. 5 Solve -3x = m + 2m - 9, -3x + 13 = 5m for m. 2 Solve -18l + 5o = -16l - 16, 3l - 5o - 19 = 0 for l. 3 Solve 4w + 4a - 8 = 0, -3w + 2a - 29 = -45 for w. 4 Solve 6x + 2o = 0, -4x = -8o + 4o + 16 for x. -1 Solve -150 = -5a - n - 159, 0 = -4a - 3n - 16 for a. -1 Solve 0 = -3r + b, 5r - 6b + 2 = -5b for r. -1 Solve 5q = -2g - 0g + 13, -4q - 5g + 7 = 0 for q. 3 Solve 2u + 22n = 18n, -2n - 8 = -3u for u. 2 Solve 4z - 2z - 10 = -u, 3u = 4z for u. 4 Solve -2o = 2a + 10, -919a = -917a - 4o - 20 for a. 0 Solve 0 = -4t - 4, 6b - 12 = 11b + 2t for b. -2 Solve 5q = 0, -4k - 36 = -q - 16 for k. -5 Solve 19 = -n + 5u, 4n - 2u = 3 - 7 for n. 1 Solve -a = 2i, i - 4 = -3a + 1 for a. 2 Solve 2c - 12 = 5t, 2c + 2c = 5t + 4 for c. -4 Solve 0 = 4v - m + 25, 4v - 6m + m = -45 for v. -5 Solve x + 4t = 5x - 24, 3x + 5t = -6 for x. 3 Solve -2z = -j + 10, -41j = -39j + 3z + 1 for j. 4 Solve -p + 4p = -5r - 22, -2r + 2p = -4 for r. -2 Solve 3x + 23 = -2x + n, 6 = -3x - 2n for x. -4 Solve -z = 3j - 14, 5j + 0 - 25 = 0 for z. -1 Solve -5r - 226u - 13 = -228u, -5r - 17 = -3u for r. -1 Solve -7y + 3g + 10 = -8y, -5 = -4y + 3g for y. -1 Solve 2j + 2j = 5c + 3, 2j = -3c - 15 for j. -3 Solve 5h - 2r - 5 + 27 = 0, 0 = -3h + r - 13 for h. -4 Solve 4q = -x - 22, 2q - 3 = 4x - 5 for x. -2 Solve -28 = 4j + 4q, -q - 3 = -j - 2 for j. -3 Solve -5m + 17 = -4n, 5n = -39m + 40m - 16 for n. -3 Solve 0 = g - p - 5, -2g - 2p - 6 = -0 for g. 1 Solve 0 = -17c - 0c - 4o - 48, -o = -c - 9 for c. -4 Solve -3u = g - 17, -g + u = 2 + 1 for g. 2 Solve 2w - 11 = 5l, 4w + 8 = 5l + 25 for w. 3 Solve 2k + 4 - 11 = 3z, 3k - 15 = 0 for z. 1 Solve 3p + 11 = 2b - 7b, -2p + 1 = -5b for b. -1 Solve 2g - k - 4 = 0, 3g - 5k = 7g - 8 for g. 2 Solve 0 = 43o - 38o + 2y - 16, 3o - 2y = -16 for o. 0 Solve -7g + 10g + 5d - 21 = 0, -4d + 6 = -3g for g. 2 Solve 5b + 5c = -10, -33 = -4b + 5c - 41 for b. -2 Solve -69z + 67z = -5j - 12, z + 16 = -3j for z. -4 Solve 2w + 3y = 0, -4y + 4 = 5w - w for w. 3 Solve -4l = -5t + 22, 5 = -l + 2t - 2 for l. -3 Solve 0 = -3x + 2t + 9, -5x - t - 39 + 54 = 0 for x. 3 Solve 3z = 6y - 3y, 8 = 2y for z. 4 Solve -5l = 3g, -g + 0g = -4l for l. 0 Solve 4j + 31 = -2b + 17, -j - 20 = -5b for b. 3 Solve -5d = -c - 19, -4c - 136d = -138d + 22 for c. -4 Solve 5s + 4y - 3y = -27, 5y = 2s for s. -5 Solve 0 = -2w + 4h + 18, 3w + 3h + 2h + 17 = 0 for w. 1 Solve -17 = 5l + 3v, -4l + 4v + 355 - 343 = 0 for l. -1 Solve t + x + 18 = 4t, 0 = -4t + 3x + 29 for t. 5 Solve 3f - 3j - 9 = 5f, 6 = 3f - 2j for f. 0 Solve -2y = 5o + 17, 6o = 10o - 3y + 9 for o. -3 Solve 0 = 2f, -2 = -3h - f - 8 for h. -2 Solve -13l + 14 = -14l + 3r, 5r - 26 = 3l for l. -2 Solve 3 = 3g - 12, 5t - 5g = -15 for t. 2 Solve -3i = 14q - 18q + 14, 4i - 28 = -4q for i. 2 Solve 4d - 2d + 8 = 0, -4 = 4a - 4d for a. -5 Solve 4n - 6k = -10k + 16, 2n - 5k = 1 for n. 3 Solve -f = -2b, 2 = -5f + 3b - 12 for f. -4 Solve -3c - 2r = 16, -8 = 2c + r + 2 for c. -4 Solve 7h - 8 = 6h + z, 8 = -4h - 4z for h. 3 Solve -221s - 4 = -223s - 2b, -5s = -b + 2 for s. 0 Solve 35y - 34y - 8 = 3z, -5z - 2y - 6 = 0 for z. -2 Solve 5o - 14 = -5k + 4k, -o + 6 = k for k. 4 Solve 0 = 4y + 2b + 12, 15 = y + 18b - 13b for y. -5 Solve -98z - 15 = -4g - 97z, 3g + 3z = 15 for g. 4 Solve -5z + 5f + 30 = -3z, 12 = -3f for z. 5 Solve -58h + 32 = -54h + 5l, 0 = 3l - 12 for h. 3 Solve -3c = 3j - 30 + 9, 4c = 2j + 10 for c. 4 Solve j + 3l = -13, 5l + 22 = -4j - 2 for j. -1 Solve 36r = 39r + 4o, -4o = 5r for r. 0 Solve 0 = 3k - 27j + 32j + 11, 5k - 23 = 2j for k. 3 Solve -t = -2p + 9, 5p - 28t - 15 = -24t for p. 7 Solve 4k = -2n + 10, 10 = 2k - 0k for n. -5 Solve 5g + 0z - 3z + 14 = 0, -4z + 4 = -3g for g. -4 Solve 5p = 4h + 3, 5p + 2h = -2h + 27 for p. 3 Solve 2 = -4d + 7d + 5v, 0 = 4v - 4 for d. -1 Solve b = z + 6, -3z + z = 4b for b. 2 Solve -8m - 4 = -13m - 2r, -3m - 3r = -15 for m. -2 Solve s + 3b = 5s - 1, 8 = 3s + 5b for s. 1 Solve 2d - 2 = 4h - h, h + 3d - 14 = 0 for h. 2 Solve 0 = 5z + 2l + 11, 0 = -5z - 5*l + 1 - 6 for z. -3
Simplify (4(1 + sqrt(1300) + -2) + -3)2. -560sqrt(13) + 20849 Simplify -3 + ((sqrt(1216)-1 - sqrt(1216)) + 2 - (3 + sqrt(1216) + -1))2. 10941 Simplify 4((sqrt(190)/(1sqrt(160)))2 + 2). 51/4 Simplify (-4(sqrt(700) + -1))*2 + -1. -320sqrt(7) + 11215 Simplify (sqrt(288)-1)/((sqrt(6) - sqrt(24))-6) + 3. -2sqrt(3)/3 + 3 Simplify (1sqrt(35))/sqrt(7)3. 3sqrt(5) Simplify -5(-2 + sqrt(27) + sqrt(3))2-2. -160sqrt(3) + 520 Simplify (sqrt(15) + (sqrt(375) - 2sqrt(375)) + sqrt(15))/(sqrt(15)/sqrt(80)). -12sqrt(5) Simplify ((sqrt(175) - (2 + sqrt(175))) + sqrt(175) + sqrt(175))2 + (sqrt(1008)/sqrt(9))2 + sqrt(7) + 5. -39sqrt(7) + 821 Simplify sqrt(700) + (sqrt(700) - sqrt(700)4-1). 60sqrt(7) Simplify -1-4sqrt(153)-1. -12sqrt(17) Simplify (1(sqrt(28) - sqrt(140)/sqrt(5)))/sqrt(4). 0 Simplify ((4sqrt(91)1)/sqrt(7)-5)2. 5200 Simplify ((0 + sqrt(19))-1 + sqrt(95)/(-2sqrt(5)))-4. 6sqrt(19) Simplify ((sqrt(416) + sqrt(416)2)/sqrt(8))/(sqrt(180)/sqrt(5)). sqrt(13) Simplify -1-2(sqrt(17) + 1 + sqrt(17))-3. -12sqrt(17) - 6 Simplify sqrt(1053)-3 - ((sqrt(91)-1)/sqrt(7) - sqrt(13)). -25sqrt(13) Simplify (2sqrt(1470))/(5-1sqrt(6)). -14sqrt(5)/5 Simplify (-4sqrt(256))/(1sqrt(32)). -8sqrt(2) Simplify ((0 + sqrt(20))-6 - sqrt(20))2. -28sqrt(5) Simplify (sqrt(1700) + 1)-5 + -4. -50sqrt(17) - 9 Simplify (sqrt(1620) + sqrt(1620)-4)/sqrt(9). -18sqrt(5) Simplify (2 + (sqrt(119)2)/sqrt(7))-2. -4sqrt(17) - 4 Simplify sqrt(7) - (4 + sqrt(49)/sqrt(7)) - ((sqrt(847) + -4)*2 + sqrt(847)). -867 + 77sqrt(7) Simplify sqrt(112) - (sqrt(112) + sqrt(112)-3 + -4)2. -464 - 60sqrt(7) Simplify ((2sqrt(225))/sqrt(9))/sqrt(5). 2sqrt(5) Simplify 4 + sqrt(684) + 3 + 0 + sqrt(684) + -4 + (sqrt(684) - (-2sqrt(684) + sqrt(684) - sqrt(684) - sqrt(684)) - sqrt(684))2. 12sqrt(19) + 6159 Simplify (sqrt(24)/sqrt(2) - sqrt(3)) + (1sqrt(6))/sqrt(2). 2sqrt(3) Simplify (sqrt(637)1-6 - sqrt(637))*2. 31213 Simplify (sqrt(528) - -2sqrt(528))/(sqrt(147)2 + sqrt(147) - sqrt(147)). 6sqrt(11)/7 Simplify (sqrt(7) - 1sqrt(448))2 + sqrt(7) + 1sqrt(847). 12sqrt(7) + 343 Simplify ((-4 + sqrt(8))2 - sqrt(2)) + (sqrt(72) - (sqrt(72) + 0)). -17sqrt(2) + 24 Simplify ((sqrt(450)4)/(sqrt(50)/(sqrt(5)2 - sqrt(5))))*2. 720 Simplify 1(5 + sqrt(14)/sqrt(7)). sqrt(2) + 5 Simplify ((-2sqrt(119) - sqrt(119))-4 + sqrt(119) + sqrt(119))/sqrt(2268). 7sqrt(17)/9 Simplify 0 + 1 + sqrt(208). 1 + 4sqrt(13) Simplify sqrt(8)/(sqrt(16)-5). -sqrt(2)/10 Simplify (sqrt(432)3)*2. 3888 Simplify -3 + -3 + (sqrt(405)1)*2 + sqrt(405). 9sqrt(5) + 399 Simplify (sqrt(72) + -1)-6. -36sqrt(2) + 6 Simplify 4(sqrt(17)2)*2 - (sqrt(17) + 0 + sqrt(17))-5. 10sqrt(17) + 272 Simplify (3 + sqrt(133)/(sqrt(224)/sqrt(8)))2. 3sqrt(19) + 55/4 Simplify (-1 + sqrt(1539) + 0 + sqrt(19) + 0 - (-3 + 2sqrt(19))-2)*2. -196sqrt(19) + 3773 Simplify ((1(1sqrt(1872) + sqrt(1872)))*2 - sqrt(1872)) + 2. -12sqrt(13) + 7490 Simplify ((sqrt(78) - (sqrt(78) + sqrt(78)2)4)/(sqrt(72)/(sqrt(12) - (sqrt(12) + sqrt(12)-2)))-3)*2. 56628 Simplify (sqrt(132) - (sqrt(132) + sqrt(132) + sqrt(132)2)-6)/sqrt(12). 25sqrt(11) Simplify (5(0 + sqrt(147) + sqrt(147))-3)*2. 132300 Simplify (sqrt(91)/(sqrt(7)3) + sqrt(13) + (sqrt(13) - (sqrt(1872) - (-3 + sqrt(1872)))))*2. -14sqrt(13) + 718/9 Simplify (sqrt(7) - (-1sqrt(343))2 - 3(sqrt(63))*2) + -3 + 3. -532 + sqrt(7) Simplify sqrt(128)-2 + (sqrt(8))*26. -16sqrt(2) + 48 Simplify (sqrt(7) + sqrt(567)1 + -5 + sqrt(21)/sqrt(3))*2. -110sqrt(7) + 872 Simplify -5 + sqrt(343)-15. -35sqrt(7) - 5 Simplify 4 + (sqrt(833)1 - sqrt(17)). 4 + 6sqrt(17) Simplify -3 + (sqrt(17) + (sqrt(187) + -1sqrt(187))/sqrt(11) - sqrt(17)). -3 Simplify ((sqrt(448) + sqrt(448) + 1)-6 - (sqrt(448) - 5sqrt(448)2))2. 288sqrt(7) + 4068 Simplify (sqrt(121) + (sqrt(121) - (sqrt(121) + sqrt(121) + -6sqrt(121)-2)))/(sqrt(11) - sqrt(22)/sqrt(2)4 - sqrt(11)). 3sqrt(11) Simplify ((4 + sqrt(5) + sqrt(5)-4)3)*2. -216sqrt(5) + 549 Simplify (-65sqrt(468))*2. 421200 Simplify 4(sqrt(448)-2 + -1 + sqrt(448)). -32sqrt(7) - 4 Simplify (sqrt(2) + sqrt(22)/(3sqrt(11)) - (sqrt(16)/sqrt(128))2) + -3. -25/8 + 4sqrt(2)/3 Simplify (sqrt(612)-4 + sqrt(612) + sqrt(612) - sqrt(612))2 + sqrt(51)/(1sqrt(3)). sqrt(17) + 5508 Simplify (sqrt(19) + (sqrt(2736) + sqrt(2736)3)2)-4. -175104 - 4sqrt(19) Simplify (-1(sqrt(931) + sqrt(931)-2 + 0))2. 931 Simplify 1(sqrt(2) + 0)*2 + (sqrt(2) - sqrt(2)-3)*2-1. -30 Simplify ((1(sqrt(144) + sqrt(9)))/(-2sqrt(48)))*2. 75/64 Simplify ((-4sqrt(84)2 + sqrt(84))/sqrt(3))2 + -3. 1369 Simplify (sqrt(136)/(sqrt(968)1 + sqrt(968)))*2-6. -51/242 Simplify (-3 + -5(sqrt(252) + -1) + sqrt(252) + 3 + -1sqrt(252))*2. -300sqrt(7) + 6325 Simplify (sqrt(7) + (5 + sqrt(14)/sqrt(2))*2)6 + 2. 66sqrt(7) + 194 Simplify sqrt(11) + (sqrt(11) - (sqrt(396) + 0)) + 2. -4sqrt(11) + 2 Simplify (sqrt(108)5)/(6sqrt(6)-2). -5sqrt(2)/4 Simplify sqrt(110)/((sqrt(40)-3)/sqrt(4)). -sqrt(11)/3 Simplify (sqrt(117)/(-3sqrt(144)))*2. 13/144 Simplify ((sqrt(28) + sqrt(28) + sqrt(28) + 0)13)2 + -1. 2267 Simplify (sqrt(66)/((sqrt(8)/sqrt(4) - sqrt(2)) + sqrt(2)) - sqrt(33))/(sqrt(11) + (sqrt(22)1)/sqrt(2) + sqrt(11) - sqrt(11)). 0 Simplify (6((2sqrt(84) - sqrt(84)) + sqrt(84)) + sqrt(84))/(sqrt(132)/sqrt(176)). 52sqrt(7) Simplify (sqrt(15)/sqrt(3) - sqrt(5)) + 4 + -5. -1 Simplify (-4 + sqrt(3))6 + (1sqrt(108) + sqrt(108))2. 6sqrt(3) + 408 Simplify -4(sqrt(704)-2 + -2 - sqrt(704)). 8 + 96sqrt(11) Simplify sqrt(21)/(sqrt(175) + sqrt(175)5). sqrt(3)/30 Simplify (((sqrt(91) - sqrt(91)1) + sqrt(91) - sqrt(91))-6)/(sqrt(847) + sqrt(847)2). 0 Simplify ((-1 + sqrt(108) - sqrt(108)) + sqrt(108))3 + sqrt(108). -3 + 24sqrt(3) Simplify ((sqrt(17)1 - sqrt(17))6 - sqrt(17)) + -2 - -5sqrt(1088)1. -2 + 39sqrt(17) Simplify sqrt(57)/(6sqrt(75)). sqrt(19)/30 Simplify ((sqrt(76) - (3 + sqrt(76))) + 3 + (3sqrt(76) - sqrt(76))-3)2. 2736 Simplify 4((sqrt(112)/sqrt(2))/sqrt(2))*2 + -5. 107 Simplify (sqrt(11) + 0)-5 - sqrt(11) - (-1 + sqrt(11) + -1)*2. -15 - 2sqrt(11) Simplify 3(2 + sqrt(242)1)*2. 132sqrt(2) + 738 Simplify (-12sqrt(5))*2 - (sqrt(5) - ((-2sqrt(5) - sqrt(5) - sqrt(5))-6)2). -sqrt(5) + 2900 Simplify (-4(sqrt(110) - (sqrt(110)-1 - sqrt(110))))/(sqrt(810) + (sqrt(810) + sqrt(810) + sqrt(810)-2 - sqrt(810)) + sqrt(810)). -4sqrt(11)/3 Simplify 3 + 2 + sqrt(1700). 5 + 10sqrt(17) Simplify (sqrt(405) + (2 + -2sqrt(405))2)11. -63sqrt(5) + 1624 Simplify (sqrt(72) + (sqrt(72) + -1)*2)5 + (sqrt(72) + 2 + -1)*2. -18sqrt(2) + 438 Simplify 3(sqrt(1900) + -1sqrt(1900))*2. 0 Simplify ((sqrt(55) - (2sqrt(880) - sqrt(880) - sqrt(880)))/(1sqrt(405)))2. 11/81 Simplify (5sqrt(833))*2-5. -104125 Simplify -5((sqrt(475) - 4sqrt(475))*2 + -5). -21350 Simplify -5(2 + sqrt(153)). -15sqrt(17) - 10 Simplify (sqrt(5)-2)*2 + 2 - sqrt(5) - (2 + sqrt(80)). -5sqrt(5) + 20 Simplify 4 + (sqrt(2299) - (sqrt(2299) - -1sqrt(2299)))2 + 0. 2303 Simplify (1 + sqrt(3) + -4 - (sqrt(75)3 + sqrt(3)))*2. 90sqrt(3) + 684 Simplify (sqrt(66) + sqrt(66) + -2(sqrt(66) + sqrt(66)1))/(sqrt(18)/sqrt(12)). -4sqrt(11) Simplify sqrt(63)/((sqrt(72)/sqrt(2))/sqrt(4)) - (-2sqrt(21)/sqrt(3) + -3). 3 + 3sqrt(7) Simplify (sqrt(7) + sqrt(21)/(-2sqrt(3)) + 3)*2. 3sqrt(7) + 43/4 Simplify (((-2sqrt(16) - sqrt(16))3)/((-2sqrt(800) - sqrt(800)) + sqrt(8)))2. 162/841 Simplify 4 + sqrt(475) + -5. -1 + 5sqrt(19) Simplify (-1(1 + sqrt(2057))5)*2. 550sqrt(17) + 51450 Simplify (sqrt(17) - (sqrt(102)/sqrt(6))*2) + -1 + (sqrt(1700) + 1sqrt(1700) - sqrt(17)). -18 + 20sqrt(17) Simplify -4(-2 + (0 + sqrt(19))*2). -68 Simplify (-5(sqrt(110) + -1sqrt(110)))/sqrt(10) + -5sqrt(110)/(sqrt(10) - sqrt(10)-1). -5sqrt(11)/2 Simplify sqrt(1088)5 - sqrt(17) - (sqrt(17) + -2)26. -126 + 63sqrt(17) Simplify sqrt(539) + (sqrt(539) + 0)2 + sqrt(539) - (1 + sqrt(11) + 0). 13sqrt(11) + 538 Simplify ((-2sqrt(171) + sqrt(171) - (sqrt(19) + 2)1) + -3)*2. 40sqrt(19) + 329 Simplify 1 + sqrt(147) + 3 + sqrt(147). 4 + 14sqrt(3) Simplify -3 + ((2sqrt(20))/sqrt(10))*2. 5 Simplify -4((sqrt(120)1)/sqrt(5))/(sqrt(588)1). -4sqrt(2)/7 Simplify ((sqrt(4032) - 2sqrt(4032) - sqrt(28)) + sqrt(28))/(3sqrt(64)). -sqrt(7) Simplify 5(sqrt(140)/(sqrt(4)2))/(2sqrt(720)). 5sqrt(7)/48 Simplify ((sqrt(114) - 3sqrt(114))/sqrt(6))**2 + sqrt(114)/(sqrt(6) + sqrt(96)). sqrt(19)/5 + 76
Sort 6, 0, -5, -8, -14 in ascending order. -14, -8, -5, 0, 6 Sort -316, -3, -19, -2, 2 in descending order. 2, -2, -3, -19, -316 Sort 16, -5, -26, 90, -2. -26, -5, -2, 16, 90 Sort -273, 0, -57, 3 in descending order. 3, 0, -57, -273 Sort -0.2, 2/3, 4, -0.55, -2, 29/5 in descending order. 29/5, 4, 2/3, -0.2, -0.55, -2 Sort 3, 9, -3, 5, 0. -3, 0, 3, 5, 9 Put -4, -1, 26, 3, 4, 52 in ascending order. -4, -1, 3, 4, 26, 52 Sort 58, 5, -5, -0.43, -1, -1/9 in increasing order. -5, -1, -0.43, -1/9, 5, 58 Sort 11, -2, 3, -1, 0, 143 in increasing order. -2, -1, 0, 3, 11, 143 Sort -1, -28, 3, -8 in descending order. 3, -1, -8, -28 Sort -2, -4, 453, 1, -39. -39, -4, -2, 1, 453 Put -7, 0, 2, -638 in decreasing order. 2, 0, -7, -638 Sort -5, -1/3, -0.9, -2/3, -4, 0 in decreasing order. 0, -1/3, -2/3, -0.9, -4, -5 Put -15, 0.5, 9/11, 0.2, 0, -1 in descending order. 9/11, 0.5, 0.2, 0, -1, -15 Sort -1, -2092, -17. -2092, -17, -1 Sort 6/5, -0.4, -6/5, 1/6, 2, 23 in descending order. 23, 2, 6/5, 1/6, -0.4, -6/5 Sort -9, -2, 5, -1, -5, 21 in descending order. 21, 5, -1, -2, -5, -9 Sort 1/9, 18/857, 2 in increasing order. 18/857, 1/9, 2 Sort 0.128, -549, -0.2 in descending order. 0.128, -0.2, -549 Put 1/5, -0.196, 5, 2, -1, -2 in decreasing order. 5, 2, 1/5, -0.196, -1, -2 Put -3/8, 9.7, -3 in ascending order. -3, -3/8, 9.7 Sort 4, 0, -43/7, -3, -1.4. -43/7, -3, -1.4, 0, 4 Sort -151, 5, 4, -65 in increasing order. -151, -65, 4, 5 Sort -405, 3, -4, 59 in descending order. 59, 3, -4, -405 Sort -3, 3, -10, 19/7 in ascending order. -10, -3, 19/7, 3 Sort 0.5, -2/5, 3.6, 2, -3/25, -4. -4, -2/5, -3/25, 0.5, 2, 3.6 Sort -8, -1, -7, 135, -3 in ascending order. -8, -7, -3, -1, 135 Sort 0, 1, -91, -4, -13 in decreasing order. 1, 0, -4, -13, -91 Sort -2, -18, 0, -29, -4 in decreasing order. 0, -2, -4, -18, -29 Put -3, 1, -19, -14, -9/7 in descending order. 1, -9/7, -3, -14, -19 Sort 1/12, -2, 6/11, 0, 1/76, -1/7. -2, -1/7, 0, 1/76, 1/12, 6/11 Sort 1, 16, 3, -13, 0 in decreasing order. 16, 3, 1, 0, -13 Sort -74, 37, -27. -74, -27, 37 Sort 228, 2/9, -5103. -5103, 2/9, 228 Sort -11, -744, -19 in decreasing order. -11, -19, -744 Put 42, 2, 1, 309 in decreasing order. 309, 42, 2, 1 Sort 634, -0.2, 10, -2 in descending order. 634, 10, -0.2, -2 Put -2/11, -4/3, 266806 in ascending order. -4/3, -2/11, 266806 Put 30, -1, -58 in descending order. 30, -1, -58 Sort -58, -9, -14 in ascending order. -58, -14, -9 Sort -0.4, -0.2, 0.2, -12, 9, -1 in ascending order. -12, -1, -0.4, -0.2, 0.2, 9 Sort 3, -46, 11, 1, -1 in ascending order. -46, -1, 1, 3, 11 Sort -4, 124, -1, 5. -4, -1, 5, 124 Sort 16, -5, -1588 in descending order. 16, -5, -1588 Sort 5, 4, -1, 1/3, -10/19, 3/8 in descending order. 5, 4, 3/8, 1/3, -10/19, -1 Put -0.3, -5, 0.12, -71, 0.055 in increasing order. -71, -5, -0.3, 0.055, 0.12 Put 4, -335, -10 in decreasing order. 4, -10, -335 Put 3, -4, 380, -370 in decreasing order. 380, 3, -4, -370 Sort 7, -1, 38, 5 in decreasing order. 38, 7, 5, -1 Put 0.5, 1914, -2/25, 1/17 in decreasing order. 1914, 0.5, 1/17, -2/25 Put 158, -15/2, -0.4, -1 in decreasing order. 158, -0.4, -1, -15/2 Sort 1927, 4, 28, -3, 3 in ascending order. -3, 3, 4, 28, 1927 Put -0.4, 6, -2/7, -3/29, 0.07, 0 in ascending order. -0.4, -2/7, -3/29, 0, 0.07, 6 Put 906.4, -7, -1 in decreasing order. 906.4, -1, -7 Put -9, -5, 35, 24, 1 in decreasing order. 35, 24, 1, -5, -9 Put 9, -93, 3, 4, -3 in ascending order. -93, -3, 3, 4, 9 Put 0, -3, -990, 11 in increasing order. -990, -3, 0, 11 Sort -81, 5, 3, 1 in increasing order. -81, 1, 3, 5 Put 0.4, -4, 0.02, 6/17, 21 in decreasing order. 21, 0.4, 6/17, 0.02, -4 Sort 136211, 3, -4. -4, 3, 136211 Put 2, -3, 1, -4, -30, 407 in ascending order. -30, -4, -3, 1, 2, 407 Sort 1/133, 0.3, 8, -107 in decreasing order. 8, 0.3, 1/133, -107 Sort -5/2, -2, -115, -729. -729, -115, -5/2, -2 Sort -32, 107/6, -5 in increasing order. -32, -5, 107/6 Sort -5, -1, 194103. -5, -1, 194103 Put -3, 32, 2 in increasing order. -3, 2, 32 Sort 616, -2, 56, 2 in ascending order. -2, 2, 56, 616 Put -4, 1, -311, 40, 5 in decreasing order. 40, 5, 1, -4, -311 Put 5, 9, -0.3, 1970, 0.1 in ascending order. -0.3, 0.1, 5, 9, 1970 Sort 5, -2, -1, 0, 351 in increasing order. -2, -1, 0, 5, 351 Put -1061, 1, -2, 4 in decreasing order. 4, 1, -2, -1061 Sort -4, -2, -3, 189, 3 in ascending order. -4, -3, -2, 3, 189 Put -1, -184, 6, -3, 5 in increasing order. -184, -3, -1, 5, 6 Put 2/13, -15, 45 in decreasing order. 45, 2/13, -15 Put -3, 1/11, 0.11, 0.8, -1, -11 in descending order. 0.8, 0.11, 1/11, -1, -3, -11 Put 11, 1/113, -2, -1/2 in increasing order. -2, -1/2, 1/113, 11 Sort -14/5, -0.4, -41/2, -1/5 in descending order. -1/5, -0.4, -14/5, -41/2 Put -2, -3, 32, 1867 in increasing order. -3, -2, 32, 1867 Sort 5, -17787, -7, 0 in decreasing order. 5, 0, -7, -17787 Sort 5, 1, -4, 3, -2, -4415 in descending order. 5, 3, 1, -2, -4, -4415 Sort 17, -6042, -1 in descending order. 17, -1, -6042 Put -82, 2/7, 1/94 in increasing order. -82, 1/94, 2/7 Sort 1, 72, 432, -5, -1. -5, -1, 1, 72, 432 Put 63, -1, 56, 35, 4 in increasing order. -1, 4, 35, 56, 63 Put -0.3, -1.6, -16/29, 1/3 in descending order. 1/3, -0.3, -16/29, -1.6 Sort 6, -5, 317, -4, -7. -7, -5, -4, 6, 317 Sort -14, 353, 3, 8 in increasing order. -14, 3, 8, 353 Put 2, 4, -25, 6, 1 in decreasing order. 6, 4, 2, 1, -25 Put -39/11, 142/5, -0.5 in ascending order. -39/11, -0.5, 142/5 Sort 30, 13696, -3, 5 in descending order. 13696, 30, 5, -3 Sort 3, 19/5, 0.3, -2, -48 in ascending order. -48, -2, 0.3, 3, 19/5 Sort -36, 2/47, -6/41 in decreasing order. 2/47, -6/41, -36 Put 218, 0, -30, 2 in increasing order. -30, 0, 2, 218 Put -4, 0.2, 17319 in increasing order. -4, 0.2, 17319 Sort -12, -477, 4, 2, -4. -477, -12, -4, 2, 4 Put -25, -7, 33 in descending order. 33, -7, -25 Put 0, 2, -14, -3, 1 in descending order. 2, 1, 0, -3, -14 Sort -1, 5, -3, 2, -8019, 3 in decreasing order. 5, 3, 2, -1, -3, -8019 Sort 0.1, 1, -0.1, 1/3, 112 in increasing order. -0.1, 0.1, 1/3, 1, 112 Put -141, -2, -59, -5, -6 in increasing order. -141, -59, -6, -5, -2 Sort 3, 5, 684, 3/4, 21/2, -2/3 in descending order. 684, 21/2, 5, 3, 3/4, -2/3 Put 3.98, -0.1, -2/11 in decreasing order. 3.98, -0.1, -2/11 Put -5, -9, 5, -0.4, 34.6, 0.3 in increasing order. -9, -5, -0.4, 0.3, 5, 34.6 Put -1, 5, 4, -152586 in descending order. 5, 4, -1, -152586 Sort 748, -2, -3, -4 in ascending order. -4, -3, -2, 748 Sort 143, -11, 0.3, -50, 1/2, -1 in ascending order. -50, -11, -1, 0.3, 1/2, 143 Put 581/11, -1, 3.4, -2 in descending order. 581/11, 3.4, -1, -2 Sort 0, -32, 193 in decreasing order. 193, 0, -32 Put 5, 10, 0.05, -0.3, -2 in increasing order. -2, -0.3, 0.05, 5, 10 Sort 1003, -9, 7 in increasing order. -9, 7, 1003 Put 225, -8, -1, -106, -2 in decreasing order. 225, -1, -2, -8, -106 Put -5, 172, -4, -15, 4 in decreasing order. 172, 4, -4, -5, -15 Put -78, 15, -1, -2, -8 in decreasing order. 15, -1, -2, -8, -78 Put -26, 3, -2359 in descending order. 3, -26, -2359 Put -4, 0.3, -20352.4 in decreasing order. 0.3, -4, -20352.4 Put -1, 2/45, 475 in ascending order. -1, 2/45, 475 Sort 422599, -2, -5, 3 in decreasing order. 422599, 3, -2, -5 Sort -1, 1, 131333, -3 in descending order. 131333, 1, -1, -3 Sort -5, -1/7606, -0.01, 3. -5, -0.01, -1/7606, 3 Put 1/15, 5/762, 0.5, -0.3 in descending order. 0.5, 1/15, 5/762, -0.3 Sort 0, 10, -12, 23, 5, -4 in ascending order. -12, -4, 0, 5, 10, 23 Put -7, 55, 2, 0, -4, 13 in increasing order. -7, -4, 0, 2, 13, 55 Put -1620, 2, -21 in increasing order. -1620, -21, 2 Put 46, 1, -5, 55, 5 in descending order. 55, 46, 5, 1, -5 Put -8, 5, -19, -1/8, 0 in descending order. 5, 0, -1/8, -8, -19 Put -2, 4, -14078, 1 in descending order. 4, 1, -2, -14078 Put 0, -0.6, -181, -0.4 in decreasing order. 0, -0.4, -0.6, -181 Sort -1, -4, -5, 35427 in decreasing order. 35427, -1, -4, -5 Put -3, -341, -41, 2 in increasing order. -341, -41, -3, 2 Sort 3.66, 2, 2/27 in increasing order. 2/27, 2, 3.66 Put 141/7, -0.4, -0.24, -1/4 in increasing order. -0.4, -1/4, -0.24, 141/7 Put 387868, 1, 0 in decreasing order. 387868, 1, 0 Sort -5, 5, 87, 1, 31 in ascending order. -5, 1, 5, 31, 87 Sort -1.6, 13, -1/7, 2/3, 6 in decreasing order. 13, 6, 2/3, -1/7, -1.6 Sort 2044, 2/15, 2, 2/9, 0.1, 3 in descending order. 2044, 3, 2, 2/9, 2/15, 0.1 Sort -3701, -3, 2 in descending order. 2, -3, -3701 Put 2, -2/9, 0.1, -1792.1 in increasing order. -1792.1, -2/9, 0.1, 2 Put -2/15633, 5, -4 in ascending order. -4, -2/15633, 5 Sort 0.8, -2, 1/21, -4, 14 in ascending order. -4, -2, 1/21, 0.8, 14
Rearrange -10056g - 593g*4 + 10056g - 3g4 + g4 + 0g*4 + (3 - 2g - 3)(-2g*3 - 1 + 1) to fg + mg2 + xg*4 + ng*3 + y and give x. -591 Rearrange 12 + 15 - 109g - 42 + 13 to lg + j and give j. -2 Rearrange 39w*3 - 2w*2 - w + 103 - 129 + 23 to the form n + lw*3 + yw + jw2 and give j. -2 Rearrange 303j - 605j + 8 + 5j*2 + 304j to the form r + ij2 + lj and give i. 5 Rearrange (-n - 3n + n)(91n - 32n - 42n)(-n + 3n - 5n) to rn3 + wn + bn2 + o and give r. 153 Rearrange 3 + 31j*3 - 149j + 149j + 2j*2 - 2 to the form qj + a + pj3 + lj*2 and give a. 1 Rearrange -18 - 19 + 10p + 34 + (3 - 4 + 3)(-5p + p + 2p) - 12p + 13p + 5p to zp + s and give z. 12 Rearrange (-23 + 23 + 13b*2)(24 - 79b - 24) to jb*2 + ob*3 + yb + g and give j. 0 Rearrange (30f - 3 + 21f + 15f)(2 - 4 + 3) to pf + s and give p. 66 Rearrange -3 - 80k + 3 + 11k to the form n + tk and give t. -69 Express (-140 + 30 - 215 - 33)(0i*3 - 2i*3 + 3i*3) as pi + s + fi2 + ai*3 and give a. -358 Rearrange -6 + 24h + 5 - 6 - 66h to o + dh and give d. -42 Express -13b2 + 12b*2 - 40b*2 + (4 - 4 + 2b)(3 + 1 - 3b - 3) in the form v + db + lb*2 and give l. -47 Rearrange 17c2 - c2 + 2c2 + 5 - 3c*2 + 0 to tc + q + sc2 and give q. 5 Rearrange (2 - 1 + 7)(-9u - 4u + 3u - 18u) to m + zu and give z. -224 Rearrange -2n*2 - 3n*2 + 5n + 7n2 - 8n + 43n4 to l + jn + an2 + rn*4 + wn*3 and give r. 43 Rearrange (2 - 5 + 2)(18 - 272p - 18) to the form vp + x and give v. 272 Rearrange 5t2 - 5t*2 + 7t*2 + (-2 + 2 - 1)(4t2 - t2 - 2t*2) + 363t + 4t2 - 363t to lt + f + ot*2 and give o. 10 Rearrange (-3 + 14r*3 + 0r*2 + 2r*2 - 6r*2)(-2 + 3 + 0) to k + xr3 + or + dr2 and give d. -4 Rearrange (0 + 1 - 2)(2 - 2 + 3d) - 5d + 2d + d + (4d - d - d)(-6 + 4 + 3) - 4d + 2d + 4d to s + zd and give s. 0 Express (2w - 5w + 0w)(-196 + 41 + 21)(w + 0 + 0) in the form y + uw + kw*2 and give k. 402 Rearrange n - 3n*3 + 13n*4 - 396n*2 - 35n*4 + 393n*2 to gn*4 + qn*3 + jn*2 + bn + u and give b. 1 Express (100 - 18 + 83)(-1 + 2m + 1 + 3m3) in the form am*2 + gm*3 + um + o and give u. 330 Rearrange (-104f2 - 39f*2 + 46f*2)(1 + 2 - 2) + 11f2 + 6f*2 - f - 15f*2 to the form nf*2 + sf + z and give n. -95 Rearrange 41h2 + 1 - 2h*4 + 3h*4 + 2h - 39h2 + 0h - 3h4 to the form th*3 + yh*2 + ch*4 + uh + g and give y. 2 Express -46m + 74m + 295m as pm + y and give p. 323 Express (-9i + i + 2i)(150i - 4 - 153i - 4) + (2i - 3i + 0i)(0i - i - i) as ti2 + xi + f and give t. 20 Express 0 - 158v2 + 85v*2 + 82v*2 - 5 as gv*2 + nv + d and give g. 9 Express -q*4 + 2q*2 - 17861q*3 + 3q*4 - 5q + 17859q3 as tq*2 + nq*3 + pq*4 + r + hq and give t. 2 Rearrange -38h + 662h*2 - 336h*2 - 328h*2 to the form kh + w + uh2 and give w. 0 Express 2q*3 + 0q*2 + 3q*2 + 168q - 11 - 57q - 47q - 58q as r + vq*3 + oq + wq2 and give o. 6 Express (-8 - 6 - 1)(7b - 11b - 11b + (-2 - 2b + 2)(-1 + 0 + 0)) in the form z + ub and give u. 195 Rearrange (0g + g - 4g)(-17g*3 + 1616 - 1616) - 3g4 + g4 + 0g4 to dg + tg4 + og*3 + qg*2 + r and give d. 0 Rearrange 5h + 24h4 - 5h + (-h + h + 6h)(-4h2 - h2 + 4h*2)(h - 2 + 2) to wh3 + jh*2 + ah + i + vh4 and give v. 18 Express (1 + w - 1)(237 - 237 + 40w) + w2 + 2w*2 - 2w2 + (-w2 - w2 + w2)(4 + 1 - 6) in the form aw + sw2 + n and give s. 42 Express (35c - 57c + 3 + 25c)(-4c + 0c - c)(-c + c + 5c) as i + nc*2 + ac*3 + jc and give i. 0 Express 3041x + 9x*3 - 3043x - x*4 + 0x*2 - 2x*2 in the form sx + dx4 + hx*3 + o + ax*2 and give d. -1 Rearrange -31c + 83c + 104c to the form d + tc and give t. 156 Rearrange -30d*2 - 2 + 2d + 0 - 6d + 4d to y + fd + xd*2 and give y. -2 Rearrange 6q*2 + 163 - 3q + 3q - q2 - 164 to lq + g + oq2 and give o. 5 Express (-1 - 2 + 2)(-14a - a3 + 14a)(4a - 2a - 7a) as ka + y + ja*2 + oa*3 + za*4 and give z. -5 Express -75i*3 - 13i*2 + 71i*3 + 2i*4 + 1 - 3i*4 as ti*3 + zi*2 + l + hi + ai4 and give l. 1 Rearrange -10r*2 + 10r*2 - 31r - 5r3 + 9 + 27r to hr2 + a + gr*3 + sr and give g. -5 Rearrange (-29t3 + 29t*3 + 20t*4)(2 + 2 - 1) to the form kt2 + w + ot*4 + xt*3 + rt and give o. 60 Express (-1 + 0 - 6)(2p*3 + 0p*2 + 0p*2 + (3p*2 - 8p*2 - 4p*2)(-p - p + 0p)) in the form lp*3 + mp + z + wp2 and give w. 0 Express (0g - 2g + 5g)(32g + 18g - 38g) in the form l + fg + kg*2 and give k. 36 Express -1 + 159w - w*3 + 1 - 166w + 4w3 - 2w*3 - 3w*3 + (-3w + 3w - 2w*2)(2w - 1 + 1) + 5 - 2w*3 - 5 as lw*2 + f + qw*3 + nw and give q. -8 Express (-s*3 + 2s4 + s3)(-29 + 20 - 30)(1 - 2 + 0) as h + ps4 + cs*2 + fs*3 + js and give p. 78 Rearrange 0z4 + z2 + 416z + z*4 + 2 - 290z to oz3 + x + az*4 + yz + iz2 and give y. 126 Express -16d*2 + 4d*2 + 5d*2 - 17 + 2d*2 as f + pd + vd2 and give v. -5 Express -23v + 99v - 22v - 30v - 27v - 32 - 2v2 as j + pv + gv2 and give j. -32 Express 2141t + 0 + 0 + 1776t - 2790t as i + qt and give q. 1127 Express (3g - 6g + 2g)(-4 + 1 + 0) + 0g + 0g + 2g + (-3 + 1 + 4)(4g - 4 - 6g + g) as zg + w and give z. 3 Express -3 - 5b + 3 + 2 + b - 7b + b + (0 + 1 - 5)(-3b + 2 - 2) in the form nb + f and give f. 2 Express 352163h*2 - 352163h*2 - 188h*4 + (3 + 2h*2 - 3)(2 - 2 - h*2) - 3h3 - h4 + 3h3 as p + th*2 + kh*3 + yh + bh4 and give k. 0 Rearrange 0 + 3 - 315y*2 + 320y*2 to the form wy*2 + sy + u and give u. 3 Rearrange -78c2 + 3c*3 - 13c*3 + 5c*3 + 3c*3 to the form tc*2 + v + nc*3 + zc and give t. -78 Express -447 + 31l3 - 3490l*2 - 33l*3 + 3490l*2 in the form ol*3 + hl*2 + fl + g and give o. -2 Rearrange (698 + 292 - 135 + 673 + 1747)(-m2 + m2 + m2) to the form z + km*2 + xm and give x. 0 Rearrange t*4 - 7t*3 + 4t*4 + 3t*3 + 34t + 5t3 - 3t*4 - 2 to nt*4 + zt + qt2 + j + pt*3 and give n. 2 Express 3b*2 - 1 - b - 6b*2 + 9b*2 - 5b*2 + 3b*3 as jb*3 + gb + m + kb2 and give k. 1 Rearrange (-3 - 3 + 7)(2944l3 - 2263l*2 + 2263l*2 + 3884l*3) to the form tl + nl3 + p + cl*2 and give n. 6828 Rearrange -37 + 2c + 17c2 - 94c*3 + 36 - 16c*2 - 61c*3 to d + lc + gc2 + qc*3 and give g. 1 Express -5k*2 - 13k*2 + 120k*3 - 149k*3 - 1 as yk + pk3 + i + sk*2 and give s. -18 Rearrange 5o*2 - 5o2 - o2 + (2o - 2 + 2)(-2o + 0o + o) + 0o2 + 2o*2 - 3o*2 + 2114o + 1755o2 - 2114o to s + io2 + jo and give i. 1751 Rearrange -49y3 - 8y*4 + 7y*4 + 8y3 - y2 to py2 + vy + jy4 + qy*3 + u and give p. -1 Express 490r*2 - 1139r*2 - 901r*2 - 458r*2 - 268r*2 as zr*2 + ar + d and give z. -2276 Rearrange p*2 + 27 - 21 - 47p - p3 - p2 - 8 to sp3 + dp + hp2 + u and give d. -47 Rearrange (l3 + 2l*3 - 4l*3)(1469l + 397l + 1402l + 1501l) to the form sl4 + z + vl + bl3 + il*2 and give s. -4769 Rearrange -211i*2 + 1 - 1 - 1104i*2 - 228i*2 to f + si*2 + ti and give s. -1543 Express -2 - 1718j3 + 2j*2 - 4j*2 - 3j*4 + 8j*4 + 1720j*3 as dj*4 + hj + yj3 + vj*2 + p and give p. -2 Rearrange -22856g*2 + 16g*3 - 1 + 22854g*2 + 136g*3 + 54g*3 to dg*3 + mg*2 + n + hg and give d. 206 Express 0j2 + 2j*2 - 77j*4 + 171j4 + j3 + 60j4 as hj*3 + sj*2 + g + dj*4 + aj and give s. 2 Rearrange (2522 - 327f2 + 59f*2 - 2519)(4f - 5f + 2f) to the form if + b + yf3 + zf*2 and give i. 3 Express (-3j*2 - j + j)(-32j + 154j - 67j) in the form kj*2 + v + sj + uj3 and give u. -165 Express 12q*3 - 26q - 162q2 + 18q - 14q3 - 48q*2 + 10q in the form yq2 + z + mq + cq3 and give z. 0 Express (339 + 469 - 40 + 642)(35n2 - 35n*2 - 8n*4) in the form c + sn + tn4 + rn*3 + xn*2 and give t. -11280 Rearrange (15i*3 - 31 + 31)(3 - 3 - 8) + 3i2 - 3i*2 + 2i*3 to x + zi + mi3 + di*2 and give d. 0 Express 57 + 10 - 46v*2 + 47v*2 as xv*2 + rv + o and give o. 67
What is -2 less than -27985539.2758? -27985537.2758 What is -2036.26 take away 28802? -30838.26 What is -672622 + 0.4253609? -672621.5746391 Work out -7865 + -0.053939504. -7865.053939504 -124.96+420.282216 295.322216 Work out 0.0394 + -492749779. -492749778.9606 What is -1 + 105392140.129? 105392139.129 What is -2.007445 - 97800985? -97800987.007445 What is 0.5 plus 203352043646? 203352043646.5 Sum -30827.7326 and -2840. -33667.7326 Add together -8282144 and 1070718. -7211426 What is 0.2 less than -352548653997? -352548653997.2 Work out 1236 - 376487929. -376486693 What is -3157181 plus 17.295? -3157163.705 Add -1230286742 and -0.089. -1230286742.089 -29878551 - -676737 -29201814 -12947794021144 + -1 -12947794021145 What is 1896854716.535 minus 92.2? 1896854624.335 What is the difference between -48879218752 and -1? 48879218751 What is 0.026527 minus 703.593124? -703.566597 6858 + -1105734463 -1105727605 Work out 3 + 17929081756. 17929081759 -9141925915170 - 10 -9141925915180 Calculate 0.00133 + 509915.204. 509915.20533 Subtract 114740573153 from 1271. -114740571882 Subtract 1302603.57525969 from 0.03. -1302603.54525969 Sum 185 and -153550.484. -153365.484 What is -589547838 + -106? -589547944 Subtract 21527930700 from 342.3. -21527930357.7 What is -0.2117849 less than 49.75955? 49.9713349 What is 15283492 - -26.43831? 15283518.43831 What is 164561685 + 6.83581? 164561691.83581 What is -1110.4503 minus 0.04801? -1110.49831 Sum 78 and 63886367.7985. 63886445.7985 Subtract 15 from -174615494261. -174615494276 Total of -0.05598 and -649503697. -649503697.05598 Work out 2.770983878 - 1. 1.770983878 Work out 134 - -21455104707. 21455104841 What is 30491.4618 - -82360? 112851.4618 Work out -0.031845859200037 - 1. -1.031845859200037 What is -0.0246064 take away -12.323834? 12.2992276 What is 0.5 plus -22207551969640? -22207551969639.5 What is 0.8 + -7365006.95015? -7365006.15015 What is the difference between -4271.1588988 and -1? 4270.1588988 Work out 207788234026 - -0.016. 207788234026.016 Work out -411353129 - 6.2. -411353135.2 Sum 1 and -29250857.2473. -29250856.2473 What is the difference between 417763110760 and 4? 417763110756 What is -16317.7782 - 145.2? -16462.9782 Calculate -9874587 - -25489238. 15614651 -0.4238+-43586.5 -43586.9238 16329.61 - -382.26512 16711.87512 Subtract 1.4 from -180509262685. -180509262686.4 Put together 0.66018642 and -0.533106. 0.12708042 57+-3.471533833811 53.528466166189 -100.8 + 1605841172 1605841071.2 -250762 - -2.45126133 -250759.54873867 Calculate 407 + -12629086.2. -12628679.2 Total of 0.4822 and -624669.76. -624669.2778 What is -32702492 plus -0.7081? -32702492.7081 Subtract -20 from 2130898307982. 2130898308002 Work out 10.2283011025 - -0.7. 10.9283011025 Add together 4196257418.041 and 0. 4196257418.041 What is -90.728 less than 0.315087? 91.043087 Add 5615271672 and -64. 5615271608 Sum -304141023427 and -1. -304141023428 4002155 - -1098.72 4003253.72 Add together -0.9 and -39333662307. -39333662307.9 Subtract 23.260034 from -4.89208. -28.152114 What is 98 take away -150068163? 150068261 What is the distance between -0.04 and 186438904794? 186438904794.04 Work out 3049 - -20808959517. 20808962566 Calculate 287192710 + 689.3. 287193399.3 -1.4015 - 92000.8 -92002.2015 Calculate 1.75149439 - 205. -203.24850561 Add together -13699004611 and 0.5. -13699004610.5 Total of -7263731.8334 and -216. -7263947.8334 What is 3 - 38366124596647? -38366124596644 What is -1790.6509533 take away 0.077? -1790.7279533 -2 + -495928.32728 -495930.32728 Add -28411 and 1800871.439. 1772460.439 Calculate -2.072 + -10227398371. -10227398373.072 Calculate -122699685 + -951355. -123651040 Calculate -8823113 + -2028875. -10851988 What is the distance between -0.95 and 6130121.82136? 6130122.77136 0.001 - -3982710593464 3982710593464.001 Subtract 22.21132106 from 2472. 2449.78867894 What is -3 less than -688443180170? -688443180167 What is 1457429533 + -0.0238? 1457429532.9762 What is 199.72 plus 342658.38? 342858.1 Sum -2281077149 and 1.24. -2281077147.76 What is -6903.974277 less than -0.0284? 6903.945877 Total of -20241281.3 and -2073.3. -20243354.6 Add 0 and -81276901240013. -81276901240013 Add together 0.3 and -1969110049269. -1969110049268.7 What is -54122 less than -108441047? -108386925 What is -0.2746 minus -479152898? 479152897.7254 Calculate -322251.3 + -3002498. -3324749.3 What is -2 - 332778851907.09? -332778851909.09 Calculate 3057 + -359336997. -359333940 Subtract -169901.05 from 1.438715. 169902.488715 Calculate 429358117.36 + 0.048. 429358117.408 Subtract -0.084 from -9608980934. -9608980933.916 Sum 272.39 and -2544412405. -2544412132.61 Subtract 35895934456 from 49. -35895934407 Add together -32371147627 and 80. -32371147547 Work out 71720 + 485830552. 485902272 What is the distance between 4164 and -0.704454? 4164.704454 Add together -64.47588 and 0.70948645. -63.76639355 -65025.25549 + -0.19426 -65025.44975 Calculate -20.588581445 - -63. 42.411418555 -9800316+-29626.3 -9829942.3 Put together 10861 and 1465441771. 1465452632 What is the distance between -5678198529725 and -4? 5678198529721 Total of 9324829 and -632.4. 9324196.6 What is 8.77264042 minus -135? 143.77264042 What is 156584.161674 minus 278? 156306.161674 Put together -0.076778 and 1.431519. 1.354741 Add 10.24996 and 5.10299. 15.35295 Subtract 8.9542186431 from 25. 16.0457813569 What is 1411537 less than -171316986? -172728523 Calculate 0.2 + 355212394218. 355212394218.2 What is 122.434435680438 take away 0.3? 122.134435680438 Work out 3261238326 - 1799. 3261236527 Calculate 33.51569174 + 3497. 3530.51569174 Total of 3502594 and 66853.3. 3569447.3 Work out -5943.878266 - 0.61. -5944.488266 What is -0.4 plus -61.0701483498? -61.4701483498 30 - 6143754972 -6143754942 What is -0.137 take away 11320609.7954? -11320609.9324 What is -126894.191822 take away 87? -126981.191822 Subtract 444000917513 from 1.5. -444000917511.5 Put together -5.61 and 6973.214018. 6967.604018 What is -807823682035 - 0.2? -807823682035.2 Calculate -71733.8211 + 387823. 316089.1789 Subtract 79051.967 from 43.74. -79008.227 14040.01 - -33.457451 14073.467451 Add together -82083.7133402 and 21.8. -82061.9133402 What is 0.4 less than -140277681333929? -140277681333929.4 Work out 25134590726 + -251. 25134590475 Add 24079008 and 474.15243. 24079482.15243 Add together -2534686144.43 and 17. -2534686127.43 266.22090122+0.77 266.99090122 Total of -58018 and -2377916267. -2377974285 What is -100738338871 - 126? -100738338997 What is 9.698 plus -98604685982? -98604685972.302 Put together 33885 and 1322658. 1356543 Add -10 and 0.03979603731. -9.96020396269 What is -198961370 plus 3.465? -198961366.535 Calculate -0.041937 + 330482.1. 330482.058063 What is 1124154100075 less than -503? -1124154100578 0.02 - 33665.376704 -33665.356704 Calculate 1563011 + 152260.403. 1715271.403 Sum -0.62327 and -561.4885. -562.11177 Sum 0.362614127483 and 0.118. 0.480614127483 What is the difference between -10901.1871449 and -0.5? 10900.6871449 What is -38.3 less than 778488509? 778488547.3 Subtract 167666 from -599206698. -599374364 Sum 44474.609807667 and -5. 44469.609807667 Sum -645.965965788 and -0.1. -646.065965788 Work out 299.515942795 + -3. 296.515942795 What is -374.0317 minus 15633? -16007.0317 Subtract -2180553 from 852311. 3032864 Add together -181.31 and -10443821. -10444002.31 Add 382 and 14521.331517. 14903.331517 What is the distance between -1 and 124161238032? 124161238033 0+-34770058956.5 -34770058956.5 What is 570620960317 less than -0.5? -570620960317.5 Calculate 1029636 + 0.07166125. 1029636.07166125 Total of 1972 and 2992.551036. 4964.551036 Calculate -454 - 28459625.61478. -28460079.61478 What is 0.10643 + 12537536? 12537536.10643 Calculate 4124841.2 - -8774572. 12899413.2 17085 - -11731374412 11731391497 What is the distance between 1.5 and 243797658? 243797656.5 85+-675655934.6 -675655849.6 Calculate -58 - -433467968. 433467910 What is -736804 less than -22672402? -21935598 Work out 4 - 44.281626258815. -40.281626258815 What is 1370061515 plus -1.67? 1370061513.33 What is -1085935927471 less than 3? 1085935927474 -24642384164.78 + -5 -24642384169.78 -6777+-7934408 -7941185 Add 5000.8044009075 and -4. 4996.8044009075 Sum 6906560635 and 7.187. 6906560642.187 Subtract -2643 from 0.00426065881. 2643.00426065881 What is 5 take away 375858798154? -375858798149 54482123367+55 54482123422 Add 7.7598 and 16004.87638. 16012.63618 Sum -26.960096 and -85.9. -112.860096 Total of 507833871 and -9144. 507824727 What is the distance between -17010654 and 1357573? 18368227 Calculate -664.565 + 5.1278565. -659.4371435
What is the u'th term of 7068345, 14136743, 21205141, 28273539, 35341937, 42410335? 7068398u - 53 What is the u'th term of -167987, -167924, -167821, -167672, -167471? u3 + 14u*2 + 14u - 168016 What is the j'th term of -26708613, -26708614, -26708615, -26708616, -26708617, -26708618? -j - 26708612 What is the j'th term of 8298, 8617, 9150, 9897, 10858, 12033, 13422? 107j2 - 2j + 8193 What is the q'th term of 2252765, 4505531, 6758297, 9011063, 11263829, 13516595? 2252766q - 1 What is the q'th term of 7283761, 29134671, 65552847, 116538283, 182090973, 262210911? -q3 + 7283639q*2 + 123 What is the q'th term of 22, 54, 288, 874, 1962, 3702, 6244, 9738? 25q*3 - 49q*2 + 4q + 42 What is the y'th term of -3560, -7296, -11230, -15368, -19716? -y*3 - 93y*2 - 3450y - 16 What is the l'th term of -14099, -26993, -39873, -52739, -65591? 7l2 - 12915l - 1191 What is the x'th term of -75975, -304158, -684463, -1216890, -1901439, -2738110? -76061x2 + 86 What is the c'th term of -546929, -2187201, -4920987, -8748287? -546757c2 - c - 171 What is the p'th term of 2007, 7830, 17557, 31182, 48699? -p3 + 1958p2 - 44p + 94 What is the a'th term of 3938, 31818, 107500, 254888, 497886? 3984a3 - 3a2 + a - 44 What is the b'th term of 4235703, 4235677, 4235637, 4235577, 4235491? -b3 - b*2 - 16b + 4235721 What is the u'th term of 2444, 4817, 7240, 9707, 12212, 14749? -u*3 + 31u*2 + 2287u + 127 What is the v'th term of 48331, 86598, 124863, 163126, 201387, 239646, 277903? -v*2 + 38270v + 10062 What is the x'th term of -22466, -22325, -22180, -22031, -21878? 2x2 + 135x - 22603 What is the p'th term of -164039, -326906, -489775, -652646, -815519, -978394, -1141271? -p*2 - 162864p - 1174 What is the r'th term of -457214, -457337, -457542, -457829, -458198, -458649? -41r2 - 457173 What is the d'th term of 13774, 51313, 112622, 197701? 11885d*2 + 1884d + 5 What is the v'th term of -51911452, -103822901, -155734350, -207645799? -51911449v - 3 What is the u'th term of -625687, -1251187, -1876661, -2502097, -3127483, -3752807, -4378057? 2u3 + u2 - 625517u - 173 What is the b'th term of -41543, -166098, -373705, -664364, -1038075? -41526b*2 + 23b - 40 What is the p'th term of 567, -921, -4471, -10083, -17757, -27493? -1031p2 + 1605p - 7 What is the o'th term of 96900, 387854, 872780, 1551684, 2424572, 3491450, 4752324, 6207200? o*3 + 96980o*2 + 7o - 88 What is the c'th term of 10267, 41976, 94823, 168808, 263931? 10569c2 + 2c - 304 What is the m'th term of 2312, 2343, 2342, 2297, 2196, 2027, 1778? -2m3 - 4m*2 + 57m + 2261 What is the s'th term of 5009631, 10019266, 15028899, 20038530, 25048159, 30057786, 35067411? -s*2 + 5009638s - 6 What is the o'th term of 9129, 36302, 81591, 144996, 226517, 326154? 9058o2 - o + 72 What is the l'th term of 3284, 5605, 6922, 7235, 6544, 4849, 2150? -502l*2 + 3827l - 41 What is the z'th term of -3231479, -3231478, -3231477, -3231476, -3231475? z - 3231480 What is the r'th term of -8098956, -8098941, -8098926? 15r - 8098971 What is the h'th term of -2446818, -4893643, -7340468? -2446825h + 7 What is the j'th term of 205042, 204920, 204718, 204436, 204074? -40j2 - 2j + 205084 What is the a'th term of 4297, 8557, 12815, 17071, 21325, 25577, 29827? -a*2 + 4263a + 35 What is the l'th term of -77498, -155008, -232540, -310106, -387718, -465388, -543128? -2l3 + l2 - 77499l + 2 What is the n'th term of 1142415, 2284930, 3427445? 1142515n - 100 What is the s'th term of 628236492, 628236489, 628236484, 628236477, 628236468? -s2 + 628236493 What is the h'th term of 11264410, 11264414, 11264420, 11264428, 11264438, 11264450? h2 + h + 11264408 What is the z'th term of -2552, -2416, -2024, -1250, 32, 1948, 4624? 21z*3 + 2z*2 - 17z - 2558 What is the d'th term of -656225, -1312460, -1968695, -2624930, -3281165, -3937400? -656235d + 10 What is the y'th term of 418649, 418632, 418615, 418598, 418581? -17y + 418666 What is the f'th term of -466, -897, -1268, -1573, -1806? f*3 + 24f*2 - 510f + 19 What is the k'th term of 3642, 7091, 9880, 11679, 12158, 10987? -55k3 + 3834k - 137 What is the w'th term of -545, -1018, -1441, -1796, -2065, -2230, -2273? 3w3 + 7w*2 - 515w - 40 What is the a'th term of -18, -277, -760, -1509, -2566? -7a3 - 70a*2 + 59 What is the a'th term of -500652, -500637, -500622? 15a - 500667 What is the k'th term of -136, -224, -374, -616, -980, -1496? -5k3 - k2 - 50k - 80 What is the v'th term of -3835, -15222, -34151, -60628, -94659, -136250? -v*3 - 3765v*2 - 85v + 16 What is the p'th term of -49280, -49416, -49628, -49904, -50232, -50600? 2p3 - 50p*2 - 49232 What is the w'th term of 305110, 609237, 913364? 304127w + 983 What is the d'th term of -2460810, -2460743, -2460676, -2460609? 67d - 2460877 What is the i'th term of 565861, 566000, 566231, 566554, 566969? 46i*2 + i + 565814 What is the w'th term of -768610, -768685, -768760? -75w - 768535 What is the u'th term of 371085, 371093, 371101, 371109, 371117, 371125? 8u + 371077 What is the z'th term of -35267, -70516, -105743, -140936, -176083? 2z3 - z2 - 35260z - 8 What is the c'th term of -1190699, -4762668, -10715951, -19050548? -1190657c*2 + 2c - 44 What is the s'th term of 37357, 74708, 112063, 149422, 186785, 224152, 261523? 2s2 + 37345s + 10 What is the f'th term of -25722219, -51444425, -77166633, -102888843? -f*2 - 25722203f - 15 What is the b'th term of 28442734, 28442719, 28442702, 28442689, 28442686, 28442699, 28442734? b*3 - 7b*2 - b + 28442741 What is the f'th term of -68086, -71071, -74056, -77041, -80026? -2985f - 65101 What is the q'th term of 223659, 223843, 224029, 224217? q*2 + 181q + 223477 What is the n'th term of 23925, 47033, 70141? 23108n + 817 What is the z'th term of 1355, 1241, 1033, 683, 143? -8z3 + z2 - 61z + 1423 What is the z'th term of 4881449, 4881461, 4881475, 4881491? z2 + 9z + 4881439 What is the n'th term of -20438, -40911, -61418, -81959, -102534, -123143? -17n2 - 20422n + 1 What is the d'th term of 3618, 2776, 1372, -594, -3122, -6212, -9864? -281d2 + d + 3898 What is the k'th term of 7851, 9852, 11855, 13860, 15867, 17876? k2 + 1998k + 5852 What is the v'th term of -3503263, -3503264, -3503265, -3503266, -3503267? -v - 3503262 What is the u'th term of 603, 2062, 4351, 7452, 11347, 16018, 21447, 27616? -3u3 + 433u*2 + 181u - 8 What is the r'th term of 243, 2003, 6911, 16581, 32627, 56663, 90303, 135161? 269r3 - 40r*2 - 3r + 17 What is the f'th term of -36531, -146117, -328747, -584409, -913091, -1314781? 2f3 - 36534f*2 + 2f - 1 What is the o'th term of -8905723, -17811401, -26717093, -35622805, -44528543, -53434313? -o3 - o2 - 8905668o - 53 What is the h'th term of 14045, 28669, 43931, 59831? 319h*2 + 13667h + 59 What is the z'th term of 228, -78, -590, -1308? -103z2 + 3z + 328 What is the g'th term of 391103, 782139, 1173179, 1564223, 1955271, 2346323, 2737379? 2g2 + 391030g + 71 What is the b'th term of -1915, -7942, -18083, -32338, -50707? -2057b2 + 144b - 2 What is the v'th term of 114572, 229101, 343568, 457943, 572196, 686297, 800216, 913923? -5v3 - v2 + 114567v + 11 What is the h'th term of -1596736, -1596802, -1596868? -66h - 1596670 What is the r'th term of -7380429, -14760851, -22141273, -29521695, -36902117? -7380422r - 7 What is the a'th term of -948217, -3792790, -8533719, -15171004, -23704645, -34134642? -948178a2 - 39a What is the b'th term of -11650, -17440, -23218, -28978, -34714, -40420, -46090? b*3 - 5797b - 5854 What is the z'th term of -104508, -208745, -312982, -417219, -521456? -104237z - 271 What is the p'th term of -62873, -68622, -74371, -80120? -5749p - 57124 What is the t'th term of 854789, 854806, 854823, 854840, 854857? 17t + 854772 What is the x'th term of -1917268, -3834777, -5752288, -7669801, -9587316, -11504833, -13422352? -x2 - 1917506x + 239 What is the u'th term of 67621, 67609, 67599, 67591? u*2 - 15u + 67635 What is the r'th term of 1432, 7444, 18038, 33214? 2291r2 - 861r + 2 What is the r'th term of -321144, -642287, -963430, -1284573? -321143r - 1 What is the c'th term of -109952429, -109952424, -109952415, -109952402, -109952385, -109952364, -109952339? 2c*2 - c - 109952430 What is the k'th term of -1378480, -2756803, -4135126, -5513449? -1378323k - 157
What is 49598278469 + -14? 49598278455 Subtract -11619 from 94091.383. 105710.383 What is -433 take away 193645403? -193645836 What is 146.018 + 63.9187? 209.9367 What is the difference between 17239987 and 920.3? 17239066.7 Add together -3589 and 3.1301176631. -3585.8698823369 What is 1013765 + 106552290? 107566055 Total of -99.55 and 6228547.261. 6228447.711 Subtract 6 from -2683535364348. -2683535364354 Put together 160.8779 and -1.791425. 159.086475 -1511826761970 + 97 -1511826761873 Work out 4990418 - -0.131617. 4990418.131617 7905 + -410381546 -410373641 What is 113302.04 minus -5.4883? 113307.5283 Put together -108308.5062048 and -1.1. -108309.6062048 8340.07841+-0.0525 8340.02591 What is the difference between 1834109914 and -406? 1834110320 What is 0.9 - -26865861722383? 26865861722383.9 Subtract 13961.1141826 from -0.06. -13961.1741826 Work out -7554.02762 - 2.5988. -7556.62642 Put together -3252787 and 0.9923. -3252786.0077 What is -9471748670612 minus 3? -9471748670615 What is the distance between -2.596633 and -0.09622? 2.500413 What is -18.2 + 928.842407? 910.642407 Add -819 and 460520.4. 459701.4 What is -53.8 plus -4974647158? -4974647211.8 What is the distance between 997 and -0.2208133252? 997.2208133252 What is -440993738 - 412? -440994150 What is 10 less than -33697543091128? -33697543091138 Calculate -6 - -22.99993421298. 16.99993421298 What is 34964174723 + -70? 34964174653 Add together 719 and -397841395. -397840676 Calculate -1175.6007 - 200.57. -1376.1707 Add -58435.4978601 and 1. -58434.4978601 What is the difference between -4.4 and -105323683663? 105323683658.6 Add 4133494290199 and 0. 4133494290199 What is 0.014 + -20028044590? -20028044589.986 What is -0.233499 plus -109045802? -109045802.233499 -0.3 + 0.065887250791 -0.234112749209 What is -195704 take away 407707756? -407903460 0.05 + -1464701781583 -1464701781582.95 What is -5012851 plus -0.01760631? -5012851.01760631 Total of 306540.62767 and -1. 306539.62767 What is -929886.05115 - 135? -930021.05115 Sum 334896 and 324035. 658931 Add together -307287 and 3263235.6. 2955948.6 What is -339831611534 - -4? -339831611530 What is -70440113.04245 minus -0.03? -70440113.01245 What is the distance between 0.138 and -91232007? 91232007.138 Sum -1747307824 and 9817. -1747298007 Add together 7545663363791 and 1. 7545663363792 Subtract 4.1 from 60.37266599. 56.27266599 What is -1.16482913606 - -6.56? 5.39517086394 Sum 27012603223109 and 0.11. 27012603223109.11 0.5 + 12790825.8483 12790826.3483 Put together -903 and 2.17785685. -900.82214315 -184391644+-66886 -184458530 Add 148988117113 and 48. 148988117161 What is 0.5 minus 60816784303? -60816784302.5 What is -873365084.9 - -1698? -873363386.9 What is the difference between 245.42061 and 40612.5? 40367.07939 Add -100982958 and 15559. -100967399 What is 21.9415006 + 0.1264? 22.0679006 -154 + 4969204427 4969204273 Subtract -2239183664 from 62170. 2239245834 What is -13112892761444 - 0? -13112892761444 What is 1754770689 plus -0.836? 1754770688.164 Put together 0.3 and -306718018535.8. -306718018535.5 What is 0.312 - -3099858824? 3099858824.312 What is -94.74 minus -10694.3733? 10599.6333 0.02472+4920960662 4920960662.02472 What is 22 minus 24727115296566? -24727115296544 What is -0.1 take away 9972544.720178? -9972544.820178 Calculate -5027 + 145.744169. -4881.255831 Sum -14523507 and 762145. -13761362 What is the distance between -7.714897 and -821.04? 813.325103 What is the distance between -0.016948 and 6760973? 6760973.016948 -11.189+-10.116571 -21.305571 What is the distance between -11435.612 and 27325? 38760.612 -201160398263 + -6.9 -201160398269.9 Sum -0.288 and 165732854.4. 165732854.112 -22 + -90248414553 -90248414575 Sum 0.5 and 1324311141123. 1324311141123.5 Total of 2587587.069 and 1083. 2588670.069 Add -171377683102198 and 5. -171377683102193 0.5+-1.1288763849 -0.6288763849 Add 162204680152 and 1. 162204680153 -148019213 + -4390274 -152409487 4052.3 + 9953084 9957136.3 What is -1075615772 minus 8.8? -1075615780.8 9.95675743 - -1327 1336.95675743 -5329957.1+-393.05 -5330350.15 What is -0.4 + 32707588160? 32707588159.6 Sum 1680.8294759 and 8739. 10419.8294759 Total of 0.5 and -5077190318577. -5077190318576.5 What is 41.742 + 34968025? 34968066.742 6611933084 + -16 6611933068 Put together -17788.2197219588 and 0.4. -17787.8197219588 Calculate -0.05 - -4.54437437. 4.49437437 Subtract 290.4371926 from -1373. -1663.4371926 Add -1368848540.9097 and 0.2. -1368848540.7097 What is 6 plus -87378157158? -87378157152 What is 23902 - 6397708664? -6397684762 2.28205725232 - 0.076 2.20605725232 Work out 0.06321 + -32197029. -32197028.93679 What is 33 minus -152904582898? 152904582931 Add -0.022623 and -18752.906. -18752.928623 Work out -296942019890 - 8. -296942019898 What is -111466441020396 - 5? -111466441020401 Calculate -51158916638 - -0.1. -51158916637.9 Calculate -19.55603 - 4649082. -4649101.55603 Work out -147.645 + 0.01868549. -147.62631451 -18115+2252811290.3 2252793175.3 What is 8.15838 + 6488.4423? 6496.60068 What is 0.5 plus 43023982961551? 43023982961551.5 Calculate -1686.5 + 2631247.89. 2629561.39 7536594442856+-0.25 7536594442855.75 What is 4243935541 less than -0.841? -4243935541.841 14702150569 + 0.34 14702150569.34 What is -3721756364 + -2.1? -3721756366.1 -1.34 + 0.24992219525 -1.09007780475 What is 74471338592 + 0.68? 74471338592.68 What is 20156.7303 less than -9080? -29236.7303 What is -5.50741835783 - 759? -764.50741835783 -989 - -9733450912 9733449923 What is the difference between 940341.45 and 66.8? 940274.65 What is 0.028160108317946 - 2? -1.971839891682054 Subtract 285362155 from -185.9671. -285362340.9671 What is -76089721904 minus -0.4? -76089721903.6 What is 0.0054791789 plus -10399? -10398.9945208211 Subtract 439270635 from -68. -439270703 -707366923709 - 0.4 -707366923709.4 Subtract -3299.295 from -44451. -41151.705 What is -33622838703 plus 29? -33622838674 What is -0.2008441168289 + -0.5? -0.7008441168289 What is the difference between -125815962 and -269876? 125546086 What is the distance between -48.9408637077 and -29? 19.9408637077 What is 1 - -600131499885? 600131499886 What is -31057631313486 less than -1? 31057631313485 Subtract 8990.6 from -8822607. -8831597.6 What is 788.876864867 less than 2.07? -786.806864867 What is -1 + -88403962584? -88403962585 Add 2 and -0.533909033243. 1.466090966757 Work out -142.2 - 2145692.9. -2145835.1 What is 32361147751 less than -9560? -32361157311 Calculate 247556.6607 - -0.136. 247556.7967 Put together 83652 and -725429. -641777 Calculate -28 - 0.08760954193122. -28.08760954193122 Subtract 133939246866 from -5.827. -133939246871.827 -158463 + -143.9059 -158606.9059 What is the distance between 31700541.79 and 365.36? 31700176.43 Subtract 418835964132 from 0.82. -418835964131.18 What is 3.08727 plus 13613952? 13613955.08727 Add together -481049478 and -442. -481049920 What is 0.863858 + 22716.9? 22717.763858 What is -7314 less than -227739089? -227731775 -32+906869976539 906869976507 -46132537 + 47.23456 -46132489.76544 What is the distance between -1275233 and 97536? 1372769 What is -0.0187629 - -57331? 57330.9812371 Work out -1147 - 162896.193. -164043.193 What is -3408103849 take away 69.29? -3408103918.29 What is the distance between -122756208 and -101047? 122655161 -134089 + 5.27754 -134083.72246 What is 0.08007862 + 12.19768? 12.27775862 Work out -442182309 - -15612. -442166697 Add together -1146223.548398 and 2. -1146221.548398 -0.3+-16176096.442236 -16176096.742236 What is 45406410485.451 less than 0.4? -45406410485.051 What is the distance between 0.04005569 and 1.243? 1.20294431 Calculate -137 + -11203435397. -11203435534 29783.9 - -856537 886320.9 Add together 112276102794 and 17. 112276102811 Add together 12560917585335 and -0.1. 12560917585334.9 Subtract 59.26735438 from 1264. 1204.73264562 Subtract 68247766 from -41189. -68288955 -1261838249.4+348 -1261837901.4 Total of 0.004 and 3255.31592038. 3255.31992038 What is the distance between 54867 and -0.084555? 54867.084555 Add 2977.04126797 and 1.1. 2978.14126797 Work out -1113686341935 + 4. -1113686341931 Add -1.23 and 349527710948. 349527710946.77 What is the difference between -8969 and 38473.74? 47442.74 What is -6335 minus -407857843? 407851508 What is 686554.381 minus 0.03281? 686554.34819 Work out 0.31 - 24737351240849. -24737351240848.69 What is -0.4090633 plus -1.8717379? -2.2808012 Calculate 25989 + 397.70178. 26386.70178 Subtract -60406093289.4 from -244. 60406093045.4 What is -406963347 minus 135? -406963482 What is 747549.9848 minus -22? 747571.9848
Let x(c) = 495c2 - 15. Let g(h) = -h2 - 3. Give 10g(t) - 2x(t). -1000t*2 Let h(s) = -37s + 3. Let m(d) = 3d + 2. Determine h(r) - 5m(r). -52r - 7 Let a be 8/69/6. Let w(u) = -2u + 1. Let p(t) be the first derivative of -5t*2 + 5t + 59. Suppose 2i + i = -33. Calculate ap(o) + iw(o). 2o - 1 Let g(k) = k*3 - 8k*2 + 7. Suppose 24s - 13s = 55. Let b(z) = -7z*2 + 16z + 0z3 + z3 - 16z + 6. Determine sb(m) - 4g(m). m*3 - 3m*2 + 2 Let h(m) = 2m - 10. Let d(t) = 1 + 4 + 4016t - 4018t + 4. Give 4d(a) + 3h(a). -2a + 6 Let p(t) = -120t*3 + 65t. Let f = -247 - -312. Let h(b) = 8b3 - 9b. Let q(l) = -25l3 + 26l. Let m(u) = -8h(u) - 3q(u). Give fm(a) + 6p(a). -5a3 Suppose -2x + 10 = -3z, 5 = -3x + 2. Let t(f) = -5f3 - 5f*2 + 4f - 4. Let b(q) = -q*3 + q - 1. Give zb(p) + t(p). -p*3 - 5p*2 Let a(c) = -5c*2 - 2c + 4. Suppose -109 - 472 = 83o. Let n(j) = -9j*2 - 3j + 7. Determine oa(m) + 4n(m). -m*2 + 2m Let a(z) = -16z2 + 15z + 10. Let n(b) = -3b2 - b + 1. Give -a(k) + 5n(k). k*2 - 20k - 5 Let y(d) = d*2 + d - 1. Let a(w) = 25w*2 + 2w - 5. Determine a(i) - 2y(i). 23i*2 - 3 Let s(m) = -7m*3 - 8m*2 + 11m - 14. Let o(g) = 2g2 - 5g*2 + 3g2 + g2 - 2g3 + 4g - 5 - 4g2. Calculate -11o(f) + 4s(f). -6f3 + f2 - 1 Let r(x) = 32x - 1. Let g(c) = 28c - 1. Let s(f) = 7g(f) - 6r(f). Let o(m) = 11m - 2. Let t = 8 + -11. Calculate to(d) + 8s(d). -d - 2 Let a(m) be the first derivative of m4 - m2/2 + 6m + 3. Let f(j) = -13 + 12 - 10j3 + 9j*3. Suppose -3g - 6 = -2g. Determine gf(v) - a(v). 2v3 + v Let s(k) = 16k*3 + 11k*2 - 31k - 11. Let n(o) = o*2 - 46o + 374. Let h be n(11). Let x(b) = 3b3 + 2b*2 - 6b - 2. Give hx(f) + 2s(f). -f*3 + 4f Let h(z) = z*2 + 4z - 2. Suppose 0 = -9r + 12r - 9. Let a(q) = -3q2 - 9q + 5. Determine ra(t) + 7h(t). -2t2 + t + 1 Let b(w) = -5w + 2. Let f = -303 + 302. Let p(k) = k. Calculate fb(u) - 6p(u). -u - 2 Let t(f) = 9f3 + 10f*2 - 300. Let d(m) = -13m*3 - 14m*2 + 450. Calculate -5d(g) - 7t(g). 2g*3 - 150 Let h(d) = -3d + 106. Let p(g) = -g*2 + 14g - 423. Determine -9h(s) - 2p(s). 2s2 - s - 108 Let z(a) = -a - 5. Let o = 105 + -66. Suppose 5v = 2t - 14, 4t - 7 = -5v - o. Let j(f) = f + 4. Let s = 7 + -9. Calculate sz(p) + tj(p). -p - 2 Let q(a) = -6a*2 + 4a + 1. Let x(l) = -35l + l2 + 73l - 39l. What is -q(b) - 4x(b)? 2b2 - 1 Let n(t) = 5t + 17. Let c(x) = -5x - 20. Give -5c(j) - 6n(j). -5j - 2 Let r(a) = 69384a - 1029. Let i(t) = -135t + 2. What is 1029i(l) + 2r(l)? -147l Let w(d) = 97d*3 + 2d + 2. Let p(h) = -96h3 - 3h - 3. What is 2p(u) + 3w(u)? 99u3 Let m(f) be the first derivative of 2f + 8 - 3/2f2. Let b(l) = -2l*3 - 3l*2 - 2l - 1. Let g be b(-2). Let r(i) = 2i - 1. Give gr(o) + 4m(o). 2o + 1 Let k(c) = c*3 + c - 4. Let o(h) = -6h*3 - 8h*2 + 5h + 16. What is 4k(i) + o(i)? -2i*3 - 8i*2 + 9i Let m be 7 + (-37)/5 - 34/(-10). Let p = -47 + 40. Let x(a) = 6a2 - 2a - 2. Let y(t) = 13t2 - 4t - 4. Determine my(v) + px(v). -3v2 + 2v + 2 Suppose 5i - 8i + l + 14 = 0, -3i + 6 = 3l. Let c(x) = 54x3 + 45x*2 + 45x. Let t(p) = -5p3 - 4p*2 - 4p. Calculate ic(g) + 45t(g). -9g3 Let v(w) = -498515w*3 + 2228w. Let r(p) = 1119p3 - 5p. Determine -2228r(a) - 5v(a). -557a3 Let q(j) = j2 + j - 1. Let o(a) = -7a*3 - 28a*2 - 28a + 28. Suppose 294f - 9 = 303f. Calculate fo(b) - 28q(b). 7b3 Let f(y) = y2 - 1. Let g(p) = -646p*3 + 6p*2 - 6. Determine -6f(a) + g(a). -646a3 Let x(u) = -8u. Let k(j) = -15j. Let i = -1185 + 1188. Calculate ik(z) - 5x(z). -5z Suppose -4h - 15 = -7h. Let c(b) = b*3 + 3b + 3. Let f(a) = 144 - 173 + 25 - 4a - a3. What is hc(t) + 4f(t)? t3 - t - 1 Let s(w) = 90w - 878. Let b(c) = 8c - 80. Calculate 68b(h) - 6s(h). 4h - 172 Let y(j) = j. Suppose -9 = -5x + 11. Let p = x + 1. Suppose f + a + 8 = 0, 4a + p = 2f + 3f. Let t(n) = 3n. Determine ft(z) + 8y(z). -z Let p(y) = -y. Suppose -3h + 7h - 4 = -4a, -2a - 1 = h. Let u be (-12)/(-2)(h + -2). Let o(j) = 2j. What is up(q) + o(q)? -4q Let u be (-49)/(-63) - (-6)/27. Let q be (2 + 6/(-2))-4. Let g(o) = 6o + 2. Let f(z) be the third derivative of -z4/24 - 2z*2. Give qf(h) + ug(h). 2h + 2 Let j(i) = -10i + 1. Let a(u) = 9u. Let n(o) = -2o3 - 9o*2 + o + 17. Let d be n(-4). What is da(z) - 2j(z)? -7z - 2 Let l(j) = -3j3 - 3j*2 + 5j + 5. Let t(o) = 7o3 + 5o*2 - 9o - 9. What is -5l(v) - 3t(v)? -6v3 + 2v + 2 Let a(f) = f*3 + 4f*2 + 2f - 6. Let j = 65 - 64. Let z(c) = -c*2 + 96c + j - 96c. Calculate -a(n) - 6z(n). -n*3 + 2n*2 - 2n Let c(n) = -n*3 - 13n*2 + 4n + 56. Let v(u) = -23u2 + 7u + 112. What is 7c(s) - 4v(s)? -7s3 + s2 - 56 Let y(i) = -300i*3 + 3i2 - 3. Let j(b) = b3 - b*2 + 1. Calculate -3j(u) - y(u). 297u3 Let h(r) be the third derivative of -r4/8 + 3r2. Let g(u) = -u3 - 2u2 + 6u - 4. Let s be g(0). Let p(k) = -k. What is sh(a) + 9p(a)? 3a Let v be (-105)/91 + 2/13. Let x(h) = h - 27. Let b(m) = m - 8. Let n(y) = 15b(y) - 5x(y). Let a(i) = -i - 1. Give vn(c) - 15a(c). 5c Let b(l) = -316l + 11. Let s(j) = -105j + 4. Calculate -4b(q) + 11s(q). 109q Let c be -151/5(-2 - 0). Let g(h) = -5h*2 - 6. Let j(i) = -11i*2 - 13. Give cj(l) - 13g(l). -l2 Let w(v) = -3v + 2. Let j(s) be the first derivative of 7s2/2 - 3s + 308. Give 2j(n) + 5w(n). -n + 4 Let s(n) = -n*3 + 6n - 6. Let b(v) = v*3 - 5v + 5. Let l = -28 - -22. Let d be (l/5)/(5/(-25)). Give db(r) + 5s(r). r*3 Let m(y) = -9y. Let q(o) = -45o - 1. Suppose 4g - 4f = 0, -2 = -3g - 0g + 4f. Determine gq(k) + 11m(k). -9k + 2 Let h(p) = p2 + 59p + 4. Let u(w) = -w*2 - 60w - 3. Determine 2h(a) + 3u(a). -a*2 - 62a - 1 Let y(n) = 2n2 - n - 3. Suppose -3x + 21 + 0 = 2a, 0 = 4a + 2x - 22. Suppose -ap + 21 - 18 = 0. Let l(w) = -w + 1. Give pl(q) + y(q). 2q*2 - 2q - 2 Let m(a) = -3a. Let n(x) be the second derivative of 5x3/2 + x2/2 - 17x - 4. Let d(i) = i3 - 6i*2 + 5i + 2. Let r be d(5). Give rn(f) + 11m(f). -3f + 2 Let n(q) = -259q - 378. Let t(i) = -13i - 19. Determine 6n(m) - 119t(m). -7m - 7 Let y(t) = 5t2 + t + 4. Let u = -73 - -104. Let q(x) = 16x + 16x + 5 + x2 - ux + 5x2. What is -4q(o) + 5y(o)? o2 + o Let o(w) = -173w + 2. Let f(z) = 87z - 1. Determine -11f(t) - 6o(t). 81t - 1 Let t(k) = 7k2 + 62k - 1. Let j(p) = 2p2 - p. What is 3j(h) - t(h)? -h*2 - 65h + 1 Let i(c) = 26c + 125. Let n(l) = 8l + 41. Determine -2i(b) + 7n(b). 4b + 37 Let s(v) = 2 - 1 + 9v - 4v - 6v. Let q(h) = -9h + 3 + 8h + 3h + h3 - 5. Determine q(n) + 2s(n). n*3 Let a(o) = -4o + 1. Let h(q) = 6q - 7. Give -a(j) + h(j). 10j - 8 Let b = 12 - 7. Let d be ((-17)/b - -3)-5. Suppose n = 2n + 18. Let v(s) = s*2. Let z(j) = 8j*2 - j - 1. Calculate dz(o) + nv(o). -2o*2 - 2o - 2 Let l = -7 + 10. Let x = l - 0. Let w be (-12 - -1) + (-4 - -7). Let q(a) = a*2 + a + 1. Let p(c) = 2c*2 + 2c + 3. What is wq(b) + xp(b)? -2b2 - 2b + 1 Let o(i) = -i*2 - i - 1. Let j(x) = -6x - 10. Let m be 175/28 - (-5)/(-4). Let t(z) = -z*2 - 11z - 19. Let y(f) = mj(f) - 3t(f). Give -4o(d) - y(d). d2 + d - 3 Let b(q) = 6 + 17q - 3q - 4 + 10. Let r(s) = -5s - 4. Determine -6b(a) - 17r(a). a - 4 Let x(t) = t + 6. Suppose 2q + 6 = 5q. Suppose 6v = qv + 4. Let n(y) = -1. Let l = -270 - -275. Give ln(o) + vx(o). o + 1 Let w(z) = -z*3 + 4z2 + z - 3. Let d(j) = j3 - 3j2 + 2. Let b be 5/(18/(-8) + 2). Let m = b - -39. Let q = -17 + m. What is qw(g) + 3d(g)? g3 - g2 + 2g Let s(v) = -5v3 + 2v*2 - 4v - 2. Let f(o) = -o*2 - 6o - 1. Let i be f(-6). Let m = 548 + -552. Let b(j) = j*3 + j + 1. Calculate is(d) + mb(d). d3 - 2d*2 - 2 Suppose -22u + 11 = -33u. Let r(p) = 1. Let v(l) = l + 1 - 1. Determine uv(c) - r(c). -c - 1 Let g(r) = 6r3 + 13r*2. Let y(w) = 4w*3 + 15w*2. Determine 3g(s) - 4y(s). 2s*3 - 21s*2 Let j(d) = -6d + 3. Let y(r) = 3r + 2. Let c(a) = a + 1. Let m(f) = 5c(f) - 2y(f). Suppose 0 = p - 4p, 4p - 4 = -4n. Calculate nj(x) - 5m(x). -x - 2 Let y(t) = -1. Let l(u) = -u + 5. Let n be 1/(-1) - (-2 + -1). Suppose -9v + 5v - 2s = -42, 5v - s = 49. What is nl(a) + vy(a)? -2*a
Let u = 6 - 2. Suppose -uz - 40 = 124. What is the remainder when -2 + (4 + -1 - z) is divided by 15? 12 Suppose -2i + 3i = 24. Let l(t) = 2t*2 - 6t - 51. What is the remainder when i is divided by l(-4)? 4 Let j = 1054 + -709. What is the remainder when j is divided by 31? 4 Let q(l) = -l*3 + 22 - 7l - 45 + 22 + 8l2. Let z be q(7). Let x(h) = -13h + 2. What is the remainder when 57 is divided by x(z)? 12 Suppose -1913 - 3103 = -19r. Calculate the remainder when r is divided by 16. 8 Let k = 68 - 41. Suppose y = -2y + k. Calculate the remainder when (18/((-1)/1) - -3)/(-1) is divided by y. 6 Let k = -883 - -588. Calculate the remainder when 59 is divided by (-1)/(-2) + k/(-10). 29 Let j = -1410 + 1438. What is the remainder when 104 is divided by j? 20 Let k be -81 + 8 - (-1 - -3). Let j = k + 115. Let a = j + -25. What is the remainder when a is divided by 4? 3 Let t be -1 + ((-4)/(-3))/(12/(-36)). Calculate the remainder when 17 is divided by 9 - (-15)/t - 4. 1 Suppose -24c = -29c + 65. Suppose 15m = 14m + c. Calculate the remainder when 62 is divided by m. 10 Let g = -4 + 4. Suppose gy - y = -14. What is the remainder when (-80)/28 + 3 + (-816)/(-21) is divided by y? 11 Let u(z) = z3 - 5z*2 - 15z + 7. Let n be u(7). Suppose n = -9o + 48 + 6. Calculate the remainder when 10 is divided by o. 4 Let j = -737 - -820. Calculate the remainder when 250 is divided by j. 1 Suppose -20j + 2318 = 198. Calculate the remainder when j is divided by 32. 10 Let k = 87 - 53. Suppose 0 = -5m + 200 - 155. What is the remainder when k is divided by m? 7 Let m = 20 - 7. Calculate the remainder when (23/((-483)/60))/(4/(-70)) is divided by m. 11 Let c(q) = -q2 + 23q - 11. Let g = -29 + 26. Let s = g + 21. Calculate the remainder when c(s) is divided by 27. 25 Let i = -294 - -314. Calculate the remainder when 151 is divided by i. 11 Suppose 0 = 5q - x - 100, -10 = 2x - 0. What is the remainder when 378 is divided by q? 17 Let l = -16 - -26. Suppose n - 31 = 3v, 4n - 4v + v = 115. Calculate the remainder when n is divided by l. 8 Let y(c) = 11c + 41. Calculate the remainder when 146 is divided by y(-1). 26 Let l(j) = j*2 + 51j + 16. Calculate the remainder when l(18) is divided by 79. 73 Let m = 50 + -53. Calculate the remainder when 108/3 - 3 - m is divided by 10. 6 Let c(w) = -w*2 - 8w - 1. Calculate the remainder when 15 is divided by c(-7). 3 Suppose -3w + 1 = -2. Let z = w - -8. Suppose z = -3m + 48. What is the remainder when m is divided by 4? 1 Suppose n = -5u + 57 - 3, -4n = 5u - 51. Suppose a + ua = 264. What is the remainder when 64 is divided by a? 20 Suppose 130 = 3h + 121. Calculate the remainder when h is divided by 1/((-8)/(-6) + -1). 0 Suppose 4k - 2i = -0k - 70, 0 = -3k - 2i - 35. Suppose 19y - 35 = -206. Let c = y - k. What is the remainder when c is divided by 2? 0 Let g = 30 + -9. Calculate the remainder when g is divided by 4 + ((-4)/22 - (-237)/33). 10 Suppose -6l + 20 = -2l, 0 = -v + 2l - 9. Let j(b) = 12b3 + b2 - 3b + 2. Calculate the remainder when j(v) is divided by 5. 2 What is the remainder when (88/(-10))/(46/(-345)) is divided by 14? 10 Suppose 10 = 5s - 10. Suppose sb = -2n + 28, 5n = b + 2b + 5. What is the remainder when 17 is divided by 9(n/6)/1? 5 Let j(x) = 4x + 4. Let m be j(-2). Let t be m - -6 - 38. What is the remainder when 19 is divided by -22/8t? 8 Let j(w) = -42w + 5. Calculate the remainder when 93 is divided by j(-1). 46 Let r be 8(-9)/(-30) + 2/(-5). Suppose 0 = -4z - 4p + 148, 1 - 11 = rp. What is the remainder when z is divided by 15? 12 Let r(o) = 3o*3 - 24o*2 - 20o - 12. What is the remainder when 199 is divided by r(9)? 46 Suppose 4w - 15 = w. Let x be (-13 - -7 - 5)(-2)/1. Calculate the remainder when ((-3)/12x)/(2/(-4)) is divided by w. 1 Let z = -1705 - -2018. What is the remainder when z is divided by 43? 12 Suppose 2g - 2 = -5b, -4g + 2 = 4b - 2. Suppose -2q - 5h = -47, 4 = 4h - b. What is the remainder when 51 is divided by q? 9 Let w(h) = 7h3 + 11h - 2. Calculate the remainder when w(3) is divided by 13. 12 Let c be 1173/12 + (-6)/8. Suppose -c = -2t - 5n + 4n, 0 = -3n + 9. Calculate the remainder when t is divided by 17. 13 Let k be 7 - -1(1 + -2). What is the remainder when 39 + -9 + (-144)/(-16) is divided by ((-20)/(-6))/(2/k)? 9 Let q = 137 - 241. Let z = 126 + q. What is the remainder when z is divided by 10? 2 Let u = 26 - 8. What is the remainder when (552/16)/(1/2) is divided by u? 15 Suppose -644 = 3b - 7b - 2g, 0 = -3b + g + 488. Calculate the remainder when b is divided by 40. 2 Let h be 1 - (-2 - 0)82. Suppose -5u = 2f - 98, -h = -3f - 3u - 0. Let x = 26 + -11. Calculate the remainder when f is divided by x. 14 Let h be 104/(-18) + (-14)/63. Let x be (-202)/6 + h/18. Let y = x + 47. Calculate the remainder when 25 is divided by y. 12 Let i = 28 - -7. Calculate the remainder when ((10 - 11)346)/(-2) is divided by i. 33 Let a = 178 + -159. Calculate the remainder when 281 is divided by a. 15 Let y(h) = h2 + 16h - 53. Calculate the remainder when y(8) is divided by 16. 11 Suppose -2r + r + 7 = 0. Let d(n) = -2n*2 + 14n - 7. Let s be d(6). Suppose -104 = j - sj. Calculate the remainder when j is divided by r. 5 Suppose r - 186 = -2f, 15 = -3f - 2f. Calculate the remainder when r is divided by 65. 62 Let x be 6/((-2)/(-4) + -2). Let f = x - -8. Suppose ft - 10 = -t. Calculate the remainder when t is divided by 1. 0 What is the remainder when (-1)/(0 - 4/52) is divided by (-60)/(-14) - 8/28? 1 Suppose 0 = 5j + 3k - 19, 4j + k - 5k = 28. Suppose 4z = jz - 2s - 20, 5z - 86 = -4s. What is the remainder when z is divided by 10? 8 Let w(m) = -1. Let k(n) = 5n + 7. Let t(y) = k(y) + 6w(y). Let z = -146 - -152. What is the remainder when t(z) is divided by 17? 14 Let m(j) = j*2. Let x be m(2). Suppose n - xn - 43 = -2i, -3n = 3. Calculate the remainder when i is divided by 12. 8 Let l = 11 - -1. Let w be -11 + -40 + (-3)/(-1). Let o = -1 - w. Calculate the remainder when o is divided by l. 11 Let t = 75 - -164. Calculate the remainder when t is divided by 8. 7 Let a = -31 + 124. Calculate the remainder when a is divided by 20. 13 Let y(h) = h*3 - 3h*2 + 4h + 31. What is the remainder when 92 is divided by y(0)? 30 Let g be (-8)/(-2)35/20. Suppose -8 = -2u - 4s, 4s = -u + gs + 4. Suppose 3k + 28 = 4m, -3m - k + u = k. What is the remainder when 19 is divided by m? 3 Suppose 4d = -3g + 89, -10d + 6d = 5g - 143. What is the remainder when 77 is divided by g? 23 Suppose 6m + 70 = -m. Calculate the remainder when 52 is divided by (171/(-45))/(2/m). 14 Let g(t) = -3t + 8. Let w(k) = -2k + 7. Let h(f) = 5g(f) - 6w(f). Suppose 0 = 3b - 8b - 25. Calculate the remainder when 51 is divided by h(b). 12 Let t(f) = f*3 - 13f*2 - f + 17. Let n be t(13). Suppose -p + np = 114. What is the remainder when 149 is divided by p? 35 Let j = 16 - -20. Suppose 0 = 44o - 40o - 196. Suppose -3t + o = 5a - 40, 5a - 4t - 103 = 0. Calculate the remainder when j is divided by a. 17 Let t(g) = g*2 + 9g - 17. Let l = -23 + 12. What is the remainder when t(l) is divided by 2? 1 Calculate the remainder when 393 is divided by (38/(-76) + 10/(-12))-27. 33 What is the remainder when ((7 - -4) + 32)7 is divided by 99? 4 Let z(c) = 38c2 - 2c - 1. Let y(u) = -u*3 + 54u*2 - 197u - 139. What is the remainder when z(-1) is divided by y(50)? 6 Suppose -31n = -37n - 144. Let p = n - -128. What is the remainder when p is divided by 12? 8 Let i = 378 - 345. What is the remainder when 75 is divided by i? 9 Suppose 5j - 880 - 395 = 0. Suppose 5h + j = 5c, -2c + 100 = -0c - 3h. Let z = 112 - c. What is the remainder when z is divided by 31? 28 Suppose a - 22 = -5. Calculate the remainder when (-8)/(-36) - (-1130)/18 is divided by a. 12 What is the remainder when (24/10)/6 - (-197784)/90 is divided by 71? 68 Calculate the remainder when (2 + -7)/((-10)/78) is divided by 11. 6 Let l(n) = -12n - 3. Let g be (4 - 44/(-6))-3. Let m = 117 + g. Calculate the remainder when m is divided by l(-2). 20 Suppose 5v + 95 = 4q, -4v = 3q - 2v - 100. What is the remainder when 569 is divided by q? 29 Let k = -154 + 175. What is the remainder when 61 is divided by k? 19 Suppose -w = 4x - 6w - 245, -x = -3w - 63. Suppose 28b = 27b + 32. What is the remainder when x is divided by b? 28
Let y be 27/(-12)(-8)/3. Suppose 0 = 2g + 3o - 18, -y + 33 = 3g + 2o. Solve 0 = 5i - gi - 20 for i. -5 Suppose 0 = 4c - 2w - 0w + 10, w = -4c + 5. Suppose 4j - 32 = -0j. Solve 3i - ji - 15 = c for i. -3 Let a(x) = x2 - 5x - 6. Let z be a(6). Solve 4w + 0 - 4 = z for w. 1 Let l(a) = -22a - 3. Let g be l(-1). Solve 4 - g = 3t for t. -5 Let b = 15 + -13. Let p be 2 + 12/8b. Solve 0 = pm - m - 20 for m. 5 Let b be (-2)/5 - ((-21)/15 + 0). Solve o = -4 - b for o. -5 Suppose -3t - 12 = -3d + t, 2d - 5t = 15. Solve d = -5n + 3n + 10 for n. 5 Let b(q) = q - 1. Let h be b(5). Suppose -16 = -2d + 8. Suppose h = n, -i - 2n - n = -d. Solve io + 2 = -o for o. -2 Suppose 0 = -2s, -5h + s + 10 = -2s. Suppose 4 = 4q - hq. Solve -qi - 3i = -15 for i. 3 Suppose 0 = 3m, -24 = -4f - 0m - 3m. Let s be f - 3/124. Solve sh - 4h = 3 for h. 3 Suppose -5t + 42 = 3p + 14, 0 = -t + 5p. Suppose 4c - 12 = -4m, 4c - 4 = -m + t. Solve 0 = a + a + c for a. -1 Suppose -5b = -4g - 124, -2b + 4g + 52 = -0g. Suppose -3h = -0h - b. Solve 0j = -2j + h for j. 4 Let h be (18/(-12))/((-1)/(-2)). Let m = h + 6. Suppose 5f - g = -0g + 18, 0 = -f + mg - 2. Solve -2d = -d - f for d. 4 Let n(l) = 4l - 2. Let x be n(3). Suppose -h + 2q - 4 = 4q, -2h = 5q + x. Suppose h = -4f - 4r + 4, -3f - 5r = f. Solve -1 = -fs - 16 for s. -3 Suppose 11v - 4 = 9v. Solve 2 = -vo - 0 for o. -1 Let n(h) = h*3 - 8h*2 + 9h - 10. Let v be n(7). Suppose o = vo. Solve a + 2a - 3 = o for a. 1 Let q be (-3)/1 + 0 - -4. Solve 0 = -v - q - 3 for v. -4 Suppose -4x + x - 2z = 22, 4x + 3z + 31 = 0. Let l be x((-3)/2)/3. Solve lj = j for j. 0 Let t(l) = l*3 - 2l*2 - l - 4. Let b be t(3). Suppose -bm + 5m - 15 = 0. Solve mh + 23 = -2 for h. -5 Suppose -2x = 6r - r - 17, 0 = 5x - 2r - 57. Solve -5f - 1 = -x for f. 2 Suppose 0 = -0s - s - 14s. Solve -8m + 3m + 5 = s for m. 1 Let h be (-2 - 12/(-5))5. Let s be (4 - 0)h/4. Let v be s/6(12 - 0). Solve v = r - 2r for r. -4 Let p be (-64)/(-12) + 2/(-6). Suppose 4x = -12, pw - 6x - 16 = -4x. Solve wz = 3z for z. 0 Suppose -5o + o = 0. Suppose 0 = v - 5v + 80. Suppose 3k - v = -k. Solve -k = p - o for p. -5 Let f(n) = -n*3 - 10n*2 - 9n + 6. Let d be f(-9). Let s be 93/6 + 9/d. Let u(z) = -z*3 - 2z*2 + 2z. Let i be u(-3). Solve s = -5m - i for m. -4 Let o = -8 + 11. Suppose oa - 68 = -8. Solve 2p = -2p + a for p. 5 Suppose -3a - a = 12. Let d(l) = 2l + 6. Let g be d(a). Solve g = -4m + 8 for m. 2 Suppose -2g - 12 = -5q, 2g - 36 = -5q - 2g. Let f(m) = 6m2 - m + 1. Let z be f(1). Let k = z + -4. Solve kp - q = 4 for p. 4 Let c(x) = 4x - 2. Let h be c(2). Let w = -1 + h. Suppose -5g - 40 = -3q, 4q - 2g - 5 = wq. Solve q = -s - 4s for s. -1 Suppose -f - 3p - 5 = 0, 0 = 3f - 5f - 4p - 2. Suppose -2r = -fr + 20. Let l(j) = -j3 + 3j*2 + 6j - 4. Let z be l(r). Solve 0 = zc - 9 + 1 for c. 2 Let h(n) = -7n + 3. Let a be h(-2). Let m = a + -15. Solve -m = -g - 3 for g. -1 Suppose 0 = -5u + 6u, 2n - u = 0. Solve 4j + 1 + 11 = n for j. -3 Let d = 0 - -4. Let o = -203 + 210. Suppose c - 2w = -7, 5w = -c + 11 + 10. Solve du + o = -c for u. -2 Let z(c) be the third derivative of c4/24 - c3/6 - c2. Let t be z(4). Suppose 2q = -2y - 4, q - 2y + 14 = -6y. Solve tj + q = -7 for j. -3 Let u be -4 + 5 + (-3)/(-3). Suppose 2p + 4m + m = 5, up + 2m = 2. Solve 0 = -2i - p - 6 for i. -3 Let i = 13 - 2. Solve 4p = 5 + i for p. 4 Suppose -4a = -6a - 6. Let z be (-58)/a - (-4)/6. Solve -4c + z = c for c. 4 Let d = 81 - 34. Suppose d = -3i + 131. Let z be 8/i + 26/7. Solve v = 5v - z for v. 1 Let f be 0 + -1 - (0 - 1). Let l(j) = j3 - 4j*2 - 6j - 1. Let z(y) = 5y2 + 7y + 1. Let x(o) = -5l(o) - 4z(o). Let q be x(-1). Solve fv = qv for v. 0 Let g = 10 + -11. Let t = g + 4. Solve -tv + 7 = 1 for v. 2 Let t be (-2)/623. Suppose -h = 4s + 21, -6h - 2s - 13 = -3h. Let u be (h2)/(2/t). Solve p = -up for p. 0 Let q be (6 + 2)/((-1)/(-2)). Suppose 9 = 4n + 1. Solve nk + q = -2k for k. -4 Suppose 0 = 8y - 4y. Solve y = -x - x - 2 for x. -1 Let v = 15 + -15. Suppose -5z + 3c - 7c + 13 = v, -2z - 8 = -5c. Solve l + 2 + z = 0 for l. -3 Let l(i) = i + 1. Let w(t) = -t + 14. Let n(s) = 5l(s) - w(s). Let p be n(4). Solve 5 = -5h - p for h. -4 Let j be 4 + -10 + 2-1. Let v = 8 + j. Solve 5g - g + 12 = v for g. -3 Suppose u - 3d + 6 = d, -3u = -4d - 6. Solve -u = 4l + 6 for l. -3 Suppose -4m = -25 + 5. Suppose -l - w + 18 = -2w, 0 = -mw - 15. Solve -3z + 0 = l for z. -5 Let b = 1 + 2. Suppose 0 = -3g - 2a - 1, -g + 3a = -5g - b. Solve 3 = -0l - gl for l. -1 Suppose 4w = -f - 18, -w = 3f - 3w - 16. Solve 7z - 5 = fz for z. 1 Let d be 23/15 - 92/(-20). Solve 0 = -3k - 2k + d for k. 1 Let p = -13 - -27. Suppose -3o = 2i - 4 + p, 3o - 5i = 25. Solve o = -2x + 5 - 3 for x. 1 Let i = 6 + -2. Suppose 1 = o - i. Suppose -of + 20 = -f. Solve -2l - f = -3l for l. 5 Let r be ((-6)/(-21))/(-4 + 29/7). Solve 3n = rn - 3 for n. -3 Let s(b) = b3 + 9b*2 - 3b + 1. Let w be s(-8). Suppose 4g - 11 - w = 0. Solve 5u = -5 + g for u. 4 Let w = -29 + 44. Suppose -h + w = -0h. Solve -5x - h = 5 for x. -4 Suppose -c = 3c + 3p - 9, 4p - 12 = -5c. Let g(q) = 1. Let n(w) = -w*2 + w + 9. Let x(v) = -6g(v) + n(v). Let i be x(c). Solve 0f - i = f for f. -3 Suppose 3r + 0r - 27 = 0. Suppose -4x + 24 = -4s, 3x - r = -s + 5. Solve xw = 3w for w. 0 Let m(s) = -2s - 2. Let k be m(-3). Let v = 7 - 5. Suppose -p + 48 = vp. Solve 4 - p = kh for h. -3 Suppose -7 = -4x + 9. Let h(k) = 3k. Let u be h(x). Solve -u = 2q + q for q. -4 Let f(q) = q*3 + q - 2. Let g be f(2). Let o(p) = -2p*2 - 3 - gp - 2p2 + 3p*2. Let h be o(-6). Solve 0x = -3x + h for x. 3 Suppose 0 = k + 5i + 3, -4k + 12 = -i - 3i. Suppose -3q - 2q + 25 = -2l, -l + 10 = kq. Solve la = 3a for a. 0 Suppose -2u + 9 + 15 = 0. Let l = -8 + u. Solve la - 13 + 5 = 0 for a. 2 Let h be (-4)/(-10) - (-4)/(-10). Suppose 2a + ha = 0. Suppose 0 = -3m - 2w, am + 2w = -m. Solve m = b - 2b - 1 for b. -1 Let d be (-16)/(-6)3/2. Suppose 0s = -2s - 28. Let u = -3 - s. Solve da = -u - 1 for a. -3 Let u = 5 - 3. Suppose -2 = -2f - us, 3f + 6s - s - 3 = 0. Let i(d) = d + 1. Let l be i(f). Solve l = x + 1 for x. 1 Suppose -16 = -4v - 4. Solve r = vr - 4 for r. 2 Let v = -20 + 9. Let x = 15 + v. Solve -xm + 3 = -5 for m. 2 Let t(n) = -3n2 + 2n - 1 - n + 2. Let h be t(-1). Let q be 10/4 - h/(-6). Solve -8 + 0 = -ql for l. 4 Suppose 19 = 2d - 11. Solve 0 = 5p - d - 5 for p. 4 Suppose 4f = 2 + 10, 3b - 21 = -4f. Solve -b = -2k + k for k. 3 Suppose 2p - 10 = u + 4p, 20 = -4p. Suppose u = -3j - j. Suppose jg - 3g = 0. Solve gw + 2 = -w for w. -2 Suppose 0b = 4b. Let f(d) = d*2 - 4d + 4. Let t be f(4). Solve x - tx - 15 = b for x. -5 Suppose 10 = 9h - 7h. Solve 0 = 2v - v - h for v. 5 Let i(j) = -j*3 + 10j*2 + 12j - 13. Let t be i(11). Let f be -1 - (-59 - 2/t). Let h be (-1)/(-2) - f/(-6). Solve 0 = -4k - 6 - h for k. -4 Let i(p) = 4p + 42. Let d be i(-10). Solve 1 = c - d for c. 3 Suppose 0 = -5d - 9 + 4. Let k = d + 6. Solve 2i - k = 3 for i. 4 Let u be -1 + 3 + (-13 - 0). Let y(s) = -s - 5. Let w be y(u). Solve -q = -wq - 10 for q. -2 Let h(k) = -k3 - k2 + k - 2. Let m be h(-2). Let q(b) = -6b3 + 1. Let s be q(-1). Let a(z) = z2 - 7z + 3. Let i be a(s). Solve -v - i = -mv for v. -3 Let u = -21 + 34. Suppose -4 = un - 17n. Solve -n = -g - 0 for g. 1 Suppose 4w - 2x - 21 = 5, 3w = -5x - 13. Suppose wj - j - 18 = 0. Solve -r = r - j for r. 3 Let h(b) = -b3 + 13 + 10b - 8b2 + 0b*3 + 0b*3. Suppose 2r = -3r - 45. Let j be h(r). Solve 1 = -jz - 7 for z. -2 Let z be ((-8)/5)/(2/(-5)). Suppose -9 = t - z. Let w be 2/t - (-22)/5. Solve -f + w = -1 for f. 5 Suppose 3x + 2x - 10 = 0. Solve xq - 6 = -0q for q. 3 Let g = 4 + -1. Solve -s + gs = 2 for s. 1 Suppose -4t + 3c = 2c - 36, t - 4c = 9. Let k(q) = -3q - 3 + tq + 3q. Let l be k(2). Solve -3i - 2i + l = 0 for i. 3 Suppose d - 4d = 0, -5q - d = -75. Let f = -3 + q. Suppose -3g + 3z + f = 0, -3g = 2g + 2z + 8. Solve gi + 2 = -i for i. -2 Let h = 9 + -6. Let d = 0 + h. Solve -dr - 8 = r for r. -2 Let x be 5((-44)/(-20) + -2). Solve c + x = 2 for c. 1
Let o(a) = -a*2 + 10a - 12. Let q be ((-5)/2 - -3)/(3/36). Let f be o(q). Calculate the highest common divisor of 12 and f. 12 Suppose 0 = -i + 3i - 10. Suppose 0u - 40 = iu. Let n be (-544)/(-18) + u/36. What is the highest common divisor of n and 45? 15 Let t(u) = -u - 15u - 2u3 - 12 - 15u2 + u3 + u. Let p be t(-14). Calculate the greatest common factor of p and 5. 1 Let p(j) = -12j + 10j*3 - 11j*3 - 207j*2 + 219j*2. Let x be p(10). Calculate the highest common divisor of x and 16. 16 Let l = -126 + 270. Suppose l = 4h + 4h. Calculate the greatest common divisor of 126 and h. 18 Let r = 40 - 46. Let i(j) = -19j + 26. Let h be i(r). Calculate the highest common divisor of h and 28. 28 Suppose 28t - 888 = 1128. What is the greatest common divisor of 360 and t? 72 Suppose -3o + 22 = -4q, -o + 3q - 52 = -66. Suppose 4s + 26 = 2. Let c = s - -7. Calculate the highest common divisor of o and c. 1 Let a be -14((-27)/(-6) - -4). Let h = -96 - a. Calculate the highest common divisor of h and 253. 23 Let p(u) = -u + 63. Let o be p(-4). What is the greatest common factor of 134 and o? 67 Suppose -3o = 2o - 45. Let p be -3 + o + -3 + 45. Let b(s) = -s*2 - 6s + 7. Let m be b(-5). Calculate the greatest common factor of p and m. 12 Let r be 2/9 - (-2000)/72. Suppose -2g = i - 199, 5g - 2g = 2i + 288. Calculate the greatest common factor of r and g. 14 Let d be (-1)/((-4)/(-8)) - (-141 - 1). Calculate the highest common factor of d and 20. 20 Suppose -w + 1279 = n, -4w + 2559 = 2n - 3w. Calculate the highest common factor of n and 48. 16 Let i = -31 - -27. Let g be 0 - (2 + 2)/i. Calculate the greatest common divisor of g and 2. 1 Let s(y) = -7y - 23. Let p be s(-5). Suppose pn - 60 = 9n. Calculate the highest common factor of 20 and n. 20 Let l(c) = c*2 - 2c - 3. Let d be l(-3). Let h(s) = 4s - 16. Let z be h(7). What is the greatest common divisor of z and d? 12 Suppose -227x + 233x = 990. Let n be 4/10 - 489/(-15). What is the highest common factor of n and x? 33 Suppose -o = -20 - 14. Let t be 1/(2/o) - 0. Let n(l) = 1614l - 16021. Let y be n(10). Calculate the highest common factor of t and y. 17 Let f be 1(-1 + -1) - -13. Suppose 0 = 3v - 5v + 198. Calculate the highest common factor of f and v. 11 Suppose -2p - 16 = -s, 0 = -4s - 4p + 39 + 37. What is the greatest common factor of s and 126? 18 Let r = 2284 + -1378. Calculate the greatest common factor of r and 6. 6 Let c be ((-1 - 0)/(180/612))/(2/(-40)). Suppose 4q = 84 + 324. Calculate the highest common factor of c and q. 34 Let u = -230 + 257. What is the highest common factor of u and 6? 3 Suppose t + 0t + 239 = 5p, 5p - 2t = 238. Let i = 995 + -983. What is the highest common divisor of p and i? 12 Suppose 4i = -2b + 188, -7b + 11b = -2i + 100. Calculate the highest common factor of 414 and i. 46 Let i = 1 - -2. Suppose -25 + 15 = -5v. Suppose iy = vy + 30. Calculate the highest common factor of y and 10. 10 Let v = 637 - 618. What is the greatest common factor of 703 and v? 19 Let j be (14 - (-11121)/39) + (-4)/26. What is the greatest common factor of 23 and j? 23 Suppose -5c + 2m - 518 = -1677, 3c + 4m = 685. What is the greatest common divisor of c and 483? 21 Let r(h) = h2 - 16h + 55. Let l be r(12). Calculate the greatest common factor of 8 and l. 1 Suppose -5d + 429 = 8d. Calculate the highest common divisor of d and 1023. 33 Suppose 609 = 4z - 135. Let g = z + -126. Calculate the greatest common factor of 36 and g. 12 Let h be 12/2 + -4 + -8. Let l(u) = -u3 - 7u*2 - 6u + 7. Let s be l(h). Suppose i - 126 = -i. Calculate the greatest common divisor of s and i. 7 Let r be 4/3(-138)/(-4). Suppose -8y + 72 = -5y. Suppose 4u - 5h - 72 = 0, -3h + y + 11 = u. Calculate the greatest common factor of u and r. 23 Let c(q) = -76q + 7. Let y be c(0). Let l = 82 + -33. What is the highest common divisor of l and y? 7 Let n(g) = 478g + 490. Let j be n(-1). Let v(o) = -o*2 + 6o - 1. Let b be v(3). Calculate the greatest common divisor of b and j. 4 Suppose 3w - 60 = -3h, -5w + 40 = -h + 3h. Let y = h - 12. Let a be ((-2)/(-3))/(8/480). What is the highest common factor of y and a? 8 Let b(q) = -33q + 357. Let f be b(9). What is the greatest common factor of f and 150? 30 Let h(n) = -2n*3 - 4n*2 - 5n - 4. Let a be h(-2). Let m be 14/1 + (-3 - a/(-3)). What is the greatest common divisor of m and 104? 13 Let p(f) = -f*2 - 7f - 6. Let u be p(-4). Let v(m) = m + 13. Let s be v(-6). Let w = s - u. What is the greatest common divisor of w and 9? 1 Suppose -225 = -0s - 5s. Suppose -s = -6c + 3c. Calculate the highest common divisor of 165 and c. 15 Suppose -5v - 4p = -144, 2v - p + 10 = 65. Let q(n) = -n2 + 5n + 13. Let o be q(6). What is the highest common factor of v and o? 7 Let y = -13 + 5. Let b = -7 - y. What is the highest common divisor of b and 16? 1 Suppose 12 = -3i, 0i = y - i - 20. Let z(d) = 24d2 + 1. Let c be z(1). Suppose c = 4w - 135. Calculate the highest common divisor of y and w. 8 Let p be 2/(-6) - 3801/(-63). What is the highest common divisor of 260 and p? 20 Suppose 2p + 3p - 23 = -3u, 0 = u - 1. Suppose -pc = c - 75. Let q(o) = -o + 11. Let b be q(6). What is the greatest common factor of b and c? 5 Let y(h) = h. Let i be y(6). Suppose -14d - 36 = -20d. Suppose -42 = 5c - dc. Calculate the greatest common factor of c and i. 6 Let r(i) = -i*2 + 20i - 14. Let j be r(15). Let m = j + -58. What is the highest common factor of m and 9? 3 Let u = -621 + 773. Calculate the highest common divisor of u and 16. 8 Suppose -s = -147 + 43. Suppose 5r - 45 = 5a, -2a + 0a + 8 = 0. What is the highest common divisor of s and r? 13 Suppose 0 = -6f + f + 2a + 277, f - a - 56 = 0. What is the highest common divisor of 15 and f? 5 Let x be (1 + 0)107 + 7. What is the greatest common factor of 399 and x? 57 Let v(l) = 2l - 42. Let y be v(21). Suppose -5i + 6 + 194 = y. Calculate the greatest common factor of i and 360. 40 Let n = 4 + -2. Suppose -14 = -2s + o + o, 0 = 5s + no - 63. Suppose 0 = b - 3t - 13, t = -3b + 3t + s. Calculate the highest common factor of 1 and b. 1 Suppose 164 = -3o + o + v, 5v = o + 73. Let z = -38 - o. What is the greatest common divisor of 9 and z? 9 Let g(s) = 16 - 12 + 0s + s + s. Let l be g(2). What is the highest common factor of l and 72? 8 Let z(b) = -b*3 + 6b*2 + 6b - 9. Let x be z(6). Calculate the highest common divisor of 27 and x. 27 Suppose 0 = v - 0 - 2, 4m - 130 = v. Calculate the highest common divisor of 9 and m. 3 Let q(z) = z2 - 2z. Let f be q(4). Let m(g) = g*2 + 18g - 27. Let h be m(-23). Calculate the greatest common factor of f and h. 8 Let h(c) = c*3 - 3c*2 - 3c - 5. Let z be h(4). Let w be -21-8(-4)/(z - 23). Calculate the highest common factor of 7 and w. 7 Let g(a) = -80a + 18. Let b be g(-5). What is the greatest common divisor of b and 66? 22 Let p(n) = -n3 + 9n*2 - 3n + 9. Let k be p(6). Let j = -93 + 102. What is the greatest common factor of k and j? 9 Let w(k) = k*2 - 24k - 297. Let y be w(-32). What is the highest common divisor of y and 13? 13 Suppose -2g - 10 = -v, 0g = -g - v - 2. Let k = g - -14. Suppose 7h - k = 2h. What is the greatest common factor of 4 and h? 2 Let m = -543 - -559. Calculate the greatest common divisor of m and 8. 8 Let r = 535 + -439. What is the greatest common divisor of 12 and r? 12 Let m(z) = 7z - 10. Suppose -2k + j = -12, 0k - j = 4k - 24. Let r be m(k). What is the highest common divisor of r and 4? 4 Let g(t) = 11t2 - 3t - 8. Let d be g(-8). Let l be ((-8)/(-5))/(18/d). What is the greatest common factor of l and 16? 16 Suppose x = 5x + z - 613, -2z - 750 = -5x. Calculate the highest common divisor of 88 and x. 8 Let d = -131 - -174. Let c be 1 + (d + 4 + -5 - 1). Suppose 4y = -5s + 122, -y + 2y + 5s - 38 = 0. Calculate the greatest common divisor of y and c. 14 Suppose -6f + 2f + 12 = 0, 0 = -2b + 4f + 60. Let n = -479 - -533. What is the highest common divisor of b and n? 18 Let n(k) = -2k*3 + 2k*2 - 12k + 5. Let h be n(-5). What is the greatest common divisor of h and 292? 73 Let x be ((-8)/208-13)/((-1)/(-4130)). Calculate the highest common divisor of x and 35. 35 Let b(a) = 49 + 4a - 3*a + 17 + 6. Let v be b(0). Let g = v + -46. What is the greatest common factor of g and 104? 26
Let i = -14857 + 14857.021295. Round i to 3 decimal places. 0.021 Let v = -1316 + 1320.6792. Let z = -4.7 + v. Round z to three decimal places. -0.021 Let k = -556165 - -556164.9478438. Let f = 95.9619438 - k. Let t = 96 - f. Round t to 3 dps. -0.014 Let p = -45135312 + 70604312. What is p rounded to the nearest one hundred thousand? 25500000 Let c = 806 + -317. Suppose -81 = -3g - c. Round g to the nearest 100. -100 Let s = 118 + -569. Let g = s - -450.634. Let r = g - -0.38. What is r rounded to two dps? 0.01 Let s = -7 - -37. Let c be 714000/(-13/s). Round c to the nearest one million. -7000000 Let a = -2.82270011803 - -2.8227. Round a to seven decimal places. -0.0000001 Let z = -82893 + 144963. What is z rounded to the nearest 1000? 62000 Suppose -5s + 3x = 408308, 3s + 230882 + 14096 = -5x. What is s rounded to the nearest one thousand? -82000 Suppose -17m - 27 = 75. Let u be 60570 - (-2)/m(29 + -29). What is u rounded to the nearest 1000? 61000 Let s = 1.662 - 1.67423. Let y = -0.0175 - s. Round y to 3 decimal places. -0.005 Let j = -655.89 - -12.89. Let i = -642.99999647 - j. Round i to seven decimal places. 0.0000035 Let m = 11796 - 11795.88954. Let j = m - -6.24254. Round j to 0 decimal places. 6 Let y = -1.5651 + 0.3367. Round y to one decimal place. -1.2 Let c = 64975 + -64321.66. What is c rounded to the nearest 10? 650 Let f be -198388(5-1 + (-2 - -5)). Let k = f - -163224. Suppose 18g - 17g - k = 0. Round g to the nearest 100000. 600000 Let d = 1371.449 + -1365.2004646. Let i = d + -6.30657. Let j = 0.058 + i. Round j to five decimal places. -0.00003 Let v = 184 - 91.9. Let t = v + -91.619. What is t rounded to 1 dp? 0.5 Let i = 1758362756681.999998403 + -1758362753041. Let h = i + -3641. What is h rounded to 7 dps? -0.0000016 Let z = -2972.083965 + 3015.084. Let u = -0.0305 - 42.9695. Let y = u + z. Round y to five dps. 0.00004 Let v = -110 - -199. Let s = v - 92.75. What is s rounded to zero dps? -4 Suppose 0 + 10 = -2d - 5b, -4b - 31 = -3d. Suppose 0 = -dx + y + 41750002, 2y + 29731056 = 3x + 4681052. Round x to the nearest one hundred thousand. 8400000 Let y = 1778.8535 - -0.1465. Let v = y + -1778.999996305. Round v to 7 dps. 0.0000037 Let n be 2 - 0 - 1(3 - 1). Let s be ((-7160)/(-12)-3)/(n - 1). Let a be (-3)/60 + s-1. Round a to the nearest one hundred. -1800 Suppose -5q = -3p - 218720, 0 = 2q + 4p - 90751 + 3263. Let n = q + -12034. Round n to the nearest 1000. 32000 Let i = 125.67 - 160.04. Round i to the nearest integer. -34 Let c = -17038 - 31232. What is c rounded to the nearest 1000? -48000 Let m = 0.1187 + -5145.6187. What is m rounded to the nearest one hundred? -5100 Let z = -2796.20176 + 14857.45486. Let p = -12062 + z. Let b = p - -0.785. What is b rounded to two dps? 0.04 Let d = -1537.24 + 1537.2547078. What is d rounded to 3 dps? 0.015 Let n = -53208.3 - 577489.7. Let k = n + 630142.982. Let x = 556 + k. Round x to one decimal place. 1 Let x = 26112370123.9515 + -25815765930.951617. Let v = x - 296604386. Let n = v + 193. Round n to 5 dps. -0.00012 Let h = 0.37516256 - 0.3754. Round h to five decimal places. -0.00024 Let i = 105.01739 + -0.24739. Let j = i + 32.33. What is j rounded to the nearest 10? 140 Let g = 172.7 + -172.70000021934. What is g rounded to 7 decimal places? -0.0000002 Let j = -16434 + 16435.4301. What is j rounded to one decimal place? 1.4 Suppose -7h + 530160016 = h. Suppose -2b + 22090002 = c, -2b + 4b - h = -3c. What is c rounded to the nearest 1000000? 22000000 Let h = 246.9 + 25.1. Let x = 271.99999432 - h. Round x to 7 dps. -0.0000057 Let s = -641 + 911. Let v = 270.00000162 - s. Round v to seven dps. 0.0000016 Let x = 0.0643 + 1.8029. Let r = 1.87 - x. What is r rounded to three dps? 0.003 Let v = 9886.7 + -9886.615734. Let p = 0.084 - v. Round p to 5 dps. -0.00027 Let l = -0.8 - -0.845. Let v = l + -0.139. Let u = 0.093973 + v. What is u rounded to 5 dps? -0.00003 Suppose -12k - 420128318 = k + 429096682. Round k to the nearest one million. -65000000 Let b = -142.9 + 141. Let h = b + 73.9. Let r = 72.00016 - h. Round r to four dps. 0.0002 Let l be 28/(-6) - (-4)/(-24)2. Let r be (6(-3)/l)/((-5)/(-25)). Let n be 13 - 1 - (-8)/((-48)/r). What is n rounded to zero decimal places? 9 Suppose -p - 54p - 1171324000 = -11p. What is p rounded to the nearest one hundred thousand? -26600000 Let z = 45.0915 + 445.1465. Let r = -491 + z. What is r rounded to one decimal place? -0.8 Let c = 1172.08494 + -1172. What is c rounded to three dps? 0.085 Let c(z) = 3981250z*2 - 14z + 56. Let s be 24/6 - (6/3 + -2). Let t be c(s). Round t to the nearest 1000000. 64000000 Let o(q) = 11q - 11846. Let b be o(0). Let m = b - -5856. Round m to the nearest one hundred. -6000 Let m = -4568.55 - -5132.4838. Let d = -564 + m. Round d to two decimal places. -0.07 Let d = 18 + -21.5. Let n = -19.7 - -34.6. Let o = n - d. Round o to the nearest integer. 18 Let b = 381.12 - -302.64. What is b rounded to the nearest ten? 680 Let k = 29932.3 + -29671.242. Let g = k - 261. Round g to 1 decimal place. 0.1 Let q = 7139756.4605 - 7140639.46051846. Let m = q - -883. What is m rounded to 6 dps? -0.000018 Let j = 3152.6 - 3152.77637. Round j to 2 dps. -0.18 Let f = -0.0313 + 4.2213. Let w = -4.1228 + f. Round w to two dps. 0.07 Let f = 1107.2990079 + -1107.3. Let q = -17.999 - -18. Let o = q + f. Round o to 6 dps. 0.000008 Let u = -10529714 - -15785184. Let t = -5255438.000076 + u. Let b = t + -32. What is b rounded to 5 decimal places? -0.00008 Let q = 13630.78 - 13507. Round q to the nearest 10. 120 Let r = 36.21 + -20.036. Let o = 11.3129 - r. Let z = o - -0.0511. Round z to one dp. -4.8 Let r = 4724573 - 11660173. What is r rounded to the nearest one hundred thousand? -6900000 Let u(r) = 5r*3 + 90r*2 + 85r + 12. Let h be u(-17). Let s = 0 - 0. Suppose 8d - hd - 102800000 = s. What is d rounded to the nearest one million? -26000000 Let w = 32240 + -32239.999960805. Round w to seven decimal places. 0.0000392 Let q be -102((-225)/(-18) + (-15)/3). Let z = -839 - q. What is z rounded to the nearest one hundred? -100 Let k = 49.63 - 50.69672. What is k rounded to 2 decimal places? -1.07 Let u = -32.69916 - -32.848. What is u rounded to 2 decimal places? 0.15 Let j be (5 - (-1)/(-1)) + (4 - 20). Let o be (2/2)/(-31/j). Suppose -3g + 2v + 585006 = 0, ov + 0v = g - 195012. Round g to the nearest 10000. 200000 Let m = -349 + 223. Let d = m + 159. Round d to 0 dps. 33 Let x = -1112 - -886. Let v = 226.0872 + x. Round v to 3 decimal places. 0.087 Let d = -33544.000032711 + 33544. Round d to seven dps. -0.0000327 Let y = 473708856 + -473708846.89999724. Let g = -478 - -468.9. Let h = g + y. What is h rounded to six decimal places? 0.000003 Let o = -577 - -576.925. Let i = o - -0.074996168. What is i rounded to 6 dps? -0.000004 Let d = 82035.79009 + -82035. Round d to one dp. 0.8 Let p = 169653 - 87748. Round p to the nearest 10000. 80000 Let m = -2685 - -2942.3. Let o = 272 - m. Let t = o - 14.6999873. What is t rounded to six decimal places? 0.000013 Suppose -16u + 39u = -37u - 684732000. Round u to the nearest 100000. -11400000 Suppose 5n = -n + 161478. Suppose -5t - 10 = 0, 101889 = -4k - t - n. Round k to the nearest one thousand. -32000 Let u = -77 + 132. Let i = 1040 + -1097.7. Let n = u + i. What is n rounded to 0 decimal places? -3 Let v = -731349 + 731769.0005. Let q = 420 - v. Round q to 4 dps. -0.0005 Let z = 13.805 + -14. Let s = 0.362 + z. What is s rounded to 2 decimal places? 0.17 Suppose 61419 - 302199 = 10o. Let x = o - -67078. Round x to the nearest 100000. 0 Let u(q) = -4q + 58. Let m be u(14). Let i be -14097 - m - (-6 + 3)/(-3). Round i to the nearest 1000. -14000 Let i = -58.07 + 58.06995423. What is i rounded to six decimal places? -0.000046 Let m = -49571 + 88585. What is m rounded to the nearest ten thousand? 40000 Suppose -23616d + 23607d - 83742300 = 0. What is d rounded to the nearest 1000000? -9000000 Let c = 1435073.27104241 + -731329.28304199. Let d = c + -703744. Let w = d - -0.012. What is w rounded to seven decimal places? 0.0000004 Let j = 10.34535 + 5.15258. Let m = j + -20.8975. Let a = -5.4 - m. What is a rounded to 4 decimal places? -0.0004 Let p = 142604.2 - 142603.43352364. Let n = 0.546477 - p. Let u = n + 0.22. Round u to seven decimal places. 0.0000006 Let v = -649.17 - -654. Let g = v + -1.13. Let f = g - -1. Round f to 1 dp. 4.7
Let c be 1/(-3) + (-14)/(-6). Suppose -5f = -7 + 2. Which is greater: f or c? c Let q be -2 + 1 - (1 + 4). Which is smaller: q or 1? q Let m be (4/10)/((-13)/(-195)). Let v be 4/((-8)/m-1). Is v at most 3? True Suppose -5i + 4z - 9 = 0, -2z + 12 + 0 = -4i. Are i and -5 non-equal? False Let x be (-8)/(-28) - 26/(-56). Which is smaller: x or -4? -4 Let m(y) = 2y + 1. Let t(l) = -l2 + 4l - 1. Let q be t(3). Let p be m(q). Suppose h + 3u + 5 = 0, ph - 3h + 3u + 4 = 0. Is h greater than or equal to 1? True Let b(z) = 3z3 + z. Let q be b(1). Let y = 0.01 + 2.19. Let l = 2 - y. Which is greater: q or l? q Let x be -7 + 3 + 5 + 1. Is x less than or equal to 2? True Let p = -15 + 14. Which is smaller: p or 2/7? p Let c(h) = -2h + 2. Let g be c(0). Let d be g-2(-2)/(-8). Which is greater: d or -4? d Suppose 5w = -c + 12, -c + 3w - 4w + 16 = 0. Which is smaller: 1/2 or c? 1/2 Let p = -1001584/3269849 + -104/6913. Let r = p - -6/43. Which is bigger: 0 or r? 0 Let s = 0.05 - -0.15. Is -8 != s? True Suppose 7n + 0n = 21. Which is bigger: -39 or n? n Let u(s) = -s3 - 3s*2 - s + 1. Let z be u(-3). Let p be 3 + (2 - z - 2). Which is bigger: -2/27 or p? -2/27 Let b = -6 + 5.7. Do b and -0.1 have the same value? False Suppose 2x = -9 - 3. Let d = x - -7. Is -1 at least as big as d? False Let q = 210 + -1894/9. Is 1 bigger than q? True Let d(f) = -2f3 - 22f*2 + 1. Let l be d(-11). Is 1/5 greater than or equal to l? False Suppose -3n = -0n - 6. Let j be 4/8(1 - -9). Suppose 5c = -h + 8, nc + jh - 18 = -1. Which is smaller: 0 or c? 0 Suppose -9b + 6b - 27 = 0. Which is smaller: -0.04 or b? b Let q be (4/60)/((-2)/(-354)) - 4. Which is bigger: -2 or q? q Let j(u) = u3 + 12u*2 + 5u - 16. Let q be j(-12). Let k be q/(-6) + (-4)/6. Is 12 less than k? False Let z be (-26)/6 - (-1 - 2). Let m be -1 - ((2 - 1) + -1). Which is bigger: m or z? m Let m(g) = g*2 + 11g - 26. Let h be m(-13). Which is smaller: -5/6 or h? -5/6 Let r(n) = n*2 - 4n + 3. Let c be r(5). Which is smaller: 3 or c? 3 Let t = 1.76 + 0.24. Let b(v) = -v*3 + 8v*2 + 1. Let i = -11 - -19. Let s be b(i). Which is greater: s or t? t Suppose 0 = 4z + 5k - 13 - 6, -2 = z - k. Which is greater: z or -14? z Let k = -1013606932/1575 - -643560. Let d = k - -2/1575. Are 0 and d non-equal? True Let b = -8 - -8.8. Are -2 and b unequal? True Suppose -4k + 15 = k. Suppose kp - 6 = 4a, a - 2p - 10 = -7p. Let o = -0.32 + 0.02. Is a smaller than o? False Let k = 68 + -58. Which is bigger: 1 or k? k Let f be (1 + 1/2)(-312)/(-36). Which is smaller: f or 43/3? f Let y = -0.306 + 0.3. Are y and 0.1 nonequal? True Let z(a) = -3a*2 - 2a - 2. Let r be z(-2). Let l = 4 + r. Let s be ((-8)/(-6))/((-4)/18). Is s > l? False Let o = 5 - 6. Let n(w) = w*2 + 7w + 2. Let h be n(-7). Let y be (2-1)/h - 1. Which is smaller: y or o? y Suppose 2z - q - 11 = 0, 3q = 13 - 4. Let l be ((-2)/5)/(1/(-5)). Suppose ln + z = -u, -2u + 6u + 4 = -2n. Is -1/5 greater than u? False Let s(x) = -x3 + 2x*2 - 3x + 2. Let j be s(2). Let n be 18/j - (-4)/(-8). Is 1 equal to n? False Let s = 1.4 - 0.7. Let g = -0.2 + s. Let h = -0.4 + g. Is 1/3 greater than h? True Let w(n) = n - 1. Let d be w(2). Suppose -1 = 2l + d. Which is smaller: -2 or l? -2 Suppose -4u + 29 = 13. Let y be 1/((-3)/(-15))-1. Let i = y + u. Are i and -3 unequal? True Let j(m) = 2m*3 - 18m*2 - 22m + 20. Let w be j(10). Is -5/4 at most as big as w? True Let v = 2.8 - 1.8. Which is smaller: v or 12? v Let y(w) = -w + 3. Suppose 0 = -4l + l. Let j be y(l). Suppose 0 = -2s - js. Which is smaller: 1/3 or s? s Let a = -74 - -33. Does a = -41? True Let c(q) = -q3 + 3q + 1. Let v be c(-2). Suppose 0 = -5f - vh - 9, 2f + 4h - 5h + 8 = 0. Is f less than -2? True Let y = 17 - 24. Let d = 14 + y. Let h = d + -8. Is h < 0? True Let d = -595/3 + 13676/69. Are 1 and d nonequal? True Let z be (-1)/(-1) + ((-10)/15)/(-2). Are z and 6 equal? False Let j = 470857 + -5184414/11. Let r = j - -453. Which is bigger: 1 or r? 1 Let g = 22 + -19. Suppose gc + 14 - 5 = 0. Which is smaller: 2 or c? c Let m be (3 + -1)1/(-2). Suppose -6 = -3p - 18. Let g be (-34)/48 + p/(-12). Is m at most as big as g? True Suppose 2g - 4j - 2 = 0, 8g + j = 10g - 14. Let o = -5 + 16. Are g and o unequal? True Suppose 3m + y - 11 = 0, 2 - 5 = m - 3y. Let k be 2/m(-15)/10. Let n = -1143/7 + 163. Does n = k? False Suppose 19g + 340 + 116 = 0. Is -25 < g? True Suppose -3a + 5t - 3t = -105, -a + 30 = t. Is 0.3 smaller than a? True Let i = 116/621 + -6/23. Is 0 at most i? False Let u be 4/(-6)54/12. Suppose 2 = -3y + 4b + 18, 0 = -4y - 4b + 12. Let l(z) = -2z + 6. Let j be l(y). Which is greater: j or u? j Suppose 0r + 5r + 5 = 5s, 2 = -2r + 4s. Let n be (2/2)/(1/2). Let m = r + n. Which is smaller: -1/5 or m? -1/5 Let n(k) = -4k - 16. Let x be n(-12). Let g = x - 28. Let w(f) = f3 + 2f*2 - 3f + 3. Let j be w(-3). Are g and j equal? False Let t = 14 + -16. Suppose -3k + 5 = 23. Is t greater than k? True Let l = -569 - -25603/45. Is -1 at most as big as l? True Let c be ((-1)/(-102))/(((-3)/(-4))/(-3)). Which is greater: c or 0? 0 Let l be (2 + 0)2/(-5). Suppose 0 = -3i + 5p + 13, 4p + 5 - 2 = -5i. Suppose 3y + 5 = -i. Which is smaller: l or y? y Let n = -22 + 16. Is n greater than or equal to -6? True Let c be ((-1)/(-2))/(3/(-6)). Let t = -144 + 1010/7. Which is greater: c or t? t Let j = 2011/13 - 154. Which is bigger: j or 1? 1 Let l(r) = r + 9. Let j be l(-8). Is 2/25 at most as big as j? True Let u(a) = 3a - 42. Let n be u(14). Suppose 0c = -2c - 4. Let w be c/(-11)(-3)/(-2). Is w less than n? False Let q = -11 + 16. Suppose 4u = qm + 16, -2m = 3u + 3 + 8. Which is bigger: 1/9 or u? 1/9 Let q(t) = t + 1. Let l(r) = 5r + 4. Let i(g) = 2l(g) - 11q(g). Let h be i(-4). Let m be -2 - (0 - h)2. Do m and -0.1 have different values? True Let q = -9.62 + 12.7. Let m = 0.08 - q. Is m at most as big as -2/7? True Let d(u) = 11u - 1. Let w be d(1). Let n be 26/w - 2/(-5). Let j = n - 1. Which is smaller: 0 or j? 0 Suppose 13 = 4a + 2z - 9, -a - 2 = -2z. Suppose 5s + 5 = al, l = -0l + 4s - 7. Suppose 7 = -2q - 2m + 3, 0 = lq + 2m - 5. Does 5 = q? False Let f be ((-253)/(-12))/(-11) - (-1)/4. Suppose -3g + 25 + 29 = 0. Suppose -3q + 6q = -4u - g, -2 = q. Is u equal to f? False Suppose 5n - 31 = -c, 0 = -c + n - 2n + 11. Suppose 0t + 2t = 12. Is c less than t? False Let d(h) = -7h - 2. Let v be d(-1). Let n be (-12)/99/(-2). Let i be n + (-3)/(-6)-2. Is v equal to i? True Let f = -29 - -30. Which is smaller: f or 5? f Let c = -849/136 + 49/8. Let r = 2 + -2. Which is smaller: r or c? c Suppose -20 = -5y - 0. Which is greater: y or 8? 8 Let x be (12/10)/((-26)/(-455)). Which is greater: x or 19? x Let p(a) = -5a*2 + 9a + 1. Let b(g) = -9g2 + 17g + 2. Let c(s) = -6b(s) + 11p(s). Let j be c(-3). Is j at least as big as 1? False Let a(d) = -2d3 - 2d*2 - 1. Let h be a(-2). Let x be 2/h + 55/(-70). Is x greater than 1? False Suppose -2 - 10 = 2x. Suppose -3a + w - 10 = 0, -4a - 3w + 5 = 14. Which is greater: a or x? a Suppose 48g - 50g = 0. Let z be (-215)/275 - (-6)/10. Is z less than or equal to g? True Let c = -52 - -469/9. Is 0 at least as big as c? False Let v(s) be the second derivative of -s4/6 - 5s*3/6 + 3s*2 + s. Let a be v(-5). Let t be a/(-5) + 1/5. Which is bigger: t or 2? t Suppose 0 = -2v - 92 + 92. Which is bigger: v or -3/32? v Suppose -2h = 9 - 27. Suppose -t - h = -4t. Is 3 >= t? True Let c(x) = -x. Suppose -3b = -0b. Let f be c(b). Let m be ((-6)/(-16))/(6/4). Which is greater: f or m? m Let k(c) = c + 4. Let f be k(3). Let u = 11 + -3. Is u smaller than f? False Let s(x) = 2x - 13. Suppose -n = 3b + 1, 4n + 2b = n + 25. Let q be s(n). Is 7 <= q? True Suppose 7a - 8 = 27. Is a at least 2? True Let f be (0 + 2)/(8/6). Let y(l) = 4l - 3. Let p be y(2). Suppose 3d - pd + 4 = 0. Are d and f nonequal? True Let v = -75280 + 374148/5. Let q = 446 + v. Let n = -71/15 - q. Which is greater: n or -1? n Suppose -5p - 10 = -5b, 0 = 5b + 3p - 5p - 1. Let w = -4 + 3. Is b <= w? True Let g = 1 + -0.9. Is g less than or equal to 20? True Let f = -2 - -5/3. Let t = -16/23 - -250/161. Does t = f? False Let z be -2 + (0 - 1) + -1. Suppose -2f = 2f - 8. Suppose 8 = -fh + 2. Which is smaller: z or h? z Let n = -7622/4631 + 4/421. Which is greater: -3 or n? n
1.114709765 + 0.095 1.209709765 Calculate -0.423049021026 + -0.4. -0.823049021026 What is -66126860386 + 168.4? -66126860217.6 Add -26463678.924 and 435.6. -26463243.324 -9+73146287885 73146287876 -345361+424191 78830 Sum -18.959387787 and 8. -10.959387787 Subtract 1560057.51 from 497. -1559560.51 What is -1884622.7 - -1.48085? -1884621.21915 What is -84977838 - 1825.6? -84979663.6 Calculate -0.28 - 38089959191. -38089959191.28 -48305042.77365 + -0.08 -48305042.85365 Sum -0.0241 and -0.19688723. -0.22098723 What is -438324588805 + 22.5? -438324588782.5 What is -35655 take away 740.29412? -36395.29412 What is 56.608 + 4573.31114? 4629.91914 Add 1217831331 and -2649. 1217828682 -17409836513 - -0.2 -17409836512.8 What is -0.3 take away -0.070170688956? -0.229829311044 -663863 - 1013655 -1677518 Put together 12.1918078286 and 0.07. 12.2618078286 Work out 1417692 - 88821. 1328871 Work out -32.6033 - -23.1648137. -9.4384863 What is 14758 - 3332414? -3317656 What is the distance between -4352.92 and 5692470? 5696822.92 What is 22.43 - 166663142? -166663119.57 Work out 4 + 360456904550. 360456904554 What is the difference between 482279099236 and 1? 482279099235 Sum 149520045 and -2.828. 149520042.172 Add together 2930061241808 and 0. 2930061241808 What is the difference between 720.80172 and 0.361259? 720.440461 Calculate -1702.534 + -1701657. -1703359.534 0.28 - 1132518414192.5 -1132518414192.22 What is -485061 minus 42594? -527655 What is 47 plus -1332065802? -1332065755 10058611 - 310973 9747638 Sum -7765927 and 31090976. 23325049 102+1.099633695 103.099633695 Work out -5644.9511477 + 10. -5634.9511477 Add -18.90601432 and 112992. 112973.09398568 Put together 45630421 and 19055. 45649476 Subtract -2545357002 from 394.1. 2545357396.1 What is 34 plus 42384440274? 42384440308 Add 71867.1524 and 0.11817. 71867.27057 What is 4 less than -452399132841722? -452399132841726 Total of -627.23851 and -529.22. -1156.45851 -5088 - -31449683 31444595 Sum -2.285651 and 11.227. 8.941349 Put together -27.68 and -498055.52. -498083.2 Add together 2500 and 98263219705. 98263222205 Add together -18.6408317024896 and 3. -15.6408317024896 What is the distance between 0.09512654 and 920032? 920031.90487346 Put together 2 and 11.97624236596. 13.97624236596 Subtract 0.0061 from -1605300021. -1605300021.0061 What is the distance between 26704 and 57.5550508? 26646.4449492 37899 + 1360389 1398288 Calculate 0.1 - 20646304578983. -20646304578982.9 Sum 55544 and 965159176. 965214720 Total of -25360 and -151576494. -151601854 0.0767+-63957304 -63957303.9233 What is 16 - 744157939521? -744157939505 What is 110703854481 take away -0.4? 110703854481.4 Add together 0.8 and -0.075063818603. 0.724936181397 What is 75565434 - -10963? 75576397 Add together -33.143996213 and 3. -30.143996213 What is 702.72151174 - 5? 697.72151174 What is 25.97954 minus -79.7743? 105.75384 -4000 + 16701.0465261 12701.0465261 What is -0.35 + -55213483792? -55213483792.35 What is -107295.53980314 - -0.07? -107295.46980314 -0.3+686162940323 686162940322.7 Subtract -867 from -279179690.9. -279178823.9 Sum 62.673553 and -162441. -162378.326447 What is -1.7 take away -3025283328117? 3025283328115.3 What is 21364 - -21911.844? 43275.844 Subtract -10346889 from -17558832. -7211943 Put together 113459375 and -37.75. 113459337.25 Total of 101.9 and -578096190. -578096088.1 1682836.93+-1.713 1682835.217 Put together -52 and 3796299645. 3796299593 What is the difference between -0.3 and -28.568793223865? 28.268793223865 Sum 25611970.5437 and -0.8. 25611969.7437 Total of 13.1 and -435382739. -435382725.9 What is -115.64 less than -40015.6352? -39899.9952 Work out -263328047 - -1677.5. -263326369.5 Calculate 20.814307 + -12534.2. -12513.385693 Work out 10 + 17660005902. 17660005912 What is 0.01420899 minus -549.3977? 549.41190899 Work out 1549 - 12922922900. -12922921351 38403+12169507 12207910 Work out -227357 - 1747.31. -229104.31 45941386114+-420 45941385694 106.804279 - 6.148954 100.655325 What is -0.3 - -36287.1314724? 36286.8314724 -88604 - -75387.395 -13216.605 -17.817547 - 2564.221 -2582.038547 What is 13013047 plus 862? 13013909 Total of -6038.5441801 and -16822. -22860.5441801 Add together 3278495908758 and -0.05. 3278495908757.95 Work out 172097.5014758 + -1. 172096.5014758 What is the difference between -73829668725 and 0.06? 73829668725.06 Put together -0.11 and -47221178946452. -47221178946452.11 Sum 47743541 and -8358.3. 47735182.7 What is the distance between -43048 and -9707.9528? 33340.0472 What is -11.48685 less than -2431.0125? -2419.52565 -83831 - 0.287733141 -83831.287733141 What is 5.30657106 + -0.08308? 5.22349106 What is the distance between 57842889 and -11.6453? 57842900.6453 Calculate -15925316974.61 + -11. -15925316985.61 What is -909216.77 minus -737254? -171962.77 What is 0.04 take away 197417.9431905? -197417.9031905 Subtract 469420.2 from 0.49662946. -469419.70337054 160944 - 143.8296 160800.1704 Total of -7 and 884.964864727. 877.964864727 What is the difference between 5265.604211431 and -0.4? 5266.004211431 What is the distance between 0.41 and -151554133795? 151554133795.41 Work out -24700848000 + -189. -24700848189 Add 9393.0805 and -1451. 7942.0805 What is -20118 - -4.68381838? -20113.31618162 Calculate -276391836959 - -0.23. -276391836958.77 Sum -228.395503 and -5.07. -233.465503 Add together 0.017 and -1939967254.29. -1939967254.273 Put together -5.5 and 3621118482760. 3621118482754.5 Add 39 and 5154648867636. 5154648867675 8555772+1447982 10003754 Add -0.07539931 and 1714.2. 1714.12460069 What is -2 plus -4030.2103232957? -4032.2103232957 Add 0.0094169221 and -0.266879. -0.2574620779 Sum 923726.47976 and 1. 923727.47976 What is -0.032585534 take away 48375? -48375.032585534 What is the difference between 417943949132 and -0.03? 417943949132.03 Total of 1.9 and -0.016917483891. 1.883082516109 Sum 330582.0479 and -1.2269. 330580.821 -3981919 - -3049493 -932426 What is 4.3 plus 52558290214.63? 52558290218.93 What is the distance between 0.5 and 604089732? 604089731.5 Work out -532762399.63 - 0.95. -532762400.58 What is the distance between 0.03 and 64947984590? 64947984589.97 Calculate 265590436 + 160. 265590596 What is -45512.519 minus 2391778? -2437290.519 Work out -79.21184725 + -3.12. -82.33184725 -9358890875967 - -2 -9358890875965 Put together -6.2558242339 and -2.235. -8.4908242339 What is 286513971 plus 36061? 286550032 What is 1 plus 392667702483.03? 392667702484.03 What is 149259251.36 less than 3? -149259248.36 What is -62278.53 take away -42585? -19693.53 Total of 240235507 and 11.59. 240235518.59 -45 + -4876663992 -4876664037 What is -87 minus -257717871192? 257717871105 Calculate -39365 - -4502.198. -34862.802 Put together 224517091 and -57719. 224459372 Add together -868.2 and 1200.6559. 332.4559 What is -779247619 plus -69.24? -779247688.24 Subtract 108.387 from 2082219.8. 2082111.413 Subtract 20.0334870576 from -33. -53.0334870576 Calculate -15822938430 - 14485. -15822952915 Calculate -1.448757 + -898169.1. -898170.548757 Sum -8 and -13499999524859. -13499999524867 22441.849+1831 24272.849 Calculate 2505714428954 + -0.07. 2505714428953.93 What is -1928066919756 + 18? -1928066919738 1387992+-205561 1182431 What is the distance between -5518.6 and 17197663? 17203181.6 Put together 795.81057 and -442.43. 353.38057 Work out 9197692.63888 - -0.3. 9197692.93888 What is 3.8044142602 minus 0.314? 3.4904142602 Work out -0.38450525 - -14.839. 14.45449475 793 + 36754483 36755276 What is -0.189505036 take away -95.781? 95.591494964 Sum 156987053006 and 0.2. 156987053006.2 -3185316 + -2392874 -5578190 Add together -0.039549 and -2968060. -2968060.039549 Calculate -0.20395 + 340.0049. 339.80095 Work out -1250322859.19049 + 1. -1250322858.19049 Subtract -104217921.88 from -23. 104217898.88 Total of 3 and 8505.959685. 8508.959685 What is the distance between 0.01764262 and 59493.13? 59493.11235738 Work out -1.1 - 65341.19903. -65342.29903 What is 2353 minus 4860109370? -4860107017 Total of -0.18 and 22105938741578. 22105938741577.82 What is the distance between 41127491 and -4.9892? 41127495.9892 Subtract 65511867000 from 0.5. -65511866999.5 0.009+-0.1191248664 -0.1101248664 -99.4187002+-0.131 -99.5497002 200435663+38961 200474624 What is 129849250.003 - -84? 129849334.003 Subtract -5 from 9986359573626. 9986359573631 2110887029428 + 0.5 2110887029428.5 Total of -7 and 1031254.13935. 1031247.13935 Work out 4730 + -2179896941. -2179892211 Subtract -2275054502.4 from -0.1. 2275054502.3 What is 4143.57284513 take away 452? 3691.57284513 What is 967639 - 238026? 729613
Calculate the remainder when 114647 is divided by 22684. 1227 What is the remainder when 14925958 is divided by 56? 54 Calculate the remainder when 2694470 is divided by 897865. 875 Calculate the remainder when 30827466 is divided by 371415. 21 Calculate the remainder when 3819020 is divided by 202. 8 Calculate the remainder when 73963774 is divided by 34. 4 Calculate the remainder when 125195 is divided by 1788. 35 Calculate the remainder when 13226493 is divided by 512. 509 Calculate the remainder when 132872 is divided by 3591. 5 Calculate the remainder when 44452724 is divided by 1201424. 36 Calculate the remainder when 3661277 is divided by 14. 11 Calculate the remainder when 651643 is divided by 651331. 312 Calculate the remainder when 1792486 is divided by 477. 397 What is the remainder when 396834 is divided by 99163? 182 What is the remainder when 493931 is divided by 15861? 2240 Calculate the remainder when 47789 is divided by 209. 137 What is the remainder when 134086 is divided by 1658? 1446 Calculate the remainder when 1766896 is divided by 2940. 2896 Calculate the remainder when 226136 is divided by 10766. 50 Calculate the remainder when 1241888 is divided by 874. 808 What is the remainder when 145083813 is divided by 18? 15 Calculate the remainder when 30589 is divided by 30539. 50 What is the remainder when 35321 is divided by 34905? 416 Calculate the remainder when 401697 is divided by 111. 99 Calculate the remainder when 10506 is divided by 4317. 1872 Calculate the remainder when 3614875 is divided by 1375. 0 What is the remainder when 83076 is divided by 11098? 5390 What is the remainder when 109167 is divided by 116? 11 What is the remainder when 2052672 is divided by 966? 888 Calculate the remainder when 3537529 is divided by 18. 7 Calculate the remainder when 11767897 is divided by 41. 36 Calculate the remainder when 31025149 is divided by 3261. 3256 What is the remainder when 289865 is divided by 1169? 1122 Calculate the remainder when 6239249 is divided by 450. 449 What is the remainder when 2014017 is divided by 2915? 2667 What is the remainder when 116907754 is divided by 899? 895 What is the remainder when 9216340 is divided by 641? 42 What is the remainder when 3292257 is divided by 555? 552 What is the remainder when 10296 is divided by 3097? 1005 Calculate the remainder when 2343871 is divided by 12. 7 Calculate the remainder when 139090 is divided by 6950. 90 What is the remainder when 1015948 is divided by 325? 323 Calculate the remainder when 1087021 is divided by 181073. 583 Calculate the remainder when 4342605 is divided by 1546. 1437 Calculate the remainder when 481585 is divided by 80264. 1 Calculate the remainder when 49279 is divided by 1557. 1012 What is the remainder when 7706732 is divided by 1994? 1916 Calculate the remainder when 1346951 is divided by 2287. 2195 Calculate the remainder when 937987 is divided by 374. 369 What is the remainder when 718293 is divided by 179561? 49 Calculate the remainder when 45514 is divided by 4878. 1612 Calculate the remainder when 122052478 is divided by 10. 8 What is the remainder when 259230 is divided by 5513? 119 What is the remainder when 159734 is divided by 944? 198 Calculate the remainder when 1485375 is divided by 5735. 10 What is the remainder when 2712079 is divided by 3486? 3457 What is the remainder when 42748210 is divided by 19? 15 What is the remainder when 19693198 is divided by 94? 10 What is the remainder when 70195009 is divided by 1076? 1073 Calculate the remainder when 347589 is divided by 9448. 7461 Calculate the remainder when 1267960 is divided by 316864. 504 What is the remainder when 23071831 is divided by 4614352? 71 Calculate the remainder when 82034232 is divided by 4861. 4857 Calculate the remainder when 20602742 is divided by 20602733. 9 What is the remainder when 13646262 is divided by 94? 0 Calculate the remainder when 638769 is divided by 835. 829 What is the remainder when 485286 is divided by 97040? 86 What is the remainder when 51577 is divided by 17158? 103 What is the remainder when 53811 is divided by 53504? 307 What is the remainder when 1229490 is divided by 1090? 1060 Calculate the remainder when 1627568 is divided by 1233. 8 What is the remainder when 2849721 is divided by 766? 201 Calculate the remainder when 1009157266 is divided by 28. 26 Calculate the remainder when 436926 is divided by 19. 2 What is the remainder when 2356704 is divided by 862? 858 What is the remainder when 89994 is divided by 171? 48 What is the remainder when 1226200 is divided by 3133? 1197 Calculate the remainder when 70240 is divided by 15092. 9872 Calculate the remainder when 1917044 is divided by 283. 2 What is the remainder when 4417841 is divided by 542? 541 What is the remainder when 1402282 is divided by 116855? 22 Calculate the remainder when 460010 is divided by 57500. 10 Calculate the remainder when 23517 is divided by 1902. 693 Calculate the remainder when 10431858 is divided by 5215915. 28 Calculate the remainder when 782380 is divided by 38. 36 Calculate the remainder when 260394 is divided by 1163. 1045 Calculate the remainder when 22280 is divided by 3147. 251 Calculate the remainder when 847098 is divided by 22890. 168 What is the remainder when 666387 is divided by 74009? 306 Calculate the remainder when 34008 is divided by 6673. 643 Calculate the remainder when 262000 is divided by 716. 660 Calculate the remainder when 943360 is divided by 8576. 0 Calculate the remainder when 73068 is divided by 379. 300 Calculate the remainder when 4240340 is divided by 2592. 2420 Calculate the remainder when 52910001 is divided by 14. 11 Calculate the remainder when 1420159 is divided by 265. 24 Calculate the remainder when 159071 is divided by 409. 379 Calculate the remainder when 9421771 is divided by 724751. 8 What is the remainder when 4892481 is divided by 17227? 13 What is the remainder when 32836 is divided by 1070? 736 What is the remainder when 2600 is divided by 60? 20 What is the remainder when 118430 is divided by 58285? 1860 Calculate the remainder when 340267 is divided by 414. 373 What is the remainder when 696188 is divided by 174037? 40 Calculate the remainder when 6013502 is divided by 124. 122 What is the remainder when 49112126 is divided by 5014? 5010 Calculate the remainder when 1180586 is divided by 5342. 4 Calculate the remainder when 973912213 is divided by 671. 670 Calculate the remainder when 10012972 is divided by 41. 34 What is the remainder when 9853497 is divided by 300? 297 What is the remainder when 22333276 is divided by 1556? 8 Calculate the remainder when 29041504 is divided by 4148785. 9 What is the remainder when 2471571305 is divided by 54? 53 What is the remainder when 33879 is divided by 33110? 769 Calculate the remainder when 894 is divided by 440. 14 Calculate the remainder when 2914887 is divided by 1456400. 2087 What is the remainder when 971285 is divided by 13490? 5 What is the remainder when 2092794 is divided by 31234? 116 What is the remainder when 14512605 is divided by 134? 3 Calculate the remainder when 1085565 is divided by 6132. 201 What is the remainder when 2087119 is divided by 10079? 766 What is the remainder when 1199464 is divided by 2725? 464 Calculate the remainder when 58329157 is divided by 9. 4 Calculate the remainder when 8346979 is divided by 473. 421 What is the remainder when 163810 is divided by 1014? 556 What is the remainder when 113049 is divided by 2456? 73 What is the remainder when 1901247 is divided by 380249? 2 Calculate the remainder when 7874305 is divided by 328. 9 Calculate the remainder when 7969433 is divided by 220. 153 Calculate the remainder when 3988211 is divided by 124. 123 What is the remainder when 1553927 is divided by 34? 25 Calculate the remainder when 252186 is divided by 101. 90 What is the remainder when 17016617 is divided by 5672196? 29 Calculate the remainder when 1879821 is divided by 244. 45 Calculate the remainder when 27777 is divided by 22. 13 What is the remainder when 57527969 is divided by 45? 14 Calculate the remainder when 1270035 is divided by 1270002. 33 Calculate the remainder when 548288 is divided by 548144. 144 Calculate the remainder when 320710 is divided by 320636. 74 Calculate the remainder when 2397344 is divided by 14102. 4 What is the remainder when 10737512 is divided by 2213? 36 Calculate the remainder when 17521978 is divided by 873. 868 What is the remainder when 51636409 is divided by 27? 16
Four letters picked without replacement from ugubyhy. Give prob of picking 1 g, 1 y, and 2 u. 2/35 What is prob of picking 1 y, 1 k, and 1 a when three letters picked without replacement from kayeyklkkkakeleeaykl? 21/380 Calculate prob of picking 1 n and 3 d when four letters picked without replacement from {h: 3, n: 2, e: 2, g: 6, d: 6}. 10/969 Calculate prob of picking 1 c and 1 d when two letters picked without replacement from dec. 1/3 Calculate prob of picking 2 w when two letters picked without replacement from www. 1 Four letters picked without replacement from {e: 3, n: 3, l: 6, y: 1}. Give prob of picking 2 l and 2 e. 9/143 Calculate prob of picking 1 h and 1 s when two letters picked without replacement from {s: 1, h: 1, r: 9}. 1/55 Two letters picked without replacement from {v: 2, t: 1, s: 1, n: 4}. What is prob of picking 2 n? 3/14 What is prob of picking 2 w, 1 j, and 1 k when four letters picked without replacement from wljwstk? 1/35 What is prob of picking 3 n when three letters picked without replacement from {n: 10}? 1 Four letters picked without replacement from xxexxec. Give prob of picking 1 e and 3 x. 8/35 Four letters picked without replacement from wwbwlwdwwlwwwbllbww. What is prob of picking 3 w and 1 b? 165/1292 Two letters picked without replacement from {q: 6, e: 12}. What is prob of picking 2 e? 22/51 What is prob of picking 2 u when two letters picked without replacement from {r: 5, q: 5, h: 2, u: 7}? 7/57 Two letters picked without replacement from {z: 1, x: 7}. What is prob of picking 1 x and 1 z? 1/4 Two letters picked without replacement from qqyyymvqmyywl. What is prob of picking 1 w and 1 v? 1/78 Two letters picked without replacement from {b: 1, z: 1, d: 1, y: 1, h: 1}. What is prob of picking 1 b and 1 d? 1/10 Two letters picked without replacement from uuuuzuzz. Give prob of picking 2 z. 3/28 Calculate prob of picking 2 e when two letters picked without replacement from {a: 1, y: 1, p: 3, e: 2}. 1/21 What is prob of picking 2 e when two letters picked without replacement from {e: 2, u: 1, n: 1}? 1/6 Four letters picked without replacement from {u: 10, k: 4, q: 2}. Give prob of picking 4 k. 1/1820 Four letters picked without replacement from {r: 3, y: 5}. What is prob of picking 2 y and 2 r? 3/7 What is prob of picking 2 q when two letters picked without replacement from qqeeqeqx? 3/14 Calculate prob of picking 1 c and 1 p when two letters picked without replacement from {p: 2, c: 6}. 3/7 Four letters picked without replacement from {u: 8, d: 2}. Give prob of picking 2 d and 2 u. 2/15 Two letters picked without replacement from {x: 3, i: 9, t: 4, u: 2}. What is prob of picking 2 x? 1/51 Calculate prob of picking 1 e and 3 s when four letters picked without replacement from {s: 4, d: 1, f: 3, e: 2}. 4/105 Two letters picked without replacement from wwigbwcwc. What is prob of picking 1 i and 1 c? 1/18 Two letters picked without replacement from {d: 3, s: 1, m: 1}. Give prob of picking 1 m and 1 s. 1/10 What is prob of picking 1 k and 1 p when two letters picked without replacement from pkm? 1/3 Three letters picked without replacement from {y: 1, k: 2, s: 1, x: 1}. What is prob of picking 1 k, 1 s, and 1 x? 1/5 Two letters picked without replacement from hzmqlmmmhzggmzzmgzmm. What is prob of picking 1 l and 1 g? 3/190 What is prob of picking 1 h and 1 k when two letters picked without replacement from kxhhxkaa? 1/7 Two letters picked without replacement from {y: 4, q: 5, g: 2, v: 8}. Give prob of picking 1 q and 1 y. 20/171 Three letters picked without replacement from owooojoooowww. Give prob of picking 3 w. 2/143 Two letters picked without replacement from ojjoiddijjjiijoijij. What is prob of picking 2 i? 5/57 Three letters picked without replacement from {v: 2, k: 1, i: 5, d: 7, a: 1, p: 4}. What is prob of picking 1 k and 2 i? 1/114 Four letters picked without replacement from {g: 4, k: 3, s: 2, h: 9, z: 1}. Give prob of picking 2 h and 2 k. 9/323 Two letters picked without replacement from {a: 2, f: 1, j: 1, i: 2, m: 1}. Give prob of picking 1 f and 1 a. 2/21 Two letters picked without replacement from {x: 1, n: 2}. Give prob of picking 2 n. 1/3 Two letters picked without replacement from zzfzzcpzpppyr. What is prob of picking 2 p? 1/13 Four letters picked without replacement from {x: 2, a: 1, e: 4, v: 1, f: 4, k: 7}. Give prob of picking 2 e, 1 k, and 1 a. 7/646 Calculate prob of picking 1 o and 1 c when two letters picked without replacement from soiimcmisiisiiosis. 2/153 What is prob of picking 3 b when three letters picked without replacement from bbiibbb? 2/7 Calculate prob of picking 2 h and 1 n when three letters picked without replacement from hhyybrn. 1/35 What is prob of picking 1 x and 1 j when two letters picked without replacement from lojltlolloljlxxololl? 2/95 What is prob of picking 2 i and 1 r when three letters picked without replacement from {z: 3, p: 1, r: 3, i: 2, b: 2, e: 4}? 3/455 Calculate prob of picking 2 e when two letters picked without replacement from vvvvvvvvee. 1/45 Four letters picked without replacement from tttstssssss. What is prob of picking 4 t? 1/330 What is prob of picking 1 e and 1 k when two letters picked without replacement from {l: 1, b: 4, e: 1, m: 1, k: 4}? 4/55 Calculate prob of picking 1 j, 1 t, 1 p, and 1 u when four letters picked without replacement from jpttutidtituu. 3/143 Three letters picked without replacement from {e: 5, i: 13}. Give prob of picking 3 e. 5/408 What is prob of picking 1 u and 3 a when four letters picked without replacement from aaaaaaaaauaaaaaaaaaa? 1/5 What is prob of picking 1 r and 2 l when three letters picked without replacement from {l: 8, r: 2}? 7/15 Two letters picked without replacement from jhhcjjchccjhjhjhjjhh. What is prob of picking 2 c? 3/95 Four letters picked without replacement from {o: 8, l: 4, a: 1, j: 2}. What is prob of picking 1 j, 1 a, 1 o, and 1 l? 64/1365 What is prob of picking 1 j and 1 d when two letters picked without replacement from {j: 1, d: 3}? 1/2 Two letters picked without replacement from bbiovlk. What is prob of picking 1 k and 1 l? 1/21 What is prob of picking 1 m and 2 k when three letters picked without replacement from kkqqsipqiiimi? 1/286 Calculate prob of picking 1 n and 3 u when four letters picked without replacement from {u: 10, n: 10}. 80/323 Two letters picked without replacement from mvzcplz. Give prob of picking 1 z and 1 m. 2/21 What is prob of picking 3 y when three letters picked without replacement from yyywsyyysswwwwys? 1/16 Two letters picked without replacement from hhh. What is prob of picking 2 h? 1 What is prob of picking 1 y and 3 b when four letters picked without replacement from vvbyvbybvv? 1/105 Calculate prob of picking 2 y when two letters picked without replacement from {y: 3, f: 7}. 1/15 Four letters picked without replacement from {z: 1, c: 1, x: 4, t: 4, b: 7}. Give prob of picking 1 b, 1 z, and 2 t. 3/170 What is prob of picking 1 r, 1 t, and 2 o when four letters picked without replacement from {o: 2, t: 7, r: 2, l: 8}? 7/1938 Two letters picked without replacement from ttjijsam. What is prob of picking 1 t and 1 s? 1/14 Three letters picked without replacement from {j: 2, s: 2, m: 2, w: 2, l: 1, p: 3}. What is prob of picking 1 s, 1 p, and 1 m? 3/55 Four letters picked without replacement from sgasggsagasgasabgsa. What is prob of picking 1 g, 2 a, and 1 b? 15/646 Calculate prob of picking 1 t, 1 d, and 1 l when three letters picked without replacement from otllcoooltczddtttolc. 2/57 Calculate prob of picking 1 z, 1 l, and 2 j when four letters picked without replacement from lluzjljzllzjjjluuzu. 20/323 Calculate prob of picking 1 f and 1 h when two letters picked without replacement from ghhyzfy. 2/21 Three letters picked without replacement from {f: 1, q: 4, d: 4, k: 3, p: 7}. What is prob of picking 1 p, 1 k, and 1 q? 28/323 Three letters picked without replacement from govgogvgpgooggogggg. Give prob of picking 1 o and 2 v. 5/969 Calculate prob of picking 1 x and 1 y when two letters picked without replacement from {m: 1, h: 1, q: 1, x: 2, y: 11}. 11/60 What is prob of picking 2 s, 1 a, and 1 e when four letters picked without replacement from usyaaarsareu? 4/495 Two letters picked without replacement from ruuuuuuuurr. Give prob of picking 2 u. 28/55 Four letters picked without replacement from ljljjjljjlj. Give prob of picking 2 l and 2 j. 21/55
What is 171159 to the power of 1/2, to the nearest integer? 414 What is 2210073 to the power of 1/4, to the nearest integer? 39 What is the cube root of 2965501 to the nearest integer? 144 What is the cube root of 30413208 to the nearest integer? 312 What is the cube root of 345257 to the nearest integer? 70 What is 336289 to the power of 1/8, to the nearest integer? 5 What is 506596 to the power of 1/2, to the nearest integer? 712 What is the square root of 3210501 to the nearest integer? 1792 What is the cube root of 3383864 to the nearest integer? 150 What is the square root of 2564600 to the nearest integer? 1601 What is the cube root of 2304261 to the nearest integer? 132 What is the square root of 18194374 to the nearest integer? 4265 What is the ninth root of 11989962 to the nearest integer? 6 What is 244894 to the power of 1/2, to the nearest integer? 495 What is the fourth root of 6242569 to the nearest integer? 50 What is 12978226 to the power of 1/4, to the nearest integer? 60 What is 35078408 to the power of 1/3, to the nearest integer? 327 What is the square root of 7782589 to the nearest integer? 2790 What is the square root of 295925 to the nearest integer? 544 What is the third root of 471866 to the nearest integer? 78 What is the third root of 425493 to the nearest integer? 75 What is the fourth root of 186597 to the nearest integer? 21 What is the sixth root of 232291 to the nearest integer? 8 What is the cube root of 1839420 to the nearest integer? 123 What is the square root of 329169 to the nearest integer? 574 What is 272400 to the power of 1/3, to the nearest integer? 65 What is 8213868 to the power of 1/3, to the nearest integer? 202 What is the cube root of 27233016 to the nearest integer? 301 What is the cube root of 118791 to the nearest integer? 49 What is the cube root of 4169794 to the nearest integer? 161 What is 358459 to the power of 1/5, to the nearest integer? 13 What is the third root of 401073 to the nearest integer? 74 What is 4176252 to the power of 1/3, to the nearest integer? 161 What is the ninth root of 1220538 to the nearest integer? 5 What is 16478700 to the power of 1/3, to the nearest integer? 254 What is 15509842 to the power of 1/2, to the nearest integer? 3938 What is 17015 to the power of 1/2, to the nearest integer? 130 What is the fifth root of 1708644 to the nearest integer? 18 What is 955201 to the power of 1/4, to the nearest integer? 31 What is 17073 to the power of 1/2, to the nearest integer? 131 What is the third root of 75224 to the nearest integer? 42 What is the fifth root of 332146 to the nearest integer? 13 What is the seventh root of 1414123 to the nearest integer? 8 What is 1405154 to the power of 1/7, to the nearest integer? 8 What is the cube root of 1433900 to the nearest integer? 113 What is 59240 to the power of 1/5, to the nearest integer? 9 What is 3930325 to the power of 1/2, to the nearest integer? 1983 What is the square root of 2374301 to the nearest integer? 1541 What is the third root of 153240 to the nearest integer? 54 What is the third root of 456552 to the nearest integer? 77 What is the tenth root of 12499988 to the nearest integer? 5 What is the square root of 15581634 to the nearest integer? 3947 What is 624202 to the power of 1/3, to the nearest integer? 85 What is 830368 to the power of 1/5, to the nearest integer? 15 What is the fifth root of 364466 to the nearest integer? 13 What is 1039289 to the power of 1/3, to the nearest integer? 101 What is the third root of 278679 to the nearest integer? 65 What is the ninth root of 670276 to the nearest integer? 4 What is the square root of 382726 to the nearest integer? 619 What is the third root of 5326458 to the nearest integer? 175 What is 12322688 to the power of 1/10, to the nearest integer? 5 What is 1228276 to the power of 1/2, to the nearest integer? 1108 What is 1451992 to the power of 1/5, to the nearest integer? 17 What is 11403236 to the power of 1/2, to the nearest integer? 3377 What is 4207 to the power of 1/7, to the nearest integer? 3 What is 448571 to the power of 1/4, to the nearest integer? 26 What is the fifth root of 5771900 to the nearest integer? 23 What is the sixth root of 8978630 to the nearest integer? 14 What is 503949 to the power of 1/3, to the nearest integer? 80 What is 948986 to the power of 1/2, to the nearest integer? 974 What is the eighth root of 134893 to the nearest integer? 4 What is the third root of 8288525 to the nearest integer? 202 What is 17038839 to the power of 1/8, to the nearest integer? 8 What is 2259895 to the power of 1/3, to the nearest integer? 131 What is the fifth root of 4545933 to the nearest integer? 21 What is 15740924 to the power of 1/5, to the nearest integer? 28 What is the tenth root of 1058672 to the nearest integer? 4 What is 1389901 to the power of 1/6, to the nearest integer? 11 What is the square root of 794745 to the nearest integer? 891 What is the third root of 7342142 to the nearest integer? 194 What is 176039 to the power of 1/3, to the nearest integer? 56 What is the third root of 8458004 to the nearest integer? 204 What is the square root of 369692 to the nearest integer? 608 What is 263013 to the power of 1/4, to the nearest integer? 23 What is the eighth root of 823018 to the nearest integer? 5 What is 230441 to the power of 1/10, to the nearest integer? 3 What is the fourth root of 151277 to the nearest integer? 20 What is the third root of 15005708 to the nearest integer? 247 What is the ninth root of 441419 to the nearest integer? 4 What is 71557 to the power of 1/10, to the nearest integer? 3 What is the third root of 186966 to the nearest integer? 57 What is 2289981 to the power of 1/3, to the nearest integer? 132 What is 571758 to the power of 1/4, to the nearest integer? 27 What is 7644381 to the power of 1/6, to the nearest integer? 14 What is 722821 to the power of 1/2, to the nearest integer? 850 What is 667969 to the power of 1/2, to the nearest integer? 817 What is the square root of 9419481 to the nearest integer? 3069 What is the cube root of 255172 to the nearest integer? 63 What is 30570602 to the power of 1/2, to the nearest integer? 5529 What is 22335809 to the power of 1/2, to the nearest integer? 4726 What is 115912 to the power of 1/10, to the nearest integer? 3 What is the third root of 18382559 to the nearest integer? 264 What is 151057 to the power of 1/10, to the nearest integer? 3 What is 80003 to the power of 1/9, to the nearest integer? 4 What is the fourth root of 1419419 to the nearest integer? 35 What is the cube root of 2896284 to the nearest integer? 143 What is 543350 to the power of 1/2, to the nearest integer? 737 What is the seventh root of 1981895 to the nearest integer? 8 What is 2865421 to the power of 1/2, to the nearest integer? 1693 What is the square root of 922747 to the nearest integer? 961 What is the square root of 25982346 to the nearest integer? 5097 What is 305415 to the power of 1/2, to the nearest integer? 553 What is the tenth root of 870946 to the nearest integer? 4 What is 2871324 to the power of 1/2, to the nearest integer? 1694 What is the square root of 273067 to the nearest integer? 523 What is the cube root of 3863394 to the nearest integer? 157 What is 1519554 to the power of 1/8, to the nearest integer? 6 What is 56854 to the power of 1/2, to the nearest integer? 238 What is 141048 to the power of 1/2, to the nearest integer? 376 What is the square root of 1689434 to the nearest integer? 1300 What is 20560933 to the power of 1/2, to the nearest integer? 4534 What is the third root of 509117 to the nearest integer? 80 What is the sixth root of 974777 to the nearest integer? 10 What is the square root of 11097710 to the nearest integer? 3331 What is 9431886 to the power of 1/2, to the nearest integer? 3071 What is 2873548 to the power of 1/7, to the nearest integer? 8 What is the square root of 573669 to the nearest integer? 757 What is the seventh root of 137869 to the nearest integer? 5 What is the square root of 5021955 to the nearest integer? 2241 What is 325208 to the power of 1/2, to the nearest integer? 570 What is the third root of 32211 to the nearest integer? 32 What is the cube root of 614590 to the nearest integer? 85 What is the cube root of 488422 to the nearest integer? 79 What is 3744028 to the power of 1/3, to the nearest integer? 155 What is 1300274 to the power of 1/9, to the nearest integer? 5 What is the square root of 1103344 to the nearest integer? 1050
Find the third derivative of 5419d4 + 13376d*2. 130056d Find the second derivative of -114t4 - 105t. -1368t2 What is the third derivative of -3230h4 + h2 + 286h - 1 wrt h? -77520h What is the second derivative of 45a3 - 2a - 325 wrt a? 270a Find the second derivative of -178c*3 - 700c. -1068c What is the first derivative of -2187d + 432? -2187 What is the third derivative of jo2u*3 - 25ju3 - 2ju2 - 3ju + 11o*3u*3 - 120o*3 wrt u? 6jo2 - 150j + 66o3 What is the third derivative of -3hny + 7hy*3 - hy*2 - 9h - 86ny*3 - 2y*3 - 10y*2 wrt y? 42h - 516n - 12 Find the second derivative of -5bt2 - 2btv - bt - 107bv - b + 4t*2v - 3tv wrt t. -10b + 8v Find the second derivative of -222n3 + 205n wrt n. -1332n What is the third derivative of 8310v*3 - 449v*2 - 2v - 1? 49860 What is the third derivative of -3o6 - 1282o*5 - 609o*2 + 2o + 2 wrt o? -360o3 - 76920o*2 Differentiate 3s*4 + 12s*2 - 525 wrt s. 12s*3 + 24s What is the third derivative of 513j3r5 - j3r + 150jr2 wrt r? 30780j*3r*2 Find the third derivative of -5002b*3 - 11b*2 + 78b wrt b. -30012 What is the second derivative of 43m4 + m3 + 206m - 5? 516m2 + 6m Differentiate -q*2rz2 - 100q*2r + 3q2z*2 - 228q*2z + 3q2 with respect to r. -q2z*2 - 100q*2 What is the derivative of 858y*3 + 209? 2574y*2 Find the third derivative of 44c*4 - 7c*3 - 129c*2 - 2c wrt c. 1056c - 42 Find the first derivative of -206z*2 - 161 wrt z. -412z What is the derivative of -2v3 - 36v + 141 wrt v? -6v2 - 36 What is the second derivative of 6919s*4 - 2s - 7668 wrt s? 83028s2 Find the first derivative of -4682il + i + 783l + 12 wrt i. -4682l + 1 Find the second derivative of 2j*5l + 39j4l - jl - 27j - 2 wrt j. 40j3l + 468j2l Differentiate -241j2u*3 - 272j*2 - 3ju3 with respect to u. -723j*2u*2 - 9ju2 Find the second derivative of -389q*5 + 902q + 13. -7780q3 Find the first derivative of 2o*3 + 5o*2 - 49o + 6869 wrt o. 6o2 + 10o - 49 Find the first derivative of -40z2 - 3z + 1801 wrt z. -80z - 3 Find the second derivative of -2a*3o*3w - 11a3ow - 3a*3w + 3a2 - 32ao3w + 2aow + o2w wrt o. -12a3ow - 192aow + 2w Find the second derivative of -4787k*4 + 4191k wrt k. -57444k2 What is the derivative of -2g*3z*2 + 6g*2z*3 - 9g - z*3 + 563 wrt g? -6g*2z*2 + 12gz3 - 9 Differentiate 1570pt2 + 3147t*2 wrt p. 1570t2 What is the third derivative of m3q6 + 8m*3q*3 - 2m*3q - 44m2q*2 wrt q? 120m*3q*3 + 48m*3 Differentiate -81r*3v*2 + 3r*2v*3 + 1215v*3 with respect to r. -243r*2v*2 + 6rv3 Find the second derivative of 30d*3 + 2d*2 - 13d - 11 wrt d. 180d + 4 What is the second derivative of -5016d*2 + 2116d? -10032 Find the first derivative of 68hm*3 - 2hm2 + 35hm + 9824m*3 wrt h. 68m*3 - 2m*2 + 35m Differentiate 5845s2 + 358 wrt s. 11690s What is the derivative of 782l3o*2 - 2l*3o + l*3 - 23l*2 wrt o? 1564l*3o - 2l3 Find the second derivative of 2l3 + l2 + 104l wrt l. 12l + 2 What is the second derivative of -2c4r - 86c3nr - 3c*2n + 2cnr + c + 270n - 2r wrt c? -24c*2r - 516cnr - 6n Find the third derivative of -3fl*3 + 2fl2z*3 - 4flz*3 + 2fz2 - 14f + 73l3z*3 wrt l. -18f + 438z3 Find the second derivative of 1150dm3 + 2dm2 - dm - 11d - 22m wrt m. 6900dm + 4d Find the second derivative of 7cn2z*2 - 2cn2z + 3cn*2 + 7cnz*2 - 2cz + 2n*2z*2 + 55n*2z wrt z. 14cn*2 + 14cn + 4n*2 Find the first derivative of 96r*3 + 3r*2 - 4r + 2866. 288r2 + 6r - 4 What is the second derivative of -9l4 - 20l*2 - 18l + 17? -108l2 - 40 What is the derivative of -z3 + 823z*2 + 3993? -3z*2 + 1646z Find the second derivative of g*3j*2 - 2g*3jp + 2g*3p + 4g2j*2p - 67g2p - 2j2p - 68j2 + j + 2p wrt j. 2g3 + 8g*2p - 4p - 136 What is the second derivative of 33t*3x*2z + 475t3xz2 - 9t*3z - 2t2x*2z + 2tx*3 - 2x*3z*2 wrt z? 950t*3x - 4x3 Find the third derivative of 419n*3 + 112n*2 - 3. 2514 Find the third derivative of -985x*3 - 1161x*2. -5910 What is the second derivative of -225h*3r*3 + 2h*3r*2 + 84hr - 2r*3 wrt h? -1350hr3 + 12hr2 Differentiate -47i*2q + 1398i2 - 6q with respect to q. -47i2 - 6 What is the third derivative of 518b*3 + 550b*2? 3108 What is the first derivative of -23b*2u3 - b2 - 18bku - ku*3 - 1108u*3 wrt b? -46bu3 - 2b - 18ku What is the derivative of -2c3f - 3c3 + 222c*2f - 10c2 wrt f? -2c*3 + 222c*2 Differentiate 655l*3 + 1138 with respect to l. 1965l*2 What is the second derivative of 2825a*2h*2 + 23a*2 + h - 2 wrt h? 5650a*2 What is the second derivative of -122kt4 - 17kt3 + 30kt + 8k + 2t - 1 wrt t? -1464kt2 - 102kt What is the first derivative of 9653a*2f*2 + 3174a*2 + 1 wrt f? 19306a*2f What is the second derivative of 2831y5 + 2339y? 56620y3 What is the derivative of 3pz - 435p - z + 1607 wrt p? 3z - 435 Differentiate -825n + 537 wrt n. -825 Find the second derivative of -518k3 + k + 48 wrt k. -3108k Find the third derivative of 2f3h*3 - 40f*3 - 17f*2 + 28fh3 wrt f. 12h*3 - 240 What is the first derivative of 6l*3q*3 + 44l*3 - 5300q*3 wrt l? 18l*2q*3 + 132l*2 Differentiate 429y - 1000 wrt y. 429 Differentiate -15gl*2w*2 + 84gl2 + 2glw + 7gl + 7w3 with respect to w. -30gl2w + 2gl + 21w2 What is the second derivative of 4qt3 - 5qt2 - 6qt - 15q - 3t3 wrt t? 24qt - 10q - 18t Differentiate 254t - 112 wrt t. 254 Find the second derivative of -10777x2 + 4956x. -21554 Find the second derivative of -562j3r*2 + 22j*3r - j*3 - 2jr wrt r. -1124j*3 Find the third derivative of 148fq3v*3 - fq*3 - 90fq2v*2 + 7fq2v - fqv*3 - 10q*3v*3 wrt q. 888fv3 - 6f - 60v3 Differentiate -1515n*2 + 1399 wrt n. -3030n What is the derivative of -51f3ly3 - 7fly*2 + ly*3 + ly + 51y3 wrt f? -153f*2ly3 - 7ly2 What is the second derivative of 159l*3 + 95l? 954l What is the second derivative of 34m*3 - 17m*2 + 15m + 112 wrt m? 204m - 34 What is the second derivative of -673c*2n*2 + 3cn2 - 7c + 7 wrt c? -1346n2 Find the third derivative of 866p*5 - 1329p*2. 51960p*2 Find the third derivative of dj*3o*2 + 4dj3o - 2dj*2o*3 + 2dj2 - 2djo - 5j3o*3 + 7o*3 + 3o*2 wrt o. -12dj2 - 30j*3 + 42 What is the third derivative of 1308r*3 - 3521r*2 wrt r? 7848 Find the third derivative of 136z*3 - 158z*2 wrt z. 816 What is the second derivative of -127bh4 + 41bh2 + 4bh - 15b + 23h wrt h? -1524bh2 + 82b Find the second derivative of 8a4 + 20a*3 + 877a. 96a2 + 120a Find the third derivative of 1108t3 - t2 - 706t - 1. 6648 What is the second derivative of 86b4 + 117b wrt b? 1032b2 What is the derivative of 6j*2r - 15j2 - 17jr + 12j - r + 5 wrt r? 6j2 - 17j - 1 What is the third derivative of -2c6d + 2590c4d*2 - 987c*2d*2 - 2c*2d - c*2 wrt c? -240c*3d + 62160cd*2 What is the first derivative of -gp*3t + 72gp*3 + 5gp2t - 32gt*2 wrt t? -gp*3 + 5gp2 - 64gt Find the first derivative of -411p*4 - 2p + 223 wrt p. -1644p3 - 2 Find the first derivative of 19m*3s + 8152m3 - 3m*2s + 21s wrt s. 19m*3 - 3m*2 + 21 What is the third derivative of 4901c*3 + 2c*2 + 9c + 45 wrt c? 29406 What is the first derivative of h*4x + 118h3x + 21x - 4 wrt h? 4h*3x + 354h2x What is the second derivative of -3u4 - 16u*3 + 110u + 1? -36u2 - 96u What is the second derivative of -2cx*4 - 2cx2 + cx + 85c - 56x*4 wrt x? -24cx2 - 4c - 672x2 Find the third derivative of -4q*6 - 2q*4 - 1036q*3 + 4147q*2 + 2q. -480q3 - 48q - 6216 Differentiate 2bgq - 2bg + 3bqr*3 - b + 3gqr - 3gr*3 + 6r*3 wrt q. 2bg + 3br3 + 3gr Differentiate -lr*2 - 2ly3z + 4l - 8r*2z - 13r2 - ry*3 - 10y*3z with respect to z. -2ly*3 - 8r*2 - 10y**3
Let c(x) = -x*2 - 1. Let t(h) = 32h*2 - 5. What is -30c(u) + 6t(u)? 222u2 Let h(y) = y2 - 6y. Let o(n) = -n3 + 33n*2 - n + 31. Let t be o(33). Let r(a) = -a. Give th(c) + 10r(c). -2c*2 + 2c Let o(i) = 21i2 + 68i - 3. Let a(b) = -25b2 - 69b + 4. Calculate -5a(z) - 6o(z). -z*2 - 63z - 2 Let b(y) be the third derivative of 0 + 0y + 1/12y*4 + 7y*2 + 2/3y*3. Let c(q) = 4q + 9. Determine -5b(o) + 2c(o). -2o - 2 Let o = -2 + 9. Let z(f) = 2f + 2f - f + 6 - of*2 - 4f. Let u(r) be the second derivative of -5r4/3 - r3/2 + 17r*2/2 - 2r. Give 6u(n) - 17z(n). -n*2 - n Let b(s) = 4s*3 + 7s. Let f(k) = -2k3 - 4k. Let z = -3 - 1. Let q(l) = -l*3 + 2l*2 + 2. Let p be q(3). Give pf(t) + zb(t). -2t3 Let i(m) = -m2 - 13m + 1. Let k(f) = 3f*2 + 72f + 2. Let r(b) = -5i(b) - k(b). Let j(c) = c2 - 4c - 4. Calculate -7j(l) + 4r(l). l*2 Let k(l) = 5l - 14. Let q(d) = -3d + 9. Let a(j) = j3 + 2j*2 + j + 4. Let o = 3 - 6. Let g be a(o). Let w = 55 - 60. Determine gq(p) + wk(p). -p - 2 Let s(o) = -o3 - 2o*2 + 8o - 2. Let i(b) = -3b3 - 6b*2 + 24b - 7. What is 2i(a) - 7s(a)? a*3 + 2a*2 - 8a Let y(l) be the first derivative of -209l2/2 - 77l + 340. Let r(b) = 8b + 3. Give -77r(j) - 3y(j). 11j Let k(n) = 4n3 + 2n*2 + 4n - 4. Let p be (-2)/(-7) + (-160)/(-224). Let o(f) = f*2 + f - 1. Calculate pk(j) - 4o(j). 4j*3 - 2j2 Let q(n) = n3 + 2n + 6 + 4n + 0n - 6n*2 + 3n3. Let z(v) = -v. Let i(m) = -m3 + m*2 - 4m - 1. Let o(t) = -i(t) + 3z(t). What is -6o(p) + q(p)? -2p3 Let x(j) = -2j - 2. Let h(w) = -3 - 3 + 6 - 5 + 4. Determine 2h(i) + x(i). -2i - 4 Let n(p) = -6p3 - 5p2 + p + 5. Let d(u) = u3 + u*2 - 4u. Let b(l) = 11l3 + 10l*2 - 24l - 4. Let q(t) = b(t) - 6d(t). Give -4n(k) - 5q(k). -k3 - 4k Let h(d) be the third derivative of d*4/3 - 19d*3/6 - 17d*2. Let f(c) = 9c - 21. Let k(n) = 5f(n) - 6h(n). Let g(p) = -p + 4. Determine 5g(l) - 2k(l). l + 2 Let j(z) = z. Let s(h) = -3h - 5. Let w(x) = 25x + 43. Let d(f) = 51s(f) + 6w(f). Suppose 4r = 8, 11 = 3c - 4r + 2r. Give cj(b) + d(b). 2b + 3 Let p(v) = -v + 8. Let m(x) = -2x. What is -2m(c) + p(c)? 3c + 8 Let d(q) = 2q*3 - 8q - 5. Let k be d(0). Let c(p) = -11p3 - 3p*2 - 5p - 5. Let b(f) = -12f3 - 4f*2 - 6f - 6. Determine kb(s) + 6c(s). -6s3 + 2s*2 Let h(z) = 5z + 5. Suppose 0 = p + 7 - 3, 3u + p + 19 = 0. Let q(a) = -4a - 4. Calculate uh(x) - 6q(x). -x - 1 Let s = -1297 - -1296. Let f(i) = 9i2 - 2i + 6. Let a(n) = n*2 - n + 1. Calculate sf(b) + 4a(b). -5b*2 - 2b - 2 Let s(r) = 5r2 - 72. Let k(p) = p2 + p + 3. Calculate 2k(y) - s(y). -3y2 + 2y + 78 Let i be ((-2)/5)/((-1)/(-15)). Let v(o) = -8o - 4. Let z(t) be the third derivative of 7t4/24 + t3/2 - 2t2 + 65. What is iz(k) - 5v(k)? -2k + 2 Let j(v) = 28v + 406. Let d(z) = -45z - 610. Give 5d(a) + 8j(a). -a + 198 Let b(h) = -43h - 11. Let g(c) = 13c + 4. Determine -4b(z) - 14g(z). -10z - 12 Let n(q) = -q2. Let r(m) = -m + 1. Suppose 3v + 2 = 5v. Suppose 26p + 6 = 23p. Determine pn(g) + vr(g). 2g*2 - g + 1 Let f(s) = -4s*2 - 7s - 9. Let v(a) = -a2 + a + 2. Let y(m) = -m2 - m - 1. Let b(u) = -v(u) + 3y(u). What is -11b(r) + 6f(r)? -2r*2 + 2r + 1 Let x(c) = -2c3 + c - 1. Let n(z) = -z2 - 1. Let g(i) = -2i*3 - 3i*2 + i - 4. Let q(d) = -g(d) + 3n(d). Suppose -7m = -48 + 13. Give mx(v) + 6q(v). 2v*3 - v + 1 Let o(r) be the first derivative of 13r*4/4 + 41r*3/3 - 9r*2/2 - 9r + 62. Let j(p) = 3p3 + 10p*2 - 2p - 2. Calculate 9j(m) - 2o(m). m*3 + 8m2 Let l(f) be the third derivative of -f6/40 - f*5/15 - 5f*4/24 + 7f*3/6 + 79f*2. Let i(a) = -2a*3 - 3a*2 - 4a + 6. What is -4i(v) + 3l(v)? -v*3 + v - 3 Let f(y) = 11y*3 - 6y*2 + 6y + 6. Let z(d) = -d3 + d2 - d - 1. Let x(u) = u*3 + 2u*2 - 4u - 6. Let r be x(0). Determine rz(n) - f(n). -5n*3 Let y(b) = -5b + 13. Let q(s) = 4s - 12. Suppose 3p + 26j - 25j - 12 = 0, j = -5p + 18. What is pq(h) + 2y(h)? 2h - 10 Let c(w) = -7w2 - 5w. Let i(n) = 9n2 - 2n. Let h be i(-2). Suppose 0q - 5q = h. Let y = 3 + q. Let a(v) = 6v2 + 4v. Calculate ya(b) - 4c(b). -2b2 Let u(l) = 1. Let g(t) be the first derivative of 7t*2/2 - 6t + 102. Calculate -g(w) - 6u(w). -7w Let w(s) = 3s2 + 2s - 20. Let k(z) = z - 2. Calculate 3k(y) - w(y). -3y*2 + y + 14 Let x = -174 - -183. Let c(r) = -6r - 4 + 3 + 3 - 3r3. Let b(i) = 6i*3 + 13i - 4. Determine xc(n) + 4b(n). -3n3 - 2n + 2 Let x(u) = -4u2 - 5. Let v(s) = 5s3 - s2 + s + 2. Let d be v(-1). Let m(n) = -9n2 - 9. What is dm(b) + 9x(b)? 9b2 Let t(w) = w3 + 1. Let s(y) = -y3 + y2 - 3y + 3. Let f be s(2). Let p be 99/77 - (-2)/f. Let j(d) = 0 - 6 - 2d + 0 - 7d3. Give pj(z) + 6t(z). -z3 - 2z Let p(a) = 14a3 - a2 + 4a - 4. Let m(k) = -26k3 + k2 - 8k + 8. What is -6m(s) - 11p(s)? 2s3 + 5s*2 + 4s - 4 Let y(j) = -968j - 2. Let i(d) = 3038553d + 6279. Determine 2i(r) + 6279y(r). -966r Let q(l) = -l + 1. Let n(o) = -6o - 70. Calculate -n(p) + 5q(p). p + 75 Let m(j) be the second derivative of j3/6 + j2/2 - 4j. Let b(a) = 16a + 35. Let t(s) = -24s - 50. Let l(p) = 7b(p) + 5t(p). Give -l(f) - 5m(f). 3f Let f(z) = -10z3 + 4z*2 - 4z + 4. Let g(q) = -81q3 + 33q*2 - 33q + 33. Let u = -2452 + 2448. What is ug(t) + 33f(t)? -6t3 Let b(c) = -9c + 5. Let o(n) = 1. Let q(u) = -b(u) - 3o(u). Let a(r) = -8r + 7. Give -7a(d) - 6q(d). 2d - 1 Let g(p) = 3 - 3p3 - p3 - 211p + 208p + 0p3. Suppose -5d - m - m - 25 = 0, -2d + m = 1. Let l(k) = -3k*3 - 2k + 2. What is dl(q) + 2g(q)? q*3 Let t(x) = -x + 13. Let f(q) = -q + 11. Give -6f(z) + 5t(z). z - 1 Let j(k) = -15k + 7. Let r(v) = -13v + 5. Let i(p) = 4j(p) - 5r(p). Let l(d) = -d2 - 4d - 2. Let u(h) = -2h + 1. Let o be u(2). Give ol(a) - 2i(a). 3a*2 + 2a Let s(p) = 8p - 18. Let y(b) = -7b + 21. Calculate 5s(m) + 6y(m). -2m + 36 Let d(w) = 2w*3 + 518w*2 - 3. Let f(n) = 2n*3 + 516n*2 - 2. Determine 2d(r) - 3f(r). -2r*3 - 512r*2 Let p(n) = -40n + 115. Let c be p(4). Let d(k) = -120k3 + 45k - 45. Let u(a) = 11a3 - 4a + 4. Calculate cu(x) - 4d(x). -15x3 Let z(j) = -j2. Let w(s) = s3 - 3s2 - s - 2. Let q(b) = b3 - 4b2 - b + 3. Let p be q(4). Give pw(k) + 3z(k). -k3 + k + 2 Let c(q) = 7q*2 - 9q + 82. Let w(d) = -4d2 + 5d - 42. Calculate 3c(o) + 5w(o). o*2 - 2o + 36 Suppose 4r - 5k + 11 = r, -2k - 4 = 0. Let b(l) = -5l*3 + 2l + 9. Let d(a) = -2a3 + a + 4. Determine rd(j) + 3b(j). -j3 - j - 1 Suppose -552 = 58v + 34v. Let w(d) = -6d - 6. Let j(c) = -7c - 6. Determine vw(f) + 5j(f). f + 6 Suppose 2c - 5p - 11 = 0, -1 - 3 = -4p. Let n(k) = -1 + 1 - ck + 9k + 1. Let q(v) = -3v - 8. Calculate -6n(z) - q(z). -3z + 2 Let a(s) be the second derivative of -3s5/20 + s3/2 + s. Let x = 1021 + -1019. Let u(w) = 16w3 + w2 - 16w. Calculate xu(y) + 11a(y). -y*3 + 2y*2 + y Let m(h) = 3h*3 + 4h*2 + 31. Let f(b) = -4b*3 - 5b*2 - 34. Determine 4f(k) + 5m(k). -k3 + 19 Let n(c) = -4c + 2. Let b(s) = 5s - 1. Let m(d) = -5b(d) - 6n(d). Let g(a) = a + 3. What is 5g(y) + 3m(y)? 2y - 6 Let k(j) = -168j3 - 49j. Let f(o) = o. Determine -98f(s) - 2k(s). 336s3 Let h(r) = 6r - 1 - 2r2 + 11 - 4. Let s(x) = x2 - 5x - 5. Suppose 0i + 4f = -2i + 26, 0 = -4i + 4f + 4. Give ih(w) + 6s(w). -4w2 Let y(n) = -n2 + n + 1. Let r(d) = -d*3 - 49d*2 - 6d - 6. Calculate -r(f) - 6y(f). f3 + 55f*2 Let d(l) = -1. Let s(g) = -2g - 18. Let h(q) = -57q - 192. Let a be h(-4). Calculate ad(o) - 2s(o). 4o Let h(s) = -5s3 - 2s*2 - s - 3. Let a(b) = -11b*3 - 5b*2 - 3b - 8. Give 2a(z) - 5h(z). 3z3 - z - 1 Let o be (2 - 8) + (2 - 0). Let z(y) = 11y. Let j(l) = 10l. Suppose 96c - 97c = -3a + 13, -4a + 30 = 5c. Give aj(b) + oz(b). 6b Let l(i) be the third derivative of i4/3 - i3/2 - 124i*2 - i. Let k(d) = 9d - 2. Calculate 3k(s) - 2l(s). 11s Let f(k) = -62k*2 - 15k + 82. Let p(i) = -29i2 - 7i + 41. Give -6f(r) + 13p(r). -5r2 - r + 41 Let h(q) = -53q - 52q - 54q + 158q + 1. Let z(m) = -2m + 2. Determine 5h(k) - 2z(k). -k + 1
Let s(l) = -l - 9. Let o(k) = 6k + 43. Let c(x) = -2o(x) - 11s(x). What is c(10)? 3 Let y be (-2 - (-65)/20)-4. Let r(f) = -6f - 12. Determine r(y). 18 Suppose -6q + 7 = -5. Let k(z) = -11zq - 6 - 9z2 - z3 + 16z2 + 3z. Give k(-5). 4 Let b be 4/14 + 60/(-14) - -6. Suppose -t + 23 = bt - 2m, 3t = -5m - 5. Let v(f) = f*2 - 5f. Calculate v(t). 0 Let g(w) = -w*2 + 22w + 25. Let a(y) = -y*2 + 27y + 26. Let h(v) = 5a(v) - 6g(v). What is h(-6)? -2 Let t be 2 + (-7 - -8) + 41. Let k(d) = -d3 + 41d + 2 - 38d + 4 + 6d*2. Give k(t). -22 Let i(b) = 4b + b*3 + 2 + 4b*2 - 5b - 3b2. Let k = 16 + -4. Let c = k - 14. Give i(c). 0 Let r(i) = -i2 - 2i + 4. Let h be r(-3). Let j(z) = z*2 + h + 2z - 1 - 6. Calculate j(-5). 9 Let f(m) = 2m2 - 7m - 45. Let u be f(7). Let b(t) = 7t + 4. What is b(u)? 32 Let r(h) = -h2 - 2h - 1. Suppose 5u - 3p + 125 = 27, -5u - 5p = 90. Let n = u - -35. Suppose 3i + n = -b, 5b + 9 = 5i + 29. Calculate r(b). 0 Let i(x) = -176x - 33. Let s(u) = -27u - 5. Let o(v) = -5i(v) + 33s(v). Let f(h) = 5h. Let b(l) = 5f(l) + 2o(l). Give b(1). 3 Let v(z) = -4z2 + 6z + 7. Let y(s) = -s*2. Let h = 19 + -24. Let j(g) = hy(g) + v(g). Suppose 2r = 5o + 30, 0 = 2o - r + 4r + 12. Calculate j(o). 7 Let f(k) = -k*3 - 4k*2 + 5k + 2. Suppose 0 = -3t + t. Suppose -4v - 29 + 21 = t. Let l be ((-5)/v)/(3/(-6)). Determine f(l). 2 Let n(m) = m*2 + 6m + 7. Let o = -142 + 136. Determine n(o). 7 Suppose f + 0f = -4v + 11, 2v + 5 = 3f. Let p(a) be the second derivative of fa - 2a*2 + 0 + 1/4a*4 + 1/20a*5 - 2/3a3. Determine p(-4). -4 Let k(c) = 5 - 1 + c + 2. Let o(r) = -7 - 9 + 0 + r. Let y be o(16). What is k(y)? 6 Let p(a) = a2 - 4. Let x be p(3). Let q(k) = -1 - 17 - 3k + 11 + k2. What is q(x)? 3 Suppose -5y = -t - t - 24, 33 = 5y + t. Let j(k) = 7 - 5k2 - k3 + 7k + 0k*2 - y + 7. Let n be (2/2 + -7)1. Give j(n). 2 Let k(g) = -g + 1. Let d = 818 + -819. Give k(d). 2 Let y(o) be the third derivative of o*6/120 - 11o5/60 + o4/12 - 5o3/3 + 112o2 + 1. Give y(11). 12 Let v(s) be the third derivative of -s4/24 - 5s3/6 + s2. Suppose -2m = 3m + 67m + 504. What is v(m)? 2 Let u(l) = -3l3 - 33l*2 - 26l + 7. Let q(y) = -y*3 - 11y*2 - 9y + 3. Let c(m) = 7q(m) - 2u(m). Determine c(-10). 17 Let n = 13 - 10. Let t(r) = -2 - 1 + 3r2 + r2 + rn + 0r*2 + 2r. Calculate t(-3). 0 Let t(y) = -6y2 - 29y + 7. Let l be t(-5). Let u(z) = z - 7z + 2z - lz. What is u(-2)? 12 Let v(j) = 2j + 9 - 7j + 13 - 24 - j. What is v(4)? -26 Let n be 0 + 5/((-10)/8). Let v be 20/n + 3 - 6. Let z(f) = f2 + 9f + 11. Give z(v). 3 Let u be 72/14(-252)/(-24). Let g = -53 + u. Let o(n) = n + 1. Let w(a) = a2 - 6a - 4. Let m(q) = -4o(q) - w(q). Give m(g). 1 Let f(w) = -w2 - 4w + 1. Let t be f(-5). Let a(d) = 4d2 - 26d + 10. Let p(q) = 5q2 - 34q + 13. Let c(j) = 9a(j) - 7p(j). What is c(t)? -1 Suppose f + 66 = 3f. Let o = -29 + f. Let i(l) = -4l*2 - 3 - o + 11 - 8l + l3. Calculate i(5). -11 Let a(j) = -j3 + 9j2 - 9j + 6. Let o be a(8). Let w be o + 1 + 0/1. Let d(f) = -f + 2 - 4 + 1. What is d(w)? 0 Let l(j) = j*3 + 2j*2 + 2j + 15. Let s(i) = -i*2 + i + 3. Let c(o) = -l(o) + 3s(o). Calculate c(-5). -11 Let y(h) = -11h. Suppose 3o = 5o - 52. Let b = 27 - o. Determine y(b). -11 Let j(v) be the second derivative of v4/12 - 2v*3/3 + 11v. Let d(f) = -f*3 - 6f*2 + 3. Let c be d(-6). Calculate j(c). -3 Suppose 0 = 4n - 4, -2a + 5n = a - 1. Let u(v) = 9 + av + 0v - v. Determine u(0). 9 Let r(o) = o*3 + 19o*2 - 5o - 25. Let i be r(-19). Let t(u) be the first derivative of 5 - u*2 - 14 - 73u + iu. Give t(-5). 7 Let l be (6/9)/(1/18). Let i = 14 - l. Let j(c) be the second derivative of -c4/12 - c3/6 + c2 + 2c. Give j(i). -4 Let x(d) = -2 + d + 20d2 + 0 - 25d2. Let b be x(1). Let t(n) = -n3 - 5n2 + 7n - 1. Determine t(b). -7 Let p(h) = h3 - h2 - 2h - 3. Let c = 35 - 11. Let u = 27 - c. Determine p(u). 9 Let t(q) = -q2 - 10q - 5. Let b be t(-11). Let r = b + 20. Let h(d) be the third derivative of -d4/8 - d3/6 + 18d2. Determine h(r). -13 Let x(h) = -55h*2 - 5 + 16h - 2 + 56h2 + 6. What is x(-16)? -1 Suppose 2c + 51 = 3u, 6c + 3u + 39 = 3c. Let z = c - -22. Let f(x) = -x*3 + 4x*2 - 2x + 5. Calculate f(z). -3 Let b(l) = -l*2 - 4l - 5. Let z(o) = o*2 + 8o + 16. Let y be z(-4). Suppose ys - 7s - 28 = 0. What is b(s)? -5 Let z = 1661 - 1652. Let l(g) = g*2 - 11g + 19. Give l(z). 1 Suppose 3d - 2 = 4i - 2i, 15 = -5i + 5d. Let c(o) = 6o + 43. Calculate c(i). 1 Let a(k) be the second derivative of -k*5/20 - 7k4/12 + k3/6 + 5k2 - 89k - 1. Give a(-7). 3 Let t(o) = o*2 - o - 2. Let z = -817 - -816. What is t(z)? 0 Let q be (8/(-4))/2 - 36. Let p = q - -39. Let l be ((-7)/14)/(p/(-4)). Let a(d) = 5d. Calculate a(l). 5 Let w = 1479 - 1490. Let f(x) = -x*3 - 9x*2 + 23x + 9. Calculate f(w). -2 Let a(p) = -8 + 11p - 13 - 13 + 35. Calculate a(1). 12 Let j(x) = 4x. Let u = 1 - -5. Suppose -t + u - 2 = 0. Suppose 0 = tg - 3n + 6, g - 3n + 7 = -5n. Give j(g). -12 Let f(c) = 0c2 + 3c - 2 - c + 2c2. Let v(r) = 4r - 29. Let j be v(8). Let z be (-4)/(-6)j(1 + 0). What is f(z)? 10 Let b(d) = 3d - 7 - 2d*2 + 4d2 - d2. Let g be b(-5). Let w(p) = -p + 3. Let i(x) = -2x + 7. Let o(s) = 4i(s) - 7w(s). Calculate o(g). 4 Let s(o) = 2o*2 - 9o - 18. Let n(i) = i*2 - 4i - 10. Let l(b) = 5n(b) - 3s(b). Let y = -6 + 13. Calculate l(y). 4 Let t be 5815/100. Let h(b) = 4b3 + 2b*2 - 10b. Let x(m) = -2 - 3 + 3 + m*2 - 11m + 5m3 + 3. Let r(d) = -6h(d) + 5x(d). What is r(t)? -1 Let a(l) = l2 + 6l + 3. Let o be a(-5). Let s(u) = u*3 - 4u*2 + 2u - 5. Let r be s(4). Let m(p) = -2p2 + p2 + 0 + 0p2 - 1 - pr. Calculate m(o). 3 Let v(n) = 11n3 - n2 + 18n + 12. Let s(k) = 31k3 - 2k*2 + 52k + 34. Let x(w) = -6s(w) + 17v(w). Let j be 43(-1)/(-2). Give x(j). 0 Let d(h) = -3h3 - 8h*2 + 3. Let r(w) = -2w*3 - 9w*2 + 3. Let k(l) = 3d(l) - 4r(l). What is k(12)? -3 Let h(k) = -k3 - 7k*2 - 9k - 15. Let c be h(-6). Let r(w) = -w + 3. Calculate r(c). 0 Let i(a) = -2a2 - 6a - 6. Let r(x) = -5x2 - 18x - 17. Let n(d) = -8i(d) + 3r(d). Calculate n(4). -11 Let s(w) = -41 - 23w + 8w - 3 + 8w + w2. Let z be s(11). Let j(o) = o2 - 4. Determine j(z). -4 Let w(y) = -1 - 2y*2 + 4 + 0 - 6y + y + 3y2. Determine w(6). 9 Let n(f) be the second derivative of 0 + 1/2f*2 - 15f + 2/3f3. Give n(-2). -7 Let r(g) = -20g + 16. Let b be r(1). Let f(c) = -c*3 - 6c*2 - 3c. Calculate f(b). -20 Suppose -8k + 4k + 4 = 0. Let r(z) = -13z3 - 4z*2 - 5z. Let s(o) = -38o3 - 11o*2 - 14o. Let v(t) = -11r(t) + 4s(t). Calculate v(k). -10 Suppose 2g = -2w - 3 - 3, 3g + 15 = 0. Suppose -m + 4 = -5q - 0m, 5q + wm = -7. Let d(o) = 5o3 + o2 + o. What is d(q)? -5 Let q(x) = x*3 - 3x*2 - 3x - 1. Let h be q(4). Let d(j) = -15 + j2 + 4 + jh + 0j + 0j. Suppose 7y = 3y. Calculate d(y). -11 Let l(f) = -f - 6. Let z(k) = -3k - 4. Let i(x) = -3l(x) + 4z(x). Give i(2). -16 Let v(w) be the first derivative of 2w*2 - 6 + 2w*3 + 4w - 1/4w4. What is v(7)? -17 Let r(h) be the third derivative of h4/24 - h3 + 2h*2 - 106. What is r(-11)? -17 Let z be (-21)/49(1 + -24). Let f(r) = 2r*2 - 4r + 2. What is f(z)? 8 Let j = -27625 - -27626. Let q(w) = -5w2 - 2w + 2. Let f(l) = 3l2 + l - 1. Let c(g) = 7f(g) + 3q(g). What is c(j)? 6 Let a(i) = 0 + 17i*2 + i + i + 4 - 23i2 + i3. Give a(5). -11 Let r(g) be the second derivative of -g4/12 - g3 - 3g2 + 712g. Calculate r(-4). 2 Let f(v) be the first derivative of -v + 2v - 4v*2 - 5v*2 - 13 + 6v*2. Determine f(3). -17 Suppose -n - 2m + 8 = 0, 5 = 28m - 23m. Let s(i) = -6i - 11. What is s(n)? -47 Let v(u) = u - 2u + u*3 + 630 - 629. Determine v(1). 1 Let q = -2 - -3. Let k = -19 + 23. Let n(b) = -4b - 4b + 1 - 4 + k. Calculate n(q). -7 Let v(o) = -o3 + 2o + 1. Let y = -3 + 7. Suppose -5j + 18 = -yj. Suppose -j = 4z + 2x, 0x = 5z - 2x. Give v(z). 5 Let u(g) = -g2 - 3g + 3. Let m(y) = -y*2 + 19y - 39. Let f be m(17). Determine u(f). -7 Let a = 1 - 5. Let t(y) = -3y3 + 2y*2 + 4y*3 + 4 + 8y*2 - 5y*2 + 5y + y. Give t(a). -4
Simplify (m*4mm(-1/3))(-2/47) assuming m is positive. m(-28/141) Simplify ((n/(n/(nn*(-9))))/nn)/nn/(n(1/8)n) assuming n is positive. n(-73/8) Simplify (v(-2))*(-50)/((vv/(v*(-2/15)/vv))/v(2/5)) assuming v is positive. v(1474/15) Simplify (q(-3/16))49 assuming q is positive. q*(-147/16) Simplify ((j/((jjj(-3/7))/j))/j)/j(-2/13) assuming j is positive. j(-38/91) Simplify cc(((c(6/13)/cc)/c)/cc)/cc/(cc(23/2)) assuming c is positive. c(-287/26) Simplify ((y2y)/(y/(yyy/y*1)))/(yy(yy/y*(-3))/yyy/((y(-3)y)/yyy)) assuming y is positive. y(-5) Simplify (h(-3)/(h/((hh(-5))/hh)))23 assuming h is positive. h(-184) Simplify (x(4/9))(-10/11) assuming x is positive. x(-40/99) Simplify (u/(u/(u/u(-48)u))u)/(uu(-18/13)) assuming u is positive. u(668/13) Simplify (uu(-2))(-2/131)/((u*(-4/7)u)/(uuu(1/4))) assuming u is positive. u(6737/3668) Simplify j*(3/8)jj(-5/6)/jj*(-9)j/j6 assuming j is positive. j(-347/24) Simplify (xx(-7)x(3/7))(-2/19) assuming x is positive. x(78/133) Simplify j(1/2)/jj(-8)j(jj*(-2/7)jj)(-41) assuming j is positive. j(-1663/14) Simplify (((a3a)/a)(-35))(-49) assuming a is positive. a*5145 Simplify (jjjj(1/10))(-14) assuming j is positive. j(-217/5) Simplify (m0/m(2/5))(-2/63) assuming m is positive. m(4/315) Simplify (a(-15))(13/6) assuming a is positive. a(-65/2) Simplify (zz6)(-32) assuming z is positive. z(-224) Simplify ((d/d(9/2))/(d(-4/9)d))/(d(-1))(-1/63) assuming d is positive. d(-57/14) Simplify (r(2/21)/(r2/r))31 assuming r is positive. r*(-589/21) Simplify ((n/(((nn/(n*(-2/5)n))/n)/n))/n(1/4))/(n(-4)n/((n/(nn*(5/4)n))/n)) assuming n is positive. n*(11/10) Simplify (a(a/a*5)/aa)4 assuming a is positive. a(-12) Simplify ((((((f/f*(-1))/f)/f)/f)/ff)/fff7)(-3/4) assuming f is positive. f(-9/2) Simplify (o(-4)oo(-4))27 assuming o is positive. o(-189) Simplify o0/(o/(o/o*(-1/10)))(o(-1))(2/21) assuming o is positive. o(1/210) Simplify (w(-1))(-1/3) assuming w is positive. w(1/3) Simplify (w/(ww9)w)41 assuming w is positive. w(-328) Simplify ((mmm/m*(-2/7)m)/m)/mm/m(-29) assuming m is positive. m(226/7) Simplify i(2/15)/(i/(i/(ii*(-29))i)) assuming i is positive. i(437/15) Simplify (k(1/4)k)(8/11)/(kk(-1)/k)28 assuming k is positive. k(318/11) Simplify k(2/9)/k(kk*(-2/25)k)/kkk assuming k is positive. k*(482/225) Simplify (tt/((tt/(t(1/2)t)t)/t))21 assuming t is positive. t(63/2) Simplify ((pp(-4))/p(2/7))/((p/(p/(p*2pp)))/p)44 assuming p is positive. p(-947/7) Simplify f/(((f(3/22)/f)/f)/f)ff26f assuming f is positive. f(701/22) Simplify s(-1/5)/(s/s*(-2/9))(s/(ss(-7)ss))/ss4 assuming s is positive. s(296/45) Simplify (t(-11)/(t5/t))(14/5) assuming t is positive. t(-42) Simplify o(2/29)/o1 assuming o is positive. o*(-27/29) Simplify (p/(pp*(-1))p9)22 assuming p is positive. p220 Simplify (q2/q)*(-1/11)(q(-2/9)/q)(-1/12) assuming q is positive. q*(13/1188) Simplify (((i/((iii0)/i))/i)/i)(-6) assuming i is positive. i12 Simplify (n(-2/15)/n(-1/9))(-1/35) assuming n is positive. n(1/1575) Simplify ((ww6)/w)/w(-1/6)((w/w0)/w)(23/5) assuming w is positive. w(37/6) Simplify (bb/(b/(b/(b((b/((b/(b(2/37)b))/b))/b)/bb))))(4/19) assuming b is positive. b(-8/703) Simplify (i(ii(-2/17)/iii)/i)/(i(-14)/i) assuming i is positive. i(287/17) Simplify (jj*(1/5))/(jj(((j(((((j/(j/(j(j/j(-1/15))/j)))/jj)/j)/j)/j)/j)/j)/j)/j) assuming j is positive. j(62/15) Simplify (j/(j(2/3)/jj))(1/9)j*(-1/3)j*(2/9)j assuming j is positive. j(25/27) Simplify ((k/k(-9))/k)/(k/k(-4/3)) assuming k is positive. k(20/3) Simplify (yy(-1)y*(-1/2)y)/((yy/(y/(y(y/(y/(((y/y*(-2/27))/yy)/y)))/y)))/(yyy*(1/4)y)) assuming y is positive. y*(289/108) Simplify (((ll/(l/(l/l*(3/2)))l)/l)/l(-5))/(l7/(l*(-3/2)l)) assuming l is positive. l(-2) Simplify (((t/(t(12/5)t))/t)/tt)(25/2) assuming t is positive. t(-85/2) Simplify (x/x*(-11/4))/(xxx7x) assuming x is positive. x(-25/4) Simplify i(-2/51)ii*(-3/10)/ii assuming i is positive. i(337/510) Simplify (h(-5))8 assuming h is positive. h(-40) Simplify ((h(h/h(-4))/h)/hh/h*(2/7))/((hh5)/(h/h(2/13))) assuming h is positive. h(-40/91) Simplify f(-17)/f(-18) assuming f is positive. f Simplify (y1)(-1/18)/(y(-2/5)/((y/(y*(3/7)yy))/yy)) assuming y is positive. y(-683/630) Simplify (w(-1/3)/(w2/w))/(((w/w6)/w)/ww/(w4/w)) assuming w is positive. w(23/3) Simplify ((p(-4/7)/pp)/p)/(p/(p/(p/p(-3/11)))) assuming p is positive. p(-219/77) Simplify w(-36)/(w/w46) assuming w is positive. w9 Simplify (g(-2))*2(g/g1)(1/4) assuming g is positive. g(-4) Simplify (q3q(-1))(-2/23) assuming q is positive. q(-4/23) Simplify (fff(1/2)f)(2/67)/(f(2/9))(-30) assuming f is positive. f(1361/201) Simplify (w/w*(2/9)w)/(ww/w2w)w(-2)/w(-1/7) assuming w is positive. w(-68/63) Simplify i3/i(1/3)i*(-4)/(ii(1/9)) assuming i is positive. i(-22/9) Simplify (u(-1/3)/u0)/(u*(1/9)/(uu(-1/5))) assuming u is positive. u(16/45) Simplify (z0)23/(z*(-2/17)zzz/z4) assuming z is positive. z(19/17) Simplify (b(2/5)/b)40(b(-2/7))43 assuming b is positive. b(-254/7) Simplify i(-28)/((i/(i/(ii3)))/i) assuming i is positive. i(-31) Simplify (jj/(j/(j/(j/j(-5)))))22 assuming j is positive. j(-88) Simplify m(-13)/m(-3) assuming m is positive. m(-10) Simplify i4ii/i(3/4)i*(-2/9)/((ii(-3/5)/i)/i) assuming i is positive. i(1193/180) Simplify ((s/(ss(2/3)))/(ss(2/9)/s))/(s0/sss(-2/17)) assuming s is positive. s(-118/153) Simplify (z*(2/27)/(zz/(z/(zz/(z/(z(-6/7)/z))))))/(z(-4/3)zz(-3)) assuming z is positive. z(617/189) Simplify (c(-1/3)/c)(-1/2)((c/((c*(-2/9)/c)/c))/c)/cc(-1) assuming c is positive. c(8/9) Simplify c/c*(-3)(c/(cc(-5)c)cc)/cc(3/4)/(c(2/15)/cc) assuming c is positive. c(577/60) Simplify ((d/d(1/4))/d)*23/((d((d/d*(-1/4))/d)/d)/dd7) assuming d is positive. d(-12) Simplify ((t/(ttt(-9/2)))/t(-12))(1/7) assuming t is positive. t(31/14) Simplify w13/(w/w(-2/31)) assuming w is positive. w*(370/31) Simplify (((iiii*(-5/7)i)/i)/(i/i(1/2)))(-46) assuming i is positive. i*(-575/7) Simplify (jj*(-1)j)*(-18)(j*(-1/3)j)/j2 assuming j is positive. j(-58/3) Simplify l*(1/5)/lll(-4)l((ll*(2/21))/l)/l((l/l(-9))/l)/l assuming l is positive. l(451/105) Simplify (dd/d(-3))7 assuming d is positive. d35 Simplify (r(2/5)r/(r*(3/2)r))/(r*(-5/2)(r/(rr(-1)))/r) assuming r is positive. r(7/5) Simplify (q/(qq*8)qq(-8))(-6/7) assuming q is positive. q(90/7) Simplify (x(-17)/x)/((x/x19)/x) assuming x is positive. x Simplify ((v(-2/7)/vv)(-1/49))(-35) assuming v is positive. v(-10/49) Simplify j(-4/7)/j(-32) assuming j is positive. j(220/7) Simplify u*(-8)/(u(u/u*(2/15)u)/uu) assuming u is positive. u(-163/15) Simplify (c(-1/2))(-2/29) assuming c is positive. c(1/29) Simplify (nn*(-22))/(n/(n/(n/(nnn(-1/23)/n)))) assuming n is positive. n(-484/23) Simplify (qq(-2/11))/q(2/53) assuming q is positive. q*(455/583) Simplify (i/(((iii(-1)/i)/ii)/i))(-1/20)/(i(2/3)/(ii/((i2i)/i)i)) assuming i is positive. i(7/30) Simplify (gg(2/5))27 assuming g is positive. g(189/5) Simplify (k(-2/15)/((kk(k(k/((kk*(-12))/k)k)/k)/k)/k))(2/41) assuming k is positive. k(-424/615) Simplify (sss*(-6)sss)/s(3/2) assuming s is positive. s(-5/2) Simplify (r/(r*(-11)/rr)rrr(-3/5))/(r(-8)/(r/r(4/3))) assuming r is positive. r(316/15) Simplify p(-11)p/(p/(p/p*15))p assuming p is positive. p(-24) Simplify ((((h/h(-15)h)/h)/h)/h(2/9))(-25) assuming h is positive. h(-3325/9) Simplify (o(-7)o/o(1/25))(-4/3) assuming o is positive. o(604/75) Simplify (a(-3/8)a(-5/3))/(aa*5/aa(-6)) assuming a is positive. a(-25/24) Simplify g*(-2/21)g(-1/6) assuming g is positive. g(-11/42) Simplify y/((yy((y(y/((y/y5)/y)y)/y)/y)/y)/y)yy(y/y39)/y assuming y is positive. y*(-42)
Calculate the remainder when 2344 is divided by 273. 160 What is the remainder when 35742 is divided by 122? 118 What is the remainder when 34338 is divided by 8? 2 Calculate the remainder when 4991 is divided by 37. 33 What is the remainder when 78133 is divided by 9765? 13 What is the remainder when 3046789 is divided by 17? 15 Calculate the remainder when 174123 is divided by 87058. 7 What is the remainder when 14348 is divided by 277? 221 What is the remainder when 3359 is divided by 100? 59 Calculate the remainder when 14957 is divided by 13. 7 Calculate the remainder when 43905 is divided by 147. 99 Calculate the remainder when 1155562 is divided by 56. 2 Calculate the remainder when 121449 is divided by 87. 84 Calculate the remainder when 1532 is divided by 509. 5 What is the remainder when 1334986 is divided by 187? 180 Calculate the remainder when 3964 is divided by 493. 20 Calculate the remainder when 9066 is divided by 4239. 588 Calculate the remainder when 96887 is divided by 425. 412 What is the remainder when 129133 is divided by 15? 13 Calculate the remainder when 61126 is divided by 541. 534 Calculate the remainder when 10902 is divided by 1816. 6 What is the remainder when 1631 is divided by 291? 176 Calculate the remainder when 1860 is divided by 69. 66 Calculate the remainder when 4124 is divided by 429. 263 What is the remainder when 14610 is divided by 174? 168 What is the remainder when 21592 is divided by 40? 32 What is the remainder when 162088 is divided by 98? 94 What is the remainder when 41220 is divided by 130? 10 What is the remainder when 3445 is divided by 449? 302 What is the remainder when 6351 is divided by 4? 3 What is the remainder when 8716 is divided by 1076? 108 Calculate the remainder when 2942 is divided by 154. 16 Calculate the remainder when 499658 is divided by 1103. 1102 What is the remainder when 102639 is divided by 43? 41 What is the remainder when 4231416 is divided by 128? 120 What is the remainder when 1337147 is divided by 403? 396 Calculate the remainder when 194435 is divided by 396. 395 Calculate the remainder when 1207 is divided by 625. 582 Calculate the remainder when 240935 is divided by 80308. 11 Calculate the remainder when 29451 is divided by 795. 36 Calculate the remainder when 997521 is divided by 10. 1 What is the remainder when 11507 is divided by 170? 117 What is the remainder when 812927 is divided by 6? 5 What is the remainder when 13474 is divided by 3901? 1771 Calculate the remainder when 28182 is divided by 5. 2 Calculate the remainder when 64151 is divided by 6414. 11 Calculate the remainder when 144235 is divided by 18029. 3 Calculate the remainder when 29000 is divided by 302. 8 Calculate the remainder when 53771 is divided by 21. 11 What is the remainder when 315359 is divided by 540? 539 Calculate the remainder when 540886 is divided by 62. 60 Calculate the remainder when 23382 is divided by 21. 9 Calculate the remainder when 233 is divided by 167. 66 What is the remainder when 1147 is divided by 473? 201 Calculate the remainder when 8776 is divided by 54. 28 What is the remainder when 1281 is divided by 382? 135 What is the remainder when 1268 is divided by 111? 47 Calculate the remainder when 5207 is divided by 4. 3 What is the remainder when 4662 is divided by 1506? 144 Calculate the remainder when 134560 is divided by 1843. 21 Calculate the remainder when 5665 is divided by 259. 226 What is the remainder when 12410 is divided by 703? 459 What is the remainder when 58990 is divided by 1133? 74 Calculate the remainder when 632634 is divided by 15. 9 What is the remainder when 31898 is divided by 238? 6 Calculate the remainder when 4927 is divided by 2421. 85 Calculate the remainder when 26965 is divided by 461. 227 What is the remainder when 1150 is divided by 249? 154 What is the remainder when 1003407 is divided by 476? 475 Calculate the remainder when 1007 is divided by 959. 48 Calculate the remainder when 6736 is divided by 2239. 19 What is the remainder when 932326 is divided by 164? 150 Calculate the remainder when 145615 is divided by 958. 957 Calculate the remainder when 44342 is divided by 6331. 25 Calculate the remainder when 6541 is divided by 66. 7 What is the remainder when 583 is divided by 497? 86 What is the remainder when 192494 is divided by 891? 38 Calculate the remainder when 5307 is divided by 230. 17 What is the remainder when 771405 is divided by 198? 195 What is the remainder when 148556 is divided by 3? 2 Calculate the remainder when 4138 is divided by 1817. 504 What is the remainder when 3147 is divided by 1568? 11 Calculate the remainder when 3054 is divided by 645. 474 Calculate the remainder when 2130 is divided by 146. 86 Calculate the remainder when 9641 is divided by 838. 423 Calculate the remainder when 43652 is divided by 5. 2 What is the remainder when 21537 is divided by 11? 10 Calculate the remainder when 5380 is divided by 18. 16 Calculate the remainder when 5427 is divided by 216. 27 What is the remainder when 462 is divided by 89? 17 What is the remainder when 27328 is divided by 9105? 13 Calculate the remainder when 177836 is divided by 179. 89 Calculate the remainder when 19366 is divided by 152. 62 What is the remainder when 484549 is divided by 19? 11 What is the remainder when 991590 is divided by 991588? 2 What is the remainder when 326240 is divided by 45? 35 Calculate the remainder when 190759 is divided by 23843. 15 Calculate the remainder when 62140 is divided by 110. 100 What is the remainder when 2610 is divided by 260? 10 Calculate the remainder when 158081 is divided by 10538. 11 What is the remainder when 899440 is divided by 26? 22 What is the remainder when 17841 is divided by 380? 361 Calculate the remainder when 18442 is divided by 369. 361 What is the remainder when 10461 is divided by 492? 129 What is the remainder when 5369 is divided by 75? 44 What is the remainder when 21531 is divided by 127? 68 What is the remainder when 1493213 is divided by 11? 7 What is the remainder when 2100994 is divided by 612? 610 What is the remainder when 1701278 is divided by 196? 194 What is the remainder when 15404 is divided by 593? 579 What is the remainder when 42469 is divided by 1340? 929 Calculate the remainder when 3790 is divided by 1878. 34 Calculate the remainder when 27410 is divided by 1053. 32 What is the remainder when 6951 is divided by 3401? 149 Calculate the remainder when 388708 is divided by 194347. 14 Calculate the remainder when 2996 is divided by 2902. 94 Calculate the remainder when 168196 is divided by 36. 4 Calculate the remainder when 373339 is divided by 732. 19 What is the remainder when 14690 is divided by 1904? 1362 What is the remainder when 938502 is divided by 55? 37 What is the remainder when 24566 is divided by 83? 81 What is the remainder when 3368 is divided by 35? 8 What is the remainder when 129595 is divided by 64782? 31 What is the remainder when 3233 is divided by 1579? 75 What is the remainder when 22973 is divided by 11467? 39 What is the remainder when 1460 is divided by 780? 680 Calculate the remainder when 14594 is divided by 248. 210 Calculate the remainder when 31691 is divided by 722. 645 Calculate the remainder when 43384 is divided by 477. 454 Calculate the remainder when 24776649 is divided by 53. 50 Calculate the remainder when 146847 is divided by 13. 12 What is the remainder when 2649186 is divided by 728? 722 Calculate the remainder when 49507 is divided by 12358. 75 Calculate the remainder when 1119 is divided by 593. 526 Calculate the remainder when 31462 is divided by 213. 151 What is the remainder when 18598 is divided by 18301? 297 What is the remainder when 722693 is divided by 24? 5 Calculate the remainder when 2208089 is divided by 23. 20 What is the remainder when 1233 is divided by 363? 144 Calculate the remainder when 10344 is divided by 3446. 6 Calculate the remainder when 610059 is divided by 47. 46 Calculate the remainder when 114732 is divided by 101. 97 Calculate the remainder when 41181 is divided by 156. 153 What is the remainder when 1851 is divided by 219? 99 Calculate the remainder when 3323496 is divided by 199. 196 Calculate the remainder when 16093 is divided by 50. 43 What is the remainder when 41586 is divided by 20780? 26 Calculate the remainder when 160315 is divided by 423. 421 Calculate the remainder when 222219 is divided by 74045. 84 What is the remainder when 1803 is divided by 257? 4 Calculate the remainder when 8277 is divided by 82. 77
Expand -4a5 + 5a - 2a5 + 7a*5 + 2a5 + a5 - a*5 + (2a2 - a2 - 3a2)(a*3 + 4a*3 - 3a3). -a5 + 5a Expand (-4 + 2 + 0 + (0 - 1 + 3)(-2 - 2 + 2))(-49q + 11q3 + 49q). -66q3 Expand -3y + y*4 + 3y + (-y - 7y + 4y)(-1 - y3 + 1) + 0y*4 + 4y*4 - 6y4 + (-3 + y3 + 3)(y - 8 + 8). 4y*4 Expand 0u + 0u - 2u + 1 - 1 - u + (4u - 2u + 0u)(2 - 1 + 1) + 1 + u - 1 - 52u - 26u + 34u. -42u Expand -95y3 - 25y*3 - 51y*3 + (-2y*3 + 3y*3 - 3y*3)(0 + 1 + 0) + 3y3 - 2y*3 - 2y*3 + 2y*3 + 0y*3 - 4y*3. -176y*3 Expand (-15 - 36 + 6)(-1 + d + 1 + (-2 - 2 + 2)(6d + 0d - 4d)). 135d Expand ((-7 + 4 + 1)(0 - 5 + 2) - 2 + 3 + 1)(-11o + 30o + 0o)(4o*4 + 2o*4 - 5o*4) + 3o5 - o5 + 0o5. 154o*5 Expand (-171 - 163 + 270)(4c2 + 0c*2 - 7c*2). 192c*2 Expand (16 + 2 + 4)(12 - 3h + 2h - 27). -22h - 330 Expand (-63 + 37 - 74)(3a4 - 6a*4 + 10a*4). -700a*4 Expand (2 + 3 + 1)(0 - 2x2 + 0) - 4 + 127x - 3x2 - 127x. -15x2 - 4 Expand (2 - 5 - 6)(3h + 0h - 5h - h - 1 + 1 + (0 + 2 - 3)(2h + 4h - 5h) + 5h - 5h + h + 3h - 4h + 0h). 36h Expand (-248b*2 + 248b*2 - 3b*3)(4b2 - 5b*2 + 5b*2 + (-3b*2 + 2b*2 - 2b*2)(-1 + 2 + 1)). 6b5 Expand 0g - 2g + 0g + (150g + 202g - 104g)(0 + 1 - 3 + 5 + 1 - 4 + (4 + 1 - 3)(-2 + 1 - 1) + 1 + 5 - 4). -498g Expand -n*5 + 3n*5 + 3n*5 + (2 + 2 - 3)(6 + n*5 - 6). 6n*5 Expand (5 + 0 - 2)(13r4 + 19r*4 - 2r*4) + 3r4 + r4 - 5r4. 89r*4 Expand -3m + 3m - m - 8m + 0m + 5m + 3 - m - 3 + (-3 - 2m + 3)(2 - 1 + 1) - m + 4m + 0m. -6m Expand 6h - 5h - 4h + 2h + 3h - h + (-3h - 3h + 4h)(0 - 3 + 2) + 7h - h - 3h + (-1 + 2 - 6)(2h - h + 0h). h Expand -1656f + 2530f - 1326f + 4f - 2f - 3f + (-f - f + 3f)(1 - 3 + 1). -454f Expand (-6j + j + 0j)(2j*2 - 3j2 - j2) - 2j2 - 158 + 53j*3 + 158. 63j*3 - 2j*2 Expand -4d*2 - 3d*5 + 4d*2 + (-4d2 + d2 + 4d2)(3d3 + 0d*3 - 2d*3) + 27d - 27d - 6d*5 + 2d*3. -8d*5 + 2d*3 Expand (s - 3s + 3s)(s - s + s*2)(3 - 1 + 2 + (5 + 3 - 5)(-4 + 1 + 4) + (2 + 0 - 3)(6 - 2 - 3)). 6s3 Expand (a3 + 2a*2 - 2a*2 + (4 + 1 - 3)(3a3 + 4a*3 - 5a*3))(-2a + 2a + 9a2). 45a*5 Expand (-2 + 2 - 3i*2)(-5i + 4i + 4i) + 2i*3 + 0i*3 - 3i*3 - 12i*2. -10i*3 - 12i*2 Expand (-182a - 426a + 141a)(3 + 0 - 1)(0a3 + a4 + 0a*3). -934a*5 Expand (2a + 4a - 4a)(0 - 2 + 3) - 4 + 2a + 4 + (-4a + a - 6a)(-5 + 3 + 3)(-5 - 4 + 1). 76a Expand (4f*3 + 2f*3 - 4f*3)(41f2 - 51f*2 - 94f*2 + (4 + f - 4)(1 - 2 + 3)(-f + 5f - 3f)). -204f*5 Expand 10i*2 - 7i*2 + 8i*2 + (0i - i + 2i)(0i + 3i - 2i) - 2i*2 - 2i*2 + 2i*2 - 1. 10i*2 - 1 Expand (5r*3 - 20r*3 - 22r*3)(-3 + 1 + 1)(-7 - 9 + 3). -481r*3 Expand (-55c*2 + 1258 - 1256 - c + 25c*2)(3 + 2 - 4). -30c2 - c + 2 Expand (-2g - 2g + 3g)(g - 2g - g) + (3 - g - 3)(23g + 11g - 49g) + 2g2 + 3g*2 - 3g2 + g2 + 0g + 0g. 20g2 Expand (-2 + 2o*2 + 2)(-99 + 99 + 57o)(-2o - o + o). -228o*4 Expand ((3 - 3 - a)(352 - 482 + 243) - a - a + 3a)(5 - 4 + 1). -224a Expand (-22 + 22 - 4z)(4z*2 + 0z*2 - 2z*2) + 9z*3 - 10z + 10z. z3 Expand ((1 + 3 - 6)(-1 + 0 - 1) + 1 + 1 - 3 - 5 - 3 + 2)(0r - 2r - r). 9r Expand (-3 + 0 + 1)(10s*2 - 6s*2 - 12s*2) + 8s*2 + 3s*2 - 4s*2. 23s*2 Expand (3186 + 16w*3 - 2w*2 - 5w*3 - 3200)(5w - 5w - 2w2). -22w*5 + 4w*4 + 28w*2 Expand (28q*3 - 7q*3 - 20q*3 + 4)(4 - 4 + q). q*4 + 4q Expand (-89w2 - 267w*2 - 145w*2)((w2 - w2 + 2w3)(0 + 2 + 0) + 3w2 - w3 - 3w*2). -1503w*5 Expand (0q3 - q3 - q*3 + (-3 + 3 - 2q*2)(-3q + 3q + 4q) + ((6 - 6 - 3q)(-2 + 2 - 2) + 0q + 2q + 0q)(2q2 + q2 - 5q2))(1 - 2 - 9). 260q3 Expand (20k - 25k + 12k)(-k + 2k - 2k). -7k*2 Expand 2x*4 - 3x*4 + 0x4 + (-x2 + 3x2 - x2)(-2 + 2 - 2x - 1 - x + 1 + (-1 - 2 + 1)(-3 + 3 - x) + 3x - 3x - 2x)(2x + 3x - 4x). -4x*4 Expand (-14p*2 - 10p*2 - 20p*2)(1 - 1 - 2p + (0p + 2p + 0p)(4 - 1 - 1) + 2p + 0p + 0p). -176p3 Expand (-7x*2 - 2x - 17x2 - 8x*3 + 22x*2)(6 + 4 - 6). -32x3 - 8x*2 - 8x Expand (0 - 1 - 1)(1235 + 80r - 1235). -160r Expand (255 - 141 - 115 - 983s + (0s - 3s + 5s)(1 + 0 - 3) + 2 - 2 + s)(1 - 5 + 2). 1972s + 2 Expand (-7r + 25r + 30r)(-1 + 1 - 1). -48r Expand (2h - h*3 - 2h)((0 - 2 + 7)(3 - 3 - 1) - 3 + 7 - 2). 3h3 Expand (5 - 3 - 1 + (-4 + 1 + 1)(-5 + 2 + 2))((2 - 1 - 2)(5i + i - 4i) + 16i + 207i - 68i). 459i Expand (-c*5 + 2c5 + c5)(90 + 68 - 2 + 140). 592c*5 Expand (3 - 5 + 1)(-u + u - 2u2) - 5u*2 + 4u*2 - 7u*2. -6u*2 Expand (0 - 1 + 3)((0 + 3 - 5)(-6p + 2p - 2p) + 2p - 6p + 2p) - 1 + p + 1. 21p Expand (0 + 0 + 1)(3 + 0 + 5)(0 + 2 + 0)(0p - p + 0p + 3 - p - 3 + (3 + 0 - 2)(3p + p - 5p)). -48p Expand (3 + 0 - 5)(v + 2v + 0v)(-102 + 102 + 13v) + (-1 + 2v2 + 1)(-2 + 1 + 2). -76v2 Expand 2c + 4c2 - 2c*2 + 2c + (-1 + 2 + 0 + c)(-1 + 0 + 3)(-c - 14c + 2c). -24c2 - 22c Expand (-2g + 4g + 3g)(4g2 - 7g + 7g) + 110g - 110g + 17g*3. 37g*3 Expand -f + 3f + 2f + (13 - 9 + 23)(-2 + f + 2). 31f Expand (-1 + 3 - 3)(-z*2 + 3z2 + z2) + (z - 5z + 2z)(-1 - 2z - 44z - 174z). 437z2 + 2z Expand (2 - 2h4 - 2)(2 - h - 2) - 84h5 - 22h*5 - 3h*5 - 3h*5 + 0h*5 + 4h*5. -106h*5 Expand 52x*2 - 17x*2 + 28x*2 + (-3 + 3 + 1)(3x2 - 6x*2 + 4x*2) + (0x - 7x + 0x)(3x - 6x + 2x). 71x2 Expand (4n - n - n)(-3 + 6 - 1) + (-31 - 5 + 11)(-n - n + n) + n - n + n + (-3n - n + 2n)(-2 + 2 - 1) + 4 - 4 + 2n. 34n Expand 3w - 18w + 8w - w + 0w - w + 6w - 2w - 2w + 4w - 3w + 0w + (0w - w + 3w)(1 + 1 - 3). -8w Expand (1397 - 735 - 122 + 5 - 2 - 2 + (-4 + 0 + 5)(0 + 4 - 2))(h2 - 5h*2 + 2h*2). -1086h*2 Expand (3 - 3 + 2)(f + 0 + 0) + (-3 + 3 - 2)(4f + f - 3f) + f + 1 - 1 - 69f + 91f - 121f. -100f Expand (-1 - 2 + 0)(0u3 + 3u3 - u3 + (-4u2 + 4u*2 - 2u*2)(-5u + 3u + 0u) + 256u*2 + 26u*3 - 256u*2). -96u*3 Expand 14a - 1948 + 1948 + (-2 + 2 + 2)(-1 + a + 1). 16a Expand -1 - 2l2 + 1 + 22l*2 - 58l*2 - 66l*2 + 2l*2 - 3l*2 + 0l*2 + (l + 0l - 2l)(2l + 0 + 0). -107l2 Expand (i2 + 0i2 - 3i*2)(0i + 201 - 9i + 7i). 4i*3 - 402i*2 Expand (y - y - 2y*2)(99y - 161y - 122y). 368y*3 Expand (3 + 9z - 3)(-3 + 7 - 2 - 2 + 3 + 1 + (-1 + 1 + 1)(2 - 4 + 0) - 3 + 1 + 1 - 1 - 1 + 0). -9z Expand (0h + 0h - 2h*4)(1 + 1 + 0) - h3 + h4 + h*3 - 6h*4 + 3h*4 + 2h*4 + (0h*3 + 24h*3 + 0h*3)(9 - 9 + 6h). 140h*4 Expand (0y*2 - 2y2 + y2)(y + 2y - 4y) + 4y - 5y + 157y*3 - 183y*3. -25y3 - y Expand (-l2 - 3l2 + 5l*2)(-l*2 - 3l*2 + 2l2) - l3 + l3 - l3 - 3l - 3l*4 + (3l - 4l + 5l)(-l3 + 4l3 - l3). 3l4 - l3 - 3l Expand (112 - 112 - 13c2)(-10 - 4c + 3c + 12 - 2c2). 26c*4 + 13c*3 - 26c*2 Expand (-2h - 27 + 27)(3 + 10 + 8). -42h Expand -3236r + 31r*2 + 3236r + (5r2 + 0r*2 - 6r*2)(-1 + 3 + 0) + r*2 - r + r. 30r*2 Expand (-1 + 1 + 2q)(-7q - 5 + 5)(-51q*3 + 32q*3 + 31q*3). -168q*5 Expand (85 + 65u*3 - 85)(3 + 2 + 1). 390u3 Expand (3 + 10 - 12)(-16 + 16 - 18g5). -18g*5 Expand (4 + 8 + 4)(-2d + 3d - 2d). -16d Expand (-j*3 - 14j*3 - 23j*3)(-3 + j*2 + 4 - 1). -38j*5 Expand (u - u - 4u*2 + (-u + 12u + 4u)(0u + 7u - u))(-3u + u + 3u). 86u*3 Expand (-f - 5f - 37f)(-3 + 3f + 6 + 2f + 1). -215f2 - 172f Expand (2 - 42 + 20 - 26)(3a - 9a + a). 230a Expand (-2g2 + 6g*2 + 12g*2)(3 + 6 - 8). 16g2 Expand (4i - 4i + i)(-3 - 4 + 4 + (3 - 1 + 0)(-3 + 4 - 2)) + 2i + 1 - 1 + (2i - 2i - 2i)(-5 + 4 + 0) - 6 + 8i + 5i - 11i. i - 6 Expand (0p*2 - 2p2 + p2)(3p - 3 - 5p + 9) - 9p*3 - 7p*3 + 23p*3 + (2p + 0 + 0)(-p + p2 + p) - 3p*3 + 5p3 - p3. 12p3 - 6p*2 Expand (-80 - 9 - 47)(v + 2v - 4v)(1 - 1 - 3v*3). -408v*4 Expand (2c - c - 3c)(-142c2 + 142c*2 + 27c*4) + (-3c + 2c + 2c)(-6c4 + c4 + 4c4) + 26c*5 - 242c + 242c. -29c**5
Let i = 48 + -38. Let a be -6-28/6. Find the third derivative of 5y6 + iy*6 - ay*2 + 42y*2 wrt y. 1800y*3 Let j(h) be the second derivative of -17h*6/5 + 19h*4/6 + 6847h*2 - 14445h. Find the first derivative of j(k) wrt k. -408k3 + 76k Let m(g) be the third derivative of -11g5/30 + g4/12 - 767g*3/6 + 2715g*2. Find the second derivative of m(j) wrt j. -44 What is the second derivative of 2326167o*2 + 1663o*3 - 2326167o*2 - 236o*3 - 1126o wrt o? 8562o Let b(x) be the second derivative of 913x*7/21 - 91x*4/4 + 45x - 1. What is the third derivative of b(a) wrt a? 109560a2 Let h(w) = 380w*3 - 2w*2 - 28w - 10006. Let q(b) = -126b3 + b2 + 10b + 3335. Let a(s) = 5h(s) + 14q(s). Differentiate a(p) with respect to p. 408p2 + 8p Differentiate 1210i + 3048i - 1503 - 767i - 225 with respect to i. 3491 Suppose -44 = 2x - 60. Differentiate -1419w + 1387w - 7 - x with respect to w. -32 Suppose 2x - 15 = -4g + 15, -23 = -x - 4g. Suppose -4n = -xn + 9. Find the first derivative of -z3 + 33 - 5z*n - 9z*3 - 2z*3 wrt z. -51z*2 Let t(r) be the second derivative of 171r*6/5 + 221r4/6 - r3/3 - r*2 + 438r + 1. Find the third derivative of t(l) wrt l. 24624l Let w(y) be the third derivative of -113/6y*3 + 0 - 40y*2 + y + 49/12y*4. Differentiate w(f) with respect to f. 98 Suppose 3l = 6l + 132. Let o = l - -48. Find the second derivative of -13s + os5 + 14s - 17s wrt s. 80s*3 Let m(i) be the second derivative of 1/10i*5 + 0 + 0i*2 - 30i - 1/6i3 - 7/3i*4. Find the third derivative of m(u) wrt u. 12 Let o(q) be the third derivative of -7q*6/120 - 107q5/60 - q4/24 + 3997q3/3 - 168q*2 - 16q. What is the derivative of o(d) wrt d? -21d2 - 214d - 1 Find the second derivative of 8i4 + 1821i + 10i4 + 354i*2 + 6i*4 + 5i*2 - 23i*4 wrt i. 12i*2 + 718 What is the second derivative of 450j + 420j4 - 868j + 455j + 353j + 547j wrt j? 5040j*2 Suppose 75a - 854 = 61a. What is the first derivative of -21t*4 - 15 + 21 + a + 74t*4 wrt t? 212t*3 Let r(x) = -2x + 5. Suppose d = 2n - 2 + 3, n - d + 1 = 0. Let s be r(n). What is the third derivative of -38 - 43 - 8y*4 + 81 + sy*2 wrt y? -192y Let m = 4 + -10. Let u(o) = 20o - 13. Let i(q) = -21q + 13. Let h be -8 - (12/6 + -5). Let v(p) = hi(p) + mu(p). Differentiate v(g) with respect to g. -15 Differentiate 91p2 - 1414p*3 - 1405p*3 - 842 - 343 - 1413p*3 + 4223p*3 with respect to p. -27p*2 + 182p Find the second derivative of 44z3 - 15z + 27z4 + 41z*3 + 42z - 60 - 26z3 wrt z. 324z*2 + 354z Let v(s) be the second derivative of -s*6/10 + 43s*5/4 - 227s*4/12 + 430s - 2. What is the third derivative of v(j) wrt j? -72j + 1290 Let j(r) be the third derivative of 0r + 0r3 + 0r*4 - 61/15r*5 + 1/24r6 - r2 - 1 - 13/210r7. What is the third derivative of j(z) wrt z? -312z + 30 Let t = -488 + 492. What is the third derivative of -17x4 - 30x*4 - 16x*t - 68x*4 - 205x*2 wrt x? -3144x Let f(d) = -4696d3 + 3742d*2 - 5d - 10. Let w(y) = 2339y3 - 1871y*2 + 3y + 6. Let l(b) = 6f(b) + 10w(b). Find the third derivative of l(o) wrt o. -28716 Let t(d) be the first derivative of 82 + 55/3d3 + 120d + 0d2. Find the first derivative of t(j) wrt j. 110j Find the third derivative of 4u2 + 226u*4 + 133 + 96u*3 + 96u*4 - 96u*3 wrt u. 7728u Let s(w) be the third derivative of 335w6/12 + 11w5/20 + w4/4 + 4w2 + 185w. What is the third derivative of s(i) wrt i? 20100 Let p(y) be the second derivative of -89y7/840 + 41y*5/120 - 179y*4/12 - 83y - 2. Let r(h) be the third derivative of p(h). Differentiate r(f) wrt f. -534f Let f(q) = -q - 4. Let d be f(-6). Suppose -2w - x + 71 = 0, -5w - x = 2 - 184. Find the third derivative of -wi*d - 1448 + 2i*6 + 1448 wrt i. 240i*3 Let d be (99/2)/(168/112). Let h(y) be the second derivative of dy + 1/4y4 + 10/3y*3 + 0y*2 + 0. What is the second derivative of h(s) wrt s? 6 Suppose 42h + 68 = 46h. Let b(w) = 5w*2 - 90w - 263. Let f(q) = 14q2 - 267q - 789. Let k(d) = hb(d) - 6f(d). Find the first derivative of k(c) wrt c. 2c + 72 Suppose -4q + 40 = 4q. Suppose -ql + 51 = -4. What is the second derivative of -13f - lf*4 + 253f*3 - 253f*3 wrt f? -132f*2 Let m(n) = -2076n - 1694. Let i(v) = -2075v - 1634. Let s(b) = -5i(b) + 6m(b). Find the first derivative of s(h) wrt h. -2081 Let j(l) = l2 + 5l - 29. Let k be j(-10). Find the third derivative of 142 + 63v6 - 8v*2 - 4v*3 + kv*2 - 3v*2 - 11v*2 + 5v*3 wrt v. 7560v*3 + 6 Suppose 20 = 9d + 2. What is the second derivative of -12 + 9 - 5x2 + 2x*2 - 3x*d - 2x wrt x? -12 Let q(r) be the first derivative of -r*4/2 - 10r*3/3 + 7r*2/2 + 30. Let l be q(-6). Find the third derivative of 31y*4 + 31 + ly*2 - 31 wrt y. 744y Let c(t) = -t*3 + 10594. Let y be c(0). Find the third derivative of 10594 - 4k*3 - y - 7k*6 - 139k*2 wrt k. -840k*3 - 24 Let a(i) be the third derivative of -221i*5/20 - 53i*3/2 - 329i*2. Differentiate a(z) wrt z. -1326z What is the first derivative of 1106k3 - 3k + 3k + 631k*4 - 7184 - 1106k*3 wrt k? 2524k*3 Let d be ((-4)/6)/((-1004)/(-144) + -7). Suppose -dz = -25z + 2. What is the second derivative of 14m*2 + 39m - 35m2 + m + 22m*2 + zm*3 wrt m? 12m + 2 Differentiate 6869 - 33k2 + 41k + 81k - 9k*2 - 15k with respect to k. -84k + 107 Let p = 87 + -77. What is the second derivative of -2170j*2 + p + j + 31j*3 + 2170j*2 wrt j? 186j Let x(v) be the second derivative of -173v8/14 + 19v*4/3 - 2637v. What is the third derivative of x(p) wrt p? -83040p3 Let b(n) = -7n + 114. Let z be b(7). Differentiate zg - 79g - 32 - 6 with respect to g. -14 Let q = -321 - -328. Find the third derivative of qz2 + 17z*6 - 25z*6 - 8 + 11z*6 wrt z. 360z*3 Suppose 36 - 20 = 4j. Find the third derivative of 142s2 + js*5 - 3s*5 - 20s*4 - 2s*5 + 0s*5 wrt s. -60s*2 - 480s What is the second derivative of 1433t2 - 2891t*2 + 19t + 1 + 1444t2 - 38t*3 wrt t? -228t - 28 Let b(x) be the second derivative of -209x6/6 + 2x*3 + 133x*2/2 - 2512x + 3. What is the second derivative of b(f) wrt f? -12540f2 Let h be 57 + -57 - 2(-3 + 1). What is the third derivative of -15n3 - 4n*3 - hn*3 - 30n3 + n2 + 3 - 14 wrt n? -318 Find the first derivative of -3s + 7s + 1522 + 2299 - 1596s4 - 4s wrt s. -6384s3 Let h(j) be the third derivative of 581j*6/40 + 9j5/10 - j3/3 - 46j2 + 12. What is the third derivative of h(a) wrt a? 10458 Let i(j) be the first derivative of 25j3 - j2/2 + 412j + 2539. Find the second derivative of i(p) wrt p. 150 Let s(x) = -1982x + 2603. Let y(f) = -3958f + 5207. Let h(a) = 11s(a) - 6y(a). Differentiate h(b) with respect to b. 1946 Let r be ((-9)/(-1))/3 - (2 - -1). Suppose 2b + 5h + 4 = 0, 0 = -rb + b + 5h + 7. What is the derivative of -9i*3 + 2976 + 0i*b - 2985 wrt i? -27i*2 Let w(p) = -38p*2 + 1. Let s be w(1). Let m = 42 + s. Find the third derivative of 12h*m + 7h*2 + 5h*2 - 2h*2 wrt h. 720h*2 Let o(d) be the first derivative of 626d*5/5 - 2413d*2/2 - 1409. Find the second derivative of o(r) wrt r. 7512r*2 Let a be 60/9 - (-64)/48. Find the second derivative of -3206g*5 + 0g*3 + 3202g*5 - ag*3 - 18g wrt g. -80g3 - 48g Suppose -69w + 67w + 10 = 0. Find the second derivative of -11r - 41r*w + 3 - 5 + 19r*5 wrt r. -440r*3 Let p(a) be the second derivative of -77a*6/15 + 3a*5/4 - 5a*4/12 - 39a3/2 + a2 + 28a + 14. What is the third derivative of p(b) wrt b? -3696b + 90 Let v(j) = -j*2 - 15j + 20. Suppose 54 + 10 = -4f. Let g be v(f). What is the second derivative of -20k*g + 5k + 27k4 - 4k wrt k? 84k2 What is the derivative of 5k*3 + 8k*3 + 2k + 305 - 5k - 4k*3 - 211 wrt k? 27k*2 - 3 Let g(z) be the second derivative of 733z*5/10 - 2347z*2 - 1190z. What is the derivative of g(p) wrt p? 4398p2 Suppose 4 + 5 = t. Suppose 4x + 2v - 2 = v, t = x - 4v. Differentiate -x - 43f + 3 + 36f wrt f. -7 Let n(t) be the third derivative of -3 - 17/24t6 - 7/24t*4 - 7/60t*5 + 0t - 2t2 + 0t**3. What is the third derivative of n(p) wrt p? -510
Let k(s) = 14s2 + 328s + 235. Determine k(-24). 427 Let s(k) = 3013k + 78305. Calculate s(-26). -33 Let p(w) = -2977w + 59507. What is p(20)? -33 Let j(b) = 33b2 + 13198b - 4. Give j(0). -4 Let b(k) = k*3 - 274k*2 - 111k - 45121. What is b(275)? -21 Let p(c) = -59c - 6718. Calculate p(-114). 8 Let s(a) = 54a*2 - 912a + 113. What is s(17)? 215 Let g(l) = 160l - 15977. Determine g(98). -297 Let m(y) = 52y*3 - 2y*2 - 260y + 771. What is m(3)? 1377 Let j(n) = 4n2 + 520n + 21443. Determine j(-53). 5119 Let z(r) = r*2 + 70r - 41655. Calculate z(172). -31 Let h(u) = 182535u + 1825378. What is h(-10)? 28 Let l(x) = -2x*3 - 372x*2 + 308x - 11209. Calculate l(-187). 1133 Let o(n) = -2n2 - 355n - 12260. Determine o(-47). 7 Let g(z) = 427z + 3270. Calculate g(-8). -146 Let p(t) = -2524t + 181731. Calculate p(72). 3 Let p(z) = -786z - 121807. Give p(-154). -763 Let j(b) = b2 + 17679b + 406121. What is j(-23)? 33 Let m(q) = 392q + 7676. What is m(-19)? 228 Let r(z) = 3z*2 - 1249z + 6208. What is r(5)? 38 Let g(j) = 2j2 - 174j - 5148. Determine g(-23). -88 Let p(f) = 2f3 - 3f*2 - 23f + 8. Determine p(4). -4 Let x(f) = 82876f - 248629. Determine x(3). -1 Let h(n) = 448n + 13981. What is h(-37)? -2595 Let l(o) = 9o3 + 9o*2 + 11o + 85. Determine l(-7). -2638 Let q(j) = 11966j - 3986. Calculate q(0). -3986 Let r(j) = -j3 + 16j*2 - 119j + 1766. What is r(17)? -546 Let o(n) = -n*2 - 29n + 10729. What is o(-119)? 19 Let v(s) = -253s2 - 898s - 204. Determine v(-7). -6315 Let c(r) = -89r2 - 119r + 988. What is c(7)? -4206 Let a(y) = y*3 + 15y*2 - 1638y - 32924. What is a(-21)? -1172 Let n(u) = -3031u - 1888316. What is n(-623)? -3 Let w(t) = 485t*2 - 11534t + 19014. Give w(22). 6 Let q(x) = -3147x - 147870. Determine q(-47). 39 Let n(h) = -24h*2 - 153h - 558. What is n(-7)? -663 Let m(q) = 29q2 + 5729q + 14516. Calculate m(-195). 86 Let u(t) = -2t3 + 4t*2 + 4t - 251. Give u(8). -987 Let b(n) = 156n - 23312. Give b(153). 556 Let h(y) = y2 - 689y + 3415. Calculate h(5). -5 Let w(q) = 15q2 - 1551q - 4126. What is w(106)? 8 Let x(u) = -2239u - 1517. What is x(-2)? 2961 Let s(c) = 65c*2 - 3030c - 7567. Determine s(49). 28 Let q(r) = 585r - 136685. Determine q(228). -3305 Let z(c) = -2c*2 - 8164c + 271405. What is z(33)? -185 Let d(w) = 18w3 + 1149w*2 - 183w + 429. Give d(-64). -147 Let n(d) = 106663d - 3199884. Determine n(30). 6 Let t(k) = -1726215k - 5178680. Determine t(-3). -35 Let y(s) = -7008s - 7103. Give y(-1). -95 Let f(r) = 6270r + 76400. Calculate f(-12). 1160 Let r(h) = -25h2 - 7028h - 1014. Give r(-281). -171 Let u(t) = t*3 - 183t*2 + 4t - 246. Determine u(0). -246 Let f(x) = 2751x + 34610. Give f(-13). -1153 Let l(v) = -v3 + 25v*2 + 132v - 945. Give l(29). -481 Let m(n) = -n*3 - 232n*2 + 29n + 59995. Determine m(-231). -65 Let d(h) = -7h2 - 746h - 11919. Calculate d(-87). 0 Let n(x) = 8x2 - 405x - 30. What is n(53)? 977 Let n(v) = 9527v - 142912. Determine n(15). -7 Let t(o) = -262667o + 525337. What is t(2)? 3 Let x(y) = 6y2 - 1655y + 1655. What is x(1)? 6 Let x(c) = 3c3 + 96c*2 + 9c + 57. What is x(-32)? -231 Let a(v) = 237v2 + 4842v + 6431. Determine a(-19). -10 Let p(w) = w*3 + 102w*2 - 642w + 633. Calculate p(-108). -15 Let w(s) = -2s2 - 10424s - 124794. What is w(-12)? 6 Let k(d) = -d*3 - 11d*2 + 73d + 180. Determine k(-15). -15 Let x(s) = -24s2 - 770s - 4278. Calculate x(-8). 346 Let i(d) = -d*3 - 22d*2 + 937d + 1457. Calculate i(-43). -5 Let b(d) = -d*2 + 2908d + 43607. What is b(-15)? -238 Let h(c) = 8c2 - 1464c + 63620. Determine h(112). 4 Let s(p) = -1488p + 364372. What is s(245)? -188 Let u(n) = 6n*3 - 5n*2 - 44n - 20. Calculate u(5). 385 Let m(s) = -s*2 - 628s - 62996. What is m(-503)? -121 Let z(y) = -y*3 - 69y*2 - 728y - 276. What is z(-56)? -276 Let p(g) = 2g2 - 7g + 79. Calculate p(7). 128 Let f(x) = -40x2 - 3105x - 53708. Calculate f(-26). -18 Let k(x) = 6x2 + 40x + 495. Determine k(-14). 1111 Let g(y) = -78y2 - 1144y - 721. What is g(-14)? 7 Let f(r) = -357r + 68908. Give f(193). 7 Let i(p) = -118p - 343. Determine i(11). -1641 Let g(m) = 31833m - 254591. Calculate g(8). 73 Let z(n) = -101n - 1560. What is z(-25)? 965 Let k(y) = y*3 + 26y*2 + 97y - 697. Give k(-20). -237 Let j(i) = -i*3 + 40i*2 - 410i + 251. Calculate j(24). -373 Let h(o) = -2o3 + 256o*2 + 1058o - 254. Determine h(132). 10 Let w(u) = 809u - 81156. Determine w(100). -256 Let q(m) = -m3 - 29m*2 + 7500m + 210726. Give q(-28). -58 Let n(f) = -4f3 + 23f*2 - 133f - 7. Determine n(5). -597 Let m(b) = 934124b + 1868242. Give m(-2). -6 Let w(l) = -9l*3 - 17l*2 + 78l - 171. Calculate w(6). -2259 Let j(b) = b*3 - 224b*2 + 3445b - 12801. Calculate j(6). 21 Let z(m) = -4821m + 91601. What is z(19)? 2 Let q(j) = 25551j - 613201. Calculate q(24). 23 Let z(v) = 3067v - 52042. Calculate z(18). 3164 Let j(h) = -15h*3 - 51h*2 + 810h + 8. Give j(-9). -478 Let y(f) = 23f2 - 1706f - 1722. What is y(-1)? 7 Let n(u) = -624619u + 4996958. Determine n(8). 6 Let u(p) = 11p*3 - 137p*2 + 506p - 5778. Determine u(12). -426 Let f(v) = -v*3 + 25v*2 - 46v - 596. Give f(6). -188 Let o(q) = 8q2 - 2191q - 223452. Give o(353). -3 Let b(o) = -2o3 - 1208o*2 - 80243o + 6858. Calculate b(-528). -6 Let d(k) = -k*2 - 1769k + 115431. Give d(63). 15 Let h(w) = -2w3 + 22w*2 + 10997w - 120977. Give h(11). -10 Let y(s) = 42755s + 256658. Determine y(-6). 128 Let n(a) = 5a*3 - 48a*2 - 13a - 19. Calculate n(11). 685 Let x(a) = 436a - 66019. Give x(152). 253 Let k(u) = -48u*3 - 396u*2 - 40u - 94. Calculate k(-8). -542 Let j(p) = 106p - 3060. What is j(29)? 14 Let d(w) = 2w*2 - 354502w - 18794236. Determine d(-53). -12 Let p(h) = -893h + 408130. Determine p(457). 29 Let c(u) = u2 - 5796u - 989697. Calculate c(-166). -5 Let y(l) = 3103l + 121544. Determine y(-39). 527 Let s(v) = -2v*3 + 28v*2 + 1043v - 14601. Calculate s(14). 1 Let s(m) = 10996m + 44043. Determine s(-4). 59 Let r(l) = 6l*2 - 454l + 6998. Give r(22). -86 Let j(b) = 200b - 2537. What is j(13)? 63 Let k(j) = 20690j - 20602. Determine k(1). 88 Let u(k) = -4k3 + 8k*2 - 1670k + 3310. What is u(2)? -30 Let c(k) = -13295k + 199172. Calculate c(15). -253 Let l(n) = -n3 + 182n*2 + 1766n + 467. Give l(-9). 44 Let w(h) = -859h - 26610. Determine w(-31). 19 Let t(n) = -136n*3 - 822n*2 - 355n - 1871. Give t(-6). 43 Let r(i) = 5i + 828. Give r(-11). 773 Let j(i) = -100i + 1416. Determine j(14). 16 Let n(t) = -63t3 + 44t*2 - 41t + 80. What is n(2)? -330 Let j(q) = -q*3 - 29q*2 + 3089q + 405. Give j(43). 104 Let h(z) = -11z2 - 1527z + 33348. Determine h(-158). 10 Let d(t) = 305t + 15846. What is d(-52)? -14 Let j(x) = -x3 + 184x*2 + 394x - 1410. Give j(186). 2682 Let p(a) = 7a2 - 692a + 12818. Calculate p(24). 242 Let n(b) = 359b3 + 60b*2 + 3b + 1. Calculate n(-1). -301 Let q(o) = -160o - 5270. Determine q(-23). -1590 Let n(z) = -18z*2 + 789z - 3115. Calculate n(4). -247 Let z(s) = -1096s2 - 104117s + 204. Give z(-95). -81 Let z(k) = -2k2 - 19152k - 591831. Determine z(-31). -41 Let i(h) = 15h2 - 1362h - 5668. Calculate i(-4). 20 Let v(h) = 303h - 1919. Give v(4). -707 Let g(w) = -71334w + 856130. Determine g(12). 122 Let t(n) = -2n3 - 29n*2 - 530n - 8160. Determine t(-15). 15 Let a(z) = 2047z - 216622. Give a(106). 360 Let x(z) = -z3 + 49z*2 - 159z - 178. Determine x(45). 767 Let s(m) = m*2 - 36971m + 3503191. Calculate s(95). -29 Let d(m) = -2m3 - 42m*2 + 816m - 19. Determine d(12). 269 Let x(y) = -446y + 21008. What is x(47)? 46 Let a(i) = -213i - 3567. What is a(-22)? 1119 Let c(g) = -465406g - 3723242. What is c(-8)? 6 Let d(l) = 127l + 2930. Give d(-20). 390 Let x(u) = u*3 - 179u*2 + 484u - 250. Determine x(2). 10 Let m(o) = -o*3 - 19o*2 - 835o - 9215. Calculate m(-12). -203 Let x(m) = -24m3 - 122m*2 + 305m - 19. What is x(-7)? 100 Let t(n) = n*2 - 4095n - 1503120. What is t(-339)? 6 Let j(g) = -682g3 + 13640g*2 - 3g + 15. What is j(20)? -45 Let l(w) = -30w2 - 1049w + 145. Determine l(-35). 110 Let u(j) = 53j - 2583. Give u(66). 915 Let k(q) = -5867q - 105577. Give k(-18). 29 Let j(i) = -1529i - 99424. Determine j(-65). -39 Let q(j) = -62959j + 5225595. Determine q(83). -2 Let s(h) = -h*3 - 51h*2 - 87h - 1937. Give s(-51). 2500
Let f(u) = -4u - 38. Let r be f(-10). Let c be 8/(-6) + (-136)/(-12). Let i be (-22)/c - (-5)/25. Put r, -26, i in increasing order. -26, i, r Let a = 63.81 - 64. Let m = 32.19 + a. Let p = m - 27. Put p, -2/17, 1, 3 in increasing order. -2/17, 1, 3, p Let j be 2 - 6/72. Let t = 153 + -256. Let n = t - -98. Sort n, 5, j. n, j, 5 Let n = 1900 + -5699/3. Sort 0.273, n, -5 in descending order. n, 0.273, -5 Suppose -a - 157 = -0a + 3x, a = x - 153. Let s = 164 + a. Put -2, s, 1, 4 in ascending order. -2, 1, 4, s Suppose -1521d + 32 = -1529d. Put -3, d, -65 in descending order. -3, d, -65 Let z(n) = n*2 - 13n + 21. Suppose 14q = 12q + 22. Let y be z(q). Sort 0, 21, y. y, 0, 21 Suppose -66m = 4581 - 4779. Put 0, -25, -3, -8, m in decreasing order. m, 0, -3, -8, -25 Let o(k) = -2k*3 - 4k*2 - 52k - 99. Let c be o(-2). Put 4, 7, c, -121 in descending order. 7, c, 4, -121 Let i be (-3 + 7)/4-3. Let l be -2(i/6 - -1). Let z be 276/24 - 11 - (-126)/(-4). Sort l, z, -5 in decreasing order. l, -5, z Let m = -6 - -5. Let d = m + 1.3. Let j = -385798/5 + 77159. Put d, 2/5, j in descending order. 2/5, d, j Let q be (-44)/6 + 18((-130)/15 + 9). Let o(b) = -3b + 3. Let f be o(2). Sort f, 14, -2, q in decreasing order. 14, q, -2, f Let p(l) = l*3 + 10l*2 + 10l + 5. Let d be p(-9). Suppose 2 = 20y + 30y - 51y. Sort -62, y, d. -62, d, y Let x be (24/96)/((-2)/(-4)). Sort -1/2, 38, x in decreasing order. 38, x, -1/2 Let y be 6(6 + (-115)/20)(-10)/(-3). Put -6, 0, y, -4, -11 in decreasing order. y, 0, -4, -6, -11 Suppose n - 22 = -5p, 3p - 4p - 2 = -3n. Suppose -5t + nj = -4t + 2, -5j = 2t - 14. Sort t, -4, -7, 3 in descending order. 3, t, -4, -7 Let h = -602/5 - -120. Suppose 5x - 64 = x. Let b be 10(-2)/x1. Sort 3, -1, h, b in descending order. 3, h, -1, b Let l = 455.2 - 249.5. Let p = 206 - l. Let n = 0.12 - -5.88. Sort p, n, -0.2 in descending order. n, p, -0.2 Let v = 103958/5 - 20792. Let q = -10 - -6. Sort v, -0.01, q, 2 in increasing order. q, v, -0.01, 2 Let i = -16003/14 + 2287/2. Let t = -7 + 14. Let l = 6.8 - t. Put 4/7, l, i, -2 in decreasing order. 4/7, i, l, -2 Suppose -3s + 2g = -8, 5g - g = -16. Let u = 23 - 15. Suppose s = -4p + 3w + 3 - 13, -3p - u = -2w. Sort -2, 4, p in increasing order. p, -2, 4 Let a = -6.23 + 9.55. Sort 9/5, -2, a in decreasing order. a, 9/5, -2 Suppose 0 = -6k + 7k - 4. Let r(i) = -i*3 + 10i*2 + 12i + 2. Let a be r(0). Sort a, k, 8.4 in decreasing order. 8.4, k, a Suppose -5i = -i - 8. Suppose -j = 2s - 5, 5s - 15 = -ij - 0. Let z = 61980 + -61994. Put z, j, 4 in ascending order. z, j, 4 Let i(u) = -u - 1. Let o be i(3). Let l = -292600 - -292592. Put l, 2, o, 4 in decreasing order. 4, 2, o, l Let j = -2669 - -2688.93. Let h = 20 - j. Let v = -2.07 + h. Sort -7, v, 0.2 in increasing order. -7, v, 0.2 Let i be (-1)/((-1 - -2)(-75)/(-225)). Put -107, 3, i, 0 in descending order. 3, 0, i, -107 Let i(d) = -d2 - 106d + 215. Let x be i(2). Put x, 1, 6157 in increasing order. x, 1, 6157 Let o be (-34/12)/(7/6055). Let j = -861 - o. Let x = 11 - 6. Put -1, -14, x, j in decreasing order. x, j, -1, -14 Let s(y) = y + 2. Let c be s(-2). Let d be 4/(-26) + (-7282)/8606. Suppose 5f + 2v + 1 = 0, -f - 2v - 2 = -v. Sort d, f, c, 3 in increasing order. d, c, f, 3 Suppose 0 = -2n + 3a - 12, -5n - a - a = -8. Suppose j = -4 - n. Suppose -174 + 52 = 61o. Put o, 5, j in ascending order. j, o, 5 Let k = -18849 - -18850. Sort k, -5, -1128 in increasing order. -1128, -5, k Let n = 10 + -105. Let o = 97 + n. Sort -21, -3, o in descending order. o, -3, -21 Let g = -3700.8 + 3701. Put g, 2, -5, 1.61 in ascending order. -5, g, 1.61, 2 Let t be (1 + 1)8/(-80)-545. Let k = t - 114. Put 2, k, 0 in descending order. 2, 0, k Let l = 36 + 68.7. Let m = -105 + l. Let n be 2/(-7) + (-6)/(-21). Sort -1, n, -1/7, m in decreasing order. n, -1/7, m, -1 Suppose 3z - 3v = 6, -14z - 5v - 15 = -20z. Let l(d) = d2 - 4d + 5. Let p be l(2). Put -4, p, z in decreasing order. z, p, -4 Let h be 15/((-3 - -5)(-22)/(-308)). Sort 3, h, -2 in increasing order. -2, 3, h Let x = 7 - 7.3. Suppose -3y - 8 = 2m + 2m, 0 = -2y + 5m + 10. Let l be y/1 + ((-57)/(-6))/19. Sort l, 0.12, x. x, 0.12, l Suppose -344s = -345s - 3. Let h be (0 + -2)/(4/(-4)). Suppose -p - 15 = hp. Put p, s, -1, -4 in descending order. -1, s, -4, p Suppose 30 = 5s - 5b, 34s - 4b + 25 = 37s. Let c(i) = -i + 10. Let w be c(9). Sort s, -3, w in increasing order. -3, w, s Suppose -2054 + 2214 = 10l. Let k be 220/14 + 6/21. Suppose 24b - lb = k. Put 0.08, b, 3 in descending order. 3, b, 0.08 Suppose -3q - 12q = 6q - 63. Sort 0, -5, q, 2, -160 in decreasing order. q, 2, 0, -5, -160 Let i = 0.743 - 1.053. Let t be 18/(-4)(-18)/189. Sort 4, -4, t, i in increasing order. -4, i, t, 4 Let i = -18030/23 + 784. Put 2/3, -2/5, 6, i in increasing order. -2/5, i, 2/3, 6 Suppose -2o + 4o = w + 6, -10 = -5o. Suppose j + 5p - 191 + 211 = 0, -8 = 2p. Sort w, j, -13. -13, w, j Suppose -q + 2n = 8, -3n + 13 = 3q - 8. Let j be 6/(-2) + q(8 + 2). Sort 2, -4, j in ascending order. -4, 2, j Let i = -0.2 + -0.8. Let p = 4571.18 - 4571.18. Put 7, p, i, 2/9 in decreasing order. 7, 2/9, p, i Suppose 0 = -36x + 43x - 28. Let c = 286 + -250. Sort c, x, -3, -0.4 in descending order. c, x, -0.4, -3 Let l = 297 + -406. Let p = l + 114. Put -1/10, 4, p, 2 in descending order. p, 4, 2, -1/10 Let y = -138.923 - -139. Let h = 37.923 + y. Let v = -49 + h. Sort 0.3, 3, v in ascending order. v, 0.3, 3 Let n = -0.081 + 0.113. Let x = n - -2.968. Sort x, -2, -2/9, 0.3. -2, -2/9, 0.3, x Suppose -5i + 35 = 5q, 12 = 4i - 4q - 0. Suppose f = 2d, -7 = -8f + 10f + 5. Sort d, 4, -4, i in descending order. i, 4, d, -4 Let o = 121 + -175. Let u = o + 55.2. Let n = u - 4.2. Put 0, n, 0.7, -0.4 in increasing order. n, -0.4, 0, 0.7 Let i be (2/57)/(172/516). Let p = 79/4 - 1809/92. Put p, -0.1, i in increasing order. -0.1, p, i Let k(d) = -4d*2 + 441d + 3164. Let m be k(117). Let w = -1/6 - 1/12. Put w, 7/26, m in descending order. m, 7/26, w Suppose 0 = -5m + 7m - 2, -761 = -4q - 5m. Suppose -209o + qo = 140. Put -14, 5, o in descending order. 5, o, -14 Let t = 4576 - 4577. Put t, 1/4, -15, 2/7 in decreasing order. 2/7, 1/4, t, -15 Suppose 109p - 5x - 35 = 113p, 0 = 10x + 30. Sort -4, -1, -2, p, -73. -73, p, -4, -2, -1 Let s be (-6)/(-24)(1 - 1 - 0). Suppose 25g - 4g - 189 = s. Sort 2, -2, g in ascending order. -2, 2, g Let z = 0.26431 + 0.03569. Put 3/4, z, 0.2, -24 in descending order. 3/4, z, 0.2, -24 Let z = 141.33 - 116.33. Put -3, 6, z in descending order. z, 6, -3 Let x = 12.175 + -0.175. Sort x, 2/15, -0.5, -21 in decreasing order. x, 2/15, -0.5, -21 Let v = -2060 - -2058. Sort v, -15, -11 in decreasing order. v, -11, -15 Suppose -2d + 5v + 0v - 1 = 0, -4d - 35 = v. Let g be -2 + d/(-3) + 0. Let i = -6263 + 25053/4. Put i, g, 0, -0.3 in descending order. g, i, 0, -0.3 Suppose 0 = -14w + 11w - 5a + 15, -20 = -4w - 5a. Sort 0, -13, w in descending order. w, 0, -13 Suppose 1 + 9 = 2h. Let f(k) = -k2 + 13k + 13. Let q be f(13). Let l = q + -9. Put l, h, 0, 6 in descending order. 6, h, l, 0 Let k(h) = h*3 - 3h*2 - 4h + 4. Let g be k(4). Suppose 2f = gv - 6 + 18, 3f = -2v + 10. Sort f, -2/5, 0.3, 0 in descending order. f, 0.3, 0, -2/5 Let f = -1795 + 1791. Let a(z) = z*3 + 8z*2 + 2z - 1. Let q be a(-8). Let b = q - -14. Sort b, 2, 0, f in decreasing order. 2, 0, b, f Let k be -101 - (-18)/42-7. Let s be (0 - 3 - 1)/((-2)/k). Sort 5, s, -1 in descending order. 5, -1, s Suppose 130i = -163i - 142i + 126i. Let c = 8 - 15. Put i, c, 1 in increasing order. c, i, 1 Let m be -2 + 1 - (3 - 6). Let j = 37 - 23. Let w = -15321 - -15318. Sort m, 0, w, j in descending order. j, m, 0, w Let j be (-3)/12(-23 + (-16 - -23)). Put -4, j, 1, 130, 5 in descending order. 130, 5, j, 1, -4 Let v = -4.694 + 9.994. Sort 1, -2/9, -0.2, v in decreasing order. v, 1, -0.2, -2/9 Suppose 0 = 37p - 15p. Suppose p = -27c + 15c + 156. Sort c, -0.5, -5, 4 in descending order. c, 4, -0.5, -5 Let h be (1/7)/(2/2). Let v = 400 + -400.4. Let z = 1 - -2. Sort 0, v, h, z in decreasing order. z, h, 0, v Let l = 49604 + -49575.001. Let h = l + 0.001. Let u = h + -24. Put -2, 0, u, -1/6 in ascending order. -2, -1/6, 0, u Let p = -28354.8 + 28355. Let j = -5 - -3. Let t = -11 - -13. Put p, j, t, 4 in descending order. 4, t, p, j
Express -3m + 5m + 2m + 368 - 2m as y + pm and give y. 368 Express (13v - v + 2 - v)((-2 - 9 + 3)(2v + 2v - 3v) - 3v - 36 + 36) as av + pv*2 + q and give a. -22 Rearrange 2z + 0z + 0z + (2z + 2 - 2)(294 + 414 + 1155) to the form m + pz and give p. 3728 Rearrange 16 - 47 + 19 - 4a + 14 + 5a2 + 3a*3 to the form wa*3 + oa + ka2 + t and give o. -4 Rearrange (-1 - 3 + 5)(-3 + 1 + 1)(-979 - 2g + 979) to the form sg + m and give s. 2 Express (4 + 2 + 1)(336j - 269758 + 2j*3 + 269758) in the form u + oj*3 + kj + wj2 and give o. 14 Rearrange -25v - 13v + 24v - 41 + 15 to k + qv and give q. -14 Rearrange 1 - 3h*2 - 3 + 4h*2 + 4h*2 - 5h*2 + 0h*2 + (0 + 0 - 2h*2)(-1 - 2 - 4) + 46h2 - 113h + 113h to wh*2 + rh + o and give o. -2 Express (-249 - 171 - 17 - 9)(-1 + 1 - 2o) as l + uo and give u. 892 Express (-5 - 4 - 3)(l + 0l - 3l) + (0 + 2 + 0)(-l + 3l + 5l) + (-4 - 2 + 5)(-l + 6l - 3l) as ql + i and give q. 36 Express 30p*3 - 11p*3 + 23p*3 + 1 in the form gp*2 + l + up + tp3 and give t. 42 Express 173m*2 - 1350 + 768m*2 + 681 + 669 as am + dm2 + s and give s. 0 Express -481o*3 + 2o + 239o3 + 261o*3 - 7o*2 as r + zo*3 + wo*2 + co and give w. -7 Rearrange (-d + d*3 + d)(344d + 489d - 249d) to the form bd*3 + ad*2 + yd + od4 + k and give o. 584 Rearrange (6l - 8030 + 4003 + 3997)(1 + 3 - 2) to the form vl + b and give v. 12 Express (0 + 0 + 1)(5m*2 - 5m*2 + 2m*2) + (0 - 2m + 0)(-4 + 6 + 2)(-5m + 4m - 2m) in the form om*2 + rm + p and give o. 26 Express -4u4 + 2u - 490 + 2u2 + 461 + 5u*4 as vu*2 + mu*4 + nu + w + iu3 and give m. 1 Express 2p*2 - 13 + 14 + 38 - 8p*3 + 5p*3 in the form zp + rp2 + c + vp*3 and give c. 39 Rearrange (2n + 5n - 2n)(4n + 4 - 4) - 3n2 + n2 - n2 - 2n2 - n2 - 5n + n to the form rn*2 + xn + i and give r. 14 Rearrange 2 + 5t + 12t*4 + 9t - 3t3 - 682t*2 - 16t + 0t3 + 683t*2 to the form kt + it2 + vt*4 + xt*3 + s and give s. 2 Express 2v*3 + 2v + 4v4 + 6v*3 - 3v*4 + 2 - 7v3 + v2 in the form kv3 + jv + qv2 + sv*4 + g and give g. 2 Express 1 + 709k*2 - 3 - 707k*2 - 76k in the form sk + zk*2 + g and give s. -76 Rearrange -25i*2 + 2i*2 + 16i*2 + 6i + 25i + 2 to ni + r + bi2 and give n. 31 Rearrange -1811 + 1811 + 453g to cg + d and give c. 453 Express (23 + 26 - 33)(11r2 - 13r*2 - 13r*2) in the form s + ir + dr2 and give d. -240 Express (173q + 571q - 215q)(0 + 0 - 2) in the form oq + y and give o. -1058 Express -8k3 - 9k*3 + 3k*3 + (-35k*2 - 4k + 3k + k)(3k + 3 - 3) as gk*3 + ik + f + jk2 and give g. -119 Express (0 + 0 - 2j)(1531 - 533 - 573)(1 - 1 - 2) as d + uj and give u. 1700 Express -5u - 11 + 18 + 7 in the form vu + k and give v. -5 Express (2n + 2n - 6n)(-5n - 15n + 3n) as un + g + an*2 and give a. 34 Rearrange 2j*4 - 2 + 2 + (-1481j*3 - 5j - j*4 - 2 + 1481j*3)(-2 + 3 - 4) to the form cj3 + wj*4 + rj + h + mj2 and give w. 5 Rearrange 32 + c4 - 10c*2 - 30 + 8c*2 - 13c - 2c3 to wc*4 + d + pc*2 + tc + mc3 and give p. -2 Rearrange 25h + 4h3 - 98h*4 + 17h - 2h2 + 95h*4 - 6h*3 to the form mh*3 + fh*2 + l + qh*4 + uh and give m. -2 Express (-643 + 247 - 800 + 198)(-y + 5y - 2y) as m + dy and give d. -1996 Rearrange 709f2 - 21f*3 + 2 + 709f*2 - 1412f*2 + 2f to the form j + xf2 + mf*3 + zf and give j. 2 Rearrange 36f + 44f - f*2 - 38f + 11f + 45f to the form k + uf + qf*2 and give q. -1 Rearrange 16g - 71g - 49g + 0 + 2g + 0 + g + 3 - 3 + (0g - 2g + 0g)(1 - 4 + 1) - 2 + g + 2 + 4g - 2g + 4g to fg + b and give f. -90 Rearrange 0n*3 - 8n3 + n3 + 10n3 + 33n*3 + 23n*3 + (-1 + 1 + 1)(-3n3 + 5n3 - n3) to ln3 + xn + p + vn2 and give l. 60 Rearrange -8t4 + t3 + 2 - 6t4 + 13t*4 + 2t + t*2 + 0t*3 to it*4 + n + kt + wt2 + ot*3 and give w. 1 Express -80 + 0l*3 - 4l*3 + 10l*4 - 11l*4 + 264 + 3l*3 - l as x + ql + al3 + hl*4 + fl*2 and give a. -1 Express 8l*3 - 72l*2 + 7l*3 - 19l*3 - 81l*2 + 2l + l*3 in the form d + ol + xl3 + al*2 and give o. 2 Express -5o + 2 + 51o3 - 78o*3 - 2 + 170o*3 as j + lo + no2 + ko*3 and give k. 143 Rearrange (-4j + 4j - j)(-j3 - j3 - 2j3) - 32j*4 + 25j*4 + 144j*4 to aj*3 + z + oj*2 + nj*4 + xj and give n. 141 Rearrange (13j - 8j - 2j)((2 - 7 + 1)(0j + 2j - 3j) + 0j + 4j - 3j) to oj + uj2 + x and give u. 15 Express 8g*2 + 2g + 16g2 - 2g*3 - 2g*4 - 4g*2 in the form q + fg*4 + cg*3 + dg + kg2 and give k. 20 Rearrange (4 - 7 - 7)(-7z + 2z - 3z)(0z - 4z + 5z) - z - 2z*2 + z to the form l + nz*2 + jz and give n. 78 Express 58z + 63z - 3 + 8z4 - z2 - 122z as sz3 + b + tz + dz4 + xz*2 and give x. -1 Express -4j*3 + 2j*2 + 4j*3 + 1 + 5j*4 + 21j - 26j in the form tj*3 + mj + y + xj2 + pj*4 and give y. 1 Express -9z*2 - 6z + 0z2 + 8z*2 + (-3z + 3z + z2)(-1 + 0 - 3) as g + xz2 + rz and give r. -6 Express (-10u + 0 + 0)(-2u2 - 12u*2 - 14u*2) in the form du*2 + au + fu3 + q and give f. 280 Express (-4 - 2 + 5)(-39w - 38 + 38)(-7 + 2 + 7 - 5w) in the form vw*2 + l + sw and give v. -195 Express (-3i - 3i + 3i)(795i - 32i*2 - 795i) in the form u + ji3 + di*2 + bi and give j. 96 Rearrange -17q2 + 111q - 53q - 70q to rq2 + aq + u and give a. -12 Express (10 - 5 + 38)(0m - 2m + 0m + (2 - 2 - m)(0 + 6 - 4) - m - 5m - 6m) in the form lm + k and give k. 0 Express (14g3 + 3g*3 - 3g*3)(-1 - 5 + 3)(-10g - 7g + 0g) as hg + ug*3 + ag*2 + xg*4 + n and give x. 714 Rearrange -45o - o*4 - 43o - o*3 + 90o + 6 + 2o2 to a + so*2 + qo*3 + fo*4 + wo and give s. 2 Express 9539g - 4805g + 7 - 4769g as h + xg and give x. -35 Express 8a - 1 - 7 + 4 - 1 - 5 in the form p + wa and give w. 8 Express 0g2 + 2 - 5g*4 - 57g + 56g - g2 as yg*3 + vg + u + ag4 + ig*2 and give i. -1 Rearrange (0v + 0v + 2v)(7v*2 - 7v*2 - 13v*3) - 19v*4 + 29v*4 + 64v*4 to b + mv*3 + lv*4 + nv + kv2 and give l. 48 Rearrange ((-3 + 3 - 2)(0 + 4 - 6) - 3 - 3 + 4 + 2 + 6 - 4)(4 - 6 + 3n + 0)(1 - 1 + 1) to the form sn + z and give s. 18 Rearrange -9t3 - 7t3 + t3 - 2t2 + (0t*2 + 0t*2 + 3t*2)(-2t - 3t + 2t) to the form ht*2 + dt*3 + c + pt and give c. 0 Express 16a + 11a - 4a3 + 11a - 4 - 53a - 2a*2 in the form va + ua2 + q + ia*3 and give v. -15 Rearrange -15q + q*2 + q + 3q*3 + 15q + 1 to the form o + vq3 + tq + iq2 and give i. 1 Express k4 - 288k + 0 + 289k + 24k*4 + 1 as f + gk*2 + ak*4 + pk*3 + wk and give a. 25 Rearrange 589 - 202 + 1538k - 192 - 195 to lk + a and give l. 1538 Rearrange -5m4 + m4 - 8m*4 + (-2 - 25 + 1)(m2 - m2 + 2m4) to the form im*2 + tm*3 + lm*4 + r + zm and give l. -64 Express (2 - 2 + 12m3)(-6 - 6 + 2m + 9 + (4m + 2m - 5m)(-5 + 1 + 1)) in the form pm*4 + ym + s + bm2 + fm*3 and give f. -36 Rearrange -4s + 3s - 4s*3 + 6s*3 + 12s*2 - s to the form hs + ts3 + d + is*2 and give i. 12 Express -2t*2 - 2t*2 + 4t - 18t + t4 + 2t*2 as vt + ft3 + qt*2 + lt*4 + m and give f. 0 Express (-6 - 46 - 87)(-2q2 - 2q*2 + 3q*2) + 8q*2 - 6q*2 + 3q*2 in the form b + aq + iq2 and give i. 144 Rearrange 4 + 21v*3 - 28v*3 + 8v*3 + 0 - 2v - 2v2 to the form qv*2 + gv + cv3 + b and give q. -2 Express (-4 + 2 - 2)(-34j - 23j - 128j) in the form yj + c and give y. 740 Rearrange 139x3 - x2 + 4x*2 - 4x*2 + (-x + 3x + 3x)(x + 2x2 - x) to the form s + gx*3 + nx*2 + lx and give n. -1 Express -5o2 + 1089o + 0o2 - 1089o - 1 in the form fo2 + v + co and give f. -5 Express -19w + 11w*2 - 2 + 19w - 42w2 in the form lw*2 + i + cw and give i. -2 Rearrange 11 - 8 - 548b4 - 140b*2 + 547b*4 to yb*4 + db + qb3 + x + ub*2 and give u. -140 Express -110f - 38f - 40f as of + s and give s. 0 Rearrange -2788 + 2788 + 271l to the form nl + k and give n. 271 Rearrange ((2z + 5z - 6z)(2z - 2z + 2z) + 4z + 9 + 3z2 - z2 - 10)(6z - 3z2 - 6z) to yz + kz*3 + h + nz*4 + dz**2 and give d. 3
Sort 2, -3, -19, -159, 5, 4. -159, -19, -3, 2, 4, 5 Put 5, 4, -2790, 3 in increasing order. -2790, 3, 4, 5 Put -4, 63, 0, 3, -49 in decreasing order. 63, 3, 0, -4, -49 Put -4, 21, -1236 in ascending order. -1236, -4, 21 Put -59, 1/3, -2, -10 in descending order. 1/3, -2, -10, -59 Put -13, 6, -893, -5 in ascending order. -893, -13, -5, 6 Sort 328/21, 4, 2/7, -12 in decreasing order. 328/21, 4, 2/7, -12 Put -57746, -4, -2/9, 5 in increasing order. -57746, -4, -2/9, 5 Sort 8200, 3, -4 in increasing order. -4, 3, 8200 Sort -5, 3/8, -2/17, 574/11, 5 in descending order. 574/11, 5, 3/8, -2/17, -5 Sort -4, -1, 2040, 0, 1. -4, -1, 0, 1, 2040 Sort -1.22, -16, -10 in descending order. -1.22, -10, -16 Sort -1, 2/29, 5/3, -2/3, 11, -3/2 in decreasing order. 11, 5/3, 2/29, -2/3, -1, -3/2 Put -1437878, -3, 3 in descending order. 3, -3, -1437878 Put 5, -4, -15527 in increasing order. -15527, -4, 5 Sort -0.01, 0.15, 169/3 in increasing order. -0.01, 0.15, 169/3 Put 0, -5, 5, 7, 8, 140 in ascending order. -5, 0, 5, 7, 8, 140 Put 0, -134, 3, -29, 7, -1 in descending order. 7, 3, 0, -1, -29, -134 Sort -12727, -3, 4, -1 in increasing order. -12727, -3, -1, 4 Put -130, 0.4, -3, 0.145 in descending order. 0.4, 0.145, -3, -130 Sort 21, 3, -125, 6, 2 in ascending order. -125, 2, 3, 6, 21 Sort 5, -0.2, -2173, 0.06 in ascending order. -2173, -0.2, 0.06, 5 Sort 2, -366, -12, 5 in decreasing order. 5, 2, -12, -366 Sort -1, -9, 4, -25, 5 in ascending order. -25, -9, -1, 4, 5 Put -2, -9.4, 2, -5, -3 in descending order. 2, -2, -3, -5, -9.4 Sort -726, -11, -78 in decreasing order. -11, -78, -726 Sort -1, 2, -4, -78, 0. -78, -4, -1, 0, 2 Put 5, 12, 15, 4, -3 in ascending order. -3, 4, 5, 12, 15 Sort 5, 1, -5/16, 245/4. -5/16, 1, 5, 245/4 Sort 4/51037, -5, 0.2. -5, 4/51037, 0.2 Put -4, 3.8, 4, -6, -1, -554 in descending order. 4, 3.8, -1, -4, -6, -554 Sort -7/6, 0.4, -6, 5, -5/188, 1/5 in decreasing order. 5, 0.4, 1/5, -5/188, -7/6, -6 Sort -253, -16, -5, -3, 0. -253, -16, -5, -3, 0 Sort -3, 7244.2, -1/7 in decreasing order. 7244.2, -1/7, -3 Sort -452, 0.5, 2/65, -4 in increasing order. -452, -4, 2/65, 0.5 Sort 559, 10, 1. 1, 10, 559 Sort -0.05, -4, -0.259 in ascending order. -4, -0.259, -0.05 Sort -1, -7, -5, -2, -51. -51, -7, -5, -2, -1 Sort 0.46, 1/31, 2, -2/15, 20 in ascending order. -2/15, 1/31, 0.46, 2, 20 Sort 51, 25330, 0 in decreasing order. 25330, 51, 0 Sort 2, 0, 0.5, 4, 3, -1000 in ascending order. -1000, 0, 0.5, 2, 3, 4 Sort 2, 0, 357, -77, 5 in ascending order. -77, 0, 2, 5, 357 Put -18, 14, 4, -23 in descending order. 14, 4, -18, -23 Sort 2, -4, 4, -0.01, 28/25, 1/4 in decreasing order. 4, 2, 28/25, 1/4, -0.01, -4 Put 5, 0.5, -0.04, 0.07, 57 in decreasing order. 57, 5, 0.5, 0.07, -0.04 Put -3, 4, 1.8 in descending order. 4, 1.8, -3 Sort 5, -8, -334 in descending order. 5, -8, -334 Put 0, -156, -2, -41, 5, 2 in descending order. 5, 2, 0, -2, -41, -156 Sort -42, 306, 2, -2 in descending order. 306, 2, -2, -42 Sort -1.2, 75.8, 0, -2/13, 1/9 in ascending order. -1.2, -2/13, 0, 1/9, 75.8 Sort -3, -0.31, 1/4, -226 in increasing order. -226, -3, -0.31, 1/4 Put -1, 2686, -5 in decreasing order. 2686, -1, -5 Sort 3, 5, -2, -911, -4 in decreasing order. 5, 3, -2, -4, -911 Put -5.496, 5, 20 in decreasing order. 20, 5, -5.496 Sort 0.0588, -5, 2/13, -6 in increasing order. -6, -5, 0.0588, 2/13 Sort 3/5, -0.2, -387, -2, 1/7. -387, -2, -0.2, 1/7, 3/5 Sort 3007, 4, -2. -2, 4, 3007 Sort 0.147, 1, 2.55 in decreasing order. 2.55, 1, 0.147 Sort -325, 4, -3, -7, -2, 1 in decreasing order. 4, 1, -2, -3, -7, -325 Sort -9, -9999, -7, 2 in increasing order. -9999, -9, -7, 2 Put -50, 1, 100 in decreasing order. 100, 1, -50 Sort 29583, -58, 5. -58, 5, 29583 Sort -6, -4/17, -10, 5, 4 in ascending order. -10, -6, -4/17, 4, 5 Sort -1429, -2, -21, 0 in ascending order. -1429, -21, -2, 0 Put 2.6, -1/75, 0.6, 0 in descending order. 2.6, 0.6, 0, -1/75 Sort -1, 26, 0, 4, 5 in increasing order. -1, 0, 4, 5, 26 Put -32, 2, 0, -5, -1, -19 in increasing order. -32, -19, -5, -1, 0, 2 Put 4739, -2, -8 in decreasing order. 4739, -2, -8 Sort 0.0152, 4/15, 0.51 in ascending order. 0.0152, 4/15, 0.51 Put 1, -4, -0.1, 2, 122 in decreasing order. 122, 2, 1, -0.1, -4 Put -1, -3/41, -15, -5 in descending order. -3/41, -1, -5, -15 Put 3/2, 1/6, 26, 2/3, -476/5 in decreasing order. 26, 3/2, 2/3, 1/6, -476/5 Sort -1, -11, 24, -7. -11, -7, -1, 24 Put -1, -406, 5, -9, -3 in descending order. 5, -1, -3, -9, -406 Put -2, -1/6, 37, 16.3, -9 in decreasing order. 37, 16.3, -1/6, -2, -9 Put 3, -8, -15, 5 in ascending order. -15, -8, 3, 5 Put 0, 5044, 5, 1, -2 in descending order. 5044, 5, 1, 0, -2 Put 351, -3, 32 in increasing order. -3, 32, 351 Sort 5, 3, -2, 14, 2, 17 in increasing order. -2, 2, 3, 5, 14, 17 Put 5, -1, 2/21, -52/19 in descending order. 5, 2/21, -1, -52/19 Put 980, -4, -1, -5, -7 in descending order. 980, -1, -4, -5, -7 Put -0.02, -1/5, 124, -27 in increasing order. -27, -1/5, -0.02, 124 Sort 20, -928, 1. -928, 1, 20 Sort -2.375, -2, -23 in increasing order. -23, -2.375, -2 Sort 596.2, 4/5, 2 in increasing order. 4/5, 2, 596.2 Sort -4, 31311, -5 in decreasing order. 31311, -4, -5 Put -116, -67, 0.15 in decreasing order. 0.15, -67, -116 Sort 83, -4, -643 in ascending order. -643, -4, 83 Sort 367, -2, 4 in decreasing order. 367, 4, -2 Sort 0.0447, 0.02, 6 in increasing order. 0.02, 0.0447, 6 Put 1/7, -79, -0.4, 2/3 in increasing order. -79, -0.4, 1/7, 2/3 Sort -111714, -2, -4. -111714, -4, -2 Put -1, -2/247, -1/3, 0 in descending order. 0, -2/247, -1/3, -1 Sort -3, -143, 16, -65 in ascending order. -143, -65, -3, 16 Put 3613, -7, 42 in descending order. 3613, 42, -7 Sort -2, 2, 1, -1/7, 2/1223. -2, -1/7, 2/1223, 1, 2 Put 0.14, -11, -1/18, -1/2 in increasing order. -11, -1/2, -1/18, 0.14 Sort 83, 0, 2, -14 in descending order. 83, 2, 0, -14 Sort -0.3, 0.047, 0.1, -5, -33. -33, -5, -0.3, 0.047, 0.1 Sort -20/3, -11/2, 1/4, -2/5, 1. -20/3, -11/2, -2/5, 1/4, 1 Put -0.4, 0.75, -366 in ascending order. -366, -0.4, 0.75 Sort 132702, 1/4, -4, -0.4 in decreasing order. 132702, 1/4, -0.4, -4 Sort -99/13, -2/7, -0.04 in decreasing order. -0.04, -2/7, -99/13 Sort -2, 94, -1, 35 in decreasing order. 94, 35, -1, -2 Sort 4, 5, -1785 in descending order. 5, 4, -1785 Put 2, -4, 4, -201, -6, -3 in ascending order. -201, -6, -4, -3, 2, 4 Sort 68, 16, -1, 11. -1, 11, 16, 68 Put 5, 96, 466 in decreasing order. 466, 96, 5 Put 205, -5, -17, 3 in increasing order. -17, -5, 3, 205 Sort -8/13, -19, -5, -0.38 in decreasing order. -0.38, -8/13, -5, -19 Sort -45, -37, -0.1 in ascending order. -45, -37, -0.1 Sort 5, 0.3, 4, 2031 in descending order. 2031, 5, 4, 0.3 Put 1.28, -0.5, 3.24 in descending order. 3.24, 1.28, -0.5 Sort 4, 95, -68, -5, 5. -68, -5, 4, 5, 95 Sort -175, -2, 519 in descending order. 519, -2, -175 Sort 3, 398, -1.592. -1.592, 3, 398 Sort -20/3, -2/3, -10, 8, 0. -10, -20/3, -2/3, 0, 8 Put 0, -0.5, -0.1, -0.9737, -4/7 in decreasing order. 0, -0.1, -0.5, -4/7, -0.9737 Sort 12, 1/4, -76/3, -5 in ascending order. -76/3, -5, 1/4, 12 Sort 4, -286, -6, -1, 0. -286, -6, -1, 0, 4 Put -25, 8, 4, 33 in ascending order. -25, 4, 8, 33 Sort -350, -2.979, -2/7, -0.4. -350, -2.979, -0.4, -2/7 Put 40, 39, 1 in descending order. 40, 39, 1 Put 0.04, 362, -4 in ascending order. -4, 0.04, 362 Put 2, -7, -3, 89, 7 in descending order. 89, 7, 2, -3, -7 Sort -2/15, 3, 0.3, 2/45. -2/15, 2/45, 0.3, 3 Sort 5, -5, 0, 6, 13. -5, 0, 5, 6, 13 Sort 3, -2, -3, 326, -5 in ascending order. -5, -3, -2, 3, 326 Put 0.39, 0.007, -8, 3, -4, -0.2 in ascending order. -8, -4, -0.2, 0.007, 0.39, 3 Put 13, 5, 4, -1139 in descending order. 13, 5, 4, -1139 Sort 0.14, 0.3, -0.5, -3/2, 3 in decreasing order. 3, 0.3, 0.14, -0.5, -3/2 Sort -4, 6392, 6, -3 in descending order. 6392, 6, -3, -4 Put -1/2, 4, 207 in descending order. 207, 4, -1/2 Sort 10, -3, 0.012, 0.4, -2.2, 2. -3, -2.2, 0.012, 0.4, 2, 10 Sort 17, -31, -7, 1, 5, -3 in ascending order. -31, -7, -3, 1, 5, 17 Put 4, -58, 0, -44 in ascending order. -58, -44, 0, 4 Sort 5, -8, -557, -2, -5, -13 in decreasing order. 5, -2, -5, -8, -13, -557 Sort -2, -15, -113, 4, -1 in decreasing order. 4, -1, -2, -15, -113 Sort 0, -12553, 3 in decreasing order. 3, 0, -12553 Put 18, -7, -4, -5, -9, 0 in ascending order. -9, -7, -5, -4, 0, 18 Sort -96, -552, -6 in ascending order. -552, -96, -6 Sort -8, -4, -93, -1 in descending order. -1, -4, -8, -93 Put 2/15, -138, 1/6, -1/6, 5 in ascending order. -138, -1/6, 2/15, 1/6, 5 Sort -10, 3, -2, 1, 522 in descending order. 522, 3, 1, -2, -10 Put -5, -1, -4, -773, -3, 0.1 in descending order. 0.1, -1, -3, -4, -5, -773

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.