prompt
stringlengths
19
879k
completion
stringlengths
3
53.8k
api
stringlengths
8
59
import numpy as np from precomputeFx import * all_nodes_180 = np.load('../../latticeFiles/all_nodes_latt180.npy',allow_pickle=True) # precompute fx for all possible lattice locations for a given fault; ## fault_name: string for file save prefix to indicate fault ## fault: array with first element fault strike and second element fault dip ## arr_of_nodes: either all_nodes_180 or all_nodes_360 ## num_nodes: typically len(arr_of_nodes) test_fx_ = precompute_fx('test_fault_1',
np.array([0.0,np.pi/2])
numpy.array
# coding: utf-8 """ Created on 16/05/2019 @author: baptiste """ from ho_homog import periodicity import numpy as np import logging from pytest import approx logger = logging.getLogger("Test_periodicity") logger.setLevel(logging.DEBUG) formatter = logging.Formatter( "%(asctime)s :: %(levelname)s :: %(name)s :: %(message)s", "%H:%M:%S" ) stream_handler = logging.StreamHandler() stream_handler.setLevel(logging.DEBUG) stream_handler.setFormatter(formatter) logger.addHandler(stream_handler) def test_pbc_from_vectors(): per_vect = np.array([[4.0, 0.0], [0.0, 8.0]]) pbc = periodicity.PeriodicDomain.pbc_dual_base(per_vect, "XY") test_points = [ (0.0, 0.0), (4.0, 0.0), (4.0, 8.0), (0.0, 8.0), (2.0, 0.0), (4.0, 4.0), (2.0, 8.0), (0.0, 4.0), ] test_points = [np.array(coord) for coord in test_points] inside_results = [ True, False, False, False, True, False, False, True, ] map_results = [ (39996, 79992), (0.0, 0.0), (0.0, 0.0), (0.0, 0.0), (39996, 79992), (0.0, 4.0), (2.0, 0.0), (39996, 79992), ] map_results = [
np.array(coord)
numpy.array
import os from options.test_options import TestOptions from models import create_model from util.util import tensor2labelim, tensor2confidencemap from models.sne_model import SNE import torchvision.transforms as transforms import torch import numpy as np import cv2 import copy import tqdm import glob class dataset(): def __init__(self): self.num_labels = 2 def load_calib(filepath): rawdata = read_calib_file(filepath) K =
np.reshape(rawdata['cam_K'], (3,3))
numpy.reshape
# Copyright (C) 2019-2021 Ruhr West University of Applied Sciences, Bottrop, Germany # AND Elektronische Fahrwerksysteme GmbH, Gaimersheim Germany # # This Source Code Form is subject to the terms of the Apache License 2.0 # If a copy of the APL2 was not distributed with this # file, You can obtain one at https://www.apache.org/licenses/LICENSE-2.0.txt. import numpy as np from netcal import AbstractCalibration, dimensions, accepts from .NearIsotonicRegression import NearIsotonicRegression class ENIR(AbstractCalibration): """ Ensemble of Near Isotonic Regression (ENIR) models [1]_. These models allow - in contrast to standard :class:`IsotonicRegression` method - a violation of the monotony restrictions. Using the *modified Pool-Adjacent-Violators Algorithm (mPAVA)*, this method build multiple Near Isotonic Regression models and weights them by a certain score function. Let :math:`\\mathcal{D} = \\{(x_0, y_0), (x_1, y_1), ... \\}` denote a data set with input data :math:`x` and ground truth labels :math:`y \\in \\{0, 1\\}` of length :math:`N`. Let :math:`M` denote a model with estimated parameters :math:`\\hat{\\theta}` of length :math:`K` and let :math:`\\hat{p}` denote the confidence estimates on :math:`\\mathcal{D}` of model :math:`M` by parameters :math:`\\hat{\\theta}`. The score function might either be the *Aikaike Information Criterion (AIC)* given by .. math:: AIC = -2 L ( \\hat{\\theta} ) + 2K or the *Bayesian Information Criterion* given by .. math:: BIC = -2 L ( \\hat{\\theta} ) + \log(N)K with :math:`L (\\hat{ \\theta })` as the log-likelihood given by .. math:: L (\\hat{ \\theta }) = \\sum_{i=1}^N y^{(i)} \\log(\\hat{p}^{(i)}_\\hat{\\theta}) + (1-y^{(i)}) \\log(1 - \\hat{p}^{(i)}_\\hat{\\theta}) . These scores can be used to calculate a model posterior given by .. math:: p(M | \\mathcal{D}) \\propto p( \\mathcal{D} | M )p(M) \\approx \\exp( -BIC/2 )p(M) . Using the elbow method to sort out models with a low relative score, the weights for each model can be obtained by normalizing over all model posterior scores. Parameters ---------- score_function: str, default='BIC' define score functions: - 'BIC': Bayesian-Information-Criterion - 'AIC': Akaike-Information-Criterion quick_init : bool, default=True Allow quick initialization of NIR (equal consecutive values are grouped directly). detection : bool, default: False If False, the input array 'X' is treated as multi-class confidence input (softmax) with shape (n_samples, [n_classes]). If True, the input array 'X' is treated as a box predictions with several box features (at least box confidence must be present) with shape (n_samples, [n_box_features]). independent_probabilities : bool, optional, default: False Boolean for multi class probabilities. If set to True, the probability estimates for each class are treated as independent of each other (sigmoid). References ---------- .. [1] Naeini, <NAME>, and <NAME>: "Binary classifier calibration using an ensemble of near isotonic regression models." 2016 IEEE 16th International Conference on Data Mining (ICDM). IEEE, 2016. `Get source online <https://ieeexplore.ieee.org/iel7/7837023/7837813/07837860.pdf>`_ """ @accepts(str, bool, bool, bool) def __init__(self, score_function: str = 'BIC', quick_init: bool = True, detection: bool = False, independent_probabilities: bool = False): """ Constructor. Parameters ---------- score_function: str, default='BIC' define score functions: - 'BIC': Bayesian-Information-Criterion - 'AIC': Akaike-Information-Criterion quick_init : bool, default=True Allow quick initialization of NIR (equal consecutive values are grouped directly). detection : bool, default: False If False, the input array 'X' is treated as multi-class confidence input (softmax) with shape (n_samples, [n_classes]). If True, the input array 'X' is treated as a box predictions with several box features (at least box confidence must be present) with shape (n_samples, [n_box_features]). independent_probabilities : bool, optional, default: False Boolean for multi class probabilities. If set to True, the probability estimates for each class are treated as independent of each other (sigmoid). """ super().__init__(detection=detection, independent_probabilities=independent_probabilities) # for multi class calibration with K classes, K binary calibration models are needed self._multiclass_instances = [] # list of all binning models with [<NearIsotonicRegression>, ...] self._binning_models = [] self._model_scores = [] if type(score_function) != str: raise AttributeError("Score function must be string.") if score_function.lower() not in ['aic', 'bic']: raise AttributeError("Unknown score function \'%s\'" % score_function) self.score_function = score_function.lower() self.quick_init = quick_init def clear(self): """ Clear model parameters. """ super().clear() # for multi class calibration with K classes, K binary calibration models are needed for instance in self._multiclass_instances: del instance self._multiclass_instances.clear() # list of all binning models with [<NearIsotonicRegression>, ...] for model in self._binning_models: del model self._binning_models.clear() self._model_scores = None @accepts(bool) def get_params(self, deep=True): """ Get parameters for this estimator. Parameters ---------- deep : boolean, optional If True, will return the parameters for this estimator and contained subobjects that are estimators. Returns ------- params : mapping of string to any Parameter names mapped to their values. """ # get all params of current instance and save as dict params = super().get_params(deep=deep) if deep: # save binning models as well - this is not captured by super class method params['_binning_models'] = [] for model in self._binning_models: params['_binning_models'].append(model.get_params(deep=deep)) return params def set_params(self, **params) -> 'ENIR': """ Set the parameters of this estimator. The method works on simple estimators as well as on nested objects (such as pipelines). The latter have parameters of the form ``<component>__<parameter>`` so that it's possible to update each component of a nested object. Returns ------- self """ if '_binning_models' in params: self._binning_models = [] for model in params['_binning_models']: instance = NearIsotonicRegression() instance.set_params(**model) self._binning_models.append(instance) # remove key and value from dict to prevent override in super method del params['_binning_models'] # invoke super method super().set_params(**params) return self @dimensions((1, 2), (1, 2)) def fit(self, X: np.ndarray, y: np.ndarray) -> 'ENIR': """ Build ENIR calibration model. Parameters ---------- X : np.ndarray, shape=(n_samples, [n_classes]) or (n_samples, [n_box_features]) NumPy array with confidence values for each prediction on classification with shapes 1-D for binary classification, 2-D for multi class (softmax). On detection, this array must have 2 dimensions with number of additional box features in last dim. y : np.ndarray, shape=(n_samples, [n_classes]) NumPy array with ground truth labels. Either as label vector (1-D) or as one-hot encoded ground truth array (2-D). Returns ------- ENIR Instance of class :class:`ENIR`. """ # detection mode is not supported natively if self.detection: print("WARNING: Detection mode is not supported natively by ENIR method. " "This will discard all additional box information and only keep confidence scores.") # if 2d, keep only confidence scores and preserve 2d structure if len(X.shape) == 2: X = np.expand_dims(X[:, 0], axis=1) X, y = super().fit(X, y) # multiclass case: create K sub models for each label occurrence if not self._is_binary_classification(): # create multiple one vs all models self._multiclass_instances = self._create_one_vs_all_models(X, y, ENIR, self.score_function, self.quick_init) return self # binary classification problem but got two entries? (probability for 0 and 1 separately)? # we only need probability p for Y=1 (probability for 0 is (1-p) ) if len(X.shape) == 2: X = np.array(X[:, 1]) else: X = np.array(X) X, y = self._sort_arrays(X, y) # log action print("Get path of all Near Isotonic Regression models with mPAVA ...") iso = NearIsotonicRegression(quick_init=self.quick_init, independent_probabilities=self.independent_probabilities) iso.fit(X, y) model_list = [iso] while iso is not None: iso = iso.get_next_model() model_list.append(iso) # first element is perfect fit to training data - discard due to overfitting model_list.pop(0) # last element is always None - indicator of mPAVA termination model_list.pop() # get model scores and binning models by elbow method self._model_scores, self._binning_models = self._elbow(X, y, model_list, self.score_function, alpha=0.001) return self @dimensions((1, 2)) def transform(self, X: np.ndarray) -> np.ndarray: """ After model calibration, this function is used to get calibrated outputs of uncalibrated confidence estimates. Parameters ---------- X : np.ndarray, shape=(n_samples, [n_classes]) NumPy array with uncalibrated confidence estimates. 1-D for binary classification, 2-D for multi class (softmax). Returns ------- np.ndarray, shape=(n_samples, [n_classes]) NumPy array with calibrated confidence estimates. 1-D for binary classification, 2-D for multi class (softmax). """ # detection mode is not supported natively if self.detection: # if 2d, keep only confidence scores and preserve 2d structure if len(X.shape) == 2: X = np.expand_dims(X[:, 0], axis=1) X = super().transform(X) # prepare return value vector calibrated =
np.zeros(X.shape)
numpy.zeros
# coding: utf-8 import numpy as np import matplotlib.pyplot as plt plt.style.use(['transitions.mplstyle']) import matplotlib colors = matplotlib.rcParams['axes.prop_cycle'].by_key()['color'] black = matplotlib.rcParams['text.color'] width = matplotlib.rcParams['axes.linewidth'] from matplotlib import colors as mplcolors import sys sys.path.append('lib/') import plotting import evolimmune def func(pienv, s): return np.clip((pienv*(2.0-s) + s-1.0)/s, 0, 1) s = np.linspace(0, 1) fig, axes = plt.subplots(figsize=(6.6, 2.7), ncols=2) ax = axes[0] cmap = mplcolors.LinearSegmentedColormap.from_list('mycmap', [colors[0], colors[1]]) CS = ax.contour(func(s[:,None], s[None,:]), extent=(0, 1, 0, 1), cmap=cmap, levels=
np.arange(0.2, 1.0, 0.2)
numpy.arange
""" This module is used to generate a 3d mesh based on a 2d section in the xy-plane that is revolved around the x-axis. Note that only quadratic elements are supported. For linear elements, Abaqus' builtin routine works reasonably well (although the node coordinate accuracy seem a bit low), see :py:func:`~rollover.three_d.wheel.substructure.generate_3d_mesh` """ from __future__ import print_function import numpy as np from rollover.utils import naming_mod as names def generate(wheel_model, mesh_size): """ Based on a meshed 2d-profile of a wheel, generate a 3d-revolved mesh with angular spacing such that the elements on the outer radius have a circumferential size of mesh_size. :param wheel_model: A model that contains a wheel part with a 2d section mesh :type wheel_model: Model object (Abaqus) :param mesh_size: The mesh size to decide the angular increments :type mesh_size: float :returns: The wheel part and the angles for the element end planes :type: tuple( Part object(Abaqus), np.array ) """ wheel_part = wheel_model.parts[names.wheel_part] # 1) Extract the 2d mesh mesh_2d = get_2d_mesh(wheel_part) # 2) Create the 3d-mesh mesh_3d = make_3d_mesh_quad(mesh_2d, mesh_size) # 3) Save the 3d-mesh to a part definition in an abaqus input file input_file = save_3d_mesh_to_inp(mesh_3d) # 4) Import the mesh. Delete the old part, and import the 3d mesh del wheel_model.parts[names.wheel_part] wheel_model.PartFromInputFile(inputFileName=input_file) wheel_part = wheel_model.parts[names.wheel_part] return wheel_part, mesh_3d['angles'] def get_2d_mesh(wheel_part): """ Based on the wheel part, determine the 2d mesh information :param wheel_part: The wheel part containing the 2d mesh :type wheel_part: Part object (Abaqus) :returns: Mesh specification with the following fields: - nodes: np.array with node coordinates - elements: dictionary with keys according to number of nodes in element: N3,N4,N6,N8. Each item contains a list of list of node labels - edge_nodes: list of labels of nodes that belong to the edges of the elements (and not the corners) - corner_nodes: list of labels of nodes that belong to the corners of the elements. :rtype: dict """ node_coords = np.array([n.coordinates for n in wheel_part.nodes]) elements = {'N3': [], 'N4': [], 'N6': [], 'N8': []} edge_nodes = [] corner_nodes = [] for e in wheel_part.elements: enods = e.connectivity num_enods = len(enods) key = 'N' + str(num_enods) if key in elements: elements[key].append(enods) else: raise ValueError('Unknown element type with ' + str(num_enods) + ' nodes.\n' + '- Element label: ' + e.label + '\n' + '- Element nodes: ' + enods + '\n' + '- Element type : ' + e.type + '\n') if num_enods > 4: # 2nd order, second half of nodes on edges for n in enods[:num_enods/2]: if n not in corner_nodes: corner_nodes.append(n) for n in enods[num_enods/2:]: if n not in edge_nodes: edge_nodes.append(n) else: # 1st order elements, all nodes at corners for n in enods: if n not in corner_nodes: corner_nodes.append(n) the_mesh = {'nodes': node_coords, 'elements': elements, 'edge_nodes': edge_nodes, 'corner_nodes': corner_nodes} return the_mesh def make_3d_mesh_quad(mesh_2d, mesh_size): """ Revolve a 2d-mesh into a 3d-mesh :param mesh_2d: Mesh specification with the following fields: - nodes: np.array with node coordinates - elements: dictionary with keys according to number of nodes in element: N3,N4,N6,N8. Each item contains a list of list of node labels - edge_nodes: list of labels of nodes that belong to the edges of the elements (and not the corners) - corner_nodes: list of labels of nodes that belong to the corners of the elements. :type mesh_2d: dict :param mesh_size: The circumferential mesh size at largest radius :type mesh_size: float :returns: Mesh specification with the following fields: - nodes: np.array with node coordinates - elements: dictionary with keys according to number of nodes in element: N15, N20. Each item contains a list of list of node labels - angles: np.array of angles for angular increments of elements. :rtype: dict """ nodes_2d = mesh_2d['nodes'] elems_2d = mesh_2d['elements'] edge_node_num_2d = mesh_2d['edge_nodes'] corner_node_num_2d = mesh_2d['corner_nodes'] r_outer = np.max(np.abs(nodes_2d[:, 1])) num_angles = int(r_outer*2*np.pi/mesh_size) angles = np.linspace(0, 2*np.pi, num_angles+1)[:-1] delta_angle = angles[1]-angles[0] # Calculate size of mesh and allocate variables num_corner_nodes_2d = len(corner_node_num_2d) num_edge_nodes_2d = len(edge_node_num_2d) num_nodes_per_section = 2*num_corner_nodes_2d + num_edge_nodes_2d nodes = np.zeros((num_nodes_per_section*num_angles, 3), dtype=np.float) corner_node_num = np.zeros((num_corner_nodes_2d, num_angles), dtype=np.int) edge_ip_node_num = np.zeros((num_edge_nodes_2d, num_angles), dtype=np.int) edge_op_node_num = np.zeros((num_corner_nodes_2d, num_angles), dtype=np.int) edge_op_node_num[-1,-1] = -1 # Used the first iteration in the loop for i, ang in enumerate(angles): # Corner nodes corner_node_num[:, i] = edge_op_node_num[-1,i-1] + 1 + np.arange(num_corner_nodes_2d) for j, num in enumerate(corner_node_num[:,i]): coords_2d = nodes_2d[corner_node_num_2d[j], :] nodes[num, :] = rotate_coords(coords_2d, ang) # Edge nodes (in plane) edge_ip_node_num[:, i] = corner_node_num[-1,i] + 1 +
np.arange(num_edge_nodes_2d)
numpy.arange
""" Created on Thu Oct. 10 2019 Recent changes for the version 0.1.1: 1) Insead of giving the input optical penetration depth only give the input of the complex refractive index "n". This is a material parameter, so the input is given in the simulation --> add_layer(.) command. Now "LB" and "TMM" source are initialized almost in the same way 2) One of the Outputs of sim.run() is T. But now we change it to be a 3 dimensional array, with dim0 = time; dim1 = space; dim2 = subsystem 3) The input for the visual class in the v.contour() function should not be a string but just numbers corresponding to different systems. @author: <NAME> <EMAIL> """ import numpy as np import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import Axes3D from bspline import Bspline from bspline.splinelab import aptknt import time from matplotlib.animation import FuncAnimation as movie from tqdm import tqdm #Progressbar #============================================================================== class temperature(object): def __init__(self): self.plt_points = 30 #number of points in x grid self.length = np.array([0,0]) #length of x space,starting from 0 self.Left_BC_Type = 1 #Boundary conditions Default is Neumann self.Right_BC_Type = 1 #1=> Neumann; 0=> Dirichlet self.init = lambda x: 300+0*x # initial temperature of probe self.n = np.array([1,1],dtype=complex) # Initial refractive index air|...|air self.conductivity = [1] #This gets deleted after initialisation self.heatCapacity = [1] #those values are just here to make space self.rho = [1] #Actual values are given, when 'addLayer(length, conductivity,heatCapacity,rho)' is executed self.collocpts = 12 self.setup = False #first time setup to not double calculated def getProperties(self): #to depict the properties of the object for i in (self.__dict__): name = str(i) value = str(self.__dict__[i]) print('{:<20}{:>10}'.format( name,value )) def __repr__(self): return('Temperature') #for every layer, a function to calculate the derivative of k(T) def diff_conductivity(self,phi,num_of_material): eps =1e-9 dc = (self.conductivity[num_of_material](phi+eps)-self.conductivity[num_of_material](phi))/eps return(dc) #Creating the key matrices for B-splines. Those are A0,A1,A2 #A0 => Zero derivative; A1 => 1st order derivative.... #We create the matices for every layer, with respective length ect #then we put them together to Abig => Boundary and interface conditions are applied here. def Msetup(self): #Deleting the ifrst element of the default initialization #After creating the element with 'addLayer' we dont need them! if not self.setup: self.length = self.length[1:] self.conductivity = self.conductivity[1:] self.heatCapacity = self.heatCapacity[1:] self.rho = self.rho[1:] self.setup = True #Length and numper of grid points for each respective layer length = self.length plt_points = self.plt_points num_of_points = self.collocpts #Number of points per layer used in the spline for collocation order = 5 #order of the spline x = np.array(np.zeros([np.size(length)-1,num_of_points])) x_plt = np.array(np.zeros([np.size(length)-1,plt_points])) knot_vector = np.array(np.zeros([np.size(length)-1,num_of_points+order+1])) basis = np.array(np.zeros(np.size(length)-1)) A0h = []; A1h = []; A2h = []; Ch = []; LayerMat = np.array([np.zeros((num_of_points,num_of_points))]) #Create all the big matices A0,A1,A2 & C. C is used to map on a fine mesh in x- space. #For every layer we set up splines between the boundaries for i in range(0,np.size(length)-1): x[i,:] = np.linspace(length[i], length[i+1] , num_of_points) x_plt[i,:] = np.linspace(length[i], length[i+1] , plt_points) knot_vector[i,:] = aptknt(x[i,:], order) #prepare for Spline matrix basis = Bspline(knot_vector[i,:],order) A0hinter = basis.collmat(x[i,:], deriv_order = 0); A0hinter[-1,-1] = 1 A1hinter = basis.collmat(x[i,:], deriv_order = 1); A1hinter[-1] = -np.flip(A1hinter[0],0) A2hinter = basis.collmat(x[i,:], deriv_order = 2); A2hinter[-1,-1] = 1 Chinter = basis.collmat(x_plt[i,:], deriv_order = 0); Chinter[-1,-1] = 1 LayerMat = np.append(LayerMat,np.array([np.dot(A2hinter,np.linalg.inv(A0hinter))]),axis = 0) A0h = np.append(A0h,A0hinter) A1h = np.append(A1h,A1hinter) A2h = np.append(A2h,A2hinter) Ch = np.append(Ch,Chinter) #Reshape the long string of appended Matrix, such that #rows: x-points; colums: i´th basis spline LayerMat = LayerMat[1:,:,:] A0h = np.reshape(A0h, (-1,num_of_points)) A1h = np.reshape(A1h, (-1,num_of_points)) A2h = np.reshape(A2h, (-1,num_of_points)) Ch = np.reshape(Ch,(-1,num_of_points)) #Ch => More points in x, but same number of basis splines #Clearing the interface points, to not double count N = num_of_points plp = plt_points interfaces = np.shape(x)[0]-1 sizeA = np.shape(x)[0]*N-interfaces sizeCb = np.shape(x)[0]*plp-interfaces Abig = np.zeros([sizeA,sizeA]) A1b = np.zeros([sizeA,sizeA]) A2b = np.zeros([sizeA,sizeA]) Cb = np.zeros([sizeCb,sizeA]) #Clearing the double counts from the space grid xflat = x.flatten() x_plt_flat = x_plt.flatten() #index of double counts doublec = np.array([np.arange(1,len(length)-1)])*N doublec_plt = np.array([np.arange(1,len(length)-1)])*plp xflat = np.delete(xflat,doublec) x_plt_flat = np.delete(x_plt_flat,doublec_plt) #Filling the big matrices. startA = 0; endA = N-1 startC = 0; endC = plp-1 for i in range(0,interfaces+1): Abig[startA:endA,startA:endA+1] = A0h[startA+i:endA+i,:] A1b[startA:endA+1,startA:endA+1] = A1h[startA+i:endA+i+1,:] A2b[startA:endA+1,startA:endA+1] = A2h[startA+i:endA+i+1,:] Cb[startC:endC+1,startA:endA+1] = Ch[startC+i:endC+i+1,:] startA += N-1; endA += N-1 startC += plp-1; endC += plp-1 #Create A00 with no interface condition to correctly compute phi in loop #The copy needs to be done befor interface conditions are applied in Abig A00 = Abig.copy() A00[-1,-1] = 1; #Here we make init, conductivity & capacity all functions, in case they are # given as integeres or floats. Also thorw warinings if not every layer has a # conducitvity or capacity ============================================ #Making init a function, in case it is given as a scalar if np.size(self.init) == 1 and isinstance(self.init,(int,float)): dummy = self.init self.init = lambda x: dummy + 0*x if len(length) > 2: #multilayer case if len(length)-1 !=( len(self.heatCapacity) & len(self.conductivity) ): print('--------------------------------------------------------') print('The number of different layers must match the number of number of' \ 'inputs for Conductivity, heatCapacity, rho.') print('--------------------------------------------------------') if np.size(self.conductivity) is not interfaces+1: print('--------------------------------------------------------') print('Not every Layer has been given a conductivity function' \ 'Adjust your input of the conductivity functions with respect to the layers.') print('--------------------------------------------------------') if np.size(self.heatCapacity) is not interfaces+1: print('--------------------------------------------------------') print('Not every Layer has been given a heatCapacity function value.'\ 'Adjust your input of the heatCapacity functions with respect to the layers.') print('--------------------------------------------------------') #Make Functions in case heat capacity/conductivity are given as variables if (all(self.conductivity) or all(self.heatCapacity) or all(self.init)) == False: print('No heatCapacity, conductivity or initial function given.') print('--------------------------------------------------------') #make the conductivity always a function if len(length) >2 or np.size(self.conductivity)>=2: for j in list(range (0,np.size(self.conductivity))): if isinstance(self.conductivity[j],(int,float,list)) : dummy3 = self.conductivity[j] self.conductivity[j] = (lambda b: lambda a: b+0*a)(dummy3) #make the conductivity always a function for j in list(range (0,np.size(self.heatCapacity))): if isinstance(self.heatCapacity[j],(int, float,list)) : dummy4 = self.heatCapacity[j] self.heatCapacity[j] = (lambda b: lambda a: b+0*a)(dummy4) else : if isinstance(self.conductivity[0],(int,float)): dummy1 = self.conductivity self.conductivity = [lambda phi: dummy1 + 0*phi] if isinstance(self.heatCapacity[0],(int,float)): dummy2 = self.heatCapacity self.heatCapacity = lambda phi: dummy2 + 0*phi self.heatCapacity = [self.heatCapacity] #End of function creation for init(x), conductivity[l](phi), heatCapacity[l](phi) # with respect to every layer 'l' ===================================== def interconditions(phi,interfaces): N = num_of_points end_i = N-1 intercondiL = np.zeros((interfaces,N)) intercondiR = np.zeros((interfaces,N)) for i in range(interfaces): intercondiL[i] = self.conductivity[i](phi[end_i])*A1h[end_i+i] intercondiR[i] = self.conductivity[i+1](phi[end_i])*A1h[end_i+i+1] end_i += N-1 return(intercondiL,intercondiR) #Initial Electron temperature initphi = self.init(xflat) initphi_large = self.init(x_plt_flat) intercon = interconditions(initphi,interfaces) #filling up Abig wiht the interface condition in the middle of the grid start_i = 0; end_i = N-1 for i in range(0,interfaces): Abig[end_i,start_i:end_i] = intercon[0][i][:-1]#Lhs interface flow Abig[end_i,end_i+1:end_i+N] = -intercon[1][i][1:]#Rhs interface flow Abig[end_i,end_i] = intercon[0][i][-1] -intercon[1][i][0] start_i += N-1; end_i += N-1 Abig[-1,-1] = 1 #to correct Cox algorithm #Now Matrix Abig is completed and interface condition is applied. #Treating 2 types of boundary conditions: 0=> Dirichlet; 1=> Neumann, # where 0´th and -1´th row need to be first order derivatives for flux. neumannBL = A1b[0].copy(); neumannBR = A1b[-1].copy(); if self.Left_BC_Type == 1: Abig[0] = -neumannBL if self.Right_BC_Type == 1: Abig[-1] = neumannBR #Clear for BC! (first and last row need to be cleared to correctly apply BC) A1b[0] = 0; A2b[0] = 0; A1b[-1] = 0; A2b[-1] = 0; #Get inital c coefficients for splines using init (=phi_init) c = np.dot(np.linalg.inv(A00),self.init(xflat)) #Passed on properties to the simulation class return(c,A00,Abig,A1b,A2b,Cb,length,N,plp,xflat,x_plt_flat,initphi_large,interfaces,LayerMat,A1h) def addLayer(self,L,refind,conductivity,heatCapacity,rho): """ Add parameters of every layer: (length,conductivity[electron,lattice,spin],heatCapacity[electron, lattice, spin],density, coupling[E-L,L-S,S-E]) The units in SI are: [length] = m [n] = complex refractive index [conductivity] = W/(mK) [heatCapacity] = J/(m^3K^2) [density] = kg/m^3 [Coupling] = W/(m^3K) """ self.length = np.append(self.length,self.length[-1]+L) #Squeez in the refracitve index between two layers of air: air|...|...|air self.n = np.concatenate((self.n[:-1],[refind],[self.n[-1]])) self.conductivity.append(conductivity) self.heatCapacity.append(heatCapacity) self.rho = np.append(self.rho,rho) #============================================================================== class simulation(object): def __init__(self,num_of_temp,source): self.temp_data = temperature() #import the temperatuer object self.num_of_temp = num_of_temp #1 if only electron temp. 2 if electron and lattice temp. self.start_time = 0 #starting time (can be negative) self.final_time = 10 #time when simulation stops self.time_step = [] #can either be given or is automatically calculated in stability self.left_BC = 0 #function or constant what the boundary condition self.right_BC = 0 #on the left or right side of the problem is. self.stability_lim = [270,3000] self.temp_data_Lat = [] #Default case is without lattice temperature self.temp_data_Spin = [] if num_of_temp >= 2: #if Lattice temp is considered self.temp_data_Lat = temperature() #in case also a lattice module is given self.coupling = [] #Coupling between Electron and Lattice system self.left_BC_L = 0 #Setting the default to zero flux self.right_BC_L = 0 #The BC type is indicated in the temperature class if num_of_temp == 3: #In case spin coupling is also considered self.temp_data_Spin = temperature() self.coupling_LS = [] #Coupling between Lattice and Spin system self.coupling_SE = [] #Coupling between Electron and Spin system self.left_BC_S = 0 #Default zero flux Neumann boundary conditions self.right_BC_S = 0 #On both sides self.source = source #object source can be passed on #to depict the properties of the object def getProperties(self): for i in (self.__dict__): name = str(i) value = str(self.__dict__[i]) print('{:<20}{:>10}'.format( name,value )) def __repr__(self): return('Simulation') def changeInit(self,system,function): """ Change the initial condition of every system. .changeInit(system,function) has 2 input arguments system --> string "electron" or "lattice" or "spin" function --> a function handle or a number defining the value of the system at t=0 over the entire domain x. """ if (system == "electron") or (system == "Electron") or (system == 1): self.temp_data.init = function if (system == "lattice") or (system == "Lattice") or (system == 2): self.temp_data_Lat.init = function if (system == "spin") or (system == "Spin") or (system == 3): self.temp_data_Spin = function def changeBC_Type(self,system,side,BCType): """ Function to change the type of the boundary condition on the left and right side of the material, for every system, "electron", "lattice", "spin" respectively. .changeBC_Type(system,side,BCType) has 3 inputs, all of them are strings. system --> "electron" or "lattice" or "spin". Altenatively: "1", "2", "3" side --> "left" or "right" BCType --> "dirichlet" fixing the value/ "neumann" fixing the flux. """ if (system == "electron") or (system == "Electron") or (system == 1): if side == "left": if (BCType == "dirichlet") or (BCType == 0): self.temp_data.Left_BC_Type = 0 if (BCType == "neumann") or (BCType == 1): self.temp_data.Left_BC_Type = 1 if side == "right": if (BCType == "dirichlet") or (BCType == 0): self.temp_data.Right_BC_Type = 0 if (BCType == "neumann") or (BCType == 1): self.temp_data.Right_BC_Type = 1 if (system == "lattice") or (system == "Lattice") or (system == 2): if side == "left": if (BCType == "dirichlet") or (BCType == 0): self.temp_data_Lat.Left_BC_Type = 0 if (BCType == "neumann") or (BCType == 1): self.temp_data_Lat.Left_BC_Type = 1 if side == "right": if (BCType == "dirichlet") or (BCType == 0): self.temp_data_Lat.Right_BC_Type = 0 if (BCType == "neumann") or (BCType == 1): self.temp_data_Lat.Right_BC_Type = 1 if (system == "spin") or (system == "Spin") or (system == 3): print("Line 326 Spinsystem") if side == "left": if (BCType == "dirichlet") or (BCType == 0): self.temp_data_Spin.Left_BC_Type = 0 if (BCType == "neumann") or (BCType == 1): self.temp_data_Spin.Left_BC_Type = 1 if side == "right": if (BCType == "dirichlet") or (BCType == 0): self.temp_data_Spin.Right_BC_Type = 0 if (BCType == "neumann") or (BCType == 1): self.temp_data_Spin.Right_BC_Type = 1 def changeBC_Value(self,system,side,function): """ Function to change the value of the boundary condition on the left and right side of the material, for every system, "electron", "lattice", "spin" respectively. .changeBC_Value(system,side,function) the first two are strings, the last one is a function handle or a number. system --> "electron" or "lattice" or "spin"| Altenatively: "1", "2", "3" side --> "left" or "right" function--> function or number fixing the value on the boundaries for all times. """ if (system == "electron") or (system == "Electron") or (system == 1): if side == "left": self.left_BC = function if side == "right": self.right_BC = function if (system == "lattice") or (system == "Lattice") or (system == 2): if side == "left": self.left_BC_L = function if side == "right": self.right_BC_L = function if (system == "spin") or (system == "Spin") or (system == 3): if side == "left": self.left_BC_S = function if side == "right": self.right_BC_S = function def addSubstrate(self,name = "silicon"): """ Automatically create in the silicon substrate using input parameters, mostly taken from: Contribution of the electron-phonon interaction to Lindhard energy partition at low energy in Ge and Si detectors for astroparticle physics applications, by <NAME> and <NAME> Note: Refractive index for 400 nm light! """ if (name == "Silicon") or (name =="silicon") or (name =="Si"): k_el_Si = 130#W/(m*K); k_lat_Si = lambda T: np.piecewise(T,[T<=120.7,T>120.7],\ [lambda T: 100*(0.09*T**3*(0.016*np.exp(-0.05*T)+np.exp(-0.14*T))), lambda T: 100*(13*1e3*T**(-1.6))]) rho_Si = 2.32e3#kg/(m**3) C_el_Si = lambda Te: 150/rho_Si *Te C_lat_Si = 1.6e6/rho_Si G_Si = 1e17*18#W/(m**3*K) #Set three layers of Silicon after each other. #The space resolution on the Film|Substrate edge is high #and decreases as one moves in bulk direction if self.num_of_temp == 2:#Lattice only in the 2T self.temp_data_Lat.addLayer(20e-9,5.5674+0.38612j,k_lat_Si,C_lat_Si,rho_Si) self.coupling = np.append(self.coupling,G_Si) self.temp_data_Lat.addLayer(100e-9,5.5674+0.38612j,k_lat_Si,C_lat_Si,rho_Si) self.coupling = np.append(self.coupling,G_Si) self.temp_data_Lat.addLayer(100000e-9,5.5674+0.38612j,k_lat_Si,C_lat_Si,rho_Si) self.coupling = np.append(self.coupling,G_Si) #In the 1 and 2 temperature case electron always gets appended self.temp_data.addLayer(20e-9,5.5674+0.38612j,k_el_Si,C_el_Si,rho_Si) self.temp_data.addLayer(100e-9,5.5674+0.38612j,k_el_Si,C_el_Si,rho_Si) self.temp_data.addLayer(100000e-9,5.5674+0.38612j,k_el_Si,C_el_Si,rho_Si) def addLayer(self,L,n,conductivity,heatCapacity,rho,coupling=0,*args): """ Add parameters of every layer: (length,conductivity[electron,lattice,spin],heatCapacity[electron, lattice, spin],density, coupling[E-L,L-S,S-E]) The units in SI are: [length] = m [n] = complex refractive index [conductivity] = W/(mK) [heatCapacity] = J/(m^3K^2) [density] = kg/m^3 [Coupling] = W/(m^3K) """ #check all input arguments and make them to lists, for the multi layer case #make list when given as int or float typecheck = np.array([]) if type(conductivity) is not (list or type(typecheck)): conductivity = [conductivity] if type(heatCapacity) is not (list or type(typecheck)): heatCapacity = [heatCapacity] #do typecheck only for the lattice system in the 2TM-case if self.num_of_temp == 2: if (np.size(conductivity) or np.size(heatCapacity))<2: print('Lattice parameters are missing.\n Add parameters for Lattice system.') return(128) self.temp_data_Lat.addLayer(L,n,conductivity[1],heatCapacity[1],rho) #Only electron spin coupling is under consideration self.coupling = np.append(self.coupling,coupling) #do typecheck for the Lattice and the Spin system if self.num_of_temp == 3: if (np.size(conductivity) or np.size(heatCapacity) or np.size(coupling))<3: print('Input parameters are missing.\n Add parameters for '\ 'conductivity/heatCapacity or coupling for Lattice/Spin system.') return(128) self.temp_data_Lat.addLayer(L,n,conductivity[1],heatCapacity[1],rho) self.temp_data_Spin.addLayer(L,n,conductivity[2],heatCapacity[2],rho) #In the 3Tm case the coupling input arg is a vector of len 3. Unwrap them: self.coupling = np.append(self.coupling,coupling[0]) self.coupling_LS = np.append(self.coupling_LS,coupling[1]) self.coupling_SE = np.append(self.coupling_SE,coupling[2]) #For the electronic system always add the parameters! self.temp_data.addLayer(L,n,conductivity[0],heatCapacity[0],rho) def interconditions(self,phi,interfaces,conductivity,N,A1h): """ A function which gives back an array where the intereface condition is returned for the left and right side of the interface. Gets called in the E.E.-loop. """ end_i = N-1 intercondiL = np.zeros((interfaces,N)) intercondiR = np.zeros((interfaces,N)) for i in range(interfaces): intercondiL[i] = conductivity[i](phi[end_i])*A1h[end_i+i] intercondiR[i] = conductivity[i+1](phi[end_i])*A1h[end_i+i+1] end_i += N-1 return(intercondiL,intercondiR) def sourceprofile(self,absorptionprofile,timeprofile,xflat,x0,t,N): #Consider Lambert Beers law in space and different types in time if (absorptionprofile == "LB") and (self.source.fluence is not 0): optical_penetration_depth = self.source.ref2delta(self.temp_data.n,self.source.lambda_vac) if (timeprofile == "Gaussian"): print('-----------------------------------------------------------') print('Lambert Beer´s absorption law and a Gaussian time profile is applied as source.') print('-----------------------------------------------------------') sourceM = self.source.init_G_source(xflat,x0,t,optical_penetration_depth,N,self.source.Gaussian) if (timeprofile == "repGaussian") or (timeprofile == "RepGaussian"): print('-----------------------------------------------------------') print('Lambert Beer absorption profile and a repeated Gaussian time profile is taken into account for the source.'\ 'The frequency of the pulse repetition has to be indicated via s.frequency = number (in 1/seconds).') print('-----------------------------------------------------------') self.source.multipulse = True xmg, tmg = np.meshgrid(xflat,t) if (self.source.frequency is not False): time_range = tmg[-1,-1]-self.source.t0 pulses = int(round(time_range * self.source.frequency)) #Add up Gaussian pulses with different t0, according to the frequency given #from t0 onwards, until the end of the time grid customtime = np.zeros(np.shape(tmg)) for i in range(0,pulses): t00 = self.source.t0 + i/self.source.frequency customtime +=np.exp(-(tmg-t00)**2*np.log(2)/(self.source.FWHM**2)) sourceM = self.source.init_G_source(xflat,x0,t,optical_penetration_depth,N,self.source.Gaussian,customtime) if(self.source.frequency is not False) and (self.source.num_of_pulses is not False): #Creating a certain number of pulses according to self.num_of_pulses time_range = tmg[-1,-1]-self.source.t0 pulses = self.source.num_of_pulses #If num_of_pulses is bigger too big to fit in the timerange [t0,t_end] throw warning if (pulses > int(round(time_range * self.source.frequency))): pulses = int(round(time_range * self.source.frequency)) print('Number of pulses is too big to fit in the timerange under consideration. \n'\ 'Adjust t_end or consider a smaller number of pulses.') customtime = np.zeros(np.shape(tmg)) for i in range(0,pulses): t00 = self.source.t0 +i/self.source.frequency customtime +=np.exp(-(tmg-t00)**2*np.log(2)/(self.source.FWHM**2)) sourceM = self.source.init_G_source(xflat,x0,t,optical_penetration_depth,N,self.source.Gaussian,customtime) if(self.source.frequency is False) and (self.source.num_of_pulses is False): print('-----------------------------------------------------------') print('Assign the propertiy s.frequncy, to consider a certain pulse frequency.\n'\ 'If only a certain number of pulses should be considered, assign the value s.num_of_pulses = integer.') print('-----------------------------------------------------------') if (timeprofile == "custom") or (timeprofile == "Custom"): [ttime,amplitude] = self.source.loadData #To extract the custom time profile and the scaling factor [sourcemat,customtime,scaling] = self.source.custom(t,xflat,ttime,amplitude,optical_penetration_depth[0]) #To get the space profile: Source with different optical penetration depth defined on the xflat gird sourceM = self.source.init_G_source(xflat,x0,t,optical_penetration_depth,N,self.source.Gaussian,customtime,scaling) #Consider Transfer Matrix in space and different types in time if (absorptionprofile == "TMM") and (self.source.fluence is not 0): """ This will implement a transfer matrix approach to local absorption instead as using the Lambert Beer´s law considered in the Gaussian source type. """ #Multiplying with 1e9, since the absorption()-function. In the source module only works if length is in units of nm! x0m = x0*1e9#converte the lentgh into nm if len(x0) is not (len(self.temp_data.n)-1): print('-----------------------------------------------------------') print('Number of considered layers does not match with given refractive indices.\n'\ 'in ´temperature.n(Air|Film layer1|Film layer2|...|Air)´ anly consider the film layers. \n'\ 'The refractive index of the substrate gets added automatically later when \n'\ '`simulation.addSubstrate(\'name\')` gets called.') print('-----------------------------------------------------------') if (timeprofile == "Gaussian"): sourceM = self.source.createTMM(self.temp_data.n,xflat,t,x0m) print('-----------------------------------------------------------') print('Transfer matrix absorption profile and a Gaussian time profile is taken into account for the source.\n'\ 'Length of every layer has to be given in units of meter.') print('-----------------------------------------------------------') if (timeprofile == "custom") or (timeprofile == "Custom"): print('-----------------------------------------------------------') print('Transfer matrix absorption profile of and a custom time profile is taken into account for the source.\n'\ 'Length of every layer has to be given in units of meter.') print('-----------------------------------------------------------') if self.source.loadData is False: print('-----------------------------------------------------------') print('Import an array, containing the data of the custom pulse.'\ 'arr[0,:] = time; arr[1,:] = amplitude') print('-----------------------------------------------------------') [ttime,amplitude] = self.source.loadData lam = 1#Lamda does not matter here since the spacial absorption is calculated via TMM [sourceM,customtime,scaling] = self.source.custom(t,xflat,ttime,amplitude,lam) #The cfeateTMM(xgrid,timegrid,length,*args) has customtime as an optional argument sourceM = self.source.createTMM(self.temp_data.n,xflat,t,x0m,customtime,scaling) if (timeprofile == "RepGaussian") or (timeprofile== "repGaussian"): print('-----------------------------------------------------------') print('Transfer matrix absorption profile and a repeated Gaussian time profile is taken into account for the source.'\ 'Length of every layer has to be given in units of meter.') print('-----------------------------------------------------------') self.source.multipulse = True xmg, tmg = np.meshgrid(xflat,t) if (self.source.frequency is not False): time_range = tmg[-1,-1]-self.source.t0 pulses = int(round(time_range * self.source.frequency)) #Add up Gaussian pulses with different t0, according to the frequency given #from t0 onwards, until the end of the time grid customtime = np.zeros(np.shape(tmg)) for i in range(0,pulses): t00 = self.source.t0 + i/self.source.frequency customtime +=np.exp(-(tmg-t00)**2*np.log(2)/(self.source.FWHM**2)) sourceM = self.source.createTMM(self.temp_data.n,xflat,t,x0m,customtime) if(self.source.frequency is not False) and (self.source.num_of_pulses is not False): #Creating a certain number of pulses according to self.num_of_pulses time_range = tmg[-1,-1]-self.source.t0 pulses = self.source.num_of_pulses #If num_of_pulses is bigger too big to fit in the timerange [t0,t_end] throw warning if (pulses > int(round(time_range * self.source.frequency))): pulses = int(round(time_range * self.source.frequency)) print('Number of pulses is too big to fit in the timerange under consideration. \n'\ 'Adjust t_end or consider a smaller number of pulses.') customtime = np.zeros(np.shape(tmg)) for i in range(0,pulses): t00 = self.source.t0 +i/self.source.frequency customtime +=np.exp(-(tmg-t00)**2*np.log(2)/(self.source.FWHM**2)) sourceM = self.source.createTMM(self.temp_data.n,xflat,t,x0m,customtime) if(self.source.frequency is False) and (self.source.num_of_pulses is False): print('-----------------------------------------------------------') print('Assign the propertiy s.frequncy, to consider a certain pulse frequency.\n'\ 'If only a certain number of pulses should be considered, assign the value s.num_of_pulses = integer.') print('-----------------------------------------------------------') return(sourceM) # This is the main Explicit Euler loop where the solution to T(x,t) is calculated. def run(self): idealtimestep = self.stability() if not self.time_step: self.time_step = idealtimestep print('-----------------------------------------------------------') print(' No specific time constant has been indicated. \n '\ 'The stability region has been calculated and an appropriate timestep has been chosen.\n '\ 'Timestep = {idealtimestep:.2e} s'.format(idealtimestep=idealtimestep)) print('-----------------------------------------------------------') if (self.time_step-idealtimestep)/idealtimestep > 0.1: print('-----------------------------------------------------------') print('The manually chosen time step of {time_step:.2e} is eventually too big and could cause instabilities in the simulation.\n '\ 'We suggest a timestep of {idealtimestep:.2e} s'.format(time_step=self.time_step,idealtimestep=idealtimestep)) print('-----------------------------------------------------------') if(self.time_step-idealtimestep)/idealtimestep < -0.2: print('-----------------------------------------------------------') print('The maunually chosen time step of {time_step:.2e} is very small and will eventually cause a long simulation time.\n'\ 'We suggest a timestep of {idealtimestep:.2e} s'.format(time_step=self.time_step,idealtimestep=idealtimestep)) print('-----------------------------------------------------------') #loading simulation relevant properties from the structural tmeperature object [c_E,A00,Abig,A1b,A2b,Cb,length,N,plp,xflat,x_plt_flat,initphi_large,interfaces,LayerMat,A1h] = self.temp_data.Msetup() t = np.arange(self.start_time,self.final_time,self.time_step) #only if the injection would make the time grid smaller, to not move into instable regime if self.source.FWHM: if (6*self.source.FWHM/200 < idealtimestep): #inject 200 extra points around pulse to fully capture the shape of the pulse tinj = np.linspace(self.source.t0 - 3*self.source.FWHM,self.source.t0 + 3*self.source.FWHM,200) smaller = np.where(t<self.source.t0 - 3*self.source.FWHM)[0] bigger = np.where(t>self.source.t0 + 3*self.source.FWHM)[0] #new time grid with higher resolution t = np.concatenate((t[smaller],tinj,t[bigger]),axis=0) tstep = np.ones(len(t)) tstep[:-1] = np.diff(t); tstep[-1] = np.diff(t)[-1] #If a more refined grid is choosen around t0. We inject a fine time grid around t0, to correctly capture the pulse shape if self.source.adjusted_grid is not False: if self.source.dt0 == False: print('-----------------------------------------------------------') print('The option for an adjusted grid is True, but no interval for a more refined grid has been given.'/ 'Indicate dt0 (around which values the time grid should have higher resolution) in the source object') print('-----------------------------------------------------------') if 2*self.source.dt0/self.source.extra_points < idealtimestep: print('-----------------------------------------------------------') print('A refined Grid around t0 has been applied') print('-----------------------------------------------------------') tinj = np.linspace(self.source.t0-self.source.dt0,self.source.t0+self.source.dt0,self.source.extra_points) smaller = np.where(t<self.source.t0 - self.source.dt0)[0] bigger = np.where(t>self.source.t0 + self.source.dt0)[0] #new time grid with higher resolution t = np.concatenate((t[smaller],tinj,t[bigger]),axis=0) tstep = np.ones(len(t)) tstep[:-1] = np.diff(t); tstep[-1] = np.diff(t)[-1] else: print('-----------------------------------------------------------') print('No refined time grid is applied. The timestep is alerady very small.' \ 'You can use the simulation class with the property self.time_step and '\ 'assign it to a smaller value as the current time step.') print('-----------------------------------------------------------') #Initialize the systems and load the matrices if self.temp_data_Lat: if self.temp_data.plt_points is not self.temp_data_Lat.plt_points: self.temp_data_Lat.plt_points = self.temp_data.plt_points print('-----------------------------------------------------------') print('The number of plotting points in the electron system \n'\ 'is not the same as in the lattice system.\n'\ 'They are set equal to avoid matrix dimension missmatch.') print('-----------------------------------------------------------') if self.temp_data.collocpts is not self.temp_data_Lat.collocpts: self.temp_data_Lat.collocpts = self.temp_data.collocpts print(self.temp_data_Lat.collocpts) print('-----------------------------------------------------------') print('The number of collocation points in the electron system \n'\ 'is not the same as in the lattice system.\n'\ 'They are set equal to avoid matrix dimension missmatch.') print('-----------------------------------------------------------') [c_L,A00,Abig,A1b,A2b,Cb,length,N,plp,xflat,x_plt_flat,initphi_large_L,interfaces,LayerMat,A1h] = self.temp_data_Lat.Msetup() if self.temp_data_Spin: print("Line 728 Spinsystem") if self.temp_data.plt_points is not self.temp_data_Spin.plt_points: self.temp_data_Spin.plt_points = self.temp_data.plt_points print('-----------------------------------------------------------') print('The number of plotting points in the electron system \n'\ 'is not the same as in the spin system.\n'\ 'They are set equal to avoid matrix dimension missmatch.') print('-----------------------------------------------------------') if self.temp_data.collocpts is not self.temp_data_Spin.collocpts: self.temp_data_Spin.collocpts = self.temp_data.collocpts print('-----------------------------------------------------------') print('The number of collocation points in the electron system \n'\ 'is not the same as in the spin system.\n'\ 'They are set equal to avoid matrix dimension missmatch.') print('-----------------------------------------------------------') [c_S,A00,Abig,A1b,A2b,Cb,length,N,plp,xflat,x_plt_flat,initphi_large_S,interfaces,LayerMat,A1h] = self.temp_data_Spin.Msetup() if (self.source.fluence == 0): print('-----------------------------------------------------------') print('No source is applied.\n'\ 'source.fluence = 0') print('-----------------------------------------------------------') xmg, tmg = np.meshgrid(xflat,t) sourceM = np.zeros_like(xmg) else: sourceM = self.sourceprofile(self.source.spaceprofile,self.source.timeprofile,xflat,self.temp_data.length,t,N) #Making the boundary conditions a function of t, in case they are given as scalars if isinstance(self.left_BC,(int,float)): dummy = self.left_BC self.left_BC = lambda t: dummy + 0*t if isinstance(self.right_BC,(int,float)): dummy1 = self.right_BC self.right_BC = lambda t: dummy1 + 0*t #Makint the boundary conditions a matrix for the electron case BC_E = np.zeros((len(c_E),len(t))) BC_E[0] = self.left_BC(t) BC_E[-1] = self.right_BC(t) #Checking the Lattice system boundary conditions if self.temp_data_Lat: if isinstance(self.left_BC_L,(int,float)): dummy2 = self.left_BC_L self.left_BC_L = lambda t: dummy2 + 0*t if isinstance(self.right_BC_L,(int,float)): dummy3 = self.right_BC_L self.right_BC_L = lambda t: dummy3 + 0*t #Makint the boundary conditions a matrix for the lattice case BC_L = np.zeros((len(c_L),len(t))) BC_L[0] = self.left_BC_L(t) BC_L[-1] = self.right_BC_L(t) #Checking the Spine system boundary conditions #It impies that we at least consider 2 temperatures -> under this "if-tree" if self.temp_data_Spin: if isinstance(self.left_BC_S,(int,float)): dummy4 = self.left_BC_S self.left_BC_S = lambda t: dummy4 + 0*t if isinstance(self.right_BC_S,(int,float)): dummy5 = self.right_BC_S self.right_BC_S = lambda t: dummy5 + 0*t #Makint the boundary conditions a matrix for the Spin case BC_S = np.zeros((len(c_S),len(t))) BC_S[0] = self.left_BC_S(t) BC_S[-1] = self.right_BC_S(t) #Check if the Lattice/Spin and Spin/Electron coupling constants have the right size if np.size(self.coupling_LS)<np.size(length)-1: self.coupling_LS = self.coupling_LS*np.ones(np.size(self.temp_data.length)-1) print('-----------------------------------------------------------') print('Not every layer has a unique Lattice-Spin coupling constant \'G_LS \'.\n')\ ('=> G_LS will be set to the value of the first layer = {coupling_LS[0]:.2e}\n for all other layers.'.format(coupling_LS=self.coupling_LS)) print('-----------------------------------------------------------') if np.size(self.coupling_SE)<np.size(length)-1: self.coupling_SE = self.coupling_SE*np.ones(np.size(self.temp_data.length)-1) print('-----------------------------------------------------------') print('Not every layer has a unique Spin-Electron coupling constant \'G_SE \'.\n')\ ('=> G_SE will be set to the value of the first layer = {coupling_SE[0]:.2e}\n for all other layers.'.format(coupling_SE=self.coupling_SE)) print('-----------------------------------------------------------') #If only the two temperature model is considered I only need to check one coupling constant if np.size(self.coupling)<np.size(length)-1: self.coupling = self.coupling*np.ones(np.size(self.temp_data.length)-1) print('-----------------------------------------------------------') print('Not every layer has a unique coupling constant \'G \'.\n')\ ('=> G will be set to the value of the first layer = {coupling[0]:.2e}\n for all other layers.'.format(coupling=self.coupling)) print('-----------------------------------------------------------') # The 3 Temperature Case is being considered if self.temp_data_Spin: #Setup arrays for electron temperature phi_E = np.zeros((len(t),len(x_plt_flat))); phi_E[0] = initphi_large Flow_1E = np.zeros(len(c_E)) Flow_2E = np.zeros(len(c_E)) dphi_E = np.zeros(len(c_E)) intphi_E = np.zeros(len(c_E)) #Setup arrays for lattice temperature phi_L = np.zeros((len(t),len(x_plt_flat))); phi_L[0] = initphi_large_L #300*np.ones(len(phi_L[0])) Flow_1L = np.zeros(len(c_L)) Flow_2L = np.zeros(len(c_L)) dphi_L = np.zeros(len(c_L)) intphi_L = np.zeros(len(c_L)) #Setup arrays for the spin temperature phi_S = np.zeros((len(t),len(x_plt_flat))); phi_S[0] = initphi_large_S #300*np.ones(len(phi_L[0])) Flow_1S = np.zeros(len(c_S)) Flow_2S = np.zeros(len(c_S)) dphi_S = np.zeros(len(c_S)) intphi_S = np.zeros(len(c_S)) #General setup for E.E. loop condi = np.array([np.arange(1,len(length)-1)])*(N-1) #Index to apply interface condition cnfill = np.array([np.arange(1,len(length)-1)])*(plp-1)#correct interface condition with real value for phi A00[0] = 1; A00[-1] = 1 #Avoide devide through 0 in dphi_L! Clar for BC before intphi calc. Abig_E = np.copy(Abig) #Since Abig can change due to interconditions we split it here Abig_L = np.copy(Abig) #The interface conditions are applied on every time step Abig_S = np.copy(Abig) #Every system gets individual matrix start_EL = time.time() for i in tqdm(range(1,len(t)),position = 0): #Calculate Solution at every time step and respective derivatives phi0_E = np.dot(A00,c_E); phi1_E = np.dot(A1b,c_E); phi2_E = np.dot(A2b,c_E) phi0_L = np.dot(A00,c_L); phi1_L = np.dot(A1b,c_L); phi2_L = np.dot(A2b,c_L) phi0_S = np.dot(A00,c_S); phi1_S = np.dot(A1b,c_S); phi2_S = np.dot(A2b,c_S) #Calculating interface conditions which are applied later intercon_E = self.interconditions(phi_E[i-1],interfaces,self.temp_data.conductivity,N,A1h) intercon_L = self.interconditions(phi_L[i-1],interfaces,self.temp_data_Lat.conductivity,N,A1h) intercon_S = self.interconditions(phi_S[i-1],interfaces,self.temp_data_Spin.conductivity,N,A1h) startf = 0;endf = N-1 #Construct all picewise flows and piecewise dphi. Iterate over layers for j in range(0,interfaces+1): #electron: d/dx[k(phi) * d/dx(phi)] Flow_1E[startf:endf] = self.temp_data.diff_conductivity(phi0_E[startf:endf],j) Flow_2E[startf:endf] = self.temp_data.conductivity[j](phi0_E[startf:endf]) Flow_1E[startf:endf] *=phi1_E[startf:endf]**2 Flow_2E[startf:endf] *= phi2_E[startf:endf] #lattice Flow_1L[startf:endf] = self.temp_data_Lat.diff_conductivity(phi0_L[startf:endf],j) Flow_2L[startf:endf] = self.temp_data_Lat.conductivity[j](phi0_L[startf:endf]) Flow_1L[startf:endf] *=phi1_L[startf:endf]**2 Flow_2L[startf:endf] *= phi2_L[startf:endf] #Spin Flow_1S[startf:endf] = self.temp_data_Spin.diff_conductivity(phi0_S[startf:endf],j) Flow_2S[startf:endf] = self.temp_data_Spin.conductivity[j](phi0_S[startf:endf]) Flow_1S[startf:endf] *=phi1_S[startf:endf]**2 Flow_2S[startf:endf] *= phi2_S[startf:endf] #calculate delta phi for electron, lattice and spin #This is the core of the problem dphi_E[startf:endf] = 1/(self.temp_data.heatCapacity[j](phi0_E)[startf:endf]*self.temp_data.rho[j])*\ (Flow_1E[startf:endf]+Flow_2E[startf:endf]+sourceM[i,startf:endf] +\ self.coupling[j]*(phi0_L[startf:endf]-phi0_E[startf:endf])+self.coupling_SE[j]*(phi0_S[startf:endf]-phi0_E[startf:endf])) #Lattice time derivative dphi_L[startf:endf] = 1/(self.temp_data_Lat.heatCapacity[j](phi0_L)[startf:endf]*self.temp_data_Lat.rho[j])*\ (Flow_1L[startf:endf]+Flow_2L[startf:endf] +\ self.coupling[j]*(phi0_E[startf:endf]-phi0_L[startf:endf])+self.coupling_LS[j]*(phi0_S[startf:endf]-phi0_L[startf:endf])) #Spin system time derivative dphi_S[startf:endf] = 1/(self.temp_data_Spin.heatCapacity[j](phi0_S)[startf:endf]*self.temp_data_Spin.rho[j])*\ (Flow_1S[startf:endf]+Flow_2S[startf:endf] +\ self.coupling_LS[j]*(phi0_L[startf:endf]-phi0_S[startf:endf])+self.coupling_SE[j]*(phi0_E[startf:endf]-phi0_S[startf:endf])) startf += N-1; endf +=N-1 #Move one layer further start_i = 0; end_i = N-1 #Apply interface conditions for all layers in every time step, i.e.: #filling up Abig wiht the interface condition in the middle of the grid for k in range(0,interfaces): #for the electron system Abig_E[end_i,start_i:end_i] = intercon_E[0][k][:-1]#Lhs interface flow Abig_E[end_i,end_i+1:end_i+N] = -intercon_E[1][k][1:]#Rhs interface flow Abig_E[end_i,end_i] = intercon_E[0][k][-1] -intercon_E[1][k][0] #for the lattice system Abig_L[end_i,start_i:end_i] = intercon_L[0][k][:-1]#Lhs interface flow Abig_L[end_i,end_i+1:end_i+N] = -intercon_L[1][k][1:]#Rhs interface flow Abig_L[end_i,end_i] = intercon_L[0][k][-1] -intercon_L[1][k][0] #for the Spin system Abig_S[end_i,start_i:end_i] = intercon_S[0][k][:-1]#Lhs interface flow Abig_S[end_i,end_i+1:end_i+N] = -intercon_S[1][k][1:]#Rhs interface flow Abig_S[end_i,end_i] = intercon_S[0][k][-1] -intercon_S[1][k][0] start_i += N-1; end_i += N-1 #computing the flux for every time step at the boundaries #If Neumann BC-> devide over k(T) since BC_Type = 1 #If Dirichlet BC -> devide over 1 since BC_Type = 0 Flux_E = BC_E[:,i]#Avoidint 0 in denominator Flux_E[0] /= self.temp_data.conductivity[0](c_E[0])**self.temp_data.Left_BC_Type + 1e-12 Flux_E[-1] /= self.temp_data.conductivity[-1](c_E[-1])**self.temp_data.Right_BC_Type + 1e-12 Flux_L = BC_L[:,i] Flux_L[0] /= self.temp_data_Lat.conductivity[0](c_L[0])**self.temp_data_Lat.Left_BC_Type + 1e-12 Flux_L[-1] /= self.temp_data_Lat.conductivity[-1](c_L[-1])**self.temp_data_Lat.Right_BC_Type + 1e-12 Flux_S = BC_S[:,i] Flux_S[0] /= self.temp_data_Spin.conductivity[0](c_S[0])**self.temp_data_Spin.Left_BC_Type + 1e-12 Flux_S[-1] /= self.temp_data_Spin.conductivity[-1](c_S[-1])**self.temp_data_Spin.Right_BC_Type + 1e-12 #Clear for boundary conditions at the edgeds of the grid dphi_E[0] = 0; dphi_E[-1] = 0; phi0_E[0] = 0; phi0_E[-1] = 0; dphi_L[0] = 0; dphi_L[-1] = 0; phi0_L[0] = 0; phi0_L[-1] = 0; dphi_S[0] = 0; dphi_S[-1] = 0; phi0_S[0] = 0; phi0_S[-1] = 0; #intermediate phi with low resolution in space according to explicit euler intphi_E = phi0_E + tstep[i] * dphi_E + Flux_E intphi_L = phi0_L + tstep[i] * dphi_L + Flux_L intphi_S = phi0_S + tstep[i] * dphi_S + Flux_S #Interface condition: Setting the rhs to 0, such that the heat transported (flux = Q = k*d/dx phi) #from left is what comes out at the right hand side Q_1 -> Q_2 intphi_E[condi] = 0 #Interface condition: Q_1 -Q_2 = 0 intphi_L[condi] = 0 intphi_S[condi] = 0 #electron: use c to map on high resolution x-grid #since in Abig, k(T(t)) is inserted we have to solve the system for every step c_E = np.linalg.solve(Abig_E,intphi_E) # c(t) for every timestep phi_E[i] = np.dot(Cb,c_E) # map spline coefficients to fine Cb grid phi_E[i,cnfill] = c_E[condi] #correct the values for phi at interface #lattice c_L = np.linalg.solve(Abig_L,intphi_L) phi_L[i] = np.dot(Cb,c_L) phi_L[i,cnfill] = c_L[condi] #spin c_S = np.linalg.solve(Abig_S,intphi_S) phi_S[i] = np.dot(Cb,c_S) phi_S[i,cnfill] = c_S[condi] end_EL = time.time() print('-----------------------------------------------------------') print('Heat diffusion in a coupled electron-latticelspin system has been simulated') print('Eleapsed time in E.E.- loop:', end_EL-start_EL) print('-----------------------------------------------------------') T = [] T.append(phi_E); T.append(phi_L); T.append(phi_S) return(x_plt_flat,t,T) #=======End 3 temp Case ================================= #The two temperature model is considered if self.temp_data_Lat: #Setup arrays for electron temperature phi_E = np.zeros((len(t),len(x_plt_flat))); phi_E[0] = initphi_large Flow_1E = np.zeros(len(c_E)) Flow_2E = np.zeros(len(c_E)) dphi_E = np.zeros(len(c_E)) intphi_E = np.zeros(len(c_E)) #Setup arrays for lattice temperature phi_L = np.zeros((len(t),len(x_plt_flat))); phi_L[0] = initphi_large_L Flow_1L = np.zeros(len(c_L)) Flow_2L = np.zeros(len(c_L)) dphi_L = np.zeros(len(c_L)) intphi_L = np.zeros(len(c_L)) #General setup for E.E. loop condi = np.array([np.arange(1,len(length)-1)])*(N-1) #Index to apply interface condition cnfill = np.array([np.arange(1,len(length)-1)])*(plp-1)#correct interface condition with real value for phi A00[0] = 1; A00[-1] = 1 #Avoide devide through 0 in dphi_L! Clar for BC before intphi calc. Abig_E = np.copy(Abig) #Since Abig can change due to interconditions we split it here Abig_L = np.copy(Abig) #The interface conditions are applied on every time step start_EL = time.time() for i in tqdm(range(1,len(t)),position = 0): #Calculate Solution at every time step and respective derivatives phi0_E = np.dot(A00,c_E); phi1_E = np.dot(A1b,c_E); phi2_E = np.dot(A2b,c_E) phi0_L = np.dot(A00,c_L); phi1_L = np.dot(A1b,c_L); phi2_L = np.dot(A2b,c_L) #Calculating interface conditions which are applied later intercon_E = self.interconditions(phi_E[i-1],interfaces,self.temp_data.conductivity,N,A1h) intercon_L = self.interconditions(phi_L[i-1],interfaces,self.temp_data_Lat.conductivity,N,A1h) startf = 0;endf = N-1 #Construct all picewise flows and piecewise dphi Iterate over layers for j in range(0,interfaces+1): #electron Flow_1E[startf:endf] = self.temp_data.diff_conductivity(phi0_E[startf:endf],j) Flow_2E[startf:endf] = self.temp_data.conductivity[j](phi0_E[startf:endf]) Flow_1E[startf:endf] *=phi1_E[startf:endf]**2 Flow_2E[startf:endf] *= phi2_E[startf:endf] #lattice Flow_1L[startf:endf] = self.temp_data_Lat.diff_conductivity(phi0_L[startf:endf],j) Flow_2L[startf:endf] = self.temp_data_Lat.conductivity[j](phi0_L[startf:endf]) Flow_1L[startf:endf] *=phi1_L[startf:endf]**2 Flow_2L[startf:endf] *= phi2_L[startf:endf] #calculate delta phi for electron and lattice #This is the core of the problem dphi_E[startf:endf] = 1/(self.temp_data.heatCapacity[j](phi0_E)[startf:endf]*self.temp_data.rho[j])*\ (Flow_1E[startf:endf]+Flow_2E[startf:endf]+sourceM[i,startf:endf] + self.coupling[j]*(phi0_L[startf:endf]-phi0_E[startf:endf])) dphi_L[startf:endf] = 1/(self.temp_data_Lat.heatCapacity[j](phi0_L)[startf:endf]*self.temp_data_Lat.rho[j])*\ (Flow_1L[startf:endf]+Flow_2L[startf:endf] + self.coupling[j]*(phi0_E[startf:endf]-phi0_L[startf:endf])) startf += N-1; endf +=N-1 #filling up Abig wiht the interface condition in the middle of the grid start_i = 0; end_i = N-1 for k in range(0,interfaces): #Apply interface conditions for all layers in every time step #for the electron system Abig_E[end_i,start_i:end_i] = intercon_E[0][k][:-1]#Lhs interface flow Abig_E[end_i,end_i+1:end_i+N] = -intercon_E[1][k][1:]#Rhs interface flow Abig_E[end_i,end_i] = intercon_E[0][k][-1] -intercon_E[1][k][0] #for the lattice system Abig_L[end_i,start_i:end_i] = intercon_L[0][k][:-1]#Lhs interface flow Abig_L[end_i,end_i+1:end_i+N] = -intercon_L[1][k][1:]#Rhs interface flow Abig_L[end_i,end_i] = intercon_L[0][k][-1] -intercon_L[1][k][0] start_i += N-1; end_i += N-1 #computing the flux for every time step for the boundaries Flux_E = BC_E[:,i] Flux_E[0] /= self.temp_data.conductivity[0](c_E[0])**self.temp_data.Left_BC_Type + 1e-12 Flux_E[-1] /= self.temp_data.conductivity[-1](c_E[-1])**self.temp_data.Right_BC_Type + 1e-12 Flux_L = BC_L[:,i] Flux_L[0] /= self.temp_data_Lat.conductivity[0](c_L[0])**self.temp_data_Lat.Left_BC_Type + 1e-12 Flux_L[-1] /= self.temp_data_Lat.conductivity[-1](c_L[-1])**self.temp_data_Lat.Right_BC_Type + 1e-12 #Clear for boundary conditions at the edgeds of the grid dphi_E[0] = 0; dphi_E[-1] = 0; dphi_L[0] = 0; dphi_L[-1] = 0 phi0_E[0] = 0; phi0_E[-1] = 0; phi0_L[0] = 0; phi0_L[-1] = 0; #intermediate phi with low resolution in space according to explicit euler intphi_E = phi0_E + tstep[i] * dphi_E + Flux_E intphi_E[condi] = 0 intphi_L = phi0_L + tstep[i] * dphi_L + Flux_L intphi_L[condi] = 0 #Interface condition: Q_1 -Q_2 = 0 #electron: use c to map on high resolution x-grid #since in Abig, k(T(t)) is inserted we have to solve the system for every step c_E = np.linalg.solve(Abig_E,intphi_E) # c(t) for every timestep phi_E[i] = np.dot(Cb,c_E) # map spline coefficients to fine Cb grid phi_E[i,cnfill] = c_E[condi] #correct the values for phi at interface #lattice c_L = np.linalg.solve(Abig_L,intphi_L) phi_L[i] = np.dot(Cb,c_L) phi_L[i,cnfill] = c_L[condi] end_EL = time.time() print('-----------------------------------------------------------') print('Heat diffusion in a coupled electron-lattice system has been simulated') print('Eleapsed time in E.E.- loop:', end_EL-start_EL) print('-----------------------------------------------------------') T = [] T.append(phi_E); T.append(phi_L) return(x_plt_flat,t,T) #=============End 2Temp Case ======================== else: #this is the single temperature case. (Only electron temperature) #prepare space to store phi solution on fine plt grid. And Flow_1,2 vectors phi = np.zeros((len(t),len(x_plt_flat))); phi[0] = initphi_large Flow_1 = np.zeros(len(c_E)) Flow_2 = np.zeros(len(c_E)) dphi = np.zeros(len(c_E)) intphi = np.zeros(len(c_E)) condi = np.array([np.arange(1,len(length)-1)])*(N-1) #Index to apply interface condition cnfill = np.array([np.arange(1,len(length)-1)])*(plp-1) #correct interface condition with real value for phi A00[0] = 1; A00[-1] = 1 #Avoid 1/0 division in dphi calculation. See E.E. loop startE = time.time() for i in tqdm(range(1,len(t)),position = 0): phi0 = np.dot(A00,c_E); phi1 = np.dot(A1b,c_E); phi2 = np.dot(A2b,c_E) intercon_E = self.interconditions(phi[i-1],interfaces,self.temp_data.conductivity,N,A1h) #get interface conditions for every time step startf = 0;endf = N-1 #construct all picewise flows and piecewise dphi for j in range(0,interfaces+1): Flow_1[startf:endf] = self.temp_data.diff_conductivity(phi0[startf:endf],j) Flow_2[startf:endf] = self.temp_data.conductivity[j](phi0[startf:endf]) Flow_1[startf:endf] *=phi1[startf:endf]**2 Flow_2[startf:endf] *= phi2[startf:endf] dphi[startf:endf] = 1/(self.temp_data.heatCapacity[j](phi0)[startf:endf]*self.temp_data.rho[j])*\ (Flow_1[startf:endf]+Flow_2[startf:endf]+sourceM[i,startf:endf]) startf += N-1; endf +=N-1 #filling up Abig wiht the interface condition in the middle of the grid start_i = 0; end_i = N-1 for k in range(0,interfaces): #Apply interface conditions for all layers in every time step Abig[end_i,start_i:end_i] = intercon_E[0][k][:-1]#Lhs interface flow Abig[end_i,end_i+1:end_i+N] = -intercon_E[1][k][1:]#Rhs interface flow Abig[end_i,end_i] = intercon_E[0][k][-1] -intercon_E[1][k][0] start_i += N-1; end_i += N-1 #computing the flux for every time step for the boundaries Flux_E = BC_E[:,i] Flux_E[0] /= self.temp_data.conductivity[0](c_E[0])**self.temp_data.Left_BC_Type + 1e-12 Flux_E[-1] /= self.temp_data.conductivity[-1](c_E[-1])**self.temp_data.Right_BC_Type + 1e-12 #Make space for BC dphi[0] = 0; dphi[-1] = 0 phi0[0] = 0; phi0[-1] = 0 intphi = phi0 + tstep[i] * dphi + Flux_E intphi[condi] = 0 #Interface condition: Q_1 -Q_2 = 0 # c(t) for every timestep #since in Abig k(T(t)) is inserted we have to solve the system for every step c_E = np.linalg.solve(Abig,intphi) #this system has to be solved in every time step phi[i] = np.dot(Cb,c_E) # map spline coefficients to fine Cb grid phi[i,cnfill] = c_E[condi] #correct the values for phi at interface endE = time.time() print('-----------------------------------------------------------') print('Electron temperature heat diffusion has been simulated.') print('Eleapsed time in E.E.- loop:', endE-startE) print('-----------------------------------------------------------') return(x_plt_flat,t,phi) def stability(self): """ If only the electron temperature system is under consideration, we only compute the eigenvalues of lambda_i = k/(C*rho)*A00^-1*A2b. This is we consider the minimum Eigenvalue for each layer to represent the time konstant. The time constant for E.E. is then given by -2/min(lambda_i), which is the criterion for stability for E.E. loops, to obtain convergence. """ [c,A00,Abig,A1b,A2b,Cb,length,N,plp,xflat,x_plt_flat,initphi_large,interfaces,LayerMat,A1h] = self.temp_data.Msetup() A00[0,0] = 1; A00[-1,-1] = 1 rho_E = self.temp_data.rho conductivity_E = self.temp_data.conductivity conductivity_E = np.asarray(conductivity_E) typecheck = np.array([1])[0] for i in range(0,len(conductivity_E)): #In case conductivity is a function k(T) we compute a worst case scenario #this is because we can only compare integers. if not isinstance(conductivity_E[i],(int,float,type(typecheck))): testT = np.linspace(self.stability_lim[0],self.stability_lim[1],50) conductivity_E[i] = max(conductivity_E[i](testT)) heatCapacity_E = self.temp_data.heatCapacity heatCapacity_E = np.asarray(heatCapacity_E) for i in range(0,len(heatCapacity_E)): #In case heatCapacity is a function C(T) we compute a worst case scenario #and take an integer value to compare if not isinstance(heatCapacity_E[i],(int,float,type(typecheck))): testT = np.linspace(self.stability_lim[0],self.stability_lim[1],50) heatCapacity_E[i] = min(heatCapacity_E[i](testT)) Eval = np.zeros(interfaces+1) #for each layer there will be an eigenvalue koeff1 = conductivity_E/(heatCapacity_E*rho_E) for i in range(0,interfaces+1): Lambda = koeff1[i]*LayerMat[i] Eval[i] = min(np.real(np.linalg.eig(Lambda)[0])) tkonst_E = -1.9/Eval if self.num_of_temp == 2: """ In the multy temperature case, we also consider the lattice dynamics, with respective k_L/(C_L*rho_L) dynamics. In addition, we also have to consider, the coupling between those two layers. I.e. G_mat. with coefficients koeff_2 = G/(heatCapacity*rho) Therefor we compute eigenvalues of the combined system: lambda_i = eval(Lambda + G_mat) for each layer. The time constant is again -2/min(lambda_i) """ if self.temp_data.collocpts is not self.temp_data_Lat.collocpts: self.temp_data_Lat.collocpts = self.temp_data.collocpts print('-----------------------------------------------------------') print('The number of collocation points in the electron system \n'\ 'is not the same as in the lattice system.\n'\ 'They are set equal to avoid matrix dimension missmatch.') print('-----------------------------------------------------------') [c,A00_L,Abig,A1b,A2b_L,Cb,length,N,plp,xflat,x_plt_flat,initphi_large,interfaces,LayerMat,A1h] = self.temp_data_Lat.Msetup() A00_L[0,0] = 1; A00_L[-1,-1] = 1 rho_L = self.temp_data_Lat.rho G = self.coupling G = np.asarray(G) conductivity_L = self.temp_data_Lat.conductivity conductivity_L = np.asarray(conductivity_L) #In case conductivity is a function k(T) we compute a worst case scenario for i in range(0,len(conductivity_L)): if not isinstance(conductivity_L[i],(int ,float,type(typecheck))): testT = np.linspace(self.stability_lim[0],self.stability_lim[1],50) conductivity_L[i] = max(conductivity_L[i](testT)) heatCapacity_L = self.temp_data_Lat.heatCapacity heatCapacity_L = np.asarray(heatCapacity_L) #In case heatCapacity is a function C(T) we compute a worst case scenario for i in range(0,len(heatCapacity_L)): if not isinstance(heatCapacity_L[i],(int,float,type(typecheck))): testT = np.linspace(self.stability_lim[0],self.stability_lim[1],50) heatCapacity_L[i] = min(heatCapacity_L[i](testT)) #M: for every layer we load the respective matrix from the temperature class M = np.shape(LayerMat)[1] Lambda = np.zeros((2*M,2*M)) Eval = np.zeros(interfaces+1) G_mat = np.zeros((2*M,2*M)) koeff1_E = conductivity_E/(heatCapacity_E*rho_E) koeff1_L = conductivity_L/(heatCapacity_L*rho_L) koeff2_E = G/(heatCapacity_E*rho_E) koeff2_L = G/(heatCapacity_L*rho_L) for i in range(0,interfaces+1): Lambda[0:M,0:M] = koeff1_E[i]*LayerMat[i] Lambda[M:,M:] = koeff1_L[i]*LayerMat[i] G_mat[0:M,0:M] = -koeff2_E[i]*np.eye(M) G_mat[0:M,M:] = koeff2_E[i]*np.eye(M) G_mat[M:,0:M] = koeff2_L[i]*np.eye(M) G_mat[M:,M:] = -koeff2_L[i]*np.eye(M) Eval[i] = min(np.real(np.linalg.eig(Lambda+G_mat)[0])) tkonst = -1.9/Eval return(min(tkonst)) if self.num_of_temp == 3: """ Consider the case of a three temperature odel and follow the same procedure as in the two TM case, except for now take all the coupling constants int consideration! """ if self.temp_data.collocpts is not self.temp_data_Lat.collocpts: self.temp_data_Lat.collocpts = self.temp_data.collocpts print('-----------------------------------------------------------') print('The number of collocation points in the electron system \n'\ 'is not the same as in the lattice system.\n'\ 'They are set equal to avoid matrix dimension missmatch.') print('-----------------------------------------------------------') if self.temp_data.collocpts is not self.temp_data_Spin.collocpts: self.temp_data_Spin.collocpts = self.temp_data.collocpts print('-----------------------------------------------------------') print('The number of collocation points in the electron system \n'\ 'is not the same as in the spin system.\n'\ 'They are set equal to avoid matrix dimension missmatch.') print('-----------------------------------------------------------') [c,A00_L,Abig,A1b,A2b_L,Cb,length,N,plp,xflat,x_plt_flat,initphi_large,interfaces,LayerMat,A1h] = self.temp_data_Lat.Msetup() A00_L[0,0] = 1; A00_L[-1,-1] = 1 rho = self.temp_data_Lat.rho #Load different coupling constants and make them arrays G_EL = self.coupling; G_EL = np.asarray(G_EL) G_LS = self.coupling_LS; G_LS = np.asarray(G_LS) G_SE = self.coupling_SE; G_SE = np.asarray(G_SE) conductivity_L = self.temp_data_Lat.conductivity conductivity_L = np.asarray(conductivity_L) conductivity_S = self.temp_data_Spin.conductivity conductivity_S = np.asarray(conductivity_S) heatCapacity_L = self.temp_data_Lat.heatCapacity heatCapacity_L = np.asarray(heatCapacity_L) heatCapacity_S = self.temp_data_Spin.heatCapacity heatCapacity_S = np.asarray(heatCapacity_S) #In case heatCapacity is a function C(T) we compute a worst case scenario #That is we reduce the problem into a constant coefficient case for i in range(0,len(conductivity_L)): if not isinstance(conductivity_L[i],(int,float,type(typecheck))): testT = np.linspace(self.stability_lim[0],self.stability_lim[1],50) conductivity_L[i] = max(conductivity_L[i](testT)) for i in range(0,len(conductivity_S)): if not isinstance(conductivity_S[i],(int,float,type(typecheck))): testT = np.linspace(self.stability_lim[0],self.stability_lim[1],50) conductivity_S[i] = max(conductivity_S[i](testT)) for i in range(0,len(heatCapacity_L)): if not isinstance(heatCapacity_L[i],(int,float,type(typecheck))): testT = np.linspace(self.stability_lim[0],self.stability_lim[1],50) heatCapacity_L[i] = min(heatCapacity_L[i](testT)) for i in range(0,len(heatCapacity_S)): if not isinstance(heatCapacity_S[i],(int,float,type(typecheck))): testT = np.linspace(self.stability_lim[0],self.stability_lim[1],50) heatCapacity_S[i] = min(heatCapacity_S[i](testT)) #construct Matrices for the Kronecker product K11 = np.array([[1,0,0],[0,0,0],[0,0,0]]) K12 = np.array([[0,1,0],[0,0,0],[0,0,0]]) K13 = np.array([[0,0,1],[0,0,0],[0,0,0]]) K21 = np.array([[0,0,0],[1,0,0],[0,0,0]]) K22 = np.array([[0,0,0],[0,1,0],[0,0,0]]) K23 = np.array([[0,0,0],[0,0,1],[0,0,0]]) K31 = np.array([[0,0,0],[0,0,0],[1,0,0]]) K32 = np.array([[0,0,0],[0,0,0],[0,1,0]]) K33 = np.array([[0,0,0],[0,0,0],[0,0,1]]) #Unity matrix for kronecker product on the RHS and palce to store Eval unity = np.eye(np.shape(LayerMat)[1]) Eval = np.zeros(interfaces+1) #Compute the minimum eigenvalue for every layer for i in range(0,interfaces+1): coeff_E = conductivity_E[i]/(heatCapacity_E[i]*rho[i]) coeff_L = conductivity_L[i]/(heatCapacity_L[i]*rho[i]) coeff_S = conductivity_S[i]/(heatCapacity_S[i]*rho[i]) Lambda = np.kron(K11,coeff_E*LayerMat[i]) Lambda += np.kron(K22,coeff_L*LayerMat[i]) Lambda += np.kron(K33,coeff_S*LayerMat[i]) G_mat = np.kron(K11,-unity*coeff_E*(G_EL[i]+G_SE[i])) G_mat += np.kron(K12,unity*coeff_E*G_EL[i]) G_mat += np.kron(K13,unity*coeff_E*G_SE[i]) G_mat += np.kron(K21,unity*coeff_L*G_EL[i]) G_mat += np.kron(K22,-unity*coeff_L*(G_EL[i]+G_LS[i])) G_mat += np.kron(K23,unity*coeff_L*G_LS[i]) G_mat += np.kron(K31,unity*coeff_S*G_SE[i]) G_mat += np.kron(K32,unity*coeff_S*G_LS[i]) G_mat += np.kron(K33,-unity*coeff_S*(G_SE[i]+G_LS[i])) #Compute the minimum eigenvalue for each layer Eval[i] = min(np.real(np.linalg.eig(Lambda+G_mat)[0])) tkonst = -1.9/Eval #The global time constant will be guided by the fastest dynamics #of all the layers! return(min(tkonst)) else: #if there is only electron temperature, only those dynamics will be #considered, when time step for the E.E. loop is calculated. return(min(tkonst_E)) class source(object): def __init__(self): self.spaceprofile = 'TMM' self.timeprofile = 'Gaussian' self.fluence = 0 self.t0 = 0 self.FWHM = False self.loadData = False self.multipulse = False self.frequency = False self.num_of_pulses = False self.adjusted_grid = False self.dt0 = False self.extra_points = 200 self.theta_in = 0# 0 is perpendicular to surface/ pi/2 is grazing self.lambda_vac = False self.polarization = 'p' def getProperties(self): # to depict the properties of the object for i in (self.__dict__): name = str(i) value = str(self.__dict__[i]) print('{:<20}{:>10}'.format( name,value )) def __repr__(self): return('Source') def ref2delta(self,refindex,lambdavac): """ Use the refractive index and compute the optical penetration depth This is used for Lambert Beer´s absorption law. """ lambdavac_m = lambdavac*1e-9 #corp away the two layers of air and only consider target film layers refindex = refindex[1:-1] #If there is no imaginary part we avoid dividing over 0 for i in range(0,len(refindex)): if np.imag(refindex[i]) == 0: refindex[i] = refindex[i] + 1e-9j deltap = (4*np.pi/lambdavac_m*np.imag(refindex))**(-1) return(deltap) def Gaussian(self,xmg,tmg,lam,A,sigma2,x0,customtime = None): if not (self.fluence or self.FWHM): print('------------------------------------------------------------') print('Create a pulse with defining pulse properties. \n ' +\ '.fluence, .optical_penetration_depth, .FWHM') print('------------------------------------------------------------') if np.any(customtime) == None: #Create a source with respect to each lam of every layer. Use the init_G_source function Gauss = A*np.exp(-(tmg-self.t0)**2/(2*sigma2)) #Gaussian in time else: Gauss = A*customtime#custom in time Gauss *= lam*np.exp(-lam*(xmg-x0))#space profile: LB decay return(Gauss) def init_G_source(self,xflat,x0,t,opt_pen,N,func,customtime = None,scaling = 0): """ First an empty array 'sourceM' is created. Then we iterate over the different layers and call func --> Gaussian. This will create a 2D (time, space) Gaussian source grid with different lam[i]. For each layer, the problem is receted, i.e. we have new Amplitude, new scope of the x-grid, new lambda. Only sigma stays the same. """ lam = 1/opt_pen #create space for solution of source in matrix form xmg, tmg = np.meshgrid(xflat,t) sourceM = np.zeros(np.shape(xmg)) if np.any(customtime) == None: #Convert the input, fluence & FWHM given in 'source' class to Amplitude and sigma sigma2 = self.FWHM**2/(2*np.log(2)) A = self.fluence/np.sqrt(2*np.pi*sigma2) #loop over all layers and change lambda, Amplitude and scope of the x-grid startL = 0; endL = N-1 for i in range(2,len(opt_pen)+2): sourceM[:,startL:endL] = func(xmg[:,startL:endL],tmg[:,startL:endL],lam[i-2],A,sigma2,x0[i-2]) #at the end of each loop: the intensity of the end of previous layer #will be the starting intensity of the next layer A = A*np.exp(-(x0[i-1]-x0[i-2])*lam[i-2]) startL = endL; endL = i*N-i+1 else:#In the case of LB in space and custom in time if (self.timeprofile== "RepGaussian") or (self.timeprofile=="repGaussian"): sigma2 = self.FWHM**2/(2*np.log(2)) A = self.fluence/np.sqrt(2*np.pi*sigma2) startL = 0; endL = N-1 for i in range(2,len(opt_pen)+2): sourceM[:,startL:endL] = func(xmg[:,startL:endL],tmg[:,startL:endL],lam[i-2],A,sigma2,x0[i-2],customtime[:,startL:endL]) #at the end of each loop: the intensity of the end of previous layer #will be the starting intensity of the next layer A = A*np.exp(-(x0[i-1]-x0[i-2])*lam[i-2]) startL = endL; endL = i*N-i+1 if (self.timeprofile== "custom") or (self.timeprofile == "Custom"): A = scaling#calculated in the custom() function sigma2 = 0#It is not needed startL = 0; endL = N-1 for i in range(2,len(opt_pen)+2): sourceM[:,startL:endL] = func(xmg[:,startL:endL],tmg[:,startL:endL],lam[i-2],A,sigma2,x0[i-2],customtime[:,startL:endL]) #at the end of each loop: the intensity of the end of previous layer #will be the starting intensity of the next layer A = A*np.exp(-(x0[i-1]-x0[i-2])*lam[i-2]) startL = endL; endL = i*N-i+1 return(sourceM) #mytime is the timegrid of the simulation #time, amplitude are the timegrids of the inputdata collected from the lab def custom(self,mytime,myspace,ttime,amplitude,opt_pen): lam = 1/opt_pen #Mapping the obtained data to the simulation time grid via interpolation ampl1D = np.interp(mytime,ttime,amplitude**2) #Compute the right amplitude. using the area under the curve integr = np.trapz(ampl1D,mytime,np.diff(mytime)) #scling factore to get the amplitude right scaling = self.fluence/integr xmg,tmg = np.meshgrid(myspace,mytime) ampltime= np.interp(tmg,ttime,amplitude**2) #ampltime *= scaling ampl2D = ampltime*lam*np.exp(-lam*xmg) return(ampl2D,ampltime,scaling) def fresnel(self,theta_in,n_in,n_out,pol): n_in = complex(n_in); n_out = complex(n_out) theta_out = np.arcsin(n_in*np.sin(theta_in)/n_out) if pol == 's': rs = (n_in*np.cos(theta_in) - n_out*np.cos(theta_out))/\ (n_in*np.cos(theta_in) + n_out*np.cos(theta_out)) ts = 2*n_in*np.cos(theta_in)/(n_in*np.cos(theta_in)+n_out*np.cos(theta_out)) return(theta_out,rs,ts) if pol == 'p': rp = (n_out*np.cos(theta_in)-n_in*np.cos(theta_out))/\ (n_out*np.cos(theta_in)+n_in*np.cos(theta_out)) tp = 2* n_in*np.cos(theta_in)/(n_out*np.cos(theta_in)+n_in*np.cos(theta_out)) return(theta_out,rp,tp) def TM(self,theta_in,lambda0,n_vec,d_vec,pol): #create complex arrays for variables theta = np.zeros(len(n_vec), dtype = complex); theta[0] = theta_in phi = np.zeros(len(n_vec),dtype = complex) rn = np.zeros(len(n_vec)-1, dtype = complex) tn = np.zeros_like(rn,dtype = complex) M_n = np.zeros((len(n_vec),2,2), dtype = complex) M = np.eye(2,dtype = complex) for i in range(len(n_vec)-1): # to obtian all angels/rn/tn for each layer [theta[i+1],rn[i],tn[i]] = self.fresnel(theta[i],n_vec[i],n_vec[i+1],pol) #M = M0*M1*M2*M4*.... for k in range(1,len(n_vec)-1):#loop over all interfaces except 1st phi[k] = 2*np.pi*n_vec[k]*np.cos(theta[k])*d_vec[k]/lambda0 Tn = np.array([[np.exp(-1j*phi[k]),0],[0,np.exp(1j*phi[k])]],dtype = complex)/tn[k] Pn = np.array([[1,rn[k]],[rn[k],1]],dtype = complex) M_n[k] = np.dot(Tn,Pn) M = np.dot(M,M_n[k]) #compute for the first interface: trans0 = np.array([[1,rn[0]],[rn[0],1]],dtype= complex)/tn[0] M = np.dot(trans0,M) #Complex transmission/reflection amplitude t = 1/M[0,0] r = M[1,0]/M[0,0] #Fraction of power transmitted if pol == 's': #s-polarized T = np.abs(t)**2*np.real(n_vec[-1]*np.cos(theta[-1]))/\ np.real(n_vec[0]*np.cos(theta[0])) elif pol == 'p': #p-polarized T = np.abs(t)**2*np.real(n_vec[-1]*np.cos(np.conj(theta[-1])))/\ np.real(n_vec[0]*np.cos(np.conj(theta[0]))) #Fraction of power reflected R = np.abs(r)**2 A = 1.-T-R return(M,M_n,t,r,T,R,A,theta) def layerAmpl(self,theta_in,lambda0,n_vec,d_vec,pol): """ After r & t have been calculated and all the respective matrices M_n for each layer are known, we can go 'backwards', i.e. from the last to the first layer, and compute all the amplituedes for the forward v_n and backward w_n traveling wave. -> [v_n,w_n].T = M_n @ [v_{n+1},w_{n+1}].T """ [M,M_n,t,r,T,R,A,theta] = self.TM(theta_in,lambda0,n_vec,d_vec,pol) vw_list = np.zeros((len(n_vec),2),dtype = complex) vw =np.array([[t],[0]]) vw_list[-1,:] = vw.T for i in range(len(n_vec)-2,0,-1): vw = np.dot(M_n[i],vw) vw_list[i,:] = vw.T return(vw_list,theta) def absorption(self,theta_in,lambda0,n_vec,d_vec,pol,points): #reload the forward and backward wave coefficients for every layer [vw_n,theta] = self.layerAmpl(theta_in,lambda0,n_vec,d_vec,pol) total_len = np.sum(d_vec[1:-1]) pointcount = 0 #a is an array where the normalized absorbtion for the entire grid is stored a = [] for i in range(1,len(n_vec)-1): kz = 2*np.pi*n_vec[i]*
np.cos(theta[i])
numpy.cos
#!/usr/bin/env python # coding: utf-8 # In[7]: import pandas as pd import numpy as np from tqdm import tqdm import matplotlib.pyplot as plt import time import random from itertools import chain # Digit data loading # # In[8]: training_data = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\trainingimages",skip_blank_lines=False, header=None,squeeze = True) training_labels = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\traininglabels",skip_blank_lines=False, header=None) test_images = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\testimages",skip_blank_lines=False, header=None,squeeze = True) test_labels = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\testlabels",skip_blank_lines=False, header=None) # In[9]: print(training_data[0:28], test_images[0:28]) # In[ ]: # Each image in digit data is described as 28*28 pixel image. Which can be mapped # In[10]: def transform_data(data): data_temp = data.copy() for i in range(data_temp.shape[0]): data_temp[i] = data_temp[i].replace(' ', '0').replace('#', '1').replace('+', '1') data_temp = data_temp.apply(lambda x: pd.Series(list(x))) data_temp = data_temp.apply(pd.to_numeric) return data_temp train_digit_data= transform_data(training_data) test_digit_data=transform_data(test_images) # In[12]: # Selecting 4x4 pixel blocks and their number of color pixels(1) as features def colorpixelcount(df, image_height, feature_size): count_list=[] for i in range(int(image_height/feature_size)): for j in range(int(df.shape[1]/feature_size)): count=0 for k in range((i*feature_size),(i*feature_size)+feature_size): for l in range((j*feature_size),(j*feature_size)+feature_size): if df.iloc[k,l]==1: count=count+1 count_list.append(count) return count_list def perceptron_features(data_temp, image_height, feature_size): feat_list=[] re = 0 while re<int(len(data_temp)/image_height): temp=colorpixelcount(data_temp.iloc[(image_height*re):(image_height*(re+1)),:].reset_index(drop=True), image_height, feature_size) feat_list.append(temp) re=re+1 return feat_list # In[13]: def perceptron_train(data_for_train, classes, iterations, labels,image_height, feature_size): start_time = time.time() perc_features = np.asarray(perceptron_features(data_for_train, image_height, feature_size)) weights = np.ones((classes,perc_features.shape[1])) trained_vector = np.zeros((classes,1)) for _ in range(iterations): for image_no in range(len(labels)): temp_output = np.dot(perc_features[image_no], weights.T) # get the highest predicted class value from the predicted class_temp = np.where(max(temp_output) == temp_output)[0][0] if class_temp != labels[image_no]: weights[class_temp] -= perc_features[image_no] weights[labels[image_no]] += perc_features[image_no] end_time = time.time() return weights, end_time-start_time # In[14]: def perceptron_test(test_digit_data,weights, test_labels, image_height, feature_size): perc_test_features = np.asarray(perceptron_features(test_digit_data,image_height, feature_size)) labels = np.asarray(test_labels) misclassified = 0 for image_no in range(len(test_labels)): predict_array = np.dot(perc_test_features[image_no],weights.T) class_temp = np.where(max(predict_array) == predict_array)[0][0] if class_temp != labels[image_no][0]: misclassified += 1 return (1 - misclassified/len(labels))*100 # accuracy = 1 - perceptron_test(weights,test_labels) # accuracy # In[176]: def perceptron_digit(classes,image_height, feature_size): ratio = np.arange(0.1,1.1,0.1) accuracies = [] std_accuracies = [] times = [] for value in tqdm(ratio): times_inner = [] accuracies_inner =[] for _ in range(4): num_samples = training_labels.shape[0] data_random_samples = random.sample(range(num_samples), int(value * num_samples)) data_sample_range = [ range(i * image_height, (i+1)*image_height) for i in data_random_samples] data_sample_range = list(chain(*data_sample_range)) data_for_train = train_digit_data.iloc[data_sample_range] labels_for_train = (np.asarray(training_labels)[data_random_samples]) weights, time = perceptron_train(data_for_train,classes,3,labels_for_train, image_height, feature_size) times_inner.append(time) accuracies_inner.append(perceptron_test(test_digit_data,weights, test_labels, image_height, feature_size)) accuracies.append(round(np.mean(accuracies_inner),3)) std_accuracies.append(round(np.std(accuracies_inner),3)) times.append(round(np.mean(times_inner),3)) training_split = np.array([ 10 * i for i in range(1,11,1)]) final_results = pd.DataFrame(list(zip(training_split,accuracies, std_accuracies, times)), columns = ['Training_split','Mean(Accuracy) (%)', 'Std(Accuracy) (%)','Training Time (sec)']) plt.plot(ratio,accuracies ) plt.title("Training split vs Accuracy ") plt.xlabel("Training Split") plt.ylabel("Accuracy") plt.show() plt.plot(ratio,times ) plt.title("Training time vs Training split") plt.xlabel("Training split") plt.ylabel("Time for training") plt.show() return final_results perceptron_digit(10,28,4) # Face classification for Perceptron # In[15]: training_face_data = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\facedata\\facedatatrain",skip_blank_lines=False, header=None,squeeze = True) training_face_labels = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\facedata\\facedatatrainlabels",skip_blank_lines=False, header=None) test_face_images = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\facedata\\facedatatest",skip_blank_lines=False, header=None,squeeze = True) test_face_labels = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\facedata\\facedatatestlabels",skip_blank_lines=False, header=None) # validation_face_images = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\facedata\\facedatavalidation",skip_blank_lines=False, header=None,squeeze = True) # validation_face_labels = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\facedata\\facedatavalidationlabels",skip_blank_lines=False, header=None) face_data_train = transform_data(training_face_data) face_data_test = transform_data(test_face_images) # In[16]: print(face_data_train.shape) print(training_face_labels.shape) # In[17]: def perceptron_face(classes,image_size, feature_size): accuracies = [] std_accuracies = [] times = [] ratio = np.arange(0.1,1.05,0.1) for value in tqdm(ratio): times_inner = [] accuracies_inner =[] for _ in range(4): num_samples = training_face_labels.shape[0] data_random_samples = random.sample(range(num_samples), int(value * num_samples)) data_sample_range = [ range(i * image_size, (i+1)*image_size) for i in data_random_samples] data_sample_range = list(chain(*data_sample_range)) data_face_train = face_data_train.iloc[data_sample_range] labels_for_train = (np.asarray(training_face_labels)[data_random_samples]) weights, time = perceptron_train(data_face_train,classes,1,labels_for_train, image_size, feature_size) times_inner.append(time) accuracies_inner.append(perceptron_test(face_data_test,weights, test_face_labels, image_size, feature_size)) accuracies.append(round(np.mean(accuracies_inner),3)) std_accuracies.append(round(np.std(np.array(accuracies_inner)),3)) times.append(round(np.mean(times_inner),3)) training_split = np.array([ 10 *i for i in range(1,11,1)]) final_results = pd.DataFrame(list(zip(training_split, accuracies, std_accuracies, times)), columns = ['Training_ratio','Mean(Accuracy) %', 'Std(Accuracy) %', 'Training Time (sec)']) plt.plot(ratio,accuracies ) plt.title("Training split vs Accuracy ") plt.xlabel("Training Split") plt.ylabel("Accuracy") plt.show() plt.plot(ratio,times ) plt.title("Training time vs Training split") plt.xlabel("Training split") plt.ylabel("Time for training") plt.show() return final_results # perceptron_face(2,70,2) # In[ ]: # In[18]: training_data = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\trainingimages",skip_blank_lines=False, header=None,squeeze = True) training_labels = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\traininglabels",skip_blank_lines=False, header=None) test_images = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\testimages",skip_blank_lines=False, header=None,squeeze = True) test_labels = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\testlabels",skip_blank_lines=False, header=None) # validation_images = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\validationimages",skip_blank_lines=False, header=None,squeeze = True) # validation_labels = pd.read_csv("C:\\Users\\<NAME>\\Desktop\\Project\\digitdata\\validationlabels",skip_blank_lines=False, header=None) # In[19]: train_digit_data= transform_data(training_data) test_digit_data=transform_data(test_images) # In[20]: train_digit_data.shape # We are not extracting the features separately here, which would mean each pixel is considered as an individual feature. # # In[21]: def knn_digit(train_data,k,image_height): train_shape = train_data.shape test_shape = test_digit_data.shape num_images = training_labels.shape[0] testing_num_images = test_labels.shape[0] # converting the testdata into numpy array and flattened for calculations test_dig_np = np.zeros(shape = (testing_num_images, test_shape[1]*image_height)) for i in range(testing_num_images): test_dig_np[i] = test_digit_data.iloc[i*image_height:(i+1)*image_height,:].to_numpy().flatten() accuracy = [] accuracy_std = [] time_list = [] ratio = np.arange(0.1,1.05,0.1) # flatten the training dataset for split in tqdm(ratio): accuracy_inner = [] time_inner = [] for _ in range(2): train_dig_np = np.zeros(shape=(int((train_shape[0]/image_height)*split),train_shape[1]*image_height)) start_time = time.time() num_samples = training_labels.shape[0] data_random_samples = random.sample(range(num_samples), int(split * num_samples)) data_sample_range = [ range(i * image_height, (i+1)*image_height) for i in data_random_samples] data_sample_range = list(chain(*data_sample_range)) train_temp_data = train_data.iloc[data_sample_range,:] for i in range(int(num_images*split)): train_dig_np[i] = train_temp_data[i*image_height:(i+1)*image_height].to_numpy().flatten() error = 0 for image_no in range(testing_num_images): each_image = test_digit_data[image_no*image_height:(image_no+1)*image_height] each_image = each_image.to_numpy().flatten() neighbours_vector = np.zeros(int(num_images*split)) # check each test image vector to each image in training dataset for j in range(int(num_images*split)): neighbours_vector[j] = ((each_image - train_dig_np[j])**2).sum() neighbour_df = pd.DataFrame(neighbours_vector) neighbour_df = neighbour_df[0].sort_values()[0:k] class_labels = [] for class_index in neighbour_df.index: class_labels.append(training_labels.iloc[data_random_samples[class_index],0]) predicted_class = pd.DataFrame(class_labels) predicted_value = predicted_class[0].value_counts().idxmax() # if the predicted class is not equal return training error if predicted_value != test_labels.iloc[image_no][0]: error += 1 # print(predicted_value, test_labels.iloc[image_no][0]) # print(error, testing_num_images) end_time = time.time() accuracy_inner.append(1 - error/testing_num_images) time_inner.append(end_time - start_time) accuracy.append(
np.mean(accuracy_inner)
numpy.mean
# Differentiable plasticity: Omniglot task. # Copyright (c) 2018 Uber Technologies, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # You MUST download the Python version of the Omniglot dataset # (https://github.com/brendenlake/omniglot), and move the 'omniglot-master' # directory inside this directory. # To get the results shown in the paper: # python3 omniglot.py --nbclasses 5 --nbiter 5000000 --rule oja --activ tanh --stepsizelr 1000000 --prestime 1 --gamma .666 --alpha free --lr 3e-5 # Alternative (using a shared, though still learned alpha across all connections): # python3 omniglot.py --nbclasses 5 --nbiter 5000000 --activ tanh --stepsizelr 1000000 --prestime 1 --gamma 0.3 --lr 1e-4 --alpha yoked # Note that this code uses click rather than argparse for command-line # parameter handling. I won't do that again. import pdb import torch import torch.nn as nn from torch.autograd import Variable import click import numpy as np from numpy import random import torch.nn.functional as F from torch import optim from torch.optim import lr_scheduler import random import sys import pickle import pdb import time import skimage from skimage import transform from skimage import io import os import platform # Uber-only #import OpusHdfsCopy #from OpusHdfsCopy import transferFileToHdfsDir, checkHdfs import numpy as np import glob np.set_printoptions(precision=4) defaultParams = { 'activ': 'tanh', # 'tanh' or 'selu' #'plastsize': 200, 'rule': 'hebb', # 'hebb' or 'oja' 'alpha': 'free', # 'free' of 'yoked' (if the latter, alpha is a single scalar learned parameter, shared across all connection) 'stepsizelr': 1e6, # How often should we change the learning rate? 'nbclasses': 5, 'gamma': .666, # The annealing factor of learning rate decay for Adam 'flare': 0, # Whether or not the ConvNet has more features in higher channels 'nbshots': 1, # Number of 'shots' in the few-shots learning 'prestime': 1, 'nbfeatures' : 64, # 128 is better (unsurprisingly) but we keep 64 for fair comparison with other reports 'prestimetest': 1, 'ipd': 0, # Inter-presentation delay 'imgsize': 31, 'nbiter': 5000000, 'lr': 3e-5, 'test_every': 500, 'save_every': 5000, 'rngseed':0 } NBTESTCLASSES = 100 #ttype = torch.FloatTensor; ttype = torch.cuda.FloatTensor; # Generate the full list of inputs, labels, and the target label for an episode def generateInputsLabelsAndTarget(params, imagedata, test=False): #print(("Input Boost:", params['inputboost'])) #params['nbsteps'] = params['nbshots'] * ((params['prestime'] + params['ipd']) * params['nbclasses']) + params['prestimetest'] inputT = np.zeros((params['nbsteps'], 1, 1, params['imgsize'], params['imgsize'])) #inputTensor, initially in numpy format... Note dimensions: number of steps x batchsize (always 1) x NbChannels (also 1) x h x w labelT = np.zeros((params['nbsteps'], 1, params['nbclasses'])) #labelTensor, initially in numpy format... patterns=[] if test: cats = np.random.permutation(np.arange(len(imagedata) - NBTESTCLASSES, len(imagedata)))[:params['nbclasses']] # Which categories to use for this *testing* episode? else: cats = np.random.permutation(np.arange(len(imagedata) - NBTESTCLASSES))[:params['nbclasses']] # Which categories to use for this *training* episode? #print("Test is", test, ", cats are", cats) #cats = np.array(range(params['nbclasses'])) + 10 cats = np.random.permutation(cats) #print(cats) # We show one picture of each category, with labels, then one picture of one of these categories as a test, without label # But each of the categories may undergo rotation by 0, 90, 180 or 270deg, for augmenting the dataset # NOTE: We randomly assign one rotation to all the possible categories, not just the ones selected for the episode - it makes the coding simpler rots = np.random.randint(4, size=len(imagedata)) #rots.fill(0) testcat = random.choice(cats) # select the class on which we'll test in this episode unpermcats = cats.copy() # Inserting the character images and labels in the input tensor at the proper places location = 0 for nc in range(params['nbshots']): np.random.shuffle(cats) # Presentations occur in random order for ii, catnum in enumerate(cats): #print(catnum) p = random.choice(imagedata[catnum]) for nr in range(rots[catnum]): p =
np.rot90(p)
numpy.rot90
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import torch from torch.utils import data import numpy as np from functools import reduce from egg.zoo.objects_game.util import compute_binomial import itertools import os import pathlib class VectorsLoader: def __init__(self, perceptual_dimensions=[4, 4, 4, 4, 4], n_distractors=1, batch_size=32, train_samples=128000, validation_samples=4096, test_samples=1024, shuffle_train_data=False, dump_data_folder=None, load_data_path =None, seed=None): self.perceptual_dimensions = perceptual_dimensions self._n_features = len(self.perceptual_dimensions) self.n_distractors = n_distractors self.batch_size = batch_size self.train_samples = train_samples self.validation_samples = validation_samples self.test_samples = test_samples self.shuffle_train_data = shuffle_train_data self.load_data_path = load_data_path self.dump_data_folder = pathlib.Path(dump_data_folder) if dump_data_folder is not None else None seed = seed if seed else np.random.randint(0, 2 ** 31) self.random_state = np.random.RandomState(seed) @property def n_features(self): return self._n_features @n_features.setter def n_features(self, n_features): self._n_features = n_features def upd_cl_options(self, opts): opts.perceptual_dimensions = self.perceptual_dimensions opts.train_samples = self.train_samples opts.validation_samples = self.validation_samples opts.test_samples = self.test_samples opts.n_distractors = self.n_distractors def load_data(self, data_file): data =
np.load(data_file)
numpy.load
from collections import OrderedDict from datetime import date import numpy as np from Constants import Constants from DCN_Experiments import DCN_Experiments from PS_Manager import PS_Manager from PS_Treated_Generator import PS_Treated_Generator from TARNet_Experiments import TARNet_Experiments from Utils import Utils from dataloader import DataLoader class Experiments: def __init__(self, running_mode): self.dL = DataLoader() self.running_mode = running_mode self.np_covariates_X_train = None self.np_covariates_X_test = None self.np_covariates_T_train = None self.np_covariates_T_test = None def run_all_experiments(self, train_path, test_path, iterations, ps_model_type): device = Utils.get_device() print(device) results_list = [] run_parameters = self.__get_run_parameters() print(str(run_parameters["summary_file_name"])) file1 = open(run_parameters["summary_file_name"], "a") for iter_id in range(iterations): print("--" * 20) print("iter_id: {0}".format(iter_id)) print("Jobs - NN") print("--" * 20) input_nodes = run_parameters["input_nodes"] self.np_covariates_X_train, self.np_covariates_X_test, self.np_covariates_X_val, \ self.np_covariates_T_train, \ self.np_covariates_T_test, self.np_covariates_T_val \ = self.__load_data(train_path, test_path, iter_id) # get propensity score for classifier training and testing ps_score_list_train, ps_score_list_val, ps_score_list_test, ps_model = \ self.__get_ps_model(ps_model_type, iter_id, run_parameters["input_nodes"], device) run_parameters["consolidated_file_path"] = self.get_consolidated_file_name(ps_model_type) print("--->>Train size: ") data_loader_dict_train = self.dL.prepare_tensor_for_DCN(self.np_covariates_X_train, self.np_covariates_T_train, ps_score_list_train, run_parameters["is_synthetic"]) print("--->>Validation size: ") data_loader_dict_val = self.dL.prepare_tensor_for_DCN(self.np_covariates_X_val, self.np_covariates_T_val, ps_score_list_val, run_parameters["is_synthetic"]) print("--->>Test size: ") data_loader_dict_test = self.dL.prepare_tensor_for_DCN(self.np_covariates_X_test, self.np_covariates_T_test, ps_score_list_test, run_parameters["is_synthetic"]) n_treated_original = data_loader_dict_train["treated_data"][0].shape[0] n_control_original = data_loader_dict_train["control_data"][0].shape[0] # Execute PM GAN ps_t = PS_Treated_Generator(data_loader_dict_train, data_loader_dict_val, ps_model, ps_model_type) balanced_dataset_dict = ps_t.simulate_treated_semi_supervised(input_nodes, iter_id, device) tensor_treated_balanced_dcn = balanced_dataset_dict["tensor_treated_balanced_dcn"] tensor_control_balanced_dcn = balanced_dataset_dict["tensor_control_balanced_dcn"] n_treated_balanced_dcn = balanced_dataset_dict["n_treated_balanced_dcn"] n_control_balanced_dcn = balanced_dataset_dict["n_control_balanced_dcn"] tensor_balanced_tarnet = balanced_dataset_dict["tensor_balanced_tarnet"] n_total_balanced_tarnet = balanced_dataset_dict["n_total_balanced_tarnet"] n_treated_balanced_tarnet = balanced_dataset_dict["n_treated_balanced_tarnet"] print("---" * 20) print("-----------> !! Supervised Training(DCN Models ) !!<-----------") # run DCN Models tensor_treated_train_original = \ Utils.create_tensors_from_tuple(data_loader_dict_train["treated_data"]) tensor_control_train_original = \ Utils.create_tensors_from_tuple(data_loader_dict_train["control_data"]) model_save_paths = { "Model_DCN_PD_shared": run_parameters["Model_DCN_PD_shared"].format(iter_id), "Model_DCN_PD_y1": run_parameters["Model_DCN_PD_y1"].format(iter_id), "Model_DCN_PD_y0": run_parameters["Model_DCN_PD_y0"].format(iter_id), "Model_DCN_PD_02_shared": run_parameters["Model_DCN_PD_02_shared"].format(iter_id), "Model_DCN_PD_02_y1": run_parameters["Model_DCN_PD_02_y1"].format(iter_id), "Model_DCN_PD_02_y0": run_parameters["Model_DCN_PD_02_y0"].format(iter_id), "Model_DCN_PD_05_shared": run_parameters["Model_DCN_PD_05_shared"].format(iter_id), "Model_DCN_PD_05_y1": run_parameters["Model_DCN_PD_05_y1"].format(iter_id), "Model_DCN_PD_05_y0": run_parameters["Model_DCN_PD_05_y0"].format(iter_id), "Model_DCN_PM_GAN_shared": run_parameters["Model_DCN_PM_GAN_shared"].format(iter_id), "Model_DCN_PM_GAN_y1": run_parameters["Model_DCN_PM_GAN_y1"].format(iter_id), "Model_DCN_PM_GAN_y0": run_parameters["Model_DCN_PM_GAN_y0"].format(iter_id), "Model_DCN_PM_GAN_02_shared": run_parameters["Model_DCN_PM_GAN_02_shared"].format(iter_id), "Model_DCN_PM_GAN_02_y1": run_parameters["Model_DCN_PM_GAN_02_y1"].format(iter_id), "Model_DCN_PM_GAN_02_y0": run_parameters["Model_DCN_PM_GAN_02_y0"].format(iter_id), "Model_DCN_PM_GAN_05_shared": run_parameters["Model_DCN_PM_GAN_05_shared"].format(iter_id), "Model_DCN_PM_GAN_05_y1": run_parameters["Model_DCN_PM_GAN_05_y1"].format(iter_id), "Model_DCN_PM_GAN_05_y0": run_parameters["Model_DCN_PM_GAN_05_y0"].format(iter_id), "Model_DCN_PM_GAN_PD_shared": run_parameters["Model_DCN_PM_GAN_PD_shared"].format(iter_id), "Model_DCN_PM_GAN_PD_y1": run_parameters["Model_DCN_PM_GAN_PD_y1"].format(iter_id), "Model_DCN_PM_GAN_PD_y0": run_parameters["Model_DCN_PM_GAN_PD_y0"].format(iter_id) } dcn_experiments = DCN_Experiments(input_nodes, device) dcn_pd_models_eval_dict = dcn_experiments.evaluate_DCN_Model(tensor_treated_train_original, tensor_control_train_original, n_treated_original, n_control_original, tensor_treated_balanced_dcn, tensor_control_balanced_dcn, n_treated_balanced_dcn, n_control_balanced_dcn, data_loader_dict_val, data_loader_dict_test, model_save_paths) print("---" * 20) print("-----------> !! Supervised Evaluation(DCN Models) !! <-----------") print("---" * 20) print("--> 1. Model 1: DCN - PD Supervised Training Evaluation: ") dcn_pd_eval = dcn_pd_models_eval_dict["dcn_pd_eval_dict"] dcn_pd_ate_pred, dcn_pd_att_pred, dcn_pd_bias_att, dcn_pd_atc_pred, dcn_pd_policy_value, \ dcn_pd_policy_risk, dcn_pd_err_fact = \ self.__process_evaluated_metric( dcn_pd_eval["yf_list"], dcn_pd_eval["e_list"], dcn_pd_eval["T_list"], dcn_pd_eval["y1_hat_list"], dcn_pd_eval["y0_hat_list"], dcn_pd_eval["ITE_dict_list"], dcn_pd_eval["predicted_ITE"], run_parameters["DCN_PD"], iter_id) print("---" * 20) print("--> 2. Model 2: DCN - PD(Dropout 0.5) Supervised Training Evaluation: ") dcn_pd_05_eval_dict = dcn_pd_models_eval_dict["dcn_pd_05_eval_dict"] dcn_pd_05_ate_pred, dcn_pd_05_att_pred, dcn_pd_05_bias_att, dcn_pd_05_atc_pred, \ dcn_pd_05_policy_value, \ dcn_pd_05_policy_risk, dcn_pd_05_err_fact = \ self.__process_evaluated_metric( dcn_pd_05_eval_dict["yf_list"], dcn_pd_05_eval_dict["e_list"], dcn_pd_05_eval_dict["T_list"], dcn_pd_05_eval_dict["y1_hat_list"], dcn_pd_05_eval_dict["y0_hat_list"], dcn_pd_05_eval_dict["ITE_dict_list"], dcn_pd_05_eval_dict["predicted_ITE"], run_parameters["DCN_PD_05"], iter_id) print("---" * 20) print("--> 3. Model 3: PM GAN - No dropout Supervised Training Evaluation: ") dcn_pm_gan_eval = dcn_pd_models_eval_dict["dcn_pm_gan_eval_dict"] dcn_pm_gan_ate_pred, dcn_pm_gan_att_pred, dcn_pm_gan_bias_att, dcn_pm_gan_atc_pred, \ dcn_pm_gan_policy_value, dcn_pm_gan_policy_risk, dcn_pm_gan_err_fact = \ self.__process_evaluated_metric( dcn_pm_gan_eval["yf_list"], dcn_pm_gan_eval["e_list"], dcn_pm_gan_eval["T_list"], dcn_pm_gan_eval["y1_hat_list"], dcn_pm_gan_eval["y0_hat_list"], dcn_pm_gan_eval["ITE_dict_list"], dcn_pm_gan_eval["predicted_ITE"], run_parameters["DCN_PM_GAN"], iter_id) print("---" * 20) print("--> 4. Model 4: PM GAN - dropout 0.5 Supervised Training Evaluation: ") dcn_pm_gan_eval_05 = dcn_pd_models_eval_dict["dcn_pm_gan_eval_drp_05_dict"] dcn_pm_gan_05_ate_pred, dcn_pm_gan_05_att_pred, dcn_pm_gan_05_bias_att, dcn_pm_gan_05_atc_pred, \ dcn_pm_gan_05_policy_value, dcn_pm_gan_05_policy_risk, dcn_pm_gan_05_err_fact = \ self.__process_evaluated_metric( dcn_pm_gan_eval_05["yf_list"], dcn_pm_gan_eval_05["e_list"], dcn_pm_gan_eval_05["T_list"], dcn_pm_gan_eval_05["y1_hat_list"], dcn_pm_gan_eval_05["y0_hat_list"], dcn_pm_gan_eval_05["ITE_dict_list"], dcn_pm_gan_eval_05["predicted_ITE"], run_parameters["DCN_PM_GAN_05"], iter_id) print("---" * 20) print("--> 5. Model 5: PM GAN - PD Supervised Training Evaluation: ") dcn_pm_gan_eval_pd = dcn_pd_models_eval_dict["dcn_pm_gan_eval_pd_dict"] dcn_pm_gan_pd_ate_pred, dcn_pm_gan_pd_att_pred, dcn_pm_gan_pd_bias_att, dcn_pm_gan_pd_atc_pred, \ dcn_pm_gan_pd_policy_value, dcn_pm_gan_pd_policy_risk, dcn_pm_gan_pd_err_fact = \ self.__process_evaluated_metric( dcn_pm_gan_eval_pd["yf_list"], dcn_pm_gan_eval_pd["e_list"], dcn_pm_gan_eval_pd["T_list"], dcn_pm_gan_eval_pd["y1_hat_list"], dcn_pm_gan_eval_pd["y0_hat_list"], dcn_pm_gan_eval_pd["ITE_dict_list"], dcn_pm_gan_eval_pd["predicted_ITE"], run_parameters["DCN_PM_GAN_PD"], iter_id) print("---" * 20) print("---" * 20) # run TARNet Models print("-----------> !! Supervised Training(TARNet Models) !!<-----------") tarnet_experiments = TARNet_Experiments(input_nodes, device) tarnet_experiments_models_eval_dict = tarnet_experiments.evaluate_TARNet_Model( data_loader_dict_train["treated_data"], data_loader_dict_train["control_data"], tensor_balanced_tarnet, data_loader_dict_val, data_loader_dict_test, n_total_balanced_tarnet, n_treated_balanced_tarnet) print("---" * 20) print("---> !! Supervised Evaluation(TARNet Models) !! <---") print("---" * 20) print("--> 1. Model 1: TARNet Supervised Training Evaluation: ") tarnet_eval = tarnet_experiments_models_eval_dict["tarnet_eval_dict"] tarnet_ate_pred, tarnet_att_pred, tarnet_bias_att, tarnet_atc_pred, \ tarnet_policy_value, tarnet_policy_risk, tarnet_err_fact = \ self.__process_evaluated_metric( tarnet_eval["yf_list"], tarnet_eval["e_list"], tarnet_eval["T_list"], tarnet_eval["y1_hat_list"], tarnet_eval["y0_hat_list"], tarnet_eval["ITE_dict_list"], tarnet_eval["predicted_ITE"], run_parameters["TARNET"], iter_id) print("--> 2. Model 2: TARNet PM GAN Supervised Training Evaluation: ") tarnet_pm_gan_eval = tarnet_experiments_models_eval_dict["tarnet_pm_gan_eval_dict"] tarnet_pm_gan_ate_pred, tarnet_pm_gan_att_pred, tarnet_pm_gan_bias_att, tarnet_pm_gan_atc_pred, \ tarnet_pm_gan_policy_value, tarnet_pm_gan_policy_risk, tarnet_pm_gan_err_fact = \ self.__process_evaluated_metric( tarnet_pm_gan_eval["yf_list"], tarnet_pm_gan_eval["e_list"], tarnet_pm_gan_eval["T_list"], tarnet_pm_gan_eval["y1_hat_list"], tarnet_pm_gan_eval["y0_hat_list"], tarnet_pm_gan_eval["ITE_dict_list"], tarnet_pm_gan_eval["predicted_ITE"], run_parameters["TARNET"], iter_id) print("---" * 20) result_dict = OrderedDict() result_dict["iter_id"] = iter_id result_dict["dcn_pd_ate_pred"] = dcn_pd_ate_pred result_dict["dcn_pd_att_pred"] = dcn_pd_att_pred result_dict["dcn_pd_bias_att"] = dcn_pd_bias_att result_dict["dcn_pd_atc_pred"] = dcn_pd_atc_pred result_dict["dcn_pd_policy_value"] = dcn_pd_policy_value result_dict["dcn_pd_policy_risk"] = dcn_pd_policy_risk result_dict["dcn_pd_err_fact"] = dcn_pd_err_fact result_dict["dcn_pd_05_ate_pred"] = dcn_pd_05_ate_pred result_dict["dcn_pd_05_att_pred"] = dcn_pd_05_att_pred result_dict["dcn_pd_05_bias_att"] = dcn_pd_05_bias_att result_dict["dcn_pd_05_atc_pred"] = dcn_pd_05_atc_pred result_dict["dcn_pd_05_policy_value"] = dcn_pd_05_policy_value result_dict["dcn_pd_05_policy_risk"] = dcn_pd_05_policy_risk result_dict["dcn_pd_05_err_fact"] = dcn_pd_05_err_fact result_dict["dcn_pm_gan_ate_pred"] = dcn_pm_gan_ate_pred result_dict["dcn_pm_gan_att_pred"] = dcn_pm_gan_att_pred result_dict["dcn_pm_gan_bias_att"] = dcn_pm_gan_bias_att result_dict["dcn_pm_gan_atc_pred"] = dcn_pm_gan_atc_pred result_dict["dcn_pm_gan_policy_value"] = dcn_pm_gan_policy_value result_dict["dcn_pm_gan_policy_risk"] = dcn_pm_gan_policy_risk result_dict["dcn_pm_gan_err_fact"] = dcn_pm_gan_err_fact result_dict["dcn_pm_gan_05_att_pred"] = dcn_pm_gan_05_ate_pred result_dict["dcn_pm_gan_05_att_pred"] = dcn_pm_gan_05_att_pred result_dict["dcn_pm_gan_05_bias_att"] = dcn_pm_gan_05_bias_att result_dict["dcn_pm_gan_05_atc_pred"] = dcn_pm_gan_05_atc_pred result_dict["dcn_pm_gan_05_policy_value"] = dcn_pm_gan_05_policy_value result_dict["dcn_pm_gan_05_policy_risk"] = dcn_pm_gan_05_policy_risk result_dict["dcn_pm_gan_05_err_fact"] = dcn_pm_gan_05_err_fact result_dict["dcn_pm_gan_pd_att_pred"] = dcn_pm_gan_pd_ate_pred result_dict["dcn_pm_gan_pd_att_pred"] = dcn_pm_gan_pd_att_pred result_dict["dcn_pm_gan_pd_bias_att"] = dcn_pm_gan_pd_bias_att result_dict["dcn_pm_gan_pd_atc_pred"] = dcn_pm_gan_pd_atc_pred result_dict["dcn_pm_gan_pd_policy_value"] = dcn_pm_gan_pd_policy_value result_dict["dcn_pm_gan_pd_policy_risk"] = dcn_pm_gan_pd_policy_risk result_dict["dcn_pm_gan_pd_err_fact"] = dcn_pm_gan_pd_err_fact result_dict["tarnet_ate_pred"] = tarnet_ate_pred result_dict["tarnet_att_pred"] = tarnet_att_pred result_dict["tarnet_bias_att"] = tarnet_bias_att result_dict["tarnet_atc_pred"] = tarnet_atc_pred result_dict["tarnet_policy_value"] = tarnet_policy_value result_dict["tarnet_policy_risk"] = tarnet_policy_risk result_dict["tarnet_err_fact"] = tarnet_err_fact result_dict["tarnet_pm_gan_ate_pred"] = tarnet_pm_gan_ate_pred result_dict["tarnet_pm_gan_att_pred"] = tarnet_pm_gan_att_pred result_dict["tarnet_pm_gan_bias_att"] = tarnet_pm_gan_bias_att result_dict["tarnet_pm_gan_atc_pred"] = tarnet_pm_gan_atc_pred result_dict["tarnet_pm_gan_policy_value"] = tarnet_pm_gan_policy_value result_dict["tarnet_pm_gan_policy_risk"] = tarnet_pm_gan_policy_risk result_dict["tarnet_pm_gan_err_fact"] = tarnet_pm_gan_err_fact file1.write("\nToday's date: {0}\n".format(date.today())) file1.write("Iter: {0}, bias_att_DCN_PD: {1}, bias_att_DCN_PD(0.5): {2}, " "bias_att_DCN_PM_GAN: {3}, " "bias_att_DCN_PM_GAN_05: {4}, bias_att_DCN_PM_GAN(PD): {5}, " "policy_risk_DCN_PD: {6}, " "policy_risk_DCN_PD(0.5): {7}, policy_risk_DCN_PM_GAN: {8}, " "policy_risk_PM_GAN_05: {9}, policy_risk_PM_GAN(PD): {10}, " .format(iter_id, dcn_pd_bias_att, dcn_pd_05_bias_att, dcn_pm_gan_bias_att, dcn_pm_gan_05_bias_att, dcn_pm_gan_pd_bias_att, dcn_pd_policy_risk, dcn_pd_05_policy_risk, dcn_pm_gan_policy_risk, dcn_pm_gan_05_policy_risk, dcn_pm_gan_pd_policy_risk)) results_list.append(result_dict) bias_att_set_DCN_PD = [] policy_risk_set_DCN_PD = [] bias_att_set_DCN_PD_05 = [] policy_risk_set_DCN_PD_05 = [] bias_att_DCN_PM_GAN = [] policy_risk_set_DCN_PM_GAN = [] bias_att_DCN_PM_GAN_05 = [] policy_risk_set_DCN_PM_GAN_05 = [] bias_att_DCN_PM_GAN_PD = [] policy_risk_set_DCN_PM_GAN_PD = [] bias_att_tarnet = [] policy_risk_set_tarnet = [] bias_att_tarnet_PM_GAN = [] policy_risk_set_tarnet_PM_GAN = [] for result in results_list: bias_att_set_DCN_PD.append(result["dcn_pd_bias_att"]) policy_risk_set_DCN_PD.append(result["dcn_pd_policy_risk"]) bias_att_set_DCN_PD_05.append(result["dcn_pd_05_bias_att"]) policy_risk_set_DCN_PD_05.append(result["dcn_pd_05_policy_risk"]) bias_att_DCN_PM_GAN.append(result["dcn_pm_gan_bias_att"]) policy_risk_set_DCN_PM_GAN.append(result["dcn_pm_gan_policy_risk"]) bias_att_DCN_PM_GAN_05.append(result["dcn_pm_gan_05_bias_att"]) policy_risk_set_DCN_PM_GAN_05.append(result["dcn_pm_gan_05_policy_risk"]) bias_att_DCN_PM_GAN_PD.append(result["dcn_pm_gan_pd_bias_att"]) policy_risk_set_DCN_PM_GAN_PD.append(result["dcn_pm_gan_pd_policy_risk"]) bias_att_tarnet.append(result["tarnet_bias_att"]) policy_risk_set_tarnet.append(result["tarnet_policy_risk"]) bias_att_tarnet_PM_GAN.append(result["tarnet_pm_gan_bias_att"]) policy_risk_set_tarnet_PM_GAN.append(result["tarnet_pm_gan_policy_risk"]) bias_att_DCN_PD_mean = np.mean(
np.array(bias_att_set_DCN_PD)
numpy.array
import os.path from pathlib import Path from ctypes import * from sys import platform from numpy.ctypeslib import ndpointer import numpy as np from PIL import Image try: import eyeRendererHelperFunctions as eyeTools except Exception as e: print("Error importing eyeTools:", e) print("This is most likely because you do not have the 'python-examples' folder set as a path in $PYTHONPATH.") exit() def getIdFromMap(mapImage, x, y): r = mapImage[y,x,0] << 24 # Red g = mapImage[y,x,1] << 16 # Green b = mapImage[y,x,2] << 8 # Blue a = mapImage[y,x,3] # Alpha idOut = r | g | b | a return(idOut) def getProjectionImageUsingMap(vector, vectorMax, idMap, pjWidth,pjHeight): np.copy(idMap) output = np.zeros((pjWidth, pjHeight), dtype=np.uint8) for x in range(pjWidth): for y in range(pjHeight): pixelId = getIdFromMap(idMap, x, y) output[x,y] = int(vector[pixelId]/vectorMax * 255) return(output) try: # Load the renderer eyeRenderer = CDLL("../../build/make/lib/libEyeRenderer3.so") print("Successfully loaded", eyeRenderer) # Configure the renderer's function outputs and inputs using the helper functions eyeTools.configureFunctions(eyeRenderer) #Load a scene print("Loading scene (please wait)...") eyeRenderer.loadGlTFscene(c_char_p(b"../../data/natural-standin-sky.gltf")) print("Scene loaded!") # Make sure there's a place to save to Path("output/generated-data/alias-demo-quantified/").mkdir(parents=True, exist_ok=True) Path("output/vector-data/").mkdir(parents=True, exist_ok=True) Path("output/view-images/").mkdir(parents=True, exist_ok=True) Path("output/generated-data/spread-analysis/").mkdir(parents=True, exist_ok=True) ###### First, generate the ommatidial id map #Resize the renderer display in order to render the spherically-projected variable sample rate renderWidth = 700 renderHeight = 300 eyeTools.setRenderSize(eyeRenderer, renderWidth, renderHeight) # Go to the 'insect-eye-spherical-projector' camera eyeRenderer.gotoCameraByName(c_char_p(b"insect-eye-spherical-projector-ids")) eyeRenderer.renderFrame() # Just straight-up render the spherical projector ids idMap = np.copy(np.flipud(eyeRenderer.getFramePointer())) # Copy (remember here the data is still owned by the render, so we need this copy) the id map (plus flip it the right way up) eyeRenderer.saveFrameAs(c_char_p(("output/generated-data/alias-demo-quantified/projection-ids.ppm").encode())) # Save the image for sanity checking # Also generate a set of weights that store how much of an influence on an # average each compound eye should have based on it's area coverage in steradians perSteradianWeights = [1.0/i.getSolidAngle() for i in eyeTools.readEyeFile("../../data/eyes/1000-horizontallyAcute-variableDegree.eye")] perSteradianWeights = np.asarray(perSteradianWeights) ###### Second, generate ommatidial sample data into a big multi-dim array to perform analysis on # Change to vector rendering eyeRenderer.gotoCameraByName(c_char_p(b"insect-eye-fast-vector")) # Prepare to generate vector data (1000 ommatidia) vectorWidth = 1000 maxOmmatidialSamples = renderWidth # The upper bound of how many samples will be taken per ommatidium in the analysis spreadSampleCount = 1000 # How many times each frame is rendered to get a sense of the spread of results from a given ommatidium at different sampling rates eyeTools.setRenderSize(eyeRenderer, vectorWidth, 1) # Create a numpy array to store the eye data # This is a set of eye matricies, each one being a 1st-order stack of samples (the width of the number of ommatidia, and 3 channels deep) eyeSampleMatrix = np.zeros((maxOmmatidialSamples,spreadSampleCount, vectorWidth, 3), dtype=np.uint8) # Iterate over eye sample counts for idx, samples in enumerate(range(1, maxOmmatidialSamples+1)): eyeRenderer.setCurrentEyeSamplesPerOmmatidium(samples) eyeRenderer.renderFrame() # First call to ensure randoms are configured # For each sample count, generate N images to compare for i in range(spreadSampleCount): renderTime = eyeRenderer.renderFrame() # Second call to actually render the image # Retrieve the data frameData = eyeRenderer.getFramePointer() frameDataRGB = frameData[:,:,:3] # Remove the alpha channel eyeSampleMatrix[idx,i,:,:] = np.copy(frameDataRGB[:, :, :]) eyeRenderer.displayFrame() ###### Now calculate the per-ommatidial sample variance and standard deviation at each sample rate print("") maxSd = 0 maxVariance = 0 variances = np.zeros((renderWidth, vectorWidth, 1)) standardDeviations = np.zeros((renderWidth, vectorWidth, 1)) avgVariancePerSteradianPerImage = np.zeros(renderWidth) avgSdPerSteradianPerImage = np.zeros(renderWidth) for sampleCount, ommatidialSamples in enumerate(eyeSampleMatrix): # Get the per-ommatidial spread here meanImage = np.mean(ommatidialSamples, axis=0) # The means of each ommatidium (RGB) summedSquaredDifferences = np.zeros((meanImage.shape[0],1)) for ommatidiumId, image in enumerate(ommatidialSamples): print("\rCalculating per-ommatidial spread at each sample rate (Image: {}, Sample: {})...".format(sampleCount+1, ommatidiumId+1), end='') for indexInMean, pixelInImage in enumerate(image): difference = np.linalg.norm(pixelInImage - meanImage[indexInMean,:]) difference = difference*difference summedSquaredDifferences[indexInMean] += difference varianceImage = summedSquaredDifferences / (len(ommatidialSamples)-1) sdImage = np.sqrt(varianceImage) variances[sampleCount] = varianceImage standardDeviations[sampleCount] = sdImage # Keep track of the maximum variance and standard deviation maxVariance = max(maxVariance, np.max(varianceImage)) maxSd = max(maxSd,
np.max(sdImage)
numpy.max
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """ ------------------------------------------------- File Name:LinearRegression Description : 使用 sklearn 的 iris 数据,x: 花瓣宽度 y: 花瓣长度, 大致满足 线性关系 Email : <EMAIL> Date:2017/12/15 """ import numpy as np import torch import torch.nn as nn import torch.nn.functional as F from sklearn.datasets import load_iris from torch.autograd import Variable iris = load_iris() # 将 y 统一为矩阵的形式 X = np.array([[d[3]] for d in iris.data]) y =
np.array([[d[0]] for d in iris.data])
numpy.array
# Copyright 2017 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tests for recurrent layers functionality other than GRU, LSTM, SimpleRNN. See also: lstm_test.py, gru_test.py, simplernn_test.py. """ import collections import numpy as np import tensorflow.compat.v2 as tf from absl.testing import parameterized import keras from keras.engine import base_layer_utils from keras.layers.rnn import gru from keras.layers.rnn import gru_v1 from keras.layers.rnn import lstm from keras.layers.rnn import lstm_v1 from keras.testing_infra import test_combinations from keras.testing_infra import test_utils from keras.utils import generic_utils # isort: off from tensorflow.python.training.tracking import ( util as trackable_util, ) # Used for nested input/output/state RNN test. NestedInput = collections.namedtuple("NestedInput", ["t1", "t2"]) NestedState = collections.namedtuple("NestedState", ["s1", "s2"]) @test_combinations.run_all_keras_modes class RNNTest(test_combinations.TestCase): def test_minimal_rnn_cell_non_layer(self): class MinimalRNNCell: def __init__(self, units, input_dim): self.units = units self.state_size = units self.kernel = keras.backend.variable( np.random.random((input_dim, units)) ) def call(self, inputs, states): prev_output = states[0] output = keras.backend.dot(inputs, self.kernel) + prev_output return output, [output] # Basic test case. cell = MinimalRNNCell(32, 5) x = keras.Input((None, 5)) layer = keras.layers.RNN(cell) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) # Test stacking. cells = [ MinimalRNNCell(8, 5), MinimalRNNCell(32, 8), MinimalRNNCell(32, 32), ] layer = keras.layers.RNN(cells) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) def test_minimal_rnn_cell_non_layer_multiple_states(self): class MinimalRNNCell: def __init__(self, units, input_dim): self.units = units self.state_size = (units, units) self.kernel = keras.backend.variable( np.random.random((input_dim, units)) ) def call(self, inputs, states): prev_output_1 = states[0] prev_output_2 = states[1] output = keras.backend.dot(inputs, self.kernel) output += prev_output_1 output -= prev_output_2 return output, [output * 2, output * 3] # Basic test case. cell = MinimalRNNCell(32, 5) x = keras.Input((None, 5)) layer = keras.layers.RNN(cell) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) # Test stacking. cells = [ MinimalRNNCell(8, 5), MinimalRNNCell(16, 8), MinimalRNNCell(32, 16), ] layer = keras.layers.RNN(cells) self.assertEqual(layer.cell.state_size, ((8, 8), (16, 16), (32, 32))) self.assertEqual(layer.cell.output_size, 32) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) def test_minimal_rnn_cell_layer(self): class MinimalRNNCell(keras.layers.Layer): def __init__(self, units, **kwargs): self.units = units self.state_size = units super().__init__(**kwargs) def build(self, input_shape): self.kernel = self.add_weight( shape=(input_shape[-1], self.units), initializer="uniform", name="kernel", ) self.recurrent_kernel = self.add_weight( shape=(self.units, self.units), initializer="uniform", name="recurrent_kernel", ) self.built = True def call(self, inputs, states): prev_output = states[0] h = keras.backend.dot(inputs, self.kernel) output = h + keras.backend.dot( prev_output, self.recurrent_kernel ) return output, [output] def get_config(self): config = {"units": self.units} base_config = super().get_config() return dict(list(base_config.items()) + list(config.items())) # Test basic case. x = keras.Input((None, 5)) cell = MinimalRNNCell(32) layer = keras.layers.RNN(cell) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) # Test basic case serialization. x_np = np.random.random((6, 5, 5)) y_np = model.predict(x_np) weights = model.get_weights() config = layer.get_config() with generic_utils.CustomObjectScope( {"MinimalRNNCell": MinimalRNNCell} ): layer = keras.layers.RNN.from_config(config) y = layer(x) model = keras.models.Model(x, y) model.set_weights(weights) y_np_2 = model.predict(x_np) self.assertAllClose(y_np, y_np_2, atol=1e-4) # Test stacking. cells = [MinimalRNNCell(8), MinimalRNNCell(12), MinimalRNNCell(32)] layer = keras.layers.RNN(cells) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) # Test stacked RNN serialization. x_np = np.random.random((6, 5, 5)) y_np = model.predict(x_np) weights = model.get_weights() config = layer.get_config() with generic_utils.CustomObjectScope( {"MinimalRNNCell": MinimalRNNCell} ): layer = keras.layers.RNN.from_config(config) y = layer(x) model = keras.models.Model(x, y) model.set_weights(weights) y_np_2 = model.predict(x_np) self.assertAllClose(y_np, y_np_2, atol=1e-4) def test_minimal_rnn_cell_abstract_rnn_cell(self): class MinimalRNNCell(keras.layers.AbstractRNNCell): def __init__(self, units, **kwargs): self.units = units super().__init__(**kwargs) @property def state_size(self): return self.units def build(self, input_shape): self.kernel = self.add_weight( shape=(input_shape[-1], self.units), initializer="uniform", name="kernel", ) self.recurrent_kernel = self.add_weight( shape=(self.units, self.units), initializer="uniform", name="recurrent_kernel", ) self.built = True def call(self, inputs, states): prev_output = states[0] h = keras.backend.dot(inputs, self.kernel) output = h + keras.backend.dot( prev_output, self.recurrent_kernel ) return output, output @property def output_size(self): return self.units cell = MinimalRNNCell(32) x = keras.Input((None, 5)) layer = keras.layers.RNN(cell) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) # Test stacking. cells = [MinimalRNNCell(8), MinimalRNNCell(16), MinimalRNNCell(32)] layer = keras.layers.RNN(cells) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) def test_rnn_with_time_major(self): batch = 10 time_step = 5 embedding_dim = 4 units = 3 # Test basic case. x = keras.Input((time_step, embedding_dim)) time_major_x = keras.layers.Lambda( lambda t: tf.transpose(t, [1, 0, 2]) )(x) layer = keras.layers.SimpleRNN( units, time_major=True, return_sequences=True ) self.assertEqual( layer.compute_output_shape( (time_step, None, embedding_dim) ).as_list(), [time_step, None, units], ) y = layer(time_major_x) self.assertEqual(layer.output_shape, (time_step, None, units)) y = keras.layers.Lambda(lambda t: tf.transpose(t, [1, 0, 2]))(y) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( np.zeros((batch, time_step, embedding_dim)), np.zeros((batch, time_step, units)), ) # Test stacking. x = keras.Input((time_step, embedding_dim)) time_major_x = keras.layers.Lambda( lambda t: tf.transpose(t, [1, 0, 2]) )(x) cell_units = [10, 8, 6] cells = [keras.layers.SimpleRNNCell(cell_units[i]) for i in range(3)] layer = keras.layers.RNN(cells, time_major=True, return_sequences=True) y = layer(time_major_x) self.assertEqual(layer.output_shape, (time_step, None, cell_units[-1])) y = keras.layers.Lambda(lambda t: tf.transpose(t, [1, 0, 2]))(y) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( np.zeros((batch, time_step, embedding_dim)), np.zeros((batch, time_step, cell_units[-1])), ) # Test masking. x = keras.Input((time_step, embedding_dim)) time_major = keras.layers.Lambda(lambda t: tf.transpose(t, [1, 0, 2]))( x ) mask = keras.layers.Masking()(time_major) rnn = keras.layers.SimpleRNN( units, time_major=True, return_sequences=True )(mask) y = keras.layers.Lambda(lambda t: tf.transpose(t, [1, 0, 2]))(rnn) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( np.zeros((batch, time_step, embedding_dim)), np.zeros((batch, time_step, units)), ) # Test layer output x = keras.Input((time_step, embedding_dim)) rnn_1 = keras.layers.SimpleRNN(units, return_sequences=True) y = rnn_1(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( np.zeros((batch, time_step, embedding_dim)), np.zeros((batch, time_step, units)), ) x_np = np.random.random((batch, time_step, embedding_dim)) y_np_1 = model.predict(x_np) time_major = keras.layers.Lambda(lambda t: tf.transpose(t, [1, 0, 2]))( x ) rnn_2 = keras.layers.SimpleRNN( units, time_major=True, return_sequences=True ) y_2 = rnn_2(time_major) y_2 = keras.layers.Lambda(lambda t: tf.transpose(t, [1, 0, 2]))(y_2) model_2 = keras.models.Model(x, y_2) rnn_2.set_weights(rnn_1.get_weights()) y_np_2 = model_2.predict(x_np) self.assertAllClose(y_np_1, y_np_2, atol=1e-4) def test_rnn_cell_with_constants_layer(self): # Test basic case. x = keras.Input((None, 5)) c = keras.Input((3,)) cell = RNNCellWithConstants(32, constant_size=3) layer = keras.layers.RNN(cell) y = layer(x, constants=c) model = keras.models.Model([x, c], y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( [np.zeros((6, 5, 5)), np.zeros((6, 3))], np.zeros((6, 32)) ) # Test basic case serialization. x_np = np.random.random((6, 5, 5)) c_np = np.random.random((6, 3)) y_np = model.predict([x_np, c_np]) weights = model.get_weights() config = layer.get_config() custom_objects = {"RNNCellWithConstants": RNNCellWithConstants} with generic_utils.CustomObjectScope(custom_objects): layer = keras.layers.RNN.from_config(config.copy()) y = layer(x, constants=c) model = keras.models.Model([x, c], y) model.set_weights(weights) y_np_2 = model.predict([x_np, c_np]) self.assertAllClose(y_np, y_np_2, atol=1e-4) # test flat list inputs. with generic_utils.CustomObjectScope(custom_objects): layer = keras.layers.RNN.from_config(config.copy()) y = layer([x, c]) model = keras.models.Model([x, c], y) model.set_weights(weights) y_np_3 = model.predict([x_np, c_np]) self.assertAllClose(y_np, y_np_3, atol=1e-4) # Test stacking. cells = [ gru.GRUCell(8), RNNCellWithConstants(12, constant_size=3), RNNCellWithConstants(32, constant_size=3), ] layer = keras.layers.RNN(cells) y = layer(x, constants=c) model = keras.models.Model([x, c], y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( [np.zeros((6, 5, 5)), np.zeros((6, 3))], np.zeros((6, 32)) ) # Test GRUCell reset_after property. x = keras.Input((None, 5)) c = keras.Input((3,)) cells = [gru.GRUCell(32, reset_after=True)] layer = keras.layers.RNN(cells) y = layer(x, constants=c) model = keras.models.Model([x, c], y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( [np.zeros((6, 5, 5)), np.zeros((6, 3))], np.zeros((6, 32)) ) # Test stacked RNN serialization x_np = np.random.random((6, 5, 5)) c_np = np.random.random((6, 3)) y_np = model.predict([x_np, c_np]) weights = model.get_weights() config = layer.get_config() with generic_utils.CustomObjectScope(custom_objects): layer = keras.layers.RNN.from_config(config.copy()) y = layer(x, constants=c) model = keras.models.Model([x, c], y) model.set_weights(weights) y_np_2 = model.predict([x_np, c_np]) self.assertAllClose(y_np, y_np_2, atol=1e-4) def test_rnn_cell_with_non_keras_constants(self): # Test basic case. x = keras.Input((None, 5)) c = tf.zeros([6, 3], dtype=tf.float32) cell = RNNCellWithConstants(32, constant_size=3) layer = keras.layers.RNN(cell) y = layer(x, constants=c) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) # Test stacking. cells = [ gru.GRUCell(8), RNNCellWithConstants(12, constant_size=3), RNNCellWithConstants(32, constant_size=3), ] layer = keras.layers.RNN(cells) y = layer(x, constants=c) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) def test_rnn_cell_with_constants_layer_passing_initial_state(self): # Test basic case. x = keras.Input((None, 5)) c = keras.Input((3,)) s = keras.Input((32,)) cell = RNNCellWithConstants(32, constant_size=3) layer = keras.layers.RNN(cell) y = layer(x, initial_state=s, constants=c) model = keras.models.Model([x, s, c], y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( [np.zeros((6, 5, 5)), np.zeros((6, 32)), np.zeros((6, 3))], np.zeros((6, 32)), ) # Test basic case serialization. x_np = np.random.random((6, 5, 5)) s_np = np.random.random((6, 32)) c_np = np.random.random((6, 3)) y_np = model.predict([x_np, s_np, c_np]) weights = model.get_weights() config = layer.get_config() custom_objects = {"RNNCellWithConstants": RNNCellWithConstants} with generic_utils.CustomObjectScope(custom_objects): layer = keras.layers.RNN.from_config(config.copy()) y = layer(x, initial_state=s, constants=c) model = keras.models.Model([x, s, c], y) model.set_weights(weights) y_np_2 = model.predict([x_np, s_np, c_np]) self.assertAllClose(y_np, y_np_2, atol=1e-4) # verify that state is used y_np_2_different_s = model.predict([x_np, s_np + 10.0, c_np]) with self.assertRaises(AssertionError): self.assertAllClose(y_np, y_np_2_different_s, atol=1e-4) # test flat list inputs with generic_utils.CustomObjectScope(custom_objects): layer = keras.layers.RNN.from_config(config.copy()) y = layer([x, s, c]) model = keras.models.Model([x, s, c], y) model.set_weights(weights) y_np_3 = model.predict([x_np, s_np, c_np]) self.assertAllClose(y_np, y_np_3, atol=1e-4) def test_rnn_cell_with_non_keras_constants_and_initial_state(self): # Test basic case. x = keras.Input((None, 5)) c = tf.zeros([6, 3], dtype=tf.float32) s = tf.zeros([6, 32], dtype=tf.float32) cell = RNNCellWithConstants(32, constant_size=3) layer = keras.layers.RNN(cell) y = layer(x, initial_state=s, constants=c) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) # Test stacking. cells = [ gru.GRUCell(8), RNNCellWithConstants(12, constant_size=3), RNNCellWithConstants(32, constant_size=3), ] layer = keras.layers.RNN(cells) s = [ tf.zeros([6, 8], dtype=tf.float32), tf.zeros([6, 12], dtype=tf.float32), tf.zeros([6, 32], dtype=tf.float32), ] y = layer(x, initial_state=s, constants=c) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch(np.zeros((6, 5, 5)), np.zeros((6, 32))) def test_stacked_rnn_attributes(self): if tf.executing_eagerly(): self.skipTest("reduce_sum is not available in eager mode.") cells = [keras.layers.LSTMCell(1), keras.layers.LSTMCell(1)] layer = keras.layers.RNN(cells) layer.build((None, None, 1)) # Test weights self.assertEqual(len(layer.trainable_weights), 6) cells[0].trainable = False self.assertEqual(len(layer.trainable_weights), 3) self.assertEqual(len(layer.non_trainable_weights), 3) # Test `get_losses_for` and `losses` x = keras.Input((None, 1)) loss_1 = tf.reduce_sum(x) loss_2 = tf.reduce_sum(cells[0].kernel) cells[0].add_loss(loss_1, inputs=x) cells[0].add_loss(loss_2) self.assertEqual(len(layer.losses), 2) self.assertEqual(layer.get_losses_for(None), [loss_2]) self.assertEqual(layer.get_losses_for(x), [loss_1]) # Test `updates` cells = [keras.layers.LSTMCell(1), keras.layers.LSTMCell(1)] layer = keras.layers.RNN(cells) x = keras.Input((None, 1)) _ = layer(x) update_1 = tf.compat.v1.assign_add( cells[0].kernel, x[0, 0, 0] * cells[0].kernel ) update_2 = tf.compat.v1.assign_add( cells[0].kernel, tf.ones_like(cells[0].kernel) ) # TODO(b/128682878): Remove when RNNCells are __call__'d. with base_layer_utils.call_context().enter(layer, x, True, None): cells[0].add_update(update_1) cells[0].add_update(update_2) self.assertEqual(len(layer.updates), 2) def test_rnn_dynamic_trainability(self): layer_class = keras.layers.SimpleRNN embedding_dim = 4 units = 3 layer = layer_class(units) layer.build((None, None, embedding_dim)) self.assertEqual(len(layer.weights), 3) self.assertEqual(len(layer.trainable_weights), 3) self.assertEqual(len(layer.non_trainable_weights), 0) layer.trainable = False self.assertEqual(len(layer.weights), 3) self.assertEqual(len(layer.trainable_weights), 0) self.assertEqual(len(layer.non_trainable_weights), 3) layer.trainable = True self.assertEqual(len(layer.weights), 3) self.assertEqual(len(layer.trainable_weights), 3) self.assertEqual(len(layer.non_trainable_weights), 0) @parameterized.parameters( [keras.layers.SimpleRNN, keras.layers.GRU, keras.layers.LSTM] ) def test_rnn_cell_trainability(self, layer_cls): # https://github.com/tensorflow/tensorflow/issues/32369. layer = layer_cls(3, trainable=False) self.assertFalse(layer.cell.trainable) layer.trainable = True self.assertTrue(layer.cell.trainable) def test_state_reuse_with_dropout(self): layer_class = keras.layers.SimpleRNN embedding_dim = 4 units = 3 timesteps = 2 num_samples = 2 input1 = keras.Input( batch_shape=(num_samples, timesteps, embedding_dim) ) layer = layer_class( units, return_state=True, return_sequences=True, dropout=0.2 ) state = layer(input1)[1:] input2 = keras.Input( batch_shape=(num_samples, timesteps, embedding_dim) ) output = layer_class(units)(input2, initial_state=state) model = keras.Model([input1, input2], output) inputs = [ np.random.random((num_samples, timesteps, embedding_dim)), np.random.random((num_samples, timesteps, embedding_dim)), ] model.predict(inputs) def test_builtin_and_custom_rnn_cell_serialization(self): @keras.utils.generic_utils.register_keras_serializable( package="TestOnly" ) class CustomRNNCell(keras.layers.Layer): def __init__(self, units, **kwargs): self.units = units self.state_size = units super().__init__(**kwargs) def build(self, input_shape): self.kernel = self.add_weight( shape=(input_shape[-1], self.units), initializer="uniform", name="kernel", ) self.recurrent_kernel = self.add_weight( shape=(self.units, self.units), initializer="uniform", name="recurrent_kernel", ) self.built = True def call(self, inputs, states): prev_output = states[0] h = keras.backend.dot(inputs, self.kernel) output = h + keras.backend.dot( prev_output, self.recurrent_kernel ) return output, [output] def get_config(self): config = {"units": self.units} base_config = super().get_config() return dict(list(base_config.items()) + list(config.items())) for cell_class in [ keras.layers.SimpleRNNCell, keras.layers.GRUCell, keras.layers.LSTMCell, CustomRNNCell, ]: # Test basic case. x = keras.Input((None, 5)) cell = cell_class(32) layer = keras.layers.RNN(cell) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) # Test basic case serialization. x_np = np.random.random((6, 5, 5)) y_np = model.predict(x_np) weights = model.get_weights() config = layer.get_config() layer = keras.layers.RNN.from_config(config) y = layer(x) model = keras.models.Model(x, y) model.set_weights(weights) y_np_2 = model.predict(x_np) self.assertAllClose(y_np, y_np_2, atol=1e-4) # Test stacking. cells = [cell_class(8), cell_class(12), cell_class(32)] layer = keras.layers.RNN(cells) y = layer(x) model = keras.models.Model(x, y) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) # Test stacked RNN serialization. x_np = np.random.random((6, 5, 5)) y_np = model.predict(x_np) weights = model.get_weights() config = layer.get_config() layer = keras.layers.RNN.from_config(config) y = layer(x) model = keras.models.Model(x, y) model.set_weights(weights) y_np_2 = model.predict(x_np) self.assertAllClose(y_np, y_np_2, atol=1e-4) @parameterized.named_parameters( *test_utils.generate_combinations_with_testcase_name( layer=[ keras.layers.SimpleRNN, gru_v1.GRU, lstm_v1.LSTM, gru.GRU, lstm.LSTM, ], unroll=[True, False], ) ) def test_rnn_dropout(self, layer, unroll): rnn_layer = layer(3, dropout=0.1, recurrent_dropout=0.1, unroll=unroll) if not unroll: x = keras.Input((None, 5)) else: x = keras.Input((5, 5)) y = rnn_layer(x) model = keras.models.Model(x, y) model.compile("sgd", "mse", run_eagerly=test_utils.should_run_eagerly()) x_np = np.random.random((6, 5, 5)) y_np = np.random.random((6, 3)) model.train_on_batch(x_np, y_np) @parameterized.named_parameters( *test_utils.generate_combinations_with_testcase_name( cell=[ keras.layers.SimpleRNNCell, keras.layers.GRUCell, keras.layers.LSTMCell, ], unroll=[True, False], ) ) def test_stacked_rnn_dropout(self, cell, unroll): cells = [ cell(3, dropout=0.1, recurrent_dropout=0.1), cell(3, dropout=0.1, recurrent_dropout=0.1), ] layer = keras.layers.RNN(cells, unroll=unroll) if not unroll: x = keras.Input((None, 5)) else: x = keras.Input((5, 5)) y = layer(x) model = keras.models.Model(x, y) model.compile("sgd", "mse", run_eagerly=test_utils.should_run_eagerly()) x_np = np.random.random((6, 5, 5)) y_np = np.random.random((6, 3)) model.train_on_batch(x_np, y_np) def test_dropout_mask_reuse(self): # The layer is created with recurrent_initializer = zero, so that the # the recurrent state won't affect the output. By doing this, we can # verify the output and see if the same mask is applied to for each # timestep. layer_1 = keras.layers.SimpleRNN( 3, dropout=0.5, kernel_initializer="ones", recurrent_initializer="zeros", return_sequences=True, unroll=True, ) layer_2 = keras.layers.RNN( keras.layers.SimpleRNNCell( 3, dropout=0.5, kernel_initializer="ones", recurrent_initializer="zeros", ), return_sequences=True, unroll=True, ) layer_3 = keras.layers.RNN( [ keras.layers.SimpleRNNCell( 3, dropout=0.5, kernel_initializer="ones", recurrent_initializer="zeros", ), keras.layers.SimpleRNNCell( 3, dropout=0.5, kernel_initializer="ones", recurrent_initializer="zeros", ), ], return_sequences=True, unroll=True, ) def verify(rnn_layer): inputs = tf.constant(1.0, shape=(6, 2, 5)) out = rnn_layer(inputs, training=True) if not tf.executing_eagerly(): self.evaluate(tf.compat.v1.global_variables_initializer()) batch_1 = self.evaluate(out) batch_1_t0, batch_1_t1 = batch_1[:, 0, :], batch_1[:, 1, :] self.assertAllClose(batch_1_t0, batch_1_t1) # This simulate the layer called with multiple batches in eager mode if tf.executing_eagerly(): out2 = rnn_layer(inputs, training=True) else: out2 = out batch_2 = self.evaluate(out2) batch_2_t0, batch_2_t1 = batch_2[:, 0, :], batch_2[:, 1, :] self.assertAllClose(batch_2_t0, batch_2_t1) # Also validate that different dropout is used by between batches. self.assertNotAllClose(batch_1_t0, batch_2_t0) self.assertNotAllClose(batch_1_t1, batch_2_t1) for l in [layer_1, layer_2, layer_3]: verify(l) def test_stacked_rnn_compute_output_shape(self): cells = [keras.layers.LSTMCell(3), keras.layers.LSTMCell(6)] embedding_dim = 4 timesteps = 2 layer = keras.layers.RNN( cells, return_state=True, return_sequences=True ) output_shape = layer.compute_output_shape( (None, timesteps, embedding_dim) ) expected_output_shape = [ (None, timesteps, 6), (None, 3), (None, 3), (None, 6), (None, 6), ] self.assertEqual( [tuple(o.as_list()) for o in output_shape], expected_output_shape ) # Test reverse_state_order = True for stacked cell. stacked_cell = keras.layers.StackedRNNCells( cells, reverse_state_order=True ) layer = keras.layers.RNN( stacked_cell, return_state=True, return_sequences=True ) output_shape = layer.compute_output_shape( (None, timesteps, embedding_dim) ) expected_output_shape = [ (None, timesteps, 6), (None, 6), (None, 6), (None, 3), (None, 3), ] self.assertEqual( [tuple(o.as_list()) for o in output_shape], expected_output_shape ) def test_stacked_rnn_with_training_param(self): # See https://github.com/tensorflow/tensorflow/issues/32586 class CellWrapper(keras.layers.AbstractRNNCell): def __init__(self, cell): super().__init__() self.cell = cell @property def state_size(self): return self.cell.state_size @property def output_size(self): return self.cell.output_size def build(self, input_shape): self.cell.build(input_shape) self.built = True def get_initial_state( self, inputs=None, batch_size=None, dtype=None ): return self.cell.get_initial_state( inputs=inputs, batch_size=batch_size, dtype=dtype ) def call(self, inputs, states, training=None, **kwargs): assert training is not None return self.cell(inputs, states=states, training=training) cell = keras.layers.LSTMCell(32) cell = CellWrapper(cell) cell = keras.layers.StackedRNNCells([cell]) rnn = keras.layers.RNN(cell) inputs = np.ones((8, 4, 16), dtype=np.float32) rnn(inputs, training=True) def test_stacked_rnn_with_nested_cell(self): batch = 10 t = 5 i1, i2, i3 = 3, 4, 5 o11, o12, o13 = 2, 3, 4 o21, o22, o23 = 4, 5, 6 # test 1: use_tuple=False cells = [NestedCell(o11, o12, o13), NestedCell(o21, o22, o23)] rnn = keras.layers.RNN(cells, return_sequences=True, return_state=True) input_1 = keras.Input((t, i1)) input_2 = keras.Input((t, i2, i3)) output1, output2, state1, state2 = rnn((input_1, input_2)) s11, s12 = state1 s21, s22 = state2 self.assertEqual(output1.shape.as_list(), [None, t, o21]) self.assertEqual(output2.shape.as_list(), [None, t, o22, o23]) self.assertEqual(s11.shape.as_list(), [None, o11]) self.assertEqual(s12.shape.as_list(), [None, o12, o13]) self.assertEqual(s21.shape.as_list(), [None, o21]) self.assertEqual(s22.shape.as_list(), [None, o22, o23]) model = keras.models.Model([input_1, input_2], [output1, output2]) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( [np.zeros((batch, t, i1)), np.zeros((batch, t, i2, i3))], [np.zeros((batch, t, o21)), np.zeros((batch, t, o22, o23))], ) self.assertEqual( model.output_shape, [(None, t, o21), (None, t, o22, o23)] ) # test 2: use_tuple=True cells = [ NestedCell(o11, o12, o13, use_tuple=True), NestedCell(o21, o22, o23), ] rnn = keras.layers.RNN(cells, return_sequences=True, return_state=True) input_1 = keras.Input((t, i1)) input_2 = keras.Input((t, i2, i3)) output1, output2, state1, state2 = rnn( NestedInput(t1=input_1, t2=input_2) ) s11, s12 = state1 s21, s22 = state2 self.assertEqual(output1.shape.as_list(), [None, t, o21]) self.assertEqual(output2.shape.as_list(), [None, t, o22, o23]) self.assertEqual(s11.shape.as_list(), [None, o11]) self.assertEqual(s12.shape.as_list(), [None, o12, o13]) self.assertEqual(s21.shape.as_list(), [None, o21]) self.assertEqual(s22.shape.as_list(), [None, o22, o23]) model = keras.models.Model([input_1, input_2], [output1, output2]) model.compile( optimizer="rmsprop", loss="mse", run_eagerly=test_utils.should_run_eagerly(), ) model.train_on_batch( [np.zeros((batch, t, i1)), np.zeros((batch, t, i2, i3))], [np.zeros((batch, t, o21)),
np.zeros((batch, t, o22, o23))
numpy.zeros
import numpy as np from scipy.stats import iqr from ..config import MAX_VAL_AFTER_NORMALIZATION from ..utils.dataUtils import morphDilation, gaussianFilter, radial_profile, applyRelativeThr, getCoordsWithinSphere from ..utils.genericException import GenericError DEFAULT_PERCENTIL = 95 DEFAULT_BINARY_MASK_THR= 0.01 def targetNormalizationRegr(x, mask): mask = morphDilation(mask, 1) binary_mask = np.where(mask > DEFAULT_BINARY_MASK_THR, 1, 0) background = np.median(x[binary_mask < 1]) background_median = np.median(background) background_upper_percentil = np.percentile(background, DEFAULT_PERCENTIL) x = np.clip(x, background_median, None) x = x * binary_mask target_inside_mask = x[binary_mask > 0] target_inside_mask = target_inside_mask[target_inside_mask > background_median] target_upper_percentil = np.percentile(target_inside_mask, DEFAULT_PERCENTIL) target_iqr = target_upper_percentil - background_upper_percentil if target_iqr <= 0: raise ValueError("Bad iqr %.3f. Is your input masked?. Unmasked inputs required" % target_iqr) x = x / target_iqr x = np.clip(x, None, MAX_VAL_AFTER_NORMALIZATION) #Just to prevent outliers return x def targetNormalizationLocscale(x, mask): binary_mask = np.where(morphDilation(mask, 1) > DEFAULT_BINARY_MASK_THR, 1, 0) background = np.median(x[binary_mask < 1]) background_median = np.median(background) background_upper_percentil = np.percentile(background, DEFAULT_PERCENTIL) x = np.clip(x, background_median, None) x = x * mask target_inside_mask = x[binary_mask > 0] target_inside_mask = target_inside_mask[target_inside_mask > background_median] target_upper_percentil = np.percentile(target_inside_mask, DEFAULT_PERCENTIL) target_iqr = target_upper_percentil - background_upper_percentil if target_iqr <= 0: raise ValueError("Bad iqr %.3f. Is your input masked?. Unmasked inputs required" % target_iqr) x = x / target_iqr x = np.clip(x, None, MAX_VAL_AFTER_NORMALIZATION) #Just to prevent outliers return x def targetNormalization_2(x, y, mask): inside_x = x[morphDilation(mask, 1)>= DEFAULT_BINARY_MASK_THR] mean_x, std_x = np.mean(inside_x), np.std(inside_x) inside_y= y[mask>= DEFAULT_BINARY_MASK_THR] mean_y, std_y = np.mean(inside_y), np.std(inside_y) y= ((y-mean_y)/std_y)*std_x + mean_x return y def targetNormalizationClassif(x): x= np.clip(x, np.percentile(x,0.1), np.percentile(x,99.9)) x_norm= minMaxNormalization(x) return x_norm def inputNormalizationWithMask(x, mask): mask = morphDilation(mask, 3) mask= applyRelativeThr(mask, DEFAULT_BINARY_MASK_THR) median_val = np.median( x[mask>0] ) iqr_val = iqr(x[mask > 0], rng=(10,DEFAULT_PERCENTIL)) x_norm= (x-median_val)/iqr_val x_norm*= mask return x_norm def inputNormalizationWithMask_2(x, mask): mask = morphDilation(mask, 3) mask= applyRelativeThr(mask, DEFAULT_BINARY_MASK_THR) selection= (mask>0) & (x>0) median_val = np.median( x[selection ] ) iqr_val = iqr(x[selection], rng=(10,DEFAULT_PERCENTIL)) # iqr_val= x[selection].max()- x[selection].min() x_norm= (x-median_val)/iqr_val x_norm*= mask return x_norm def inputNormalizationWithMask_3(x, mask): #This might is too tight for general purposes mask = np.where(morphDilation(mask, 1) > DEFAULT_BINARY_MASK_THR, 1, 0) selection= (mask>0) & (x>0) median_val = np.median( x[selection ] ) iqr_val = iqr(x[selection], rng=(10,DEFAULT_PERCENTIL)) # iqr_val= x[selection].max()- x[selection].min() x_norm= (x-median_val)/iqr_val x_norm*= mask return x_norm def inputNormalization_classification(x): x_min= -x.min() x_range= x.max()-x_min midPoint= x_min+ x_range*.5 conditionSplit= x<midPoint x_min= np.percentile(x[conditionSplit], 5) x_max = np.percentile(x[~ conditionSplit], DEFAULT_PERCENTIL) if not np.isclose(x_min, x_max): x= x/(x_max-x_min) x = np.clip(x, None, MAX_VAL_AFTER_NORMALIZATION) # Just to prevent outliers return x def inputNormalization(x): x= robustNormalization(x ) x = np.clip(x, None, MAX_VAL_AFTER_NORMALIZATION) # Just to prevent outliers return x def inputNormalization_2(x): from skimage.filters import threshold_otsu otsu_thr= threshold_otsu(x) out_mean= np.mean(x[x<otsu_thr]) inner_range= iqr(x[x>=otsu_thr], rng= (10, DEFAULT_PERCENTIL) ) if inner_range==0: raise NormalizationError("warning, bad iqr %.3f. Is your input masked?. Unmasked inputs required" % inner_range) x=(x- out_mean)/inner_range x = np.clip(x, None, MAX_VAL_AFTER_NORMALIZATION) # Just to prevent outliers return x def inputNormalization_3(x, noise_stats=None): ''' Performs input normalization using typical cryo-em schema of normalizing according noise: let noise mean be 0 and noise std=0.1 :param x: input volume :param noise_stats=(mean_noise, std_noise): The statistics of the noise for the input volumen. If none, it will try to automatically guess them :return: normalized input ''' if noise_stats is None: meanInNoise, stdInNosise= _guessNoiseStats_radialProfile(x) print("Noise stats: mean=%f std=%f"%(meanInNoise, stdInNosise)) else: meanInNoise, stdInNosise= noise_stats x_norm= (x-meanInNoise)/ (stdInNosise*10) #Desired noise distribution mean=0 and std=0.1 assert not np.any(np.isnan(x_norm)), "Error normalizing input. Some nans were generated in the volume. Try an alternative normalization option" return x_norm def _guessNoiseStats_radialProfile(x): from .dataUtils import resizeVol from scipy import ndimage from scipy.signal import argrelextrema #First part is a set of heuristics to identify the circular noise around the protein x_gauss= gaussianFilter(resizeVol(x, (100, 100, 100)), 0.1 ) #Resize to seep up and filter to reduce noise level. win_size=5 win_mean = ndimage.uniform_filter(x_gauss, win_size) win_sqr_mean = ndimage.uniform_filter(x_gauss ** 2, win_size) #This is a good estimation of the protein region win_var = win_sqr_mean - win_mean ** 2 interestingCurve= radial_profile(win_var)-radial_profile(win_mean) energyCurve= radial_profile(win_sqr_mean) # import matplotlib.pyplot as plt # f= plt.figure() # plt.plot(radial_profile(win_mean),label='win_mean') # plt.plot(radial_profile(win_sqr_mean),label='win_sqr_mean') # plt.plot(radial_profile(win_var),label='win_var') # plt.plot(radial_profile(win_var)-radial_profile(win_mean),label='win_var_minus_win_mean') # plt.legend() # f.show() # #plt.show() # # from devel_code.trainNet.dataManager import plot_vol_and_target # plot_vol_and_target(x, x_gauss, win_sqr_mean) candidateMinima= argrelextrema(interestingCurve, np.less)[0] if len(candidateMinima)>0: toLookIndex= np.min(candidateMinima) if interestingCurve[toLookIndex]>=0: toLookIndex = np.min(np.argmin(interestingCurve)) # Noise border will be at index > toLookIndex else: toLookIndex = np.min(np.argmin(interestingCurve)) # Noise border will be at index > toLookIndex if toLookIndex>50: #Radial noise, the most typical, has 50 over 100 voxels radius candidateNoiseDist = x_gauss.shape[0] // 2 print("Automatic radial noise detection may have failed. No suitable min index found. Guessing radial noise of radius %s%%"%(candidateNoiseDist)) else: maxInterestingIdx= np.min(np.argmax(interestingCurve[toLookIndex:51])).astype(np.int32)+toLookIndex if ( energyCurve[maxInterestingIdx]> interestingCurve[maxInterestingIdx] and interestingCurve[maxInterestingIdx]>0) : #np.isclose(maxInterestingIdx, maxWinMean, rtol=1e-2): raise NormalizationError("Warning, the input might be hollow structure. Automatic masking might fail. Aborting...") try: toLookIndex2= np.min(np.where(interestingCurve[toLookIndex:]>0))+toLookIndex try: toLookIndex3 = np.min(np.where(interestingCurve[toLookIndex2:] <= 0)) + toLookIndex2 candidateNoiseDist = round((toLookIndex2 + toLookIndex3) * 0.5) grad_1 = np.mean(np.diff(interestingCurve[-10:])) grad_2 = np.mean(np.diff(interestingCurve[-25:-10])) if grad_1 > 1e-8 and grad_2 >1e-8 and grad_1 > 3 * grad_2: candidateNoiseDist =
np.sqrt(3 * (x_gauss.shape[0] // 2) ** 2)
numpy.sqrt
''' @Authors: <NAME>, <NAME>, <NAME>, <NAME> @Purpose: Explore 6DOF rocket trajectory, esspecially quaternion rotation Learning resources: https://eater.net/quaternions ''' import numpy as np import oyaml as yaml import math class Rotator: def __init__(self): self.re = 0; self.i = 0; self.j = 0; self.k = 1 self.body_vector = np.array([[0],[1],[0],[0]]) ''' https://en.wikipedia.org/wiki/Quaternions_and_spatial_rotation#Using_quaternions_as_rotations This function should take inputs: 'Cartesian, unit rotation-axis (Vector), Rotation Angle in radians (Theta) and form a quaternion vector ''' def form_quaternion(self, vector, theta): assert self.vector_is_unit(vector), 'Class: Rotator, Fxn: form_quaternion, vector is not a unit quaternion' r = np.cos(theta/2) i = -1*np.sin(theta/2)*vector[0] j = -1*np.sin(theta/2)*vector[1] k = -1*np.sin(theta/2)*vector[2] quaternion = np.array([[r],[i],[j],[k]]) return quaternion ''' https://math.stackexchange.com/questions/40164/how-do-you-rotate-a-vector-by-a-unit-quaternion ''' def rotate_body(self, quaternion): left = quaternion right = np.array([[quaternion[0]], -quaternion[1], -quaternion[2], -quaternion[3]]) h1 = self.hamilton_product(left, self.body_vector) print('H1: {}'.format(h1)) self.body_vector = self.hamilton_product(h1,right) ''' https://en.wikipedia.org/wiki/Quaternion#Hamilton_product https://math.stackexchange.com/questions/40164/how-do-you-rotate-a-vector-by-a-unit-quaternion ''' def hamilton_product(self, vec1, vec2): a1 = vec1[0]; a2 = vec2[0] b1 = vec1[1]; b2 = vec2[1] c1 = vec1[2]; c2 = vec2[2] d1 = vec1[3]; d2 = vec2[3] r = float(a1*a2 - b1*b2 - c1*c2 - d1*d2) x = float(a1*b2 + b1*a2 + c1*d2 - d1*c2) y = float(a1*c2 - b1*d2 + c1*a2 + d1*b2) z = float(d1*d2 + b1*c2 - c1*b2 + d1*a2) return np.array([[r],[x],[y],[z]]) def report_body_vector(self): print(self.body_vector) ''' Convert some arbitrary vector to a unit vector (divide components by the magnitude) ''' def unitify_vector(self, vector): mag = np.linalg.norm(vector) return vector/mag ''' Checker function to verify a vector of arbitrary length is a unit vector Tolerance variable to allow 'close enough' cases to succeed ''' def vector_is_unit(vec): squares = [x*x for x in vec] vec_sum = np.sum(squares) norm = np.sqrt(vec_sum) tolerance = .01 if abs(norm-1) < tolerance: return true return false ''' https://en.wikipedia.org/wiki/Quaternions_and_spatial_rotation#Using_quaternions_as_rotations q' = q2q1 q1 first, then q2 USE QUATERNION MULTIPLICATION RULE: v*w where v and w are both quaternions with no real part v*w = v x w - v * w v*w where v and w are both quaternions with real part s and t (see wikipedia) v*w = (s + v)*(t + w) = (st - v * w)+(sw + tv + v x w) ''' def combine_quaternions(self, q1, q2): re1 = q1[0]; re2 = q2[0] q1 = q1[1:3]; q2 = q2[1:3] cross = np.cross(q2, q1); dot = np.dot(q2, q1) re_prime = (re1*re2 - dot) temp = re1*q2 + re2*q1 + cross q_prime = np.array([[re_prime],[temp[0]],[temp[1]],[temp[2]]]) return q_prime class Rocket(Rotator): def __init__(self, rocket_data, environment_obj, reference=None, units='english'): super().__init__() ''' abs_orientation is a (unit) vector representing the orientation of the rocket relative to the launch location axis or global axis ''' self.abs_orientation =
np.array([[0],[0],[1]])
numpy.array
import numpy as np import numpy.ma as ma from scipy.sparse import csc_matrix as sparse_matrix from scipy.sparse.linalg import eigs from scipy.linalg import eig from scipy.sparse import diags,identity,coo_matrix import msmtools.estimation as msm_estimation import msmtools.analysis as msm_analysis import stats import matplotlib.pyplot as plt def segment_maskedArray(tseries,min_size=50): ''' Segments time series in case it has missing data ''' if len(tseries.shape)>1: mask = ~np.any(tseries.mask,axis=1) else: mask = ~tseries.mask segments = np.where(np.abs(np.diff(np.concatenate([[False], mask, [False]]))))[0].reshape(-1, 2) return segments def get_count_matrix(labels,lag,nstates): observable_seqs = ma.compress_rows(ma.vstack([labels[:-lag],labels[lag:]]).T) row = observable_seqs[:,0] col = observable_seqs[:,1] data = np.ones(row.size) C = coo_matrix((data, (row, col)), shape=(nstates, nstates)) count_matrix = C.tocsr() return count_matrix def get_count_ms(dtrajs,delay,nstates): if len(dtrajs.shape)>1: count_ms = coo_matrix((nstates,nstates)) for dtraj in dtrajs: try: count_ms+=get_count_matrix(dtraj,delay,nstates) except: print('Warning! No samples.') continue else: try: count_ms=get_count_matrix(dtrajs,delay,nstates) except: print('Warning! No samples.') return count_ms def tscales_samples(labels,delay,dt,size,n_modes=5,reversible=True): dtrajs = get_split_trajs(labels,size) nstates = np.max(labels)+1 P_traj=[] ts_traj = [] for sample_traj in dtrajs: count_ms = get_count_ms(sample_traj,delay,nstates) connected_count_matrix = msm_estimation.connected_cmatrix(count_ms) P = msm_estimation.tmatrix(connected_count_matrix) if reversible: R = get_reversible_transition_matrix(P) tscale = compute_tscales(R,delay,dt,k=n_modes+1) else: tscale = compute_tscales(P,delay,dt,k=n_modes+1) ts_traj.append(tscale) P_traj.append(P) return ts_traj,P_traj def transition_matrix(labels,lag,return_connected=False): nstates = np.max(labels)+1 count_matrix = get_count_matrix(labels,lag,nstates) connected_count_matrix = msm_estimation.connected_cmatrix(count_matrix) P = msm_estimation.tmatrix(connected_count_matrix) if return_connected: lcs = msm_estimation.largest_connected_set(count_matrix) return lcs,P else: return P def get_connected_labels(labels,lcs): final_labels = ma.zeros(labels.shape,dtype=int) for key in np.argsort(lcs): final_labels[labels==lcs[key]]=key+1 final_labels[final_labels==0] = ma.masked final_labels-=1 return final_labels def sorted_spectrum(R,k=5,which='LR'): eigvals,eigvecs = eigs(R,k=k,which=which) sorted_indices = np.argsort(eigvals.real)[::-1] return eigvals[sorted_indices],eigvecs[:,sorted_indices] def compute_tscales(P,delay,dt=1,k=2): try: if P.shape[1]<=10: eigvals = np.sort(eig(P.toarray())[0])[::-1][:k] else: eigvals = eigs(P,k=k,which='LR',return_eigenvectors=False) sorted_indices = np.argsort(eigvals.real)[::-1] eigvals = eigvals[sorted_indices][1:].real eigvals[np.abs(eigvals-1)<1e-12] = np.nan eigvals[eigvals<1e-12] = np.nan return -(delay*dt)/np.log(np.abs(eigvals)) except: return np.array([np.nan]*(k-1)) def get_reversible_transition_matrix(P): probs = stationary_distribution(P) P_hat = diags(1/probs)*P.transpose()*diags(probs) R=(P+P_hat)/2 return R def get_split_trajs(labels,size = 0): if size == 0: size = len(labels)/20 return ma.array([labels[kt:kt+size] for kt in range(0,len(labels)-size,size)]) def implied_tscale(labels,size,delay,dt,n_modes,reversible=True): dtrajs = get_split_trajs(labels,size) nstates = np.max(labels)+1 count_ms = get_count_ms(dtrajs,delay,nstates) connected_count_matrix = msm_estimation.connected_cmatrix(count_ms) P = msm_estimation.tmatrix(connected_count_matrix) if reversible: R = get_reversible_transition_matrix(P) tscale = compute_tscales(R,delay,dt,k=n_modes+1) else: tscale = compute_tscales(P,delay,dt,k=n_modes+1) return tscale def get_bootstrapped_Ps(labels,delay,n_samples,size = 0): #get dtrajs to deal with possible nans dtrajs = get_split_trajs(labels,size) nstates = np.unique(labels.compressed()).shape[0] sample_Ps=[] for k in range(n_samples): sample_trajs = [dtrajs[k] for k in np.random.randint(0,len(dtrajs),len(dtrajs))] count_ms = get_count_ms(sample_trajs,delay,nstates) connected_count_matrix = msm_estimation.connected_cmatrix(count_ms) P = msm_estimation.tmatrix(connected_count_matrix) sample_Ps.append(P) return sample_Ps def boostrap_tscales(labels,delay,dt,n_modes,n_samples = 1000,size=0,reversible=True): Ps = get_bootstrapped_Ps(labels,delay,n_samples,size) tscales=np.zeros((n_samples,n_modes)) for k,P in enumerate(Ps): if reversible: R = get_reversible_transition_matrix(P) tscale = compute_tscales(R,delay,dt,k=n_modes+1) else: tscale = compute_tscales(P,delay,dt,k=n_modes+1) tscales[k,:]=tscale return tscales def bootstrap_tscale_sample(labels,delay,dt,n_modes,size=0,reversible=True): dtrajs = get_split_trajs(labels,size) nstates = np.unique(labels.compressed()).shape[0] sample_trajs = [dtrajs[k] for k in np.random.randint(0,len(dtrajs),len(dtrajs))] count_ms = get_count_ms(sample_trajs,delay,nstates) connected_count_matrix = msm_estimation.connected_cmatrix(count_ms) P = msm_estimation.tmatrix(connected_count_matrix) if reversible: R = get_reversible_transition_matrix(P) tscale = compute_tscales(R,delay,dt,k=n_modes+1) else: tscale = compute_tscales(P,delay,dt,k=n_modes+1) return tscale def bootstrap_tscales_delays(range_delays,labels,n_modes,dt,n_samples=1000,size=0,reversible=True): dtrajs = get_split_trajs(labels,size) nstates = np.unique(labels.compressed()).shape[0] sample_trajs = [dtrajs[k] for k in np.random.randint(0,len(dtrajs),len(dtrajs))] tscales=np.zeros((len(range_delays),n_modes)) for kd,delay in enumerate(range_delays): try: count_ms = get_count_ms(sample_trajs,delay,nstates) connected_count_matrix = msm_estimation.connected_cmatrix(count_ms) P = msm_estimation.tmatrix(connected_count_matrix) if reversible: R = get_reversible_transition_matrix(P) tscale = compute_tscales(R,delay,dt,k=n_modes+1) else: tscale = compute_tscales(P,delay,dt,k=n_modes+1) tscales[kd,:] = tscale except: continue return tscales def compute_implied_tscales(labels,range_delays,dt=1,n_modes=5,n_samples=1000,size=0,reversible=False,confidence = 95): if size==0: size = np.max(range_delays)*2 cil = (100-confidence)/2 ciu = 100-cil cil_delay=np.zeros((len(range_delays),n_modes)) ciu_delay=np.zeros((len(range_delays),n_modes)) mean_delay=np.zeros((len(range_delays),n_modes)) bootstrapped_tscales = [] for kd,delay in enumerate(range_delays): mean_tscale = implied_tscale(labels,size,delay,dt,n_modes,reversible) tscales_samples = boostrap_tscales(labels,delay,dt,n_modes,n_samples,size,reversible) mean_delay[kd,:] = mean_tscale cil_delay[kd,:] = np.nanpercentile(tscales_samples,cil,axis=0) ciu_delay[kd,:] = np.nanpercentile(tscales_samples,ciu,axis=0) return cil_delay,ciu_delay,mean_delay def find_asymptote(ts,tol=1e-5): es_0 = np.percentile(ts,80) tau_0 = np.where(np.diff(np.sign(ts-es_0)))[0][0] es_list=[es_0,] tau_list=[tau_0,] m,b=np.polyfit(np.arange(tau_0,len(ts)),np.cumsum(ts)[tau_list[-1]:],1) es_list.append(m) tau_list.append(np.where(np.diff(np.sign(ts-m)))[0][0]) while es_list[-1]-es_list[-2]>tol: m,b=np.polyfit(np.arange(tau_list[-1],len(ts)),np.cumsum(ts)[tau_list[-1]:],1) es_list.append(m) try: tau_list.append(np.where(np.diff(np.sign(ts-m)))[0][0]) except: break return tau_list[-1],es_list[-1] def stationary_distribution(P): probs = msm_analysis.statdist(P) return probs def get_entropy(labels): #get dtrajs to deal with possible nans P = transition_matrix(labels,1) probs = stationary_distribution(P) logP = P.copy() logP.data = np.log(logP.data) return (-diags(probs).dot(P.multiply(logP))).sum() def simulate(P,state0,iters): ''' Monte Carlo simulation of the markov chain characterized by the matrix P state0: initial system iters: number of iterations of the simulation ''' states = np.zeros(iters,dtype=int) states[0]=state0 state=state0 for k in range(1,iters): new_state = np.random.choice(np.arange(P.shape[1]),p=list(np.hstack(P[state,:].toarray()))) state=new_state states[k]=state return states def state_lifetime(states,tau): ''' Get distribution of lifetimes of each state in states tau is the sampling time of the states ''' durations=[] for state in np.sort(np.unique(states.compressed())): gaps = states==state gaps_boundaries = np.where(np.abs(np.diff(np.concatenate([[False], gaps, [False]]))))[0].reshape(-1, 2) durations.append(np.hstack(np.diff(gaps_boundaries))*tau) return durations from scipy.signal import find_peaks def optimal_partition(phi2,inv_measure,P,return_rho = True): X = phi2 c_range = np.sort(phi2)[1:-1] rho_c = np.zeros(len(c_range)) rho_sets = np.zeros((len(c_range),2)) for kc,c in enumerate(c_range): labels = np.zeros(len(X),dtype=int) labels[X<=c] = 1 rho_sets[kc] = [(inv_measure[labels==idx]*(P[labels==idx,:][:,labels==idx])).sum()/inv_measure[labels==idx].sum() for idx in range(2)] rho_c = np.min(rho_sets,axis=1) peaks, heights = find_peaks(rho_c, height=0.5) if len(peaks)==0: #lower height print('No prominent coherent set') return None else: idx = peaks[np.argmax(heights['peak_heights'])] c_opt = c_range[idx] kmeans_labels = np.zeros(len(X),dtype=int) kmeans_labels[X<c_opt] = 1 if return_rho: return c_range,rho_sets,idx,kmeans_labels else: return kmeans_labels def subdivide_state_optimal(phi2,kmeans_labels,inv_measure,P,indices,plot): if plot: c_range,rho_sets,idx,labels_ = optimal_partition(phi2,inv_measure,P,return_rho=True) kmeans_labels[indices] = labels_+np.max(kmeans_labels)+1 plt.figure(figsize=(5,5)) plt.scatter(c_range,rho_sets[:,0],s=10) plt.scatter(c_range,rho_sets[:,1],s=10) rho_c = np.min(rho_sets,axis=1) plt.plot(c_range,rho_c,c='k',ls='--') plt.scatter(c_range[idx],rho_c[idx],c='r',marker='x') plt.ylim(.2,1) plt.xlabel(r'$\phi_2$',fontsize=15) plt.ylabel(r'$\rho$',fontsize=15) plt.xticks(fontsize=12) print(len(np.unique(kmeans_labels))) plt.show() else: kmeans_labels[indices] = optimal_partition(phi2,inv_measure,P,return_rho=False)+np.max(kmeans_labels)+1 final_kmeans_labels = np.zeros(kmeans_labels.shape,dtype=int) for new_idx,label in enumerate(np.sort(np.unique(kmeans_labels))): final_kmeans_labels[kmeans_labels==label]=new_idx return final_kmeans_labels def recursive_partitioning_optimal(final_labels,delay,phi2,inv_measure,P,n_final_states,plot=False,save=False): c_range,rho_sets,idx,kmeans_labels = optimal_partition(phi2,inv_measure,P,return_rho=True) if plot: plt.figure(figsize=(5,5)) plt.scatter(c_range,rho_sets[:,0],s=10) plt.scatter(c_range,rho_sets[:,1],s=10) rho_c = np.min(rho_sets,axis=1) plt.plot(c_range,rho_c,c='k',ls='--') plt.scatter(c_range[idx],rho_c[idx],c='r',marker='x') plt.ylim(.3,1) # plt.xlim(-0.04,0.04) plt.xlabel(r'$\phi_2$',fontsize=15) plt.ylabel(r'$\rho$',fontsize=15) plt.xticks(fontsize=12) print(len(
np.unique(kmeans_labels)
numpy.unique
#!/usr/bin/env python u""" read_cryosat_L1b.py Written by <NAME> (02/2020) Reads CryoSat Level-1b data products from baselines A, B and C Reads CryoSat Level-1b netCDF4 data products from baseline D Supported CryoSat Modes: LRM, SAR, SARin, FDM, SID, GDR INPUTS: full_filename: full path of CryoSat .DBL or .nc file OUTPUTS: Location: Time and Orbit Group Data: Measurements Group Geometry: External Corrections Group Waveform_1Hz: Average Waveforms Group Waveform_20Hz: Waveforms Group (with SAR/SARIN Beam Behavior Parameters) METADATA: MPH, SPH and DSD Header data PYTHON DEPENDENCIES: numpy: Scientific Computing Tools For Python https://numpy.org https://numpy.org/doc/stable/user/numpy-for-matlab-users.html netCDF4: Python interface to the netCDF C library https://unidata.github.io/netcdf4-python/netCDF4/index.html UPDATE HISTORY: Updated 02/2020: tilde-expansion of cryosat-2 files before opening add scale factors function for converting packed units in binary files convert from hard to soft tabulation Updated 11/2019: empty placeholder dictionary for baseline D DSD headers Updated 09/2019: added netCDF4 read function for baseline D will output with same variable names as the binary read functions Updated 04/2019: USO correction signed 32 bit int Updated 10/2018: updated header read functions for python3 Updated 05/2016: using __future__ print and division functions Written 03/2016 """ from __future__ import print_function from __future__ import division import os import re import netCDF4 import numpy as np #-- PURPOSE: Initiate L1b MDS variables for CryoSat Baselines A and B def cryosat_baseline_AB(fid, n_records, MODE): n_SARIN_RW = 512 n_SAR_RW = 128 n_LRM_RW = 128 n_blocks = 20 n_BeamBehaviourParams = 50 #-- CryoSat-2 Time and Orbit Group Location = {} #-- Time: day part Location['Day'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Time: second part Location['Second'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- Time: microsecond part Location['Micsec'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- USO correction factor Location['USO_Corr'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Mode ID Location['Mode_ID'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Source sequence counter Location['SSC'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Instrument configuration Location['Inst_config'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- Record Counter Location['Rec_Count'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Location['Lat'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Location['Lon'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Location['Alt'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instantaneous altitude rate derived from orbit: packed units (mm/s, 1e-3 m/s) Location['Alt_rate'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Satellite velocity vector. In ITRF: packed units (mm/s, 1e-3 m/s) #-- ITRF= International Terrestrial Reference Frame Location['Sat_velocity'] = np.zeros((n_records,n_blocks,3),dtype=np.int32) #-- Real beam direction vector. In CRF: packed units (micro-m, 1e-6 m) #-- CRF= CryoSat Reference Frame. Location['Real_beam'] = np.zeros((n_records,n_blocks,3),dtype=np.int32) #-- Interferometric baseline vector. In CRF: packed units (micro-m, 1e-6 m) Location['Baseline'] = np.zeros((n_records,n_blocks,3),dtype=np.int32) #-- Measurement Confidence Data Flags #-- Generally the MCD flags indicate problems when set #-- If MCD is 0 then no problems or non-nominal conditions were detected #-- Serious errors are indicated by setting bit 31 Location['MCD'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- CryoSat-2 Measurement Group #-- Derived from instrument measurement parameters Data_20Hz = {} #-- Window Delay reference (two-way) corrected for instrument delays Data_20Hz['TD'] = np.zeros((n_records,n_blocks),dtype=np.int64) #-- H0 Initial Height Word from telemetry Data_20Hz['H_0'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- COR2 Height Rate: on-board tracker height rate over the radar cycle Data_20Hz['COR2'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Coarse Range Word (LAI) derived from telemetry Data_20Hz['LAI'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Fine Range Word (FAI) derived from telemetry Data_20Hz['FAI'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Automatic Gain Control Channel 1: AGC gain applied on Rx channel 1. #-- Gain calibration corrections are applied (Sum of AGC stages 1 and 2 #-- plus the corresponding corrections) (dB/100) Data_20Hz['AGC_CH1'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Automatic Gain Control Channel 2: AGC gain applied on Rx channel 2. #-- Gain calibration corrections are applied (dB/100) Data_20Hz['AGC_CH2'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Total Fixed Gain On Channel 1: gain applied by the RF unit. (dB/100) Data_20Hz['TR_gain_CH1'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Total Fixed Gain On Channel 2: gain applied by the RF unit. (dB/100) Data_20Hz['TR_gain_CH2'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Transmit Power in microWatts Data_20Hz['TX_Power'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Doppler range correction: Radial component (mm) #-- computed for the component of satellite velocity in the nadir direction Data_20Hz['Doppler_range'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instrument Range Correction: transmit-receive antenna (mm) #-- Calibration correction to range on channel 1 computed from CAL1. Data_20Hz['TR_inst_range'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instrument Range Correction: receive-only antenna (mm) #-- Calibration correction to range on channel 2 computed from CAL1. Data_20Hz['R_inst_range'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instrument Gain Correction: transmit-receive antenna (dB/100) #-- Calibration correction to gain on channel 1 computed from CAL1 Data_20Hz['TR_inst_gain'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instrument Gain Correction: receive-only (dB/100) #-- Calibration correction to gain on channel 2 computed from CAL1 Data_20Hz['R_inst_gain'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Internal Phase Correction (microradians) Data_20Hz['Internal_phase'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- External Phase Correction (microradians) Data_20Hz['External_phase'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Noise Power measurement (dB/100): converted from telemetry units to be #-- the noise floor of FBR measurement echoes. #-- Set to -9999.99 when the telemetry contains zero. Data_20Hz['Noise_power'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Phase slope correction (microradians) #-- Computed from the CAL-4 packets during the azimuth impulse response #-- amplitude (SARIN only). Set from the latest available CAL-4 packet. Data_20Hz['Phase_slope'] = np.zeros((n_records,n_blocks),dtype=np.int32) Data_20Hz['Spares1'] = np.zeros((n_records,n_blocks,4),dtype=np.int8) #-- CryoSat-2 External Corrections Group Geometry = {} #-- Dry Tropospheric Correction packed units (mm, 1e-3 m) Geometry['dryTrop'] = np.zeros((n_records),dtype=np.int32) #-- Wet Tropospheric Correction packed units (mm, 1e-3 m) Geometry['wetTrop'] = np.zeros((n_records),dtype=np.int32) #-- Inverse Barometric Correction packed units (mm, 1e-3 m) Geometry['InvBar'] = np.zeros((n_records),dtype=np.int32) #-- Delta Inverse Barometric Correction packed units (mm, 1e-3 m) Geometry['DAC'] = np.zeros((n_records),dtype=np.int32) #-- GIM Ionospheric Correction packed units (mm, 1e-3 m) Geometry['Iono_GIM'] = np.zeros((n_records),dtype=np.int32) #-- Model Ionospheric Correction packed units (mm, 1e-3 m) Geometry['Iono_model'] = np.zeros((n_records),dtype=np.int32) #-- Ocean tide Correction packed units (mm, 1e-3 m) Geometry['ocTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Long period equilibrium ocean tide Correction packed units (mm, 1e-3 m) Geometry['lpeTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Ocean loading tide Correction packed units (mm, 1e-3 m) Geometry['olTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Solid Earth tide Correction packed units (mm, 1e-3 m) Geometry['seTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Geocentric Polar tide Correction packed units (mm, 1e-3 m) Geometry['gpTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Surface Type: enumerated key to classify surface at nadir #-- 0 = Open Ocean #-- 1 = Closed Sea #-- 2 = Continental Ice #-- 3 = Land Geometry['Surf_type'] = np.zeros((n_records),dtype=np.uint32) Geometry['Spare1'] = np.zeros((n_records,4),dtype=np.int8) #-- Corrections Status Flag Geometry['Corr_status'] = np.zeros((n_records),dtype=np.uint32) #-- Correction Error Flag Geometry['Corr_error'] = np.zeros((n_records),dtype=np.uint32) Geometry['Spare2'] = np.zeros((n_records,4),dtype=np.int8) #-- CryoSat-2 Average Waveforms Groups Waveform_1Hz = {} if (MODE == 'LRM'): #-- Low-Resolution Mode #-- Data Record Time (MDSR Time Stamp) Waveform_1Hz['Day'] = np.zeros((n_records),dtype=np.int32) Waveform_1Hz['Second'] = np.zeros((n_records),dtype=np.uint32) Waveform_1Hz['Micsec'] = np.zeros((n_records),dtype=np.uint32) #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lat'] = np.zeros((n_records),dtype=np.int32) #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lon'] = np.zeros((n_records),dtype=np.int32) #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Waveform_1Hz['Alt'] = np.zeros((n_records),dtype=np.int32) #-- Window Delay (two-way) corrected for instrument delays Waveform_1Hz['TD'] = np.zeros((n_records),dtype=np.int64) #-- 1 Hz Averaged Power Echo Waveform Waveform_1Hz['Waveform'] = np.zeros((n_records,n_LRM_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_1Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Echo Scale Power (a power of 2) Waveform_1Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Number of echoes averaged Waveform_1Hz['N_avg_echoes'] = np.zeros((n_records),dtype=np.uint16) Waveform_1Hz['Flags'] = np.zeros((n_records),dtype=np.uint16) elif (MODE == 'SAR'): #-- SAR Mode #-- Data Record Time (MDSR Time Stamp) Waveform_1Hz['Day'] = np.zeros((n_records),dtype=np.int32) Waveform_1Hz['Second'] = np.zeros((n_records),dtype=np.uint32) Waveform_1Hz['Micsec'] = np.zeros((n_records),dtype=np.uint32) #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lat'] = np.zeros((n_records),dtype=np.int32) #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lon'] = np.zeros((n_records),dtype=np.int32) #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Waveform_1Hz['Alt'] = np.zeros((n_records),dtype=np.int32) #-- Window Delay (two-way) corrected for instrument delays Waveform_1Hz['TD'] = np.zeros((n_records),dtype=np.int64) #-- 1 Hz Averaged Power Echo Waveform Waveform_1Hz['Waveform'] = np.zeros((n_records,n_SAR_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_1Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Echo Scale Power (a power of 2) Waveform_1Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Number of echoes averaged Waveform_1Hz['N_avg_echoes'] = np.zeros((n_records),dtype=np.uint16) Waveform_1Hz['Flags'] = np.zeros((n_records),dtype=np.uint16) elif (MODE == 'SIN'): #-- SARIN Mode #-- Same as the LRM/SAR groups but the waveform array is 512 bins instead of #-- 128 and the number of echoes averaged is different. #-- Data Record Time (MDSR Time Stamp) Waveform_1Hz['Day'] = np.zeros((n_records),dtype=np.int32) Waveform_1Hz['Second'] = np.zeros((n_records),dtype=np.uint32) Waveform_1Hz['Micsec'] = np.zeros((n_records),dtype=np.uint32) #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lat'] = np.zeros((n_records),dtype=np.int32) #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lon'] = np.zeros((n_records),dtype=np.int32) #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Waveform_1Hz['Alt'] = np.zeros((n_records),dtype=np.int32) #-- Window Delay (two-way) corrected for instrument delays Waveform_1Hz['TD'] = np.zeros((n_records),dtype=np.int64) #-- 1 Hz Averaged Power Echo Waveform Waveform_1Hz['Waveform'] = np.zeros((n_records,n_SARIN_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_1Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Echo Scale Power (a power of 2) Waveform_1Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Number of echoes averaged Waveform_1Hz['N_avg_echoes'] = np.zeros((n_records),dtype=np.uint16) Waveform_1Hz['Flags'] = np.zeros((n_records),dtype=np.uint16) #-- CryoSat-2 Waveforms Groups #-- Beam Behavior Parameters Beam_Behavior = {} #-- Standard Deviation of Gaussian fit to range integrated stack power. Beam_Behavior['SD'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Stack Center: Mean of Gaussian fit to range integrated stack power. Beam_Behavior['Center'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Stack amplitude parameter scaled in dB/100. Beam_Behavior['Amplitude'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- 3rd moment: providing the degree of asymmetry of the range integrated #-- stack power distribution. Beam_Behavior['Skewness'] = np.zeros((n_records,n_blocks),dtype=np.int16) #-- 4th moment: Measure of peakiness of range integrated stack power distribution. Beam_Behavior['Kurtosis'] = np.zeros((n_records,n_blocks),dtype=np.int16) Beam_Behavior['Spare'] = np.zeros((n_records,n_blocks,n_BeamBehaviourParams-5),dtype=np.int16) #-- CryoSat-2 mode specific waveforms Waveform_20Hz = {} if (MODE == 'LRM'): #-- Low-Resolution Mode #-- Averaged Power Echo Waveform [128] Waveform_20Hz['Waveform'] = np.zeros((n_records,n_blocks,n_LRM_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_20Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Echo Scale Power (a power of 2 to scale echo to Watts) Waveform_20Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Number of echoes averaged Waveform_20Hz['N_avg_echoes'] = np.zeros((n_records,n_blocks),dtype=np.uint16) Waveform_20Hz['Flags'] = np.zeros((n_records,n_blocks),dtype=np.uint16) elif (MODE == 'SAR'): #-- SAR Mode #-- Averaged Power Echo Waveform [128] Waveform_20Hz['Waveform'] = np.zeros((n_records,n_blocks,n_SAR_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_20Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Echo Scale Power (a power of 2 to scale echo to Watts) Waveform_20Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Number of echoes averaged Waveform_20Hz['N_avg_echoes'] = np.zeros((n_records,n_blocks),dtype=np.uint16) Waveform_20Hz['Flags'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Beam behaviour parameters Waveform_20Hz['Beam'] = Beam_Behavior elif (MODE == 'SIN'): #-- SARIN Mode #-- Averaged Power Echo Waveform [512] Waveform_20Hz['Waveform'] = np.zeros((n_records,n_blocks,n_SARIN_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_20Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Echo Scale Power (a power of 2 to scale echo to Watts) Waveform_20Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Number of echoes averaged Waveform_20Hz['N_avg_echoes'] = np.zeros((n_records,n_blocks),dtype=np.uint16) Waveform_20Hz['Flags'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Beam behaviour parameters Waveform_20Hz['Beam'] = Beam_Behavior #-- Coherence [512]: packed units (1/1000) Waveform_20Hz['Coherence'] = np.zeros((n_records,n_blocks,n_SARIN_RW),dtype=np.int16) #-- Phase Difference [512]: packed units (microradians) Waveform_20Hz['Phase_diff'] = np.zeros((n_records,n_blocks,n_SARIN_RW),dtype=np.int32) #-- for each record in the CryoSat file for r in range(n_records): #-- CryoSat-2 Time and Orbit Group for b in range(n_blocks): Location['Day'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Second'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['Micsec'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['USO_Corr'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Mode_ID'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Location['SSC'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Location['Inst_config'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['Rec_Count'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['Lat'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Lon'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Alt'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Alt_rate'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Sat_velocity'][r,b,:] = np.fromfile(fid,dtype='>i4',count=3) Location['Real_beam'][r,b,:] = np.fromfile(fid,dtype='>i4',count=3) Location['Baseline'][r,b,:] = np.fromfile(fid,dtype='>i4',count=3) Location['MCD'][r,b] = np.fromfile(fid,dtype='>u4',count=1) #-- CryoSat-2 Measurement Group #-- Derived from instrument measurement parameters for b in range(n_blocks): Data_20Hz['TD'][r,b] = np.fromfile(fid,dtype='>i8',count=1) Data_20Hz['H_0'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['COR2'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['LAI'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['FAI'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['AGC_CH1'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['AGC_CH2'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TR_gain_CH1'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TR_gain_CH2'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TX_Power'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Doppler_range'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TR_inst_range'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['R_inst_range'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TR_inst_gain'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['R_inst_gain'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Internal_phase'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['External_phase'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Noise_power'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Phase_slope'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Spares1'][r,b,:] = np.fromfile(fid,dtype='>i1',count=4) #-- CryoSat-2 External Corrections Group Geometry['dryTrop'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['wetTrop'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['InvBar'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['DAC'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['Iono_GIM'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['Iono_model'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['ocTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['lpeTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['olTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['seTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['gpTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['Surf_type'][r] = np.fromfile(fid,dtype='>u4',count=1) Geometry['Spare1'][r,:] = np.fromfile(fid,dtype='>i1',count=4) Geometry['Corr_status'][r] = np.fromfile(fid,dtype='>u4',count=1) Geometry['Corr_error'][r] = np.fromfile(fid,dtype='>u4',count=1) Geometry['Spare2'][r,:] = np.fromfile(fid,dtype='>i1',count=4) #-- CryoSat-2 Average Waveforms Groups if (MODE == 'LRM'): #-- Low-Resolution Mode Waveform_1Hz['Day'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Second'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Micsec'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Lat'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Lon'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Alt'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['TD'][r] = np.fromfile(fid,dtype='>i8',count=1) Waveform_1Hz['Waveform'][r,:] = np.fromfile(fid,dtype='>u2',count=n_LRM_RW) Waveform_1Hz['Linear_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Power2_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['N_avg_echoes'][r] = np.fromfile(fid,dtype='>u2',count=1) Waveform_1Hz['Flags'][r] = np.fromfile(fid,dtype='>u2',count=1) elif (MODE == 'SAR'): #-- SAR Mode Waveform_1Hz['Day'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Second'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Micsec'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Lat'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Lon'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Alt'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['TD'][r] = np.fromfile(fid,dtype='>i8',count=1) Waveform_1Hz['Waveform'][r,:] = np.fromfile(fid,dtype='>u2',count=n_SAR_RW) Waveform_1Hz['Linear_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Power2_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['N_avg_echoes'][r] = np.fromfile(fid,dtype='>u2',count=1) Waveform_1Hz['Flags'][r] = np.fromfile(fid,dtype='>u2',count=1) elif (MODE == 'SIN'): #-- SARIN Mode Waveform_1Hz['Day'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Second'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Micsec'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Lat'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Lon'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Alt'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['TD'][r] = np.fromfile(fid,dtype='>i8',count=1) Waveform_1Hz['Waveform'][r,:] = np.fromfile(fid,dtype='>u2',count=n_SARIN_RW) Waveform_1Hz['Linear_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Power2_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['N_avg_echoes'][r] = np.fromfile(fid,dtype='>u2',count=1) Waveform_1Hz['Flags'][r] = np.fromfile(fid,dtype='>u2',count=1) #-- CryoSat-2 Waveforms Groups if (MODE == 'LRM'): #-- Low-Resolution Mode for b in range(n_blocks): Waveform_20Hz['Waveform'][r,b,:] = np.fromfile(fid,dtype='>u2',count=n_LRM_RW) Waveform_20Hz['Linear_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['Power2_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['N_avg_echoes'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Flags'][r,b] = np.fromfile(fid,dtype='>u2',count=1) elif (MODE == 'SAR'): #-- SAR Mode for b in range(n_blocks): Waveform_20Hz['Waveform'][r,b,:] = np.fromfile(fid,dtype='>u2',count=n_SAR_RW) Waveform_20Hz['Linear_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['Power2_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['N_avg_echoes'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Flags'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['SD'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Center'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Amplitude'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Skewness'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Kurtosis'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Spare'][r,b,:] = np.fromfile(fid,dtype='>i2',count=(n_BeamBehaviourParams-5)) elif (MODE == 'SIN'): #-- SARIN Mode for b in range(n_blocks): Waveform_20Hz['Waveform'][r,b,:] = np.fromfile(fid,dtype='>u2',count=n_SARIN_RW) Waveform_20Hz['Linear_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['Power2_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['N_avg_echoes'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Flags'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['SD'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Center'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Amplitude'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Skewness'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Kurtosis'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Spare'][r,b,:] = np.fromfile(fid,dtype='>i2',count=(n_BeamBehaviourParams-5)) Waveform_20Hz['Coherence'][r,b,:] = np.fromfile(fid,dtype='>i2',count=n_SARIN_RW) Waveform_20Hz['Phase_diff'][r,b,:] = np.fromfile(fid,dtype='>i4',count=n_SARIN_RW) #-- Bind all the bits of the l1b_mds together into a single dictionary CS_l1b_mds = {} CS_l1b_mds['Location'] = Location CS_l1b_mds['Data'] = Data_20Hz CS_l1b_mds['Geometry'] = Geometry CS_l1b_mds['Waveform_1Hz'] = Waveform_1Hz CS_l1b_mds['Waveform_20Hz'] = Waveform_20Hz #-- return the output dictionary return CS_l1b_mds #-- PURPOSE: Initiate L1b MDS variables for CryoSat Baseline C def cryosat_baseline_C(fid, n_records, MODE): n_SARIN_BC_RW = 1024 n_SARIN_RW = 512 n_SAR_BC_RW = 256 n_SAR_RW = 128 n_LRM_RW = 128 n_blocks = 20 n_BeamBehaviourParams = 50 #-- CryoSat-2 Time and Orbit Group Location = {} #-- Time: day part Location['Day'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Time: second part Location['Second'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- Time: microsecond part Location['Micsec'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- USO correction factor Location['USO_Corr'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Mode ID Location['Mode_ID'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Source sequence counter Location['SSC'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Instrument configuration Location['Inst_config'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- Record Counter Location['Rec_Count'] = np.zeros((n_records,n_blocks),dtype=np.uint32) #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Location['Lat'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Location['Lon'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Location['Alt'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instantaneous altitude rate derived from orbit: packed units (mm/s, 1e-3 m/s) Location['Alt_rate'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Satellite velocity vector. In ITRF: packed units (mm/s, 1e-3 m/s) #-- ITRF= International Terrestrial Reference Frame Location['Sat_velocity'] = np.zeros((n_records,n_blocks,3),dtype=np.int32) #-- Real beam direction vector. In CRF: packed units (micro-m/s, 1e-6 m/s) #-- CRF= CryoSat Reference Frame. Location['Real_beam'] = np.zeros((n_records,n_blocks,3),dtype=np.int32) #-- Interferometric baseline vector. In CRF: packed units (micro-m/s, 1e-6 m/s) Location['Baseline'] = np.zeros((n_records,n_blocks,3),dtype=np.int32) #-- Star Tracker ID Location['ST_ID'] = np.zeros((n_records,n_blocks),dtype=np.int16) #-- Antenna Bench Roll Angle (Derived from star trackers) #-- packed units (0.1 micro-degree, 1e-7 degrees) Location['Roll'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Antenna Bench Pitch Angle (Derived from star trackers) #-- packed units (0.1 micro-degree, 1e-7 degrees) Location['Pitch'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Antenna Bench Yaw Angle (Derived from star trackers) #-- packed units (0.1 micro-degree, 1e-7 degrees) Location['Yaw'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Measurement Confidence Data Flags #-- Generally the MCD flags indicate problems when set #-- If MCD is 0 then no problems or non-nominal conditions were detected #-- Serious errors are indicated by setting bit 31 Location['MCD'] = np.zeros((n_records,n_blocks),dtype=np.uint32) Location['Spares'] = np.zeros((n_records,n_blocks,2),dtype=np.int16) #-- CryoSat-2 Measurement Group #-- Derived from instrument measurement parameters Data_20Hz = {} #-- Window Delay reference (two-way) corrected for instrument delays Data_20Hz['TD'] = np.zeros((n_records,n_blocks),dtype=np.int64) #-- H0 Initial Height Word from telemetry Data_20Hz['H_0'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- COR2 Height Rate: on-board tracker height rate over the radar cycle Data_20Hz['COR2'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Coarse Range Word (LAI) derived from telemetry Data_20Hz['LAI'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Fine Range Word (FAI) derived from telemetry Data_20Hz['FAI'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Automatic Gain Control Channel 1: AGC gain applied on Rx channel 1. #-- Gain calibration corrections are applied (Sum of AGC stages 1 and 2 #-- plus the corresponding corrections) (dB/100) Data_20Hz['AGC_CH1'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Automatic Gain Control Channel 2: AGC gain applied on Rx channel 2. #-- Gain calibration corrections are applied (dB/100) Data_20Hz['AGC_CH2'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Total Fixed Gain On Channel 1: gain applied by the RF unit. (dB/100) Data_20Hz['TR_gain_CH1'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Total Fixed Gain On Channel 2: gain applied by the RF unit. (dB/100) Data_20Hz['TR_gain_CH2'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Transmit Power in microWatts Data_20Hz['TX_Power'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Doppler range correction: Radial component (mm) #-- computed for the component of satellite velocity in the nadir direction Data_20Hz['Doppler_range'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instrument Range Correction: transmit-receive antenna (mm) #-- Calibration correction to range on channel 1 computed from CAL1. Data_20Hz['TR_inst_range'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instrument Range Correction: receive-only antenna (mm) #-- Calibration correction to range on channel 2 computed from CAL1. Data_20Hz['R_inst_range'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instrument Gain Correction: transmit-receive antenna (dB/100) #-- Calibration correction to gain on channel 1 computed from CAL1 Data_20Hz['TR_inst_gain'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Instrument Gain Correction: receive-only (dB/100) #-- Calibration correction to gain on channel 2 computed from CAL1 Data_20Hz['R_inst_gain'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Internal Phase Correction (microradians) Data_20Hz['Internal_phase'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- External Phase Correction (microradians) Data_20Hz['External_phase'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Noise Power measurement (dB/100) Data_20Hz['Noise_power'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Phase slope correction (microradians) #-- Computed from the CAL-4 packets during the azimuth impulse response #-- amplitude (SARIN only). Set from the latest available CAL-4 packet. Data_20Hz['Phase_slope'] = np.zeros((n_records,n_blocks),dtype=np.int32) Data_20Hz['Spares1'] = np.zeros((n_records,n_blocks,4),dtype=np.int8) #-- CryoSat-2 External Corrections Group Geometry = {} #-- Dry Tropospheric Correction packed units (mm, 1e-3 m) Geometry['dryTrop'] = np.zeros((n_records),dtype=np.int32) #-- Wet Tropospheric Correction packed units (mm, 1e-3 m) Geometry['wetTrop'] = np.zeros((n_records),dtype=np.int32) #-- Inverse Barometric Correction packed units (mm, 1e-3 m) Geometry['InvBar'] = np.zeros((n_records),dtype=np.int32) #-- Delta Inverse Barometric Correction packed units (mm, 1e-3 m) Geometry['DAC'] = np.zeros((n_records),dtype=np.int32) #-- GIM Ionospheric Correction packed units (mm, 1e-3 m) Geometry['Iono_GIM'] = np.zeros((n_records),dtype=np.int32) #-- Model Ionospheric Correction packed units (mm, 1e-3 m) Geometry['Iono_model'] = np.zeros((n_records),dtype=np.int32) #-- Ocean tide Correction packed units (mm, 1e-3 m) Geometry['ocTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Long period equilibrium ocean tide Correction packed units (mm, 1e-3 m) Geometry['lpeTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Ocean loading tide Correction packed units (mm, 1e-3 m) Geometry['olTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Solid Earth tide Correction packed units (mm, 1e-3 m) Geometry['seTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Geocentric Polar tide Correction packed units (mm, 1e-3 m) Geometry['gpTideElv'] = np.zeros((n_records),dtype=np.int32) #-- Surface Type: enumerated key to classify surface at nadir #-- 0 = Open Ocean #-- 1 = Closed Sea #-- 2 = Continental Ice #-- 3 = Land Geometry['Surf_type'] = np.zeros((n_records),dtype=np.uint32) Geometry['Spare1'] = np.zeros((n_records,4),dtype=np.int8) #-- Corrections Status Flag Geometry['Corr_status'] = np.zeros((n_records),dtype=np.uint32) #-- Correction Error Flag Geometry['Corr_error'] = np.zeros((n_records),dtype=np.uint32) Geometry['Spare2'] = np.zeros((n_records,4),dtype=np.int8) #-- CryoSat-2 Average Waveforms Groups Waveform_1Hz = {} if (MODE == 'LRM'): #-- Low-Resolution Mode #-- Data Record Time (MDSR Time Stamp) Waveform_1Hz['Day'] = np.zeros((n_records),dtype=np.int32) Waveform_1Hz['Second'] = np.zeros((n_records),dtype=np.uint32) Waveform_1Hz['Micsec'] = np.zeros((n_records),dtype=np.uint32) #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lat'] = np.zeros((n_records),dtype=np.int32) #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lon'] = np.zeros((n_records),dtype=np.int32) #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Waveform_1Hz['Alt'] = np.zeros((n_records),dtype=np.int32) #-- Window Delay (two-way) corrected for instrument delays Waveform_1Hz['TD'] = np.zeros((n_records),dtype=np.int64) #-- 1 Hz Averaged Power Echo Waveform Waveform_1Hz['Waveform'] = np.zeros((n_records,n_LRM_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_1Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Echo Scale Power (a power of 2 to scale echo to Watts) Waveform_1Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Number of echoes averaged Waveform_1Hz['N_avg_echoes'] = np.zeros((n_records),dtype=np.uint16) Waveform_1Hz['Flags'] = np.zeros((n_records),dtype=np.uint16) elif (MODE == 'SAR'): #-- SAR Mode #-- Data Record Time (MDSR Time Stamp) Waveform_1Hz['Day'] = np.zeros((n_records),dtype=np.int32) Waveform_1Hz['Second'] = np.zeros((n_records),dtype=np.uint32) Waveform_1Hz['Micsec'] = np.zeros((n_records),dtype=np.uint32) #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lat'] = np.zeros((n_records),dtype=np.int32) #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lon'] = np.zeros((n_records),dtype=np.int32) #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Waveform_1Hz['Alt'] = np.zeros((n_records),dtype=np.int32) #-- Window Delay (two-way) corrected for instrument delays Waveform_1Hz['TD'] = np.zeros((n_records),dtype=np.int64) #-- 1 Hz Averaged Power Echo Waveform Waveform_1Hz['Waveform'] = np.zeros((n_records,n_SAR_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_1Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Echo Scale Power (a power of 2 to scale echo to Watts) Waveform_1Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Number of echoes averaged Waveform_1Hz['N_avg_echoes'] = np.zeros((n_records),dtype=np.uint16) Waveform_1Hz['Flags'] = np.zeros((n_records),dtype=np.uint16) elif (MODE == 'SIN'): #-- SARIN Mode #-- Same as the LRM/SAR groups but the waveform array is 512 bins instead of #-- 128 and the number of echoes averaged is different. #-- Data Record Time (MDSR Time Stamp) Waveform_1Hz['Day'] = np.zeros((n_records),dtype=np.int32) Waveform_1Hz['Second'] = np.zeros((n_records),dtype=np.uint32) Waveform_1Hz['Micsec'] = np.zeros((n_records),dtype=np.uint32) #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lat'] = np.zeros((n_records),dtype=np.int32) #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Waveform_1Hz['Lon'] = np.zeros((n_records),dtype=np.int32) #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Waveform_1Hz['Alt'] = np.zeros((n_records),dtype=np.int32) #-- Window Delay (two-way) corrected for instrument delays Waveform_1Hz['TD'] = np.zeros((n_records),dtype=np.int64) #-- 1 Hz Averaged Power Echo Waveform Waveform_1Hz['Waveform'] = np.zeros((n_records,n_SARIN_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_1Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Echo Scale Power (a power of 2 to scale echo to Watts) Waveform_1Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records),dtype=np.int32) #-- Number of echoes averaged Waveform_1Hz['N_avg_echoes'] = np.zeros((n_records),dtype=np.uint16) Waveform_1Hz['Flags'] = np.zeros((n_records),dtype=np.uint16) #-- CryoSat-2 Waveforms Groups #-- Beam Behavior Parameters Beam_Behavior = {} #-- Standard Deviation of Gaussian fit to range integrated stack power. Beam_Behavior['SD'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Stack Center: Mean of Gaussian fit to range integrated stack power. Beam_Behavior['Center'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Stack amplitude parameter scaled in dB/100. Beam_Behavior['Amplitude'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- 3rd moment: providing the degree of asymmetry of the range integrated #-- stack power distribution. Beam_Behavior['Skewness'] = np.zeros((n_records,n_blocks),dtype=np.int16) #-- 4th moment: Measure of peakiness of range integrated stack power distribution. Beam_Behavior['Kurtosis'] = np.zeros((n_records,n_blocks),dtype=np.int16) #-- Standard deviation as a function of boresight angle (microradians) Beam_Behavior['SD_boresight_angle'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Stack Center angle as a function of boresight angle (microradians) Beam_Behavior['Center_boresight_angle'] = np.zeros((n_records,n_blocks),dtype=np.int16) Beam_Behavior['Spare'] = np.zeros((n_records,n_blocks,n_BeamBehaviourParams-7),dtype=np.int16) #-- CryoSat-2 mode specific waveform variables Waveform_20Hz = {} if (MODE == 'LRM'): #-- Low-Resolution Mode #-- Averaged Power Echo Waveform [128] Waveform_20Hz['Waveform'] = np.zeros((n_records,n_blocks,n_LRM_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_20Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Echo Scale Power (a power of 2) Waveform_20Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Number of echoes averaged Waveform_20Hz['N_avg_echoes'] = np.zeros((n_records,n_blocks),dtype=np.uint16) Waveform_20Hz['Flags'] = np.zeros((n_records,n_blocks),dtype=np.uint16) elif (MODE == 'SAR'): #-- SAR Mode #-- Averaged Power Echo Waveform [256] Waveform_20Hz['Waveform'] = np.zeros((n_records,n_blocks,n_SAR_BC_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_20Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Echo Scale Power (a power of 2) Waveform_20Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Number of echoes averaged Waveform_20Hz['N_avg_echoes'] = np.zeros((n_records,n_blocks),dtype=np.uint16) Waveform_20Hz['Flags'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Beam behaviour parameters Waveform_20Hz['Beam'] = Beam_Behavior elif (MODE == 'SIN'): #-- SARIN Mode #-- Averaged Power Echo Waveform [1024] Waveform_20Hz['Waveform'] = np.zeros((n_records,n_blocks,n_SARIN_BC_RW),dtype=np.uint16) #-- Echo Scale Factor (to scale echo to watts) Waveform_20Hz['Linear_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Echo Scale Power (a power of 2) Waveform_20Hz['Power2_Wfm_Multiplier'] = np.zeros((n_records,n_blocks),dtype=np.int32) #-- Number of echoes averaged Waveform_20Hz['N_avg_echoes'] = np.zeros((n_records,n_blocks),dtype=np.uint16) Waveform_20Hz['Flags'] = np.zeros((n_records,n_blocks),dtype=np.uint16) #-- Beam behaviour parameters Waveform_20Hz['Beam'] = Beam_Behavior #-- Coherence [1024]: packed units (1/1000) Waveform_20Hz['Coherence'] = np.zeros((n_records,n_blocks,n_SARIN_BC_RW),dtype=np.int16) #-- Phase Difference [1024]: packed units (microradians) Waveform_20Hz['Phase_diff'] = np.zeros((n_records,n_blocks,n_SARIN_BC_RW),dtype=np.int32) #-- for each record in the CryoSat file for r in range(n_records): #-- CryoSat-2 Time and Orbit Group for b in range(n_blocks): Location['Day'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Second'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['Micsec'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['USO_Corr'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Mode_ID'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Location['SSC'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Location['Inst_config'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['Rec_Count'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['Lat'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Lon'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Alt'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Alt_rate'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Sat_velocity'][r,b,:] = np.fromfile(fid,dtype='>i4',count=3) Location['Real_beam'][r,b,:] = np.fromfile(fid,dtype='>i4',count=3) Location['Baseline'][r,b,:] = np.fromfile(fid,dtype='>i4',count=3) Location['ST_ID'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Location['Roll'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Pitch'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['Yaw'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Location['MCD'][r,b] = np.fromfile(fid,dtype='>u4',count=1) Location['Spares'][r,b,:] = np.fromfile(fid,dtype='>i2',count=2) #-- CryoSat-2 Measurement Group #-- Derived from instrument measurement parameters for b in range(n_blocks): Data_20Hz['TD'][r,b] = np.fromfile(fid,dtype='>i8',count=1) Data_20Hz['H_0'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['COR2'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['LAI'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['FAI'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['AGC_CH1'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['AGC_CH2'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TR_gain_CH1'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TR_gain_CH2'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TX_Power'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Doppler_range'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TR_inst_range'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['R_inst_range'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['TR_inst_gain'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['R_inst_gain'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Internal_phase'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['External_phase'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Noise_power'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Phase_slope'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Data_20Hz['Spares1'][r,b,:] = np.fromfile(fid,dtype='>i1',count=4) #-- CryoSat-2 External Corrections Group Geometry['dryTrop'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['wetTrop'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['InvBar'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['DAC'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['Iono_GIM'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['Iono_model'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['ocTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['lpeTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['olTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['seTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['gpTideElv'][r] = np.fromfile(fid,dtype='>i4',count=1) Geometry['Surf_type'][r] = np.fromfile(fid,dtype='>u4',count=1) Geometry['Spare1'][r,:] = np.fromfile(fid,dtype='>i1',count=4) Geometry['Corr_status'][r] = np.fromfile(fid,dtype='>u4',count=1) Geometry['Corr_error'][r] = np.fromfile(fid,dtype='>u4',count=1) Geometry['Spare2'][r,:] = np.fromfile(fid,dtype='>i1',count=4) #-- CryoSat-2 Average Waveforms Groups if (MODE == 'LRM'): #-- Low-Resolution Mode Waveform_1Hz['Day'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Second'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Micsec'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Lat'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Lon'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Alt'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['TD'][r] = np.fromfile(fid,dtype='>i8',count=1) Waveform_1Hz['Waveform'][r,:] = np.fromfile(fid,dtype='>u2',count=n_LRM_RW) Waveform_1Hz['Linear_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Power2_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['N_avg_echoes'][r] = np.fromfile(fid,dtype='>u2',count=1) Waveform_1Hz['Flags'][r] = np.fromfile(fid,dtype='>u2',count=1) elif (MODE == 'SAR'): #-- SAR Mode Waveform_1Hz['Day'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Second'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Micsec'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Lat'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Lon'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Alt'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['TD'][r] = np.fromfile(fid,dtype='>i8',count=1) Waveform_1Hz['Waveform'][r,:] = np.fromfile(fid,dtype='>u2',count=n_SAR_RW) Waveform_1Hz['Linear_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Power2_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['N_avg_echoes'][r] = np.fromfile(fid,dtype='>u2',count=1) Waveform_1Hz['Flags'][r] = np.fromfile(fid,dtype='>u2',count=1) elif (MODE == 'SIN'): #-- SARIN Mode Waveform_1Hz['Day'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Second'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Micsec'][r] = np.fromfile(fid,dtype='>u4',count=1) Waveform_1Hz['Lat'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Lon'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Alt'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['TD'][r] = np.fromfile(fid,dtype='>i8',count=1) Waveform_1Hz['Waveform'][r,:] = np.fromfile(fid,dtype='>u2',count=n_SARIN_RW) Waveform_1Hz['Linear_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['Power2_Wfm_Multiplier'][r] = np.fromfile(fid,dtype='>i4',count=1) Waveform_1Hz['N_avg_echoes'][r] = np.fromfile(fid,dtype='>u2',count=1) Waveform_1Hz['Flags'][r] = np.fromfile(fid,dtype='>u2',count=1) #-- CryoSat-2 Waveforms Groups if (MODE == 'LRM'): #-- Low-Resolution Mode for b in range(n_blocks): Waveform_20Hz['Waveform'][r,b,:] = np.fromfile(fid,dtype='>u2',count=n_LRM_RW) Waveform_20Hz['Linear_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['Power2_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['N_avg_echoes'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Flags'][r,b] = np.fromfile(fid,dtype='>u2',count=1) elif (MODE == 'SAR'): #-- SAR Mode for b in range(n_blocks): Waveform_20Hz['Waveform'][r,b,:] = np.fromfile(fid,dtype='>u2',count=n_SAR_BC_RW) Waveform_20Hz['Linear_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['Power2_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['N_avg_echoes'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Flags'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['SD'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Center'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Amplitude'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Skewness'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Kurtosis'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['SD_boresight_angle'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Center_boresight_angle'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Spare'][r,b,:] = np.fromfile(fid,dtype='>i2',count=(n_BeamBehaviourParams-7)) elif (MODE == 'SIN'): #-- SARIN Mode for b in range(n_blocks): Waveform_20Hz['Waveform'][r,b,:] = np.fromfile(fid,dtype='>u2',count=n_SARIN_BC_RW) Waveform_20Hz['Linear_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['Power2_Wfm_Multiplier'][r,b] = np.fromfile(fid,dtype='>i4',count=1) Waveform_20Hz['N_avg_echoes'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Flags'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['SD'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Center'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Amplitude'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Skewness'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Kurtosis'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['SD_boresight_angle'][r,b] = np.fromfile(fid,dtype='>u2',count=1) Waveform_20Hz['Beam']['Center_boresight_angle'][r,b] = np.fromfile(fid,dtype='>i2',count=1) Waveform_20Hz['Beam']['Spare'][r,b,:] = np.fromfile(fid,dtype='>i2',count=(n_BeamBehaviourParams-7)) Waveform_20Hz['Coherence'][r,b,:] = np.fromfile(fid,dtype='>i2',count=n_SARIN_BC_RW) Waveform_20Hz['Phase_diff'][r,b,:] = np.fromfile(fid,dtype='>i4',count=n_SARIN_BC_RW) #-- Bind all the bits of the l1b_mds together into a single dictionary CS_l1b_mds = {} CS_l1b_mds['Location'] = Location CS_l1b_mds['Data'] = Data_20Hz CS_l1b_mds['Geometry'] = Geometry CS_l1b_mds['Waveform_1Hz'] = Waveform_1Hz CS_l1b_mds['Waveform_20Hz'] = Waveform_20Hz #-- return the output dictionary return CS_l1b_mds #-- PURPOSE: Initiate L1b MDS variables for CryoSat Baseline D (netCDF4) def cryosat_baseline_D(full_filename, MODE, UNPACK=False): #-- open netCDF4 file for reading fid = netCDF4.Dataset(os.path.expanduser(full_filename),'r') #-- use original unscaled units unless UNPACK=True fid.set_auto_scale(UNPACK) #-- get dimensions ind_first_meas_20hz_01 = fid.variables['ind_first_meas_20hz_01'][:].copy() ind_meas_1hz_20_ku = fid.variables['ind_meas_1hz_20_ku'][:].copy() n_records = len(ind_first_meas_20hz_01) n_SARIN_D_RW = 1024 n_SARIN_RW = 512 n_SAR_D_RW = 256 n_SAR_RW = 128 n_LRM_RW = 128 n_blocks = 20 #-- CryoSat-2 Time and Orbit Group Location = {} #-- MDS Time Location['Time'] = np.ma.zeros((n_records,n_blocks)) Location['Time'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) time_20_ku = fid.variables['time_20_ku'][:].copy() #-- Time: day part Location['Day'] = np.ma.zeros((n_records,n_blocks)) Location['Day'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) #-- Time: second part Location['Second'] = np.ma.zeros((n_records,n_blocks)) Location['Second'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) #-- Time: microsecond part Location['Micsec'] = np.ma.zeros((n_records,n_blocks)) Location['Micsec'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) #-- USO correction factor Location['USO_Corr'] = np.ma.zeros((n_records,n_blocks)) Location['USO_Corr'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) uso_cor_20_ku = fid.variables['uso_cor_20_ku'][:].copy() #-- Mode ID Location['Mode_ID'] = np.ma.zeros((n_records,n_blocks)) Location['Mode_ID'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_instr_mode_op_20_ku =fid.variables['flag_instr_mode_op_20_ku'][:].copy() #-- Mode Flags Location['Mode_flags'] = np.ma.zeros((n_records,n_blocks)) Location['Mode_flags'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_instr_mode_flags_20_ku =fid.variables['flag_instr_mode_flags_20_ku'][:].copy() #-- Platform attitude control mode Location['Att_control'] = np.ma.zeros((n_records,n_blocks)) Location['Att_control'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_instr_mode_att_ctrl_20_ku =fid.variables['flag_instr_mode_att_ctrl_20_ku'][:].copy() #-- Instrument configuration Location['Inst_config'] = np.ma.zeros((n_records,n_blocks)) Location['Inst_config'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_instr_conf_rx_flags_20_ku = fid.variables['flag_instr_conf_rx_flags_20_ku'][:].copy() #-- acquisition band Location['Inst_band'] = np.ma.zeros((n_records,n_blocks)) Location['Inst_band'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_instr_conf_rx_bwdt_20_ku = fid.variables['flag_instr_conf_rx_bwdt_20_ku'][:].copy() #-- instrument channel Location['Inst_channel'] = np.ma.zeros((n_records,n_blocks)) Location['Inst_channel'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_instr_conf_rx_in_use_20_ku = fid.variables['flag_instr_conf_rx_in_use_20_ku'][:].copy() #-- tracking mode Location['Tracking_mode'] = np.ma.zeros((n_records,n_blocks)) Location['Tracking_mode'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_instr_conf_rx_trk_mode_20_ku = fid.variables['flag_instr_conf_rx_trk_mode_20_ku'][:].copy() #-- Source sequence counter Location['SSC'] = np.ma.zeros((n_records,n_blocks)) Location['SSC'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) seq_count_20_ku = fid.variables['seq_count_20_ku'][:].copy() #-- Record Counter Location['Rec_Count'] = np.ma.zeros((n_records,n_blocks)) Location['Rec_Count'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) rec_count_20_ku = fid.variables['rec_count_20_ku'][:].copy() #-- Lat: packed units (0.1 micro-degree, 1e-7 degrees) Location['Lat'] = np.ma.zeros((n_records,n_blocks)) Location['Lat'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) lat_20_ku = fid.variables['lat_20_ku'][:].copy() #-- Lon: packed units (0.1 micro-degree, 1e-7 degrees) Location['Lon'] = np.ma.zeros((n_records,n_blocks)) Location['Lon'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) lon_20_ku = fid.variables['lon_20_ku'][:].copy() #-- Alt: packed units (mm, 1e-3 m) #-- Altitude of COG above reference ellipsoid (interpolated value) Location['Alt'] = np.ma.zeros((n_records,n_blocks)) Location['Alt'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) alt_20_ku = fid.variables['alt_20_ku'][:].copy() #-- Instantaneous altitude rate derived from orbit: packed units (mm/s, 1e-3 m/s) Location['Alt_rate'] = np.ma.zeros((n_records,n_blocks)) Location['Alt_rate'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) orb_alt_rate_20_ku = fid.variables['orb_alt_rate_20_ku'][:].copy() #-- Satellite velocity vector. In ITRF: packed units (mm/s, 1e-3 m/s) #-- ITRF= International Terrestrial Reference Frame Location['Sat_velocity'] = np.ma.zeros((n_records,n_blocks,3)) Location['Sat_velocity'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) sat_vel_vec_20_ku = fid.variables['sat_vel_vec_20_ku'][:].copy() #-- Real beam direction vector. In CRF: packed units (micro-m/s, 1e-6 m/s) #-- CRF= CryoSat Reference Frame. Location['Real_beam'] = np.ma.zeros((n_records,n_blocks,3)) Location['Real_beam'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) beam_dir_vec_20_ku = fid.variables['beam_dir_vec_20_ku'][:].copy() #-- Interferometric baseline vector. In CRF: packed units (micro-m/s, 1e-6 m/s) Location['Baseline'] = np.ma.zeros((n_records,n_blocks,3)) Location['Baseline'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) inter_base_vec_20_ku = fid.variables['inter_base_vec_20_ku'][:].copy() #-- Star Tracker ID Location['ST_ID'] = np.ma.zeros((n_records,n_blocks)) Location['ST_ID'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_instr_conf_rx_str_in_use_20_ku = fid.variables['flag_instr_conf_rx_str_in_use_20_ku'][:].copy() #-- Antenna Bench Roll Angle (Derived from star trackers) #-- packed units (0.1 micro-degree, 1e-7 degrees) Location['Roll'] = np.ma.zeros((n_records,n_blocks)) Location['Roll'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) off_nadir_roll_angle_str_20_ku = fid.variables['off_nadir_roll_angle_str_20_ku'][:].copy() #-- Antenna Bench Pitch Angle (Derived from star trackers) #-- packed units (0.1 micro-degree, 1e-7 degrees) Location['Pitch'] = np.ma.zeros((n_records,n_blocks)) Location['Pitch'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) off_nadir_pitch_angle_str_20_ku = fid.variables['off_nadir_pitch_angle_str_20_ku'][:].copy() #-- Antenna Bench Yaw Angle (Derived from star trackers) #-- packed units (0.1 micro-degree, 1e-7 degrees) Location['Yaw'] = np.ma.zeros((n_records,n_blocks)) Location['Yaw'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) off_nadir_yaw_angle_str_20_ku = fid.variables['off_nadir_yaw_angle_str_20_ku'][:].copy() #-- Measurement Confidence Data Flags #-- Generally the MCD flags indicate problems when set #-- If MCD is 0 then no problems or non-nominal conditions were detected #-- Serious errors are indicated by setting bit 31 Location['MCD'] = np.ma.zeros((n_records,n_blocks)) Location['MCD'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) flag_mcd_20_ku = fid.variables['flag_mcd_20_ku'][:].copy() #-- CryoSat-2 Measurement Group #-- Derived from instrument measurement parameters Data_20Hz = {} #-- Window Delay reference (two-way) corrected for instrument delays Data_20Hz['TD'] = np.ma.zeros((n_records,n_blocks)) Data_20Hz['TD'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) window_del_20_ku = fid.variables['window_del_20_ku'][:].copy() #-- H0 Initial Height Word from telemetry Data_20Hz['H_0'] = np.ma.zeros((n_records,n_blocks)) Data_20Hz['H_0'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) h0_applied_20_ku = fid.variables['h0_applied_20_ku'][:].copy() #-- COR2 Height Rate: on-board tracker height rate over the radar cycle Data_20Hz['COR2'] = np.ma.zeros((n_records,n_blocks)) Data_20Hz['COR2'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) cor2_applied_20_ku = fid.variables['cor2_applied_20_ku'][:].copy() #-- Coarse Range Word (LAI) derived from telemetry Data_20Hz['LAI'] = np.ma.zeros((n_records,n_blocks)) Data_20Hz['LAI'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) h0_lai_word_20_ku = fid.variables['h0_lai_word_20_ku'][:].copy() #-- Fine Range Word (FAI) derived from telemetry Data_20Hz['FAI'] = np.ma.zeros((n_records,n_blocks)) Data_20Hz['FAI'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) h0_fai_word_20_ku = fid.variables['h0_fai_word_20_ku'][:].copy() #-- Automatic Gain Control Channel 1: AGC gain applied on Rx channel 1. #-- Gain calibration corrections are applied (Sum of AGC stages 1 and 2 #-- plus the corresponding corrections) (dB/100) Data_20Hz['AGC_CH1'] = np.ma.zeros((n_records,n_blocks)) Data_20Hz['AGC_CH1'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) agc_ch1_20_ku = fid.variables['agc_ch1_20_ku'][:].copy() #-- Automatic Gain Control Channel 2: AGC gain applied on Rx channel 2. #-- Gain calibration corrections are applied (dB/100) Data_20Hz['AGC_CH2'] = np.ma.zeros((n_records,n_blocks)) Data_20Hz['AGC_CH2'].mask = np.zeros((n_records,n_blocks),dtype=np.bool) agc_ch2_20_ku = fid.variables['agc_ch2_20_ku'][:].copy() #-- Total Fixed Gain On Channel 1: gain applied by the RF unit. (dB/100) Data_20Hz['TR_gain_CH1'] =
np.ma.zeros((n_records,n_blocks))
numpy.ma.zeros
import numpy as np import gym from meta_mb.logger import logger from meta_mb.meta_envs.base import MetaEnv from gym.envs.mujoco.mujoco_env import MujocoEnv class SwimmerRandVelEnv(MetaEnv, MujocoEnv, gym.utils.EzPickle): def __init__(self): self.set_task(self.sample_tasks(1)[0]) MujocoEnv.__init__(self, 'swimmer.xml', 4) gym.utils.EzPickle.__init__(self) def sample_tasks(self, n_tasks): # for fwd/bwd env, goal direc is backwards if - 1.0, forwards if + 1.0 return np.random.uniform(0.1, 0.2, (n_tasks, )) def set_task(self, task): """ Args: task: task of the meta-learning environment """ self.goal_vel = task def get_task(self): """ Returns: task: task of the meta-learning environment """ return self.goal_vel def step(self, a): ctrl_cost_coeff = 0.0001 xposbefore = self.sim.data.qpos[0] self.do_simulation(a, self.frame_skip) xposafter = self.sim.data.qpos[0] reward_fwd = np.abs((xposafter - xposbefore) / self.dt - self.goal_vel) reward_ctrl = - ctrl_cost_coeff * np.square(a).sum() reward = reward_fwd + reward_ctrl ob = self._get_obs() return ob, reward, False, dict(reward_fwd=reward_fwd, reward_ctrl=reward_ctrl) def _get_obs(self): qpos = self.sim.data.qpos qvel = self.sim.data.qvel return np.concatenate([qpos.flat[2:], qvel.flat]) def reset_model(self): self.set_state( self.init_qpos + self.np_random.uniform(low=-.1, high=.1, size=self.model.nq), self.init_qvel + self.np_random.uniform(low=-.1, high=.1, size=self.model.nv) ) return self._get_obs() def log_diagnostics(self, paths, prefix=''): progs = [ path["observations"][-1][-3] - path["observations"][0][-3] for path in paths ] logger.record_tabular(prefix+'AverageForwardProgress', np.mean(progs)) logger.record_tabular(prefix+'MaxForwardProgress', np.max(progs)) logger.record_tabular(prefix+'MinForwardProgress', np.min(progs)) logger.record_tabular(prefix+'StdForwardProgress',
np.std(progs)
numpy.std
""" Implementation of various calibration methods from https://github.com/JonathanWenger/pycalib. """ import warnings import matplotlib.pyplot as plt import numpy as np import scipy.cluster.vq import scipy.optimize import scipy.special import scipy.stats import sklearn import sklearn.isotonic import sklearn.linear_model import sklearn.multiclass import sklearn.utils from sklearn.base import clone from sklearn.preprocessing import LabelBinarizer from sklearn.utils._joblib import Parallel from sklearn.utils._joblib import delayed from sklearn.utils.validation import check_is_fitted # Ignore binned_statistic FutureWarning # warnings.simplefilter(action='ignore', category=FutureWarning) class CalibrationMethod(sklearn.base.BaseEstimator): """ A generic class for probability calibration A calibration method takes a set of posterior class probabilities and transform them into calibrated posterior probabilities. Calibrated in this sense means that the empirical frequency of a correct class prediction matches its predicted posterior probability. """ def __init__(self): super().__init__() def fit(self, X, y): """ Fit the calibration method based on the given uncalibrated class probabilities X and ground truth labels y. Parameters ---------- X : array-like, shape (n_samples, n_classes) Training data, i.e. predicted probabilities of the base classifier on the calibration set. y : array-like, shape (n_samples,) Target classes. Returns ------- self : object Returns an instance of self. """ raise NotImplementedError("Subclass must implement this method.") def predict_proba(self, X): """ Compute calibrated posterior probabilities for a given array of posterior probabilities from an arbitrary classifier. Parameters ---------- X : array-like, shape (n_samples, n_classes) The uncalibrated posterior probabilities. Returns ------- P : array, shape (n_samples, n_classes) The predicted probabilities. """ raise NotImplementedError("Subclass must implement this method.") def predict(self, X): """ Predict the class of new samples after scaling. Predictions are identical to the ones from the uncalibrated classifier. Parameters ---------- X : array-like, shape (n_samples, n_classes) The uncalibrated posterior probabilities. Returns ------- C : array, shape (n_samples,) The predicted classes. """ return np.argmax(self.predict_proba(X), axis=1) def plot(self, filename, xlim=[0, 1], **kwargs): """ Plot the calibration map. Parameters ---------- xlim : array-like Range of inputs of the calibration map to be plotted. **kwargs : Additional arguments passed on to :func:`matplotlib.plot`. """ # TODO: Fix this plotting function # Generate data and transform x = np.linspace(0, 1, 10000) y = self.predict_proba(np.column_stack([1 - x, x]))[:, 1] # Plot and label plt.plot(x, y, **kwargs) plt.xlim(xlim) plt.xlabel("p(y=1|x)") plt.ylabel("f(p(y=1|x))") class NoCalibration(CalibrationMethod): """ A class that performs no calibration. This class can be used as a baseline for benchmarking. logits : bool, default=False Are the inputs for calibration logits (e.g. from a neural network)? """ def __init__(self, logits=False): self.logits = logits def fit(self, X, y): return self def predict_proba(self, X): if self.logits: return scipy.special.softmax(X, axis=1) else: return X class TemperatureScaling(CalibrationMethod): """ Probability calibration using temperature scaling Temperature scaling [1]_ is a one parameter multi-class scaling method. Output confidence scores are calibrated, meaning they match empirical frequencies of the associated class prediction. Temperature scaling does not change the class predictions of the underlying model. Parameters ---------- T_init : float Initial temperature parameter used for scaling. This parameter is optimized in order to calibrate output probabilities. verbose : bool Print information on optimization procedure. References ---------- .. [1] On calibration of modern neural networks, <NAME>, <NAME>, <NAME>, <NAME>, ICML 2017 """ def __init__(self, T_init=1.0, verbose=False): super().__init__() if T_init <= 0: raise ValueError("Temperature not greater than 0.") self.T_init = T_init self.verbose = verbose def fit(self, X, y): """ Fit the calibration method based on the given uncalibrated class probabilities or logits X and ground truth labels y. Parameters ---------- X : array-like, shape (n_samples, n_classes) Training data, i.e. predicted probabilities or logits of the base classifier on the calibration set. y : array-like, shape (n_samples,) Target classes. Returns ------- self : object Returns an instance of self. """ # Define objective function (NLL / cross entropy) def objective(T): # Calibrate with given T P = scipy.special.softmax(X / T, axis=1) # Compute negative log-likelihood P_y = P[np.array(np.arange(0, X.shape[0])), y] tiny = np.finfo(np.float).tiny # to avoid division by 0 warning NLL = - np.sum(np.log(P_y + tiny)) return NLL # Derivative of the objective with respect to the temperature T def gradient(T): # Exponential terms E = np.exp(X / T) # Gradient dT_i = (np.sum(E * (X - X[np.array(np.arange(0, X.shape[0])), y].reshape(-1, 1)), axis=1)) \ / np.sum(E, axis=1) grad = - dT_i.sum() / T ** 2 return grad # Optimize self.T = scipy.optimize.fmin_bfgs(f=objective, x0=self.T_init, fprime=gradient, gtol=1e-06, disp=self.verbose)[0] # Check for T > 0 if self.T <= 0: raise ValueError("Temperature not greater than 0.") return self def predict_proba(self, X): """ Compute calibrated posterior probabilities for a given array of posterior probabilities from an arbitrary classifier. Parameters ---------- X : array-like, shape (n_samples, n_classes) The uncalibrated posterior probabilities. Returns ------- P : array, shape (n_samples, n_classes) The predicted probabilities. """ # Check is fitted check_is_fitted(self, "T") # Transform with scaled softmax return scipy.special.softmax(X / self.T, axis=1) def latent(self, z): """ Evaluate the latent function Tz of temperature scaling. Parameters ---------- z : array-like, shape=(n_evaluations,) Input confidence for which to evaluate the latent function. Returns ------- f : array-like, shape=(n_evaluations,) Values of the latent function at z. """ check_is_fitted(self, "T") return self.T * z def plot_latent(self, z, filename, **kwargs): """ Plot the latent function of the calibration method. Parameters ---------- z : array-like, shape=(n_evaluations,) Input confidence to plot latent function for. filename : Filename / -path where to save output. kwargs Additional arguments passed on to matplotlib.pyplot.subplots. Returns ------- """ pass class PlattScaling(CalibrationMethod): """ Probability calibration using Platt scaling Platt scaling [1]_ [2]_ is a parametric method designed to output calibrated posterior probabilities for (non-probabilistic) binary classifiers. It was originally introduced in the context of SVMs. It works by fitting a logistic regression model to the model output using the negative log-likelihood as a loss function. Parameters ---------- regularization : float, default=10^(-12) Regularization constant, determining degree of regularization in logistic regression. random_state : int, RandomState instance or None, optional (default=None) The seed of the pseudo random number generator to use when shuffling the data. If `int`, `random_state` is the seed used by the random number generator; If `RandomState` instance, `random_state` is the random number generator; If `None`, the random number generator is the RandomState instance used by `np.random`. References ---------- .. [1] <NAME>. Probabilistic Outputs for Support Vector Machines and Comparisons to Regularized Likelihood Methods in Advances in Large-Margin Classifiers (MIT Press, 1999) .. [2] <NAME>., <NAME>. & <NAME>. A note on Platt’s probabilistic outputs for support vector machines. Machine learning 68, 267–276 (2007) """ def __init__(self, regularization=10 ** -12, random_state=None): super().__init__() self.regularization = regularization self.random_state = sklearn.utils.check_random_state(random_state) def fit(self, X, y, n_jobs=None): """ Fit the calibration method based on the given uncalibrated class probabilities X and ground truth labels y. Parameters ---------- X : array-like, shape (n_samples, n_classes) Training data, i.e. predicted probabilities of the base classifier on the calibration set. y : array-like, shape (n_samples,) Target classes. n_jobs : int or None, optional (default=None) The number of jobs to use for the computation. ``None`` means 1 unless in a :obj:`joblib.parallel_backend` context. ``-1`` means using all processors. See :term:`Glossary <n_jobs>` for more details. Returns ------- self : object Returns an instance of self. """ if X.ndim == 1: raise ValueError("Calibration training data must have shape (n_samples, n_classes).") elif np.shape(X)[1] == 2: self.logistic_regressor_ = sklearn.linear_model.LogisticRegression(C=1 / self.regularization, solver='lbfgs', random_state=self.random_state) self.logistic_regressor_.fit(X[:, 1].reshape(-1, 1), y) elif np.shape(X)[1] > 2: self.onevsrest_calibrator_ = OneVsRestCalibrator(calibrator=clone(self), n_jobs=n_jobs) self.onevsrest_calibrator_.fit(X, y) return self def predict_proba(self, X): """ Compute calibrated posterior probabilities for a given array of posterior probabilities from an arbitrary classifier. Parameters ---------- X : array-like, shape (n_samples, n_classes) The uncalibrated posterior probabilities. Returns ------- P : array, shape (n_samples, n_classes) The predicted probabilities. """ if X.ndim == 1: raise ValueError("Calibration data must have shape (n_samples, n_classes).") elif np.shape(X)[1] == 2: check_is_fitted(self, "logistic_regressor_") return self.logistic_regressor_.predict_proba(X[:, 1].reshape(-1, 1)) elif np.shape(X)[1] > 2: check_is_fitted(self, "onevsrest_calibrator_") return self.onevsrest_calibrator_.predict_proba(X) class IsotonicRegression(CalibrationMethod): """ Probability calibration using Isotonic Regression Isotonic regression [1]_ [2]_ is a non-parametric approach to mapping (non-probabilistic) classifier scores to probabilities. It assumes an isotonic (non-decreasing) relationship between classifier scores and probabilities. Parameters ---------- out_of_bounds : string, optional, default: "clip" The ``out_of_bounds`` parameter handles how x-values outside of the training domain are handled. When set to "nan", predicted y-values will be NaN. When set to "clip", predicted y-values will be set to the value corresponding to the nearest train interval endpoint. When set to "raise", allow ``interp1d`` to throw ValueError. References ---------- .. [1] Transforming Classifier Scores into Accurate Multiclass Probability Estimates, <NAME> & <NAME>, (KDD 2002) .. [2] Predicting Good Probabilities with Supervised Learning, <NAME> & <NAME>, ICML 2005 """ def __init__(self, out_of_bounds="clip"): super().__init__() self.out_of_bounds = out_of_bounds def fit(self, X, y, n_jobs=None): """ Fit the calibration method based on the given uncalibrated class probabilities X and ground truth labels y. Parameters ---------- X : array-like, shape (n_samples, n_classes) Training data, i.e. predicted probabilities of the base classifier on the calibration set. y : array-like, shape (n_samples,) Target classes. n_jobs : int or None, optional (default=None) The number of jobs to use for the computation. ``None`` means 1 unless in a :obj:`joblib.parallel_backend` context. ``-1`` means using all processors. See :term:`Glossary <n_jobs>` for more details. Returns ------- self : object Returns an instance of self. """ if X.ndim == 1: raise ValueError("Calibration training data must have shape (n_samples, n_classes).") elif np.shape(X)[1] == 2: self.isotonic_regressor_ = sklearn.isotonic.IsotonicRegression(increasing=True, out_of_bounds=self.out_of_bounds) self.isotonic_regressor_.fit(X[:, 1], y) elif np.shape(X)[1] > 2: self.onevsrest_calibrator_ = OneVsRestCalibrator(calibrator=clone(self), n_jobs=n_jobs) self.onevsrest_calibrator_.fit(X, y) return self def predict_proba(self, X): """ Compute calibrated posterior probabilities for a given array of posterior probabilities from an arbitrary classifier. Parameters ---------- X : array-like, shape (n_samples, n_classes) The uncalibrated posterior probabilities. Returns ------- P : array, shape (n_samples, n_classes) The predicted probabilities. """ if X.ndim == 1: raise ValueError("Calibration data must have shape (n_samples, n_classes).") elif np.shape(X)[1] == 2: check_is_fitted(self, "isotonic_regressor_") p1 = self.isotonic_regressor_.predict(X[:, 1]) return np.column_stack([1 - p1, p1]) elif np.shape(X)[1] > 2: check_is_fitted(self, "onevsrest_calibrator_") return self.onevsrest_calibrator_.predict_proba(X) class HistogramBinning(CalibrationMethod): """ Probability calibration using histogram binning Histogram binning [1]_ is a nonparametric approach to probability calibration. Classifier scores are binned into a given number of bins either based on fixed width or frequency. Classifier scores are then computed based on the empirical frequency of class 1 in each bin. Parameters ---------- mode : str, default='equal_width' Binning mode used. One of ['equal_width', 'equal_freq']. n_bins : int, default=20 Number of bins to bin classifier scores into. input_range : list, shape (2,), default=[0, 1] Range of the classifier scores. .. [1] <NAME>. & <NAME>. Obtaining calibrated probability estimates from decision trees and naive Bayesian classifiers in Proceedings of the 18th International Conference on Machine Learning (ICML, 2001), 609–616. """ def __init__(self, mode='equal_width', n_bins=20, input_range=[0, 1]): super().__init__() if mode in ['equal_width', 'equal_freq']: self.mode = mode else: raise ValueError("Mode not recognized. Choose on of 'equal_width', or 'equal_freq'.") self.n_bins = n_bins self.input_range = input_range def fit(self, X, y, n_jobs=None): """ Fit the calibration method based on the given uncalibrated class probabilities X and ground truth labels y. Parameters ---------- X : array-like, shape (n_samples, n_classes) Training data, i.e. predicted probabilities of the base classifier on the calibration set. y : array-like, shape (n_samples,) Target classes. n_jobs : int or None, optional (default=None) The number of jobs to use for the computation. ``None`` means 1 unless in a :obj:`joblib.parallel_backend` context. ``-1`` means using all processors. See :term:`Glossary <n_jobs>` for more details. Returns ------- self : object Returns an instance of self. """ if X.ndim == 1: raise ValueError("Calibration training data must have shape (n_samples, n_classes).") elif np.shape(X)[1] == 2: return self._fit_binary(X, y) elif np.shape(X)[1] > 2: self.onevsrest_calibrator_ = OneVsRestCalibrator(calibrator=clone(self), n_jobs=n_jobs) self.onevsrest_calibrator_.fit(X, y) return self def _fit_binary(self, X, y): if self.mode == 'equal_width': # Compute probability of class 1 in each equal width bin binned_stat = scipy.stats.binned_statistic(x=X[:, 1], values=np.equal(1, y), statistic='mean', bins=self.n_bins, range=self.input_range) self.prob_class_1 = binned_stat.statistic # TODO: test this and correct attributes self.binning = binned_stat.bin_edges elif self.mode == 'equal_freq': # Find binning based on equal frequency self.binning = np.quantile(X[:, 1], q=np.linspace(self.input_range[0], self.input_range[1], self.n_bins + 1)) # Compute probability of class 1 in equal frequency bins digitized = np.digitize(X[:, 1], bins=self.binning) digitized[digitized == len(self.binning)] = len(self.binning) - 1 # include rightmost edge in partition self.prob_class_1 = [y[digitized == i].mean() for i in range(1, len(self.binning))] return self def predict_proba(self, X): """ Compute calibrated posterior probabilities for a given array of posterior probabilities from an arbitrary classifier. Parameters ---------- X : array-like, shape (n_samples, n_classes) The uncalibrated posterior probabilities. Returns ------- P : array, shape (n_samples, n_classes) The predicted probabilities. """ if X.ndim == 1: raise ValueError("Calibration data must have shape (n_samples, n_classes).") elif np.shape(X)[1] == 2: check_is_fitted(self, ["binning", "prob_class_1"]) # Find bin of predictions digitized = np.digitize(X[:, 1], bins=self.binning) digitized[digitized == len(self.binning)] = len(self.binning) - 1 # include rightmost edge in partition # Transform to empirical frequency of class 1 in each bin p1 = np.array([self.prob_class_1[j] for j in (digitized - 1)]) # If empirical frequency is NaN, do not change prediction p1 = np.where(np.isfinite(p1), p1, X[:, 1]) assert np.all(np.isfinite(p1)), "Predictions are not all finite." return np.column_stack([1 - p1, p1]) elif np.shape(X)[1] > 2: check_is_fitted(self, "onevsrest_calibrator_") return self.onevsrest_calibrator_.predict_proba(X) class BayesianBinningQuantiles(CalibrationMethod): """ Probability calibration using Bayesian binning into quantiles Bayesian binning into quantiles [1]_ considers multiple equal frequency binning models and combines them through Bayesian model averaging. Each binning model :math:`M` is scored according to :math:`\\text{Score}(M) = P(M) \\cdot P(D | M),` where a uniform prior :math:`P(M)` is assumed. The marginal likelihood :math:`P(D | M)` has a closed form solution under the assumption of independent binomial class distributions in each bin with beta priors. Parameters ---------- C : int, default = 10 Constant controlling the number of binning models. input_range : list, shape (2,), default=[0, 1] Range of the scores to calibrate. .. [1] <NAME>., <NAME>. & <NAME>. Obtaining Well Calibrated Probabilities Using Bayesian Binning in Proceedings of the Twenty-Ninth AAAI Conference on Artificial Intelligence, Austin, Texas, USA. """ def __init__(self, C=10, input_range=[0, 1]): super().__init__() self.C = C self.input_range = input_range def _binning_model_logscore(self, probs, y, partition, N_prime=2): """ Compute the log score of a binning model Each binning model :math:`M` is scored according to :math:`Score(M) = P(M) \\cdot P(D | M),` where a uniform prior :math:`P(M)` is assumed and the marginal likelihood :math:`P(D | M)` has a closed form solution under the assumption of a binomial class distribution in each bin with beta priors. Parameters ---------- probs : array-like, shape (n_samples, ) Predicted posterior probabilities. y : array-like, shape (n_samples, ) Target classes. partition : array-like, shape (n_bins + 1, ) Interval partition defining a binning. N_prime : int, default=2 Equivalent sample size expressing the strength of the belief in the prior distribution. Returns ------- log_score : float Log of Bayesian score for a given binning model """ # Setup B = len(partition) - 1 p = (partition[1:] - partition[:-1]) / 2 + partition[:-1] # Compute positive and negative samples in given bins N = np.histogram(probs, bins=partition)[0] digitized = np.digitize(probs, bins=partition) digitized[digitized == len(partition)] = len(partition) - 1 # include rightmost edge in partition m = [y[digitized == i].sum() for i in range(1, len(partition))] n = N - m # Compute the parameters of the Beta priors tiny = np.finfo(np.float).tiny # Avoid scipy.special.gammaln(0), which can arise if bin has zero width alpha = N_prime / B * p alpha[alpha == 0] = tiny beta = N_prime / B * (1 - p) beta[beta == 0] = tiny # Prior for a given binning model (uniform) log_prior = - np.log(self.T) # Compute the marginal log-likelihood for the given binning model log_likelihood = np.sum( scipy.special.gammaln(N_prime / B) + scipy.special.gammaln(m + alpha) + scipy.special.gammaln(n + beta) - ( scipy.special.gammaln(N + N_prime / B) + scipy.special.gammaln(alpha) + scipy.special.gammaln( beta))) # Compute score for the given binning model log_score = log_prior + log_likelihood return log_score def fit(self, X, y, n_jobs=None): """ Fit the calibration method based on the given uncalibrated class probabilities X and ground truth labels y. Parameters ---------- X : array-like, shape (n_samples, n_classes) Training data, i.e. predicted probabilities of the base classifier on the calibration set. y : array-like, shape (n_samples,) Target classes. n_jobs : int or None, optional (default=None) The number of jobs to use for the computation. ``None`` means 1 unless in a :obj:`joblib.parallel_backend` context. ``-1`` means using all processors. See :term:`Glossary <n_jobs>` for more details. Returns ------- self : object Returns an instance of self. """ if X.ndim == 1: raise ValueError("Calibration training data must have shape (n_samples, n_classes).") elif np.shape(X)[1] == 2: self.binnings = [] self.log_scores = [] self.prob_class_1 = [] self.T = 0 return self._fit_binary(X, y) elif np.shape(X)[1] > 2: self.onevsrest_calibrator_ = OneVsRestCalibrator(calibrator=clone(self), n_jobs=n_jobs) self.onevsrest_calibrator_.fit(X, y) return self def _fit_binary(self, X, y): # Determine number of bins N = len(y) min_bins = int(max(1, np.floor(N ** (1 / 3) / self.C))) max_bins = int(min(np.ceil(N / 5), np.ceil(self.C * N ** (1 / 3)))) self.T = max_bins - min_bins + 1 # Define (equal frequency) binning models and compute scores self.binnings = [] self.log_scores = [] self.prob_class_1 = [] for i, n_bins in enumerate(range(min_bins, max_bins + 1)): # Compute binning from data and set outer edges to range binning_tmp = np.quantile(X[:, 1], q=np.linspace(self.input_range[0], self.input_range[1], n_bins + 1)) binning_tmp[0] = self.input_range[0] binning_tmp[-1] = self.input_range[1] # Enforce monotonicity of binning (np.quantile does not guarantee monotonicity) self.binnings.append(np.maximum.accumulate(binning_tmp)) # Compute score self.log_scores.append(self._binning_model_logscore(probs=X[:, 1], y=y, partition=self.binnings[i])) # Compute empirical accuracy for all bins digitized = np.digitize(X[:, 1], bins=self.binnings[i]) # include rightmost edge in partition digitized[digitized == len(self.binnings[i])] = len(self.binnings[i]) - 1 def empty_safe_bin_mean(a, empty_value): """ Assign the bin mean to an empty bin. Corresponds to prior assumption of the underlying classifier being calibrated. """ if a.size == 0: return empty_value else: return a.mean() self.prob_class_1.append( [empty_safe_bin_mean(y[digitized == k], empty_value=(self.binnings[i][k] + self.binnings[i][k - 1]) / 2) for k in range(1, len(self.binnings[i]))]) return self def predict_proba(self, X): """ Compute calibrated posterior probabilities for a given array of posterior probabilities from an arbitrary classifier. Parameters ---------- X : array-like, shape (n_samples, n_classes) The uncalibrated posterior probabilities. Returns ------- P : array, shape (n_samples, n_classes) The predicted probabilities. """ if X.ndim == 1: raise ValueError("Calibration data must have shape (n_samples, n_classes).") elif np.shape(X)[1] == 2: check_is_fitted(self, ["binnings", "log_scores", "prob_class_1", "T"]) # Find bin for all binnings and the associated empirical accuracy posterior_prob_binnings = np.zeros(shape=[np.shape(X)[0], len(self.binnings)]) for i, binning in enumerate(self.binnings): bin_ids = np.searchsorted(binning, X[:, 1]) bin_ids = np.clip(bin_ids, a_min=0, a_max=len(binning) - 1) # necessary if X is out of range posterior_prob_binnings[:, i] = [self.prob_class_1[i][j] for j in (bin_ids - 1)] # Computed score-weighted average norm_weights = np.exp(np.array(self.log_scores) - scipy.special.logsumexp(self.log_scores)) posterior_prob = np.sum(posterior_prob_binnings * norm_weights, axis=1) # Compute probability for other class return np.column_stack([1 - posterior_prob, posterior_prob]) elif
np.shape(X)
numpy.shape
import argparse import os import ruamel.yaml as yaml import numpy as np import random import time import datetime import json from pathlib import Path import torch import torch.nn as nn import torch.nn.functional as F import torch.backends.cudnn as cudnn import torch.distributed as dist from torch.utils.data import DataLoader from tqdm import tqdm from models.singlestream_v2.baseline_retrieval import ALBEF from models.vit import interpolate_pos_embed from models.tokenization_bert import BertTokenizer import utils from dataset import create_dataset, create_sampler, create_loader from scheduler import create_scheduler from optim import create_optimizer @torch.no_grad() def evaluation(model, data_loader, tokenizer, device, config): # test model.eval() metric_logger = utils.MetricLogger(delimiter=" ") header = 'Evaluation:' print('Computing features for evaluation...') start_time = time.time() texts = data_loader.dataset.text num_text = len(texts) text_bs = 256 text_feats = [] text_embeds = [] text_atts = [] text_inputs = [] for i in tqdm(range(0, num_text, text_bs)): text = texts[i: min(num_text, i+text_bs)] text_input = tokenizer(text, padding='max_length', truncation=True, max_length=30, return_tensors="pt").to(device) text_inputs.append(text_input) text_output = model.text_encoder(text_input.input_ids, attention_mask = text_input.attention_mask, mode='text') text_feat = text_output.last_hidden_state text_embed = F.normalize(model.text_proj(text_feat[:,0,:])) text_embeds.append(text_embed) text_feats.append(text_feat) text_atts.append(text_input.attention_mask) text_embeds = torch.cat(text_embeds,dim=0) text_feats = torch.cat(text_feats,dim=0) text_atts = torch.cat(text_atts,dim=0) text_tokens = torch.cat([_.input_ids for _ in text_inputs], dim=0) image_feats = [] image_embeds = [] for image, img_id in tqdm(data_loader): image = image.to(device) image_feat = model.visual_encoder(image) image_embed = model.vision_proj(image_feat[:,0,:]) image_embed = F.normalize(image_embed,dim=-1) image_feats.append(image_feat) image_embeds.append(image_embed) image_feats = torch.cat(image_feats,dim=0) image_embeds = torch.cat(image_embeds,dim=0) sims_matrix = image_embeds @ text_embeds.t() # sims_matrix = torch.Tensor(np.load('/net/acadia10a/data/zkhan/albef-sims/albef-epoch30-sims.npy')).to(device) score_matrix_i2t = torch.full((len(data_loader.dataset.image),len(texts)),-100.0).to(device) num_tasks = utils.get_world_size() rank = utils.get_rank() step = sims_matrix.size(0)//num_tasks + 1 start = rank*step end = min(sims_matrix.size(0),start+step) for i,sims in enumerate(metric_logger.log_every(sims_matrix[start:end], 50, header)): topk_sim, topk_idx = sims.topk(k=config['k_test'], dim=0) encoder_output = image_feats[start+i].repeat(config['k_test'],1,1) encoder_att = torch.ones(encoder_output.size()[:-1],dtype=torch.long).to(device) output = model.text_encoder(text_tokens[topk_idx], attention_mask = text_atts[topk_idx], encoder_hidden_states = encoder_output, encoder_attention_mask = encoder_att, return_dict = True, mode = 'multimodal' ) score = model.itm_head(output.last_hidden_state[:,0,:])[:,1] score_matrix_i2t[start+i,topk_idx] = score sims_matrix = sims_matrix.t() score_matrix_t2i = torch.full((len(texts),len(data_loader.dataset.image)),-100.0).to(device) step = sims_matrix.size(0)//num_tasks + 1 start = rank*step end = min(sims_matrix.size(0),start+step) for i,sims in enumerate(metric_logger.log_every(sims_matrix[start:end], 50, header)): topk_sim, topk_idx = sims.topk(k=config['k_test'], dim=0) encoder_output = image_feats[topk_idx] encoder_att = torch.ones(encoder_output.size()[:-1],dtype=torch.long).to(device) output = model.text_encoder(text_tokens[start+i].repeat(config['k_test'],1), attention_mask = text_atts[start+i].repeat(config['k_test'],1), encoder_hidden_states = encoder_output, encoder_attention_mask = encoder_att, return_dict = True, mode = 'multimodal' ) score = model.itm_head(output.last_hidden_state[:,0,:])[:,1] score_matrix_t2i[start+i,topk_idx] = score if args.distributed: dist.barrier() torch.distributed.all_reduce(score_matrix_i2t, op=torch.distributed.ReduceOp.SUM) torch.distributed.all_reduce(score_matrix_t2i, op=torch.distributed.ReduceOp.SUM) total_time = time.time() - start_time total_time_str = str(datetime.timedelta(seconds=int(total_time))) print('Evaluation time {}'.format(total_time_str)) return score_matrix_i2t.cpu().numpy(), score_matrix_t2i.cpu().numpy() @torch.no_grad() def itm_eval(scores_i2t, scores_t2i, txt2img, img2txt): #Images->Text ranks = np.zeros(scores_i2t.shape[0]) for index,score in enumerate(scores_i2t): inds = np.argsort(score)[::-1] # Score rank = 1e20 for i in img2txt[index]: tmp = np.where(inds == i)[0][0] if tmp < rank: rank = tmp ranks[index] = rank # Compute metrics tr1 = 100.0 * len(np.where(ranks < 1)[0]) / len(ranks) tr5 = 100.0 * len(
np.where(ranks < 5)
numpy.where
import os import json import argparse import logging from pathlib import Path import time from typing import Tuple import pandas as pd import numpy as np import tqdm from melloddy_tuner.utils import hash_reference_set from melloddy_tuner.utils.helper import ( load_config, load_key, make_dir, read_input_file, create_log_files, sanity_check_assay_sizes, sanity_check_assay_type, sanity_check_uniqueness, save_df_as_csv, ) from melloddy_tuner.utils.config import ConfigDict from multiprocessing import Pool def init_arg_parser(): """Argparser module to load commandline arguments. Returns: [Namespace]: Arguments from argparser """ parser = argparse.ArgumentParser(description="smiles standardization") parser.add_argument( "-assay", "--assay_file", type=str, help="path of the assay metadata file T0", required=True, ) parser.add_argument( "-a", "--activity_file", type=str, help="path of the activity data file T1", required=True, ) parser.add_argument( "-mt", "--mapping_table", type=str, help="path of the mapping table T5", required=True, ) parser.add_argument( "-c", "--config_file", type=str, help="path of the config file", required=True ) parser.add_argument( "-k", "--key_file", type=str, help="path of the key file", required=True ) parser.add_argument( "-o", "--output_dir", type=str, help="path to the generated output directory", required=True, ) parser.add_argument( "-r", "--run_name", type=str, help="name of your current run", required=True ) parser.add_argument( "-rh", "--ref_hash", type=str, help="path to the reference hash key file provided by the consortium. (ref_hash.json)", ) parser.add_argument( "-ni", "--non_interactive", help="Enables an non-interactive mode for cluster/server usage", action="store_true", default=False, ) parser.add_argument( "-cpu", "--number_cpu", type=int, help="number of CPUs", default=1 ) args = parser.parse_args() return args def most_common_qualifier(qualifiers: list) -> str: """Determines the most common qualifier, in case of a tie including '=' returns '=' Input: qualifiers - list of qualifiers, accepted values '<', '>' and '=' Output: str: the most common qualifier. In case of a tie prefers '='. If a tie is between '<' and '>' - returns None """ counts = [] for qual in ["<", ">", "="]: counts.append((qual, qualifiers.count(qual))) counts.sort(key=lambda tup: tup[1], reverse=True) if counts[0][1] > counts[1][1]: return counts[0][0] elif counts[0][0] == "=" or counts[1][0] == "=" or counts[2][1] == counts[0][1]: return "=" else: return None def aggr_median(values, qualifiers) -> Tuple: """Identifies median of values and the most common qualifier""" return np.median(values), most_common_qualifier(list(qualifiers)) def aggr_min(values, qualifiers) -> Tuple: """Identifies the minimum value and teh corresponding qualifier""" return values[np.argmin(values)], qualifiers[np.argmin(values)] def aggr_max(values, qualifiers) -> Tuple: """Identifies the maximum values and the corresponding qualifier If '<' qualifier is present, only those elements ae considered """ if (">" in qualifiers) or ("=" in qualifiers): mask = np.array([i for i in range(len(qualifiers)) if qualifiers[i] != "<"]) ind = mask[np.argmax(
np.array(values)
numpy.array
from math import exp import torch import torch.nn as nn import torch.nn.functional as F import torchvision.models as models # from kornia.color import rgb_to_yuv from torch.nn.modules.loss import _Loss import numpy as np def gaussian(window_size, sigma): gauss = torch.Tensor([exp(-(x - window_size//2)**2/float(2*sigma**2)) for x in range(window_size)]) return gauss/gauss.sum() def create_window(window_size, channel=1): _1D_window = gaussian(window_size, 1.5).unsqueeze(1) _2D_window = _1D_window.mm(_1D_window.t()).float().unsqueeze(0).unsqueeze(0) window = _2D_window.expand(channel, 1, window_size, window_size).contiguous() return window def ssim(img1, img2, window_size=11, window=None, size_average=True, full=False, val_range=None): # Value range can be different from 255. Other common ranges are 1 (sigmoid) and 2 (tanh). if val_range is None: if torch.max(img1) > 128: max_val = 255 else: max_val = 1 if torch.min(img1) < -0.5: min_val = -1 else: min_val = 0 L = max_val - min_val else: L = val_range padd = 0 (_, channel, height, width) = img1.size() if window is None: real_size = min(window_size, height, width) window = create_window(real_size, channel=channel).to(img1.device) mu1 = F.conv2d(img1, window, padding=padd, groups=channel) mu2 = F.conv2d(img2, window, padding=padd, groups=channel) mu1_sq = mu1.pow(2) mu2_sq = mu2.pow(2) mu1_mu2 = mu1 * mu2 sigma1_sq = F.conv2d(img1 * img1, window, padding=padd, groups=channel) - mu1_sq sigma2_sq = F.conv2d(img2 * img2, window, padding=padd, groups=channel) - mu2_sq sigma12 = F.conv2d(img1 * img2, window, padding=padd, groups=channel) - mu1_mu2 C1 = (0.01 * L) ** 2 C2 = (0.03 * L) ** 2 v1 = 2.0 * sigma12 + C2 v2 = sigma1_sq + sigma2_sq + C2 cs = torch.mean(v1 / v2) # contrast sensitivity ssim_map = ((2 * mu1_mu2 + C1) * v1) / ((mu1_sq + mu2_sq + C1) * v2) if size_average: ret = ssim_map.mean() else: ret = ssim_map.mean(1).mean(1).mean(1) if full: return ret, cs return ret def msssim(img1, img2, window_size=11, size_average=True, val_range=None, normalize=False): device = img1.device weights = torch.FloatTensor([0.0448, 0.2856, 0.3001, 0.2363, 0.1333]).to(device) levels = weights.size()[0] mssim = [] mcs = [] for _ in range(levels): sim, cs = ssim(img1, img2, window_size=window_size, size_average=size_average, full=True, val_range=val_range) mssim.append(sim) mcs.append(cs) img1 = F.avg_pool2d(img1, (2, 2)) img2 = F.avg_pool2d(img2, (2, 2)) mssim = torch.stack(mssim) mcs = torch.stack(mcs) # Normalize (to avoid NaNs during training unstable models, not compliant with original definition) if normalize: mssim = (mssim + 1) / 2 mcs = (mcs + 1) / 2 pow1 = mcs ** weights pow2 = mssim ** weights # From Matlab implementation https://ece.uwaterloo.ca/~z70wang/research/iwssim/ output = torch.prod(pow1[:-1] * pow2[-1]) return output # Classes to re-use window class SSIM(torch.nn.Module): def __init__(self, window_size=11, size_average=True, val_range=None): super(SSIM, self).__init__() self.window_size = window_size self.size_average = size_average self.val_range = val_range # Assume 1 channel for SSIM self.channel = 1 self.window = create_window(window_size) def forward(self, img1, img2): (_, channel, _, _) = img1.size() if channel == self.channel and self.window.dtype == img1.dtype: window = self.window else: window = create_window(self.window_size, channel).to(img1.device).type(img1.dtype) self.window = window self.channel = channel return ssim(img1, img2, window=window, window_size=self.window_size, size_average=self.size_average) class MSSSIM(torch.nn.Module): def __init__(self, window_size=11, size_average=True, channel=3): super(MSSSIM, self).__init__() self.window_size = window_size self.size_average = size_average self.channel = channel def forward(self, img1, img2): # TODO: store window between calls if possible return msssim(img1, img2, window_size=self.window_size, size_average=self.size_average) class MeanShift(nn.Conv2d): def __init__(self, rgb_range, rgb_mean, rgb_std, sign=-1): super(MeanShift, self).__init__(3, 3, kernel_size=1) std = torch.Tensor(rgb_std) self.weight.data = torch.eye(3).view(3, 3, 1, 1) self.weight.data.div_(std.view(3, 1, 1, 1)) self.bias.data = sign * rgb_range * torch.Tensor(rgb_mean) self.bias.data.div_(std) self.requires_grad = False class VGG(torch.nn.Module): def __init__(self, conv_index, rgb_range=1): super(VGG, self).__init__() vgg_features = models.vgg19(pretrained=True).features modules = [m for m in vgg_features] if conv_index == '22': self.vgg = nn.Sequential(*modules[:8]) elif conv_index == '54': self.vgg = nn.Sequential(*modules[:35]) vgg_mean = (0.485, 0.456, 0.406) vgg_std = (0.229 * rgb_range, 0.224 * rgb_range, 0.225 * rgb_range) self.sub_mean = MeanShift(rgb_range, vgg_mean, vgg_std) self.vgg.requires_grad = False def forward(self, sr, hr): def _forward(x): x = self.sub_mean(x) x = self.vgg(x) return x vgg_sr = _forward(sr) with torch.no_grad(): vgg_hr = _forward(hr.detach()) loss = F.l1_loss(vgg_sr, vgg_hr) return loss def color_loss(out, target): out_yuv = rgb_to_yuv(out) out_u = out_yuv[:, 1, :, :] out_v = out_yuv[:, 2, :, :] target_yuv = rgb_to_yuv(target) target_u = target_yuv[:, 1, :, :] target_v = target_yuv[:, 2, :, :] return torch.div(torch.mean((out_u - target_u).pow(1)).abs() + torch.mean((out_v - target_v).pow(1)).abs(), 2) class BurstLoss(_Loss): def __init__(self, size_average=None, reduce=None, reduction='mean'): super(BurstLoss, self).__init__(size_average, reduce, reduction) self.reduction = reduction use_cuda = torch.cuda.is_available() device = torch.device("cuda:0" if use_cuda else "cpu") prewitt_filter = 1 / 6 * np.array([[1, 0, -1], [1, 0, -1], [1, 0, -1]]) self.prewitt_filter_horizontal = torch.nn.Conv2d(in_channels=1, out_channels=1, kernel_size=prewitt_filter.shape, padding=prewitt_filter.shape[0] // 2).to(device) self.prewitt_filter_horizontal.weight.data.copy_(torch.from_numpy(prewitt_filter).to(device)) self.prewitt_filter_horizontal.bias.data.copy_(torch.from_numpy(
np.array([0.0])
numpy.array
import numpy as np from os import path def calcZScore(data): # # of std deviation away from mean mn =
np.mean(data)
numpy.mean
#!/usr/bin/env python3 import rawpy import imageio import numpy as np import scipy.stats as stats from scipy.optimize import minimize_scalar from astropy.io import fits import argparse import os.path def weighted_var(values, weights): """ Return the weighted variance. values, weights -- Numpy ndarrays with the same shape. """ average = np.average(values, weights=weights) # Fast and numerically precise: variance = np.average((values - average)**2, weights=weights) return variance def optimize_dark_numerical(light, dark): # try numerical optimization fun = lambda alpha: weighted_var(np.round(np.clip((light - alpha*dark).flatten(), 0, np.inf)), dark.flatten()) r = minimize_scalar(fun, [0, 2]) if r.success: print(f"Successful optimization.") else: print("Optimization not successful.") print(r) return r.x def optimize_dark_fast(light, dark): """ Find optimal dark frame scaling by minimizing global dark current-weighted image variance. """ light, dark = light.flatten(), dark.flatten() light_avg = np.average(light, weights=dark) dark_avg =
np.average(dark, weights=dark)
numpy.average
''' Functions that help visualize results ''' import os import matplotlib.pyplot as plt from matplotlib.patches import Ellipse import numpy as np from . import config __all__ = ['plotter', 'segment_plotter', 'plot_poincare', 'plot_breathing'] def plotter(working_data, measures, show=True, figsize=None, title='Heart Rate Signal Peak Detection', moving_average=False): # pragma: no cover '''plots the analysis results. Function that uses calculated measures and data stored in the working_data{} and measures{} dict objects to visualise the fitted peak detection solution. Parameters ---------- working_data : dict dictionary object that contains all heartpy's working data (temp) objects. will be created if not passed to function measures : dict dictionary object used by heartpy to store computed measures. Will be created if not passed to function show : bool when False, function will return a plot object rather than display the results. default : True figsize: tuple Set dimensions of image in inches like in matplotlib. figsize=(x, y) default: None => (6.4, 4.8) title : string title for the plot. default : "Heart Rate Signal Peak Detection" moving_average : bool whether to display the moving average on the plot. The moving average is used for peak fitting. default: False Returns ------- out : matplotlib plot object only returned if show == False. Examples -------- First let's load and analyse some data to visualise >>> import heartpy as hp >>> data, _ = hp.load_exampledata(0) >>> wd, m = hp.process(data, 100.0) Then we can visualise >>> plot_object = plotter(wd, m, show=False, title='some awesome title') This returns a plot object which can be visualized or saved or appended. See matplotlib API for more information on how to do this. A matplotlib plotting object is returned. This can be further processed and saved to a file. ''' #get color palette colorpalette = config.get_colorpalette_plotter() # create plot x-var fs = working_data['sample_rate'] plotx = np.arange(0, len(working_data['hr'])/fs, 1/fs) #check if there's a rounding error causing differing lengths of plotx and signal diff = len(plotx) - len(working_data['hr']) if diff < 0: #add to linspace plotx = np.append(plotx, plotx[-1] + (plotx[-2] - plotx[-1])) elif diff > 0: #trim linspace plotx = plotx[0:-diff] peaklist = working_data['peaklist'] ybeat = working_data['ybeat'] rejectedpeaks = working_data['removed_beats'] rejectedpeaks_y = working_data['removed_beats_y'] fig, ax = plt.subplots(figsize=figsize) ax.set_title(title) ax.plot(plotx, working_data['hr'], color=colorpalette[0], label='heart rate signal', zorder=-10) ax.set_xlabel('Time (s)') if moving_average: ax.plot(plotx, working_data['rolling_mean'], color='gray', alpha=0.5) ax.scatter(np.asarray(peaklist)/fs, ybeat, color=colorpalette[1], label='BPM:%.2f' %(measures['bpm'])) ax.scatter(rejectedpeaks/fs, rejectedpeaks_y, color=colorpalette[2], label='rejected peaks') #check if rejected segment detection is on and has rejected segments try: if len(working_data['rejected_segments']) >= 1: for segment in working_data['rejected_segments']: ax.axvspan(segment[0], segment[1], facecolor='red', alpha=0.5) except: pass ax.legend(loc=4, framealpha=0.6) if show: fig.show() else: return fig def segment_plotter(working_data, measures, title='Heart Rate Signal Peak Detection', figsize=(6, 6), path='', start=0, end=None, step=1): # pragma: no cover '''plots analysis results Function that plots the results of segmentwise processing of heart rate signal and writes all results to separate files at the path provided. Parameters ---------- working_data : dict dictionary object that contains all heartpy's working data (temp) objects. will be created if not passed to function measures : dict dictionary object used by heartpy to store computed measures. Will be created if not passed to function title : str the title used in the plot figsize : tuple figsize tuple to be passed to matplotlib path : str the path where the files will be stored, folder must exist. start : int what segment to start plotting with default : 0 end : int last segment to plot. Must be smaller than total number of segments default : None, will plot until end step : int stepsize used when iterating over plots every step'th segment will be plotted default : 1 Returns ------- None Examples -------- This function has no examples. See documentation of heartpy for more info. ''' #sanity check assert 0 < step < len(working_data['hr']), 'step must be larger than zero and smaller than total number of segments' #set endpoint if not explicitly defined if end == None: end = len(working_data['hr']) else: #make sure it is defined within boundary conditions assert end <= len(working_data['hr']), 'defined "end" endpoint is larger than number of segments' #add trailing path slash if user omitted it if not (path.endswith('/') or path.endswith('\\')) and len(path) > 0: path += '/' #create path if it doesn't exist if not os.path.isdir(path): os.makedirs(path) #make plots filenum = 0 for i in range(start, end, step): wd_segment = {} m_segment = {} #assign values to sub-object for plotting purposes wd_segment['peaklist'] = working_data['peaklist'][i] wd_segment['ybeat'] = working_data['ybeat'][i] wd_segment['removed_beats'] = working_data['removed_beats'][i] wd_segment['removed_beats_y'] = working_data['removed_beats_y'][i] wd_segment['hr'] = working_data['hr'][i] wd_segment['rolling_mean'] = working_data['rolling_mean'][i] wd_segment['sample_rate'] = working_data['sample_rate'][i] m_segment['bpm'] = measures['bpm'][i] try: wd_segment['rejected_segments'] = working_data['rejected_segments'][i] except: pass #plot it using built-in plotter plt.figure(figsize = figsize) p = plotter(wd_segment, m_segment, show=False) p.savefig('%s%i.png' %(path, filenum)) plt.close('all') filenum += 1 def plot_poincare(working_data, measures, show = True, figsize=None, title='Poincare plot'): # pragma: no cover '''visualize poincare plot function that visualises poincare plot. Parameters ---------- working_data : dict dictionary object that contains all heartpy's working data (temp) objects. will be created if not passed to function measures : dict dictionary object used by heartpy to store computed measures. Will be created if not passed to function show : bool whether to show the plot right away, or return a matplotlib object for further manipulation figsize: tuple Set dimensions of image in inches like in matplotlib. figsize=(x, y) default: None => (6.4, 4.8) title : str the title used in the plot Returns ------- out : matplotlib plot object only returned if show == False. Examples -------- This function has no examples. See documentation of heartpy for more info. ''' #get color palette colorpalette = config.get_colorpalette_poincare() #get values from dict x_plus = working_data['poincare']['x_plus'] x_minus = working_data['poincare']['x_minus'] sd1 = measures['sd1'] sd2 = measures['sd2'] #define figure fig, ax = plt.subplots(subplot_kw={'aspect': 'equal'}, figsize=figsize) #plot scatter ax.scatter(x_plus, x_minus, color = colorpalette[0], alpha = 0.75, label = 'peak-peak intervals') #plot identity line mins = np.min([x_plus, x_minus]) maxs = np.max([x_plus, x_minus]) identity_line = np.linspace(np.min(mins), np.max(maxs)) ax.plot(identity_line, identity_line, color='black', alpha=0.5, label = 'identity line') #rotate SD1, SD2 vectors 45 degrees counterclockwise sd1_xrot, sd1_yrot = rotate_vec(0, sd1, 45) sd2_xrot, sd2_yrot = rotate_vec(0, sd2, 45) #plot rotated SD1, SD2 lines ax.plot([np.mean(x_plus), np.mean(x_plus) + sd1_xrot], [np.mean(x_minus), np.mean(x_minus) + sd1_yrot], color = colorpalette[1], label = 'SD1') ax.plot([np.mean(x_plus), np.mean(x_plus) - sd2_xrot], [np.mean(x_minus), np.mean(x_minus) + sd2_yrot], color = colorpalette[2], label = 'SD2') #plot ellipse xmn = np.mean(x_plus) ymn = np.mean(x_minus) el = Ellipse((xmn, ymn), width = sd2 * 2, height = sd1 * 2, angle = 45.0) ax.add_artist(el) el.set_edgecolor((0,0,0)) el.fill = False ax.set_xlabel(r'RRi$_n$ (ms)') ax.set_ylabel(r'RRi$_{n+1}$ (ms)') ax.legend(loc=4, framealpha=0.6) ax.set_title(title) if show: fig.show() else: return fig def rotate_vec(x, y, angle): '''rotates vector around origin point Function that takes vector and angle, and rotates around origin point with given amount of degrees. Helper function for poincare plotting Parameters ---------- x : int or float vector x coordinate y : int or float vector y coordinate angle: int or float the angle of rotation applied to the vecftor Returns ------- x_rot : float new x coordinate with rotation applied y_rot : float new x coordinate with rotation applied Examples -------- Given a vector (0,1), if we apply a rotation of 90 degrees clockwise we expect to get (1,0). Let's test >>> x_new, y_new = rotate_vec(0, 1, -90) >>> print('%.3f, %.3f' %(x_new, y_new)) 1.000, 0.000 ''' theta = np.radians(angle) cs =
np.cos(theta)
numpy.cos
import numpy as np class BinaryCriticalPoints(object): """ Class for finding critical points on for binary phase diagrams. """ def __init__(self): pass def coexistence_points(self, phase1, phase2): """ Find coexistence points. :param np.ndarray phase1: Second order polynomial for phase1 :param np.ndarray phase2: Second order polynomial for phase2 """ delta_a = phase2[2] - phase1[2] delta_b = phase2[1] - phase1[1] c1 = phase1[0] c2 = phase2[0] # Calculate points that enters in second order # equation (x - B)**2 = C B = 0.5*c2*delta_b/(c1*c2 - c2**2) C = (4*c1*delta_a + delta_b**2)/(4*c1*c2 - 4*c2**2) x2_minus = B - np.sqrt(B**2 + C) x1_minus = 0.5*(delta_b + 2*c2*x2_minus)/c1 x2_pluss = B + np.sqrt(B**2 + C) x1_pluss = 0.5*(delta_b + 2*c2*x2_pluss)/c1 if self._in_interval(x1_minus) and self._in_interval(x2_minus): x1 = x1_minus x2 = x2_minus elif self._in_interval(x1_pluss) and self._in_interval(x2_pluss): x1 = x1_pluss x2 = x2_pluss else: raise ValueError("Did not find any co-existence point!") return x1, x2 def _in_interval(self, x): return x > 0.0 and x < 1.0 def spinodal(self, phase): """ Find the spinodal line """ double_deriv = np.polyder(phase, m=2) roots = np.roots(double_deriv) return np.real(roots[~np.iscomplex(roots)]) def plot(self, x, y, polys=[]): from matplotlib import pyplot as plt fig = plt.figure() ax = fig.add_subplot(1, 1, 1) ax.plot(x, y) for p in polys: ax.plot(x, np.polyval(p, x)) ax.set_xlabel("Concentration") ax.set_ylabel("Free energy") y_range =
np.max(y)
numpy.max
import time, sys, os import dill as pickle import numpy as np import scipy.constants as constants import scipy.interpolate as interp import scipy.optimize as opti import scipy.signal as signal import numdifftools as ndt from mpl_toolkits.mplot3d import Axes3D import matplotlib.pyplot as plt import grav_util_3 as gu import bead_util as bu import configuration as config import warnings warnings.filterwarnings("ignore") theory_data_dir = '/data/grav_sim_data/2um_spacing_data/' patches_base_path = '/processed_data/comsol_data/patch_potentials/' patches_name = 'patch_pot_2um_0Vrms_bias-1Vdc' # Include some legacy grav data to compare to later data_dirs = [#'/data/20180625/bead1/grav_data/shield/X50-75um_Z15-25um_17Hz', \ #\ #'/data/20180704/bead1/grav_data/shield', \ #\ #'/data/20180808/bead4/grav_data/shield1' \ #\ '/data/20180827/bead2/500e_data/dipole_v_height_ac' \ #'/data/20180904/bead1/cant_force/ac_cant_elec_force_10s', \ #'/data/20180904/bead1/recharged_20180909/cant_force/acgrid_3freqs_10s' ] load_files = False p0_bead_dict = {'20180625': [19.0, 40.0, 20.0], \ '20180704': [18.7, 40.0, 20.0], \ '20180808': [18.0, 40.0, 20.0], \ '20180827': [35.0 ,40.0, 15.0] } p0_bead_dict = {'20180827': [0.0 ,0.0, 0.0], \ '20180904': [0.0 ,0.0, 0.0] } opt_ext = '_electrostatics' harms = [1] #harms = [1,2,3,4,5] charge = 430 * constants.elementary_charge * (-1.0) plot_field_test = False plot_cost_function = False plot_keyscale = 1.0e-13 maxfreq = 200 dim3 = False unity_errors = False init = [15.0, 0.0, 28.0, -50] init_rot = [15.0, 0.0, 28.0, -50, 0.0, 0.0, 0.0] ############################################################ ############################################################ xx = np.load(open(patches_base_path + patches_name + '.xx', 'rb')) yy = np.load(open(patches_base_path + patches_name + '.yy', 'rb')) zz = np.load(open(patches_base_path + patches_name + '.zz', 'rb')) dx = xx[1] - xx[0] dy = yy[1] - yy[0] dz = zz[1] - zz[0] field = np.load(open(patches_base_path + patches_name + '.field', 'rb')) potential = np.load(open(patches_base_path + patches_name + '.potential', 'rb')) print(field[0].shape) gradE = [] gradE_func = [] for resp in [0,1,2]: gradE.append( np.gradient(field[resp], dx, dy, dz)[resp] ) gradE_func.append( interp.RegularGridInterpolator((xx, yy, zz), gradE[resp], \ bounds_error=False, \ fill_value=None) ) pot_func = interp.RegularGridInterpolator((xx, yy, zz), potential, \ bounds_error=False, fill_value=None) field_func = [] for resp in [0,1,2]: field_func.append( interp.RegularGridInterpolator((xx, yy, zz), field[resp], \ bounds_error=False, fill_value=None) ) if plot_field_test: posvec = np.linspace(-20e-6, 20e-6, 101) posvec = np.linspace(-5e-6, 100e-6, 106) ones = np.ones_like(posvec) xval = 20.0e-6 yval = 0.0e-6 zval = 0.0e-6 eval_pts = np.stack((posvec, yval*ones, zval*ones), axis=-1) #eval_pts = np.stack((xval*ones, posvec, zval*ones), axis=-1) #eval_pts = np.stack((xval*ones, yval*ones, posvec), axis=-1) ann_str = 'Sep: %0.2f um, Height: %0.2f um' % (xval*1e6, zval*1e6) plt.figure() plt.plot(posvec*1e6, pot_func(eval_pts)) plt.figure(figsize=(7,5)) #plt.title(name) plt.plot(posvec*1e6, field_func[0](eval_pts)*charge, label='fx') plt.plot(posvec*1e6, field_func[1](eval_pts)*charge, label='fy') plt.plot(posvec*1e6, field_func[2](eval_pts)*charge, label='fz') plt.legend() plt.xlabel('Displacement Along Attractor [um]') plt.ylabel('Force on 500e$^-$ [N]') plt.annotate(ann_str, xy=(0.2, 0.9), xycoords='axes fraction') plt.tight_layout() plt.grid() plt.show() ############################################################ ############################################################ ############################################################ ############################################################ for ddir in data_dirs: paths = gu.build_paths(ddir, opt_ext=opt_ext) datafiles = bu.find_all_fnames(ddir) p0_bead = p0_bead_dict[paths['date']] if load_files: agg_dat = gu.AggregateData(datafiles, p0_bead=p0_bead, harms=harms, \ elec_drive=True, elec_ind=0, maxfreq=maxfreq, \ plot_harm_extraction=False, dim3=dim3) agg_dat.save(paths['agg_path']) else: agg_dat = gu.AggregateData([], p0_bead=p0_bead, harms=harms, dim3=dim3) agg_dat.load(paths['agg_path']) agg_dat.bin_rough_stage_positions(ax_disc=1.0, dim3=dim3) agg_dat.handle_sparse_binning(dim3=dim3, verbose=False) #print 'Testing sparse handling...', #agg_dat.handle_sparse_binning(dim3=dim3, verbose=True) #print 'Done!' #raw_input() #print agg_dat.ax0vec #print agg_dat.ax1vec #print agg_dat.ax2vec #print len(agg_dat.file_data_objs) force_plane_dict = agg_dat.get_vector_force_plane(plot_resp=(0,2), fig_ind=1, \ plot=True, show=False, \ sign=[1.0, 1.0, 1.0], dim3=dim3, \ keyscale=plot_keyscale) force_plane_dict_2 = agg_dat.get_vector_force_plane(plot_resp=(1,2), fig_ind=2, \ plot=True, show=True, \ sign=[1.0, 1.0, 1.0], dim3=dim3, \ keyscale=plot_keyscale) err_dict = {0: 'xerr', 1: 'yerr', 2: 'zerr'} dat = [[], [], []] err = [[], [], []] for resp in [0,1,2]: dat[resp] = force_plane_dict[resp] err[resp] = force_plane_dict[err_dict[resp]] dat = np.array(dat) err = np.array(err) #for i in range(10): # print force_plane_dict['drive'][i,:,:] # raw_input() volt_drive = np.mean(force_plane_dict['drive']) print('Voltage Drive: ', volt_drive) #raw_input() hist_scale_fac = np.std(dat) * 0.1 scale_fac = 1.0 dat_sc = dat * (1.0 / scale_fac) err_sc = err * (1.0 / scale_fac) if unity_errors: err_sc = err_sc - err_sc + 1.0 pos_dict = agg_dat.make_ax_arrs(dim3=dim3) seps = pos_dict['seps'] heights = pos_dict['heights'] if dim3: yposvec = pos_dict['ypos'] seps_g, ypos_g, heights_g = np.meshgrid(seps, yposvec, heights, indexing='ij') else: yposvec = np.array([0.0]) seps_g, heights_g = np.meshgrid(seps, heights, indexing='ij') rot_point = [] def F_comsol_func(sep_off, ypos, height_off, charge, eval_resp=0, \ rot_angles=[0.0, 0.0, 0.0], rot_point=[], \ radians=False, plot_rot=False, \ add_dipole=False, dipole_moment=0.0, \ dim3=False): if dim3: interp_mesh = np.array([(seps_g + sep_off) * 1.0e-6, \ (ypos_g + ypos) * 1.0e-6, \ (heights_g + height_off) * 1.0e-6]) else: interp_mesh = np.array(np.meshgrid((seps+sep_off)*1e-6, (yposvec+ypos)*1e-6, (heights+height_off)*1e-6, indexing='ij')) interp_points = np.rollaxis(interp_mesh, 0, 4) interp_points = interp_points.reshape((interp_mesh.size // 3, 3)) npts = interp_points.shape[0] rot_matrix = bu.euler_rotation_matrix(rot_angles, radians=radians) if not len(rot_point): p0 = [] for resp in [0,1,2]: p0.append( np.mean(interp_points[:,resp])) else: p0 = rot_point p0 = np.array(p0) rot_pts = [] for resp in [0,1,2]: rot_pts_vec = np.zeros(npts) for resp2 in [0,1,2]: rot_pts_vec += rot_matrix[resp,resp2] * (interp_points[:,resp2] - p0[resp2]) rot_pts.append(rot_pts_vec) rot_pts_vec += p0[resp] rot_pts = np.array(rot_pts) rot_pts = rot_pts.T if plot_rot: fig = plt.figure() ax = fig.add_subplot(111, projection='3d') ax.scatter(interp_points[:,0]*1e6, interp_points[:,1]*1e6, \ interp_points[:,2]*1e6, label='Original') ax.scatter(rot_pts[:,0]*1e6, rot_pts[:,1]*1e6, rot_pts[:,2]*1e6, \ label='Rot') ax.set_xlabel('X') ax.set_ylabel('Y') ax.set_zlabel('Z') plt.show() field_res = interp.interpn((xx, yy, zz), field[eval_resp], rot_pts, \ bounds_error=False, fill_value=None) if dim3: shaped = np.reshape(field_res, (len(seps), len(yposvec), len(heights))) else: shaped = np.reshape(field_res, (len(seps), len(heights))) out = shaped * charge * constants.elementary_charge return out #* volt_drive ''' Fcomsol = [] for resp in [0,1,2]: Fcomsol.append(F_comsol_func(15, 0, 28, -50, eval_resp=resp, \ rot_angles=[0.0, 0.0, 0.0], rot_point=[], \ radians=False, plot_rot=False, \ add_dipole=False, dipole_moment=0.0, \ dim3=False)) fig = plt.figure(7) ax = fig.add_subplot(111) qdat = ax.quiver(seps_g, heights_g, dat[0], dat[2], \ color='k', pivot='mid', label='Force', scale=plot_keyscale*4) qcom = ax.quiver(seps_g, heights_g, Fcomsol[0], Fcomsol[2], \ color='r', pivot='mid', label='Error', scale=plot_keyscale*4) ax.set_xlabel('Separation [um]') ax.set_ylabel('Height [um]') plt.show() ''' def cost_function(params, Ndof=True): delta_sep, ypos, delta_height, charge = params cost = 0.0 N = 0 for resp in [0,1,2]: func_vals = F_comsol_func(delta_sep, ypos, delta_height, charge, eval_resp=resp, \ dim3=dim3) func_vals *= (1.0 / scale_fac) diff_sq = np.abs( dat_sc[resp] - func_vals )**2 #var = (np.ones_like(func_vals))**2 var = (err_sc[resp])**2 cost += np.sum( diff_sq / var ) N += diff_sq.size if Ndof: cost *= (1.0 / float(N)) return 0.5 * cost def cost_function_rot(params, Ndof=True): delta_sep, ypos, delta_height, charge, rotx, roty, rotz = params cost = 0.0 N = 0 for resp in [0,1,2]: func_vals = F_comsol_func(delta_sep, ypos, delta_height, charge, \ rot_angles=[rotx, roty, rotz], rot_point=rot_point, \ radians=False, eval_resp=resp, \ dim3=dim3) func_vals *= (1.0 / scale_fac) diff_sq = np.abs( dat_sc[resp] - func_vals )**2 #var = (np.ones_like(func_vals))**2 var = (err_sc[resp])**2 cost += np.sum( diff_sq / var ) N += diff_sq.size if Ndof: cost *= (1.0 / float(N)) window = signal.tukey(91,0.8) angles = np.linspace(-45,45,91) penalty_box = interp.interp1d(angles, 1.0-window, bounds_error=False, fill_value=1.0) ang_penalty = 1.0e5 * ( penalty_box(rotx) + penalty_box(roty) + penalty_box(rotz)) return 0.5 * cost + ang_penalty def diff_function(params, axes=[0,1,2]): delta_sep, ypos, delta_height, charge = params diff = [] for resp in [0,1,2]: if resp not in axes: continue func_vals = F_comsol_func(delta_sep, ypos, delta_height, charge, eval_resp=resp, \ dim3=dim3) func_vals *= (1.0 / scale_fac) diff += list( ((dat_sc[resp] - func_vals) / err_sc[resp]).flatten() ) return np.array(diff) def diff_function_rot(params, axes=[0,1,2], no_penalty=False): delta_sep, ypos, delta_height, charge, rotx, roty, rotz = params #rotz = 0 diff = [] for resp in [0,1,2]: if resp not in axes: continue func_vals = F_comsol_func(delta_sep, ypos, delta_height, charge, \ rot_angles=[rotx, roty, rotz], \ rot_point=rot_point,\ radians=False, eval_resp=resp, \ dim3=dim3) func_vals *= (1.0 / scale_fac) diff += list( ((func_vals - dat_sc[resp]) / err_sc[resp]).flatten() ) window = signal.tukey(91,0.8) angles = np.linspace(-45,45,91) penalty_box = interp.interp1d(angles, 2.5*(1.0-window) + 1, bounds_error=False, fill_value=1.0) ang_penalty = ( penalty_box(rotx) + penalty_box(roty) + penalty_box(rotz)) ypenalty = 0 if no_penalty: ang_penalty = 1.0 return np.array(diff) * ang_penalty if plot_cost_function: test = [
np.linspace(5.0, 25.0, 101)
numpy.linspace
import PIL.Image as Image import array import h5py import cv2 as cv from scipy.ndimage.filters import uniform_filter import pcl import numpy as np import time import _pickle as cPickle import copy import math def hdf2affimg(filename): """ Convert hdf5 file(output of affordance map network in lua) to img # Notice according to the output of the model we need to resize """ h = h5py.File(filename,'r') res = h['results'] res = np.array(res) res = res[0,1,:,:] resresize = cv.resize(res, (512, 424), interpolation=cv.INTER_CUBIC) resresize[np.where(resresize>1)] = 0.9999 resresize[np.where(resresize<0)] = 0 return resresize def get_patch(location_2d, cur_color, cur_depth, post_afford, size=(128,128)): """ input the postprocessed affordance map return the 4*128*128 patch (cascade the depth and rgb) """ # Normalization of input cur_color = cur_color / 255. cur_depth = cur_depth / 65535. y = location_2d[0] x = location_2d[1] r = int(size[0]/2) patch_color = cur_color[y-r:y+r,x-r:x+r,:] patch_depth = cur_depth[y-r:y+r,x-r:x+r] patch_afford = post_afford[y-r:y+r,x-r:x+r] patch_rgbd = np.zeros((size[0], size[1], 4)) patch_rgbd[:,:,0:3] = patch_color patch_rgbd[:,:,3] = patch_depth # Resize the patch for a smaller action space patch_size = int(size[0]/4) patch_rgbd = cv.resize(patch_rgbd, dsize=(patch_size, patch_size), interpolation=cv.INTER_CUBIC) return np.transpose(patch_rgbd, (2,0,1)), patch_afford, location_2d def postproc_affimg(cur_color, cur_depth, cur_afford, bg_color, bg_depth, intri, border_pos): """ # postprocess the affordance map # convert from the afford_model from matlab to python """ cur_color = cur_color / 255.0 cur_depth = cur_depth / 10000 temp = (np.abs(cur_color -bg_color) < 0.3) foregroundMaskColor = np.sum(temp, axis = 2) != 3 backgroundDepth_mask = np.zeros(bg_depth.shape, dtype = bool) backgroundDepth_mask[bg_depth!=0] = True foregroundMaskDepth = backgroundDepth_mask & (np.abs(cur_depth-bg_depth) > 0.005) foregroundMask = (foregroundMaskColor | foregroundMaskDepth) x = np.linspace(0,512-1,512) y = np.linspace(0,424-1,424) pixX,pixY = np.meshgrid(x,y) camX = (pixX-intri[0,2])*cur_depth/intri[0,0] camY = (pixY-intri[1,2])*cur_depth/intri[1,1] camZ = cur_depth validDepth = foregroundMask & (camZ != 0) # only points with valid depth and within foreground mask inputPoints = [camX[validDepth],camY[validDepth],camZ[validDepth]] inputPoints = np.asarray(inputPoints,dtype=np.float32) foregroundPointcloud = pcl.PointCloud(np.transpose(inputPoints)) foregroundNormals = _surface_normals(foregroundPointcloud) tmp = np.zeros((foregroundNormals.size, 4), dtype=np.float16) for i in range(foregroundNormals.size): tmp[i] = foregroundNormals[i] foregroundNormals = np.nan_to_num(tmp[:,0:3]) pixX = np.rint(np.dot(inputPoints[0,:],intri[0,0])/inputPoints[2,:]+intri[0,2]) pixY = np.rint(np.dot(inputPoints[1,:],intri[1,1])/inputPoints[2,:]+intri[1,2]) surfaceNormalsMap = np.zeros(cur_color.shape) arraySize = surfaceNormalsMap.shape pixX = pixX.astype(np.int) pixY = pixY.astype(np.int) tmp =
np.ones(pixY.shape)
numpy.ones
import numpy as np import sys, os sys.path.append(os.pardir) from activation import * from layers import * from loss import * from collections import OrderedDict class TwoLayerNet: def __init__(self, input_size, hidden_size, output_size, batch_norm=True, weight_decay=0.0, Prelu=False): self.Prelu = Prelu self.weight_decay = weight_decay self.batch_norm = batch_norm self.params = {} self.params['W1'] = np.random.randn(input_size, hidden_size) /
np.sqrt(input_size/2.0)
numpy.sqrt
# ---------------------------------------------------------------------------- # Copyright (c) 2013--, scikit-bio development team. # # Distributed under the terms of the Modified BSD License. # # The full license is in the file COPYING.txt, distributed with this software. # ---------------------------------------------------------------------------- from unittest import TestCase, main import warnings import numpy as np from skbio import Sequence, Protein, DNA, RNA, TabularMSA from skbio.alignment import ( global_pairwise_align_protein, local_pairwise_align_protein, global_pairwise_align_nucleotide, local_pairwise_align_nucleotide, make_identity_substitution_matrix, local_pairwise_align, global_pairwise_align) from skbio.alignment._pairwise import ( _init_matrices_sw, _init_matrices_nw, _compute_score_and_traceback_matrices, _traceback, _first_largest, _compute_substitution_score) from skbio.sequence import GrammaredSequence from skbio.util import classproperty from skbio.util._decorator import overrides class CustomSequence(GrammaredSequence): @classproperty @overrides(GrammaredSequence) def gap_chars(cls): return set('^$') @classproperty @overrides(GrammaredSequence) def default_gap_char(cls): return '^' @classproperty @overrides(GrammaredSequence) def definite_chars(cls): return set('WXYZ') @classproperty @overrides(GrammaredSequence) def degenerate_map(cls): return {} class PairwiseAlignmentTests(TestCase): """ Note: In the high-level tests, the expected results were derived with assistance from the EMBOSS web server: http://www.ebi.ac.uk/Tools/psa/emboss_needle/ http://www.ebi.ac.uk/Tools/psa/emboss_water/ In some cases, placement of non-gap characters surrounded by gap characters are slighly different between scikit-bio and the EMBOSS server. These differences arise from arbitrary implementation differences, and always result in the same score (which tells us that the alignments are equivalent). In cases where the expected results included here differ from those generated by the EMBOSS server, I note the EMBOSS result as a comment below the expected value. """ def setUp(self): """Ignore warnings during tests.""" warnings.simplefilter("ignore") def tearDown(self): """Clear the list of warning filters, so that no filters are active.""" warnings.resetwarnings() def test_make_identity_substitution_matrix(self): expected = {'A': {'A': 1, 'C': -2, 'G': -2, 'T': -2, 'U': -2}, 'C': {'A': -2, 'C': 1, 'G': -2, 'T': -2, 'U': -2}, 'G': {'A': -2, 'C': -2, 'G': 1, 'T': -2, 'U': -2}, 'T': {'A': -2, 'C': -2, 'G': -2, 'T': 1, 'U': -2}, 'U': {'A': -2, 'C': -2, 'G': -2, 'T': -2, 'U': 1}} self.assertEqual(make_identity_substitution_matrix(1, -2), expected) expected = {'A': {'A': 5, 'C': -4, 'G': -4, 'T': -4, 'U': -4}, 'C': {'A': -4, 'C': 5, 'G': -4, 'T': -4, 'U': -4}, 'G': {'A': -4, 'C': -4, 'G': 5, 'T': -4, 'U': -4}, 'T': {'A': -4, 'C': -4, 'G': -4, 'T': 5, 'U': -4}, 'U': {'A': -4, 'C': -4, 'G': -4, 'T': -4, 'U': 5}} self.assertEqual(make_identity_substitution_matrix(5, -4), expected) # TODO: duplicate of test_global_pairwise_align_custom_alphabet, remove # when nondegenerate_chars is removed def test_global_pairwise_align_custom_alphabet_nondegenerate_chars(self): custom_substitution_matrix = make_identity_substitution_matrix( 1, -1, alphabet=CustomSequence.nondegenerate_chars) custom_msa, custom_score, custom_start_end = global_pairwise_align( CustomSequence("WXYZ"), CustomSequence("WXYYZZ"), 10.0, 5.0, custom_substitution_matrix) # Expected values computed by running an equivalent alignment using the # DNA alphabet with the following mapping: # # W X Y Z # | | | | # A C G T # self.assertEqual(custom_msa, TabularMSA([CustomSequence('WXYZ^^'), CustomSequence('WXYYZZ')])) self.assertEqual(custom_score, 2.0) self.assertEqual(custom_start_end, [(0, 3), (0, 5)]) def test_global_pairwise_align_custom_alphabet(self): custom_substitution_matrix = make_identity_substitution_matrix( 1, -1, alphabet=CustomSequence.definite_chars) custom_msa, custom_score, custom_start_end = global_pairwise_align( CustomSequence("WXYZ"), CustomSequence("WXYYZZ"), 10.0, 5.0, custom_substitution_matrix) # Expected values computed by running an equivalent alignment using the # DNA alphabet with the following mapping: # # W X Y Z # | | | | # A C G T # self.assertEqual(custom_msa, TabularMSA([CustomSequence('WXYZ^^'), CustomSequence('WXYYZZ')])) self.assertEqual(custom_score, 2.0) self.assertEqual(custom_start_end, [(0, 3), (0, 5)]) # TODO: duplicate of test_local_pairwise_align_custom_alphabet, remove # when nondegenerate_chars is removed. def test_local_pairwise_align_custom_alphabet_nondegenerate_chars(self): custom_substitution_matrix = make_identity_substitution_matrix( 5, -4, alphabet=CustomSequence.nondegenerate_chars) custom_msa, custom_score, custom_start_end = local_pairwise_align( CustomSequence("YWXXZZYWXXWYYZWXX"), CustomSequence("YWWXZZZYWXYZWWX"), 5.0, 0.5, custom_substitution_matrix) # Expected values computed by running an equivalent alignment using the # DNA alphabet with the following mapping: # # W X Y Z # | | | | # A C G T # self.assertEqual( custom_msa, TabularMSA([CustomSequence('WXXZZYWXXWYYZWXX'), CustomSequence('WXZZZYWX^^^YZWWX')])) self.assertEqual(custom_score, 41.0) self.assertEqual(custom_start_end, [(1, 16), (2, 14)]) def test_local_pairwise_align_custom_alphabet(self): custom_substitution_matrix = make_identity_substitution_matrix( 5, -4, alphabet=CustomSequence.definite_chars) custom_msa, custom_score, custom_start_end = local_pairwise_align( CustomSequence("YWXXZZYWXXWYYZWXX"), CustomSequence("YWWXZZZYWXYZWWX"), 5.0, 0.5, custom_substitution_matrix) # Expected values computed by running an equivalent alignment using the # DNA alphabet with the following mapping: # # W X Y Z # | | | | # A C G T # self.assertEqual( custom_msa, TabularMSA([CustomSequence('WXXZZYWXXWYYZWXX'), CustomSequence('WXZZZYWX^^^YZWWX')])) self.assertEqual(custom_score, 41.0) self.assertEqual(custom_start_end, [(1, 16), (2, 14)]) def test_global_pairwise_align_invalid_type(self): with self.assertRaisesRegex(TypeError, "GrammaredSequence.*" "TabularMSA.*'Sequence'"): global_pairwise_align(DNA('ACGT'), Sequence('ACGT'), 1.0, 1.0, {}) def test_global_pairwise_align_dtype_mismatch(self): with self.assertRaisesRegex(TypeError, "same dtype: 'DNA' != 'RNA'"): global_pairwise_align(DNA('ACGT'), TabularMSA([RNA('ACGU')]), 1.0, 1.0, {}) with self.assertRaisesRegex(TypeError, "same dtype: 'DNA' != 'RNA'"): global_pairwise_align(TabularMSA([DNA('ACGT')]), TabularMSA([RNA('ACGU')]), 1.0, 1.0, {}) def test_global_pairwise_align_protein(self): obs_msa, obs_score, obs_start_end = global_pairwise_align_protein( Protein("HEAGAWGHEE"), Protein("PAWHEAE"), gap_open_penalty=10., gap_extend_penalty=5.) self.assertEqual(obs_msa, TabularMSA([Protein("HEAGAWGHEE-"), Protein("---PAW-HEAE")])) self.assertEqual(obs_score, 23.0) self.assertEqual(obs_start_end, [(0, 9), (0, 6)]) # EMBOSS result: P---AW-HEAE obs_msa, obs_score, obs_start_end = global_pairwise_align_protein( Protein("HEAGAWGHEE"), Protein("PAWHEAE"), gap_open_penalty=5., gap_extend_penalty=0.5) self.assertEqual(obs_msa, TabularMSA([Protein("HEAGAWGHE-E"), Protein("---PAW-HEAE")])) self.assertEqual(obs_score, 30.0) self.assertEqual(obs_start_end, [(0, 9), (0, 6)]) # Protein sequences with metadata obs_msa, obs_score, obs_start_end = global_pairwise_align_protein( Protein("HEAGAWGHEE", metadata={'id': "s1"}), Protein("PAWHEAE", metadata={'id': "s2"}), gap_open_penalty=10., gap_extend_penalty=5.) self.assertEqual( obs_msa, TabularMSA([Protein("HEAGAWGHEE-", metadata={'id': "s1"}), Protein("---PAW-HEAE", metadata={'id': "s2"})])) self.assertEqual(obs_score, 23.0) self.assertEqual(obs_start_end, [(0, 9), (0, 6)]) # One TabularMSA and one Protein as input obs_msa, obs_score, obs_start_end = global_pairwise_align_protein( TabularMSA([Protein("HEAGAWGHEE", metadata={'id': "s1"})]), Protein("PAWHEAE", metadata={'id': "s2"}), gap_open_penalty=10., gap_extend_penalty=5.) self.assertEqual( obs_msa, TabularMSA([Protein("HEAGAWGHEE-", metadata={'id': "s1"}), Protein("---PAW-HEAE", metadata={'id': "s2"})])) self.assertEqual(obs_score, 23.0) self.assertEqual(obs_start_end, [(0, 9), (0, 6)]) # One single-sequence alignment as input and one double-sequence # alignment as input. Score confirmed manually. obs_msa, obs_score, obs_start_end = global_pairwise_align_protein( TabularMSA([Protein("HEAGAWGHEE", metadata={'id': "s1"}), Protein("HDAGAWGHDE", metadata={'id': "s2"})]), TabularMSA([Protein("PAWHEAE", metadata={'id': "s3"})]), gap_open_penalty=10., gap_extend_penalty=5.) self.assertEqual( obs_msa, TabularMSA([Protein("HEAGAWGHEE-", metadata={'id': "s1"}), Protein("HDAGAWGHDE-", metadata={'id': "s2"}), Protein("---PAW-HEAE", metadata={'id': "s3"})])) self.assertEqual(obs_score, 21.0) self.assertEqual(obs_start_end, [(0, 9), (0, 6)]) # TypeError on invalid input self.assertRaises(TypeError, global_pairwise_align_protein, 42, Protein("HEAGAWGHEE")) self.assertRaises(TypeError, global_pairwise_align_protein, Protein("HEAGAWGHEE"), 42) def test_global_pairwise_align_protein_invalid_dtype(self): with self.assertRaisesRegex(TypeError, "TabularMSA with Protein dtype.*dtype " "'DNA'"): global_pairwise_align_protein(TabularMSA([Protein('PAW')]), TabularMSA([DNA('ACGT')])) def test_global_pairwise_align_protein_penalize_terminal_gaps(self): obs_msa, obs_score, obs_start_end = global_pairwise_align_protein( Protein("HEAGAWGHEE"), Protein("PAWHEAE"), gap_open_penalty=10., gap_extend_penalty=5., penalize_terminal_gaps=True) self.assertEqual(obs_msa, TabularMSA([Protein("HEAGAWGHEE"), Protein("---PAWHEAE")])) self.assertEqual(obs_score, 1.0) self.assertEqual(obs_start_end, [(0, 9), (0, 6)]) def test_global_pairwise_align_nucleotide_penalize_terminal_gaps(self): # in these tests one sequence is about 3x the length of the other. # we toggle penalize_terminal_gaps to confirm that it results in # different alignments and alignment scores. seq1 = DNA("ACCGTGGACCGTTAGGATTGGACCCAAGGTTG") seq2 = DNA("T"*25 + "ACCGTGGACCGTAGGATTGGACCAAGGTTA" + "A"*25) obs_msa, obs_score, obs_start_end = global_pairwise_align_nucleotide( seq1, seq2, gap_open_penalty=5., gap_extend_penalty=0.5, match_score=5, mismatch_score=-4, penalize_terminal_gaps=False) self.assertEqual( obs_msa, TabularMSA([DNA("-------------------------ACCGTGGACCGTTAGGA" "TTGGACCCAAGGTTG-------------------------"), DNA("TTTTTTTTTTTTTTTTTTTTTTTTTACCGTGGACCGT-AGGA" "TTGGACC-AAGGTTAAAAAAAAAAAAAAAAAAAAAAAAAA")])) self.assertEqual(obs_score, 131.0) obs_msa, obs_score, obs_start_end = global_pairwise_align_nucleotide( seq1, seq2, gap_open_penalty=5., gap_extend_penalty=0.5, match_score=5, mismatch_score=-4, penalize_terminal_gaps=True) self.assertEqual( obs_msa, TabularMSA([DNA("-------------------------ACCGTGGACCGTTAGGA" "TTGGACCCAAGGTT-------------------------G"), DNA("TTTTTTTTTTTTTTTTTTTTTTTTTACCGTGGACCGT-AGGA" "TTGGACC-AAGGTTAAAAAAAAAAAAAAAAAAAAAAAAAA")])) self.assertEqual(obs_score, 97.0) def test_local_pairwise_align_protein(self): obs_msa, obs_score, obs_start_end = local_pairwise_align_protein( Protein("HEAGAWGHEE"), Protein("PAWHEAE"), gap_open_penalty=10., gap_extend_penalty=5.) self.assertEqual(obs_msa, TabularMSA([Protein("AWGHE"), Protein("AW-HE")])) self.assertEqual(obs_score, 26.0) self.assertEqual(obs_start_end, [(4, 8), (1, 4)]) obs_msa, obs_score, obs_start_end = local_pairwise_align_protein( Protein("HEAGAWGHEE"), Protein("PAWHEAE"), gap_open_penalty=5., gap_extend_penalty=0.5) self.assertEqual(obs_msa, TabularMSA([Protein("AWGHE-E"), Protein("AW-HEAE")])) self.assertEqual(obs_score, 32.0) self.assertEqual(obs_start_end, [(4, 9), (1, 6)]) # Protein sequences with metadata obs_msa, obs_score, obs_start_end = local_pairwise_align_protein( Protein("HEAGAWGHEE", metadata={'id': "s1"}), Protein("PAWHEAE", metadata={'id': "s2"}), gap_open_penalty=10., gap_extend_penalty=5.) self.assertEqual( obs_msa, TabularMSA([Protein("AWGHE", metadata={'id': "s1"}), Protein("AW-HE", metadata={'id': "s2"})])) self.assertEqual(obs_score, 26.0) self.assertEqual(obs_start_end, [(4, 8), (1, 4)]) # Fails when either input is passed as a TabularMSA self.assertRaises(TypeError, local_pairwise_align_protein, TabularMSA([Protein("HEAGAWGHEE", metadata={'id': "s1"})]), Protein("PAWHEAE", metadata={'id': "s2"}), gap_open_penalty=10., gap_extend_penalty=5.) self.assertRaises(TypeError, local_pairwise_align_protein, Protein("HEAGAWGHEE", metadata={'id': "s1"}), TabularMSA([Protein("PAWHEAE", metadata={'id': "s2"})]), gap_open_penalty=10., gap_extend_penalty=5.) # TypeError on invalid input self.assertRaises(TypeError, local_pairwise_align_protein, 42, Protein("HEAGAWGHEE")) self.assertRaises(TypeError, local_pairwise_align_protein, Protein("HEAGAWGHEE"), 42) def test_global_pairwise_align_nucleotide(self): obs_msa, obs_score, obs_start_end = global_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC"), DNA("GAACTTTGACGTAAC"), gap_open_penalty=5., gap_extend_penalty=0.5, match_score=5, mismatch_score=-4) self.assertEqual(obs_msa, TabularMSA([DNA("G-ACCTTGACCAGGTACC"), DNA("GAACTTTGAC---GTAAC")])) self.assertEqual(obs_score, 41.0) self.assertEqual(obs_start_end, [(0, 16), (0, 14)]) obs_msa, obs_score, obs_start_end = global_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC"), DNA("GAACTTTGACGTAAC"), gap_open_penalty=10., gap_extend_penalty=0.5, match_score=5, mismatch_score=-4) self.assertEqual(obs_msa, TabularMSA([DNA("-GACCTTGACCAGGTACC"), DNA("GAACTTTGAC---GTAAC")])) self.assertEqual(obs_score, 32.0) self.assertEqual(obs_start_end, [(0, 16), (0, 14)]) # DNA sequences with metadata obs_msa, obs_score, obs_start_end = global_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC", metadata={'id': "s1"}), DNA("GAACTTTGACGTAAC", metadata={'id': "s2"}), gap_open_penalty=10., gap_extend_penalty=0.5, match_score=5, mismatch_score=-4) self.assertEqual( obs_msa, TabularMSA([DNA("-GACCTTGACCAGGTACC", metadata={'id': "s1"}), DNA("GAACTTTGAC---GTAAC", metadata={'id': "s2"})])) self.assertEqual(obs_score, 32.0) self.assertEqual(obs_start_end, [(0, 16), (0, 14)]) # Align one DNA sequence and one TabularMSA, score computed manually obs_msa, obs_score, obs_start_end = global_pairwise_align_nucleotide( TabularMSA([DNA("GACCTTGACCAGGTACC", metadata={'id': "s1"}), DNA("GACCATGACCAGGTACC", metadata={'id': "s2"})]), DNA("GAACTTTGACGTAAC", metadata={'id': "s3"}), gap_open_penalty=10., gap_extend_penalty=0.5, match_score=5, mismatch_score=-4) self.assertEqual( obs_msa, TabularMSA([DNA("-GACCTTGACCAGGTACC", metadata={'id': "s1"}), DNA("-GACCATGACCAGGTACC", metadata={'id': "s2"}), DNA("GAACTTTGAC---GTAAC", metadata={'id': "s3"})])) self.assertEqual(obs_score, 27.5) self.assertEqual(obs_start_end, [(0, 16), (0, 14)]) # TypeError on invalid input self.assertRaises(TypeError, global_pairwise_align_nucleotide, 42, DNA("ACGT")) self.assertRaises(TypeError, global_pairwise_align_nucleotide, DNA("ACGT"), 42) def test_global_pairwise_align_nucleotide_invalid_dtype(self): with self.assertRaisesRegex(TypeError, "TabularMSA with DNA or RNA dtype.*dtype " "'Protein'"): global_pairwise_align_nucleotide(TabularMSA([DNA('ACGT')]), TabularMSA([Protein('PAW')])) def test_local_pairwise_align_nucleotide(self): obs_msa, obs_score, obs_start_end = local_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC"), DNA("GAACTTTGACGTAAC"), gap_open_penalty=5., gap_extend_penalty=0.5, match_score=5, mismatch_score=-4) self.assertEqual(obs_msa, TabularMSA([DNA("ACCTTGACCAGGTACC"), DNA("ACTTTGAC---GTAAC")])) self.assertEqual(obs_score, 41.0) self.assertEqual(obs_start_end, [(1, 16), (2, 14)]) obs_msa, obs_score, obs_start_end = local_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC"), DNA("GAACTTTGACGTAAC"), gap_open_penalty=10., gap_extend_penalty=5., match_score=5, mismatch_score=-4) self.assertEqual(obs_msa, TabularMSA([DNA("ACCTTGAC"), DNA("ACTTTGAC")])) self.assertEqual(obs_score, 31.0) self.assertEqual(obs_start_end, [(1, 8), (2, 9)]) # DNA sequences with metadata obs_msa, obs_score, obs_start_end = local_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC", metadata={'id': "s1"}), DNA("GAACTTTGACGTAAC", metadata={'id': "s2"}), gap_open_penalty=10., gap_extend_penalty=5., match_score=5, mismatch_score=-4) self.assertEqual( obs_msa, TabularMSA([DNA("ACCTTGAC", metadata={'id': "s1"}), DNA("ACTTTGAC", metadata={'id': "s2"})])) self.assertEqual(obs_score, 31.0) self.assertEqual(obs_start_end, [(1, 8), (2, 9)]) # Fails when either input is passed as a TabularMSA self.assertRaises(TypeError, local_pairwise_align_nucleotide, TabularMSA([DNA("GACCTTGACCAGGTACC", metadata={'id': "s1"})]), DNA("GAACTTTGACGTAAC", metadata={'id': "s2"}), gap_open_penalty=10., gap_extend_penalty=5., match_score=5, mismatch_score=-4) self.assertRaises(TypeError, local_pairwise_align_nucleotide, DNA("GACCTTGACCAGGTACC", metadata={'id': "s1"}), TabularMSA([DNA("GAACTTTGACGTAAC", metadata={'id': "s2"})]), gap_open_penalty=10., gap_extend_penalty=5., match_score=5, mismatch_score=-4) # TypeError on invalid input self.assertRaises(TypeError, local_pairwise_align_nucleotide, 42, DNA("ACGT")) self.assertRaises(TypeError, local_pairwise_align_nucleotide, DNA("ACGT"), 42) def test_nucleotide_aligners_use_substitution_matrices(self): alt_sub = make_identity_substitution_matrix(10, -10) # alternate substitution matrix yields different alignment (the # aligned sequences and the scores are different) with local alignment msa_no_sub, score_no_sub, start_end_no_sub = \ local_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC"), DNA("GAACTTTGACGTAAC"), gap_open_penalty=10., gap_extend_penalty=5., match_score=5, mismatch_score=-4) msa_alt_sub, score_alt_sub, start_end_alt_sub = \ local_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC"), DNA("GAACTTTGACGTAAC"), gap_open_penalty=10., gap_extend_penalty=5., match_score=5, mismatch_score=-4, substitution_matrix=alt_sub) self.assertNotEqual(msa_no_sub, msa_alt_sub) self.assertNotEqual(score_no_sub, score_alt_sub) self.assertNotEqual(start_end_no_sub, start_end_alt_sub) # alternate substitution matrix yields different alignment (the # aligned sequences and the scores are different) with global alignment msa_no_sub, score_no_sub, start_end_no_sub = \ global_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC"), DNA("GAACTTTGACGTAAC"), gap_open_penalty=10., gap_extend_penalty=5., match_score=5, mismatch_score=-4) msa_alt_sub, score_alt_sub, start_end_alt_sub = \ global_pairwise_align_nucleotide( DNA("GACCTTGACCAGGTACC"), DNA("GAACTTTGACGTAAC"), gap_open_penalty=10., gap_extend_penalty=5., match_score=5, mismatch_score=-4, substitution_matrix=alt_sub) self.assertNotEqual(msa_no_sub, msa_alt_sub) self.assertNotEqual(score_no_sub, score_alt_sub) self.assertEqual(start_end_no_sub, start_end_alt_sub) def test_local_pairwise_align_invalid_type(self): with self.assertRaisesRegex(TypeError, 'GrammaredSequence.*Sequence'): local_pairwise_align(DNA('ACGT'), Sequence('ACGT'), 1.0, 1.0, {}) def test_local_pairwise_align_type_mismatch(self): with self.assertRaisesRegex(TypeError, "same type: 'DNA' != 'RNA'"): local_pairwise_align(DNA('ACGT'), RNA('ACGU'), 1.0, 1.0, {}) def test_init_matrices_sw(self): expected_score_m = np.zeros((5, 4)) expected_tback_m = [[0, 0, 0, 0], [0, -1, -1, -1], [0, -1, -1, -1], [0, -1, -1, -1], [0, -1, -1, -1]] actual_score_m, actual_tback_m = _init_matrices_sw( TabularMSA([DNA('AAA', metadata={'id': 'id'})]), TabularMSA([DNA('AAAA', metadata={'id': 'id'})]), 5, 2) np.testing.assert_array_equal(actual_score_m, expected_score_m) np.testing.assert_array_equal(actual_tback_m, expected_tback_m) def test_init_matrices_nw(self): expected_score_m = [[0, -5, -7, -9], [-5, 0, 0, 0], [-7, 0, 0, 0], [-9, 0, 0, 0], [-11, 0, 0, 0]] expected_tback_m = [[0, 3, 3, 3], [2, -1, -1, -1], [2, -1, -1, -1], [2, -1, -1, -1], [2, -1, -1, -1]] actual_score_m, actual_tback_m = _init_matrices_nw( TabularMSA([DNA('AAA', metadata={'id': 'id'})]), TabularMSA([DNA('AAAA', metadata={'id': 'id'})]), 5, 2) np.testing.assert_array_equal(actual_score_m, expected_score_m) np.testing.assert_array_equal(actual_tback_m, expected_tback_m) def test_compute_substitution_score(self): # these results were computed manually subs_m = make_identity_substitution_matrix(5, -4) gap_chars = set('-.') self.assertEqual( _compute_substitution_score(['A'], ['A'], subs_m, 0, gap_chars), 5.0) self.assertEqual( _compute_substitution_score(['A', 'A'], ['A'], subs_m, 0, gap_chars), 5.0) self.assertEqual( _compute_substitution_score(['A', 'C'], ['A'], subs_m, 0, gap_chars), 0.5) self.assertEqual( _compute_substitution_score(['A', 'C'], ['A', 'C'], subs_m, 0, gap_chars), 0.5) self.assertEqual( _compute_substitution_score(['A', 'A'], ['A', '-'], subs_m, 0, gap_chars), 2.5) self.assertEqual( _compute_substitution_score(['A', 'A'], ['A', '-'], subs_m, 1, gap_chars), 3) # alt subs_m subs_m = make_identity_substitution_matrix(1, -2) self.assertEqual( _compute_substitution_score(['A', 'A'], ['A', '-'], subs_m, 0, gap_chars), 0.5) def test_compute_score_and_traceback_matrices(self): # these results were computed manually expected_score_m = [[0, -5, -7, -9], [-5, 2, -3, -5], [-7, -3, 4, -1], [-9, -5, -1, 6], [-11, -7, -3, 1]] expected_tback_m = [[0, 3, 3, 3], [2, 1, 3, 3], [2, 2, 1, 3], [2, 2, 2, 1], [2, 2, 2, 2]] m = make_identity_substitution_matrix(2, -1) actual_score_m, actual_tback_m = _compute_score_and_traceback_matrices( TabularMSA([DNA('ACG', metadata={'id': 'id'})]), TabularMSA([DNA('ACGT', metadata={'id': 'id'})]), 5, 2, m) np.testing.assert_array_equal(actual_score_m, expected_score_m) np.testing.assert_array_equal(actual_tback_m, expected_tback_m) # different sequences # these results were computed manually expected_score_m = [[0, -5, -7, -9], [-5, 2, -3, -5], [-7, -3, 4, -1], [-9, -5, -1, 3], [-11, -7, -3, -2]] expected_tback_m = [[0, 3, 3, 3], [2, 1, 3, 3], [2, 2, 1, 3], [2, 2, 2, 1], [2, 2, 2, 1]] m = make_identity_substitution_matrix(2, -1) actual_score_m, actual_tback_m = _compute_score_and_traceback_matrices( TabularMSA([DNA('ACC', metadata={'id': 'id'})]), TabularMSA([DNA('ACGT', metadata={'id': 'id'})]), 5, 2, m) np.testing.assert_array_equal(actual_score_m, expected_score_m) np.testing.assert_array_equal(actual_tback_m, expected_tback_m) # four sequences provided in two alignments # these results were computed manually expected_score_m = [[0, -5, -7, -9], [-5, 2, -3, -5], [-7, -3, 4, -1], [-9, -5, -1, 3], [-11, -7, -3, -2]] expected_tback_m = [[0, 3, 3, 3], [2, 1, 3, 3], [2, 2, 1, 3], [2, 2, 2, 1], [2, 2, 2, 1]] m = make_identity_substitution_matrix(2, -1) actual_score_m, actual_tback_m = _compute_score_and_traceback_matrices( TabularMSA([DNA('ACC', metadata={'id': 's1'}), DNA('ACC', metadata={'id': 's2'})]), TabularMSA([DNA('ACGT', metadata={'id': 's3'}), DNA('ACGT', metadata={'id': 's4'})]), 5, 2, m)
np.testing.assert_array_equal(actual_score_m, expected_score_m)
numpy.testing.assert_array_equal
import numpy as np from math import pi def make_swatches( start=0.5, rotations=0, min_sat=1.2, max_sat=1.2, min_light=0.0, max_light=1.0, gamma=1.0, numbers=256.0, reverse=False, float=False, hex=False, ) -> list: """Generates a list of RGB values with the cubehelix color scheme. Cubehelix is intended to create color schemes spanning from black to white, traversing through red, green, and blue using a tapered helix in the colour cube with increasing perceived intensity. See http://www.mrao.cam.ac.uk/~dag/CUBEHELIX/ Args: start: The central hue at the middle of the scheme, ranging from 0.0 to 3.0. rotations: Deviation from the central hue with rotations of the helix. Defaults to 0 being monochrome. Can be negative. min_sat: The saturation at the start of the scheme. max_sat: The saturation at the end of the scheme. min_light: The lightness at the start of the scheme. max_light: The lightness at the end of the scheme. gamma: Emphasis of low or high intensity. numbers: The number of colors within the scheme. reverse: Return color list reversed. float: Convert return values to float rather than 8-bit int. hex: Convert none-float values to #xxxxxx format. """ # Clip some of the passed values into ranges that make sense. start = np.clip(start, 0.0, 3.0) min_sat = np.clip(min_sat, 0, 2) max_sat = np.clip(max_sat, 0, 2) min_light = np.clip(min_light, 0, 2) max_light = np.clip(max_light, 0, 2) numbers = np.clip(numbers, 1, 1024) # Define transform scalars fract = np.linspace(min_light, max_light, numbers) phi = 2.0 * pi * ((start + 1) / 3.0 + rotations * fract) fract **= gamma satar = np.linspace(min_sat, max_sat, numbers) amp = satar * fract * (1.0 - fract) / 2.0 # Define transform vectors/matrices transform_matrix = np.array( [[-0.14861, +1.78277], [-0.29227, -0.90649], [+1.97249, +0.00000]] ) rotation_vector = np.array([
np.cos(phi)
numpy.cos
''' Created on Dec 31, 2013 @author: <NAME> (<EMAIL>) @copyright: (c) 2013 <NAME> @license: MIT ''' # standard library from __future__ import division, print_function import logging import os import types # external libraries import numpy as np import scipy.signal import scipy.io.wavfile import matplotlib.pyplot as plt #=================================================================================================== # Classes #=================================================================================================== class Audio(object): def __init__(self, channels=0, fs=96000, nofsamples=0, duration=None, initialdata=None, dtype=np.float64): """Base class for audio processing. Samples are stored as a numpy array. We can create an instance by specifying a channel count and one of either a duration or a sample count parameter. The other way of creating an instance is by providing an already existing numpy array containing the audio samples. The shape of the audio samples are always (Nsamples_per_channel, Nchannels). """ self._logger = logging.getLogger(__name__) # We sometimes divide by the sample rate to get time values assert fs > 0, "sample rate cannot be zero or negative" self.fs = fs # sample rate should always be specified in the constructor self.nofsamples = None # number of samples per channel self.duration = None # duration (length) in seconds self.ch = None # number of channels self._comment = '' if initialdata is None: # if we are not given any initial samples we create an empty array of # zeros for the audio samples. assert isinstance(channels, int) assert not(nofsamples!=0 and duration is not None), "choose either samples or duration" self.ch = channels if duration is not None: self.nofsamples = int(duration*self.fs) self.duration = duration else: self.nofsamples = nofsamples self._set_duration() # create space for the samples self.samples = np.zeros((self.nofsamples, self.ch), dtype=dtype) else: # An array of initial samples are given, use this to extract # channel count and durations. assert isinstance(initialdata, np.ndarray), \ 'Only numpy arrays are allowed as initial data' assert channels == 0, "parameter 'channels' is redundant if initial data is specified" assert nofsamples == 0, "parameter 'nofsamples' is redundant if initial data is specified" assert duration is None, "parameter 'duration' is redundant if initial data is specified" # copy the data to avoid unexpected data corruption self.samples = initialdata.copy() if self.samples.ndim == 1: # if the array is # array([ 1., 1., 1.]) # we expand it to # array([[ 1.], # [ 1.], # [ 1.]]) # self.samples = np.expand_dims(self.samples, axis=1) assert self.samples.ndim == 2, 'shape must be (Nsamples, Nchannels)' self.nofsamples, self.ch = self.samples.shape # initial data is assumed to have more samples than channels assert self.nofsamples > self.ch, 'shape must be (Nsamples, Nchannels)' self._set_duration() assert self.nofsamples is not None assert self.duration is not None assert self.ch is not None def __str__(self): s = '=======================================\n' s += 'classname : %s\n' %self.__class__.__name__ s += 'sample rate : %.1f [Hz]\n' %self.fs s += 'channels : %i\n' %self.ch s += 'duration : %.3f [s]\n' %self.duration s += 'datatype : %s\n' %self.samples.dtype s += 'samples per ch : %i\n' %self.nofsamples s += 'data size : %.3f [Mb]\n' %(self.samples.nbytes/(1024*1024)) s += 'has comment : %s\n' %('yes' if len(self._comment)!=0 else 'no') if self.ch != 0: # += '-----------------:---------------------\n' s += 'peak : %s\n' %np.array_str(self.peak()[0], precision=4, suppress_small=True) s += 'RMS : %s\n' %np.array_str(self.rms(), precision=4, suppress_small=True) s += 'crestfactor : %s\n' %np.array_str(self.crest_factor(), precision=4, suppress_small=True) s += '-----------------:---------------------\n' return s def __len__(self): return self.nofsamples def _set_duration(self): """internal method If we have modified the samples variable (by padding with zeros for example) we need to re-calculate the duration """ self.duration = self.nofsamples/self.fs def _set_samples(self, idx=0, samples=None): """internal method NOTE: idx != channel idx is always zero indexed since it refers to the numpy array. Channels are always indexed from one since this is the natural way of identifying channel numbers. """ assert isinstance(samples, np.ndarray) assert len(samples) == self.nofsamples self.samples[:,idx] = samples def pretty_string_samples(self, idx_start=0, idx_end=20, precision=4, header=False): s = '' if header: t = ' ' u = 'ch' for i in range(self.ch): t += '-------:' u += ' %2i :' %(i+1) t += '\n' u += '\n' s += t # -------:-------:-------: s += u # ch 1 : 2 : 3 : s += t # -------:-------:-------: s += np.array_str(self.samples[idx_start:idx_end,:], max_line_width=260, # we can print 32 channels before linewrap precision=precision, suppress_small=True) if (idx_end-idx_start) < self.nofsamples: s = s[:-1] # strip the right ']' character s += '\n ...,\n' lastlines = np.array_str(self.samples[-3:,:], max_line_width=260, precision=precision, suppress_small=True) s += ' %s\n' %lastlines[1:] # strip first '[' return s def pad(self, nofsamples=0): """Zero pad *at the end* of the current audio data. increases duration by samples/fs """ assert nofsamples >= 0, "Can't append negative number of samples" zeros =
np.zeros((nofsamples, self.ch), dtype=self.samples.dtype)
numpy.zeros
from __future__ import print_function, division import os import numpy as np from ..discretization import StructuredGrid from ..datbase import DataType, DataInterface import flopy.utils.binaryfile as bf from flopy.utils import HeadFile import numpy.ma as ma import struct import sys # Module for exporting vtk from flopy np_to_vtk_type = {'int8': 'Int8', 'uint8': 'UInt8', 'int16': 'Int16', 'uint16': 'UInt16', 'int32': 'Int32', 'uint32': 'UInt32', 'int64': 'Int64', 'uint64': 'UInt64', 'float32': 'Float32', 'float64': 'Float64'} np_to_struct = {'int8': 'b', 'uint8': 'B', 'int16': 'h', 'uint16': 'H', 'int32': 'i', 'uint32': 'I', 'int64': 'q', 'uint64': 'Q', 'float32': 'f', 'float64': 'd'} class XmlWriterInterface: """ Helps writing vtk files. Parameters ---------- file_path : str output file path """ def __init__(self, file_path): # class attributes self.open_tag = False self.current = [] self.indent_level = 0 self.indent_char = ' ' # open file and initialize self.f = self._open_file(file_path) self.write_string('<?xml version="1.0"?>') # open VTKFile element self.open_element('VTKFile').add_attributes(version='0.1') def _open_file(self, file_path): """ Open the file for writing. Return ------ File object. """ raise NotImplementedError('must define _open_file in child class') def write_string(self, string): """ Write a string to the file. """ raise NotImplementedError('must define write_string in child class') def open_element(self, tag): if self.open_tag: self.write_string(">") indent = self.indent_level * self.indent_char self.indent_level += 1 tag_string = "\n" + indent + "<%s" % tag self.write_string(tag_string) self.open_tag = True self.current.append(tag) return self def close_element(self, tag=None): self.indent_level -= 1 if tag: assert (self.current.pop() == tag) if self.open_tag: self.write_string(">") self.open_tag = False indent = self.indent_level * self.indent_char tag_string = "\n" + indent + "</%s>" % tag self.write_string(tag_string) else: self.write_string("/>") self.open_tag = False self.current.pop() return self def add_attributes(self, **kwargs): assert self.open_tag for key in kwargs: st = ' %s="%s"' % (key, kwargs[key]) self.write_string(st) return self def write_line(self, text): if self.open_tag: self.write_string('>') self.open_tag = False self.write_string('\n') indent = self.indent_level * self.indent_char self.write_string(indent) self.write_string(text) return self def write_array(self, array, actwcells=None, **kwargs): """ Write an array to the file. Parameters ---------- array : ndarray the data array being output actwcells : array array of the active cells kwargs : dictionary Attributes to be added to the DataArray element """ raise NotImplementedError('must define write_array in child class') def final(self): """ Finalize the file. Must be called. """ self.close_element('VTKFile') assert (not self.open_tag) self.f.close() class XmlWriterAscii(XmlWriterInterface): """ Helps writing ascii vtk files. Parameters ---------- file_path : str output file path """ def __init__(self, file_path): super(XmlWriterAscii, self).__init__(file_path) def _open_file(self, file_path): """ Open the file for writing. Return ------ File object. """ return open(file_path, "w") def write_string(self, string): """ Write a string to the file. """ self.f.write(string) def write_array(self, array, actwcells=None, **kwargs): """ Write an array to the file. Parameters ---------- array : ndarray the data array being output actwcells : array array of the active cells kwargs : dictionary Attributes to be added to the DataArray element """ # open DataArray element with relevant attributes self.open_element('DataArray') vtk_type = np_to_vtk_type[array.dtype.name] self.add_attributes(type=vtk_type) self.add_attributes(**kwargs) self.add_attributes(format='ascii') # write the data nlay = array.shape[0] for lay in range(nlay): if actwcells is not None: idx = (actwcells[lay] != 0) array_lay_flat = array[lay][idx].flatten() else: array_lay_flat = array[lay].flatten() # replace NaN values by -1e9 as there is a bug is Paraview when # reading NaN in ASCII mode # https://gitlab.kitware.com/paraview/paraview/issues/19042 # this may be removed in the future if they fix the bug array_lay_flat[np.isnan(array_lay_flat)] = -1e9 s = ' '.join(['{}'.format(val) for val in array_lay_flat]) self.write_line(s) # close DataArray element self.close_element('DataArray') return class XmlWriterBinary(XmlWriterInterface): """ Helps writing binary vtk files. Parameters ---------- file_path : str output file path """ def __init__(self, file_path): super(XmlWriterBinary, self).__init__(file_path) if sys.byteorder == "little": self.byte_order = '<' self.add_attributes(byte_order='LittleEndian') else: self.byte_order = '>' self.add_attributes(byte_order='BigEndian') self.add_attributes(header_type="UInt64") # class attributes self.offset = 0 self.byte_count_size = 8 self.processed_arrays = [] def _open_file(self, file_path): """ Open the file for writing. Return ------ File object. """ return open(file_path, "wb") def write_string(self, string): """ Write a string to the file. """ self.f.write(str.encode(string)) def write_array(self, array, actwcells=None, **kwargs): """ Write an array to file. Parameters ---------- array : ndarray the data array being output actwcells : array array of the active cells kwargs : dictionary Attributes to be added to the DataArray element """ # open DataArray element with relevant attributes self.open_element('DataArray') vtk_type = np_to_vtk_type[array.dtype.name] self.add_attributes(type=vtk_type) self.add_attributes(**kwargs) self.add_attributes(format='appended', offset=self.offset) # store array for later writing (appended data section) if actwcells is not None: array = array[actwcells != 0] a = np.ascontiguousarray(array.ravel()) array_size = array.size * array[0].dtype.itemsize self.processed_arrays.append([a, array_size]) # calculate the offset of the start of the next piece of data # offset is calculated from beginning of data section self.offset += array_size + self.byte_count_size # close DataArray element self.close_element('DataArray') return def _write_size(self, block_size): # size is a 64 bit unsigned integer byte_order = self.byte_order + 'Q' block_size = struct.pack(byte_order, block_size) self.f.write(block_size) def _append_array_binary(self, data): # see vtk documentation and more details here: # https://vtk.org/Wiki/VTK_XML_Formats#Appended_Data_Section assert (data.flags['C_CONTIGUOUS'] or data.flags['F_CONTIGUOUS']) assert data.ndim==1 data_format = self.byte_order + str(data.size) + \ np_to_struct[data.dtype.name] binary_data = struct.pack(data_format, *data) self.f.write(binary_data) def final(self): """ Finalize the file. Must be called. """ # build data section self.open_element('AppendedData') self.add_attributes(encoding='raw') self.write_line('_') for a, block_size in self.processed_arrays: self._write_size(block_size) self._append_array_binary(a) self.close_element('AppendedData') # call super final super(XmlWriterBinary, self).final() class _Array(object): # class to store array and tell if array is 2d def __init__(self, array, array2d): self.array = array self.array2d = array2d def _get_basic_modeltime(perlen_list): modeltim = 0 totim = [] for tim in perlen_list: totim.append(modeltim) modeltim += tim return totim class Vtk(object): """ Class to build VTK object for exporting flopy vtk Parameters ---------- model : MFModel flopy model instance verbose : bool If True, stdout is verbose nanval : float no data value, default is -1e20 smooth : bool if True, will create smooth layer elevations, default is False point_scalars : bool if True, will also output array values at cell vertices, default is False; note this automatically sets smooth to True vtk_grid_type : str Specific vtk_grid_type or 'auto' (default). Possible specific values are 'ImageData', 'RectilinearGrid', and 'UnstructuredGrid'. If 'auto', the grid type is automatically determined. Namely: * A regular grid (in all three directions) will be saved as an 'ImageData'. * A rectilinear (in all three directions), non-regular grid will be saved as a 'RectilinearGrid'. * Other grids will be saved as 'UnstructuredGrid'. true2d : bool If True, the model is expected to be 2d (1 layer, 1 row or 1 column) and the data will be exported as true 2d data, default is False. binary : bool if True the output file will be binary, default is False Attributes ---------- arrays : dict Stores data arrays added to VTK object """ def __init__(self, model, verbose=None, nanval=-1e+20, smooth=False, point_scalars=False, vtk_grid_type='auto', true2d=False, binary=False): if point_scalars: smooth = True if verbose is None: verbose = model.verbose self.verbose = verbose # set up variables self.model = model self.modelgrid = model.modelgrid self.nlay = self.modelgrid.nlay if hasattr(self.model, 'dis') and hasattr(self.model.dis, 'laycbd'): self.nlay = self.nlay + np.sum(self.model.dis.laycbd.array > 0) self.nrow = self.modelgrid.nrow self.ncol = self.modelgrid.ncol self.shape = (self.nlay, self.nrow, self.ncol) self.shape2d = (self.shape[1], self.shape[2]) self.shape_verts = (self.shape[0]+1, self.shape[1]+1, self.shape[2]+1) self.shape_verts2d = (self.shape_verts[1], self.shape_verts[2]) self.nanval = nanval self.arrays = {} self.vectors = {} self.smooth = smooth self.point_scalars = point_scalars self.has_cell_data = False self.has_point_data = False # check if structured grid, vtk only supports structured grid assert (isinstance(self.modelgrid, StructuredGrid)) # cbd self.cbd_on = False # get ibound if self.modelgrid.idomain is None: # ibound = None ibound = np.ones(self.shape) else: ibound = self.modelgrid.idomain # build cbd ibound if ibound is not None and hasattr(self.model, 'dis') and \ hasattr(self.model.dis, 'laycbd'): self.cbd = np.where(self.model.dis.laycbd.array > 0) ibound = np.insert(ibound, self.cbd[0] + 1, ibound[self.cbd[ 0], :, :], axis=0) self.cbd_on = True self.ibound = ibound self.true2d = true2d self.nx = self.modelgrid.ncol self.ny = self.modelgrid.nrow self.nz = self.modelgrid.nlay if self.true2d: if self.nz == 1: self.nz = 0 elif self.ny == 1: self.ny = 0 elif self.nx == 1: self.nx = 0 else: raise ValueError('The option true2d was used but the model is ' 'not 2d.') self.cell_type = 8 else: self.cell_type = 11 self.vtk_grid_type, self.file_extension = \ self._vtk_grid_type(vtk_grid_type) self.binary = binary return def _vtk_grid_type(self, vtk_grid_type='auto'): """ Determines the vtk grid type and corresponding file extension. Parameters ---------- vtk_grid_type : str Specific vtk_grid_type or 'auto'. Possible specific values are 'ImageData', 'RectilinearGrid', and 'UnstructuredGrid'. If 'auto', the grid type is automatically determined. Namely: * A regular grid (in all three directions) will be saved as an 'ImageData'. * A rectilinear (in all three directions), non-regular grid will be saved as a 'RectilinearGrid'. * Other grids will be saved as 'UnstructuredGrid'. Returns ---------- (vtk_grid_type, file_extension) : tuple of two strings """ # if 'auto', determine the vtk grid type automatically if vtk_grid_type == 'auto': if self.modelgrid.grid_type == 'structured': if self.modelgrid.is_regular or \ (self.modelgrid.is_regular_xy and self.nz == 0) or \ (self.modelgrid.is_regular_xz and self.ny == 0) or \ (self.modelgrid.is_regular_yz and self.nx == 0): vtk_grid_type = 'ImageData' elif self.modelgrid.is_rectilinear or self.nz == 0: vtk_grid_type = 'RectilinearGrid' else: vtk_grid_type = 'UnstructuredGrid' else: vtk_grid_type = 'UnstructuredGrid' # otherwise, check the validity of the passed vtk_grid_type else: allowable_types = ['ImageData', 'RectilinearGrid', 'UnstructuredGrid'] if not any(vtk_grid_type in s for s in allowable_types): raise ValueError('"' + vtk_grid_type + '" is not a correct '\ 'vtk_grid_type.') if (vtk_grid_type == 'ImageData' or \ vtk_grid_type == 'RectilinearGrid') and \ not self.modelgrid.grid_type == 'structured': raise NotImplementedError('vtk_grid_type cannot be "' + \ vtk_grid_type + '" for a grid '\ 'that is not structured') if vtk_grid_type == 'ImageData' and \ not self.modelgrid.is_regular and \ not (self.modelgrid.is_regular_xy and self.nz == 0) and \ not (self.modelgrid.is_regular_xz and self.ny == 0) and \ not (self.modelgrid.is_regular_yz and self.nx == 0): raise ValueError('vtk_grid_type cannot be "ImageData" for a '\ 'non-regular grid spacing') if vtk_grid_type == 'RectilinearGrid' and \ not self.modelgrid.is_rectilinear and not self.nz == 0: raise ValueError('vtk_grid_type cannot be "RectilinearGrid" '\ 'for a non-rectilinear grid spacing') # determine the file extension if vtk_grid_type == 'ImageData': file_extension = '.vti' elif vtk_grid_type == 'RectilinearGrid': file_extension = '.vtr' # else vtk_grid_type == 'UnstructuredGrid' else: file_extension = '.vtu' # return vtk grid type and file extension return (vtk_grid_type, file_extension) def _format_array(self, a, array2d=False): """ Formats array for vtk output. Parameters ---------- name : str name of the array a : flopy array the array to be added to the vtk object array2d : bool True if the array is 2d Return ------ Formatted array (note a copy is made) """ # if array is 2d reformat to 3d array if array2d: if a.shape == self.shape2d: array = np.full(self.shape, self.nanval) elif a.shape == self.shape_verts2d: array = np.full(self.shape_verts, self.nanval) else: raise ValueError('Incompatible array size') array[0, :, :] = a a = array # deal with inactive cells inactive3d = self.ibound==0 if a.shape == self.shape: # set to nan where nanval or where ibound==0 where_to_nan = np.logical_or(a==self.nanval, inactive3d) self.has_cell_data = True elif a.shape == self.shape_verts: # set to nan where ibound==0 at all 8 neighbors where_to_nan = np.full(self.shape_verts, True) where_to_nan[:-1, :-1, :-1] = inactive3d where_to_nan[:-1, :-1, 1:] = np.logical_and( where_to_nan[:-1, :-1, 1:], inactive3d) where_to_nan[:-1, 1:, :-1] = np.logical_and( where_to_nan[:-1, 1:, :-1], inactive3d) where_to_nan[:-1, 1:, 1:] = np.logical_and( where_to_nan[:-1, 1:, 1:], inactive3d) where_to_nan[1:, :-1, :-1] = np.logical_and( where_to_nan[1:, :-1, :-1], inactive3d) where_to_nan[1:, :-1, 1:] = np.logical_and( where_to_nan[1:, :-1, 1:], inactive3d) where_to_nan[1:, 1:, :-1] = np.logical_and( where_to_nan[1:, 1:, :-1], inactive3d) where_to_nan[1:, 1:, 1:] = np.logical_and( where_to_nan[1:, 1:, 1:], inactive3d) self.has_point_data = True self.smooth = True else: # incompatible size, skip this array return None a = np.where(where_to_nan, np.nan, a) return a def add_array(self, name, a, array2d=False): """ Adds an array to the vtk object. Parameters ---------- name : str Name of the array. a : flopy array The array to be added to the vtk object. The shape should match either grid cells or grid vertices. array2d : bool true if the array is 2d and represents the first layer, default is False """ # format array a = self._format_array(a, array2d) # add to self.arrays if a is not None: self.arrays[name] = a return def add_vector(self, name, v, array2d=False): """ Adds a vector (i.e., a tuple of arrays) to the vtk object. Parameters ---------- name : str Name of the vector. v : tuple of arrays The vector to be added to the vtk object. The shape of each component should match either grid cells or grid vertices. array2d : bool true if the vector components are 2d arrays and represent the first layer, default is False Notes ----- If the grid is rotated, the vector will be rotated too, assuming that the first and second components are along x and y directions, respectively. """ # format each component of the vector vf = () for vcomp in v: vcomp = self._format_array(vcomp, array2d=array2d) if vcomp is None: return vf = vf + (vcomp,) # rotate the vector according to grid if self.modelgrid.angrot_radians != 0.: from ..utils import geometry vf = list(vf) vf[0], vf[1] = geometry.rotate(vf[0], vf[1], 0., 0., self.modelgrid.angrot_radians) vf = tuple(vf) # add to self.vectors self.vectors[name] = vf return def write(self, output_file, timeval=None): """ Writes the stored arrays to vtk file in XML format. Parameters ---------- output_file : str output file name without extension (extension is determined automatically) timeval : scalar model time value to be stored in the time section of the vtk file, default is None """ # output file output_file = output_file + self.file_extension if self.verbose: print('Writing vtk file: ' + output_file) # initialize xml file if self.binary: xml = XmlWriterBinary(output_file) else: xml = XmlWriterAscii(output_file) xml.add_attributes(type=self.vtk_grid_type) # grid type xml.open_element(self.vtk_grid_type) # if time value write time section if timeval: xml.open_element('FieldData') xml.write_array(np.array([timeval]), Name='TimeValue', NumberOfTuples='1', RangeMin='{0}', RangeMax='{0}') xml.close_element('FieldData') if self.vtk_grid_type == 'UnstructuredGrid': # get the active data cells based on the data arrays and ibound actwcells3d = self._configure_data_arrays() # get the verts and iverts to be output verts, iverts, _ = \ self._get_3d_vertex_connectivity(actwcells=actwcells3d) # check if there is data to be written out if len(verts) == 0: # if nothing, cannot write file return # get the total number of cells and vertices ncells = len(iverts) if self.true2d: npoints = ncells * 4 else: npoints = ncells * 8 if self.verbose: print('Number of point is {}, Number of cells is {}\n'.format( npoints, ncells)) # piece xml.open_element('Piece') xml.add_attributes(NumberOfPoints=npoints, NumberOfCells=ncells) # points xml.open_element('Points') verts = np.array(list(verts.values())) verts.reshape(npoints, 3) xml.write_array(verts, Name='points', NumberOfComponents='3') xml.close_element('Points') # cells xml.open_element('Cells') # connectivity iverts = np.array(list(iverts.values())) xml.write_array(iverts, Name='connectivity', NumberOfComponents='1') # offsets offsets = np.empty((iverts.shape[0]), np.int32) icount = 0 for index, row in enumerate(iverts): icount += len(row) offsets[index] = icount xml.write_array(offsets, Name='offsets', NumberOfComponents='1') # types types = np.full((iverts.shape[0]), self.cell_type, dtype=np.uint8) xml.write_array(types, Name='types', NumberOfComponents='1') # end cells xml.close_element('Cells') elif self.vtk_grid_type == 'ImageData': # note: in vtk, "extent" actually means indices of grid lines vtk_extent_str = '0' + ' ' + str(self.nx) + ' ' + \ '0' + ' ' + str(self.ny) + ' ' + \ '0' + ' ' + str(self.nz) xml.add_attributes(WholeExtent=vtk_extent_str) grid_extent = self.modelgrid.xyzextent vtk_origin_str = str(grid_extent[0]) + ' ' + \ str(grid_extent[2]) + ' ' + \ str(grid_extent[4]) xml.add_attributes(Origin=vtk_origin_str) vtk_spacing_str = str(self.modelgrid.delr[0]) + ' ' + \ str(self.modelgrid.delc[0]) + ' ' + \ str(self.modelgrid.top[0, 0] - self.modelgrid.botm[0, 0, 0]) xml.add_attributes(Spacing=vtk_spacing_str) # piece xml.open_element('Piece').add_attributes(Extent=vtk_extent_str) elif self.vtk_grid_type == 'RectilinearGrid': # note: in vtk, "extent" actually means indices of grid lines vtk_extent_str = '0' + ' ' + str(self.nx) + ' ' + \ '0' + ' ' + str(self.ny) + ' ' + \ '0' + ' ' + str(self.nz) xml.add_attributes(WholeExtent=vtk_extent_str) # piece xml.open_element('Piece').add_attributes(Extent=vtk_extent_str) # grid coordinates xml.open_element('Coordinates') # along x xedges = self.modelgrid.xyedges[0] xml.write_array(xedges, Name='coord_x', NumberOfComponents='1') # along y yedges = np.flip(self.modelgrid.xyedges[1]) xml.write_array(yedges, Name='coord_y', NumberOfComponents='1') # along z zedges = np.flip(self.modelgrid.zedges) xml.write_array(zedges, Name='coord_z', NumberOfComponents='1') # end coordinates xml.close_element('Coordinates') if self.has_cell_data: # cell data xml.open_element('CellData') # loop through stored arrays for name, a in self.arrays.items(): if a.shape == self.shape_verts: # these are dealt with later continue if self.vtk_grid_type == 'UnstructuredGrid': xml.write_array(a, actwcells=actwcells3d, Name=name, NumberOfComponents='1') else: # flip "a" so coordinates increase along with indices as in # vtk a = np.flip(a, axis=[0, 1]) xml.write_array(a, Name=name, NumberOfComponents='1') # loop through stored vectors for name, v in self.vectors.items(): if v[0].shape == self.shape_verts: # these are dealt with later continue ncomp = len(v) v_as_array = np.moveaxis(np.array(v), 0, -1) if self.vtk_grid_type == 'UnstructuredGrid': shape4d = actwcells3d.shape + (ncomp,) actwcells4d = actwcells3d.reshape(actwcells3d.shape + (1,)) actwcells4d = np.broadcast_to(actwcells4d, shape4d) xml.write_array(v_as_array, actwcells=actwcells4d, Name=name, NumberOfComponents=ncomp) else: # flip "v" so coordinates increase along with indices as in # vtk v_as_array = np.flip(v_as_array, axis=[0, 1]) xml.write_array(v_as_array, Name=name, NumberOfComponents=ncomp) # end cell data xml.close_element('CellData') if self.point_scalars or self.has_point_data: # point data (i.e., values at vertices) xml.open_element('PointData') # loop through stored arrays for name, a in self.arrays.items(): if a.shape == self.shape: if not self.point_scalars: continue # get the array values onto vertices if self.vtk_grid_type == 'UnstructuredGrid': _, _, averts = self._get_3d_vertex_connectivity( actwcells=actwcells3d, zvalues=a) a = np.array(list(averts.values())) else: a = self.modelgrid.array_at_verts(a) a = np.flip(a, axis=[0, 1]) # deal with true2d if self.true2d: if self.nz == 0: a = a[0, :, :] elif self.ny == 0: a = a[:, 0, :] elif self.nz == 0: a = a[:, :, 0] else: if self.vtk_grid_type == 'UnstructuredGrid': # still need to do this to be consistent with # connectivity (i.e. 8 points for every cell) _, _, averts = self._get_3d_vertex_connectivity( actwcells=actwcells3d, zvalues=a) a = np.array(list(averts.values())) else: # flip "a" so coordinates increase along with indices # as in vtk a = np.flip(a, axis=[0, 1]) # deal with true2d if self.true2d: if self.nz == 0: a = a[0, :, :] elif self.ny == 0: a = a[:, 0, :] elif self.nz == 0: a = a[:, :, 0] xml.write_array(a, Name=name, NumberOfComponents='1') # loop through stored vectors for name, v in self.vectors.items(): if v[0].shape == self.shape: if not self.point_scalars: continue # get the vector values onto vertices v_verts = () for vcomp in v: if self.vtk_grid_type == 'UnstructuredGrid': _, _, averts = self._get_3d_vertex_connectivity( actwcells=actwcells3d, zvalues=vcomp) vcomp = np.array(list(averts.values())) else: vcomp = self.modelgrid.array_at_verts(vcomp) vcomp = np.flip(vcomp, axis=[0, 1]) # deal with true2d if self.true2d: if self.nz == 0: vcomp = vcomp[0, :, :] elif self.ny == 0: vcomp = vcomp[:, 0, :] elif self.nz == 0: vcomp = vcomp[:, :, 0] v_verts = v_verts + (vcomp,) v = v_verts else: v_verts = () for vcomp in v: if self.vtk_grid_type == 'UnstructuredGrid': # still need to do this to be consistent with # connectivity (i.e. 8 points for every cell) _, _, averts = self._get_3d_vertex_connectivity( actwcells=actwcells3d, zvalues=vcomp) vcomp = np.array(list(averts.values())) else: vcomp =
np.flip(vcomp, axis=[0, 1])
numpy.flip
import numpy as np import torch from darts.models.forecasting.forecasting_model import GlobalForecastingModel import os import sys def warn(*args, **kwargs): pass import warnings warnings.warn = warn module_paths = [ os.path.abspath(os.getcwd()), ] for module_path in module_paths: print(module_path) if module_path not in sys.path: sys.path.append(module_path) from models.utils import eval_all_dyn_syst, scaler, new_args_dict import pandas as pd from functools import partial print = partial(print, flush=True) from sklearn.linear_model import Ridge from typing import Union, Sequence, Optional from darts import TimeSeries class esn(GlobalForecastingModel): def delete(self): return 0 def __init__(self, iters, cell_type, reservoir_size=1000, sparsity=0.01, radius=0.6, sigma_input=1, dynamics_fit_ratio=2 / 7, regularization=0.0, scaler_tt='Standard', solver='auto', model_name='RC-CHAOS-ESN', seed=1, ensemble_base_model=False): self.model_name = model_name self.iters = iters self.reservoir_size = reservoir_size self.sparsity = sparsity self.radius = radius self.sigma_input = sigma_input self.dynamics_fit_ratio = dynamics_fit_ratio self.regularization = regularization self.solver = 'auto' self.scaler_tt = scaler_tt self.scaler = scaler(self.scaler_tt) def getWeights(self, sizex, sizey, radius, sparsity): W = np.random.random((sizex, sizey)) eigenvalues, _ = np.linalg.eig(W) eigenvalues = np.abs(eigenvalues) W = (W / np.max(eigenvalues)) * radius return W def augmentHidden(self, h): h_aug = h.copy() h_aug[::2] = pow(h_aug[::2], 2.0) return h_aug def getAugmentedStateSize(self): return self.reservoir_size def fit(self, series: Union[TimeSeries, Sequence[TimeSeries]], past_covariates: Optional[Union[TimeSeries, Sequence[TimeSeries]]] = None, future_covariates: Optional[Union[TimeSeries, Sequence[TimeSeries]]] = None ) -> None: super().fit(series) data = np.array(series.all_values()) train_input_sequence = data.squeeze(1) dynamics_length = int(len(data) * self.dynamics_fit_ratio) N, input_dim = np.shape(train_input_sequence) train_input_sequence = self.scaler.scaleData(train_input_sequence) W_h = self.getWeights(self.reservoir_size, self.reservoir_size, self.radius, self.sparsity) # Input weights W_in = np.zeros((self.reservoir_size, input_dim)) q = int(self.reservoir_size / input_dim) for i in range(0, input_dim): W_in[i * q:(i + 1) * q, i] = self.sigma_input * (-1 + 2 * np.random.rand(q)) # Training length tl = N - dynamics_length W_h = torch.tensor(W_h, requires_grad=True) W_in = torch.tensor(W_in, requires_grad=True) learning_rate = 0.01 a0 = learning_rate decay = 0.95 iterations = self.iters for iter in range(iterations): h = torch.zeros((self.reservoir_size, 1), dtype=torch.float64) # Washout phase for t in range(dynamics_length): i = np.reshape(train_input_sequence[t], (-1, 1)) i = torch.tensor(i) h = torch.tanh(W_h @ h + W_in @ i) H = [] Y = [] # Training for t in range(tl - 1): i = np.reshape(train_input_sequence[t + dynamics_length], (-1, 1)) i = torch.tensor(i, dtype=torch.float64) h = torch.tanh(W_h @ h + W_in @ i) copy = torch.clone(h) copy[1::2] = 1 h_aug = h * copy H.append(h_aug[:, 0]) target = np.reshape(train_input_sequence[t + dynamics_length + 1], (-1, 1)) Y.append(target[:, 0]) split = int(tl * 0.8) H_train = [torch.clone(x).detach().numpy() for x in H[:split]] Y_train = Y[:split] H_test = H[split:] Y_test = [torch.tensor(x) for x in Y[split:]] H = [torch.clone(x).detach().numpy() for x in H] ridge = Ridge(alpha=self.regularization, fit_intercept=False, copy_X=True, solver=self.solver) if iter == iterations - 1: ridge.fit(H, Y) W_out = torch.tensor(ridge.coef_) break else: ridge.fit(H_train, Y_train) W_out = torch.tensor(ridge.coef_) loss = torch.tensor([0], dtype=torch.float64) for sample in range(len(H_test)): loss += torch.pow(W_out @ H_test[sample] - Y_test[sample], 2) loss /= len(H_test) loss.backward() with torch.no_grad(): print('Loss: ' + str(loss * 1e9)) W_in -= learning_rate * W_in.grad W_h -= learning_rate * W_h.grad W_in.grad.zero_() W_h.grad.zero_() learning_rate = decay ** iter * a0 self.W_in = W_in.detach().numpy() self.W_h = W_h.detach().numpy() self.W_out = W_out.detach().numpy() self.n_trainable_parameters = np.size(self.W_out) self.n_model_parameters = np.size(self.W_in) +
np.size(self.W_h)
numpy.size
# coding: utf-8 # # Building your Recurrent Neural Network - Step by Step # # Welcome to Course 5's first assignment! In this assignment, you will implement your first Recurrent Neural Network in numpy. # # Recurrent Neural Networks (RNN) are very effective for Natural Language Processing and other sequence tasks because they have "memory". They can read inputs $x^{\langle t \rangle}$ (such as words) one at a time, and remember some information/context through the hidden layer activations that get passed from one time-step to the next. This allows a uni-directional RNN to take information from the past to process later inputs. A bidirection RNN can take context from both the past and the future. # # **Notation**: # - Superscript $[l]$ denotes an object associated with the $l^{th}$ layer. # - Example: $a^{[4]}$ is the $4^{th}$ layer activation. $W^{[5]}$ and $b^{[5]}$ are the $5^{th}$ layer parameters. # # - Superscript $(i)$ denotes an object associated with the $i^{th}$ example. # - Example: $x^{(i)}$ is the $i^{th}$ training example input. # # - Superscript $\langle t \rangle$ denotes an object at the $t^{th}$ time-step. # - Example: $x^{\langle t \rangle}$ is the input x at the $t^{th}$ time-step. $x^{(i)\langle t \rangle}$ is the input at the $t^{th}$ timestep of example $i$. # # - Lowerscript $i$ denotes the $i^{th}$ entry of a vector. # - Example: $a^{[l]}_i$ denotes the $i^{th}$ entry of the activations in layer $l$. # # We assume that you are already familiar with `numpy` and/or have completed the previous courses of the specialization. Let's get started! # Let's first import all the packages that you will need during this assignment. # In[3]: import numpy as np from rnn_utils import * # ## 1 - Forward propagation for the basic Recurrent Neural Network # # Later this week, you will generate music using an RNN. The basic RNN that you will implement has the structure below. In this example, $T_x = T_y$. # <img src="images/RNN.png" style="width:500;height:300px;"> # <caption><center> **Figure 1**: Basic RNN model </center></caption> # Here's how you can implement an RNN: # # **Steps**: # 1. Implement the calculations needed for one time-step of the RNN. # 2. Implement a loop over $T_x$ time-steps in order to process all the inputs, one at a time. # # Let's go! # # ## 1.1 - RNN cell # # A Recurrent neural network can be seen as the repetition of a single cell. You are first going to implement the computations for a single time-step. The following figure describes the operations for a single time-step of an RNN cell. # # <img src="images/rnn_step_forward.png" style="width:700px;height:300px;"> # <caption><center> **Figure 2**: Basic RNN cell. Takes as input $x^{\langle t \rangle}$ (current input) and $a^{\langle t - 1\rangle}$ (previous hidden state containing information from the past), and outputs $a^{\langle t \rangle}$ which is given to the next RNN cell and also used to predict $y^{\langle t \rangle}$ </center></caption> # # **Exercise**: Implement the RNN-cell described in Figure (2). # # **Instructions**: # 1. Compute the hidden state with tanh activation: $a^{\langle t \rangle} = \tanh(W_{aa} a^{\langle t-1 \rangle} + W_{ax} x^{\langle t \rangle} + b_a)$. # 2. Using your new hidden state $a^{\langle t \rangle}$, compute the prediction $\hat{y}^{\langle t \rangle} = softmax(W_{ya} a^{\langle t \rangle} + b_y)$. We provided you a function: `softmax`. # 3. Store $(a^{\langle t \rangle}, a^{\langle t-1 \rangle}, x^{\langle t \rangle}, parameters)$ in cache # 4. Return $a^{\langle t \rangle}$ , $y^{\langle t \rangle}$ and cache # # We will vectorize over $m$ examples. Thus, $x^{\langle t \rangle}$ will have dimension $(n_x,m)$, and $a^{\langle t \rangle}$ will have dimension $(n_a,m)$. # In[4]: # GRADED FUNCTION: rnn_cell_forward def rnn_cell_forward(xt, a_prev, parameters): """ Implements a single forward step of the RNN-cell as described in Figure (2) Arguments: xt -- your input data at timestep "t", numpy array of shape (n_x, m). a_prev -- Hidden state at timestep "t-1", numpy array of shape (n_a, m) parameters -- python dictionary containing: Wax -- Weight matrix multiplying the input, numpy array of shape (n_a, n_x) Waa -- Weight matrix multiplying the hidden state, numpy array of shape (n_a, n_a) Wya -- Weight matrix relating the hidden-state to the output, numpy array of shape (n_y, n_a) ba -- Bias, numpy array of shape (n_a, 1) by -- Bias relating the hidden-state to the output, numpy array of shape (n_y, 1) Returns: a_next -- next hidden state, of shape (n_a, m) yt_pred -- prediction at timestep "t", numpy array of shape (n_y, m) cache -- tuple of values needed for the backward pass, contains (a_next, a_prev, xt, parameters) """ # Retrieve parameters from "parameters" Wax = parameters["Wax"] Waa = parameters["Waa"] Wya = parameters["Wya"] ba = parameters["ba"] by = parameters["by"] ### START CODE HERE ### (≈2 lines) # compute next activation state using the formula given above a_next = np.tanh(np.dot(Wax,xt) + np.dot(Waa,a_prev) + ba) # compute output of the current cell using the formula given above yt_pred = softmax(np.dot(Wya,a_next) + by) ### END CODE HERE ### # store values you need for backward propagation in cache cache = (a_next, a_prev, xt, parameters) return a_next, yt_pred, cache # In[5]: np.random.seed(1) xt = np.random.randn(3,10) a_prev = np.random.randn(5,10) Waa = np.random.randn(5,5) Wax = np.random.randn(5,3) Wya = np.random.randn(2,5) ba = np.random.randn(5,1) by = np.random.randn(2,1) parameters = {"Waa": Waa, "Wax": Wax, "Wya": Wya, "ba": ba, "by": by} a_next, yt_pred, cache = rnn_cell_forward(xt, a_prev, parameters) print("a_next[4] = ", a_next[4]) print("a_next.shape = ", a_next.shape) print("yt_pred[1] =", yt_pred[1]) print("yt_pred.shape = ", yt_pred.shape) # **Expected Output**: # # <table> # <tr> # <td> # **a_next[4]**: # </td> # <td> # [ 0.59584544 0.18141802 0.61311866 0.99808218 0.85016201 0.99980978 # -0.18887155 0.99815551 0.6531151 0.82872037] # </td> # </tr> # <tr> # <td> # **a_next.shape**: # </td> # <td> # (5, 10) # </td> # </tr> # <tr> # <td> # **yt[1]**: # </td> # <td> # [ 0.9888161 0.01682021 0.21140899 0.36817467 0.98988387 0.88945212 # 0.36920224 0.9966312 0.9982559 0.17746526] # </td> # </tr> # <tr> # <td> # **yt.shape**: # </td> # <td> # (2, 10) # </td> # </tr> # # </table> # ## 1.2 - RNN forward pass # # You can see an RNN as the repetition of the cell you've just built. If your input sequence of data is carried over 10 time steps, then you will copy the RNN cell 10 times. Each cell takes as input the hidden state from the previous cell ($a^{\langle t-1 \rangle}$) and the current time-step's input data ($x^{\langle t \rangle}$). It outputs a hidden state ($a^{\langle t \rangle}$) and a prediction ($y^{\langle t \rangle}$) for this time-step. # # # <img src="images/rnn.png" style="width:800px;height:300px;"> # <caption><center> **Figure 3**: Basic RNN. The input sequence $x = (x^{\langle 1 \rangle}, x^{\langle 2 \rangle}, ..., x^{\langle T_x \rangle})$ is carried over $T_x$ time steps. The network outputs $y = (y^{\langle 1 \rangle}, y^{\langle 2 \rangle}, ..., y^{\langle T_x \rangle})$. </center></caption> # # # # **Exercise**: Code the forward propagation of the RNN described in Figure (3). # # **Instructions**: # 1. Create a vector of zeros ($a$) that will store all the hidden states computed by the RNN. # 2. Initialize the "next" hidden state as $a_0$ (initial hidden state). # 3. Start looping over each time step, your incremental index is $t$ : # - Update the "next" hidden state and the cache by running `rnn_cell_forward` # - Store the "next" hidden state in $a$ ($t^{th}$ position) # - Store the prediction in y # - Add the cache to the list of caches # 4. Return $a$, $y$ and caches # In[6]: # GRADED FUNCTION: rnn_forward def rnn_forward(x, a0, parameters): """ Implement the forward propagation of the recurrent neural network described in Figure (3). Arguments: x -- Input data for every time-step, of shape (n_x, m, T_x). a0 -- Initial hidden state, of shape (n_a, m) parameters -- python dictionary containing: Waa -- Weight matrix multiplying the hidden state, numpy array of shape (n_a, n_a) Wax -- Weight matrix multiplying the input, numpy array of shape (n_a, n_x) Wya -- Weight matrix relating the hidden-state to the output, numpy array of shape (n_y, n_a) ba -- Bias numpy array of shape (n_a, 1) by -- Bias relating the hidden-state to the output, numpy array of shape (n_y, 1) Returns: a -- Hidden states for every time-step, numpy array of shape (n_a, m, T_x) y_pred -- Predictions for every time-step, numpy array of shape (n_y, m, T_x) caches -- tuple of values needed for the backward pass, contains (list of caches, x) """ # Initialize "caches" which will contain the list of all caches caches = [] # Retrieve dimensions from shapes of x and parameters["Wya"] n_x, m, T_x = x.shape n_y, n_a = parameters["Wya"].shape ### START CODE HERE ### # initialize "a" and "y" with zeros (≈2 lines) a = np.zeros([n_a,m,T_x]) y_pred = np.zeros([n_y,m,T_x]) # Initialize a_next (≈1 line) a_next = a0 # loop over all time-steps for t in range(T_x): # Update next hidden state, compute the prediction, get the cache (≈1 line) a_next, yt_pred, cache = rnn_cell_forward(x[:,:,t],a_next,parameters) # Save the value of the new "next" hidden state in a (≈1 line) a[:,:,t] = a_next # Save the value of the prediction in y (≈1 line) y_pred[:,:,t] = yt_pred # Append "cache" to "caches" (≈1 line) caches.append(cache) ### END CODE HERE ### # store values needed for backward propagation in cache caches = (caches, x) return a, y_pred, caches # In[7]: np.random.seed(1) x = np.random.randn(3,10,4) a0 = np.random.randn(5,10) Waa = np.random.randn(5,5) Wax = np.random.randn(5,3) Wya = np.random.randn(2,5) ba = np.random.randn(5,1) by = np.random.randn(2,1) parameters = {"Waa": Waa, "Wax": Wax, "Wya": Wya, "ba": ba, "by": by} a, y_pred, caches = rnn_forward(x, a0, parameters) print("a[4][1] = ", a[4][1]) print("a.shape = ", a.shape) print("y_pred[1][3] =", y_pred[1][3]) print("y_pred.shape = ", y_pred.shape) print("caches[1][1][3] =", caches[1][1][3]) print("len(caches) = ", len(caches)) # **Expected Output**: # # <table> # <tr> # <td> # **a[4][1]**: # </td> # <td> # [-0.99999375 0.77911235 -0.99861469 -0.99833267] # </td> # </tr> # <tr> # <td> # **a.shape**: # </td> # <td> # (5, 10, 4) # </td> # </tr> # <tr> # <td> # **y[1][3]**: # </td> # <td> # [ 0.79560373 0.86224861 0.11118257 0.81515947] # </td> # </tr> # <tr> # <td> # **y.shape**: # </td> # <td> # (2, 10, 4) # </td> # </tr> # <tr> # <td> # **cache[1][1][3]**: # </td> # <td> # [-1.1425182 -0.34934272 -0.20889423 0.58662319] # </td> # </tr> # <tr> # <td> # **len(cache)**: # </td> # <td> # 2 # </td> # </tr> # # </table> # Congratulations! You've successfully built the forward propagation of a recurrent neural network from scratch. This will work well enough for some applications, but it suffers from vanishing gradient problems. So it works best when each output $y^{\langle t \rangle}$ can be estimated using mainly "local" context (meaning information from inputs $x^{\langle t' \rangle}$ where $t'$ is not too far from $t$). # # In the next part, you will build a more complex LSTM model, which is better at addressing vanishing gradients. The LSTM will be better able to remember a piece of information and keep it saved for many timesteps. # ## 2 - Long Short-Term Memory (LSTM) network # # This following figure shows the operations of an LSTM-cell. # # <img src="images/LSTM.png" style="width:500;height:400px;"> # <caption><center> **Figure 4**: LSTM-cell. This tracks and updates a "cell state" or memory variable $c^{\langle t \rangle}$ at every time-step, which can be different from $a^{\langle t \rangle}$. </center></caption> # # Similar to the RNN example above, you will start by implementing the LSTM cell for a single time-step. Then you can iteratively call it from inside a for-loop to have it process an input with $T_x$ time-steps. # # ### About the gates # # #### - Forget gate # # For the sake of this illustration, lets assume we are reading words in a piece of text, and want use an LSTM to keep track of grammatical structures, such as whether the subject is singular or plural. If the subject changes from a singular word to a plural word, we need to find a way to get rid of our previously stored memory value of the singular/plural state. In an LSTM, the forget gate lets us do this: # # $$\Gamma_f^{\langle t \rangle} = \sigma(W_f[a^{\langle t-1 \rangle}, x^{\langle t \rangle}] + b_f)\tag{1} $$ # # Here, $W_f$ are weights that govern the forget gate's behavior. We concatenate $[a^{\langle t-1 \rangle}, x^{\langle t \rangle}]$ and multiply by $W_f$. The equation above results in a vector $\Gamma_f^{\langle t \rangle}$ with values between 0 and 1. This forget gate vector will be multiplied element-wise by the previous cell state $c^{\langle t-1 \rangle}$. So if one of the values of $\Gamma_f^{\langle t \rangle}$ is 0 (or close to 0) then it means that the LSTM should remove that piece of information (e.g. the singular subject) in the corresponding component of $c^{\langle t-1 \rangle}$. If one of the values is 1, then it will keep the information. # # #### - Update gate # # Once we forget that the subject being discussed is singular, we need to find a way to update it to reflect that the new subject is now plural. Here is the formulat for the update gate: # # $$\Gamma_u^{\langle t \rangle} = \sigma(W_u[a^{\langle t-1 \rangle}, x^{\{t\}}] + b_u)\tag{2} $$ # # Similar to the forget gate, here $\Gamma_u^{\langle t \rangle}$ is again a vector of values between 0 and 1. This will be multiplied element-wise with $\tilde{c}^{\langle t \rangle}$, in order to compute $c^{\langle t \rangle}$. # # #### - Updating the cell # # To update the new subject we need to create a new vector of numbers that we can add to our previous cell state. The equation we use is: # # $$ \tilde{c}^{\langle t \rangle} = \tanh(W_c[a^{\langle t-1 \rangle}, x^{\langle t \rangle}] + b_c)\tag{3} $$ # # Finally, the new cell state is: # # $$ c^{\langle t \rangle} = \Gamma_f^{\langle t \rangle}* c^{\langle t-1 \rangle} + \Gamma_u^{\langle t \rangle} *\tilde{c}^{\langle t \rangle} \tag{4} $$ # # # #### - Output gate # # To decide which outputs we will use, we will use the following two formulas: # # $$ \Gamma_o^{\langle t \rangle}= \sigma(W_o[a^{\langle t-1 \rangle}, x^{\langle t \rangle}] + b_o)\tag{5}$$ # $$ a^{\langle t \rangle} = \Gamma_o^{\langle t \rangle}* \tanh(c^{\langle t \rangle})\tag{6} $$ # # Where in equation 5 you decide what to output using a sigmoid function and in equation 6 you multiply that by the $\tanh$ of the previous state. # ### 2.1 - LSTM cell # # **Exercise**: Implement the LSTM cell described in the Figure (3). # # **Instructions**: # 1. Concatenate $a^{\langle t-1 \rangle}$ and $x^{\langle t \rangle}$ in a single matrix: $concat = \begin{bmatrix} a^{\langle t-1 \rangle} \\ x^{\langle t \rangle} \end{bmatrix}$ # 2. Compute all the formulas 1-6. You can use `sigmoid()` (provided) and `np.tanh()`. # 3. Compute the prediction $y^{\langle t \rangle}$. You can use `softmax()` (provided). # In[8]: # GRADED FUNCTION: lstm_cell_forward def lstm_cell_forward(xt, a_prev, c_prev, parameters): """ Implement a single forward step of the LSTM-cell as described in Figure (4) Arguments: xt -- your input data at timestep "t", numpy array of shape (n_x, m). a_prev -- Hidden state at timestep "t-1", numpy array of shape (n_a, m) c_prev -- Memory state at timestep "t-1", numpy array of shape (n_a, m) parameters -- python dictionary containing: Wf -- Weight matrix of the forget gate, numpy array of shape (n_a, n_a + n_x) bf -- Bias of the forget gate, numpy array of shape (n_a, 1) Wi -- Weight matrix of the update gate, numpy array of shape (n_a, n_a + n_x) bi -- Bias of the update gate, numpy array of shape (n_a, 1) Wc -- Weight matrix of the first "tanh", numpy array of shape (n_a, n_a + n_x) bc -- Bias of the first "tanh", numpy array of shape (n_a, 1) Wo -- Weight matrix of the output gate, numpy array of shape (n_a, n_a + n_x) bo -- Bias of the output gate, numpy array of shape (n_a, 1) Wy -- Weight matrix relating the hidden-state to the output, numpy array of shape (n_y, n_a) by -- Bias relating the hidden-state to the output, numpy array of shape (n_y, 1) Returns: a_next -- next hidden state, of shape (n_a, m) c_next -- next memory state, of shape (n_a, m) yt_pred -- prediction at timestep "t", numpy array of shape (n_y, m) cache -- tuple of values needed for the backward pass, contains (a_next, c_next, a_prev, c_prev, xt, parameters) Note: ft/it/ot stand for the forget/update/output gates, cct stands for the candidate value (c tilde), c stands for the memory value """ # Retrieve parameters from "parameters" Wf = parameters["Wf"] bf = parameters["bf"] Wi = parameters["Wi"] bi = parameters["bi"] Wc = parameters["Wc"] bc = parameters["bc"] Wo = parameters["Wo"] bo = parameters["bo"] Wy = parameters["Wy"] by = parameters["by"] # Retrieve dimensions from shapes of xt and Wy n_x, m = xt.shape n_y, n_a = Wy.shape ### START CODE HERE ### # Concatenate a_prev and xt (≈3 lines) concat = np.zeros([n_a+n_x,m]) concat[: n_a, :] = a_prev concat[n_a :, :] = xt # Compute values for ft, it, cct, c_next, ot, a_next using the formulas given figure (4) (≈6 lines) ft = sigmoid(np.dot(Wf,concat) + bf) it = sigmoid(np.dot(Wi,concat) + bi) cct = np.tanh(np.dot(Wc,concat) + bc) c_next = ft*c_prev + it*cct ot = sigmoid(np.dot(Wo,concat) + bo) a_next = ot*np.tanh(c_next) # Compute prediction of the LSTM cell (≈1 line) yt_pred = softmax(np.dot(Wy, a_next) + by) ### END CODE HERE ### # store values needed for backward propagation in cache cache = (a_next, c_next, a_prev, c_prev, ft, it, cct, ot, xt, parameters) return a_next, c_next, yt_pred, cache # In[9]: np.random.seed(1) xt = np.random.randn(3,10) a_prev = np.random.randn(5,10) c_prev = np.random.randn(5,10) Wf = np.random.randn(5, 5+3) bf = np.random.randn(5,1) Wi = np.random.randn(5, 5+3) bi = np.random.randn(5,1) Wo = np.random.randn(5, 5+3) bo = np.random.randn(5,1) Wc = np.random.randn(5, 5+3) bc = np.random.randn(5,1) Wy = np.random.randn(2,5) by = np.random.randn(2,1) parameters = {"Wf": Wf, "Wi": Wi, "Wo": Wo, "Wc": Wc, "Wy": Wy, "bf": bf, "bi": bi, "bo": bo, "bc": bc, "by": by} a_next, c_next, yt, cache = lstm_cell_forward(xt, a_prev, c_prev, parameters) print("a_next[4] = ", a_next[4]) print("a_next.shape = ", c_next.shape) print("c_next[2] = ", c_next[2]) print("c_next.shape = ", c_next.shape) print("yt[1] =", yt[1]) print("yt.shape = ", yt.shape) print("cache[1][3] =", cache[1][3]) print("len(cache) = ", len(cache)) # **Expected Output**: # # <table> # <tr> # <td> # **a_next[4]**: # </td> # <td> # [-0.66408471 0.0036921 0.02088357 0.22834167 -0.85575339 0.00138482 # 0.76566531 0.34631421 -0.00215674 0.43827275] # </td> # </tr> # <tr> # <td> # **a_next.shape**: # </td> # <td> # (5, 10) # </td> # </tr> # <tr> # <td> # **c_next[2]**: # </td> # <td> # [ 0.63267805 1.00570849 0.35504474 0.20690913 -1.64566718 0.11832942 # 0.76449811 -0.0981561 -0.74348425 -0.26810932] # </td> # </tr> # <tr> # <td> # **c_next.shape**: # </td> # <td> # (5, 10) # </td> # </tr> # <tr> # <td> # **yt[1]**: # </td> # <td> # [ 0.79913913 0.15986619 0.22412122 0.15606108 0.97057211 0.31146381 # 0.00943007 0.12666353 0.39380172 0.07828381] # </td> # </tr> # <tr> # <td> # **yt.shape**: # </td> # <td> # (2, 10) # </td> # </tr> # <tr> # <td> # **cache[1][3]**: # </td> # <td> # [-0.16263996 1.03729328 0.72938082 -0.54101719 0.02752074 -0.30821874 # 0.07651101 -1.03752894 1.41219977 -0.37647422] # </td> # </tr> # <tr> # <td> # **len(cache)**: # </td> # <td> # 10 # </td> # </tr> # # </table> # ### 2.2 - Forward pass for LSTM # # Now that you have implemented one step of an LSTM, you can now iterate this over this using a for-loop to process a sequence of $T_x$ inputs. # # <img src="images/LSTM_rnn.png" style="width:500;height:300px;"> # <caption><center> **Figure 4**: LSTM over multiple time-steps. </center></caption> # # **Exercise:** Implement `lstm_forward()` to run an LSTM over $T_x$ time-steps. # # **Note**: $c^{\langle 0 \rangle}$ is initialized with zeros. # In[10]: # GRADED FUNCTION: lstm_forward def lstm_forward(x, a0, parameters): """ Implement the forward propagation of the recurrent neural network using an LSTM-cell described in Figure (3). Arguments: x -- Input data for every time-step, of shape (n_x, m, T_x). a0 -- Initial hidden state, of shape (n_a, m) parameters -- python dictionary containing: Wf -- Weight matrix of the forget gate, numpy array of shape (n_a, n_a + n_x) bf -- Bias of the forget gate, numpy array of shape (n_a, 1) Wi -- Weight matrix of the update gate, numpy array of shape (n_a, n_a + n_x) bi -- Bias of the update gate, numpy array of shape (n_a, 1) Wc -- Weight matrix of the first "tanh", numpy array of shape (n_a, n_a + n_x) bc -- Bias of the first "tanh", numpy array of shape (n_a, 1) Wo -- Weight matrix of the output gate, numpy array of shape (n_a, n_a + n_x) bo -- Bias of the output gate, numpy array of shape (n_a, 1) Wy -- Weight matrix relating the hidden-state to the output, numpy array of shape (n_y, n_a) by -- Bias relating the hidden-state to the output, numpy array of shape (n_y, 1) Returns: a -- Hidden states for every time-step, numpy array of shape (n_a, m, T_x) y -- Predictions for every time-step, numpy array of shape (n_y, m, T_x) caches -- tuple of values needed for the backward pass, contains (list of all the caches, x) """ # Initialize "caches", which will track the list of all the caches caches = [] ### START CODE HERE ### # Retrieve dimensions from shapes of x and parameters['Wy'] (≈2 lines) n_x, m, T_x = x.shape n_y, n_a = parameters['Wy'].shape # initialize "a", "c" and "y" with zeros (≈3 lines) a = np.zeros([n_a, m, T_x]) c = np.zeros([n_a, m, T_x]) y = np.zeros([n_y, m, T_x]) # Initialize a_next and c_next (≈2 lines) a_next = a0 c_next = np.zeros([n_a, m]) # loop over all time-steps for t in range(T_x): # Update next hidden state, next memory state, compute the prediction, get the cache (≈1 line) a_next, c_next, yt, cache = lstm_cell_forward(x[:,:,t], a_next, c_next, parameters) # Save the value of the new "next" hidden state in a (≈1 line) a[:,:,t] = a_next # Save the value of the prediction in y (≈1 line) y[:,:,t] = yt # Save the value of the next cell state (≈1 line) c[:,:,t] = c_next # Append the cache into caches (≈1 line) caches.append(cache) ### END CODE HERE ### # store values needed for backward propagation in cache caches = (caches, x) return a, y, c, caches # In[11]: np.random.seed(1) x = np.random.randn(3,10,7) a0 = np.random.randn(5,10) Wf = np.random.randn(5, 5+3) bf = np.random.randn(5,1) Wi = np.random.randn(5, 5+3) bi = np.random.randn(5,1) Wo = np.random.randn(5, 5+3) bo = np.random.randn(5,1) Wc = np.random.randn(5, 5+3) bc = np.random.randn(5,1) Wy = np.random.randn(2,5) by = np.random.randn(2,1) parameters = {"Wf": Wf, "Wi": Wi, "Wo": Wo, "Wc": Wc, "Wy": Wy, "bf": bf, "bi": bi, "bo": bo, "bc": bc, "by": by} a, y, c, caches = lstm_forward(x, a0, parameters) print("a[4][3][6] = ", a[4][3][6]) print("a.shape = ", a.shape) print("y[1][4][3] =", y[1][4][3]) print("y.shape = ", y.shape) print("caches[1][1[1]] =", caches[1][1][1]) print("c[1][2][1]", c[1][2][1]) print("len(caches) = ", len(caches)) # **Expected Output**: # # <table> # <tr> # <td> # **a[4][3][6]** = # </td> # <td> # 0.172117767533 # </td> # </tr> # <tr> # <td> # **a.shape** = # </td> # <td> # (5, 10, 7) # </td> # </tr> # <tr> # <td> # **y[1][4][3]** = # </td> # <td> # 0.95087346185 # </td> # </tr> # <tr> # <td> # **y.shape** = # </td> # <td> # (2, 10, 7) # </td> # </tr> # <tr> # <td> # **caches[1][1][1]** = # </td> # <td> # [ 0.82797464 0.23009474 0.76201118 -0.22232814 -0.20075807 0.18656139 # 0.41005165] # </td> # # </tr> # <tr> # <td> # **c[1][2][1]** = # </td> # <td> # -0.855544916718 # </td> # </tr> # # </tr> # <tr> # <td> # **len(caches)** = # </td> # <td> # 2 # </td> # </tr> # # </table> # Congratulations! You have now implemented the forward passes for the basic RNN and the LSTM. When using a deep learning framework, implementing the forward pass is sufficient to build systems that achieve great performance. # # The rest of this notebook is optional, and will not be graded. # ## 3 - Backpropagation in recurrent neural networks (OPTIONAL / UNGRADED) # # In modern deep learning frameworks, you only have to implement the forward pass, and the framework takes care of the backward pass, so most deep learning engineers do not need to bother with the details of the backward pass. If however you are an expert in calculus and want to see the details of backprop in RNNs, you can work through this optional portion of the notebook. # # When in an earlier course you implemented a simple (fully connected) neural network, you used backpropagation to compute the derivatives with respect to the cost to update the parameters. Similarly, in recurrent neural networks you can to calculate the derivatives with respect to the cost in order to update the parameters. The backprop equations are quite complicated and we did not derive them in lecture. However, we will briefly present them below. # ### 3.1 - Basic RNN backward pass # # We will start by computing the backward pass for the basic RNN-cell. # # <img src="images/rnn_cell_backprop.png" style="width:500;height:300px;"> <br> # <caption><center> **Figure 5**: RNN-cell's backward pass. Just like in a fully-connected neural network, the derivative of the cost function $J$ backpropagates through the RNN by following the chain-rule from calculas. The chain-rule is also used to calculate $(\frac{\partial J}{\partial W_{ax}},\frac{\partial J}{\partial W_{aa}},\frac{\partial J}{\partial b})$ to update the parameters $(W_{ax}, W_{aa}, b_a)$. </center></caption> # #### Deriving the one step backward functions: # # To compute the `rnn_cell_backward` you need to compute the following equations. It is a good exercise to derive them by hand. # # The derivative of $\tanh$ is $1-\tanh(x)^2$. You can find the complete proof [here](https://www.wyzant.com/resources/lessons/math/calculus/derivative_proofs/tanx). Note that: $ \text{sech}(x)^2 = 1 - \tanh(x)^2$ # # Similarly for $\frac{ \partial a^{\langle t \rangle} } {\partial W_{ax}}, \frac{ \partial a^{\langle t \rangle} } {\partial W_{aa}}, \frac{ \partial a^{\langle t \rangle} } {\partial b}$, the derivative of $\tanh(u)$ is $(1-\tanh(u)^2)du$. # # The final two equations also follow same rule and are derived using the $\tanh$ derivative. Note that the arrangement is done in a way to get the same dimensions to match. # In[28]: def rnn_cell_backward(da_next, cache): """ Implements the backward pass for the RNN-cell (single time-step). Arguments: da_next -- Gradient of loss with respect to next hidden state cache -- python dictionary containing useful values (output of rnn_cell_forward()) Returns: gradients -- python dictionary containing: dx -- Gradients of input data, of shape (n_x, m) da_prev -- Gradients of previous hidden state, of shape (n_a, m) dWax -- Gradients of input-to-hidden weights, of shape (n_a, n_x) dWaa -- Gradients of hidden-to-hidden weights, of shape (n_a, n_a) dba -- Gradients of bias vector, of shape (n_a, 1) """ # Retrieve values from cache (a_next, a_prev, xt, parameters) = cache # Retrieve values from parameters Wax = parameters["Wax"] Waa = parameters["Waa"] Wya = parameters["Wya"] ba = parameters["ba"] by = parameters["by"] ### START CODE HERE ### # compute the gradient of tanh with respect to a_next (≈1 line) dtanh = (1 - a_next**2)*da_next # compute the gradient of the loss with respect to Wax (≈2 lines) dxt = np.dot(Wax.T,dtanh) dWax = np.dot(dtanh,xt.T) # compute the gradient with respect to Waa (≈2 lines) da_prev = np.dot(Waa.T,dtanh) dWaa = np.dot(dtanh,a_prev.T) # compute the gradient with respect to b (≈1 line) dba = np.sum(dtanh, axis=1, keepdims=True) ### END CODE HERE ### # Store the gradients in a python dictionary gradients = {"dxt": dxt, "da_prev": da_prev, "dWax": dWax, "dWaa": dWaa, "dba": dba} return gradients # In[29]: np.random.seed(1) xt = np.random.randn(3,10) a_prev = np.random.randn(5,10) Wax = np.random.randn(5,3) Waa = np.random.randn(5,5) Wya = np.random.randn(2,5) b = np.random.randn(5,1) by = np.random.randn(2,1) parameters = {"Wax": Wax, "Waa": Waa, "Wya": Wya, "ba": ba, "by": by} a_next, yt, cache = rnn_cell_forward(xt, a_prev, parameters) da_next = np.random.randn(5,10) gradients = rnn_cell_backward(da_next, cache) print("gradients[\"dxt\"][1][2] =", gradients["dxt"][1][2]) print("gradients[\"dxt\"].shape =", gradients["dxt"].shape) print("gradients[\"da_prev\"][2][3] =", gradients["da_prev"][2][3]) print("gradients[\"da_prev\"].shape =", gradients["da_prev"].shape) print("gradients[\"dWax\"][3][1] =", gradients["dWax"][3][1]) print("gradients[\"dWax\"].shape =", gradients["dWax"].shape) print("gradients[\"dWaa\"][1][2] =", gradients["dWaa"][1][2]) print("gradients[\"dWaa\"].shape =", gradients["dWaa"].shape) print("gradients[\"dba\"][4] =", gradients["dba"][4]) print("gradients[\"dba\"].shape =", gradients["dba"].shape) # **Expected Output**: # # <table> # <tr> # <td> # **gradients["dxt"][1][2]** = # </td> # <td> # -0.460564103059 # </td> # </tr> # <tr> # <td> # **gradients["dxt"].shape** = # </td> # <td> # (3, 10) # </td> # </tr> # <tr> # <td> # **gradients["da_prev"][2][3]** = # </td> # <td> # 0.0842968653807 # </td> # </tr> # <tr> # <td> # **gradients["da_prev"].shape** = # </td> # <td> # (5, 10) # </td> # </tr> # <tr> # <td> # **gradients["dWax"][3][1]** = # </td> # <td> # 0.393081873922 # </td> # </tr> # <tr> # <td> # **gradients["dWax"].shape** = # </td> # <td> # (5, 3) # </td> # </tr> # <tr> # <td> # **gradients["dWaa"][1][2]** = # </td> # <td> # -0.28483955787 # </td> # </tr> # <tr> # <td> # **gradients["dWaa"].shape** = # </td> # <td> # (5, 5) # </td> # </tr> # <tr> # <td> # **gradients["dba"][4]** = # </td> # <td> # [ 0.80517166] # </td> # </tr> # <tr> # <td> # **gradients["dba"].shape** = # </td> # <td> # (5, 1) # </td> # </tr> # </table> # #### Backward pass through the RNN # # Computing the gradients of the cost with respect to $a^{\langle t \rangle}$ at every time-step $t$ is useful because it is what helps the gradient backpropagate to the previous RNN-cell. To do so, you need to iterate through all the time steps starting at the end, and at each step, you increment the overall $db_a$, $dW_{aa}$, $dW_{ax}$ and you store $dx$. # # **Instructions**: # # Implement the `rnn_backward` function. Initialize the return variables with zeros first and then loop through all the time steps while calling the `rnn_cell_backward` at each time timestep, update the other variables accordingly. # In[42]: def rnn_backward(da, cache): """ Implement the backward pass for a RNN over an entire sequence of input data. Arguments: da -- Upstream gradients of all hidden states, of shape (n_a, m, T_x) caches -- tuple containing information from the forward pass (rnn_forward) Returns: gradients -- python dictionary containing: dx -- Gradient w.r.t. the input data, numpy-array of shape (n_x, m, T_x) da0 -- Gradient w.r.t the initial hidden state, numpy-array of shape (n_a, m) dWax -- Gradient w.r.t the input's weight matrix, numpy-array of shape (n_a, n_x) dWaa -- Gradient w.r.t the hidden state's weight matrix, numpy-arrayof shape (n_a, n_a) dba -- Gradient w.r.t the bias, of shape (n_a, 1) """ ### START CODE HERE ### # Retrieve values from the first cache (t=1) of caches (≈2 lines) (caches, x) = cache (a1, a0, x1, parameters) = caches[0] # Retrieve dimensions from da's and x1's shapes (≈2 lines) n_a, m, T_x = da.shape n_x, m = x1.shape # initialize the gradients with the right sizes (≈6 lines) dx = np.zeros([n_x, m, T_x]) dWax = np.zeros([n_a, n_x]) dWaa = np.zeros([n_a, n_a]) dba = np.zeros([n_a, 1]) da0 = np.zeros([n_a, m]) da_prevt = np.zeros([n_a, m]) # Loop through all the time steps for t in reversed(range(T_x)): # Compute gradients at time step t. Choose wisely the "da_next" and the "cache" to use in the backward propagation step. (≈1 line) gradients = rnn_cell_backward(da[:,:,t] + da_prevt, caches[t]) # Retrieve derivatives from gradients (≈ 1 line) dxt, da_prevt, dWaxt, dWaat, dbat = gradients["dxt"], gradients["da_prev"], gradients["dWax"], gradients["dWaa"], gradients["dba"] # Increment global derivatives w.r.t parameters by adding their derivative at time-step t (≈4 lines) dx[:, :, t] = dxt dWax += dWaxt dWaa += dWaat dba += dbat # Set da0 to the gradient of a which has been backpropagated through all time-steps (≈1 line) da0 = da_prevt ### END CODE HERE ### # Store the gradients in a python dictionary gradients = {"dx": dx, "da0": da0, "dWax": dWax, "dWaa": dWaa,"dba": dba} return gradients # In[43]: np.random.seed(1) x = np.random.randn(3,10,4) a0 = np.random.randn(5,10) Wax = np.random.randn(5,3) Waa = np.random.randn(5,5) Wya = np.random.randn(2,5) ba = np.random.randn(5,1) by = np.random.randn(2,1) parameters = {"Wax": Wax, "Waa": Waa, "Wya": Wya, "ba": ba, "by": by} a, y, caches = rnn_forward(x, a0, parameters) da = np.random.randn(5, 10, 4) gradients = rnn_backward(da, caches) print("gradients[\"dx\"][1][2] =", gradients["dx"][1][2]) print("gradients[\"dx\"].shape =", gradients["dx"].shape) print("gradients[\"da0\"][2][3] =", gradients["da0"][2][3]) print("gradients[\"da0\"].shape =", gradients["da0"].shape) print("gradients[\"dWax\"][3][1] =", gradients["dWax"][3][1]) print("gradients[\"dWax\"].shape =", gradients["dWax"].shape) print("gradients[\"dWaa\"][1][2] =", gradients["dWaa"][1][2]) print("gradients[\"dWaa\"].shape =", gradients["dWaa"].shape) print("gradients[\"dba\"][4] =", gradients["dba"][4]) print("gradients[\"dba\"].shape =", gradients["dba"].shape) # **Expected Output**: # # <table> # <tr> # <td> # **gradients["dx"][1][2]** = # </td> # <td> # [-2.07101689 -0.59255627 0.02466855 0.01483317] # </td> # </tr> # <tr> # <td> # **gradients["dx"].shape** = # </td> # <td> # (3, 10, 4) # </td> # </tr> # <tr> # <td> # **gradients["da0"][2][3]** = # </td> # <td> # -0.314942375127 # </td> # </tr> # <tr> # <td> # **gradients["da0"].shape** = # </td> # <td> # (5, 10) # </td> # </tr> # <tr> # <td> # **gradients["dWax"][3][1]** = # </td> # <td> # 11.2641044965 # </td> # </tr> # <tr> # <td> # **gradients["dWax"].shape** = # </td> # <td> # (5, 3) # </td> # </tr> # <tr> # <td> # **gradients["dWaa"][1][2]** = # </td> # <td> # 2.30333312658 # </td> # </tr> # <tr> # <td> # **gradients["dWaa"].shape** = # </td> # <td> # (5, 5) # </td> # </tr> # <tr> # <td> # **gradients["dba"][4]** = # </td> # <td> # [-0.74747722] # </td> # </tr> # <tr> # <td> # **gradients["dba"].shape** = # </td> # <td> # (5, 1) # </td> # </tr> # </table> # ## 3.2 - LSTM backward pass # ### 3.2.1 One Step backward # # The LSTM backward pass is slighltly more complicated than the forward one. We have provided you with all the equations for the LSTM backward pass below. (If you enjoy calculus exercises feel free to try deriving these from scratch yourself.) # # ### 3.2.2 gate derivatives # # $$d \Gamma_o^{\langle t \rangle} = da_{next}*\tanh(c_{next}) * \Gamma_o^{\langle t \rangle}*(1-\Gamma_o^{\langle t \rangle})\tag{7}$$ # # $$d\tilde c^{\langle t \rangle} = dc_{next}*\Gamma_u^{\langle t \rangle}+ \Gamma_o^{\langle t \rangle} (1-\tanh(c_{next})^2) * i_t * da_{next} * \tilde c^{\langle t \rangle} * (1-\tanh(\tilde c)^2) \tag{8}$$ # # $$d\Gamma_u^{\langle t \rangle} = dc_{next}*\tilde c^{\langle t \rangle} + \Gamma_o^{\langle t \rangle} (1-\tanh(c_{next})^2) * \tilde c^{\langle t \rangle} * da_{next}*\Gamma_u^{\langle t \rangle}*(1-\Gamma_u^{\langle t \rangle})\tag{9}$$ # # $$d\Gamma_f^{\langle t \rangle} = dc_{next}*\tilde c_{prev} + \Gamma_o^{\langle t \rangle} (1-\tanh(c_{next})^2) * c_{prev} * da_{next}*\Gamma_f^{\langle t \rangle}*(1-\Gamma_f^{\langle t \rangle})\tag{10}$$ # # ### 3.2.3 parameter derivatives # # $$ dW_f = d\Gamma_f^{\langle t \rangle} * \begin{pmatrix} a_{prev} \\ x_t\end{pmatrix}^T \tag{11} $$ # $$ dW_u = d\Gamma_u^{\langle t \rangle} * \begin{pmatrix} a_{prev} \\ x_t\end{pmatrix}^T \tag{12} $$ # $$ dW_c = d\tilde c^{\langle t \rangle} * \begin{pmatrix} a_{prev} \\ x_t\end{pmatrix}^T \tag{13} $$ # $$ dW_o = d\Gamma_o^{\langle t \rangle} * \begin{pmatrix} a_{prev} \\ x_t\end{pmatrix}^T \tag{14}$$ # # To calculate $db_f, db_u, db_c, db_o$ you just need to sum across the horizontal (axis= 1) axis on $d\Gamma_f^{\langle t \rangle}, d\Gamma_u^{\langle t \rangle}, d\tilde c^{\langle t \rangle}, d\Gamma_o^{\langle t \rangle}$ respectively. Note that you should have the `keep_dims = True` option. # # Finally, you will compute the derivative with respect to the previous hidden state, previous memory state, and input. # # $$ da_{prev} = W_f^T*d\Gamma_f^{\langle t \rangle} + W_u^T * d\Gamma_u^{\langle t \rangle}+ W_c^T * d\tilde c^{\langle t \rangle} + W_o^T * d\Gamma_o^{\langle t \rangle} \tag{15}$$ # Here, the weights for equations 13 are the first n_a, (i.e. $W_f = W_f[:n_a,:]$ etc...) # # $$ dc_{prev} = dc_{next}\Gamma_f^{\langle t \rangle} + \Gamma_o^{\langle t \rangle} * (1- \tanh(c_{next})^2)*\Gamma_f^{\langle t \rangle}*da_{next} \tag{16}$$ # $$ dx^{\langle t \rangle} = W_f^T*d\Gamma_f^{\langle t \rangle} + W_u^T * d\Gamma_u^{\langle t \rangle}+ W_c^T * d\tilde c_t + W_o^T * d\Gamma_o^{\langle t \rangle}\tag{17} $$ # where the weights for equation 15 are from n_a to the end, (i.e. $W_f = W_f[n_a:,:]$ etc...) # # **Exercise:** Implement `lstm_cell_backward` by implementing equations $7-17$ below. Good luck! :) # In[96]: def lstm_cell_backward(da_next, dc_next, cache): """ Implement the backward pass for the LSTM-cell (single time-step). Arguments: da_next -- Gradients of next hidden state, of shape (n_a, m) dc_next -- Gradients of next cell state, of shape (n_a, m) cache -- cache storing information from the forward pass Returns: gradients -- python dictionary containing: dxt -- Gradient of input data at time-step t, of shape (n_x, m) da_prev -- Gradient w.r.t. the previous hidden state, numpy array of shape (n_a, m) dc_prev -- Gradient w.r.t. the previous memory state, of shape (n_a, m, T_x) dWf -- Gradient w.r.t. the weight matrix of the forget gate, numpy array of shape (n_a, n_a + n_x) dWi -- Gradient w.r.t. the weight matrix of the update gate, numpy array of shape (n_a, n_a + n_x) dWc -- Gradient w.r.t. the weight matrix of the memory gate, numpy array of shape (n_a, n_a + n_x) dWo -- Gradient w.r.t. the weight matrix of the output gate, numpy array of shape (n_a, n_a + n_x) dbf -- Gradient w.r.t. biases of the forget gate, of shape (n_a, 1) dbi -- Gradient w.r.t. biases of the update gate, of shape (n_a, 1) dbc -- Gradient w.r.t. biases of the memory gate, of shape (n_a, 1) dbo -- Gradient w.r.t. biases of the output gate, of shape (n_a, 1) """ # Retrieve information from "cache" (a_next, c_next, a_prev, c_prev, ft, it, cct, ot, xt, parameters) = cache # Retrieve values from parameters Wf = parameters['Wf'] Wo = parameters['Wo'] Wi = parameters['Wi'] Wc = parameters['Wc'] ### START CODE HERE ### # Retrieve dimensions from xt's and a_next's shape (≈2 lines) n_x, m = xt.shape n_a, m = a_next.shape # Compute gates related derivatives, you can find their values can be found by looking carefully at equations (7) to (10) (≈4 lines) dot = da_next * np.tanh(c_next) * ot * (1 - ot) dcct = (dc_next * it + ot * (1 - np.square(np.tanh(c_next))) * it * da_next) * (1 - np.square(cct)) dit = (dc_next * cct + ot * (1 - np.square(np.tanh(c_next))) * cct * da_next) * it * (1 - it) dft = (dc_next * c_prev + ot *(1 - np.square(np.tanh(c_next))) * c_prev * da_next) * ft * (1 - ft) # Code equations (7) to (10) (≈4 lines) ##dit = None ##dft = None ##dot = None ##dcct = None concat = np.concatenate((a_prev, xt)) # Compute parameters related derivatives. Use equations (11)-(14) (≈8 lines) dWf = np.dot(dft, concat.T) dWi = np.dot(dit, concat.T) dWc = np.dot(dcct, concat.T) dWo = np.dot(dot, concat.T) dbf = np.sum(dft, axis=1 ,keepdims = True) dbi = np.sum(dit, axis=1, keepdims = True) dbc = np.sum(dcct, axis=1, keepdims = True) dbo = np.sum(dot, axis=1, keepdims = True) # Compute derivatives w.r.t previous hidden state, previous memory state and input. Use equations (15)-(17). (≈3 lines) da_prev = np.dot(Wf[:, :n_a].T, dft) + np.dot(Wi[:, :n_a].T, dit) + np.dot(Wc[:, :n_a].T, dcct) + np.dot(Wo[:, :n_a].T, dot) dc_prev = dc_next * ft + ot * (1 - np.square(np.tanh(c_next))) * ft * da_next dxt = np.dot(Wf[:, n_a:].T, dft) + np.dot(Wi[:, n_a:].T, dit) + np.dot(Wc[:, n_a:].T, dcct) + np.dot(Wo[:, n_a:].T, dot) ### END CODE HERE ### # Save gradients in dictionary gradients = {"dxt": dxt, "da_prev": da_prev, "dc_prev": dc_prev, "dWf": dWf,"dbf": dbf, "dWi": dWi,"dbi": dbi, "dWc": dWc,"dbc": dbc, "dWo": dWo,"dbo": dbo} return gradients # In[97]: np.random.seed(1) xt = np.random.randn(3,10) a_prev = np.random.randn(5,10) c_prev = np.random.randn(5,10) Wf = np.random.randn(5, 5+3) bf = np.random.randn(5,1) Wi =
np.random.randn(5, 5+3)
numpy.random.randn
# -*- coding: utf-8 -*- # vim: tabstop=4 expandtab shiftwidth=4 softtabstop=4 # Also if needed: retab ''' TEST equimap ''' from __future__ import (unicode_literals, absolute_import, \ print_function, division) import matplotlib.pyplot as plt import numpy as np import os import sys import time #import warnings if __name__ == '__main__': #print('path 1 =', sys.path) sys.path.insert(0, os.path.abspath(os.path.join(os.path.dirname(__file__), '..'))) #print('path 2 =', sys.path) # Local modules import imas import equimap #import imas_west #import pywed as pw shot = 53221 tol_val = 1E-10 # For 2D plots interp_points = 60 # FIRST POINT B_NORM # ------------------ time_in = np.linspace(36, 37, 10) Phi_in = np.linspace(0, 2*np.pi/18, 100) R_in = np.full(Phi_in.shape, 3) Z_in = np.zeros(R_in.shape) # Read equilibrium data idd = imas.ids(shot, 0) idd.open_env('imas_public', 'west', '3') idd.equilibrium.get() out = idd.equilibrium equiDict = {} # Declaration of arrays 2d plots equi_grid = idd.equilibrium.grids_ggd[0].grid[0] NbrPoints = len(equi_grid.space[0].objects_per_dimension[0].object) equiDict['r'] = np.full(NbrPoints, np.nan) equiDict['z'] = np.full(NbrPoints, np.nan) for ii in range(NbrPoints): equiDict['r'][ii] = equi_grid.space[0].objects_per_dimension[0]. \ object[ii].geometry[0] equiDict['z'][ii] = equi_grid.space[0].objects_per_dimension[0]. \ object[ii].geometry[1] # For 2D plots R_all = np.linspace(np.min(equiDict['r']), np.max(equiDict['r']), interp_points) Z_all = np.linspace(np.min(equiDict['z']), np.max(equiDict['z']), interp_points) R_all_tot = np.repeat(R_all, interp_points) Z_all_tot = np.tile(Z_all, interp_points) Rr = R_all_tot.reshape((interp_points, interp_points)) Zr = Z_all_tot.reshape((interp_points, interp_points)) # CALL EQUIMAP start = time.time() oute = equimap.get(shot, time=time_in, \ R=R_in, Phi=Phi_in, Z=Z_in, \ quantity='b_field_norm') end = time.time() print() print('time in equimap.get b_norm =', end - start) print() print('oute.shape b_norm =', oute.shape) # CALL EQUIMAP start = time.time() oute_noR = equimap.get(shot, time=time_in, \ R=R_in, Phi=Phi_in, Z=Z_in, \ quantity='b_field_norm', no_ripple=True) end = time.time() print() print('time in equimap.get b_norm no Ripple =', end - start) print() print('oute.shape b_norm no ripple =', oute_noR.shape) print() print('Mean value B_norm ripple =', np.mean(oute[int(0.5*oute.shape[0]), :])) print('Mean value B_norm NO ripple =', \ np.mean(oute_noR[int(0.5*oute_noR.shape[0]), :])) diff_mean_val = np.mean(oute[int(0.5*oute.shape[0]), :]) \ - np.mean(oute_noR[int(0.5*oute_noR.shape[0]), :]) print('Diff mean values =', diff_mean_val) percent_diff = np.abs(100*diff_mean_val \ / np.mean(oute[int(0.5*oute.shape[0]), :])) print('Percent diff mean values =', percent_diff) # CHECK # ----- if (np.abs(percent_diff - 0.011052598088) > tol_val): print() print('ERROR: Higher than tolerance percent difference ' \ + str(np.abs(percent_diff - 0.011052598088))) print() #raise RuntimeError # FOR: # shot = 53221 # time_in = np.linspace(36, 37, 10) # Phi_in = np.linspace(0, 2*np.pi/18, 100) # R_in = np.full(Phi_in.shape, 3) # Z_in = np.zeros(R_in.shape) # RESULTS: # Mean value B_norm ripple = 3.05593472975 # Mean value B_norm NO ripple = 3.05627248994 # Diff mean values = -0.000337760183512 # Percent diff mean values = 0.011052598088 print() # PLOTS plt.figure() plt.plot(time_in, oute[:, -1], label='B_norm at R={0}, Phi=Z=0'.format(R_in[-1])) plt.plot(time_in, oute_noR[:, -1], label='B_norm no ripple at R={0}, Phi=Z=0'.format(R_in[-1])) plt.legend() plt.xlabel('Time [s]') plt.ylabel('B_norm [T]') plt.figure() plt.plot(Phi_in, oute[int(0.5*oute.shape[0]), :], \ label='B_norm at t={0:.2f}, R={1}, Z=0'.format( \ time_in[int(0.5*oute.shape[0])], R_in[-1])) plt.plot(Phi_in, oute_noR[int(0.5*oute.shape[0]), :], \ label='B_norm no ripple at t={0:.2f}, R={1}, Z=0'.format( \ time_in[int(0.5*oute.shape[0])], R_in[-1])) plt.legend() plt.xlabel('Phi [rad]') plt.ylabel('B_norm [T]') # SECOND POSITION B_NORM # ---------------------- t_ignitron = [] t_ignitron.append(32) print() print('t_igni =', t_ignitron[0]) print() time_in = np.linspace(t_ignitron[0], 38, 10) Phi_in =
np.linspace(0, 2*np.pi/18, 100)
numpy.linspace
"""Miscellaneous functions to analyze the simulation results. Index ----- .. currentmodule:: nanoqm.analysis.tools .. autosummary:: API --- """ import os from typing import List, Tuple import numpy as np import pyparsing as pa from scipy.optimize import curve_fit from ..common import fs_to_cm, h2ev, hbar, r2meV """ Functions to fit data """ def gauss_function(x: float, sigma: float) -> np.ndarray: """Compute a Gaussian function used for fitting data.""" return np.exp(-0.5 * (-x / sigma) ** 2) def lorentzian_function(x_L, sigma_L, amplitude_L): """Compute a Lorentzian function used for fitting data.""" return amplitude_L * sigma_L**2 / (sigma_L**2 + x_L ** 2) def exp_function(x, x0, amplitude): """Compute an Exponential function used for fitting data.""" return amplitude * np.exp(-x / x0) def sine_function(t_phonon, amplitude, offset, phase, n_periods, dt): """Compute a sinusoidal function used for fitting data.""" t = np.arange(0, n_periods * t_phonon, dt) # (gap) energy y = offset + amplitude * (np.sin(2 * np.pi * t / t_phonon + phase)) y_mean = np.mean(y) y_dummy = y / h2ev # to delete ... return y_dummy, y, y_mean, t def sqrt_func(x, a): """Compute a square root function used for fitting data.""" return a * np.sqrt(x) def func_conv(x_real: np.ndarray, x_grid: np.ndarray, delta: float) -> np.ndarray: """Compute a convolution on a grid using a Gaussian function.""" return np.exp(-2 * (x_grid - x_real) ** 2 / delta ** 2) def convolute(x: np.ndarray, y: np.ndarray, x_points: np.ndarray, sigma: float) -> np.ndarray: """Convolute a spectrum on a grid of x_points. You need as input x, y and the grid where to convolute. """ # Compute gaussian prefactor prefactor = np.sqrt(2.0) / (sigma * np.sqrt(np.pi)) # Convolute spectrum over grid y_points = prefactor * np.stack([ np.sum(y * func_conv(x, x_point, sigma)) for x_point in x_points ]) return y_points """ Useful functions to compute autocorrelation, dephasing, etc. """ def autocorrelate(f: np.ndarray) -> Tuple[float, float]: """Compute the un-normalized and normalized autocorrelation of a function.""" d_f = f - f.mean() d_f2 = np.append(d_f, d_f, axis=0) # Compute the autocorrelation function uacf = np.correlate(d_f, d_f2, "valid")[:d_f.size] / d_f.size # Compute the normalized autocorrelation function nacf = uacf / uacf[0] return uacf, nacf def spectral_density(f, dt): """Fourier Transform of a given function f using a dense grid with 100000 points. In the case of a FFT of a normalized autocorrelation function, this corresponds to a spectral density """ n_pts = 100000 f_fft = abs(1 / np.sqrt(2 * np.pi) * np.fft.rfft(f, n_pts) * dt) ** 2 # Fourier Transform of the time axis freq = np.fft.rfftfreq(n_pts, dt) # Conversion of the x axis (given in cycles/fs) to cm-1 freq = freq * fs_to_cm return f_fft, freq def dephasing(f: np.ndarray, dt: float): """Compute the dephasing time of a given function. f = energies, in eV (if other function/unit: then the line_broadening will not be in eV) dt = time step, in fs Use the optical response formalisms: <NAME>, Principles of Nonlinear Optical Spectroscopy, 1995 About the implementation we use the 2nd order cumulant expansion. See also eq. (2) in : Kilina et al. Phys. Rev. Lett., 110, 180404, (2013) To calculate the dephasing time tau we fit the dephasing function to a gaussian of the type : exp(-0.5 * (-x / tau) ** 2) """ # Conversion of hbar to hartree * fs hbar_au = hbar / h2ev ts = np.arange(f.shape[0]) * dt cumu_ii = np.asarray([np.trapz(f[0:i + 1], dx=(dt / hbar), axis=0) for i in range(ts.size)]) cumu_i = np.asarray([np.trapz(cumu_ii[0:i + 1], dx=(dt / hbar), axis=0) for i in range(ts.size)]) deph = np.exp(-cumu_i) return deph, ts def fit_dephasing(fit_func, deph, ts, res, t_deph_guess): """Work in progress (?). fit_func = 0 for Gaussian fit, or 1 for exponential fit deph = dephasing function vs. time " ts = time, in fs res = factor by which to increase the time resolution of ts for the fit t_deph_guess = initial guess, in fs """ np.seterr(over='ignore') if fit_func == 0: # fit with Gaussian popt, pcov = curve_fit(gauss_function, ts, deph, p0=(t_deph_guess, deph[0])) # [0] ts_fit = np.arange(res * deph.shape[0]) * dt / res deph_fit = popt[1] * np.exp(-0.5 * (-ts_fit / popt[0]) ** 2) deph_time = popt[0] # in fs (defined as standard deviation of a Gaussian) e_fwhm = std_to_fwhm * hbar / deph_time # FWHM in eV perr = np.sqrt(np.diag(pcov)) deph_time_err = perr[0] # error (standard deviation) for the deph. time e_fwhm_err = deph_time_err * std_to_fwhm * hbar / (deph_time ** 2) # error (standard deviation) for the FWHM elif fit_func == 1: # fit with exponential popt, pcov = curve_fit(exp_function, ts, deph, p0=(t_deph_guess, deph[0])) # [0] ts_fit = np.arange(res * deph.shape[0]) * dt / res deph_fit = popt[1] * np.exp(-ts_fit / popt[0]) deph_time = popt[0] # in fs (defined as the exp. time constant) e_fwhm = 2 * hbar / deph_time # FWHM in eV perr = np.sqrt(
np.diag(pcov)
numpy.diag
datadir = '/home/suriya/_/tf/datasets/qa/bAbI/tasks/en-10k/' WHITELIST = 'abcdefghijklmnopqrstuvwxyz, ' import os import nltk import itertools import numpy as np import pickle from random import shuffle def get_files(): # get list of files filenames = [ fname for fname in os.listdir(datadir) ] # sort them filenames = sorted(filenames, key = lambda x : int( x[2 : x.find('_')] )) # add path to filename return [ datadir + fname for fname in filenames ] def read_task(task_id): # get file names filenames = get_files() # get task specific files tfilenames = filenames[(task_id-1)*2 : (task_id-1)*2 + 2] # read from files content = '' for filename in tfilenames: with open(filename) as f: content += f.read().lower() return content.split('\n')[:-1] def read_all_tasks(): # get file names filenames = get_files() # read from files content = '' for filename in filenames: with open(filename) as f: content += f.read().lower() return content.split('\n')[:-1] def reshape_content(lines): stories = [] story_lines = [] questions = [] answers = [] for line in lines: if line and '?' in line: # parse answer try: answer = line[line.find('?')+1:].split('\t')[1] except: print(line) # parse question question = ' '.join(line.split(' ')[1:]) question = question[ : question.find('?') + 1 ] # add items to lists stories.append(story_lines) questions.append(filter_word(question)) answers.append(filter_word(answer)) # empty(v) story_lines story_lines = [] else: if line: # add lines of each story(facts) to temp list story_lines.append( filter_word(' '.join(line.split(' ')[1:]) ) ) return stories, questions, answers def index_(tokenized_sentences): # get frequency distribution freq_dist = nltk.FreqDist(itertools.chain(tokenized_sentences)) # get vocabulary of 'vocab_size' most used words vocab = freq_dist.most_common() # index2word index2word = ['_'] + ['?'] + ['.'] + [ x[0] for x in vocab ] # - : zero paddding # word2index word2index = dict([(w,i) for i,w in enumerate(index2word)] ) return index2word, word2index, freq_dist def tokenize(lines): tokenized = [] for line in lines: words = [] for word in line.split(' '): words.append( ''.join( [ ch for ch in word if ch in WHITELIST ] )) tokenized.append(words) return tokenized def filter_word(word): return ''.join([ ch for ch in word if ch in WHITELIST ]) def zero_pad(stories, questions, answers, w2i): num_lines = len(answers) # answers idx_a = np.array([ w2i[ans] for ans in answers ], dtype=np.int32) # questions max_q_sent_len = max([ len(q.split(' ')) for q in questions ]) idx_q = np.zeros([num_lines, max_q_sent_len + 1], dtype=np.int32) # iterate through questions for i,q in enumerate(questions): for j,w in enumerate(q.split(' ')): idx_q[i][j] = w2i[w.replace('?', '')] # add ? to question idx_q[i][j+1] = w2i['?'] # stories max_s_sent_len = max([ len(line.split(' ')) for story in stories for line in story ]) max_s_lines = max([ len(story) for story in stories ]) idx_s = np.zeros([num_lines, max_s_lines, max_s_sent_len + 1], dtype=np.int32) for i,story in enumerate(stories): for j,line in enumerate(story): for k,w in enumerate(line.split(' ')): idx_s[i][j][k] = w2i[w.replace('.', '')] idx_s[i][j][k+1] = w2i['.'] return idx_a, idx_q, idx_s def process_data(): lines = read_all_tasks() stories, questions, answers = reshape_content(lines) # shuffle data data = list(zip(stories, questions, answers)) shuffle(data) stories, questions, answers = zip(*data) # index data tokenized = [ w for story in stories for line in story for w in line.split(' ') ] tokenized += [ w for q in questions for w in q.split(' ') ] tokenized += [ w for w in answers] # get loopups idx2w, w2idx, freq_dist = index_(tokenized) # zero padding idx_a, idx_q, idx_s = zero_pad(stories, questions, answers, w2idx) print('shapes') print(idx_a.shape, idx_q.shape, idx_s.shape) # save them np.save('idx_q.npy', idx_q) np.save('idx_s.npy', idx_s) np.save('idx_a.npy', idx_a) # let us now save the necessary dictionaries metadata = { 'w2idx' : w2idx, 'idx2w' : idx2w, 'freq_dist' : freq_dist } # write to disk : data control dictionaries with open('metadata.pkl', 'wb') as f: pickle.dump(metadata, f) if __name__ == '__main__': process_data() def load_data(PATH=''): # read data control dictionaries with open(PATH + 'metadata.pkl', 'rb') as f: metadata = pickle.load(f) # read numpy arrays idx_s =
np.load(PATH + 'idx_s.npy')
numpy.load
#---------------------------------------------------------------- # NAME || AM || e-mail # <NAME> || 432 || <EMAIL> # <NAME> || 431 || <EMAIL> #---------------------------------------------------------------- # Course: Optimization # Project 1 # Written in Python 3.8.6 import numpy as np import pandas as pd import matplotlib.pyplot as plt from numpy.linalg import inv, cholesky, norm from numpy.linalg.linalg import LinAlgError import time import sys # Globals # Our data for the first 30 days. Training set. df_covid_data = pd.read_csv("./Data/covid_data_30_GR.dat", delim_whitespace=True, names = ["Day", "Cases"]) # Scaling step df_covid_data["Scaled Day"] = df_covid_data["Day"].div(10) df_covid_data["Scaled Cases"] = df_covid_data["Cases"].div(10000) # Our data for days 13 - 17 of November based on https://covid19.who.int/region/euro/country/gr df_covid_data_testset = pd.DataFrame(data = np.array([[31, 66637], [32, 69675], [33, 72510], [34, 74205], [35, 76403]]), columns = ["Day", "Cases"]) # Scaling step df_covid_data_testset["Scaled Day"] = df_covid_data_testset["Day"].div(10) df_covid_data_testset["Scaled Cases"] = df_covid_data_testset["Cases"].div(10000) # Defining the polynomial model, its gradiend and its hessian matrix def model(a, x): return a[0] + a[1] * x + a[2] * np.power(x, 2) + a[3] *
np.power(x, 3)
numpy.power
import numpy as np import matplotlib.pyplot as plt # be careful with deep and shallow copies class Quat(object): def __init__(self, *args, **kwargs): self.quatCoef = np.zeros(4, dtype=float) # construt with Bunge euler angles (radians, ZXZ) if len(args) == 3: ph1 = args[0] phi = args[1] ph2 = args[2] self.quatCoef[0] = np.cos(phi / 2.0) * np.cos((ph1 + ph2) / 2.0) self.quatCoef[1] = -np.sin(phi / 2.0) * np.cos((ph1 - ph2) / 2.0) self.quatCoef[2] = -np.sin(phi / 2.0) * np.sin((ph1 - ph2) / 2.0) self.quatCoef[3] = -np.cos(phi / 2.0) * np.sin((ph1 + ph2) / 2.0) # construt with array of quat coefficients elif len(args) == 1: self.quatCoef = args[0] # construt with quat coefficients elif len(args) == 4: self.quatCoef[0] = args[0] self.quatCoef[1] = args[1] self.quatCoef[2] = args[2] self.quatCoef[3] = args[3] if (self.quatCoef[0] < 0): self.quatCoef = self.quatCoef * -1 # overload static method with instance method of same name in object self.plotIPF = self._plotIPF @classmethod def fromAxisAngle(cls, axis, angle): """Create a quat object from an axis angle pair Args: axis (np.array size 3): Axis of rotation angle (float): Rotation arround axis (radians) Returns: Quat: Initialised Quat object """ # normalise the axis vector axis = axis / np.sqrt(np.dot(axis, axis)) # calculate quat coefficients quatCoef = np.zeros(4, dtype=float) quatCoef[0] = np.cos(angle / 2) quatCoef[1:4] = np.sin(angle / 2) * axis # call constructor return cls(quatCoef) def eulerAngles(self): # See Melcher, <NAME>, <NAME>, <NAME>, B. Conversion of EBSD data by a # quaternion based algorithm to be used for grain structure simulations # or # Rowenhorst, D et al. Consistent representations of and conversions between 3D rotations # P = +1 eulers = np.empty(3, dtype=float) q = self.quatCoef q03 = q[0]**2 + q[3]**2 q12 = q[1]**2 + q[2]**2 chi = np.sqrt(q03 * q12) if (chi == 0 and q12 == 0): eulers[0] = np.arctan2(-2 * q[0] * q[3], q[0]**2 - q[3]**2) eulers[1] = 0 eulers[2] = 0 elif (chi == 0 and q03 == 0): eulers[0] = np.arctan2(2 * q[1] * q[2], q[1]**2 - q[2]**2) eulers[1] = np.pi eulers[2] = 0 else: cosPh1 = (-q[0] * q[1] - q[2] * q[3]) / chi sinPh1 = (-q[0] * q[2] + q[1] * q[3]) / chi cosPhi = q[0]**2 + q[3]**2 - q[1]**2 - q[2]**2 sinPhi = 2 * chi cosPh2 = (-q[0] * q[1] + q[2] * q[3]) / chi sinPh2 = (q[1] * q[3] + q[0] * q[2]) / chi eulers[0] = np.arctan2(sinPh1, cosPh1) eulers[1] = np.arctan2(sinPhi, cosPhi) eulers[2] = np.arctan2(sinPh2, cosPh2) if eulers[0] < 0: eulers[0] += 2 * np.pi if eulers[2] < 0: eulers[2] += 2 * np.pi return eulers def rotMatrix(self): rotMatrix = np.empty((3, 3), dtype=float) q = self.quatCoef qbar = q[0]**2 - q[1]**2 - q[2]**2 - q[3]**2 rotMatrix[0, 0] = qbar + 2 * q[1]**2 rotMatrix[0, 1] = 2 * (q[1] * q[2] - q[0] * q[3]) rotMatrix[0, 2] = 2 * (q[1] * q[3] + q[0] * q[2]) rotMatrix[1, 0] = 2 * (q[1] * q[2] + q[0] * q[3]) rotMatrix[1, 1] = qbar + 2 * q[2]**2 rotMatrix[1, 2] = 2 * (q[2] * q[3] - q[0] * q[1]) rotMatrix[2, 0] = 2 * (q[1] * q[3] - q[0] * q[2]) rotMatrix[2, 1] = 2 * (q[2] * q[3] + q[0] * q[1]) rotMatrix[2, 2] = qbar + 2 * q[3]**2 return rotMatrix # show components when the quat is printed def __repr__(self): return "[%.4f, %.4f, %.4f, %.4f]" % (self.quatCoef[0], self.quatCoef[1], self.quatCoef[2], self.quatCoef[3]) def __str__(self): return "[%.4f, %.4f, %.4f, %.4f]" % (self.quatCoef[0], self.quatCoef[1], self.quatCoef[2], self.quatCoef[3]) def _plotIPF(self, direction, symGroup, **kwargs): Quat.plotIPF([self], direction, symGroup, **kwargs) # overload * operator for quaterion product and vector product def __mul__(self, right): if isinstance(right, type(self)): # another quat newQuatCoef = np.zeros(4, dtype=float) newQuatCoef[0] = (self.quatCoef[0] * right.quatCoef[0] - np.dot(self.quatCoef[1:4], right.quatCoef[1:4])) newQuatCoef[1:4] = (self.quatCoef[0] * right.quatCoef[1:4] + right.quatCoef[0] * self.quatCoef[1:4] + np.cross(self.quatCoef[1:4], right.quatCoef[1:4])) return Quat(newQuatCoef) raise TypeError() # # overload % operator for dot product # def __mod__(self, right): def dot(self, right): if isinstance(right, type(self)): return np.dot(self.quatCoef, right.quatCoef) raise TypeError() # overload + operator def __add__(self, right): if isinstance(right, type(self)): return Quat(self.quatCoef + right.quatCoef) raise TypeError() # overload += operator def __iadd__(self, right): if isinstance(right, type(self)): self.quatCoef += right.quatCoef return self raise TypeError() # allow array like setting/getting of components def __getitem__(self, key): return self.quatCoef[key] def __setitem__(self, key, value): self.quatCoef[key] = value return def norm(self): return np.sqrt(np.dot(self.quatCoef[0:4], self.quatCoef[0:4])) def normalise(self): self.quatCoef /= self.norm() return # also the inverse if this is a unit quaterion @property def conjugate(self): return Quat(self.quatCoef[0], -self.quatCoef[1], -self.quatCoef[2], -self.quatCoef[3]) def transformVector(self, vector): """Transforms vector by the quaternion. For EBSD quaterions this is a transformation from sample space to crystal space. Perform on conjugate of quaternion for crystal to sample. Args: vector (numpy.ndarray): Vector to transform Returns: numpy.ndarray: Transformed vector """ if isinstance(vector, np.ndarray) and vector.shape == (3,): vectorQuat = Quat(0, vector[0], vector[1], vector[2]) vectorQuatTransformed = (self * vectorQuat) * self.conjugate vectorTransformed = vectorQuatTransformed.quatCoef[1:4] return vectorTransformed raise TypeError("Vector must be a size 3 numpy array.") def misOri(self, right, symGroup, returnQuat=0): """Calculate misorientation angle between 2 orientations taking into account the symmetries of the crystal structure. Angle is 2*arccos(output). Args: rigth (quat): Orientation to find misorientation to symGroup (str): Crystal type (cubic, hexagonal) returnQuat (int): What to return Returns: various: returnQuat = 0 - misorientation returnQuat = 1 - symmetric equivalent with min misorientation returnQuat = 2 - both """ if isinstance(right, type(self)): minMisOri = 0 # actually looking for max of this as it is cos of misoriention angle for sym in Quat.symEqv(symGroup): # loop over symmetrically equivelent orienations quatSym = sym * right currentMisOri = abs(self.dot(quatSym)) if currentMisOri > minMisOri: # keep if misorientation lower minMisOri = currentMisOri minQuatSym = quatSym if returnQuat == 1: return minQuatSym elif returnQuat == 2: return minMisOri, minQuatSym else: return minMisOri raise TypeError("Input must be a quaternion.") def misOriAxis(self, right): """Calculate misorientation axis between 2 orientations. This does not consider symmetries of the crystal structure. Args: rigth (quat): Orientation to find misorientation axis to Returns: numpy.ndarray: axis of misorientation """ if isinstance(right, type(self)): Dq = right * self.conjugate Dq = Dq.quatCoef misOriAxis = (2 * Dq[1:4] * np.arccos(Dq[0])) / np.sqrt(1 - np.power(Dq[0], 2)) return misOriAxis raise TypeError("Input must be a quaternion.") # Static methods @staticmethod def createManyQuats(eulerArray): """Create a an array of quats from an array of Euler angles Args: eulerArray (array): Size 3 x n x ... x m """ ph1 = eulerArray[0] phi = eulerArray[1] ph2 = eulerArray[2] oriShape = eulerArray.shape[1:] quatComps = np.zeros((4,) + oriShape, dtype=float) quatComps[0] = np.cos(phi / 2.0) * np.cos((ph1 + ph2) / 2.0) quatComps[1] = -np.sin(phi / 2.0) * np.cos((ph1 - ph2) / 2.0) quatComps[2] = -np.sin(phi / 2.0) * np.sin((ph1 - ph2) / 2.0) quatComps[3] = -np.cos(phi / 2.0) * np.sin((ph1 + ph2) / 2.0) quats = np.empty(oriShape, dtype=Quat) for idx in np.ndindex(oriShape): quats[idx] = Quat(quatComps[(slice(None),) + idx]) # quatComps[(slice(None),) + idx] is equivalent to quatComps[:, idx[0], ..., idx[n]] return quats @staticmethod def calcSymEqvs(quats, symGroup): syms = Quat.symEqv(symGroup) quatComps = np.empty((len(syms), 4, len(quats))) # store quat components in array for i, quat in enumerate(quats): quatComps[0, :, i] = quat.quatCoef # calculate symmetrical equivalents for i, sym in enumerate(syms[1:], start=1): # sym[i] * quat for all points (* is quaternion product) quatComps[i, 0, :] = (quatComps[0, 0, :] * sym[0] - quatComps[0, 1, :] * sym[1] - quatComps[0, 2, :] * sym[2] - quatComps[0, 3, :] * sym[3]) quatComps[i, 1, :] = (quatComps[0, 0, :] * sym[1] + quatComps[0, 1, :] * sym[0] - quatComps[0, 2, :] * sym[3] + quatComps[0, 3, :] * sym[2]) quatComps[i, 2, :] = (quatComps[0, 0, :] * sym[2] + quatComps[0, 2, :] * sym[0] - quatComps[0, 3, :] * sym[1] + quatComps[0, 1, :] * sym[3]) quatComps[i, 3, :] = (quatComps[0, 0, :] * sym[3] + quatComps[0, 3, :] * sym[0] - quatComps[0, 1, :] * sym[2] + quatComps[0, 2, :] * sym[1]) # swap into positve hemisphere if required quatComps[i, :, quatComps[i, 0, :] < 0] = -quatComps[i, :, quatComps[i, 0, :] < 0] return quatComps @staticmethod def calcAverageOri(quatComps): avOri = np.copy(quatComps[0, :, 0]) currMisOris = np.empty(quatComps.shape[0]) for i in range(1, quatComps.shape[2]): # calculate misorientation between current average and all symmetrical equivalents # Dot product of each symm quat in quatComps with refOri for point i currMisOris[:] = abs(np.einsum("ij,j->i", quatComps[:, :, i], avOri)) # find min misorientation with current average then add to it maxIdx = np.argmax(currMisOris[:]) avOri += quatComps[maxIdx, :, i] # Convert components back to a quat and normalise avOri = Quat(avOri) avOri.normalise() return avOri @staticmethod def calcMisOri(quatComps, refOri): misOris = np.empty((quatComps.shape[0], quatComps.shape[2])) # Dot product of each quat in quatComps with refOri misOris[:, :] = abs(np.einsum("ijk,j->ik", quatComps, refOri.quatCoef)) maxIdxs0 = np.argmax(misOris, axis=0) maxIdxs1 = np.arange(misOris.shape[1]) minMisOris = misOris[maxIdxs0, maxIdxs1] minQuatComps = quatComps[maxIdxs0, :, maxIdxs1].transpose() minMisOris[minMisOris > 1] = 1 return minMisOris, minQuatComps @staticmethod def polarAngles(x, y, z): mod = np.sqrt(x**2 + y**2 + z**2) x = x / mod y = y / mod z = z / mod # alpha - angle with z axis alpha = np.arccos(z) # beta - angle around z axis beta = np.arctan2(y, x) return alpha, beta @staticmethod def stereoProject(*args): if len(args) == 3: alpha, beta = Quat.polarAngles(args[0], args[1], args[2]) elif len(args) == 2: alpha, beta = args else: raise Exception("3 arguments for pole directions and 2 for polar angles.") alphaComp = np.tan(alpha / 2) xp = alphaComp * np.cos(beta) yp = alphaComp * np.sin(beta) return xp, yp @staticmethod def plotLine(startPoint, endPoint, plotSymmetries=False, symGroup=None, res=100, projection=None, ax=None, **kwargs): if projection is None: projection = Quat.stereoProject if ax is None: ax = plt.gca() lines = [] lines.append((startPoint, endPoint)) if plotSymmetries: if symGroup is None: raise Exception("Please provide a symGroup") for symm in Quat.symEqv(symGroup)[1:]: startPointSymm = symm.transformVector(startPoint).astype(int) endPointSymm = symm.transformVector(endPoint).astype(int) if startPointSymm[2] < 0: startPointSymm *= -1 if endPointSymm[2] < 0: endPointSymm *= -1 lines.append((startPointSymm, endPointSymm)) linePoints = np.zeros((3, res), dtype=float) for line in lines: for i in range(3): if line[0][i] == line[1][i]: linePoints[i] = np.full(res, line[0][i]) else: linePoints[i] = np.linspace(line[0][i], line[1][i], res) xp, yp = projection(linePoints[0], linePoints[1], linePoints[2]) ax.plot(xp, yp, **kwargs) @staticmethod def labelPoint(point, label, projection=None, ax=None, padX=0, padY=0, **kwargs): if projection is None: projection = Quat.stereoProject if ax is None: ax = plt.gca() xp, yp = projection(point[0], point[1], point[2]) ax.text(xp + padX, yp + padY, label, **kwargs) @staticmethod def plotPoleAxis(plotType, symGroup, ax=None): if ax is None: ax = plt.gca() if plotType == "IPF" and symGroup == "cubic": # line between [001] and [111] Quat.plotLine(np.array([0, 0, 1]), np.array([1, 1, 1]), ax=ax, c='k', lw=2) # line between [001] and [101] Quat.plotLine(np.array([0, 0, 1]), np.array([1, 0, 1]), ax=ax, c='k', lw=2) # line between [101] and [111] Quat.plotLine(np.array([1, 0, 1]), np.array([1, 1, 1]), ax=ax, c='k', lw=2) # label poles Quat.labelPoint(np.array([0, 0, 1]), '001', ax=ax, padY=-0.005, va='top', ha='center') Quat.labelPoint(np.array([1, 0, 1]), '101', ax=ax, padY=-0.005, va='top', ha='center') Quat.labelPoint(np.array([1, 1, 1]), '111', ax=ax, padY=0.005, va='bottom', ha='center') ax.axis('equal') ax.axis('off') else: print("Only works for cubic") @staticmethod def plotIPF(quats, direction, symGroup, ax=None, **kwargs): plotParams = {'marker': '+', 'c': 'r'} plotParams.update(kwargs) if ax is None: ax = plt.gca() if symGroup == "hexagonal": raise Exception("Have fun with that") # Plot IPF axis # plt.figure() Quat.plotPoleAxis("IPF", symGroup, ax=ax) # get array of symmetry operations. shape - (numSym, 4, numQuats) quatCompsSym = Quat.calcSymEqvs(quats, symGroup) # array to store crytal directions for all orientations and symmetries directionCrystal = np.empty((3, quatCompsSym.shape[0], quatCompsSym.shape[2])) # temp variables to use bleow quatDotVec = (quatCompsSym[:, 1, :] * direction[0] + quatCompsSym[:, 2, :] * direction[1] + quatCompsSym[:, 3, :] * direction[2]) temp = (np.square(quatCompsSym[:, 0, :]) - np.square(quatCompsSym[:, 1, :]) - np.square(quatCompsSym[:, 2, :]) - np.square(quatCompsSym[:, 3, :])) # transform the pole direction to crystal coords for all orientations and symmetries # (quatCompsSym * vectorQuat) * quatCompsSym.conjugate directionCrystal[0, :, :] = (2 * quatDotVec * quatCompsSym[:, 1, :] + temp * direction[0] + 2 * quatCompsSym[:, 0, :] * (quatCompsSym[:, 2, :] * direction[2] - quatCompsSym[:, 3, :] * direction[1])) directionCrystal[1, :, :] = (2 * quatDotVec * quatCompsSym[:, 2, :] + temp * direction[1] + 2 * quatCompsSym[:, 0, :] * (quatCompsSym[:, 3, :] * direction[0] - quatCompsSym[:, 1, :] * direction[2])) directionCrystal[2, :, :] = (2 * quatDotVec * quatCompsSym[:, 3, :] + temp * direction[2] + 2 * quatCompsSym[:, 0, :] * (quatCompsSym[:, 1, :] * direction[1] - quatCompsSym[:, 2, :] * direction[0])) # normalise vectors directionCrystal /= np.sqrt(np.einsum('ijk,ijk->jk', directionCrystal, directionCrystal)) # move all vectors into north hemisphere directionCrystal[:, directionCrystal[2, :, :] < 0] *= -1 # convert to spherical coordinates alpha, beta = Quat.polarAngles(directionCrystal[0], directionCrystal[1], directionCrystal[2]) # find the poles in the fundamental triangle if symGroup == "cubic": # first beta should be between 0 and 45 deg leaving 3 symmetric equivalents per orientation trialPoles = np.logical_and(beta >= 0, beta <= np.pi / 4) # if less than 3 left need to expand search slighly to catch edge cases if np.sum(np.sum(trialPoles, axis=0) < 3) > 0: deltaBeta = 1e-8 trialPoles = np.logical_and(beta >= -deltaBeta, beta <= np.pi / 4 + deltaBeta) # create array to store angles of pols in fundermental triangle alphaFund, betaFund = np.empty((quatCompsSym.shape[2])), np.empty((quatCompsSym.shape[2])) # now of symmetric equivalents left we want the one with minimum alpha # loop over different orientations for i in range(trialPoles.shape[1]): # create array of indexes of poles kept in previous step trialPoleIdxs = np.arange(trialPoles.shape[0])[trialPoles[:, i]] # find pole with minimum alpha of those kept in previous step # then use trialPoleIdxs to get its index in original arrays poleIdx = trialPoleIdxs[np.argmin(alpha[trialPoles[:, i], i])] # add to final array of poles alphaFund[i] = alpha[poleIdx, i] betaFund[i] = beta[poleIdx, i] else: print("Only works for cubic") # project onto equatorial plane xp, yp = Quat.stereoProject(alphaFund, betaFund) # plot poles ax.scatter(xp, yp, **plotParams) @staticmethod def symEqv(group): overRoot2 = np.sqrt(2) / 2 sqrt3over2 = np.sqrt(3) / 2 qsym = [] # identity - this should always be returned as the first symmetry qsym.append(Quat(np.array([1.0, 0.0, 0.0, 0.0]))) # from <NAME>'s fspl_orir.f90 code # checked for consistency with mtex # cubic tetrads(100) qsym.append(Quat(np.array([overRoot2, overRoot2, 0.0, 0.0]))) qsym.append(Quat(np.array([0.0, 1.0, 0.0, 0.0]))) qsym.append(Quat(
np.array([overRoot2, -overRoot2, 0.0, 0.0])
numpy.array
""" Derived from: https://github.com/kratzert/finetune_alexnet_with_tensorflow/ """ import numpy as np import cv2 class BatchPreprocessor(object): def __init__(self, dataset_file_path, num_classes, output_size=[227, 227], horizontal_flip=False, shuffle=False, mean_color=[132.2766, 139.6506, 146.9702], multi_scale=None): self.num_classes = num_classes self.output_size = output_size self.horizontal_flip = horizontal_flip self.shuffle = shuffle self.mean_color = mean_color self.multi_scale = multi_scale self.pointer = 0 self.images = [] self.labels = [] # Read the dataset file dataset_file = open(dataset_file_path) lines = dataset_file.readlines() for line in lines: items = line.split() self.images.append(items[0]) self.labels.append(int(items[1])) # Shuffle the data if self.shuffle: self.shuffle_data() def shuffle_data(self): images = self.images[:] labels = self.labels[:] self.images = [] self.labels = [] idx = np.random.permutation(len(labels)) for i in idx: self.images.append(images[i]) self.labels.append(labels[i]) def reset_pointer(self): self.pointer = 0 if self.shuffle: self.shuffle_data() def next_batch(self, batch_size): # Get next batch of image (path) and labels paths = self.images[self.pointer:(self.pointer+batch_size)] labels = self.labels[self.pointer:(self.pointer+batch_size)] # Update pointer self.pointer += batch_size # Read images images = np.ndarray([batch_size, self.output_size[0], self.output_size[1], 3]) for i in range(len(paths)): img = cv2.imread(paths[i]) # Flip image at random if flag is selected if self.horizontal_flip and np.random.random() < 0.5: img = cv2.flip(img, 1) if self.multi_scale is None: # Resize the image for output img = cv2.resize(img, (self.output_size[0], self.output_size[0])) img = img.astype(np.float32) elif isinstance(self.multi_scale, list): # Resize to random scale new_size = np.random.randint(self.multi_scale[0], self.multi_scale[1], 1)[0] img = cv2.resize(img, (new_size, new_size)) img = img.astype(np.float32) # random crop at output size diff_size = new_size - self.output_size[0] random_offset_x = np.random.randint(0, diff_size, 1)[0] random_offset_y =
np.random.randint(0, diff_size, 1)
numpy.random.randint
from __future__ import division from Metodo import Metodo from bokeh.plotting import figure, output_file, show from bokeh.embed import components import numpy as np from numpy import sin, cos, tan, sqrt, e, pi, log, \ cosh, sinh, tanh, arccos, arcsin, abs, arctan
np.seterr(divide="ignore", invalid="ignore")
numpy.seterr
import argparse from planet_wind_constants import * from scipy.special import wofz import time from scipy.optimize import newton from scipy.interpolate import interp1d from scipy.integrate import quad from scipy.interpolate import RegularGridInterpolator import planet_wind_utils_v6 as pw import numpy as np import matplotlib.pyplot as plt import matplotlib as mpl import deepdish as dd # pip install deepdish mpl.use('Agg') #from scipy.optimize import root def I(mu, ld1, ld2): return np.where(mu == 0.0, 0.0, (1. - ld1 * (1. - mu) - ld2 * (1. - mu)**2)) def Voigt(x, alpha, gamma): sigma = alpha / np.sqrt(2.0*np.log(2.0)) return np.real(wofz((x + 1j*gamma)/sigma/np.sqrt(2.0)))/sigma/np.sqrt(2.0*np.pi) def New_get_interp_function(d, var): dph = np.gradient(d['x3v'])[0] x3v = np.append(d['x3v'][0]-dph, d['x3v']) x3v = np.append(x3v, x3v[-1]+dph) var_data = np.append([var[-1]], var, axis=0) var_data = np.append(var_data, [var_data[0]], axis=0) var_interp = RegularGridInterpolator( (x3v, d['x2v'], d['x1v']), var_data, bounds_error=True) return var_interp def initial_guess(floor_val = 1.e-30): # initial guess for electron number density ne_init = 0.1*d['rho']*Xuni/c.mp #print("ne_init:",np.sum(ne_init)) # initial guess for number density of H I nh1 = np.copy(d['rho']*Xuni/c.mp - ne_init) nhe1 = np.copy(d['rho']*Yuni/(4.0*c.mp)) nhe3 = np.ones_like(nhe1)*floor_val #print("nh1:",np.sum(nh1)) #print("nhe1:",np.sum(nhe1)) #print("nhe3:",np.sum(nhe3)) # initial guess for optical depth in each cell tau_integral = np.clip(nh1*sigma_photo_nu0*d['gx1v'],floor_val,100) tau1_integral = np.clip(nhe1*sigma_photo_nu1*d['gx1v'],floor_val,100) tau3_integral = np.clip(nhe3*sigma_photo_nu3*d['gx1v'],floor_val,100) #print ("tau:", np.sum(tau_integral) ) #print ("tau1:", np.sum(tau1_integral) ) #print ("tau3:", np.sum(tau3_integral) ) ne = apply_lim( phi*np.exp(-tau_integral)/(2.0*alpha) * (np.sqrt(1.0 + apply_lim(4.0*d['rho']*Xuni*alpha/(c.mp*phi*np.exp(-tau_integral)), floor_val)) - 1.0), floor_val) # electrons from hydrogen ionization nh1= apply_lim(d['rho']*Xuni/c.mp - ne, floor_val) # neutral hydrogen return tau_integral, tau1_integral, tau3_integral, ne, nh1 def new_guess(tau_integral, tau1_integral, tau3_integral, ne, nh1, floor_val = 1.e-30): # H number desnity nh_plus = apply_lim( phi*np.exp(-1.0*tau_integral)*d['rho']*Xuni/c.mp / (phi*np.exp(-1.0*tau_integral) + ne*alpha), floor_val ) # ionized hydrogen print('diff nh1 (med, av):',np.median(d['rho']*Xuni/c.mp - nh_plus - nh1), np.average(d['rho']*Xuni/c.mp - nh_plus - nh1)) nh1 = apply_lim(d['rho']*Xuni/c.mp - nh_plus, floor_val) # neutral hydrogen # helium number densities f3 = apply_lim((ne*alpha1 - (ne*alpha3)*(ne*alpha1 + phi1*np.exp(-1.0*tau1_integral) + ne*q13a)/(ne*alpha3 - ne*q13a)) / (ne*alpha1 - A31 - ne*q31a - ne*q31b - nh1*Q31 - (ne*alpha1 + phi1*np.exp(-1.0*tau1_integral) + ne*q13a)*(ne*alpha3 + A31 + phi3*np.exp(-1.0*tau3_integral) + ne*q31a + ne*q31b + nh1*Q31)/(ne*alpha3 - ne*q13a)), floor_val) f1 = apply_lim((ne*alpha3 - f3*(ne*alpha3 + A31 + phi3*np.exp(-tau3_integral) + ne*q31a + ne*q31b + nh1*Q31)) / (ne*alpha3 - ne*q13a), floor_val) nhe1 = apply_lim(f1*d['rho']*Yuni/(4.0*c.mp), floor_val) # ground-state helium nhe3 = apply_lim(f3*d['rho']*Yuni/(4.0*c.mp), floor_val) # metastable-state helium # ionized helium nhe_plus = apply_lim((1.0 - f1 - f3)*d['rho']*Yuni/(4.0*c.mp), floor_val) # optical depth tau_integral = np.clip(nh1*sigma_photo_nu0*d['gx1v'],floor_val,100) tau1_integral = np.clip(nhe1*sigma_photo_nu1*d['gx1v'],floor_val,100) tau3_integral = np.clip(nhe3*sigma_photo_nu3*d['gx1v'],floor_val,100) ne = np.copy(nh_plus + nhe_plus) return ne, nh1, nh_plus, nhe1, nhe3, nhe_plus, tau_integral, tau1_integral, tau3_integral def generate_random(N_mc): theta = 2*np.pi*np.random.random_sample(N_mc) r = np.sqrt(np.random.random_sample(N_mc)) yrandom = r*np.cos(theta) zrandom = r*np.sin(theta) return yrandom, zrandom def generate_random_weighted(N_mc,yp,zp,rad_planet_frac): yrandom = [] zrandom = [] rad = [] while len(yrandom)<N_mc: theta = np.random.uniform(0,2*np.pi) r = (1+np.sqrt(yp**2 + zp**2))*(np.random.uniform(0,1))**1.5 if (r>rad_planet_frac): yr = yp + r*np.cos(theta) zr = zp + r*np.sin(theta) if(yr**2 + zr**2 < 1): rad.append(r) yrandom.append(yr) zrandom.append(zr) yrandom = np.array(yrandom) zrandom = np.array(zrandom) rad = np.array(rad) weights = rad**(4/3.) norm = np.sum(weights) weights *= norm**-1 return yrandom, zrandom, weights def generate_rays_weighted(Nr,slope,yp,zp,rad_planet_frac): """Nr is the number of radius bins from the planet, slope is the power law sampling (1=linear, <1 is centrally concentrated)""" #rf = np.logspace(np.log10(rad_planet_frac),np.log10(1+np.sqrt(yp**2 + zp**2)),Nr) # faces of the rings rf = np.linspace(rad_planet_frac**slope,(1+np.sqrt(yp**2 + zp**2))**slope,Nr)**(1/slope) ra = (2/3)*(rf[1:]**3 - rf[0:-1]**3)/(rf[1:]**2 - rf[0:-1]**2) ## Area weighted centers dr = rf[1:]-rf[0:-1] rr = [] tt = [] da = [] for i in range(len(ra)): Nth = np.int(np.round(2*np.pi*ra[i] / dr[i])) th = np.linspace(0,2*np.pi,Nth+1) th = 0.5*(th[1:]+th[0:-1]) dth = th[1]-th[0] for j in range(Nth): rr.append(ra[i]) tt.append(th[j]) da.append( np.pi*(rf[i+1]**2-rf[i]**2)/Nth ) rr = np.array(rr).flatten() tt = np.array(tt).flatten() da = np.array(da).flatten() yrays = yp + rr*np.cos(tt) zrays = zp + rr*np.sin(tt) sel = np.sqrt(yrays**2 + zrays**2 ) < 1.0 yrays = yrays[sel].copy() zrays = zrays[sel].copy() da = da[sel].copy() print("selected N=",len(yrays),"rays") return yrays,zrays,da def sum_tau_LOS(ray): nu_array = np.broadcast_to(nu, (len(ray['vx']), len(nu))) vx_array = np.broadcast_to(ray['vx'], (len(nu), len(ray['vx']))).T vy_array = np.broadcast_to(ray['vy'], (len(nu), len(ray['vx']))).T nhe3_array = np.broadcast_to(ray['nhe3'], (len(nu), len(ray['vx']))).T dl_array = np.broadcast_to(ray['dl'], (len(nu), len(ray['vx']))).T da1_array = np.broadcast_to(ray['da1'], (len(nu), len(ray['vx']))).T da2_array = np.broadcast_to(ray['da2'], (len(nu), len(ray['vx']))).T da3_array = np.broadcast_to(ray['da3'], (len(nu), len(ray['vx']))).T delta_u1 = np.copy(c.c*(nu_array-nu1)/nu1 + (vx_array * np.cos(azim_angle) + vy_array*np.sin(azim_angle))*np.sign(x2)) xx1 = np.copy(delta_u1*nu1/c.c) delta_u2 = np.copy(c.c*(nu_array-nu2)/nu2 + (vx_array * np.cos(azim_angle) + vy_array*np.sin(azim_angle))*np.sign(x2)) xx2 = np.copy(delta_u2*nu2/c.c ) delta_u3 = np.copy(c.c*(nu_array-nu3)/nu3 + (vx_array * np.cos(azim_angle) + vy_array*np.sin(azim_angle))*np.sign(x2)) xx3 = np.copy(delta_u3*nu3/c.c) tauLOS1 = np.sum(nhe3_array*dl_array*cs1 * Voigt(xx1, da1_array, natural_gamma), axis=0) tauLOS2 = np.sum(nhe3_array*dl_array*cs2 * Voigt(xx2, da2_array, natural_gamma), axis=0) tauLOS3 = np.sum(nhe3_array*dl_array*cs3 * Voigt(xx3, da3_array, natural_gamma), axis=0) return tauLOS1, tauLOS2, tauLOS3 def MC_ray(dart): """ computes sum of tau along LOS of a ray defined by integer 'dart' """ ydart = yrandom[dart] zdart = zrandom[dart] print('dart: ', dart, ydart, zdart) ray = pw.get_ray(planet_pos=(x2, y2, z2), ydart=ydart, zdart=zdart, azim_angle=azim_angle, pol_angle=0.0, rstar=rad_star, rplanet=rp, fstep=f_raystep, inner_lim=in_lim, outer_lim=out_lim) #print(ray['l']) #print("min dl / rp= ",np.min(ray['dl'])/rp ) # boolean, whether the ray intersects the planet throughplanet = (np.amin( np.sqrt( (ray['x']-x2)**2 + (ray['y']-y2)**2 + (ray['z']-z2)**2 ) ) < rp) ray['nhe3'] = nhe3_interp((ray['phi'], ray['theta'], ray['r'])) ray['vx'] = vx_interp((ray['phi'], ray['theta'], ray['r'])) ray['vy'] = vy_interp((ray['phi'], ray['theta'], ray['r'])) ray['vz'] = vz_interp((ray['phi'], ray['theta'], ray['r'])) ray['temp'] = temp_interp((ray['phi'], ray['theta'], ray['r'])) ray['da1'] = np.sqrt(2.0*np.log(2.0))*nu1 * \ np.sqrt(0.25*c.kB*ray['temp']/c.mp)/c.c ray['da2'] = np.sqrt(2.0*np.log(2.0))*nu2 * \ np.sqrt(0.25*c.kB*ray['temp']/c.mp)/c.c ray['da3'] = np.sqrt(2.0*np.log(2.0))*nu3 * \ np.sqrt(0.25*c.kB*ray['temp']/c.mp)/c.c tauLOS1, tauLOS2, tauLOS3 = sum_tau_LOS(ray) if throughplanet: expfac = np.zeros_like(tauLOS1) print ("...planet crossing ray!") else: expfac = np.exp(-tauLOS1 - tauLOS2 - tauLOS3) return expfac def make_plots(it_num, jcoord): # temp plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][:, jcoord, :], d['y'][:, jcoord, :], np.log10( d['temp'][:, jcoord, :]), cmap=plt.cm.Spectral, vmax=6, vmin=2,shading='auto') plt.colorbar(label=r"T [K]") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'temp_'+str(it_num+1)+'.png') plt.close() # tau hydrogen plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][:, jcoord, :], d['y'][:, jcoord, :], np.log10( tau_integral[:, jcoord, :]), cmap=plt.cm.magma, vmax=-2.0, vmin=-7.0,shading='auto') plt.colorbar(label=r"$\tau$") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'tauHI_'+str(it_num+1)+'.png') plt.close() # tau helium singlet plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][:, jcoord, :], d['y'][:, jcoord, :], np.log10( tau1_integral[:, jcoord, :]), cmap=plt.cm.magma, vmax=-2.0, vmin=-7.0,shading='auto') plt.colorbar(label=r"$\tau1$") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'tauHe1_'+str(it_num+1)+'.png') plt.close() # tau helium triplet plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][:, jcoord, :], d['y'][:, jcoord, :], np.log10( tau3_integral[:, jcoord, :]), cmap=plt.cm.magma, vmax=0.0, vmin=-7.0,shading='auto') plt.colorbar(label=r"$\tau3$") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'tauHe3_'+str(it_num+1)+'.png') plt.close() # electron number density plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][:, jcoord, :], d['y'][:, jcoord, :], np.log10( ne[:, jcoord, :]), cmap=plt.cm.magma, vmax=10.0, vmin=-5.0,shading='auto') plt.colorbar(label=r"ne") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'ne_'+str(it_num+1)+'.png') plt.close() # H I number density plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][:, jcoord, :], d['y'][:, jcoord, :], np.log10( nh1[:, jcoord, :]), cmap=plt.cm.magma, vmax=10.0, vmin=-5.0,shading='auto') plt.colorbar(label=r"nh1") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'nh1_'+str(it_num+1)+'.png') plt.close() # He I singlet number density plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][:, jcoord, :], d['y'][:, jcoord, :], np.log10( nhe1[:, jcoord, :]), cmap=plt.cm.magma, vmax=10.0, vmin=-5.0,shading='auto') plt.colorbar(label=r"nhe1") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'nhe1_'+str(it_num+1)+'.png') plt.close() # He I triplet number density plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][:, jcoord, :], d['y'][:, jcoord, :], np.log10( nhe3[:, jcoord, :]), cmap=plt.cm.magma, vmax=5.0, vmin=-7.0,shading='auto') plt.colorbar(label=r"nhe3") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'nhe3_'+str(it_num+1)+'.png') plt.close() def make_side_plots(it_num, icoord): # tau plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][icoord, :, :], d['z'][icoord, :, :], np.log10( tau_integral[icoord, :, :]), cmap=plt.cm.magma, vmax=0.0, vmin=-7.0,shading='auto') plt.colorbar(label=r"$\tau$") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'stau05_'+str(it_num+1)+'.png') plt.close() # H I number density plt.figure(figsize=(8, 8)) plt.pcolormesh(d['x'][icoord, :, :], d['z'][icoord, :, :], np.log10( nh1[icoord, :, :]), cmap=plt.cm.magma, vmax=10.0, vmin=-5.0,shading='auto') plt.colorbar(label=r"nh1") plt.axis('equal') plt.plot(x2, y2, 'w*') plt.xlim(-lim/2-a, lim/2-a) plt.ylim(-lim/2, lim/2) plt.savefig(base_dir+'snh05_'+str(it_num+1)+'.png') plt.close() def get_BC_prop(d): bc_ind = np.argmin(d['rp'].flatten()) print("rp/Rp=", d['rp'].flatten()[bc_ind] / rp) pp = d['press'].flatten()[bc_ind] rhop = d['rho'].flatten()[bc_ind] Bern = gamma/(gamma-1.0)*pp/rhop - c.G*m2/rp print("Bern = ", Bern) K = pp/rhop**gamma print("K =", K) lambda_planet = c.G*m2*rhop/(gamma*pp*rp) print("lambda = ", lambda_planet) mdot_est = np.pi*rhop * \ np.sqrt(c.G*m2*(rp*lambda_planet)**3)*np.exp(1.5-lambda_planet) print("mdot_est =", mdot_est) return Bern, K, lambda_planet, mdot_est def parker_fv(v, r): return v*np.exp(-0.5*v*v/(vS*vS))/vS - rS*rS*np.exp(-2.0*rS/r + 1.5)/(r*r) def parker_frho(r, v): return rhoS*np.exp(2.0*rS/r - 1.5 - 0.5*v*v/(vS*vS)) def get_Parker_rho_v_func(r_out=1.e11, num=1000): vguess = 1.e5 r_aux = np.linspace(1.0/(0.9*rp), 1/r_out, num) r = 1.0/r_aux res_v =
np.zeros(num)
numpy.zeros
# MIT License # # Copyright (c) 2017 <NAME>, <NAME> # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in all # copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # SOFTWARE. import numpy as np import matplotlib.pyplot as plt import threading from src.manager.DataManager import DataManager from src.manager.RunManager import RunManager from src.manager.PlotManager import PlotManager from src.utils.Progressbar import Progressbar from src.utils.ThreadedPause import ThreadedPause class ScriptRunner: def __init__(self, run_config, model_details): self.run_config = run_config self.model_details = model_details # Format settings line_length = 80 line = line_length * "-" print(line) # create the log directory helper self.run_manager = RunManager(run_config) print(line) # Initialize the model self.run_manager.init_model(model_details) self.stats = self.run_manager.create_stats() self.conf = self.run_manager.model_config print(line) # transformation parameters run_config['in_length'] = self.run_manager.model_config['rec_num_layers'] run_config['out_length'] = self.run_manager.model_config['rec_num_layers_teacher_forcing'] \ + self.run_manager.model_config['rec_num_layers_student_forcing'] # create the data manager and get the transformed data loader = DataManager(run_config) self.data_sets = loader.load_divided_data() set_labels = run_config['set_labels'] # define the size of training and validation set for set_index in range(len(self.data_sets)): data = self.data_sets[set_index] size = np.size(data[0], 2) label = set_labels[set_index] print("Size of Set {} is {}".format(size, label)) print(line) # create model header print("Model {} ({})".format(self.run_manager.model.name, self.conf['model_params'])) print(line) # create progressbar self.p_bar = Progressbar(self.conf['episodes'], line_length) # status variables self.update = False self.semaphore = threading.Semaphore() self.progress_count = self.run_manager.current_episode self.stats.last_episode = self.run_manager.current_episode - 1 # obtain slices etc. validation_set_index = self.run_config['validation_set_index'] train_set_index = self.run_config['train_set_index'] val_data = self.data_sets[validation_set_index] train_data = self.data_sets[train_set_index] num_vis_traj = self.run_config['num_visualized_results'] va_slices = np.random.permutation(np.size(val_data[0], 2))[:num_vis_traj] tr_slices = np.random.permutation(np.size(train_data[0], 2))[:num_vis_traj] self.all_in = np.concatenate((train_data[0][:, :, tr_slices], val_data[0][:, :, va_slices]), axis=2) real_output = np.concatenate((train_data[1][:, :, tr_slices], val_data[1][:, :, va_slices]), axis=2) pred_output = self.run_manager.model.predict(self.all_in) self.plots = PlotManager(run_config['num_visualized_results'], run_config['input_grouping'], run_config['output_grouping'], self.all_in, real_output, pred_output) # set interactive mode on plt.ion() plt.show() if self.run_manager.current_episode > 0: self.stats.plot() self.plots.plot() thread = threading.Thread(None, self.train, "Training Thread") thread.start() while thread.is_alive(): self.plot() ThreadedPause.pause(2) def train(self): validation_set_index = self.run_config['validation_set_index'] train_set_index = self.run_config['train_set_index'] train_data = self.data_sets[train_set_index] # set the range for episode in range(self.run_manager.current_episode, self.conf['episodes']): # execute as much episodes for step in range(self.conf['steps_per_episode']): # sample them randomly according to the batch size and train the model slices = np.random.randint(0,
np.size(train_data[0], 2)
numpy.size
############################################################################### # actionAngle: a Python module to calculate actions, angles, and frequencies # # class: actionAngleIsochroneApprox # # Calculate actions-angle coordinates for any potential by using # an isochrone potential as an approximate potential and using # a Fox & Binney (2013?) + torus machinery-like algorithm # (angle-fit) (Bovy 2014) # # methods: # __call__: returns (jr,lz,jz) # actionsFreqs: returns (jr,lz,jz,Or,Op,Oz) # actionsFreqsAngles: returns (jr,lz,jz,Or,Op,Oz,ar,ap,az) # ############################################################################### import math import warnings import numpy as nu import numpy.linalg as linalg from scipy import optimize from galpy.potential import dvcircdR, vcirc, _isNonAxi from galpy.potential.Potential import flatten as flatten_potential from .actionAngleIsochrone import actionAngleIsochrone from .actionAngle import actionAngle from galpy.potential import IsochronePotential, MWPotential from galpy.util import bovy_plot, galpyWarning from galpy.util.bovy_conversion import physical_conversion, \ potential_physical_input, time_in_Gyr _TWOPI= 2.*nu.pi _ANGLETOL= 0.02 #tolerance for deciding whether full angle range is covered _APY_LOADED= True try: from astropy import units except ImportError: _APY_LOADED= False class actionAngleIsochroneApprox(actionAngle): """Action-angle formalism using an isochrone potential as an approximate potential and using a Fox & Binney (2014?) like algorithm to calculate the actions using orbit integrations and a torus-machinery-like angle-fit to get the angles and frequencies (Bovy 2014)""" def __init__(self,*args,**kwargs): """ NAME: __init__ PURPOSE: initialize an actionAngleIsochroneApprox object INPUT: Either: b= scale parameter of the isochrone parameter (can be Quantity) ip= instance of a IsochronePotential aAI= instance of an actionAngleIsochrone pot= potential to calculate action-angle variables for tintJ= (default: 100) time to integrate orbits for to estimate actions (can be Quantity) ntintJ= (default: 10000) number of time-integration points integrate_method= (default: 'dopr54_c') integration method to use dt= (None) orbit.integrate dt keyword (for fixed stepsize integration) maxn= (default: 3) Default value for all methods when using a grid in vec(n) up to this n (zero-based) ro= distance from vantage point to GC (kpc; can be Quantity) vo= circular velocity at ro (km/s; can be Quantity) OUTPUT: instance HISTORY: 2013-09-10 - Written - Bovy (IAS) """ actionAngle.__init__(self, ro=kwargs.get('ro',None),vo=kwargs.get('vo',None)) if not 'pot' in kwargs: #pragma: no cover raise IOError("Must specify pot= for actionAngleIsochroneApprox") self._pot= flatten_potential(kwargs['pot']) if self._pot == MWPotential: warnings.warn("Use of MWPotential as a Milky-Way-like potential is deprecated; galpy.potential.MWPotential2014, a potential fit to a large variety of dynamical constraints (see Bovy 2015), is the preferred Milky-Way-like potential in galpy", galpyWarning) if not 'b' in kwargs and not 'ip' in kwargs \ and not 'aAI' in kwargs: #pragma: no cover raise IOError("Must specify b=, ip=, or aAI= for actionAngleIsochroneApprox") if 'aAI' in kwargs: if not isinstance(kwargs['aAI'],actionAngleIsochrone): #pragma: no cover raise IOError("'Provided aAI= does not appear to be an instance of an actionAngleIsochrone") self._aAI= kwargs['aAI'] elif 'ip' in kwargs: ip= kwargs['ip'] if not isinstance(ip,IsochronePotential): #pragma: no cover raise IOError("'Provided ip= does not appear to be an instance of an IsochronePotential") self._aAI= actionAngleIsochrone(ip=ip) else: if _APY_LOADED and isinstance(kwargs['b'],units.Quantity): b= kwargs['b'].to(units.kpc).value/self._ro else: b= kwargs['b'] self._aAI= actionAngleIsochrone(ip=IsochronePotential(b=b, normalize=1.)) self._tintJ= kwargs.get('tintJ',100.) if _APY_LOADED and isinstance(self._tintJ,units.Quantity): self._tintJ= self._tintJ.to(units.Gyr).value\ /time_in_Gyr(self._vo,self._ro) self._ntintJ= kwargs.get('ntintJ',10000) self._integrate_dt= kwargs.get('dt',None) self._tsJ= nu.linspace(0.,self._tintJ,self._ntintJ) self._integrate_method= kwargs.get('integrate_method','dopr54_c') self._maxn= kwargs.get('maxn',3) self._c= False ext_loaded= False if ext_loaded and (('c' in kwargs and kwargs['c']) or not 'c' in kwargs): #pragma: no cover self._c= True else: self._c= False # Check the units self._check_consistent_units() return None def _evaluate(self,*args,**kwargs): """ NAME: __call__ (_evaluate) PURPOSE: evaluate the actions (jr,lz,jz) INPUT: Either: a) R,vR,vT,z,vz[,phi]: 1) floats: phase-space value for single object (phi is optional) (each can be a Quantity) 2) numpy.ndarray: [N] phase-space values for N objects (each can be a Quantity) b) Orbit instance: initial condition used if that's it, orbit(t) if there is a time given as well as the second argument cumul= if True, return the cumulative average actions (to look at convergence) OUTPUT: (jr,lz,jz) HISTORY: 2013-09-10 - Written - Bovy (IAS) """ R,vR,vT,z,vz,phi= self._parse_args(False,False,*args) if self._c: #pragma: no cover pass else: #Use self._aAI to calculate the actions and angles in the isochrone potential acfs= self._aAI._actionsFreqsAngles(R.flatten(), vR.flatten(), vT.flatten(), z.flatten(), vz.flatten(), phi.flatten()) jrI= nu.reshape(acfs[0],R.shape)[:,:-1] jzI= nu.reshape(acfs[2],R.shape)[:,:-1] anglerI= nu.reshape(acfs[6],R.shape) anglezI= nu.reshape(acfs[8],R.shape) if nu.any((nu.fabs(nu.amax(anglerI,axis=1)-_TWOPI) > _ANGLETOL)\ *(nu.fabs(nu.amin(anglerI,axis=1)) > _ANGLETOL)): #pragma: no cover warnings.warn("Full radial angle range not covered for at least one object; actions are likely not reliable",galpyWarning) if nu.any((nu.fabs(nu.amax(anglezI,axis=1)-_TWOPI) > _ANGLETOL)\ *(nu.fabs(nu.amin(anglezI,axis=1)) > _ANGLETOL)): #pragma: no cover warnings.warn("Full vertical angle range not covered for at least one object; actions are likely not reliable",galpyWarning) danglerI= ((nu.roll(anglerI,-1,axis=1)-anglerI) % _TWOPI)[:,:-1] danglezI= ((nu.roll(anglezI,-1,axis=1)-anglezI) % _TWOPI)[:,:-1] if kwargs.get('cumul',False): sumFunc= nu.cumsum else: sumFunc= nu.sum jr= sumFunc(jrI*danglerI,axis=1)/sumFunc(danglerI,axis=1) jz= sumFunc(jzI*danglezI,axis=1)/sumFunc(danglezI,axis=1) if _isNonAxi(self._pot): lzI= nu.reshape(acfs[1],R.shape)[:,:-1] anglephiI= nu.reshape(acfs[7],R.shape) danglephiI= ((nu.roll(anglephiI,-1,axis=1)-anglephiI) % _TWOPI)[:,:-1] if nu.any((nu.fabs(nu.amax(anglephiI,axis=1)-_TWOPI) > _ANGLETOL)\ *(nu.fabs(nu.amin(anglephiI,axis=1)) > _ANGLETOL)): #pragma: no cover warnings.warn("Full azimuthal angle range not covered for at least one object; actions are likely not reliable",galpyWarning) lz= sumFunc(lzI*danglephiI,axis=1)/sumFunc(danglephiI,axis=1) else: lz= R[:,0]*vT[:,0] return (jr,lz,jz) def _actionsFreqs(self,*args,**kwargs): """ NAME: actionsFreqs (_actionsFreqs) PURPOSE: evaluate the actions and frequencies (jr,lz,jz,Omegar,Omegaphi,Omegaz) INPUT: Either: a) R,vR,vT,z,vz[,phi]: 1) floats: phase-space value for single object (phi is optional) (each can be a Quantity) 2) numpy.ndarray: [N] phase-space values for N objects (each can be a Quantity) b) Orbit instance: initial condition used if that's it, orbit(t) if there is a time given as well as the second argument maxn= (default: object-wide default) Use a grid in vec(n) up to this n (zero-based) ts= if set, the phase-space points correspond to these times (IF NOT SET, WE ASSUME THAT ts IS THAT THAT IS ASSOCIATED WITH THIS OBJECT) _firstFlip= (False) if True and Orbits are given, the backward part of the orbit is integrated first and stored in the Orbit object OUTPUT: (jr,lz,jz,Omegar,Omegaphi,Omegaz) HISTORY: 2013-09-10 - Written - Bovy (IAS) """ acfs= self._actionsFreqsAngles(*args,**kwargs) return (acfs[0],acfs[1],acfs[2],acfs[3],acfs[4],acfs[5]) def _actionsFreqsAngles(self,*args,**kwargs): """ NAME: actionsFreqsAngles (_actionsFreqsAngles) PURPOSE: evaluate the actions, frequencies, and angles (jr,lz,jz,Omegar,Omegaphi,Omegaz,angler,anglephi,anglez) INPUT: Either: a) R,vR,vT,z,vz[,phi]: 1) floats: phase-space value for single object (phi is optional) (each can be a Quantity) 2) numpy.ndarray: [N] phase-space values for N objects (each can be a Quantity) b) Orbit instance: initial condition used if that's it, orbit(t) if there is a time given as well as the second argument maxn= (default: object-wide default) Use a grid in vec(n) up to this n (zero-based) ts= if set, the phase-space points correspond to these times (IF NOT SET, WE ASSUME THAT ts IS THAT THAT IS ASSOCIATED WITH THIS OBJECT) _firstFlip= (False) if True and Orbits are given, the backward part of the orbit is integrated first and stored in the Orbit object OUTPUT: (jr,lz,jz,Omegar,Omegaphi,Omegaz,angler,anglephi,anglez) HISTORY: 2013-09-10 - Written - Bovy (IAS) """ from galpy.orbit import Orbit _firstFlip= kwargs.get('_firstFlip',False) #If the orbit was already integrated, set ts to the integration times if isinstance(args[0],Orbit) and hasattr(args[0]._orb,'orbit') \ and not 'ts' in kwargs: kwargs['ts']= args[0]._orb.t elif (isinstance(args[0],list) and isinstance(args[0][0],Orbit)) \ and hasattr(args[0][0]._orb,'orbit') \ and not 'ts' in kwargs: kwargs['ts']= args[0][0]._orb.t R,vR,vT,z,vz,phi= self._parse_args(True,_firstFlip,*args) if 'ts' in kwargs and not kwargs['ts'] is None: ts= kwargs['ts'] if _APY_LOADED and isinstance(ts,units.Quantity): ts= ts.to(units.Gyr).value\ /time_in_Gyr(self._vo,self._ro) else: ts= nu.empty(R.shape[1]) ts[self._ntintJ-1:]= self._tsJ ts[:self._ntintJ-1]= -self._tsJ[1:][::-1] maxn= kwargs.get('maxn',self._maxn) if self._c: #pragma: no cover pass else: #Use self._aAI to calculate the actions and angles in the isochrone potential if '_acfs' in kwargs: acfs= kwargs['_acfs'] else: acfs= self._aAI._actionsFreqsAngles(R.flatten(), vR.flatten(), vT.flatten(), z.flatten(), vz.flatten(), phi.flatten()) jrI= nu.reshape(acfs[0],R.shape)[:,:-1] jzI= nu.reshape(acfs[2],R.shape)[:,:-1] anglerI= nu.reshape(acfs[6],R.shape) anglezI= nu.reshape(acfs[8],R.shape) if nu.any((nu.fabs(nu.amax(anglerI,axis=1)-_TWOPI) > _ANGLETOL)\ *(nu.fabs(nu.amin(anglerI,axis=1)) > _ANGLETOL)): #pragma: no cover warnings.warn("Full radial angle range not covered for at least one object; actions are likely not reliable",galpyWarning) if nu.any((nu.fabs(nu.amax(anglezI,axis=1)-_TWOPI) > _ANGLETOL)\ *(nu.fabs(nu.amin(anglezI,axis=1)) > _ANGLETOL)): #pragma: no cover warnings.warn("Full vertical angle range not covered for at least one object; actions are likely not reliable",galpyWarning) danglerI= ((nu.roll(anglerI,-1,axis=1)-anglerI) % _TWOPI)[:,:-1] danglezI= ((nu.roll(anglezI,-1,axis=1)-anglezI) % _TWOPI)[:,:-1] jr= nu.sum(jrI*danglerI,axis=1)/nu.sum(danglerI,axis=1) jz= nu.sum(jzI*danglezI,axis=1)/nu.sum(danglezI,axis=1) if _isNonAxi(self._pot): #pragma: no cover lzI= nu.reshape(acfs[1],R.shape)[:,:-1] anglephiI= nu.reshape(acfs[7],R.shape) if nu.any((nu.fabs(nu.amax(anglephiI,axis=1)-_TWOPI) > _ANGLETOL)\ *(nu.fabs(nu.amin(anglephiI,axis=1)) > _ANGLETOL)): #pragma: no cover warnings.warn("Full azimuthal angle range not covered for at least one object; actions are likely not reliable",galpyWarning) danglephiI= ((nu.roll(anglephiI,-1,axis=1)-anglephiI) % _TWOPI)[:,:-1] lz= nu.sum(lzI*danglephiI,axis=1)/nu.sum(danglephiI,axis=1) else: lz= R[:,len(ts)//2]*vT[:,len(ts)//2] #Now do an 'angle-fit' angleRT= dePeriod(nu.reshape(acfs[6],R.shape)) acfs7= nu.reshape(acfs[7],R.shape) negFreqIndx= nu.median(acfs7-nu.roll(acfs7,1,axis=1),axis=1) < 0. #anglephi is decreasing anglephiT= nu.empty(acfs7.shape) anglephiT[negFreqIndx,:]= dePeriod(_TWOPI-acfs7[negFreqIndx,:]) negFreqPhi= nu.zeros(R.shape[0],dtype='bool') negFreqPhi[negFreqIndx]= True anglephiT[True^negFreqIndx,:]= dePeriod(acfs7[True^negFreqIndx,:]) angleZT= dePeriod(nu.reshape(acfs[8],R.shape)) #Write the angle-fit as Y=AX, build A and Y nt= len(ts) no= R.shape[0] #remove 0,0,0 and half-plane if _isNonAxi(self._pot): nn= (2*maxn-1)**2*maxn-(maxn-1)*(2*maxn-1)-maxn else: nn= maxn*(2*maxn-1)-maxn A= nu.zeros((no,nt,2+nn)) A[:,:,0]= 1. A[:,:,1]= ts #sorting the phi and Z grids this way makes it easy to exclude the origin phig= list(nu.arange(-maxn+1,maxn,1)) phig.sort(key = lambda x: abs(x)) phig= nu.array(phig,dtype='int') if _isNonAxi(self._pot): grid= nu.meshgrid(nu.arange(maxn),phig,phig) else: grid= nu.meshgrid(nu.arange(maxn),phig) gridR= grid[0].T.flatten()[1:] #remove 0,0,0 gridZ= grid[1].T.flatten()[1:] mask = nu.ones(len(gridR),dtype=bool) # excludes axis that is not in half-space if _isNonAxi(self._pot): gridphi= grid[2].T.flatten()[1:] mask= True\ ^(gridR == 0)*((gridphi < 0)+((gridphi==0)*(gridZ < 0))) else: mask[:2*maxn-3:2]= False gridR= gridR[mask] gridZ= gridZ[mask] tangleR= nu.tile(angleRT.T,(nn,1,1)).T tgridR= nu.tile(gridR,(no,nt,1)) tangleZ= nu.tile(angleZT.T,(nn,1,1)).T tgridZ= nu.tile(gridZ,(no,nt,1)) if _isNonAxi(self._pot): gridphi= gridphi[mask] tgridphi= nu.tile(gridphi,(no,nt,1)) tanglephi= nu.tile(anglephiT.T,(nn,1,1)).T sinnR= nu.sin(tgridR*tangleR+tgridphi*tanglephi+tgridZ*tangleZ) else: sinnR= nu.sin(tgridR*tangleR+tgridZ*tangleZ) A[:,:,2:]= sinnR #Matrix magic atainv= nu.empty((no,2+nn,2+nn)) AT= nu.transpose(A,axes=(0,2,1)) for ii in range(no): atainv[ii,:,:,]= linalg.inv(nu.dot(AT[ii,:,:],A[ii,:,:])) ATAR= nu.sum(AT*nu.transpose(nu.tile(angleRT,(2+nn,1,1)),axes=(1,0,2)),axis=2) ATAT= nu.sum(AT*nu.transpose(nu.tile(anglephiT,(2+nn,1,1)),axes=(1,0,2)),axis=2) ATAZ= nu.sum(AT*nu.transpose(nu.tile(angleZT,(2+nn,1,1)),axes=(1,0,2)),axis=2) angleR= nu.sum(atainv[:,0,:]*ATAR,axis=1) OmegaR= nu.sum(atainv[:,1,:]*ATAR,axis=1) anglephi= nu.sum(atainv[:,0,:]*ATAT,axis=1) Omegaphi= nu.sum(atainv[:,1,:]*ATAT,axis=1) angleZ= nu.sum(atainv[:,0,:]*ATAZ,axis=1) OmegaZ= nu.sum(atainv[:,1,:]*ATAZ,axis=1) Omegaphi[negFreqIndx]= -Omegaphi[negFreqIndx] anglephi[negFreqIndx]= _TWOPI-anglephi[negFreqIndx] if kwargs.get('_retacfs',False): return (jr,lz,jz,OmegaR,Omegaphi,OmegaZ, #pragma: no cover angleR % _TWOPI, anglephi % _TWOPI, angleZ % _TWOPI,acfs) else: return (jr,lz,jz,OmegaR,Omegaphi,OmegaZ, angleR % _TWOPI, anglephi % _TWOPI, angleZ % _TWOPI) def plot(self,*args,**kwargs): """ NAME: plot PURPOSE: plot the angles vs. each other, to check whether the isochrone approximation is good INPUT: Either: a) R,vR,vT,z,vz: floats: phase-space value for single object b) Orbit instance type= ('araz') type of plot to make a) 'araz': az vs. ar, with color-coded aphi b) 'araphi': aphi vs. ar, with color-coded az c) 'azaphi': aphi vs. az, with color-coded ar d) 'jr': cumulative average of jr with time, to assess convergence e) 'lz': same as 'jr' but for lz f) 'jz': same as 'jr' but for jz deperiod= (False), if True, de-period the angles downsample= (False) if True, downsample what's plotted to 400 points +plot kwargs OUTPUT: plot to output HISTORY: 2013-09-10 - Written - Bovy (IAS) """ #Kwargs type= kwargs.pop('type','araz') deperiod= kwargs.pop('deperiod',False) downsample= kwargs.pop('downsample',False) #Parse input R,vR,vT,z,vz,phi= self._parse_args('a' in type,False,*args) #Use self._aAI to calculate the actions and angles in the isochrone potential acfs= self._aAI._actionsFreqsAngles(R.flatten(), vR.flatten(), vT.flatten(), z.flatten(), vz.flatten(), phi.flatten()) if type == 'jr' or type == 'lz' or type == 'jz': jrI= nu.reshape(acfs[0],R.shape)[:,:-1] jzI= nu.reshape(acfs[2],R.shape)[:,:-1] anglerI= nu.reshape(acfs[6],R.shape) anglezI= nu.reshape(acfs[8],R.shape) danglerI= ((nu.roll(anglerI,-1,axis=1)-anglerI) % _TWOPI)[:,:-1] danglezI= ((nu.roll(anglezI,-1,axis=1)-anglezI) % _TWOPI)[:,:-1] if True: sumFunc= nu.cumsum jr= sumFunc(jrI*danglerI,axis=1)/sumFunc(danglerI,axis=1) jz= sumFunc(jzI*danglezI,axis=1)/sumFunc(danglezI,axis=1) lzI= nu.reshape(acfs[1],R.shape)[:,:-1] anglephiI= nu.reshape(acfs[7],R.shape) danglephiI= ((nu.roll(anglephiI,-1,axis=1)-anglephiI) % _TWOPI)[:,:-1] lz= sumFunc(lzI*danglephiI,axis=1)/sumFunc(danglephiI,axis=1) from galpy.orbit import Orbit if isinstance(args[0],Orbit) and hasattr(args[0]._orb,'t'): ts= args[0]._orb.t[:-1] else: ts= self._tsJ[:-1] if type == 'jr': if downsample: plotx= ts[::int(round(self._ntintJ//400))] ploty= jr[0,::int(round(self._ntintJ//400))]/jr[0,-1] plotz= anglerI[0,:-1:int(round(self._ntintJ//400))] else: plotx= ts ploty= jr[0,:]/jr[0,-1] plotz= anglerI[0,:-1] bovy_plot.bovy_plot(plotx,ploty, c=plotz, s=20., scatter=True, edgecolor='none', xlabel=r'$t$', ylabel=r'$J^A_R / \langle J^A_R \rangle$', clabel=r'$\theta^A_R$', vmin=0.,vmax=2.*nu.pi, crange=[0.,2.*nu.pi], colorbar=True, **kwargs) elif type == 'lz': if downsample: plotx= ts[::int(round(self._ntintJ//400))] ploty= lz[0,::int(round(self._ntintJ//400))]/lz[0,-1] plotz= anglephiI[0,:-1:int(round(self._ntintJ//400))] else: plotx= ts ploty= lz[0,:]/lz[0,-1] plotz= anglephiI[0,:-1] bovy_plot.bovy_plot(plotx,ploty,c=plotz,s=20., scatter=True, edgecolor='none', xlabel=r'$t$', ylabel=r'$L^A_Z / \langle L^A_Z \rangle$', clabel=r'$\theta^A_\phi$', vmin=0.,vmax=2.*nu.pi, crange=[0.,2.*nu.pi], colorbar=True, **kwargs) elif type == 'jz': if downsample: plotx= ts[::int(round(self._ntintJ//400))] ploty= jz[0,::int(round(self._ntintJ//400))]/jz[0,-1] plotz= anglezI[0,:-1:int(round(self._ntintJ//400))] else: plotx= ts ploty= jz[0,:]/jz[0,-1] plotz= anglezI[0,:-1] bovy_plot.bovy_plot(plotx,ploty,c=plotz,s=20., scatter=True, edgecolor='none', xlabel=r'$t$', ylabel=r'$J^A_Z / \langle J^A_Z \rangle$', clabel=r'$\theta^A_Z$', vmin=0.,vmax=2.*nu.pi, crange=[0.,2.*nu.pi], colorbar=True, **kwargs) else: if deperiod: if 'ar' in type: angleRT= dePeriod(nu.reshape(acfs[6],R.shape)) else: angleRT= nu.reshape(acfs[6],R.shape) if 'aphi' in type: acfs7= nu.reshape(acfs[7],R.shape) negFreqIndx= nu.median(acfs7-nu.roll(acfs7,1,axis=1),axis=1) < 0. #anglephi is decreasing anglephiT= nu.empty(acfs7.shape) anglephiT[negFreqIndx,:]= dePeriod(_TWOPI-acfs7[negFreqIndx,:]) negFreqPhi= nu.zeros(R.shape[0],dtype='bool') negFreqPhi[negFreqIndx]= True anglephiT[True^negFreqIndx,:]= dePeriod(acfs7[True^negFreqIndx,:]) else: anglephiT= nu.reshape(acfs[7],R.shape) if 'az' in type: angleZT= dePeriod(nu.reshape(acfs[8],R.shape)) else: angleZT= nu.reshape(acfs[8],R.shape) xrange= None yrange= None else: angleRT= nu.reshape(acfs[6],R.shape) anglephiT= nu.reshape(acfs[7],R.shape) angleZT= nu.reshape(acfs[8],R.shape) xrange= [-0.5,2.*nu.pi+0.5] yrange= [-0.5,2.*nu.pi+0.5] vmin, vmax= 0.,2.*nu.pi crange= [vmin,vmax] if type == 'araz': if downsample: plotx= angleRT[0,::int(round(self._ntintJ//400))] ploty= angleZT[0,::int(round(self._ntintJ//400))] plotz= anglephiT[0,::int(round(self._ntintJ//400))] else: plotx= angleRT[0,:] ploty= angleZT[0,:] plotz= anglephiT[0,:] bovy_plot.bovy_plot(plotx,ploty,c=plotz,s=20., scatter=True, edgecolor='none', xlabel=r'$\theta^A_R$', ylabel=r'$\theta^A_Z$', clabel=r'$\theta^A_\phi$', xrange=xrange,yrange=yrange, vmin=vmin,vmax=vmax, crange=crange, colorbar=True, **kwargs) elif type == 'araphi': if downsample: plotx= angleRT[0,::int(round(self._ntintJ//400))] ploty= anglephiT[0,::int(round(self._ntintJ//400))] plotz= angleZT[0,::int(round(self._ntintJ//400))] else: plotx= angleRT[0,:] ploty= anglephiT[0,:] plotz= angleZT[0,:] bovy_plot.bovy_plot(plotx,ploty,c=plotz,s=20., scatter=True, edgecolor='none', xlabel=r'$\theta^A_R$', clabel=r'$\theta^A_Z$', ylabel=r'$\theta^A_\phi$', xrange=xrange,yrange=yrange, vmin=vmin,vmax=vmax, crange=crange, colorbar=True, **kwargs) elif type == 'azaphi': if downsample: plotx= angleZT[0,::int(round(self._ntintJ//400))] ploty= anglephiT[0,::int(round(self._ntintJ//400))] plotz= angleRT[0,::int(round(self._ntintJ//400))] else: plotx= angleZT[0,:] ploty= anglephiT[0,:] plotz= angleRT[0,:] bovy_plot.bovy_plot(plotx,ploty,c=plotz,s=20., scatter=True, edgecolor='none', clabel=r'$\theta^A_R$', xlabel=r'$\theta^A_Z$', ylabel=r'$\theta^A_\phi$', xrange=xrange,yrange=yrange, vmin=vmin,vmax=vmax, crange=crange, colorbar=True, **kwargs) return None def _parse_args(self,freqsAngles=True,_firstFlip=False,*args): """Helper function to parse the arguments to the __call__ and actionsFreqsAngles functions""" from galpy.orbit import Orbit RasOrbit= False integrated= True #whether the orbit was already integrated when given if len(args) == 5 or len(args) == 3: #pragma: no cover raise IOError("Must specify phi for actionAngleIsochroneApprox") if len(args) == 6 or len(args) == 4: if len(args) == 6: R,vR,vT, z, vz, phi= args else: R,vR,vT, phi= args z, vz= 0., 0. if isinstance(R,float): os= [Orbit([R,vR,vT,z,vz,phi])] RasOrbit= True integrated= False elif len(R.shape) == 1: #not integrated yet os= [Orbit([R[ii],vR[ii],vT[ii],z[ii],vz[ii],phi[ii]]) for ii in range(R.shape[0])] RasOrbit= True integrated= False if isinstance(args[0],Orbit) \ or (isinstance(args[0],list) and isinstance(args[0][0],Orbit)) \ or RasOrbit: if RasOrbit: pass elif not isinstance(args[0],list): os= [args[0]] if len(os[0]._orb.vxvv) == 3 or len(os[0]._orb.vxvv) == 5: #pragma: no cover raise IOError("Must specify phi for actionAngleIsochroneApprox") else: os= args[0] if len(os[0]._orb.vxvv) == 3 or len(os[0]._orb.vxvv) == 5: #pragma: no cover raise IOError("Must specify phi for actionAngleIsochroneApprox") self._check_consistent_units_orbitInput(os[0]) if not hasattr(os[0]._orb,'orbit'): #not integrated yet if _firstFlip: for o in os: o._orb.vxvv[1]= -o._orb.vxvv[1] o._orb.vxvv[2]= -o._orb.vxvv[2] o._orb.vxvv[4]= -o._orb.vxvv[4] [o.integrate(self._tsJ,pot=self._pot, method=self._integrate_method, dt=self._integrate_dt) for o in os] if _firstFlip: for o in os: o._orb.vxvv[1]= -o._orb.vxvv[1] o._orb.vxvv[2]= -o._orb.vxvv[2] o._orb.vxvv[4]= -o._orb.vxvv[4] o._orb.orbit[:,1]= -o._orb.orbit[:,1] o._orb.orbit[:,2]= -o._orb.orbit[:,2] o._orb.orbit[:,4]= -o._orb.orbit[:,4] integrated= False ntJ= os[0].getOrbit().shape[0] no= len(os) R= nu.empty((no,ntJ)) vR= nu.empty((no,ntJ)) vT= nu.empty((no,ntJ)) z= nu.zeros((no,ntJ))+10.**-7. #To avoid numpy warnings for vz= nu.zeros((no,ntJ))+10.**-7. #planarOrbits phi= nu.empty((no,ntJ)) for ii in range(len(os)): this_orbit= os[ii].getOrbit() R[ii,:]= this_orbit[:,0] vR[ii,:]= this_orbit[:,1] vT[ii,:]= this_orbit[:,2] if this_orbit.shape[1] == 6: z[ii,:]= this_orbit[:,3] vz[ii,:]= this_orbit[:,4] phi[ii,:]= this_orbit[:,5] else: phi[ii,:]= this_orbit[:,3] if freqsAngles and not integrated: #also integrate backwards in time, such that the requested point is not at the edge no= R.shape[0] nt= R.shape[1] oR=
nu.empty((no,2*nt-1))
numpy.empty
import numpy as np import pytest import sklearn from autogluon.core.metrics import confusion_matrix, log_loss, quadratic_kappa from autogluon.core.metrics.softclass_metrics import soft_log_loss def test_confusion_matrix_with_valid_inputs_without_labels_and_weights(): # Given input_solution = [2, 0, 2, 2, 0, 1] input_prediction = [0, 0, 2, 2, 0, 2] expected_output = np.array([[2, 0, 0], [0, 0, 1], [1, 0, 2]]) # When observed_output = confusion_matrix(input_solution, input_prediction) # Then assert(
np.array_equal(expected_output, observed_output)
numpy.array_equal
# ======================================================================================= # ======================================================================================= import numpy as np import sys import getopt import code # For development: code.interact(local=locals()) from datetime import datetime from matplotlib.dates import date2num, num2date import csv from scipy.io import netcdf import matplotlib.pyplot as plt from calendar import monthrange # ======================================================================================= # Parameters # ======================================================================================= simple_verify_ts = False simple_verify_means = False epsilon = 0.622 # Ratio of gas constants vapor/dry air [g/g] e_0 = 0.611 # saturation vapor pressure at 0C Clausius-Clapeyron [kPa] L_vap = 2.5*10.0**6 # Latent heat of vaporization [J/kg] R_vap = 461.0 # gas constant for water vapor [J/Kg/K] T_0 = 273.0 # Temperature at freezing point of water [K] d_per_mo = [31,28,31,30,31,30,31,31,30,31,30,31] # Days per month (NO LEAP YEAR) # ======================================================================================= # Classes and Types # ======================================================================================= class ctrltype: # This holds control parameter specified in XML def __init__(self,csv_file,time_res_sec_in,time_res_sec_out,n_header_row,n_fields, \ nodata_flags,grid_name_out,fill_value,missing_value, \ acknowledge,history,date_format,time_format,timestamp_type,utc_offset): self.csv_file = csv_file self.time_res_sec_in = time_res_sec_in self.time_res_sec_out = time_res_sec_out self.n_header_row = n_header_row self.n_fields = n_fields self.nodata_flags = nodata_flags self.grid_name_out = grid_name_out self.fill_value = fill_value self.missing_value = missing_value self.timestamp_type = timestamp_type self.acknowledge = acknowledge self.history = history self.date_format = date_format self.time_format = time_format self.utc_offset = utc_offset class contype: # This holds constants specified in XML (Like Lat/lon) def __init__(self,name,long_name,units,mode,value,dims): self.name = name self.long_name = long_name self.units = units self.mode = mode self.value = float(value) self.dims = int(dims) class vartype: # This holds time dependent variables specified in XML/CSV (like temp,etc) def __init__(self,name,long_name,units,mode,col_id,unit_mult,unit_off): self.name = name self.long_name = long_name self.units = units self.mode = mode self.col_id = col_id self.unit_mult = unit_mult self.unit_off = unit_off # These are for generating diagnostic plots self.d_mean = np.zeros((24,3)) self.d_mean[:,0] = 100000.0 self.m_mean =
np.zeros((12,3))
numpy.zeros
# @Time : 2020/10/19 # @Author : <NAME> # @Email : <EMAIL> # UPDATE # @Time : 2021/7/9 # @Author : <NAME> # @Email : <EMAIL> """ recbole.data.customized_dataset ################################## We only recommend building customized datasets by inheriting. Customized datasets named ``[Model Name]Dataset`` can be automatically called. """ from collections import defaultdict import copy import numpy as np import torch from recbole.data import get_dataloader from recbole.data.dataset import KGSeqDataset, SequentialDataset from recbole.data.interaction import Interaction from recbole.sampler import SeqSampler from recbole.sampler.sampler import MetaSeqSampler from recbole.utils.enum_type import FeatureType, FeatureSource class GRU4RecKGDataset(KGSeqDataset): def __init__(self, config): super().__init__(config) class KSRDataset(KGSeqDataset): def __init__(self, config): super().__init__(config) class DIENDataset(SequentialDataset): """:class:`DIENDataset` is based on :class:`~recbole.data.dataset.sequential_dataset.SequentialDataset`. It is different from :class:`SequentialDataset` in `data_augmentation`. It add users' negative item list to interaction. The original version of sampling negative item list is implemented by <NAME> (<EMAIL>) in 2021/2/25, and he updated the codes in 2021/3/19. In 2021/7/9, Yupeng refactored SequentialDataset & SequentialDataLoader, then refactored DIENDataset, either. Attributes: augmentation (bool): Whether the interactions should be augmented in RecBole. seq_sample (recbole.sampler.SeqSampler): A sampler used to sample negative item sequence. neg_item_list_field (str): Field name for negative item sequence. neg_item_list (torch.tensor): all users' negative item history sequence. """ def __init__(self, config): super().__init__(config) list_suffix = config['LIST_SUFFIX'] neg_prefix = config['NEG_PREFIX'] self.seq_sampler = SeqSampler(self) self.neg_item_list_field = neg_prefix + self.iid_field + list_suffix self.neg_item_list = self.seq_sampler.sample_neg_sequence(self.inter_feat[self.iid_field]) def data_augmentation(self): """Augmentation processing for sequential dataset. E.g., ``u1`` has purchase sequence ``<i1, i2, i3, i4>``, then after augmentation, we will generate three cases. ``u1, <i1> | i2`` (Which means given user_id ``u1`` and item_seq ``<i1>``, we need to predict the next item ``i2``.) The other cases are below: ``u1, <i1, i2> | i3`` ``u1, <i1, i2, i3> | i4`` """ self.logger.debug('data_augmentation') self._aug_presets() self._check_field('uid_field', 'time_field') max_item_list_len = self.config['MAX_ITEM_LIST_LENGTH'] self.sort(by=[self.uid_field, self.time_field], ascending=True) last_uid = None uid_list, item_list_index, target_index, item_list_length = [], [], [], [] seq_start = 0 for i, uid in enumerate(self.inter_feat[self.uid_field].numpy()): if last_uid != uid: last_uid = uid seq_start = i else: if i - seq_start > max_item_list_len: seq_start += 1 uid_list.append(uid) item_list_index.append(slice(seq_start, i)) target_index.append(i) item_list_length.append(i - seq_start) uid_list = np.array(uid_list) item_list_index = np.array(item_list_index) target_index =
np.array(target_index)
numpy.array
""" Defines the ColorMapper and ColorMapTemplate classes. """ # Major library imports from types import IntType, FloatType from numpy import arange, array, asarray, clip, divide, float32, int8, isinf, \ isnan, ones, searchsorted, sometrue, sort, take, uint8, where, zeros, \ linspace, ones_like # Enthought library imports from traits.api import Any, Array, Bool, Dict, Event, Float, HasTraits, \ Int, Property, Str, Trait # Relative imports from abstract_colormap import AbstractColormap from data_range_1d import DataRange1D from speedups import map_colors class ColorMapTemplate(HasTraits): """ A class representing the state of a ColorMapper, for use when persisting plots. """ # The segment data of the color map. segment_map = Any # The number of steps in the color map. steps = Int(256) # Low end of the color map range. range_low_setting = Trait('auto', 'auto', Float) # High end of the color map range. range_high_setting = Trait('auto', 'auto', Float) def __init__(self, colormap=None, **kwtraits): """ Creates this template from a color map instance or creates an empty template. """ if colormap: self.from_colormap(colormap) return def from_colormap(self, colormap): """ Populates this template from a color map. """ self.segment_map = colormap._segmentdata.copy() self.steps = colormap.steps self.range_low_setting = colormap.range.low_setting self.range_high_setting = colormap.range.high_setting return def to_colormap(self, range=None): """ Returns a ColorMapper instance from this template. """ colormap = ColorMapper(self.segment_map, steps = self.steps) if range: colormap.range = range else: colormap.range = DataRange1D(low = self.range_low_setting, high = self.range_high_setting) return colormap class ColorMapper(AbstractColormap): """ Represents a simple band-of-colors style of color map. The look-up transfer function is a simple linear function between defined intensities. There is no limit to the number of steps that can be defined. If the segment intervals contain very few array locations, quantization errors will occur. Construction of a ColorMapper can be done through the factory methods from_palette_array() and from_segment_map(). Do not make direct calls to the ColorMapper constructor. """ # The color table. color_bands = Property(Array) # The total number of color steps in the map. steps = Int(256) # The name of this color map. name = Str # Not used. low_pos = None # Not used. high_pos = None # A generic "update" event that generally means that anything that relies # on this mapper for visual output should do a redraw or repaint. updated = Event # Are the mapping arrays out of date? _dirty = Bool(True) # The raw segment data for creating the mapping array. _segmentdata = Dict # (Str, Tuple | List) #------------------------------------------------------------------------ # Static methods. #------------------------------------------------------------------------ @classmethod def from_palette_array(cls, palette, **traits): """ Creates a ColorMapper from a palette array. The palette colors are linearly interpolated across the range of mapped values. The *palette* parameter is a Nx3 or Nx4 array of intensity values, where N > 1:: [[R0, G0, B0], ... [R(N-1), G(N-1), B(N-1)]] [[R0, G0, B0, A0], ... [R(N-1), G(N-1), B(N-1), A(N-1]] """ palette = asarray(palette) n_colors, n_components = palette.shape if n_colors < 2: raise ValueError("Palette must contain at least two colors.") if n_components not in (3,4): raise ValueError("Palette must be of RGB or RGBA colors. " "Got %s color components." % n_components) # Compute the % offset for each of the color locations. offsets = linspace(0.0, 1.0, n_colors) # From the offsets and the color data, generate a segment map. segment_map = {} red_values = palette[:,0] segment_map['red'] = zip(offsets, red_values, red_values) green_values = palette[:,1] segment_map['green'] = zip(offsets, green_values, green_values) blue_values = palette[:,2] segment_map['blue'] = zip(offsets, blue_values, blue_values) if n_components == 3: alpha_values = ones(n_colors) else: alpha_values = palette[:,3] segment_map['alpha'] = zip(offsets, alpha_values, alpha_values) return cls(segment_map, **traits) @classmethod def from_segment_map(cls, segment_map, **traits): """ Creates a Colormapper from a segment map. The *segment_map* parameter is a dictionary with 'red', 'green', and 'blue' (and optionally 'alpha') entries. Each entry is a list of (x, y0, y1) tuples: * x: an offset in [0..1] (offsets within the list must be in ascending order) * y0: value for the color channel for values less than or equal to x * y1: value for the color channel for values greater than x When a data value gets mapped to a color, it will be normalized to be within [0..1]. For each RGB(A) component, the two adjacent values will be found in the segment_map. The mapped component value will be found by linearly interpolating the two values. Generally, y0==y1. Colormaps with sharp transitions will have y0!=y1 at the transitions. """ if 'alpha' not in segment_map: segment_map = segment_map.copy() segment_map['alpha'] = [(0.0, 1.0, 1.0), (1.0, 1.0, 1.0)] return cls(segment_map, **traits) @classmethod def from_file(cls, filename, **traits): """ Creates a ColorMapper from a file. The *filename* parameter is the name of a file whose lines each contain 4 or 5 float values between 0.0 and 1.0. The first value is an offset in the range [0..1], and the remaining 3 or 4 values are red, green, blue, and optionally alpha values for the color corresponding to that offset. The first line is assumed to contain the name of the colormap. """ colormap_file = open(filename, 'r') lines = colormap_file.readlines() colormap_file.close() rgba_arr = [[],[],[],[]] for line in lines[1:]: strvalues = line.strip().split() values = [float32(value) for value in strvalues] if len(values) > 4: channels = (0,1,2,3) else: channels = (0,1,2) for i in channels: channeltuple = (values[0], values[i+1], values[i+1]) rgba_arr[i].append(channeltuple) # Alpha is frequently unspecified. if len(rgba_arr[-1]) == 0: rgba_arr[-1] = [(0.0, 1.0, 1.0), (1.0, 1.0, 1.0)] if 'name' not in traits: # Don't override the code. traits['name'] = lines[0].strip() rgba_dict = { 'red': rgba_arr[0], 'green': rgba_arr[1], 'blue': rgba_arr[2], 'alpha': rgba_arr[3], } return cls(rgba_dict, **traits) #------------------------------------------------------------------------ # Public methods #------------------------------------------------------------------------ def __init__(self, segmentdata, **kwtraits): """ Creates a Colormapper from a segment map. The *segment_map* parameter is a dictionary with 'red', 'green', and 'blue' (and optionally 'alpha') entries. Each entry is a list of (x, y0, y1) tuples: * x: an offset in [0..1] (offsets within the list must be in ascending order) * y0: value for the color channel for values less than or equal to x * y1: value for the color channel for values greater than x When a data value gets mapped to a color, it will be normalized to be within [0..1]. For each RGB(A) component, the two adjacent values will be found in the segment_map. The mapped component value will be found by linearly interpolating the two values. Generally, y0==y1. Colormaps with sharp transitions will have y0!=y1 at the transitions. """ self._segmentdata = segmentdata super(ColorMapper, self).__init__(**kwtraits) return def map_screen(self, data_array): """ Maps an array of data values to an array of colors. """ if self._dirty: self._recalculate() rgba = map_colors(data_array, self.steps, self.range.low, self.range.high, self._red_lut, self._green_lut, self._blue_lut, self._alpha_lut) return rgba def map_index(self, ary): """ Maps an array of values to their corresponding color band index. """ if self._dirty: self._recalculate() indices = (ary - self.range.low) / (self.range.high - self.range.low) * self.steps return clip(indices.astype(IntType), 0, self.steps - 1) def reverse_colormap(self): """ Reverses the color bands of this colormap. """ for name in ("red", "green", "blue", "alpha"): data = asarray(self._segmentdata[name]) data[:, (1,2)] = data[:, (2,1)] data[:,0] = (1.0 - data[:,0]) self._segmentdata[name] = data[::-1] self._recalculate() #------------------------------------------------------------------------ # Private methods #------------------------------------------------------------------------ def _get_color_bands(self): """ Gets the color bands array. """ if self._dirty: self._recalculate() luts = [self._red_lut, self._green_lut, self._blue_lut] if self.color_depth is 'rgba': luts.append(self._alpha_lut) result = zip(*luts) return result def _recalculate(self): """ Recalculates the mapping arrays. """ self._red_lut = self._make_mapping_array( self.steps, self._segmentdata['red'] ) self._green_lut = self._make_mapping_array( self.steps, self._segmentdata['green'] ) self._blue_lut = self._make_mapping_array( self.steps, self._segmentdata['blue'] ) self._alpha_lut = self._make_mapping_array( self.steps, self._segmentdata['alpha'] ) self.updated = True self._dirty = False return #### matplotlib #### def _make_mapping_array(self, n, data): """Creates an N-element 1-D lookup table The *data* parameter is a list of x,y0,y1 mapping correspondences (which can be lists or tuples), where all the items are values between 0 and 1, inclusive. The items in the mapping are: * x: a value being mapped * y0: the value of y for values of x less than or equal to the given x value. * y1: the value of y for values of x greater than the given x value. The two values of y allow for discontinuous mapping functions (for example, as might be found in a sawtooth function) The list must start with x=0, end with x=1, and all values of x must be in increasing order. Values between the given mapping points are determined by simple linear interpolation. The function returns an array "result" where result[x*(N-1)] gives the closest value for values of x between 0 and 1. """ try: adata =
array(data)
numpy.array
""" This module contains a class `sqrt_lasso`_ that implements post selection for the square root lasso. Code based on algorithms described in http://arxiv.org/abs/1504.08031. """ from copy import copy import numpy as np, warnings from scipy.stats import norm as ndist, chi as chidist from scipy.interpolate import interp1d from scipy.stats import t as tdist from statsmodels.api import OLS # regreg http://github.com/regreg import regreg.api as rr # local from .lasso import _constraint_from_data from ..constraints.quasi_affine import (constraints_unknown_sigma, constraints as quasi_affine, orthogonal as orthogonal_QA) from ..constraints.affine import (constraints as affine_constraints, gibbs_test, sample_from_sphere) from ..truncated import find_root from ..distributions.discrete_multiparameter import multiparameter_family from ..distributions.discrete_family import discrete_family from ..sampling.sqrt_lasso import (sample_sqrt_lasso, sample_sqrt_lasso_segment) class sqlasso_objective(rr.smooth_atom): """ The square-root LASSO objective. Essentially smooth, but singular on $\{\beta: y=X\beta\}$. This singularity is ignored in solving the problem. It might be a problem sometimes? """ _sqrt2 = np.sqrt(2) # often used constant def __init__(self, X, Y): self.X = X self.Y = Y self._sqerror = rr.squared_error(X, Y) def smooth_objective(self, x, mode='both', check_feasibility=False): f, g = self._sqerror.smooth_objective(x, mode='both', check_feasibility=check_feasibility) f = self._sqrt2 * np.sqrt(f) if mode == 'both': return f, g / f elif mode == 'grad': return g / f elif mode == 'func': return f else: raise ValueError("mode incorrectly specified") def solve_sqrt_lasso(X, Y, weights=None, initial=None, **solve_kwargs): """ Solve the square-root LASSO optimization problem: $$ \text{minimize}_{\beta} \|y-X\beta\|_2 + D |\beta|, $$ where $D$ is the diagonal matrix with weights on its diagonal. Parameters ---------- y : np.float((n,)) The target, in the model $y = X\beta$ X : np.float((n, p)) The data, in the model $y = X\beta$ weights : np.float Coefficients of the L-1 penalty in optimization problem, note that different coordinates can have different coefficients. initial : np.float(p) Initial point for optimization. solve_kwargs : dict Arguments passed to regreg solver. """ n, p = X.shape if n < p: return solve_sqrt_lasso_skinny(X, Y, weights=weights, initial=initial, **solve_kwargs) else: return solve_sqrt_lasso_fat(X, Y, weights=weights, initial=initial, **solve_kwargs) def solve_sqrt_lasso_fat(X, Y, weights=None, initial=None, **solve_kwargs): """ Solve the square-root LASSO optimization problem: $$ \text{minimize}_{\beta} \|y-X\beta\|_2 + D |\beta|, $$ where $D$ is the diagonal matrix with weights on its diagonal. Parameters ---------- y : np.float((n,)) The target, in the model $y = X\beta$ X : np.float((n, p)) The data, in the model $y = X\beta$ weights : np.float Coefficients of the L-1 penalty in optimization problem, note that different coordinates can have different coefficients. initial : np.float(p) Initial point for optimization. solve_kwargs : dict Arguments passed to regreg solver. """ X = rr.astransform(X) n, p = X.output_shape[0], X.input_shape[0] if weights is None: lam = choose_lambda(X) weights = lam * np.ones((p,)) loss = sqlasso_objective(X, Y) penalty = rr.weighted_l1norm(weights, lagrange=1.) problem = rr.simple_problem(loss, penalty) if initial is not None: problem.coefs[:] = initial soln = problem.solve(**solve_kwargs) return soln class sqlasso_objective_skinny(rr.smooth_atom): """ The square-root LASSO objective on larger parameter space: .. math:: (\beta, \sigma) \mapsto \frac{\|y-X\beta\|_2^2}{\sigma} + \sigma """ def __init__(self, X, Y): self.X = rr.astransform(X) n, p = self.X.output_shape[0], self.X.input_shape[0] self.Y = Y if n > p: self._quadratic_term = np.dot(X.T, X) self._linear_term = -2 * np.dot(X.T, Y) self._constant_term = (Y**2).sum() self._sqerror = rr.squared_error(X, Y) def smooth_objective(self, x, mode='both', check_feasibility=False): n, p = self.X.output_shape[0], self.X.input_shape[0] beta, sigma = x[:p], x[p] if n > p: if mode in ['grad', 'both']: g = np.zeros(p+1) g0 = np.dot(self._quadratic_term, beta) f1 = self._constant_term + (self._linear_term * beta).sum() + (g0 * beta).sum() g1 = 2 * g0 + self._linear_term else: g1 = np.dot(self._quadratic_term, beta) f1 = self._constant_term + (self._linear_term * beta).sum() + (g1 * beta).sum() else: if mode in ['grad', 'both']: g = np.zeros(p+1) f1, g1 = self._sqerror.smooth_objective(beta, 'both') f1 *= 2; g1 *= 2 else: f1 = self._sqerror.smooth_objective(beta, 'func') f1 *= 2 f = f1 / sigma + sigma if mode == 'both': g[:p] = g1 / sigma g[p] = -f1 / sigma**2 + 1. return f, g elif mode == 'grad': g[:p] = g1 / sigma g[p] = -f1 / sigma**2 + 1. return g elif mode == 'func': return f else: raise ValueError("mode incorrectly specified") def solve_sqrt_lasso_skinny(X, Y, weights=None, initial=None, **solve_kwargs): """ Solve the square-root LASSO optimization problem: $$ \text{minimize}_{\beta} \|y-X\beta\|_2 + D |\beta|, $$ where $D$ is the diagonal matrix with weights on its diagonal. Parameters ---------- y : np.float((n,)) The target, in the model $y = X\beta$ X : np.float((n, p)) The data, in the model $y = X\beta$ weights : np.float Coefficients of the L-1 penalty in optimization problem, note that different coordinates can have different coefficients. initial : np.float(p) Initial point for optimization. solve_kwargs : dict Arguments passed to regreg solver. """ n, p = X.shape if weights is None: lam = choose_lambda(X) weights = lam * np.ones((p,)) weight_dict = dict(zip(np.arange(p), 2 * weights)) penalty = rr.mixed_lasso(range(p) + [rr.NONNEGATIVE], lagrange=1., weights=weight_dict) loss = sqlasso_objective_skinny(X, Y) problem = rr.simple_problem(loss, penalty) problem.coefs[-1] = np.linalg.norm(Y) if initial is not None: problem.coefs[:-1] = initial soln = problem.solve(**solve_kwargs) return soln[:-1] class sqrt_lasso(object): r""" A class for the square-root LASSO for post-selection inference. The problem solved is .. math:: \text{minimize}_{\beta} \|y-X\beta\|^2 + \lambda \|\beta\|_1 where $\lambda$ is `lam` and .. math:: \lambda_{\max} = \frac{1}{n} \|X^Ty\|_{\infty} """ # level for coverage is 1-alpha alpha = 0.05 UMAU = False def __init__(self, y, X, weights): """ Parameters ---------- y : np.float(y) The target, in the model $y = X\beta$ X : np.float((n, p)) The data, in the model $y = X\beta$ weights : np.float(p) or float Coefficients in weighted L-1 penalty in optimization problem. If a float, weights are proportional to 1. """ n, p = X.shape self.y = y self.X = X n, p = X.shape if np.array(weights).shape == (): weights = weights * np.ones(p) self.weights = weights def fit(self, **solve_kwargs): """ Fit the square root LASSO using `regreg` using `weights=self.weights.` Parameters ---------- solve_kwargs : dict Arguments passed to regreg solver. Returns ------- soln : np.float Solution to lasso with `sklearn_alpha=self.lagrange`. """ y, X = self.y, self.X n, p = self.X.shape if n < p: self._soln = solve_sqrt_lasso_skinny(X, y, self.weights, **solve_kwargs) else: self._soln = solve_sqrt_lasso_fat(X, y, self.weights, **solve_kwargs) beta = self._soln self.active = (beta != 0) # E nactive = self.active.sum() # |E| if nactive: self.z_E = np.sign(beta[self.active]) # z_E # calculate the "partial correlation" operator R = X_{-E}^T (I - P_E) X_E = self._X_E = self.X[:,self.active] X_notE = self.X[:,~self.active] self._XEinv = np.linalg.pinv(X_E) self.df_E = n - nactive self.P_E = np.dot(X_E, self._XEinv) self.R_E = np.identity(n) - self.P_E w_E = np.dot(self._XEinv.T, self.weights[self.active] * self.z_E) sigma_multiplier = np.sqrt(self.df_E / (1 - np.linalg.norm(w_E)**2)) self.sigma_E = np.linalg.norm((y - np.dot(self.P_E, y))) / np.sqrt(self.df_E) (self._active_constraints, self._inactive_constraints, self._constraints) = _constraint_from_data(X_E, X_notE, self.z_E, self.active, sigma_multiplier * self.sigma_E * self.weights, self.sigma_E, np.dot(X_notE.T, self.R_E)) W_E = np.dot(self._XEinv, w_E) s_E = np.sign(self.z_E * W_E) self._S_trunc_denominator = denominator = sigma_multiplier * W_E * self.z_E self.S_trunc_interval = self.compute_sigma_truncation_interval(np.dot(self._XEinv, y)) # HACK to make things more stable? self.S_trunc_interval[0] = 0 self._quasi_affine_constraints = orthogonal_QA(self._active_constraints.linear_part, np.zeros(self._active_constraints.linear_part.shape[0]), self._active_constraints.offset / (self.sigma_E * np.sqrt(self.df_E)), (self.sigma_E * np.sqrt(self.df_E))**2, self.df_E) # for metropolis hastings data carving sampler self.full_quasi = quasi_affine(self.constraints.linear_part, np.zeros(self.constraints.linear_part.shape[0]), self.constraints.offset / (self.sigma_E * np.sqrt(self.df_E)), self.R_E) cov = np.identity(n) * self.sigma_hat**2 for con in [self._active_constraints, self._inactive_constraints, self._constraints, self._quasi_affine_constraints]: con.covariance[:] = cov else: self.df_E = self.y.shape[0] self.sigma_E = np.linalg.norm(y) / np.sqrt(self.df_E) self.S_trunc_interval = [0, np.inf] self._active_constraints = self._inactive_constraints = self._constraints = None self.active = np.nonzero(self.active)[0] def compute_sigma_truncation_interval(self, coef, raise_if_outside=False): numerator = coef * self.z_E denominator = self._S_trunc_denominator s_E =
np.sign(self.z_E * denominator)
numpy.sign
''' Visualization for RGB results. ''' import sys, os cur_file_path = os.path.dirname(os.path.realpath(__file__)) sys.path.append(os.path.join(cur_file_path, '..')) import importlib, time, math, shutil, csv, random import numpy as np import cv2 import torch import torch.nn as nn from torch.utils.data import Dataset, DataLoader from utils.config import SplitLineParser from utils.transforms import rotation_matrix_to_angle_axis, batch_rodrigues from utils.torch import load_state from utils.logging import mkdir from fitting.fitting_utils import load_res, prep_res, run_smpl from fitting.eval_utils import SMPL_SIZES from body_model.body_model import BodyModel from body_model.utils import SMPL_PATH, SMPLH_PATH, SMPL_JOINTS, SMPLX_PATH from viz.utils import viz_smpl_seq, viz_results, create_gif, create_video, create_multi_comparison_images, smpl_connections, imapper_connections, comp_connections from viz.mesh_viewer import COMPRESS_PARAMS J_BODY = len(SMPL_JOINTS)-1 # no root GT_RES_NAME = 'gt_results' PRED_RES_NAME = 'stage3_results' PRED_PRIOR_RES_NAME = 'stage3_results_prior' STAGES_RES_NAMES = ['stage1_results', 'stage2_results', 'stage3_init_results'] # results in camera frame STAGES_PRIOR_RES_NAMES = ['stage2_results_prior', 'stage3_init_results_prior'] # results in prior frame (w.r.t final floor fit) FINAL_RES_NAME = 'final_results' FINAL_PRIOR_RES_NAME = 'final_results_prior' OBS_NAME = 'observations' FPS = 30 # visualization options GROUND_ALPHA = 1.0 BODY_ALPHA = None # use to make body mesh translucent IM_EXTN = 'jpg' # png # to use for rendering jpg saves a lot of space def parse_args(argv): parser = SplitLineParser(fromfile_prefix_chars='@', allow_abbrev=False) parser.add_argument('--results', type=str, required=True, help='Path to the results_out directory from fitting to run viz on.') parser.add_argument('--out', type=str, required=True, help='Path to save visualizations to.') # visualization options parser.add_argument('--viz-final-only', dest='viz_final_only', action='store_true', help="If given only visualize the final full sequence result and not the subsequences.") parser.set_defaults(viz_final_only=False) parser.add_argument('--viz-stages', dest='viz_stages', action='store_true', help="If given, visualizes intermediate optimization stages and comparison to final pred.") parser.set_defaults(viz_stages=False) parser.add_argument('--viz-prior-frame', dest='viz_prior_frame', action='store_true', help="If given, also visualizes results in the HuMoR canonical coordinate frame.") parser.set_defaults(viz_prior_frame=False) parser.add_argument('--viz-obs-2d', dest='viz_obs_2d', action='store_true', help="If given, visualizes 2D joint observations on top of og video") parser.set_defaults(viz_obs_2d=False) parser.add_argument('--viz-no-render-cam-body', dest='viz_render_cam_body', action='store_false', help="If given, does not render body mesh from camera view") parser.set_defaults(viz_render_cam_body=True) parser.add_argument('--viz-pred-floor', dest='viz_pred_floor', action='store_true', help="Render the predicted floor from the camera view.") parser.set_defaults(viz_pred_floor=False) parser.add_argument('--viz-contacts', dest='viz_contacts', action='store_true', help="Render predicted contacts on the joints") parser.set_defaults(viz_contacts=False) parser.add_argument('--viz-wireframe', dest='viz_wireframe', action='store_true', help="Render body and floor in wireframe") parser.set_defaults(viz_wireframe=False) parser.add_argument('--viz-bodies-static', type=int, default=None, help="If given, renders all body predictions at once at this given frame interval interval.") parser.add_argument('--viz-no-bg', dest='viz_bg', action='store_false', help="If given will not overlay the rendering on top of OG video.") parser.set_defaults(viz_bg=True) parser.add_argument('--viz-render-width', type=int, default=1280, help="Width of rendered output images") parser.add_argument('--viz-render-height', type=int, default=720, help="Width of rendered output images") parser.add_argument('--shuffle', dest='shuffle', action='store_true', help="Shuffles viz ordering") parser.set_defaults(shuffle=False) parser.add_argument('--flip-img', dest='flip_img', action='store_true', help="Flips the loaded image about y-axis. This is useful for PROX result.") parser.set_defaults(flip_img=False) known_args, unknown_args = parser.parse_known_args(argv) return known_args def main(args): print(args) mkdir(args.out) qual_out_path = args.out D_IMW, D_IMH = args.viz_render_width, args.viz_render_height device = torch.device('cuda:0') if torch.cuda.is_available() else torch.device('cpu') # collect our results directories all_result_dirs = [os.path.join(args.results, f) for f in sorted(os.listdir(args.results)) if f[0] != '.'] all_result_dirs = [f for f in all_result_dirs if os.path.isdir(f)] if args.shuffle: random.seed(0) random.shuffle(all_result_dirs) print(all_result_dirs) seq_name_list = [] body_model_dict = dict() for residx, result_dir in enumerate(all_result_dirs): seq_name = result_dir.split('/')[-1] is_final_res = seq_name == 'final_results' if not is_final_res: if args.viz_final_only: continue seq_name = '_'.join(result_dir.split('/')[-1].split('_')[:-1]) print('Visualizing %s %d / %d...' % (seq_name, residx, len(all_result_dirs))) obs_dict = load_res(result_dir, OBS_NAME + '.npz') cur_img_paths = obs_dict['img_paths'] # used to load in results from baselines cur_frame_names = ['.'.join(f.split('/')[-1].split('.')[:-1]) for f in cur_img_paths] # load in humor prediction pred_res = load_res(result_dir, PRED_RES_NAME + '.npz') if pred_res is None: print('Could not find final pred (stage 3) results for %s, skipping...' % (seq_name)) continue T = pred_res['trans'].shape[0] # check if have any nans valid for smpk in SMPL_SIZES.keys(): cur_valid = (torch.sum(torch.logical_not(torch.isfinite(torch.Tensor(pred_res[smpk])))).item() == 0) if not cur_valid: print('Found NaNs in prediction for %s, filling with zeros...' % (smpk)) # print(pred_res[smpk].shape) if smpk == 'betas': pred_res[smpk] = np.zeros((pred_res[smpk].shape[0]), dtype=np.float) else: pred_res[smpk] = np.zeros((T, pred_res[smpk].shape[1]), dtype=np.float) floor_valid = (torch.sum(torch.logical_not(torch.isfinite(torch.Tensor(pred_res['floor_plane'])))).item() == 0) if not floor_valid: print('Predicted floor is NaN, replacing with up.') pred_res['floor_plane'] = np.array([0.0, -1.0, 0.0, 0.0]) pred_res = prep_res(pred_res, device, T) num_pred_betas = pred_res['betas'].size(1) pred_floor_plane = torch.Tensor(pred_res['floor_plane']).to(device) # humor prediction in prior frame pred_res_prior = None if args.viz_prior_frame: pred_res_prior = load_res(result_dir, PRED_PRIOR_RES_NAME + '.npz') if pred_res_prior is None: print('Could not find final prior pred (stage 3) results for %s, skipping...' % (seq_name)) continue pred_res_prior = prep_res(pred_res_prior, device, T) # load stages results if needed cur_viz_stages = args.viz_stages and not is_final_res cur_stages_res = None if cur_viz_stages: cur_stages_res = dict() for stage_name in STAGES_RES_NAMES: stage_res = load_res(result_dir, stage_name + '.npz') if stage_res is None: print('Could not find results for stage %s of %s, skipping...' % (stage_name, seq_name)) continue cur_stages_res[stage_name] = prep_res(stage_res, device, T) # load prior stages results if needed cur_stages_prior_res = None if args.viz_prior_frame and cur_viz_stages: cur_stages_prior_res = dict() for stage_name in STAGES_PRIOR_RES_NAMES: stage_res = load_res(result_dir, stage_name + '.npz') if stage_res is None: print('Could not find results for stage %s of %s, skipping...' % (stage_name, seq_name)) continue cur_stages_prior_res[stage_name] = prep_res(stage_res, device, T) # # create body models for each # meta_path = os.path.join(result_dir, 'meta.txt') if not os.path.exists(meta_path): print('Could not find metadata for %s, skipping...' % (seq_name)) continue optim_bm_path = gt_bm_path = None with open(meta_path, 'r') as f: optim_bm_str = f.readline().strip() optim_bm_path = optim_bm_str.split(' ')[1] gt_bm_str = f.readline().strip() gt_bm_path = gt_bm_str.split(' ')[1] # humor model pred_bm = None if optim_bm_path not in body_model_dict: pred_bm = BodyModel(bm_path=optim_bm_path, num_betas=num_pred_betas, batch_size=T).to(device) if not is_final_res: # final results will be different length, so want to re-load for subsequences body_model_dict[optim_bm_path] = pred_bm if not is_final_res: pred_bm = body_model_dict[optim_bm_path] # we are using this sequence for sure seq_name_list.append(seq_name) # run through SMPL pred_body = run_smpl(pred_res, pred_bm) stages_body = None if cur_stages_res is not None: stages_body = dict() for k, v in cur_stages_res.items(): stages_body[k] = run_smpl(v, pred_bm) # get body smpl joints stage_body_joints = stages_body[k].Jtr[:, :len(SMPL_JOINTS)] cur_stages_res[k]['joints3d_smpl'] = stage_body_joints # prior frame through SMPL pred_prior_body = None if pred_res_prior is not None: pred_prior_body = run_smpl(pred_res_prior, pred_bm) stages_prior_body = None if cur_stages_prior_res is not None: stages_prior_body = dict() for k, v in cur_stages_prior_res.items(): stages_prior_body[k] = run_smpl(v, pred_bm) # load in image frames IMW, IMH = None, None img_arr =
np.zeros((T, D_IMH, D_IMW, 3), dtype=np.float32)
numpy.zeros
import os import pandas as pd import numpy as np import dash import dash_core_components as dcc import dash_html_components as html import plotly.graph_objs as go df_all = pd.read_csv("result_all.csv") df_kanto = pd.read_csv("result_kanto.csv") df_kanto_groupby = df_kanto.groupby("station_id", as_index=False).mean() df_timeserias_all = pd.read_csv("result_timeserias_all.csv") # Or using s3 bucket. # df = pd.read_csv("s3://your-bucket/result.csv") MAPBOX_ACCESS_TOKEN = os.getenv("MAPBOX_ACCESS_TOKEN", "YOUR TOKEN") # FIXME: input your mapbox token # https://docs.mapbox.com/help/how-mapbox-works/access-tokens/ PORT = os.getenv("PORT", "8080") app = dash.Dash() application = app.server app.css.append_css({ "external_url": "https://cdn.rawgit.com/plotly/dash-app-stylesheets/" "2d266c578d2a6e8850ebce48fdb52759b2aef506/stylesheet-oil-and-gas.css"}) app.layout = html.Div(children=[ html.H1(children="温度マップ"), html.H2(children="全国の温度マップ"), html.Div([ html.Div([ dcc.Graph(id="temp-map",) ], className="eight columns"), html.Div([ html.Button("平均気温", id="btn-avg", n_clicks_timestamp="0"), html.Button("最高気温", id="btn-high", n_clicks_timestamp="0"), html.Button("最低気温", id="btn-low", n_clicks_timestamp="0"), html.Div(id="container-button-temp-select") ], className="four columns"), html.Div([ dcc.Graph(id="low-and-high", figure={ "data": [ go.Scatter( x=df_all[df_all["prefecture"] == i]["low_temperature"], y=df_all[df_all["prefecture"] == i]["high_temperature"], text=df_all[df_all["prefecture"] == i]["prefecture"], mode="markers", opacity=0.7, marker={ "size": 15, "line": {"width": 0.5, "color": "white"} }, name=i )for i in df_all["prefecture"].unique() ], "layout": go.Layout( xaxis={"title": "最低気温"}, yaxis={"title": "最高気温"}, margin={"l": 50, "b": 50, "t": 10, "r": 10}, showlegend=False, hovermode="closest") }) ], className="four columns") ], className="row"), html.H2(children="関東の温度マップ"), html.Div([ html.Div([ dcc.Graph( id="temp-kanto-map", figure={ "data": [ go.Scattermapbox( lat=df_kanto_groupby[df_kanto_groupby["station_id"] == i]["latitude"], lon=df_kanto_groupby[df_kanto_groupby["station_id"] == i]["longitude"], mode="markers", customdata=df_kanto_groupby[df_kanto_groupby["station_id"] == i]["station_id"], marker=dict( symbol="circle", size=16, opacity=0.8, colorscale="RdBu", cmin=df_kanto_groupby["avg_temperature"].min(), color=df_kanto_groupby[df_kanto_groupby["station_id"] == i]["avg_temperature"], cmax=df_kanto_groupby["avg_temperature"].max(), ), text=df_kanto_groupby[df_kanto_groupby["station_id"] == i]["avg_temperature"], ) for i in df_kanto_groupby["station_id"].unique() ], "layout": go.Layout( autosize=True, showlegend=False, hovermode="closest", mapbox=dict( accesstoken=MAPBOX_ACCESS_TOKEN, bearing=0, center=dict( lat=np.mean(df_kanto_groupby["latitude"]), lon=np.mean(df_kanto_groupby["longitude"]) ), pitch=100, zoom=8, ), height=600 ) } ) ], className="six columns"), html.Div([ dcc.Graph(id="temp-timesearias") ], className="six columns",) ], className="row"), ]) @app.callback(dash.dependencies.Output("temp-map", "figure"), [dash.dependencies.Input("btn-avg", "n_clicks_timestamp"), dash.dependencies.Input('btn-high', "n_clicks_timestamp"), dash.dependencies.Input("btn-low", "n_clicks_timestamp")]) def update_temp_map(btn1, btn2, btn3): if int(btn1) > int(btn2) and int(btn1) > int(btn3): index = "avg_temperature" elif int(btn2) > int(btn1) and int(btn2) > int(btn3): index = "high_temperature" elif int(btn3) > int(btn1) and int(btn3) > int(btn2): index = "low_temperature" else: index = "avg_temperature" return { "data": [ go.Scattermapbox( lat=df_all[df_all["prefecture"] == i]["latitude"], lon=df_all[df_all["prefecture"] == i]["longitude"], mode="markers", marker=dict( symbol="circle", size=20, opacity=0.8, colorscale="RdBu", cmin=df_all[index].min(), color=df_all[df_all["prefecture"] == i][index], cmax=df_all[index].max(), ), text=df_all[df_all["prefecture"] == i][index], name=str(df_all[df_all["prefecture"] == i]["prefecture"].values), ) for i in df_all["prefecture"].unique() ], "layout": go.Layout( autosize=True, showlegend=False, hovermode="closest", mapbox=dict( accesstoken=MAPBOX_ACCESS_TOKEN, bearing=0, center=dict( lat=np.mean(df_all["latitude"]), lon=
np.mean(df_all["longitude"])
numpy.mean
import inspect import albumentations import mmcv import numpy as np from albumentations import Compose from imagecorruptions import corrupt from numpy import random from mmdet.core.evaluation.bbox_overlaps import bbox_overlaps from ..registry import PIPELINES @PIPELINES.register_module class Resize(object): """Resize images & bbox & mask. This transform resizes the input image to some scale. Bboxes and masks are then resized with the same scale factor. If the input dict contains the key "scale", then the scale in the input dict is used, otherwise the specified scale in the init method is used. `img_scale` can either be a tuple (single-scale) or a list of tuple (multi-scale). There are 3 multiscale modes: - `ratio_range` is not None: randomly sample a ratio from the ratio range and multiply it with the image scale. - `ratio_range` is None and `multiscale_mode` == "range": randomly sample a scale from the a range. - `ratio_range` is None and `multiscale_mode` == "value": randomly sample a scale from multiple scales. Args: img_scale (tuple or list[tuple]): Images scales for resizing. multiscale_mode (str): Either "range" or "value". ratio_range (tuple[float]): (min_ratio, max_ratio) keep_ratio (bool): Whether to keep the aspect ratio when resizing the image. """ def __init__(self, img_scale=None, multiscale_mode='range', ratio_range=None, keep_ratio=True): if img_scale is None: self.img_scale = None else: if isinstance(img_scale, list): self.img_scale = img_scale else: self.img_scale = [img_scale] assert mmcv.is_list_of(self.img_scale, tuple) if ratio_range is not None: # mode 1: given a scale and a range of image ratio assert len(self.img_scale) == 1 else: # mode 2: given multiple scales or a range of scales assert multiscale_mode in ['value', 'range'] self.multiscale_mode = multiscale_mode self.ratio_range = ratio_range self.keep_ratio = keep_ratio @staticmethod def random_select(img_scales): assert mmcv.is_list_of(img_scales, tuple) scale_idx = np.random.randint(len(img_scales)) img_scale = img_scales[scale_idx] return img_scale, scale_idx @staticmethod def random_sample(img_scales): assert mmcv.is_list_of(img_scales, tuple) and len(img_scales) == 2 img_scale_long = [max(s) for s in img_scales] img_scale_short = [min(s) for s in img_scales] long_edge = np.random.randint( min(img_scale_long), max(img_scale_long) + 1) short_edge = np.random.randint( min(img_scale_short), max(img_scale_short) + 1) img_scale = (long_edge, short_edge) return img_scale, None @staticmethod def random_sample_ratio(img_scale, ratio_range): assert isinstance(img_scale, tuple) and len(img_scale) == 2 min_ratio, max_ratio = ratio_range assert min_ratio <= max_ratio ratio = np.random.random_sample() * (max_ratio - min_ratio) + min_ratio scale = int(img_scale[0] * ratio), int(img_scale[1] * ratio) return scale, None def _random_scale(self, results): if self.ratio_range is not None: scale, scale_idx = self.random_sample_ratio( self.img_scale[0], self.ratio_range) elif len(self.img_scale) == 1: scale, scale_idx = self.img_scale[0], 0 elif self.multiscale_mode == 'range': scale, scale_idx = self.random_sample(self.img_scale) elif self.multiscale_mode == 'value': scale, scale_idx = self.random_select(self.img_scale) else: raise NotImplementedError results['scale'] = scale results['scale_idx'] = scale_idx def _resize_img(self, results): if self.keep_ratio: img, scale_factor = mmcv.imrescale( results['img'], results['scale'], return_scale=True) else: img, w_scale, h_scale = mmcv.imresize( results['img'], results['scale'], return_scale=True) scale_factor = np.array([w_scale, h_scale, w_scale, h_scale], dtype=np.float32) results['img'] = img results['img_shape'] = img.shape results['pad_shape'] = img.shape # in case that there is no padding results['scale_factor'] = scale_factor results['keep_ratio'] = self.keep_ratio def _resize_bboxes(self, results): img_shape = results['img_shape'] for key in results.get('bbox_fields', []): bboxes = results[key] * results['scale_factor'] bboxes[:, 0::2] = np.clip(bboxes[:, 0::2], 0, img_shape[1] - 1) bboxes[:, 1::2] = np.clip(bboxes[:, 1::2], 0, img_shape[0] - 1) results[key] = bboxes def _resize_masks(self, results): for key in results.get('mask_fields', []): if results[key] is None: continue if self.keep_ratio: masks = [ mmcv.imrescale( mask, results['scale_factor'], interpolation='nearest') for mask in results[key] ] else: mask_size = (results['img_shape'][1], results['img_shape'][0]) masks = [ mmcv.imresize(mask, mask_size, interpolation='nearest') for mask in results[key] ] results[key] = masks def _resize_landmarks(self, results): key = "gt_landmarks" if key in results: img_shape = results['img_shape'] w_scale = results['scale_factor'][0] h_scale = results['scale_factor'][1] scale_factor = np.array([w_scale, h_scale] * 5, dtype=np.float32) ldms = results[key] * scale_factor ldms[:, 0::2] = np.clip(ldms[:, 0::2], 0, img_shape[1] - 1) ldms[:, 1::2] = np.clip(ldms[:, 1::2], 0, img_shape[0] - 1) results[key] = ldms def __call__(self, results): if 'scale' not in results: self._random_scale(results) self._resize_img(results) self._resize_bboxes(results) self._resize_masks(results) self._resize_landmarks(results) return results def __repr__(self): repr_str = self.__class__.__name__ repr_str += ('(img_scale={}, multiscale_mode={}, ratio_range={}, ' 'keep_ratio={})').format(self.img_scale, self.multiscale_mode, self.ratio_range, self.keep_ratio) return repr_str @PIPELINES.register_module class RandomFlip(object): """Flip the image & bbox & mask. If the input dict contains the key "flip", then the flag will be used, otherwise it will be randomly decided by a ratio specified in the init method. Args: flip_ratio (float, optional): The flipping probability. """ def __init__(self, flip_ratio=None): self.flip_ratio = flip_ratio if flip_ratio is not None: assert flip_ratio >= 0 and flip_ratio <= 1 def bbox_flip(self, bboxes, img_shape): """Flip bboxes horizontally. Args: bboxes(ndarray): shape (..., 4*k) img_shape(tuple): (height, width) """ assert bboxes.shape[-1] % 4 == 0 w = img_shape[1] flipped = bboxes.copy() flipped[..., 0::4] = w - bboxes[..., 2::4] - 1 flipped[..., 2::4] = w - bboxes[..., 0::4] - 1 return flipped def __call__(self, results): if 'flip' not in results: flip = True if np.random.rand() < self.flip_ratio else False results['flip'] = flip if results['flip']: # flip image results['img'] = mmcv.imflip(results['img']) # flip bboxes for key in results.get('bbox_fields', []): results[key] = self.bbox_flip(results[key], results['img_shape']) # flip masks for key in results.get('mask_fields', []): results[key] = [mask[:, ::-1] for mask in results[key]] return results def __repr__(self): return self.__class__.__name__ + '(flip_ratio={})'.format( self.flip_ratio) @PIPELINES.register_module class Pad(object): """Pad the image & mask. There are two padding modes: (1) pad to a fixed size and (2) pad to the minimum size that is divisible by some number. Args: size (tuple, optional): Fixed padding size. size_divisor (int, optional): The divisor of padded size. pad_val (float, optional): Padding value, 0 by default. """ def __init__(self, size=None, size_divisor=None, pad_val=0): self.size = size self.size_divisor = size_divisor self.pad_val = pad_val # only one of size and size_divisor should be valid assert size is not None or size_divisor is not None assert size is None or size_divisor is None def _pad_img(self, results): if self.size is not None: padded_img = mmcv.impad(results['img'], self.size) elif self.size_divisor is not None: padded_img = mmcv.impad_to_multiple( results['img'], self.size_divisor, pad_val=self.pad_val) results['img'] = padded_img results['pad_shape'] = padded_img.shape results['pad_fixed_size'] = self.size results['pad_size_divisor'] = self.size_divisor def _pad_masks(self, results): pad_shape = results['pad_shape'][:2] for key in results.get('mask_fields', []): padded_masks = [ mmcv.impad(mask, pad_shape, pad_val=self.pad_val) for mask in results[key] ] results[key] = np.stack(padded_masks, axis=0) def __call__(self, results): self._pad_img(results) self._pad_masks(results) return results def __repr__(self): repr_str = self.__class__.__name__ repr_str += '(size={}, size_divisor={}, pad_val={})'.format( self.size, self.size_divisor, self.pad_val) return repr_str @PIPELINES.register_module class Normalize(object): """Normalize the image. Args: mean (sequence): Mean values of 3 channels. std (sequence): Std values of 3 channels. to_rgb (bool): Whether to convert the image from BGR to RGB, default is true. """ def __init__(self, mean, std, to_rgb=True): self.mean = np.array(mean, dtype=np.float32) self.std = np.array(std, dtype=np.float32) self.to_rgb = to_rgb def __call__(self, results): results['img'] = mmcv.imnormalize(results['img'], self.mean, self.std, self.to_rgb) results['img_norm_cfg'] = dict( mean=self.mean, std=self.std, to_rgb=self.to_rgb) return results def __repr__(self): repr_str = self.__class__.__name__ repr_str += '(mean={}, std={}, to_rgb={})'.format( self.mean, self.std, self.to_rgb) return repr_str @PIPELINES.register_module class RandomCrop(object): """Random crop the image & bboxes & masks. Args: crop_size (tuple): Expected size after cropping, (h, w). """ def __init__(self, crop_size): self.crop_size = crop_size def __call__(self, results): img = results['img'] margin_h = max(img.shape[0] - self.crop_size[0], 0) margin_w = max(img.shape[1] - self.crop_size[1], 0) offset_h = np.random.randint(0, margin_h + 1) offset_w = np.random.randint(0, margin_w + 1) crop_y1, crop_y2 = offset_h, offset_h + self.crop_size[0] crop_x1, crop_x2 = offset_w, offset_w + self.crop_size[1] # crop the image img = img[crop_y1:crop_y2, crop_x1:crop_x2, :] img_shape = img.shape results['img'] = img results['img_shape'] = img_shape # crop bboxes accordingly and clip to the image boundary for key in results.get('bbox_fields', []): bbox_offset = np.array([offset_w, offset_h, offset_w, offset_h], dtype=np.float32) bboxes = results[key] - bbox_offset bboxes[:, 0::2] = np.clip(bboxes[:, 0::2], 0, img_shape[1] - 1) bboxes[:, 1::2] = np.clip(bboxes[:, 1::2], 0, img_shape[0] - 1) results[key] = bboxes # filter out the gt bboxes that are completely cropped if 'gt_bboxes' in results: gt_bboxes = results['gt_bboxes'] valid_inds = (gt_bboxes[:, 2] > gt_bboxes[:, 0]) & ( gt_bboxes[:, 3] > gt_bboxes[:, 1]) # if no gt bbox remains after cropping, just skip this image if not np.any(valid_inds): return None results['gt_bboxes'] = gt_bboxes[valid_inds, :] if 'gt_labels' in results: results['gt_labels'] = results['gt_labels'][valid_inds] # filter and crop the masks if 'gt_masks' in results: valid_gt_masks = [] for i in np.where(valid_inds)[0]: gt_mask = results['gt_masks'][i][crop_y1:crop_y2, crop_x1: crop_x2] valid_gt_masks.append(gt_mask) results['gt_masks'] = valid_gt_masks return results def __repr__(self): return self.__class__.__name__ + '(crop_size={})'.format( self.crop_size) @PIPELINES.register_module class SegResizeFlipPadRescale(object): """A sequential transforms to semantic segmentation maps. The same pipeline as input images is applied to the semantic segmentation map, and finally rescale it by some scale factor. The transforms include: 1. resize 2. flip 3. pad 4. rescale (so that the final size can be different from the image size) Args: scale_factor (float): The scale factor of the final output. """ def __init__(self, scale_factor=1): self.scale_factor = scale_factor def __call__(self, results): if results['keep_ratio']: gt_seg = mmcv.imrescale( results['gt_semantic_seg'], results['scale'], interpolation='nearest') else: gt_seg = mmcv.imresize( results['gt_semantic_seg'], results['scale'], interpolation='nearest') if results['flip']: gt_seg = mmcv.imflip(gt_seg) if gt_seg.shape != results['pad_shape']: gt_seg = mmcv.impad(gt_seg, results['pad_shape'][:2]) if self.scale_factor != 1: gt_seg = mmcv.imrescale( gt_seg, self.scale_factor, interpolation='nearest') results['gt_semantic_seg'] = gt_seg return results def __repr__(self): return self.__class__.__name__ + '(scale_factor={})'.format( self.scale_factor) @PIPELINES.register_module class PhotoMetricDistortion(object): """Apply photometric distortion to image sequentially, every transformation is applied with a probability of 0.5. The position of random contrast is in second or second to last. 1. random brightness 2. random contrast (mode 0) 3. convert color from BGR to HSV 4. random saturation 5. random hue 6. convert color from HSV to BGR 7. random contrast (mode 1) 8. randomly swap channels Args: brightness_delta (int): delta of brightness. contrast_range (tuple): range of contrast. saturation_range (tuple): range of saturation. hue_delta (int): delta of hue. """ def __init__(self, brightness_delta=32, contrast_range=(0.5, 1.5), saturation_range=(0.5, 1.5), hue_delta=18): self.brightness_delta = brightness_delta self.contrast_lower, self.contrast_upper = contrast_range self.saturation_lower, self.saturation_upper = saturation_range self.hue_delta = hue_delta def __call__(self, results): img = results['img'] # random brightness if random.randint(2): delta = random.uniform(-self.brightness_delta, self.brightness_delta) img += delta # mode == 0 --> do random contrast first # mode == 1 --> do random contrast last mode = random.randint(2) if mode == 1: if random.randint(2): alpha = random.uniform(self.contrast_lower, self.contrast_upper) img *= alpha # convert color from BGR to HSV img = mmcv.bgr2hsv(img) # random saturation if random.randint(2): img[..., 1] *= random.uniform(self.saturation_lower, self.saturation_upper) # random hue if random.randint(2): img[..., 0] += random.uniform(-self.hue_delta, self.hue_delta) img[..., 0][img[..., 0] > 360] -= 360 img[..., 0][img[..., 0] < 0] += 360 # convert color from HSV to BGR img = mmcv.hsv2bgr(img) # random contrast if mode == 0: if random.randint(2): alpha = random.uniform(self.contrast_lower, self.contrast_upper) img *= alpha # randomly swap channels if random.randint(2): img = img[..., random.permutation(3)] results['img'] = img return results def __repr__(self): repr_str = self.__class__.__name__ repr_str += ('(brightness_delta={}, contrast_range={}, ' 'saturation_range={}, hue_delta={})').format( self.brightness_delta, self.contrast_range, self.saturation_range, self.hue_delta) return repr_str @PIPELINES.register_module class Expand(object): """Random expand the image & bboxes. Randomly place the original image on a canvas of 'ratio' x original image size filled with mean values. The ratio is in the range of ratio_range. Args: mean (tuple): mean value of dataset. to_rgb (bool): if need to convert the order of mean to align with RGB. ratio_range (tuple): range of expand ratio. """ def __init__(self, mean=(0, 0, 0), to_rgb=True, ratio_range=(1, 4)): if to_rgb: self.mean = mean[::-1] else: self.mean = mean self.min_ratio, self.max_ratio = ratio_range def __call__(self, results): if random.randint(2): return results img, boxes = [results[k] for k in ('img', 'gt_bboxes')] h, w, c = img.shape ratio = random.uniform(self.min_ratio, self.max_ratio) expand_img = np.full((int(h * ratio), int(w * ratio), c), self.mean).astype(img.dtype) left = int(random.uniform(0, w * ratio - w)) top = int(random.uniform(0, h * ratio - h)) expand_img[top:top + h, left:left + w] = img boxes = boxes + np.tile((left, top), 2).astype(boxes.dtype) results['img'] = expand_img results['gt_bboxes'] = boxes if 'gt_masks' in results: expand_gt_masks = [] for mask in results['gt_masks']: expand_mask = np.full((int(h * ratio), int(w * ratio)), 0).astype(mask.dtype) expand_mask[top:top + h, left:left + w] = mask expand_gt_masks.append(expand_mask) results['gt_masks'] = expand_gt_masks return results def __repr__(self): repr_str = self.__class__.__name__ repr_str += '(mean={}, to_rgb={}, ratio_range={})'.format( self.mean, self.to_rgb, self.ratio_range) return repr_str @PIPELINES.register_module class MinIoURandomCrop(object): """Random crop the image & bboxes, the cropped patches have minimum IoU requirement with original image & bboxes, the IoU threshold is randomly selected from min_ious. Args: min_ious (tuple): minimum IoU threshold crop_size (tuple): Expected size after cropping, (h, w). """ def __init__(self, min_ious=(0.1, 0.3, 0.5, 0.7, 0.9), min_crop_size=0.3): # 1: return ori img self.sample_mode = (1, *min_ious, 0) self.min_crop_size = min_crop_size def __call__(self, results): img, boxes, labels = [ results[k] for k in ('img', 'gt_bboxes', 'gt_labels') ] h, w, c = img.shape while True: mode = random.choice(self.sample_mode) if mode == 1: return results min_iou = mode for i in range(50): new_w = random.uniform(self.min_crop_size * w, w) new_h = random.uniform(self.min_crop_size * h, h) # h / w in [0.5, 2] if new_h / new_w < 0.5 or new_h / new_w > 2: continue left = random.uniform(w - new_w) top = random.uniform(h - new_h) patch = np.array( (int(left), int(top), int(left + new_w), int(top + new_h))) overlaps = bbox_overlaps( patch.reshape(-1, 4), boxes.reshape(-1, 4)).reshape(-1) if overlaps.min() < min_iou: continue # center of boxes should inside the crop img center = (boxes[:, :2] + boxes[:, 2:]) / 2 mask = ((center[:, 0] > patch[0]) * (center[:, 1] > patch[1]) * (center[:, 0] < patch[2]) * (center[:, 1] < patch[3])) if not mask.any(): continue boxes = boxes[mask] labels = labels[mask] # adjust boxes img = img[patch[1]:patch[3], patch[0]:patch[2]] boxes[:, 2:] = boxes[:, 2:].clip(max=patch[2:]) boxes[:, :2] = boxes[:, :2].clip(min=patch[:2]) boxes -=
np.tile(patch[:2], 2)
numpy.tile
# -*- coding: utf-8 -*- from screws.freeze.main import FrozenOnly import numpy as np class ___3dCSCG_1Form_Vortex_Detection___(FrozenOnly): """A wrapper of all vortex detection methods. So, we consider this 1 form as a variable of a flow field. """ def __init__(self, _1sf): self._sf_ = _1sf self._freeze_self_() def ___PRIVATE_generate_gradient_tensor_at___(self, xi, eta, sigma): """We compute the gradient tensor of this 1form. To do so, we first project this 1-form into a vector of 3 standard 0-forms which represent the three components. Then we do the gradient (apply the incidence matrix E10) to each standard 0-form. It returns a 3 by 3 tensor representing ((du_dx, du_dy, du_dz), (dv_dx, dv_dy, dv_dz), (dw_dx, dw_dy, dw_dz)). Each value are 3d evaluated at *meshgrid(xi, eta, sigma, indexing='ij) :param xi: 1d increasing array in [-1,1]. :param eta: 1d increasing array in [-1,1]. :param sigma: 1d increasing array in [-1,1]. """ assert np.ndim(xi) == 1 and np.all(
np.diff(xi)
numpy.diff
# external imports import numpy as np import matplotlib.pyplot as plt from scipy.linalg import block_diag # internal inputs from pympc.dynamics.discrete_time_systems import AffineSystem, PieceWiseAffineSystem from pympc.optimization.parametric_programs import MultiParametricQuadraticProgram, MultiParametricMixedIntegerQuadraticProgram from pympc.optimization.programs import linear_program class ModelPredictiveController(object): """ Model predictive controller for linear systems, it solves the optimal control problem V*(x(0)) := min_{x(.), u(.)} 1/2 sum_{t=0}^{N-1} x'(t) Q x(t) + u'(t) R u(t) + \frac{1}{2} x'(N) P x(N) s.t. x(t+1) = A x(t) + B u(t), t=0, ..., N-1, (x(t), u(t)) in D, t=0, ..., N-1, x(N) in X_N, in order to get the optimal control seuquence (u(0), ..., u(N-1)). """ def __init__(self, S, N, Q, R, P, D, X_N): """ Initilizes the controller. Arguments ---------- S : instance of LinerSystem Linear system to be controlled. N : int Horizon of the optimal control problem. Q : numpy.ndarray Quadratic cost for the state. R : numpy.ndarray Quadratic cost for the input. P : numpy.ndarray Quadratic cost for the terminal state. D : instance of Polyhedron Stage constraint for state and inputs. X_N : instance of Polyhedron Terminal set. """ # store inputs self.S = S self.N = N self.Q = Q self.R = R self.P = P self.D = D self.X_N = X_N # initilize explicit solution self.explicit_solution = None # condense mpqp self.mpqp = self._condense_program() def _condense_program(self): """ Generates and stores the optimal control problem in condensed form. Returns ---------- instance of MultiParametricQuadraticProgram Condensed mpQP. """ # create fake PWA system and use PWA condenser c = np.zeros((self.S.nx, 1)) S = AffineSystem(self.S.A, self.S.B, c) S = PieceWiseAffineSystem([S], [self.D]) mode_sequence = [0]*self.N return condense_optimal_control_problem(S, self.Q, self.R, self.P, self.X_N, mode_sequence) def feedforward(self, x): """ Given the state x of the system, returns the optimal sequence of N inputs and the related cost. Arguments ---------- x : numpy.ndarray State of the system. Returns ---------- u_feedforward : list of numpy.ndarray Optimal control signals for t = 0, ..., N-1. V : float Optimal value function for the given state. """ # solve and check feasibility sol = self.mpqp.solve(x) if sol['min'] is None: return None, None # from vector to list of vectors u_feedforward = [sol['argmin'][self.S.nu*i : self.S.nu*(i+1), :] for i in range(self.N)] V = sol['min'] return u_feedforward, V def feedback(self, x): """ Returns the optimal feedback for the given state x. Arguments ---------- x : numpy.ndarray State of the system. Returns ---------- u_feedback : numpy.ndarray Optimal feedback. """ # get feedforward and extract first input u_feedforward = self.feedforward(x)[0] if u_feedforward is None: return None return u_feedforward[0] def store_explicit_solution(self, **kwargs): """ Solves the mpqp (condensed optimal control problem) explicitly. Returns ---------- instance of ExplicitSolution Explicit solution of the underlying mpqp problem. """ self.explicit_solution = self.mpqp.explicit_solve(**kwargs) def feedforward_explicit(self, x): """ Finds the critical region where the state x is and returns the optimal feedforward and the cost to go. Arguments ---------- x : numpy.ndarray State of the system. Returns ---------- u_feedforward : list of numpy.ndarray Optimal control signals for t = 0, ..., N-1. V : float Optimal value function for the given state. """ # check that the explicit solution has been found if self.explicit_solution is None: raise ValueError('explicit solution not stored.') # evaluate lookup table u = self.explicit_solution.u(x) if u is not None: u = [u[t*self.S.nu:(t+1)*self.S.nu, :] for t in range(self.N)] return u, self.explicit_solution.V(x) def feedback_explicit(self, x): """ Finds the critical region where the state x is and returns the optimal feedback for the given state x. Arguments ---------- x : numpy.ndarray State of the system. Returns ---------- u_feedback : numpy.ndarray Optimal feedback. """ # get feedforward and extract first input u_feedforward = self.feedforward_explicit(x)[0] if u_feedforward is None: return None return u_feedforward[0] def plot_state_space_partition(self, print_active_set=False, **kwargs): """ Finds the critical region where the state x is, and returns the PWA feedforward. Arguments ---------- print_active_set : bool If True it prints the active set of each critical region in its center. """ # check that the required plot is 2d and that the solution is available if self.S.nx != 2: raise ValueError('can plot only 2-dimensional partitions.') if self.explicit_solution is None: raise ValueError('explicit solution not stored.') # plot every critical region with random colors for cr in self.explicit_solution.critical_regions: cr.polyhedron.plot(facecolor=np.random.rand(3), **kwargs) # if required print active sets if print_active_set: plt.text(cr.polyhedron.center[0], cr.polyhedron.center[1], str(cr.active_set)) def plot_optimal_value_function(self, resolution=100, **kwargs): """ Plots the level sets of the optimal value function V*(x). Arguments ---------- resolution : float Size of the grid for the contour plot. """ # check dimension of the state if self.S.nx != 2: raise ValueError('can plot only 2-dimensional value functions.') if self.explicit_solution is None: raise ValueError('explicit solution not stored.') # get feasible set feasible_set = self.mpqp.get_feasible_set() # create box containing the feasible set x_max = max([v[0,0] for v in feasible_set.vertices]) x_min = min([v[0,0] for v in feasible_set.vertices]) y_max = max([v[1,0] for v in feasible_set.vertices]) y_min = min([v[1,0] for v in feasible_set.vertices]) # create grid x = np.linspace(x_min, x_max, resolution) y = np.linspace(y_min, y_max, resolution) X, Y = np.meshgrid(x, y) # evaluate grid zs = np.array([self.explicit_solution.V(np.array([[x],[y]])) for x,y in zip(np.ravel(X), np.ravel(Y))]) Z = zs.reshape(X.shape) # plot feasible_set.plot(**kwargs) cp = plt.contour(X, Y, Z) plt.colorbar(cp) plt.title(r'$V^*(x)$') class HybridModelPredictiveController(object): def __init__(self, S, N, Q, R, P, X_N): """ Initilizes the controller. Arguments ---------- S : instance of PieceWiseAffineSystem PWA system to be controlled. N : int Horizon of the optimal control problem. Q : numpy.ndarray Quadratic cost for the state. R : numpy.ndarray Quadratic cost for the input. P : numpy.ndarray Quadratic cost for the terminal state. X_N : instance of Polyhedron Terminal set. """ # store inputs self.S = S self.N = N self.Q = Q self.R = R self.P = P self.X_N = X_N # get bigMs self._alpha, self._beta = self._get_bigM_dynamics() self._gamma = self._get_bigM_domains() # condense miqp self.mpmiqp = self._condense_program() def _get_bigM_dynamics(self): """ Computes all the bigMs for the dynamics of the PWA system. The PWA system has the dynamics x(t+1) = A_i x(t) + B_i u(t) + c_i if (x(t),u(t)) in D_i, where i in {1, ..., s}. In order to express it in mixed-integer form, for t = 0, ..., N-1, we introduce the auxiliary variables z_i(t), and we set x(t+1) = sum_{i=1}^s z_i(t). We now reformulate the dynamics as z_i(t) >= alpha_ii delta_i(t), (1) z_i(t) <= beta_ii delta_i(t), (2) A_i x(t) + B_i u(t) + c_i - z_i(t) >= sum_{j=1, j!=i}^s alpha_ij delta_j(t), (3) A_i x(t) + B_i u(t) + c_i - z_i(t) <= sum_{j=1, j!=i}^s beta_ij delta_j(t). (4) Here alpha_ij (<< 0) and beta_ij (>> 0) are both vectors of bigMs and delta_j(t) is a binary variable (equal to 1 if the system is in mode j, zero otherwise). If the system is in mode k at time t (i.e. delta_k(t) = 1), we have that z_i(t) = 0, for all i != k, z_k(t) >= alpha_kk, z_k(t) <= beta_kk, A_i x(t) + B_i u(t) + c_i - z_i(t) >= alpha_ik, for all i != k, A_i x(t) + B_i u(t) + c_i - z_i(t) <= beta_ik, for all i != k, A_k x(t) + B_k u(t) + c_k = z_k(t), that sets x(t+1) = z_k(t) = A_k x(t) + B_k u(t) + c_k as desired. It is very important to choose the bigMs as tight as possible, for this reason we set alpha_ij := min_{(x,u) in D_j} A_i x + B_i u + c_i, beta_ij := max_{(x,u) in D_j} A_i x + B_i u + c_i. (Note that the previous are a number of LPs equal to the number of states.) The previous ensures that when the system is mode j != i, the dynamics A_i x + B_i u + c_i is lower bounded by alpha_ik and upper bounded by beta_ij. Returns ---------- alpha : list of lists of numpy.ndarray alpha[i][j] is the vector alpha_ij defined above. beta : list of lists of numpy.ndarray beta[i][j] is the vector beta_ij defined above. """ # initialize list of bigMs alpha = [] beta = [] # outer loop over the number of affine systems for i, S_i in enumerate(self.S.affine_systems): alpha_i = [] beta_i = [] A_i = np.hstack((S_i.A, S_i.B)) # inner loop over the number of affine systems for j, S_j in enumerate(self.S.affine_systems): alpha_ij = [] beta_ij = [] D_j = self.S.domains[j] # solve two LPs for each component of the state vector for k in range(S_i.nx): f = A_i[k:k+1,:].T sol = linear_program(f, D_j.A, D_j.b, D_j.C, D_j.d) alpha_ij.append(sol['min'] + S_i.c[k,0]) sol = linear_program(-f, D_j.A, D_j.b, D_j.C, D_j.d) beta_ij.append(- sol['min'] + S_i.c[k,0]) # close inner loop appending bigMs alpha_i.append(np.vstack(alpha_ij)) beta_i.append(
np.vstack(beta_ij)
numpy.vstack
#!/usr/bin/python """ Convert planeflight output to NetCDF form en masse. A list of variables can be provided to restrict output This function is written to convert any pf output to NetCDF. NOTES: - if GRD output is provided, 3D output can be obtained ( also in NetCDF form ) """ import glob import time import os.path import sys import numpy as np from pandas import DataFrame import AC_tools as AC # --- Master settings for main call # Verbose/debug output? (set debug=True) DEBUG = True VERBOSE = False # Use planeflight files ending with ".out", which have been renumerated # (Fortran string formatting cuts off output > 5 digits ) renumerated = True # True#False#True # Use # make 3D gridded output netCDF? GRD_input_3D = True # False#True # Are there mulitple sites? Multiple_sites = False # True # NOTE: this option is not currently working def main(wd, vars=None, npwd=None, GRD_input_3D=False, renumerated=False, verbose=False, debug=False): """ Driver to process planeflight output from GEOS-Chem NOTES: --- - more details on GEOS-Chem's planeflight diagnostic: (http://acmg.seas.harvard.edu/geos/doc/man/chapter_13.html) """ # Get save directory and set output NC name import os if not isinstance(npwd, str): npwd = get_dir('npwd') out_nc = npwd + 'pf_{}_{}.nc'.format(wd.split('/')[-3], wd.split('/')[-2], wd.split('/')[-1]) print(("Atempting to append/create file (already exists?:{}): {}".format( os.path.isfile(out_nc), out_nc))) # Get pf files if not os.path.isfile(out_nc): files = get_pf_files(wd, renumerated=renumerated) # Make NetCDF as table of all pf files. ( check for file first ) if not os.path.isfile(out_nc): mk_NetCDF_of_pf_files(files, ncfilename=out_nc, debug=debug) # If 2D data, make 3D (lon, lat, time) NetCDF file if GRD_input_3D: make_3D_NetCDF(ncfilename=out_nc, wd=wd, debug=debug) # Process multiple sites to "subgrouped" NetCDF file # NOTE: this is currently not functioning ... TODO if Multiple_sites: make_2D_subgroup_NetCDF(ncfilename=out_nc, wd=wd, debug=debug) def get_pf_files(wd, renumerated=False, debug=False): """ Get pf files - edit this give location of planeflight files """ # Ensure working dorectory string has leading foreward slash if wd[-1] != '/': wd += '/' # Get files filenames = '/plane_flight_logs/plane*log*' if renumerated: filenames += '.out' files = glob.glob(wd + filenames) if debug: print((wd, filenames, files)) return files def mk_NetCDF_of_pf_files(files, ncfilename=None, debug=False): """ Make a table like NetCDF file from to any pf output """ # --- Setup NetCDF file ncfile = Dataset(ncfilename, 'w', format='NETCDF4') # --- Loop files, read in and add to NetCDF npoint = 1 for n, file in enumerate(files): # If 1st file setup NetCDF if n == 0: # Get Header infomation from first file vars, sites = get_pf_headers(files[0], debug=debug) # Extract all points from file df, vars = AC.pf_csv2pandas(file=file, vars=vars, epoch=True, r_vars=True) if debug: print((df.shape, df.columns)) # set unlimited data points dimension (POINT) POINT = ncfile.createDimension('POINT', None) # loop and create variables for each column (exc. last ) if debug: print(vars) [ncfile.createVariable(var, var2type(var), ('POINT')) for var in vars] # close the file ncfile.close() else: # Extract all points from file df, vars = AC.pf_csv2pandas(file=file, vars=vars, epoch=True, r_vars=True) # Open the file in append mode ncfile = Dataset(ncfilename, 'a', format='NETCDF4') if debug: print((df.index)) # Fill variables for given dim_len = len(df.index) for var in vars: ncfile.variables[var][npoint:npoint+dim_len] = df[var].values # Tidy up and count npoint += dim_len del df ncfile.close() def var2type(var, debug=False): """ Insure that strings are i8 type, add additions to list for a NetCDF, type must be: 'f4' (32-bit floating point), 'f8' (64-bit floating point), 'i4' (32-bit signed integer), 'i2' (16-bit signed integer), 'i8' (64-bit singed integer), 'i1' (8-bit signed integer), 'u1' (8-bit unsigned integer), 'u2' (16-bit unsigned integer), 'u4' (32-bit unsigned integer), 'u8' (64-bit unsigned integer), or 'S1' (single-character string) ... Also: also a 'S' datatype for variable length strings ( ==numpy object) """ if any([i in var for i in ['TYPE', 'Epoch']]): case = 2 elif any([i in var for i in ['LOC']]): case = 3 else: case = 1 cases = { 1: 'f8', # 'f8' (64-bit floating point), 2: 'i8', # 'i8' (64-bit singed integer), # 3: 'S' # also a 'S' datatype for variable length strings ( numpy object) 3: 'S1' } return cases[case] def get_3D_vars(vars): """ from a list of pf variables, remove known 2D varables """ known2D = ['Epoch', 'LON', 'LAT', 'YYYYMMDD', 'LOC', 'HHMM', 'POINT'] return [i for i in vars if (i not in known2D)] def get_site_description_vars(vars): """ from a list of pf variables, get known site specific varables """ known2D = [ 'Epoch', 'LON', 'LAT', 'YYYYMMDD', 'LOC', 'HHMM', 'POINT', 'PRESS' ] return [i for i in vars if (i not in known2D)] def make_3D_NetCDF(ncfilename, wd, debug=False): """ Create NetCDF of 3D arrays for all variables in 2D NetCDF file Takes a table form NetCDF and build 3D arrays from lat and lon in the given file. """ # --- Read existing & setup new NetCDF file ncfile2D = Dataset(ncfilename, 'r', format='NETCDF4') # Setup dimensions vars = ncfile2D.variables if debug: print([i for i in vars]) lats, lons, Epoch = [ncfile2D[i] for i in ('LAT', 'LON', 'Epoch')] if debug: print([len(i) for i in (lats, lons, Epoch)]) lats, lons, Epoch = [np.array(i) for i in (lats, lons, Epoch)] lats, lons = [list(sorted(set(i))) for i in (lats, lons)] # remove fill value. ( 9.969209968386869e+36 ) <= Improve this approach... [i.pop(-1) for i in (lons, lats)] # setup 3D NetCDF file ncfilename = ncfilename.split('.nc')[0]+'_3D.nc' ncfile = Dataset(ncfilename, 'w', format='NETCDF4') ncfile.createDimension('lat', len(lats)) ncfile.createDimension('lon', len(lons)) ncfile.createDimension('time', None) # Define the coordinate variables. They will hold the coordinate # information, that is, the latitudes and longitudes. time = ncfile.createVariable('time', 'f4', ('time',)) lat = ncfile.createVariable('lat', 'f4', ('lat',)) lon = ncfile.createVariable('lon', 'f4', ('lon',)) # --- Add meta data # Assign units attributes to coordinate var data. This attaches a # text attribute to each of the coordinate variables, containing the # units. lat.units = 'degrees_north' lat.long_name = 'Latitude' lat.standard_name = 'Latitude' lat.axis = "Y" lon.units = 'degrees_east' lon.long_name = 'Longitude' lon.standard_name = 'Longitude' lon.axis = "X" time.units = 'seconds since 1970-01-01 00:00:00' time.calendar = "standard" time.standard_name = 'Time' time.axis = "T" # set global varibles ncfile.Description = 'planeflight output from '.format(wd) ncfile.Contact = '<NAME> (<EMAIL>)' # ncfile.History = 'Created {}'.format( time.ctime(time.time()) ) ncfile.Grid = 'lat: {}-{}, lon: {}-{}'.format(lats[0], lats[-1], lons[0], lons[-1]) # ncfile.Temp_Res = "Hourly" # ncfile.SpatialCoverage='Global' # write data to coordinate vars. lon[:] = lons lat[:] = lats # Get unique timesteps timesteps = sorted(set(Epoch)) # masked 1st value ( headers? ) timesteps.pop(0) # set time dimension to timestep values time[:] = timesteps # select only 3D vars vars3D = get_3D_vars(vars) # --- Loop 3D species and create variables (with set dimensions) for var in vars3D: ncfile.createVariable(var, var2type(var), ('time', 'lat', 'lon'), ) # close NetCDF ncfile.close() # --- Loop through timesteps (epoch) and add to NetCDF # Loop over timesteps for t in timesteps: # open NetCDF in append mode ncfile = Dataset(ncfilename, 'a', format='NETCDF4') # get 1st and last indices for time stamp start, end = [(i.min(), i.max()) for i in np.where(ncfile2D.variables['Epoch'] == t)][0] # Extract Data for timestep & species for var in vars3D: data_ = ncfile2D.variables[var][start:end] lons_ = ncfile2D.variables['LON'][start:end] lats_ = ncfile2D.variables['LAT'][start:end] if debug: print((t, var, [i.shape for i in (data_, lats_, lons_)])) # stack data by LAT/LON to 3D array ( using pandas ) df = DataFrame(data_, index=[lats_, lons_]).unstack() # add data to array ncfile.variables[var][timesteps.index(t)] = df.values # remove from memory del df, data_, lats_, lons_ # Save out final NetCDF file ncfile.close() def make_2D_subgroup_NetCDF(ncfilename, wd, debug=False): """ Create NetCDF of 2D arrays for all variables in 2D NetCDF file by subgroup ( e.g. multiple sites outputted for at same interval ) Takes a table form NetCDF and build 2D arrays per unit 'POINT' from sites in the given file. """ # --- Read existing & setup new NetCDF file ncfile2D = Dataset(ncfilename, 'r', format='NETCDF4') # Setup dimensions vars = ncfile2D.variables if debug: print([i for i in vars]) # Get tim in files Epoch, LOC = [np.array(ncfile2D[i]) for i in ('Epoch', 'LOC')] if debug: print([len(i) for i in [Epoch]]) Epoch, LOC = [list(sorted(set(i))) for i in (Epoch, LOC)] # remove 1st empty LOC entry LOC = LOC[1:] # setup 3D NetCDF file ncfilename = ncfilename.split('.nc')[0]+'_2D_by_site.nc' ncfile = Dataset(ncfilename, 'w', format='NETCDF4') ncfile.createDimension('time', None) # Define the coordinate variables. They will hold the coordinate # information, that is, the time time = ncfile.createVariable('time', 'f4', ('time',)) # --- Add meta data # Assign units attributes to coordinate var data. This attaches a # text attribute to each of the coordinate variables, containing the # units. # Loop each unique variable and add meta data time.units = 'seconds since 1970-01-01 00:00:00' time.calendar = "standard" time.standard_name = 'Time' time.axis = "T" # set global varibles # ncfile.Description = 'planeflight output from '.format( wd ) ncfile.Contact = '<NAME> (<EMAIL>)' # ncfile.History = 'Created {}'.format( time.ctime(time.time()) ) # ncfile.Temp_Res = "Hourly" # ncfile.SpatialCoverage='Global' # Get unique timesteps timesteps = sorted(set(Epoch)) # masked 1st value ( headers? ) timesteps.pop(0) # set time dimension to timestep values time[:] = timesteps # --- Add shared variables # select only 3D vars # ( variables are referred to as 3D as the function was written for grid # input. Here the table shape is altered but it remains 2D ) vars3D = get_site_description_vars(vars) # --- Loop 3D species and create variables (with set dimensions) for var in vars3D: # Loop sites and add to beginning of variable for site in LOC: ncfile.createVariable(site+'_'+var, var2type(var), ('time'), ) # close NetCDF ncfile.close() # --- Loop through timesteps (epoch) and add to NetCDF # Loop over timesteps in chunks chunk_size = 7*24 # Note for 365 days, this does make equally sized chunks # chunk_size = 24 # Note for 365 days, this does make equally sized chunks ts_chunks = chunks(timesteps, chunk_size) # check for ts_chunk in ts_chunks: # Open NetCDF in append mode ncfile = Dataset(ncfilename, 'a', format='NETCDF4') if debug: print((ts_chunk[0], timesteps[0])) # Get 1st and last indices for time stamp chunk start = np.where(ncfile2D.variables['Epoch'] == ts_chunk[0]) start =
np.array(start)
numpy.array
# The MIT License (MIT) # Copyright (c) 2020-2021 CoML # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # SOFTWARE. # AUTHORS # <NAME>, <NAME>, <NAME> from abc import ABCMeta, abstractmethod from typing import Optional, Iterable, List import numpy as np import pyannote.core.segment from pyannote.core import Segment from sortedcontainers import SortedSet from typing_extensions import Literal from .continuum import Continuum, Annotator PivotType = Literal["float_pivot", "int_pivot"] class AbstractContinuumSampler(metaclass=ABCMeta): """ Tool for generating sampled continuua from a reference continuum. Used to compute the "expected disorder" when calculating the gamma, using particular sampling techniques. Must be initalized (with self.init_sampling for instance) """ _reference_continuum: Optional[Continuum] _ground_truth_annotators: Optional[SortedSet] def __init__(self): """Super constructor, sets everything to None since a call to init_sampling to set parameters is mandatory.""" self._reference_continuum = None self._ground_truth_annotators = None def init_sampling(self, reference_continuum: Continuum, ground_truth_annotators: Optional[Iterable['Annotator']] = None): """ Parameters ---------- reference_continuum: Continuum the continuum that will be shuffled into the samples ground_truth_annotators: iterable of str, optional the set of annotators (from the reference) that will be considered for sampling """ assert reference_continuum, "Cannot initialize sampling with an empty reference continuum." self._reference_continuum = reference_continuum if ground_truth_annotators is None: self._ground_truth_annotators = self._reference_continuum.annotators else: assert self._reference_continuum.annotators.issuperset(ground_truth_annotators), \ "Can't sample from ground truth annotators not in the reference continuum." self._ground_truth_annotators = SortedSet(ground_truth_annotators) def _has_been_init(self): assert self._reference_continuum is not None, \ "Sampler hasnt been initialized. Call 'sampler.init_sampling' before 'sampler.sample_from_continuum'." @property @abstractmethod def sample_from_continuum(self) -> Continuum: """ Returns a shuffled continuum based on the reference. Everything in the generated sample is at least a copy. Raises ------ ValueError: if `init_sampling` or another initalization method hasn't been called before. """ pass class ShuffleContinuumSampler(AbstractContinuumSampler): """ This continuum sampler uses the methods used in gamma-software, ie those described in gamma-paper : https://www.aclweb.org/anthology/J15-3003.pdf, section 5.2. and implemented in the GammaSoftware. """ _pivot_type: PivotType def __init__(self, pivot_type: PivotType = 'int_pivot'): """This constructor allows to set the pivot type to int or float. Defaults to int to match the java implementation.""" super().__init__() self._pivot_type = pivot_type def init_sampling(self, reference_continuum: Continuum, ground_truth_annotators: Optional[Iterable['Annotator']] = None): """ Parameters ---------- reference_continuum: Continuum the continuum that will be shuffled into the samples ground_truth_annotators: iterable of str, optional the set of annotators (from the reference) that will be considered for sampling """ super().init_sampling(reference_continuum, ground_truth_annotators) @staticmethod def _remove_pivot_segment(pivot: float, segments: List[Segment], dist: float) -> List[Segment]: """ Returns a copy of the given list of segments, minus the segment delimited by [pivot - dist, pivot + dist]. """ new_segments = [] while len(segments) > 0: segment = segments.pop() if segment.start >= pivot - dist: if segment.end <= pivot + dist: continue else: new_segments.append(Segment(pivot + dist, segment.end)) else: if segment.end > pivot + dist: new_segments.append(Segment(segment.start, pivot - dist)) new_segments.append(Segment(pivot + dist, segment.end)) else: new_segments.append(Segment(segment.start, pivot - dist)) return new_segments def _random_from_segments(self, segments: List[Segment]) -> float: """ Returns a random value from the provided list of segments, by randomly choosing a segment (weighted by its length) and then using uniform distribution in it. """ segments = np.array(segments) weights = np.array(list(segment.end - segment.start for segment in segments)) weights /= np.sum(weights) try: segment = np.random.choice(np.array(segments), p=weights) except ValueError: return 1 if self._pivot_type == 'int_pivot': return int(np.random.uniform(segment.start, segment.end)) else: return np.random.uniform(segment.start, segment.end) @property def sample_from_continuum(self) -> Continuum: self._has_been_init() assert self._pivot_type in ('float_pivot', 'int_pivot') continuum = self._reference_continuum min_dist_between_pivots = continuum.avg_length_unit / 2 bound_inf, bound_sup = continuum.bounds new_continuum = continuum.copy_flush() annotators = self._ground_truth_annotators while not new_continuum: # Simple check to prevent returning an empty continuum. segments_available = [Segment(bound_inf, bound_sup)] for idx in range(len(annotators)): if len(segments_available) != 0: pivot: float = self._random_from_segments(segments_available) segments_available = self._remove_pivot_segment(pivot, segments_available, min_dist_between_pivots) else: pivot = np.random.uniform(bound_inf, bound_sup) rnd_annotator = np.random.choice(annotators) new_annotator = f'Sampled_annotation {idx}' new_continuum.add_annotator(new_annotator) for unit in continuum.iter_annotator(rnd_annotator): if unit.segment.start + pivot > bound_sup: new_continuum.add(new_annotator, Segment(unit.segment.start + pivot + bound_inf - bound_sup, unit.segment.end + pivot + bound_inf - bound_sup), unit.annotation) else: new_continuum.add(new_annotator, Segment(unit.segment.start + pivot, unit.segment.end + pivot), unit.annotation) return new_continuum class StatisticalContinuumSampler(AbstractContinuumSampler): """ This sampler creates continua using the average and standard deviation of : - The number of annotations per annotator - The gap between two of an annotator's annotations - The duration of the annotations' segments The sample is thus created by computing normal distributions using these parameters. It also requires the probability of occurence of each annotations category. You can either initalize sampling with custom values or with a reference continuum. """ _avg_nb_units_per_annotator: float _std_nb_units_per_annotator: float _avg_gap: float _std_gap: float _avg_unit_duration: float _std_unit_duration: float _categories: np.ndarray _categories_weight: np.ndarray def _set_gap_information(self): # To prevent glitching continua with 1 unit gaps = [0] current_annotator = None last_unit = None for annotator, unit in self._reference_continuum: if annotator != current_annotator: current_annotator = annotator else: gaps.append(unit.segment.start - last_unit.segment.end) last_unit = unit for annotation_set in self._reference_continuum._annotations.values(): if len(annotation_set) == 0: continue if annotation_set[0].segment.start > 0: gaps.append(annotation_set[0].segment.start) self._avg_gap = float(
np.mean(gaps)
numpy.mean
#!/usr/bin/env python from __future__ import print_function import os from os.path import splitext, join, isfile, isdir, basename import argparse import numpy as np # from scipy import misc, ndimage import tensorflow.keras.backend as K from tensorflow.keras.models import model_from_json, load_model import tensorflow as tf import layers_builder as layers from glob import glob from utils import utils from tensorflow.python.keras.utils.generic_utils import CustomObjectScope import cv2 import math from PIL import Image # -- Fix for macos, uncomment it # import matplotlib # matplotlib.use('TkAgg') # -- import matplotlib.pyplot as plt from ade20k_labels import ade20k_label_dict as ade20k_labels from imageio import imread # These are the means for the ImageNet pretrained ResNet DATA_MEAN = np.array([[[123.68, 116.779, 103.939]]]) # RGB order class PSPNet(object): """Pyramid Scene Parsing Network by <NAME> et al 2017""" def __init__(self, nb_classes, resnet_layers, input_shape, weights): self.input_shape = input_shape self.num_classes = nb_classes json_path = join("weights", "keras", weights + ".json") h5_path = join("weights", "keras", weights + ".h5") if 'pspnet' in weights: if os.path.isfile(json_path) and os.path.isfile(h5_path): print("Keras model & weights found, loading...") with CustomObjectScope({'Interp': layers.Interp}): with open(json_path) as file_handle: self.model = model_from_json(file_handle.read()) self.model.load_weights(h5_path) else: print("No Keras model & weights found, import from npy weights.") self.model = layers.build_pspnet(nb_classes=nb_classes, resnet_layers=resnet_layers, input_shape=self.input_shape) self.set_npy_weights(weights) else: print('Load pre-trained weights') self.model = load_model(weights) def predict(self, img, flip_evaluation=False): """ Predict segementation for an image. Arguments: img: must be rowsxcolsx3 """ if img.shape[0:2] != self.input_shape: print( "Input %s not fitting for network size %s, resizing. You may want to try sliding prediction for better results." % ( img.shape[0:2], self.input_shape)) img = np.array(Image.fromarray(img).resize(size=self.input_shape)) # img = misc.imresize(img, self.input_shape) img = img - DATA_MEAN img = img[:, :, ::-1] # RGB => BGR img = img.astype('float32') probs = self.feed_forward(img, flip_evaluation) return probs def predict_sliding(self, full_img, flip_evaluation): """ Predict on tiles of exactly the network input shape. This way nothing gets squeezed. """ tile_size = self.input_shape classes = self.num_classes overlap = 1 / 3 stride = math.ceil(tile_size[0] * (1 - overlap)) tile_rows = max(int(math.ceil((full_img.shape[0] - tile_size[0]) / stride) + 1), 1) # strided convolution formula tile_cols = max(int(math.ceil((full_img.shape[1] - tile_size[1]) / stride) + 1), 1) print("Need %i x %i prediction tiles @ stride %i px" % (tile_cols, tile_rows, stride)) full_probs =
np.zeros((full_img.shape[0], full_img.shape[1], classes))
numpy.zeros
import logging import h5py as h5 import numpy as np import dfcs_vipa log = logging.getLogger(__name__) # * Collect arrays and comb teeth intensities def collect_h5(path, path_dc): """Return all data from HDF5 DC measurements. Subtracts dark current from the signal measurements. Args: - path, path_dc: paths to signal and dark measurement files. Returns: - 3D array with first dimension corresponds to different measurements and the last two corresponding to camera array. """ with h5.File(path, 'r') as f: with h5.File(path_dc, 'r') as fdc: arrs = (f['data'][...].astype(np.int32)-fdc['data'][...].astype(np.int32)) return arrs def average_h5(path, path_dc): """Return averaged data from HDF5 DC measurements. Subtracts dark current from the signal measurements. Args: - path, path_dc: paths to signal and dark measurement files. Returns: - 2D array containing averaged and DC-subtracted measurement. """ with h5.File(path, 'r') as f: with h5.File(path_dc, 'r') as fdc: arr = (f['data'][...].mean(axis=0) - fdc['data'][...].mean(axis=0)) return arr def collect_element(path, path_dc, row, col, mask_cols, mask_rows=None): """Collect single comb tooth intensities from data arrays. Args: - path, path_dc: paths to signal and dark measurement files, - row, col: position of the comb tooth, - mask_cols, mask_rows: numpy fancy indexing arrays defining single comb tooth pattern. Returns: - NumPy 1D array containing comb tooth intensities. """ # define the hyperslab col_min, col_max = col + mask_cols.min(), col + mask_cols.max() + 1 if mask_rows is not None: row_min, row_max = row + mask_rows.min(), row + mask_rows.max() + 1 else: row_min, row_max = row, row + 1 # collect the hyperslab with the spectral element with h5.File(path, 'r') as f: with h5.File(path_dc, 'r') as f_dc: element_array = (f['data'][..., row_min:row_max, col_min:col_max].astype(np.int32) - f_dc['data'][..., row_min:row_max, col_min:col_max].astype(np.int32)) # retrieve the data for a single spectral element if mask_rows is not None: rows = mask_rows - np.min(mask_rows) else: rows = np.zeros(mask_cols.shape, dtype=mask_cols.dtype) cols = mask_cols - np.min(mask_cols) elements = element_array[..., rows, cols].sum(axis=-1) return elements def collect(arr, grid_fancy, mask_cols, mask_rows=None): """Collect comb teeth intensities from data array. Args: - arr: Numpy 2D array of (averaged) camera frame, - grid_fancy: tuple of rows and cols array defining positions of the comb teeth, - mask_cols, mask_rows: numpy fancy indexing arrays defining single comb tooth pattern. """ rows, cols = grid_fancy cols = cols[:, np.newaxis] + mask_cols if mask_rows is not None: rows = rows[:, np.newaxis] + mask_rows else: rows = rows[:, np.newaxis] elements = arr[..., rows, cols] return elements.sum(axis=-1) def collect_multi(ilist, fmt, fmt_dc): """Collect averaged camera arrays from multiple files. Args: - ilist: sequence which elements are formatted into fmt and fmt_dc to get paths to measurement files, - fmt, fmt_dc: format strings. Returns: - 3D array with first dimension corresponds to different measurements and the last two corresponding to camera frame dimensions. """ ilength = len(ilist) multi_arr = np.empty((ilength, dfcs_vipa.ROWS, dfcs_vipa.COLS)) for j, i in enumerate(ilist): log.info("Averaging '{:s}'".format(fmt.format(i))) multi_arr[j] = average_h5(fmt.format(i), fmt_dc.format(i)) return multi_arr def collect_multi_single(ilist, fmt, fmt_dc): """Collect camera arrays from multiple files. Parameters ---------- ilist: sequence Sequence which elements are formatted into `fmt` and `fmt_dc` to get paths to measurement files. fmt : str Format string for bright frame. fmt_dc: str Format string for dark frame. Returns ------- ndarray 4D array with first dimension corresponding to different measurements, second dimension corresponding to different frames and the last two corresponding to camera frame dimensions. """ ilength = len(ilist) with h5.File(fmt.format(ilist[0]), 'r') as test_file: frame_num = test_file['data'].shape[0] multi_arr = np.empty((ilength, frame_num, dfcs_vipa.ROWS, dfcs_vipa.COLS)) for j, i in enumerate(ilist): log.info("Collecting '{:s}'".format(fmt.format(i))) multi_arr[j] = collect_h5(fmt.format(i), fmt_dc.format(i)) return multi_arr def collect_multi_frep_scan(beat_range, scan_range, frep_range, fmt, fmt_dc, alt=True): """Collect averaged camera arrays from different freps and scans. The result is a nested dictionary with first level corresponding to different freps, the second level corresponding to different scans through the cavity modes. Each frep, scan pair corresponds to a 3D NumPy array (a result of collect_multi) with first dimension numbering different points on the cavity mode. Args: - beat_range: a list of ints numbering measurements within a cavity mode scan, - scan_range: a list of ints numbering independent scans of a cavity mode, - frep_range: a list of ints numbering different freps (jumps), - fmt, fmt_dc: twice-nested format strings, the outer pattern corresponds to the frep number, the inner one to scan-beat number, - alt: if True then the direction of cavity mode scan is reversed every second scan. Returns: - twice-nested dictionary (frep=>scan=>collect_multi). """ frep_arr_avgs = {} for l in frep_range: beat_arr_avgs = {} for k in scan_range: final_beat = (beat_range + k*40) if alt: if k % 2: final_beat = final_beat[::-1] beat_arr_avgs[k] = collect_multi( final_beat, fmt.format(l), fmt_dc.format(l)) frep_arr_avgs[l] = beat_arr_avgs return frep_arr_avgs def collect_multi_frep_scan_single(beat_range, scan_range, frep_range, fmt, fmt_dc, alt=True): """Collect camera arrays from different freps and scans. The result is a nested dictionary with first level corresponding to different freps, the second level corresponding to different scans through the cavity modes and the third level corresponding to different beat note. Each frep, scan pair corresponds to a 4D NumPy array (a result of collect_multi_single) with first dimension numbering different points on the cavity mode and the second one numbering different frames. Parameters ---------- beat_range: list of int A list of ints numbering measurements within a cavity mode scan, scan_range: list of int A list of ints numbering independent scans of a cavity mode, frep_range: list of int A list of ints numbering different freps (jumps), fmt : str fmt_dc : str Twice-nested format strings, the outer pattern corresponds to the frep number, the inner one to scan-beat number, alt : bool If True then the direction of cavity mode scan is reversed every second scan. Returns ------- dict Twice-nested dictionary (frep=>scan=>beats), where `beats` is a 4D array (beat=>frame=>row=>col). """ frep_arr_avgs = {} for l in frep_range: beat_arr_avgs = {} for k in scan_range: final_beat = (beat_range + k*40) if alt: if k % 2: final_beat = final_beat[::-1] beat_arr_avgs[k] = collect_multi_single( final_beat, fmt.format(l), fmt_dc.format(l)) frep_arr_avgs[l] = beat_arr_avgs return frep_arr_avgs def beat_range_list(beat_range, scan_range, alt=True): for k in scan_range: final_beat = (beat_range + k*40) if alt: if k % 2: final_beat = final_beat[::-1] for i in final_beat: yield i # * Noise analysis def frame_stdevs_h5(path): """Return standard deviations of each frame. """ with h5.File(path, 'r') as f: stdevs = frame_stdevs(f['data'][...]) return stdevs def threshold_stdevs(stdevs, scale): return stdevs.mean() + scale*np.std(stdevs) def frame_stdevs(arr): mean = arr.mean(axis=0) return np.sum(np.sum((arr-mean)**2, axis=-1), axis=-1) def spectra_stdevs(arr, grid_fancy, mask_cols, mask_rows=None): spectra = collect(arr, grid_fancy, mask_cols, mask_rows) spectra_mean = spectra.mean(axis=0) return
np.sum((spectra-spectra_mean)**2, axis=-1)
numpy.sum
"""add_pin adss a Pin to a port, add_pins adds Pins to all ports: - pins - outline Some functions modify a component without changing its name. Make sure these functions are inside a new Component or called as a decorator They without modifying the cell name """ import json from functools import partial from typing import Callable, List, Optional, Tuple, Union import gdspy import numpy as np from numpy import ndarray from omegaconf import OmegaConf from phidl.device_layout import Device as Component from phidl.device_layout import DeviceReference as ComponentReference from phidl.device_layout import Port from gdsfactory.snap import snap_to_grid Layer = Tuple[int, int] Layers = Tuple[Layer, ...] LayerSpec = Optional[Union[Layer, str, int]] LayerSpecs = Tuple[LayerSpec, ...] nm = 1e-3 def _rotate(v: ndarray, m: ndarray) -> ndarray: return np.dot(m, v) def get_pin_triangle_polygon_tip(port: Port) -> Tuple[List[float], Tuple[float, float]]: """Returns triangle polygon and tip position""" p = port orientation = p.orientation if orientation is None: raise ValueError("Port {port.name} needs to have an orientation.") ca = np.cos(orientation * np.pi / 180) sa = np.sin(orientation * np.pi / 180) rot_mat = np.array([[ca, -sa], [sa, ca]]) d = p.width / 2 dbot = np.array([0, -d]) dtop = np.array([0, d]) dtip = np.array([d, 0]) p0 = p.position + _rotate(dbot, rot_mat) p1 = p.position + _rotate(dtop, rot_mat) ptip = p.position + _rotate(dtip, rot_mat) polygon = [p0, p1, ptip] polygon = np.stack(polygon) return polygon, ptip def add_pin_triangle( component: Component, port: Port, layer: LayerSpec = "PORT", layer_label: LayerSpec = "TEXT", ) -> None: """Add triangle pin with a right angle, pointing out of the port Args: component: to add pin. port: Port. layer: for the pin marker. layer_label: for the label. """ polygon, ptip = get_pin_triangle_polygon_tip(port=port) component.add_polygon(polygon, layer=layer) if layer_label: component.add_label( text=str(port.name), position=ptip, layer=layer_label, ) def add_pin_rectangle_inside( component: Component, port: Port, pin_length: float = 0.1, layer: LayerSpec = "PORT", layer_label: LayerSpec = "TEXT", ) -> None: """Add square pin towards the inside of the port Args: component: to add pins. port: Port. pin_length: length of the pin marker for the port. layer: for the pin marker. layer_label: for the label. .. code:: _______________ | | | | | | || | || | | | | __ | |_______________| """ p = port a = p.orientation ca = np.cos(a * np.pi / 180) sa = np.sin(a * np.pi / 180) rot_mat = np.array([[ca, -sa], [sa, ca]]) d = p.width / 2 dbot = np.array([0, -d]) dtop = np.array([0, d]) dbotin = np.array([-pin_length, -d]) dtopin = np.array([-pin_length, +d]) p0 = p.position + _rotate(dbot, rot_mat) p1 = p.position + _rotate(dtop, rot_mat) ptopin = p.position + _rotate(dtopin, rot_mat) pbotin = p.position + _rotate(dbotin, rot_mat) polygon = [p0, p1, ptopin, pbotin] component.add_polygon(polygon, layer=layer) if layer_label: component.add_label( text=str(p.name), position=p.midpoint, layer=layer_label, ) def add_pin_rectangle_double( component: Component, port: Port, pin_length: float = 0.1, layer: LayerSpec = "PORT", layer_label: LayerSpec = "TEXT", ) -> None: """Add two square pins: one inside with label, one outside. Args: component: to add pins. port: Port. pin_length: length of the pin marker for the port. layer: for the pin marker. layer_label: for the label. .. code:: _______________ | | | | | | ||| | ||| | | | | __ | |_______________| __ """ p = port a = p.orientation ca = np.cos(a * np.pi / 180) sa = np.sin(a * np.pi / 180) rot_mat =
np.array([[ca, -sa], [sa, ca]])
numpy.array
"""Test for Conductivity_RTA.py.""" import numpy as np # first list is k_P, second list is k_C si_pbesol_kappa_P_RTA = [ 108.723, 108.723, 108.723, 0.000, 0.000, 0.000, ] # old value 107.991 si_pbesol_kappa_C = [0.167, 0.167, 0.167, 0.000, 0.000, 0.000] si_pbesol_kappa_P_RTA_iso = [ 97.494, 97.494, 97.494, 0.000, 0.000, 0.000, ] # old value 96.92419 si_pbesol_kappa_C_iso = [0.177, 0.177, 0.177, 0.000, 0.000, 0.000] si_pbesol_kappa_P_RTA_with_sigmas = [ 110.534, 110.534, 110.534, 0, 0, 0, ] # old value 109.6985 si_pbesol_kappa_C_with_sigmas = [0.163, 0.163, 0.163, 0.000, 0.000, 0.000] si_pbesol_kappa_P_RTA_with_sigmas_iso = [ 97.268, 97.268, 97.268, 0, 0, 0, ] # old value 96.03248 si_pbesol_kappa_C_with_sigmas_iso = [0.179, 0.179, 0.179, 0.000, 0.000, 0.000] si_pbesol_kappa_P_RTA_si_nosym = [ 39.325, # old value 38.242347 39.323, # old value 38.700219 39.496, # old value 39.198018 -0.004, # old value 0.3216, 0.020, # old value 0.207731, 0.018, # old value 0.283, ] si_pbesol_kappa_C_si_nosym = [0.009, 0.009, 0.009, 0.000, 0.000, 0.000] si_pbesol_kappa_P_RTA_si_nomeshsym = [ 39.411, 39.411, 39.411, 0, 0, 0, ] # old value 38.90918 si_pbesol_kappa_C_si_nomeshsym = [0.009, 0.009, 0.009, 0.000, 0.000, 0.000] nacl_pbe_kappa_P_RTA = [ 7.753, 7.753, 7.753, 0.000, 0.000, 0.000, ] # old value 7.72798252 nacl_pbe_kappa_C = [0.081, 0.081, 0.081, 0.000, 0.000, 0.000] nacl_pbe_kappa_RTA_with_sigma = [7.742, 7.742, 7.742, 0, 0, 0] # old value 7.71913708 nacl_pbe_kappa_C_with_sigma = [0.081, 0.081, 0.081, 0.000, 0.000, 0.000] aln_lda_kappa_P_RTA = [ 203.304, 203.304, 213.003, 0, 0, 0, ] # old value [203.304059, 203.304059, 213.003125, 0, 0, 0] aln_lda_kappa_C = [0.084, 0.084, 0.037, 0, 0, 0] aln_lda_kappa_P_RTA_with_sigmas = [ 213.820000, 213.820000, 224.800000, 0, 0, 0, ] # old value [213.820000, 213.820000, 224.800121, 0, 0, 0] aln_lda_kappa_C_with_sigmas = [0.084, 0.084, 0.036, 0, 0, 0] def test_kappa_RTA_si(si_pbesol): """Test RTA by Si.""" kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol, [9, 9, 9]) np.testing.assert_allclose(si_pbesol_kappa_P_RTA, kappa_P_RTA, atol=0.5) np.testing.assert_allclose(si_pbesol_kappa_C, kappa_C, atol=0.02) def test_kappa_RTA_si_full_pp(si_pbesol): """Test RTA with full-pp by Si.""" kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol, [9, 9, 9], is_full_pp=True) np.testing.assert_allclose(si_pbesol_kappa_P_RTA, kappa_P_RTA, atol=0.5) np.testing.assert_allclose(si_pbesol_kappa_C, kappa_C, atol=0.02) def test_kappa_RTA_si_iso(si_pbesol): """Test RTA with isotope scattering by Si.""" kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol, [9, 9, 9], is_isotope=True) np.testing.assert_allclose(si_pbesol_kappa_P_RTA_iso, kappa_P_RTA, atol=0.5) np.testing.assert_allclose(si_pbesol_kappa_C_iso, kappa_C, atol=0.02) def test_kappa_RTA_si_with_sigma(si_pbesol): """Test RTA with smearing method by Si.""" si_pbesol.sigmas = [ 0.1, ] kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol, [9, 9, 9]) np.testing.assert_allclose(si_pbesol_kappa_P_RTA_with_sigmas, kappa_P_RTA, atol=0.5) np.testing.assert_allclose(si_pbesol_kappa_C_with_sigmas, kappa_C, atol=0.02) si_pbesol.sigmas = None def test_kappa_RTA_si_with_sigma_full_pp(si_pbesol): """Test RTA with smearing method and full-pp by Si.""" si_pbesol.sigmas = [ 0.1, ] kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol, [9, 9, 9], is_full_pp=True) np.testing.assert_allclose(si_pbesol_kappa_P_RTA_with_sigmas, kappa_P_RTA, atol=0.5) np.testing.assert_allclose(si_pbesol_kappa_C_with_sigmas, kappa_C, atol=0.02) si_pbesol.sigmas = None def test_kappa_RTA_si_with_sigma_iso(si_pbesol): """Test RTA with smearing method and isotope scattering by Si.""" si_pbesol.sigmas = [ 0.1, ] kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol, [9, 9, 9], is_isotope=True) np.testing.assert_allclose( si_pbesol_kappa_P_RTA_with_sigmas_iso, kappa_P_RTA, atol=0.5 ) np.testing.assert_allclose(si_pbesol_kappa_C_with_sigmas_iso, kappa_C, atol=0.02) si_pbesol.sigmas = None def test_kappa_RTA_si_compact_fc(si_pbesol_compact_fc): """Test RTA with compact-fc by Si.""" kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol_compact_fc, [9, 9, 9]) np.testing.assert_allclose(si_pbesol_kappa_P_RTA, kappa_P_RTA, atol=0.5) np.testing.assert_allclose(si_pbesol_kappa_C, kappa_C, atol=0.02) def test_kappa_RTA_si_nosym(si_pbesol, si_pbesol_nosym): """Test RTA without considering symmetry by Si.""" si_pbesol_nosym.fc2 = si_pbesol.fc2 si_pbesol_nosym.fc3 = si_pbesol.fc3 kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol_nosym, [4, 4, 4]) kappa_P_RTA_r = kappa_P_RTA.reshape(-1, 3).sum(axis=1) kappa_C_r = kappa_C.reshape(-1, 3).sum(axis=1) kappa_P_ref = np.reshape(si_pbesol_kappa_P_RTA_si_nosym, (-1, 3)).sum(axis=1) kappa_C_ref = np.reshape(si_pbesol_kappa_C_si_nosym, (-1, 3)).sum(axis=1) np.testing.assert_allclose(kappa_P_ref / 3, kappa_P_RTA_r / 3, atol=0.8) np.testing.assert_allclose(kappa_C_ref / 3, kappa_C_r / 3, atol=0.02) def test_kappa_RTA_si_nomeshsym(si_pbesol, si_pbesol_nomeshsym): """Test RTA without considering mesh symmetry by Si.""" si_pbesol_nomeshsym.fc2 = si_pbesol.fc2 si_pbesol_nomeshsym.fc3 = si_pbesol.fc3 kappa_P_RTA, kappa_C = _get_kappa_RTA(si_pbesol_nomeshsym, [4, 4, 4]) np.testing.assert_allclose( si_pbesol_kappa_P_RTA_si_nomeshsym, kappa_P_RTA, atol=0.5 ) np.testing.assert_allclose(si_pbesol_kappa_C_si_nomeshsym, kappa_C, atol=0.02) def test_kappa_RTA_si_N_U(si_pbesol): """Test RTA with N and U scatterings by Si.""" ph3 = si_pbesol mesh = [4, 4, 4] is_N_U = True ph3.mesh_numbers = mesh ph3.init_phph_interaction() ph3.run_thermal_conductivity( temperatures=[ 300, ], is_N_U=is_N_U, conductivity_type="wigner", ) gN, gU = ph3.thermal_conductivity.get_gamma_N_U() gN_ref = [ 0.00000000, 0.00000000, 0.00000000, 0.07402084, 0.07402084, 0.07402084, 0.00078535, 0.00078535, 0.00917995, 0.02178049, 0.04470075, 0.04470075, 0.00173337, 0.00173337, 0.01240191, 0.00198981, 0.03165195, 0.03165195, 0.00224713, 0.00224713, 0.00860026, 0.03083611, 0.03083611, 0.02142118, 0.00277534, 0.00330170, 0.02727451, 0.00356415, 0.01847744, 0.01320643, 0.00155072, 0.00365611, 0.01641919, 0.00650083, 0.02576069, 0.01161589, 0.00411969, 0.00411969, 0.00168211, 0.00168211, 0.01560092, 0.01560092, 0.00620091, 0.00620091, 0.03764912, 0.03764912, 0.02668523, 0.02668523, ] gU_ref = [ 0.00000000, 0.00000000, 0.00000000, 0.00000000, 0.00000000, 0.00000000, 0.00015178, 0.00015178, 0.00076936, 0.00727539, 0.00113112, 0.00113112, 0.00022696, 0.00022696, 0.00072558, 0.00000108, 0.00021968, 0.00021968, 0.00079397, 0.00079397, 0.00111068, 0.00424761, 0.00424761, 0.00697760, 0.00221593, 0.00259510, 0.01996296, 0.00498962, 0.01258375, 0.00513825, 0.00148802, 0.00161955, 0.01589219, 0.00646134, 0.00577275, 0.00849711, 0.00313208, 0.00313208, 0.00036610, 0.00036610, 0.01135335, 0.01135335, 0.00000000, 0.00000000, 0.00000000, 0.00000000, 0.00000000, 0.00000000, ] # print(np.sum(gN), np.sum(gU)) np.testing.assert_allclose( np.sum([gN_ref, gU_ref], axis=0), gN.ravel() + gU.ravel(), atol=1e-2 ) np.testing.assert_allclose(gN_ref, gN.ravel(), atol=1e-2) np.testing.assert_allclose(gU_ref, gU.ravel(), atol=1e-2) def test_kappa_RTA_nacl(nacl_pbe): """Test RTA by NaCl.""" kappa_P_RTA, kappa_C = _get_kappa_RTA(nacl_pbe, [9, 9, 9]) np.testing.assert_allclose(nacl_pbe_kappa_P_RTA, kappa_P_RTA, atol=0.5) np.testing.assert_allclose(nacl_pbe_kappa_C, kappa_C, atol=0.02) def test_kappa_RTA_nacl_with_sigma(nacl_pbe): """Test RTA with smearing method by NaCl.""" nacl_pbe.sigmas = [ 0.1, ] nacl_pbe.sigma_cutoff = 3 kappa_P_RTA, kappa_C = _get_kappa_RTA(nacl_pbe, [9, 9, 9]) np.testing.assert_allclose(nacl_pbe_kappa_RTA_with_sigma, kappa_P_RTA, atol=0.5)
np.testing.assert_allclose(nacl_pbe_kappa_C_with_sigma, kappa_C, atol=0.02)
numpy.testing.assert_allclose
from __future__ import division import unittest from inferelator import utils from inferelator.postprocessing import GOLD_STANDARD_COLUMN, CONFIDENCE_COLUMN, TARGET_COLUMN, REGULATOR_COLUMN from inferelator.postprocessing import results_processor from inferelator.postprocessing import results_processor_mtl from inferelator.postprocessing import MetricHandler, RankSummingMetric import pandas as pd import pandas.testing as pdt import numpy as np import os import tempfile import shutil import logging logging.getLogger('matplotlib').setLevel(logging.ERROR) class TestResults(unittest.TestCase): def setUp(self): # Data was taken from a subset of row 42 of Bacillus subtilis run results self.beta1 = pd.DataFrame(np.array([[-0.2841755, 0, 0.2280624, -0.3852462, 0.2545609]]), ['gene1'], ['tf1', 'tf2', 'tf3', 'tf4', 'tf5']) self.rescaled_beta1 = pd.DataFrame(np.array([[0.09488207, 0, 0.07380172, 0.15597205, 0.07595131]]), ['gene1'], ['tf1', 'tf2', 'tf3', 'tf4', 'tf5']) self.beta2 = pd.DataFrame(np.array([[0, 0.2612011, 0.1922999, 0.00000000, 0.19183277]]), ['gene1'], ['tf1', 'tf2', 'tf3', 'tf4', 'tf5']) self.rescaled_beta2 = pd.DataFrame(np.array([[0, 0.09109101, 0.05830292, 0.00000000, 0.3675702]]), ['gene1'], ['tf1', 'tf2', 'tf3', 'tf4', 'tf5']) # Toy data self.beta = pd.DataFrame(np.array([[0, 1], [0.5, 0.05]]), ['gene1', 'gene2'], ['tf1', 'tf2']) self.beta_resc = pd.DataFrame(np.array([[0, 1.1], [1, 0.05]]), ['gene1', 'gene2'], ['tf1', 'tf2']) self.prior = pd.DataFrame([[0, 1], [1, 0]], ['gene1', 'gene2'], ['tf1', 'tf2']) self.gold_standard = pd.DataFrame([[0, 1], [1, 0]], ['gene1', 'gene2'], ['tf1', 'tf2']) self.gold_standard_unaligned = pd.DataFrame([[0, 1], [0, 0]], ['gene1', 'gene3'], ['tf1', 'tf2']) @staticmethod def make_PR_data(gs, confidences): data = utils.melt_and_reindex_dataframe(confidences, value_name=CONFIDENCE_COLUMN).reset_index() data = data.join(utils.melt_and_reindex_dataframe(gs, value_name=GOLD_STANDARD_COLUMN), on=[TARGET_COLUMN, REGULATOR_COLUMN], how='outer') return data class TestResultsProcessor(TestResults): def test_full_stack(self): rp = results_processor.ResultsProcessor([self.beta], [self.beta_resc]) result = rp.summarize_network(None, self.gold_standard, self.prior) self.assertEqual(result.score, 1) def test_combining_confidences_two_betas_negative_values_assert_nonzero_betas(self): _, _, betas_non_zero = results_processor.ResultsProcessor.threshold_and_summarize([self.beta1, self.beta2], 0.5) np.testing.assert_equal(betas_non_zero, np.array([[1, 1, 2, 1, 2]])) def test_combining_confidences_two_betas_negative_values_assert_sign_betas(self): _, betas_sign, _ = results_processor.ResultsProcessor.threshold_and_summarize([self.beta1, self.beta2], 0.5) np.testing.assert_equal(betas_sign, np.array([[-1, 1, 2, -1, 2]])) def test_threshold_and_summarize_one_beta(self): beta1 = pd.DataFrame(np.array([[1, 0], [0.5, 0]]), ['gene1', 'gene2'], ['tf1', 'tf2']) thresholded_mat, _, _ = results_processor.ResultsProcessor.threshold_and_summarize([beta1], 0.5) np.testing.assert_equal(thresholded_mat.values, np.array([[1, 0], [1, 0]])) def test_threshold_and_summarize_two_betas(self): beta1 = pd.DataFrame(np.array([[1, 0], [0.5, 0]]), ['gene1', 'gene2'], ['tf1', 'tf2']) beta2 = pd.DataFrame(np.array([[0, 0], [0.5, 1]]), ['gene1', 'gene2'], ['tf1', 'tf2']) thresholded_mat, _, _ = results_processor.ResultsProcessor.threshold_and_summarize([beta1, beta2], 0.5) np.testing.assert_equal(thresholded_mat.values, np.array([[1, 0], [1, 1]])) def test_threshold_and_summarize_three_betas(self): beta1 = pd.DataFrame(np.array([[1, 0], [0.5, 0]]), ['gene1', 'gene2'], ['tf1', 'tf2']) beta2 = pd.DataFrame(np.array([[0, 0], [0.5, 0]]), ['gene1', 'gene2'], ['tf1', 'tf2']) beta3 = pd.DataFrame(np.array([[0.5, 0.2], [0.5, 0.1]]), ['gene1', 'gene2'], ['tf1', 'tf2']) thresholded_mat, _, _ = results_processor.ResultsProcessor.threshold_and_summarize([beta1, beta2, beta3], 0.5) np.testing.assert_equal(thresholded_mat.values, np.array([[1, 0], [1, 0]])) def test_threshold_and_summarize_three_betas_negative_values(self): beta1 = pd.DataFrame(np.array([[1, 0], [-0.5, 0]]), ['gene1', 'gene2'], ['tf1', 'tf2']) beta2 = pd.DataFrame(np.array([[0, 0], [-0.5, 1]]), ['gene1', 'gene2'], ['tf1', 'tf2']) beta3 = pd.DataFrame(np.array([[-0.5, 0.2], [-0.5, 0.1]]), ['gene1', 'gene2'], ['tf1', 'tf2']) thresholded_mat, _, _ = results_processor.ResultsProcessor.threshold_and_summarize([beta1, beta2, beta3], 0.5) np.testing.assert_equal(thresholded_mat.values, np.array([[1, 0], [1, 1]])) def test_mean_and_median(self): beta1 = pd.DataFrame(np.array([[1, 1], [1, 1]]), ['gene1', 'gene2'], ['tf1', 'tf2']) beta2 = pd.DataFrame(np.array([[2, 2], [2, 2]]), ['gene1', 'gene2'], ['tf1', 'tf2']) mean, median = results_processor.ResultsProcessor.mean_and_median([beta1, beta2]) np.testing.assert_equal(mean, np.array([[1.5, 1.5], [1.5, 1.5]])) np.testing.assert_equal(median, np.array([[1.5, 1.5], [1.5, 1.5]])) class TestNetworkCreator(TestResults): def setUp(self): super(TestNetworkCreator, self).setUp() self.metric = MetricHandler.get_metric("aupr") self.pr_calc = self.metric([self.rescaled_beta1, self.rescaled_beta2], self.gold_standard, "keep_all_gold_standard") self.beta_sign, self.beta_nonzero = results_processor.ResultsProcessor.summarize([self.beta1, self.beta2]) self.beta_threshold = results_processor.ResultsProcessor.passes_threshold(self.beta_nonzero, 2, 0.5) def test_process_network(self): net = results_processor.ResultsProcessor.process_network(self.pr_calc, self.prior, beta_threshold=self.beta_threshold) self.assertListEqual(net['regulator'].tolist(), ['tf5', 'tf4', 'tf1']) self.assertListEqual(net['target'].tolist(), ['gene1'] * 3) self.assertListEqual(net['combined_confidences'].tolist(), [0.6, 0.3, 0.1]) def test_network_summary(self): temp_dir = tempfile.mkdtemp() net = results_processor.ResultsProcessor.process_network(self.pr_calc, self.prior, beta_threshold=self.beta_threshold) result = results_processor.InferelatorResults(net, self.beta_threshold, self.pr_calc.all_confidences, self.pr_calc) result.write_result_files(temp_dir) processed_data = pd.read_csv(os.path.join(temp_dir, "network.tsv"), sep="\t", index_col=None, header=0) self.assertEqual(processed_data.shape[0], 3) self.assertListEqual(processed_data['regulator'].tolist(), ['tf5', 'tf4', 'tf1']) self.assertListEqual(processed_data['target'].tolist(), ['gene1'] * 3) self.assertListEqual(processed_data['combined_confidences'].tolist(), [0.6, 0.3, 0.1]) shutil.rmtree(temp_dir) class TestRankSummary(TestResults): def setUp(self): super(TestRankSummary, self).setUp() self.metric = RankSummingMetric def test_making_network_dataframe(self): calc = self.metric([self.beta_resc, self.beta_resc], self.gold_standard_unaligned) pdt.assert_frame_equal(calc.gold_standard, self.gold_standard_unaligned) self.assertEqual(calc.confidence_data.shape[0], 6) self.assertEqual(pd.isnull(calc.confidence_data[CONFIDENCE_COLUMN]).sum(), 2) self.assertEqual(pd.isnull(calc.confidence_data[GOLD_STANDARD_COLUMN]).sum(), 2) def test_combining_confidences_one_beta(self): # rescaled betas are only in the beta = pd.DataFrame(np.array([[0.5, 0], [0.5, 1]]), ['gene1', 'gene2'], ['tf1', 'tf2']) confidences = self.metric.compute_combined_confidences([beta]) np.testing.assert_equal(confidences.values, np.array([[0.5, 0.0], [0.5, 1.0]])) def test_combining_confidences_one_beta_invariant_to_rescale_division(self): # rescaled betas are only in the beta = pd.DataFrame(
np.array([[1, 0], [1, 2]])
numpy.array
# -*- coding: utf-8 -*_ """ fbe.py ========================================================================= FBE module provides several utilities and signal parametrization methods. """ __author__ = '<NAME>' import spectrum import numpy as np from typing import Tuple from scipy.io import wavfile import scipy.signal import os import soundfile as sf class sin2cos2: """ Class for computing signal windowing function with sin(x)^2 and cos(x)^2 tails. :param frame: the frame length in samples :type frame: int :param overlap: the size of the overlaping part of the window (the length of the tails on both sides) :type overlap: int :return: nothing """ def __init__(self, frame : int = 512, overlap : int = 50): self._win = np.zeros((frame,)) self._frame = frame self._overlap = overlap self._compute_window() def _compute_window(self): for i in range(self._overlap): self._win[i] = np.sin(2*np.pi/(4*(self._overlap+2))*(i+1))**2 for i in range(self._overlap,self._frame-self._overlap): self._win[i] = 1 for i in range(self._frame-self._overlap,self._frame): self._win[i] = np.cos(2*np.pi/(4*(self._overlap+2))*(i-self._frame+self._overlap+1))**2 def window(self): """ Method returning the vector of window's values. :return: the window :rtype: numpy array of length frame """ return self._win class fbe: """ Versatile class computing various speech signal representations, mostly based on AR modelling and Mel Frequency Filterbanks. :param frame_zero_adding: required length of the sequence after zero adding operation, defaults to None, which indicates no zero adding :type frame_zero_adding: int :param frame: frame length in samples :type frame: int :param sr: sampling frequency in Hz :type sr: float :param preem_alfa: the preemphasis coefficient :type preem_alfa: float :param freq_range: frequency range in which the mel frequency filterbanks should be computed :type freq_range: np.ndarray two elemements vector of floats :param filts_num: number of mel frequency triangular filters in the filterbank :type filts_num: int :param window: the windowing function :type window: np.ndarray, numpy vector of floats, defaults to None, which causes using of rectangular window :param ar_order: the AR model order :type ar_order: int :param cepstral_lifter: the cepstral lifter in MFCC computation :type cepstral_lifter: int :param num_ceps: number of cepstra :type num_ceps: int :returns: nothing .. note:: PSD is abbreviation for power spectral density in the whole documentation. AR is abbreviation for autoregressive in the whole documentation. """ def __init__(self, frame_zero_adding=None, frame=512, sr=16000, preem_alfa=0.95, overlap=0, freq_range=[20., 8000.], filts_num=23, num_gfs=70, spl_of_max_amplitude=88, window=None, ar_order=16, cepstral_lifter=22, num_ceps=13): if overlap==0 or overlap > frame/2: overlap = frame/2 if window is None: window = np.ones((frame,)) if frame != len(window): print("ERROR in fbe, frame and window lengths do not match, program exits ...") sys.exit(1) self.sr = sr # sampling frequency in Hz self.frame = frame # number of samples in the frame self.num_ceps = num_ceps if not frame_zero_adding is None: self._nfft = frame_zero_adding # fft length, sets the self._nfft atribute else: self._nfft = frame self.preem_alfa = preem_alfa # preemphasis coefficient self.freq_range = freq_range # frequency range in Hz self.filts_num = filts_num # number of triangular filterbank channels self.K = int(self._nfft / 2.) + 1 # length of the unique part of the FFT self.f_min = 0 self.f_max = float(sr) / 2. self.f_low = self.freq_range[0] self.f_high = self.freq_range[1] # matrices self._tfb = self._tfb() # compute the mel-frequency triangular filterbank, sets the H atribute self._pinv_tfb = self._pinv_tfb() self._wgh_mat = self._wgh_mat() self._inv_wgh_mat = self._inv_wgh_mat() # window self._window = window self._ar_order = ar_order # compute cepstral lifter L = cepstral_lifter N = num_ceps self.cepstral_lifter = 1+0.5*L*np.sin(np.pi*np.asarray(range(N))/float(L)) # dct matrix self.dctmat = np.zeros((self.num_ceps,self.filts_num)) for i in range(self.num_ceps): for j in range(self.filts_num): self.dctmat[i,j] =
np.sqrt(2./self.filts_num)
numpy.sqrt
import matplotlib.pyplot as plt import numpy as np import pandas as pd # Deep Recurrent Reinforcement Learning: 1 capa LSTM y 4 capas Dense, Funcion de activacion tanh, 12 episodes, 50 iteraciones drnnLSTMtanhMakespan0=[799, 798, 799, 799, 805, 806, 799, 805, 805, 800, 798, 798] drnnLSTMtanhMakespan1=[800, 798, 796, 800, 796, 794, 795, 798, 800, 798, 805, 798] drnnLSTMtanhMakespan2=[796, 800, 798, 804, 800, 798, 798, 798, 800, 800, 802, 797] drnnLSTMtanhMakespan3=[805, 800, 800, 803, 794, 802, 800, 798, 799, 804, 799, 806] drnnLSTMtanhMakespan4=[796, 798, 795, 798, 796, 799, 800, 796, 796, 798, 806, 800] drnnLSTMtanhMakespan5=[798, 798, 799, 800, 800, 808, 798, 798, 801, 796, 799, 798] drnnLSTMtanhMakespan6=[800, 796, 805, 798, 798, 796, 799, 800, 803, 800, 798, 800] drnnLSTMtanhMakespan7=[799, 805, 802, 805, 800, 799, 800, 799, 805, 800, 794, 796] drnnLSTMtanhMakespan8=[799, 798, 800, 798, 798, 800, 800, 800, 804, 799, 800, 804] drnnLSTMtanhMakespan9=[795, 800, 795, 796, 798, 796, 797, 800, 797, 798, 796, 795] drnnLSTMtanhMakespan10=[804, 799, 805, 798, 798, 798, 805, 800, 796, 804, 796, 799] drnnLSTMtanhMakespan11=[795, 803, 805, 798, 795, 801, 798, 798, 804, 803, 799, 804] drnnLSTMtanhMakespan12=[798, 798, 799, 800, 798, 798, 799, 799, 801, 796, 799, 798] drnnLSTMtanhMakespan13=[798, 798, 799, 797, 796, 796, 800, 797, 805, 800, 800, 794] drnnLSTMtanhMakespan14=[800, 798, 798, 796, 800, 800, 798, 798, 802, 798, 802, 798] drnnLSTMtanhMakespan15=[796, 796, 800, 801, 800, 800, 796, 794, 796, 800, 796, 798] drnnLSTMtanhMakespan16=[798, 798, 795, 797, 795, 799, 800, 796, 795, 796, 800, 800] drnnLSTMtanhMakespan17=[794, 795, 800, 798, 795, 796, 798, 796, 795, 794, 798, 796] drnnLSTMtanhMakespan18=[797, 795, 794, 794, 800, 796, 796, 795, 798, 795, 798, 794] drnnLSTMtanhMakespan19=[797, 795, 795, 796, 798, 799, 795, 799, 795, 794, 795, 795] drnnLSTMtanhMakespan20=[796, 794, 798, 797, 798, 799, 795, 795, 797, 795, 795, 792] drnnLSTMtanhMakespan21=[797, 795, 797, 793, 794, 794, 800, 794, 798, 795, 797, 795] drnnLSTMtanhMakespan22=[794, 800, 798, 795, 795, 796, 796, 799, 795, 794, 795, 795] drnnLSTMtanhMakespan23=[795, 795, 794, 795, 794, 794, 797, 799, 796, 794, 794, 795] drnnLSTMtanhMakespan24=[798, 795, 795, 795, 792, 794, 795, 794, 794, 795, 795, 795] drnnLSTMtanhMakespan25=[794, 792, 794, 795, 795, 794, 794, 794, 794, 795, 794, 793] drnnLSTMtanhMakespan26=[794, 794, 795, 796, 798, 795, 794, 794, 794, 794, 795, 794] drnnLSTMtanhMakespan27=[795, 794, 795, 795, 795, 794, 794, 794, 794, 794, 795, 795] drnnLSTMtanhMakespan28=[795, 794, 794, 795, 794, 795, 795, 795, 795, 794, 795, 794] drnnLSTMtanhMakespan29=[792, 794, 795, 794, 794, 795, 794, 793, 795, 794, 795, 792] drnnLSTMtanhMakespan30=[795, 794, 795, 795, 794, 794, 794, 795, 794, 794, 794, 794] drnnLSTMtanhMakespan31=[794, 794, 795, 794, 795, 793, 795, 795, 795, 792, 794, 794] drnnLSTMtanhMakespan32=[795, 795, 794, 793, 795, 795, 795, 795, 794, 794, 795, 794] drnnLSTMtanhMakespan33=[793, 794, 795, 793, 792, 795, 794, 794, 794, 794, 794, 795] drnnLSTMtanhMakespan34=[794, 795, 795, 794, 794, 794, 794, 793, 794, 794, 794, 794] drnnLSTMtanhMakespan35=[794, 794, 797, 793, 792, 794, 793, 794, 795, 794, 795, 792] drnnLSTMtanhMakespan36=[794, 794, 793, 794, 795, 797, 795, 795, 794, 795, 793, 794] drnnLSTMtanhMakespan37=[795, 793, 795, 794, 795, 798, 795, 794, 795, 793, 795, 794] drnnLSTMtanhMakespan38=[794, 795, 793, 795, 794, 794, 794, 794, 794, 794, 797, 795] drnnLSTMtanhMakespan39=[794, 794, 795, 794, 795, 795, 794, 795, 794, 795, 798, 797] drnnLSTMtanhMakespan40=[795, 795, 794, 795, 794, 795, 795, 794, 794, 794, 795, 795] drnnLSTMtanhMakespan41=[794, 795, 792, 794, 794, 798, 795, 794, 794, 794, 793, 795] drnnLSTMtanhMakespan42=[793, 795, 794, 793, 794, 794, 792, 794, 795, 794, 794, 793] drnnLSTMtanhMakespan43=[793, 792, 793, 794, 794, 795, 792, 794, 795, 794, 795, 794] drnnLSTMtanhMakespan44=[793, 794, 795, 795, 794, 794, 795, 798, 794, 792, 795, 794] drnnLSTMtanhMakespan45=[795, 794, 794, 794, 794, 792, 794, 795, 794, 796, 795, 794] drnnLSTMtanhMakespan46=[794, 793, 793, 795, 795, 794, 794, 794, 794, 796, 794, 794] drnnLSTMtanhMakespan47=[794, 794, 795, 794, 794, 795, 792, 795, 794, 795, 795, 794] drnnLSTMtanhMakespan48=[794, 795, 794, 794, 794, 792, 794, 795, 796, 794, 794, 795] drnnLSTMtanhMakespan49=[794, 794, 794, 794, 794, 794, 792, 794, 793, 794, 795, 794] drnnLSTMtanhRewards0=[-0.1759911894273128, -0.17580964970257765, -0.1759911894273128, -0.1759911894273128, -0.177078750549934, -0.17725973169122497, -0.1759911894273128, -0.177078750549934, -0.177078750549934, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765] drnnLSTMtanhRewards1=[-0.17617264919621228, -0.17580964970257765, -0.17544633017412387, -0.17617264919621228, -0.17544633017412387, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.17580964970257765, -0.17580964970257765] drnnLSTMtanhRewards2=[-0.17544633017412387, -0.17617264919621228, -0.17580964970257765, -0.1768976897689769, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17653532907770195, -0.17562802996914942] drnnLSTMtanhRewards3=[-0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.17671654929577466, -0.17508269018743108, -0.17653532907770195, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.1768976897689769, -0.1759911894273128, -0.17725973169122497] drnnLSTMtanhRewards4=[-0.17580964970257765, -0.17544633017412387, -0.17526455026455026, -0.17580964970257765, -0.17544633017412387, -0.1759911894273128, -0.17617264919621228, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17725973169122497, -0.17617264919621228] drnnLSTMtanhRewards5=[-0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17617264919621228, -0.17617264919621228, -0.1776214552648934, -0.17580964970257765, -0.17580964970257765, -0.1763540290620872, -0.17544633017412387, -0.1759911894273128, -0.17580964970257765] drnnLSTMtanhRewards6=[-0.17617264919621228, -0.17544633017412387, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.1759911894273128, -0.17617264919621228, -0.17671654929577466, -0.17617264919621228, -0.17580964970257765, -0.17617264919621228] drnnLSTMtanhRewards7=[-0.1759911894273128, -0.177078750549934, -0.17653532907770195, -0.177078750549934, -0.17617264919621228, -0.1759911894273128, -0.17617264919621228, -0.1759911894273128, -0.177078750549934, -0.17617264919621228, -0.17508269018743108, -0.17544633017412387] drnnLSTMtanhRewards8=[-0.1759911894273128, -0.17580964970257765, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17617264919621228, -0.1768976897689769, -0.1759911894273128, -0.17617264919621228, -0.1768976897689769] drnnLSTMtanhRewards9=[-0.17526455026455026, -0.17617264919621228, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17544633017412387, -0.17562802996914942, -0.17617264919621228, -0.17562802996914942, -0.17580964970257765, -0.17544633017412387, -0.17526455026455026] drnnLSTMtanhRewards10=[-0.1768976897689769, -0.1759911894273128, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.17617264919621228, -0.17544633017412387, -0.1768976897689769, -0.17544633017412387, -0.1759911894273128] drnnLSTMtanhRewards11=[-0.17526455026455026, -0.17671654929577466, -0.177078750549934, -0.17580964970257765, -0.17526455026455026, -0.1763540290620872, -0.17580964970257765, -0.17580964970257765, -0.1768976897689769, -0.17671654929577466, -0.1759911894273128, -0.1768976897689769] drnnLSTMtanhRewards12=[-0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.1759911894273128, -0.1763540290620872, -0.17544633017412387, -0.1759911894273128, -0.17580964970257765] drnnLSTMtanhRewards13=[-0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17562802996914942, -0.17544633017412387, -0.17544633017412387, -0.17617264919621228, -0.17562802996914942, -0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.17508269018743108] drnnLSTMtanhRewards14=[-0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17653532907770195, -0.17580964970257765, -0.17653532907770195, -0.17580964970257765] drnnLSTMtanhRewards15=[-0.17544633017412387, -0.17544633017412387, -0.17617264919621228, -0.1763540290620872, -0.17617264919621228, -0.17617264919621228, -0.17544633017412387, -0.17508269018743108, -0.17544633017412387, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765] drnnLSTMtanhRewards16=[-0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.1759911894273128, -0.17617264919621228, -0.17544633017412387, -0.17544633017412387, -0.17526455026455026, -0.17617264919621228, -0.17617264919621228] drnnLSTMtanhRewards17=[-0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17617264919621228, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17544633017412387] drnnLSTMtanhRewards18=[-0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17617264919621228, -0.17544633017412387, -0.17544633017412387, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.17508269018743108] drnnLSTMtanhRewards19=[-0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.1759911894273128, -0.17526455026455026, -0.1759911894273128, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026] drnnLSTMtanhRewards20=[-0.17544633017412387, -0.17508269018743108, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765, -0.1759911894273128, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17471872931833224] drnnLSTMtanhRewards21=[-0.17562802996914942, -0.17526455026455026, -0.17562802996914942, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17617264919621228, -0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026] drnnLSTMtanhRewards22=[-0.17508269018743108, -0.17617264919621228, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17544633017412387, -0.1759911894273128, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026] drnnLSTMtanhRewards23=[-0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17562802996914942, -0.1759911894273128, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026] drnnLSTMtanhRewards24=[-0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026] drnnLSTMtanhRewards25=[-0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.1749007498897221] drnnLSTMtanhRewards26=[-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drnnLSTMtanhRewards27=[-0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026] drnnLSTMtanhRewards28=[-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drnnLSTMtanhRewards29=[-0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224] drnnLSTMtanhRewards30=[-0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drnnLSTMtanhRewards31=[-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108] drnnLSTMtanhRewards32=[-0.17526455026455026, -0.17526455026455026, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drnnLSTMtanhRewards33=[-0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026] drnnLSTMtanhRewards34=[-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drnnLSTMtanhRewards35=[-0.17508269018743108, -0.17508269018743108, -0.17562802996914942, -0.17471872931833224, -0.1749007498897221, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224] drnnLSTMtanhRewards36=[-0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17508269018743108] drnnLSTMtanhRewards37=[-0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108] drnnLSTMtanhRewards38=[-0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026] drnnLSTMtanhRewards39=[-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17562802996914942] drnnLSTMtanhRewards40=[-0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026] drnnLSTMtanhRewards41=[-0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17526455026455026] drnnLSTMtanhRewards42=[-0.1749007498897221, -0.17526455026455026, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221] drnnLSTMtanhRewards43=[-0.1749007498897221, -0.17471872931833224, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drnnLSTMtanhRewards44=[-0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108] drnnLSTMtanhRewards45=[-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108] drnnLSTMtanhRewards46=[-0.17508269018743108, -0.1749007498897221, -0.1749007498897221, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108] drnnLSTMtanhRewards47=[-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108] drnnLSTMtanhRewards48=[-0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026] drnnLSTMtanhRewards49=[-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] # Deep Recurrent Reinforcement Learning: 1 capa LSTM y 4 capas Dense, Funcion de activacion relu, 12 episodes, 50 iteraciones drnnLSTMreluMakespan0=[805, 800, 800, 800, 794, 800, 798, 809, 795, 800, 798, 798] drnnLSTMreluMakespan1=[798, 798, 796, 799, 800, 796, 796, 798, 798, 794, 798, 800] drnnLSTMreluMakespan2=[805, 805, 798, 799, 806, 799, 806, 799, 800, 798, 805, 795] drnnLSTMreluMakespan3=[800, 800, 800, 796, 800, 800, 799, 806, 808, 798, 797, 798] drnnLSTMreluMakespan4=[805, 805, 795, 796, 799, 804, 798, 794, 798, 794, 796, 810] drnnLSTMreluMakespan5=[798, 798, 798, 795, 800, 798, 796, 802, 800, 800, 805, 801] drnnLSTMreluMakespan6=[800, 798, 798, 795, 800, 796, 800, 798, 799, 796, 805, 800] drnnLSTMreluMakespan7=[800, 800, 800, 799, 798, 798, 800, 805, 800, 799, 800, 801] drnnLSTMreluMakespan8=[799, 800, 800, 799, 795, 795, 805, 795, 798, 800, 798, 800] drnnLSTMreluMakespan9=[800, 796, 805, 798, 798, 795, 805, 800, 799, 795, 800, 805] drnnLSTMreluMakespan10=[805, 798, 805, 800, 801, 805, 799, 805, 798, 800, 800, 798] drnnLSTMreluMakespan11=[798, 803, 800, 797, 795, 796, 794, 799, 800, 800, 800, 796] drnnLSTMreluMakespan12=[799, 798, 799, 795, 798, 795, 798, 798, 798, 795, 798, 798] drnnLSTMreluMakespan13=[798, 798, 799, 796, 798, 796, 800, 799, 796, 794, 796, 795] drnnLSTMreluMakespan14=[796, 798, 806, 799, 804, 798, 805, 798, 800, 805, 794, 800] drnnLSTMreluMakespan15=[806, 795, 800, 796, 798, 796, 810, 798, 799, 798, 800, 800] drnnLSTMreluMakespan16=[799, 796, 798, 798, 798, 800, 798, 810, 796, 805, 800, 795] drnnLSTMreluMakespan17=[798, 798, 798, 794, 798, 805, 801, 798, 800, 799, 798, 798] drnnLSTMreluMakespan18=[795, 800, 794, 798, 797, 798, 794, 800, 797, 796, 794, 794] drnnLSTMreluMakespan19=[798, 802, 794, 798, 799, 795, 797, 795, 800, 796, 797, 796] drnnLSTMreluMakespan20=[794, 797, 795, 794, 799, 795, 795, 795, 800, 797, 794, 798] drnnLSTMreluMakespan21=[799, 798, 796, 795, 794, 798, 795, 795, 798, 798, 795, 794] drnnLSTMreluMakespan22=[794, 794, 795, 797, 795, 795, 795, 792, 794, 795, 794, 794] drnnLSTMreluMakespan23=[794, 794, 794, 794, 795, 796, 793, 794, 795, 794, 797, 795] drnnLSTMreluMakespan24=[794, 792, 792, 794, 796, 792, 794, 795, 794, 792, 796, 795] drnnLSTMreluMakespan25=[794, 795, 795, 794, 794, 792, 795, 792, 795, 794, 794, 794] drnnLSTMreluMakespan26=[795, 794, 794, 795, 794, 794, 793, 794, 797, 795, 794, 795] drnnLSTMreluMakespan27=[794, 794, 795, 796, 795, 797, 794, 794, 795, 801, 794, 795] drnnLSTMreluMakespan28=[795, 795, 795, 795, 794, 792, 794, 797, 794, 795, 795, 795] drnnLSTMreluMakespan29=[794, 792, 798, 794, 797, 795, 793, 795, 795, 794, 795, 795] drnnLSTMreluMakespan30=[795, 794, 798, 794, 794, 795, 792, 796, 794, 796, 794, 794] drnnLSTMreluMakespan31=[794, 795, 795, 794, 795, 794, 795, 795, 794, 794, 795, 795] drnnLSTMreluMakespan32=[798, 794, 794, 794, 798, 792, 795, 795, 795, 796, 794, 795] drnnLSTMreluMakespan33=[794, 796, 794, 794, 794, 795, 794, 794, 797, 793, 793, 795] drnnLSTMreluMakespan34=[794, 794, 795, 794, 794, 793, 794, 795, 793, 795, 795, 794] drnnLSTMreluMakespan35=[798, 796, 795, 794, 795, 795, 795, 795, 794, 795, 797, 795] drnnLSTMreluMakespan36=[794, 796, 794, 794, 794, 794, 795, 795, 797, 796, 795, 795] drnnLSTMreluMakespan37=[795, 794, 796, 795, 795, 795, 795, 794, 792, 797, 794, 793] drnnLSTMreluMakespan38=[794, 798, 794, 792, 794, 792, 795, 797, 793, 794, 794, 797] drnnLSTMreluMakespan39=[792, 794, 794, 794, 792, 795, 795, 795, 794, 794, 795, 794] drnnLSTMreluMakespan40=[792, 795, 795, 792, 795, 795, 794, 795, 794, 795, 794, 795] drnnLSTMreluMakespan41=[794, 797, 795, 794, 795, 795, 798, 794, 795, 796, 796, 794] drnnLSTMreluMakespan42=[794, 795, 795, 795, 794, 795, 795, 794, 794, 795, 793, 795] drnnLSTMreluMakespan43=[795, 794, 795, 794, 795, 795, 792, 794, 794, 795, 794, 795] drnnLSTMreluMakespan44=[795, 794, 792, 795, 794, 794, 795, 794, 796, 795, 796, 794] drnnLSTMreluMakespan45=[795, 794, 793, 794, 793, 795, 794, 794, 795, 794, 795, 794] drnnLSTMreluMakespan46=[794, 796, 793, 794, 794, 795, 799, 795, 794, 794, 794, 794] drnnLSTMreluMakespan47=[794, 794, 794, 794, 795, 793, 795, 795, 794, 795, 795, 795] drnnLSTMreluMakespan48=[794, 794, 795, 794, 795, 795, 795, 794, 794, 795, 795, 794] drnnLSTMreluMakespan49=[795, 795, 795, 794, 795, 795, 794, 795, 793, 793, 792, 792] drnnLSTMreluRewards0=[-0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.17617264919621228, -0.17508269018743108, -0.17617264919621228, -0.17580964970257765, -0.1778021978021978, -0.17526455026455026, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765] drnnLSTMreluRewards1=[-0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.1759911894273128, -0.17617264919621228, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.17508269018743108, -0.17580964970257765, -0.17617264919621228] drnnLSTMreluRewards2=[-0.177078750549934, -0.177078750549934, -0.17580964970257765, -0.1759911894273128, -0.17725973169122497, -0.1759911894273128, -0.17725973169122497, -0.1759911894273128, -0.17617264919621228, -0.17580964970257765, -0.177078750549934, -0.17526455026455026] drnnLSTMreluRewards3=[-0.17617264919621228, -0.17617264919621228, -0.17617264919621228, -0.17544633017412387, -0.17617264919621228, -0.17617264919621228, -0.1759911894273128, -0.17725973169122497, -0.1776214552648934, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765] drnnLSTMreluRewards4=[-0.177078750549934, -0.177078750549934, -0.17526455026455026, -0.17544633017412387, -0.1759911894273128, -0.1768976897689769, -0.17580964970257765, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17544633017412387, -0.17798286090969018] drnnLSTMreluRewards5=[-0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.17617264919621228, -0.17580964970257765, -0.17544633017412387, -0.17653532907770195, -0.17617264919621228, -0.17617264919621228, -0.177078750549934, -0.1763540290620872] drnnLSTMreluRewards6=[-0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.17617264919621228, -0.17544633017412387, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.17544633017412387, -0.177078750549934, -0.17617264919621228] drnnLSTMreluRewards7=[-0.17617264919621228, -0.17617264919621228, -0.17617264919621228, -0.1759911894273128, -0.17580964970257765, -0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.17617264919621228, -0.1759911894273128, -0.17617264919621228, -0.1763540290620872] drnnLSTMreluRewards8=[-0.1759911894273128, -0.17617264919621228, -0.17617264919621228, -0.1759911894273128, -0.17526455026455026, -0.17526455026455026, -0.177078750549934, -0.17526455026455026, -0.17580964970257765, -0.17617264919621228, -0.17580964970257765, -0.17617264919621228] drnnLSTMreluRewards9=[-0.17617264919621228, -0.17544633017412387, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.17526455026455026, -0.17617264919621228, -0.1759911894273128, -0.17526455026455026, -0.17617264919621228, -0.177078750549934] drnnLSTMreluRewards10=[-0.177078750549934, -0.17580964970257765, -0.177078750549934, -0.17617264919621228, -0.1763540290620872, -0.1759911894273128, -0.177078750549934, -0.177078750549934, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765] drnnLSTMreluRewards11=[-0.17580964970257765, -0.17671654929577466, -0.17617264919621228, -0.17562802996914942, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108, -0.1759911894273128, -0.17617264919621228, -0.17617264919621228, -0.17617264919621228, -0.17544633017412387] drnnLSTMreluRewards12=[-0.1759911894273128, -0.17580964970257765, -0.1759911894273128, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.17580964970257765] drnnLSTMreluRewards13=[-0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17544633017412387, -0.17580964970257765, -0.17544633017412387, -0.17617264919621228, -0.1759911894273128, -0.17544633017412387, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026] drnnLSTMreluRewards14=[-0.17544633017412387, -0.17580964970257765, -0.17725973169122497, -0.1759911894273128, -0.1768976897689769, -0.17580964970257765, -0.177078750549934, -0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.17508269018743108, -0.17617264919621228] drnnLSTMreluRewards15=[-0.17725973169122497, -0.17526455026455026, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765, -0.17544633017412387, -0.17798286090969018, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228] drnnLSTMreluRewards16=[-0.1759911894273128, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17617264919621228, -0.17580964970257765, -0.17798286090969018, -0.17544633017412387, -0.177078750549934, -0.17617264919621228, -0.17526455026455026] drnnLSTMreluRewards17=[-0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17508269018743108, -0.17580964970257765, -0.177078750549934, -0.1763540290620872, -0.17580964970257765, -0.17617264919621228, -0.1759911894273128, -0.17580964970257765, -0.17580964970257765] drnnLSTMreluRewards18=[-0.17526455026455026, -0.17617264919621228, -0.17508269018743108, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765, -0.17508269018743108, -0.17617264919621228, -0.17562802996914942, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108] drnnLSTMreluRewards19=[-0.17580964970257765, -0.17653532907770195, -0.17508269018743108, -0.17580964970257765, -0.1759911894273128, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17617264919621228, -0.17544633017412387, -0.17562802996914942, -0.17544633017412387] drnnLSTMreluRewards20=[-0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.1759911894273128, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17617264919621228, -0.17562802996914942, -0.17508269018743108, -0.17580964970257765] drnnLSTMreluRewards21=[-0.1759911894273128, -0.17580964970257765, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108] drnnLSTMreluRewards22=[-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108] drnnLSTMreluRewards23=[-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026] drnnLSTMreluRewards24=[-0.17508269018743108, -0.17471872931833224, -0.17471872931833224, -0.17508269018743108, -0.17544633017412387, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17471872931833224, -0.17544633017412387, -0.17526455026455026] drnnLSTMreluRewards25=[-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drnnLSTMreluRewards26=[-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026] drnnLSTMreluRewards27=[-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17562802996914942, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.1763540290620872, -0.17508269018743108, -0.17526455026455026] drnnLSTMreluRewards28=[-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17562802996914942, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026] drnnLSTMreluRewards29=[-0.17508269018743108, -0.17471872931833224, -0.17580964970257765, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026] drnnLSTMreluRewards30=[-0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17544633017412387, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108] drnnLSTMreluRewards31=[-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026] drnnLSTMreluRewards32=[-0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17471872931833224, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108, -0.17526455026455026] drnnLSTMreluRewards33=[-0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17562802996914942, -0.1749007498897221, -0.1749007498897221, -0.17526455026455026] drnnLSTMreluRewards34=[-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108] drnnLSTMreluRewards35=[-0.17580964970257765, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026] drnnLSTMreluRewards36=[-0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026] drnnLSTMreluRewards37=[-0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17471872931833224, -0.17562802996914942, -0.17508269018743108, -0.1749007498897221] drnnLSTMreluRewards38=[-0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17471872931833224, -0.17526455026455026, -0.17562802996914942, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17562802996914942] drnnLSTMreluRewards39=[-0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drnnLSTMreluRewards40=[-0.17471872931833224, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026] drnnLSTMreluRewards41=[-0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.17544633017412387, -0.17508269018743108] drnnLSTMreluRewards42=[-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026] drnnLSTMreluRewards43=[-0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026] drnnLSTMreluRewards44=[-0.17526455026455026, -0.17508269018743108, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108] drnnLSTMreluRewards45=[-0.17526455026455026, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drnnLSTMreluRewards46=[-0.17508269018743108, -0.17544633017412387, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.1759911894273128, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drnnLSTMreluRewards47=[-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026] drnnLSTMreluRewards48=[-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108] drnnLSTMreluRewards49=[-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.1749007498897221, -0.17471872931833224, -0.17471872931833224] # Deep Recurrent Reinforcement Learning: 1 capa GRU y 4 capas Dense, Funcion de activacion tanh, 12 episodes, 50 iteraciones drnnGRUtanhMakespan0 = [798, 799, 798, 804, 805, 799, 801, 801, 801, 799, 798, 796] drnnGRUtanhMakespan1 = [800, 798, 798, 798, 798, 798, 801, 798, 795, 796, 800, 796] drnnGRUtanhMakespan2 = [795, 804, 805, 800, 800, 796, 804, 800, 795, 798, 798, 801] drnnGRUtanhMakespan3 = [806, 796, 794, 797, 798, 800, 800, 808, 805, 798, 800, 809] drnnGRUtanhMakespan4 = [805, 801, 795, 798, 798, 800, 796, 796, 805, 798, 799, 798] drnnGRUtanhMakespan5 = [804, 799, 798, 804, 796, 799, 798, 805, 796, 805, 798, 800] drnnGRUtanhMakespan6 = [800, 799, 794, 801, 799, 796, 800, 804, 797, 796, 800, 798] drnnGRUtanhMakespan7 = [798, 800, 810, 810, 805, 800, 795, 798, 800, 805, 799, 800] drnnGRUtanhMakespan8 = [798, 797, 800, 800, 804, 805, 798, 798, 801, 795, 798, 809] drnnGRUtanhMakespan9 = [803, 800, 800, 805, 805, 798, 804, 803, 805, 801, 810, 801] drnnGRUtanhMakespan10 = [798, 799, 798, 798, 805, 804, 805, 798, 799, 798, 800, 800] drnnGRUtanhMakespan11 = [796, 795, 805, 800, 800, 798, 795, 804, 805, 798, 800, 800] drnnGRUtanhMakespan12 = [799, 799, 809, 800, 799, 799, 797, 805, 799, 800, 798, 795] drnnGRUtanhMakespan13 = [805, 800, 800, 805, 800, 799, 798, 801, 798, 797, 805, 800] drnnGRUtanhMakespan14 = [800, 798, 800, 800, 800, 804, 804, 799, 799, 800, 798, 798] drnnGRUtanhMakespan15 = [805, 800, 795, 800, 804, 795, 800, 798, 799, 798, 800, 796] drnnGRUtanhMakespan16 = [806, 795, 801, 799, 799, 796, 796, 794, 802, 796, 800, 802] drnnGRUtanhMakespan17 = [796, 800, 798, 800, 794, 800, 804, 805, 798, 810, 800, 798] drnnGRUtanhMakespan18 = [798, 800, 794, 794, 797, 798, 800, 805, 798, 798, 804, 798] drnnGRUtanhMakespan19 = [796, 800, 806, 799, 796, 800, 798, 805, 798, 799, 797, 805] drnnGRUtanhMakespan20 = [805, 800, 799, 796, 805, 805, 805, 794, 809, 796, 800, 797] drnnGRUtanhMakespan21 = [798, 800, 800, 800, 798, 801, 796, 801, 801, 801, 795, 799] drnnGRUtanhMakespan22 = [798, 801, 797, 800, 799, 795, 799, 799, 800, 801, 800, 799] drnnGRUtanhMakespan23 = [800, 798, 799, 805, 794, 800, 798, 796, 796, 804, 800, 794] drnnGRUtanhMakespan24 = [800, 800, 798, 805, 804, 799, 798, 801, 800, 798, 798, 798] drnnGRUtanhMakespan25 = [798, 798, 798, 795, 800, 803, 798, 798, 800, 799, 796, 798] drnnGRUtanhMakespan26 = [796, 798, 798, 798, 805, 796, 798, 798, 805, 795, 801, 796] drnnGRUtanhMakespan27 = [794, 796, 796, 800, 800, 798, 800, 798, 802, 798, 797, 798] drnnGRUtanhMakespan28 = [799, 799, 800, 800, 798, 802, 799, 798, 795, 795, 794, 798] drnnGRUtanhMakespan29 = [798, 796, 796, 797, 796, 798, 800, 800, 796, 798, 800, 795] drnnGRUtanhMakespan30 = [799, 798, 795, 795, 800, 795, 798, 798, 799, 798, 805, 799] drnnGRUtanhMakespan31 = [795, 799, 794, 794, 796, 795, 795, 794, 798, 797, 798, 795] drnnGRUtanhMakespan32 = [797, 798, 795, 796, 798, 795, 797, 798, 795, 794, 795, 796] drnnGRUtanhMakespan33 = [799, 795, 794, 794, 798, 795, 798, 797, 800, 796, 795, 794] drnnGRUtanhMakespan34 = [798, 795, 798, 796, 798, 794, 796, 798, 798, 798, 796, 797] drnnGRUtanhMakespan35 = [795, 798, 796, 798, 794, 801, 795, 800, 795, 800, 794, 800] drnnGRUtanhMakespan36 = [798, 799, 796, 797, 795, 794, 800, 795, 795, 794, 795, 795] drnnGRUtanhMakespan37 = [799, 798, 795, 795, 794, 795, 795, 796, 805, 795, 798, 796] drnnGRUtanhMakespan38 = [798, 794, 795, 795, 795, 796, 795, 796, 800, 798, 797, 796] drnnGRUtanhMakespan39 = [794, 795, 795, 797, 795, 795, 794, 794, 798, 795, 794, 798] drnnGRUtanhMakespan40 = [795, 795, 795, 795, 795, 795, 794, 794, 793, 797, 794, 795] drnnGRUtanhMakespan41 = [794, 794, 795, 793, 795, 795, 792, 794, 795, 794, 794, 794] drnnGRUtanhMakespan42 = [795, 795, 795, 796, 794, 797, 795, 795, 792, 795, 796, 793] drnnGRUtanhMakespan43 = [794, 795, 795, 794, 795, 794, 798, 794, 797, 795, 794, 794] drnnGRUtanhMakespan44 = [795, 795, 793, 794, 795, 794, 795, 795, 794, 794, 795, 794] drnnGRUtanhMakespan45 = [794, 794, 794, 794, 794, 794, 795, 794, 794, 794, 796, 795] drnnGRUtanhMakespan46 = [795, 794, 795, 794, 794, 794, 793, 794, 795, 795, 794, 797] drnnGRUtanhMakespan47 = [794, 794, 794, 794, 795, 794, 795, 792, 794, 795, 794, 794] drnnGRUtanhMakespan48 = [795, 794, 794, 794, 795, 798, 794, 794, 794, 795, 794, 794] drnnGRUtanhMakespan49 = [795, 795, 794, 795, 793, 795, 796, 794, 795, 794, 794, 797] drnnGRUtanhRewards0 = [-0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.1768976897689769, -0.177078750549934, -0.1759911894273128, -0.1763540290620872, -0.1763540290620872, -0.1763540290620872, -0.1759911894273128, -0.17580964970257765, -0.17544633017412387] drnnGRUtanhRewards1 = [-0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.1763540290620872, -0.17580964970257765, -0.17526455026455026, -0.17544633017412387, -0.17617264919621228, -0.17544633017412387] drnnGRUtanhRewards2 = [-0.17526455026455026, -0.1768976897689769, -0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.17544633017412387, -0.1768976897689769, -0.17617264919621228, -0.17526455026455026, -0.17580964970257765, -0.17580964970257765, -0.1763540290620872] drnnGRUtanhRewards3 = [-0.17725973169122497, -0.17544633017412387, -0.17508269018743108, -0.17562802996914942, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.1776214552648934, -0.177078750549934, -0.17580964970257765, -0.17617264919621228, -0.1778021978021978] drnnGRUtanhRewards4 = [-0.177078750549934, -0.1763540290620872, -0.17526455026455026, -0.17580964970257765, -0.17580964970257765, -0.17617264919621228, -0.17544633017412387, -0.17544633017412387, -0.177078750549934, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765] drnnGRUtanhRewards5 = [-0.1768976897689769, -0.1759911894273128, -0.17580964970257765, -0.1768976897689769, -0.17544633017412387, -0.1759911894273128, -0.17580964970257765, -0.177078750549934, -0.17544633017412387, -0.177078750549934, -0.17580964970257765, -0.17617264919621228] drnnGRUtanhRewards6 = [-0.17617264919621228, -0.1759911894273128, -0.17508269018743108, -0.1763540290620872, -0.1759911894273128, -0.17544633017412387, -0.17617264919621228, -0.1768976897689769, -0.17562802996914942, -0.17544633017412387, -0.17617264919621228, -0.17580964970257765] drnnGRUtanhRewards7 = [-0.17580964970257765, -0.17617264919621228, -0.17798286090969018, -0.177078750549934, -0.17798286090969018, -0.17617264919621228, -0.17526455026455026, -0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.1759911894273128, -0.17617264919621228] drnnGRUtanhRewards8 = [-0.17580964970257765, -0.17562802996914942, -0.17617264919621228, -0.17617264919621228, -0.1768976897689769, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.1763540290620872, -0.17580964970257765, -0.1778021978021978] drnnGRUtanhRewards9 = [-0.17671654929577466, -0.17617264919621228, -0.17617264919621228, -0.177078750549934, -0.177078750549934, -0.17580964970257765, -0.1768976897689769, -0.17671654929577466, -0.177078750549934, -0.1763540290620872, -0.17798286090969018, -0.1763540290620872] drnnGRUtanhRewards10 = [-0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.1768976897689769, -0.177078750549934, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228] drnnGRUtanhRewards11 = [-0.17544633017412387, -0.17526455026455026, -0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.17526455026455026, -0.1768976897689769, -0.177078750549934, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228] drnnGRUtanhRewards12 = [-0.1759911894273128, -0.1759911894273128, -0.1778021978021978, -0.17617264919621228, -0.1759911894273128, -0.1759911894273128, -0.17562802996914942, -0.177078750549934, -0.1759911894273128, -0.17617264919621228, -0.17580964970257765, -0.17526455026455026] drnnGRUtanhRewards13 = [-0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.177078750549934, -0.17617264919621228, -0.1759911894273128, -0.17580964970257765, -0.1763540290620872, -0.17580964970257765, -0.17562802996914942, -0.177078750549934, -0.17617264919621228] drnnGRUtanhRewards14 = [-0.17617264919621228, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17617264919621228, -0.1768976897689769, -0.1768976897689769, -0.1759911894273128, -0.1759911894273128, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765] drnnGRUtanhRewards15 = [-0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.17526455026455026, -0.1768976897689769, -0.17526455026455026, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17617264919621228, -0.17544633017412387] drnnGRUtanhRewards16 = [-0.17725973169122497, -0.17526455026455026, -0.1763540290620872, -0.1759911894273128, -0.1759911894273128, -0.17544633017412387, -0.17544633017412387, -0.17508269018743108, -0.17653532907770195, -0.17544633017412387, -0.17617264919621228, -0.17653532907770195] drnnGRUtanhRewards17 = [-0.17544633017412387, -0.17617264919621228, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17508269018743108, -0.1768976897689769, -0.177078750549934, -0.17580964970257765, -0.17798286090969018, -0.17617264919621228, -0.17580964970257765] drnnGRUtanhRewards18 = [-0.17580964970257765, -0.17617264919621228, -0.17508269018743108, -0.17508269018743108, -0.17562802996914942, -0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.1768976897689769, -0.17580964970257765] drnnGRUtanhRewards19 = [-0.17544633017412387, -0.17617264919621228, -0.17725973169122497, -0.1759911894273128, -0.17544633017412387, -0.17617264919621228, -0.17580964970257765, -0.177078750549934, -0.17580964970257765, -0.17562802996914942, -0.1759911894273128, -0.177078750549934] drnnGRUtanhRewards20 = [-0.17617264919621228, -0.177078750549934, -0.1759911894273128, -0.17544633017412387, -0.177078750549934, -0.177078750549934, -0.177078750549934, -0.17508269018743108, -0.1778021978021978, -0.17544633017412387, -0.17617264919621228, -0.17562802996914942] drnnGRUtanhRewards21 = [-0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.1763540290620872, -0.17544633017412387, -0.1763540290620872, -0.1763540290620872, -0.1763540290620872, -0.17526455026455026, -0.1759911894273128] drnnGRUtanhRewards22 = [-0.17580964970257765, -0.1763540290620872, -0.17562802996914942, -0.17617264919621228, -0.1759911894273128, -0.17526455026455026, -0.1759911894273128, -0.1759911894273128, -0.17617264919621228, -0.1763540290620872, -0.17617264919621228, -0.1759911894273128] drnnGRUtanhRewards23 = [-0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.177078750549934, -0.17508269018743108, -0.17617264919621228, -0.17580964970257765, -0.17544633017412387, -0.17544633017412387, -0.1768976897689769, -0.17617264919621228, -0.17508269018743108] drnnGRUtanhRewards24 = [-0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.177078750549934, -0.1768976897689769, -0.17580964970257765, -0.1763540290620872, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765] drnnGRUtanhRewards25 = [-0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.17617264919621228, -0.17580964970257765, -0.17671654929577466, -0.17580964970257765, -0.17617264919621228, -0.1759911894273128, -0.17544633017412387, -0.17580964970257765] drnnGRUtanhRewards26 = [-0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.17526455026455026, -0.1763540290620872, -0.17544633017412387] drnnGRUtanhRewards27 = [-0.17508269018743108, -0.17544633017412387, -0.17544633017412387, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.17617264919621228, -0.17580964970257765, -0.17653532907770195, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765] drnnGRUtanhRewards28 = [-0.1759911894273128, -0.1759911894273128, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.17653532907770195, -0.17580964970257765, -0.1759911894273128, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765] drnnGRUtanhRewards29 = [-0.17580964970257765, -0.17544633017412387, -0.17544633017412387, -0.17562802996914942, -0.17544633017412387, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765, -0.17617264919621228, -0.17526455026455026] drnnGRUtanhRewards30 = [-0.1759911894273128, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17617264919621228, -0.17526455026455026, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.1759911894273128] drnnGRUtanhRewards31 = [-0.17526455026455026, -0.1759911894273128, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765, -0.17526455026455026] drnnGRUtanhRewards32 = [-0.17562802996914942, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026] drnnGRUtanhRewards33 = [-0.1759911894273128, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17580964970257765, -0.17562802996914942, -0.17617264919621228, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108] drnnGRUtanhRewards34 = [-0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17544633017412387, -0.17508269018743108, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17562802996914942] drnnGRUtanhRewards35 = [-0.17526455026455026, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17508269018743108, -0.1763540290620872, -0.17526455026455026, -0.17617264919621228, -0.17526455026455026, -0.17617264919621228, -0.17508269018743108, -0.17617264919621228] drnnGRUtanhRewards36 = [-0.17580964970257765, -0.1759911894273128, -0.17544633017412387, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17617264919621228, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026] drnnGRUtanhRewards37 = [-0.1759911894273128, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.177078750549934, -0.17526455026455026, -0.17580964970257765, -0.17544633017412387] drnnGRUtanhRewards38 = [-0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17544633017412387, -0.17617264919621228, -0.17580964970257765, -0.17562802996914942, -0.17544633017412387] drnnGRUtanhRewards39 = [-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765] drnnGRUtanhRewards40 = [-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17562802996914942, -0.17508269018743108, -0.17526455026455026] drnnGRUtanhRewards41 = [-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drnnGRUtanhRewards42 = [-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17544633017412387, -0.1749007498897221] drnnGRUtanhRewards43 = [-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108] drnnGRUtanhRewards44 = [-0.17526455026455026, -0.17526455026455026, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drnnGRUtanhRewards45 = [-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026] drnnGRUtanhRewards46 = [-0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17562802996914942] drnnGRUtanhRewards47 = [-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108] drnnGRUtanhRewards48 = [-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108] drnnGRUtanhRewards49 = [-0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17562802996914942] # Deep Recurrent Reinforcement Learning: 1 capa GRU y 4 capas Dense, Funcion de activacion relu, 12 episodes, 50 iteraciones drnnGRUreluMakespan0 = [800, 799, 798, 797, 798, 800, 800, 796, 800, 794, 800, 800] drnnGRUreluMakespan1 = [798, 800, 805, 795, 799, 808, 795, 800, 796, 798, 799, 798] drnnGRUreluMakespan2 = [799, 800, 806, 800, 800, 805, 805, 798, 799, 807, 800, 800] drnnGRUreluMakespan3 = [798, 795, 799, 800, 800, 796, 798, 800, 800, 804, 805, 800] drnnGRUreluMakespan4 = [811, 800, 799, 800, 805, 798, 798, 799, 796, 804, 805, 804] drnnGRUreluMakespan5 = [799, 795, 797, 800, 798, 800, 800, 798, 800, 797, 800, 798] drnnGRUreluMakespan6 = [798, 800, 798, 799, 797, 798, 800, 796, 801, 799, 795, 798] drnnGRUreluMakespan7 = [800, 804, 795, 801, 796, 806, 805, 798, 800, 799, 799, 804] drnnGRUreluMakespan8 = [800, 799, 799, 800, 805, 796, 800, 800, 810, 796, 800, 798] drnnGRUreluMakespan9 = [794, 800, 799, 805, 800, 800, 798, 798, 796, 795, 798, 796] drnnGRUreluMakespan10 = [798, 800, 798, 801, 795, 802, 796, 809, 800, 800, 798, 795] drnnGRUreluMakespan11 = [804, 800, 799, 799, 798, 803, 798, 798, 805, 803, 800, 796] drnnGRUreluMakespan12 = [800, 799, 805, 797, 798, 796, 799, 794, 799, 805, 799, 800] drnnGRUreluMakespan13 = [796, 800, 798, 800, 795, 799, 800, 804, 800, 794, 805, 805] drnnGRUreluMakespan14 = [800, 795, 796, 798, 798, 801, 805, 794, 800, 801, 801, 796] drnnGRUreluMakespan15 = [798, 800, 796, 796, 798, 794, 797, 800, 796, 801, 795, 799] drnnGRUreluMakespan16 = [800, 805, 794, 800, 799, 800, 805, 801, 798, 800, 801, 799] drnnGRUreluMakespan17 = [797, 803, 801, 808, 794, 799, 799, 800, 805, 796, 801, 796] drnnGRUreluMakespan18 = [805, 800, 800, 804, 799, 798, 800, 799, 804, 796, 800, 804] drnnGRUreluMakespan19 = [804, 798, 800, 799, 799, 799, 805, 795, 801, 799, 799, 805] drnnGRUreluMakespan20 = [799, 804, 796, 798, 796, 798, 800, 805, 799, 810, 800, 800] drnnGRUreluMakespan21 = [798, 799, 799, 805, 798, 798, 805, 798, 794, 799, 798, 798] drnnGRUreluMakespan22 = [799, 798, 798, 796, 798, 805, 799, 798, 798, 799, 796, 798] drnnGRUreluMakespan23 = [798, 805, 808, 798, 798, 805, 810, 796, 804, 799, 800, 799] drnnGRUreluMakespan24 = [798, 796, 798, 795, 800, 798, 799, 798, 797, 805, 798, 800] drnnGRUreluMakespan25 = [799, 796, 799, 798, 805, 798, 798, 800, 796, 794, 810, 798] drnnGRUreluMakespan26 = [799, 798, 805, 800, 802, 798, 799, 799, 799, 794, 802, 797] drnnGRUreluMakespan27 = [798, 800, 805, 796, 798, 795, 802, 796, 798, 800, 798, 794] drnnGRUreluMakespan28 = [796, 805, 798, 800, 800, 798, 810, 798, 798, 798, 796, 796] drnnGRUreluMakespan29 = [800, 798, 798, 802, 794, 798, 796, 808, 800, 800, 798, 799] drnnGRUreluMakespan30 = [798, 796, 798, 798, 794, 798, 794, 800, 796, 794, 800, 800] drnnGRUreluMakespan31 = [794, 802, 797, 799, 798, 800, 799, 799, 796, 796, 798, 798] drnnGRUreluMakespan32 = [799, 798, 794, 795, 798, 805, 804, 797, 795, 800, 796, 798] drnnGRUreluMakespan33 = [803, 799, 805, 796, 794, 798, 797, 798, 798, 794, 794, 798] drnnGRUreluMakespan34 = [810, 796, 795, 798, 799, 798, 796, 795, 795, 797, 798, 798] drnnGRUreluMakespan35 = [799, 799, 799, 799, 795, 798, 795, 800, 796, 795, 795, 796] drnnGRUreluMakespan36 = [795, 797, 798, 799, 799, 799, 800, 794, 796, 795, 798, 800] drnnGRUreluMakespan37 = [800, 798, 799, 794, 800, 796, 798, 798, 797, 800, 794, 798] drnnGRUreluMakespan38 = [800, 799, 794, 796, 795, 800, 796, 804, 800, 795, 800, 798] drnnGRUreluMakespan39 = [794, 798, 795, 804, 805, 799, 798, 800, 796, 798, 795, 794] drnnGRUreluMakespan40 = [799, 798, 796, 798, 798, 799, 800, 796, 798, 798, 799, 798] drnnGRUreluMakespan41 = [796, 798, 800, 797, 799, 796, 797, 796, 799, 804, 805, 798] drnnGRUreluMakespan42 = [798, 794, 795, 799, 799, 798, 797, 798, 798, 798, 798, 795] drnnGRUreluMakespan43 = [799, 798, 794, 794, 795, 794, 795, 799, 799, 800, 799, 794] drnnGRUreluMakespan44 = [795, 796, 795, 799, 794, 795, 794, 796, 795, 794, 795, 796] drnnGRUreluMakespan45 = [794, 797, 794, 795, 796, 795, 794, 799, 795, 794, 798, 798] drnnGRUreluMakespan46 = [795, 795, 794, 795, 794, 794, 792, 794, 795, 797, 794, 794] drnnGRUreluMakespan47 = [798, 796, 797, 798, 794, 798, 794, 797, 794, 803, 798, 798] drnnGRUreluMakespan48 = [795, 794, 796, 798, 795, 794, 796, 795, 796, 794, 796, 796] drnnGRUreluMakespan49 = [798, 798, 796, 798, 798, 796, 796, 798, 798, 798, 796, 798] drnnGRUreluRewards0 = [-0.17617264919621228, -0.1759911894273128, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17544633017412387, -0.17617264919621228, -0.17508269018743108, -0.17617264919621228, -0.17617264919621228] drnnGRUreluRewards1 = [-0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.17526455026455026, -0.1759911894273128, -0.1776214552648934, -0.17526455026455026, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765] drnnGRUreluRewards2 = [-0.1759911894273128, -0.17617264919621228, -0.17725973169122497, -0.17617264919621228, -0.17617264919621228, -0.177078750549934, -0.177078750549934, -0.17580964970257765, -0.1759911894273128, -0.1774406332453826, -0.17617264919621228, -0.17617264919621228] drnnGRUreluRewards3 = [-0.17580964970257765, -0.17526455026455026, -0.1759911894273128, -0.17617264919621228, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.1768976897689769, -0.177078750549934, -0.17617264919621228] drnnGRUreluRewards4 = [-0.1781634446397188, -0.17617264919621228, -0.1759911894273128, -0.17617264919621228, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17544633017412387, -0.1768976897689769, -0.177078750549934, -0.1768976897689769] drnnGRUreluRewards5 = [-0.1759911894273128, -0.17526455026455026, -0.17562802996914942, -0.17617264919621228, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.17617264919621228, -0.17562802996914942, -0.17617264919621228, -0.17580964970257765] drnnGRUreluRewards6 = [-0.17580964970257765, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.17562802996914942, -0.17580964970257765, -0.17544633017412387, -0.17617264919621228, -0.1763540290620872, -0.1759911894273128, -0.17526455026455026, -0.17580964970257765] drnnGRUreluRewards7 = [-0.17617264919621228, -0.1768976897689769, -0.17526455026455026, -0.1763540290620872, -0.17544633017412387, -0.17725973169122497, -0.177078750549934, -0.17580964970257765, -0.17617264919621228, -0.1759911894273128, -0.1759911894273128, -0.1768976897689769] drnnGRUreluRewards8 = [-0.17617264919621228, -0.1759911894273128, -0.1759911894273128, -0.17617264919621228, -0.177078750549934, -0.17544633017412387, -0.17617264919621228, -0.17617264919621228, -0.17798286090969018, -0.17544633017412387, -0.17617264919621228, -0.17580964970257765] drnnGRUreluRewards9 = [-0.17508269018743108, -0.17617264919621228, -0.1759911894273128, -0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17526455026455026, -0.17580964970257765, -0.17544633017412387] drnnGRUreluRewards10 = [-0.17580964970257765, -0.17617264919621228, -0.17580964970257765, -0.1763540290620872, -0.17526455026455026, -0.17653532907770195, -0.17544633017412387, -0.1778021978021978, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.17526455026455026] drnnGRUreluRewards11 = [-0.1768976897689769, -0.17617264919621228, -0.1759911894273128, -0.1759911894273128, -0.17580964970257765, -0.17671654929577466, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.17671654929577466, -0.17617264919621228, -0.17544633017412387] drnnGRUreluRewards12 = [-0.17617264919621228, -0.1759911894273128, -0.177078750549934, -0.17562802996914942, -0.17580964970257765, -0.17544633017412387, -0.1759911894273128, -0.17508269018743108, -0.1759911894273128, -0.177078750549934, -0.1759911894273128, -0.17617264919621228] drnnGRUreluRewards13 = [-0.17544633017412387, -0.17617264919621228, -0.17580964970257765, -0.17617264919621228, -0.17526455026455026, -0.1759911894273128, -0.17617264919621228, -0.1768976897689769, -0.17617264919621228, -0.17508269018743108, -0.177078750549934, -0.177078750549934] drnnGRUreluRewards14 = [-0.17617264919621228, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.1763540290620872, -0.177078750549934, -0.17508269018743108, -0.17617264919621228, -0.1763540290620872, -0.1763540290620872, -0.17544633017412387] drnnGRUreluRewards15 = [-0.17580964970257765, -0.17617264919621228, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17508269018743108, -0.17562802996914942, -0.17617264919621228, -0.17544633017412387, -0.1763540290620872, -0.17526455026455026, -0.1759911894273128] drnnGRUreluRewards16 = [-0.17617264919621228, -0.177078750549934, -0.17508269018743108, -0.17617264919621228, -0.1759911894273128, -0.17617264919621228, -0.177078750549934, -0.1763540290620872, -0.17580964970257765, -0.17617264919621228, -0.1763540290620872, -0.1759911894273128] drnnGRUreluRewards17 = [-0.17562802996914942, -0.17671654929577466, -0.1763540290620872, -0.1776214552648934, -0.17508269018743108, -0.1759911894273128, -0.17617264919621228, -0.1759911894273128, -0.177078750549934, -0.17544633017412387, -0.1763540290620872, -0.17544633017412387] drnnGRUreluRewards18 = [-0.177078750549934, -0.17617264919621228, -0.17617264919621228, -0.1768976897689769, -0.1759911894273128, -0.17580964970257765, -0.17617264919621228, -0.1759911894273128, -0.1768976897689769, -0.17544633017412387, -0.17617264919621228, -0.1768976897689769] drnnGRUreluRewards19 = [-0.1768976897689769, -0.17580964970257765, -0.17617264919621228, -0.1759911894273128, -0.1759911894273128, -0.1759911894273128, -0.177078750549934, -0.17526455026455026, -0.1763540290620872, -0.1759911894273128, -0.1759911894273128, -0.177078750549934] drnnGRUreluRewards20 = [-0.1759911894273128, -0.1768976897689769, -0.17544633017412387, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.1759911894273128, -0.17798286090969018, -0.17617264919621228, -0.17617264919621228] drnnGRUreluRewards21 = [-0.17580964970257765, -0.1759911894273128, -0.1759911894273128, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.17580964970257765, -0.17508269018743108, -0.1759911894273128, -0.17580964970257765, -0.17580964970257765] drnnGRUreluRewards22 = [-0.1759911894273128, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.177078750549934, -0.1759911894273128, -0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17544633017412387, -0.17580964970257765] drnnGRUreluRewards23 = [-0.17580964970257765, -0.177078750549934, -0.1776214552648934, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.17798286090969018, -0.17544633017412387, -0.1768976897689769, -0.1759911894273128, -0.17617264919621228, -0.1759911894273128] drnnGRUreluRewards24 = [-0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17562802996914942, -0.177078750549934, -0.17580964970257765, -0.17617264919621228] drnnGRUreluRewards25 = [-0.1759911894273128, -0.17544633017412387, -0.1759911894273128, -0.17580964970257765, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.17617264919621228, -0.17544633017412387, -0.17508269018743108, -0.17798286090969018, -0.17580964970257765] drnnGRUreluRewards26 = [-0.1759911894273128, -0.17580964970257765, -0.177078750549934, -0.17617264919621228, -0.17653532907770195, -0.17580964970257765, -0.1759911894273128, -0.1759911894273128, -0.1759911894273128, -0.17508269018743108, -0.17653532907770195, -0.17562802996914942] drnnGRUreluRewards27 = [-0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17653532907770195, -0.17544633017412387, -0.17580964970257765, -0.17617264919621228, -0.17580964970257765, -0.17508269018743108] drnnGRUreluRewards28 = [-0.17544633017412387, -0.177078750549934, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.17798286090969018, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17544633017412387] drnnGRUreluRewards29 = [-0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.17653532907770195, -0.17508269018743108, -0.17580964970257765, -0.17544633017412387, -0.1776214552648934, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128] drnnGRUreluRewards30 = [-0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17617264919621228, -0.17544633017412387, -0.17508269018743108, -0.17617264919621228, -0.17617264919621228] drnnGRUreluRewards31 = [-0.17508269018743108, -0.17653532907770195, -0.17562802996914942, -0.1759911894273128, -0.17580964970257765, -0.17617264919621228, -0.1759911894273128, -0.1759911894273128, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765] drnnGRUreluRewards32 = [-0.1759911894273128, -0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.1768976897689769, -0.177078750549934, -0.17562802996914942, -0.17526455026455026, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765] drnnGRUreluRewards33 = [-0.17671654929577466, -0.1759911894273128, -0.177078750549934, -0.17544633017412387, -0.17508269018743108, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765] drnnGRUreluRewards34 = [-0.17798286090969018, -0.17544633017412387, -0.17526455026455026, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17580964970257765, -0.17580964970257765] drnnGRUreluRewards35 = [-0.1759911894273128, -0.1759911894273128, -0.1759911894273128, -0.1759911894273128, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17617264919621228, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387] drnnGRUreluRewards36 = [-0.17526455026455026, -0.17562802996914942, -0.17580964970257765, -0.1759911894273128, -0.1759911894273128, -0.1759911894273128, -0.17617264919621228, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17580964970257765, -0.17617264919621228] drnnGRUreluRewards37 = [-0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.17508269018743108, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.17562802996914942, -0.17617264919621228, -0.17508269018743108, -0.17580964970257765] drnnGRUreluRewards38 = [-0.17617264919621228, -0.1759911894273128, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17617264919621228, -0.17544633017412387, -0.1768976897689769, -0.17617264919621228, -0.17526455026455026, -0.17617264919621228, -0.17580964970257765] drnnGRUreluRewards39 = [-0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.1768976897689769, -0.177078750549934, -0.1759911894273128, -0.17580964970257765, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108] drnnGRUreluRewards40 = [-0.1759911894273128, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765] drnnGRUreluRewards41 = [-0.17544633017412387, -0.17580964970257765, -0.17617264919621228, -0.17562802996914942, -0.1759911894273128, -0.17544633017412387, -0.17562802996914942, -0.17544633017412387, -0.1759911894273128, -0.1768976897689769, -0.177078750549934, -0.17580964970257765] drnnGRUreluRewards42 = [-0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.1759911894273128, -0.1759911894273128, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026] drnnGRUreluRewards43 = [-0.1759911894273128, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.1759911894273128, -0.1759911894273128, -0.17617264919621228, -0.1759911894273128, -0.17508269018743108] drnnGRUreluRewards44 = [-0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.1759911894273128, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387] drnnGRUreluRewards45 = [-0.17508269018743108, -0.17562802996914942, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.1759911894273128, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17580964970257765] drnnGRUreluRewards46 = [-0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17562802996914942, -0.17508269018743108, -0.17508269018743108] drnnGRUreluRewards47 = [-0.17580964970257765, -0.17544633017412387, -0.17562802996914942, -0.17580964970257765, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17562802996914942, -0.17508269018743108, -0.17671654929577466, -0.17580964970257765, -0.17580964970257765] drnnGRUreluRewards48 = [-0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108, -0.17544633017412387, -0.17544633017412387] drnnGRUreluRewards49 = [-0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765] # Deep Reinforcement Learning: 5 capas Dense, Funcion de activacion tanh, 12 episodios, 50 iteraciones drlTanhMakespan0 = [794, 794, 805, 799, 810, 800, 794, 810, 804, 806, 812, 808] drlTanhMakespan1 = [796, 795, 795, 798, 799, 800, 800, 795, 797, 796, 797, 799] drlTanhMakespan2 = [800, 797, 798, 801, 799, 800, 796, 795, 797, 796, 794, 798] drlTanhMakespan3 = [800, 795, 799, 796, 799, 798, 795, 799, 795, 799, 798, 796] drlTanhMakespan4 = [809, 795, 795, 800, 797, 795, 798, 798, 799, 799, 798, 798] drlTanhMakespan5 = [795, 795, 795, 799, 795, 798, 795, 800, 795, 796, 795, 805] drlTanhMakespan6 = [794, 800, 795, 793, 798, 795, 794, 798, 795, 799, 795, 796] drlTanhMakespan7 = [795, 795, 795, 795, 798, 795, 797, 797, 795, 795, 798, 797] drlTanhMakespan8 = [795, 795, 795, 794, 800, 800, 794, 795, 794, 794, 797, 795] drlTanhMakespan9 = [793, 794, 796, 795, 796, 800, 794, 797, 793, 795, 798, 795] drlTanhMakespan10 = [795, 795, 797, 794, 795, 798, 797, 795, 798, 794, 794, 794] drlTanhMakespan11 = [795, 795, 795, 795, 797, 795, 795, 794, 795, 795, 795, 794] drlTanhMakespan12 = [794, 798, 795, 794, 795, 795, 795, 797, 799, 795, 795, 795] drlTanhMakespan13 = [795, 797, 795, 800, 796, 795, 796, 795, 795, 795, 798, 794] drlTanhMakespan14 = [795, 795, 796, 794, 794, 794, 797, 795, 798, 795, 795, 793] drlTanhMakespan15 = [799, 794, 795, 795, 795, 796, 801, 797, 795, 794, 795, 799] drlTanhMakespan16 = [795, 795, 796, 798, 795, 795, 795, 795, 795, 798, 798, 796] drlTanhMakespan17 = [800, 798, 795, 795, 798, 794, 795, 795, 797, 795, 796, 794] drlTanhMakespan18 = [797, 800, 798, 797, 796, 794, 799, 797, 795, 796, 799, 798] drlTanhMakespan19 = [797, 800, 795, 794, 794, 796, 795, 798, 796, 798, 797, 795] drlTanhMakespan20 = [794, 795, 795, 799, 798, 797, 795, 795, 798, 795, 798, 795] drlTanhMakespan21 = [796, 795, 795, 795, 795, 797, 798, 794, 797, 795, 796, 794] drlTanhMakespan22 = [799, 796, 795, 795, 795, 795, 796, 795, 796, 798, 796, 795] drlTanhMakespan23 = [799, 799, 795, 796, 796, 799, 796, 797, 794, 794, 798, 796] drlTanhMakespan24 = [795, 795, 797, 800, 797, 795, 795, 796, 795, 795, 798, 799] drlTanhMakespan25 = [795, 797, 795, 795, 795, 795, 800, 796, 795, 797, 795, 795] drlTanhMakespan26 = [795, 795, 799, 794, 797, 794, 794, 798, 794, 796, 795, 798] drlTanhMakespan27 = [796, 796, 795, 796, 798, 797, 794, 795, 794, 794, 794, 798] drlTanhMakespan28 = [795, 795, 794, 798, 796, 796, 800, 797, 797, 796, 795, 794] drlTanhMakespan29 = [795, 795, 798, 800, 797, 794, 796, 794, 792, 794, 794, 795] drlTanhMakespan30 = [798, 797, 795, 799, 797, 800, 798, 799, 797, 800, 794, 796] drlTanhMakespan31 = [794, 795, 800, 798, 800, 794, 800, 798, 799, 798, 798, 798] drlTanhMakespan32 = [795, 795, 795, 794, 794, 794, 793, 795, 794, 793, 794, 795] drlTanhMakespan33 = [794, 797, 792, 794, 795, 795, 797, 795, 795, 794, 792, 795] drlTanhMakespan34 = [795, 794, 795, 798, 795, 796, 794, 795, 794, 794, 795, 794] drlTanhMakespan35 = [796, 794, 797, 793, 794, 798, 795, 794, 793, 793, 795, 794] drlTanhMakespan36 = [795, 795, 794, 795, 795, 795, 794, 795, 795, 793, 795, 794] drlTanhMakespan37 = [794, 794, 798, 794, 794, 796, 795, 794, 793, 795, 795, 792] drlTanhMakespan38 = [794, 796, 795, 794, 798, 798, 795, 795, 794, 794, 795, 794] drlTanhMakespan39 = [794, 795, 795, 796, 792, 794, 795, 794, 795, 794, 794, 795] drlTanhMakespan40 = [798, 795, 794, 795, 794, 794, 793, 795, 794, 794, 797, 794] drlTanhMakespan41 = [795, 792, 795, 794, 794, 795, 794, 795, 792, 797, 795, 795] drlTanhMakespan42 = [792, 794, 794, 795, 794, 794, 795, 794, 792, 794, 794, 794] drlTanhMakespan43 = [794, 796, 794, 793, 795, 795, 793, 798, 794, 794, 798, 794] drlTanhMakespan44 = [794, 794, 794, 794, 795, 794, 793, 794, 794, 795, 795, 794] drlTanhMakespan45 = [790, 794, 793, 794, 793, 794, 795, 794, 791, 795, 795, 794] drlTanhMakespan46 = [792, 794, 794, 794, 794, 794, 794, 793, 794, 794, 794, 794] drlTanhMakespan47 = [794, 794, 794, 794, 794, 794, 794, 794, 792, 795, 793, 795] drlTanhMakespan48 = [794, 794, 792, 792, 797, 794, 792, 794, 794, 795, 794, 795] drlTanhMakespan49 = [795, 794, 794, 796, 794, 797, 794, 794, 794, 794, 794, 794] drlTanhMakespan50 = [794, 792, 795, 794, 794, 794, 794, 794, 795, 794, 795, 794] drlTanhMakespan51 = [794, 792, 796, 795, 794, 794, 795, 794, 795, 795, 795, 794] drlTanhMakespan52 = [794, 794, 795, 792, 795, 795, 795, 792, 794, 793, 795, 794] drlTanhMakespan53 = [794, 792, 794, 792, 794, 794, 794, 795, 795, 794, 794, 792] drlTanhMakespan54 = [795, 793, 794, 794, 794, 792, 795, 794, 794, 792, 794, 796] drlTanhMakespan55 = [795, 794, 794, 795, 795, 793, 794, 795, 794, 797, 795, 792] drlTanhMakespan56 = [795, 795, 792, 795, 794, 795, 794, 794, 794, 795, 795, 795] drlTanhMakespan57 = [795, 792, 795, 794, 795, 795, 792, 795, 794, 797, 792, 792] drlTanhMakespan58 = [795, 795, 794, 795, 792, 794, 794, 794, 792, 792, 792, 793] drlTanhMakespan59 = [795, 794, 792, 794, 794, 794, 792, 794, 794, 794, 793, 795] drlTanhMakespan60 = [794, 795, 795, 795, 798, 794, 794, 794, 794, 794, 794, 792] drlTanhMakespan61 = [792, 795, 794, 794, 795, 794, 792, 795, 795, 794, 794, 795] drlTanhMakespan62 = [795, 794, 794, 794, 799, 794, 792, 794, 795, 795, 794, 793] drlTanhMakespan63 = [791, 795, 792, 796, 794, 794, 792, 795, 793, 794, 792, 794] drlTanhRewards0 = [-0.17508269018743108, -0.17508269018743108, -0.177078750549934, -0.1759911894273128, -0.17798286090969018, -0.17617264919621228, -0.17508269018743108, -0.17798286090969018, -0.1768976897689769, -0.17725973169122497, -0.17834394904458598, -0.1776214552648934] drlTanhRewards1 = [-0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17617264919621228, -0.1759911894273128, -0.17617264919621228, -0.17526455026455026, -0.17562802996914942, -0.17544633017412387, -0.17562802996914942, -0.1759911894273128] drlTanhRewards2 = [-0.17617264919621228, -0.17562802996914942, -0.17580964970257765, -0.1763540290620872, -0.1759911894273128, -0.17617264919621228, -0.17544633017412387, -0.17526455026455026, -0.17562802996914942, -0.17508269018743108, -0.17544633017412387, -0.17580964970257765] drlTanhRewards3 = [-0.17617264919621228, -0.1759911894273128, -0.17526455026455026, -0.17544633017412387, -0.1759911894273128, -0.17580964970257765, -0.17526455026455026, -0.1759911894273128, -0.17526455026455026, -0.1759911894273128, -0.17580964970257765, -0.17544633017412387] drlTanhRewards4 = [-0.1778021978021978, -0.17526455026455026, -0.17526455026455026, -0.17617264919621228, -0.17562802996914942, -0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765] drlTanhRewards5 = [-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.1759911894273128, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17617264919621228, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.177078750549934] drlTanhRewards6 = [-0.17508269018743108, -0.17617264919621228, -0.17526455026455026, -0.1749007498897221, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.1759911894273128, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17544633017412387] drlTanhRewards7 = [-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17562802996914942, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17562802996914942] drlTanhRewards8 = [-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17617264919621228, -0.17508269018743108, -0.17617264919621228, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026] drlTanhRewards9 = [-0.1749007498897221, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17544633017412387, -0.17617264919621228, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.1749007498897221, -0.17580964970257765, -0.17526455026455026] drlTanhRewards10 = [-0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17562802996914942, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drlTanhRewards11 = [-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026] drlTanhRewards12 = [-0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.1759911894273128, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026] drlTanhRewards13 = [-0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17617264919621228, -0.17544633017412387, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17508269018743108] drlTanhRewards14 = [-0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.1749007498897221] drlTanhRewards15 = [-0.1759911894273128, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17562802996914942, -0.1763540290620872, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.1759911894273128] drlTanhRewards16 = [-0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.17544633017412387] drlTanhRewards17 = [-0.17617264919621228, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108] drlTanhRewards18 = [-0.17562802996914942, -0.17617264919621228, -0.17580964970257765, -0.17562802996914942, -0.17544633017412387, -0.1759911894273128, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17544633017412387, -0.1759911894273128, -0.17580964970257765] drlTanhRewards19 = [-0.17562802996914942, -0.17617264919621228, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17580964970257765, -0.17562802996914942, -0.17526455026455026] drlTanhRewards20 = [-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.1759911894273128, -0.17580964970257765, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026] drlTanhRewards21 = [-0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17562802996914942, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108] drlTanhRewards22 = [-0.1759911894273128, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17544633017412387, -0.17526455026455026] drlTanhRewards23 = [-0.1759911894273128, -0.1759911894273128, -0.17544633017412387, -0.17544633017412387, -0.17526455026455026, -0.1759911894273128, -0.17544633017412387, -0.17562802996914942, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17544633017412387] drlTanhRewards24 = [-0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17617264919621228, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17580964970257765, -0.1759911894273128] drlTanhRewards25 = [-0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17617264919621228, -0.17544633017412387, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026] drlTanhRewards26 = [-0.17526455026455026, -0.17526455026455026, -0.1759911894273128, -0.17508269018743108, -0.17562802996914942, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17580964970257765] drlTanhRewards27 = [-0.17544633017412387, -0.17544633017412387, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17562802996914942, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108] drlTanhRewards28 = [-0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17544633017412387, -0.17562802996914942, -0.17544633017412387, -0.17617264919621228, -0.17562802996914942, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108] drlTanhRewards29 = [-0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17617264919621228, -0.17562802996914942, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026] drlTanhRewards30 = [-0.17580964970257765, -0.17562802996914942, -0.17526455026455026, -0.1759911894273128, -0.17562802996914942, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.17562802996914942, -0.17617264919621228, -0.17508269018743108, -0.17544633017412387] drlTanhRewards31 = [-0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17508269018743108, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17580964970257765] drlTanhRewards32 = [-0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026] drlTanhRewards33 = [-0.17508269018743108, -0.17562802996914942, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17471872931833224, -0.17526455026455026] drlTanhRewards34 = [-0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drlTanhRewards35 = [-0.17544633017412387, -0.17508269018743108, -0.17562802996914942, -0.1749007498897221, -0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.1749007498897221, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108] drlTanhRewards36 = [-0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108] drlTanhRewards37 = [-0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224] drlTanhRewards38 = [-0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108] drlTanhRewards39 = [-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026] drlTanhRewards40 = [-0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17562802996914942, -0.17508269018743108] drlTanhRewards41 = [-0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17562802996914942, -0.17526455026455026, -0.17526455026455026] drlTanhRewards42 = [-0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drlTanhRewards43 = [-0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.1749007498897221, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108] drlTanhRewards44 = [-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108] drlTanhRewards45 = [-0.1749007498897221, -0.17435444714191128, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17453662842012357, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108] drlTanhRewards46 = [-0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drlTanhRewards47 = [-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17526455026455026, -0.1749007498897221, -0.17526455026455026] drlTanhRewards48 = [-0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17471872931833224, -0.17508269018743108, -0.17562802996914942, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026] drlTanhRewards49 = [-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17562802996914942, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drlTanhRewards50 = [-0.17508269018743108, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108] drlTanhRewards51 = [-0.17508269018743108, -0.17471872931833224, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108] drlTanhRewards52 = [-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.1749007498897221, -0.17526455026455026, -0.17508269018743108] drlTanhRewards53 = [-0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224] drlTanhRewards54 = [-0.17526455026455026, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17544633017412387] drlTanhRewards55 = [-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17471872931833224] drlTanhRewards56 = [-0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026] drlTanhRewards57 = [-0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17562802996914942, -0.17471872931833224, -0.17471872931833224] drlTanhRewards58 = [-0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17471872931833224, -0.17471872931833224, -0.1749007498897221] drlTanhRewards59 = [-0.17526455026455026, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17526455026455026] drlTanhRewards60 = [-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224] drlTanhRewards61 = [-0.17471872931833224, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17471872931833224, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026] drlTanhRewards62 = [-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1759911894273128, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.1749007498897221] drlTanhRewards63 = [-0.17453662842012357, -0.17471872931833224, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17526455026455026, -0.1749007498897221, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108] # Deep Reinforcement Learning: 5 capas Dense, Funcion de activacion relu, 12 episodios, 50 iteraciones drlReluMakespan0 = [796, 798, 809, 798, 796, 800, 798, 799, 800, 794, 800, 798] drlReluMakespan1 = [800, 800, 801, 806, 804, 806, 808, 798, 796, 796, 798, 800] drlReluMakespan2 = [805, 805, 798, 800, 800, 798, 801, 799, 800, 806, 800, 800] drlReluMakespan3 = [798, 799, 798, 795, 798, 808, 803, 800, 798, 795, 799, 800] drlReluMakespan4 = [805, 805, 799, 796, 798, 803, 799, 800, 800, 800, 795, 794] drlReluMakespan5 = [799, 796, 795, 800, 801, 796, 800, 795, 803, 800, 800, 805] drlReluMakespan6 = [799, 795, 798, 794, 805, 796, 795, 799, 798, 795, 804, 796] drlReluMakespan7 = [795, 798, 799, 798, 798, 799, 795, 794, 796, 794, 795, 805] drlReluMakespan8 = [805, 794, 794, 795, 798, 795, 798, 795, 799, 800, 796, 798] drlReluMakespan9 = [797, 797, 797, 794, 795, 794, 794, 797, 796, 795, 801, 799] drlReluMakespan10 = [799, 794, 797, 795, 794, 794, 795, 795, 795, 796, 797, 799] drlReluMakespan11 = [796, 798, 800, 795, 805, 794, 798, 796, 795, 794, 798, 795] drlReluMakespan12 = [800, 795, 794, 798, 800, 805, 800, 798, 804, 799, 794, 803] drlReluMakespan13 = [796, 799, 798, 794, 800, 794, 795, 796, 798, 795, 794, 799] drlReluMakespan14 = [795, 798, 798, 798, 805, 798, 798, 798, 795, 794, 800, 796] drlReluMakespan15 = [795, 798, 795, 805, 798, 794, 795, 798, 796, 794, 795, 796] drlReluMakespan16 = [798, 795, 796, 799, 796, 798, 798, 795, 795, 795, 795, 799] drlReluMakespan17 = [794, 798, 796, 798, 795, 801, 794, 798, 797, 795, 796, 801] drlReluMakespan18 = [798, 795, 798, 798, 801, 798, 795, 795, 797, 800, 794, 800] drlReluMakespan19 = [795, 798, 794, 800, 796, 795, 798, 797, 795, 794, 796, 796] drlReluMakespan20 = [794, 794, 795, 795, 795, 795, 796, 798, 799, 799, 799, 795] drlReluMakespan21 = [802, 796, 794, 797, 797, 800, 794, 794, 804, 803, 798, 797] drlReluMakespan22 = [794, 795, 795, 795, 798, 795, 794, 799, 794, 803, 795, 794] drlReluMakespan23 = [794, 798, 799, 794, 795, 795, 799, 795, 796, 795, 797, 799] drlReluMakespan24 = [795, 794, 797, 800, 794, 795, 795, 795, 795, 800, 800, 798] drlReluMakespan25 = [795, 794, 797, 796, 798, 795, 795, 794, 799, 795, 794, 798] drlReluMakespan26 = [801, 795, 800, 794, 794, 796, 800, 798, 798, 799, 794, 796] drlReluMakespan27 = [796, 795, 796, 795, 796, 795, 795, 800, 794, 794, 794, 796] drlReluMakespan28 = [794, 794, 795, 796, 794, 795, 795, 797, 794, 794, 796, 795] drlReluMakespan29 = [793, 794, 795, 800, 795, 795, 794, 798, 798, 796, 795, 794] drlReluMakespan30 = [802, 794, 794, 798, 794, 796, 805, 794, 800, 794, 796, 794] drlReluMakespan31 = [797, 794, 794, 794, 800, 800, 794, 794, 798, 795, 794, 798] drlReluMakespan32 = [794, 798, 794, 795, 794, 795, 798, 794, 794, 795, 794, 798] drlReluMakespan33 = [798, 794, 798, 795, 794, 793, 797, 798, 794, 794, 801, 793] drlReluMakespan34 = [794, 798, 794, 795, 794, 793, 798, 795, 794, 800, 794, 795] drlReluMakespan35 = [794, 796, 794, 796, 806, 795, 795, 795, 796, 795, 795, 799] drlReluMakespan36 = [795, 794, 794, 796, 796, 798, 794, 796, 794, 795, 794, 795] drlReluMakespan37 = [795, 794, 795, 798, 794, 794, 794, 794, 794, 794, 795, 797] drlReluMakespan38 = [794, 798, 794, 798, 797, 794, 794, 795, 795, 794, 795, 795] drlReluMakespan39 = [797, 794, 795, 796, 796, 796, 798, 794, 794, 795, 794, 798] drlReluMakespan40 = [798, 795, 795, 798, 792, 795, 795, 794, 795, 794, 798, 794] drlReluMakespan41 = [795, 794, 794, 794, 794, 794, 798, 793, 794, 794, 794, 793] drlReluMakespan42 = [794, 794, 794, 794, 799, 794, 795, 794, 796, 794, 794, 794] drlReluMakespan43 = [794, 797, 795, 794, 795, 794, 794, 795, 794, 794, 793, 794] drlReluMakespan44 = [794, 792, 793, 794, 794, 796, 794, 798, 795, 794, 794, 796] drlReluMakespan45 = [795, 794, 799, 794, 794, 793, 794, 795, 795, 793, 796, 794] drlReluMakespan46 = [794, 796, 794, 794, 794, 794, 794, 793, 799, 792, 794, 794] drlReluMakespan47 = [795, 794, 793, 794, 796, 797, 794, 794, 795, 794, 794, 794] drlReluMakespan48 = [794, 794, 794, 792, 794, 794, 795, 794, 794, 794, 794, 794] drlReluMakespan49 = [794, 794, 795, 792, 797, 797, 794, 794, 792, 800, 795, 795] drlReluRewards0 = [-0.17544633017412387, -0.17580964970257765, -0.1778021978021978, -0.17544633017412387, -0.17580964970257765, -0.17617264919621228, -0.17580964970257765, -0.1759911894273128, -0.17508269018743108, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765] drlReluRewards1 = [-0.17617264919621228, -0.17617264919621228, -0.1763540290620872, -0.17725973169122497, -0.1768976897689769, -0.17725973169122497, -0.1776214552648934, -0.17580964970257765, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17617264919621228] drlReluRewards2 = [-0.177078750549934, -0.177078750549934, -0.17580964970257765, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765, -0.1763540290620872, -0.1759911894273128, -0.17617264919621228, -0.17725973169122497, -0.17617264919621228, -0.17617264919621228] drlReluRewards3 = [-0.17580964970257765, -0.1759911894273128, -0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.1776214552648934, -0.17671654929577466, -0.17617264919621228, -0.17580964970257765, -0.17526455026455026, -0.1759911894273128, -0.17617264919621228] drlReluRewards4 = [-0.177078750549934, -0.177078750549934, -0.1759911894273128, -0.17544633017412387, -0.17580964970257765, -0.17671654929577466, -0.1759911894273128, -0.17617264919621228, -0.17617264919621228, -0.17617264919621228, -0.17526455026455026, -0.17508269018743108] drlReluRewards5 = [-0.1759911894273128, -0.17544633017412387, -0.17526455026455026, -0.17617264919621228, -0.1763540290620872, -0.17544633017412387, -0.17526455026455026, -0.17617264919621228, -0.17671654929577466, -0.17617264919621228, -0.17617264919621228, -0.177078750549934] drlReluRewards6 = [-0.1759911894273128, -0.17526455026455026, -0.17580964970257765, -0.17508269018743108, -0.177078750549934, -0.17544633017412387, -0.17526455026455026, -0.1759911894273128, -0.17580964970257765, -0.17526455026455026, -0.1768976897689769, -0.17544633017412387] drlReluRewards7 = [-0.17526455026455026, -0.1759911894273128, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.177078750549934] drlReluRewards8 = [-0.177078750549934, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.1759911894273128, -0.17617264919621228, -0.17544633017412387, -0.17580964970257765] drlReluRewards9 = [-0.17562802996914942, -0.17562802996914942, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17562802996914942, -0.17544633017412387, -0.17526455026455026, -0.1763540290620872, -0.1759911894273128] drlReluRewards10 = [-0.1759911894273128, -0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17562802996914942, -0.1759911894273128] drlReluRewards11 = [-0.17544633017412387, -0.17580964970257765, -0.17617264919621228, -0.17526455026455026, -0.177078750549934, -0.17508269018743108, -0.17580964970257765, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17526455026455026] drlReluRewards12 = [-0.17617264919621228, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17617264919621228, -0.177078750549934, -0.17617264919621228, -0.17580964970257765, -0.1768976897689769, -0.1759911894273128, -0.17508269018743108, -0.17671654929577466] drlReluRewards13 = [-0.17544633017412387, -0.1759911894273128, -0.17580964970257765, -0.17508269018743108, -0.17617264919621228, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.1759911894273128] drlReluRewards14 = [-0.17526455026455026, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.177078750549934, -0.17580964970257765, -0.17580964970257765, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17617264919621228, -0.17544633017412387] drlReluRewards15 = [-0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.177078750549934, -0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17544633017412387, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387] drlReluRewards16 = [-0.17580964970257765, -0.17526455026455026, -0.17544633017412387, -0.1759911894273128, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.1759911894273128] drlReluRewards17 = [-0.17508269018743108, -0.17580964970257765, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.1763540290620872, -0.17508269018743108, -0.17580964970257765, -0.17562802996914942, -0.17526455026455026, -0.17544633017412387, -0.1763540290620872] drlReluRewards18 = [-0.17580964970257765, -0.17526455026455026, -0.17580964970257765, -0.17580964970257765, -0.1763540290620872, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17617264919621228, -0.17508269018743108, -0.17617264919621228] drlReluRewards19 = [-0.17526455026455026, -0.17580964970257765, -0.17508269018743108, -0.17617264919621228, -0.17544633017412387, -0.17526455026455026, -0.17580964970257765, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17544633017412387] drlReluRewards20 = [-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17580964970257765, -0.1759911894273128, -0.1759911894273128, -0.1759911894273128, -0.17526455026455026] drlReluRewards21 = [-0.17653532907770195, -0.17544633017412387, -0.17562802996914942, -0.17508269018743108, -0.17562802996914942, -0.17617264919621228, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.1768976897689769, -0.17671654929577466, -0.17562802996914942] drlReluRewards22 = [-0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.1759911894273128, -0.17508269018743108, -0.17671654929577466, -0.17526455026455026, -0.17508269018743108] drlReluRewards23 = [-0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.1759911894273128, -0.17508269018743108, -0.17526455026455026, -0.1759911894273128, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17562802996914942, -0.1759911894273128] drlReluRewards24 = [-0.17526455026455026, -0.17508269018743108, -0.17562802996914942, -0.17617264919621228, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17617264919621228, -0.17617264919621228, -0.17580964970257765] drlReluRewards25 = [-0.17526455026455026, -0.17508269018743108, -0.17562802996914942, -0.17544633017412387, -0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.1759911894273128, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765] drlReluRewards26 = [-0.1763540290620872, -0.17526455026455026, -0.17617264919621228, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17617264919621228, -0.17580964970257765, -0.17580964970257765, -0.1759911894273128, -0.17508269018743108, -0.17544633017412387] drlReluRewards27 = [-0.17544633017412387, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17617264919621228, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387] drlReluRewards28 = [-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17562802996914942, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026] drlReluRewards29 = [-0.1749007498897221, -0.17526455026455026, -0.17508269018743108, -0.17617264919621228, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17580964970257765, -0.17544633017412387, -0.17526455026455026, -0.17508269018743108] drlReluRewards30 = [-0.17653532907770195, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17544633017412387, -0.177078750549934, -0.17508269018743108, -0.17617264919621228, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108] drlReluRewards31 = [-0.17562802996914942, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17617264919621228, -0.17617264919621228, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17508269018743108, -0.17580964970257765] drlReluRewards32 = [-0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765] drlReluRewards33 = [-0.17580964970257765, -0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.1749007498897221, -0.17562802996914942, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.1763540290620872, -0.1749007498897221] drlReluRewards34 = [-0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.1749007498897221, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17617264919621228, -0.17508269018743108, -0.17526455026455026] drlReluRewards35 = [-0.17508269018743108, -0.17544633017412387, -0.17725973169122497, -0.17508269018743108, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.17526455026455026, -0.17544633017412387, -0.17526455026455026, -0.17526455026455026, -0.1759911894273128] drlReluRewards36 = [-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026] drlReluRewards37 = [-0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17562802996914942] drlReluRewards38 = [-0.17508269018743108, -0.17580964970257765, -0.17508269018743108, -0.17580964970257765, -0.17562802996914942, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026] drlReluRewards39 = [-0.17562802996914942, -0.17508269018743108, -0.17526455026455026, -0.17544633017412387, -0.17544633017412387, -0.17544633017412387, -0.17580964970257765, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765] drlReluRewards40 = [-0.17580964970257765, -0.17526455026455026, -0.17526455026455026, -0.17580964970257765, -0.17471872931833224, -0.17526455026455026, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17580964970257765, -0.17508269018743108] drlReluRewards41 = [-0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17580964970257765, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221] drlReluRewards42 = [-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1759911894273128, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drlReluRewards43 = [-0.17508269018743108, -0.17562802996914942, -0.17526455026455026, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108] drlReluRewards44 = [-0.17508269018743108, -0.17471872931833224, -0.1749007498897221, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17580964970257765, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17544633017412387] drlReluRewards45 = [-0.17526455026455026, -0.17508269018743108, -0.1759911894273128, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17526455026455026, -0.17526455026455026, -0.1749007498897221, -0.17544633017412387, -0.17508269018743108] drlReluRewards46 = [-0.17508269018743108, -0.17544633017412387, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.1749007498897221, -0.1759911894273128, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108] drlReluRewards47 = [-0.17526455026455026, -0.17508269018743108, -0.1749007498897221, -0.17508269018743108, -0.17544633017412387, -0.17562802996914942, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drlReluRewards48 = [-0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108, -0.17508269018743108] drlReluRewards49 = [-0.17508269018743108, -0.17508269018743108, -0.17526455026455026, -0.17471872931833224, -0.17562802996914942, -0.17562802996914942, -0.17508269018743108, -0.17508269018743108, -0.17471872931833224, -0.17617264919621228, -0.17526455026455026, -0.17526455026455026] if __name__ == "__main__": ############################################## ############################################## ############################################## # Deep Recurrent Reinforcement Learning with 1 GRU layer and 4 Dense layers drnnGRUtanhMakespan = [] drnnGRUtanhRewards = [] drnnGRUtanhMakespanList = [] drnnGRUtanhRewardsList = [] drnnGRUtanhMakespanValues = [] drnnGRUtanhRewardsValues = [] drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan0)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan1)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan2)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan3)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan4)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan5)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan6)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan7)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan8)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan9)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan10)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan11)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan12)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan13)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan14)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan15)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan16)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan17)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan18)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan19)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan20)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan21)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan22)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan23)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan24)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan25)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan26)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan27)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan28)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan29)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan30)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan31)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan32)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan33)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan34)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan35)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan36)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan37)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan38)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan39)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan40)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan41)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan42)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan43)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan44)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan45)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan46)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan47)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan48)) drnnGRUtanhMakespan.append(np.mean(drnnGRUtanhMakespan49)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards0)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards1)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards2)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards3)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards4)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards5)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards6)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards7)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards8)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards9)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards10)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards11)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards12)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards13)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards14)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards15)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards16)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards17)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards18)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards19)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards20)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards21)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards22)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards23)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards24)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards25)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards26)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards27)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards28)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards29)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards30)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards31)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards32)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards33)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards34)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards35)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards36)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards37)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards38)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards39)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards40)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards41)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards42)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards43)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards44)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards45)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards46)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards47)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards48)) drnnGRUtanhRewards.append(np.mean(drnnGRUtanhRewards49)) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan0) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan1) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan2) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan3) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan4) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan5) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan6) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan7) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan8) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan9) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan10) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan11) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan12) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan13) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan14) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan15) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan16) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan17) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan18) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan19) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan20) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan21) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan22) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan23) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan24) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan25) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan26) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan27) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan28) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan29) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan30) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan31) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan32) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan33) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan34) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan35) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan36) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan37) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan38) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan39) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan40) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan41) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan42) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan43) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan44) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan45) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan46) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan47) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan48) drnnGRUtanhMakespanList.append(drnnGRUtanhMakespan49) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards0) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards1) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards2) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards3) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards4) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards5) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards6) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards7) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards8) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards9) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards10) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards11) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards12) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards13) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards14) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards15) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards16) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards17) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards18) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards19) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards20) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards21) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards22) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards23) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards24) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards25) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards26) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards27) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards28) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards29) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards30) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards31) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards32) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards33) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards34) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards35) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards36) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards37) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards38) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards39) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards40) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards41) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards42) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards43) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards44) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards45) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards46) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards47) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards48) drnnGRUtanhRewardsList.append(drnnGRUtanhRewards49) drnnGRUreluMakespan = [] drnnGRUreluRewards = [] drnnGRUreluMakespanList = [] drnnGRUreluRewardsList = [] drnnGRUreluMakespanValues = [] drnnGRUreluRewardsValues = [] drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan0)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan1)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan2)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan3)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan4)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan5)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan6)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan7)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan8)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan9)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan10)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan11)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan12)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan13)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan14)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan15)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan16)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan17)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan18)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan19)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan20)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan21)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan22)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan23)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan24)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan25)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan26)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan27)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan28)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan29)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan30)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan31)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan32)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan33)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan34)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan35)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan36)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan37)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan38)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan39)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan40)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan41)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan42)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan43)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan44)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan45)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan46)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan47)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan48)) drnnGRUreluMakespan.append(np.mean(drnnGRUreluMakespan49)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards0)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards1)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards2)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards3)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards4)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards5)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards6)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards7)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards8)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards9)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards10)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards11)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards12)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards13)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards14)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards15)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards16)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards17)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards18)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards19)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards20)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards21)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards22)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards23)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards24)) drnnGRUreluRewards.append(np.mean(drnnGRUreluRewards25)) drnnGRUreluRewards.append(
np.mean(drnnGRUreluRewards26)
numpy.mean
"""Definitions of ground truth NSRTs for all environments.""" from typing import List, Sequence, Set, cast import itertools import numpy as np from predicators.src.envs import create_env, BlocksEnv, PaintingEnv, \ PlayroomEnv, BehaviorEnv from predicators.src.structs import NSRT, Predicate, State, GroundAtom, \ ParameterizedOption, Variable, Type, LiftedAtom, Object, Array from predicators.src.settings import CFG from predicators.src.envs.behavior_options import navigate_to_param_sampler, \ grasp_obj_param_sampler, place_ontop_obj_pos_sampler from predicators.src.envs import get_cached_env_instance, ToolsEnv from predicators.src.utils import null_sampler def get_gt_nsrts(predicates: Set[Predicate], options: Set[ParameterizedOption]) -> Set[NSRT]: """Create ground truth NSRTs for an env.""" if CFG.env in ("cover", "cover_hierarchical_types", "cover_typed_options", "cover_regrasp", "cover_multistep_options", "cover_multistep_options_fixed_tasks"): nsrts = _get_cover_gt_nsrts() elif CFG.env == "cluttered_table": nsrts = _get_cluttered_table_gt_nsrts() elif CFG.env == "cluttered_table_place": nsrts = _get_cluttered_table_gt_nsrts(with_place=True) elif CFG.env == "blocks": nsrts = _get_blocks_gt_nsrts() elif CFG.env == "behavior": nsrts = _get_behavior_gt_nsrts() # pragma: no cover elif CFG.env == "painting": nsrts = _get_painting_gt_nsrts() elif CFG.env == "tools": nsrts = _get_tools_gt_nsrts() elif CFG.env == "playroom": nsrts = _get_playroom_gt_nsrts() elif CFG.env == "repeated_nextto": nsrts = _get_repeated_nextto_gt_nsrts() else: raise NotImplementedError("Ground truth NSRTs not implemented") # Filter out excluded predicates from NSRTs, and filter out NSRTs whose # options are excluded. final_nsrts = set() for nsrt in nsrts: if nsrt.option not in options: continue nsrt = nsrt.filter_predicates(predicates) final_nsrts.add(nsrt) return final_nsrts def _get_from_env_by_names(env_name: str, names: Sequence[str], env_attr: str) -> List: """Helper for loading types, predicates, and options by name.""" env = create_env(env_name) name_to_env_obj = {} for o in getattr(env, env_attr): name_to_env_obj[o.name] = o assert set(name_to_env_obj).issuperset(set(names)) return [name_to_env_obj[name] for name in names] def _get_types_by_names(env_name: str, names: Sequence[str]) -> List[Type]: """Load types from an env given their names.""" return _get_from_env_by_names(env_name, names, "types") def _get_predicates_by_names(env_name: str, names: Sequence[str]) -> List[Predicate]: """Load predicates from an env given their names.""" return _get_from_env_by_names(env_name, names, "predicates") def _get_options_by_names(env_name: str, names: Sequence[str]) -> List[ParameterizedOption]: """Load parameterized options from an env given their names.""" return _get_from_env_by_names(env_name, names, "options") def _get_cover_gt_nsrts() -> Set[NSRT]: """Create ground truth NSRTs for CoverEnv or environments that inherit from CoverEnv.""" # Types block_type, target_type, robot_type = _get_types_by_names( CFG.env, ["block", "target", "robot"]) # Objects block = Variable("?block", block_type) robot = Variable("?robot", robot_type) target = Variable("?target", target_type) # Predicates IsBlock, IsTarget, Covers, HandEmpty, Holding = \ _get_predicates_by_names(CFG.env, ["IsBlock", "IsTarget", "Covers", "HandEmpty", "Holding"]) # Options if CFG.env in ("cover", "cover_hierarchical_types", "cover_regrasp"): PickPlace, = _get_options_by_names(CFG.env, ["PickPlace"]) elif CFG.env in ("cover_typed_options", "cover_multistep_options", "cover_multistep_options_fixed_tasks"): Pick, Place = _get_options_by_names(CFG.env, ["Pick", "Place"]) if CFG.env in ("cover_multistep_options", "cover_multistep_options_fixed_tasks") and \ CFG.cover_multistep_use_learned_equivalents: LearnedEquivalentPick, LearnedEquivalentPlace = _get_options_by_names( CFG.env, ["LearnedEquivalentPick", "LearnedEquivalentPlace"]) nsrts = set() # Pick parameters = [block] holding_predicate_args = [block] if CFG.env in ("cover_multistep_options", "cover_multistep_options_fixed_tasks"): parameters.append(robot) holding_predicate_args.append(robot) preconditions = {LiftedAtom(IsBlock, [block]), LiftedAtom(HandEmpty, [])} add_effects = {LiftedAtom(Holding, holding_predicate_args)} delete_effects = {LiftedAtom(HandEmpty, [])} if CFG.env in ("cover", "cover_hierarchical_types", "cover_regrasp"): option = PickPlace option_vars = [] elif CFG.env in ("cover_multistep_options", "cover_multistep_options_fixed_tasks") and \ CFG.cover_multistep_use_learned_equivalents: option = LearnedEquivalentPick option_vars = [block, robot] elif CFG.env in ("cover_typed_options", "cover_multistep_options", "cover_multistep_options_fixed_tasks"): option = Pick option_vars = [block] if CFG.env in ("cover_multistep_options", "cover_multistep_options_fixed_tasks") and \ CFG.cover_multistep_use_learned_equivalents: def pick_sampler(state: State, goal: Set[GroundAtom], rng: np.random.Generator, objs: Sequence[Object]) -> Array: # The only things that change are the block's grasp, and the # robot's grip, holding, x, and y. del goal # unused assert len(objs) == 2 block, robot = objs assert block.is_instance(block_type) assert robot.is_instance(robot_type) bx, by = state.get(block, "x"), state.get(block, "y") rx, ry = state.get(robot, "x"), state.get(robot, "y") bw = state.get(block, "width") if CFG.cover_multistep_degenerate_oracle_samplers: desired_x = float(bx) else: desired_x = rng.uniform(bx - bw / 2, bx + bw / 2) # is_block, is_target, width, x, grasp, y, height # grasp changes from -1.0 to 1.0 block_param = [0.0, 0.0, 0.0, 0.0, 2.0, 0.0, 0.0] # x, y, grip, holding # grip changes from -1.0 to 1.0 # holding changes from -1.0 to 1.0 robot_param = [desired_x - rx, by - ry, 2.0, 2.0] param = block_param + robot_param return
np.array(param, dtype=np.float32)
numpy.array
#!/usr/bin/env python3 import gym import gym_bfw import time import argparse import numpy as np import torch from lib import wrappers from lib import dqn_model import collections DEFAULT_ENV_NAME = "Bfw-v0" def play_round(net, state, counter, total_reward): state_v = torch.tensor(np.array([state], copy=False)) q_vals = net(state_v).data.numpy()[0] action = np.argmax(q_vals) counter[action] += 1 state, reward, done, _ = env.step(action) total_reward += reward if done: return True return False if __name__ == "__main__": parser = argparse.ArgumentParser() parser.add_argument("-m1", "--model1", required=True, help="Model player 1 file to load") parser.add_argument("-m2", "--model2", required=True, help="Model player 2 file to load") parser.add_argument("-e", "--env", default=DEFAULT_ENV_NAME, help="Environment name to use, default=" + DEFAULT_ENV_NAME) args = parser.parse_args() env = wrappers.make_env(args.env, gui=True, scenario="multi_side_ai") net1 = dqn_model.DQN(env.observation_space.shape, env.action_space.n) net2 = dqn_model.DQN(env.observation_space.shape, env.action_space.n) net1.load_state_dict(torch.load(args.model1, map_location=lambda storage, loc: storage)) net2.load_state_dict(torch.load(args.model2, map_location=lambda storage, loc: storage)) state1 = env.reset() state2 = state1 total_reward1 = 0.0 total_reward2 = 0.0 counter1 = collections.Counter() counter2 = collections.Counter() epsilon = 0.2 frame = 0 while True: if frame % 2 == 0: if np.random.random() < epsilon: action = env.action_space.sample() else: state_v = torch.tensor(np.array([state1], copy=False)) q_vals = net1(state_v).data.numpy()[0] action = np.argmax(q_vals) counter1[action] += 1 state1, reward, done, _ = env.step((0, action)) total_reward1 += reward if done: break # if play_round(net1, state1, c1, total_reward1): # break else: if
np.random.random()
numpy.random.random
""" The pycity_scheduling framework Copyright (C) 2022, Institute for Automation of Complex Power Systems (ACS), E.ON Energy Research Center (E.ON ERC), RWTH Aachen University Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """ import numpy as np import unittest import datetime import logging import warnings import pyomo.environ as pyomo from pyomo.opt import TerminationCondition from shapely.geometry import Point from pycity_scheduling import constants, solvers from pycity_scheduling.classes import * from pycity_scheduling.util.metric import * class TestModule(unittest.TestCase): def test_filter_entities(self): e = get_env(4, 8) bd = Building(e) bes = BuildingEnergySystem(e) pv = Photovoltaic(e, 0) bes.addDevice(pv) bd.addEntity(bes) def do_test(gen): entities = list(gen) self.assertEqual(1, len(entities)) self.assertIn(pv, entities) do_test(filter_entities(bd.get_entities(), 'PV')) do_test(filter_entities(bd, 'generation_devices')) do_test(filter_entities(bd, [Photovoltaic])) do_test(filter_entities(bd, ['PV'])) do_test(filter_entities(bd, {'PV': Photovoltaic})) with self.assertRaises(ValueError): next(filter_entities(bd, 'PPV')) with self.assertRaises(ValueError): next(filter_entities(bd, [int])) with self.assertRaises(ValueError): next(filter_entities(bd, None)) return class TestBattery(unittest.TestCase): def setUp(self): e = get_env(3) self.bat = Battery(e, 10, 20, soc_init=0.875, eta=0.5) return def test_populate_model(self): model = pyomo.ConcreteModel() self.bat.populate_model(model) model.c1 = pyomo.Constraint(expr=self.bat.model.e_el_vars[2] == 10) model.c2 = pyomo.Constraint(expr=self.bat.model.e_el_vars[0] == 5) obj = pyomo.sum_product(self.bat.model.p_el_demand_vars, self.bat.model.p_el_demand_vars) model.o = pyomo.Objective(expr=obj) result = solve_model(model) # TODO stats are currently not correct due to a pyomo bug # use result as a workaround #model.compute_statistics() #stats = model.statistics #self.assertEqual(12, stats.number_of_variables) self.assertEqual(13, result.Problem[0].number_of_variables) var_sum = pyomo.value(pyomo.quicksum(self.bat.model.p_el_vars[t] for t in range(1, 3))) self.assertAlmostEqual(40, var_sum, places=5) var_sum = pyomo.value(pyomo.quicksum( self.bat.model.p_el_supply_vars[t] + self.bat.model.p_el_demand_vars[t] for t in range(1, 3) )) self.assertAlmostEqual(40, var_sum, places=5) return def test_update_model(self): model = pyomo.ConcreteModel() self.bat.populate_model(model) demand_var = self.bat.model.p_el_vars self.bat.update_model() model.c1 = pyomo.Constraint(expr=self.bat.model.e_el_vars[0] == 10) obj = pyomo.sum_product(demand_var, demand_var) model.o = pyomo.Objective(expr=obj) solve_model(model) self.assertAlmostEqual(10, pyomo.value(demand_var[0]), places=5) return def test_update_schedule(self): model = pyomo.ConcreteModel() self.bat.populate_model(model) self.bat.update_model() self.bat.model.p_el_demand_vars.setlb(3.0) self.bat.model.p_el_demand_vars.setub(3.0) self.bat.model.p_el_supply_vars.setlb(0.0) self.bat.model.p_el_supply_vars.setub(0.0) obj = pyomo.sum_product(self.bat.model.p_el_demand_vars, self.bat.model.p_el_demand_vars) model.o = pyomo.Objective(expr=obj) solve_model(model) self.bat.update_schedule() assert_equal_array(self.bat.p_el_schedule, [3] * 3) assert_equal_array(self.bat.e_el_schedule, 0.875 * 10 + np.arange(1, 4)*3*0.25*0.5) return def test_calculate_co2(self): self.bat.p_el_schedule = np.array([10]*3) self.assertEqual(0, calculate_co2(self.bat)) return def test_get_objective(self): model = pyomo.ConcreteModel() self.bat.populate_model(model) obj = self.bat.get_objective(2) vs = list(pyomo.current.identify_variables(obj)) for t in range(3): self.assertIn(self.bat.model.p_el_vars[t], vs) self.bat.model.p_el_vars[t] = t * 5 self.assertEqual(3, len(vs)) self.assertEqual(sum(2*(5*t)**2 for t in range(3)), pyomo.value(obj)) return def test_e_ini(self): expected_schedule = list(range(4, 21, 2)) e = get_env(3, 9, 2) model = pyomo.ConcreteModel() bat = Battery(e, 20, 10, soc_init=0.1, eta=0.8) bat.populate_model(model) model.o = pyomo.Objective(expr=-bat.model.e_el_vars[2]) for t in range(4): bat.update_model() solve_model(model) bat.update_schedule() e.timer.mpc_update() assert_equal_array(bat.e_el_schedule, expected_schedule[:3+t*2] + [0] * 2 * (3-t)) assert_equal_array(bat.p_el_schedule, [10] * (3 + t * 2) + [0] * 2 * (3 - t)) assert_equal_array(bat.p_el_demand_schedule, [10] * (3 + t * 2) + [0] * 2 * (3 - t)) assert_equal_array(bat.p_el_supply_schedule, [0] * 9) return def test_no_discharge(self): e = get_env(9, 9) model = pyomo.ConcreteModel() bat = Battery(e, 30, 10, p_el_max_discharge=0, soc_init=0.5, eta=1) bat.populate_model(model) bat.update_model() model.o = pyomo.Objective(expr=pyomo.sum_product(bat.model.p_el_vars)) solve_model(model) bat.update_schedule() assert_equal_array(bat.e_el_schedule, [15] * 9) assert_equal_array(bat.p_el_schedule, [0] * 9) assert_equal_array(bat.p_el_demand_schedule, [0] * 9) assert_equal_array(bat.p_el_supply_schedule, [0] * 9) return class TestBoiler(unittest.TestCase): def setUp(self): e = get_env(4, 8) self.bl = Boiler(e, 10, 0.4) return def test_calculate_co2(self): self.bl.p_th_heat_schedule = - np.array([10] * 8) self.bl.p_th_heat_ref_schedule = - np.array([4] * 8) co2_em = np.array([1111]*8) co2 = calculate_co2(self.bl, co2_emissions=co2_em) self.assertEqual(50.0*constants.CO2_EMISSIONS_GAS, co2) co2 = calculate_co2(self.bl, timestep=4, co2_emissions=co2_em) self.assertEqual(25.0*constants.CO2_EMISSIONS_GAS, co2) self.bl.load_schedule("ref") co2 = calculate_co2(self.bl, co2_emissions=co2_em) self.assertEqual(20.0*constants.CO2_EMISSIONS_GAS, co2) return def test_lower_activation(self): e = get_env(4, 8) bl = Boiler(e, 10, lower_activation_limit=0.5) model = pyomo.ConcreteModel() bl.populate_model(model, "integer") bl.update_model("integer") model.o = pyomo.Objective(expr=bl.model.p_th_heat_vars[0]) results = solve_model(model) self.assertEqual(TerminationCondition.optimal, results.solver.termination_condition) bl.model.p_th_heat_vars[0].setub(-0.1) bl.model.p_th_heat_vars[0].setlb(-4.9) logger = logging.getLogger("pyomo.core") oldlevel = logger.level logger.setLevel(logging.ERROR) results = solve_model(model) logger.setLevel(oldlevel) self.assertEqual(TerminationCondition.infeasible, results.solver.termination_condition) return def test_objective(self): model = pyomo.ConcreteModel() self.bl.populate_model(model) self.bl.get_objective() return class TestBuilding(unittest.TestCase): def setUp(self): e = get_env(4, 8) self.bd = Building(e) return def test_get_objective(self): model = pyomo.ConcreteModel() env = self.bd.environment env.prices.tou_prices[:4] = [1, 2, 3, 4] env.prices.co2_prices[:4] = [5, 4, 3, 2] bes = BuildingEnergySystem(env) self.bd.addEntity(bes) self.bd.populate_model(model) obj = self.bd.get_objective(2) vs = list(pyomo.current.identify_variables(obj)) self.assertEqual(4, len(vs)) for t in range(4): self.bd.model.p_el_vars[t].value = 10**t self.assertAlmostEqual(2*4321/10*4, pyomo.value(obj), places=5) model = pyomo.ConcreteModel() bd2 = Building(env, 'co2') bd2.addEntity(bes) bd2.populate_model(model) obj = bd2.get_objective(2) vs = list(pyomo.current.identify_variables(obj)) self.assertEqual(4, len(vs)) for t in range(4): bd2.model.p_el_vars[t].value = 10**t # numerical errors caused by /14 and co2_prices being np.float32 self.assertAlmostEqual(2*2345/14*4, pyomo.value(obj), places=3) model = pyomo.ConcreteModel() bd3 = Building(env, 'peak-shaving') bd3.addEntity(bes) bd3.populate_model(model) obj = bd3.get_objective(2) vs = list(pyomo.current.identify_variables(obj)) self.assertEqual(4, len(vs)) for t in range(4): bd3.model.p_el_vars[t].value = 10**t self.assertEqual(2*1010101, pyomo.value(obj)) model = pyomo.ConcreteModel() bd4 = Building(env, None) bd4.addEntity(bes) bd4.populate_model(model) obj = bd4.get_objective(2) vs = list(pyomo.current.identify_variables(obj)) self.assertEqual(0, len(vs)) for t in range(4): bd4.model.p_el_vars[t].value = 10 ** t self.assertEqual(0, pyomo.value(obj)) bd5 = Building(env, "invalid") self.assertRaisesRegex(ValueError, ".*Building.*", bd5.get_objective) return def test_calculate_co2(self): bes = BuildingEnergySystem(self.bd.environment) pv = Photovoltaic(self.bd.environment, 0) bes.addDevice(pv) self.bd.addEntity(bes) self.bd.p_el_schedule = np.array([-5] * 2 + [5] * 4 + [-5] * 2) self.bd.p_el_ref_schedule = np.array([-2] * 2 + [2] * 4 + [-2] * 2) pv.p_el_schedule = - np.array([10]*8) pv.p_el_ref_schedule = - np.array([4]*8) co2_em = np.array([100]*4 + [400]*4) co2 = calculate_co2(self.bd, co2_emissions=co2_em) self.assertEqual(20.0*constants.CO2_EMISSIONS_PV+1250.0, co2) co2 = calculate_co2(self.bd, timestep=4, co2_emissions=co2_em) self.assertEqual(10.0*constants.CO2_EMISSIONS_PV+250.0, co2) self.bd.load_schedule("ref") co2 = calculate_co2(self.bd, co2_emissions=co2_em) self.assertEqual(8.0*constants.CO2_EMISSIONS_PV+500.0, co2) return def test_robustness(self): model = pyomo.ConcreteModel() env = self.bd.environment bes = BuildingEnergySystem(env) self.bd.addEntity(bes) ths1 = ThermalHeatingStorage(env, 10) bes.addDevice(ths1) ths2 = ThermalHeatingStorage(env, 25) bes.addDevice(ths2) ap = Apartment(env) self.bd.addEntity(ap) loadcurve = np.array([15, 15, 10, 10]) sh = SpaceHeating(env, loadcurve=loadcurve) ap.addEntity(sh) eh = ElectricalHeater(env, 20) bes.addDevice(eh) self.bd.populate_model(model, robustness=(3, 0.5)) self.bd.update_model(robustness=(3, 0.5)) assert_equal_array(np.array([self.bd.model.lower_robustness_bounds[i].value for i in range(3)]), np.cumsum(loadcurve[:3])*0.5/4) assert_equal_array(np.array([self.bd.model.upper_robustness_bounds[i].value for i in range(3)]), 35 - np.cumsum(loadcurve[:3]) * 0.5 / 4) self.assertEqual(17.5, self.bd.model.lower_robustness_bounds[3].value) self.assertEqual(17.5, self.bd.model.upper_robustness_bounds[3].value) return def testReset(self): env = self.bd.environment bes = BuildingEnergySystem(env) self.bd.addEntity(bes) schedules = list(self.bd.schedules.keys()) model = pyomo.ConcreteModel() self.bd.populate_model(model) self.bd.update_model() model.o = pyomo.Objective(expr=pyomo.sum_product(self.bd.model.p_el_vars)) solve_model(model) self.assertEqual(schedules, list(self.bd.schedules.keys())) self.bd.update_schedule() self.assertEqual(schedules, list(self.bd.schedules.keys())) self.bd.schedules["ref"]["p_el"] = np.arange(8) self.bd.copy_schedule("new", "ref") schedules.append("new") self.bd.reset("ref") for k in schedules: if k == "new": e = np.arange(8) else: e = np.zeros(8) assert_equal_array(self.bd.schedules[k]["p_el"], e) self.bd.reset() for k in schedules: assert_equal_array(self.bd.schedules[k]["p_el"], np.zeros(8)) self.assertEqual(schedules, list(self.bd.schedules.keys())) with self.assertRaises(KeyError): self.bd.load_schedule("nonexistent") self.bd.p_el_schedule with self.assertRaises(KeyError): self.bd.load_schedule(None) self.bd.p_el_schedule return class TestChiller(unittest.TestCase): def setUp(self): e = get_env(4, 8) self.ch = Chiller(e, 10, cop=np.full(8, 11)) return def test_update_model(self): m = pyomo.ConcreteModel() self.ch.populate_model(m) self.ch.update_model() c = self.ch.model.p_coupl_constr[0] f, l = pyomo.current.decompose_term(c.body) self.assertTrue(f) for coeff, value in l: if value is self.ch.model.p_el_vars[0]: self.assertEqual(11, coeff) if value is self.ch.model.p_th_cool_vars[0]: self.assertEqual(1, coeff) if value is None: self.assertEqual(0, coeff) return def test_lower_activation(self): e = get_env(4, 8) ch = Chiller(e, 10, cop=np.full(8, 11), lower_activation_limit=0.5) m = pyomo.ConcreteModel() ch.populate_model(m, "integer") ch.update_model("integer") obj = pyomo.sum_product(ch.model.p_th_cool_vars, ch.model.p_th_cool_vars) obj += 2 * 3 * pyomo.sum_product(ch.model.p_th_cool_vars) m.o = pyomo.Objective(expr=obj) solve_model(m) ch.update_schedule() assert_equal_array(ch.p_th_cool_schedule[:4], [-5] * 4) return class TestCurtailableLoad(unittest.TestCase): combinations = [(4, 1), (3, 1), (2, 1), (1, 1), (1, 3), (1, 4), (2, 2), (2, 3), (0, 1), (0, 2), (0, 3), (0, 4)] horizon = 5 def setUp(self): self.e = get_env(5, 20) return def test_populate_model(self): model = pyomo.ConcreteModel() cl = CurtailableLoad(self.e, 2, 0.5) cl.populate_model(model) obj = pyomo.sum_product(cl.model.p_el_vars) model.o = pyomo.Objective(expr=obj) solve_model(model) cl.update_schedule() self.assertAlmostEqual(5, pyomo.value(obj)) self.assertTrue(5, sum(cl.p_el_schedule[:5])) return def test_populate_model_on_off(self): model = pyomo.ConcreteModel() cl = CurtailableLoad(self.e, 2, 0.5, 2, 2) cl.populate_model(model) obj = pyomo.sum_product(cl.model.p_el_vars) model.o = pyomo.Objective(expr=obj) solve_model(model) cl.update_schedule() self.assertAlmostEqual(7, pyomo.value(obj)) self.assertAlmostEqual(7, sum(cl.p_el_schedule[:5])) return def test_populate_model_integer(self): for low, full in self.combinations: min_states = sum(np.tile([False]*low + [True]*full, 5)[:5]) for nom in [0.5, 1, 2]: with self.subTest(msg="max_low={} min_full={} nom={}".format(low, full, nom)): model = pyomo.ConcreteModel() cl = CurtailableLoad(self.e, nom, 0.75, low, full) cl.populate_model(model, mode="integer") obj = pyomo.sum_product(cl.model.p_el_vars) model.o = pyomo.Objective(expr=obj) results = solve_model(model) cl.update_schedule() schedule_states = np.isclose(cl.p_el_schedule[:5], [nom]*5) assert_equal_array(cl.p_state_schedule[:5], schedule_states) self.assertEqual(min_states, sum(schedule_states)) self.assertAlmostEqual(min_states*nom+(5-min_states)*nom*0.75, pyomo.value(obj)) return def test_update_model(self): for width in [1, 2, 4, 5]: with self.subTest(msg="step width={}".format(width)): model = pyomo.ConcreteModel() cl = CurtailableLoad(self.e, 2, 0.5) cl.populate_model(model) obj = pyomo.sum_product(cl.model.p_el_vars) model.o = pyomo.Objective(expr=obj) solve_model(model) for t in range(0, 20-5+1, width): self.e.timer.current_timestep = t cl.update_model() solve_model(model) cl.update_schedule() self.assertAlmostEqual(5, pyomo.value(obj)) self.assertAlmostEqual(5, sum(cl.p_el_schedule[t:t+5])) return def test_update_model_on_off(self): for low, full in self.combinations: for width in [1, 2, 4, 5]: with self.subTest(msg="max_low={} min_full={} step width={}".format(low, full, width)): model = pyomo.ConcreteModel() cl = CurtailableLoad(self.e, 2, 0.5, low, full) cl.populate_model(model) obj = pyomo.sum_product(cl.model.p_el_vars) model.o = pyomo.Objective(expr=obj) solve_model(model) for t in range(0, 20-5+1, width): self.e.timer.current_timestep = t cl.update_model() solve_model(model) cl.update_schedule() endtimestep = self.e.timer.current_timestep + cl.op_horizon for t in range(0, endtimestep): self.assertGreaterEqual(cl.p_el_schedule[t], 1) self.assertLessEqual(cl.p_el_schedule[t], 2) for t in range(0, endtimestep-(low+full)+1): self.assertGreaterEqual(sum(cl.p_el_schedule[t:t+low+full]) + 1e-4, 1*low + 2*full) return def test_update_model_integer(self): for low, full in self.combinations: states = np.tile([False] * low + [True] * full, 20)[:20] for width in [1, 2, 4, 5]: with self.subTest(msg="max_low={} min_full={} step width={}".format(low, full, width)): model = pyomo.ConcreteModel() cl = CurtailableLoad(self.e, 2, 0.5, low, full) cl.populate_model(model, mode="integer") obj = pyomo.sum_product(cl.model.p_el_vars) for t in range(0, 20-5+1, width): self.e.timer.current_timestep = t cl.update_model(mode="integer") model.o = pyomo.Objective(expr=obj) results = solve_model(model) self.assertEqual(results.solver.termination_condition, TerminationCondition.optimal) best_obj = pyomo.value(obj) model.o_constr = pyomo.Constraint(expr=best_obj == obj) model.del_component("o") model.o = pyomo.Objective(expr=pyomo.sum_product(range(0, -cl.op_horizon, -1), cl.model.p_el_vars)) results = solve_model(model) model.del_component("o") model.del_component("o_constr") self.assertEqual(results.solver.termination_condition, TerminationCondition.optimal) cl.update_schedule() schedule_states_el = np.isclose(cl.p_el_schedule[t:t+5], [2] * 5) schedule_states_b = np.isclose(cl.p_state_schedule[t:t+5], [1] * 5) assert_equal_array(schedule_states_b, states[t:t + 5]) assert_equal_array(schedule_states_el, schedule_states_b) assert_equal_array( cl.p_el_schedule[t:t+5], np.full(5, 2 * 0.5) + np.array(states[t:t+5]) * (2 * (1. - 0.5)) ) return def test_integer_first(self): for low, full in self.combinations: if low > 0: with self.subTest(msg="max_low={} min_full={}".format(low, full)): model = pyomo.ConcreteModel() cl = CurtailableLoad(self.e, 2, 0.5, low, full) cl.populate_model(model, mode="integer") self.e.timer.current_timestep = 1 cl.p_state_schedule[0] = False cl.p_el_schedule[0] = 1 cl.update_model("integer") cl.model.p_state_vars[0].setub(1.0) cl.model.p_state_vars[0].setlb(1.0) cl.model.p_state_vars[1].setub(0.0) cl.model.p_state_vars[1].setlb(0.0) model.o = pyomo.Objective(expr=cl.model.p_state_vars[0]) logger = logging.getLogger("pyomo.core") oldlevel = logger.level logger.setLevel(logging.ERROR) results = solve_model(model) logger.setLevel(oldlevel) if full > 1: self.assertEqual(results.solver.termination_condition, TerminationCondition.infeasible) else: self.assertEqual(results.solver.termination_condition, TerminationCondition.optimal) return def test_small_horizon(self): for width in [1, 2, 4]: for horizon in [1, 2, 4]: if horizon >= width: with self.subTest(msg="width={} horizon={}".format(width, horizon)): e = get_env(horizon, 20) model = pyomo.ConcreteModel() cl = CurtailableLoad(e, 2, 0.5) cl.populate_model(model) obj = pyomo.sum_product(cl.model.p_el_vars) model.o = pyomo.Objective(expr=obj) for t in range(0, 21 - horizon, width): e.timer.current_timestep = t cl.update_model() solve_model(model) self.assertEqual(1, pyomo.value(cl.model.p_el_vars[0])) cl.update_schedule() assert_equal_array(cl.p_el_schedule, [1] * 20) return def test_small_horizon_low_full(self): for horizon in [1, 2, 4]: e = get_env(horizon, 20) for width in [1, 2, 4]: if horizon >= width: for low, full in self.combinations: with self.subTest(msg="width={} horizon={} max_low={} min_full={}" .format(width, horizon, low, full)): model = pyomo.ConcreteModel() cl = CurtailableLoad(e, 2, 0.5, low, full) cl.populate_model(model) obj = pyomo.sum_product(cl.model.p_el_vars) model.c = pyomo.Objective(expr=obj) for t in range(0, 21 - horizon, width): e.timer.current_timestep = t cl.update_model() solve_model(model) cl.update_schedule() for t in range(0, 20 - (low + full) + 1): self.assertGreaterEqual(sum(cl.p_el_schedule[t:t + low + full]) + 1e-4, 1 * low + 2 * full, np.array2string(cl.p_el_schedule)) return def test_small_horizon_low_full_integer(self): for horizon in [1, 2, 4]: e = get_env(horizon, 20) for width in [1, 2, 4]: if horizon >= width: for low, full in self.combinations: with self.subTest(msg="width={} horizon={} max_low={} min_full={}".format(width, horizon, low, full)): states = np.tile([1] * low + [2] * full, 20)[:20] model = pyomo.ConcreteModel() cl = CurtailableLoad(e, 2, 0.5, low, full) cl.populate_model(model, mode="integer") obj = pyomo.sum_product(cl.model.p_el_vars) for t in range(0, 21 - horizon, width): e.timer.current_timestep = t cl.update_model(mode="integer") model.o = pyomo.Objective(expr=obj) results = solve_model(model) self.assertEqual(results.solver.termination_condition, TerminationCondition.optimal) best_obj = pyomo.value(obj) model.o_constr = pyomo.Constraint(expr=best_obj == obj) model.del_component("o") model.o = pyomo.Objective(expr=pyomo.sum_product(range(-1, -cl.op_horizon-1, -1), cl.model.p_el_vars)) results = solve_model(model) model.del_component("o") model.del_component("o_constr") self.assertEqual(results.solver.termination_condition, TerminationCondition.optimal) cl.update_schedule() assert_equal_array(cl.p_el_schedule, states) return class TestCityDistrict(unittest.TestCase): def setUp(self): e = get_env(4, 8) self.cd = CityDistrict(e) return def test_get_objective(self): m = pyomo.ConcreteModel() self.cd.populate_model(m) def zero_constr(model, t): return model.p_el_vars[t] == 0 self.cd.model.extra_constr = pyomo.Constraint(self.cd.model.t, rule=zero_constr) m.o = pyomo.Objective(expr=self.cd.get_objective()) solve_model(m) for t in range(4): self.cd.model.p_el_vars[t].value = t self.assertEqual(self.cd.objective, "price") self.cd.environment.prices.da_prices = np.array([1]*2 + [4]*6) self.assertAlmostEqual(8.4, pyomo.value(self.cd.get_objective())) self.cd.objective = 'peak-shaving' self.assertAlmostEqual(14, pyomo.value(self.cd.get_objective())) self.cd.objective = 'valley-filling' self.cd.valley_profile = np.array([-1]*8) self.assertAlmostEqual(2, pyomo.value(self.cd.get_objective())) self.cd.objective = None self.assertAlmostEqual(0, pyomo.value(self.cd.get_objective())) self.cd.objective = "invalid" self.assertRaisesRegex(ValueError, ".*CityDistrict.*", self.cd.get_objective) m = pyomo.ConcreteModel() self.cd.objective = "max-consumption" self.cd.populate_model(m) self.cd.model.p_el_vars[0].setub(-1) m.o = pyomo.Objective(expr=self.cd.get_objective()) solve_model(m) self.assertAlmostEqual(1, pyomo.value(self.cd.get_objective())) return def test_calculate_costs(self): self.cd.p_el_schedule = np.array([10]*4 + [-20]*4) self.cd.p_el_ref_schedule = np.array([4]*4 + [-4]*4) prices = np.array([10]*4 + [20]*4) costs = calculate_costs(self.cd, prices=prices, feedin_factor=0.5) self.assertEqual(-100, costs) costs = calculate_costs(self.cd, timestep=4, prices=prices) self.assertEqual(100, costs) self.cd.load_schedule("ref") costs = calculate_costs(self.cd, prices=prices) self.assertEqual(-40, costs) return def test_calculate_co2(self): pv = Photovoltaic(self.cd.environment, 0) self.cd.addEntity(pv, Point(0, 0)) self.cd.p_el_schedule = np.array([-5] * 2 + [5] * 4 + [-5] * 2) self.cd.p_el_ref_schedule = np.array([-2] * 2 + [2] * 4 + [-2] * 2) pv.p_el_schedule = - np.array([10] * 8) pv.p_el_ref_schedule = - np.array([4] * 8) co2_em = np.array([100] * 4 + [400] * 4) co2 = calculate_co2(self.cd, co2_emissions=co2_em) self.assertEqual(20.0*constants.CO2_EMISSIONS_PV+1250.0, co2) co2 = calculate_co2(self.cd, timestep=4, co2_emissions=co2_em) self.assertEqual(10.0*constants.CO2_EMISSIONS_PV+250.0, co2) self.cd.load_schedule("ref") co2 = calculate_co2(self.cd, co2_emissions=co2_em) self.assertEqual(8.0*constants.CO2_EMISSIONS_PV+500.0, co2) return def test_self_consumption(self): pv = Photovoltaic(self.cd.environment, 0) self.cd.addEntity(pv, Point(0, 0)) self.cd.p_el_schedule =
np.array([4]*2 + [-4]*2 + [-10]*2 + [-2]*2)
numpy.array
#!usr/bin/python 3.6 #-*-coding:utf-8-*- ''' @file: da.py, deterministic annealing algorithm @Author: <NAME> (<EMAIL>) @Date: 11/28/2019 @Paper reference: Clustering with Capacity and Size Constraints: A Deterministic Approach ''' import numpy as np import matplotlib.pyplot as plt from copy import deepcopy import collections import random from scipy.spatial.distance import cdist import os import sys path = os.path.dirname(os.path.abspath(__file__)) sys.path.append(path) import base class DeterministicAnnealing(base.Base): def __init__(self, n_clusters, distribution, max_iters=1000, distance_func=cdist, random_state=42, T=None): ''' Args: n_clusters (int): number of clusters distribution (list): a list of ratio distribution for each cluster T (list): inverse choice of beta coefficients ''' super(DeterministicAnnealing, self).__init__(n_clusters, max_iters, distance_func) self.lamb = distribution assert np.sum(distribution) == 1 assert len(distribution) == n_clusters assert isinstance(T, list) or T is None self.beta = None self.T = T self.cluster_centers_ = None self.labels_ = None self._eta = None self._demands_prob = None random.seed(random_state) np.random.seed(random_state) def fit(self, X, demands_prob=None): # setting T, loop T = [1, 0.1, 1e-2, 1e-3, 1e-4, 1e-5, 1e-6, 1e-7, 1e-8] solutions = [] diff_list = [] is_early_terminated = False n_samples, n_features = X.shape self.capacity = [n_samples * d for d in self.lamb] if demands_prob is None: demands_prob = np.ones((n_samples, 1)) else: demands_prob = np.asarray(demands_prob).reshape((-1, 1)) assert demands_prob.shape[0] == X.shape[0] demands_prob = demands_prob / sum(demands_prob) for t in T: self.T = t centers = self.initial_centers(X) eta = self.lamb labels = None for _ in range(self.max_iters): self.beta = 1. / self.T distance_matrix = self.distance_func(X, centers) eta = self.update_eta(eta, demands_prob, distance_matrix) gibbs = self.update_gibbs(eta, distance_matrix) centers = self.update_centers(demands_prob, gibbs, X) self.T *= 0.999 labels = np.argmax(gibbs, axis=1) if self._is_satisfied(labels): break solutions.append([labels, centers]) resultant_clusters = len(collections.Counter(labels)) diff_list.append(abs(resultant_clusters - self.n_clusters)) if resultant_clusters == self.n_clusters: is_early_terminated = True break # modification for non-strictly satisfaction, only works for one demand per location # labels = self.modify(labels, centers, distance_matrix) if not is_early_terminated: best_index = np.argmin(diff_list) labels, centers = solutions[best_index] self.cluster_centers_ = centers self.labels_ = labels self._eta = eta self._demands_prob = demands_prob def predict(self, X): distance_matrix = self.distance_func(X, self.cluster_centers_) eta = self.update_eta(self._eta, self._demands_prob, distance_matrix) gibbs = self.update_gibbs(eta, distance_matrix) labels = np.argmax(gibbs, axis=1) return labels def modify(self, labels, centers, distance_matrix): centers_distance = self.distance_func(centers, centers) adjacent_centers = {i: np.argsort(centers_distance, axis=1)[i, 1:3].tolist() for i in range(self.n_clusters)} while not self._is_satisfied(labels): count = collections.Counter(labels) cluster_id_list = list(count.keys()) random.shuffle(cluster_id_list) for cluster_id in cluster_id_list: num_points = count[cluster_id] diff = num_points - self.capacity[cluster_id] if diff <= 0: continue adjacent_cluster = None adjacent_cluster = random.choice(adjacent_centers[cluster_id]) if adjacent_cluster is None: continue cluster_point_id = np.where(labels==cluster_id)[0].tolist() diff_distance = distance_matrix[cluster_point_id, adjacent_cluster] \ - distance_matrix[cluster_point_id, cluster_id] remove_point_id = np.asarray(cluster_point_id)[np.argsort(diff_distance)[:diff]] labels[remove_point_id] = adjacent_cluster return labels def initial_centers(self, X): selective_centers = random.sample(range(X.shape[0]), self.n_clusters) centers = X[selective_centers] return centers def _is_satisfied(self, labels): count = collections.Counter(labels) for cluster_id in range(len(self.capacity)): if cluster_id not in count: return False num_points = count[cluster_id] if num_points > self.capacity[cluster_id]: return False return True def update_eta(self, eta, demands_prob, distance_matrix): n_points, n_centers = distance_matrix.shape eta_repmat = np.tile(np.asarray(eta).reshape(1, -1), (n_points, 1)) exp_term = np.exp(- self.beta * distance_matrix) divider = exp_term / np.sum(np.multiply(exp_term, eta_repmat), axis=1).reshape((-1, 1)) eta = np.divide(np.asarray(self.lamb), np.sum(divider * demands_prob, axis=0)) return eta def update_gibbs(self, eta, distance_matrix): n_points, n_centers = distance_matrix.shape eta_repmat = np.tile(np.asarray(eta).reshape(1, -1), (n_points, 1)) exp_term = np.exp(- self.beta * distance_matrix) factor = np.multiply(exp_term, eta_repmat) gibbs = factor /
np.sum(factor, axis=1)
numpy.sum
""" This file implements different metric calculation functions for a given conversation. """ # Note: some imports are defined inside the methods of the metrics (for cases where only some metrics are computed) import os import string from pathlib import Path import numpy as np import torch from nltk.corpus import stopwords from metric_helpers import cosine_similarity, _get_sentiment_multiplier stopwords = stopwords.words('english') question_words = {'who', 'what', 'why', 'where', 'how', 'when'} _ = [stopwords.remove(q) for q in question_words] punct = list(string.punctuation) contractions = ["'s", "'d", "'ld", "n't", "'re", "'ll", "'ve"] filters = set(stopwords + contractions + punct) ROOT_DIR = os.path.dirname(os.path.abspath(__file__)) def question(conversation): """Counts whether each utterance in the given conversation contains a question (yes: 1, no: 0)""" num_turns = len(conversation) is_question_in_utterance = np.zeros(num_turns) for i, utterance in enumerate(conversation): if any(question_word in utterance for question_word in question_words) and '?' in utterance: is_question_in_utterance[i] = 1 return is_question_in_utterance def conversation_repetition(conversation): """Counts the number of distinct words in the current utterance that were also in any of the previous utterances""" num_turns = len(conversation) num_repeats_in_utterances = np.zeros(num_turns) filtered = [set(utterance).difference(filters) for utterance in conversation] # filter stopwords, contractions and punctuation for i in range(1, num_turns): current = filtered[i] prev = set.union(*filtered[:i]) repeats = current.intersection(prev) num_repeats_in_utterances[i] = len(repeats) return num_repeats_in_utterances def self_repetition(conversation): # called 'reward_conversation_repetition' (for bot utterances) in original paper """ Counts the number of distinct words in the current utterance that were also in any of the previous utterances of the current speaker (assuming two-speaker multi-turn dialog) """ num_turns = len(conversation) num_repeats_in_utterances = np.zeros(num_turns) filtered = [set(utterance).difference(filters) for utterance in conversation] # filter stopwords, contractions and punctuation # first and second utterance can't repeat any word of previous utterances of the current speaker num_repeats_in_utterances[0] = 0 num_repeats_in_utterances[1] = 0 for i in range(2, num_turns): current = filtered[i] # current utterance prev = set.union(*filtered[:i][i%2::i]) # all utterances of the current speaker so far repeats = current.intersection(prev) num_repeats_in_utterances[i] = len(repeats) return num_repeats_in_utterances def utterance_repetition(conversation): # called 'word_similarity' in original paper """Counts the number of distinct words in the current utterance that were also in the previous utterance""" num_turns = len(conversation) num_repeats_in_utterances = np.zeros(num_turns) filtered = [set(utterance).difference(filters) for utterance in conversation] # filter stopwords, contractions and punctuation num_repeats_in_utterances[0] = 0 # first utterance can't repeat any word of previous utterance for i in range(1, num_turns): current = filtered[i] prev = filtered[i-1] repeats = current.intersection(prev) num_repeats_in_utterances[i] = len(repeats) return num_repeats_in_utterances def word_repetition(conversation): # called 'utterance_repetition' in original paper """Counts the number of words that occur multiple times within the same utterance (duplicates) """ num_turns = len(conversation) num_repeats_in_utterances = np.zeros(num_turns) filtered = [[token for token in utterance if token not in filters] for utterance in conversation] # filter stopwords, contractions and punctuation for i in range(num_turns): repeats = len(filtered[i]) - len(set(filtered[i])) # (difference is positive if a word occurs multiple times) num_repeats_in_utterances[i] = repeats return num_repeats_in_utterances def utterance_length(conversation): """Counts the length of each utterance.""" filtered = [[token for token in utterance if token not in punct] for utterance in conversation] # filter punctuation return np.array([len(filtered_utterance) for filtered_utterance in filtered]) # caveats: if the sentiment is negative, it may only be because of the topic, not the person being unhappy with the bot def deepmoji(conversation): """Computes the Deepmoji sentiment of each utterance and its (sentiment) coherence with the previous utterance in Deepmoji embedding space""" # Init deepmoji just once if 'botmoji' not in globals(): print('Loading deepmoji') from torchMoji.api.botmoji import Botmoji with torch.no_grad(): global botmoji botmoji = Botmoji() # botmoji takes list of utterance strings (not list of lists of tokens) utterances = [' '.join(tokens) for tokens in conversation] # Run deepmoji: embed utterances sentiment_multiplier = _get_sentiment_multiplier() utterance_emojis = botmoji.encode_multiple(utterances) sentiments = np.dot(utterance_emojis, sentiment_multiplier) # compute coherence (cosine similarity) of each utterance with the previous utterance rolled = np.roll(utterance_emojis, shift=1, axis=0) emoji_coherence = cosine_similarity(utterance_emojis, rolled) # for the first utterance the coherence with the previous utterance cannot be computed --> manually set to zero emoji_coherence[0] = 0.0 return [sentiments, emoji_coherence] def infersent_coherence(conversation): """ Computes the (semantic) coherence of each utterance with the previous utterance in InferSent embedding space (cosine_similarity). """ # Init infersent just once if 'botsent' not in globals(): print('Loading InferSent') from inferSent.api.botsent import Botsent with torch.no_grad(): global botsent dataset_dir = Path(ROOT_DIR).joinpath('datasets/reddit_casual/train') botsent = Botsent(dataset_dir, use_pca=False) utterances = [' '.join(tokens) for tokens in conversation] # Run botsent: embed utterances embedded_utterances = botsent.encode_multiple(utterances) # compute coherence (cosine similarity) of each utterance with the previous utterance rolled = np.roll(embedded_utterances, shift=1, axis=0) coherence = cosine_similarity(embedded_utterances, rolled) # for the first utterance the coherence with the previous utterance cannot be computed --> manually set to zero coherence[0] = 0.0 return coherence def USE_similarity(conversation): """ Computes the (semantic) coherence of each utterance with the previous utterance in UniversalSentenceEncoder embedding space (cosine_similarity). Get model: 1. download model from: https://tfhub.dev/google/universal-sentence-encoder-large/3 2. unzip at configs.project_dir/UniversalSentenceEncoder """ if 'universal_encoder' not in globals(): print('Loading Universal Sentence Encoder') # import tensorflow as tf import tensorflow.compat.v1 as tf tf.disable_eager_execution() import tensorflow_hub as hub global universal_encoder, sess, sents, embed_op use_path = os.path.join(ROOT_DIR, "UniversalSentenceEncoder/universal-sentence-encoder-large_3") with tf.device('/cpu:0'): universal_encoder = hub.Module(use_path) sents = tf.placeholder(tf.string, shape=None, name="input_sents") embed_op = universal_encoder(sents) sess = tf.Session() sess.run([tf.global_variables_initializer(), tf.tables_initializer()]) utterances = [' '.join(tokens) for tokens in conversation] # Run UniversalSentenceEncoder: embed utterances embedded_utterances = sess.run(embed_op, feed_dict={sents: utterances}) # compute coherence (cosine similarity) of each utterance with the previous utterance rolled = np.roll(embedded_utterances, shift=1, axis=0) coherence = cosine_similarity(embedded_utterances, rolled) # for the first utterance the coherence with the previous utterance cannot be computed --> manually set to zero coherence[0] = 0.0 return coherence def word2vec_coherence(conversation): """ Computes the coherence of each utterance with the previous utterance in word2vec embedding space (cosine_similarity) Get GoogleNews vectors: 1. download vectors from: https://code.google.com/archive/p/word2vec/ 2. unzip at configs.project_dir/word2vec """ if 'word2vec' not in globals(): print('Loading word2vec dict') import gensim global word2vec, keys word2vec_path = Path(ROOT_DIR).joinpath("word2vec/GoogleNews-vectors-negative300.bin") word2vec = gensim.models.KeyedVectors.load_word2vec_format(word2vec_path, binary=True) keys = word2vec.vocab num_turns = len(conversation) coherence = np.zeros(num_turns) # Embed each word in all utterances of the conversation with word2vec and compute the mean embedding per utterance # (average over all words in each utterance) embedded_utterances = [] indices_of_utterances_without_embeddings = [] for idx, utterance in enumerate(conversation): embedded_utterance = [] for word in utterance: # embed utterance if word in keys: embedded_utterance.append(word2vec[word]) if not embedded_utterance: # no word in the utterance could be embedded (no embedding in word2vec) indices_of_utterances_without_embeddings.append(idx) # save index to set coherence to 0 afterwards embedded_utterances.append(np.mean([word2vec['placeholder']], axis=0)) # add placeholder, will be set to 0! else: embedded_utterances.append(np.mean(embedded_utterance, axis=0)) embedded_utterances = np.array(embedded_utterances) # compute coherence (cosine similarity) of each utterance with the previous utterance rolled =
np.roll(embedded_utterances, shift=1, axis=0)
numpy.roll
# -*- coding: utf-8 -*- """ Created on Thu Apr 23 10:53:34 2015 @author: adeshmu2 """ import numpy as np import time from bitconv import bitconvarray # extract features, create instances and create labels from the test data. def createInstances(total_device_power, device_timer, device_power,weather_data,classify,timewindow): #def createInstances(total_device_power, device_timer, device_power, classify, timewindow): timestep = 3#device_timer[2,1] - device_timer[1,1] numdata = len(total_device_power) numdevices = len(device_power[0]) idxstep = int(timewindow/timestep) numinstances = int(numdata/idxstep) binarylabels = np.zeros(shape=(numinstances,numdevices),dtype=np.int) # create 5 minute snippets from the given data. stridx = 0 endidx = idxstep - 1 snippets = np.zeros(shape=(numinstances,idxstep)) snippets_timer = np.zeros(shape=(numinstances,idxstep)) snippets_tstamp = np.zeros(shape=(numinstances)) snippets_temp = np.zeros(shape=(numinstances)) snippets_devices = np.zeros(shape=(idxstep,numdevices)) labels = np.zeros(shape=(numinstances)) print('instances: {}'.format(numinstances)) for instance in range(0,numinstances): snippets[instance,:] = total_device_power[stridx:endidx+1] snippets_timer[instance,:] = device_timer[stridx:endidx+1,0] snippets_tstamp[instance] = device_timer[endidx+1,0] snippets_temp[instance] = weather_data[endidx+1] for device in range(0,numdevices): snippets_devices[:,device] = device_power[stridx:endidx+1,device] # get the correct labels labels[instance],binarylabels[instance,:] = extractLabel(snippets_devices,numdevices) stridx = endidx + 1 endidx = endidx + idxstep if classify == 1: instances = extractFeaturesBayes(snippets,snippets_tstamp,snippets_temp,numinstances,weather_data,snippets_timer) #instances = extractFeaturesBayes(snippets, snippets_tstamp, numinstances, snippets_timer) else: #elif classify == 2 or classify == 3 or classify == 4 or classify == 5 or classify == 6: instances = extractFeaturesRegression(snippets,snippets_tstamp,snippets_temp,numinstances,weather_data,snippets_timer) #instances = extractFeaturesRegression(snippets,snippets_tstamp,numinstances,snippets_timer) return instances, labels, binarylabels, snippets def extractFeaturesBayes(snippets,snippets_tstamp,snippets_temp,numinstances,weather_data,snippets_timer): #def extractFeaturesBayes(snippets, snippets_tstamp, numinstances, snippets_timer): instances = np.zeros(shape=(numinstances,7)) available_weather_data = True if np.sum(weather_data) > 0 else False for instance in range(0,numinstances): # feature 0 - average power instance avg_instance = np.average(snippets[instance,:]) instances[instance,0] = avgRanking(avg_instance) # feature 1 - std deviation of power std_instance = np.std(snippets[instance,:]) instances[instance,1] = stdRanking(std_instance) # feature 2 - local hour of the day fraction local_time_sec = time.localtime(snippets_tstamp[instance]) time_hour = float(local_time_sec.tm_hour) + float(local_time_sec.tm_min)/60 instances[instance,2] = todRanking(time_hour) # feature 3 - local average temperature during the 5 minute window if available_weather_data > 0: instances[instance,3] = weatherRanking(snippets_temp[instance]) else: instances[instance, 3] = 0 # feature 4 - Maximum power reading instances[instance, 4] = maxPowerRanking(max(snippets[instance,:])) # feature 5 - The energy (integral of power) reading instances[instance, 5] = energyRanking(np.trapz(snippets[instance,:],snippets_timer[instance,:])) # feature 6 - Day of the week instances[instance,6] = local_time_sec.tm_wday return instances def extractFeaturesRegression(snippets, snippets_tstamp, snippets_temp, numinstances, weather_data, snippets_timer): #def extractFeaturesRegression(snippets, snippets_tstamp, numinstances, snippets_timer): instances = np.zeros(shape=(numinstances, 7)) available_weather_data = True if np.sum(weather_data) > 0 else False for instance in range(0,numinstances): # feature 0 - average power instance avg_instance = np.average(snippets[instance,:]) instances[instance,0] = avg_instance # feature 1 - std deviation of power std_instance = np.std(snippets[instance,:]) instances[instance,1] = std_instance # feature 2 - local hour of the day fraction local_time_sec = time.localtime(snippets_tstamp[instance]) time_hour = float(local_time_sec.tm_hour) + float(local_time_sec.tm_min)/60 instances[instance,2] = todRanking(time_hour) # feature 3 - local average temperature during the 5 minute window if available_weather_data: instances[instance,3] = snippets_temp[instance] else: instances[instance,3] = 0 # feature 4 - Maximum power reading instances[instance, 4] = max(snippets[instance, :]) # feature 5 - The energy (integral of power) reading instances[instance, 5] =
np.trapz(snippets[instance, :], snippets_timer[instance, :])
numpy.trapz
# -*- coding: utf-8 -*- """ Created on Fri Oct 5 18:56:30 2018 @author: <NAME> """ from mpl_toolkits.mplot3d import Axes3D import matplotlib.pyplot as plt from matplotlib import cm from matplotlib.ticker import LinearLocator, FormatStrFormatter import numpy as np from sklearn.decomposition import PCA from random import seed from random import random from random import gauss import random import copy from scipy import stats def data_rand(N,M,sigma,Groups=2): # create the data container data_rand = [] Labels = [] # seed random number generator # generate random numbers between 0-1 for _ in range(M): mean_random = random.randint(50,150)#create one mean value v = []#create the sample points for each variable for k in range(N): v.append(gauss(mean_random, random.randint(sigma,2*sigma))) data_rand.append(v) for _ in range(N): Labels.append(random.randint(0,Groups-1)) return data_rand,Labels def add_signifficance(data,Labels,Groups,averageSig,sigma,sigvars): sig = [] for j in Groups: if j>0: for v in sigvars: k = random.randint(averageSig-2*sigma,averageSig+2*sigma) + gauss(0, random.randint(sigma,2*sigma)) sig.append(k) data[Labels==j,v] = data[Labels==j,v] + k return data,sig def JSDe(X,Y,w,k): #project the data to k N,M = np.shape(X) T = np.repeat([k],N,0) xp = np.sort(np.sum(X*T,1)/np.linalg.norm(k)**2) j = 0 JSDe = 0 C =
np.unique(Y)
numpy.unique
def transform_scalars(dataset): """Delete Slices in Dataset""" from tomviz import utils import numpy as np axis = 0; #----USER SPECIFIED VARIABLES-----# ###firstSlice### ###lastSlice### ###axis### #Axis along which to delete the subarray #---------------------------------# # Get the current dataset. array = utils.get_array(dataset) # Get indices of the slices to be deleted. indices = np.linspace(firstSlice,lastSlice,lastSlice-firstSlice+1).astype(int) # Delete the specified slices. array =
np.delete(array,indices,axis)
numpy.delete
import numpy as np def getMedCurve(xar, yar, loose=True, threshold=3, error=False): """Takes repeated nummerical data (replicates passed as lists, stored in a list) and computes the average and error. Useful for displaying "average" plots with error bands. This function was taken from the following github repo (https://github.com/CellMechLab/nanoindentation), author Dr <NAME> at the Cellular Mechanobiology Lab, University of Glasgow.""" if loose is False: xmin = -np.inf xmax = np.inf deltax = 0 nonecount = 0 for x in xar: if x is not None and np.min(x) is not None: xmin = np.max([xmin, np.min(x)]) xmax = np.min([xmax, np.max(x)]) deltax += ((np.max(x)-np.min(x))/(len(x)-1)) else: nonecount += 1 deltax /= (len(xar)-nonecount) xnew = np.linspace(xmin, xmax, int((xmax-xmin)/(deltax))) ynew = np.zeros(len(xnew)) for i in range(len(xar)): if xar[i] is not None and np.min(xar[i]) is not None: ycur = np.interp(xnew, xar[i], yar[i]) ynew += ycur ynew /= (len(xar)-nonecount) else: xmin = np.inf xmax = -np.inf deltax = 0 for x in xar: try: xmin = np.min([xmin, np.min(x)]) xmax = np.max([xmax,
np.max(x)
numpy.max
""" Monitoring algorithms for Quicklook pipeline """ import numpy as np import scipy.ndimage import yaml from lvmspec.quicklook.qas import MonitoringAlg, QASeverity from lvmspec.quicklook import qlexceptions from lvmspec.quicklook import qllogger import os,sys import datetime from astropy.time import Time from lvmspec.qa import qalib from lvmspec.io import qa qlog=qllogger.QLLogger("QuickLook",0) log=qlog.getlog() def qlf_post(qadict): """ A general function to HTTP post the QA output dictionary, intended for QLF requires environmental variables: QLF_API_URL, QLF_USER, QLF_PASSWD Args: qadict: returned dictionary from a QA """ #- Check for environment variables and set them here if "QLF_API_URL" in os.environ: qlf_url=os.environ.get("QLF_API_URL") if "QLF_USER" not in os.environ or "QLF_PASSWD" not in os.environ: log.warning("Environment variables are not set for QLF. Set QLF_USER and QLF_PASSWD.") else: qlf_user=os.environ.get("QLF_USER") qlf_passwd=os.environ.get("QLF_PASSWD") log.debug("Environment variables are set for QLF. Now trying HTTP post.") #- All set. Now try to HTTP post try: import requests response=requests.get(qlf_url) #- Check if the api has json api=response.json() #- proceed with post job={"name":"QL","status":0,"dictionary":qadict} #- QLF should disintegrate dictionary response=requests.post(api['job'],json=job,auth=(qlf_user,qlf_passwd)) except: log.error("Skipping HTTP post... Exception",exc_info=true) else: log.warning("Skipping QLF. QLF_API_URL must be set as environment variable") class Get_RMS(MonitoringAlg): def __init__(self,name,config,logger=None): if name is None or name.strip() == "": name="RMS" from lvmspec.image import Image as im kwargs=config['kwargs'] parms=kwargs['param'] key=kwargs['refKey'] if 'refKey' in kwargs else "NOISE_AMP" status=kwargs['statKey'] if 'statKey' in kwargs else "NOISE_STAT" kwargs["SAMI_RESULTKEY"]=key kwargs["SAMI_QASTATUSKEY"]=status if "ReferenceMetrics" in kwargs: r=kwargs["ReferenceMetrics"] if key in r: kwargs["REFERENCE"]=r[key] if "NOISE_WARN_RANGE" in parms and "NOISE_NORMAL_RANGE" in parms: kwargs["RANGES"]=[(np.asarray(parms["NOISE_WARN_RANGE"]),QASeverity.WARNING), (np.asarray(parms["NOISE_NORMAL_RANGE"]),QASeverity.NORMAL)]# sorted by most severe to least severe MonitoringAlg.__init__(self,name,im,config,logger) def run(self,*args,**kwargs): if len(args) == 0 : raise qlexceptions.ParameterException("Missing input parameter") if not self.is_compatible(type(args[0])): raise qlexceptions.ParameterException("Incompatible parameter type. Was expecting lvmspec.image.Image got {}".format(type(args[0]))) input_image=args[0] if "paname" not in kwargs: paname=None else: paname=kwargs["paname"] if "ReferenceMetrics" in kwargs: refmetrics=kwargs["ReferenceMetrics"] else: refmetrics=None amps=False if "amps" in kwargs: amps=kwargs["amps"] if "param" in kwargs: param=kwargs["param"] else: param=None if "qlf" in kwargs: qlf=kwargs["qlf"] else: qlf=False if "qafile" in kwargs: qafile = kwargs["qafile"] else: qafile = None if "qafig" in kwargs: qafig=kwargs["qafig"] else: qafig = None return self.run_qa(input_image,paname=paname,amps=amps,qafile=qafile,qafig=qafig, param=param, qlf=qlf, refmetrics=refmetrics) def run_qa(self,image,paname=None,amps=False,qafile=None, qafig=None,param=None,qlf=False, refmetrics=None): retval={} retval["EXPID"] = '{0:08d}'.format(image.meta["EXPID"]) retval["PANAME"] = paname retval["QATIME"] = datetime.datetime.now().isoformat() retval["CAMERA"] = image.meta["CAMERA"] retval["PROGRAM"] = image.meta["PROGRAM"] retval["FLAVOR"] = image.meta["FLAVOR"] retval["NIGHT"] = image.meta["NIGHT"] kwargs=self.config['kwargs'] # return rms values in rms/sqrt(exptime) rmsccd=qalib.getrms(image.pix/np.sqrt(image.meta["EXPTIME"])) #- should we add dark current and/or readnoise to this as well? if param is None: log.debug("Param is None. Using default param instead") param = { "NOISE_NORMAL_RANGE":[-1.0, 1.0], "NOISE_WARN_RANGE":[-2.0, 2.0] } retval["PARAMS"] = param if "REFERENCE" in kwargs: retval['PARAMS']['NOISE_AMP_REF']=kwargs["REFERENCE"] expnum=[] rms_row=[] rms_amps=[] rms_over_amps=[] overscan_values=[] #- get amp/overcan boundary in pixels from lvmspec.preproc import _parse_sec_keyword for kk in ['1','2','3','4']: thisampboundary=_parse_sec_keyword(image.meta["CCDSEC"+kk]) thisoverscanboundary=_parse_sec_keyword(image.meta["BIASSEC"+kk]) for i in range(image.pix[thisoverscanboundary].shape[0]): rmsrow = qalib.getrms(image.pix[thisoverscanboundary][i]/np.sqrt(image.meta["EXPTIME"])) rms_row.append(rmsrow) rms_thisover_thisamp=qalib.getrms(image.pix[thisoverscanboundary]/np.sqrt(image.meta["EXPTIME"])) rms_thisamp=qalib.getrms(image.pix[thisampboundary]/np.sqrt(image.meta["EXPTIME"])) rms_amps.append(rms_thisamp) rms_over_amps.append(rms_thisover_thisamp) rmsover=np.max(rms_over_amps) rmsdiff_err='NORMAL' if amps: rms_amps=[] rms_over_amps=[] overscan_values=[] #- get amp/overcan boundary in pixels from lvmspec.preproc import _parse_sec_keyword for kk in ['1','2','3','4']: thisampboundary=_parse_sec_keyword(image.meta["CCDSEC"+kk]) thisoverscanboundary=_parse_sec_keyword(image.meta["BIASSEC"+kk]) rms_thisover_thisamp=qalib.getrms(image.pix[thisoverscanboundary]/np.sqrt(image.meta["EXPTIME"])) thisoverscan_values=np.ravel(image.pix[thisoverscanboundary]/np.sqrt(image.meta["EXPTIME"])) rms_thisamp=qalib.getrms(image.pix[thisampboundary]/np.sqrt(image.meta["EXPTIME"])) rms_amps.append(rms_thisamp) rms_over_amps.append(rms_thisover_thisamp) overscan_values+=thisoverscan_values.tolist() rmsover=np.std(overscan_values) # retval["METRICS"]={"RMS":rmsccd,"NOISE":rmsover,"RMS_AMP":np.array(rms_amps),"NOISE_AMP":np.array(rms_over_amps),"RMS_ROW":rms_row,"EXPNUM_WARN":expnum} retval["METRICS"]={"RMS":rmsccd,"NOISE":rmsover,"RMS_AMP":np.array(rms_amps),"NOISE_AMP":np.array(rms_over_amps),"RMS_ROW":rms_row,"NOISE_STAT":rmsdiff_err,"EXPNUM_WARN":expnum} else: # retval["METRICS"]={"RMS":rmsccd,"NOISE":rmsover,"RMS_ROW":rms_row,"EXPNUM_WARN":expnum} retval["METRICS"]={"RMS":rmsccd,"NOISE":rmsover,"RMS_ROW":rms_row,"NOISE_STAT":rmsdiff_err,"EXPNUM_WARN":expnum} if qlf: qlf_post(retval) if qafile is not None: outfile = qa.write_qa_ql(qafile,retval) log.debug("Output QA data is in {}".format(outfile)) if qafig is not None: from lvmspec.qa.qa_plots_ql import plot_RMS plot_RMS(retval,qafig) log.debug("Output QA fig {}".format(qafig)) return retval def get_default_config(self): return {} class Count_Pixels(MonitoringAlg): def __init__(self,name,config,logger=None): if name is None or name.strip() == "": name="COUNTPIX" from lvmspec.image import Image as im kwargs=config['kwargs'] parms=kwargs['param'] key=kwargs['refKey'] if 'refKey' in kwargs else "NPIX_AMP" status=kwargs['statKey'] if 'statKey' in kwargs else "NPIX_STAT" kwargs["SAMI_RESULTKEY"]=key kwargs["SAMI_QASTATUSKEY"]=status if "ReferenceMetrics" in kwargs: r=kwargs["ReferenceMetrics"] if key in r: kwargs["REFERENCE"]=r[key] if "NPIX_WARN_RANGE" in parms and "NPIX_NORMAL_RANGE" in parms: kwargs["RANGES"]=[(np.asarray(parms["NPIX_WARN_RANGE"]),QASeverity.WARNING), (np.asarray(parms["NPIX_NORMAL_RANGE"]),QASeverity.NORMAL)]# sorted by most severe to least severe MonitoringAlg.__init__(self,name,im,config,logger) def run(self,*args,**kwargs): if len(args) == 0 : raise qlexceptions.ParameterException("Missing input parameter") if not self.is_compatible(type(args[0])): raise qlexceptions.ParameterException("Incompatible input. Was expecting {} got {}".format(type(self.__inpType__),type(args[0]))) input_image=args[0] if "paname" not in kwargs: paname=None else: paname=kwargs["paname"] if "ReferenceMetrics" in kwargs: refmetrics=kwargs["ReferenceMetrics"] else: refmetrics=None amps=False if "amps" in kwargs: amps=kwargs["amps"] if "param" in kwargs: param=kwargs["param"] else: param=None if "qlf" in kwargs: qlf=kwargs["qlf"] else: qlf=False if "qafile" in kwargs: qafile = kwargs["qafile"] else: qafile = None if "qafig" in kwargs: qafig=kwargs["qafig"] else: qafig = None return self.run_qa(input_image,paname=paname,amps=amps,qafile=qafile,qafig=qafig, param=param, qlf=qlf, refmetrics=refmetrics) def run_qa(self,image,paname=None,amps=False,qafile=None,qafig=None, param=None, qlf=False, refmetrics=None): retval={} retval["PANAME"] = paname retval["QATIME"] = datetime.datetime.now().isoformat() retval["EXPID"] = '{0:08d}'.format(image.meta["EXPID"]) retval["CAMERA"] = image.meta["CAMERA"] retval["PROGRAM"] = image.meta["PROGRAM"] retval["FLAVOR"] = image.meta["FLAVOR"] retval["NIGHT"] = image.meta["NIGHT"] kwargs=self.config['kwargs'] if param is None: log.debug("Param is None. Using default param instead") param = { "CUTLO":3, # low threshold for number of counts in sigmas "CUTHI":10, "NPIX_NORMAL_RANGE":[200.0, 500.0], "NPIX_WARN_RANGE":[50.0, 650.0] } retval["PARAMS"] = param if "REFERENCE" in kwargs: retval['PARAMS']['NPIX_AMP_REF']=kwargs["REFERENCE"] #- get the counts over entire CCD in counts per second npixlo=qalib.countpix(image.pix,nsig=param['CUTLO']) #- above 3 sigma in counts npixhi=qalib.countpix(image.pix,nsig=param['CUTHI']) #- above 10 sigma in counts npix_err='NORMAL' #- get the counts for each amp if amps: npixlo_amps=[] npixhi_amps=[] #- get amp boundary in pixels from lvmspec.preproc import _parse_sec_keyword for kk in ['1','2','3','4']: ampboundary=_parse_sec_keyword(image.meta["CCDSEC"+kk]) npixlo_thisamp=qalib.countpix(image.pix[ampboundary]/image.meta["EXPTIME"],nsig=param['CUTLO']) npixlo_amps.append(npixlo_thisamp) npixhi_thisamp=qalib.countpix(image.pix[ampboundary]/image.meta["EXPTIME"],nsig=param['CUTHI']) npixhi_amps.append(npixhi_thisamp) # retval["METRICS"]={"NPIX_LOW":npixlo,"NPIX_HIGH":npixhi,"NPIX_AMP": npixlo_amps,"NPIX_HIGH_AMP": npixhi_amps} retval["METRICS"]={"NPIX_LOW":npixlo,"NPIX_HIGH":npixhi,"NPIX_AMP": npixlo_amps,"NPIX_HIGH_AMP": npixhi_amps,"NPIX_STAT":npix_err} else: # retval["METRICS"]={"NPIX_LOW":npixlo,"NPIX_HIGH":npixhi} retval["METRICS"]={"NPIX_LOW":npixlo,"NPIX_HIGH":npixhi,"NPIX_STAT":npix_err} if qlf: qlf_post(retval) if qafile is not None: outfile = qa.write_qa_ql(qafile,retval) log.debug("Output QA data is in {}".format(outfile)) if qafig is not None: from lvmspec.qa.qa_plots_ql import plot_countpix plot_countpix(retval,qafig) log.debug("Output QA fig {}".format(qafig)) return retval def get_default_config(self): return {} class Integrate_Spec(MonitoringAlg): def __init__(self,name,config,logger=None): if name is None or name.strip() == "": name="INTEG" from lvmspec.frame import Frame as fr kwargs=config['kwargs'] parms=kwargs['param'] key=kwargs['refKey'] if 'refKey' in kwargs else "INTEG_AVG" status=kwargs['statKey'] if 'statKey' in kwargs else "MAGDIFF_STAT" kwargs["SAMI_RESULTKEY"]=key kwargs["SAMI_QASTATUSKEY"]=status if "ReferenceMetrics" in kwargs: r=kwargs["ReferenceMetrics"] if key in r: kwargs["REFERENCE"]=r[key] if "MAGDIFF_WARN_RANGE" in parms and "MAGDIFF_NORMAL_RANGE" in parms: kwargs["RANGES"]=[(np.asarray(parms["MAGDIFF_WARN_RANGE"]),QASeverity.WARNING), (np.asarray(parms["MAGDIFF_NORMAL_RANGE"]),QASeverity.NORMAL)]# sorted by most severe to least severe MonitoringAlg.__init__(self,name,fr,config,logger) def run(self,*args,**kwargs): if len(args) == 0 : raise qlexceptions.ParameterException("Missing input parameter") if not self.is_compatible(type(args[0])): raise qlexceptions.ParameterException("Incompatible input. Was expecting {}, got {}".format(type(self.__inpType__),type(args[0]))) fibermap=kwargs['FiberMap'] input_frame=args[0] if "paname" not in kwargs: paname=None else: paname=kwargs["paname"] if "ReferenceMetrics" in kwargs: refmetrics=kwargs["ReferenceMetrics"] else: refmetrics=None amps=False if "amps" in kwargs: amps=kwargs["amps"] if "param" in kwargs: param=kwargs["param"] else: param=None dict_countbins=None if "dict_countbins" in kwargs: dict_countbins=kwargs["dict_countbins"] if "qlf" in kwargs: qlf=kwargs["qlf"] else: qlf=False if "qafile" in kwargs: qafile = kwargs["qafile"] else: qafile = None if "qafig" in kwargs: qafig=kwargs["qafig"] else: qafig = None return self.run_qa(fibermap,input_frame,paname=paname,amps=amps, dict_countbins=dict_countbins, qafile=qafile,qafig=qafig, param=param, qlf=qlf, refmetrics=refmetrics) def run_qa(self,fibermap,frame,paname=None,amps=False,dict_countbins=None, qafile=None,qafig=None, param=None, qlf=False, refmetrics=None): retval={} retval["PANAME" ] = paname retval["QATIME"] = datetime.datetime.now().isoformat() retval["EXPID"] = '{0:08d}'.format(frame.meta["EXPID"]) retval["CAMERA"] = frame.meta["CAMERA"] retval["PROGRAM"] = frame.meta["PROGRAM"] retval["FLAVOR"] = frame.meta["FLAVOR"] retval["NIGHT"] = frame.meta["NIGHT"] kwargs=self.config['kwargs'] ra = fibermap["RA_TARGET"] dec = fibermap["DEC_TARGET"] #- get the integrals for all fibers flux=frame.flux wave=frame.wave integrals=np.zeros(flux.shape[0]) for ii in range(len(integrals)): integrals[ii]=qalib.integrate_spec(wave,flux[ii]) #- average integrals over fibers of each object type and get imaging magnitudes integ_avg_tgt=[] mag_avg_tgt=[] for T in ["ELG","QSO","LRG","STD"]: fibers=np.where(frame.fibermap['OBJTYPE']==T)[0] if len(fibers) < 1: log.warning("no {} fibers found.".format(T)) magnitudes=frame.fibermap['MAG'][fibers] mag_avg=np.mean(magnitudes) mag_avg_tgt.append(mag_avg) integ=integrals[fibers] integ_avg=np.mean(integ) integ_avg_tgt.append(integ_avg) if T == "STD": starfibers=fibers int_stars=integ int_average=integ_avg # simple, temporary magdiff calculation (to be corrected...) magdiff_avg=[] for i in range(len(mag_avg_tgt)): mag_fib=-2.5*np.log(integ_avg_tgt[i]/frame.meta["EXPTIME"])+30. if mag_avg_tgt[i] != np.nan: magdiff=mag_fib-mag_avg_tgt[i] else: magdiff=nan magdiff_avg.append(magdiff) if param is None: log.debug("Param is None. Using default param instead") param = { "MAGDIFF_NORMAL_RANGE":[-0.5, 0.5], "MAGDIFF_WARN_RANGE":[-1.0, 1.0] } retval["PARAMS"] = param if "REFERENCE" in kwargs: retval['PARAMS']['MAGDIFF_TGT_REF']=kwargs["REFERENCE"] magdiff_avg_amp = [0.0] magdiff_err='NORMAL' #- get the counts for each amp if amps: #- get the fiducial boundary leftmax = dict_countbins["LEFT_MAX_FIBER"] rightmin = dict_countbins["RIGHT_MIN_FIBER"] bottommax = dict_countbins["BOTTOM_MAX_WAVE_INDEX"] topmin = dict_countbins["TOP_MIN_WAVE_INDEX"] fidboundary = qalib.slice_fidboundary(frame,leftmax,rightmin,bottommax,topmin) int_avg_amps=np.zeros(4) for amp in range(4): wave=frame.wave[fidboundary[amp][1]] select_thisamp=starfibers[(starfibers >= fidboundary[amp][0].start) & (starfibers < fidboundary[amp][0].stop)] stdflux_thisamp=frame.flux[select_thisamp,fidboundary[amp][1]] if len(stdflux_thisamp)==0: continue else: integ_thisamp=np.zeros(stdflux_thisamp.shape[0]) for ii in range(stdflux_thisamp.shape[0]): integ_thisamp[ii]=qalib.integrate_spec(wave,stdflux_thisamp[ii]) int_avg_amps[amp]=np.mean(integ_thisamp) # retval["METRICS"]={"RA":ra,"DEC":dec, "INTEG":int_stars, "INTEG_AVG":int_average,"INTEG_AVG_AMP":int_avg_amps, "STD_FIBERID": starfibers.tolist(),"MAGDIFF_TGT":magdiff_avg,"MAGDIFF_AVG_AMP":magdiff_avg_amp} retval["METRICS"]={"RA":ra,"DEC":dec, "INTEG":int_stars, "INTEG_AVG":int_average,"INTEG_AVG_AMP":int_avg_amps, "STD_FIBERID": starfibers.tolist(),"MAGDIFF_TGT":magdiff_avg,"MAGDIFF_AVG_AMP":magdiff_avg_amp,"MAGDIFF_STAT":magdiff_err} else: # retval["METRICS"]={"RA":ra,"DEC":dec, "INTEG":int_stars,"INTEG_AVG":int_average,"STD_FIBERID":starfibers.tolist(),"MAGDIFF_TGT":magdiff_avg} retval["METRICS"]={"RA":ra,"DEC":dec, "INTEG":int_stars,"INTEG_AVG":int_average,"STD_FIBERID":starfibers.tolist(),"MAGDIFF_TGT":magdiff_avg,"MAGDIFF_STAT":magdiff_err} if qlf: qlf_post(retval) if qafile is not None: outfile = qa.write_qa_ql(qafile,retval) log.debug("Output QA data is in {}".format(outfile)) if qafig is not None: from lvmspec.qa.qa_plots_ql import plot_integral plot_integral(retval,qafig) log.debug("Output QA fig {}".format(qafig)) return retval def get_default_config(self): return {} class Sky_Continuum(MonitoringAlg): def __init__(self,name,config,logger=None): if name is None or name.strip() == "": name="SKYCONT" from lvmspec.frame import Frame as fr kwargs=config['kwargs'] parms=kwargs['param'] key=kwargs['refKey'] if 'refKey' in kwargs else "SKYCONT" status=kwargs['statKey'] if 'statKey' in kwargs else "SKYCONT_STAT" kwargs["SAMI_RESULTKEY"]=key kwargs["SAMI_QASTATUSKEY"]=status if "ReferenceMetrics" in kwargs: r=kwargs["ReferenceMetrics"] if key in r: kwargs["REFERENCE"]=r[key] if "SKYCONT_WARN_RANGE" in parms and "SKYCONT_NORMAL_RANGE" in parms: kwargs["RANGES"]=[(np.asarray(parms["SKYCONT_WARN_RANGE"]),QASeverity.WARNING), (np.asarray(parms["SKYCONT_NORMAL_RANGE"]),QASeverity.NORMAL)]# sorted by most severe to least severe MonitoringAlg.__init__(self,name,fr,config,logger) def run(self,*args,**kwargs): if len(args) == 0 : raise qlexceptions.ParameterException("Missing input parameter") if not self.is_compatible(type(args[0])): raise qlexceptions.ParameterException("Incompatible input. Was expecting {}, got {}".format(type(self.__inpType__),type(args[0]))) fibermap=kwargs['FiberMap'] input_frame=args[0] camera=input_frame.meta["CAMERA"] wrange1=None wrange2=None if "wrange1" in kwargs: wrange1=kwargs["wrange1"] if "wrange2" in kwargs: wrange2=kwargs["wrange2"] if wrange1==None: if camera[0]=="b": wrange1= "4000,4500" if camera[0]=="r": wrange1= "5950,6200" if camera[0]=="z": wrange1= "8120,8270" if wrange2==None: if camera[0]=="b": wrange2= "5250,5550" if camera[0]=="r": wrange2= "6990,7230" if camera[0]=="z": wrange2= "9110,9280" paname=None if "paname" in kwargs: paname=kwargs["paname"] if "ReferenceMetrics" in kwargs: refmetrics=kwargs["ReferenceMetrics"] else: refmetrics=None amps=False if "amps" in kwargs: amps=kwargs["amps"] if "param" in kwargs: param=kwargs["param"] else: param=None dict_countbins=None if "dict_countbins" in kwargs: dict_countbins=kwargs["dict_countbins"] if "qlf" in kwargs: qlf=kwargs["qlf"] else: qlf=False if "qafile" in kwargs: qafile = kwargs["qafile"] else: qafile = None if "qafig" in kwargs: qafig=kwargs["qafig"] else: qafig=None return self.run_qa(fibermap,input_frame,wrange1=wrange1,wrange2=wrange2,paname=paname,amps=amps, dict_countbins=dict_countbins,qafile=qafile,qafig=qafig, param=param, qlf=qlf, refmetrics=refmetrics) def run_qa(self,fibermap,frame,wrange1=None,wrange2=None, paname=None,amps=False,dict_countbins=None, qafile=None,qafig=None, param=None, qlf=False, refmetrics=None): #- qa dictionary retval={} retval["PANAME" ]= paname retval["QATIME"] = datetime.datetime.now().isoformat() retval["EXPID"] = '{0:08d}'.format(frame.meta["EXPID"]) retval["CAMERA"] = frame.meta["CAMERA"] retval["PROGRAM"] = frame.meta["PROGRAM"] retval["FLAVOR"] = frame.meta["FLAVOR"] retval["NIGHT"] = frame.meta["NIGHT"] kwargs=self.config['kwargs'] ra = fibermap["RA_TARGET"] dec = fibermap["DEC_TARGET"] if param is None: log.debug("Param is None. Using default param instead") from lvmspec.io import read_params desi_params = read_params() param = {} for key in ['B_CONT','R_CONT', 'Z_CONT', 'SKYCONT_WARN_RANGE', 'SKYCONT_ALARM_RANGE']: param[key] = desi_params['qa']['skysub']['PARAMS'][key] retval["PARAMS"] = param if "REFERENCE" in kwargs: retval['PARAMS']['SKYCONT_REF']=kwargs["REFERENCE"] skyfiber, contfiberlow, contfiberhigh, meancontfiber, skycont = qalib.sky_continuum( frame, wrange1, wrange2) skycont_err = 'NORMAL' if amps: leftmax = dict_countbins["LEFT_MAX_FIBER"] rightmin = dict_countbins["RIGHT_MIN_FIBER"] bottommax = dict_countbins["BOTTOM_MAX_WAVE_INDEX"] topmin = dict_countbins["TOP_MIN_WAVE_INDEX"] fidboundary = qalib.slice_fidboundary(frame,leftmax,rightmin,bottommax,topmin) k1=np.where(skyfiber < fidboundary[0][0].stop)[0] maxsky_index=max(k1) contamp1=np.mean(contfiberlow[:maxsky_index]) contamp3=np.mean(contfiberhigh[:maxsky_index]) if fidboundary[1][0].start >=fidboundary[0][0].stop: k2=np.where(skyfiber > fidboundary[1][0].start)[0] minsky_index=min(k2) contamp2=np.mean(contfiberlow[minsky_index:]) contamp4=np.mean(contfiberhigh[minsky_index:]) else: contamp2=0 contamp4=0 skycont_amps=np.array((contamp1,contamp2,contamp3,contamp4)) #- in four amps regions # retval["METRICS"]={"RA":ra,"DEC":dec, "SKYFIBERID": skyfiber.tolist(), "SKYCONT":skycont, "SKYCONT_FIBER":meancontfiber, "SKYCONT_AMP":skycont_amps} retval["METRICS"]={"RA":ra,"DEC":dec, "SKYFIBERID": skyfiber.tolist(), "SKYCONT":skycont, "SKYCONT_FIBER":meancontfiber, "SKYCONT_AMP":skycont_amps, "SKYCONT_STAT":skycont_err} else: # retval["METRICS"]={"RA":ra,"DEC":dec, "SKYFIBERID": skyfiber.tolist(), "SKYCONT":skycont, "SKYCONT_FIBER":meancontfiber} retval["METRICS"]={"RA":ra,"DEC":dec, "SKYFIBERID": skyfiber.tolist(), "SKYCONT":skycont, "SKYCONT_FIBER":meancontfiber, "SKYCONT_STAT":skycont_err} if qlf: qlf_post(retval) if qafile is not None: outfile = qa.write_qa_ql(qafile,retval) log.debug("Output QA data is in {}".format(outfile)) if qafig is not None: from lvmspec.qa.qa_plots_ql import plot_sky_continuum plot_sky_continuum(retval,qafig) log.debug("Output QA fig {}".format(qafig)) return retval def get_default_config(self): return {} class Sky_Peaks(MonitoringAlg): def __init__(self,name,config,logger=None): if name is None or name.strip() == "": name="SKYPEAK" from lvmspec.frame import Frame as fr kwargs=config['kwargs'] parms=kwargs['param'] key=kwargs['refKey'] if 'refKey' in kwargs else "PEAKCOUNT_MED_SKY" status=kwargs['statKey'] if 'statKey' in kwargs else "PEAKCOUNT_STAT" kwargs["SAMI_RESULTKEY"]=key kwargs["SAMI_QASTATUSKEY"]=status if "ReferenceMetrics" in kwargs: r=kwargs["ReferenceMetrics"] if key in r: kwargs["REFERENCE"]=r[key] if "PEAKCOUNT_WARN_RANGE" in parms and "PEAKCOUNT_NORMAL_RANGE" in parms: kwargs["RANGES"]=[(np.asarray(parms["PEAKCOUNT_WARN_RANGE"]),QASeverity.WARNING), (np.asarray(parms["PEAKCOUNT_NORMAL_RANGE"]),QASeverity.NORMAL)]# sorted by most severe to least severe MonitoringAlg.__init__(self,name,fr,config,logger) def run(self,*args,**kwargs): if len(args) == 0 : raise qlexceptions.ParameterException("Missing input parameter") if not self.is_compatible(type(args[0])): raise qlexceptions.ParameterException("Incompatible parameter type. Was expecting lvmspec.image.Image, got {}".format(type(args[0]))) fibermap=kwargs['FiberMap'] input_frame=args[0] if "paname" not in kwargs: paname=None else: paname=kwargs["paname"] if "ReferenceMetrics" in kwargs: refmetrics=kwargs["ReferenceMetrics"] else: refmetrics=None amps=False if "amps" in kwargs: amps=kwargs["amps"] if "param" in kwargs: param=kwargs["param"] else: param=None psf = None if "PSFFile" in kwargs: psf=kwargs["PSFFile"] if "qlf" in kwargs: qlf=kwargs["qlf"] else: qlf=False if "qafile" in kwargs: qafile = kwargs["qafile"] else: qafile = None if "qafig" in kwargs: qafig=kwargs["qafig"] else: qafig = None return self.run_qa(fibermap,input_frame,paname=paname,amps=amps,psf=psf, qafile=qafile, qafig=qafig, param=param, qlf=qlf, refmetrics=refmetrics) def run_qa(self,fibermap,frame,paname=None,amps=False,psf=None, qafile=None,qafig=None, param=None, qlf=False, refmetrics=None): from lvmspec.qa.qalib import sky_peaks retval={} retval["PANAME"] = paname retval["QATIME"] = datetime.datetime.now().isoformat() retval["EXPID"] = '{0:08d}'.format(frame.meta["EXPID"]) retval["CAMERA"] = camera = frame.meta["CAMERA"] retval["PROGRAM"] = frame.meta["PROGRAM"] retval["FLAVOR"] = frame.meta["FLAVOR"] retval["NIGHT"] = frame.meta["NIGHT"] kwargs=self.config['kwargs'] ra = fibermap["RA_TARGET"] dec = fibermap["DEC_TARGET"] # Parameters if param is None: log.info("Param is None. Using default param instead") from lvmspec.io import read_params desi_params = read_params() param = desi_params['qa']['skypeaks']['PARAMS'] # Run nspec_counts, sky_counts = sky_peaks(param, frame, amps=amps) rms_nspec = qalib.getrms(nspec_counts) rms_skyspec = qalib.getrms(sky_counts) sumcount_med_sky=[] retval["PARAMS"] = param if "REFERENCE" in kwargs: retval['PARAMS']['PEAKCOUNT_REF']=kwargs["REFERENCE"] # retval["METRICS"]={"RA":ra,"DEC":dec, "PEAKCOUNT":nspec_counts,"PEAKCOUNT_RMS":rms_nspec,"PEAKCOUNT_MED_SKY":sumcount_med_sky,"PEAKCOUNT_RMS_SKY":rms_skyspec} sumcount_err='NORMAL' retval["METRICS"]={"RA":ra,"DEC":dec, "PEAKCOUNT":nspec_counts,"PEAKCOUNT_RMS":rms_nspec,"PEAKCOUNT_MED_SKY":sumcount_med_sky,"PEAKCOUNT_RMS_SKY":rms_skyspec,"PEAKCOUNT_STAT":sumcount_err} if qlf: qlf_post(retval) if qafile is not None: outfile = qa.write_qa_ql(qafile,retval) log.debug("Output QA data is in {}".format(outfile)) if qafig is not None: from lvmspec.qa.qa_plots_ql import plot_sky_peaks plot_sky_peaks(retval,qafig) log.debug("Output QA fig {}".format(qafig)) return retval def get_default_config(self): return {} class Calc_XWSigma(MonitoringAlg): def __init__(self,name,config,logger=None): if name is None or name.strip() == "": name="XWSIGMA" from lvmspec.image import Image as im kwargs=config['kwargs'] parms=kwargs['param'] key=kwargs['refKey'] if 'refKey' in kwargs else "WSIGMA_MED_SKY" status=kwargs['statKey'] if 'statKey' in kwargs else "XWSIGMA_STAT" kwargs["SAMI_RESULTKEY"]=key kwargs["SAMI_QASTATUSKEY"]=status if "ReferenceMetrics" in kwargs: r=kwargs["ReferenceMetrics"] if key in r: kwargs["REFERENCE"]=r[key] if "XWSIGMA_WARN_RANGE" in parms and "XWSIGMA_NORMAL_RANGE" in parms: kwargs["RANGES"]=[(np.asarray(parms["XWSIGMA_WARN_RANGE"]),QASeverity.WARNING), (np.asarray(parms["XWSIGMA_NORMAL_RANGE"]),QASeverity.NORMAL)]# sorted by most severe to least severe MonitoringAlg.__init__(self,name,im,config,logger) def run(self,*args,**kwargs): if len(args) == 0 : raise qlexceptions.ParameterException("Missing input parameter") if not self.is_compatible(type(args[0])): raise qlexceptions.ParameterException("Incompatible parameter type. Was expecting lvmspec.image.Image got {}".format(type(args[0]))) fibermap=kwargs['FiberMap'] input_image=args[0] if "paname" not in kwargs: paname=None else: paname=kwargs["paname"] if "ReferenceMetrics" in kwargs: refmetrics=kwargs["ReferenceMetrics"] else: refmetrics=None amps=False if "amps" in kwargs: amps=kwargs["amps"] if "param" in kwargs: param=kwargs["param"] else: param=None psf = None if "PSFFile" in kwargs: psf=kwargs["PSFFile"] fibermap = None if "FiberMap" in kwargs: fibermap=kwargs["FiberMap"] if "qlf" in kwargs: qlf=kwargs["qlf"] else: qlf=False if "qafile" in kwargs: qafile = kwargs["qafile"] else: qafile = None if "qafig" in kwargs: qafig=kwargs["qafig"] else: qafig = None return self.run_qa(fibermap,input_image,paname=paname,amps=amps,psf=psf, qafile=qafile,qafig=qafig, param=param, qlf=qlf, refmetrics=refmetrics) def run_qa(self,fibermap,image,paname=None,amps=False,psf=None, qafile=None,qafig=None, param=None, qlf=False, refmetrics=None): from scipy.optimize import curve_fit retval={} retval["PANAME"] = paname retval["QATIME"] = datetime.datetime.now().isoformat() retval["EXPID"] = '{0:08d}'.format(image.meta["EXPID"]) retval["CAMERA"] = camera = image.meta["CAMERA"] retval["PROGRAM"] = image.meta["PROGRAM"] retval["FLAVOR"] = image.meta["FLAVOR"] retval["NIGHT"] = image.meta["NIGHT"] kwargs=self.config['kwargs'] ra = fibermap["RA_TARGET"] dec = fibermap["DEC_TARGET"] if param is None: log.debug("Param is None. Using default param instead") if image.meta["FLAVOR"] == 'arc': param = { "B_PEAKS":[4047.7, 4359.6, 5087.2], "R_PEAKS":[6144.8, 6508.3, 6600.8, 6718.9, 6931.4, 7034.4,], "Z_PEAKS":[8379.9, 8497.7, 8656.8, 8783.0], "XWSIGMA_NORMAL_RANGE":[-2.0, 2.0], "XWSIGMA_WARN_RANGE":[-4.0, 4.0] } else: param = { "B_PEAKS":[3914.4, 5199.3, 5578.9], "R_PEAKS":[6301.9, 6365.4, 7318.2, 7342.8, 7371.3], "Z_PEAKS":[8401.5, 8432.4, 8467.5, 9479.4, 9505.6, 9521.8], "XWSIGMA_NORMAL_RANGE":[-2.0, 2.0], "XWSIGMA_WARN_RANGE":[-4.0, 4.0] } dw=2. dp=3 b_peaks=param['B_PEAKS'] r_peaks=param['R_PEAKS'] z_peaks=param['Z_PEAKS'] if fibermap["OBJTYPE"][0] == 'ARC': import lvmspec.psf psf=lvmspec.psf.PSF(psf) xsigma=[] wsigma=[] xsigma_sky=[] wsigma_sky=[] xsigma_amp1=[] wsigma_amp1=[] xsigma_amp2=[] wsigma_amp2=[] xsigma_amp3=[] wsigma_amp3=[] xsigma_amp4=[] wsigma_amp4=[] if fibermap['FIBER'].shape[0] >= 500: fibers = 500 else: fibers = fibermap['FIBER'].shape[0] for i in range(fibers): if camera[0]=="b": peak_wave=np.array([b_peaks[0]-dw,b_peaks[0]+dw,b_peaks[1]-dw,b_peaks[1]+dw,b_peaks[2]-dw,b_peaks[2]+dw]) xpix=psf.x(ispec=i,wavelength=peak_wave) ypix=psf.y(ispec=i,wavelength=peak_wave) xpix_peak1=np.arange(int(round(xpix[0]))-dp,int(round(xpix[1]))+dp+1,1) ypix_peak1=np.arange(int(round(ypix[0])),int(round(ypix[1])),1) xpix_peak2=np.arange(int(round(xpix[2]))-dp,int(round(xpix[3]))+dp+1,1) ypix_peak2=np.arange(int(round(ypix[2])),int(round(ypix[3])),1) xpix_peak3=np.arange(int(round(xpix[4]))-dp,int(round(xpix[5]))+dp+1,1) ypix_peak3=np.arange(int(round(ypix[4])),int(round(ypix[5])),1) xpopt1,xpcov1=curve_fit(qalib.gauss,np.arange(len(xpix_peak1)),image.pix[int(np.mean(ypix_peak1)),xpix_peak1]) wpopt1,wpcov1=curve_fit(qalib.gauss,np.arange(len(ypix_peak1)),image.pix[ypix_peak1,int(np.mean(xpix_peak1))]) xpopt2,xpcov2=curve_fit(qalib.gauss,np.arange(len(xpix_peak2)),image.pix[int(np.mean(ypix_peak2)),xpix_peak2]) wpopt2,wpcov2=curve_fit(qalib.gauss,np.arange(len(ypix_peak2)),image.pix[ypix_peak2,int(np.mean(xpix_peak2))]) xpopt3,xpcov3=curve_fit(qalib.gauss,np.arange(len(xpix_peak3)),image.pix[int(np.mean(ypix_peak3)),xpix_peak3]) wpopt3,wpcov3=curve_fit(qalib.gauss,np.arange(len(ypix_peak3)),image.pix[ypix_peak3,int(np.mean(xpix_peak3))]) xsigma1=np.abs(xpopt1[2]) wsigma1=np.abs(wpopt1[2]) xsigma2=np.abs(xpopt2[2]) wsigma2=np.abs(wpopt2[2]) xsigma3=np.abs(xpopt3[2]) wsigma3=np.abs(wpopt3[2]) xsig=np.array([xsigma1,xsigma2,xsigma3]) wsig=np.array([wsigma1,wsigma2,wsigma3]) xsigma_avg=np.mean(xsig) wsigma_avg=np.mean(wsig) xsigma.append(xsigma_avg) wsigma.append(wsigma_avg) if camera[0]=="r": peak_wave=np.array([r_peaks[0]-dw,r_peaks[0]+dw,r_peaks[1]-dw,r_peaks[1]+dw,r_peaks[2]-dw,r_peaks[2]+dw,r_peaks[3]-dw,r_peaks[3]+dw,r_peaks[4]-dw,r_peaks[4]+dw]) xpix=psf.x(ispec=i,wavelength=peak_wave) ypix=psf.y(ispec=i,wavelength=peak_wave) xpix_peak1=np.arange(int(round(xpix[0]))-dp,int(round(xpix[1]))+dp+1,1) ypix_peak1=np.arange(int(round(ypix[0])),int(round(ypix[1])),1) xpix_peak2=np.arange(int(round(xpix[2]))-dp,int(round(xpix[3]))+dp+1,1) ypix_peak2=np.arange(int(round(ypix[2])),int(round(ypix[3])),1) xpix_peak3=np.arange(int(round(xpix[4]))-dp,int(round(xpix[5]))+dp+1,1) ypix_peak3=np.arange(int(round(ypix[4])),int(round(ypix[5])),1) xpix_peak4=np.arange(int(round(xpix[6]))-dp,int(round(xpix[7]))+dp+1,1) ypix_peak4=np.arange(int(round(ypix[6])),int(round(ypix[7])),1) xpix_peak5=np.arange(int(round(xpix[8]))-dp,int(round(xpix[9]))+dp+1,1) ypix_peak5=np.arange(int(round(ypix[8])),int(round(ypix[9])),1) xpopt1,xpcov1=curve_fit(qalib.gauss,np.arange(len(xpix_peak1)),image.pix[int(np.mean(ypix_peak1)),xpix_peak1]) wpopt1,wpcov1=curve_fit(qalib.gauss,np.arange(len(ypix_peak1)),image.pix[ypix_peak1,int(np.mean(xpix_peak1))]) xpopt2,xpcov2=curve_fit(qalib.gauss,np.arange(len(xpix_peak2)),image.pix[int(np.mean(ypix_peak2)),xpix_peak2]) wpopt2,wpcov2=curve_fit(qalib.gauss,np.arange(len(ypix_peak2)),image.pix[ypix_peak2,int(np.mean(xpix_peak2))]) xpopt3,xpcov3=curve_fit(qalib.gauss,np.arange(len(xpix_peak3)),image.pix[int(np.mean(ypix_peak3)),xpix_peak3]) wpopt3,wpcov3=curve_fit(qalib.gauss,np.arange(len(ypix_peak3)),image.pix[ypix_peak3,int(np.mean(xpix_peak3))]) xpopt4,xpcov4=curve_fit(qalib.gauss,np.arange(len(xpix_peak4)),image.pix[int(np.mean(ypix_peak4)),xpix_peak4]) wpopt4,wpcov4=curve_fit(qalib.gauss,np.arange(len(ypix_peak4)),image.pix[ypix_peak4,int(np.mean(xpix_peak4))]) xpopt5,xpcov5=curve_fit(qalib.gauss,np.arange(len(xpix_peak5)),image.pix[int(np.mean(ypix_peak5)),xpix_peak5]) wpopt5,wpcov5=curve_fit(qalib.gauss,np.arange(len(ypix_peak5)),image.pix[ypix_peak5,int(np.mean(xpix_peak5))]) xsigma1=np.abs(xpopt1[2]) wsigma1=np.abs(wpopt1[2]) xsigma2=np.abs(xpopt2[2]) wsigma2=np.abs(wpopt2[2]) xsigma3=np.abs(xpopt3[2]) wsigma3=np.abs(wpopt3[2]) xsigma4=np.abs(xpopt4[2]) wsigma4=np.abs(wpopt4[2]) xsigma5=np.abs(xpopt5[2]) wsigma5=np.abs(wpopt5[2]) xsig=np.array([xsigma1,xsigma2,xsigma3,xsigma4,xsigma5]) wsig=np.array([wsigma1,wsigma2,wsigma3,wsigma4,wsigma5]) xsigma_avg=np.mean(xsig) wsigma_avg=np.mean(wsig) xsigma.append(xsigma_avg) wsigma.append(wsigma_avg) if camera[0]=="z": peak_wave=np.array([z_peaks[0]-dw,z_peaks[0]+dw,z_peaks[1]-dw,z_peaks[1]+dw,z_peaks[2]-dw,z_peaks[2]+dw,z_peaks[3]-dw,z_peaks[3]+dw]) xpix=psf.x(ispec=i,wavelength=peak_wave) ypix=psf.y(ispec=i,wavelength=peak_wave) xpix_peak1=np.arange(int(round(xpix[0]))-dp,int(round(xpix[1]))+dp+1,1) ypix_peak1=np.arange(int(round(ypix[0])),int(round(ypix[1])),1) xpix_peak2=np.arange(int(round(xpix[2]))-dp,int(round(xpix[3]))+dp+1,1) ypix_peak2=np.arange(int(round(ypix[2])),int(round(ypix[3])),1) xpix_peak3=np.arange(int(round(xpix[4]))-dp,int(round(xpix[5]))+dp+1,1) ypix_peak3=np.arange(int(round(ypix[4])),int(round(ypix[5])),1) xpix_peak4=np.arange(int(round(xpix[6]))-dp,int(round(xpix[7]))+dp+1,1) ypix_peak4=np.arange(int(round(ypix[6])),int(round(ypix[7])),1) xpopt1,xpcov1=curve_fit(qalib.gauss,np.arange(len(xpix_peak1)),image.pix[int(np.mean(ypix_peak1)),xpix_peak1]) wpopt1,wpcov1=curve_fit(qalib.gauss,np.arange(len(ypix_peak1)),image.pix[ypix_peak1,int(np.mean(xpix_peak1))]) xpopt2,xpcov2=curve_fit(qalib.gauss,np.arange(len(xpix_peak2)),image.pix[int(np.mean(ypix_peak2)),xpix_peak2]) wpopt2,wpcov2=curve_fit(qalib.gauss,np.arange(len(ypix_peak2)),image.pix[ypix_peak2,int(np.mean(xpix_peak2))]) xpopt3,xpcov3=curve_fit(qalib.gauss,np.arange(len(xpix_peak3)),image.pix[int(np.mean(ypix_peak3)),xpix_peak3]) wpopt3,wpcov3=curve_fit(qalib.gauss,np.arange(len(ypix_peak3)),image.pix[ypix_peak3,int(np.mean(xpix_peak3))]) xpopt4,xpcov4=curve_fit(qalib.gauss,np.arange(len(xpix_peak4)),image.pix[int(np.mean(ypix_peak4)),xpix_peak4]) wpopt4,wpcov4=curve_fit(qalib.gauss,np.arange(len(ypix_peak4)),image.pix[ypix_peak4,int(np.mean(xpix_peak4))]) xsigma1=np.abs(xpopt1[2]) wsigma1=np.abs(wpopt1[2]) xsigma2=np.abs(xpopt2[2]) wsigma2=np.abs(wpopt2[2]) xsigma3=np.abs(xpopt3[2]) wsigma3=np.abs(wpopt3[2]) xsigma4=np.abs(xpopt4[2]) wsigma4=np.abs(wpopt4[2]) xsig=np.array([xsigma1,xsigma2,xsigma3,xsigma4]) wsig=np.array([wsigma1,wsigma2,wsigma3,wsigma4]) xsigma_avg=np.mean(xsig) wsigma_avg=np.mean(wsig) xsigma.append(xsigma_avg) wsigma.append(wsigma_avg) if fibermap['OBJTYPE'][i]=='SKY': xsigma_sky=xsigma wsigma_sky=wsigma if amps: if fibermap['FIBER'][i]<240: if camera[0]=="b": xsig_amp1=np.array([xsigma1]) xsig_amp3=np.array([xsigma2,xsigma3]) wsig_amp1=np.array([wsigma1]) wsig_amp3=np.array([wsigma2,wsigma3]) if camera[0]=="r": xsig_amp1=np.array([xsigma1,xsigma2]) xsig_amp3=np.array([xsigma3,xsigma4,xsigma5]) wsig_amp1=np.array([wsigma1,wsigma2]) wsig_amp3=np.array([wsigma3,wsigma4,wsigma5]) if camera[0]=="z": xsig_amp1=np.array([xsigma1,xsigma2,xsigma3]) xsig_amp3=np.array([xsigma4]) wsig_amp1=np.array([wsigma1,wsigma2,wsigma3]) wsig_amp3=np.array([wsigma4]) xsigma_amp1.append(xsig_amp1) wsigma_amp1.append(wsig_amp1) xsigma_amp3.append(xsig_amp3) wsigma_amp3.append(wsig_amp3) if fibermap['FIBER'][i]>260: if camera[0]=="b": xsig_amp2=np.array([xsigma1]) xsig_amp4=np.array([xsigma2,xsigma3]) wsig_amp2=np.array([wsigma1]) wsig_amp4=np.array([wsigma2,wsigma3]) if camera[0]=="r": xsig_amp2=np.array([xsigma1,xsigma2]) xsig_amp4=np.array([xsigma3,xsigma4,xsigma5]) wsig_amp2=np.array([wsigma1,wsigma2]) wsig_amp4=np.array([wsigma3,wsigma4,wsigma5]) if camera[0]=="z": xsig_amp2=np.array([xsigma1,xsigma2,xsigma3]) xsig_amp4=np.array([xsigma4]) wsig_amp2=np.array([wsigma1,wsigma2,wsigma3]) wsig_amp4=np.array([wsigma4]) xsigma_amp2.append(xsig_amp2) wsigma_amp2.append(wsig_amp2) xsigma_amp4.append(xsig_amp4) wsigma_amp4.append(wsig_amp4) if fibermap['FIBER'].shape[0]<260: xsigma_amp2=np.zeros(len(xsigma)) xsigma_amp4=np.zeros(len(xsigma)) wsigma_amp2=np.zeros(len(wsigma)) wsigma_amp4=np.zeros(len(wsigma)) xsigma=np.array(xsigma) wsigma=np.array(wsigma) xsigma_med=np.median(xsigma) wsigma_med=np.median(wsigma) xsigma_med_sky=np.median(xsigma_sky) wsigma_med_sky=np.median(wsigma_sky) xwsigma=np.array([xsigma_med_sky,wsigma_med_sky]) xamp1_med=np.median(xsigma_amp1) xamp2_med=np.median(xsigma_amp2) xamp3_med=np.median(xsigma_amp3) xamp4_med=np.median(xsigma_amp4) wamp1_med=np.median(wsigma_amp1) wamp2_med=np.median(wsigma_amp2) wamp3_med=np.median(wsigma_amp3) wamp4_med=np.median(wsigma_amp4) xsigma_amp=np.array([xamp1_med,xamp2_med,xamp3_med,xamp4_med]) wsigma_amp=np.array([wamp1_med,wamp2_med,wamp3_med,wamp4_med]) xshift=0.0 wshift=0.0 xshift_fib=[] wshift_fib=[] xshift_amp=[] wshift_amp=[] shift_warn=[] retval["PARAMS"] = param if "REFERENCE" in kwargs: retval['PARAMS']['XWSIGMA_REF']=kwargs["REFERENCE"] shift_err='NORMAL' if amps: # retval["METRICS"]={"RA":ra,"DEC":dec, "XSIGMA":xsigma,"XSIGMA_MED":xsigma_med,"XSIGMA_AMP":xsigma_amp,"XSIGMA_MED_SKY":xsigma_med_sky,"XSHIFT":xshift,"XSHIFT_FIB":xshift_fib,"XSHIFT_AMP":xshift_amp,"WSIGMA":wsigma,"WSIGMA_MED":wsigma_med,"WSIGMA_AMP":wsigma_amp,"WSIGMA_MED_SKY":wsigma_med_sky,"WSHIFT":wshift,"WSHIFT_FIB":wshift_fib,"WSHIFT_AMP":wshift_amp,"XWSIGMA":xwsigma} retval["METRICS"]={"RA":ra,"DEC":dec, "XSIGMA":xsigma,"XSIGMA_MED":xsigma_med,"XSIGMA_AMP":xsigma_amp,"XSHIFT":xshift,"XSHIFT_FIB":xshift_fib,"XSHIFT_AMP":xshift_amp,"WSIGMA":wsigma,"WSIGMA_MED":wsigma_med,"WSIGMA_AMP":wsigma_amp,"WSHIFT":wshift,"WSHIFT_FIB":wshift_fib,"WSHIFT_AMP":wshift_amp,"XWSIGMA":xwsigma,"XWSIGMA_STAT":shift_err} else: # retval["METRICS"]={"RA":ra,"DEC":dec, "XSIGMA":xsigma,"XSIGMA_MED":xsigma_med,"XSIGMA_MED_SKY":xsigma_med_sky,"XSHIFT":xshift,"XSHIFT_FIB":xshift_fib,"WSIGMA":wsigma,"WSIGMA_MED":wsigma_med,"WSIGMA_MED_SKY":wsigma_med_sky,"WSHIFT":wshift,"WSHIFT_FIB":wshift_fib,"XWSIGMA":xwsigma} retval["METRICS"]={"RA":ra,"DEC":dec, "XSIGMA":xsigma,"XSIGMA_MED":xsigma_med,"XSIGMA_MED_SKY":xsigma_med_sky,"XSHIFT":xshift,"XSHIFT_FIB":xshift_fib,"WSIGMA":wsigma,"WSIGMA_MED":wsigma_med,"WSIGMA_MED_SKY":wsigma_med_sky,"WSHIFT":wshift,"WSHIFT_FIB":wshift_fib,"XWSIGMA_STAT":shift_err} #- http post if needed if qlf: qlf_post(retval) if qafile is not None: outfile = qa.write_qa_ql(qafile,retval) log.debug("Output QA data is in {}".format(outfile)) if qafig is not None: from lvmspec.qa.qa_plots_ql import plot_XWSigma plot_XWSigma(retval,qafig) log.debug("Output QA fig {}".format(qafig)) return retval def get_default_config(self): return {} class Bias_From_Overscan(MonitoringAlg): def __init__(self,name,config,logger=None): if name is None or name.strip() == "": name="BIAS_OVERSCAN" import astropy rawtype=astropy.io.fits.hdu.hdulist.HDUList kwargs=config['kwargs'] parms=kwargs['param'] key=kwargs['refKey'] if 'refKey' in kwargs else "BIAS_AMP" status=kwargs['statKey'] if 'statKey' in kwargs else "BIAS_STAT" kwargs["SAMI_RESULTKEY"]=key kwargs["SAMI_QASTATUSKEY"]=status if "ReferenceMetrics" in kwargs: r=kwargs["ReferenceMetrics"] if key in r: kwargs["REFERENCE"]=r[key] if "BIAS_WARN_RANGE" in parms and "BIAS_NORMAL_RANGE" in parms: kwargs["RANGES"]=[(np.asarray(parms["BIAS_WARN_RANGE"]),QASeverity.WARNING), (np.asarray(parms["BIAS_NORMAL_RANGE"]),QASeverity.NORMAL)]# sorted by most severe to least severe MonitoringAlg.__init__(self,name,rawtype,config,logger) def run(self,*args,**kwargs): if len(args) == 0 : raise qlexceptions.ParameterException("Missing input parameter") if not self.is_compatible(type(args[0])): raise qlexceptions.ParameterException("Incompatible input. Was expecting {} got {}".format(type(self.__inpType__),type(args[0]))) input_raw=args[0] camera=kwargs["camera"] paname=None if "paname" in kwargs: paname=kwargs["paname"] if "ReferenceMetrics" in kwargs: refmetrics=kwargs["ReferenceMetrics"] else: refmetrics=None amps=False if "amps" in kwargs: amps=kwargs["amps"] if "param" in kwargs: param=kwargs["param"] else: param=None if "qlf" in kwargs: qlf=kwargs["qlf"] else: qlf=False if "qafile" in kwargs: qafile = kwargs["qafile"] else: qafile = None if "qafig" in kwargs: qafig=kwargs["qafig"] else: qafig=None return self.run_qa(input_raw,camera,paname=paname,amps=amps, qafile=qafile,qafig=qafig, param=param, qlf=qlf, refmetrics=refmetrics) def run_qa(self,raw,camera,paname=None,amps=False,qafile=None,qafig=None, param=None, qlf=False, refmetrics=None): rawimage=raw[camera.upper()].data header=raw[camera.upper()].header retval={} retval["EXPID"]= '{0:08d}'.format(header["EXPID"]) retval["CAMERA"] = camera retval["PANAME"] = paname retval["QATIME"] = datetime.datetime.now().isoformat() retval["FLAVOR"] = header["FLAVOR"] if retval["FLAVOR"] == 'arc': pass else: retval["PROGRAM"] = header["PROGRAM"] retval["NIGHT"] = header["NIGHT"] kwargs=self.config['kwargs'] rawimage=raw[camera.upper()].data header=raw[camera.upper()].header if 'INHERIT' in header and header['INHERIT']: h0 = raw[0].header for key in h0: if key not in header: header[key] = h0[key] data=[] row_data_amp1=[] row_data_amp2=[] row_data_amp3=[] row_data_amp4=[] bias_overscan=[] for kk in ['1','2','3','4']: from lvmspec.preproc import _parse_sec_keyword sel=_parse_sec_keyword(header['BIASSEC'+kk]) #- Obtain counts/second in bias region pixdata=rawimage[sel]/header["EXPTIME"] if kk == '1': for i in range(pixdata.shape[0]): row_amp1=pixdata[i] row_data_amp1.append(row_amp1) if kk == '2': for i in range(pixdata.shape[0]): row_amp2=pixdata[i] row_data_amp2.append(row_amp2) if kk == '3': for i in range(pixdata.shape[0]): row_amp3=pixdata[i] row_data_amp3.append(row_amp3) if kk == '4': for i in range(pixdata.shape[0]): row_amp4=pixdata[i] row_data_amp4.append(row_amp4) #- Compute statistics of the bias region that only reject # the 0.5% of smallest and largest values. (from sdssproc) isort=np.sort(pixdata.ravel()) nn=isort.shape[0] bias=np.mean(isort[int(0.005*nn) : int(0.995*nn)]) bias_overscan.append(bias) data.append(isort) row_data_bottom=[] row_data_top=[] for i in range(len(row_data_amp1)): row_data_lower=np.concatenate((row_data_amp1[i],row_data_amp2[i])) row_data_upper=np.concatenate((row_data_amp3[i],row_data_amp4[i])) row_data_bottom.append(row_data_lower) row_data_top.append(row_data_upper) row_data=np.concatenate((row_data_bottom,row_data_top)) mean_row=[] for i in range(len(row_data)): mean=np.mean(row_data[i]) mean_row.append(mean) full_data=np.concatenate((data[0],data[1],data[2],data[3])).ravel() bias=np.mean(bias_overscan) if param is None: log.debug("Param is None. Using default param instead") param = { "PERCENTILES":[68.2,95.4,99.7], "BIAS_NORMAL_RANGE":[-1.0, 1.0], "BIAS_WARN_RANGE:":[-2.0, 2.0] } sig1_lo = np.percentile(full_data,(100.-param['PERCENTILES'][0])/2.) sig1_hi = np.percentile(full_data,100.-sig1_lo) sig2_lo = np.percentile(full_data,(100.-param['PERCENTILES'][1])/2.) sig2_hi = np.percentile(full_data,100.-sig2_lo) sig3_lo = np.percentile(full_data,(100.-param['PERCENTILES'][2])/2.) sig3_hi = np.percentile(full_data,100.-sig3_lo) diff1sig = sig1_hi - sig1_lo diff2sig = sig2_hi - sig2_lo diff3sig = sig3_hi - sig3_lo sig5_value = np.percentile(full_data,100.-99.99994) data5sig = len(np.where(full_data <= sig5_value)[0]) retval["PARAMS"] = param if "REFERENCE" in kwargs: retval['PARAMS']['BIAS_AMP_REF']=kwargs["REFERENCE"] biasdiff_err='NORMAL' if amps: bias_amps=np.array(bias_overscan) # retval["METRICS"]={'BIAS':bias,'BIAS_AMP':bias_amps,"DIFF1SIG":diff1sig,"DIFF2SIG":diff2sig,"DIFF3SIG":diff3sig,"DATA5SIG":data5sig,"MEANBIAS_ROW":mean_row} retval["METRICS"]={'BIAS':bias,'BIAS_AMP':bias_amps,"DIFF1SIG":diff1sig,"DIFF2SIG":diff2sig,"DIFF3SIG":diff3sig,"DATA5SIG":data5sig,"MEANBIAS_ROW":mean_row,"BIAS_STAT":biasdiff_err} else: # retval["METRICS"]={'BIAS':bias,"DIFF1SIG":diff1sig,"DIFF2SIG":diff2sig,"DIFF3SIG":diff3sig,"DATA5SIG":data5sig,"MEANBIAS_ROW":mean_row} retval["METRICS"]={'BIAS':bias,"DIFF1SIG":diff1sig,"DIFF2SIG":diff2sig,"DIFF3SIG":diff3sig,"DATA5SIG":data5sig,"MEANBIAS_ROW":mean_row,"BIAS_STAT":biasdiff_err} #- http post if needed if qlf: qlf_post(retval) if qafile is not None: outfile = qa.write_qa_ql(qafile,retval) log.debug("Output QA data is in {}".format(outfile)) if qafig is not None: from lvmspec.qa.qa_plots_ql import plot_bias_overscan plot_bias_overscan(retval,qafig) log.debug("Output QA fig {}".format(qafig)) return retval def get_default_config(self): return {} class CountSpectralBins(MonitoringAlg): def __init__(self,name,config,logger=None): if name is None or name.strip() == "": name="COUNTBINS" from lvmspec.frame import Frame as fr kwargs=config['kwargs'] parms=kwargs['param'] key=kwargs['refKey'] if 'refKey' in kwargs else "NGOODFIB" status=kwargs['statKey'] if 'statKey' in kwargs else "NGOODFIB_STAT" kwargs["SAMI_RESULTKEY"]=key kwargs["SAMI_QASTATUSKEY"]=status if "ReferenceMetrics" in kwargs: r=kwargs["ReferenceMetrics"] if key in r: kwargs["REFERENCE"]=r[key] if "NGOODFIB_WARN_RANGE" in parms and "NGOODFIB_NORMAL_RANGE" in parms: kwargs["RANGES"]=[(
np.asarray(parms["NGOODFIB_WARN_RANGE"])
numpy.asarray
"""Toy cluttered table domain. This environment is created to test our planner's ability to handle failures reported by the environment. """ from typing import Dict, List, Optional, Sequence, Set import matplotlib import matplotlib.pyplot as plt import numpy as np from gym.spaces import Box from predicators.src import utils from predicators.src.envs import BaseEnv from predicators.src.settings import CFG from predicators.src.structs import Action, Array, GroundAtom, Object, \ ParameterizedOption, Predicate, State, Task, Type class ClutteredTableEnv(BaseEnv): """Toy cluttered table domain.""" def __init__(self) -> None: super().__init__() # Types self._can_type = Type( "can", ["pose_x", "pose_y", "radius", "is_grasped", "is_trashed"]) # Predicates self._HandEmpty = Predicate("HandEmpty", [], self._HandEmpty_holds) self._Holding = Predicate("Holding", [self._can_type], self._Holding_holds) self._Untrashed = Predicate("Untrashed", [self._can_type], self._Untrashed_holds) # Options self._Grasp = utils.SingletonParameterizedOption( "Grasp", self._Grasp_policy, types=[self._can_type], params_space=Box(0, 1, (4, ))) self._Dump = utils.SingletonParameterizedOption( "Dump", self._Dump_policy) @classmethod def get_name(cls) -> str: return "cluttered_table" def simulate(self, state: State, action: Action) -> State: assert self.action_space.contains(action.arr) next_state = state.copy() # Figure out which can is currently grasped, if any. grasped_can = None for can in state: if state.get(can, "is_grasped") > 0.5: assert grasped_can is None, "Multiple cans grasped?" assert state.get(can, "is_trashed") < 0.5, \ "Grasped a can that has been trashed?" grasped_can = can if np.all(action.arr == 0.0): # Handle dumping action. if grasped_can is not None: next_state.set(grasped_can, "pose_x", -999) next_state.set(grasped_can, "pose_y", -999) next_state.set(grasped_can, "is_grasped", 0.0) next_state.set(grasped_can, "is_trashed", 1.0) return next_state # Handle grasping action. if grasped_can is not None: return next_state # can't grasp while already grasping start_x, start_y, end_x, end_y = action.arr desired_can = None for can in state: this_x = state.get(can, "pose_x") this_y = state.get(can, "pose_y") this_radius = state.get(can, "radius") if np.linalg.norm([end_x - this_x, end_y - this_y]) < this_radius: assert desired_can is None desired_can = can if desired_can is None: return next_state # end point wasn't at any can self._check_collisions(start_x, start_y, end_x, end_y, state, desired_can) # No collisions, update state and return. next_state.set(desired_can, "is_grasped", 1.0) return next_state def _generate_train_tasks(self) -> List[Task]: return self._get_tasks(num=CFG.num_train_tasks, train_or_test="train") def _generate_test_tasks(self) -> List[Task]: return self._get_tasks(num=CFG.num_test_tasks, train_or_test="test") @property def predicates(self) -> Set[Predicate]: return {self._HandEmpty, self._Holding, self._Untrashed} @property def goal_predicates(self) -> Set[Predicate]: return {self._Holding} @property def types(self) -> Set[Type]: return {self._can_type} @property def options(self) -> Set[ParameterizedOption]: return {self._Grasp, self._Dump} @property def action_space(self) -> Box: # The action_space is 4-dimensional. The first two dimensions are the # start point of the vector corresponding to the grasp approach. The # last two dimensions are the end point. Dumping is a special action # where all 4 dimensions are 0. return Box(0, 1, (4, )) def render_state_plt( self, state: State, task: Task, action: Optional[Action] = None, caption: Optional[str] = None) -> matplotlib.figure.Figure: fig, ax = plt.subplots(1, 1) ax.set_aspect('equal') assert len(task.goal) == 1 goal_atom = next(iter(task.goal)) assert goal_atom.predicate == self._Holding assert len(goal_atom.objects) == 1 goal_can = goal_atom.objects[0] # Draw cans lw = 1 goal_color = "green" other_color = "red" lcolor = "black" for can in state: if state.get(can, "is_grasped"): circ = plt.Circle( (state.get(can, "pose_x"), state.get(can, "pose_y")), 1.75 * state.get(can, "radius"), facecolor="gray", alpha=0.5) ax.add_patch(circ) if can == goal_can: c = goal_color else: c = other_color circ = plt.Circle( (state.get(can, "pose_x"), state.get(can, "pose_y")), state.get(can, "radius"), linewidth=lw, edgecolor=lcolor, facecolor=c) ax.add_patch(circ) # Draw action if action: start_x, start_y, end_x, end_y = action.arr dx, dy = end_x - start_x, end_y - start_y arrow = plt.Arrow(start_x, start_y, dx, dy, width=0.1) ax.add_patch(arrow) plt.xlim(-0.1, 1.1) plt.ylim(-0.1, 1.1) plt.xticks([]) plt.yticks([]) if caption is not None: plt.suptitle(caption, wrap=True) plt.tight_layout() return fig def _get_tasks(self, num: int, train_or_test: str) -> List[Task]: tasks = [] cans = [] for i in range( max(CFG.cluttered_table_num_cans_train, CFG.cluttered_table_num_cans_test)): cans.append(Object(f"can{i}", self._can_type)) goal = {GroundAtom(self._Holding, [cans[0]])} for _ in range(num): tasks.append( Task(self._create_initial_state(cans, train_or_test), goal)) return tasks def _create_initial_state(self, cans: List[Object], train_or_test: str) -> State: data: Dict[Object, Array] = {} assert train_or_test in ("train", "test") if train_or_test == "train": num_cans = CFG.cluttered_table_num_cans_train rng = self._train_rng elif train_or_test == "test": num_cans = CFG.cluttered_table_num_cans_test rng = self._test_rng radius = CFG.cluttered_table_can_radius for i in range(num_cans): can = cans[i] while True: # keep cans near center of table to allow grasps from all angles pose = np.array(rng.uniform(0.25, 0.75, size=2), dtype=np.float32) if not self._any_intersection(pose, radius, data): break # [pose_x, pose_y, radius, is_grasped, is_trashed] data[can] = np.array([pose[0], pose[1], radius, 0.0, 0.0]) return State(data) @staticmethod def _HandEmpty_holds(state: State, objects: Sequence[Object]) -> bool: assert not objects for can in state: if state.get(can, "is_grasped") > 0.5: return False return True @staticmethod def _Holding_holds(state: State, objects: Sequence[Object]) -> bool: can, = objects return state.get(can, "is_grasped") > 0.5 @staticmethod def _Untrashed_holds(state: State, objects: Sequence[Object]) -> bool: can, = objects return state.get(can, "is_trashed") < 0.5 @staticmethod def _Grasp_policy(state: State, memory: Dict, objects: Sequence[Object], params: Array) -> Action: del state, memory, objects # unused return Action(params) # action is simply the parameter @staticmethod def _Dump_policy(state: State, memory: Dict, objects: Sequence[Object], params: Array) -> Action: del state, memory, objects, params # unused return Action(np.zeros(4, dtype=np.float32)) # no parameter for dumping @staticmethod def _any_intersection(pose: Array, radius: float, data: Dict[Object, Array]) -> bool: for other in data: other_feats = data[other] other_x = other_feats[0] other_y = other_feats[1] other_radius = other_feats[2] distance = np.linalg.norm([other_x - pose[0], other_y - pose[1]]) if distance <= (radius + other_radius): return True return False @staticmethod def _check_collisions(start_x: float, start_y: float, end_x: float, end_y: float, state: State, ignored_can: Optional[Object] = None) -> None: """Handle collision checking. We'll just threshold the angle between the grasp approach vector and the vector between (end_x, end_y) and any other can. Doing an actually correct geometric computation would involve the radii somehow, but we don't really care about this. The argument ignored_can is a can with which we don't care about colliding. This is generally the desired can, but when attempting to place a can, could also be the grasped can. """ vec1 = np.array([end_x - start_x, end_y - start_y]) colliding_can = None colliding_can_max_dist = float("-inf") for can in state: if can == ignored_can: continue this_x = state.get(can, "pose_x") this_y = state.get(can, "pose_y") vec2 = np.array([end_x - this_x, end_y - this_y]) angle = np.arccos( np.clip( vec1.dot(vec2) / (np.linalg.norm(vec1) *
np.linalg.norm(vec2)
numpy.linalg.norm
#! /usr/bin/env python # -*- coding:utf8 -*- # # utils_io.py # # This file is part of pyplanes, a software distributed under the MIT license. # For any question, please contact one of the authors cited below. # # Copyright (c) 2020 # <NAME> <<EMAIL>> # <NAME> <<EMAIL>> # <NAME> <<EMAIL>> # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in all # copies or substantial portions of the Software. # import socket import datetime import time import numpy as np import pyvtk from matplotlib import cm import matplotlib.pyplot as plt import matplotlib.tri as mtri from pyPLANES.fem.fem_entities_surfacic import * from pyPLANES.fem.fem_entities_volumic import * # def initialisation_out_files_plain(self): # pass from pymls import from_yaml, Solver, Layer, backing from mediapack import Air, Fluid def load_material(mat): if mat == "Air": Air_mat = Air() return Fluid(c=Air_mat.c,rho=Air_mat.rho) else: return from_yaml("materials/" + mat + ".yaml") def result_pymls(**kwargs): name_project = kwargs.get("name_project", "unnamed_project") ml = kwargs.get("ml", False) termination = kwargs.get("termination", "rigid") theta_d = kwargs.get("theta_d", 45) freq = kwargs.get("frequencies", np.array([440])) plot_RT = kwargs.get("plot_RT", False) solver = Solver() for _l in ml: mat = load_material(_l[0]) solver.layers.append(Layer(mat, _l[1])) R = [] if termination in ["rigid", "Rigid", "Rigid Wall", "Wall"]: solver.backing = backing.rigid T = False else: T = [] solver.backing = backing.transmission for _f in freq: _ = solver.solve(_f, theta_d) R.append(_["R"][0]) if termination == "transmission": T.append(_["T"][0]) if plot_RT: plt.figure(name_project + "/ Reflection coefficient") plt.plot(freq, [_.real for _ in R], 'r',label="Re(R) pymls") plt.plot(freq, [_.imag for _ in R], 'b',label="Im(R) pymls") plt.legend() if T is not False: plt.figure(name_project + "/ Transmission coefficient") plt.plot(freq, [_.real for _ in T], 'r',label="Re(T) pymls") plt.plot(freq, [_.imag for _ in T], 'b',label="Im(T) pymls") plt.legend() return freq, R, T def close_out_files(self): duration = time.time()-self.start_time self.info_file.write("Calculus ended at %s.\n"%(datetime.datetime.now())) self.info_file.write("Total duration = {} s\n".format(duration)) self.info_file.write("duration / freq (averaged) = {} s\n".format(duration/len(self.frequencies))) self.out_file.close() self.info_file.close() def print_entities(self): for _ in self.entities: print(_) def print_elements(self): for _ in self.elements[1:]: print(_) def print_vertices(self): for _ in self.vertices[1:]: print(_) def print_edges(self): for _ in self.edges: print(_) def print_faces(self): for _ in self.faces: print(_) def print_model_entities(self): for _ in self.model_entities: print(_) def print_reference_elements(self): print(self.reference_elements) def plot_fem_solution(self, kx=0.): if self.plot[5]: # Determination of the maximum value of the pressure p_max = 0 p_min = 1e308 for _en in self.entities: if isinstance(_en, FluidFem): for _elem in _en.elements: _, __, p_elem = _elem.display_sol(3) _max = np.amax(np.abs(p_elem)) _min = np.amin(np.abs(p_elem)) if _max >p_max: p_max = _max if _min <p_min: p_min = _min if any(self.plot[3:]): x, y, u_x, u_y, pr = [], [], [], [], [] for _en in self.entities: if isinstance(_en, FluidFem): if any(self.plot[2::3]): # Plot of pressure == True for ie, _elem in enumerate(_en.elements): # print(ie/len(_en.elements)) x_elem, y_elem, p_elem = _elem.display_sol(3) p_elem = p_elem[:, 0] p_elem *= np.exp(1j*kx*x_elem) if self.plot[2]: plt.figure("Pressure") plt.plot(y_elem, np.abs(p_elem), 'r+') plt.plot(y_elem, np.imag(p_elem), 'm.') if self.plot[5]: triang = mtri.Triangulation(x_elem, y_elem) plt.figure("Pressure map") plt.tricontourf(triang, np.abs(p_elem), cmap=cm.jet, levels=np.linspace(p_min, p_max,40)) # x.extend(list(x_elem)) # y.extend(list(y_elem)) # pr.extend(list(p_elem)) elif isinstance(_en, PemFem): if any(self.plot): # Plot of pressure == True for _elem in _en.elements: x_elem, y_elem, f_elem = _elem.display_sol([0, 1, 3]) ux_elem = f_elem[:, 0]*np.exp(1j*kx*x_elem) uy_elem = f_elem[:, 1]*np.exp(1j*kx*x_elem) p_elem = f_elem[:, 2]*
np.exp(1j*kx*x_elem)
numpy.exp
import pytest import numpy as np from cascade import kappa from cascade import group_offsets from cascade import Cascade from cascade import ScoreType from cascade import IndicatorType import factories import fixtures np.random.seed(42) def test_kappa_with_empy_qid(): qid = np.array([]) cutoff = 5 assert [] == kappa([], cutoff, qid) def _make_query_data(num_queries=1, depth=5, random_depth=False): queries = np.random.choice(list(range(num_queries)), num_queries, replace=False) scores = np.random.uniform(low=0., high=10., size=num_queries * depth) qid = [] for x in queries: qid += [x] * depth return scores, np.array(qid) def test_kappa_when_query_equals_cutoff(): cutoff = 5 query_depth = 5 scores, qid = _make_query_data(depth=query_depth) topk = sorted(scores, reverse=True) res = kappa(scores, cutoff, qid) np.testing.assert_almost_equal(res, np.full_like(res, topk[cutoff - 1])) def test_kappa_score_when_query_shorter_than_cutoff(): cutoff = 10 query_depth = 5 scores, qid = _make_query_data(depth=query_depth) topk = sorted(scores, reverse=True) res = kappa(scores, cutoff, qid) np.testing.assert_almost_equal(res, np.full_like(res, topk[query_depth - 1])) def test_kappa_score_when_query_longer_than_cutoff(): cutoff = 5 query_depth = 10 scores, qid = _make_query_data(depth=query_depth) topk = sorted(scores, reverse=True) res = kappa(scores, cutoff, qid) np.testing.assert_almost_equal(res, np.full_like(res, topk[cutoff - 1])) def test_single_stage_cascade_resets_predict_attributes(): cascade = factories.dummy_cascade() cascade.predict_reset() for ranker in cascade: assert None == ranker.predict assert None == ranker.kappa assert None == ranker.mask assert None == ranker.estimate def test_cascade_first_stage_has_no_score_mask(): X, _, qid = fixtures.train_data() cascade = factories.cascade(num_stages=1, cutoffs=[5]) ranker = cascade.rankers[0] cascade.predict(X, qid) assert Cascade.SCORE_MASK not in ranker.predict def test_cascade_first_stage_applies_cutoff(): X, _, qid = fixtures.train_data() cascade = factories.cascade(num_stages=1, cutoffs=[2]) ranker = cascade.rankers[0] ranker.booster.update() offsets = group_offsets(qid) a, b = next(offsets) cascade.predict(X, qid) expected = (b - a) * [0.01948363] np.testing.assert_almost_equal(ranker.kappa[a:b], expected) def test_cascade_first_stage_applies_mask(): X, _, qid = fixtures.train_data() cascade = factories.cascade(num_stages=1, cutoffs=[2]) ranker = cascade.rankers[0] ranker.booster.update() offsets = group_offsets(qid) a, b = next(offsets) cascade.predict(X, qid) expected = [0, 0, 1, 1, 0] np.testing.assert_almost_equal(ranker.mask[a:b], expected) def test_cascade_second_stage_applies_cutoff(): X, _, qid = fixtures.train_data() cascade = factories.cascade(num_stages=2, cutoffs=[4, 2]) cascade.update() ranker_two = cascade.rankers[1] offsets = group_offsets(qid) a, b = next(offsets) cascade.predict(X, qid) topk = sorted(ranker_two.predict[a:b], reverse=True) expected = (b - a) * [topk[1]] np.testing.assert_almost_equal(ranker_two.kappa[a:b], expected) def test_cascade_second_stage_applies_mask(): X, _, qid = fixtures.train_data() cascade = factories.cascade(num_stages=2, cutoffs=[4, 2]) cascade.update() ranker_one = cascade.rankers[0] ranker_two = cascade.rankers[1] offsets = group_offsets(qid) a, b = next(offsets) cascade.predict(X, qid) expected = [1, 0, 1, 1, 1] np.testing.assert_almost_equal(ranker_one.mask[a:b], expected) expected = [0, 0, 1, 1, 0] np.testing.assert_almost_equal(ranker_two.mask[a:b], expected) def test_cascade_score_mask_does_not_appear_in_first_stage(): X, _, qid = fixtures.train_data() cascade = factories.cascade(num_stages=2, cutoffs=[4, 2]) cascade.update() ranker_one = cascade.rankers[0] ranker_two = cascade.rankers[1] offsets = group_offsets(qid) a, b = next(offsets) cascade.predict(X, qid, is_train=True) assert Cascade.SCORE_MASK not in ranker_one.predict def test_cascade_uses_score_mask(): """As per previous implementation, always use the SCORE_MASK during predict regardless of whether we are doing training or inference. """ X, _, qid = fixtures.train_data() cascade = factories.cascade(num_stages=2, cutoffs=[4, 2]) cascade.update() ranker_one = cascade.rankers[0] ranker_two = cascade.rankers[1] offsets = group_offsets(qid) a, b = next(offsets) for is_train in [True, False]: cascade.predict(X, qid, is_train=is_train) assert Cascade.SCORE_MASK in ranker_two.predict def test_cascade_computed_kappa_when_training(): qid = np.array([1, 1, 1, 1, 1]) offsets = group_offsets(qid) a, b = next(offsets) cascade = factories.dummy_cascade() ranker = factories.ranker() ranker.cutoff = 2 prev_mask = [1, 1, 0, 1, 1] scores = np.array([0.1, 1.0, -0.03, 0.5, 0.25]) ranker.predict = np.copy(scores) # according to previous mask ranker.predict[2] = Cascade.SCORE_MASK scores = cascade.ranker_apply_cutoff(ranker, scores, prev_mask, qid, is_train=True) expected = [0.5] * 5 np.testing.assert_almost_equal(ranker.kappa[a:b], expected) assert scores is not ranker.predict def test_cascade_computed_kappa_when_inference(): qid = np.array([1, 1, 1, 1, 1]) offsets = group_offsets(qid) a, b = next(offsets) cascade = factories.dummy_cascade() ranker = factories.ranker() ranker.cutoff = 2 prev_mask = [1, 1, 0, 1, 1] # put 10. to test if SCORE_MASK is used in `ranker_apply_cutoff` scores = np.array([0.1, 1.0, 10., 0.5, 0.25]) ranker.predict = np.copy(scores) # according to previous mask ranker.predict[2] = Cascade.SCORE_MASK scores = cascade.ranker_apply_cutoff(ranker, scores, prev_mask, qid, is_train=False) expected = [0.5] * 5 np.testing.assert_almost_equal(ranker.kappa[a:b], expected) assert scores is ranker.predict def test_cascade_first_stage_score_any_type(): cascade = factories.cascade(num_stages=1, cutoffs=[4]) for name, member in ScoreType.__members__.items(): if member.name != name: # skip alias names continue cascade.set_score_type(name) ranker_one = cascade.rankers[0] cascade.ranker_score(ranker_one) assert ranker_one.predict is ranker_one.estimate def test_cascade_second_stage_score_independent_type(): cascade = factories.cascade(num_stages=2, cutoffs=[4, 2]) cascade.set_score_type('independent') ranker_one = cascade.rankers[0] ranker_one.mask = np.array([1, 1, 1, 1, 0]) ranker_one.estimate = np.array([4., 3., 2., 1., 0.]) ranker_two = cascade.rankers[1] ranker_two.predict =
np.array([5., 5., 5., 5., 5.])
numpy.array
import numpy as np import numpy.linalg as la import subprocess as sub import itertools as itt import sys import time import uuid from pathlib import Path from .Fragments import Fragments from .Potential import * from .MBE_Potential import MBE_Potential from .read_geometries import read_geoms class Constants: """Helps me keep track of constants and conversions, originally written by Mark (b3m2a1).""" atomic_units = { "wavenumbers" : 4.55634e-6, "angstroms" : 1/0.529177, "amu" : 1.000000000000000000/6.02213670000e23/9.10938970000e-28 #1822.88839 g/mol -> a.u. } masses = { "H" : ( 1.00782503223, "amu"), "O" : (15.99491561957, "amu"), "D" : (2.0141017778,"amu"), "C" : (11.9999999958,"amu"), "N" : (14.003074,"amu") } @classmethod def convert(cls, val, unit, to_AU = True): vv = cls.atomic_units[unit] return (val * vv) if to_AU else (val / vv) @classmethod def mass(cls, atom, to_AU = True): m = cls.masses[atom] if to_AU: m = cls.convert(*m) return m class HarmonicAnalysis: def __init__(self,eqGeom,atoms,potential,dx=1.0e-3,ofile=None): self.eqGeom = eqGeom self.atoms = atoms self.potential = potential self.dx = dx self.ofile=ofile self.nEls = 3 * len(self.atoms) def genStencil(self,dispTup,dim): cds = self.eqGeom dx = self.dx if dim == 1: """Generates 5-point 1D stencil for finite difference""" atm = dispTup[0] #atom of interest cd = dispTup[1] #x,y, or z stnShape = np.concatenate(([5],
np.shape(cds)
numpy.shape
# -*- coding: ISO-8859-1 -*- #----------------------------------------------------------------------------- # Copyright (c) 2014, HFTools Development Team. # # Distributed under the terms of the Modified BSD License. # # The full license is in the file COPYING.txt, distributed with this software. #----------------------------------------------------------------------------- u""" dim ======== .. autoclass:: DimBase """ import datetime import numpy as np import six from hftools.utils import is_numlike, is_integer, deprecate from hftools.py3compat import integer_types def dims_has_complex(dims): for dim in reversed(dims): dims = (ComplexDerivAxis, ComplexIndepAxis, ComplexDiagAxis) if isinstance(dim, dims): return True return False def info_has_complex(info): deprecate("info_has_complex is deprecated") return dims_has_complex(info) def flatten(sequence): for item in sequence: if isinstance(item, (list, tuple)): for subitem in flatten(item): yield subitem else: yield item class DimBase(object): sortprio = 0 def __init__(self, Name, data=None, unit=None, name=None, outputformat=None): if isinstance(Name, DimBase): dim_data = Name.data dim_name = Name.name dim_unit = Name.unit dim_outputformat = Name.outputformat else: dim_data = data dim_name = Name dim_unit = unit dim_outputformat = outputformat if data is not None: dim_data = data if unit is not None: dim_unit = unit if name is not None: dim_name = name if outputformat is not None: dim_outputformat = outputformat if isinstance(dim_data, integer_types): dim_data = list(range(dim_data)) if hasattr(dim_data, "tolist"): dim_data = [dim_data.tolist()] if not isinstance(dim_data, (list, tuple)): dim_data = list(dim_data) self._data = tuple(flatten(dim_data)) self._name = dim_name self._unit = dim_unit self._outputformat = dim_outputformat @property def data(self): if len(self._data) == 0: d =
np.array([])
numpy.array
import numpy as np from abc import ABC, abstractmethod from gym.spaces import Dict class AbstractEnvRunner(ABC): def __init__(self, *, env, model, nsteps): self.env = env self.model = model self.nenv = nenv = env.num_envs if hasattr(env, 'num_envs') else 1 if isinstance(env.observation_space, Dict): if 'depth' in env.observation_space.spaces: self.batch_ob_shape = ( (nenv*nsteps,) + env.observation_space.spaces['depth'].shape, (nenv*nsteps,) + env.observation_space.spaces['pointgoal'].shape ) self.obs = ( np.zeros((nenv,) + env.observation_space.spaces['depth'].shape, dtype=env.observation_space.spaces['depth'].dtype.name), np.zeros((nenv,) + env.observation_space.spaces['pointgoal'].shape, dtype=env.observation_space.spaces['pointgoal'].dtype.name) ) obs_reset = env.reset() batch_depth = [] batch_goal = [] for xb in range(len(obs_reset)): batch_depth.append(obs_reset[xb]['depth']) batch_goal.append(obs_reset[xb]['pointgoal']) batch_depth = np.array(batch_depth) batch_goal =
np.array(batch_goal)
numpy.array
#!/usr/bin/env python3 # -*- coding: utf-8 -*- # Created on Sun Dec 30 12:02:12 2018 # ppdire - Projection pursuit dimension reduction # @author: <NAME> (Ponalytics) #from .dicomo import dicomo import numpy as np from statsmodels.regression.quantile_regression import QuantReg import statsmodels.robust as srs import scipy.stats as sps from scipy.linalg import pinv2 from scipy.optimize import minimize import copy from sklearn.utils.metaestimators import _BaseComposition from sklearn.base import RegressorMixin,BaseEstimator,TransformerMixin, defaultdict from sklearn.utils.extmath import svd_flip from ..sprm.rm import rm from ..preprocessing.robcent import VersatileScaler import warnings from ..dicomo.dicomo import dicomo from ..dicomo._dicomo_utils import * from .capi import capi from ._ppdire_utils import * from ..preprocessing._preproc_utilities import scale_data from ..utils.utils import MyException, convert_X_input, convert_y_input import inspect class ppdire(_BaseComposition,BaseEstimator,TransformerMixin,RegressorMixin): """ PPDIRE Projection Pursuit Dimension Reduction The class allows for calculation of the projection pursuit optimization either through `scipy.optimize` or through the grid algorithm, native to this package. The class provides a very flexible way to access optimization of projection indices that can lead to either classical or robust dimension reduction. Optimization through scipy.optimize is much more efficient, yet it will only provide correct results for classical projection indices. The native grid algorithm should be used when the projection index involves order statistics of any kind, such as ranks, trimming, winsorizing, or empirical quantiles. The grid optimization algorithm for projection pursuit implemented here, was outlined in: <NAME>., <NAME>., <NAME>. and <NAME>., Robust multivariate methods: The projection pursuit approach, in: From Data and Information Analysis to Knowledge Engineering, Spiliopoulou, M., <NAME>., <NAME>., <NAME>. and <NAME>., eds., Springer Verlag, Berlin, Germany, 2006, pages 270--277. Parameters ------------ projection_index : function or class. dicomo and capi supplied in this package can both be used, but user defined projection indices can be processed ball covariance can be used. pi_arguments : dict arguments to be passed on to projection index n_components : int number of components to estimate trimming : float trimming percentage to be entered as pct/100 alpha : float. Continuum coefficient. Only relevant if ppdire is used to estimate (classical or robust) continuum regression optimizer : str. Presently: either 'grid' (native optimizer) or any of the options in scipy-optimize (e.g. 'SLSQP') optimizer_options : dict with options to pass on to the optimizer If optimizer == 'grid', ndir: int: Number of directions to calculate per iteration. maxiter: int. Maximal number of iterations. optimizer_constraints : dict or list of dicts, further constraints to be passed on to the optimizer function. regopt : str. regression option for regression step y~T. Can be set to 'OLS' (default), 'robust' (will run sprm.rm) or 'quantile' (statsmodels.regression.quantreg). center : str, how to center the data. options accepted are options from sprm.preprocessing center_data : bool scale_data : bool. Note: if set to False, convergence to correct optimum is not a given. Will throw a warning. whiten_data : bool. Typically used for ICA (kurtosis as PI) square_pi : bool. Whether to square the projection index upon evaluation. compression : bool. Use internal data compresion step for flat data. copy : bool. Whether to make a deep copy of the input data or not. verbose : bool. Set to True prints the iteration number. return_scaling_object : bool. If True, the rescaling object will be returned. Attributes ------------ Attributes always provided - `x_weights_`: X block PPDIRE weighting vectors (usually denoted W) - `x_loadings_`: X block PPDIRE loading vectors (usually denoted P) - `x_scores_`: X block PPDIRE score vectors (usually denoted T) - `x_ev_`: X block explained variance per component - `x_Rweights_`: X block SIMPLS style weighting vectors (usually denoted R) - `x_loc_`: X block location estimate - `x_sca_`: X block scale estimate - `crit_values_`: vector of evaluated values for the optimization objective. - `Maxobjf_`: vector containing the optimized objective per component. Attributes created when more than one block of data is provided: - `C_`: vector of inner relationship between response and latent variables block - `coef_`: vector of regression coefficients, if second data block provided - `intercept_`: intercept - `coef_scaled_`: vector of scaled regression coefficients (when scaling option used) - `intercept_scaled_`: scaled intercept - `residuals_`: vector of regression residuals - `y_ev_`: y block explained variance - `fitted_`: fitted response - `y_loc_`: y location estimate - `y_sca_`: y scale estimate Attributes created only when corresponding input flags are `True`: - `whitening_`: whitened data matrix (usually denoted K) - `mixing_`: mixing matrix estimate - `scaling_object_`: scaling object from `VersatileScaler` """ def __init__(self, projection_index, pi_arguments = {}, n_components = 1, trimming = 0, alpha = 1, optimizer = 'SLSQP', optimizer_options = {'maxiter': 100000}, optimizer_constraints = {}, regopt = 'OLS', center = 'mean', center_data=True, scale_data=True, whiten_data=False, square_pi = False, compression = False, copy=True, verbose=True, return_scaling_object=True): # Called arguments self.projection_index = projection_index self.pi_arguments = pi_arguments self.n_components = n_components self.trimming = trimming self.alpha = alpha self.optimizer = optimizer self.optimizer_options = optimizer_options self.optimizer_constraints = optimizer_constraints self.regopt = regopt self.center = center self.center_data = center_data self.scale_data = scale_data self.whiten_data = whiten_data self.square_pi = square_pi self.compression = compression self.copy = copy self.verbose = verbose self.return_scaling_object = return_scaling_object # Other global parameters self.constraint = 'norm' self.optrange = (-1,1) self.licenter = ['mean','median'] if not(self.center in self.licenter): raise(ValueError('Only location estimator classes allowed are: "mean", "median"')) def fit(self,X,*args,**kwargs): """ Fit a projection pursuit dimension reduction model. Parameters ------------ X : numpy array Input data. """ # Collect optional fit arguments biascorr = kwargs.pop('biascorr',False) if 'h' not in kwargs: h = self.n_components else: h = kwargs.pop('h') self.n_components = h if 'dmetric' not in kwargs: dmetric = 'euclidean' else: dmetric = kwargs.get('dmetric') if 'mixing' not in kwargs: mixing = False else: mixing = kwargs.get('mixing') if 'y' not in kwargs: na = len(args) if na > 0: #Use of *args makes it sklearn consistent flag = 'two-block' y = args[0] else: flag = 'one-block' y = 0 # to allow calls with 'y=y' in spit of no real y argument present else: flag = 'two-block' y = kwargs.get('y') if 'quantile' not in kwargs: quantile = .5 else: quantile = kwargs.get('quantile') if self.regopt == 'robust': if 'fun' not in kwargs: fun = 'Hampel' else: fun = kwargs.get('fun') if 'probp1' not in kwargs: probp1 = 0.95 else: probp1 = kwargs.get('probp1') if 'probp2' not in kwargs: probp2 = 0.975 else: probp2 = kwargs.get('probp2') if 'probp3' not in kwargs: probp3 = 0.99 else: probp3 = kwargs.get('probp3') if self.projection_index == dicomo: if self.pi_arguments['mode'] in ('M3','cos','cok'): if 'option' not in kwargs: option = 1 else: option = kwargs.get('option') if option > 3: print('Option value >3 will compute results, but meaning may be questionable') # Initiate projection index self.most = self.projection_index(**self.pi_arguments) # Initiate some parameters and data frames if self.copy: X0 = copy.deepcopy(X) self.X0 = X0 else: X0 = X X = convert_X_input(X0) n,p = X0.shape trimming = self.trimming # Check dimensions if h > min(n,p): raise(MyException('number of components cannot exceed number of samples')) if (self.projection_index == dicomo and self.pi_arguments['mode'] == 'kurt' and self.whiten_data==False): warnings.warn('Whitening step is recommended for ICA') # Pre-processing adjustment if whitening if self.whiten_data: self.center_data = True self.scale_data = False self.compression = False print('All results produced are for whitened data') # Centring and scaling if self.scale_data: if self.center=='mean': scale = 'std' elif ((self.center=='median')|(self.center=='l1median')): scale = 'mad' else: scale = 'None' warnings.warn('Without scaling, convergence to optima is not given') # Data Compression for flat tables if required if ((p>n) and self.compression): V,S,U = np.linalg.svd(X.T,full_matrices=False) X = np.matmul(U.T,np.diag(S)) n,p = X.shape if (srs.mad(X)==0).any(): warnings.warn('Due to low scales in data, compression would induce zero scales.' + '\n' + 'Proceeding without compression.') dimensions = False if copy: X = copy.deepcopy(X0) else: X = X0 else: dimensions = True else: dimensions = False # Initiate centring object and scale X data centring = VersatileScaler(center=self.center,scale=scale,trimming=trimming) if self.center_data: Xs = centring.fit_transform(X) mX = centring.col_loc_ sX = centring.col_sca_ else: Xs = X mX = np.zeros((1,p)) sX = np.ones((1,p)) fit_arguments = {} # Data whitening (best practice for ICA) if self.whiten_data: V,S,U = np.linalg.svd(Xs.T,full_matrices=False) del U K = (V/S)[:,:p] del V,S Xs = np.matmul(Xs, K) Xs *= np.sqrt(p) # Presently, X and y need to be matrices # Will be changed to use regular np.ndarray Xs = np.matrix(Xs) # Pre-process y data when available if flag != 'one-block': ny = y.shape[0] y = convert_y_input(y) if len(y.shape) < 2: y = np.matrix(y).reshape((ny,1)) # py = y.shape[1] if ny != n: raise(MyException('X and y number of rows must agree')) if self.copy: y0 = copy.deepcopy(y) self.y0 = y0 if self.center_data: ys = centring.fit_transform(y) my = centring.col_loc_ sy = centring.col_sca_ else: ys = y my = 0 sy = 1 ys = np.matrix(ys).astype('float64') else: ys = None # Initializing output matrices W = np.zeros((p,h)) T = np.zeros((n,h)) P = np.zeros((p,h)) B = np.zeros((p,h)) R = np.zeros((p,h)) B_scaled = np.zeros((p,h)) C = np.zeros((h,1)) Xev = np.zeros((h,1)) assovec = np.zeros((h,1)) Maxobjf = np.zeros((h,1)) # Initialize deflation matrices E = copy.deepcopy(Xs) f = ys bi = np.zeros((p,1)) opt_args = { 'alpha': self.alpha, 'trimming': self.trimming, 'biascorr': biascorr, 'dmetric' : 'euclidean', } if self.optimizer=='grid': # Define grid optimization ranges if 'ndir' not in self.optimizer_options: self.optimizer_options['ndir'] = 1000 optrange = np.sign(self.optrange) optmax = self.optrange[1] stop0s = np.arcsin(optrange[0]) stop1s = np.arcsin(optrange[1]) stop1c = np.arccos(optrange[0]) stop0c = np.arccos(optrange[1]) anglestart = max(stop0c,stop0s) anglestop = max(stop1c,stop1s) nangle = np.linspace(anglestart,anglestop,self.optimizer_options['ndir'],endpoint=False) alphamat = np.matrix([np.cos(nangle), np.sin(nangle)]) opt_args['_stop0c'] = stop0c opt_args['_stop0s'] = stop0s opt_args['_stop1c'] = stop1c opt_args['_stop1s'] = stop1s opt_args['optmax'] = optmax opt_args['optrange'] = self.optrange opt_args['square_pi'] = self.square_pi if optmax != 1: alphamat *= optmax if p>2: anglestart = min(opt_args['_stop0c'],opt_args['_stop0s']) anglestop = min(opt_args['_stop1c'],opt_args['_stop1s']) nangle = np.linspace(anglestart,anglestop,self.optimizer_options['ndir'],endpoint=True) alphamat2 = np.matrix([np.cos(nangle), np.sin(nangle)]) if optmax != 1: alphamat2 *= opt_args['optmax'] # Arguments for grid plane opt_args['alphamat'] = alphamat, opt_args['ndir'] = self.optimizer_options['ndir'], opt_args['maxiter'] = self.optimizer_options['maxiter'] if type(opt_args['ndir'] is tuple): opt_args['ndir'] = opt_args['ndir'][0] # Arguments for grid plane #2 grid_args_2 = { 'alpha': self.alpha, 'alphamat': alphamat2, 'ndir': self.optimizer_options['ndir'], 'trimming': self.trimming, 'biascorr': biascorr, 'dmetric' : 'euclidean', '_stop0c' : stop0c, '_stop0s' : stop0s, '_stop1c' : stop1c, '_stop1s' : stop1s, 'optmax' : optmax, 'optrange' : self.optrange, 'square_pi' : self.square_pi } if flag=='two-block': grid_args_2['y'] = f if flag=='two-block': opt_args['y'] = f # Itertive coefficient estimation for i in range(0,h): if self.optimizer=='grid': if p==2: wi,maximo = gridplane(E,self.most, pi_arguments=opt_args ) elif p>2: afin = np.zeros((p,1)) # final parameters for linear combinations Z = copy.deepcopy(E) # sort variables according to criterion meas = [self.most.fit(E[:,k], **opt_args) for k in np.arange(0,p)] if self.square_pi: meas = np.square(meas) wi,maximo = gridplane(Z[:,0:2],self.most,opt_args) Zopt = Z[:,0:2]*wi afin[0:2]=wi for j in np.arange(2,p): projmat = np.matrix([np.array(Zopt[:,0]).reshape(-1), np.array(Z[:,j]).reshape(-1)]).T wi,maximo = gridplane(projmat,self.most, opt_args ) Zopt = Zopt*float(wi[0]) + Z[:,j]*float(wi[1]) afin[0:(j+1)] = afin[0:(j+1)]*float(wi[0]) afin[j] = float(wi[1]) tj = Z*afin objf = self.most.fit(tj, **{**fit_arguments,**opt_args} ) if self.square_pi: objf *= objf # outer loop to run until convergence objfold = copy.deepcopy(objf) objf = -1000 afinbest = afin ii = 0 maxiter_2j = 2**round(np.log2(self.optimizer_options['maxiter'])) while ((ii < self.optimizer_options['maxiter'] + 1) and (abs(objfold - objf)/abs(objf) > 1e-4)): for j in np.arange(0,p): projmat = np.matrix([np.array(Zopt[:,0]).reshape(-1), np.array(Z[:,j]).reshape(-1)]).T if j > 16: divv = maxiter_2j else: divv = min(2**j,maxiter_2j) wi,maximo = gridplane_2(projmat, self.most, q=afin[j], div=divv, pi_arguments=grid_args_2 ) Zopt = Zopt*float(wi[0,0]) + Z[:,j]*float(wi[1,0]) afin *= float(wi[0,0]) afin[j] += float(wi[1,0]) # % evaluate the objective function: tj = Z*afin objfold = copy.deepcopy(objf) objf = self.most.fit(tj, q=afin, **opt_args ) if self.square_pi: objf *= objf if objf!=objfold: if self.constraint == 'norm': afinbest = afin/np.sqrt(np.sum(np.square(afin))) else: afinbest = afin ii +=1 if self.verbose: print(str(ii)) #endwhile afinbest = afin wi = np.zeros((p,1)) wi = afinbest Maxobjf[i] = objf # endif;%if p>2; else: # do not optimize by the grid algorithm if self.trimming > 0: warnings.warn('Optimization that involves a trimmed objective is not a quadratic program. The scipy-optimize result will be off!!') if 'center' in self.pi_arguments: if (self.pi_arguments['center']=='median'): warnings.warn('Optimization that involves a median in the objective is not a quadratic program. The scipy-optimize result will be off!!') constraint = {'type':'eq', 'fun': lambda x: np.linalg.norm(x) -1, } if len(self.optimizer_constraints)>0: constraint = [constraint,self.optimizer_constraints] wi = minimize(pp_objective, E[0,:].transpose(), args=(self.most,E,opt_args), method=self.optimizer, constraints=constraint, options=self.optimizer_options).x wi = np.matrix(wi).reshape((p,1)) wi /= np.sqrt(np.sum(np.square(wi))) # Computing projection weights and scores ti = E*wi if self.optimizer != 'grid': Maxobjf[i] = self.most.fit(E*wi,**opt_args) nti = np.linalg.norm(ti) pi = E.T*ti / (nti**2) if self.whiten_data: wi /= np.sqrt((wi**2).sum()) wi = K*wi wi0 = wi wi = np.array(wi) if len(W[:,i].shape) == 1: wi = wi.reshape(-1) W[:,i] = wi T[:,i] = np.array(ti).reshape(-1) P[:,i] = np.array(pi).reshape(-1) if flag != 'one-block': criteval = self.most.fit(E*wi0, **opt_args ) if self.square_pi: criteval *= criteval assovec[i] = criteval # Deflation of the datamatrix guaranteeing orthogonality restrictions E -= ti*pi.T # Calculate R-Weights R = np.dot(W[:,0:(i+1)],pinv2(np.dot(P[:,0:(i+1)].T,W[:,0:(i+1)]),check_finite=False)) # Execute regression y~T if y is present. Generate regression estimates. if flag != 'one-block': if self.regopt=='OLS': ci = np.dot(ti.T,ys)/(nti**2) elif self.regopt == 'robust': linfit = rm(fun=fun,probp1=probp1,probp2=probp2,probp3=probp3, centre=self.center,scale=scale, start_cutoff_mode='specific',verbose=self.verbose) linfit.fit(ti,ys) ci = linfit.coef_ elif self.regopt == 'quantile': linfit = QuantReg(y,ti) model = linfit.fit(q=quantile) ci = model.params # end regression if C[i] = ci bi = np.dot(R,C[0:(i+1)]) bi_scaled = bi bi = np.multiply(np.reshape(sy/sX,(p,1)),bi) B[:,i] = bi[:,0] B_scaled[:,i] = bi_scaled[:,0] # endfor; Loop for latent dimensions # Re-adjust estimates to original dimensions if data have been compressed if dimensions: B = np.matmul(V[:,0:p],B) B_scaled = np.matmul(V[:,0:p],B_scaled) R = np.matmul(V[:,0:p],R) W = np.matmul(V[:,0:p],W) P = np.matmul(V[:,0:p],P) bi = B[:,h-1] if self.center_data: Xs = centring.fit_transform(X0) mX = centring.col_loc_ sX = centring.col_sca_ else: Xs = X0 mX = np.zeros((1,p)) sX = np.ones((1,p)) bi = bi.astype("float64") if flag != 'one-block': # Calculate scaled and unscaled intercepts if dimensions: X = convert_X_input(X0) if(self.center == "mean"): intercept = sps.trim_mean(y - np.matmul(X,bi),trimming) else: intercept = np.median(np.reshape(y - np.matmul(X,bi),(-1))) yfit = np.matmul(X,bi) + intercept if not(scale == 'None'): if (self.center == "mean"): b0 = np.mean(ys - np.matmul(Xs.astype("float64"),bi)) else: b0 = np.median(np.array(ys.astype("float64") - np.matmul(Xs.astype("float64"),bi))) else: b0 = intercept # Calculate fit values and residuals yfit = yfit r = y - yfit setattr(self,"coef_",B) setattr(self,"intercept_",intercept) setattr(self,"coef_scaled_",B_scaled) setattr(self,"intercept_scaled_",b0) setattr(self,"residuals_",r) setattr(self,"fitted_",yfit) setattr(self,"y_loadings_",C) setattr(self,"y_loc_",my) setattr(self,"y_sca_",sy) setattr(self,"x_weights_",W) setattr(self,"x_loadings_",P) setattr(self,"x_rotations_",R) setattr(self,"x_scores_",T) setattr(self,"x_ev_",Xev) setattr(self,"crit_values_",assovec) setattr(self,"Maxobjf_",Maxobjf) if self.whiten_data: setattr(self,"whitening_",K) if mixing: setattr(self,"mixing_",
np.linalg.pinv(W)
numpy.linalg.pinv
from __future__ import division import numpy as np from numpy import log10 from scipy.interpolate import PchipInterpolator as interp1d def seismic(f, ifo): """Seismic noise. """ return seismicAll(f, ifo)[0] def seismicAll(f, ifo): """Seismic noise. Return (noise, noise_vertical, noise_horizontal) """ hTable = ifo.Suspension.hTable vTable = ifo.Suspension.vTable theta = ifo.Suspension.VHCoupling.theta # noise input, horizontal and vertical if 'PlatformMotion' in ifo.Seismic: if ifo.Seismic.PlatformMotion == 'BSC': nt, nr = seisBSC(f) elif ifo.Seismic.PlatformMotion == '6D': nt, nr = seis6D(f) else: nt, nr = seisBSC(f) else: nt, nr = seisBSC(f) # horizontal noise total nh = (abs(hTable)**2) * nt**2 # vertical noise total nv = (abs(theta * vTable)**2) * nt**2 # new total noise n = nv + nh # Convert into Strain PSD (4 TMs) nh *= 4 * ifo.gwinc.dhdl_sqr nv *= 4 * ifo.gwinc.dhdl_sqr n *= 4 * ifo.gwinc.dhdl_sqr return n, nh, nv def seisBSC(f): """Rough ISI noise source spectra. Returns ISI (translational, rotational) DOFs """ SEI_F = np.array([0.01, 0.03, 0.1, 0.2, 0.5, 1, 10, 30, 300]) # translational DOFs SEI_T =
np.array([3e-6, 1e-6, 2e-7, 2e-7, 8e-10, 1e-11, 3e-13, 3e-14, 3e-14])
numpy.array
import numpy as np from numpy import * from astropy import units as u from scipy.integrate import quad import math as math from math import sqrt, pi, sin, cos import matplotlib.pyplot as plt import scipy.optimize as opt from matplotlib import rcParams as rcp from matplotlib import colors from matplotlib import rc plt.rcParams['figure.figsize'] = [9, 6] plt.rcParams['figure.dpi'] = 100 plt.rcParams['xtick.labelsize'] = 10 plt.rcParams['ytick.labelsize'] = 10 rcp['axes.formatter.useoffset'] = False rcp['axes.linewidth'] = 1.5 rcp['axes.axisbelow'] = False rcp['xtick.major.size'] = 8 rcp['xtick.minor.size'] = 4 rcp['xtick.labelsize'] = 15 rcp['legend.fontsize'] = 15 rcp['xtick.direction'] = 'in' rcp['ytick.major.width'] = 2 rcp['ytick.minor.width'] = 2 rcp['savefig.dpi'] = 300 rcp["figure.dpi"] = 100 import astropy.units as u from astropy.coordinates import SkyCoord from astropy.coordinates.angles import Angle import sympy as sp c_km = (c.to('km/s').value) ######## PANTHEON data ###################### # import redshifts (cosmological + heliocentric), apparent magnitudes, error of app.magnitudes, systematic errors ######## PANTHEON data ###################### # import redshifts (cosmological + heliocentric), apparent magnitudes, error of app.magnitudes,systematic errors # Get the data from the github repository Pantheon of Dan Scolnic # # https://github.com/dscolnic/Pantheon/blob/master/lcparam_full_long_zhel.txt # data = np.loadtxt('/home/kerky/anaconda3/SN1A_DATA/PANTHEON_DATA/Scolnic_data_updated.txt', usecols=[1,2,4,5]) ### list with all the systematics as found in the PANTHEON catalog ### # get the full systematics from the same repository # #https://github.com/dscolnic/Pantheon/blob/master/sys_full_long.txt # sys = np.genfromtxt('/home/kerky/anaconda3/SN1A_DATA/PANTHEON_DATA/systematics.txt', skip_header=1) ### The list sn_names contains all the supernovae names in the PANTHEON catalog ### sn_names = np.genfromtxt('/home/kerky/anaconda3/SN1A_DATA/PANTHEON_DATA/Scolnic_data_updated.txt', usecols=[0],dtype='str') z_cmb= np.array((data[:,0])) ## CMB redshift z_hel = np.array(np.array(data[:,1])) ## heliocentric redshift mb = np.array(data[:,2]) ## apparent magnitude ### We select the C11 Scattering Model. names = np.genfromtxt('/home/kerky/anaconda3/SN1A_DATA/PANTHEON_DATA/Ancillary_C11.FITRES.txt',dtype='str', skip_header=67, usecols=[1]) ########## SEPARATE THE Pantheon sample into 13 subsamples based on idsurvey ########## idsurvey1 = np.genfromtxt('/home/kerky/anaconda3/SN1A_DATA/PANTHEON_DATA/Ancillary_C11.FITRES.txt', skip_header=67, usecols=[3], dtype="str").astype(float) ### The idsurvey1= 61, 62, 63, 64, 65, 66 constitute the CfA ### The idsurvey1=61 constitutes the CfA1 ### The idsurvey1=62 constitutes the CfA2 ### The idsurvey1=65, 66 constitute the CfA4 ### The idsurvey1=63, 64 constitute the CfA3 ### The idsurvey1=15 constitutes the PS1 ### The idsurvey1=4 constitutes the SNLS ### The idsurvey1=100, 101, 106 constitute the HST ### The idsurvey1=1 constitute the SDSS ### The idsurvey1=5 constitutes the CSP xx_high = z_cmb[(idsurvey1!=15) & (idsurvey1!=1) & (idsurvey1!=4) & (idsurvey1!=5) & (idsurvey1!=61) & (idsurvey1!=62) & (idsurvey1!= 63) &(idsurvey1!=64) & (idsurvey1!=65) & (idsurvey1!=66)] print(len(xx_high)) print(np.min(xx_high)) print(np.max(xx_high)) print(np.median(xx_high)) xx_low = z_cmb[(idsurvey1!=15) & (idsurvey1!=1) & (idsurvey1!=4) & (idsurvey1!=5) & (z_cmb<0.7)] print(len(xx_low)) print(np.min(xx_low)) print(np.max(xx_low)) print(np.median(xx_low)) xx_SDSS = z_cmb[idsurvey1==1] print(len(xx_SDSS)) print(np.min(xx_SDSS)) print(np.max(xx_SDSS)) print(np.median(xx_SDSS)) xx_SNLS = z_cmb[idsurvey1==4] print(len(xx_SNLS)) print(np.min(xx_SNLS)) print(np.max(xx_SNLS)) print(
np.median(xx_SNLS)
numpy.median
# -*- coding: utf-8 -*- """ Created on Wed Jul 24 14:09:56 2019 @author: s146959 """ # ========================================================================== # # ========================================================================== # from __future__ import absolute_import, with_statement, absolute_import, \ division, print_function, unicode_literals # ========================================================================== # # ========================================================================== # import numpy as _np import os as _os import matplotlib.pyplot as _plt #import scipy.signal.correlate as xcorr from FFT.fft_analysis import fftanal, ccf from pybaseutils.plt_utils import savefig from FFT.windows import _crosscorr def chunk(x, n): '''Split the list, xs, into n chunks''' L = len(x) assert 0 < n <= L s = L//n return [x[p:p+s] for p in range(0, L, s)] datafolder = _os.path.abspath(_os.path.join('..','..','..','..', 'Workshop')) #datafolder = _os.path.join('/homea','weir','bin') print(datafolder) # #tt=_np.linspace(0,2.0*_np.pi,401) #tt2=_np.linspace(0,4.0*_np.pi,801) #sin1=_np.sin(tt) #sin2=_np.sin(tt) # ##sin1=_np.array([0,0.5,1,2,3,3,4,2,1,0.5,0]) ##sin2=_np.array([0,0.5,1,2,3,3,4,2,1,0.5,0]) ##tt=range(len(sin1)) # #x=_crosscorr(sin1,sin2)/_np.sum(sin1**2) #[t,y]=ccf(sin1,sin2,1/((tt[-1]-tt[0])/(len(sin1)-1))) #fig0=_plt.figure() #_plt.plot(sin1) #_plt.plot(sin2) #fig=_plt.figure() #_plt.plot(y) #fig.suptitle('ccf method on sines') #fig1=_plt.figure() #_plt.plot(x) #fig1.suptitle('crosscorr method on sines') cmPerGHz = 1 for nwindows in [1,10,100,1000,10000]: # nwindows = 100 overlap=0.0 sintest=True scantitl = 'CECE_jan17_fix4' # scantitl += '_50to400' #scantitl += '_400to500' freq_ref = 60.0 # [GHz] fils = ['CECE.69769','CECE.69770','CECE.69771','CECE.69772','CECE.69773','CECE.69777'] freqs = [13.075, 13.075, 13.085, 13.095, 13.105, 13.08] freqs = [4.0*freq+8.0 for freq in freqs] #fils = ['CECE.65642','CECE.65643','CECE.65644','CECE.65645','CECE.65646','CECE.65647'] #freqs = [68.0, 68.3, 68.2, 68.1, 68.15, 68.05] # #fils.extend(['CECE.65648','CECE.65649','CECE.65650','CECE.65651','CECE.65652']) #freqs.extend([67.95, 68.25, 68.125, 67.90, 67.80]) intb = [15e3, 500e3] # original #intb = [50e3, 400e3] # broadband fluctuations # intb = [400e3, 465e3] # high frequency mode tb=[0.29,0.31] #tb=[0.3,0.39] #tb = [0.192, 0.370] nfils = len(fils) #for ii in range(1): # # filn = _os.path.abspath(_os.path.join(datafolder, fils[ii])) # print(filn) # tt, tmpRF, tmpIF = \ # _np.loadtxt(filn, dtype=_np.float64, unpack=True, usecols=(0,1,2)) # tt = 1e-3*tt # tt_tb=[_np.where(tt==tb[0])[0][0],_np.where(tt==tb[1])[0][0]] # [tau,co]=ccf(tmpRF,tmpIF,(len(tt[tt_tb[0]:tt_tb[1]])-1)/(tt[tt_tb[1]]-tt[tt_tb[0]])) # fig=_plt.figure() # sub1=_plt.subplot(3,1,1) # sub2=_plt.subplot(3,1,2,sharex=sub1) # sub3=_plt.subplot(3,1,3) # # sub1.plot(tt[tt_tb[0]:tt_tb[1]],tmpRF[tt_tb[0]:tt_tb[1]]) # sub2.plot(tt[tt_tb[0]:tt_tb[1]],tmpIF[tt_tb[0]:tt_tb[1]]) # sub3.plot(tau,co) for ii in range(1): if not sintest: filn = _os.path.abspath(_os.path.join(datafolder, fils[ii])) print(filn) tt, tmpRF, tmpIF = \ _np.loadtxt(filn, dtype=_np.float64, unpack=True, usecols=(0,1,2)) tt = 1e-3*tt tt_tb=[_np.where(tt<=tb[0])[0][0],_np.where(tt>=tb[1])[0][0]] tt_used=tt[tt_tb[0]:tt_tb[1]] RF_used=tmpRF[tt_tb[0]:tt_tb[1]] IF_used=tmpIF[tt_tb[0]:tt_tb[1]] if sintest: tb=[0,2.0] df=15.50e3 _np.random.seed() n_s=5000001 tt=_np.linspace(0,2.0*_np.pi,n_s) fs=1/(((tt[len(tt)-1]-tt[0])/len(tt))) RF_used=0.05*
_np.sin(2.0*_np.pi*(df)*tt)
numpy.sin
__copyright__ = """ Copyright (C) 2020 University of Illinois Board of Trustees Copyright (C) 2021 <NAME> """ __license__ = """ Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """ import sys import cantera as ct import numpy as np # noqa: F401 import pyrometheus as pyro import pytest try: import jax except ImportError: numpy_list = [np] jnp = None else: import jax.numpy as jnp # noqa: F401 jax.config.update("jax_enable_x64", 1) numpy_list = [np, jnp] def make_jax_pyro_class(ptk_base_cls, usr_np): if usr_np != jnp: return ptk_base_cls(usr_np) class PyroJaxNumpy(ptk_base_cls): def _pyro_make_array(self, res_list): """This works around (e.g.) numpy.exp not working with object arrays of numpy scalars. It defaults to making object arrays, however if an array consists of all scalars, it makes a "plain old" :class:`numpy.ndarray`. See ``this numpy bug <https://github.com/numpy/numpy/issues/18004>`__ for more context. """ from numbers import Number # Needed to play nicely with Jax, which frequently creates # arrays of shape () when handed numbers all_numbers = all( isinstance(e, Number) or (isinstance(e, self.usr_np.ndarray) and e.shape == ()) for e in res_list) if all_numbers: return self.usr_np.array(res_list, dtype=self.usr_np.float64) result = self.usr_np.empty_like(res_list, dtype=object, shape=(len(res_list),)) # 'result[:] = res_list' may look tempting, however: # https://github.com/numpy/numpy/issues/16564 for idx in range(len(res_list)): result[idx] = res_list[idx] return result def _pyro_norm(self, argument, normord): """This works around numpy.linalg norm not working with scalars. If the argument is a regular ole number, it uses :func:`numpy.abs`, otherwise it uses ``usr_np.linalg.norm``. """ # Wrap norm for scalars from numbers import Number if isinstance(argument, Number): return self.usr_np.abs(argument) # Needed to play nicely with Jax, which frequently creates # arrays of shape () when handed numbers if isinstance(argument, self.usr_np.ndarray) and argument.shape == (): return self.usr_np.abs(argument) return self.usr_np.linalg.norm(argument, normord) return PyroJaxNumpy(usr_np=usr_np) # Write out all the mechanisms for inspection @pytest.mark.parametrize("mechname", ["uiuc", "sanDiego"]) def test_generate_mechfile(mechname): """This "test" produces the mechanism codes.""" sol = ct.Solution(f"mechs/{mechname}.cti", "gas") with open(f"mechs/{mechname}.py", "w") as mech_file: code = pyro.gen_thermochem_code(sol) print(code, file=mech_file) @pytest.mark.parametrize("mechname", ["uiuc", "sanDiego"]) @pytest.mark.parametrize("usr_np", numpy_list) def test_get_rate_coefficients(mechname, usr_np): """This function tests that pyrometheus-generated code computes the rate coefficients matching Cantera for given temperature and composition""" sol = ct.Solution(f"mechs/{mechname}.cti", "gas") ptk_base_cls = pyro.get_thermochem_class(sol) ptk = make_jax_pyro_class(ptk_base_cls, usr_np) # Test temperatures temp = np.linspace(500.0, 3000.0, 10) for t in temp: # Set new temperature in Cantera sol.TP = t, ct.one_atm # Concentrations y = sol.Y rho = sol.density c = ptk.get_concentrations(rho, y) # Get rate coefficients and compare k_ct = sol.forward_rate_constants k_pm = ptk.get_fwd_rate_coefficients(t, c) print(k_ct) print(np.abs((k_ct-k_pm)/k_ct)) assert np.linalg.norm((k_ct-k_pm)/k_ct, np.inf) < 1e-14 return @pytest.mark.parametrize("mechname", ["uiuc", "sanDiego"]) @pytest.mark.parametrize("usr_np", numpy_list) def test_get_pressure(mechname, usr_np): """This function tests that pyrometheus-generated code computes the Cantera-predicted pressure for given density, temperature, and mass fractions """ # Create Cantera and pyrometheus objects sol = ct.Solution(f"mechs/{mechname}.cti", "gas") ptk_base_cls = pyro.get_thermochem_class(sol) ptk = make_jax_pyro_class(ptk_base_cls, usr_np) # Temperature, equivalence ratio, oxidizer ratio, stoichiometry ratio t = 300.0 phi = 2.0 alpha = 0.21 nu = 0.5 # Species mass fractions i_fu = ptk.species_index("H2") i_ox = ptk.species_index("O2") i_di = ptk.species_index("N2") x = np.zeros(ptk.num_species) x[i_fu] = (alpha * phi) / (nu + alpha * phi) x[i_ox] = nu * x[i_fu] / phi x[i_di] = (1.0 - alpha) * x[i_ox] / alpha # Get equilibrium composition sol.TPX = t, ct.one_atm, x sol.equilibrate("UV") t, rho, y = sol.TDY p_ct = sol.P # Compute pressure with pyrometheus and compare to Cantera p_pm = ptk.get_pressure(rho, t, y) assert abs(p_ct - p_pm) / p_ct < 1.0e-12 @pytest.mark.parametrize("mechname", ["uiuc", "sanDiego"]) @pytest.mark.parametrize("usr_np", numpy_list) def test_get_thermo_properties(mechname, usr_np): """This function tests that pyrometheus-generated code computes thermodynamic properties c_p, s_r, h_rt, and k_eq correctly by comparing against Cantera""" # Create Cantera and pyrometheus objects sol = ct.Solution(f"mechs/{mechname}.cti", "gas") ptk_base_cls = pyro.get_thermochem_class(sol) ptk = make_jax_pyro_class(ptk_base_cls, usr_np) # Loop over temperatures temp = np.linspace(500.0, 3000.0, 10) for t in temp: # Set state in cantera for comparison sol.TP = t, ct.one_atm # Get properties from pyrometheus and compare to Cantera cp_pm = ptk.get_species_specific_heats_r(t) cp_err =
np.linalg.norm(cp_pm - sol.standard_cp_R, np.inf)
numpy.linalg.norm
#!/usr/bin/env python import rospy import tf import math from nav_msgs.srv import GetMap from sensor_msgs.msg import LaserScan from nav_msgs.msg import Odometry from visualization_msgs.msg import MarkerArray,Marker from nav_msgs.msg import OccupancyGrid import numpy as np from mapping import Mapping import sys MAX_LASER_RANGE = 30 STATE_SIZE = 3 class SLAM_ICP(): def __init__(self): # ros param self.robot_x = rospy.get_param('/slam/robot_x',0) self.robot_y = rospy.get_param('/slam/robot_y',0) self.robot_theta = rospy.get_param('/slam/robot_theta',0) ## ros param of mapping self.map_x_width = rospy.get_param('/slam/map_width') self.map_y_width = rospy.get_param('/slam/map_height') self.map_reso = rospy.get_param('/slam/map_resolution') self.map_cellx_width = int(round(self.map_x_width/self.map_reso)) self.map_celly_width = int(round(self.map_y_width/self.map_reso)) # odom robot init states # self.sensor_sta = [self.robot_x,self.robot_y,self.robot_theta] self.isFirstScan = True self.src_pc = [] self.tar_pc = [] self.mapping = Mapping(self.map_cellx_width,self.map_celly_width,self.map_reso) # State [cos(yaw) -sin(yaw) x] # [sin(yaw) cos(yaw) y] # [0 0 1] self.xEst = np.eye(STATE_SIZE) self.xOdom = np.zeros((STATE_SIZE, 1)) # map observation self.obstacle = [] # radius self.obstacle_r = 10 # ros topic self.laser_sub = rospy.Subscriber('/scan',LaserScan,self.laserCallback) self.odom_pub = rospy.Publisher('icp_odom',Odometry,queue_size=3) self.location_pub = rospy.Publisher('icp_location',Odometry,queue_size=3) self.odom_broadcaster = tf.TransformBroadcaster() self.map_pub = rospy.Publisher('/slam_map',OccupancyGrid,queue_size=1) self.tf = tf.TransformListener() def laserCallback(self, msg): np_msg = self.laserToNumpy(msg) # icp implement in self.calc_odometry. Return the robot pose in world frame. self.xEst = self.get_trans() #transform the laser points from the laser frame into the world frame obs = self.xEst.dot(np_msg) pmap = self.mapping.update(obs[0], obs[1], self.xEst[0,2], self.xEst[1,2]) # print(pmap) self.publishMap(pmap) self.publishResult() pass def get_trans(self): self.tf.waitForTransform("/laser", "/map", rospy.Time(), rospy.Duration(4.0)) l2m, rot = self.tf.lookupTransform('/laser', '/map', rospy.Time(0)) euler = tf.transformations.euler_from_quaternion(rot) roll, pitch, yaw_l2m = euler[0], euler[1], euler[2] self.tf.waitForTransform("/map", "/world_base", rospy.Time(), rospy.Duration(4.0)) m2w, rot = self.tf.lookupTransform('/map', '/world_base', rospy.Time(0)) euler = tf.transformations.euler_from_quaternion(rot) roll, pitch, yaw_m2w = euler[0], euler[1], euler[2] dx = -l2m[0] * math.cos(yaw_l2m) - l2m[1] * math.sin(yaw_l2m) - m2w[0] dy = l2m[0] * math.sin(yaw_l2m) - l2m[1] * math.cos(yaw_l2m) - m2w[1] dyaw = -yaw_l2m - yaw_m2w # State [cos(yaw) -sin(yaw) x] # [sin(yaw) cos(yaw) y] # [0 0 1] xEst = np.array([ [math.cos(dyaw), -math.sin(dyaw), dx * math.cos(yaw_m2w) + dy * math.sin(yaw_m2w)], [math.sin(dyaw), math.cos(dyaw), -dx * math.sin(yaw_m2w) + dy * math.cos(yaw_m2w)], [0, 0, 1] ]) return xEst def laserToNumpy(self, msg): total_num = len(msg.ranges) pc = np.ones([3,total_num]) range_l = np.array(msg.ranges) range_l[range_l == np.inf] = MAX_LASER_RANGE angle_l = np.linspace(msg.angle_min,msg.angle_max,total_num) pc[0:2,:] = np.vstack((np.multiply(np.cos(angle_l),range_l),np.multiply(
np.sin(angle_l)
numpy.sin
# -*- coding: utf-8 -*- """ Created on Mon May 6 22:58:44 2013 @author: ludo """ import os import math import numpy import scipy import csv import json from time import time from PIL import Image import matplotlib from matplotlib import pylab from matplotlib import pyplot from matplotlib.patches import Circle from matplotlib import pyplot as plt from cellpack.autopack.upy import colors as col import cellpack.autopack as autopack from cellpack.autopack.transformation import signed_angle_between_vectors from cellpack.autopack.ldSequence import halton from cellpack.autopack.GeometryTools import GeometryTools, Rectangle from cellpack.autopack.upy.colors import map_colors from cellpack.autopack.plotly_result import PlotlyAnalysis def autolabel(rects, ax): # from http://matplotlib.org/examples/api/barchart_demo.html # attach some text labels for rect in rects: height = rect.get_height() ax.text( rect.get_x() + rect.get_width() / 2.0, height / 2.0, "%d" % int(height), ha="center", va="bottom", ) def autolabelyerr(ax, rects, err=None): # attach some text labels for i, rect in enumerate(rects): height = rect.get_height() v = "%.2f" % height y = 0.5 * height if err is not None: v = "%.2f" % err[i] y = 1.05 * height ax.text(rect.get_x() + rect.get_width() / 2.0, y, v, ha="center", va="bottom") def autolabels(loci1, loci2, loci3, ax, yerr1, yerr2, yerr3): # from http://matplotlib.org/examples/api/barchart_demo.html # attach some text labels for i in range(len(loci1)): # rects: rect1 = loci1[i] rect2 = loci2[i] rect3 = loci3[i] height1 = rect1.get_height() height2 = rect2.get_height() height3 = rect3.get_height() ax.text( rect1.get_x() + rect1.get_width() / 2.0, height1 / 2.0, "%2.1f" % (height1 * 100.0), ha="center", va="bottom", color="black", ) ax.text( rect2.get_x() + rect2.get_width() / 2.0, height2 / 2.0 + height1, "%2.1f" % (height2 * 100.0), ha="center", va="bottom", color="black", ) ax.text( rect3.get_x() + rect2.get_width() / 2.0, height3 / 2.0 + height1 + height2, "%2.1f" % (height3 * 100.0), ha="center", va="bottom", color="white", ) ax.text( rect1.get_x() + rect1.get_width() / 2.0, 1.01 * height1, "%2.1f" % (yerr1[i] * 100.0), ha="center", va="bottom", color="black", ) ax.text( rect2.get_x() + rect2.get_width() / 2.0, 1.01 * (height2 + height1), "%2.1f" % (yerr2[i] * 100.0), ha="center", va="bottom", color="white", ) ax.text( rect3.get_x() + rect2.get_width() / 2.0, 1.01 * (height3 + height1 + height2), "%2.1f" % (yerr3[i] * 100.0), ha="center", va="bottom", color="black", ) def getRndWeighted(listPts, weight, yerr): w = [yerr[i] * numpy.random.random() + weight[i] for i in range(len(weight))] t = numpy.cumsum(w) s = numpy.sum(w) i = numpy.searchsorted(t, numpy.random.rand(1) * s)[0] return listPts[i] class AnalyseAP: def __init__(self, env=None, viewer=None, result_file=None): self.env = None self.smallest = 99999.0 self.largest = 0.0 if env: self.env = env self.smallest, self.largest = self.getMinMaxProteinSize() self.afviewer = viewer self.helper = None if viewer: self.helper = self.afviewer.vi self.result_file = result_file self.center = [0, 0, 0] self.bbox = [[0, 0, 0], [1, 1, 1]] self.g = GeometryTools() self.g.Resolution = 1.0 # or grid step? self.current_pos = None self.current_distance = None self.plotly = PlotlyAnalysis() autopack._colors = None def getMinMaxProteinSize(self): smallest = 999999.0 largest = 0.0 for organelle in self.env.compartments: mini, maxi = organelle.getMinMaxProteinSize() if mini < smallest: smallest = mini if maxi > largest: largest = maxi if self.env.exteriorRecipe: mini, maxi = self.env.exteriorRecipe.getMinMaxProteinSize() if mini < smallest: smallest = mini if maxi > largest: largest = maxi return smallest, largest def getPositionsFromResFile(self): # could actually restore file using histoVol. # or not # need to parse apr file here anyway return [] def getPositionsFromObject(self, parents): positions = [] for parent in parents: obparent = self.helper.getObject(parent) children = self.helper.getChilds(obparent) for ch in children: ingr_name = self.helper.getName(ch) meshp = self.helper.getObject("Meshs_" + ingr_name.split("_")[0]) if meshp is None: c = self.helper.getChilds(ch) if not len(c): continue meshp_children = self.helper.getChilds( c[0] ) # continue #should get sphere/cylnder parent ? else: meshp_children = self.helper.getChilds(meshp) for cc in meshp_children: pos = self.helper.ToVec(self.helper.getTranslation(cc)) positions.append(pos) return positions def getDistanceFrom(self, target, parents=None, **options): """ target : name or host object target or target position parent : name of host parent object for the list of object to measure distance from objects : list of object or list of points """ # get distance from object to the target. # all object are in h.molecules and orga.molecules # get options if type(target) == list or type(target) == tuple: targetPos = target elif type(target) == str: o = self.helper.getObject(target) if o is not None: targetPos = self.helper.ToVec(self.helper.getTranslation(o)) # hostForm else: o = self.helper.getObject(target) if o is not None: targetPos = self.helper.ToVec(self.helper.getTranslation(o)) # hostForm listCenters = [] if self.result_file is None: if parents is None and self.result_file is None: listeParent = [self.env.name + "_cytoplasm"] for o in self.env.compartments: listeParent.append(o.name + "_Matrix") listeParent.append(o.name + "_surface") elif parents is not None and self.result_file is None: listeParent = parents listCenters = self.getPositionsFromObject(listeParent) delta = numpy.array(listCenters) - numpy.array(targetPos) delta *= delta distA = numpy.sqrt(delta.sum(1)) return distA def getClosestDistance(self, parents=None, **options): if self.result_file is None: if parents is None and self.result_file is None: listeParent = [self.env.name + "_cytoplasm"] for o in self.env.compartments: listeParent.append(o.name + "_Matrix") listeParent.append(o.name + "_surface") elif parents is not None and self.result_file is None: listeParent = parents listeCenters = self.getPositionsFromObject(listeParent) else: # use data from file # TODO: currently getPositionsFromResFile returns an empty list # listeCenters = self.getPositionsFromResFile(listeParent) listeCenters = [] # is the distance in the result array ? listeDistance = numpy.zeros(len(listeCenters)) + 99999 for i in range(len(listeCenters)): for j in range(i + 1, len(listeCenters)): # should use point d = self.helper.measure_distance(listeCenters[i], listeCenters[j]) if d < listeDistance[i]: listeDistance[i] = d return listeDistance def displayDistance( self, ramp_color1=[1, 0, 0], ramp_color2=[0, 0, 1], ramp_color3=None, cutoff=60.0, ): distances = numpy.array(self.env.grid.distToClosestSurf[:]) mask = distances > cutoff ind = numpy.nonzero(mask)[0] distances[ind] = cutoff mask = distances < 0 # -cutoff ind = numpy.nonzero(mask)[0] distances[ind] = 0 # cutoff base = self.helper.getObject(self.env.name + "distances_base") if base is None: base = self.helper.Sphere(self.env.name + "distances_base")[0] p = self.helper.getObject(self.env.name + "distances") if p is not None: self.helper.deleteObject(p) # recursif? p = self.helper.newEmpty(self.env.name + "distances") # can use cube also def displayDistanceCube( self, ramp_color1=[1, 0, 0], ramp_color2=[0, 0, 1], ramp_color3=None, cutoff=60.0, ): distances = numpy.array(self.env.grid.distToClosestSurf[:]) mask = distances > cutoff ind = numpy.nonzero(mask)[0] distances[ind] = cutoff mask = distances < 0 # -cutoff ind = numpy.nonzero(mask)[0] distances[ind] = 0 # cutoff base = self.helper.getObject(self.env.name + "distances_base_cube") if base is None: # base=self.helper.Sphere(self.env.name+"distances_base")[0] size = self.env.grid.gridSpacing base = self.helper.box( self.env.name + "distances_base_cube", center=[0.0, 0.0, 0.0], size=[size, size, size], )[0] parent_cube = self.helper.getObject(self.env.name + "distances_cubes") if parent_cube is not None: self.helper.deleteObject(parent_cube) # recursif? parent_cube = self.helper.newEmpty(self.env.name + "distances_cubes") def displayDistancePlane( self, ramp_color1=[1, 0, 0], ramp_color2=[0, 0, 1], ramp_color3=None, cutoff=60.0, ): # which axis ? distances = numpy.array(self.env.grid.distToClosestSurf[:]) ramp = col.getRamp([ramp_color1, ramp_color2], size=255) # color mask = distances > cutoff ind = numpy.nonzero(mask)[0] distances[ind] = cutoff mask = distances < 0 # -cutoff ind = numpy.nonzero(mask)[0] distances[ind] = 0 # cutoff newd = numpy.append(distances, cutoff) colors = map_colors(newd, ramp)[:-1] # 1D array of the grid x,y,1 autopack._colors = colors p = self.helper.getObject(self.env.name + "distances") if p is not None: self.helper.deleteObject(p) # recursif? p = self.helper.newEmpty(self.env.name + "distances_p") d = numpy.array(self.env.grid.boundingBox[0]) - numpy.array( self.env.grid.boundingBox[1] ) p, mpl = self.helper.plane( self.env.name + "distances_plane", center=self.env.grid.getCenter(), size=[math.fabs(d[0]), math.fabs(d[1])], parent=p, ) self.helper.rotateObj(p, [0, 0, -math.pi / 2.0]) filename = ( autopack.cache_results + os.sep + self.env.name + "distances_plane_texture.png" ) c = colors.reshape( ( self.env.grid.nbGridPoints[0], self.env.grid.nbGridPoints[1], self.env.grid.nbGridPoints[2], 3, ) ) im = Image.fromstring( "RGB", (c.shape[0], c.shape[1]), numpy.uint8(c * 255.0).tostring() ) im.save(str(filename)) mat = self.helper.createTexturedMaterial( self.env.name + "planeMat", str(filename) ) # assign the material to the plane self.helper.assignMaterial(p, mat, texture=True) def writeJSON(self, filename, data): with open(filename, "w") as fp: # doesnt work with symbol link ? json.dump( data, fp, indent=4, separators=(",", ": ") ) # ,indent=4, separators=(',', ': ') def loadJSON(self, filename): with open(filename) as data_file: data = json.load(data_file) return data def grabResultFromJSON(self, n): ingrrot = {} ingrpos = {} for i in range(n): with open("results_seed_" + str(i) + ".json") as data_file: data = json.load(data_file) for recipe in data: for ingrname in data[recipe]: for k in range(len(data[recipe][ingrname]["results"])): if ingrname not in ingrrot: ingrrot[ingrname] = [] ingrpos[ingrname] = [] ingrrot[ingrname].append( data[recipe][ingrname]["results"][k][1] ) ingrpos[ingrname].append( data[recipe][ingrname]["results"][k][0] ) return ingrpos, ingrrot def grabResultFromTXT(self, n, doanalyze=False): from autopack import transformation as t ingrrot = {} ingrpos = {} for i in range(1000): files = open("results_seed_" + str(i) + ".txt", "r") lines = files.readlines() files.close() for line in lines: line = line.replace("<", " ").replace(">", " ") elem = line.split() ingrname = elem[-5] if ingrname not in ingrrot: ingrrot[ingrname] = [] ingrpos[ingrname] = [] ingrrot[ingrname].append(eval(elem[2])) ingrpos[ingrname].append(eval(elem[0])) for ingrname in ingrrot: ingrrot[ingrname] = [ numpy.array(m).reshape((4, 4)) for m in ingrrot[ingrname] ] if doanalyze: for ingrname in ingrrot: eulers3 = [t.euler_from_matrix(m, "rxyz") for m in ingrrot[ingrname]] e3 = numpy.degrees(numpy.array(eulers3)).transpose() numpy.savetxt( ingrname + "_euler_X.csv", numpy.array(e3[0]), delimiter="," ) numpy.savetxt( ingrname + "_euler_Y.csv", numpy.array(e3[1]), delimiter="," ) numpy.savetxt( ingrname + "_euler_Z.csv", numpy.array(e3[2]), delimiter="," ) self.histo(e3[0], ingrname + "_euler_X.png", bins=12, size=max(e3[0])) self.histo(e3[1], ingrname + "_euler_Y.png", bins=12, size=max(e3[1])) self.histo(e3[2], ingrname + "_euler_Z.png", bins=12, size=max(e3[2])) # ingrpositions,distA,angles3=self.getDistanceAngle(ingrpos3, ingrrot3) # numpy.savetxt(ingrname+"_angle_X.csv", numpy.array(angles3[1]), delimiter=",") # numpy.savetxt(ingrname+"_angle_Y.csv", numpy.array(angles3[2]), delimiter=",") # numpy.savetxt(ingrname+"_angle_Z.csv", numpy.array(angles3[3]), delimiter=",") # self.histo(angles3[1],ingrname+"_angle_X.png",bins=12,size=max(angles3[1])) # self.histo(angles3[2],ingrname+"_angle_Y.png",bins=12,size=max(angles3[2])) # self.histo(angles3[3],ingrname+"_angle_Z.png",bins=12,size=max(angles3[3])) return ingrpos, ingrrot # should take any type of list... def save_csv(self, data, filename=None): if filename is None: filename = "output.csv" resultFile = open(filename, "wb") wr = csv.writer(resultFile, dialect="excel") # wr.writerows(data) list of list ? # resultFile.close() for item in data: wr.writerow([item]) resultFile.close() def rectangle_circle_area(self, bbox, center, radius): # http://www.eex-dev.net/index.php?id=100 # [[0.,0,0],[1000,1000,1]] # top,bottom, right, left # rect=Rectangle(bbox[0][0],bbox[1][0],bbox[0][1],bbox[1][1])#top,bottom, right, left rect = Rectangle( bbox[1][1], bbox[0][1], bbox[1][0], bbox[0][0] ) # top,bottom, right, left m = [center[0], center[1]] r = radius area = math.pi * r ** 2 chs = self.g.check_sphere_inside(rect, m, r) if chs: # sph not completly inside ch = self.g.check_rectangle_oustide(rect, m, r) if ch: # rectangle not outside leftBound, rightBound = self.g.getBoundary(rect, m, r) area = self.g.get_rectangle_cercle_area( rect, m, r, leftBound, rightBound ) # print area,leftBound,rightBound else: area = bbox[0][1] ** 2 return area def getAxeValue(self, ingrname, axe=0): ingrpositions = [ self.env.molecules[i][0][axe] for i in range(len(self.env.molecules)) if self.env.molecules[i][2].name == ingrname ] return ingrpositions def getAxesValues(self, positions): pp = numpy.array(positions).transpose() if len(positions) == 0: return 1, 1, 1 px = pp[0] py = pp[1] pz = pp[2] return px, py, pz def getDistance(self, ingrname, center): distA = [] ingrpositions = [ self.env.molecules[i][0] for i in range(len(self.env.molecules)) if self.env.molecules[i][2].name == ingrname ] ingrpositions = numpy.array(ingrpositions) if len(ingrpositions): delta = numpy.array(ingrpositions) - numpy.array(center) delta *= delta distA = numpy.sqrt(delta.sum(1)).tolist() return ingrpositions, distA def getDistanceAngle(self, ingr, center): # need matrix to euler? then access and plot them? # also check the measure angle one angles = [] distA = [] ingr_positions = [ self.env.molecules[i][0] for i in range(len(self.env.molecules)) if self.env.molecules[i][2].name == ingr.name ] ingr_positions = numpy.array(ingr_positions) ingr_rotation = [ self.env.molecules[i][1] for i in range(len(self.env.molecules)) if self.env.molecules[i][2].name == ingr.name ] ingr_rotation = numpy.array(ingr_rotation) if len(ingr_positions): delta = numpy.array(ingr_positions) - numpy.array(center) # lets do it on X,Y,Z and also per positions ? anglesX = numpy.array( signed_angle_between_vectors( [[0, 0, 1]] * len(ingr_positions), ingr_rotation[:, 0, :3], -delta, directed=False, axis=1, ) ) anglesY = numpy.array( signed_angle_between_vectors( [[0, 1, 0]] * len(ingr_positions), ingr_rotation[:, 1, :3], -delta, directed=False, axis=1, ) ) anglesZ = numpy.array( signed_angle_between_vectors( [[1, 0, 0]] * len(ingr_positions), ingr_rotation[:, 2, :3], -delta, directed=False, axis=1, ) ) delta *= delta distA = numpy.sqrt(delta.sum(1)).tolist() angles = numpy.array([distA, anglesX, anglesY, anglesZ]) return ingr_positions, distA, numpy.degrees(angles) def getVolumeShell(self, bbox, radii, center): # rectangle_circle_area volumes = [] box_size0 = bbox[1][0] - bbox[0][0] for i in range(len(radii) - 1): r1 = radii[i] r2 = radii[i + 1] v1 = self.g.calc_volume(r1, box_size0 / 2.0) v2 = self.g.calc_volume(r2, box_size0 / 2.0) # if v1 == 0 or v2 == 0 : # volumes.append((4./3.)*numpy.pi*(numpy.power(r2,3)-numpy.power(r1, 3))) # else : volumes.append(v2 - v1) return volumes def rdf_3d(self, ingr): # see for intersection volume here http://crowsandcats.blogspot.com/2013/04/cube-sphere-intersection-volume.html # and here http://crowsandcats.blogspot.com/2013/05/extending-radial-distributions.html # will require scipy...worth it ? # should be pairewise distance ? or not ? distances = numpy.array(self.env.distances[ingr.name]) basename = self.env.basename numpy.savetxt( basename + ingr.name + "_pos.csv", numpy.array(self.env.ingrpositions[ingr.name]), delimiter=",", ) self.histo(distances, basename + ingr.name + "_histo.png") numpy.savetxt( basename + ingr.name + "_distances.csv", numpy.array(distances), delimiter=",", ) # the bin should be not less than the biggest ingredient radius # b=int(distances.max()/self.largest) b = 100 # bin_edges = numpy.arange(0, min(box_size) / 2, bin_width) new_rdf, edges = numpy.histogramdd( distances, bins=b, range=[(distances.min(), distances.max())] ) radii = edges[0] # from http://isaacs.sourceforge.net/phys/rdfs.html dnr = new_rdf N = len(distances) V = ( self.env.grid.nbGridPoints[0] * self.env.grid.nbGridPoints[1] * self.env.grid.nbGridPoints[2] * self.env.grid.gridSpacing ** 3 ) Vshell = numpy.array(self.getVolumeShell(self.bbox, radii, self.center)) gr = (dnr * V) / (N * Vshell) numpy.savetxt(basename + ingr.name + "_rdf.csv", numpy.array(gr), delimiter=",") self.plot(gr, radii[:-1], basename + ingr.name + "_rdf.png") def getAreaShell(self, bbox, radii, center): # rectangle_circle_area areas = [] for i in range(len(radii) - 1): r1 = radii[i] r2 = radii[i + 1] area1 = self.rectangle_circle_area(bbox, center, r1) area2 = self.rectangle_circle_area(bbox, center, r2) if area1 == 0 or area2 == 0: areas.append(numpy.pi * (numpy.power(r2, 2) - numpy.power(r1, 2))) else: areas.append(area2 - area1) return areas def ripley(self, positions, dr=25, rMax=None): # K(t) = A*SUM(wij*I(i,j)/n**2) # lambda = n/A A is the area of the region containing all points # I indicator function 1 if its operand is true, 0 otherwise # t is the search radius # if homogenous K(s) = pi*s**2 # L(t) = (K(t)/pi)**1/2 # A common plot is a graph of t - \hat{L}(t) against t # which will approximately follow the horizontal zero-axis with constant # dispersion if the data follow a homogeneous Poisson process. N = len(positions) V = 1000 ** 2 diag = numpy.sqrt(1000 ** 2 + 1000 ** 2) dr = dr # all_distance.min() if rMax is None: rMax = diag edges = numpy.arange(dr, rMax + 1.1 * dr, dr) k = numpy.zeros((N, len(edges))) for i, p in enumerate(positions): di = scipy.spatial.distance.cdist( positions, [p], "euclidean", ) # dV = np.array(analyse.getAreaShell(analyse.bbox,edges,p)) for j, e in enumerate(edges): area0 = math.pi * e ** 2 # complete circle area1 = self.rectangle_circle_area(self.bbox, p, e) w = area1 / area0 k[i, j] = w * len(numpy.nonzero(di < e)[0]) / N ** 2 Kt = V * numpy.sum(k, axis=0) Lt = (Kt / numpy.pi) ** 0.5 return Kt, Lt # pos=numpy.array(self.env.ingrpositions[ingr.name])#np.array([np.array(p[0]) for p in h.molecules]) def rdf(self, positions, dr=10, rMax=None): N = len(positions) V = 1000 ** 2 diag = numpy.sqrt(1000 ** 2 + 1000 ** 2) dr = dr # all_distance.min() if rMax is None: rMax = diag edges = numpy.arange(0.0, rMax + 1.1 * dr, dr) g = numpy.zeros((N, len(edges) - 1)) dv = [] density = float(N) / float(V) for i, p in enumerate(positions): di = scipy.spatial.distance.cdist( positions, [p], "euclidean", ) dN, bins = numpy.histogram(di, bins=edges) dV = numpy.array(self.getAreaShell(self.bbox, edges, p)) dv.append(dV) g[i] = dN / (dV * density) avg = numpy.average(g, axis=0) # /np.array(dv) return avg def rdf_2d(self, ingr): # dN/N / dV/V = dN/dV * V/N distances = numpy.array(self.env.distances[ingr.name]) basename = self.env.basename numpy.savetxt( basename + ingr.name + "_pos.csv", numpy.array(self.env.ingrpositions[ingr.name]), delimiter=",", ) self.histo(distances, basename + ingr.name + "_histo.png") numpy.savetxt( basename + ingr.name + "_distances.csv", numpy.array(distances), delimiter=",", ) # the bin should be not less than the biggest ingredient radius # b=int(distances.max()/self.largest) new_rdf, edges = numpy.histogramdd( distances ) # , bins=b, range=[(distances.min(), distances.max())],normed=0) radii = edges[0] # r=radii.tolist() # r.insert(0,0.0) # radii = numpy.array(r) # rdf= new_rdf.tolist() # rdf.insert(0,0) # new_rdf = numpy.array(rdf) # from http://isaacs.sourceforge.net/phys/rdfs.html dnr = new_rdf[:] N = len(distances) V = ( self.env.grid.nbGridPoints[0] * self.env.grid.nbGridPoints[1] * self.env.grid.gridSpacing ** 2 ) Vshell = numpy.array(self.getAreaShell(self.bbox, radii, self.center)) # print Vshell # Vshell1 = numpy.pi*density*(numpy.power(radii[1:],2)-numpy.power(radii[:-1], 2)) # print Vshell1 # print radii gr = (dnr * V) / (N * Vshell) numpy.savetxt(basename + ingr.name + "_rdf.csv", numpy.array(gr), delimiter=",") self.plot(gr, radii[:-1], basename + ingr.name + "_rdf.png") # simpl approach Ni/Areai G = dnr / Vshell numpy.savetxt( basename + ingr.name + "_rdf_simple.csv", numpy.array(G), delimiter="," ) self.plot(numpy.array(G), radii[:-1], basename + ingr.name + "_rdf_simple.png") def axis_distribution_total(self, all_positions): basename = self.env.basename numpy.savetxt( basename + "total_pos.csv", numpy.array(all_positions), delimiter="," ) px, py, pz = self.getAxesValues(all_positions) # m1=numpy.nonzero( numpy.logical_and( # numpy.greater_equal(px, 0.), numpy.less_equal(px, 1000.0))) # m2=numpy.nonzero( numpy.logical_and( # numpy.greater_equal(py, 0.), numpy.less_equal(py, 1000.0))) self.histo(px, basename + "total_histo_X.png", bins=10) self.histo(py, basename + "total_histo_Y.png", bins=10) self.histo(pz, basename + "total_histo_Z.png", bins=10) def axis_distribution(self, ingr): basename = self.env.basename px, py, pz = self.getAxesValues(self.env.ingrpositions[ingr.name]) self.histo(px, basename + ingr.name + "_histo_X.png", bins=10) self.histo(py, basename + ingr.name + "_histo_Y.png", bins=10) self.histo(pz, basename + ingr.name + "_histo_Z.png", bins=10) # do it for all ingredient cumulate? def occurence_distribution(self, ingr): basename = self.env.basename occ = self.env.occurences[ingr.name] self.simpleplot(range(len(occ)), occ, basename + ingr.name + "_occurence.png") def correlation(self, ingr): basename = self.env.basename posxyz = numpy.array(self.env.ingrpositions[ingr.name]).transpose() g_average, radii, x, y, z = self.PairCorrelationFunction_3D( posxyz, 1000, 900, 100 ) self.plot(g_average, radii, basename + ingr.name + "_corr.png") def PairCorrelationFunction_3D(self, data, S, rMax, dr): """Compute the three-dimensional pair correlation function for a set of spherical particles contained in a cube with side length S. This simple function finds reference particles such that a sphere of radius rMax drawn around the particle will fit entirely within the cube, eliminating the need to compensate for edge effects. If no such particles exist, an error is returned. Try a smaller rMax...or write some code to handle edge effects! ;) Arguments: x an array of x positions of centers of particles y an array of y positions of centers of particles z an array of z positions of centers of particles S length of each side of the cube in space rMax outer diameter of largest spherical shell dr increment for increasing radius of spherical shell Returns a tuple: (g, radii, interior_x, interior_y, interior_z) g(r) a numpy array containing the correlation function g(r) radii a numpy array containing the radii of the spherical shells used to compute g(r) interior_x x coordinates of reference particles interior_y y coordinates of reference particles interior_z z coordinates of reference particles """ from numpy import zeros, sqrt, where, pi, average, arange, histogram x = data[0] y = data[1] z = data[2] # Find particles which are close enough to the cube center that a sphere of radius # rMax will not cross any face of the cube bools1 = x > rMax bools2 = x < (S - rMax) bools3 = y > rMax bools4 = y < (S - rMax) bools5 = z > rMax bools6 = z < (S - rMax) (interior_indices,) = where(bools1 * bools2 * bools3 * bools4 * bools5 * bools6) num_interior_particles = len(interior_indices) if num_interior_particles < 1: raise RuntimeError( "No particles found for which a sphere of radius rMax\ will lie entirely within a cube of side length S. Decrease rMax\ or increase the size of the cube." ) edges = arange(0.0, rMax + 1.1 * dr, dr) num_increments = len(edges) - 1 g = zeros([num_interior_particles, num_increments]) radii = zeros(num_increments) numberDensity = len(x) / S ** 3 # Compute pairwise correlation for each interior particle for p in range(num_interior_particles): index = interior_indices[p] d = sqrt((x[index] - x) ** 2 + (y[index] - y) ** 2 + (z[index] - z) ** 2) d[index] = 2 * rMax (result, bins) = histogram(d, bins=edges, normed=False) g[p, :] = result / numberDensity # Average g(r) for all interior particles and compute radii g_average = zeros(num_increments) for i in range(num_increments): radii[i] = (edges[i] + edges[i + 1]) / 2.0 rOuter = edges[i + 1] rInner = edges[i] g_average[i] = average(g[:, i]) / ( 4.0 / 3.0 * pi * (rOuter ** 3 - rInner ** 3) ) return ( g_average, radii, x[interior_indices], y[interior_indices], z[interior_indices], ) # Number of particles in shell/total number of particles/volume of shell/number density # shell volume = 4/3*pi(r_outer**3-r_inner**3) def PairCorrelationFunction_2D(self, x, y, S, rMax, dr): """Compute the two-dimensional pair correlation function, also known as the radial distribution function, for a set of circular particles contained in a square region of a plane. This simple function finds reference particles such that a circle of radius rMax drawn around the particle will fit entirely within the square, eliminating the need to compensate for edge effects. If no such particles exist, an error is returned. Try a smaller rMax...or write some code to handle edge effects! ;) Arguments: x an array of x positions of centers of particles y an array of y positions of centers of particles S length of each side of the square region of the plane rMax outer diameter of largest annulus dr increment for increasing radius of annulus Returns a tuple: (g, radii, interior_x, interior_y) g(r) a numpy array containing the correlation function g(r) radii a numpy array containing the radii of the annuli used to compute g(r) interior_x x coordinates of reference particles interior_y y coordinates of reference particles """ from numpy import zeros, sqrt, where, pi, average, arange, histogram # Number of particles in ring/area of ring/number of reference particles/number density # area of ring = pi*(r_outer**2 - r_inner**2) # Find particles which are close enough to the box center that a circle of radius # rMax will not cross any edge of the box bools1 = x > 1.1 * rMax bools2 = x < (S - 1.1 * rMax) bools3 = y > rMax * 1.1 bools4 = y < (S - rMax * 1.1) (interior_indices,) = where(bools1 * bools2 * bools3 * bools4) num_interior_particles = len(interior_indices) if num_interior_particles < 1: raise RuntimeError( "No particles found for which a circle of radius rMax\ will lie entirely within a square of side length S. Decrease rMax\ or increase the size of the square." ) edges = arange(0.0, rMax + 1.1 * dr, dr) num_increments = len(edges) - 1 g = zeros([num_interior_particles, num_increments]) radii = zeros(num_increments) numberDensity = len(x) / S ** 2 # Compute pairwise correlation for each interior particle for p in range(num_interior_particles): index = interior_indices[p] d = sqrt((x[index] - x) ** 2 + (y[index] - y) ** 2) d[index] = 2 * rMax (result, bins) = histogram(d, bins=edges, normed=False) g[p, :] = result / numberDensity # Average g(r) for all interior particles and compute radii g_average = zeros(num_increments) for i in range(num_increments): radii[i] = (edges[i] + edges[i + 1]) / 2.0 rOuter = edges[i + 1] rInner = edges[i] # divide by the area of sphere cut by sqyare g_average[i] = average(g[:, i]) / (pi * (rOuter ** 2 - rInner ** 2)) return (g_average, radii, interior_indices) def histo(self, distances, filename, bins=100, size=1000.0): pylab.clf() numpy.mean(distances), numpy.std(distances) # the histogram of the data # b=numpy.arange(distances.min(), distances.max(), 2) # n, bins, patches = pyplot.hist(distances, bins=bins, normed=1, facecolor='green')#, alpha=0.75) y, binEdges = numpy.histogram(distances, bins=bins) bincenters = 0.5 * (binEdges[1:] + binEdges[:-1]) menStd = numpy.sqrt(y) # or sigma? width = bins pyplot.bar(bincenters, y, width=width, color="r", yerr=menStd) # add a 'best fit' line? # y = mlab.normpdf( bins, mu, sigma)#should be the excepted distribution # l = pyplot.plot(bins, y, 'r--', linewidth=3) pyplot.savefig(filename) # pylab.close() # closes the current figure def plot(self, rdf, radii, file_name): pylab.clf() matplotlib.rc("font", size=14) matplotlib.rc("figure", figsize=(5, 4)) # pylab.clf() pylab.plot(radii, rdf, linewidth=3) pylab.xlabel(r"distance $r$ in $\AA$") pylab.ylabel(r"radial distribution function $g(r)$") pylab.savefig(file_name) def simpleplot(self, X, Y, filenameme, w=3): pylab.clf() pylab.plot(X, Y, linewidth=w) pylab.savefig(filenameme) def build_grid( self, bb, forceBuild=True, ): t1 = time() gridFileIn = None gridFileOut = None self.env.buildGrid( boundingBox=bb, gridFileIn=gridFileIn, rebuild=forceBuild, gridFileOut=gridFileOut, previousFill=False, ) t2 = time() gridTime = t2 - t1 print("time to Build Grid", gridTime) def pack( self, seed=20, vTestid=3, vAnalysis=0, fbox_bb=None, show_plotly_plot=True ): if show_plotly_plot: self.plotly.update_title(self.env.placeMethod) t1 = time() self.env.pack_grid( seedNum=seed, vTestid=vTestid, vAnalysis=vAnalysis, fbox=fbox_bb ) t2 = time() print("time to run pack_grid", self.env.placeMethod, t2 - t1) print("num placed", len(self.env.molecules)) if show_plotly_plot: self.plotly.update_title( f"{self.env.placeMethod} took {str(round(t2 - t1, 2))}s, packed {len(self.env.molecules)}" ) self.plotly.make_grid_heatmap(self.env) self.plotly.add_ingredient_positions(self.env) self.plotly.show() def calcDistanceMatrixFastEuclidean2(self, nDimPoints): nDimPoints = numpy.array(nDimPoints) n, m = nDimPoints.shape delta = numpy.zeros((n, n), "d") for d in range(m): data = nDimPoints[:, d] delta += (data - data[:, numpy.newaxis]) ** 2 return numpy.sqrt(delta) def flush(self): import gc import pprint for i in range(2): print("Collecting %d ..." % i) n = gc.collect() print("Unreachable objects:", n) print("Remaining Garbage:") pprint.pprint(gc.garbage) del gc.garbage[:] print def merge(self, d1, d2, merge=lambda x, y: y): result = dict(d1) for k, v in d2.items(): if k in result: result[k].extend(v) else: result[k] = v return result def plotNResult2D(self, n, bbox=[[0.0, 0, 0.0], [1000.0, 1000.0, 1000.0]]): for i in range(n): f = "results_seed_" + str(i) + ".json" self.plot_one_result_2d(filename=f, bbox=bbox) def plot_one_result_2d( self, data=None, filename=None, bbox=[[0.0, 0, 0.0], [1000.0, 1000.0, 1000.0]] ): if data is None and filename is None: return elif data is None and filename is not None: with open(filename) as data_file: data = json.load(data_file) fig = pyplot.figure() ax = fig.add_subplot(111) radius = {} ingrrot = {} ingrpos = {} for recipe in data: for ingrname in data[recipe]: for k in range(len(data[recipe][ingrname]["results"])): if ingrname not in ingrrot: ingrrot[ingrname] = [] ingrpos[ingrname] = [] radius[ingrname] = data[recipe][ingrname]["encapsulatingRadius"] ingrrot[ingrname].append(data[recipe][ingrname]["results"][k][1]) ingrpos[ingrname].append(data[recipe][ingrname]["results"][k][0]) for ingr in ingrpos: for i, p in enumerate(ingrpos[ingr]): ax.add_patch( Circle( (p[0], p[1]), radius[ingr], edgecolor="black", facecolor="red" ) ) ax.set_aspect(1.0) pyplot.axhline(y=bbox[0][1], color="k") pyplot.axhline(y=bbox[1][1], color="k") pyplot.axvline(x=bbox[0][0], color="k") pyplot.axvline(x=bbox[1][0], color="k") pyplot.axis([bbox[0][0], bbox[1][0], bbox[0][1], bbox[1][1]]) pyplot.savefig("plot" + ingr + ".png") pylab.close() # closes the current figure return ingrpos # res=plotOneResult(None,filename="results_seed_8.json") def plot_one_result_3D(self, filename, width=1000.0): plt.close("all") # closes the current figure pos = [] s = [] c = [] for i in range(len(self.env.molecules)): m = self.env.molecules[i] pos.append(numpy.array(m[0]).tolist()) s.append(m[2].encapsulatingRadius ** 2) c.append(m[2].color) fig = plt.figure() ax = fig.gca(projection="3d") x, y, z = numpy.array(pos).transpose() ax.scatter(x, y, z, s=s, c=c) ax.legend() ax.set_xlim3d(0, width) ax.set_ylim3d(0, width) ax.set_zlim3d(0, width) plt.savefig(filename) return x, y, z, s, c def one_exp(self, seed, output_path, eid=0, nmol=1, periodicity=True, dim=2): output = output_path + str(nmol) if periodicity: self.env.use_periodicity = True autopack.testPeriodicity = True else: self.env.use_periodicity = False autopack.testPeriodicity = False if dim == 3: autopack.biasedPeriodicity = [1, 1, 1] else: autopack.biasedPeriodicity = [1, 1, 0] if not os.path.exists(output): os.makedirs(output) def getHaltonUnique(self, n): seeds_f = numpy.array(halton(int(n * 1.5))) * int(n * 1.5) seeds_int = numpy.array(
numpy.round(seeds_f)
numpy.round
from __future__ import division import numpy as np def fun(xx): ########################################################################## # # ROBOT ARM FUNCTION # # Author: <NAME>, Colorado School of Mines # Questions/Comments: Please email <NAME> at <EMAIL> # # Copyright 2016, <NAME>, Colorado School of Mines # # THERE IS NO WARRANTY, EXPRESS OR IMPLIED. WE DO NOT ASSUME ANY LIABILITY # FOR THE USE OF THIS SOFTWARE. If software is modified to produce # derivative works, such modified software should be clearly marked. # Additionally, this program is free software; you can redistribute it # and/or modify it under the terms of the GNU General Public License as # published by the Free Software Foundation; version 2.0 of the License. # Accordingly, this program is distributed in the hope that it will be # useful, but WITHOUT ANY WARRANTY; without even the implied warranty # of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # General Public License for more details. # # For function details and reference information, see: # http://www.sfu.ca/~ssurjano/ # ########################################################################## # # OUTPUT AND INPUTS: # # y = distance from the end of the arm to the origin # xx = [theta1, theta2, theta3, theta4, L1, L2, L3, L4] # ######################################################################### # Shift and scale inputs from [-1,1] hypercube to describe ranges pi = np.pi b = pi/2 a = -pi/2 theta = (xx[0:4]+1)*(b-a)*0.5+a L = (xx[4:8]+1)*0.5+a L1 = L[0] L2 = L[1] L3 = L[2] L4 = L[3] T1 = theta[0] T2 = theta[1] T3 = theta[2] T4 = theta[3] u = L1*np.cos(T1)+L2*np.cos(T1+T2)+L3*np.cos(T1+T2+T3)+L4*np.cos(T1+T2+T3+T4) v = L1*np.sin(T1)+L2*np.sin(T1+T2)+L3*np.sin(T1+T2+T3)+L4*np.sin(T1+T2+T3+T4) f = (u**2 + v**2)**(0.5); out = np.array([ #(1/2)*(2*(L1*np.cos(T1)+L2*np.cos(T1+T2)+L3*np.cos(T1+T2+T3)+L4*np.cos( \ #T1+T2+T3+T4))*((-1)*L1*np.sin(T1)+(-1)*L2*np.sin(T1+T2)+(-1)*L3* \ #np.sin(T1+T2+T3)+(-1)*L4*np.sin(T1+T2+T3+T4))+2*(L1*np.cos(T1)+L2*np.cos( \ #T1+T2)+L3*np.cos(T1+T2+T3)+L4*np.cos(T1+T2+T3+T4))*(L1*np.sin(T1)+L2* \ #np.sin(T1+T2)+L3*np.sin(T1+T2+T3)+L4*np.sin(T1+T2+T3+T4)))*((L1*np.cos(T1) \ #+L2*np.cos(T1+T2)+L3*np.cos(T1+T2+T3)+L4*np.cos(T1+T2+T3+T4))**2+(L1* \ #np.sin(T1)+L2*np.sin(T1+T2)+L3*np.sin(T1+T2+T3)+L4*np.sin(T1+T2+T3+T4))**2) \ #**(-1/2), 1e-12, (1/2)*(2*(L1*np.cos(T1)+L2*np.cos(T1+T2)+L3*np.cos(T1+T2+T3)+L4*np.cos( \ T1+T2+T3+T4))*((-1)*L2*np.sin(T1+T2)+(-1)*L3*np.sin(T1+T2+T3)+(-1) \ *L4*np.sin(T1+T2+T3+T4))+2*(L2*np.cos(T1+T2)+L3*np.cos(T1+T2+T3)+L4* \ np.cos(T1+T2+T3+T4))*(L1*np.sin(T1)+L2*np.sin(T1+T2)+L3*
np.sin(T1+T2+T3)
numpy.sin
import os import cv2 import math import numpy as np import tensorflow as tf from tensorflow.contrib.framework.python.ops import add_arg_scope from tensorflow.python.training import moving_averages from PIL import Image, ImageDraw ################### Mask ################### def random_bbox(img_height=256, img_width=256, margins=0, mask_size=128, random_mask=True): """Generate a random tlhw with configuration. Args: img_height: height of image. img_width: width of image. margins: margins of mask and image border. mask_size: size of mask. random_mask: if True, random location. if False, central location. Returns: tuple: (top, left, height, width) """ if random_mask is True: maxt = img_height - margins - mask_size maxl = img_width - margins - mask_size t = tf.random_uniform( [], minval=margins, maxval=maxt, dtype=tf.int32) l = tf.random_uniform( [], minval=margins, maxval=maxl, dtype=tf.int32) else: t = (img_height - mask_size)//2 l = (img_width - mask_size)//2 h = tf.constant(mask_size) w = tf.constant(mask_size) return (t, l, h, w) def bbox2mask(bbox, img_height=256, img_width=256, max_delta=32, name='mask'): """Generate mask tensor from bbox. Args: bbox: configuration tuple, (top, left, height, width) img_height: height of image. img_width: width of image. max_delta: max delta of masks. name: name of variable scope. Returns: tf.Tensor: output with shape [1, H, W, 1] """ def npmask(bbox, height, width, delta): mask = np.zeros((1, height, width, 1), np.float32) h = np.random.randint(delta//2+1) w = np.random.randint(delta//2+1) mask[:, bbox[0]+h:bbox[0]+bbox[2]-h, bbox[1]+w:bbox[1]+bbox[3]-w, :] = 1. return mask with tf.variable_scope(name), tf.device('/cpu:0'): mask = tf.py_func( npmask, [bbox, img_height, img_width, max_delta], tf.float32, stateful=False) mask.set_shape([1] + [img_height, img_width] + [1]) return mask def brush_stroke_mask(img_height=256, img_width=256, name='mask'): """Generate free form mask tensor. Returns: tf.Tensor: output with shape [1, H, W, 1] """ min_num_vertex = 4 max_num_vertex = 12 mean_angle = 2*math.pi / 5 angle_range = 2*math.pi / 15 min_width = 12 max_width = 40 def generate_mask(H, W): average_radius = math.sqrt(H*H+W*W) / 8 mask = Image.new('L', (W, H), 0) for _ in range(np.random.randint(1, 4)): num_vertex = np.random.randint(min_num_vertex, max_num_vertex) angle_min = mean_angle - np.random.uniform(0, angle_range) angle_max = mean_angle + np.random.uniform(0, angle_range) angles = [] vertex = [] for i in range(num_vertex): if i % 2 == 0: angles.append(2*math.pi - np.random.uniform(angle_min, angle_max)) else: angles.append(np.random.uniform(angle_min, angle_max)) h, w = mask.size vertex.append((int(
np.random.randint(0, w)
numpy.random.randint
""" gui/average3 ~~~~~~~~~~~~~~~~~~~~ Graphical user interface for three-dimensional averaging of particles :author: <NAME>, 2017-2018 :copyright: Copyright (c) 2017-2018 Jungmann Lab, MPI of Biochemistry """ import os.path import sys import traceback import colorsys import matplotlib.pyplot as plt import numba import numpy as np import scipy from scipy import signal from PyQt5 import QtCore, QtGui, QtWidgets from .. import io, lib, render from numpy.lib.recfunctions import stack_arrays from cmath import rect, phase from tqdm import tqdm import scipy.ndimage.filters DEFAULT_OVERSAMPLING = 1.0 INITIAL_REL_MAXIMUM = 2.0 ZOOM = 10 / 7 N_GROUP_COLORS = 8 @numba.jit(nopython=True, nogil=True) def render_hist(x, y, oversampling, t_min, t_max): n_pixel = int(np.ceil(oversampling * (t_max - t_min))) in_view = (x > t_min) & (y > t_min) & (x < t_max) & (y < t_max) x = x[in_view] y = y[in_view] x = oversampling * (x - t_min) y = oversampling * (y - t_min) image = np.zeros((n_pixel, n_pixel), dtype=np.float32) render._fill(image, x, y) return len(x), image @numba.jit(nopython=True, nogil=True) def render_histxyz(a, b, oversampling, a_min, a_max, b_min, b_max): n_pixel_a = int(np.ceil(oversampling * (a_max - a_min))) n_pixel_b = int(np.ceil(oversampling * (b_max - b_min))) in_view = (a > a_min) & (b > b_min) & (a < a_max) & (b < b_max) a = a[in_view] b = b[in_view] a = oversampling * (a - a_min) b = oversampling * (b - b_min) image = np.zeros((n_pixel_b, n_pixel_a), dtype=np.float32) render._fill(image, a, b) return len(a), image def rotate_axis(axis, vx, vy, vz, angle, pixelsize): if axis == "z": vx_rot = np.cos(angle) * vx - np.sin(angle) * vy vy_rot = np.sin(angle) * vx + np.cos(angle) * vy vz_rot = vz elif axis == "y": vx_rot = np.cos(angle) * vx + np.sin(angle) * np.divide(vz, pixelsize) vy_rot = vy vz_rot = -np.sin(angle) * vx * pixelsize + np.cos(angle) * vz elif axis == "x": vx_rot = vx vy_rot = np.cos(angle) * vy - np.sin(angle) * np.divide(vz, pixelsize) vz_rot = np.sin(angle) * vy * pixelsize + np.cos(angle) * vz return vx_rot, vy_rot, vz_rot def compute_xcorr(CF_image_avg, image): F_image = np.fft.fft2(image) xcorr = np.fft.fftshift(np.real(np.fft.ifft2((F_image * CF_image_avg)))) return xcorr class ParametersDialog(QtWidgets.QDialog): def __init__(self, window): super().__init__(window) self.window = window self.setWindowTitle("Parameters") self.setModal(False) grid = QtWidgets.QGridLayout(self) grid.addWidget(QtWidgets.QLabel("Oversampling:"), 0, 0) self.oversampling = QtWidgets.QDoubleSpinBox() self.oversampling.setRange(1, 200) self.oversampling.setValue(DEFAULT_OVERSAMPLING) self.oversampling.setDecimals(1) self.oversampling.setKeyboardTracking(False) self.oversampling.valueChanged.connect(self.window.updateLayout) grid.addWidget(self.oversampling, 0, 1) self.iterations = QtWidgets.QSpinBox() self.iterations.setRange(1, 1) self.iterations.setValue(1) class View(QtWidgets.QLabel): def __init__(self, window): super().__init__() self.window = window self.setMinimumSize(1, 1) self.setAlignment(QtCore.Qt.AlignCenter) self.setAcceptDrops(True) self._pixmap = None def dragEnterEvent(self, event): if event.mimeData().hasUrls(): event.accept() else: event.ignore() def dropEvent(self, event): urls = event.mimeData().urls() path = urls[0].toLocalFile() ext = os.path.splitext(path)[1].lower() if ext == ".hdf5": self.open(path) def resizeEvent(self, event): if self._pixmap is not None: self.set_pixmap(self._pixmap) def set_image(self, image): cmap = np.uint8(np.round(255 * plt.get_cmap("magma")(np.arange(256)))) image /= image.max() image = np.minimum(image, 1.0) image = np.round(255 * image).astype("uint8") Y, X = image.shape self._bgra = np.zeros((Y, X, 4), dtype=np.uint8, order="C") self._bgra[..., 0] = cmap[:, 2][image] self._bgra[..., 1] = cmap[:, 1][image] self._bgra[..., 2] = cmap[:, 0][image] qimage = QtGui.QImage(self._bgra.data, X, Y, QtGui.QImage.Format_RGB32) self._pixmap = QtGui.QPixmap.fromImage(qimage) self.set_pixmap(self._pixmap) def set_pixmap(self, pixmap): self.setPixmap( pixmap.scaled( self.width(), self.height(), QtCore.Qt.KeepAspectRatio, QtCore.Qt.FastTransformation, ) ) def update_image(self, *args): oversampling = self.window.parameters_dialog.oversampling.value() t_min = -self.r t_max = self.r N_avg, image_avg = render.render_hist( self.locs, oversampling, t_min, t_min, t_max, t_max ) self.set_image(image_avg) class DatasetDialog(QtWidgets.QDialog): def __init__(self, window): super().__init__(window) self.window = window self.setWindowTitle("Datasets") self.setModal(False) self.layout = QtWidgets.QVBoxLayout() self.checks = [] self.setLayout(self.layout) def add_entry(self, path): c = QtWidgets.QCheckBox(path) self.layout.addWidget(c) self.checks.append(c) self.checks[-1].setChecked(True) class Window(QtWidgets.QMainWindow): def __init__(self): super().__init__() self.setWindowTitle("Picasso: Average3") self.resize(1024, 512) this_directory = os.path.dirname(os.path.realpath(__file__)) icon_path = os.path.join(this_directory, "icons", "average.ico") icon = QtGui.QIcon(icon_path) self.setWindowIcon(icon) self.setAcceptDrops(True) self.parameters_dialog = ParametersDialog(self) self.dataset_dialog = DatasetDialog(self) menu_bar = self.menuBar() file_menu = menu_bar.addMenu("File") open_action = file_menu.addAction("Open") open_action.setShortcut(QtGui.QKeySequence.Open) open_action.triggered.connect(self.open) file_menu.addAction(open_action) save_action = file_menu.addAction("Save") save_action.setShortcut(QtGui.QKeySequence.Save) save_action.triggered.connect(self.save) file_menu.addAction(save_action) process_menu = menu_bar.addMenu("Process") parameters_action = process_menu.addAction("Parameters") parameters_action.setShortcut("Ctrl+P") parameters_action.triggered.connect(self.parameters_dialog.show) dataset_action = process_menu.addAction("Datasets") dataset_action.triggered.connect(self.dataset_dialog.show) self.status_bar = self.statusBar() self._pixmap = None self.locs = [] self.z_state = [] self.group_index = [] self.infos = [] self.locs_paths = [] self._mode = "Zoom" self._pan = False self._size_hint = (768, 768) self.n_locs = 0 self._picks = [] self.index_blocks = [] self._drift = [] # Define DisplaySettingsDialog self.viewxy = QtWidgets.QLabel("") self.viewxz = QtWidgets.QLabel("") self.viewyz = QtWidgets.QLabel("") self.viewcp = QtWidgets.QLabel("") minsize = 512 self.viewxy.setFixedWidth(minsize) self.viewxy.setFixedHeight(minsize) self.viewxz.setFixedWidth(minsize) self.viewxz.setFixedHeight(minsize) self.viewyz.setFixedWidth(minsize) self.viewyz.setFixedHeight(minsize) self.viewcp.setFixedWidth(minsize) self.viewcp.setFixedHeight(minsize) # Define layout display_groupbox = QtWidgets.QGroupBox("Display") displaygrid = QtWidgets.QGridLayout(display_groupbox) displaygrid.addWidget(QtWidgets.QLabel("XY"), 0, 0) displaygrid.addWidget(self.viewxy, 1, 0) displaygrid.addWidget(QtWidgets.QLabel("XZ"), 0, 1) displaygrid.addWidget(self.viewxz, 1, 1) displaygrid.addWidget(QtWidgets.QLabel("YZ"), 2, 0) displaygrid.addWidget(self.viewyz, 3, 0) displaygrid.addWidget(QtWidgets.QLabel("CP"), 2, 1) displaygrid.addWidget(self.viewcp, 3, 1) button_groupbox = QtWidgets.QGroupBox("Buttons") buttongrid = QtWidgets.QGridLayout(button_groupbox) rotation_groupbox = QtWidgets.QGroupBox("Rotation + Translation") rotationgrid = QtWidgets.QGridLayout(rotation_groupbox) centerofmassbtn = QtWidgets.QPushButton("Center of Mass XYZ") axis_groupbox = QtWidgets.QGroupBox("Axis") axisgrid = QtWidgets.QGridLayout(axis_groupbox) self.x_axisbtn = QtWidgets.QRadioButton("X") self.y_axisbtn = QtWidgets.QRadioButton("Y") self.z_axisbtn = QtWidgets.QRadioButton("Z") self.z_axisbtn.setChecked(True) axisgrid.addWidget(self.x_axisbtn, 0, 0) axisgrid.addWidget(self.y_axisbtn, 0, 1) axisgrid.addWidget(self.z_axisbtn, 0, 2) proj_groupbox = QtWidgets.QGroupBox("Projection") projgrid = QtWidgets.QGridLayout(proj_groupbox) self.xy_projbtn = QtWidgets.QRadioButton("XY") self.yz_projbtn = QtWidgets.QRadioButton("YZ") self.xz_projbtn = QtWidgets.QRadioButton("XZ") self.xy_projbtn.setChecked(True) projgrid.addWidget(self.xy_projbtn, 0, 0) projgrid.addWidget(self.yz_projbtn, 0, 1) projgrid.addWidget(self.xz_projbtn, 0, 2) rotatebtn = QtWidgets.QPushButton("Rotate") self.radio_sym = QtWidgets.QRadioButton("x symmetry") self.symEdit = QtWidgets.QSpinBox() self.symEdit.setRange(2, 100) self.symEdit.setValue(8) self.radio_sym_custom = QtWidgets.QRadioButton("custom symmetry") self.symcustomEdit = QtWidgets.QLineEdit("90,180,270") deg_groupbox = QtWidgets.QGroupBox("Degrees") deggrid = QtWidgets.QGridLayout(deg_groupbox) self.full_degbtn = QtWidgets.QRadioButton("Full") self.part_degbtn = QtWidgets.QRadioButton("Part") self.degEdit = QtWidgets.QTextEdit() self.degEdit = QtWidgets.QSpinBox() self.degEdit.setRange(1, 10) self.degEdit.setValue(5) deggrid.addWidget(self.full_degbtn, 0, 0) deggrid.addWidget(self.part_degbtn, 0, 1) deggrid.addWidget(self.degEdit, 0, 2) self.full_degbtn.setChecked(True) # Rotation Groupbox rotationgrid.addWidget(axis_groupbox, 0, 0, 1, 2) rotationgrid.addWidget(proj_groupbox, 1, 0, 1, 2) rotationgrid.addWidget(deg_groupbox, 2, 0, 1, 2) rotationgrid.addWidget(rotatebtn, 3, 0, 1, 2) rotationgrid.addWidget(self.symEdit, 4, 0) rotationgrid.addWidget(self.radio_sym, 4, 1) rotationgrid.addWidget(self.radio_sym_custom, 5, 0) rotationgrid.addWidget(self.symcustomEdit, 5, 1) buttongrid.addWidget(centerofmassbtn, 0, 0) buttongrid.addWidget(rotation_groupbox, 1, 0) centerofmassbtn.clicked.connect(self.centerofmass) rotatebtn.clicked.connect(self.rotate_groups) self.translatebtn = QtWidgets.QCheckBox("Translate only") self.flipbtn = QtWidgets.QCheckBox("Consider flipped structures") self.alignxbtn = QtWidgets.QPushButton("Align X") self.alignybtn = QtWidgets.QPushButton("Align Y") self.alignzzbtn = QtWidgets.QPushButton("Align Z_Z") self.alignzybtn = QtWidgets.QPushButton("Align Z_Y") self.translatexbtn = QtWidgets.QPushButton("Translate X") self.translateybtn = QtWidgets.QPushButton("Translate Y") self.translatezbtn = QtWidgets.QPushButton("Translate Z") self.rotatexy_convbtn = QtWidgets.QPushButton("Rotate XY - Convolution") self.scorebtn = QtWidgets.QPushButton("Calculate Score") operate_groupbox = QtWidgets.QGroupBox("Operate") operategrid = QtWidgets.QGridLayout(operate_groupbox) rotationgrid.addWidget(self.translatebtn, 7, 0) rotationgrid.addWidget(self.flipbtn, 8, 0) self.x_range = QtWidgets.QLineEdit("-3,3") rotationgrid.addWidget(QtWidgets.QLabel("x-Range (Px)"), 9, 0) rotationgrid.addWidget(self.x_range, 9, 1) self.y_range = QtWidgets.QLineEdit("-3,3") rotationgrid.addWidget(QtWidgets.QLabel("y-Range (Px)"), 10, 0) rotationgrid.addWidget(self.y_range, 10, 1) self.z_range = QtWidgets.QLineEdit("-1000,1000") rotationgrid.addWidget(QtWidgets.QLabel("z-Range (nm)"), 11, 0) rotationgrid.addWidget(self.z_range, 11, 1) self.z_range.textChanged.connect(self.adjust_z) self.x_range.textChanged.connect(self.adjust_xy) self.y_range.textChanged.connect(self.adjust_xy) operategrid.addWidget(self.alignxbtn, 0, 1) operategrid.addWidget(self.alignybtn, 1, 1) operategrid.addWidget(self.alignzzbtn, 2, 1) operategrid.addWidget(self.alignzybtn, 3, 1) operategrid.addWidget(self.translatexbtn, 0, 0) operategrid.addWidget(self.translateybtn, 1, 0) operategrid.addWidget(self.translatezbtn, 2, 0) operategrid.addWidget(self.rotatexy_convbtn, 4, 0) operategrid.addWidget(self.scorebtn, 4, 1) self.rotatexy_convbtn.clicked.connect(self.rotatexy_convolution) self.alignxbtn.clicked.connect(self.align_x) self.alignybtn.clicked.connect(self.align_y) self.alignzzbtn.clicked.connect(self.align_zz) self.alignzybtn.clicked.connect(self.align_zy) self.translatexbtn.clicked.connect(self.translate_x) self.translateybtn.clicked.connect(self.translate_y) self.translatezbtn.clicked.connect(self.translate_z) self.scorebtn.clicked.connect(self.calculate_score) buttongrid.addWidget(operate_groupbox, 2, 0) self.contrastEdit = QtWidgets.QDoubleSpinBox() self.contrastEdit.setDecimals(1) self.contrastEdit.setRange(0, 10) self.contrastEdit.setValue(0.5) self.contrastEdit.setSingleStep(0.1) self.contrastEdit.valueChanged.connect(self.updateLayout) self.grid = QtWidgets.QGridLayout() self.grid.addWidget(display_groupbox, 0, 0, 2, 1) self.grid.addWidget(button_groupbox, 0, 1, 1, 1) contrast_groupbox = QtWidgets.QGroupBox("Contrast") contrastgrid = QtWidgets.QGridLayout(contrast_groupbox) contrastgrid.addWidget(self.contrastEdit) buttongrid.addWidget(contrast_groupbox) MODEL_X_DEFAULT = "0,20,40,60,0,20,40,60,0,20,40,60" MODEL_Y_DEFAULT = "0,20,40,0,20,40,0,20,40,0,20,40" MODEL_Z_DEFAULT = "0,0,0,0,0,0,0,0,0,0,0,0" self.modelchk = QtWidgets.QCheckBox("Use Model") self.model_x = QtWidgets.QLineEdit(MODEL_X_DEFAULT) self.model_y = QtWidgets.QLineEdit(MODEL_Y_DEFAULT) self.model_z = QtWidgets.QLineEdit(MODEL_Z_DEFAULT) self.model_preview_btn = QtWidgets.QPushButton("Preview") self.model_preview_btn.clicked.connect(self.model_preview) self.modelblurEdit = QtWidgets.QDoubleSpinBox() self.modelblurEdit.setDecimals(1) self.modelblurEdit.setRange(0, 10) self.modelblurEdit.setValue(0.5) self.modelblurEdit.setSingleStep(0.1) self.pixelsizeEdit = QtWidgets.QSpinBox() self.pixelsizeEdit.setRange(1, 999) self.pixelsizeEdit.setValue(130) model_groupbox = QtWidgets.QGroupBox("Model") modelgrid = QtWidgets.QGridLayout(model_groupbox) modelgrid.addWidget(self.modelchk, 0, 0) modelgrid.addWidget(QtWidgets.QLabel("X-Coordinates"), 1, 0) modelgrid.addWidget(self.model_x, 1, 1) modelgrid.addWidget(QtWidgets.QLabel("Y-Coordinates"), 2, 0) modelgrid.addWidget(self.model_y, 2, 1) modelgrid.addWidget(QtWidgets.QLabel("Z-Coordinates"), 3, 0) modelgrid.addWidget(self.model_z, 3, 1) modelgrid.addWidget(QtWidgets.QLabel("Blur:"), 4, 0) modelgrid.addWidget(self.modelblurEdit, 4, 1) modelgrid.addWidget(QtWidgets.QLabel("Pixelsize:"), 5, 0) modelgrid.addWidget(self.pixelsizeEdit, 5, 1) modelgrid.addWidget(self.model_preview_btn, 6, 0) modelgrid.addWidget(self.modelchk, 6, 1) buttongrid.addWidget(model_groupbox) mainWidget = QtWidgets.QWidget() mainWidget.setLayout(self.grid) self.setCentralWidget(mainWidget) self.status_bar.showMessage("Average3 ready.") def open(self): path, exe = QtWidgets.QFileDialog.getOpenFileName( self, "Open localizations", filter="*.hdf5" ) if path: self.add(path) def save(self, path): n_channels = len(self.locs) for i in range(n_channels): cx = self.infos[i][0]["Width"] / 2 cy = self.infos[i][0]["Height"] / 2 out_locs = self.locs[i].copy() out_locs.x += cx out_locs.y += cy info = self.infos[i] + [{"Generated by": "Picasso Average3"}] if not self.z_state[i]: out_locs = lib.remove_from_rec(out_locs, "z") out_path = os.path.splitext(self.locs_paths[i])[0] + "_avg3.hdf5" path, exe = QtWidgets.QFileDialog.getSaveFileName( self, "Save localizations", out_path, filter="*.hdf5" ) io.save_locs(path, out_locs, info) def dragEnterEvent(self, event): if event.mimeData().hasUrls(): event.accept() else: event.ignore() def dropEvent(self, event): urls = event.mimeData().urls() path = urls[0].toLocalFile() ext = os.path.splitext(path)[1].lower() if ext == ".hdf5": print("Opening {} ..".format(path)) self.add(path) def add(self, path, rendermode=True): try: locs, info = io.load_locs(path, qt_parent=self) except io.NoMetadataFileError: return if len(self.locs) == 0: self.pixelsize = 0 if not hasattr(locs, "group"): msgBox = QtWidgets.QMessageBox(self) msgBox.setWindowTitle("Error") msgBox.setText( ("Datafile does not contain group information." " Please load file with picked localizations.") ) msgBox.exec_() else: locs = lib.ensure_sanity(locs, info) if not hasattr(locs, "z"): locs = lib.append_to_rec(locs, locs.x.copy(), "z") self.pixelsize = 1 has_z = False else: has_z = True if self.pixelsize == 0: pixelsize, ok = QtWidgets.QInputDialog.getInt( self, "Pixelsize Dialog", "Please enter the pixelsize in nm", 130, ) if ok: self.pixelsize = pixelsize else: self.pixelsize = 130 self.locs.append(locs) self.z_state.append(has_z) self.infos.append(info) self.locs_paths.append(path) self.index_blocks.append(None) self._drift.append(None) self.dataset_dialog.add_entry(path) self.dataset_dialog.checks[-1].stateChanged.connect( self.updateLayout ) cx = self.infos[-1][0]["Width"] / 2 cy = self.infos[-1][0]["Height"] / 2 self.locs[-1].x -= cx self.locs[-1].y -= cy if len(self.locs) == 1: self.median_lp = np.mean( [np.median(locs.lpx), np.median(locs.lpy)] ) if hasattr(locs, "group"): groups = np.unique(locs.group) groupcopy = locs.group.copy() for i in range(len(groups)): groupcopy[locs.group == groups[i]] = i np.random.shuffle(groups) groups %= N_GROUP_COLORS self.group_color = groups[groupcopy] if render: self.fit_in_view(autoscale=True) else: if render: self.update_scene() self.oversampling = 1 if len(self.locs) == 1: self.t_min = np.min([np.min(locs.x), np.min(locs.y)]) self.t_max = np.max([np.max(locs.x), np.max(locs.y)]) self.z_min = np.min(locs.z) self.z_max = np.max(locs.z) else: self.t_min = np.min( [np.min(locs.x), np.min(locs.y), self.t_min] ) self.t_max = np.max( [np.max(locs.x), np.max(locs.y), self.t_max] ) self.z_min = np.min([np.min(locs.z), self.z_min]) self.z_max = np.min([np.max(locs.z), self.z_max]) if len(self.locs) == 1: print("Dataset loaded from {}.".format(path)) else: print( ("Dataset loaded from {}," " Total number of datasets {}.").format( path, len(self.locs) ) ) # CREATE GROUP INDEX if hasattr(locs, "group"): groups = np.unique(locs.group) n_groups = len(groups) n_locs = len(locs) group_index = scipy.sparse.lil_matrix( (n_groups, n_locs), dtype=np.bool ) progress = lib.ProgressDialog( "Creating group index", 0, len(groups), self ) progress.set_value(0) for i, group in enumerate(groups): index = np.where(locs.group == group)[0] group_index[i, index] = True progress.set_value(i + 1) self.group_index.append(group_index) self.n_groups = n_groups os.chdir(os.path.dirname(path)) self.calculate_radii() self.oversampling = 4 self.updateLayout() def updateLayout(self): if len(self.locs) > 0: pixmap1, pixmap2, pixmap3 = self.hist_multi_channel(self.locs) self.viewxy.setPixmap(pixmap1) self.viewxz.setPixmap(pixmap2) self.viewyz.setPixmap(pixmap3) def centerofmass_all(self): # Align all by center of mass n_channels = len(self.locs) out_locs_x = [] out_locs_y = [] out_locs_z = [] for j in range(n_channels): sel_locs_x = [] sel_locs_y = [] sel_locs_z = [] # stack arrays sel_locs_x = self.locs[j].x sel_locs_y = self.locs[j].y sel_locs_z = self.locs[j].z out_locs_x.append(sel_locs_x) out_locs_y.append(sel_locs_y) out_locs_z.append(sel_locs_z) out_locs_x = stack_arrays(out_locs_x, asrecarray=True, usemask=False) out_locs_y = stack_arrays(out_locs_y, asrecarray=True, usemask=False) out_locs_z = stack_arrays(out_locs_z, asrecarray=True, usemask=False) mean_x = np.mean(out_locs_x) mean_y = np.mean(out_locs_y) mean_z = np.mean(out_locs_z) for j in range(n_channels): self.locs[j].x -= mean_x self.locs[j].y -= mean_y self.locs[j].z -= mean_z def calculate_radii(self): # CALCULATE PROPER R VALUES n_channels = len(self.locs) self.r = 0 self.r_z = 0 for j in range(n_channels): self.r = np.max( [ 3 * np.sqrt( np.mean(self.locs[j].x ** 2 + self.locs[j].y ** 2) ), self.r, ] ) self.r_z = np.max( [5 * np.sqrt(np.mean(self.locs[j].z ** 2)), self.r_z] ) self.t_min = -self.r self.t_max = self.r self.z_min = -self.r_z self.z_max = self.r_z self.z_min_load = self.z_min.copy() self.z_max_load = self.z_max.copy() def centerofmass(self): print("Aligning by center of mass.. ", end="", flush=True) n_groups = self.n_groups n_channels = len(self.locs) progress = lib.ProgressDialog( "Aligning by center of mass", 0, n_groups, self ) progress.set_value(0) for i in range(n_groups): out_locs_x = [] out_locs_y = [] out_locs_z = [] for j in range(n_channels): sel_locs_x = [] sel_locs_y = [] sel_locs_z = [] index = self.group_index[j][i, :].nonzero()[1] # stack arrays sel_locs_x = self.locs[j].x[index] sel_locs_y = self.locs[j].y[index] sel_locs_z = self.locs[j].z[index] out_locs_x.append(sel_locs_x) out_locs_y.append(sel_locs_y) out_locs_z.append(sel_locs_z) progress.set_value(i + 1) out_locs_x = stack_arrays( out_locs_x, asrecarray=True, usemask=False ) out_locs_y = stack_arrays( out_locs_y, asrecarray=True, usemask=False ) out_locs_z = stack_arrays( out_locs_z, asrecarray=True, usemask=False ) mean_x = np.mean(out_locs_x) mean_y = np.mean(out_locs_y) mean_z = np.mean(out_locs_z) for j in range(n_channels): index = self.group_index[j][i, :].nonzero()[1] self.locs[j].x[index] -= mean_x self.locs[j].y[index] -= mean_y self.locs[j].z[index] -= mean_z self.calculate_radii() self.updateLayout() print("Complete.") def histtoImage(self, image): cmap = np.uint8(np.round(255 * plt.get_cmap("magma")(np.arange(256)))) image /= image.max() image = np.minimum(image, 1.0) image = np.round(255 * image).astype("uint8") Y, X = image.shape self._bgra = np.zeros((Y, X, 4), dtype=np.uint8, order="C") self._bgra[..., 0] = cmap[:, 2][image] self._bgra[..., 1] = cmap[:, 1][image] self._bgra[..., 2] = cmap[:, 0][image] qimage = QtGui.QImage(self._bgra.data, X, Y, QtGui.QImage.Format_RGB32) qimage = qimage.scaled( self.viewxy.width(), np.round(self.viewxy.height() * Y / X), QtCore.Qt.KeepAspectRatioByExpanding, ) pixmap = QtGui.QPixmap.fromImage(qimage) return pixmap def hist_multi_channel(self, locs): oversampling = self.parameters_dialog.oversampling.value() self.oversampling = oversampling if locs is None: locs = self.locs n_channels = len(locs) hues = np.arange(0, 1, 1 / n_channels) colors = [colorsys.hsv_to_rgb(_, 1, 1) for _ in hues] renderings = [] for i in range(n_channels): if self.dataset_dialog.checks[i].isChecked(): renderings.append( render.render_hist3d( locs[i], oversampling, self.t_min, self.t_min, self.t_max, self.t_max, self.z_min, self.z_max, self.pixelsize, ) ) images = np.array([_[1] for _ in renderings]) pixmap1 = self.pixmap_from_colors(images, colors, 2) pixmap2 = self.pixmap_from_colors(images, colors, 0) pixmap3 = self.pixmap_from_colors(images, colors, 1) return pixmap1, pixmap2, pixmap3 def pixmap_from_colors(self, images, colors, axisval): if axisval == 2: image = [np.sum(_, axis=axisval) for _ in images] else: image = [np.transpose(np.sum(_, axis=axisval)) for _ in images] image = np.array([self.scale_contrast(_) for _ in image]) Y, X = image.shape[1:] bgra = np.zeros((Y, X, 4), dtype=np.float32) for color, image in zip(colors, image): bgra[:, :, 0] += color[2] * image bgra[:, :, 1] += color[1] * image bgra[:, :, 2] += color[0] * image bgra = np.minimum(bgra, 1) self._bgra = self.to_8bit(bgra) qimage = QtGui.QImage(self._bgra.data, X, Y, QtGui.QImage.Format_RGB32) qimage = qimage.scaled( self.viewxy.width(), np.round(self.viewxy.height() * Y / X), QtCore.Qt.KeepAspectRatioByExpanding, ) pixmap = QtGui.QPixmap.fromImage(qimage) return pixmap def align_x(self): print("Align X") self.align_all("x") def align_y(self): print("Align Y") self.align_all("y") def align_zz(self): print("Align Z") self.align_all("zz") def align_zy(self): print("Align Z") self.align_all("zy") def translate_x(self): print("Translate X") self.translate("x") def translate_y(self): print("Translate Y") self.translate("y") def translate_z(self): print("Translate Z") self.translate("z") def translate(self, translateaxis): renderings = [ render.render_hist3d( _, self.oversampling, self.t_min, self.t_min, self.t_max, self.t_max, self.z_min, self.z_max, self.pixelsize, ) for _ in self.locs ] images = np.array([_[1] for _ in renderings]) if translateaxis == "x": image = [np.sum(_, axis=2) for _ in images] signalimg = [np.sum(_, axis=0) for _ in image] elif translateaxis == "y": image = [np.sum(_, axis=2) for _ in images] signalimg = [np.sum(_, axis=1) for _ in image] elif translateaxis == "z": image = [np.sum(_, axis=1) for _ in images] signalimg = [np.sum(_, axis=0) for _ in image] fig = plt.figure(figsize=(5, 5)) ax1 = fig.add_subplot(1, 1, 1) for element in signalimg: plt.plot(element) n_groups = self.group_index[0].shape[0] print("Translating..") for i in tqdm(range(n_groups)): self.status_bar.showMessage("Group {} / {}.".format(i, n_groups)) self.translate_group(signalimg, i, translateaxis) fig.canvas.draw() size = fig.canvas.size() width, height = size.width(), size.height() im = QtGui.QImage( fig.canvas.buffer_rgba(), width, height, QtGui.QImage.Format_ARGB32 ) self.viewcp.setPixmap((QtGui.QPixmap(im))) self.viewcp.setAlignment(QtCore.Qt.AlignCenter) plt.close(fig) self.centerofmass_all() self.updateLayout() self.status_bar.showMessage("Done!") def translate_group(self, signalimg, group, translateaxis): n_channels = len(self.locs) all_xcorr = np.zeros((1, n_channels)) all_da = np.zeros((1, n_channels)) if translateaxis == "x": proplane = "xy" elif translateaxis == "y": proplane = "xy" elif translateaxis == "z": proplane = "xz" plotmode = 0 for j in range(n_channels): if plotmode: fig = plt.figure() ax1 = fig.add_subplot(1, 3, 1) plt.plot(signalimg[j]) ax2 = fig.add_subplot(1, 3, 2) if self.dataset_dialog.checks[j].isChecked(): index = self.group_index[j][group].nonzero()[1] x_rot = self.locs[j].x[index] y_rot = self.locs[j].y[index] z_rot = self.locs[j].z[index] plane = self.render_planes( x_rot, y_rot, z_rot, proplane, self.pixelsize ) # if translateaxis == "x": projection = np.sum(plane, axis=0) elif translateaxis == "y": projection = np.sum(plane, axis=1) elif translateaxis == "z": projection = np.sum(plane, axis=1) if plotmode: plt.plot(projection) # print('Step X') # ax3 = fig.add_subplot(1,3,3) # plt.imshow(plane, interpolation='nearest', cmap=plt.cm.ocean) corrval = np.max(signal.correlate(signalimg[j], projection)) shiftval = ( np.argmax(signal.correlate(signalimg[j], projection)) - len(signalimg[j]) + 1 ) all_xcorr[0, j] = corrval all_da[0, j] = shiftval / self.oversampling if plotmode: plt.show() # value with biggest cc value form table maximumcc = np.argmax(np.sum(all_xcorr, axis=1)) dafinal = np.mean(all_da[maximumcc, :]) for j in range(n_channels): index = self.group_index[j][group].nonzero()[1] if translateaxis == "x": self.locs[j].x[index] += dafinal elif translateaxis == "y": self.locs[j].y[index] += dafinal elif translateaxis == "z": self.locs[j].z[index] += dafinal * self.pixelsize def adjust_z(self): z_range_str = np.asarray((self.z_range.text()).split(",")) z_range = [] for element in z_range_str: try: z_range.append(float(element)) except ValueError: pass z_min = z_range[0] z_max = z_range[1] self.z_min = np.max([z_min, self.z_min_load]) self.z_max = np.min([z_max, self.z_max_load]) print("Z min {}, Z max {}".format(self.z_min, self.z_max)) self.updateLayout() def adjust_xy(self): x_range_str = np.asarray((self.x_range.text()).split(",")) x_range = [] for element in x_range_str: try: x_range.append(float(element)) except ValueError: pass x_min = x_range[0] x_max = x_range[1] self.x_min = np.max([x_min, self.t_min]) self.x_max = np.min([x_max, self.t_max]) print("X min {}, X max {}".format(self.x_min, self.x_max)) y_range_str = np.asarray((self.y_range.text()).split(",")) y_range = [] for element in y_range_str: try: y_range.append(float(element)) except ValueError: pass y_min = y_range[0] y_max = y_range[1] self.y_min = np.max([y_min, self.t_min]) self.y_max = np.min([y_max, self.t_max]) print("Y min {}, Y max {}".format(self.y_min, self.y_max)) self.updateLayout() def rotatexy_convolution_group( self, CF_image_avg, angles, group, rotaxis, proplane ): n_channels = len(self.locs) n_angles = len(angles) all_xcorr = np.zeros((n_angles, n_channels)) all_da = np.zeros((n_angles, n_channels)) all_db = np.zeros((n_angles, n_channels)) for j in range(n_channels): if self.dataset_dialog.checks[j].isChecked(): index = self.group_index[j][group].nonzero()[1] x_rot = self.locs[j].x[index] y_rot = self.locs[j].y[index] z_rot = self.locs[j].z[index] x_original = x_rot.copy() y_original = y_rot.copy() z_original = z_rot.copy() if self.translatebtn.isChecked(): angles = [0] n_angles = 1 for k in range(n_angles): angle = angles[k] # rotate locs x_rot, y_rot, z_rot = rotate_axis( rotaxis, x_original, y_original, z_original, angle, self.pixelsize, ) # render group image for plane image = self.render_planes( x_rot, y_rot, z_rot, proplane, self.pixelsize ) # calculate cross-correlation if 0: fig = plt.figure() ax1 = fig.add_subplot(1, 2, 1) ax1.set_aspect("equal") plt.imshow( image, interpolation="nearest", cmap=plt.cm.ocean ) plt.colorbar() plt.show() plt.waitforbuttonpress() xcorr = np.sum(np.multiply(CF_image_avg[j], image)) all_xcorr[k, j] = xcorr # value with biggest cc value form table maximumcc = np.argmax(np.sum(all_xcorr, axis=1)) rotfinal = angles[maximumcc] for j in range(n_channels): index = self.group_index[j][group].nonzero()[1] x_rot = self.locs[j].x[index] y_rot = self.locs[j].y[index] z_rot = self.locs[j].z[index] x_original = x_rot.copy() y_original = y_rot.copy() z_original = z_rot.copy() # rotate and shift image group locs x_rot, y_rot, z_rot = rotate_axis( rotaxis, x_original, y_original, z_original, rotfinal, self.pixelsize, ) self.locs[j].x[index] = x_rot self.locs[j].y[index] = y_rot self.locs[j].z[index] = z_rot def rotatexy_convolution(self): # TODO: re-write ths with kwargs at some point rotaxis = [] if self.x_axisbtn.isChecked(): rotaxis = "x" elif self.y_axisbtn.isChecked(): rotaxis = "y" elif self.z_axisbtn.isChecked(): rotaxis = "z" n_groups = self.group_index[0].shape[0] a_step = np.arcsin(1 / (self.oversampling * self.r)) if self.full_degbtn.isChecked(): angles = np.arange(0, 2 * np.pi, a_step) elif self.part_degbtn.isChecked(): degree = self.degEdit.value() angles = np.arange( -degree / 360 * 2 * np.pi, degree / 360 * 2 * np.pi, a_step ) renderings = [ render.render_hist3d( _, self.oversampling, self.t_min, self.t_min, self.t_max, self.t_max, self.z_min, self.z_max, self.pixelsize, ) for _ in self.locs ] images = np.array([_[1] for _ in renderings]) # DELIVER CORRECT PROJECTION FOR IMAGE proplane = [] if self.xy_projbtn.isChecked(): proplane = "xy" image = [
np.sum(_, axis=2)
numpy.sum
# -*- coding: utf-8 -*- """ @author: <NAME> <<EMAIL>>, January 2017 / February 2018. """ import numpy as np from scipy.stats import multivariate_normal import time from joblib import Parallel, delayed import sys from functools import reduce from scipy.stats import triang import torch from scipy.signal import medfilt def lhs(minn,maxn,N): # Latin Hypercube sampling # Here minn and maxn are assumed to be 1xd arrays x = np.zeros((N,minn.shape[1])) for j in range (0,minn.shape[1]): idx = np.random.permutation(N)+0.5 P =(idx - x[:,j])/N x[:,j] = minn[0,j] + P*(maxn[0,j] - minn[0,j]) return x def GenCR(MCMCPar,pCR): if type(pCR) is np.ndarray: p=np.ndarray.tolist(pCR)[0] else: p=pCR CR=np.zeros((MCMCPar.seq * MCMCPar.steps),dtype=np.float) L = np.random.multinomial(MCMCPar.seq * MCMCPar.steps, p, size=1) L2 = np.concatenate((np.zeros((1),dtype=np.int), np.cumsum(L)),axis=0) r = np.random.permutation(MCMCPar.seq * MCMCPar.steps) for zz in range(0,MCMCPar.nCR): i_start = L2[zz] i_end = L2[zz+1] idx = r[i_start:i_end] CR[idx] = np.float(zz+1)/MCMCPar.nCR CR = np.reshape(CR,(MCMCPar.seq,MCMCPar.steps)) return CR, L def CalcDelta(nCR,delta_tot,delta_normX,CR): # Calculate total normalized Euclidean distance for each crossover value # Derive sum_p2 for each different CR value for zz in range(0,nCR): # Find which chains are updated with zz/MCMCPar.nCR idx = np.argwhere(CR==(1.0+zz)/nCR);idx=idx[:,0] # Add the normalized squared distance tot the current delta_tot; delta_tot[0,zz] = delta_tot[0,zz] + np.sum(delta_normX[idx]) return delta_tot def AdaptpCR(seq,delta_tot,lCR,pCR_old): if np.sum(delta_tot) > 0: pCR = seq * (delta_tot/lCR) / np.sum(delta_tot) pCR = pCR/np.sum(pCR) else: pCR=pCR_old return pCR def CompLikelihood(X,fx,MCMCPar,Measurement,Extra): if MCMCPar.lik==0: # fx contains log-density of = np.exp(fx) log_p= fx elif MCMCPar.lik==1: # fx contains density of = fx log_p=
np.log(of)
numpy.log
from __future__ import division import numpy as np def linear_merge(x1, y1, x2, y2): """ Merge data pairs (x1, y1) and (x2, y2) over the intersection of their ranges (x) using a linear interpolation of each dataset to interpolate between unaligned values. No extrapolation is performed. Input ===== :x1, array-like: abscissa coordinates of dataset 1 :y1, array-like: ordinate coordinates of dataset 1 :x2, array-like: abscissa coordinates of dataset 2 :y2, array-like: ordinate coordinates of dataset 2 OUT === Tuple of the merged x (`xm`) and interpolated y1 (`y1m`) and y2 (`y2m`): `(xm, y1m, y2m)` """ # ensure all values are ndarrays x1 = np.asarray(x1) x2 = np.asarray(x2) y1 = np.asarray(y1) y2 = np.asarray(y2) # ########## # merge on x xmerge = np.concatenate((np.sort(x1), np.sort(x2))) xmerge.sort(kind='mergesort') # perform interpolation xlo = np.max((x1.min(), x2.min())) xhi = np.min((x1.max(), x2.max())) # keep only the merged x values within the intersection of # the data ranges mask = (xmerge >= xlo) & (xmerge <= xhi) xf = xmerge[mask] y1f = np.interp(xf, x1, y1) y2f =
np.interp(xf, x2, y2)
numpy.interp
"""Fit the averaged delta sigma profiles. """ from catalog import * import numpy as np import cluster_toolkit as ct import scipy.optimize as op import matplotlib.pyplot as plt def get_model(M, args): Redges = args['Redges'] Rlam = args['Rlam'] h = args['h'] Om = args['Om'] z = args['z'] r = args['r3d'] #Mpc/h comoving Rperp = args['Rperp'] #Mpc/h comoving SCI = args['SCI'] k = args['k'] Plin = args['Plin'] xi_mm = args['xi_mm'] c,tau,fmis,Am,B0,Rs = args['params'] #c = ct.concentration.concentration_at_M(M, k, Plin, ns, Ob, Om, h, Mass_type='mean') xi_nfw = ct.xi.xi_nfw_at_R(r, M, c, Om) bias = ct.bias.bias_at_M(M,k,Plin,Om) xi_2halo = ct.xi.xi_2halo(bias, xi_mm) xi_hm = ct.xi.xi_hm(xi_nfw, xi_2halo) #print("%3e"%M) #print(bias) #rdata = np.loadtxt("testdata/r.txt") #xid = np.load("testdata/hmcfs_z006_0.05sigintr.npy") #print(xid.shape) ##xid = xid[1] #plt.loglog(r, xi_hm) #plt.loglog(r, xi_mm, ls=':') #plt.loglog(rdata, xid) #plt.show() #exit() Rmis = tau*Rlam #Mpc/h comoving #Sigmas are in Msun h/pc^2 comoving Sigma = ct.deltasigma.Sigma_at_R(Rperp, r, xi_hm, M, c, Om) Sigma_mis = ct.miscentering.Sigma_mis_at_R(Rperp, Rperp, Sigma, M, c, Om, Rmis, kernel="exponential") full_Sigma = (1-fmis)*Sigma + fmis*Sigma_mis kappa = SCI*full_Sigma*h*(1+z)**2 #DeltaSigmas are in Msun/pc^2 physical DeltaSigma = ct.deltasigma.DeltaSigma_at_R(Rperp, Rperp, Sigma, M, c, Om) *h*(1+z)**2 DeltaSigma_mis = ct.miscentering.DeltaSigma_mis_at_R(Rperp, Rperp, Sigma_mis) *h*(1+z)**2 full_DS = (1-fmis)*DeltaSigma + fmis*DeltaSigma_mis #Apply corrections B = args['boost'] full_DS *= Am/(B*(1-kappa)) ave_fDS = ct.averaging.average_profile_in_bins(Redges, Rperp/(h*(1+z)), full_DS) return ave_fDS def lnlike(pars, args): Mtrue = args['Mass'] Cal = pars M = Mtrue/Cal DSmodel = get_model(M, args)[args['inds']] #Get the data DSd = args['DSd'] icov = args['icov'] X = DSd - DSmodel chi2 = -0.5*np.dot(X,np.dot(icov,X)) return chi2 if __name__ == "__main__": #Load in the halo catalog sigs = np.arange(0.05, 0.45, step=0.05) inds = [6,7,8,9] bins = np.array([20,30,45,60,999]) zs = [1.0, 0.5, 0.25, 0.0] zmap = [2,1,0,0] #Map from fox zi to data zi, for SAC matrices covpath = "/Users/tom/Data/DESY1/RMWL/SACs/SAC_z%_l%d.txt" datapath = "ds_testdata/DSave_z%03d_%.2fsigintr.npy" halopath = "/Users/tom/Data/DESY1/RMWL/fox_files/halo_catalogs/reduced_halos_lamobs_%.2fsigintr_%03d.npy" #Output path outpath = "calibration_fits/result_%.2fsigintr.npy" for sig in sigs: outarray = np.zeros((6, 16)) #6 columns, 16 rows for each z-Lambda bin in the sim #zindex, lindex, Mtrue, lambda, cal, calunc for i,ind in enumerate(inds): print(i,ind) outarray[0, i*4:(i+1)*4] = ind #Z index outarray[1, i*4:(i+1)*4] = np.arange(4)+3 #l index zid = zmap[i] #Z index for data z = zs[i] deltap1s =
np.loadtxt("Y1_deltap1.txt")
numpy.loadtxt
from operator import add import random from attacks import utils import torch.nn.functional as F import numpy as np import torch import scipy.sparse as sp from attacks.attack import gcn_norm def dice_injection(adj, n_inject, n_edge_max, origin_labels, target_idx, device): n_classes = max(origin_labels)+1 class_pos = [[] for i in range(n_classes)] for i in origin_labels: class_id = origin_labels[i] class_pos[class_id].append(i) direct_edges = n_edge_max//2 # number of edges connect to target nodes bridge_edges = n_edge_max-direct_edges # number of edges connect to different classes n_node = adj.size(0) adj=utils.tensor_to_adj(adj) target_idx = target_idx.cpu() n_test = target_idx.shape[0] new_edges_x = [] new_edges_y = [] new_data = [] # connect injected nodes to target nodes for i in range(n_inject): islinked = np.zeros(n_test) for j in range(direct_edges): x = i + n_node yy = random.randint(0, n_test - 1) while islinked[yy] > 0: yy = random.randint(0, n_test - 1) islinked[yy] = 1 y = target_idx[yy] new_edges_x.extend([x, y]) new_edges_y.extend([y, x]) new_data.extend([1, 1]) add1 = sp.csr_matrix((n_inject, n_node)) add2 = sp.csr_matrix((n_node + n_inject, n_inject)) adj_attack = sp.vstack([adj, add1]) adj_attack = sp.hstack([adj_attack, add2]) adj_attack.row = np.hstack([adj_attack.row, new_edges_x]) adj_attack.col = np.hstack([adj_attack.col, new_edges_y]) adj_attack.data = np.hstack([adj_attack.data, new_data]) adj_attack = utils.adj_to_tensor(adj_attack).to(device) return adj_attack def random_class_injection(adj, n_inject, n_edge_max, origin_labels, target_idx, device, not_full=False): n_classes = max(origin_labels)+1 class_pos = [[] for i in range(n_classes)] min_class_len = len(target_idx) for (i,pos) in enumerate(target_idx): class_id = origin_labels[pos] class_pos[class_id].append(i) for c in class_pos: min_class_len = min(min_class_len,len(class_pos[class_id])) if not not_full: assert min_class_len >= n_edge_max, print(f"min_class_len {min_class_len}") n_node = adj.size(0) adj=utils.tensor_to_adj(adj) target_idx = target_idx.cpu() n_test = target_idx.shape[0] new_edges_x = [] new_edges_y = [] new_data = [] for i in range(n_inject): islinked = np.zeros(n_test) class_id = random.randint(0, n_classes-1) n_connections = min(len(class_pos[class_id]),n_edge_max) for j in range(n_connections): x = i + n_node yy = random.randint(0, len(class_pos[class_id]) - 1) while islinked[class_pos[class_id][yy]] > 0: yy = random.randint(0, len(class_pos[class_id]) - 1) islinked[class_pos[class_id][yy]] = 1 y = target_idx[class_pos[class_id][yy]] new_edges_x.extend([x, y]) new_edges_y.extend([y, x]) new_data.extend([1, 1]) add1 = sp.csr_matrix((n_inject, n_node)) add2 = sp.csr_matrix((n_node + n_inject, n_inject)) adj_attack = sp.vstack([adj, add1]) adj_attack = sp.hstack([adj_attack, add2]) adj_attack.row = np.hstack([adj_attack.row, new_edges_x]) adj_attack.col = np.hstack([adj_attack.col, new_edges_y]) adj_attack.data = np.hstack([adj_attack.data, new_data]) adj_attack = utils.adj_to_tensor(adj_attack).to(device) return adj_attack def random_injection(adj, n_inject, n_edge_max, target_idx, device): n_node = adj.size(0) adj=utils.tensor_to_adj(adj) target_idx = target_idx.cpu() n_test = target_idx.shape[0] new_edges_x = [] new_edges_y = [] new_data = [] for i in range(n_inject): islinked = np.zeros(n_test) for j in range(n_edge_max): x = i + n_node yy = random.randint(0, n_test - 1) while islinked[yy] > 0: yy = random.randint(0, n_test - 1) # BUG: never duplicating linked nodes # solution islinked[yy] = 1 y = target_idx[yy] new_edges_x.extend([x, y]) new_edges_y.extend([y, x]) new_data.extend([1, 1]) add1 = sp.csr_matrix((n_inject, n_node)) add2 = sp.csr_matrix((n_node + n_inject, n_inject)) adj_attack = sp.vstack([adj, add1]) adj_attack = sp.hstack([adj_attack, add2]) adj_attack.row = np.hstack([adj_attack.row, new_edges_x]) adj_attack.col = np.hstack([adj_attack.col, new_edges_y]) adj_attack.data = np.hstack([adj_attack.data, new_data]) adj_attack = utils.adj_to_tensor(adj_attack).to(device) return adj_attack def tdgia_injection(adj, n_inject, n_edge_max, origin_labels, current_pred, target_idx, device, self_connect_ratio=0.0, weight1=0.9, weight2=0.1): n_current = adj.size(0) adj=utils.tensor_to_adj(adj) target_idx = target_idx.cpu() n_test = target_idx.size(0) n_classes = origin_labels.max() + 1 n_connect = int(n_edge_max * (1 - self_connect_ratio)) n_self_connect = int(n_edge_max * self_connect_ratio) new_edges_x = [] new_edges_y = [] new_data = [] add_score = np.zeros(n_test) deg = np.array(adj.sum(axis=0))[0] + 1.0 for i in range(n_test): it = target_idx[i] label = origin_labels[it] score = current_pred[it][label] + 2 add_score1 = score / deg[it] add_score2 = score / np.sqrt(deg[it]) sc = weight1 * add_score1 + weight2 * add_score2 / np.sqrt(n_connect + n_self_connect) add_score[i] = sc # higher score is better sorted_rank = add_score.argsort() sorted_rank = sorted_rank[-n_inject * n_connect:] labelgroup = np.zeros(n_classes) # separate them by origin_labels labelil = [] for i in range(n_classes): labelil.append([]) random.shuffle(sorted_rank) for i in sorted_rank: label = origin_labels[target_idx[i]] labelgroup[label] += 1 labelil[label].append(i) pos = np.zeros(n_classes) for i in range(n_inject): for j in range(n_connect): smallest = 1 small_id = 0 for k in range(n_classes): if len(labelil[k]) > 0: if (pos[k] / len(labelil[k])) < smallest: smallest = pos[k] / len(labelil[k]) small_id = k # print((k,smallest)) # if smallest == 1: # for k in range(n_classes): # print((pos[k],len(labelil[k]))) # print((len(target_idx),n_inject, n_edge_max)) tu = labelil[small_id][int(pos[small_id])] pos[small_id] += 1 x = n_current + i y = target_idx[tu] new_edges_x.extend([x, y]) new_edges_y.extend([y, x]) new_data.extend([1, 1]) is_linked = np.zeros((n_inject, n_inject)) for i in range(n_inject): rnd_times = 100 while np.sum(is_linked[i]) < n_self_connect and rnd_times > 0: x = i + n_current rnd_times = 100 yy = random.randint(0, n_inject - 1) while (np.sum(is_linked[yy]) >= n_self_connect or yy == i or is_linked[i][yy] == 1) and (rnd_times > 0): yy = random.randint(0, n_inject - 1) rnd_times -= 1 if rnd_times > 0: y = n_current + yy is_linked[i][yy] = 1 is_linked[yy][i] = 1 new_edges_x.extend([x, y]) new_edges_y.extend([y, x]) new_data.extend([1, 1]) add1 = sp.csr_matrix((n_inject, n_current)) add2 = sp.csr_matrix((n_current + n_inject, n_inject)) adj_attack = sp.vstack([adj, add1]) adj_attack = sp.hstack([adj_attack, add2]) adj_attack.row = np.hstack([adj_attack.row, new_edges_x]) adj_attack.col = np.hstack([adj_attack.col, new_edges_y]) adj_attack.data = np.hstack([adj_attack.data, new_data]) adj_attack = utils.adj_to_tensor(adj_attack).to(device) return adj_attack def atdgia_injection(adj, n_inject, n_edge_max, origin_labels, current_pred, target_idx, device, self_connect_ratio=0.0, weight1=0.9, weight2=0.1): n_current = adj.size(0) adj=utils.tensor_to_adj(adj) target_idx = target_idx.cpu() n_test = target_idx.size(0) n_classes = origin_labels.max() + 1 n_connect = int(n_edge_max * (1 - self_connect_ratio)) n_self_connect = int(n_edge_max * self_connect_ratio) new_edges_x = [] new_edges_y = [] new_data = [] add_score = np.zeros(n_test) deg = np.array(adj.sum(axis=0))[0] + 1.0 for i in range(n_test): it = target_idx[i] label = origin_labels[it] cur_label = current_pred[it].argmax() if cur_label==label: score = 1.0 - current_pred[it][label] else: score = 0 # score = current_pred[it][label] + 2 add_score1 = score / deg[it] add_score2 = score /
np.sqrt(deg[it])
numpy.sqrt
__copyright__ = "Copyright 2016-2019, Netflix, Inc." __license__ = "Apache, Version 2.0" import unittest import numpy as np from vmaf.config import VmafConfig from vmaf.tools.reader import YuvReader class YuvReaderTest(unittest.TestCase): def test_yuv_reader(self): yuv_reader = YuvReader( filepath=VmafConfig.test_resource_path("yuv", "src01_hrc00_576x324.yuv"), width=576, height=324, yuv_type='yuv420p' ) self.assertEquals(yuv_reader.num_bytes, 13436928) self.assertEquals(yuv_reader.num_frms, 48) self.assertEquals(yuv_reader._get_uv_width_height_multiplier(), (0.5, 0.5)) def test_with(self): with YuvReader( filepath=VmafConfig.test_resource_path("yuv", "src01_hrc00_576x324.yuv"), width=576, height=324, yuv_type='yuv420p' ) as yuv_reader: assert hasattr(yuv_reader.file, "read") def test_next_y_u_v(self): with YuvReader( filepath=VmafConfig.test_resource_path("yuv", "src01_hrc00_576x324.yuv"), width=576, height=324, yuv_type='yuv420p' ) as yuv_reader: y, u, v = yuv_reader.__next__() self.assertEquals(y[0][0], 87) self.assertEquals(y[0][1], 131) self.assertEquals(y[1][0], 95) self.assertEquals(u[0][0], 92) self.assertEquals(u[0][1], 97) self.assertEquals(u[1][0], 90) self.assertEquals(v[0][0], 121) self.assertEquals(v[0][1], 126) self.assertEquals(v[1][0], 122) self.assertAlmostEquals(y.mean(), 61.928749785665296, places=4) self.assertAlmostEquals(u.mean(), 114.6326517489712, places=4) self.assertAlmostEquals(v.mean(), 122.05084019204389, places=4) y, u, v = yuv_reader.__next__() self.assertEquals(y[0][0], 142) self.assertEquals(y[0][1], 128) self.assertEquals(y[1][0], 134) self.assertEquals(u[0][0], 93) self.assertEquals(u[0][1], 102) self.assertEquals(u[1][0], 91) self.assertEquals(v[0][0], 128) self.assertEquals(v[0][1], 126) self.assertEquals(v[1][0], 124) self.assertAlmostEquals(y.mean(), 61.265260631001375, places=4) self.assertAlmostEquals(u.mean(), 114.72515860768175, places=4) self.assertAlmostEquals(v.mean(), 122.12022033607681, places=4) def test_iteration(self): y_1stmoments = [] y_2ndmoments = [] with YuvReader( filepath=VmafConfig.test_resource_path("yuv", "src01_hrc01_576x324.yuv"), width=576, height=324, yuv_type='yuv420p') as yuv_reader: for y, u, v in yuv_reader: y_1stmoments.append(y.mean()) y_2ndmoments.append(y.var() + y.mean() * y.mean()) self.assertEquals(len(y_1stmoments), 48) self.assertEquals(len(y_2ndmoments), 48) self.assertAlmostEquals(
np.mean(y_1stmoments)
numpy.mean
""" matplotlib helper functions for commong drawing tasks. """ import numpy as np import matplotlib.pyplot as plt import matplotlib.patches import scipy.spatial from ..math import eigsorted, nancov from ..text import int_to_alpha from ..missing import cooccurence_pattern from .interpolation import interpolated_patch_path from .axes import add_colorbar, subaxes from ..log import Handle logger = Handle(__name__) try: from sklearn.decomposition import PCA except ImportError: msg = "scikit-learn not installed" logger.warning(msg) def alphalabel_subplots(ax, fmt="{}", xy=(0.03, 0.95), ha="left", va="top", **kwargs): """ Add alphabetical labels to a successive series of subplots with a specified format. Parameters ----------- ax : :class:`list` | :class:`numpy.ndarray` | :class:`numpy.flatiter` Axes to label, in desired order. fmt : :class:`str` Format string to use. To add e.g. parentheses, you could specify :code:`"({})"`. xy : :class:`tuple` Position of the labels in axes coordinates. ha : :class:`str` Horizontal alignment of the labels (:code:`{"left", "right"}`). va : :class:`str` Vertical alignment of the labels (:code:`{"top", "bottom"}`). """ flat = np.array(ax).flatten() # get axes in case of iterator which is consumed _ax = [(ix, flat[ix]) for ix in range(len(flat))] labels = [(a, fmt.format(int_to_alpha(ix))) for ix, a in _ax] [ a.annotate(label, xy=xy, xycoords=a.transAxes, ha=ha, va=va, **kwargs) for a, label in labels ] def get_centroid(poly): """ Centroid of a closed polygon using the Shoelace formula. Parameters ---------- poly : :class:`matplotlib.patches.Polygon` Polygon to obtain the centroid of. Returns ------- cx, cy : :class:`tuple` Centroid coordinates. """ # get signed area verts = poly.get_xy() A = 0 cx, cy = 0, 0 x, y = verts.T for i in range(len(verts) - 1): A += x[i] * y[i + 1] - x[i + 1] * y[i] cx += (x[i] + x[i + 1]) * (x[i] * y[i + 1] - x[i + 1] * y[i]) cy += (y[i] + y[i + 1]) * (x[i] * y[i + 1] - x[i + 1] * y[i]) A /= 2 cx /= 6 * A cy /= 6 * A return cx, cy def rect_from_centre(x, y, dx=0, dy=0, **kwargs): """ Takes an xy point, and creates a rectangular patch centred about it. """ # If either x or y is nan if any([np.isnan(i) for i in [x, y]]): return None if np.isnan(dx): dx = 0 if np.isnan(dy): dy = 0 llc = (x - dx, y - dy) return matplotlib.patches.Rectangle(llc, 2 * dx, 2 * dy, **kwargs) def draw_vector(v0, v1, ax=None, **kwargs): """ Plots an arrow represnting the direction and magnitue of a principal component on a biaxial plot. Modified after <NAME>' Python Data Science Handbook https://jakevdp.github.io/PythonDataScienceHandbook/ \ 05.09-principal-component-analysis.html Todo ----- Update for ternary plots. """ ax = ax arrowprops = dict(arrowstyle="->", linewidth=2, shrinkA=0, shrinkB=0) arrowprops.update(kwargs) ax.annotate("", v1, v0, arrowprops=arrowprops) def vector_to_line( mu: np.array, vector: np.array, variance: float, spans: int = 4, expand: int = 10 ): """ Creates an array of points representing a line along a vector - typically for principal component analysis. Modified after <NAME>' Python Data Science Handbook https://jakevdp.github.io/PythonDataScienceHandbook/ \ 05.09-principal-component-analysis.html """ length = np.sqrt(variance) parts = np.linspace(-spans, spans, expand * spans + 1) line = length * np.dot(parts[:, np.newaxis], vector[np.newaxis, :]) + mu line = length * parts.reshape(parts.shape[0], 1) * vector + mu return line def plot_stdev_ellipses( comp, nstds=4, scale=100, resolution=1000, transform=None, ax=None, **kwargs ): """ Plot covariance ellipses at a number of standard deviations from the mean. Parameters ------------- comp : :class:`numpy.ndarray` Composition to use. nstds : :class:`int` Number of standard deviations from the mean for which to plot the ellipses. scale : :class:`float` Scale applying to all x-y data points. For intergration with python-ternary. transform : :class:`callable` Function for transformation of data prior to plotting (to either 2D or 3D). ax : :class:`matplotlib.axes.Axes` Axes to plot on. Returns ------- ax : :class:`matplotlib.axes.Axes` """ mean, cov = np.nanmean(comp, axis=0), nancov(comp) vals, vecs = eigsorted(cov) theta = np.degrees(np.arctan2(*vecs[::-1])) if ax is None: projection = None if callable(transform) and (transform is not None): if transform(comp).shape[1] == 3: projection = "ternary" fig, ax = plt.subplots(1, subplot_kw=dict(projection=projection)) for nstd in np.arange(1, nstds + 1)[::-1]: # backwards for svg construction # here we use the absolute eigenvalues xsig, ysig = nstd * np.sqrt(np.abs(vals)) # n sigmas ell = matplotlib.patches.Ellipse( xy=mean.flatten(), width=2 * xsig, height=2 * ysig, angle=theta[:1] ) points = interpolated_patch_path(ell, resolution=resolution).vertices if callable(transform) and (transform is not None): points = transform(points) # transform to compositional data if points.shape[1] == 3: ax_transfrom = (ax.transData + ax.transTernaryAxes.inverted()).inverted() points = ax_transfrom.transform(points) # transform to axes coords patch = matplotlib.patches.PathPatch(matplotlib.path.Path(points), **kwargs) patch.set_edgecolor("k") patch.set_alpha(1.0 / nstd) patch.set_linewidth(0.5) ax.add_artist(patch) return ax def plot_pca_vectors(comp, nstds=2, scale=100.0, transform=None, ax=None, **kwargs): """ Plot vectors corresponding to principal components and their magnitudes. Parameters ------------- comp : :class:`numpy.ndarray` Composition to use. nstds : :class:`int` Multiplier for magnitude of individual principal component vectors. scale : :class:`float` Scale applying to all x-y data points. For intergration with python-ternary. transform : :class:`callable` Function for transformation of data prior to plotting (to either 2D or 3D). ax : :class:`matplotlib.axes.Axes` Axes to plot on. Returns ------- ax : :class:`matplotlib.axes.Axes` Todo ----- * Minor reimplementation of the sklearn PCA to avoid dependency. https://en.wikipedia.org/wiki/Principal_component_analysis """ pca = PCA(n_components=2) pca.fit(comp) if ax is None: fig, ax = plt.subplots(1) for variance, vector in zip(pca.explained_variance_, pca.components_): line = vector_to_line(pca.mean_, vector, variance, spans=nstds) if callable(transform) and (transform is not None): line = transform(line) line *= scale ax.plot(*line.T, **kwargs) return ax def plot_2dhull(data, ax=None, splines=False, s=0, **plotkwargs): """ Plots a 2D convex hull around an array of xy data points. """ if ax is None: fig, ax = plt.subplots(1) chull = scipy.spatial.ConvexHull(data, incremental=True) x, y = data[chull.vertices].T if not splines: lines = ax.plot(np.append(x, [x[0]]), np.append(y, [y[0]]), **plotkwargs) else: # https://stackoverflow.com/questions/33962717/interpolating-a-closed-curve-using-scipy tck, u = scipy.interpolate.splprep([x, y], per=True, s=s) xi, yi = scipy.interpolate.splev(np.linspace(0, 1, 1000), tck) lines = ax.plot(xi, yi, **plotkwargs) return lines def plot_cooccurence(arr, ax=None, normalize=True, log=False, colorbar=False, **kwargs): """ Plot the co-occurence frequency matrix for a given input. Parameters ----------- ax : :class:`matplotlib.axes.Axes`, :code:`None` The subplot to draw on. normalize : :class:`bool` Whether to normalize the cooccurence to compare disparate variables. log : :class:`bool` Whether to take the log of the cooccurence. colorbar : :class:`bool` Whether to append a colorbar. Returns -------- :class:`matplotlib.axes.Axes` Axes on which the cooccurence plot is added. """ arr = np.array(arr) if ax is None: fig, ax = plt.subplots(1, figsize=(4 + [0.0, 0.2][colorbar], 4)) co_occur = cooccurence_pattern(arr, normalize=normalize, log=log) heatmap = ax.pcolor(co_occur, **kwargs) ax.set_yticks(np.arange(co_occur.shape[0]) + 0.5, minor=False) ax.set_xticks(np.arange(co_occur.shape[1]) + 0.5, minor=False) ax.invert_yaxis() ax.xaxis.tick_top() if colorbar: add_colorbar(heatmap, **kwargs) return ax def nan_scatter(xdata, ydata, ax=None, axes_width=0.2, **kwargs): """ Scatter plot with additional marginal axes to plot data for which data is partially missing. Additional keyword arguments are passed to matplotlib. Parameters ---------- xdata : :class:`numpy.ndarray` X data ydata: class:`numpy.ndarray` | pd.Series Y data ax : :class:`matplotlib.axes.Axes` Axes on which to plot. axes_width : :class:`float` Width of the marginal axes. Returns ------- :class:`matplotlib.axes.Axes` Axes on which the nan_scatter is plotted. """ if ax is None: fig, ax = plt.subplots(1) ax.scatter(xdata, ydata, **kwargs) if hasattr(ax, "divider"): # Don't rebuild axes div = ax.divider nanaxx = div.nanaxx nanaxy = div.nanaxy else: # Build axes nanaxx = subaxes(ax, side="bottom", width=axes_width) nanaxx.invert_yaxis() nanaxy = subaxes(ax, side="left", width=axes_width) nanaxy.invert_xaxis() ax.divider.nanaxx = nanaxx # assign for later use ax.divider.nanaxy = nanaxy nanxdata = xdata[(np.isnan(ydata) & np.isfinite(xdata))] nanydata = ydata[(np.isnan(xdata) & np.isfinite(ydata))] # yminmax = np.nanmin(ydata), np.nanmax(ydata) no_ybins = 50 ybinwidth = (np.nanmax(ydata) - np.nanmin(ydata)) / no_ybins ybins = np.linspace(np.nanmin(ydata), np.nanmax(ydata) + ybinwidth, no_ybins) nanaxy.hist(nanydata, bins=ybins, orientation="horizontal", **kwargs) nanaxy.scatter( 10 * np.ones_like(nanydata) + 5 * np.random.randn(len(nanydata)), nanydata, zorder=-1, **kwargs ) # xminmax = np.nanmin(xdata), np.nanmax(xdata) no_xbins = 50 xbinwidth = (np.nanmax(xdata) - np.nanmin(xdata)) / no_xbins xbins = np.linspace(np.nanmin(xdata), np.nanmax(xdata) + xbinwidth, no_xbins) nanaxx.hist(nanxdata, bins=xbins, **kwargs) nanaxx.scatter( nanxdata, 10 *
np.ones_like(nanxdata)
numpy.ones_like
from models.Synapses import Synapse import numpy as np class Connection: def __init__(self, pre, post, weight_change=True): self.pre = pre self.post = post self.synapses = [] self.weight_in_time = None if weight_change: self.weight_in_time = [] def add(self, pre_indices, post_indices, mu=0.5, sigma=0.01, **kwargs): for i in pre_indices: for j in post_indices: syn = Synapse(self.pre.neurons[i], self.post.neurons[j], np.random.normal(mu, sigma), **kwargs) self.synapses.append(syn) self.pre.neurons[i].target_synapses.append(syn) return self def apply(self, connection_type, mu=0.5, sigma=0.01, **kwargs): if self.weight_in_time is not None: self.weight_in_time.append(
np.zeros((self.pre.size, self.post.size))
numpy.zeros
# Copyright (c) 2020 NVIDIA Corporation. All rights reserved. # This work is licensed under the NVIDIA Source Code License - Non-commercial. Full # text can be found in LICENSE.md import torch import torch.utils.data as data import os, math import sys import os.path as osp from os.path import * import numpy as np import numpy.random as npr import cv2 import scipy.io import copy import glob try: import cPickle # Use cPickle on Python 2.7 except ImportError: import pickle as cPickle import datasets from fcn.config import cfg from utils.blob import pad_im, chromatic_transform, add_noise, add_noise_cuda from transforms3d.quaternions import mat2quat, quat2mat from utils.se3 import * from utils.pose_error import * from utils.cython_bbox import bbox_overlaps class YCBVideo(data.Dataset, datasets.imdb): def __init__(self, image_set, ycb_video_path = None): self._name = 'ycb_video_' + image_set self._image_set = image_set self._ycb_video_path = self._get_default_path() if ycb_video_path is None \ else ycb_video_path path = os.path.join(self._ycb_video_path, 'data') if not os.path.exists(path): path = os.path.join(self._ycb_video_path, 'YCB_Video_Dataset/YCB_Video_Dataset/YCB_Video_Dataset/data') self._data_path = path self._model_path = os.path.join(datasets.ROOT_DIR, 'data', 'models') # define all the classes self._classes_all = ('__background__', '002_master_chef_can', '003_cracker_box', '004_sugar_box', '005_tomato_soup_can', '006_mustard_bottle', \ '007_tuna_fish_can', '008_pudding_box', '009_gelatin_box', '010_potted_meat_can', '011_banana', '019_pitcher_base', \ '021_bleach_cleanser', '024_bowl', '025_mug', '035_power_drill', '036_wood_block', '037_scissors', '040_large_marker', \ '051_large_clamp', '052_extra_large_clamp', '061_foam_brick') self._num_classes_all = len(self._classes_all) self._class_colors_all = [(255, 255, 255), (255, 0, 0), (0, 255, 0), (0, 0, 255), (255, 255, 0), (255, 0, 255), (0, 255, 255), \ (128, 0, 0), (0, 128, 0), (0, 0, 128), (128, 128, 0), (128, 0, 128), (0, 128, 128), \ (64, 0, 0), (0, 64, 0), (0, 0, 64), (64, 64, 0), (64, 0, 64), (0, 64, 64), (192, 0, 0), (0, 192, 0), (0, 0, 192)] self._symmetry_all = np.array([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1]).astype(np.float32) self._extents_all = self._load_object_extents() self._width = 640 self._height = 480 self._intrinsic_matrix = np.array([[1.066778e+03, 0.000000e+00, 3.129869e+02], [0.000000e+00, 1.067487e+03, 2.413109e+02], [0.000000e+00, 0.000000e+00, 1.000000e+00]]) # select a subset of classes self._classes = [self._classes_all[i] for i in cfg.TRAIN.CLASSES] self._classes_test = [self._classes_all[i] for i in cfg.TEST.CLASSES] self._num_classes = len(self._classes) self._class_colors = [self._class_colors_all[i] for i in cfg.TRAIN.CLASSES] self._symmetry = self._symmetry_all[cfg.TRAIN.CLASSES] self._symmetry_test = self._symmetry_all[cfg.TEST.CLASSES] self._extents = self._extents_all[cfg.TRAIN.CLASSES] self._extents_test = self._extents_all[cfg.TEST.CLASSES] self._pixel_mean = cfg.PIXEL_MEANS / 255.0 # train classes self._points, self._points_all, self._point_blob = \ self._load_object_points(self._classes, self._extents, self._symmetry) # test classes self._points_test, self._points_all_test, self._point_blob_test = \ self._load_object_points(self._classes_test, self._extents_test, self._symmetry_test) # 3D model paths self.model_mesh_paths = ['{}/{}/textured_simple.obj'.format(self._model_path, cls) for cls in self._classes_all[1:]] self.model_sdf_paths = ['{}/{}/textured_simple_low_res.pth'.format(self._model_path, cls) for cls in self._classes_all[1:]] self.model_texture_paths = ['{}/{}/texture_map.png'.format(self._model_path, cls) for cls in self._classes_all[1:]] self.model_colors = [np.array(self._class_colors_all[i]) / 255.0 for i in range(1, len(self._classes_all))] self.model_mesh_paths_target = ['{}/{}/textured_simple.obj'.format(self._model_path, cls) for cls in self._classes[1:]] self.model_sdf_paths_target = ['{}/{}/textured_simple.sdf'.format(self._model_path, cls) for cls in self._classes[1:]] self.model_texture_paths_target = ['{}/{}/texture_map.png'.format(self._model_path, cls) for cls in self._classes[1:]] self.model_colors_target = [np.array(self._class_colors_all[i]) / 255.0 for i in cfg.TRAIN.CLASSES[1:]] self._class_to_ind = dict(zip(self._classes, range(self._num_classes))) self._image_index = self._load_image_set_index(image_set) self._size = len(self._image_index) if self._size > cfg.TRAIN.MAX_ITERS_PER_EPOCH * cfg.TRAIN.IMS_PER_BATCH: self._size = cfg.TRAIN.MAX_ITERS_PER_EPOCH * cfg.TRAIN.IMS_PER_BATCH self._roidb = self.gt_roidb() assert os.path.exists(self._ycb_video_path), \ 'ycb_video path does not exist: {}'.format(self._ycb_video_path) assert os.path.exists(self._data_path), \ 'Data path does not exist: {}'.format(self._data_path) def __getitem__(self, index): is_syn = 0 roidb = self._roidb[index] # Get the input image blob random_scale_ind = npr.randint(0, high=len(cfg.TRAIN.SCALES_BASE)) im_blob, im_depth, im_scale, height, width = self._get_image_blob(roidb, random_scale_ind) # build the label blob label_blob, mask, meta_data_blob, pose_blob, gt_boxes, vertex_targets, vertex_weights \ = self._get_label_blob(roidb, self._num_classes, im_scale, height, width) is_syn = roidb['is_syn'] im_info = np.array([im_blob.shape[1], im_blob.shape[2], im_scale, is_syn], dtype=np.float32) sample = {'image_color': im_blob, 'im_depth': im_depth, 'label': label_blob, 'mask': mask, 'meta_data': meta_data_blob, 'poses': pose_blob, 'extents': self._extents, 'points': self._point_blob, 'symmetry': self._symmetry, 'gt_boxes': gt_boxes, 'im_info': im_info, 'video_id': roidb['video_id'], 'image_id': roidb['image_id']} if cfg.TRAIN.VERTEX_REG: sample['vertex_targets'] = vertex_targets sample['vertex_weights'] = vertex_weights return sample def _get_image_blob(self, roidb, scale_ind): # rgba rgba = pad_im(cv2.imread(roidb['image'], cv2.IMREAD_UNCHANGED), 16) if rgba.shape[2] == 4: im = np.copy(rgba[:,:,:3]) alpha = rgba[:,:,3] I = np.where(alpha == 0) im[I[0], I[1], :] = 0 else: im = rgba im_scale = cfg.TRAIN.SCALES_BASE[scale_ind] if im_scale != 1.0: im = cv2.resize(im, None, None, fx=im_scale, fy=im_scale, interpolation=cv2.INTER_LINEAR) height = im.shape[0] width = im.shape[1] if roidb['flipped']: im = im[:, ::-1, :] # chromatic transform if cfg.TRAIN.CHROMATIC and cfg.MODE == 'TRAIN' and np.random.rand(1) > 0.1: im = chromatic_transform(im) if cfg.TRAIN.ADD_NOISE and cfg.MODE == 'TRAIN' and np.random.rand(1) > 0.1: im = add_noise(im) im_tensor = torch.from_numpy(im) / 255.0 im_tensor -= self._pixel_mean image_blob = im_tensor.permute(2, 0, 1).float() # depth image im_depth = pad_im(cv2.imread(roidb['depth'], cv2.IMREAD_UNCHANGED), 16) if im_scale != 1.0: im_depth = cv2.resize(im_depth, None, None, fx=im_scale, fy=im_scale, interpolation=cv2.INTER_NEAREST) im_depth = im_depth.astype('float') / 10000.0 return image_blob, im_depth, im_scale, height, width def _get_label_blob(self, roidb, num_classes, im_scale, height, width): """ build the label blob """ meta_data = scipy.io.loadmat(roidb['meta_data']) meta_data['cls_indexes'] = meta_data['cls_indexes'].flatten() classes = np.array(cfg.TRAIN.CLASSES) # read label image im_label = pad_im(cv2.imread(roidb['label'], cv2.IMREAD_UNCHANGED), 16) if roidb['flipped']: if len(im_label.shape) == 2: im_label = im_label[:, ::-1] else: im_label = im_label[:, ::-1, :] if im_scale != 1.0: im_label = cv2.resize(im_label, None, None, fx=im_scale, fy=im_scale, interpolation=cv2.INTER_NEAREST) label_blob = np.zeros((num_classes, height, width), dtype=np.float32) label_blob[0, :, :] = 1.0 for i in range(1, num_classes): I = np.where(im_label == classes[i]) if len(I[0]) > 0: label_blob[i, I[0], I[1]] = 1.0 label_blob[0, I[0], I[1]] = 0.0 # foreground mask seg = torch.from_numpy((im_label != 0).astype(np.float32)) mask = seg.unsqueeze(0).repeat((3, 1, 1)).float() # poses poses = meta_data['poses'] if len(poses.shape) == 2: poses = np.reshape(poses, (3, 4, 1)) if roidb['flipped']: poses = _flip_poses(poses, meta_data['intrinsic_matrix'], width) num = poses.shape[2] pose_blob = np.zeros((num_classes, 9), dtype=np.float32) gt_boxes = np.zeros((num_classes, 5), dtype=np.float32) count = 0 for i in range(num): cls = int(meta_data['cls_indexes'][i]) ind = np.where(classes == cls)[0] if len(ind) > 0: R = poses[:, :3, i] T = poses[:, 3, i] pose_blob[count, 0] = 1 pose_blob[count, 1] = ind qt = mat2quat(R) # egocentric to allocentric qt_allocentric = egocentric2allocentric(qt, T) if qt_allocentric[0] < 0: qt_allocentric = -1 * qt_allocentric pose_blob[count, 2:6] = qt_allocentric pose_blob[count, 6:] = T # compute box x3d = np.ones((4, self._points_all.shape[1]), dtype=np.float32) x3d[0, :] = self._points_all[ind,:,0] x3d[1, :] = self._points_all[ind,:,1] x3d[2, :] = self._points_all[ind,:,2] RT =
np.zeros((3, 4), dtype=np.float32)
numpy.zeros
""" Many of these tests use the minimal test/data/gdc.bed file which has just enough complexity to be useful in testing corner cases. When reading through the tests, it's useful to have that file open to understand what's happening. """ import os import metaseq import multiprocessing from metaseq.array_helpers import ArgumentError import numpy as np from nose.tools import assert_raises from nose.plugins.skip import SkipTest nan = np.nan inf = np.inf gs = {} for kind in ['bed', 'bam', 'bigbed', 'bigwig']: gs[kind] = metaseq.genomic_signal(metaseq.example_filename('gdc.%s' % kind), kind) PROCESSES = int(os.environ.get("METASEQ_PROCESSES", multiprocessing.cpu_count())) def test_tointerval(): assert metaseq.helpers.tointerval("chr2L:1-10[-]").strand == '-' assert metaseq.helpers.tointerval("chr2L:1-10[+]").strand == '+' assert metaseq.helpers.tointerval("chr2L:1-10").strand == '.' def test_local_count(): def check(kind, coord, expected, stranded): try: result = gs[kind].local_count(coord, stranded=stranded) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") assert result == expected, (kind, coord, result) for kind in ['bam', 'bigbed', 'bed']: for coord, expected, stranded in ( ('chr2L:1-80', 3, False), # easy case ('chr2L:1000-3000', 0, False), # above upper boundary ('chr2L:1-9', 0, False), # below lower boundary ('chr2L:71-73[-]', 2, False), # unstranded = 2 ('chr2L:71-73[-]', 1, True), # stranded = 1 ('chr2L:70-71', 2, False), # pathological corner case # ('chr2L:75-76', 0, False), # pathological corner case ): yield check, kind, coord, expected, stranded def test_local_coverage_stranded(): def check(kind, coord, expected): try: result = gs[kind].local_coverage(coord) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") assert np.all(result[0] == expected[0]) and np.all(result[1] == expected[1]), (kind, coord, result) for kind in ['bam', 'bigbed', 'bed', 'bigwig']: for coord, expected in ( ('chr2L:1-20[-]', ( np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19]), np.array([0., 0., 0., 0., 0., 0., 0., 0., 0., 1., 1., 1., 1., 1., 0., 0., 0., 0., 0.])[::-1], # note reverse------------------------------------------------------------------------^^^^^^ ), ), ('chr2L:68-76[-]', ( np.array([68, 69, 70, 71, 72, 73, 74, 75]), np.array([0., 0., 2., 2., 2., 2., 2., 0.])[::-1], # note reverse----------------------------^^^^^^ ), ), ): yield check, kind, coord, expected def test_local_coverage_shifted(): def check(kind, coord, shift_width, expected): try: result = gs[kind].local_coverage(coord, shift_width=shift_width) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") assert np.all(result[0] == expected[0]) and np.all(result[1] == expected[1]), (kind, coord, result) for kind in ['bam', 'bigbed', 'bed']: for coord, shift_width, expected in ( ('chr2L:1-20', -2, ( np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19]), np.array([0., 0., 0., 0., 0., 0., 0., 1., 1., 1., 1., 1., 0., 0., 0., 0., 0., 0., 0.]), ), ), # this one is complex, because the minus-strand read shifts left, # and the plus-strand shifts right. ('chr2L:68-76', 1, ( np.array([68, 69, 70, 71, 72, 73, 74, 75]), np.array([0., 1., 1., 2., 2., 2., 1., 1.]), ), ), # shift the reads all the way out of the window... ('chr2L:68-76', 10, ( np.array([68, 69, 70, 71, 72, 73, 74, 75]), np.array([0., 0., 0., 0., 0., 0., 0., 0.]), ), ), ): yield check, kind, coord, shift_width, expected def test_local_coverage_read_strand(): """ checks stranded full binning excludes bigwig since strand doesn't make sense for that format. """ def check(kind, coord, read_strand, expected): try: result = gs[kind].local_coverage(coord, read_strand=read_strand) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") assert np.all(result[0] == expected[0]) and np.all(result[1] == expected[1]), (kind, coord, result) for kind in ['bam', 'bigbed', 'bed']: for coord, read_strand, expected in ( ('chr2L:1-20', '+', ( np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19]), np.array([0., 0., 0., 0., 0., 0., 0., 0., 0., 1., 1., 1., 1., 1., 0., 0., 0., 0., 0.]), ), ), ('chr2L:1-20', '-', ( np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19]), np.array([0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0., 0.]), ), ), ): yield check, kind, coord, read_strand, expected def test_local_coverage_fragment_size(): def check(kind, coord, fragment_size, expected): try: result = gs[kind].local_coverage(coord, fragment_size=fragment_size) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") assert np.all(result[0] == expected[0]) and np.all(result[1] == expected[1]), (kind, coord, result) for kind in ['bam', 'bigbed', 'bed']: for coord, fragment_size, expected in ( ('chr2L:1-20', 7, ( np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19]), np.array([0., 0., 0., 0., 0., 0., 0., 0., 0., 1., 1., 1., 1., 1., 1., 1., 0., 0., 0.]), ), ), ('chr2L:68-76', 6, ( np.array([68, 69, 70, 71, 72, 73, 74, 75]), np.array([0., 1., 2., 2., 2., 2., 2., 1.]), ), ), ('chr2L:68-76', 1, ( np.array([68, 69, 70, 71, 72, 73, 74, 75]), np.array([0., 0., 1., 0., 0., 0., 1., 0.]), ), ), ): yield check, kind, coord, fragment_size, expected def test_local_coverage_score(): def check(kind, coord, expected): try: result = gs[kind].local_coverage(coord, use_score=True) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") assert np.all(result[0] == expected[0]) and np.all(result[1] == expected[1]), (kind, coord, result) for kind in ['bigbed', 'bed']: for coord, expected in ( ('chr2L:1-20', ( np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19]), np.array([0., 0., 0., 0., 0., 0., 0., 0., 0., 255., 255., 255., 255., 255., 0., 0., 0., 0., 0.]), ), ), ('chr2L:68-76', ( np.array([68, 69, 70, 71, 72, 73, 74, 75]), np.array([0., 0., 510., 510., 510., 510., 510., 0.]), ), ), ): yield check, kind, coord, expected def test_local_coverage_full(): """generator of tests for local coverage ensures that all formats are consistent in their results when retrieving the full un-binned data. """ def check(kind, coord, processes, expected): try: result = gs[kind].local_coverage(coord, processes=processes) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") assert np.all(result[0] == expected[0]) and np.all(result[1] == expected[1]), (kind, coord, result) for kind in ['bam', 'bigbed', 'bed', 'bigwig']: for coord, expected in ( ('chr2L:1-20', ( np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19]), np.array([0., 0., 0., 0., 0., 0., 0., 0., 0., 1., 1., 1., 1., 1., 0., 0., 0., 0., 0.]), ), ), ('chr2L:68-76', ( np.array([68, 69, 70, 71, 72, 73, 74, 75]), np.array([0., 0., 2., 2., 2., 2., 2., 0.]), ), ), ('chr2L:568-576', ( np.array([568, 569, 570, 571, 572, 573, 574, 575]), np.array([0., 0., 0., 0., 0., 0., 0., 0.]), ), ), ): for processes in [None, PROCESSES]: yield check, kind, coord, processes, expected def test_local_coverage_binned(): """generator of tests for local coverage ensures that all formats are consistent in their results when retrieving binned data. """ def check(kind, coord, processes, expected): if kind == 'bigwig': result = gs[kind].local_coverage(coord, bins=8, method='get_as_array', processes=processes) else: try: result = gs[kind].local_coverage(coord, bins=8, processes=processes) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") try: assert np.allclose(result[0], expected[0]) and np.allclose(result[1], expected[1]) except: print (kind, coord, result, expected) raise for kind in ['bam', 'bigbed', 'bed', 'bigwig']: for coord, expected in ( ('chr2L:1-20', ( np.array([ 1., 3.57142857, 6.14285714, 8.71428571, 11.28571429, 13.85714286, 16.42857143, 19.]), np.array([ 0., 0., 0., 0., 1., 1., 0., 0. ]), ), ), ('chr2L:68-76', ( np.array([68, 69, 70, 71, 72, 73, 74, 75]), np.array([0., 0., 2., 2., 2., 2., 2., 0.]), ), ), ): for processes in [None, PROCESSES]: yield check, kind, coord, processes, expected def test_array_binned(): def check(kind, coord, processes, expected): if kind == 'bigwig': result = gs[kind].array(coord, bins=8, method='get_as_array', processes=processes) else: try: result = gs[kind].array(coord, bins=8, processes=processes) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") try: assert np.allclose(result, expected) except: print (kind, coord, result, expected) raise for kind in ['bam', 'bigbed', 'bed', 'bigwig']: for coord, expected in ( (['chr2L:1-20'], np.array([[0., 0., 0., 0., 1., 1., 0., 0. ]]), ), (['chr2L:1-20', 'chr2L:1-20[-]'], np.array([[0., 0., 0., 0., 1., 1., 0., 0. ], [0., 0., 1., 1., 0., 0., 0., 0. ]]), ), (['chr2L:68-76'], np.array([[0., 0., 2., 2., 2., 2., 2., 0.]]), ), ): for processes in [None, PROCESSES]: yield check, kind, coord, processes, expected def test_array_binned_preserve_total(): def check(kind, coord, processes, expected): kwargs = dict(features=coord, bins=8, processes=processes, preserve_total=True) if kind == 'bigwig': assert_raises(ArgumentError, gs[kind].array, method='get_as_array', **kwargs) return else: try: result = gs[kind].array(**kwargs) except NotImplementedError: raise SkipTest("Incompatible bx-python version for bigBed") try: assert np.allclose(result, expected) except: print (kind, coord, result, expected) raise for kind in ['bam', 'bigbed', 'bed', 'bigwig']: for coord, expected in ( (['chr2L:1-20'], np.array([[0., 0., 0., 0., .5, .5, 0., 0. ]]), ), (['chr2L:1-20', 'chr2L:1-20[-]'], np.array([[0., 0., 0., 0., .5, .5, 0., 0. ], [0., 0., .5, .5, 0., 0., 0., 0. ]]), ), (['chr2L:68-76'],
np.array([[0., 0., .4, .4, .4, .4, .4, 0.]])
numpy.array