licenses
sequencelengths 1
3
| version
stringclasses 677
values | tree_hash
stringlengths 40
40
| path
stringclasses 1
value | type
stringclasses 2
values | size
stringlengths 2
8
| text
stringlengths 25
67.1M
| package_name
stringlengths 2
41
| repo
stringlengths 33
86
|
---|---|---|---|---|---|---|---|---|
[
"MIT"
] | 0.1.1 | 72e4eeb7ecb32cb134bfde2b4f7686eb816cc0c7 | code | 329 | Random.seed!(0)
#sig = [1 2; 2 2]
#sig = [1 1; 2 3]
sig = [2 3]
#sig = [2 2]
#sig = [3 2; 2 3]
S = random_S0Graph(sig)
Sthin = complement(forget_S0(complement(S)))
w = random_bounded(S.n)
@time opt1 = dsw(Sthin, w, eps=solver_eps, verbose=1)[1]
@time opt2 = dsw(S, Ψ(S, w), eps=solver_eps)[1]
@test opt1 ≈ opt2*S.n atol=tol
| NoncommutativeGraphs | https://github.com/dstahlke/NoncommutativeGraphs.jl.git |
|
[
"MIT"
] | 0.1.1 | 72e4eeb7ecb32cb134bfde2b4f7686eb816cc0c7 | code | 327 | Random.seed!(0)
#sig = [1 2; 2 2]
#sig = [1 1; 2 3]
sig = [2 3]
#sig = [2 2]
#sig = [3 2; 2 3]
S = random_S0Graph(sig)
w = random_bounded(S.n)
U = random_S1_unitary(sig);
SU = S0Graph(S.sig, U * S.S * U')
@time opt1 = dsw(S, w, eps=solver_eps)[1]
@time opt2 = dsw(SU, U*w*U', eps=solver_eps)[1]
@test opt1 ≈ opt2 atol=tol
| NoncommutativeGraphs | https://github.com/dstahlke/NoncommutativeGraphs.jl.git |
|
[
"MIT"
] | 0.1.1 | 72e4eeb7ecb32cb134bfde2b4f7686eb816cc0c7 | docs | 1478 | NoncommitativeGraphs.jl - Non-commutative graphs in Julia
=========================================================
This package provides support for non-commutative graphs, a quantum analogue
of graphs, as defined in Duan, Severini, Winter,
*Zero-error communication via quantum channels, non-commutative graphs and a quantum
Lovasz theta function*, [arXiv:1002.2514](https://arxiv.org/abs/1002.2514).
Aside from a data structure for holding such graphs, we provide functions for
computing the weighted Lovasz theta function as defined in
Stahlke, *Weighted theta functions for non-commutative graphs*,
[arXiv:2101.00162](https://arxiv.org/abs/2101.00162).
## Example
```julia
julia> using NoncommutativeGraphs, Random
julia> Random.seed!(0);
julia> sig = [3 2; 2 3]; # S₀ algebra is M₃⊗I₂ ⊕ M₂⊗I₃
julia> S = random_S0Graph(sig)
S0Graph{S0=[3 2; 2 3] S=Subspace{ComplexF64} size (12, 12) dim 83}
julia> S.S0 # vertex C*-algebra
Subspace{ComplexF64} size (12, 12) dim 13
julia> T = complement(S) # T = perp(S) + S₀
S0Graph{S0=[3 2; 2 3] S=Subspace{ComplexF64} size (12, 12) dim 74}
julia> W = randn(ComplexF64, S.n, S.n); W = W' * W; # random weight operator
julia> opt1 = dsw(S, W, eps=1e-7).λ # compute weighted theta
133.57806623525727
julia> opt2 = dsw_via_complement(complement(S), W, eps=1e-7).λ # compute weighted θ via the complement graph, using theorem 29 of arxiv:2101.00162.
133.57806730600717
julia> abs(opt1 - opt2) / abs(opt1 + opt2) < 1e-6
true
```
| NoncommutativeGraphs | https://github.com/dstahlke/NoncommutativeGraphs.jl.git |
|
[
"MIT"
] | 0.1.1 | 72e4eeb7ecb32cb134bfde2b4f7686eb816cc0c7 | docs | 1512 | NoncommitativeGraphs.jl - Non-commutative graphs in Julia
=========================================================
This package provides support for non-commutative graphs, a quantum analogue
of graphs, as defined in Duan, Severini, Winter,
*Zero-error communication via quantum channels, non-commutative graphs and a quantum
Lovasz theta function*, [arXiv:1002.2514](https://arxiv.org/abs/1002.2514).
Aside from a data structure for holding such graphs, we provide functions for
computing the weighted Lovasz theta function as defined in
Stahlke, *Weighted theta functions for non-commutative graphs*,
[arXiv:2101.00162](https://arxiv.org/abs/2101.00162).
## Example
```jldoctest; filter = r"^[0-9]+\.[0-9]+$"
julia> using NoncommutativeGraphs, Random
julia> Random.seed!(0);
julia> sig = [3 2; 2 3]; # S₀ algebra is M₃⊗I₂ ⊕ M₂⊗I₃
julia> S = random_S0Graph(sig)
S0Graph{S0=[3 2; 2 3] S=Subspace{ComplexF64} size (12, 12) dim 83}
julia> S.S0 # vertex C*-algebra
Subspace{ComplexF64} size (12, 12) dim 13
julia> T = complement(S) # T = perp(S) + S₀
S0Graph{S0=[3 2; 2 3] S=Subspace{ComplexF64} size (12, 12) dim 74}
julia> W = randn(ComplexF64, S.n, S.n); W = W' * W; # random weight operator
julia> opt1 = dsw(S, W, eps=1e-7).λ # compute weighted theta
133.57806623525727
julia> opt2 = dsw_via_complement(complement(S), W, eps=1e-7).λ # compute weighted θ via the complement graph, using theorem 29 of arxiv:2101.00162.
133.57806730600717
julia> abs(opt1 - opt2) / abs(opt1 + opt2) < 1e-6
true
```
| NoncommutativeGraphs | https://github.com/dstahlke/NoncommutativeGraphs.jl.git |
|
[
"MIT"
] | 0.1.1 | 72e4eeb7ecb32cb134bfde2b4f7686eb816cc0c7 | docs | 87 | Reference
=========
```@autodocs
Modules = [NoncommutativeGraphs]
Private = false
```
| NoncommutativeGraphs | https://github.com/dstahlke/NoncommutativeGraphs.jl.git |
|
[
"MIT"
] | 1.0.0 | f8b7fb25ab3b0691ebb1c5fadab4bbaa167eb156 | code | 18113 | module BlockEnums
import Core.Intrinsics.bitcast
export BlockEnum, @blockenum, add!, @add, blocklength, setblocklength!, getmodule, namemap,
numblocks, addblocks!, add_in_block!, maxvalind, @addinblock,
blockindex, basetype, blockrange, inblock, gtblock, geblock, ltblock, leblock
"""
namemap(::Type{<:BlockEnum})
Return the `Dict` mapping all values to name symbols.
Perhaps this should not be advertized or exposed.
"""
function namemap end
namemap(arg::Any) = throw(MethodError(namemap, (arg,)))
"""
getmodule(t::Type{<:BlockEnum})
Get the module in which `t` is defined.
"""
function getmodule end
"""
blocklength(t::Type{<:BlockEnum})
Get the length of blocks that the range of values of
`t` is partitioned into.
"""
function blocklength end
"""
blockindex(v::BlockEnum)
Get the index of the block of values `v` belongs to.
"""
function blockindex end
"""
setblocklength!(t::Type{<:BlockEnum}, block_length)
Set the length of each block in the partition of the values of `t`. This
can only be called once. In order to use the blocks you must first set up
bookkeeping by calling `addblocks!`. These blocks are called "active".
"""
function setblocklength! end
"""
numblocks(t::Type{<:BlockEnum{T}}) where T <: Integer
Return the number of blocks for which bookkeeping has been set up. The
set of values of `t` is the nonzero values of `T`, which is typically very large. Bookkeeping of
blocks requires storage. So you can only set up some of the blocks for use.
"""
function numblocks end
"""
addblocks!(t::Type{<:BlockEnum}), nblocks::Integer)
Add and initialize `nblocks` blocks to the bookkeeping
for `t`. The number of active blocks for the type
is returned.
"""
function addblocks! end
"""
compact_show(t::Type{<:BlockEnum})
Return `true` if compact show was set when `t` was defined. This omits printing
the corresponding integer when printing. To enable compact show, include the
key/val pair `compactshow=true` when defining `t`.
"""
function compact_show end
"""
maxvalind(t::Type{<:BlockEnum}, block_num::Integer)
Return the largest index for which a name has been assigned in the
`block_num`th block `t`. This number is constrained to be within
the values in the block.
"""
function maxvalind end
function _incrmaxvalind! end
function blocklength1 end
"""
BlockEnum{T<:Integer}
The abstract supertype of all enumerated types defined with [`@blockenum`](@ref).
"""
abstract type BlockEnum{T<:Integer} end
"""
basetype(V::Type{<:BlockEnum{T}})
Return `T`, which is the bitstype whose values are bitcast to
the type `V`.
This is the type of the value returned by `Integer(x::V)`.
The type is in a sense the underlying type of `V`.
"""
basetype(::Type{<:BlockEnum{T}}) where {T<:Integer} = T
"""
val(x::BlockEnum{T})
Return `x` bitcast to type `T`.
"""
val(x::BlockEnum{T}) where T = bitcast(T, x)
(::Type{T})(x::BlockEnum{T2}) where {T<:Integer,T2<:Integer} = T(bitcast(T2, x))::T
Base.cconvert(::Type{T}, x::BlockEnum{T2}) where {T<:Integer,T2<:Integer} = T(x)
Base.write(io::IO, x::BlockEnum{T}) where {T<:Integer} = write(io, T(x))
Base.read(io::IO, ::Type{T}) where {T<:BlockEnum} = T(read(io, basetype(T)))
Base.isless(x::T, y::T) where {T<:BlockEnum} = isless(basetype(T)(x), basetype(T)(y))
Base.Symbol(x::BlockEnum)::Symbol = _symbol(x)
Base.length(t::Type{<:BlockEnum}) = length(namemap(t))
Base.typemin(t::Type{<:BlockEnum}) = minimum(keys(namemap(t)))
Base.typemax(t::Type{<:BlockEnum}) = maximum(keys(namemap(t)))
"""
instances(t::Type{<:BlockEnum})
Return a `Tuple` of all of the named values of `t`.
"""
Base.instances(t::Type{<:BlockEnum}) = (sort!(Any[t(v) for v in keys(namemap(t))])...,)
"""
blockrange(t::Type{<:BlockEnum}, blockind)
Return the range of values of `t` in block number `blockind`.
"""
function blockrange(t::Type{<:BlockEnum}, blockind)
_blockind = Integer(blockind)
(_blockind <= numblocks(t) && _blockind >= 1) ||
throw(ArgumentError("Block index $blockind is out of bounds"))
blen = BlockEnums.blocklength(t)
start = blen * (_blockind - 1) + 1
stop = blen * _blockind
return start:stop
end
function inblock(el::BlockEnum, blockind)
return BlockEnums.val(el) in blockrange(typeof(el), blockind)
end
function gtblock(el::BlockEnum, blockind)
return BlockEnums.val(el) > last(blockrange(typeof(el), blockind))
end
function ltblock(el::BlockEnum, blockind)
return BlockEnums.val(el) < first(blockrange(typeof(el), blockind))
end
function geblock(el::BlockEnum, blockind)
return BlockEnums.val(el) >= first(blockrange(typeof(el), blockind))
end
function leblock(el::BlockEnum, blockind)
return BlockEnums.val(el) <= last(blockrange(typeof(el), blockind))
end
function _symbol(x::BlockEnum)
names = namemap(typeof(x))
x = Integer(x)
get(() -> Symbol("<invalid #$x>"), names, x)::Symbol
end
Base.print(io::IO, x::BlockEnum) = print(io, _symbol(x))
function Base.show(io::IO, x::BlockEnum)
sym = _symbol(x)
if !(get(io, :compact, false)::Bool)
from = get(io, :module, Main)
def = typeof(x).name.module
if from === nothing || !Base.isvisible(sym, def, from)
show(io, def)
print(io, ".")
end
end
print(io, sym)
end
function Base.show(io::IO, ::MIME"text/plain", x::BlockEnum)
print(io, x, "::")
show(IOContext(io, :compact => true), typeof(x))
compact_show(typeof(x)) && return
print(io, " = ")
show(io, Integer(x))
end
function Base.show(io::IO, m::MIME"text/plain", t::Type{<:BlockEnum})
if isconcretetype(t)
print(io, "BlockEnum ")
Base.show_datatype(io, t)
print(io, ":")
for x in instances(t)
print(io, "\n", Symbol(x), " = ")
show(io, Integer(x))
end
else
invoke(show, Tuple{IO, MIME"text/plain", Type}, io, m, t)
end
end
# give BlockEnum types scalar behavior in broadcasting
Base.broadcastable(x::BlockEnum) = Ref(x)
@noinline enum_argument_error(typename, x) = throw(ArgumentError(string("invalid value for BlockEnum $(typename): $x")))
# Following values of `s` and what is returned
# `syname` returns (:syname, nothing)
# `syname = 3` returns `(:syname, 3)`
# `s` a LineNumberNode returns `(nothing, nothing)`
function _sym_and_number(typename, _module, basetype, s)
s isa LineNumberNode && return (nothing, nothing)
if isa(s, Symbol)
i = nothing
elseif isa(s, Expr) && # For example `a = 1`
(s.head === :(=) || s.head === :kw) && # IIRC may be :(=) or :kw depending on Julia version
length(s.args) == 2 && isa(s.args[1], Symbol)
i = Core.eval(_module, s.args[2]) # allow exprs, e.g. uint128"1"
if !isa(i, Integer)
throw(ArgumentError("invalid value for BlockEnum $typename, $s; values must be integers"))
end
i = convert(basetype, i)
s = s.args[1] # Set `s` to just the symbol
else
throw(ArgumentError(string("invalid argument for BlockEnum ", typename, ": ", s)))
end
if !Base.isidentifier(s)
throw(ArgumentError("invalid name for BlockEnum $typename; \"$s\" is not a valid identifier"))
end
return (s, i)
end
function _check_begin_block(syms)
if length(syms) == 1 && syms[1] isa Expr && syms[1].head === :block
syms = syms[1].args
end
return syms
end
function _parse_block_length(blen)
isa(blen, Integer) && return blen
isa(blen, Expr) || throw(ArgumentError("blocklength must be an Integer or an expression."))
args = blen.args
if blen.head === :call && length(args) == 3 && args[1] === :(^) &&
isa(args[2], Int) && isa(args[3], Int)
return args[2] ^ args[3]
else
throw(ArgumentError("Invalid expression for blocklength $(blen)"))
end
end
"""
@blockenum BlockEnumName[::BaseType] value1[=x] value2[=y]
Create an `BlockEnum{BaseType}` subtype with name `BlockEnumName` and enum member values of
`value1` and `value2` with optional assigned values of `x` and `y`, respectively.
`BlockEnumName` can be used just like other types and enum member values as regular values, such as
# Examples
```jldoctest fruitenum
julia> @blockenum Fruit apple=1 orange=2 kiwi=3
julia> f(x::Fruit) = "I'm a Fruit with value: \$(Int(x))"
f (generic function with 1 method)
julia> f(apple)
"I'm a Fruit with value: 1"
julia> Fruit(1)
apple::Fruit = 1
```
Values can also be specified inside a `begin` block, e.g.
```julia
@blockenum BlockEnumName begin
value1
value2
end
```
`BaseType`, which defaults to [`Int32`](@ref), must be a primitive subtype of `Integer`.
Member values can be converted between the enum type and `BaseType`. `read` and `write`
perform these conversions automatically. In case the enum is created with a non-default
`BaseType`, `Integer(value1)` will return the integer `value1` with the type `BaseType`.
To list all the instances of an enum use `instances`, e.g.
```jldoctest fruitenum
julia> instances(Fruit)
(apple, orange, kiwi)
```
It is possible to construct a symbol from an enum instance:
```jldoctest fruitenum
julia> Symbol(apple)
:apple
```
"""
macro blockenum(T0::Union{Symbol,Expr}, syms...)
local modname = :nothing # Default, do not create a new module. Use module that is in scope.
local typename
local _blocklength::Int = 0
local init_num_blocks::Int = 0
_compact_show=false
if isa(T0, Expr) && T0.head === :tuple # (modulename, blockenumname)
length(T0.args) >= 1 || throw(ArgumentError("If first argument is a Tuple, it must have at least one element"))
T = T0.args[1] # `T` is the name of the new subtype of BlockEnum
for i in 2:lastindex(T0.args)
expr = T0.args[i]
(isa(expr, Expr) && expr.head === :(=)) || throw(ArgumentError(string("Expecting `=` expression as $(i)th item in init tuple.")))
(keyw, val) = (expr.args[1], expr.args[2])
if keyw === :blocklength
_blocklength = _parse_block_length(val)
elseif keyw === :mod # Symbols in this module. TODO, how to allow :module here? It is recognized as Julia reserved word
modname = val
elseif keyw === :numblocks
init_num_blocks = val
elseif keyw === :compactshow
_compact_show = val
else
throw(ArgumentError(string("Unexpected keyword $(expr.args[1])")))
end
end
else
T = T0
end
if init_num_blocks > 0 && ! (_blocklength > 0)
throw(ArgumentError(string("If numblocks is set then blocklength must be set.")))
end
basetype = Int32 # default. We may change this below.
typename = T
if isa(T, Expr) && T.head === :(::) && length(T.args) == 2 && isa(T.args[1], Symbol)
typename = T.args[1]
basetype = Core.eval(__module__, T.args[2])
if !isa(basetype, DataType) || !(basetype <: Integer) || !isbitstype(basetype)
throw(ArgumentError("invalid base type for BlockEnum $typename, $T=::$basetype; base type must be an integer primitive type"))
end
elseif !isa(T, Symbol)
throw(ArgumentError("invalid type expression for enum $T"))
end
# The new subtype of BlockEnum is now `typename`. No longer use `T`.
T = nothing # Do this to signal intent and uncover bugs
values = Vector{basetype}()
seen = Set{Symbol}()
namemap = Dict{basetype,Symbol}()
block_max_ind = Vector{Int}(undef, init_num_blocks)
for i in 1:init_num_blocks
block_max_ind[i] = (i - 1) * _blocklength
end
lo = hi = 0
i = zero(basetype)
hasexpr = false
# Symbols (and their values if present) may be wrapped in `begin`, `end`
syms = _check_begin_block(syms)
for s in syms
(s, _i) = _sym_and_number(typename, __module__, basetype, s)
s === nothing && continue # Got a LineNumberNode
if _i === nothing && i == typemin(basetype) && !isempty(values)
throw(ArgumentError("overflow in value \"$s\" of BlockEnum $typename"))
end
if _i !== nothing
hasexpr = true
i = _i
end
s = s::Symbol
if hasexpr && haskey(namemap, i)
throw(ArgumentError("both $s and $(namemap[i]) have value $i in BlockEnum $typename; values must be unique"))
end
namemap[i] = s
push!(values, i)
if s in seen
throw(ArgumentError("name \"$s\" in BlockEnum $typename is not unique"))
end
push!(seen, s)
if length(values) == 1
lo = hi = i
else
lo = min(lo, i)
hi = max(hi, i)
end
i += oneunit(i)
end
blk = quote
# enum definition
Base.@__doc__(primitive type $(esc(typename)) <: BlockEnum{$(basetype)} $(sizeof(basetype) * 8) end)
function $(esc(typename))(x::Integer)
if x > typemax($basetype) || x < typemin($basetype)
enum_argument_error($(Expr(:quote, typename)), x)
end
return bitcast($(esc(typename)), convert($(basetype), x))
end
BlockEnums.namemap(::Type{$(esc(typename))}) = $(esc(namemap))
BlockEnums.blocklength(::Type{$(esc(typename))}) = $(esc(_blocklength))
BlockEnums.numblocks(::Type{$(esc(typename))}) = length($(esc(block_max_ind)))
function BlockEnums.addblocks!(::Type{$(esc(typename))}, n::Integer)
blklen = $(esc(_blocklength))
if iszero(blklen)
throw(ArgumentError("This BlockEnum was not initialized with blocks."))
end
bmaxind = $(esc(block_max_ind))
curlen = length(bmaxind)
resize!(bmaxind, curlen + n)
for i in (curlen + 1):(curlen + n)
bmaxind[i] = (i - 1) * blklen
end
return length(bmaxind)
end
function BlockEnums.maxvalind(::Type{$(esc(typename))}, block::Integer)
return $(esc(block_max_ind))[block]
end
function BlockEnums._incrmaxvalind!(::Type{$(esc(typename))}, block::Integer)
mbi = $(esc(block_max_ind))
mbi[block] += 1
return return mbi[block]
end
function BlockEnums.blockindex(x::$(esc(typename)))
$(esc(_blocklength)) > 0 || return 0
blknum = div(Int(x), $(esc(_blocklength)), RoundUp)
return blknum
end
function BlockEnums.compact_show(::Type{$(esc(typename))})
return $(esc(_compact_show))
end
# JET complains about the fallback calls to array_subpadding when calling
# reinterpret(basetype, ::Vector{typename}). So we define these.
Base.array_subpadding(::Type{$(esc(typename))}, ::Type{$basetype}) = true
Base.array_subpadding(::Type{$basetype}, ::Type{$(esc(typename))}) = true
end
@show __module__
if isa(typename, Symbol)
if modname !== :nothing
push!(blk.args, :(module $(esc(modname)); end))
else
modname = __module__
end
push!(blk.args,
:(BlockEnums.getmodule(::Type{$(esc(typename))}) = $(esc(modname))))
push!(blk.args, :(BlockEnums._bind_vars($(esc(typename)))))
end
push!(blk.args, :nothing)
blk.head = :toplevel
return blk
end
function _bind_vars(etype)
for (i, sym) in namemap(etype)
_bind_var(getmodule(etype), sym, etype(i))
end
end
_bind_var(mod, sym, instance) = mod.eval(:(const $sym = $instance; export $sym))
function add!(a, syms...)
nmap = BlockEnums.namemap(a)
nextnum = length(a) == 0 ? 0 : maximum(keys(nmap)) + 1
local na
_module = getmodule(a)
count_assigned = 0
for sym in syms
(sym, _i) = _sym_and_number(Symbol(a), _module, basetype(a), sym)
sym in values(nmap) && throw(ArgumentError("Key $sym already defined in $a."))
if _i !== nothing
nextnum = _i
end
na = a(nextnum)
nmap[nextnum] = sym
_bind_var(_module, sym, na)
nextnum += 1
count_assigned += 1
end
if iszero(count_assigned)
throw(ArgumentError("No symbols defined in enum!"))
end
return na
end
function _get_qsyms(syms)
syms = _check_begin_block(syms)
return (QuoteNode(sym) for sym in syms if ! isa(sym, LineNumberNode))
end
macro add(a, syms...)
qsyms = _get_qsyms(syms)
:(BlockEnums.add!($(esc(a)), $(qsyms...)))
end
function add_in_block!(a, _block::Union{Integer, BlockEnum}, syms...)
block = Int(_block)
nmap = BlockEnums.namemap(a)
nextnum = maxvalind(a, block) + 1
local na
_module = getmodule(a)
for sym in syms
blocklim = blocklength(a) * block
if nextnum > blocklim
throw(ArgumentError("Attempting to set enum value above block limit $blocklim"))
end
(sym, _i) = _sym_and_number(Symbol(a), _module, basetype(a), sym)
sym in values(nmap) && throw(ArgumentError("Key $sym already defined in $a."))
if _i !== nothing
throw(ArgumentError("Setting number explicitly not allowed in block mode."))
end
na = a(nextnum)
nmap[nextnum] = sym
_bind_var(_module, sym, na)
nextnum += 1
_incrmaxvalind!(a, block)
end
return na
end
macro addinblock(a, block, syms...)
qsyms = _get_qsyms(syms)
:(BlockEnums.add_in_block!($(esc(a)), $(esc(block)), $(qsyms...)))
end
# Since we don't guarantee continguous values of instances, this does not work
# It is taken from the code for Enum
# generate code to test whether expr is in the given set of values
# function membershiptest(expr, values)
# lo, hi = extrema(values)
# if length(values) == hi - lo + 1
# :($lo <= $expr <= $hi)
# elseif length(values) < 20
# foldl((x1,x2)->:($x1 || ($expr == $x2)), values[2:end]; init=:($expr == $(values[1])))
# else
# :($expr in $(Set(values)))
# end
# end
end # module BlockEnums
| BlockEnums | https://github.com/jlapeyre/BlockEnums.jl.git |
|
[
"MIT"
] | 1.0.0 | f8b7fb25ab3b0691ebb1c5fadab4bbaa167eb156 | code | 376 | using BlockEnums
using BlockEnums: blocklength, setblocklength!, numblocks, addblocks!, maxvalind, @addinblock,
blockindex, blockrange, inblock, ltblock, gtblock, leblock, geblock
using Test
@static if Base.VERSION >= v"1.7"
if get(ENV,"BLOCKENUMS_JET_TEST","")=="true"
include("test_jet.jl")
end
end
include("test_aqua.jl")
include("test_blockenums.jl")
| BlockEnums | https://github.com/jlapeyre/BlockEnums.jl.git |
|
[
"MIT"
] | 1.0.0 | f8b7fb25ab3b0691ebb1c5fadab4bbaa167eb156 | code | 701 | using BlockEnums
using Aqua: Aqua
@testset "aqua unbound_args" begin
Aqua.test_unbound_args(BlockEnums)
end
@testset "aqua undefined exports" begin
Aqua.test_undefined_exports(BlockEnums)
end
@testset "aqua test ambiguities" begin
Aqua.test_ambiguities([BlockEnums, Core, Base])
end
@testset "aqua piracy" begin
Aqua.test_piracy(BlockEnums)
end
@testset "aqua project extras" begin
Aqua.test_project_extras(BlockEnums)
end
@testset "aqua state deps" begin
Aqua.test_stale_deps(BlockEnums)
end
@testset "aqua deps compat" begin
Aqua.test_deps_compat(BlockEnums)
end
@testset "aqua project toml formatting" begin
Aqua.test_project_toml_formatting(BlockEnums)
end
| BlockEnums | https://github.com/jlapeyre/BlockEnums.jl.git |
|
[
"MIT"
] | 1.0.0 | f8b7fb25ab3b0691ebb1c5fadab4bbaa167eb156 | code | 3245 | module Wrap1
using BlockEnums: @blockenum
@blockenum A3 a3 b3 c3
@blockenum (A4, mod=A4mod) a4 b4
end # module Wrap1
# JET does not like this reinterpret. But JET does not
# examine this code.
@testset "reinterpret" begin
@blockenum ZZ zz1 zz2 zz3
v1 = [zz1, zz2, zz3]
v2 = reinterpret(BlockEnums.basetype(ZZ), v1)
@test eltype(v2) === BlockEnums.basetype(ZZ)
@test all(x->isa(x, BlockEnums.basetype(ZZ)), v2)
end
@testset "blocks" begin
@blockenum (Z, blocklength=3)
@test numblocks(Z) == 0
@test blocklength(Z) == 3
addblocks!(Z, 10)
@test numblocks(Z) == 10
addblocks!(Z, 10)
@test numblocks(Z) == 20
@test maxvalind(Z, 1) == 0
@test maxvalind(Z, 2) == 3
@addinblock Z 1 a b c
@test_throws ArgumentError @addinblock Z 1 d
@addinblock Z 2 x y z
@test maxvalind(Z, 1) == 3
@test maxvalind(Z, 2) == 6
@test blockindex(a) == 1
@test blockindex(x) == 2
@test inblock(x, 2)
@test inblock(z, 2)
@test ! inblock(z, 1)
@test inblock(a, 1)
@test blockrange(Z, 2) === 4:6
@test ltblock(a, 2)
@test leblock(a, 2)
@test leblock(z, 2)
@test geblock(a, 1)
@test geblock(z, 1)
@test leblock(a, 1)
@test ! leblock(z, 1)
@blockenum ZZ
@test_throws ArgumentError addblocks!(ZZ, 5)
@blockenum (YY, blocklength=10^6)
@test blocklength(YY) == 1000000
end
@testset "BlockEnums.jl" begin
@blockenum A1 a1 b1 c1
@test Int.((a1, b1, c1)) == (0, 1, 2)
@test BlockEnums.val.((a1, b1, c1)) == (0, 1, 2)
@test A1(1) == b1
@test length(A1) == 3
@test Base.cconvert(Int, a1) === Int(a1)
@test instances(A1) == (a1, b1, c1)
@test BlockEnums.getmodule(A1) == Main
# Base.Enum will throw an error with the following
@test Integer(A1(111)) == 111
@test isless(a1, b1)
@test a1 < b1
@test basetype(A1) == Int32
@blockenum A1_64::Int64
@test basetype(A1_64) == Int64
@blockenum (A2, mod=A2mod) a2 b2 c2
@test Int.((A2mod.a2, A2mod.b2, A2mod.c2)) == (0, 1, 2)
@test_throws UndefVarError a2 == 0
@test BlockEnums.getmodule(A2) == A2mod
@test Int(Wrap1.a3) == 0
@test_throws UndefVarError a3 == 0
@test Int(Wrap1.A4mod.b4) == 1
@test_throws UndefVarError Wrap1.b4 == 0
@test_throws UndefVarError b4 == 0
@test BlockEnums.getmodule(Wrap1.A4) == Wrap1.A4mod
@add A1 z1 y1
@test Int(z1) == 3
@add A2 z2 y2
@test Int(A2mod.z2) == 3
@add Wrap1.A3 z3
@test Int(Wrap1.z3) == 3
@test Wrap1.A3(3) == Wrap1.z3
@add Wrap1.A4 z4
@test Int(Wrap1.A4mod.z4) == 2
@test Wrap1.A4(2) == Wrap1.A4mod.z4 # This *is* how we want scoping to work.
@test instances(Wrap1.A4) == (Wrap1.A4mod.a4, Wrap1.A4mod.b4, Wrap1.A4mod.z4)
@test_throws ArgumentError @add A1 z1
@blockenum (A5, mod=A5mod) a5=2 b5=3 c5
@test Int(A5mod.c5) == 4
@add A5 d5 e5=11 f5
@test Int(A5mod.d5) == 5
@test Int(A5mod.e5) == 11
@test Int(A5mod.f5) == 12
@test_throws ArgumentError add!(A5, Symbol("1q"))
@blockenum A6 begin
a6
b6
c6
end
@test Int(c6) == 2
@blockenum A7 begin
a7 = 10
b7
c7
end
@test Int(c7) == 12
end
| BlockEnums | https://github.com/jlapeyre/BlockEnums.jl.git |
|
[
"MIT"
] | 1.0.0 | f8b7fb25ab3b0691ebb1c5fadab4bbaa167eb156 | code | 1232 | # Borrowed from QuantumOpticsBase
using Test
using BlockEnums
using JET
using JET: ReportPass, BasicPass, InferenceErrorReport, UncaughtExceptionReport
# Custom report pass that ignores `UncaughtExceptionReport`
# Too coarse currently, but it serves to ignore the various
# "may throw" messages for runtime errors we raise on purpose
# (mostly on malformed user input)
struct MayThrowIsOk <: ReportPass end
# ignores `UncaughtExceptionReport` analyzed by `JETAnalyzer`
(::MayThrowIsOk)(::Type{UncaughtExceptionReport}, @nospecialize(_...)) = return
# forward to `BasicPass` for everything else
function (::MayThrowIsOk)(report_type::Type{<:InferenceErrorReport}, @nospecialize(args...))
BasicPass()(report_type, args...)
end
@testset "jet single calls" begin
@blockenum XX xx1 xx2
v = [xx1, xx2]
result = @report_call reinterpret(BlockEnums.basetype(XX), v)
@show result
@test length(JET.get_reports(result)) == 0
end
@testset "jet on package" begin
rep = report_package(
"BlockEnums";
report_pass=MayThrowIsOk(), # TODO have something more fine grained than a generic "do not care about thrown errors"
)
@show rep
@test length(JET.get_reports(rep)) == 0
end # testset
| BlockEnums | https://github.com/jlapeyre/BlockEnums.jl.git |
|
[
"MIT"
] | 1.0.0 | f8b7fb25ab3b0691ebb1c5fadab4bbaa167eb156 | docs | 2250 | # BlockEnums
[](https://github.com/jlapeyre/BlockEnums.jl/actions/workflows/CI.yml?query=branch%3Amain)
[](https://codecov.io/gh/jlapeyre/BlockEnums.jl)
[](https://github.com/JuliaTesting/Aqua.jl)
[](https://github.com/aviatesk/JET.jl)
<!-- [](https://juliahub.com/ui/Packages/BlockEnums/2Dg1l?t=2) -->
<!-- [](https://juliahub.com/ui/Packages/BlockEnums/2Dg1l) -->
BlockEnums is like the built-in Enums. The main differences are
* Enumerated types are mutable in the sense that instances may be added after the type is created.
* The enumeration may be partitioned into blocks of values. For example `@addinblock A 2 x` would add
the instance `x` to type `A` in the second block of indices.
```julia
julia> using BlockEnums
julia> @blockenum Fruit apple banana
julia> Fruit
BlockEnum Fruit:
apple = 0
banana = 1
julia> @add Fruit pear
pear::Fruit = 2
julia> Fruit
BlockEnum Fruit:
apple = 0
pear = 2
banana = 1
```
Some block features
```julia
julia> using BlockEnums
julia> @blockenum (Myenum, mod=MyenumMod, blocklength=100, numblocks=10, compactshow=false)
julia> @addinblock Myenum 1 a b c
c::Myenum = 3
julia> @addinblock Myenum 3 x y z
z::Myenum = 203
julia> BlockEnums.blockindex(MyenumMod.y)
3
```
### Methods for functions in `Base`
Methods for the following functions in `Base` are defined and follow the established semantics.
* `cconvert`
* `write`, converts to the underlying bitstype before writing.
* `read` , reads a value from the bitstype and converts to the `BlockEnum`
* `isless`
* `Symbol`
* `length`
* `typemin`, `typemax` These are the min and max of values with names bound to them.
* `instances`
* `print`
### Testing
BlockEnums passes [JET.jl](https://github.com/aviatesk/JET.jl) and [Aqua.jl](https://github.com/JuliaTesting/Aqua.jl) tests.
| BlockEnums | https://github.com/jlapeyre/BlockEnums.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 566 | using Documenter
using GilaElectromagnetics
push!(LOAD_PATH,"../src/")
makedocs(sitename="GilaElectromagnetics.jl Documentation",
pages = [
"Index" => "index.md",
"An other page" => "docIndex.md",
],
format = Documenter.HTML(prettyurls = false)
)
# Documenter can also automatically deploy documentation to gh-pages.
# See "Hosting Documentation" and deploydocs() in the Documenter manual
# for more information.
deploydocs(
repo = "github.com/moleskySean/GilaElectromagnetics.jl.git",
devbranch = "main"
) | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 4029 | """
GilaElectromagnetics implements single (complex) frequency electromagnetic Green
functions between generalized source and target cuboid ``volumes''. Technical
details are available in the supporting document files.
Author: Sean Molesky
Distribution: The code distributed under GNU LGPL.
"""
module GilaElectromagnetics
using AbstractFFTs, FFTW, LinearAlgebra, FastGaussQuadrature, Cubature,
CUDA, Base.Threads, ThreadsX
#=
glaMem defines the memory structures used in Gila.
exported definitions
--------------------
GlaVol---basic cuboid memory: relative cell number and size, grid values, etc.
genGlaVol---generator for GlaVol memory structure.
GlaKerOpt---hardware options for Green function protocol (egoOpr!), switch
between CPU and GPU resources, define number of available compute threads, etc.
GlaOprMem---container for the volume interaction elements (as well as internal
information) used in computing the Green function interaction between a pair of
volumes. GlaOprMem is effectively a stored Green function.
GlaOprMem---generate operator memory structure, from a volume or pair of
volumes, for use by egoOpr!
notable internal definitions
----------------------------
GlaExtInf---memory structure for translating between distinct grid layouts.
glaVolEveGen---regenerate and scale a GlaVol to have even number of cells.
=#
include("glaMem.jl")
export GlaVol, GlaKerOpt, GlaOprMem, GlaExtInf
#=
glaInt contains support functions for numerical (real space) integration of
the cuboid interactions described by the electromagnetic Green function. This
code is mostly translated from DIRECTFN_E by Athanasios Polimeridis.
Reference: Polimeridis AG, Vipiana F, Mosig JR, Wilton DR.
DIRECTFN: Fully numerical algorithms for high precision computation of singular
integrals in Galerkin SIE methods.
IEEE Transactions on Antennas and Propagation. 2013; 61(6):3112-22.
exported definitions
--------------------
notable internal definitions
----------------------------
=#
include("glaInt.jl")
#=
glaGen calculates the unique elements of the electromagnetic Green functions,
embedded in circulant form, via calls to the code contained in glaInt.
Integration tolerances ultimately used by glaInt.jl are introduced in this file.
exported definitions
--------------------
notable internal definitions
----------------------------
genEgoSlf!---computation of interaction elements for sources within one volume.
genEgoExt!---computation of interaction elements between a source and target
volume. The source and target volume are allowed to touch and have cell scales
that differ by integer factors.
=#
include("glaGen.jl")
#=
glaAct contains the package protocol for computing matrix vector products---the
action of the electromagnetic Green function on a specified current
distribution---for a given volume or pair of volumes.
exported definitions
--------------------
egoOpr!---given a GlaOprMem structure and source current distribution,
yield the resulting electromagnetic fields.
GlaOpr---a struct that wraps `egoOpr!` for easy use of the Greens function
glaSze---like `size`, but gives the size of the input/output arrays for a
GreensOperator in tensor form
isadjoint---returns true if the operator is the adjoint of the Greens operator
isselfoperator---returns true if the operator is a self operator
isexternaloperator---returns true if the operator is an external operator
notable internal definitions
----------------------------
=#
include("glaAct.jl")
export egoOpr!, GlaOpr, glaSze, isadjoint, isselfoperator, isexternaloperator
#=
glaEgoMat provides direct computation of the dense matrix defined by the
electromagnetic Green function in free space. The code is only written for self
volumes. glaEgoMat includes glaLinAlg, which allows the Green function to act a
matrix for many LinearAlgebra applications.
notable internal definitions
----------------------------
genEgoMat---return the dense matrix of a self Green function.
=#
include("../utl/glaEgoMat.jl")
end
| GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 11602 | ###MEMORY
#=
GlaOprMem(cmpInf::GlaKerOpt, trgVol::GlaVol,
srcVol::Union{GlaVol,Nothing}=nothing,
egoFur::Union{AbstractArray{<:AbstractArray{T}},
Nothing}=nothing)::GlaOprMem where T<:Union{ComplexF64,ComplexF32}
Prepare memory for green function operator---when called with a single GlaVol,
or identical source and target volumes, the function yields the self green
function construction.
GlaOpr(celSrc::NTuple{3, Int}, sclSrc::NTuple{3, Rational},
orgSrc::NTuple{3, Rational}, celTrg::NTuple{3, Int},
sclTrg::NTuple{3, Rational}, orgTrg::NTuple{3, Rational};
useGpu::Bool=false, setType::DataType=ComplexF64)
Construct an external Green's operator.
=#
include("glaMemSup.jl")
###PROCEDURE
"""
egoOpr!(egoMem::GlaOprMem,
actVec::AbstractArray{T})::AbstractArray{T} where
T<:Union{ComplexF64,ComplexF32}
Applies the electric Green function to actVec (current), returning the output
field. actVec is internally modified by egoOpr! to reduce needed allocation.
"""
#=
egoOpr! has no internal check for NaN entries---checks are done by GlaOprMem.
=#
function egoOpr!(egoMem::GlaOprMem,
actVec::AbstractArray{T})::AbstractArray{T} where
T<:Union{ComplexF64,ComplexF32}
# check that actVec is the correct size
if (egoMem.mixInf.srcCel..., 3) == size(actVec)
# device execution
if prod(egoMem.cmpInf.devMod)
return egoBrnDev!(egoMem, 0, 0, actVec)
else
return egoBrnHst!(egoMem, 0, 0, actVec)
end
else
error("Size of input vector does not match size of source volume.
Required data layout is (srcCelX, srcCelY, srcCelZ, 3).")
return actVec
end
end
# Support functions for operator action
include("glaActSup.jl")
"""
egoBrnHst!(egoMem::GlaOprMem, lvl::Integer, bId::Integer,
actVec::AbstractArray{T})::AbstractArray{T} where
T<:Union{ComplexF64,ComplexF32}
Head branching function implementing Green function action on host.
"""
function egoBrnHst!(egoMem::GlaOprMem, lvl::Integer, bId::Integer,
actVec::AbstractArray{T})::AbstractArray{T} where
T<:Union{ComplexF64,ComplexF32}
# generate branch pair to initiate operator
# size of circulant vector
brnSze = div.(egoMem.mixInf.trgCel .+ egoMem.mixInf.srcCel, 2)
# number of source partitions
parNumSrc = prod(egoMem.mixInf.srcDiv)
# number of target partitions
parNumTrg = prod(egoMem.mixInf.trgDiv)
# if necessary, reshape source vector into partitions
if lvl == 0 && sum(egoMem.mixInf.srcCel .!= size(actVec)[1:3]) > 0
# reshape current vector
# orgVec and actVec share the same underlying data
orgVec = genPrtHst(egoMem.mixInf, egoMem.cmpInf, parNumSrc, actVec)
elseif lvl == 0
orgVec = reshape(actVec, egoMem.mixInf.srcCel..., 3, parNumSrc)
else
# partitions have been created, simply rename memory
orgVec = actVec
end
# perform forward Fourier transform
if lvl > 0
# forward FFT
# possibility of changing vector size accounted for in FFT plans
egoMem.fftPlnFwd[lvl] * orgVec
end
# split branch
if lvl < length(egoMem.dimInf)
# check if size of current active vector dimension is compatible
if size(orgVec)[lvl + 1] == brnSze[lvl + 1]
prgVec = similar(orgVec)
# split branch: perform phase shift
sptBrnHst!(size(orgVec)[1:3], prgVec, lvl + 1,
egoMem.phzInf[lvl + 1], parNumSrc, orgVec, egoMem.cmpInf)
# rename vectors for consistent convention with general branching
prgVecEve = orgVec
prgVecOdd = prgVec
# size of progeny vectors must be changed
else
# current and progeny vector sizes
curSze = size(orgVec)
prgSze = ntuple(x -> x == (lvl + 1) ? brnSze[x] : curSze[x], 3)
# allocate progeny vectors
prgVecEve = Array{eltype(orgVec)}(undef, prgSze..., 3,
parNumSrc)
prgVecOdd = Array{eltype(orgVec)}(undef, prgSze..., 3,
parNumSrc)
# memory previously associated with orgVec is freed internally
sptBrnHst!(prgVecEve, prgVecOdd, lvl + 1, egoMem.phzInf[lvl + 1],
egoMem.mixInf, parNumSrc, orgVec, egoMem.cmpInf)
end
end
# branch until depth of block structure
if lvl < length(egoMem.dimInf)
# !create external handles for sync---!not sure why this is needed!
eveVec = prgVecEve
oddVec = prgVecOdd
# execute split branches---!asynchronous CPU is fine + some speed up!
@sync begin
# origin branch
Base.Threads.@spawn eveVec = egoBrnHst!(egoMem, lvl + 1, bId,
prgVecEve)
# phase modified branch
Base.Threads.@spawn oddVec = egoBrnHst!(egoMem, lvl + 1,
nxtBrnId(length(egoMem.dimInf), lvl, bId), prgVecOdd)
end
# check if size of vector must change on merge
if size(eveVec)[lvl + 1] == egoMem.mixInf.trgCel[lvl + 1]
# merge branches, includes phase operation and stream sync
mrgBrnHst!(egoMem.mixInf, eveVec, lvl + 1, parNumTrg,
egoMem.phzInf[lvl + 1], oddVec, egoMem.cmpInf)
# rename eveVec to match return name used elsewhere
retVec = eveVec
# merge and resize
else
# size of current vector
curSze = size(eveVec)
# size of cartesian indices of merged vector
mrgSze = ntuple(x -> x == (lvl + 1) ? egoMem.mixInf.trgCel[x] :
curSze[x], 3)
# allocate memory for merge
if sum(egoMem.cmpInf.devMod) == true
retVec = CuArray{eltype(eveVec)}(undef, mrgSze..., 3,
parNumTrg)
else
retVec = Array{eltype(eveVec)}(undef, mrgSze..., 3, parNumTrg)
end
# merge branches, even and odd vectors are freed, stream synced
mrgBrnHst!(egoMem.mixInf, retVec, lvl + 1, parNumTrg,
egoMem.phzInf[lvl + 1], eveVec, oddVec, egoMem.cmpInf)
end
else
retVec = zeros(eltype(orgVec), brnSze..., 3, parNumTrg)
# multiply by Toeplitz vector, avoid race condition DO NOT SPAWN!
for trgItr in eachindex(1:parNumTrg)
for srcItr in eachindex(1:parNumSrc)
mulBrnHst!(egoMem.mixInf, bId, selectdim(retVec, 5, trgItr),
view(egoMem.egoFur[bId + 1], :, :, :, :, srcItr, trgItr),
selectdim(orgVec, 5, srcItr), egoMem.cmpInf)
end
end
end
# perform reverse Fourier transform
if lvl > 0
# inverse FFT
# possibility of changing vector size accounted for in FFT plans
egoMem.fftPlnRev[lvl] * retVec
end
# terminate task and return control to previous level
# zero level return
if lvl == 0
# check if there are partitions that need to be merged
if parNumTrg == 1
return reshape(retVec, egoMem.mixInf.trgCel..., 3)
else
return mrgPrtHst(egoMem.mixInf, egoMem.cmpInf, parNumTrg, retVec)
end
end
return retVec
end
"""
egoBrnDev!(egoMem::GlaOprMem, lvl::Integer, bId::Integer,
actVec::AbstractArray{T})::AbstractArray{T} where
T<:Union{ComplexF64,ComplexF32}
Head branching function implementing Green function action on device.
"""
function egoBrnDev!(egoMem::GlaOprMem, lvl::Integer, bId::Integer,
actVec::AbstractArray{T})::AbstractArray{T} where
T<:Union{ComplexF64,ComplexF32}
# generate branch pair to initiate operator
# size of circulant vector
brnSze = div.(egoMem.mixInf.trgCel .+ egoMem.mixInf.srcCel, 2)
# number of source partitions
parNumSrc = prod(egoMem.mixInf.srcDiv)
# number of target partitions
parNumTrg = prod(egoMem.mixInf.trgDiv)
# if necessary, reshape source vector into partitions
if lvl == 0 && sum(egoMem.mixInf.srcCel .!= size(actVec)[1:3]) > 0
# reshape current vector
# orgVec and actVec share the same underlying data
orgVec = genPrtDev(egoMem.mixInf, egoMem.cmpInf, parNumSrc, actVec)
elseif lvl == 0
orgVec = reshape(actVec, egoMem.mixInf.srcCel..., 3, parNumSrc)
else
# partitions have been created, simply rename memory
orgVec = actVec
end
# perform forward Fourier transform
if lvl > 0
# forward FFT
# possibility of changing vector size accounted for in FFT plans
egoMem.fftPlnFwd[lvl] * orgVec
# wait for completion of FFT
CUDA.synchronize(CUDA.stream())
end
# split branch
if lvl < length(egoMem.dimInf)
# check if size of current active vector dimension is compatible
if size(orgVec)[lvl + 1] == brnSze[lvl + 1]
prgVec = CuArray{eltype(orgVec)}(undef, size(orgVec)[1:3]...,
3, parNumSrc)
# split branch, includes phase operation and stream sync
sptBrnDev!(size(orgVec)[1:3], prgVec, lvl + 1,
egoMem.phzInf[lvl + 1], parNumSrc, orgVec, egoMem.cmpInf)
# rename vectors for consistent convention with general branching
prgVecEve = orgVec
prgVecOdd = prgVec
# size of progeny vectors must be changed
else
# current and progeny vector sizes
curSze = size(orgVec)
prgSze = ntuple(x -> x == (lvl + 1) ? brnSze[x] : curSze[x], 3)
# allocate progeny vectors
prgVecEve = CuArray{eltype(orgVec)}(undef, prgSze..., 3,
parNumSrc)
prgVecOdd = CuArray{eltype(orgVec)}(undef, prgSze..., 3,
parNumSrc)
CUDA.synchronize(CUDA.stream())
# memory previously associated with orgVec is freed internally
sptBrnDev!(prgVecEve, prgVecOdd, lvl + 1, egoMem.phzInf[lvl + 1],
egoMem.mixInf, parNumSrc, orgVec, egoMem.cmpInf)
end
end
# branch until depth of block structure
if lvl < length(egoMem.dimInf)
# execute split branches---!async causes errors + no speed up!
# even branch
eveVec = egoBrnDev!(egoMem, lvl + 1, bId, prgVecEve)
# !wait for even branch to return, functionality choice!
if lvl < length(egoMem.dimInf) - 1
CUDA.synchronize(CUDA.stream())
end
# phase modified branch
oddVec = egoBrnDev!(egoMem, lvl + 1,
nxtBrnId(length(egoMem.dimInf), lvl, bId), prgVecOdd)
# check if size of vector must change on merge
if size(eveVec)[lvl + 1] == egoMem.mixInf.trgCel[lvl + 1]
# merge branches, includes phase operation and stream sync
mrgBrnDev!(egoMem.mixInf, eveVec, lvl + 1, parNumTrg,
egoMem.phzInf[lvl + 1], oddVec, egoMem.cmpInf)
# rename eveVec to match return name used elsewhere
retVec = eveVec
# merge and resize
else
# size of current vector
curSze = size(eveVec)
# size of cartesian indices of merged vector
mrgSze = ntuple(x -> x == (lvl + 1) ? egoMem.mixInf.trgCel[x] :
curSze[x], 3)
# allocate memory for merge
if sum(egoMem.cmpInf.devMod) == true
retVec = CuArray{eltype(eveVec)}(undef, mrgSze..., 3,
parNumTrg)
else
retVec = Array{eltype(eveVec)}(undef, mrgSze..., 3, parNumTrg)
end
# merge branches, even and odd vectors are freed, stream synced
mrgBrnDev!(egoMem.mixInf, retVec, lvl + 1, parNumTrg,
egoMem.phzInf[lvl + 1], eveVec, oddVec, egoMem.cmpInf)
end
else
retVec = CUDA.zeros(eltype(orgVec), brnSze..., 3, parNumTrg)
CUDA.synchronize(CUDA.stream())
# multiply by Toeplitz vector, avoid race condition DO NOT SPAWN!
for trgItr in eachindex(1:parNumTrg)
for srcItr in eachindex(1:parNumSrc)
# CUDA stream is synchronized inside mulBrn!
mulBrnDev!(egoMem.mixInf, bId, selectdim(retVec, 5, trgItr),
view(egoMem.egoFur[bId + 1], :, :, :, :, srcItr, trgItr),
selectdim(orgVec, 5, srcItr), egoMem.cmpInf)
end
end
# free orgVec
CUDA.synchronize(CUDA.stream())
CUDA.unsafe_free!(orgVec)
CUDA.synchronize(CUDA.stream())
end
# perform reverse Fourier transform
if lvl > 0
# inverse FFT
# possibility of changing vector size accounted for in FFT plans
egoMem.fftPlnRev[lvl] * retVec
CUDA.synchronize(CUDA.stream())
end
# terminate task and return control to previous level
CUDA.synchronize(CUDA.stream())
# zero level return
if lvl == 0
# check if there are partitions that need to be merged
if parNumTrg == 1
return reshape(retVec, egoMem.mixInf.trgCel..., 3)
else
return mrgPrtDev(egoMem.mixInf, egoMem.cmpInf, parNumTrg, retVec)
end
end
return retVec
end
###INTEGRATION
#=
Basic linear algebra definitions for egoOpr, allowing integration and simplified
use.
=#
include("glaLinAlg.jl") | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 36249 | #=
restructure input vector to match partitioned Green function data
=#
function genPrtHst(mixInf::GlaExtInf, cmpInf::GlaKerOpt, parNum::Integer,
actVec::AbstractArray{T,4})::AbstractArray{T,5} where
T<:Union{ComplexF64,ComplexF32}
# create partitioned vector
orgVec = Array{eltype(actVec)}(undef, mixInf.srcCel..., 3, parNum)
# break into partitions
@threads for itr ∈ CartesianIndices(orgVec)
# copy partition data
@inbounds orgVec[itr] =
actVec[CartesianIndex((Tuple(itr)[1:3] .- (1,1,1)) .*
mixInf.srcDiv) + CartesianIndex(1,1,1) +
mixInf.srcPar[itr[5]], itr[4]]
end
return orgVec
end
#=
split into host and device functions to clarify type inference
=#
function genPrtDev(mixInf::GlaExtInf, cmpInf::GlaKerOpt, parNum::Integer,
actVec::AbstractArray{T,4})::AbstractArray{T,5} where
T<:Union{ComplexF64,ComplexF32}
# memory for partitioned vector
orgVec = CuArray{eltype(actVec)}(undef, mixInf.srcCel..., 3, parNum)
CUDA.synchronize(CUDA.stream())
# perform partitioning
for parItr ∈ eachindex(1:parNum)
for dirItr ∈ eachindex(1:3)
@cuda threads=cmpInf.numTrd blocks=cmpInf.numBlk genPrtKer!(
size(orgVec)[1:3]..., mixInf.srcDiv...,
Tuple(mixInf.srcPar[parItr])..., dirItr, parItr, orgVec,
actVec)
end
end
# release active vector to reduce memory pressure
CUDA.synchronize(CUDA.stream())
CUDA.unsafe_free!(actVec)
CUDA.synchronize(CUDA.stream())
return orgVec
end
#=
device source vector partitioning kernel
=#
function genPrtKer!(maxX::Integer, maxY::Integer, maxZ::Integer,
stpX::Integer, stpY::Integer, stpZ::Integer,
offX::Integer, offY::Integer, offZ::Integer,
dirItr::Integer, parItr::Integer,
orgVec::AbstractArray{T,5}, actVec::AbstractArray{T,4})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (blockIdx().z - 0x1) * blockDim().z
# copy partition data
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
orgVec[itrX,itrY,itrZ,dirItr,parItr] = actVec[(itrX - 1) * stpX +
offX + 1, (itrY - 1) * stpY + offY + 1, (itrZ -1) * stpZ + offZ + 1,
dirItr]
end
return nothing
end
#=
split a branch so that even and odd Fourier coefficients are independent
=#
function sptBrnHst!(vecSze::NTuple{3,Integer},
prgVec::AbstractArray{T,5}, sptDir::Integer, phzVec::AbstractVector{T},
parNum::Integer, orgVec::AbstractArray{T,5},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
@threads for itr ∈ CartesianIndices(orgVec)
@inbounds prgVec[itr] = phzVec[itr[sptDir]] * orgVec[itr]
end
return nothing
end
#=
host and device code split to clarify code operation
=#
function sptBrnDev!(vecSze::NTuple{3,Integer},
prgVec::AbstractArray{T,5}, sptDir::Integer, phzVec::AbstractVector{T},
parNum::Integer, orgVec::AbstractArray{T,5},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
for parItr ∈ eachindex(1:parNum)
@cuda threads=cmpInf.numTrd blocks=cmpInf.numBlk sptKer!(vecSze...,
prgVec, sptDir, phzVec, parItr, orgVec)
end
CUDA.synchronize(CUDA.stream())
return nothing
end
#=
device kernel for sptBrn!
=#
function sptKer!(maxX::Integer, maxY::Integer, maxZ::Integer,
prgVec::AbstractArray{T,5}, sptDir::Integer, phzVec::AbstractVector{T},
parItr::Integer, orgVec::AbstractArray{T,5})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (blockIdx().z - 0x1) * blockDim().z
# multiplication loop selected based on phase transformation direction
if sptDir == 1
# x phase---phzVec[itrX]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
# x direction
prgVec[itrX,itrY,itrZ,1,parItr] = phzVec[itrX] *
orgVec[itrX,itrY,itrZ,1,parItr]
# y direction
prgVec[itrX,itrY,itrZ,2,parItr] = phzVec[itrX] *
orgVec[itrX,itrY,itrZ,2,parItr]
# z direction
prgVec[itrX,itrY,itrZ,3,parItr] = phzVec[itrX] *
orgVec[itrX,itrY,itrZ,3,parItr]
end
elseif sptDir == 2
# y phase---phzVec[itrY]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
# x direction
prgVec[itrX,itrY,itrZ,1,parItr] = phzVec[itrY] *
orgVec[itrX,itrY,itrZ,1,parItr]
# y direction
prgVec[itrX,itrY,itrZ,2,parItr] = phzVec[itrY] *
orgVec[itrX,itrY,itrZ,2,parItr]
# z direction
prgVec[itrX,itrY,itrZ,3,parItr] = phzVec[itrY] *
orgVec[itrX,itrY,itrZ,3,parItr]
end
else
# z phase---phzVec[itrZ]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
# x direction
prgVec[itrX,itrY,itrZ,1,parItr] = phzVec[itrZ] *
orgVec[itrX,itrY,itrZ,1,parItr]
# y direction
prgVec[itrX,itrY,itrZ,2,parItr] = phzVec[itrZ] *
orgVec[itrX,itrY,itrZ,2,parItr]
# z direction
prgVec[itrX,itrY,itrZ,3,parItr] = phzVec[itrZ] *
orgVec[itrX,itrY,itrZ,3,parItr]
end
end
return nothing
end
#=
split branches for external Green function
=#
function sptBrnHst!(prgVecEve::AbstractArray{T,5}, prgVecOdd::AbstractArray{T,5},
dirSpt::Integer, phzVec::AbstractVector{T}, mixInf::GlaExtInf,
parNum::Integer, orgVec::AbstractArray{T,5},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
# final branch size
brnSze = div.(mixInf.trgCel .+ mixInf.srcCel, 2)
# current and progeny vector sizes
curSze = size(orgVec)
prgSze = ntuple(x -> x == dirSpt ? brnSze[x] : curSze[x], 3)
# spill over of source vector into embedding extension
ovrCpy = map(UnitRange, (1,1,1), mixInf.srcCel .- brnSze)
# copy ranges
ovrRng = ntuple(x -> x == dirSpt ? ovrCpy[x] : 1:prgSze[x], 3)
# range for standard copy
stdCpy = map(UnitRange, getproperty.(ovrRng, :stop) .+ (1,1,1),
min.(mixInf.srcCel, brnSze))
stdRng = ntuple(x -> x == dirSpt ? stdCpy[x] : 1:prgSze[x], 3)
# range for zero copy
zroCpy = map(UnitRange, getproperty.(stdRng, :stop) .+ (1,1,1), brnSze)
zroRng = ntuple(x -> x == dirSpt ? zroCpy[x] : 1:prgSze[x], 3)
# offset for over range
ovrOff = ntuple(x -> x == dirSpt ? brnSze[dirSpt] : 0, 3)
# spill over indices
splRng = CartesianIndices(ovrRng) .+ CartesianIndex(ovrOff)
# perform split
# copy range where source vector spills over brnSze
@threads for crtItr ∈ CartesianIndices((ovrRng..., 1:3, 1:parNum))
# even branch
@inbounds prgVecEve[crtItr] = orgVec[crtItr] +
orgVec[splRng[crtItr[1],crtItr[2],crtItr[3]],crtItr[4],
crtItr[5]]
# odd branch
@inbounds prgVecOdd[crtItr] = phzVec[crtItr[dirSpt]] *
(orgVec[crtItr] -
orgVec[splRng[crtItr[1],crtItr[2],crtItr[3]],crtItr[4],
crtItr[5]])
end
# standard copy range
@threads for crtItr ∈ CartesianIndices((stdRng..., 1:3, 1:parNum))
# even branch
@inbounds prgVecEve[crtItr] = orgVec[crtItr]
# odd branch
@inbounds prgVecOdd[crtItr] = phzVec[crtItr[dirSpt]] *
orgVec[crtItr]
end
# zero copy range
@threads for crtItr ∈ CartesianIndices((zroRng..., 1:3, 1:parNum))
# even branch
@inbounds prgVecEve[crtItr] = 0.0 + 0.0 * im
# odd branch
@inbounds prgVecOdd[crtItr] = 0.0 + 0.0 * im
end
return nothing
end
#=
split host and device code to clarify functionality
=#
function sptBrnDev!(prgVecEve::AbstractArray{T,5}, prgVecOdd::AbstractArray{T,5},
dirSpt::Integer, phzVec::AbstractVector{T}, mixInf::GlaExtInf,
parNum::Integer, orgVec::AbstractArray{T,5},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
# final branch size
brnSze = div.(mixInf.trgCel .+ mixInf.srcCel, 2)
# current and progeny vector sizes
curSze = size(orgVec)
prgSze = ntuple(x -> x == dirSpt ? brnSze[x] : curSze[x], 3)
# spill over of source vector into embedding extension
ovrCpy = map(UnitRange, (1,1,1), mixInf.srcCel .- brnSze)
# copy ranges
ovrRng = ntuple(x -> x == dirSpt ? ovrCpy[x] : 1:prgSze[x], 3)
# range for standard copy
stdCpy = map(UnitRange, getproperty.(ovrRng, :stop) .+ (1,1,1),
min.(mixInf.srcCel, brnSze))
stdRng = ntuple(x -> x == dirSpt ? stdCpy[x] : 1:prgSze[x], 3)
# range for zero copy
zroCpy = map(UnitRange, getproperty.(stdRng, :stop) .+ (1,1,1), brnSze)
zroRng = ntuple(x -> x == dirSpt ? zroCpy[x] : 1:prgSze[x], 3)
# offset for over range
ovrOff = ntuple(x -> x == dirSpt ? brnSze[dirSpt] : 0, 3)
# spill over indices
splRng = CartesianIndices(ovrRng) .+ CartesianIndex(ovrOff)
# perform split
# copy range where source vector spills over brnSze
if !isempty(CartesianIndices(ovrRng))
for parItr ∈ eachindex(1:parNum)
for dirItr ∈ eachindex(1:3)
@cuda threads=cmpInf.numTrd blocks=cmpInf.numBlk sptBrnOvrKer!(
prgVecEve, prgVecOdd, getproperty.(ovrRng, :stop)...,
getproperty.(ovrRng, :start)..., sum(ovrOff), dirSpt,
dirItr, parItr, phzVec, orgVec)
end
end
end
# standard copy range
for parItr ∈ eachindex(1:parNum)
for dirItr ∈ eachindex(1:3)
@cuda threads=cmpInf.numTrd blocks=cmpInf.numBlk sptBrnStdKer!(
prgVecEve, prgVecOdd, getproperty.(stdRng, :stop)...,
getproperty.(stdRng, :start)..., dirSpt, dirItr, parItr,
phzVec, orgVec)
end
end
# zero copy range
if !isempty(CartesianIndices(zroRng))
for parItr ∈ eachindex(1:parNum)
for dirItr ∈ eachindex(1:3)
@cuda threads=cmpInf.numTrd blocks=cmpInf.numBlk sptBrnZroKer!(
prgVecEve, prgVecOdd, getproperty.(zroRng, :stop)...,
getproperty.(zroRng, :start)..., dirItr, parItr, orgVec)
end
end
end
# release original vector to reduce memory pressure
CUDA.synchronize(CUDA.stream())
CUDA.unsafe_free!(orgVec)
CUDA.synchronize(CUDA.stream())
return nothing
end
#=
kernel for source spill over portion
=#
function sptBrnOvrKer!(prgVecEve::AbstractArray{T,5},
prgVecOdd::AbstractArray{T,5}, endX::Integer, endY::Integer, endZ::Integer,
begX::Integer, begY::Integer, begZ::Integer, ovrOff::Integer,
dirSpt::Integer, dirItr::Integer, parItr::Integer,
phzVec::AbstractVector{T}, orgVec::AbstractArray{T,5})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (begX - 0x1) + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (begY - 0x1) + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (begZ - 0x1) + (blockIdx().z - 0x1) * blockDim().z
# multiplication loop selected based on phase transformation direction
if dirSpt == 1
# x phase---phzVec[itrX]
@inbounds for itrZ = idZ:strZ:endZ, itrY = idY:strY:endY,
itrX = idX:strX:endX
# even branch
prgVecEve[itrX,itrY,itrZ,dirItr,parItr] =
orgVec[itrX,itrY,itrZ,dirItr,parItr] +
orgVec[itrX + ovrOff,itrY,itrZ,dirItr,parItr]
# odd branch
prgVecOdd[itrX,itrY,itrZ,dirItr,parItr] = phzVec[itrX] *
(orgVec[itrX,itrY,itrZ,dirItr,parItr] -
orgVec[itrX + ovrOff,itrY,itrZ,dirItr,parItr])
end
elseif dirSpt == 2
# y phase---phzVec[itrY]
@inbounds for itrZ = idZ:strZ:endZ, itrY = idY:strY:endY,
itrX = idX:strX:endX
# even branch
prgVecEve[itrX,itrY,itrZ,dirItr,parItr] =
orgVec[itrX,itrY,itrZ,dirItr,parItr] +
orgVec[itrX,itrY + ovrOff,itrZ,dirItr,parItr]
# odd branch
prgVecOdd[itrX,itrY,itrZ,dirItr,parItr] = phzVec[itrY] *
(orgVec[itrX,itrY,itrZ,dirItr,parItr] -
orgVec[itrX,itrY + ovrOff,itrZ,dirItr,parItr])
end
else
# z phase---phzVec[itrZ]
@inbounds for itrZ = idZ:strZ:endZ, itrY = idY:strY:endY,
itrX = idX:strX:endX
# even branch
prgVecEve[itrX,itrY,itrZ,dirItr,parItr] =
orgVec[itrX,itrY,itrZ,dirItr,parItr] +
orgVec[itrX,itrY,itrZ + ovrOff,dirItr,parItr]
# odd branch
prgVecOdd[itrX,itrY,itrZ,dirItr,parItr] = phzVec[itrZ] *
(orgVec[itrX,itrY,itrZ,dirItr,parItr] -
orgVec[itrX,itrY,itrZ + ovrOff,dirItr,parItr])
end
end
return nothing
end
#=
kernel for standard branching copy
=#
function sptBrnStdKer!(prgVecEve::AbstractArray{T,5},
prgVecOdd::AbstractArray{T,5}, endX::Integer, endY::Integer, endZ::Integer,
begX::Integer, begY::Integer, begZ::Integer, dirSpt::Integer,
dirItr::Integer, parItr::Integer, phzVec::AbstractVector{T},
orgVec::AbstractArray{T,5})::Nothing where T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (begX - 0x1) + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (begY - 0x1) + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (begZ - 0x1) + (blockIdx().z - 0x1) * blockDim().z
# multiplication loop selected based on phase transformation direction
if dirSpt == 1
# x phase---phzVec[itrX]
@inbounds for itrZ = idZ:strZ:endZ, itrY = idY:strY:endY,
itrX = idX:strX:endX
# even branch
prgVecEve[itrX,itrY,itrZ,dirItr,parItr] =
orgVec[itrX,itrY,itrZ,dirItr,parItr]
# odd branch
prgVecOdd[itrX,itrY,itrZ,dirItr,parItr] = phzVec[itrX] *
orgVec[itrX,itrY,itrZ,dirItr,parItr]
end
elseif dirSpt == 2
# y phase---phzVec[itrY]
@inbounds for itrZ = idZ:strZ:endZ, itrY = idY:strY:endY,
itrX = idX:strX:endX
# even branch
prgVecEve[itrX,itrY,itrZ,dirItr,parItr] =
orgVec[itrX,itrY,itrZ,dirItr,parItr]
# odd branch
prgVecOdd[itrX,itrY,itrZ,dirItr,parItr] = phzVec[itrY] *
orgVec[itrX,itrY,itrZ,dirItr,parItr]
end
else
# z phase---phzVec[itrZ]
@inbounds for itrZ = idZ:strZ:endZ, itrY = idY:strY:endY,
itrX = idX:strX:endX
# even branch
prgVecEve[itrX,itrY,itrZ,dirItr,parItr] =
orgVec[itrX,itrY,itrZ,dirItr,parItr]
# odd branch
prgVecOdd[itrX,itrY,itrZ,dirItr,parItr] = phzVec[itrZ] *
orgVec[itrX,itrY,itrZ,dirItr,parItr]
end
end
return nothing
end
#=
kernel for additional embedding
=#
function sptBrnZroKer!(prgVecEve::AbstractArray{T,5},
prgVecOdd::AbstractArray{T,5}, endX::Integer, endY::Integer, endZ::Integer,
begX::Integer, begY::Integer, begZ::Integer, dirItr::Integer,
parItr::Integer, orgVec::AbstractArray{T,5})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (begX - 0x1) + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (begY - 0x1) + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (begZ - 0x1) + (blockIdx().z - 0x1) * blockDim().z
# zero appropriate elements
@inbounds for itrZ = idZ:strZ:endZ, itrY = idY:strY:endY,
itrX = idX:strX:endX
# even branch
prgVecEve[itrX,itrY,itrZ,dirItr,parItr] = 0.0 + 0.0 * im
# odd branch
prgVecOdd[itrX,itrY,itrZ,dirItr,parItr] = 0.0 + 0.0 * im
end
return nothing
end
#=
merge two branches, eliminating unused coefficients
=#
function mrgBrnHst!(mixInf::GlaExtInf, orgVec::AbstractArray{T,5},
mrgDir::Integer, parNumTrg::Integer, phzVec::AbstractVector{T},
prgVec::AbstractArray{T,5},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
@threads for itr ∈ CartesianIndices(orgVec)
@inbounds orgVec[itr] = 0.5 * (orgVec[itr] +
conj(phzVec[itr[mrgDir]]) * prgVec[itr])
end
return nothing
end
#=
split host and device code to clarify functionality
=#
function mrgBrnDev!(mixInf::GlaExtInf, orgVec::AbstractArray{T,5},
mrgDir::Integer, parNumTrg::Integer, phzVec::AbstractVector{T},
prgVec::AbstractArray{T,5},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
for prtItr ∈ eachindex(1:parNumTrg)
for dirItr ∈ eachindex(1:3)
@cuda threads = cmpInf.numTrd blocks = cmpInf.numBlk mrgKer!(
size(orgVec)[1:3]..., orgVec, mrgDir, phzVec, dirItr,
prtItr, prgVec)
end
end
CUDA.synchronize(CUDA.stream())
CUDA.unsafe_free!(prgVec)
CUDA.synchronize(CUDA.stream())
return nothing
end
#=
device kernel for mrgBrn!
=#
function mrgKer!(maxX::Integer, maxY::Integer, maxZ::Integer,
orgVec::AbstractArray{T,5}, mrgDir::Integer, phzVec::AbstractVector{T},
dirItr::Integer, prtItr::Integer, prgVec::AbstractArray{T,5})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (blockIdx().z - 0x1) * blockDim().z
# multiplication loop selected based on phase transformation direction
if mrgDir == 1
# x phase---phzVec[itrX]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
orgVec[itrX,itrY,itrZ,dirItr,prtItr] =
0.5 * (orgVec[itrX,itrY,itrZ,dirItr,prtItr] +
conj(phzVec[itrX]) * prgVec[itrX,itrY,itrZ,dirItr,prtItr])
end
elseif mrgDir == 2
# y phase---phzVec[itrY]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
orgVec[itrX,itrY,itrZ,dirItr,prtItr] =
0.5 * (orgVec[itrX,itrY,itrZ,dirItr,prtItr] +
conj(phzVec[itrY]) * prgVec[itrX,itrY,itrZ,dirItr,prtItr])
end
else
# z phase---phzVec[itrZ]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
orgVec[itrX,itrY,itrZ,dirItr,prtItr] =
0.5 * (orgVec[itrX,itrY,itrZ,dirItr,prtItr] +
conj(phzVec[itrZ]) * prgVec[itrX,itrY,itrZ,dirItr,prtItr])
end
end
return nothing
end
#=
generalized host merge allowing for different output size
=#
function mrgBrnHst!(mixInf::GlaExtInf, mrgVec::AbstractArray{T,5},
mrgDir::Integer, parNumTrg::Integer, phzVec::AbstractVector{T},
eveVec::AbstractArray{T,5}, oddVec::AbstractArray{T,5},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
# size of current and merged vectors
mrgSze = size(mrgVec)
curSze = size(eveVec)
# range for top half of merge vector
topRng = ntuple(x -> x == mrgDir ? (1:min(mrgSze[x], curSze[x])) :
(1:mrgSze[x]), 3)
# range for bottom half of merge vector
botRng = ntuple(x -> x == mrgDir ?
(1:(mrgSze[x] - getproperty(topRng[x], :stop))) : (1:mrgSze[x]), 3)
# offset for merge vector
offSet = ntuple(x -> x == mrgDir ?
(getproperty(botRng[x], :stop) > 0 ?
getproperty(topRng[x], :stop) : 0) : 0, 5)
# merge top range
@threads for itr ∈ CartesianIndices((topRng..., 1:3, 1:mrgSze[5]))
@inbounds mrgVec[itr] = 0.5 * (eveVec[itr] +
conj(phzVec[itr[mrgDir]]) * oddVec[itr])
end
# check if merge vector is filled
if getproperty(botRng[mrgDir], :stop) > 0
@threads for itr ∈ CartesianIndices((botRng..., 1:3, 1:mrgSze[5]))
@inbounds mrgVec[itr + CartesianIndex(offSet)] = 0.5 *
(eveVec[itr] - conj(phzVec[itr[mrgDir]]) * oddVec[itr])
end
end
return nothing
end
#=
device merge allowing for different output size
=#
function mrgBrnDev!(mixInf::GlaExtInf, mrgVec::AbstractArray{T,5},
mrgDir::Integer, parNumTrg::Integer, phzVec::AbstractVector{T},
eveVec::AbstractArray{T,5}, oddVec::AbstractArray{T,5},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
# size of current and merged vectors
mrgSze = size(mrgVec)
curSze = size(eveVec)
# range for top half of merge vector
topRng = ntuple(x -> x == mrgDir ? (1:min(mrgSze[x], curSze[x])) :
(1:mrgSze[x]), 3)
# range for bottom half of merge vector
botRng = ntuple(x -> x == mrgDir ?
(1:(mrgSze[x] - getproperty(topRng[x], :stop))) : (1:mrgSze[x]), 3)
# offset for merge vector
offSet = ntuple(x -> x == mrgDir ?
(getproperty(botRng[x], :stop) > 0 ?
getproperty(topRng[x], :stop) : 0) : 0, 5)
# merge top range
for prtItr ∈ eachindex(1:parNumTrg)
for dirItr ∈ eachindex(1:3)
@cuda threads = cmpInf.numTrd blocks = cmpInf.numBlk mrgTopKer!(
mrgVec, getproperty.(topRng, :stop)..., mrgDir, phzVec,
dirItr, prtItr, eveVec, oddVec)
end
end
# check if merge vector is filled
if getproperty(botRng[mrgDir], :stop) > 0
for prtItr ∈ eachindex(1:parNumTrg)
for dirItr ∈ eachindex(1:3)
@cuda threads = cmpInf.numTrd blocks = cmpInf.numBlk mrgBotKer!(
mrgVec, getproperty.(botRng, :stop)..., offSet[mrgDir],
mrgDir, phzVec, dirItr, prtItr, eveVec, oddVec)
end
end
end
# free liberated memory
CUDA.synchronize(CUDA.stream())
CUDA.unsafe_free!(eveVec)
CUDA.unsafe_free!(oddVec)
CUDA.synchronize(CUDA.stream())
return nothing
end
#=
device kernel for top half of generalized mrgBrn!
=#
function mrgTopKer!(mrgVec::AbstractArray{T,5}, maxX::Integer, maxY::Integer,
maxZ::Integer, mrgDir::Integer, phzVec::AbstractVector{T}, dirItr::Integer,
prtItr::Integer, eveVec::AbstractArray{T,5},
oddVec::AbstractArray{T,5})::Nothing where T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (blockIdx().z - 0x1) * blockDim().z
# multiplication loop selected based on phase transformation direction
if mrgDir == 1
# x phase---phzVec[itrX]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
mrgVec[itrX,itrY,itrZ,dirItr,prtItr] =
0.5 * (eveVec[itrX,itrY,itrZ,dirItr,prtItr] +
conj(phzVec[itrX]) * oddVec[itrX,itrY,itrZ,dirItr,prtItr])
end
elseif mrgDir == 2
# y phase---phzVec[itrY]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
mrgVec[itrX,itrY,itrZ,dirItr,prtItr] =
0.5 * (eveVec[itrX,itrY,itrZ,dirItr,prtItr] +
conj(phzVec[itrY]) * oddVec[itrX,itrY,itrZ,dirItr,prtItr])
end
else
# z phase---phzVec[itrZ]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
mrgVec[itrX,itrY,itrZ,dirItr,prtItr] =
0.5 * (eveVec[itrX,itrY,itrZ,dirItr,prtItr] +
conj(phzVec[itrZ]) * oddVec[itrX,itrY,itrZ,dirItr,prtItr])
end
end
return nothing
end
#=
device kernel for bottom half of generalized mrgBrn!
=#
function mrgBotKer!(mrgVec::AbstractArray{T,5}, maxX::Integer, maxY::Integer,
maxZ::Integer, mrgOff::Integer, mrgDir::Integer, phzVec::AbstractVector{T},
dirItr::Integer, prtItr::Integer, eveVec::AbstractArray{T,5},
oddVec::AbstractArray{T,5})::Nothing where T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (blockIdx().z - 0x1) * blockDim().z
# multiplication loop selected based on phase transformation direction
if mrgDir == 1
# x phase---phzVec[itrX]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
mrgVec[itrX + mrgOff,itrY,itrZ,dirItr,prtItr] =
0.5 * (eveVec[itrX,itrY,itrZ,dirItr,prtItr] -
conj(phzVec[itrX]) * oddVec[itrX,itrY,itrZ,dirItr,prtItr])
end
elseif mrgDir == 2
# y phase---phzVec[itrY]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
mrgVec[itrX,itrY + mrgOff,itrZ,dirItr,prtItr] =
0.5 * (eveVec[itrX,itrY,itrZ,dirItr,prtItr] -
conj(phzVec[itrY]) * oddVec[itrX,itrY,itrZ,dirItr,prtItr])
end
else
# z phase---phzVec[itrZ]
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
mrgVec[itrX,itrY,itrZ + mrgOff,dirItr,prtItr] =
0.5 * (eveVec[itrX,itrY,itrZ,dirItr,prtItr] -
conj(phzVec[itrZ]) * oddVec[itrX,itrY,itrZ,dirItr,prtItr])
end
end
return nothing
end
#=
execute Hadamard product step
=#
function mulBrnHst!(mixInf::GlaExtInf, bId::Integer,
prdVec::AbstractArray{T,4}, vecMod::AbstractArray{T,4},
orgVec::AbstractArray{T,4},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
# size of branch
brnSze = (mixInf.trgCel .+ mixInf.srcCel) .÷ 2
# unique information of Green function
egoSze = size(vecMod)[1:3]
# zero if branch is even in that direction, one if branch is odd
brnSym = Bool.([mod(div(bId, ^(2, 3 - k)), 2) for k ∈ 1:3])
# declare memory
dirSymHst = Array{Float32}(undef, 3, 8)
# selection ranges for Green function and vector
modRng = Array{StepRange}(undef, 3, 8)
vecRng = Array{StepRange}(undef, 3, 8)
# sign symmetry for Green function multiplication
symSgn = Array{Float32}(undef, 3, 8)
# perform Hadamard---forward and reverse operation in each direction
@sync begin
for divItr ∈ 0:7
# one for reverse direction, zero for forward
revSwt = [mod(div(divItr, ^(2, k - 1)), 2) for k ∈ 1:3]
# set copy ranges
for dirItr ∈ 1:3
# switch between full and partial stored information cases
if egoSze[dirItr] == brnSze[dirItr]
if revSwt[dirItr] == 0
# Green function range
modRng[dirItr,divItr + 1] = 1:1:brnSze[dirItr]
vecRng[dirItr,divItr + 1] = 1:1:brnSze[dirItr]
symSgn[dirItr, divItr + 1] = 1.0
else
modRng[dirItr,divItr + 1] = 1:1:0
vecRng[dirItr,divItr + 1] = 1:1:0
symSgn[dirItr, divItr + 1] = 0.0
end
# partial information case
else
# switch between even and odd branch cases
if brnSym[dirItr] == 0
# switch between source and target portions
if revSwt[dirItr] == 0
begInd = 1
endInd = Integer.(ceil.(mixInf.trgCel[dirItr] /
2)) + iseven(mixInf.trgCel[dirItr])
# source coefficients
else
begInd = 2
endInd = Integer.(floor.(mixInf.srcCel[dirItr] /
2)) + 1 - iseven(mixInf.trgCel[dirItr])
end
# odd coefficient branch
else
begInd = 1
# target coefficients
if revSwt[dirItr] == 0
endInd = Integer.(ceil.(mixInf.trgCel[dirItr] / 2))
# source coefficients
else
endInd = Integer.(floor.(mixInf.srcCel[dirItr] / 2))
end
end
# Green function range
modRng[dirItr,divItr + 1] = begInd:1:endInd
# vector range
if revSwt[dirItr] == 0
vecRng[dirItr,divItr + 1] = 1:1:(1 + endInd - begInd)
else
vecRng[dirItr,divItr + 1] =
brnSze[dirItr]:-1:(brnSze[dirItr] - endInd + begInd)
end
# sign symmetry for Green function multiplication
symSgn[dirItr, divItr + 1] = 1.0 - 2.0 * revSwt[dirItr]
end
end
# check that range is not empty
if !isempty(CartesianIndices(tuple(modRng[:,divItr + 1]...)))
copyto!(view(dirSymHst, :, divItr + 1),
eltype(dirSymHst).([symSgn[1,divItr + 1] *
symSgn[2,divItr + 1], symSgn[1,divItr + 1] *
symSgn[3,divItr + 1], symSgn[2,divItr + 1] *
symSgn[3,divItr + 1]]))
Base.Threads.@spawn mulKerHst!(
getproperty.(modRng[:,divItr + 1], :stop) .-
getproperty.(modRng[:,divItr + 1], :start) .+ 1,
view(dirSymHst, :, divItr +
1), view(prdVec, vecRng[:,divItr + 1]..., :),
view(vecMod, modRng[:,divItr + 1]..., :),
view(orgVec, vecRng[:,divItr + 1]..., :))
end
end
end
return nothing
end
#=
execute Hadamard product step on device
=#
function mulBrnDev!(mixInf::GlaExtInf, bId::Integer,
prdVec::AbstractArray{T,4}, vecMod::AbstractArray{T,4},
orgVec::AbstractArray{T,4},
cmpInf::GlaKerOpt=GlaKerOpt(false))::Nothing where
T<:Union{ComplexF64,ComplexF32}
# size of branch
brnSze = (mixInf.trgCel .+ mixInf.srcCel) .÷ 2
# unique information of Green function
egoSze = size(vecMod)[1:3]
# zero if branch is even in that direction, one if branch is odd
brnSym = Bool.([mod(div(bId, ^(2, 3 - k)), 2) for k ∈ 1:3])
# declare memory
dimInfDev = CuArray{Int32}(undef, 3, 8)
dirSymDev = CuArray{Float32}(undef, 3, 8)
# selection ranges for Green function and vector
modRng = Array{StepRange}(undef, 3, 8)
vecRng = Array{StepRange}(undef, 3, 8)
# sign symmetry for Green function multiplication
symSgn = Array{Float32}(undef, 3, 8)
# perform Hadamard---forward and reverse operation in each direction
@sync begin
for divItr ∈ 0:7
# one for reverse direction, zero for forward
revSwt = [mod(div(divItr, ^(2, k - 1)), 2) for k ∈ 1:3]
# set copy ranges
for dirItr ∈ 1:3
# switch between full and partial stored information cases
if egoSze[dirItr] == brnSze[dirItr]
if revSwt[dirItr] == 0
# Green function range
modRng[dirItr,divItr + 1] = 1:1:brnSze[dirItr]
vecRng[dirItr,divItr + 1] = 1:1:brnSze[dirItr]
symSgn[dirItr, divItr + 1] = 1.0
else
modRng[dirItr,divItr + 1] = 1:1:0
vecRng[dirItr,divItr + 1] = 1:1:0
symSgn[dirItr, divItr + 1] = 0.0
end
# partial information case
else
# switch between even and odd branch cases
if brnSym[dirItr] == 0
# switch between source and target portions
if revSwt[dirItr] == 0
begInd = 1
endInd = Integer.(ceil.(mixInf.trgCel[dirItr] /
2)) + iseven(mixInf.trgCel[dirItr])
# source coefficients
else
begInd = 2
endInd = Integer.(floor.(mixInf.srcCel[dirItr] /
2)) + 1 - iseven(mixInf.trgCel[dirItr])
end
# odd coefficient branch
else
begInd = 1
# target coefficients
if revSwt[dirItr] == 0
endInd = Integer.(ceil.(mixInf.trgCel[dirItr] / 2))
# source coefficients
else
endInd = Integer.(floor.(mixInf.srcCel[dirItr] / 2))
end
end
# Green function range
modRng[dirItr,divItr + 1] = begInd:1:endInd
# vector range
if revSwt[dirItr] == 0
vecRng[dirItr,divItr + 1] = 1:1:(1 + endInd - begInd)
else
vecRng[dirItr,divItr + 1] =
brnSze[dirItr]:-1:(brnSze[dirItr] - endInd + begInd)
end
# sign symmetry for Green function multiplication
symSgn[dirItr, divItr + 1] = 1.0 - 2.0 * revSwt[dirItr]
end
end
# check that range is not empty
if !isempty(CartesianIndices(tuple(modRng[:,divItr + 1]...)))
# number of elements
copyto!(view(dimInfDev, :, divItr + 1),
getproperty.(modRng[:, divItr + 1], :stop) .-
getproperty.(modRng[:, divItr + 1], :start) .+ 1)
# symmetry information
copyto!(view(dirSymDev, :, divItr + 1),
eltype(dirSymDev).([symSgn[1,divItr + 1] *
symSgn[2,divItr + 1], symSgn[1,divItr + 1] *
symSgn[3,divItr + 1], symSgn[2,divItr + 1] *
symSgn[3,divItr + 1]]))
# launch kernel
@cuda threads=cmpInf.numTrd blocks=cmpInf.numBlk mulKerDev!(
view(dimInfDev, :, divItr + 1),
view(dirSymDev, :, divItr + 1),
view(prdVec, vecRng[:,divItr + 1]..., :),
view(vecMod, modRng[:,divItr + 1]..., :),
view(orgVec, vecRng[:,divItr + 1]..., :))
end
end
end
# synchronize
CUDA.synchronize(CUDA.stream())
CUDA.unsafe_free!(dimInfDev)
CUDA.unsafe_free!(dirSymDev)
CUDA.synchronize(CUDA.stream())
return nothing
end
#=
host kernel for mulBrn!
=#
function mulKerHst!(dimInf::AbstractArray{<:Integer},
dirSym::AbstractArray{<:Real}, prdVec::AbstractArray{T,4},
vecMod::AbstractArray{T,4}, orgVec::AbstractArray{T,4},)::Nothing where
T<:Union{ComplexF64,ComplexF32}
@threads for itr ∈ CartesianIndices((1:dimInf[1], 1:dimInf[2],
1:dimInf[3]))
# vecMod follows ii, jj, kk, ij, ik, jk storage format
@inbounds prdVec[itr,1] += vecMod[itr,1] * orgVec[itr,1] +
dirSym[1] * vecMod[itr,4] * orgVec[itr,2] +
dirSym[2] * vecMod[itr,5] * orgVec[itr,3]
# j vector direction
@inbounds prdVec[itr,2] += dirSym[1] * vecMod[itr,4] * orgVec[itr,1] +
vecMod[itr,2] * orgVec[itr,2] +
dirSym[3] * vecMod[itr,6] * orgVec[itr,3]
# k vector direction
@inbounds prdVec[itr,3] += dirSym[2] * vecMod[itr,5] * orgVec[itr,1] +
dirSym[3] * vecMod[itr,6] * orgVec[itr,2] +
vecMod[itr,3] * orgVec[itr,3]
end
end
#=
device kernel for mulBrn!
=#
function mulKerDev!(dimInf::AbstractVector{<:Integer},
dirSym::AbstractVector{<:Real}, prdVec::AbstractArray{T,4},
vecMod::AbstractArray{T,4}, orgVec::AbstractArray{T,4})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (blockIdx().z - 0x1) * blockDim().z
# multiplication loops
@inbounds for itrZ = idZ:strZ:dimInf[3], itrY = idY:strY:dimInf[2],
itrX = idX:strX:dimInf[1]
# vecMod follows ii, jj, kk, ij, ik, jk storage format
prdVec[itrX,itrY,itrZ,1] += vecMod[itrX,itrY,itrZ,1] *
orgVec[itrX,itrY,itrZ,1] +
dirSym[1] * vecMod[itrX,itrY,itrZ,4] * orgVec[itrX,itrY,itrZ,2] +
dirSym[2] * vecMod[itrX,itrY,itrZ,5] * orgVec[itrX,itrY,itrZ,3]
# j vector direction
prdVec[itrX,itrY,itrZ,2] += dirSym[1] * vecMod[itrX,itrY,itrZ,4] *
orgVec[itrX,itrY,itrZ,1] +
vecMod[itrX,itrY,itrZ,2] * orgVec[itrX,itrY,itrZ,2] +
dirSym[3] * vecMod[itrX,itrY,itrZ,6] * orgVec[itrX,itrY,itrZ,3]
# k vector direction
prdVec[itrX,itrY,itrZ,3] += dirSym[2] * vecMod[itrX,itrY,itrZ,5] *
orgVec[itrX,itrY,itrZ,1] +
dirSym[3] * vecMod[itrX,itrY,itrZ,6] * orgVec[itrX,itrY,itrZ,2] +
vecMod[itrX,itrY,itrZ,3] * orgVec[itrX,itrY,itrZ,3]
end
return nothing
end
#=
merge partitions and return output vector
=#
function mrgPrtHst(mixInf::GlaExtInf, cmpInf::GlaKerOpt, parNum::Integer,
prtVec::AbstractArray{T,5})::AbstractArray{T,4} where
T<:Union{ComplexF64,ComplexF32}
# restructure partitioned vector
mrgVec = Array{eltype(prtVec)}(undef, (mixInf.trgDiv .*
mixInf.trgCel)..., 3)
# break into partitions
@threads for itr ∈ CartesianIndices(prtVec)
# copy partition data
@inbounds mrgVec[CartesianIndex((Tuple(itr)[1:3] .- (1,1,1)) .*
mixInf.trgDiv) + CartesianIndex(1,1,1) +
mixInf.trgPar[itr[5]], itr[4]] = prtVec[itr]
end
return mrgVec
end
#=
device code separated to clarify functionality and type inference
=#
function mrgPrtDev(mixInf::GlaExtInf, cmpInf::GlaKerOpt, parNum::Integer,
prtVec::AbstractArray{T,5})::AbstractArray{T,4} where
T<:Union{ComplexF64,ComplexF32}
# restructure partitioned vector
mrgVec = CuArray{eltype(prtVec)}(undef,
(mixInf.trgDiv .* mixInf.trgCel)..., 3)
CUDA.synchronize(CUDA.stream())
# perform partitioning
for parItr ∈ eachindex(1:parNum)
for dirItr ∈ eachindex(1:3)
@cuda threads=cmpInf.numTrd blocks=cmpInf.numBlk mrgPrtKer!(
size(prtVec)[1:3]..., mixInf.trgDiv...,
Tuple(mixInf.trgPar[parItr])..., dirItr, parItr, mrgVec,
prtVec)
end
end
# release active vector to reduce memory pressure
CUDA.synchronize(CUDA.stream())
CUDA.unsafe_free!(prtVec)
CUDA.synchronize(CUDA.stream())
return mrgVec
end
#=
device kernel to merge target vector partitions
=#
function mrgPrtKer!(maxX::Integer, maxY::Integer, maxZ::Integer,
stpX::Integer, stpY::Integer, stpZ::Integer,
offX::Integer, offY::Integer, offZ::Integer,
dirItr::Integer, parItr::Integer,
mrgVec::AbstractArray{T,4}, prtVec::AbstractArray{T,5})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# grid strides
strX = gridDim().x * blockDim().x
strY = gridDim().y * blockDim().y
strZ = gridDim().z * blockDim().z
# thread indices
idX = threadIdx().x + (blockIdx().x - 0x1) * blockDim().x
idY = threadIdx().y + (blockIdx().y - 0x1) * blockDim().y
idZ = threadIdx().z + (blockIdx().z - 0x1) * blockDim().z
# copy partition data
@inbounds for itrZ = idZ:strZ:maxZ, itrY = idY:strY:maxY,
itrX = idX:strX:maxX
mrgVec[(itrX - 1) * stpX + offX + 1, (itrY - 1) * stpY + offY + 1,
(itrZ - 1) * stpZ + offZ + 1, dirItr] =
prtVec[itrX,itrY,itrZ,dirItr,parItr]
end
return nothing
end
#=
binary branch indexing
=#
@inline function nxtBrnId(maxLvl::Integer, lvl::Integer, bId::Integer)::Integer
return bId + ^(2, maxLvl - (lvl + 1))
end | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 24817 | # settings for cubature integral evaluation: relative tolerance and absolute
# tolerance
const cubRelTol = 1e-6;
# const cubRelTol = 1e-3;
const cubAbsTol = 1e-9;
# const cubAbsTol = 1e-3;
# tolerance for cell contact
const cntTol = 1e-8;
"""
genEgoExt!(egoCrcExt::AbstractArray{T,5}, trgVol::GlaVol,
srcVol::GlaVol, cmpInf::GlaKerOpt)::Nothing where
T<:Union{ComplexF64,ComplexF32}
Calculate circulant vector for the Green function between a target volume,
trgVol, and source volume, srcVol.
"""
function genEgoExt!(egoCrcExt::AbstractArray{T,5}, trgVol::GlaVol,
srcVol::GlaVol, cmpInf::GlaKerOpt)::Nothing where
T<:Union{ComplexF64,ComplexF32}
facLst = facPar()
trgFac = Float64.(cubFac(trgVol.scl))
srcFac = Float64.(cubFac(srcVol.scl))
sepGrdTrg = sepGrd(trgVol, srcVol, 0)
sepGrdSrc = sepGrd(trgVol, srcVol, 1)
# calculate Green function values
genEgoCrcExt!(egoCrcExt, trgVol, srcVol, sepGrdTrg, sepGrdSrc, trgFac,
srcFac, facLst, cmpInf)
return nothing
end
"""
genEgoSlf!(egoCrc::Array{ComplexF64}, slfVol::GlaVol,
cmpInf::GlaKerOpt)::Nothing
Calculate circulant vector of the Green function on a single domain.
"""
function genEgoSlf!(egoCrcSlf::AbstractArray{T,5}, slfVol::GlaVol,
cmpInf::GlaKerOpt)::Nothing where T<:Union{ComplexF64,ComplexF32}
facLst = facPar()
trgFac = Float64.(cubFac(slfVol.scl))
srcFac = Float64.(cubFac(slfVol.scl))
srcGrd = sepGrd(slfVol, slfVol, 0)
# calculate Green function values
genEgoCrcSlf!(slfVol, egoCrcSlf, srcGrd, trgFac, srcFac, facLst, cmpInf)
return nothing
end
#=
Generate the circulant vector of the Green function between a pair of distinct
domains, checking for possible domain contact. For the procedure to function
correctly, whenever the domains are in contact, the ratio of scales between the
source and target volumes must all be integers, and cell corners must match up.
=#
function genEgoCrcExt!(egoCrcExt::AbstractArray{T,5},
trgVol::GlaVol, srcVol::GlaVol, sepGrdTrg::Array{<:StepRange,1},
sepGrdSrc::Array{<:StepRange,1}, trgFac::Array{<:Number,3},
srcFac::Array{<:Number,3}, facPar::Array{<:Integer,2},
cmpInf::GlaKerOpt)::Nothing where T<:Union{ComplexF64,ComplexF32}
## calculate domain separation
# grid scales of source and target volumes
srcGrdScl = getproperty.(srcVol.grd, :step)
trgGrdScl = getproperty.(trgVol.grd, :step)
# upper and lower edges of the source volume
srcEdg = (getproperty.(srcVol.grd, :start) .- (srcVol.scl .//2),
getproperty.(srcVol.grd, :stop) .+ (srcVol.scl .//2))
# upper and lower edges of the target volume
trgEdg = (getproperty.(trgVol.grd, :start) .- (trgVol.scl .//2),
getproperty.(trgVol.grd, :stop) .+ (trgVol.scl .//2))
# check for volume coincidence
cinChk = prod((srcEdg[1] .<= trgEdg[1]) .* (trgEdg[1] .<= srcEdg[2])) ||
prod((srcEdg[1] .<= trgEdg[2]) .* (trgEdg[2] .<= srcEdg[2]))
# check for volume overlap
ovrChk = sum((srcEdg[1] .< trgEdg[1]) .* (trgEdg[1] .< srcEdg[2])) +
sum((srcEdg[1] .< trgEdg[2]) .* (trgEdg[2] .< srcEdg[2]))
if cinChk
if ovrChk > 0
error("Source and target volumes are overlapping.")
end
# generate self Green function for contact cells
cntVol = genCntVol(trgVol, srcVol)
egoCrcCnt = Array{eltype(egoCrcExt)}(undef, 3, 3, (2 .* cntVol.cel)...)
genEgoSlf!(egoCrcCnt, cntVol, cmpInf)
# pull values for cells in contact
@threads for posItr ∈ CartesianIndices(egoCrcExt[1,1,:,:,:])
egoFunExtCnt!(cntVol, view(egoCrcExt, :, :, posItr), egoCrcCnt,
posItr, trgVol.cel, sepGrdTrg, sepGrdSrc, trgVol.scl,
srcVol.scl, trgFac, srcFac, facPar, cmpInf)
end
else
@threads for posItr ∈ CartesianIndices(egoCrcExt[1,1,:,:,:])
egoFunExt!(view(egoCrcExt, :, :, posItr), posItr, trgVol.cel,
sepGrdTrg, sepGrdSrc, trgVol.scl, srcVol.scl, trgFac, srcFac,
facPar, cmpInf)
end
end
return nothing
end
#=
Generate circulant vector for self Green function.
=#
function genEgoCrcSlf!(slfVol::GlaVol, egoCrc::AbstractArray{T,5},
srcGrd::Array{<:StepRange,1}, trgFac::Array{<:AbstractFloat,3},
srcFac::Array{<:AbstractFloat,3}, facPar::Array{<:Integer,2},
cmpInf::GlaKerOpt)::Nothing where T<:Union{ComplexF64,ComplexF32}
# allocate intermediate storage for Toeplitz interaction vector
egoToe = Array{eltype(egoCrc)}(undef, 3, 3, slfVol.cel...)
# write Green function, ignoring weakly singular integrals
@threads for crtItr ∈ CartesianIndices(egoToe[1,1,:,:,:])
@inbounds egoFunInn!(egoToe, crtItr, srcGrd, slfVol.scl, trgFac,
srcFac, facPar, cmpInf)
end
# Gauss-Legendre quadrature
glQud = gauQud(cmpInf.intOrd)
# correction values for singular integrals
# return order of normal faces is xx yy zz
wS = (^(prod(slfVol.scl), -1) .* wekS(slfVol.scl, glQud, cmpInf))
# return order of normal faces is xxY xxZ yyX yyZ zzX zzY xy xz yz
wE = (^(prod(slfVol.scl), -1) .* wekE(slfVol.scl, glQud, cmpInf))
# return order of normal faces is xx yy zz xy xz yz
wV = (^(prod(slfVol.scl), -1) .* wekV(slfVol.scl, glQud, cmpInf))
# correct singular integrals for coincident and adjacent cells
for posItr ∈ CartesianIndices(ntuple(itr -> min(slfVol.cel[itr], 2), 3))
egoFunSng!(view(egoToe, :, :, posItr), posItr, wS, wE, wV,
srcGrd, slfVol, trgFac, srcFac, facPar, cmpInf)
end
# include identity component
egoToe[1,1,1,1,1] -= 1 / (cmpInf.frqPhz^2)
egoToe[2,2,1,1,1] -= 1 / (cmpInf.frqPhz^2)
egoToe[3,3,1,1,1] -= 1 / (cmpInf.frqPhz^2)
# embed self Toeplitz vector into a circulant vector
@threads for crtItr ∈ CartesianIndices(egoCrc[1,1,:,:,:])
@inbounds egoToeCrc!(view(egoCrc, :, :, crtItr), egoToe, crtItr,
div.(size(egoCrc)[3:5], 2))
end
return nothing
end
#=
Generate circulant self Green function from Toeplitz self Green function. The
implemented mask takes into account the relative flip in the assumed dipole
direction under a coordinate reflection.
=#
function egoToeCrc!(egoCrc::AbstractArray{T,2}, egoToe::AbstractArray{T,5},
posInd::CartesianIndex{3}, indSpt::Tuple{Vararg{Integer}})::Nothing where
T<:Union{ComplexF64,ComplexF32}
if posInd[1] == (indSpt[1] + 1) || posInd[2] == (indSpt[2] + 1) ||
posInd[3] == (indSpt[3] + 1)
egoCrc[:,:] .= zeros(eltype(egoCrc), 3, 3)
else
# flip field under coordinate reflection
fi = indFlp(posInd[1], indSpt[1])
fj = indFlp(posInd[2], indSpt[2])
fk = indFlp(posInd[3], indSpt[3])
# embedding
egoCrc[:,:] .= view(egoToe, :, :,
indSel(posInd[1], indSpt[1]), indSel(posInd[2], indSpt[2]),
indSel(posInd[3], indSpt[3])) .*
[1.0 (fi * fj) (fi * fk); (fj * fi) 1.0 (fj * fk);
(fk * fi) (fk * fj) 1.0]
end
return nothing
end
#=
Write Green function element for a pair of cubes in distinct domains. Recall
that grids span the separations between a pair of volumes. No field flips are
required when calculating an external Green function.
=#
@inline function egoFunExt!(egoCrcExt::AbstractArray{T,2},
posInd::CartesianIndex{3},
indSpt::Union{Array{<:Integer,1},NTuple{3,Integer}},
sepGrdTrg::Array{<:StepRange,1}, sepGrdSrc::Array{<:StepRange,1},
sclTrg::NTuple{3,Number}, sclSrc::NTuple{3,Number},
trgFac::Array{<:Number,3}, srcFac::Array{<:AbstractFloat,3},
facPar::Array{<:Integer,2}, cmpInf::GlaKerOpt)::Nothing where
T<:Union{ComplexF64,ComplexF32}
if posInd[1] == (indSpt[1] + 1) || posInd[2] == (indSpt[2] + 1) ||
posInd[3] == (indSpt[3] + 1)
egoCrcExt[:,:] .= zeros(eltype(egoCrcExt), 3, 3)
else
egoFunOut!(egoCrcExt, [grdSel(posInd[1], indSpt[1], 1,
sepGrdTrg, sepGrdSrc), grdSel(posInd[2], indSpt[2], 2,
sepGrdTrg, sepGrdSrc), grdSel(posInd[3], indSpt[3], 3,
sepGrdTrg, sepGrdSrc)], sclTrg, sclSrc, trgFac, srcFac, facPar,
cmpInf)
end
return nothing
end
#=
Write Green element for a pair of cubes in distinct domains, checking for the
possibility of contact. Separation grids span the separations between the pair
of volumes. No field flip is required for external Green function.
=#
function egoFunExtCnt!(cntVol::GlaVol, egoCrc::AbstractArray{T,2},
egoCrcCnt::AbstractArray{T,5}, posInd::CartesianIndex{3},
indSpt::NTuple{3,Integer}, sepGrdTrg::Array{<:StepRange,1},
sepGrdSrc::Array{<:StepRange,1}, sclTrg::NTuple{3,Number},
sclSrc::NTuple{3,Number}, trgFac::Array{<:AbstractFloat,3},
srcFac::Array{<:AbstractFloat,3}, facPar::Array{<:Integer,2},
cmpInf::GlaKerOpt)::Nothing where T<:Union{ComplexF64,ComplexF32}
# separation vector
sepVec = [grdSel(posInd[1], indSpt[1], 1, sepGrdTrg, sepGrdSrc),
grdSel(posInd[2], indSpt[2], 2, sepGrdTrg, sepGrdSrc),
grdSel(posInd[3], indSpt[3], 3, sepGrdTrg, sepGrdSrc)]
# absolute separation
absSep = abs.(sepVec)
# branch between contact and non-contact cases
# contact case
if prod(absSep .< (ones(3) .* cntTol .+ ((sclTrg .+ sclSrc) ./ 2.0)))
if posInd[1] == (indSpt[1] + 1) || posInd[2] == (indSpt[2] + 1) ||
posInd[3] == (indSpt[3] + 1)
egoCrc[:,:] .= zeros(eltype(egoCrc), 3, 3)
else
egoCntOut!(cntVol, egoCrcCnt, egoCrc, posInd, sclTrg, sclSrc,
sepVec)
end
# non-contact case
else
if posInd[1] == (indSpt[1] + 1) || posInd[2] == (indSpt[2] + 1) ||
posInd[3] == (indSpt[3] + 1)
egoCrc[:,:] .= zeros(eltype(egoCrc), 3, 3)
else
egoFunOut!(egoCrc, sepVec, sclTrg, sclSrc, trgFac,
srcFac, facPar, cmpInf)
end
end
return nothing
end
#=
General external Green function interaction element.
=#
function egoFunOut!(egoCrc::AbstractArray{T,2}, grd::Array{<:AbstractFloat,1},
sclTrg::NTuple{3,Number}, sclSrc::NTuple{3,Number},
trgFac::Array{<:AbstractFloat,3}, srcFac::Array{<:AbstractFloat,3},
facPar::Array{<:Integer,2}, cmpInf::GlaKerOpt)::Nothing where
T<:Union{ComplexF64,ComplexF32}
srfMat = zeros(eltype(egoCrc), 36)
# calculate interaction contributions between all cube faces
egoSrfAdp!(grd[1], grd[2], grd[3], srfMat, trgFac, srcFac, 1:36,
facPar, srfScl(sclTrg, sclSrc), cmpInf)
# sum contributions depending on source and target current orientation
srfSum!(egoCrc, srfMat)
return nothing
end
#=
Compute Green function element for cells in contact.
=#
function egoCntOut!(cntVol::GlaVol, egoCrcCnt::Array{T,5},
egoCrc::AbstractArray{T,2}, posInd::CartesianIndex{3},
sclTrg::NTuple{3,Number}, sclSrc::NTuple{3,Number},
sepVec::Array{<:AbstractFloat,1})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# safety zero local section of the Green function
egoCrc[:,:] .= zeros(ComplexF64, 3, 3)
# contact cell locations
srcCellLocs = [[1,1,1],
[Int(sclSrc[dir] / cntVol.scl[dir]) for dir ∈ 1:3]]
trgCellSpan = [Int(sclTrg[dir] / cntVol.scl[dir]) for dir ∈ 1:3]
trgCellLocs = [[1,1,1], [1,1,1]]
sepCellSpan = [sepVec[dir] / Float64(cntVol.scl[dir]) for dir ∈ 1:3]
# positions of target cells
# lower cell boundaries
trgCellLocs[1] = Int.(round.(sepCellSpan + (srcCellLocs[2] ./ 2.0) -
(trgCellSpan ./ 2.0))) + [1,1,1]
# upper cell boundaries
trgCellLocs[2] = Int.(round.(sepCellSpan + (srcCellLocs[2] ./ 2.0) +
(trgCellSpan ./ 2.0)))
# shift cell locations into contact volume
for dir ∈ 1:3
if trgCellLocs[1][dir] < 1
# must update target cell lower bound last
for ind ∈ 1:2
srcCellLocs[ind][dir] = srcCellLocs[ind][dir] +
abs(trgCellLocs[1][dir]) + 1
end
# target cells
for ind ∈ 2:-1:1
trgCellLocs[ind][dir] = trgCellLocs[ind][dir] +
abs(trgCellLocs[1][dir]) + 1
end
end
end
# loop over contact cells
for indSrc ∈ CartesianIndices((srcCellLocs[1][1]:srcCellLocs[2][1],
srcCellLocs[1][2]:srcCellLocs[2][2],
srcCellLocs[1][3]:srcCellLocs[2][3]))
for indTrg ∈ CartesianIndices((trgCellLocs[1][1]:trgCellLocs[2][1],
trgCellLocs[1][2]:trgCellLocs[2][2],
trgCellLocs[1][3]:trgCellLocs[2][3]))
# add result to element calculation
egoCrc[:,:] .+= egoCrcCnt[:,:,
crcIndClc(cntVol, indTrg, indSrc)]
end
end
totTrgCells = (trgCellLocs[2][3] - trgCellLocs[1][3] + 1) *
(trgCellLocs[2][2] - trgCellLocs[1][2] + 1) *
(trgCellLocs[2][1] - trgCellLocs[1][1] + 1)
egoCrc[:,:] .= egoCrc[:,:] ./ totTrgCells
return nothing
end
#=
Create contact volume for self Green function calculations.
=#
function genCntVol(trgVol::GlaVol, srcVol::GlaVol)::GlaVol
# scale for greatest common division of source and target cells
cntScl = min.(trgVol.scl, srcVol.scl)
# divisions of target and source cells
trgDiv = Integer.(trgVol.scl ./ cntScl)
srcDiv = Integer.(srcVol.scl ./ cntScl)
# create padded self interaction domain for simplification of code
cntCel = (trgDiv[1] + srcDiv[1], trgDiv[2] + srcDiv[2],
trgDiv[3] + srcDiv[3])
return GlaVol(cntCel, cntScl, (0//1, 0//1, 0//1))
end
#=
General self Green function interaction element.
=#
function egoFunInn!(egoToe::AbstractArray{T,5}, posInd::CartesianIndex{3},
srcGrd::Array{<:StepRange,1}, scl::NTuple{3,Number},
trgFac::Array{<:AbstractFloat,3}, srcFac::Array{<:AbstractFloat,3},
facPar::Array{<:Integer,2}, cmpInf::GlaKerOpt)::Nothing where
T<:Union{ComplexF64,ComplexF32}
srfMat = zeros(eltype(egoToe), 36)
# calculate interaction contributions between all cube faces
if (posInd[1] > 2) || (posInd[2] > 2) || (posInd[3] > 2)
egoSrfAdp!(Float64(srcGrd[1][posInd[1]]), Float64(srcGrd[2][posInd[2]]),
Float64(srcGrd[3][posInd[3]]), srfMat, trgFac, srcFac, 1:36, facPar,
Float64.(srfScl(scl, scl)), cmpInf)
# add contributions based on source and target current orientation
srfSum!(view(egoToe, :, :, posInd), srfMat)
end
return nothing
end
#=
Calculate Green function elements for adjacent cubes, assumed to be in the same
domain. wS, wE, and wV refer to self-intersecting, edge intersecting, and
vertex intersecting cube face integrals respectively. In the wE and wV cases,
the first value returned is for in-plane faces, and the second value is for
``cornered'' faces.
The convention by which facePairs are generated begins by looping over the
source faces. Because of this choice, the transpose of the mask follows the
standard source to target matrix convention used elsewhere.
=#
function egoFunSng!(egoCrc::AbstractArray{T,2}, posInd::CartesianIndex{3},
wS::Vector{R}, wE::Vector{R}, wV::Vector{R},
srcGrd::Array{<:StepRange,1}, slfVol::GlaVol,
trgFac::Array{<:AbstractFloat,3}, srcFac::Array{<:AbstractFloat,3},
facPar::Array{<:Integer,2}, cmpInf::GlaKerOpt)::Nothing where
{T<:Union{ComplexF64,ComplexF32}, R<:Union{ComplexF64,ComplexF32}}
srfMat = zeros(eltype(egoCrc), 36)
# linear index conversion
linCon = LinearIndices((1:6, 1:6))
# face convention yzL yzU (x-faces) xzL xzU (y-faces) xyL xyU (z-faces)
# index based corrections.
if posInd == CartesianIndex(1, 1, 1)
corVal = [
wS[1] 0.0 wE[7] wE[7] wE[8] wE[8]
0.0 wS[1] wE[7] wE[7] wE[8] wE[8]
wE[7] wE[7] wS[2] 0.0 wE[9] wE[9]
wE[7] wE[7] 0.0 wS[2] wE[9] wE[9]
wE[8] wE[8] wE[9] wE[9] wS[3] 0.0
wE[8] wE[8] wE[9] wE[9] 0.0 wS[3]]
mask =[
1 0 1 1 1 1
0 1 1 1 1 1
1 1 1 0 1 1
1 1 0 1 1 1
1 1 1 1 1 0
1 1 1 1 0 1]
elseif posInd == CartesianIndex(2, 1, 1) && slfVol.scl[1] ==
getproperty(slfVol.grd[1], :step)
corVal = [
0.0 wS[1] wE[7] wE[7] wE[8] wE[8]
0.0 0.0 0.0 0.0 0.0 0.0
0.0 wE[7] wE[3] 0.0 wV[6] wV[6]
0.0 wE[7] 0.0 wE[3] wV[6] wV[6]
0.0 wE[8] wV[6] wV[6] wE[5] 0.0
0.0 wE[8] wV[6] wV[6] 0.0 wE[5]]
mask = [
0 1 1 1 1 1
0 0 0 0 0 0
0 1 1 0 1 1
0 1 0 1 1 1
0 1 1 1 1 0
0 1 1 1 0 1]
elseif posInd == CartesianIndex(2, 1, 2) && slfVol.scl[1] ==
getproperty(slfVol.grd[1], :step) && slfVol.scl[3] ==
getproperty(slfVol.grd[3], :step)
corVal = [
0.0 wE[2] wV[4] wV[4] 0.0 wE[8]
0.0 0.0 0.0 0.0 0.0 0.0
0.0 wV[4] wV[2] 0.0 0.0 wV[6]
0.0 wV[4] 0.0 wV[2] 0.0 wV[6]
0.0 wE[8] wV[6] wV[6] 0.0 wE[5]
0.0 0.0 0.0 0.0 0.0 0.0]
mask = [
0 1 1 1 0 1
0 0 0 0 0 0
0 1 1 0 0 1
0 1 0 1 0 1
0 1 1 1 0 1
0 0 0 0 0 0]
elseif posInd == CartesianIndex(1, 1, 2) && slfVol.scl[3] ==
getproperty(slfVol.grd[3], :step)
corVal = [
wE[2] 0.0 wV[4] wV[4] 0.0 wE[8]
0.0 wE[2] wV[4] wV[4] 0.0 wE[8]
wV[4] wV[4] wE[4] 0.0 0.0 wE[9]
wV[4] wV[4] 0.0 wE[4] 0.0 wE[9]
wE[8] wE[8] wE[9] wE[9] 0.0 wS[3]
0.0 0.0 0.0 0.0 0.0 0.0]
mask = [
1 0 1 1 0 1
0 1 1 1 0 1
1 1 1 0 0 1
1 1 0 1 0 1
1 1 1 1 0 1
0 0 0 0 0 0]
elseif posInd == CartesianIndex(1, 2, 1) && slfVol.scl[2] ==
getproperty(slfVol.grd[2], :step)
corVal = [
wE[1] 0.0 0.0 wE[7] wV[5] wV[5]
0.0 wE[1] 0.0 wE[7] wV[5] wV[5]
wE[7] wE[7] 0.0 wS[2] wE[9] wE[9]
0.0 0.0 0.0 0.0 0.0 0.0
wV[5] wV[5] 0.0 wE[9] wE[6] 0.0
wV[5] wV[5] 0.0 wE[9] 0.0 wE[6]]
mask = [
1 0 0 1 1 1
0 1 0 1 1 1
1 1 0 1 1 1
0 0 0 0 0 0
1 1 0 1 1 0
1 1 0 1 0 1]
elseif posInd == CartesianIndex(2, 2, 1) && slfVol.scl[1] ==
getproperty(slfVol.grd[1], :step) && slfVol.scl[2] ==
getproperty(slfVol.grd[2], :step)
corVal = [
0.0 wE[1] 0.0 wE[7] wV[5] wV[5]
0.0 0.0 0.0 0.0 0.0 0.0
0.0 wE[7] 0.0 wE[3] wV[6] wV[6]
0.0 0.0 0.0 0.0 0.0 0.0
0.0 wV[5] 0.0 wV[6] wV[3] 0.0
0.0 wV[5] 0.0 wV[6] 0.0 wV[3]]
mask = [
0 1 0 1 1 1
0 0 0 0 0 0
0 1 0 1 1 1
0 0 0 0 0 0
0 1 0 1 1 0
0 1 0 1 0 1]
elseif posInd == CartesianIndex(1, 2, 2) && slfVol.scl[2] ==
getproperty(slfVol.grd[2], :step) && slfVol.scl[3] ==
getproperty(slfVol.grd[3], :step)
corVal = [
wV[1] 0.0 0.0 wV[4] 0.0 wV[5]
0.0 wV[1] 0.0 wV[4] 0.0 wV[5]
wV[4] wV[4] 0.0 wE[4] 0.0 wE[9]
0.0 0.0 0.0 0.0 0.0 0.0
wV[5] wV[5] 0.0 wE[9] 0.0 wE[6]
0.0 0.0 0.0 0.0 0.0 0.0]
mask = [
1 0 0 1 0 1
0 1 0 1 0 1
1 1 0 1 0 1
0 0 0 0 0 0
1 1 0 1 0 1
0 0 0 0 0 0]
elseif posInd == CartesianIndex(2, 2, 2) && slfVol.scl[1] ==
getproperty(slfVol.grd[1], :step) && slfVol.scl[2] ==
getproperty(slfVol.grd[2], :step) && slfVol.scl[3] ==
getproperty(slfVol.grd[3], :step)
corVal = [
0.0 wV[1] 0.0 wV[4] 0.0 wV[5]
0.0 0.0 0.0 0.0 0.0 0.0
0.0 wV[4] 0.0 wV[2] 0.0 wV[6]
0.0 0.0 0.0 0.0 0.0 0.0
0.0 wV[5] 0.0 wV[6] 0.0 wV[3]
0.0 0.0 0.0 0.0 0.0 0.0]
mask = [
0 1 0 1 0 1
0 0 0 0 0 0
0 1 0 1 0 1
0 0 0 0 0 0
0 1 0 1 0 1
0 0 0 0 0 0]
else
println("empty case selected.")
corVal = [
0.0 0.0 0.0 0.0 0.0 0.0
0.0 0.0 0.0 0.0 0.0 0.0
0.0 0.0 0.0 0.0 0.0 0.0
0.0 0.0 0.0 0.0 0.0 0.0
0.0 0.0 0.0 0.0 0.0 0.0
0.0 0.0 0.0 0.0 0.0 0.0]
mask = [
0 0 0 0 0 0
0 0 0 0 0 0
0 0 0 0 0 0
0 0 0 0 0 0
0 0 0 0 0 0
0 0 0 0 0 0]
end
# include uncorrected surface integrals
pairListUn = linCon[findall(iszero, transpose(mask))]
egoSrfAdp!(Float64(srcGrd[1][posInd[1]]), Float64(srcGrd[2][posInd[2]]),
Float64(srcGrd[3][posInd[3]]), srfMat, trgFac, srcFac, pairListUn,
facPar, Float64.(srfScl(slfVol.scl, slfVol.scl)), cmpInf)
# correct values of srfMat where needed
for fp ∈ 1:36
if mask[facPar[fp,1], facPar[fp,2]] == 1
srfMat[fp] = corVal[facPar[fp,1], facPar[fp,2]]
end
end
# overwrite problematic elements of Green function matrix
srfSum!(egoCrc, srfMat)
return nothing
end
#=
Update egoCrc to hold Green function interactions. The storage format of egoCrc
is [[ii, ji, ki]^{T}; [ij, jj, kj]^{T}; [ik, jk, kk]^{T}].
See documentation for explanation.
=#
function srfSum!(egoCrc::AbstractArray{T,2}, srfMat::Array{T,1})::Nothing where
T<:Union{ComplexF64,ComplexF32}
# ii
egoCrc[1,1] = srfMat[15] - srfMat[16] - srfMat[21] +
srfMat[22] + srfMat[29] - srfMat[30] - srfMat[35] + srfMat[36]
# ji
egoCrc[2,1] = - srfMat[13] + srfMat[14] + srfMat[19] - srfMat[20]
# ki
egoCrc[3,1] = - srfMat[25] + srfMat[26] + srfMat[31] - srfMat[32]
# ij
egoCrc[1,2] = - srfMat[3] + srfMat[4] + srfMat[9] - srfMat[10]
# jj
egoCrc[2,2] = srfMat[1] - srfMat[2] - srfMat[7] + srfMat[8] +
srfMat[29] - srfMat[30] - srfMat[35] + srfMat[36]
# kj
egoCrc[3,2] = - srfMat[27] + srfMat[28] + srfMat[33] - srfMat[34]
# ik
egoCrc[1,3] = - srfMat[5] + srfMat[6] + srfMat[11] - srfMat[12]
# jk
egoCrc[2,3] = - srfMat[17] + srfMat[18] + srfMat[23] - srfMat[24]
# kk
egoCrc[3,3] = srfMat[1] - srfMat[2] - srfMat[7] + srfMat[8] +
srfMat[15] - srfMat[16] - srfMat[21] + srfMat[22]
return nothing
end
#=
Adaptive integration of the Green function over face pairs.
=#
function egoSrfAdp!(grdX::AbstractFloat, grdY::AbstractFloat,
grdZ::AbstractFloat, srfMat::Array{T,1},
trgFac::Array{<:AbstractFloat,3}, srcFac::Array{<:AbstractFloat,3},
pairList::Union{UnitRange{<:Integer},Array{<:Integer,1}},
facPar::Array{<:Integer,2}, srfScales::Array{<:AbstractFloat,1},
cmpInf::GlaKerOpt)::Nothing where T<:Union{ComplexF64,ComplexF32}
# container for intermediate integral evaluation
intVal = [0.0,0.0]
@inbounds for fp ∈ pairList
srfMat[fp] = 0.0 + 0.0im
# define integration kernel
intKer = (ordVec::Array{<:AbstractFloat,1},
vals::Array{<:AbstractFloat,1}) -> srfKer(ordVec, vals, grdX, grdY,
grdZ, fp, trgFac, srcFac, facPar, cmpInf)
# surface integration
intVal[:] = hcubature(2, intKer, [0.0,0.0,0.0,0.0],
[1.0,1.0,1.0,1.0], reltol = cubRelTol, abstol = cubAbsTol,
maxevals = 0, error_norm = Cubature.INDIVIDUAL)[1];
srfMat[fp] = intVal[1] + im * intVal[2]
# scaling correction
srfMat[fp] *= srfScales[fp]
end
return nothing
end
#=
Integration kernel for Green function surface integrals.
=#
function srfKer(ordVec::Array{<:AbstractFloat,1}, vals::Array{<:AbstractFloat,1},
grdX::AbstractFloat, grdY::AbstractFloat, grdZ::AbstractFloat, fp::Integer,
trgFac::Array{<:AbstractFloat,3}, srcFac::Array{<:AbstractFloat,3},
facPar::Array{<:Integer,2}, cmpInf::GlaKerOpt)::Nothing
# value of scalar Green function
z = sclEgo(dstMag(
cubVecAltAdp(1, ordVec, fp, trgFac, srcFac, facPar) + grdX,
cubVecAltAdp(2, ordVec, fp, trgFac, srcFac, facPar) + grdY,
cubVecAltAdp(3, ordVec, fp, trgFac, srcFac, facPar) + grdZ),
cmpInf.frqPhz)
vals[:] = [real(z),imag(z)]
return nothing
end
#=
Create grid of spanning separations for a pair of volumes. The flipped
separation grid is used when generating the circulant vector.
=#
function sepGrd(trgVol::GlaVol, srcVol::GlaVol,
flip::Integer)::Array{<:StepRange,1}
# grid over the source volume
if flip == 1
sep = getproperty.(srcVol.grd, :step)
str = getproperty.(trgVol.grd, :start) .-
getproperty.(srcVol.grd, :stop)
stp = getproperty.(trgVol.grd, :start) .-
getproperty.(srcVol.grd, :start)
# grid over the target volume
else
sep = getproperty.(trgVol.grd, :step)
str = getproperty.(trgVol.grd, :start) .-
getproperty.(srcVol.grd, :start)
stp = getproperty.(trgVol.grd, :stop) .-
getproperty.(srcVol.grd, :start)
end
# match step to separation orientation
for dir ∈ 1:3
if stp[dir] < str[dir]
sep[dir] *= -1
end
end
return map(StepRange, str, sep, stp)
end
#=
Return the separation between two elements from circulant embedding indices and
domain grids.
=#
@inline function grdSel(ind::Integer, indSpt::Integer, dir::Integer,
trgGrd::Array{<:StepRange,1}, srcGrd::Array{<:StepRange,1})::Float64
if ind <= indSpt
return Float64(trgGrd[dir][ind])
else
if ind > (1 + indSpt)
ind -= 1
end
return Float64(srcGrd[dir][ind - indSpt])
end
end
#=
Return a reference index relative to the embedding index of the Green function.
=#
@inline function indSel(posInd::T, indSpt::R)::CartesianIndex where
{T<:Union{CartesianIndex, Tuple{Vararg{Integer}}, Integer},
R<:Union{CartesianIndex, Tuple{Vararg{Integer}}, Integer}}
return CartesianIndex(map((x, y) -> x <= y ? x :
(x == y + 1 ? 2 * y - x + 1 : 2 * y - x + 2),
Tuple(posInd), Tuple(indSpt)))
end
#=
Flip dipole direction based on index values.
=#
@inline function indFlp(posInd::Integer, indSpt::Integer)::Float64
return posInd <= indSpt ? 1.0 : -1.0
end
#=
Calculate circulant index for self Green function vector
=#
@inline function crcIndClc(cntVol::GlaVol, trgInd::CartesianIndex{3},
srcInd::CartesianIndex{3})::CartesianIndex{3}
# separation in terms of cells
cellInd = trgInd - srcInd
# cellInd[dir] is always added because the value is negative if true
return cellInd + CartesianIndex(ntuple(itr -> (cellInd[itr] < 0) * 2 *
cntVol.cel[itr] + 1, 3))
end
#=
Returns locations and weights for 1D Gauss-Legendre quadrature. Order must be
an integer between 1 and 64. The first column of the returned array is
positions, on the interval [-1,1], the second column contains the associated
weights.
Options:
gausschebyshev(), gausslegendre(), gaussjacobi(), gaussradau(), gausslobatto(),
gausslaguerre(), gausshermite()
=#
function gauQud(ord::Int64)::Array{Float64,2}
pos, val = gausslegendre(ord)
return [pos ;; val]
end | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 20744 | #=
Conventions for the values returned by the weak functions. Small letters
correspond to normal face directions; capital letters correspond to grid
increment directions.
Self xx yy zz
1 2 3
Edge xxY xxZ yyX yyZ zzX zzY xy xz yz
1 2 3 4 5 6 7 8 9
Vertex xx yy zz xy xz yz
1 2 3 4 5 6
GilaWInt contains all necessary support functions for numerical integration of
the electromagnetic Green function. This code is translated from DIRECTFN_E by
Athanasios Polimeridis, and is distributed under the GNU LGPL.
Author: Sean Molesky
Reference: Polimeridis AG, Vipiana F, Mosig JR, Wilton DR.
DIRECTFN: Fully numerical algorithms for high precision computation of singular
integrals in Galerkin SIE methods.
IEEE Transactions on Antennas and Propagation. 2013; 61(6):3112-22.
In what follows the word weak is used in reference to the fact that the scalar
Green function surface integral is weakly singular: the integrand exhibits a
singularity proportional to the inverse of the separation distance. The letters
S, E and V refer, respectively, to integration over self-adjacent triangles,
edge-adjacent triangles, and vertex-adjacent triangles.
The article cited above contains useful error comparison plots for the number
evaluation points considered.
=#
const π = 3.1415926535897932384626433832795028841971693993751058209749445923
#=
Returns the scalar (Helmholtz) Green function. The separation dstMag is assumed
to be scaled by wavelength.
=#
@inline function sclEgo(dstMag::AbstractFloat, frqPhz::T)::ComplexF64 where
T<:Union{ComplexF64,ComplexF32}
return exp(2im * π * dstMag * frqPhz) / (4 * π * dstMag * frqPhz^2)
end
#=
Returns the scalar (Helmholtz) Green function with the singularity removed. The
separation distance dstMag is assumed to be scaled by the wavelength. The
function is used in the included glaIntSup.jl code to improve the convergence of
all weakly singular integrals.
=#
@inline function sclEgoN(dstMag::AbstractFloat, frqPhz::T)::ComplexF64 where
T<:Union{ComplexF64,ComplexF32}
if dstMag > 1e-7
return (exp(2im * π * dstMag * frqPhz) - 1) /
(4 * π * dstMag * frqPhz^2)
else
return ((im / frqPhz) - π * dstMag) / 2
end
end
#=
Returns the three dimensional Euclidean norm of a vector.
=#
@inline function dstMag(v1::AbstractFloat, v2::AbstractFloat,
v3::AbstractFloat)::Float64
return sqrt(v1^2 + v2^2 + v3^2)
end
#=
Head function for integration over coincident square panels. The scl vector
contains the characteristic lengths of a cuboid voxel relative to the
wavelength. glQud1 is an array of Gauss-Legendre quadrature weights and
positions. The cmpInf parameter determines the level of precision used for
integral calculations. Namely, cmpInf.intOrd is used internally in all
weakly singular integral computations.
=#
function wekS(scl::NTuple{3,Number}, glQud1::Array{<:AbstractFloat,2},
cmpInf::GlaKerOpt)::Array{ComplexF64,1}
grdPts = Array{Float64}(undef, 3, 18)
# weak self integrals for the three characteristic faces of a cuboid
# dir = 1 -> xy face (z-nrm) dir = 2 -> xz face (y-nrm)
# dir = 3 -> yz face (x-nrm)
return [wekSDir(3, scl, grdPts, glQud1, cmpInf) +
rSrfSlf(Float64(scl[2]), Float64(scl[3]), cmpInf);
wekSDir(2, scl, grdPts, glQud1, cmpInf) +
rSrfSlf(Float64(scl[1]), Float64(scl[3]), cmpInf);
wekSDir(1, scl, grdPts, glQud1, cmpInf) +
rSrfSlf(Float64(scl[1]), Float64(scl[2]), cmpInf)]
end
#=
Weak self-integral of a particular face.
=#
function wekSDir(dir::Integer, scl::NTuple{3,Number},
grdPts::Array{<:AbstractFloat,2}, glQud1::Array{<:AbstractFloat,2},
cmpInf::GlaKerOpt)::ComplexF64
wekGrdPts!(dir, scl, grdPts)
return (((
wekSInt(hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5]), glQud1,
cmpInf) +
wekSInt(hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4]), glQud1,
cmpInf) +
wekEInt(hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,1], grdPts[:,5], grdPts[:,4]), glQud1,
cmpInf) +
wekEInt(hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,1], grdPts[:,2], grdPts[:,5]), glQud1,
cmpInf)) + (
wekSInt(hcat(grdPts[:,4], grdPts[:,1], grdPts[:,2]), glQud1,
cmpInf) +
wekSInt(hcat(grdPts[:,4], grdPts[:,2], grdPts[:,5]), glQud1,
cmpInf) +
wekEInt(hcat(grdPts[:,4], grdPts[:,1], grdPts[:,2],
grdPts[:,4], grdPts[:,2], grdPts[:,5]), glQud1,
cmpInf) +
wekEInt(hcat(grdPts[:,4], grdPts[:,2], grdPts[:,5],
grdPts[:,4], grdPts[:,1], grdPts[:,2]), glQud1,
cmpInf))) / 2.0)
end
#=
Head function for integration over edge adjacent square panels. See wekS for
input parameter descriptions.
=#
function wekE(scl::NTuple{3,Number}, glQud1::Array{<:AbstractFloat,2},
cmpInf::GlaKerOpt)::Array{ComplexF64,1}
grdPts = Array{Float64,2}(undef, 3, 18)
# labels are panelDir-panelDir-gridIncrement
vals = wekEDir(3, scl, grdPts, glQud1, cmpInf)
# lower case letters reference the normal directions of the rectangles
# upper case letter reference the increasing axis direction when necessary
# first set
xxY = vals[1] + rSrfEdgFlt(Float64(scl[3]), Float64(scl[2]), cmpInf)
xxZ = vals[3] + rSrfEdgFlt(Float64(scl[2]), Float64(scl[3]), cmpInf)
xyA = vals[2] + rSrfEdgCrn(Float64(scl[3]), Float64(scl[2]),
Float64(scl[1]), cmpInf)
xzA = vals[4] + rSrfEdgCrn(Float64(scl[2]), Float64(scl[3]),
Float64(scl[1]), cmpInf)
vals = wekEDir(2, scl, grdPts, glQud1, cmpInf)
# second set
yyZ = vals[1] + rSrfEdgFlt(Float64(scl[1]), Float64(scl[3]), cmpInf)
yyX = vals[3] + rSrfEdgFlt(Float64(scl[3]), Float64(scl[1]), cmpInf)
yzA = vals[2] + rSrfEdgCrn(Float64(scl[1]), Float64(scl[3]),
Float64(scl[2]), cmpInf)
xyB = vals[4] + rSrfEdgCrn(Float64(scl[3]), Float64(scl[2]),
Float64(scl[1]), cmpInf)
vals = wekEDir(1, scl, grdPts, glQud1, cmpInf)
# third set
zzX = vals[1] + rSrfEdgFlt(Float64(scl[2]), Float64(scl[1]), cmpInf)
zzY = vals[3] + rSrfEdgFlt(Float64(scl[1]), Float64(scl[2]), cmpInf)
xzB = vals[2] + rSrfEdgCrn(Float64(scl[2]), Float64(scl[3]),
Float64(scl[1]), cmpInf)
yzB = vals[4] + rSrfEdgCrn(Float64(scl[1]), Float64(scl[3]),
Float64(scl[2]), cmpInf)
return [xxY; xxZ; yyX; yyZ; zzX; zzY; (xyA + xyB) / 2.0; (xzA + xzB) / 2.0;
(yzA + yzB) / 2.0]
end
#=
Weak edge integrals for a given face as specified by dir.
dir = 1 -> z face -> [y-edge (++ gridX): zz(x), xz(x);
x-edge (++ gridY) zz(y) yz(y)]
dir = 2 -> y face -> [x-edge (++ gridZ): yy(z), yz(z);
z-edge (++ gridX) yy(x) xy(x)]
dir = 3 -> x face -> [z-edge (++ gridY): xx(y), xy(y);
y-edge (++ gridZ) xx(z) xz(z)]
=#
function wekEDir(dir::Integer, scl::NTuple{3,Number},
grdPts::Array{<:AbstractFloat,2}, glQud1::Array{<:AbstractFloat,2},
cmpInf::GlaKerOpt)::Array{ComplexF64,1}
wekGrdPts!(dir, scl, grdPts)
return [wekEInt(hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,2], grdPts[:,3], grdPts[:,5]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,3], grdPts[:,6], grdPts[:,5]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,2], grdPts[:,3], grdPts[:,5]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,3], grdPts[:,6], grdPts[:,5]), glQud1, cmpInf);
wekEInt(hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,2], grdPts[:,11], grdPts[:,5]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,11], grdPts[:,14], grdPts[:,5]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,2], grdPts[:,11], grdPts[:,5]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,11], grdPts[:,14], grdPts[:,5]), glQud1, cmpInf);
wekVInt(true, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,4], grdPts[:,5], grdPts[:,7]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,5], grdPts[:,8], grdPts[:,7]), glQud1, cmpInf) +
wekEInt(hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,4], grdPts[:,5], grdPts[:,7]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,5], grdPts[:,8], grdPts[:,7]), glQud1, cmpInf);
wekVInt(true, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,4], grdPts[:,5], grdPts[:,13]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,5], grdPts[:,14], grdPts[:,13]), glQud1, cmpInf) +
wekEInt(hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,4], grdPts[:,5], grdPts[:,13]), glQud1, cmpInf) +
wekVInt(true, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,5], grdPts[:,14], grdPts[:,13]), glQud1, cmpInf)]
end
#=
Head function returning integral values for the Ego function over vertex
adjacent square panels. See wekS for input parameter descriptions.
=#
function wekV(scl::NTuple{3,Number}, glQud1::Array{<:AbstractFloat,2},
cmpInf::GlaKerOpt)::Array{ComplexF64,1}
grdPts = Array{Float64,2}(undef,3,18)
# vertex integrals for x-normal face
vals = wekVDir(3, scl, grdPts, glQud1, cmpInf)
xxO = vals[1]
xyA = vals[2]
xzA = vals[3]
# vertex integrals for y-normal face
vals = wekVDir(2, scl, grdPts, glQud1, cmpInf)
yyO = vals[1]
yzA = vals[2]
xyB = vals[3]
# vertex integrals for z-normal face
vals = wekVDir(1, scl, grdPts, glQud1, cmpInf)
zzO = vals[1]
xzB = vals[2]
yzB = vals[3]
return[xxO; yyO; zzO; (xyA + xyB) / 2.0; (xzA + xzB) / 2.0;
(yzA + yzB) / 2.0]
end
#=
Weak edge integrals for a given face as specified by dir.
dir = 1 -> z face -> [zz zx zy]
dir = 2 -> y face -> [yy yz yx]
dir = 3 -> x face -> [xx xy xz]
=#
function wekVDir(dir::Integer, scl::NTuple{3,Number},
grdPts::Array{<:AbstractFloat,2}, glQud1::Array{<:AbstractFloat,2},
cmpInf::GlaKerOpt)::Array{ComplexF64,1}
wekGrdPts!(dir, scl, grdPts)
return [wekVInt(false, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,5], grdPts[:,6], grdPts[:,9]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,5], grdPts[:,9], grdPts[:,8]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,5], grdPts[:,6], grdPts[:,9]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,5], grdPts[:,9], grdPts[:,8]), glQud1, cmpInf);
wekVInt(false, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,5], grdPts[:,17], grdPts[:,14]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,5], grdPts[:,8], grdPts[:,17]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,5], grdPts[:,17], grdPts[:,14]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,5], grdPts[:,8], grdPts[:,17]), glQud1, cmpInf);
wekVInt(false, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,5], grdPts[:,15], grdPts[:,14]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,2], grdPts[:,5],
grdPts[:,5], grdPts[:,6], grdPts[:,15]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,5], grdPts[:,15], grdPts[:,14]), glQud1, cmpInf) +
wekVInt(false, hcat(grdPts[:,1], grdPts[:,5], grdPts[:,4],
grdPts[:,5], grdPts[:,6], grdPts[:,15]), glQud1, cmpInf)]
end
#=
Generate all unique pairs of cube faces.
=#
function facPar()::Array{Integer,2}
fPairs = Array{Integer,2}(undef, 36, 2)
for i ∈ 1:6, j ∈ 1:6
k = (i - 1) * 6 + j
fPairs[k,1] = i
fPairs[k,2] = j
end
return fPairs
end
#=
Determine scaling factors for surface integrals.
=#
function srfScl(sclT::NTuple{3,Number},
sclS::NTuple{3,Number})::Array{Float64,1}
srcScl = 1.0
trgScl = 1.0
srfScl = Array{Float64,1}(undef, 36)
for srcFId ∈ 1 : 6
if srcFId == 1 || srcFId == 2 srcScl = sclS[2] * sclS[3]
elseif srcFId == 3 || srcFId == 4 srcScl = sclS[1] * sclS[3]
else srcScl = sclS[1] * sclS[2]
end
# target scaling has been switched to source scaling
for trgFId ∈ 1 : 6
if trgFId == 1 || trgFId == 2 trgScl = sclT[1]
elseif trgFId == 3 || trgFId == 4 trgScl = sclT[2]
else trgScl = sclT[3]
end
srfScl[(srcFId - 1) * 6 + trgFId] = Float64(srcScl / trgScl)
end
end
return srfScl
end
#=
Generate array of cuboid faces based from a characteristic size, l[].
L and U reference relative positions on the corresponding normal axis.
Points are number in a counter-clockwise convention when viewing the
face from the exterior of the cube.
=#
function cubFac(size::NTuple{3,Number})::Array{Float64,3}
yzL = hcat([-size[1], -size[2], -size[3]], [-size[1], size[2], -size[3]],
[-size[1], size[2], size[3]], [-size[1], -size[2], size[3]]) ./ 2
yzU = hcat([size[1], -size[2], -size[3]], [size[1], -size[2], size[3]],
[size[1], size[2], size[3]], [size[1], size[2], -size[3]]) ./ 2
xzL = hcat([-size[1], -size[2], -size[3]], [-size[1], -size[2], size[3]],
[size[1], -size[2], size[3]], [size[1], -size[2], -size[3]]) ./ 2
xzU = hcat([-size[1], size[2], -size[3]], [size[1], size[2], -size[3]],
[size[1], size[2], size[3]], [-size[1], size[2], size[3]]) ./ 2
xyL = hcat([-size[1], -size[2], -size[3]], [size[1], -size[2], -size[3]],
[size[1], size[2], -size[3]], [-size[1], size[2], -size[3]]) ./ 2
xyU = hcat([-size[1], -size[2], size[3]], [-size[1], size[2], size[3]],
[size[1], size[2], size[3]], [size[1], -size[2], size[3]]) ./ 2
return cat(yzL, yzU, xzL, xzU, xyL, xyU, dims = 3)
end
#=
Determine a directional component, set by dir, of the separation vector for a
pair points, as determined by ord, which may take on values between zero and
one. The first pair of entries are coordinates in the source surface, the
second pair of entries are coordinates in the target surface.
=#
@inline function cubVecAltAdp(dir::Integer, ordVec::Array{<:AbstractFloat,1},
fp::Integer, trgFaces::Array{<:AbstractFloat,3},
srcFaces::Array{<:AbstractFloat,3}, fPairs::Array{<:Integer,2})::Float64
return (trgFaces[dir,1,fPairs[fp,1]] +
ordVec[3] * (trgFaces[dir,2,fPairs[fp,1]] -
trgFaces[dir,1,fPairs[fp,1]]) +
ordVec[4] * (trgFaces[dir,4,fPairs[fp,1]] -
trgFaces[dir,1,fPairs[fp,1]])) -
(srcFaces[dir,1,fPairs[fp,2]] +
ordVec[1] * (srcFaces[dir,2,fPairs[fp,2]] -
srcFaces[dir,1,fPairs[fp,2]]) +
ordVec[2] * (srcFaces[dir,4,fPairs[fp,2]] -
srcFaces[dir,1,fPairs[fp,2]]))
end
#=
Create grid point system for calculation for calculation of weakly singular
integrals.
=#
function wekGrdPts!(dir::Integer, scl::NTuple{3,Number},
grdPts::Array{<:AbstractFloat,2})::Nothing
if dir == 1
# standard orientation
gridX = Float64(scl[1])
gridY = Float64(scl[2])
gridZ = Float64(scl[3])
elseif dir == 2
# single coordinate rotation
gridX = Float64(scl[3])
gridY = Float64(scl[1])
gridZ = Float64(scl[2])
elseif dir == 3
# double coordinate rotation
gridX = Float64(scl[2])
gridY = Float64(scl[3])
gridZ = Float64(scl[1])
else
error("Invalid direction selection.")
end
grdPts[:,1] = [0.0; 0.0; 0.0]
grdPts[:,2] = [gridX; 0.0; 0.0]
grdPts[:,3] = [2.0 * gridX; 0.0; 0.0]
grdPts[:,4] = [0.0; gridY; 0.0]
grdPts[:,5] = [gridX; gridY; 0.0]
grdPts[:,6] = [2.0 * gridX; gridY; 0.0]
grdPts[:,7] = [0.0; 2.0 * gridY; 0.0]
grdPts[:,8] = [gridX; 2.0 * gridY; 0.0]
grdPts[:,9] = [2.0 * gridX; 2.0 * gridY; 0.0]
grdPts[:,10] = [0.0; 0.0; gridZ]
grdPts[:,11] = [gridX; 0.0; gridZ]
grdPts[:,12] = [2.0 * gridX; 0.0; gridZ]
grdPts[:,13] = [0.0; gridY; gridZ]
grdPts[:,14] = [gridX; gridY; gridZ]
grdPts[:,15] = [2.0 * gridX; gridY; gridZ]
grdPts[:,16] = [0.0; 2.0 * gridY; gridZ]
grdPts[:,17] = [gridX; 2.0 * gridY; gridZ]
grdPts[:,18] = [2.0 * gridX; 2.0 * gridY; gridZ]
return nothing
end
#=
The code contained in glaIntSup evaluates the integrands called by the wekS,
wekE, and wekV head functions using a series of variable transformations
and analytic integral evaluations---reducing the four dimensional surface
integrals performed for ``standard'' cells to chains of one dimensional
integrals. No comments are included in this low level code, which is simply a
julia translation of DIRECTFN_E by Athanasios Polimeridis with added support for
multi-threading. For a complete description of the steps being performed see
the article cited above and references included therein.
=#
include("glaIntSup.jl")
#=
Direct evaluation of 1 / (4 * π * dstMag) integral for a square panel with
itself. la and lb are the edge lengths.
=#
@inline function rSrfSlf(la::AbstractFloat, lb::AbstractFloat,
cmpInf::GlaKerOpt)::ComplexF64
return (1 / (48 * π * cmpInf.frqPhz^2)) * (8 * la^3 + 8 * lb^3
- 8 * la^2 * sqrt(la^2 + lb^2) - 8 * lb^2 * sqrt(la^2 + lb^2) -
3 * la^2 * lb * (2 * log(la) + 2 * log(la + lb - sqrt(la^2 + lb^2)) +
log(sqrt(la^2 + lb^2) - lb) - 5 * log(lb + sqrt(la^2 + lb^2)) -
2 * log(lb - la + sqrt(la^2 + lb^2)) -
2 * log(la + 2 * lb - sqrt(la^2 + 4 * lb^2)) +
log(sqrt(la^2 + 4 * lb^2) - 2 * lb) +
2 * log(la - 2 * lb + sqrt(la^2 + 4 * lb^2)) +
log(2 * lb + sqrt(la^2 + 4 * lb^2)) +
2 * log(2 * lb - la + sqrt(la^2 + 4 * lb^2)) -
2 * log(la + 2 * lb + sqrt(la^2 + 4 * lb^2))) + 6 * la * lb^2 *
(log(64) + 4 * log(lb) + 2 * log(sqrt(la^2 + lb^2) - la) +
3 * log(la + sqrt(la^2 + lb^2)) - 3 * log(sqrt(la^2 + 4 * lb^2) - la) -
3 * log(sqrt(la^4 + 5 * la^2 * lb^2 + 4 * lb^4) +
la * (sqrt(la^2 + lb^2) - la - sqrt(la^2 + 4 * lb^2)))))
end
#=
Direct evaluation of 1 / (4 * π * dstMag) integral for a pair of cornered edge
panels. la, lb, and lc are the edge lengths, and la is assumed to be common to
both panels.
=#
@inline function rSrfEdgCrn(la::AbstractFloat, lb::AbstractFloat,
lc::AbstractFloat, cmpInf::GlaKerOpt)::ComplexF64
return (1 / (48 * π * cmpInf.frqPhz^2)) * (8 * lb * lc *
sqrt(lb^2 + lc^2) - 8 * lb * lc * sqrt(la^2 + lb^2 + lc^2) - 12 * la^3 *
acot(la * lc / (la^2 + lb^2 - lb * sqrt(la^2 + lb^2 + lc^2))) +
12 * la^3 * atan(la / lc) -
12 * la * lc^2 * atan(la * lb / (lc * sqrt(la^2 + lb^2 + lc^2))) -
12 * la * lb^2 * atan(la * lc / (lb * sqrt(la^2 + lb^2 + lc^2))) -
16 * la^3 * atan(lb * lc / (la * sqrt(la^2 + lb^2 + lc^2))) +
6 * lc^3 * atanh(lb / sqrt(lb^2 + lc^2)) -
6 * lc * (la^2 + lc^2) * atanh(lb / sqrt(la^2 + lb^2 + lc^2)) -
15 * la^2 * lc * log(la^2 + lc^2) - lc^3 * log(la^2 + lc^2) +
2 * lc^3 * log(lc / (lb + sqrt(lb^2 + lc^2))) +
6 * la^2 * lc * log(sqrt(la^2 + lb^2 + lc^2) - lb) +
24 * la^2 * lc * log(sqrt(la^2 + lb^2 + lc^2) + lb) +
2 * lc^3 * log(sqrt(la^2 + lb^2 + lc^2) + lb) +
6 * la * lb * (-2 * la * log(la^2 + lb^2) -
lc * log((lb^2 + lc^2) * (sqrt(la^2 + lb^2 + lc^2) - la)) +
3 * lc * log(la + sqrt(la^2 + lb^2 + lc^2)) +
la * log(sqrt(la^2 + lb^2 + lc^2) - lc) +
3 * la * log(sqrt(la^2 + lb^2 + lc^2) + lc)) +
2 * lb^3 * (
log((sqrt(la^2 + lb^2 + lc^2) - lc) / (lc + sqrt(la^2 + lb^2 + lc^2))) +
log(1 + (2 * lc * (lc + sqrt(lb^2 + lc^2))) / lb^2)))
end
#=
Direct evaluation of 1 / (4 * π * dstMag) integral for a pair of flat edge
panels. la and lb are the edge lengths, and lb is assumed to be ``doubled''.
=#
@inline function rSrfEdgFlt(la::AbstractFloat, lb::AbstractFloat,
cmpInf::GlaKerOpt)::ComplexF64
return (1 / (12 * π * cmpInf.frqPhz^2)) * (-la^3 + 2 * lb^2 *
(3 * lb + sqrt(la^2 + lb^2) - 2 * sqrt(la^2 + 4 * lb^2)) + la^2 *
(2 * sqrt(la^2 + lb^2) - sqrt(la^2 + 4 * lb^2))) +
(1 / (64 * π)) * la * lb * (lb * (-62 * log(2) -
5 * log(-la + sqrt(la^2 + lb^2)) +
4 * log(8 * lb^2 * (-la + sqrt(la^2 + lb^2))) -
33 * log(la + sqrt(la^2 + lb^2)) + 17 * log(-la + sqrt(la^2 + 4 * lb^2)) -
24 * log(lb * (-la + sqrt(la^2 + 4 * lb^2))) +
57 * log(la + sqrt(la^2 + 4 * lb^2))) +
4 * la * (-8 * asinh(lb / la) + 6 * asinh(2 * lb / la) +
6 * atanh(lb / sqrt(la^2 + lb^2)) + 12 * log(la) -
13 * log(-lb + sqrt(la^2 + lb^2)) + log((-lb + sqrt(la^2 + lb^2)) / la) +
log(la / (lb + sqrt(la^2 + lb^2))) - 7 * log(lb + sqrt(la^2 + lb^2)) -
2 * log((lb + sqrt(la^2 + lb^2))/la) -
3 * log(-(((lb + sqrt(la^2 + lb^2)) *
(2 * lb - sqrt(la^2 + 4 * lb^2))) / (la^2))) -
3 * log((-lb + sqrt(la^2 + lb^2)) / (-2 * lb + sqrt(la^2 + 4 * lb^2))) +
11 * log(-2 * lb + sqrt(la^2 + 4 * lb^2)) -
3 * log((lb + sqrt(la^2 + lb^2)) / (2 * lb + sqrt(la^2 + 4 * lb^2))) +
log(2 * lb + sqrt(la^2 + 4 * lb^2)) +
9 * log((2 * lb + sqrt(la^2 + 4 * lb^2)) / (lb + sqrt(la^2 + lb^2))) -
2 * log(la^2 + 2 * lb * (lb - sqrt(la^2 + lb^2)))))
end | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 14836 | #=
glaIntsup evaluates the integrands called by the weakS, weakE, and weakV head
functions using a series of variable transformations and analytic integral
evaluations---reducing the four dimensional surface integrals performed for
``standard'' cells to one dimensional integrals. Minimal comments are included
in this code, which is mostly a julia translation of DIRECTFN_E by
Athanasios Polimeridis. For a complete description of the steps
being performed see the article cited above and references included therein.
=#
#=
Weak integral evaluation for a panel interacting with itself.
=#
function wekSInt(rPts::AbstractArray{<:AbstractFloat,2},
glQud::AbstractArray{<:AbstractFloat,2}, cmpInf::GlaKerOpt)::ComplexF64
glqOrd = size(glQud)[1]
# integral as reduction
return eqvJacS(rPts) * ThreadsX.mapreduce(x -> wekSIntKer(x, glqOrd,
rPts, glQud, cmpInf), +, CartesianIndices((1:3, 1:8, 1:glqOrd));
init = 0.0 + im * 0.0)
end
#=
Kernel function for self panel integrals.
=#
function wekSIntKer(slvInd::CartesianIndex{3}, glqOrd::Integer,
rPts::AbstractArray{<:AbstractFloat,2},
glQud::AbstractArray{<:AbstractFloat,2}, cmpInf::GlaKerOpt)::ComplexF64
(ψA, ψB) = ψlimS(slvInd[2])
θ = θf(ψA, ψB, glQud[slvInd[3],1])
(ηA, ηB) = ηlimS(slvInd[2], θ)
intVal = 0.0 + im * 0.0
# component contribution
@inbounds for itr ∈ 1:glqOrd
intVal += glQud[itr,2] * nS(slvInd[1], slvInd[2], θ,
θf(ηA, ηB, glQud[itr,1]), rPts, glQud, cmpInf)
end
return 0.25 * intVal * glQud[slvInd[3],2] * (ψB - ψA) * (ηB - ηA) * sin(θ)
end
#=
Weak integral evaluation for two panels sharing an edge.
=#
function wekEInt(rPts::AbstractArray{<:AbstractFloat,2},
glQud::AbstractArray{<:AbstractFloat,2}, cmpInf::GlaKerOpt)::ComplexF64
glqOrd = size(glQud)[1]
# integral implemented as reduction
return eqvJacEV(rPts) * ThreadsX.mapreduce(x -> wekEIntKer(x, glqOrd,
rPts, glQud, cmpInf), +, CartesianIndices((1:6, 1:glqOrd));
init = 0.0 + im * 0.0)
end
#=
Kernel for edge panel reduction.
=#
function wekEIntKer(slvInd::CartesianIndex{2}, glqOrd::Integer,
rPts::AbstractArray{<:AbstractFloat,2},
glQud::AbstractArray{<:AbstractFloat,2}, cmpInf::GlaKerOpt)::ComplexF64
(ψA, ψB) = ψlimE(slvInd[1])
θB = θf(ψA, ψB, glQud[slvInd[2], 1])
(ηA, ηB) = ηlimE(slvInd[1], θB)
θA = 0.0 + im * 0.0
intVal = 0.0 + im * 0.0
# component contribution
@inbounds for itr ∈ 1:glqOrd
θA = θf(ηA, ηB, glQud[itr, 1])
intVal += glQud[itr, 2] * cos(θA) *
(nE(slvInd[1], 1, θA, θB, rPts, glQud, cmpInf) +
nE(slvInd[1], -1, θA, θB, rPts, glQud, cmpInf))
end
return 0.25 * intVal * glQud[slvInd[2], 2] * (ψB - ψA) * (ηB - ηA)
end
#=
Weak integral for panels sharing a vertex.
=#
function wekVInt(sngMod::Bool, rPts::AbstractArray{<:AbstractFloat,2},
glQud::AbstractArray{<:AbstractFloat,2}, cmpInf::GlaKerOpt)::ComplexF64
glqOrd = size(glQud)[1]
# integral as mapreduction
return eqvJacEV(rPts) * ^(π,2) * ThreadsX.mapreduce(x -> wekVIntKer(x,
glqOrd, sngMod, rPts, glQud, cmpInf), +, CartesianIndices((1:glqOrd,
1:glqOrd, 1:glqOrd,)); init = 0.0 + im * 0.0) / 144.0
end
#=
Kernel for weak vertex integral.
=#
function wekVIntKer(slvInd::CartesianIndex{3}, glqOrd::Integer, sngMod::Bool,
rPts::AbstractArray{<:AbstractFloat,2},
glQud::AbstractArray{<:AbstractFloat,2}, cmpInf::GlaKerOpt)
xPts = Array{Float64,2}(undef, 3, 2)
θA = θf(0.0, π / 3.0, glQud[slvInd[1],1])
LA = 2.0 * sqrt(3.0) / (sin(θA) + sqrt(3.0) * cos(θA))
θB = θf(0.0, π / 3.0, glQud[slvInd[2],1])
LB = 2.0 * sqrt(3.0) / (sin(θB) + sqrt(3.0) * cos(θB))
θC = θf(0.0, atan(LB / LA), glQud[slvInd[3],1])
θD = θf(atan(LB / LA), π / 2.0, glQud[slvInd[3],1])
intValC = 0.0 + im * 0.0
intValD = 0.0 + im * 0.0
θX = 0.0
# select kernel mode
if sngMod == true
# loop D
@inbounds for itrC ∈ 1:glqOrd
θX = θf(0.0, LA / cos(θC), glQud[itrC,1])
spxV!(xPts, θX, θC, θB, θA)
intValC += glQud[itrC,2] * (θX^3) *
kerEVN(rPts, xPts, cmpInf.frqPhz)
end
# loop E
@inbounds for itrD ∈ 1:glqOrd
θX = θf(0.0, LB / sin(θD), glQud[itrD,1])
spxV!(xPts, θX, θD, θB, θA)
intValD += glQud[itrD,2] * (θX^3) *
kerEVN(rPts, xPts, cmpInf.frqPhz)
end
else
# loop D
@inbounds for itrC ∈ 1:glqOrd
θX = θf(0.0, LA / cos(θC), glQud[itrC,1])
spxV!(xPts, θX, θC, θB, θA)
intValC += glQud[itrC,2] * (θX^3) *
kerEV(rPts, xPts, cmpInf.frqPhz)
end
# loop E
@inbounds for itrD ∈ 1:glqOrd
θX = θf(0.0, LB / sin(θD), glQud[itrD,1])
spxV!(xPts, θX, θD, θB, θA)
intValD += glQud[itrD,2] * (θX^3) *
kerEV(rPts, xPts, cmpInf.frqPhz)
end
end
return glQud[slvInd[1],2] * glQud[slvInd[2],2] *
glQud[slvInd[3],2] * (atan(LB / LA) * (LA * sin(θC) * intValC - LB *
cos(θD) * intValD) + 0.5 * π * LB * cos(θD) * intValD)
end
@inline function ψlimS(idf::Integer)::Tuple{Float64,Float64}
if idf == 1 || idf == 5 || idf == 6 return (0.0, π / 3.0)
elseif idf == 2 || idf == 7 return (π / 3.0, 2.0 * π / 3.0)
elseif idf == 3 || idf == 4 || idf == 8 return (2.0 * π / 3.0, π)
else error("Unrecognized identifier.")
end
end
@inline function ψlimE(idf::Integer)::Tuple{Float64,Float64}
if idf == 1 return (0.0, π / 3.0)
elseif idf == 2 || idf == 3 return (π / 3.0, π / 2.0)
elseif idf == 4 || idf == 6 return (π / 2.0, π)
elseif idf == 5 return (0.0, π / 2.0)
else error("Unrecognized identifier.")
end
end
@inline function ηlimS(idf::Integer, θ::AbstractFloat)::Tuple{Float64,Float64}
if idf == 1 || idf == 2
return (0.0, 1.0)
elseif idf == 3
return ((sqrt(3.0) - tan(π - θ)) / (sqrt(3.0) + tan(π - θ)),
1.0)
elseif idf == 4
return (0.0, (sqrt(3.0) - tan(π - θ)) / (sqrt(3.0) + tan(π - θ)))
elseif idf == 5
return ((tan(θ) - sqrt(3.0)) / (sqrt(3.0) + tan(θ)), 0.0)
elseif idf == 6
return (-1.0, (tan(θ) - sqrt(3.0)) / (sqrt(3.0) + tan(θ)))
elseif idf == 7 || idf == 8
return (-1.0, 0.0)
else
error("Unrecognized identifier.")
end
end
@inline function ηlimE(idf::Integer, θ::AbstractFloat)::Tuple{Float64,Float64}
if idf == 1
return (0.0, atan(sin(θ) + sqrt(3.0) * cos(θ)))
elseif idf == 2
return (atan(sin(θ) - sqrt(3.0) * cos(θ)),
atan(sin(θ) + sqrt(3.0) * cos(θ)))
elseif idf == 3 || idf == 4
return (0.0, atan(sin(θ) - sqrt(3.0) * cos(θ)))
elseif idf == 5
return (atan(sin(θ) + sqrt(3.0) * cos(θ)), 0.5 * π)
elseif idf == 6
return (atan(sin(θ) - sqrt(3.0) * cos(θ)), 0.5 * π)
else
error("Unrecognized identifier.")
end
end
function nS(dir::Integer, idf::Integer, θ1::T, θB::T, rPts::Array{T,2},
glQud::Array{T,2}, cmpInf::GlaKerOpt)::ComplexF64 where T<:AbstractFloat
int = 0.0 + 0.0im
glqOrd = size(glQud)[1]
if idf == 1 || idf == 5
for n ∈ 1:glqOrd
int += glQud[n,2] * aS(rPts, θ1, θB,
θf(0.0, (1.0 - θB) / cos(θ1), glQud[n,1]), dir, glQud,
cmpInf)
end
return (1.0 - θB) / (2.0 * cos(θ1)) * int
elseif idf == 2 || idf == 3
for n ∈ 1:glqOrd
int += glQud[n,2] * aS(rPts, θ1, θB,
θf(0.0, sqrt(3.0) * (1.0 - θB) / sin(θ1), glQud[n,1]), dir,
glQud, cmpInf)
end
return sqrt(3.0) * (1.0 - θB) / (2.0 * sin(θ1)) * int
elseif idf == 6 || idf == 7
for n ∈ 1:glqOrd
int += glQud[n,2] * aS(rPts, θ1, θB,
θf(0.0, sqrt(3.0) * (1.0 + θB) / sin(θ1), glQud[n,1]), dir,
glQud, cmpInf)
end
return sqrt(3.0) * (1.0 + θB) / (2.0 * sin(θ1)) * int
elseif idf == 4 || idf == 8
for n ∈ 1:glqOrd
int += glQud[n,2] * aS(rPts, θ1, θB,
θf(0.0, -(1.0 + θB) / cos(θ1), glQud[n,1]), dir, glQud,
cmpInf)
end
return -(1.0 + θB) / (2.0 * cos(θ1)) * int
else
error("Unrecognized identifier.")
end
end
function nE(idf1::Integer, idf2::Integer, θB::T, θ1::T, rPts::Array{T,2},
glQud::Array{T,2}, cmpInf::GlaKerOpt)::ComplexF64 where T<:AbstractFloat
γ = 0.0
intVal1 = 0.0 + 0.0im
intVal2 = 0.0 + 0.0im
glqOrd = size(glQud)[1]
if idf1 == 1 || idf1 == 2
γ = (sin(θ1) + sqrt(3.0) * cos(θ1) - tan(θB)) /
(sin(θ1) + sqrt(3.0) * cos(θ1) + tan(θB))
for n ∈ 1:glqOrd
intVal1 += glQud[n, 2] * intNE(n, 1, γ, θB, θ1, rPts, glQud,
idf2, cmpInf)
intVal2 += glQud[n, 2] * intNE(n, 2, γ, θB, θ1, rPts, glQud,
idf2, cmpInf)
end
return 0.5 * intVal2 + γ * 0.5 * (intVal1-intVal2)
elseif idf1 == 3
γ = sqrt(3.0) / tan(θ1)
for n ∈ 1:glqOrd
intVal1 += glQud[n, 2] * intNE(n, 1, γ, θB, θ1, rPts, glQud,
idf2, cmpInf)
intVal2 += glQud[n, 2] * intNE(n, 3, γ, θB, θ1, rPts, glQud,
idf2, cmpInf)
end
return 0.5 * intVal2 + 0.5 * γ * (intVal1 - intVal2)
elseif idf1 == 4
for n ∈ 1:glqOrd
intVal1 += glQud[n, 2] * intNE(n, 4, 1.0, θB, θ1, rPts,
glQud, idf2, cmpInf)
end
return 0.5 * intVal1
elseif idf1 == 5 || idf1 == 6
for n ∈ 1:glqOrd
intVal1 += glQud[n, 2] * intNE(n, 5, 1.0, θB, θ1, rPts,
glQud, idf2, cmpInf)
end
return 0.5 * intVal1
else
error("Unrecognized identifier.")
end
end
@inline function intNE(n::Integer, idf1::Integer, γ::T, θB::T, θ1::T,
rPts::Array{T,2}, glQud::Array{T,2}, idf2::Integer,
cmpInf::GlaKerOpt)::ComplexF64 where T <: AbstractFloat
if idf1 == 1
η = θf(0.0, γ, glQud[n,1])
λ = sqrt(3.0) * (1 + η) / (cos(θB) * (sin(θ1) + sqrt(3.0) * cos(θ1)))
elseif idf1 == 2
η = θf(γ, 1.0, glQud[n,1])
λ = sqrt(3.0) * (1.0 - abs(η)) / sin(θB)
elseif idf1 == 3
η = θf(γ, 1.0, glQud[n,1])
λ = sqrt(3.0) * (1.0 - abs(η)) /
(cos(θB) * (sin(θ1) - sqrt(3.0) * cos(θ1)))
elseif idf1 == 4
η = θf(0.0, 1.0, glQud[n,1])
λ = sqrt(3.0) * (1.0 - abs(η)) /
(cos(θB) * (sin(θ1) - sqrt(3.0) * cos(θ1)))
elseif idf1 == 5
η = θf(0.0, 1.0, glQud[n,1])
λ = sqrt(3.0) * (1.0 - η) / sin(θB)
else
error("Unrecognized identifier.")
end
return aE(rPts, λ, η, θB, θ1, glQud, idf2, cmpInf)
end
function aS(rPts::Array{T,2}, θ1::T, θB::T, θ::T, dir::Integer,
glQud::Array{T,2}, cmpInf::GlaKerOpt)::ComplexF64 where T<:AbstractFloat
xPts = Array{Float64,2}(undef, 3, 2)
glqOrd = size(glQud)[1]
aInt = 0.0 + 0.0im
η1 = 0.0
η2 = 0.0
ξ1 = 0.0
@inbounds for n ∈ 1:glqOrd
(η1, ξ1) = subTri(θB, θ * sin(θ1), dir)
(η2, ξ2) = subTri(θf(0.0, θ, glQud[n,1]) * cos(θ1) + θB,
(θ - θf(0.0, θ, glQud[n,1])) * sin(θ1), dir)
spx!(xPts, η1, η2, ξ1, ξ2)
aInt += glQud[n,2] * θf(0.0, θ, glQud[n,1]) *
kerSN(rPts, xPts, cmpInf.frqPhz)
end
return 0.5 * θ * aInt
end
function aE(rPts::Array{T,2}, λ::T, η::T, θB::T, θ1::T, glQud::Array{T,2},
idf::Integer, cmpInf::GlaKerOpt)::ComplexF64 where T<:AbstractFloat
xPts = Array{Float64,2}(undef, 3, 2)
glqOrd = size(glQud)[1]
intVal = 0.0 + 0.0im
ζ = 0.0
@inbounds for n ∈ 1:glqOrd
ζ = θf(0.0, λ, glQud[n,1])
spxE!(xPts, ζ, η, θB, θ1, idf)
intVal += glQud[n,2] * ζ * ζ * kerEVN(rPts, xPts, cmpInf.frqPhz)
end
return 0.5 * λ * intVal
end
@inline function subTri(λ1::AbstractFloat, λ2::AbstractFloat,
dir::Integer)::Tuple{Float64,Float64}
if dir == 1
return (λ1, λ2)
elseif dir == 2
return (0.5 * (1.0 - λ1 - λ2 * sqrt(3)),
0.5 * (sqrt(3.0) + λ1 * sqrt(3.0) - λ2))
elseif dir == 3
return (0.5 * (- 1.0 - λ1 + λ2 * sqrt(3)),
0.5 * (sqrt(3.0) - λ1 * sqrt(3.0) - λ2))
else
error("Unrecognized identifier.")
end
end
@inline function eqvJacEV(rPts::Array{T,2})::Float64 where T<:AbstractFloat
return sqrt(dot(cross(rPts[:,2] - rPts[:,1],
rPts[:,3] - rPts[:,1]), cross(rPts[:,2] - rPts[:,1],
rPts[:,3] - rPts[:,1]))) * sqrt(dot(cross(rPts[:,5] -
rPts[:,4], rPts[:,6] - rPts[:,4]), cross(rPts[:,5] -
rPts[:,4], rPts[:,6] - rPts[:,4]))) / 12.0
end
@inline function eqvJacS(rPts::Array{T,2})::Float64 where T<:AbstractFloat
return dot(cross(rPts[:,1] - rPts[:,2], rPts[:,3] - rPts[:,1]),
cross(rPts[:,1] - rPts[:,2], rPts[:,3] - rPts[:,1])) / 12.0
end
@inline function θf(θa::T, θb::T, pos::T)::Float64 where T<:AbstractFloat
return 0.5 * ((θb - θa) * pos + θa + θb)
end
function spxV!(xPts::Array{T,2}, θ4::T, θ3::T, θB::T, θ1::T)::Nothing where
T <: AbstractFloat
spx!(xPts, θ4 * cos(θ3) * cos(θ1) - 1.0, θ4 * sin(θ3) * cos(θB) -
1.0, θ4 * cos(θ3) * sin(θ1), θ4 * sin(θ3) * sin(θB))
return nothing
end
function spxE!(xPts::Array{T,2}, λ::T, η::T, θB::T, θ1::T,
idf::Integer)::Nothing where T<:AbstractFloat
if idf == 1
spx!(xPts, η, λ * cos(θB) * cos(θ1) - η , λ * sin(θB),
λ * cos(θB) * sin(θ1))
elseif idf == - 1
spx!(xPts, -η, -(λ * cos(θB) * cos(θ1) - η) , λ * sin(θB),
λ * cos(θB) * sin(θ1))
else
error("Unrecognized identifier.")
end
return nothing
end
#=
Two versions of the simplex function.
=#
@inline function spx!(xPts::Array{T,2}, η1::T, η2::T, ξ1::T,
ξ2::T)::Nothing where T <: AbstractFloat
xPts[1,1] = (sqrt(3.0) * (1.0 - η1) - ξ1) / (2.0 * sqrt(3.0))
xPts[2,1] = (sqrt(3.0) * (1.0 + η1) - ξ1) / (2.0 * sqrt(3.0))
xPts[3,1] = ξ1 / sqrt(3.0)
xPts[1,2] = (sqrt(3.0) * (1.0 - η2) - ξ2) / (2.0 * sqrt(3.0))
xPts[2,2] = (sqrt(3.0) * (1.0 + η2) - ξ2) / (2.0 * sqrt(3.0))
xPts[3,2] = ξ2 / sqrt(3.0)
return nothing
end
@inline function kerEV(rPts::Array{T,2}, xPts::AbstractArray{T,2},
frqPhz::Union{ComplexF64,ComplexF32})::ComplexF64 where T<:AbstractFloat
return sclEgo(dstMag(xPts[1,1] * rPts[1,1] + xPts[2,1] *
rPts[1,2] + xPts[3,1] * rPts[1,3] - (xPts[1,2] *
rPts[1,4] + xPts[2,2] * rPts[1,5] + xPts[3,2] *
rPts[1,6]), xPts[1,1] * rPts[2,1] + xPts[2,1] *
rPts[2,2] + xPts[3,1] * rPts[2,3] - (xPts[1,2] *
rPts[2,4] + xPts[2,2] * rPts[2,5] + xPts[3,2] *
rPts[2,6]), xPts[1,1] * rPts[3,1] + xPts[2,1] *
rPts[3,2] + xPts[3,1] * rPts[3,3] - (xPts[1,2] *
rPts[3,4] + xPts[2,2] * rPts[3,5] + xPts[3,2] *
rPts[3,6])), frqPhz)
end
@inline function kerEVN(rPts::Array{T,2}, xPts::AbstractArray{T,2},
frqPhz::Union{ComplexF64,ComplexF32})::ComplexF64 where T<:AbstractFloat
return sclEgoN(dstMag(xPts[1,1] * rPts[1,1] + xPts[2,1] *
rPts[1,2] + xPts[3,1] * rPts[1,3] - (xPts[1,2] *
rPts[1,4] + xPts[2,2] * rPts[1,5] + xPts[3,2] *
rPts[1,6]), xPts[1,1] * rPts[2,1] + xPts[2,1] *
rPts[2,2] + xPts[3,1] * rPts[2,3] - (xPts[1,2] *
rPts[2,4] + xPts[2,2] * rPts[2,5] + xPts[3,2] *
rPts[2,6]), xPts[1,1] * rPts[3,1] + xPts[2,1] *
rPts[3,2] + xPts[3,1] * rPts[3,3] - (xPts[1,2] *
rPts[3,4] + xPts[2,2] * rPts[3,5] + xPts[3,2] *
rPts[3,6])), frqPhz)
end
@inline function kerSN(rPts::Array{T,2}, xPts::Array{T,2},
frqPhz::Union{ComplexF64,ComplexF32})::ComplexF64 where T<:AbstractFloat
return sclEgoN(dstMag(xPts[1,1] * rPts[1,1] + xPts[2,1] *
rPts[1,2] + xPts[3,1] * rPts[1,3] - (xPts[1,2] *
rPts[1,1] + xPts[2,2] * rPts[1,2] + xPts[3,2] *
rPts[1,3]), xPts[1,1] * rPts[2,1] + xPts[2,1] *
rPts[2,2] + xPts[3,1] * rPts[2,3] - (xPts[1,2] *
rPts[2,1] + xPts[2,2] * rPts[2,2] + xPts[3,2] *
rPts[2,3]), xPts[1,1] * rPts[3,1] + xPts[2,1] *
rPts[3,2] + xPts[3,1] * rPts[3,3] - (xPts[1,2] *
rPts[3,1] + xPts[2,2] * rPts[3,2] + xPts[3,2] *
rPts[3,3])), frqPhz)
end | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 3995 | #=
Basic linear transformation properties
=#
Base.eltype(opr::GlaOpr) = eltype(eltype(opr.mem.egoFur))
Base.size(opr::GlaOpr) = (3 * prod(opr.mem.trgVol.cel),
3 * prod(opr.mem.srcVol.cel))
Base.size(opr::GlaOpr, dim::Int) = (3 * prod(opr.mem.trgVol.cel),
3 * prod(opr.mem.srcVol.cel))[dim]
LinearAlgebra.issymmetric(::GlaOpr) = false
LinearAlgebra.isposdef(::GlaOpr) = false
LinearAlgebra.ishermitian(::GlaOpr) = false
LinearAlgebra.isdiag(::GlaOpr) = false
#=
Create operator adjoint.
=#
function Base.adjoint(opr::GlaOpr)::GlaOpr
cmpInfCpy = deepcopy(opr.mem.cmpInf)
frqPhz, intOrd, adjMod, devMod, numTrd, numBlk = cmpInfCpy.frqPhz,
cmpInfCpy.intOrd, cmpInfCpy.adjMod, cmpInfCpy.devMod, cmpInfCpy.numTrd,
cmpInfCpy.numBlk
adjOpt = GlaKerOpt(frqPhz, intOrd, !adjMod, devMod, numTrd, numBlk)
memCpy = deepcopy(opr.mem)
trgVol, srcVol, mixInf, dimInf, egoFur, fftPlnFwd, fftPlnRev, phzInf =
memCpy.trgVol, memCpy.srcVol, memCpy.mixInf, memCpy.dimInf,
memCpy.egoFur, memCpy.fftPlnFwd, memCpy.fftPlnRev, memCpy.phzInf
adjMem = GlaOprMem(adjOpt, srcVol, trgVol, mixInf, dimInf, egoFur,
fftPlnFwd, fftPlnRev, phzInf)
return GlaOpr(adjMem)
end
#=
Call egoOpr! via * symbol, tensor definition of input vector.
=#
function Base.:*(opr::GlaOpr,
innVec::AbstractArray{T, 4})::AbstractArray{T,4} where T <: Complex
@assert T <: eltype(opr) "Input array must have the same element type as the operator.
eltype(opr) = $(eltype(opr))"
if opr.mem.cmpInf.devMod && !(innVec isa CuArray)
@warn "Input array is not a CuArray. Copying data to GPU."
innVec = CuArray(innVec)
end
# egoOpr! is mutating, so we need to copy the input
return egoOpr!(opr.mem, deepcopy(innVec))
end
#=
Call egoOpr! via * symbol, flattened definition of input vector.
=#
function Base.:*(opr::GlaOpr,
innVec::AbstractArray{T})::AbstractArray{T} where T <: Complex
innVecArr = reshape(innVec, glaSze(opr, 2))
outVec = opr * innVecArr
if prod(size(innVec)) == prod(glaSze(opr, 1))
return reshape(outVec, size(innVec))
elseif ndims(innVec) == 1
return vec(outVec)
end
return reshape(outVec, glaSze(opr, 1))
end
#=
Call egoOpr! via mul.
=#
function LinearAlgebra.mul!(outVec::AbstractArray{T}, opr::GlaOpr,
innVec::AbstractArray{T}, α::Number, β::Number)::AbstractArray{T} where
T <: Complex
resVec = opr * innVec
rmul!(resVec, α)
rmul!(outVec, β)
outVec .+= resVec
return outVec
end
"""
isadjoint(opr::GlaOpr)
Returns true if the operator is the adjoint of the Greens operator.
# Arguments
- `opr::GlaOpr`: The operator to check.
# Returns
- `true` if the operator is the adjoint, `false` otherwise.
"""
isadjoint(opr::GlaOpr) = opr.mem.cmpInf.adjMod
"""
isselfoperator(opr::GlaOpr)
Returns true if the operator is a self Greens operator.
# Arguments
- `opr::GlaOpr`: The operator to check.
# Returns
- `true` if the operator is a self Greens operator, `false` otherwise.
"""
isselfoperator(opr::GlaOpr) = opr.mem.srcVol == opr.mem.trgVol
"""
isexternaloperator(opr::GlaOpr)
Returns true if the operator is an external Greens operator.
# Arguments
- `opr::GlaOpr`: The operator to check.
# Returns
- `true` if the operator is an external Greens operator, `false` otherwise.
"""
isexternaloperator(opr::GlaOpr) = !isselfoperator(opr)
function Base.show(io::IO, opr::GlaOpr)
if isadjoint(opr)
print(io, "Adjoint ")
end
if isselfoperator(opr)
print(io, "Self ")
else
print(io, "External ")
end
print(io, "GlaOpr for ")
if isselfoperator(opr)
print(io, "a $(eltype(opr)) (" * join(opr.mem.srcVol.cel, "×") * ")
volume ")
print(io, "of size (" * join(opr.mem.srcVol.scl, "×") * ")λ")
else
print(io, "$(eltype(opr)) (" * join(opr.mem.srcVol.cel, "×") * ")
-> (" * join(opr.mem.trgVol.cel, "×") * ") volumes ")
print(io, "of sizes (" * join(opr.mem.srcVol.scl, "×") * ")λ
-> (" * join(opr.mem.trgVol.scl, "×") * ")λ ")
print(io, "with separation (" * join(opr.mem.trgVol.org .-
opr.mem.srcVol.org, ", ") * ")λ")
end
end
| GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 6747 | """
GlaVol
Basic spatial memory structure.
.cel---tuple of cells in rectangular prism
.scl--relative side length of a cuboid voxel compared to the wavelength
.org---center position of the domain
.grd---spatial location of the center of each cell contained in the volume
"""
#=
To simply code operation Gila internally enforces an even number of cells
during the memory preparation phase---see GlaOprMem in glaMemSup.jl.
=#
struct GlaVol
cel::NTuple{3,Integer}
scl::NTuple{3,Rational}
org::NTuple{3,Rational}
grd::Array{<:StepRange,1}
# boundary conditions here?
end
#=
GlaExtInf
Information for mapping between general source and target volumes.
.minScl---common minimum cell size
.srcDiv---divisions in each Cartesian index of source volume
.trgDiv---divisions in each Cartesian index of target volume
.trgCel---cells in a target partition
.srcCel---cells in a source partition
.trgPar---identification of volume partition with grid offsets in target volume
.srcPar---identification of volume partition with grid offsets in source volume
=#
struct GlaExtInf
minScl::NTuple{3,Rational}
trgDiv::NTuple{3,Integer}
srcDiv::NTuple{3,Integer}
trgCel::NTuple{3,Integer}
srcCel::NTuple{3,Integer}
trgPar::CartesianIndices
srcPar::CartesianIndices
end
"""
GlaKerOpt
Green function operator assembly and kernel operation options.
.frqPhz---multiplicative scaling factor allowing for complex frequencies
.intOrd---Gauss-Legendre integration order for cells in contact
.adjMod---flip between operator and operator adjoint
.devMod---boolean vector representing activation of GPUs
.numTrd---number of threads to use when running GPU kernels
.numBlk---number of threads to use when running GPU kernels
"""
#=
If intConTest.jl was failed the default intOrd used in the simplified constructor
may not be sufficient to insure that all integral values are properly converged.
It may be prudent to create the associated GlaKerOpt with higher order.
=#
struct GlaKerOpt
frqPhz::Number
intOrd::Integer
adjMod::Bool
devMod::Union{Bool,Array{<:Bool,1}}
numTrd::Union{Tuple{},NTuple{3,Integer}}
numBlk::Union{Tuple{},NTuple{3,Integer}}
end
"""
GlaOprMem
Storage structure for a Green function operator.
.cmpInf---computation information see GlaKerOpt
.trgVol---target volume of Green function
.srcVol---source volume of Green function
.mixInf---information for matching source and target grids, see GlaExtInf
.dimInfC---dimension information for Green function volumes, host side
.dimInfD---dimension information for Green function volumes, device side
.egoFur---unique Fourier transform data for circulant Green function
.fftPlnFwd---forward Fourier transform plans
.fftPlnRev---reverse Fourier transform plans
.phzInf---phase vector for splitting Fourier transforms
"""
struct GlaOprMem
cmpInf::GlaKerOpt
trgVol::GlaVol
srcVol::GlaVol
mixInf::GlaExtInf
dimInf::NTuple{3,Integer}
egoFur::AbstractArray{<:AbstractArray{T},1} where
T<:Union{ComplexF64,ComplexF32}
fftPlnFwd::AbstractArray{<:AbstractFFTs.Plan,1}
fftPlnRev::AbstractArray{<:AbstractFFTs.ScaledPlan,1}
phzInf::AbstractArray{<:AbstractArray{T},1} where
T<:Union{ComplexF64,ComplexF32}
end
"""
GlaOpr
Abstraction wrapper for GlaOprMem.
# Fields
- `mem::GlaOprMem`: Data to process the Green function.
"""
struct GlaOpr
mem::GlaOprMem
end
#=
Constructors
=#
"""
GlaVol(cel::Array{<:Integer,1}, celScl::NTuple{3,Rational},
org::NTuple{3,Rational}, grdScl::NTuple{3,Rational}=celScl)::GlaVol
Constructor for Gila Volumes.
"""
function GlaVol(cel::Union{Array{<:Integer,1},NTuple{3,Integer}},
celScl::NTuple{3,Rational}, org::NTuple{3,Rational},
grdScl::NTuple{3,Rational}=celScl)::GlaVol
if !prod(celScl .<= grdScl)
error("The cell scale must be smaller than the grid scale to avoid
partially overlapping basis elements.")
end
brd = grdScl .* (Rational.(floor.(cel ./ 2)) .- (iseven.(cel) .// 2))
grd = map(StepRange, org .- brd, grdScl, org .+ brd)
return GlaVol(Tuple(cel), celScl, org, [grd...])
end
#=
Regenerate a GlaVol enforcing that the number of cells is even. Called in
GlaOprMem constructor.
=#
function glaVolEveGen(glaVol::GlaVol)::GlaVol
# check that the number of cells in each Cartesian dimension is even
celParVec = iseven.(glaVol.cel)
# number of cells is odd in some direction
if prod(celParVec) != 1
# warn user that the volume is being regenerated.
println("Warning! A volume has been regenerated to have an even number of cells---the size of a cell has changed. The sum of the number of source and target cells must be even for the algorithm to function.")
# determine dimensions where cells will be scaled.
parVec = map(!, celParVec)
# adjust number of cells
newCelNum = glaVol.cel .+ parVec
# adjust size of cells
newCelScl = map(//, numerator.(glaVol.scl) .* glaVol.cel,
denominator.(glaVol.scl) .* newCelNum)
# adjust grid scale
oldGrdScl = Rational.(step.(glaVol.grd))
newGrdScl = map(//, numerator.(oldGrdScl) .* glaVol.cel,
denominator.(oldGrdScl) .* newCelNum)
# regenerate volume
return GlaVol(Tuple(newCelNum), newCelScl, glaVol.org, Tuple(newGrdScl))
# otherwise, everything is fine
else
return glaVol
end
end
#=
Internal constructor for external pair information, treating grid mismatch.
=#
function GlaExtInf(trgVol::GlaVol, srcVol::GlaVol)::GlaExtInf
# test that cell scales are compatible
if prod(isinteger.(srcVol.scl ./ trgVol.scl) .+ isinteger.(trgVol.scl ./
srcVol.scl)) == 0
error("Volume pair must share a common scale grid.")
end
# common scale
minScl = gcd.(srcVol.scl, trgVol.scl)
# maximal scale
maxScl = lcm.(srcVol.scl, trgVol.scl)
# grid divisions for the source and target volumes
trgDivGrd = ntuple(itr -> maxScl[itr] .÷ trgVol.scl[itr], 3)
srcDivGrd = ntuple(itr -> maxScl[itr] .÷ srcVol.scl[itr], 3)
# number of cells in each source (target) division
trgDivCel = Tuple(trgVol.cel .÷ trgDivGrd)
srcDivCel = Tuple(srcVol.cel .÷ srcDivGrd)
# confirm subdivision of source and target volumes
if prod(trgDivCel) == 0 || prod(srcDivCel) == 0
error("Volume sizes are incompatible---volume smaller than cell.")
end
# association of volume partition with grid offset
trgPar = CartesianIndices(tuple(trgDivGrd...)) .- CartesianIndex(1, 1, 1)
srcPar = CartesianIndices(tuple(srcDivGrd...)) .- CartesianIndex(1, 1, 1)
# create transfer information
return GlaExtInf(minScl, trgDivGrd, srcDivGrd, trgDivCel, srcDivCel,
trgPar, srcPar)
end
"""
GlaKerOpt(devStt::Bool)
Simplified GlaKerOpt constructor.
"""
function GlaKerOpt(devStt::Bool)
if devStt == true
return GlaKerOpt(1.0 + 0.0im, 32, false, true, (128, 2, 1),
(1, 128, 256))
else
return GlaKerOpt(1.0 + 0.0im, 32, false, false, (), ())
end
end | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 14511 | """
function GlaOprMem(cmpInf::GlaKerOpt, trgVol::GlaVol,
srcVol::Union{GlaVol,Nothing}=nothing,
egoFur::Union{AbstractArray{<:AbstractArray{T}},
Nothing}=nothing)::GlaOprMem where T<:Union{ComplexF64,ComplexF32}
Prepare memory for green function operator---when called with a single GlaVol,
or identical source and target volumes, yields the self construction.
"""
function GlaOprMem(cmpInf::GlaKerOpt, trgVol::GlaVol,
srcVol::Union{GlaVol,Nothing}=nothing;
egoFur::Union{AbstractArray{<:AbstractArray{T}, 1},
Nothing}=nothing, setTyp::DataType=ComplexF64)::GlaOprMem where
T<:Union{ComplexF64,ComplexF32}
# check functionality if device computation has been requested
if cmpInf.devMod == true && !CUDA.functional()
error("Device computation requested, but CUDA is not functional. For CPU computation use GlaKerOpt(false)---devMod = false---when declaring compute options.")
end
# flag for self green function case
slfFlg = 0
# self green function case
if isnothing(srcVol) || trgVol == srcVol
slfFlg = 1
srcVol = trgVol
mixInf = GlaExtInf(trgVol, srcVol)
# external green function case
else
# ensure that sum number of cells is even, regenerate if not
if sum(mod.(trgVol.cel .+ srcVol.cel, 2)) != 0
# regenerate target volume so that number of cells is even
trgVol = glaVolEveGen(trgVol)
# regenerate source volume so that number of cells is even
srcVol = glaVolEveGen(srcVol)
end
# useful information for aligning source and target volumes
mixInf = GlaExtInf(trgVol, srcVol)
end
# total cells in circulant
totCelCrc = mixInf.trgCel .+ mixInf.srcCel
# total number of target and source partitions
totParTrg = prod(mixInf.trgDiv)
totParSrc = prod(mixInf.srcDiv)
# branching depth of multiplication
lvl = 3
# number of multiplication branches
eoDim = ^(2, lvl)
# generate circulant green function, from glaGen
if isnothing(egoFur)
# memory for circulant green function vector
egoCrc = Array{ComplexF64}(undef, 3, 3, totCelCrc..., totParSrc,
totParTrg)
# self green function case
if slfFlg == 1
genEgoSlf!(selectdim(selectdim(egoCrc, 7, 1), 6, 1), trgVol, cmpInf)
# external green function case
else
# partition source and target for consistent distance offsets
for trgItr ∈ eachindex(1:totParTrg)
# target grid offset
trgGrdOff = Tuple(mixInf.trgPar[trgItr])
# offset of center of partition from center of volume
trgOrgOff = Rational.((trgGrdOff .- (mixInf.trgDiv .- 1)
.// 2) .* trgVol.scl .+ trgVol.org)
# grid scale of partition
trgGrdScl = mixInf.trgDiv .* trgVol.scl
# create target volume partition
trgVolPar = GlaVol(mixInf.trgCel, trgVol.scl, trgOrgOff,
trgGrdScl)
for srcItr ∈ eachindex(1:totParSrc)
# relative grid position
srcGrdOff = Tuple(mixInf.srcPar[srcItr])
# offset of center of partition from center of volume
srcOrgOff = Rational.((srcGrdOff .- (mixInf.srcDiv .- 1)
.// 2) .* srcVol.scl .+ srcVol.org)
# grid scale of partition
srcGrdScl = mixInf.srcDiv .* srcVol.scl
# create target volume partition
srcVolPar = GlaVol(mixInf.srcCel, srcVol.scl, srcOrgOff,
srcGrdScl)
# generate green function information for partition pair
genEgoExt!(selectdim(selectdim(egoCrc, 7, trgItr), 6,
srcItr), trgVolPar, srcVolPar, cmpInf)
end
end
end
# verify that egoCrc contains numeric values
if maximum(isnan.(egoCrc)) == 1 || maximum(isinf.(egoCrc)) == 1
error("Computed circulant contains non-numeric values.")
end
# Fourier transform of circulant green function
egoFurPrp = Array{eltype(egoCrc)}(undef, totCelCrc..., 6, totParSrc,
totParTrg)
# plan Fourier transform
fftCrcOut = plan_fft(egoCrc[1,1,:,:,:,1,1], (1, 2, 3))
# Fourier transform of the green function, making use of real space
# symmetry under transposition--entries are xx, yy, zz, xy, xz, yz
for trgItr ∈ eachindex(1:totParTrg), srcItr ∈ eachindex(1:totParSrc),
colItr ∈ eachindex(1:3), rowItr ∈ eachindex(1:colItr)
# vector direction moved to outer volume index---largest stride
egoFurPrp[:,:,:,blkEgoItr(3 * (colItr - 1) + rowItr), srcItr,
trgItr] = fftCrcOut * egoCrc[rowItr,colItr,:,:,:,srcItr,trgItr]
end
# verify integrity of Fourier transform data
if maximum(isnan.(egoFurPrp)) == 1 || maximum(isinf.(egoFurPrp)) == 1
error("Fourier transform of circulant contains non-numeric values.")
end
# number of unique green function blocks
ddDim = 6
# Green function construction information
mixInf = GlaExtInf(trgVol, srcVol)
# determine whether source or target volume contains more cells
srcDomDir = map(<, mixInf.trgCel, mixInf.srcCel)
trgDomDir = map(!, srcDomDir)
# number of unique elements in each cartesian index for a branch
truInf = Array{Int}(undef,3)
for dirItr ∈ eachindex(1:3)
# row and column entries are symmetric or anti-symmetric
if mixInf.trgCel[dirItr] == mixInf.srcCel[dirItr] &&
prod(mixInf.srcDiv) == 1 && prod(mixInf.trgDiv) == 1 &&
trgVol.org[dirItr] == srcVol.org[dirItr]
# store only necessary information
truInf[dirItr] = max(Integer(ceil(mixInf.trgCel[dirItr] / 2)) +
iseven(mixInf.trgCel[dirItr]), 2)
# glaVolEveGen enforces that number of cells is even
else
truInf[dirItr] = totCelCrc[dirItr] ÷ 2
end
end
# information copy indicies
cpyRng = tuple(map(UnitRange, ones(Int,3), truInf)...)
# final Fourier coefficients for a given branch
egoFur = Array{Array{setTyp}}(undef, eoDim)
# intermediate storage
egoFurInt = Array{setTyp}(undef, max.(div.(totCelCrc, 2), (2,2,2))...,
ddDim, totParSrc, totParTrg)
# only one one eighth of the green function is unique
for eoItr ∈ 0:(eoDim - 1)
# odd / even branch extraction
egoFur[eoItr + 1] = Array{setTyp}(undef, truInf..., ddDim,
totParSrc, totParTrg)
# first division is along smallest stride -> largest binary division
egoFurInt[:,:,:,:,:,:] .= setTyp.(egoFurPrp[(1 +
mod(div(eoItr, 4), 2)):2:(end - 1 + mod(div(eoItr, 4), 2)),
(1 + mod(div(eoItr, 2), 2)):2:(end - 1 + mod(div(eoItr, 2), 2)),
(1 + mod(eoItr, 2)):2:(end - 1 + mod(eoItr, 2)),:,:,:])
# extract unique information
@threads for cpyItr ∈ CartesianIndices(cpyRng)
egoFur[eoItr + 1][cpyItr,:,:,:] .= egoFurInt[cpyItr,:,:,:]
end
end
end
# verify that egoCrc contains numeric values
for eoItr ∈ eachindex(1:eoDim)
if maximum(isnan.(egoFur[eoItr])) == 1 ||
maximum(isinf.(egoFur[eoItr])) == 1
error("Fourier information contains non-numeric values.")
end
end
if cmpInf.devMod == true
return GlaOprPrp(egoFur, trgVol, srcVol, mixInf, cmpInf, setTyp)
else
setTyp = eltype(eltype(egoFur))
return GlaOprPrp(egoFur, trgVol, srcVol, mixInf, cmpInf, setTyp)
end
end
#=
Memory preparation sub-protocol.
=#
function GlaOprPrp(egoFur::AbstractArray{<:AbstractArray{T}}, trgVol::GlaVol,
srcVol::GlaVol, mixInf::GlaExtInf, cmpInf::GlaKerOpt,
setTyp::DataType)::GlaOprMem where T<:Union{ComplexF64,ComplexF32}
###MEMORY DECLARATION
# number of embedding levels---dimensionality of ambient space
lvls = 3
# operator dimensions---unique vector information does not typically
# match operator size for distinct source and target volumes
# sum of source and target volumes being divisible by 2 is guaranteed by
# glaVolEveGen in GlaOprMemGen
brnSze = div.(mixInf.trgCel .+ mixInf.srcCel, 2)
# binary indexing system of even and odd coefficient extraction
eoDim = ^(2, lvls)
# phase transformations (internal for block Toeplitz transformations)
phzInf = Array{Array{setTyp}}(undef, lvls)
# Fourier transform plans
if cmpInf.devMod == true
egoFurDev = Array{CuArray{setTyp}}(undef, eoDim)
phzInfDev = Array{CuArray{setTyp}}(undef, lvls)
fftPlnFwdDev = Array{CUDA.CUFFT.cCuFFTPlan}(undef, lvls)
fftPlnRevDev = Array{AbstractFFTs.ScaledPlan}(undef, lvls)
else
fftPlnFwd = Array{FFTW.cFFTWPlan}(undef, lvls)
fftPlnRev = Array{FFTW.ScaledPlan}(undef, lvls)
end
###MEMORY PREPARATION
# initialize Fourier transform plans
if cmpInf.devMod == true
for dir ∈ eachindex(1:lvls)
# size of vector changes throughout application for external Green
vecSzeFwd = ntuple(x -> x <= dir ? brnSze[x] : mixInf.srcCel[x], 3)
vecSzeRev = ntuple(x -> x > dir ? mixInf.trgCel[x] : brnSze[x], 3)
# Fourier transform planning area
fftWrkFwdDev = CuArray{setTyp}(undef, vecSzeFwd..., lvls,
prod(mixInf.srcDiv))
fftWrkRevDev = CuArray{setTyp}(undef, vecSzeRev..., lvls,
prod(mixInf.trgDiv))
# create Fourier transform plans
@CUDA.sync fftPlnFwdDev[dir] = plan_fft!(fftWrkFwdDev, [dir])
@CUDA.sync fftPlnRevDev[dir] = plan_ifft!(fftWrkRevDev, [dir])
end
else
for dir ∈ eachindex(1:lvls)
# size of vector changes throughout application for external Green
vecSzeFwd = ntuple(x -> x <= dir ? brnSze[x] : mixInf.srcCel[x], 3)
vecSzeRev = ntuple(x -> x > dir ? mixInf.trgCel[x] : brnSze[x], 3)
# Fourier transform planning area
fftWrkFwd = Array{setTyp}(undef, vecSzeFwd..., lvls,
prod(mixInf.srcDiv))
fftWrkRev = Array{setTyp}(undef, vecSzeRev..., lvls,
prod(mixInf.trgDiv))
# create Fourier transform plans
fftPlnFwd[dir] = plan_fft!(fftWrkFwd, [dir]; flags = FFTW.MEASURE)
fftPlnRev[dir] = plan_ifft!(fftWrkRev, [dir]; flags = FFTW.MEASURE)
end
end
# computation of phase transformation
for itr ∈ eachindex(1:lvls)
# allows calculation odd coefficient numbers
phzInf[itr] = setTyp.([exp(-im * pi * k / brnSze[itr]) for
k ∈ 0:(brnSze[itr] - 1)])
# active GPU
if cmpInf.devMod == true
phzInfDev[itr] = CuArray{setTyp}(undef, brnSze...)
copyto!(selectdim(phzInfDev, 1, itr),
selectdim(phzInf, 1, itr))
end
end
# number of unique green function blocks
ddDim = 2 * lvls
# total number of target and source partitions
totParTrg = prod(mixInf.trgDiv)
totParSrc = prod(mixInf.srcDiv)
# number of unique memory elements
truInf = div.(max.(mixInf.trgCel, mixInf.srcCel), 2) .+ 1
# transfer Fourier coefficients to GPU if active
if cmpInf.devMod == true
# active GPU
for eoItr ∈ 0:(eoDim - 1), ddItr ∈ eachindex(1:6)
egoFurDev[eoItr + 1] = CuArray{setTyp}(undef, truInf..., ddDim,
totParSrc, totParTrg)
copyto!(selectdim(egoFurDev, 1, eoItr + 1),
selectdim(egoFur, 1, eoItr + 1))
end
end
# wait for completion of GPU operation, create memory structure
if cmpInf.devMod == true
CUDA.synchronize(CUDA.stream())
GlaOprMem(cmpInf, trgVol, srcVol, mixInf, brnSze, egoFurDev,
fftPlnFwdDev, fftPlnRevDev, phzInfDev)
else
return GlaOprMem(cmpInf, trgVol, srcVol, mixInf, brnSze, egoFur,
fftPlnFwd, fftPlnRev, phzInf)
end
end
#=
Block index for a given Cartesian index.
=#
@inline function blkEgoItr(crtInd::Integer)::Integer
if crtInd == 1
return 1
elseif crtInd == 2 || crtInd == 4
return 4
elseif crtInd == 5
return 2
elseif crtInd == 7 || crtInd == 3
return 5
elseif crtInd == 8 || crtInd == 6
return 6
elseif crtInd == 9
return 3
else
error("Improper use case, there are only nine blocks.")
return 0
end
end
"""
GlaOpr(cel::NTuple{3, Int}, scl::NTuple{3, Rational},
org::NTuple{3, Rational}=(0//1, 0//1, 0//1);
useGpu::Bool=false, setTyp::DataType=ComplexF64)
Construct a self Green operator.
# Arguments
- `cel::NTuple{3, Int}`: The number of cells in each dimension.
- `scl::NTuple{3, Rational}`: The size of each cell in each dimension
(in units of wavelength).
- `org::NTuple{3, Rational}=(0//1, 0//1, 0//1)`: The origin of the volume in
each dimension (in units of wavelength).
- `useGpu::Bool=false`: Whether to use the GPU (true) or CPU (false).
- `setTyp::DataType=ComplexF64`: The element type of the operator. Must be a
subtype of `Complex`.
"""
function GlaOpr(cel::NTuple{3, Int}, scl::NTuple{3, Rational},
org::NTuple{3, Rational}=(0//1, 0//1, 0//1); useGpu::Bool=false,
setTyp::DataType=ComplexF64)::GlaOpr
if !(setTyp <: Complex)
throw(ArgumentError("setTyp must be a subtype of Complex"))
end
options = GlaKerOpt(useGpu)
slfVol = GlaVol(cel, scl, org)
slfMem = GlaOprMem(options, slfVol, setTyp=setTyp)
return GlaOpr(slfMem)
end
"""
GlaOpr(celSrc::NTuple{3, Int}, sclSrc::NTuple{3, Rational},
orgSrc::NTuple{3, Rational}, celTrg::NTuple{3, Int},
sclTrg::NTuple{3, Rational}, orgTrg::NTuple{3, Rational};
useGpu::Bool=false, setTyp::DataType=ComplexF64)
Construct an external Green's operator.
# Arguments
- `celSrc::NTuple{3, Int}`: The number of cells in each dimension of the source
volume.
- `sclSrc::NTuple{3, Rational}`: The size of each cell in each dimension of the
source volume (in units of wavelength).
- `orgSrc::NTuple{3, Rational}`: The origin of the source volume in each
dimension (in units of wavelength).
- `celTrg::NTuple{3, Int}`: The number of cells in each dimension of the target
volume.
- `sclTrg::NTuple{3, Rational}`: The size of each cell in each dimension of the
target volume (in units of wavelength).
- `orgTrg::NTuple{3, Rational}`: The origin of the target volume in each
dimension (in units of wavelength).
- `useGpu::Bool=false`: Whether to use the GPU (true) or CPU (false).
- `setTyp::DataType=ComplexF64`: The element type of the operator. Must be a
subtype of `Complex`.
"""
function GlaOpr(celSrc::NTuple{3, Int}, sclSrc::NTuple{3, Rational},
orgSrc::NTuple{3, Rational}, celTrg::NTuple{3, Int},
sclTrg::NTuple{3, Rational}, orgTrg::NTuple{3, Rational};
useGpu::Bool=false, setTyp::DataType=ComplexF64)::GlaOpr
if !(setTyp <: Complex)
throw(ArgumentError("set_type must be a subtype of Complex"))
end
opt = GlaKerOpt(useGpu)
volSrc = GlaVol(celSrc, sclSrc, orgSrc)
volTrg = GlaVol(celTrg, sclTrg, orgTrg)
extMem = GlaOprMem(opt, volTrg, volSrc, setTyp=setTyp)
return GlaOpr(extMem)
end
"""
glaSze(opr::GlaOpr)
Returns the size of the input/output arrays for a GlaOpr in tensor form.
# Arguments
- `op::GlaOpr`: The operator to check.
# Returns
- A tuple of the sizes of the input and output arrays in tensor form.
"""
glaSze(opr::GlaOpr) = ((opr.mem.trgVol.cel..., 3), (opr.mem.srcVol.cel..., 3))
"""
glaSze(op::GlaOpr, dim::Int)
Returns the size of the input/output arrays for a GlaOpr in tensor form.
# Arguments
- `op::GlaOpr`: The operator to check.
- `dim::Int`: The length of the dimension to check.
# Returns
- The size of the input/output arrays for a GlaOpr in tensor form.
"""
glaSze(opr::GlaOpr, dim::Int) = ((opr.mem.trgVol.cel..., 3),
(opr.mem.srcVol.cel..., 3))[dim] | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 4309 | #=
Compare self Green function against analytic form
=#
const π = 3.1415926535897932384626433832795028841971693993751058209749445923
const sepTol = 1.0e-9
const lowTol = 1.0e-12
#=
egoAna is the analytic Green function.
=#
function egoAna!(anaOut::AbstractArray{T}, slfVol::GlaVol,
trgRng::Vector{<:StepRange}, dipPos::Vector{<:Rational},
dipVec::Vector{T})::Nothing where T<:Union{ComplexF64,ComplexF64}
# memory allocation
linItr = zeros(Int,3)
egoCel = Array{eltype(anaOut)}(undef, slfVol.cel..., 3)
# separation magnitude and unit vector
sep = 0.0
sH = zeros(eltype(anaOut),3)
# operators components
sHs = zeros(eltype(anaOut), 3, 3)
id = [1.0 0.0 0.0; 0.0 1.0 0.0; 0.0 0.0 1.0]
egoPar = zeros(eltype(anaOut), 3, 3)
# Green function computation
for crtItr ∈ CartesianIndices(tuple(length.(trgRng)...))
# index positions
for dirItr ∈ 1:3
linItr[dirItr] = LinearIndices(egoCel)[crtItr, dirItr]
end
# separation vector
sep = 2.0 * π * sqrt((trgRng[1][crtItr[1]] - dipPos[1])^2 +
(trgRng[2][crtItr[2]] - dipPos[2])^2 +
(trgRng[3][crtItr[3]] - dipPos[3])^2)
# separation too small, use self-point approximation
if sep < sepTol
mul!(view(anaOut, linItr), (2.0 * ^(π, 2.0) * 2.0 * im / 3.0) .*
id, dipVec)
else
sH = (2 * π) .* (trgRng[1][crtItr[1]] - dipPos[1],
trgRng[2][crtItr[2]] - dipPos[2],
trgRng[3][crtItr[3]] - dipPos[3]) ./ sep
sHs = [(sH[1] * sH[1]) (sH[1] * sH[2]) (sH[1] * sH[3]);
(sH[2] * sH[1]) (sH[2] * sH[2]) (sH[2] * sH[3]);
(sH[3] * sH[1]) (sH[3] * sH[2]) (sH[3] * sH[3])]
egoPar = (2.0 * ^(π, 2.0) * exp(im * sep) / sep) .*
(((1.0 + (im * sep - 1.0) / ^(sep, 2.0)) .* id) .-
((1.0 + 3.0 * (im * sep - 1.0) / ^(sep, 2.0)) .* sHs))
LinearAlgebra.mul!(view(anaOut, linItr), egoPar, dipVec)
end
end
return nothing
end
# compare against analytic discrete dipole solution
dipVec = zeros(ComplexF64, 3)
relErr = zeros(Float64, 3)
anaOut = Array{ComplexF64}(undef, 3 * prod(oprSlfHst.srcVol.cel))
numOut = Array{ComplexF64}(undef, oprSlfHst.srcVol.cel..., 3)
difMat = Array{Float64}(undef, oprSlfHst.srcVol.cel..., 3)
innVecHst = Array{eltype(oprSlfHst.egoFur[1])}(undef, oprSlfHst.srcVol.cel..., 3)
# window to remove for field comparisons
winSze = 4 * minimum(oprSlfHst.srcVol.scl)
winInt = minimum([Int(div(1//2 * winSze, minimum(oprSlfHst.srcVol.scl))),
minimum(oprSlfHst.srcVol.cel)])
# check window size
if winInt > minimum(oprSlfHst.srcVol.cel)
error("Excluded window is too large for slfVolume.")
end
winSze = winInt * minimum(oprSlfHst.srcVol.scl)
# cartesian direction loop
for dipDir ∈ eachindex(1:3)
dipLoc = Int.([div(oprSlfHst.srcVol.cel[1], 2),
div(oprSlfHst.srcVol.cel[1], 2),
div(oprSlfHst.srcVol.cel[1], 2)])
# dipole direction and location
dipVec[:] .= 0.0 + 0.0im
dipVec[dipDir] = 1.0 + 0.0im
local dipPos = [oprSlfHst.srcVol.grd[1][dipLoc[1]],
oprSlfHst.srcVol.grd[2][dipLoc[2]],
oprSlfHst.srcVol.grd[3][dipLoc[3]]]
# output range for discrete dipole computation
local trgRng = copy(oprSlfHst.srcVol.grd)
# preform computations
innVecHst[:,:,:,:] .= 0.0 + 0.0im;
innVecHst[dipLoc[1], dipLoc[2], dipLoc[2], dipDir] =
(1.0 + 0.0im) / prod(oprSlfHst.srcVol.scl)
outVecHst = egoOpr!(oprSlfHst, innVecHst);
copyto!(numOut, outVecHst);
egoAna!(anaOut, oprSlfHst.srcVol, trgRng, dipPos, dipVec);
global anaOut = reshape(anaOut, oprSlfHst.srcVol.cel..., 3);
# comparison array
fldDif = 0.0;
for crtItr ∈ CartesianIndices((oprSlfHst.srcVol.cel..., 3))
# field difference
fldDif = abs(anaOut[crtItr] - numOut[crtItr])
difMat[crtItr] = min(fldDif, fldDif / max(abs(numOut[crtItr]), lowTol))
end
# remove points adjacent to dipole for comparison
difMat[(dipLoc[1] - winInt):(dipLoc[1] + winInt),
(dipLoc[2] - winInt):(dipLoc[2] + winInt),
(dipLoc[3] - winInt):(dipLoc[3] + winInt), :] .= 0.0 + 0.0im;
# record maximum relative error in remaining vectors
global relErr[dipDir] = maximum(difMat)
# reset for further tests
copyto!(innVecHst, zeros(eltype(innVecHst),
oprSlfHst.srcVol.cel..., 3));
global anaOut = reshape(anaOut, 3 * prod(oprSlfHst.srcVol.cel));
end
global anaOut = reshape(anaOut, oprSlfHst.srcVol.cel..., 3);
println("Maximum relative field difference outside of ", winSze,
" exclusion window.")
@show relErr; | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 1991 | #=
Compare external and self Green functions
=#
## verify agreement of host and device computation
# input vector for merged Green function
innVecMrgHst = zeros(useTyp, celU..., 3)
# source current limited to celA half
rand!(view(innVecMrgHst, :, 1:celA[2], :, :))
# prepare device computation if CUDA is functional
if CUDA.functional()
innVecMrgDev = CUDA.zeros(useTyp, celU..., 3)
# transfer information to GPU
copyto!(innVecMrgDev, innVecMrgHst)
# confirm host and device computation give equivalent results
outVecMrgHst = egoOpr!(oprMrgHst, innVecMrgHst)
outVecMrgDev = egoOpr!(oprMrgDev, innVecMrgDev)
println("Host device self compute agreement: ",
@test all(outVecMrgHst .≈ Array(outVecMrgDev)))
end
## verify agreement of self and merged external Green function
# input vector for merged Green function
innVecMrgHst = zeros(useTyp, celU..., 3)
# source current limited to celA half
rand!(view(innVecMrgHst, :, 1:celA[2], :, :))
# input vector for host external Green function
innVecExtHst = zeros(useTyp, celA..., 3)
# transfer information to external Green function
copyto!(innVecExtHst, view(innVecMrgHst, 1:celA[1], 1:celA[2], 1:celA[3], :))
if CUDA.functional()
# input vector for device external Green function
innVecExtDev = CUDA.zeros(useTyp, celA..., 3)
# transfer information to external device Green function
copyto!(innVecExtDev, innVecExtHst)
# confirm host and device computation give equivalent results
outVecExtDev = egoOpr!(oprExtDev, innVecExtDev)
end
outVecMrgHst = egoOpr!(oprMrgHst, innVecMrgHst)
outVecExtHst = egoOpr!(oprExtHst, innVecExtHst)
# confirm host and device computation give equivalent results
if CUDA.functional()
println("Host device external compute agreement: ",
@test all(outVecExtHst .≈ Array(outVecExtDev)))
end
# confirm external and self computation give equivalent results
println("Self external compute agreement: ",
@test all(view(outVecMrgHst, 1:celB[1], (celB[2] + 1):celU[2], 1:celB[3],
:) .≈ outVecExtHst)) | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 1402 | const cubRelTol = 1e-8;
const cubAbsTol = 1e-12;
#=
verify that increasing quadrature order does not change integral values.
=#
function wekIntChk(scl::NTuple{3,<:Rational}, glOrd::Integer)::Array{Float64,1}
opts = GlaKerOpt(false)
# weak integral values for internally set quadrature order
ws1 = GilaElectromagnetics.wekS(scl, GilaElectromagnetics.gauQud(glOrd),
opts)
we1 = GilaElectromagnetics.wekE(scl, GilaElectromagnetics.gauQud(glOrd),
opts)
wv1 = GilaElectromagnetics.wekV(scl, GilaElectromagnetics.gauQud(glOrd),
opts)
# weak integral values for additional quadrature points
ws2 = GilaElectromagnetics.wekS(scl, GilaElectromagnetics.gauQud(glOrd + 8),
opts)
we2 = GilaElectromagnetics.wekE(scl, GilaElectromagnetics.gauQud(glOrd + 8),
opts)
wv2 = GilaElectromagnetics.wekV(scl, GilaElectromagnetics.gauQud(glOrd + 8),
opts)
# differences
intDifS = real(maximum(abs.(ws1 .- ws2) ./ abs.(ws2)))
intDifE = real(maximum(abs.(we1 .- we2) ./ abs.(we2)))
intDifV = real(maximum(abs.(wv1 .- wv2) ./ abs.(wv2)))
return [intDifS, intDifE, intDifV]
end
# perform test
intDif = wekIntChk(oprSlfHst.srcVol.scl, oprSlfHst.cmpInf.intOrd)
if maximum(abs.(intDif)) < cubRelTol
println("Integration convergence test passed for self volume.")
else
println("Integration convergence test failed. Default GlaKerOpt integration order may be insufficient, consult glaMem.jl.")
end | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 3729 | using Test
# Make sure the constructors throw if the type is not a subtype of Complex
@test_throws ArgumentError GlaOpr((1, 1, 1), (1//1, 1//1, 1//1),
(0//1, 0//1, 0//1), setTyp=Float64)
self_operator_host = GlaOpr(oprSlfHst)
external_operator_host = GlaOpr(oprExtHst)
merge_operator_host = GlaOpr(oprMrgHst)
if CUDA.functional()
external_operator_device = GlaOpr(oprExtDev)
merge_operator_device = GlaOpr(oprMrgDev)
end
function generic_tests(opr::GlaOpr)
# Make sure the eltype is complex
@test eltype(opr) <: Complex
# Create some data to feed to Gila
x = ones(eltype(opr), size(opr, 2))
x_gilashape = reshape(x, glaSze(opr, 2))
x_gilashape_copy = deepcopy(x_gilashape)
if opr.mem.cmpInf.devMod
x_gilashape_copy = CuArray(x_gilashape_copy)
end
reference_acted_x = egoOpr!(opr.mem, x_gilashape_copy)
# Make sure the tensor multiplication is correct
acted_x_gilashape = opr * x_gilashape
@test acted_x_gilashape ≈ reference_acted_x
# Make sure the input vector is not mutated
@test x_gilashape == reshape(ones(eltype(opr), size(opr, 2)), glaSze(opr, 2))
# Make sure the vector multiplication is correct
acted_x = opr * x
@test acted_x ≈ vec(reference_acted_x)
# Make sure the input vector is not mutated
@test x == ones(eltype(opr), size(opr, 2))
# Make sure we can't multiply by the wrong complex type
t = eltype(opr) <: ComplexF32 ? ComplexF64 : ComplexF32
bad_input = ones(t, size(opr, 2))
@test_throws AssertionError opr * bad_input
# Make sure we get an error if the size of the input vector is wrong
bad_input = ones(eltype(opr), size(opr, 2) + 1)
@test_throws DimensionMismatch opr * bad_input
# Make sure the adjoint of the adjoint is the original operator
adj = adjoint(opr)
adj_adj = adjoint(adj)
@test adjoint(adj).mem.egoFur == opr.mem.egoFur
@test adj_adj * x ≈ opr * x
@test isadjoint(opr) == false
@test isadjoint(adj) == true
# Some proprerties
@test issymmetric(opr) == false
@test isposdef(opr) == false
@test ishermitian(opr) == false
@test isdiag(opr) == false
end
@testset "Self operator host" begin
@test size(self_operator_host) == (16*16*16*3, 16*16*16*3)
@test glaSze(self_operator_host) == ((16, 16, 16, 3), (16, 16, 16, 3))
@test isselfoperator(self_operator_host) == true
@test isexternaloperator(self_operator_host) == false
generic_tests(self_operator_host)
end
@testset "External operator host" begin
@test size(external_operator_host) == (16*16*16*3, 16*16*16*3)
@test glaSze(external_operator_host) == ((16, 16, 16, 3), (16, 16, 16, 3))
@test isselfoperator(external_operator_host) == false
@test isexternaloperator(external_operator_host) == true
generic_tests(external_operator_host)
end
@testset "Merge operator host" begin
@test size(merge_operator_host) == (16*32*16*3, 16*32*16*3)
@test glaSze(merge_operator_host) == ((16, 32, 16, 3), (16, 32, 16, 3))
@test isselfoperator(merge_operator_host) == true
@test isexternaloperator(merge_operator_host) == false
generic_tests(merge_operator_host)
end
if CUDA.functional()
@testset "External operator device" begin
@test size(external_operator_device) == (16*16*16*3, 16*16*16*3)
@test glaSze(external_operator_device) == ((16, 16, 16, 3), (16, 16,
16, 3))
@test isselfoperator(external_operator_device) == false
@test isexternaloperator(external_operator_device) == true
generic_tests(external_operator_device)
end
@testset "Merge operator device" begin
@test size(merge_operator_device) == (16*32*16*3, 16*32*16*3)
@test glaSze(merge_operator_device) == ((16, 32, 16, 3), (16, 32, 16,
3))
@test isselfoperator(merge_operator_device) == true
@test isexternaloperator(merge_operator_device) == false
generic_tests(merge_operator_device)
end
end
| GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 1296 | # memory declaration
global linItr = 0
innVecHst = zeros(eltype(oprSlfHst.egoFur[1]), oprSlfHst.srcVol.cel..., 3)
egoCel = Array{eltype(innVecHst)}(undef, oprSlfHst.srcVol.cel..., 3)
egoDenMat = Array{eltype(innVecHst)}(undef, 3 * prod(oprSlfHst.srcVol.cel),
3 * prod(oprSlfHst.srcVol.cel))
egoDenMatAsm = Array{eltype(innVecHst)}(undef, 3 * prod(oprSlfHst.srcVol.cel),
3 * prod(oprSlfHst.srcVol.cel))
# fill Green function matrix
for crtItr ∈ CartesianIndices(tuple(oprSlfHst.srcVol.cel..., 3))
# linear index
global linItr = LinearIndices(egoCel)[crtItr]
# set source
innVecHst[crtItr] = (1.0 + 0.0im)
# calculate resulting field
outVecHst = egoOpr!(oprSlfHst, innVecHst)
# save field result
copyto!(view(egoDenMat, :, linItr), outVecHst)
# reset input vector
copyto!(innVecHst, zeros(eltype(innVecHst), oprSlfHst.srcVol.cel..., 3))
end
# compute anti-symmetric component
adjoint!(egoDenMatAsm, egoDenMat);
lmul!((0.0 + 0.5im) * conj(cmpInfHst.frqPhz)^2, egoDenMatAsm);
axpy!((0.0 - 0.5im) * (cmpInfHst.frqPhz)^2, egoDenMat, egoDenMatAsm);
# numerical eigenvalues of anti-symmetric component of the Green function
sVals = eigvals(egoDenMatAsm);
println("Computed minimum eigenvalue of ", minimum(sVals), ".")
println("A minimal value greater than -1.0e-6 is considered normal.") | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 695 | # get number of active threads
threads = nthreads()
# Set the number of BLAS threads. The number of Julia threads is set as an
# environment variable. The total number of threads is Julia threads + BLAS
# threads. Gila is does not call BLAS libraries during threaded operations,
# so both thread counts can be set near the available number of cores.
BLAS.set_num_threads(threads)
# analogous comments apply to FFTW threads
FFTW.set_num_threads(threads)
# confirm thread counts
blasThreads = BLAS.get_num_threads()
fftwThreads = FFTW.get_num_threads()
println("GilaTest environment initialized with ", nthreads(),
" Julia threads, $blasThreads BLAS threads, and $fftwThreads FFTW threads.") | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 3973 | ###UTILITY LOADING
using CUDA, AbstractFFTs, FFTW, Base.Threads, LinearAlgebra, LinearAlgebra.BLAS,
Random, GilaElectromagnetics, Test, Serialization, Scratch
include("preamble.jl")
###SETTINGS
# type for tests
useTyp = ComplexF32
# number of cells in each volume
# to run external operator test, celU should be the union of celA and celB
celB = (16, 16, 16)
celA = (16, 16, 16)
celU = (16, 32, 16)
# size of cells relative to wavelength
# to run external operator test, the scales of the three volumes should match
sclB = (1//50, 1//50, 1//50)
sclA = (1//50, 1//50, 1//50)
sclU = (1//50, 1//50, 1//50)
# center position of volumes
# to run external operator test, volA should touch (but not overlap!) volB
orgB = (0//1, 16//50, 0//1)
orgA = (0//1, 0//1, 0//1)
orgU = (0//1, 0//1, 0//1)
## compute settings
# use for host execution
cmpInfHst = GlaKerOpt(false)
# use for device execution
if CUDA.functional()
cmpInfDev = GlaKerOpt(true)
end
###PREP
# build Gila volumes
volB = GlaVol(celB, sclB, orgB)
volA = GlaVol(celA, sclA, orgA)
volU = GlaVol(celU, sclU, orgU)
###OPERATOR MEMORY
println("Green function construction started.")
function getFur(fname)
preload_dir = @get_scratch!("preload")
if isfile(joinpath(preload_dir, fname))
return deserialize(joinpath(preload_dir, fname))
end
return nothing
end
function writeFur(fur, fname)
preload_dir = @get_scratch!("preload")
serialize(joinpath(preload_dir, fname), fur)
end
# generate from scratch---new circulant matrices
furSlfHst = getFur("slfHst.fur")
if isnothing(furSlfHst)
oprSlfHst = GlaOprMem(cmpInfHst, volA, setTyp = useTyp)
writeFur(oprSlfHst.egoFur, "slfHst.fur")
furSlfHst = oprSlfHst.egoFur
else
oprSlfHst = GlaOprMem(cmpInfHst, volA, egoFur = furSlfHst, setTyp = useTyp)
end
furExtHst = getFur("extHst.fur")
if isnothing(furExtHst)
oprExtHst = GlaOprMem(cmpInfHst, volB, volA, setTyp = useTyp)
furExtHst = oprExtHst.egoFur
writeFur(furExtHst, "extHst.fur")
else
oprExtHst = GlaOprMem(cmpInfHst, volB, volA, egoFur = furExtHst,
setTyp = useTyp)
end
# merged domains to check validity of external operator construction
furMrgHst = getFur("mrgHst.fur")
if isnothing(furMrgHst)
oprMrgHst = GlaOprMem(cmpInfHst, volU, setTyp = useTyp)
writeFur(oprMrgHst.egoFur, "mrgHst.fur")
furMrgHst = oprMrgHst.egoFur
else
oprMrgHst = GlaOprMem(cmpInfHst, volU, egoFur = furMrgHst, setTyp = useTyp)
end
# run same test on device
if CUDA.functional()
furExtDev = getFur("extDev.fur")
if isnothing(furExtDev)
oprExtDev = GlaOprMem(cmpInfDev, volB, volA, setTyp = useTyp)
writeFur(oprExtDev.egoFur, "extDev.fur")
furExtDev = oprExtDev.egoFur
else
oprExtDev = GlaOprMem(cmpInfDev, volB, volA, egoFur = furExtDev,
setTyp = useTyp)
end
furMrgDev = getFur("mrgDev.fur")
if isnothing(furMrgDev)
oprMrgDev = GlaOprMem(cmpInfDev, volU, setTyp = useTyp)
writeFur(oprMrgDev.egoFur, "mrgDev.fur")
furMrgDev = oprMrgDev.egoFur
else
oprMrgDev = GlaOprMem(cmpInfDev, volU, egoFur = furMrgDev,
setTyp = useTyp)
end
end
# serialize / deserialize to reuse Fourier information
println("Green function construction completed.")
###TESTS
## integral convergence
# println("Integral convergence test started.")
# include("intConTest.jl")
# println("Integral convergence test completed.")
# ## analytic agreement test on self operator
# println("Analytic test started.")
# include("anaTest.jl")
# println("Analytic test completed.")
# ## positive semi-definite test on self operator
# # test becomes very slow for domains larger than [16,16,16]
# println("Semi-definiteness test started.")
# include("posDefTest.jl")
# println("Semi-definiteness test completed.")
## test external Green function using self Green function
println("External operator test started.")
include("extSlfTest.jl")
println("External operator test completed.")
#test the GreensOperator structs
println("GlaOpr test started.")
include("oprTest.jl")
println("GlaOpr test completed.")
println("Testing complete.")
| GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | code | 4142 | ###UTILITY LOADING
using GilaElectromagnetics
#=
Basic code to generate the (dense) matrix of a self Green function. For a
standard desktop computer, memory issues will likely begin around a thousand
cells---16^3 is 4096.
=#
"""
function genEgoMat(celScl::{3,<:Rational},
celNum::Ntuple{3,<:Integer})::Array{ComplexF64,2}
Generate dense matrix of a Green function.
"""
function genEgoMat(celScl::NTuple{3,<:Rational},
celNum::NTuple{3,<:Integer})::Array{ComplexF64,2}
# copy tolerance---do not copy values if below threshold
cpyTol = 1.0e-15
# boiler plate compute information, alter to tighten tolerances
cmpInf = GlaKerOpt(false)
# create self volume at the origin
volOrg = (0//1, 0//1, 0//1)
slfVol = GlaVol(celNum, celScl, volOrg)
# interaction information
mixInf = GlaExtInf(slfVol, slfVol)
# generate circulant green function---GilaCrc module
egoCrc = Array{ComplexF64}(undef, 3, 3, (mixInf.trgCel .+ mixInf.srcCel)...)
GilaElectromagnetics.genEgoSlf!(egoCrc, slfVol, cmpInf)
# verify that egoCrc contains numeric values
if maximum(isnan.(egoCrc)) == 1 || maximum(isinf.(egoCrc)) == 1
error("Computed circulant contains non-numeric values.")
end
# allocate matrix memory---mixInf.srcCel == mixInf.trgCel
egoMat = zeros(ComplexF64, 3 .* prod(mixInf.srcCel), 3 .* prod(mixInf.srcCel))
# linear indices, offset by 1, for accessing matrix
linInd = LinearIndices(mixInf.srcCel) .- 1
# copy seed Toeplitz information into matrix
@threads for crtInd ∈ CartesianIndices(Tuple(mixInf.srcCel))
# linear offset
off = 3 * linInd[crtInd]
#xx
if abs(egoCrc[1,1,crtInd]) > cpyTol
egoMat[1 + off, 1] = egoCrc[1,1,crtInd]
end
#xy
if abs(egoCrc[1,2,crtInd]) > cpyTol
egoMat[1 + off, 2] = egoCrc[1,2,crtInd]
end
#xz
if abs(egoCrc[1,3,crtInd]) > cpyTol
egoMat[1 + off, 3] = egoCrc[1,3,crtInd]
end
#yx
egoMat[2 + off, 1] = egoMat[1 + off, 2]
#yy
if abs(egoCrc[2,2,crtInd]) > cpyTol
egoMat[2 + off, 2] = egoCrc[2,2,crtInd]
end
#yz
if abs(egoCrc[2,3,crtInd]) > cpyTol
egoMat[2 + off, 3] = egoCrc[2,3,crtInd]
end
#zx
egoMat[3 + off, 1] = egoMat[1 + off, 3]
#zy
egoMat[3 + off, 2] = egoMat[2 + off, 3]
if abs(egoCrc[3,3,crtInd]) > cpyTol
egoMat[3 + off, 3] = egoCrc[3,3,crtInd]
end
end
#expand block Toeplitz structure
for dimItr ∈ eachindex(1:3)
wrtSymToeBlc!(egoMat, (3 * prod(celNum[1:(dimItr - 1)]),
3 * prod(celNum[1:(dimItr - 1)])), celNum[dimItr])
end
return egoMat
end
#=
Utility function adding a level of (symmetric) block Toeplitz structure. blcSze
is the number of low-level data elements contained in a entry of the current
structure. blcDim is the the dimension of the current structure.
=#
function wrtSymToeBlc!(toeMat::Array{<:Number,2}, blcSze::NTuple{2,<:Integer},
blcDim::Integer)::Nothing
# size of a copy unit
untSze = blcSze[1] * blcDim
# number of block partitions contained in matrix
numPrt = size(toeMat)[1] / untSze
# check that result is sensible
if !isinteger(numPrt)
error("Proposed dimensions are not logically consistent.")
end
numPrt = Integer(numPrt)
# unit copy loop
for supItr ∈ range(0, (numPrt - 1))
untOff = untSze * supItr
# dimension copy loop
for dimItr ∈ eachindex(1:(blcDim - 1))
rowOff = blcSze[1] * dimItr
colOff = blcSze[2] * dimItr
# offset source range
srcCrtRngStd = CartesianIndices((
(1 + untOff):(untOff + untSze - rowOff),
blcSze[2]))
# modulo source range
srcCrtRngMod = CartesianIndices((
(1 + untOff + untSze - rowOff):(untOff + untSze),
blcSze[2]))
# offset copy range
cpyCrtRngStd = CartesianIndices((
(1 + rowOff + untOff):(untOff + untSze),
(1 + colOff):(colOff + blcSze[2])))
# modulo copy range
cpyCrtRngMod = CartesianIndices((
(1 + untOff):(rowOff + untOff),
(1 + colOff):(colOff + blcSze[2])))
# standard element copy loop
for (cpyItr, srcItr) ∈ zip(cpyCrtRngStd, srcCrtRngStd)
toeMat[cpyItr] = toeMat[srcItr]
end
# shifted element copy loop
for (cpyItr, srcItr) ∈ zip(cpyCrtRngMod, srcCrtRngMod)
toeMat[cpyItr] = toeMat[srcItr]
end
end
end
return nothing
end | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | docs | 657 | Incomplete documentation of the package can be found in the doc folder.
[](https://github.com/moleskySean/GilaElectromagnetics.jl/actions)
[](http://codecov.io/github/moleskySean/GilaElectromagnetics.jl?branch=main)
[](https://YOUR_USERNAME.github.io/MyAwesomePackage.jl/stable)
[](https://YOUR_USERNAME.github.io/MyAwesomePackage.jl/dev) | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | docs | 296 | # The GilaElectromagnetics Module
```@docs
GilaElectromagnetics
```
## Module Index
```@index
Modules = [GilaElectromagnetics]
Order = [:constant, :type, :function, :macro]
```
## Detailed API
```@autodocs
Modules = [GilaElectromagnetics]
Order = [:constant, :type, :function, :macro]
``` | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 1.0.3 | 6201cfe749b49afbd3572b05f49b13b3dc7cdd55 | docs | 123 | # GilaElectromagnetics.jl
Documentation for GilaElectromagnetics.jl
https://github.com/moleskySean/GilaElectromagnetics.jl | GilaElectromagnetics | https://github.com/moleskySean/GilaElectromagnetics.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 494 | push!(LOAD_PATH,"../src/")
using Documenter, ImplicitArrays
const pages = [
"Home" => "index.md"
]
makedocs(
modules = [ImplicitArrays],
clean = true,
doctest = true,
linkcheck = true,
checkdocs = :all,
pages = pages,
format = Documenter.HTML(),
sitename = "ImplicitArrays.jl",
repo = Remotes.GitHub("tkemmer", "ImplicitArrays.jl")
)
deploydocs(;
repo = "github.com/tkemmer/ImplicitArrays.jl.git",
devbranch = "master"
)
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 351 | module ImplicitArrays
include("compat.jl")
include("block.jl")
export BlockMatrix
include("interaction.jl")
export ConstInteractionFunction, GenericInteractionFunction, InteractionFunction, InteractionMatrix
include("fixedvalue.jl")
export FixedValueArray
include("rowprojection.jl")
export RowProjectionMatrix, RowProjectionVector
end # module
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 2910 | """
BlockMatrix{T} <: AbstractArray{T, 2}
Implicit block matrix of equally-sized matrices with elements of type `T`.
# Constructors
BlockMatrix(blocks)
BlockMatrix{T}(blocks)
BlockMatrix{T}(rows, cols[, blocks...])
BlockMatrix(rows, cols, first_block[, more_blocks...])
Create a new block matrix from the given matrix of matrices. Alternatively, create the
block matrix from a sequence of matrices, given the number of `rows` and `cols`.
# Examples
```jldoctest; setup = :(using ImplicitArrays)
julia> A = [1 2; 3 4]; B = zeros(Int, 2, 2);
julia> C = [x * y for x in 2:3, y in 3:4];
julia> BlockMatrix(1, 4, A, B, B, C)
2×8 BlockMatrix{Int64}:
1 2 0 0 0 0 6 8
3 4 0 0 0 0 9 12
```
!!! note
This type is not suitable for high-performance purposes, as matrix blocks are
stored in an abstract container to allow the composition of arbitrary matrix types.
For more details, please refer to the
[performance tips](https://docs.julialang.org/en/v1/manual/performance-tips/)
in the official Julia documentation.
"""
struct BlockMatrix{T} <: AbstractArray{T, 2}
"Dimensions of the (equally-sized) matrix blocks"
bdims::NTuple{2, Int}
"Matrix blocks"
blocks::Array{AbstractArray{T, 2}, 2}
function BlockMatrix{T}(
blocks::Array{AbstractArray{T, 2}, 2}
) where T
bdims = (1, 1)
for (i, block) ∈ enumerate(blocks)
i > 1 && @assert(
size(block) == bdims,
"invalid block dimensions (block $i expected $bdims, got $(size(block)))"
)
bdims = size(block)
end
new(bdims, blocks)
end
end
@inline BlockMatrix(
blocks::Array{AbstractArray{T, 2}, 2}
) where T = BlockMatrix{T}(blocks)
function BlockMatrix{T}(
rows::Int,
cols::Int,
blocks::Vararg{AbstractArray{T, 2}}
) where T
@assert(
rows * cols == length(blocks),
"invalid number of blocks given (expected $(rows * cols), got $(length(blocks)))"
)
B = Array{AbstractArray{T, 2}, 2}(undef, rows, cols)
for (i, b) in enumerate(blocks)
B[Int(ceil(i/cols)), (i - 1) % cols + 1] = b
end
BlockMatrix{T}(B)
end
@inline BlockMatrix(
rows::Int,
cols::Int,
block::AbstractArray{T, 2},
blocks::Vararg{AbstractArray{T, 2}}
) where T = BlockMatrix{T}(rows, cols, block, blocks...)
@inline Base.size(
M::BlockMatrix
) = M.bdims .* size(M.blocks)
@inline Base.getindex(
M::BlockMatrix,
I::Vararg{Int, 2}
) = getindex(
M.blocks[Int(ceil(I[1]/M.bdims[1])), Int(ceil(I[2]/M.bdims[2]))],
(I[1] - 1) % M.bdims[1] + 1,
(I[2] - 1) % M.bdims[2] + 1
)
@inline Base.setindex!(
M::BlockMatrix,
v::Any,
I::Vararg{Int, 2}
) = setindex!(
M.blocks[Int(ceil(I[1]/M.bdims[1])), Int(ceil(I[2]/M.bdims[2]))],
v,
(I[1] - 1) % M.bdims[1] + 1,
(I[2] - 1) % M.bdims[2] + 1
)
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 300 | # CanonicalIndexError (since Julia 1.8)
# https://github.com/JuliaLang/julia/pull/43852
function _throw_canonical_error(fun::String, T::Type)
@static if isdefined(Base, :CanonicalIndexError)
throw(CanonicalIndexError(fun, T))
else
error("$fun not defined for $T")
end
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 1767 | """
FixedValueArray{T, N} <: AbstractArray{T, N}
Implicit and arbitrarily-sized array with a common value of type `T` for all elements.
# Constructors
FixedValueArray(val, dims)
FixedValueArray(val, dims...)
Create a new matrix of the given dimensions `dims`, where each element is represented
by the given value `val`.
# Examples
```jldoctest; setup = :(using ImplicitArrays)
julia> FixedValueArray(0, (2, 5))
2×5 FixedValueArray{Int64, 2}:
0 0 0 0 0
0 0 0 0 0
julia> FixedValueArray("(^_^) Hi!", 1, 2)
1×2 FixedValueArray{String, 2}:
"(^_^) Hi!" "(^_^) Hi!"
julia> FixedValueArray(FixedValueArray(5.0, (1, 2)), (1, 3))
1×3 FixedValueArray{FixedValueArray{Float64, 2}, 2}:
[5.0 5.0] [5.0 5.0] [5.0 5.0]
julia> length(FixedValueArray(1, 1_000_000_000, 1_000_000_000))
1000000000000000000
```
"""
struct FixedValueArray{T, N} <: AbstractArray{T, N}
"Value representing all matrix elements"
val::T
"Array dimensions"
dims::NTuple{N, Int}
end
@inline FixedValueArray(val::Any, dims::Int...) = FixedValueArray(val, dims)
@inline Base.size(A::FixedValueArray) = A.dims
@inline function Base.getindex(A::FixedValueArray, i::Int)
@boundscheck checkbounds(A, i)
A.val
end
@inline function Base.getindex(A::FixedValueArray{T, N}, I::Vararg{Int, N}) where {T, N}
@boundscheck checkbounds(A, I...)
A.val
end
@inline function Base.setindex!(A::FixedValueArray, ::Any, ::Int)
_throw_canonical_error("setindex!", typeof(A))
end
# This one is required to have setindex! at index [] throw a CanonicalIndexError instead
# of a BoundsError (which is used for all other indices).
@inline function Base.setindex!(A::FixedValueArray, ::Any, ::Vararg{Int})
_throw_canonical_error("setindex!", typeof(A))
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 4432 | """
InteractionFunction{R, C, T}
Abstract base type of all interaction functions `R × C → T`.
"""
abstract type InteractionFunction{R, C, T} end
"""
struct ConstInteractionFunction{R, C, T} <: InteractionFunction{R, C, T}
Interaction function `R × C → T` that ignores its arguments and returns a fixed value.
# Constructor
ConstInteractionFunction{R, C, T}(val)
Create a constant interaction function that always returns `val`.
# Examples
```jldoctest; setup = :(using ImplicitArrays)
julia> f = ConstInteractionFunction{Float64, Float64, Int64}(42);
julia> f(1.0, 1.5)
42
```
"""
struct ConstInteractionFunction{R, C, T} <: InteractionFunction{R, C, T}
val::T
end
@inline (f::ConstInteractionFunction{R, C})(::R, ::C) where {R, C} = f.val
"""
GenericInteractionFunction{R, C, T} <: InteractionFunction{R, C, T}
Interaction function `R × C → T` acting as a type-safe wrapper for a given function.
# Constructor
GenericInteractionFunction{R, C, T}(fun)
Create an interaction function from the given function `fun`.
# Examples
```jldoctest; setup = :(using ImplicitArrays)
julia> f = GenericInteractionFunction{Int64, Int64, Int64}(+); f(9, 3)
12
julia> g = GenericInteractionFunction{Int64, Int64, Float64}(/); g(9, 3)
3.0
julia> h = GenericInteractionFunction{String, Int64, String}(repeat); h("abc", 3)
"abcabcabc"
```
!!! note
The interaction function can only be evaluated if there is a method `fun(::R, ::C)` that
returns a value of type `T`. Otherwise, a `MethodError` or `TypeError` is thrown.
"""
struct GenericInteractionFunction{R, C, T} <: InteractionFunction{R, C, T}
f::Function
end
@inline (f::GenericInteractionFunction{R, C, T})(x::R, y::C) where {R, C, T} = f.f(x, y)::T
"""
InteractionMatrix{T, R, C, F <: InteractionFunction{R, C, T}} <: AbstractArray{T, 2}
Interaction matrix with elements of type `T`, generated from row elements of type `R`, column
elements of type `C`, and an interaction function `F: R × C → T`.
# Constructors
InteractionMatrix(rowelems, colelems, interact)
InteractionMatrix{T}(rowelems, colelems, interact)
Create an interaction matrix for the given row and column element arrays as well as an interaction
function.
InteractionMatrix(rowelems, colelems, val)
Create an interaction matrix for the given (yet unused) row and column element arrays and a
constant interaction function always returning `val`. In this form, the interaction matrix acts
as a replacement for a two-dimensional [`FixedValueArray`](@ref).
# Examples
```jldoctest; setup = :(using ImplicitArrays)
julia> InteractionMatrix{Int64}([1, 2, 3], [10, 20, 30], +)
3×3 InteractionMatrix{Int64, Int64, Int64, GenericInteractionFunction{Int64, Int64, Int64}}:
11 21 31
12 22 32
13 23 33
julia> InteractionMatrix([1, 2, 3], [10, 20, 30], 42)
3×3 InteractionMatrix{Int64, Int64, Int64, ConstInteractionFunction{Int64, Int64, Int64}}:
42 42 42
42 42 42
42 42 42
julia> struct DivFun <: InteractionFunction{Int, Int, Float64} end
julia> (::DivFun)(x::Int, y::Int) = x / y
julia> InteractionMatrix([10, 20, 30], [5, 2, 1], DivFun())
3×3 InteractionMatrix{Float64, Int64, Int64, DivFun}:
2.0 5.0 10.0
4.0 10.0 20.0
6.0 15.0 30.0
```
"""
struct InteractionMatrix{T, R, C, F <: InteractionFunction{R, C, T}} <: AbstractArray{T, 2}
rowelems::Array{R, 1}
colelems::Array{C, 1}
interact::F
@inline function InteractionMatrix(
rowelems::Array{R, 1},
colelems::Array{C, 1},
interact::F
) where {T, R, C, F <: InteractionFunction{R, C, T}}
new{T, R, C, F}(rowelems, colelems, interact)
end
end
@inline InteractionMatrix{T}(
rowelems::Array{R, 1},
colelems::Array{C, 1},
interact::Function
) where {T, R, C} = InteractionMatrix(
rowelems,
colelems,
GenericInteractionFunction{R, C, T}(interact)
)
@inline InteractionMatrix(
rowelems::Array{R, 1},
colelems::Array{C, 1},
val::T
) where {T, R, C} = InteractionMatrix(
rowelems,
colelems,
ConstInteractionFunction{R, C, T}(val)
)
@inline Base.size(
A::InteractionMatrix
) = (length(A.rowelems), length(A.colelems))
@inline Base.getindex(
A::InteractionMatrix{T},
I::Vararg{Int, 2}
) where T = A.interact(A.rowelems[I[1]], A.colelems[I[2]])::T
@inline Base.setindex!(
A::InteractionMatrix,
::Any,
::Int
) = _throw_canonical_error("setindex!", typeof(A))
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 4469 | """
RowProjectionVector{T} <: AbstractArray{T, 1}
Implicit vector projecting a sequence of rows of a given vector with elements of type `T`.
# Constructors
RowProjectionVector(base, rows)
RowProjectionVector(base, rows...)
RowProjectionVector{T}(base, rows)
Create a new row-projected vector from the given `base` vector and a list or sequence of
`rows` corresponding to it. Rows can be used multiple times and in any order.
# Examples
```jldoctest; setup = :(using ImplicitArrays)
julia> v = [10, 20, 30, 40, 50];
julia> RowProjectionVector(v, [1, 3, 5])
3-element RowProjectionVector{Int64, Vector{Int64}}:
10
30
50
julia> RowProjectionVector(v, 2, 3, 2)
3-element RowProjectionVector{Int64, Vector{Int64}}:
20
30
20
```
!!! note
Changing an element through `RowProjectionVector` actually changes the element in the
underlying array. The changes are still reflected in the `RowProjectionVector`. Thus,
caution is advised when changing elements of rows that are contained multiple times
in the projection, in order to avoid unwanted side effects.
"""
struct RowProjectionVector{T, A <: AbstractArray{T, 1}} <: AbstractArray{T, 1}
"Base vector from which the projection is created"
base::A
"Rows used for the projection"
rows::Vector{Int}
function RowProjectionVector{T, A}(
base::A,
rows::Vector{Int}
) where {T, A <: AbstractArray{T, 1}}
@boundscheck _checkrowbounds(base, rows)
new(base, rows)
end
end
@inline RowProjectionVector(
base::A,
rows::Vector{Int}
) where {T, A <: AbstractArray{T, 1}} = RowProjectionVector{T, A}(base, rows)
@inline RowProjectionVector(
base::AbstractVector,
rows::Vararg{Int}
) = RowProjectionVector(base, collect(Int, rows))
@inline Base.IndexStyle(::Type{<: RowProjectionVector}) = IndexLinear()
@inline Base.size(
M::RowProjectionVector
) = (length(M.rows),)
@inline Base.getindex(
M::RowProjectionVector,
i::Int
) = getindex(M.base, getindex(M.rows, i))
@inline Base.setindex!(
M::RowProjectionVector,
v::Any,
i::Int
) = setindex!(M.base, v, getindex(M.rows, i))
"""
RowProjectionMatrix{T} <: AbstractArray{T, 2}
Implicit matrix projecting a sequence of rows of a given matrix with elements of type `T`.
# Constructors
RowProjectionMatrix(base, rows)
RowProjectionMatrix(base, rows...)
RowProjectionMatrix{T}(base, rows)
Create a new row-projected matrix from the given `base` matrix and a list or sequence of
`rows` corresponding to it. Rows can be used multiple times and in any order.
# Examples
```jldoctest; setup = :(using ImplicitArrays)
julia> M = [10 20 30; 40 50 60; 70 80 90];
julia> RowProjectionMatrix(M, [1, 3])
2×3 RowProjectionMatrix{Int64, Matrix{Int64}}:
10 20 30
70 80 90
julia> RowProjectionMatrix(M, 2, 3, 2)
3×3 RowProjectionMatrix{Int64, Matrix{Int64}}:
40 50 60
70 80 90
40 50 60
```
!!! note
Changing an element through `RowProjectionMatrix` actually changes the element in the
underlying array. The changes are still reflected in the `RowProjectionMatrix`. Thus,
caution is advised when changing elements of rows that are contained multiple times
in the projection, in order to avoid unwanted side effects.
"""
struct RowProjectionMatrix{T, A <: AbstractArray{T, 2}} <: AbstractArray{T, 2}
"Base matrix from which the projection is created"
base::A
"Rows used for the projection"
rows::Vector{Int}
function RowProjectionMatrix{T, A}(
base::A,
rows::Vector{Int}
) where {T, A <: AbstractArray{T, 2}}
@boundscheck _checkrowbounds(base, rows)
new(base, rows)
end
end
@inline RowProjectionMatrix(
base::A,
rows::Vector{Int}
) where {T, A <: AbstractArray{T, 2}} = RowProjectionMatrix{T, A}(base, rows)
@inline RowProjectionMatrix(
base::AbstractMatrix,
rows::Vararg{Int}
) = RowProjectionMatrix(base, collect(Int, rows))
@inline Base.size(
M::RowProjectionMatrix
) = (length(M.rows), size(M.base, 2))
@inline Base.getindex(
M::RowProjectionMatrix,
I::Vararg{Int, 2}
) = getindex(M.base, getindex(M.rows, I[1]), I[2])
@inline Base.setindex!(
M::RowProjectionMatrix,
v::Any,
I::Vararg{Int, 2}
) = setindex!(M.base, v, getindex(M.rows, I[1]), I[2])
@inline function _checkrowbounds(
base::AbstractArray,
rows::Vector{Int}
)
for row ∈ rows
checkbounds(base, row, :)
end
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 339 | @testitem "Aqua" begin
using Aqua
# Current workaround to avoid failing tests due to ambiguity in dependencies
# https://github.com/JuliaTesting/Aqua.jl/issues/77
@testset "Method ambiguity" begin
Aqua.test_ambiguities(ImplicitArrays)
end
Aqua.test_all(ImplicitArrays;
ambiguities=false
)
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 16085 | @testitem "BlockMatrix" begin
@testset "empty matrix" begin
@test_throws MethodError BlockMatrix(0, 0)
for A in [
BlockMatrix(Array{AbstractArray{Int, 2}, 2}(undef, 0, 0)),
BlockMatrix{Int}(Array{AbstractArray{Int, 2}, 2}(undef, 0, 0)),
BlockMatrix{Int}(0, 0)
]
@test A isa AbstractArray{Int, 2}
@test size(A) == (0, 0)
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[1]
@test_throws BoundsError A[1] = 42
end
@test_throws AssertionError BlockMatrix(0, 0, zeros(Int, 2, 2))
@test_throws AssertionError BlockMatrix{Int}(0, 0, zeros(Int, 2, 2))
@test_throws MethodError BlockMatrix{Int}(0, 0, zeros(2, 2))
end
@testset "no rows" begin
for A in [
BlockMatrix(Array{AbstractArray{Int, 2}, 2}(undef, 0, 2)),
BlockMatrix{Int}(Array{AbstractArray{Int, 2}, 2}(undef, 0, 2)),
BlockMatrix{Int}(0, 2)
]
@test A isa AbstractArray{Int, 2}
@test size(A) == (0, 2)
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[1]
@test_throws BoundsError A[1] = 42
end
@test_throws AssertionError BlockMatrix(0, 2, zeros(Int, 2, 2))
@test_throws AssertionError BlockMatrix{Int}(0, 2, zeros(Int, 2, 2))
@test_throws MethodError BlockMatrix{Int}(0, 2, zeros(2, 2))
end
@testset "no cols" begin
for A in [
BlockMatrix(Array{AbstractArray{Int, 2}, 2}(undef, 2, 0)),
BlockMatrix{Int}(Array{AbstractArray{Int, 2}, 2}(undef, 2, 0)),
BlockMatrix{Int}(2, 0)
]
@test A isa AbstractArray{Int, 2}
@test size(A) == (2, 0)
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[1]
@test_throws BoundsError A[1] = 42
end
@test_throws AssertionError BlockMatrix(2, 0, zeros(Int, 2, 2))
@test_throws AssertionError BlockMatrix{Int}(2, 0, zeros(Int, 2, 2))
@test_throws MethodError BlockMatrix{Int}(2, 0, zeros(2, 2))
end
@testset "single element" begin
B11 = 42 .* ones(Int, 1, 1)
B = Array{AbstractArray{Int, 2}, 2}(undef, 1, 1)
B[1] = B11
for (i, A) in enumerate([
BlockMatrix(B),
BlockMatrix{Int}(B),
BlockMatrix(1, 1, B11),
BlockMatrix{Int}(1, 1, B11)
])
@test A isa AbstractArray{Int, 2}
@test size(A) == (1, 1)
@test length(A) == 1
A[] = 42 + i
@test A[] isa Int
@test A[] == B11[] == 42 + i
A[1] = 43 + i
@test A[1] isa Int
@test A[1] == B11[1] == 43 + i
A[1, 1] = 44 + i
@test A[1, 1] isa Int
@test A[1, 1] == B11[1, 1] == 44 + i
@test_throws BoundsError A[0]
@test_throws BoundsError A[0, 0]
@test_throws BoundsError A[0, 1]
@test_throws BoundsError A[1, 0]
@test_throws BoundsError A[2]
@test_throws BoundsError A[1, 2]
@test_throws BoundsError A[2, 1]
@test_throws BoundsError A[2, 2]
@test_throws BoundsError A[0] = 42
@test_throws BoundsError A[0, 0] = 42
@test_throws BoundsError A[0, 1] = 42
@test_throws BoundsError A[1, 0] = 42
@test_throws BoundsError A[2] = 42
@test_throws BoundsError A[1, 2] = 42
@test_throws BoundsError A[2, 1] = 42
@test_throws BoundsError A[2, 2] = 42
end
@test_throws AssertionError BlockMatrix{Int}(1, 1)
@test_throws AssertionError BlockMatrix(1, 1, B11, B11)
@test_throws AssertionError BlockMatrix{Int}(1, 1, B11, B11)
@test_throws MethodError BlockMatrix{Float64}(1, 1, B11)
end
@testset "single row" begin
B11 = [1 2]
B12 = [3 4]
B = Array{AbstractArray{Int, 2}, 2}(undef, 1, 2)
B[1] = B11
B[2] = B12
for (i, A) in enumerate([
BlockMatrix(B),
BlockMatrix{Int}(B),
BlockMatrix(1, 2, B11, B12),
BlockMatrix{Int}(1, 2, B11, B12)
])
@test A isa AbstractArray{Int, 2}
@test size(A) == (1, 4)
@test length(A) == 4
for j in 1:4
A[j] = 42i + j
@test A[j] isa Int
@test A[j] == 42i + j
A[1, j] = 42i + j + 1
@test A[1, j] isa Int
@test A[1, j] == 42i + j + 1
end
@test_throws BoundsError A[]
@test_throws BoundsError A[0]
@test_throws BoundsError A[0, 0]
@test_throws BoundsError A[0, 1]
@test_throws BoundsError A[1, 0]
@test_throws BoundsError A[5]
@test_throws BoundsError A[1, 5]
@test_throws BoundsError A[2, 1]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[0] = 42
@test_throws BoundsError A[0, 0] = 42
@test_throws BoundsError A[0, 1] = 42
@test_throws BoundsError A[1, 0] = 42
@test_throws BoundsError A[5] = 42
@test_throws BoundsError A[1, 5] = 42
@test_throws BoundsError A[2, 1] = 42
end
@test_throws AssertionError BlockMatrix{Int}(1, 2)
@test_throws AssertionError BlockMatrix(1, 2, B11)
@test_throws AssertionError BlockMatrix{Int}(1, 2, B11)
@test_throws AssertionError BlockMatrix(1, 2, B11, B12, B12)
@test_throws AssertionError BlockMatrix{Int}(1, 2, B11, B12, B12)
@test_throws MethodError BlockMatrix{Float64}(1, 2, B11)
end
@testset "single col" begin
B11 = reshape([1, 2], (2, 1))
B21 = reshape([3, 4], (2, 1))
B = Array{AbstractArray{Int, 2}, 2}(undef, 2, 1)
B[1] = B11
B[2] = B21
for (i, A) in enumerate([
BlockMatrix(B),
BlockMatrix{Int}(B),
BlockMatrix(2, 1, B11, B21),
BlockMatrix{Int}(2, 1, B11, B21)
])
@test A isa AbstractArray{Int, 2}
@test size(A) == (4, 1)
@test length(A) == 4
for j in 1:4
A[j] = 42i + j
@test A[j] isa Int
@test A[j] == 42i + j
A[j, 1] = 42i + j + 1
@test A[j, 1] isa Int
@test A[j, 1] == 42i + j + 1
end
@test_throws BoundsError A[]
@test_throws BoundsError A[0]
@test_throws BoundsError A[0, 0]
@test_throws BoundsError A[0, 1]
@test_throws BoundsError A[1, 0]
@test_throws BoundsError A[5]
@test_throws BoundsError A[5, 1]
@test_throws BoundsError A[1, 2]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[0] = 42
@test_throws BoundsError A[0, 0] = 42
@test_throws BoundsError A[0, 1] = 42
@test_throws BoundsError A[1, 0] = 42
@test_throws BoundsError A[5] = 42
@test_throws BoundsError A[5, 1] = 42
@test_throws BoundsError A[1, 2] = 42
end
@test_throws AssertionError BlockMatrix{Int}(2, 1)
@test_throws AssertionError BlockMatrix(2, 1, B11)
@test_throws AssertionError BlockMatrix{Int}(2, 1, B11)
@test_throws AssertionError BlockMatrix(2, 1, B11, B21, B21)
@test_throws AssertionError BlockMatrix{Int}(2, 1, B11, B21, B21)
@test_throws MethodError BlockMatrix{Float64}(2, 1, B11)
end
@testset "single block" begin
B11 = [1 2 3; 4 5 6]
B = Array{AbstractArray{Int, 2}, 2}(undef, 1, 1)
B[1] = B11
for (i, A) in enumerate([
BlockMatrix(B),
BlockMatrix{Int}(B),
BlockMatrix(1, 1, B11),
BlockMatrix{Int}(1, 1, B11)
])
@test A isa AbstractArray{Int, 2}
@test size(A) == (2, 3)
@test length(A) == 6
for row in 1:2
for col in 1:3
A[row * col] = 42i + row * col
@test A[row * col] isa Int
@test A[row * col] == 42i + row * col
A[row, col] = 42i + row * col + 1
@test A[row, col] isa Int
@test A[row, col] == 42i + row * col + 1
end
end
@test_throws BoundsError A[]
@test_throws BoundsError A[0]
@test_throws BoundsError A[0, 0]
@test_throws BoundsError A[0, 1]
@test_throws BoundsError A[1, 0]
@test_throws BoundsError A[7]
@test_throws BoundsError A[1, 4]
@test_throws BoundsError A[3, 1]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[0] = 42
@test_throws BoundsError A[0, 0] = 42
@test_throws BoundsError A[0, 1] = 42
@test_throws BoundsError A[1, 0] = 42
@test_throws BoundsError A[7] = 42
@test_throws BoundsError A[1, 4] = 42
@test_throws BoundsError A[3, 1] = 42
end
@test_throws AssertionError BlockMatrix{Int}(1, 1)
@test_throws AssertionError BlockMatrix(1, 1, B11, B11)
@test_throws AssertionError BlockMatrix{Int}(1, 1, B11, B11)
@test_throws MethodError BlockMatrix{Float64}(1, 1, B11)
end
@testset "single block row" begin
B11 = [1 2 3; 7 8 9]
B12 = [4 5 6; 10 11 12]
B = Array{AbstractArray{Int, 2}, 2}(undef, 1, 2)
B[1] = B11
B[2] = B12
for (i, A) in enumerate([
BlockMatrix(B),
BlockMatrix{Int}(B),
BlockMatrix(1, 2, B11, B12),
BlockMatrix{Int}(1, 2, B11, B12)
])
@test A isa AbstractArray{Int, 2}
@test size(A) == (2, 6)
@test length(A) == 12
for row in 1:2
for col in 1:6
A[row * col] = 42i + row * col
@test A[row * col] isa Int
@test A[row * col] == 42i + row * col
A[row, col] = 42i + row * col + 1
@test A[row, col] isa Int
@test A[row, col] == 42i + row * col + 1
end
end
@test_throws BoundsError A[]
@test_throws BoundsError A[0]
@test_throws BoundsError A[0, 0]
@test_throws BoundsError A[0, 1]
@test_throws BoundsError A[1, 0]
@test_throws BoundsError A[13]
@test_throws BoundsError A[1, 7]
@test_throws BoundsError A[3, 1]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[0] = 42
@test_throws BoundsError A[0, 0] = 42
@test_throws BoundsError A[0, 1] = 42
@test_throws BoundsError A[1, 0] = 42
@test_throws BoundsError A[13] = 42
@test_throws BoundsError A[1, 7] = 42
@test_throws BoundsError A[3, 1] = 42
end
@test_throws AssertionError BlockMatrix(1, 2, B11)
@test_throws AssertionError BlockMatrix{Int}(1, 2, B11)
@test_throws AssertionError BlockMatrix(1, 2, B11, B12, B12)
@test_throws AssertionError BlockMatrix{Int}(1, 2, B11, B12, B12)
@test_throws MethodError BlockMatrix{Float64}(1, 2, B11, B12)
end
@testset "single block col" begin
B11 = [1 2 3; 4 5 6]
B21 = [7 8 9; 10 11 12]
B = Array{AbstractArray{Int, 2}, 2}(undef, 2, 1)
B[1] = B11
B[2] = B21
for (i, A) in enumerate([
BlockMatrix(B),
BlockMatrix{Int}(B),
BlockMatrix(2, 1, B11, B21),
BlockMatrix{Int}(2, 1, B11, B21)
])
@test A isa AbstractArray{Int, 2}
@test size(A) == (4, 3)
@test length(A) == 12
for row in 1:4
for col in 1:3
A[row * col] = 42i + row * col
@test A[row * col] isa Int
@test A[row * col] == 42i + row * col
A[row, col] = 42i + row * col + 1
@test A[row, col] isa Int
@test A[row, col] == 42i + row * col + 1
end
end
@test_throws BoundsError A[]
@test_throws BoundsError A[0]
@test_throws BoundsError A[0, 0]
@test_throws BoundsError A[0, 1]
@test_throws BoundsError A[1, 0]
@test_throws BoundsError A[13]
@test_throws BoundsError A[1, 4]
@test_throws BoundsError A[5, 1]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[0] = 42
@test_throws BoundsError A[0, 0] = 42
@test_throws BoundsError A[0, 1] = 42
@test_throws BoundsError A[1, 0] = 42
@test_throws BoundsError A[13] = 42
@test_throws BoundsError A[1, 4] = 42
@test_throws BoundsError A[5, 1] = 42
end
@test_throws AssertionError BlockMatrix(2, 1, B11)
@test_throws AssertionError BlockMatrix{Int}(2, 1, B11)
@test_throws AssertionError BlockMatrix(2, 1, B11, B21, B21)
@test_throws AssertionError BlockMatrix{Int}(2, 1, B11, B21, B21)
@test_throws MethodError BlockMatrix{Float64}(2, 1, B11, B21)
end
@testset "ordinary" begin
B11 = [1 2 3; 7 8 9]
B12 = [4 5 6; 10 11 12]
B21 = [13 14 15; 19 20 21]
B22 = [16 17 18; 22 23 24]
B = Array{AbstractArray{Int, 2}, 2}(undef, 2, 2)
B[1] = B11
B[2] = B21
B[3] = B12
B[4] = B22
for (i, A) in enumerate([
BlockMatrix(B),
BlockMatrix{Int}(B),
BlockMatrix(2, 2, B11, B12, B21, B22),
BlockMatrix{Int}(2, 2, B11, B12, B21, B22)
])
@test A isa AbstractArray{Int, 2}
@test size(A) == (4, 6)
@test length(A) == 24
for row in 1:4
for col in 1:6
A[row * col] = 42i + row * col
@test A[row * col] isa Int
@test A[row * col] == 42i + row * col
A[row, col] = 42i + row * col + 1
@test A[row, col] isa Int
@test A[row, col] == 42i + row * col + 1
end
end
@test_throws BoundsError A[]
@test_throws BoundsError A[0]
@test_throws BoundsError A[0, 0]
@test_throws BoundsError A[0, 1]
@test_throws BoundsError A[1, 0]
@test_throws BoundsError A[25]
@test_throws BoundsError A[1, 7]
@test_throws BoundsError A[5, 1]
@test_throws BoundsError A[] = 42
@test_throws BoundsError A[0] = 42
@test_throws BoundsError A[0, 0] = 42
@test_throws BoundsError A[0, 1] = 42
@test_throws BoundsError A[1, 0] = 42
@test_throws BoundsError A[25] = 42
@test_throws BoundsError A[1, 7] = 42
@test_throws BoundsError A[5, 1] = 42
end
@test_throws AssertionError BlockMatrix(2, 2, B11, B12, B21)
@test_throws AssertionError BlockMatrix{Int}(2, 2, B11, B12, B21)
@test_throws AssertionError BlockMatrix(2, 2, B11, B12, B21, B22, B22)
@test_throws AssertionError BlockMatrix{Int}(2, 2, B11, B12, B21, B22, B22)
@test_throws MethodError BlockMatrix{Float64}(2, 2, B11, B12, B21, B22)
end
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 189 | # CanonicalIndexError (since Julia 1.8)
# https://github.com/JuliaLang/julia/pull/43852
@static if !isdefined(Base, :CanonicalIndexError)
const CanonicalIndexError = ErrorException
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 3491 | @testitem "FixedValueArray" begin
include("compat.jl")
@testset "empty arrays" begin
A = FixedValueArray(Nothing, 0)
@test A isa FixedValueArray{DataType, 1}
@test size(A) == (0,)
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = FixedValueArray(Nothing, 0, 0)
@test A isa FixedValueArray{DataType, 2}
@test size(A) == (0, 0)
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = FixedValueArray(Nothing, 0, 1)
@test A isa FixedValueArray{DataType, 2}
@test size(A) == (0, 1)
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = FixedValueArray(Nothing, 1, 0)
@test A isa FixedValueArray{DataType, 2}
@test size(A) == (1, 0)
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = FixedValueArray(Nothing, 0, 0, 0)
@test A isa FixedValueArray{DataType, 3}
@test size(A) == (0, 0, 0)
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
end
@testset "0-dimensional arrays" begin
A = FixedValueArray(Nothing)
@test A isa FixedValueArray{DataType, 0}
@test size(A) == ()
@test length(A) == 1
@test_throws BoundsError A[0]
@test A[] == Nothing
@test_throws CanonicalIndexError A[] = Nothing
@test A[1] == Nothing
@test_throws CanonicalIndexError A[1] = Nothing
@test_throws BoundsError A[2]
end
@testset "1-dimensional arrays" begin
A = FixedValueArray(42, 3)
@test A isa FixedValueArray{Int, 1}
@test size(A) == (3,)
@test length(A) == 3
@test_throws BoundsError A[]
@test_throws CanonicalIndexError A[] = 41
@test_throws BoundsError A[0]
@test_throws CanonicalIndexError A[0] = 41
for e ∈ A
@test e == 42
end
for i ∈ eachindex(A)
@test A[i] == 42
@test_throws CanonicalIndexError A[i] = 41
end
@test_throws BoundsError A[4]
@test_throws CanonicalIndexError A[4] = 41
end
@testset "2-dimensional arrays" begin
A = FixedValueArray(42, 2, 3)
@test A isa FixedValueArray{Int, 2}
@test size(A) == (2, 3)
@test length(A) == 6
@test_throws BoundsError A[]
@test_throws CanonicalIndexError A[] = 41
@test_throws BoundsError A[0]
@test_throws CanonicalIndexError A[0] = 41
@test_throws BoundsError A[0, 1]
@test_throws CanonicalIndexError A[0, 1] = 41
@test_throws BoundsError A[1, 0]
@test_throws CanonicalIndexError A[1, 0] = 41
for e ∈ A
@test e == 42
end
for i ∈ eachindex(A)
@test A[i] == 42
@test_throws CanonicalIndexError A[i] = 41
end
for i ∈ axes(A, 1), j ∈ axes(A, 2)
@test A[i, j] == 42
@test_throws CanonicalIndexError A[i, j] = 42
end
@test_throws BoundsError A[7]
@test_throws CanonicalIndexError A[7] = 41
@test_throws BoundsError A[3, 1]
@test_throws CanonicalIndexError A[0, 1] = 41
@test_throws BoundsError A[1, 4]
@test_throws CanonicalIndexError A[1, 0] = 41
end
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 10497 | @testitem "InteractionMatrix" begin
include("compat.jl")
@testset "empty matrix" begin
A = InteractionMatrix(Int[], Int[], 11)
@test A isa AbstractArray{Int, 2}
@test size(A) == (0, 0)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = InteractionMatrix{Int}(Int[], Int[], +)
@test A isa AbstractArray{Int, 2}
@test size(A) == (0, 0)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = InteractionMatrix{Float64}(Int[], Int[], /)
@test A isa AbstractArray{Float64, 2}
@test size(A) == (0, 0)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
end
@testset "no rowelems" begin
A = InteractionMatrix(Int[], Int[42, 40, 47], 11)
@test A isa AbstractArray{Int, 2}
@test size(A) == (0, 3)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = InteractionMatrix{Int}(Int[], Int[42, 40, 47], +)
@test A isa AbstractArray{Int, 2}
@test size(A) == (0, 3)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = InteractionMatrix{Float64}(Int[], Int[42, 40, 47], /)
@test A isa AbstractArray{Float64, 2}
@test size(A) == (0, 3)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
end
@testset "no colelems" begin
A = InteractionMatrix(Int[42, 40, 47], Int[], 11)
@test A isa AbstractArray{Int, 2}
@test size(A) == (3, 0)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = InteractionMatrix{Int}(Int[42, 40, 47], Int[], +)
@test A isa AbstractArray{Int, 2}
@test size(A) == (3, 0)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
A = InteractionMatrix{Float64}(Int[42, 40, 47], Int[], /)
@test A isa AbstractArray{Float64, 2}
@test size(A) == (3, 0)
@test_throws BoundsError A[]
@test_throws BoundsError A[1]
end
@testset "single value" begin
A = InteractionMatrix(Int[2], Int[42], 11)
@test A isa AbstractArray{Int, 2}
@test size(A) == (1, 1)
@test A[] isa Int
@test A[] == 11
@test A[1] isa Int
@test A[1] == 11
@test A[1, 1] isa Int
@test A[1, 1] == 11
@test_throws BoundsError A[2]
@test_throws BoundsError A[1, 2]
@test_throws BoundsError A[2, 1]
@test_throws BoundsError A[2, 2]
@test_throws CanonicalIndexError A[] = 13
@test_throws CanonicalIndexError A[1] = 13
@test_throws CanonicalIndexError A[1, 1] = 13
A = InteractionMatrix{Int}(Int[2], Int[42], -)
@test A isa AbstractArray{Int, 2}
@test size(A) == (1, 1)
@test A[] isa Int
@test A[] == -40
@test A[1] isa Int
@test A[1] == -40
@test A[1, 1] isa Int
@test A[1, 1] == -40
@test_throws BoundsError A[2]
@test_throws BoundsError A[1, 2]
@test_throws BoundsError A[2, 1]
@test_throws BoundsError A[2, 2]
@test_throws CanonicalIndexError A[] = 13
@test_throws CanonicalIndexError A[1] = 13
@test_throws CanonicalIndexError A[1, 1] = 13
A = InteractionMatrix{Int}(Int[42], Int[2], -)
@test A[1] == 40
A = InteractionMatrix{Int}(Int[42], Int[2], /)
@test_throws TypeError A[1]
A = InteractionMatrix{Float64}(Int[42], Int[2], /)
@test A isa AbstractArray{Float64, 2}
@test A[1] isa Float64
@test A[1] == 21.0
end
@testset "single rowelem" begin
A = InteractionMatrix(Int[2], Int[42, 40, 47], 11)
@test A isa AbstractArray{Int, 2}
@test size(A) == (1, 3)
@test_throws BoundsError A[]
@test A[1] isa Int
@test A[1] == 11
@test A[2] isa Int
@test A[2] == 11
@test A[3] isa Int
@test A[3] == 11
@test A[1, 1] isa Int
@test A[1, 1] == 11
@test A[1, 2] isa Int
@test A[1, 2] == 11
@test A[1, 3] isa Int
@test A[1, 3] == 11
@test_throws BoundsError A[4]
@test_throws BoundsError A[1, 4]
@test_throws BoundsError A[2, 1]
A = InteractionMatrix{Int}(Int[2], Int[42, 40, 47], -)
@test A isa AbstractArray{Int, 2}
@test size(A) == (1, 3)
@test_throws BoundsError A[]
@test A[1] isa Int
@test A[1] == -40
@test A[2] isa Int
@test A[2] == -38
@test A[3] isa Int
@test A[3] == -45
@test A[1, 1] isa Int
@test A[1, 1] == -40
@test A[1, 2] isa Int
@test A[1, 2] == -38
@test A[1, 3] isa Int
@test A[1, 3] == -45
@test_throws BoundsError A[4]
@test_throws BoundsError A[1, 4]
@test_throws BoundsError A[2, 1]
A = InteractionMatrix{Int}(Int[2], Int[42, 40, 47], \)
@test_throws TypeError A[1]
@test_throws TypeError A[2]
@test_throws TypeError A[3]
@test_throws TypeError A[1, 1]
@test_throws TypeError A[1, 2]
@test_throws TypeError A[1, 3]
A = InteractionMatrix{Float64}(Int[2], Int[42, 40,47], \)
@test A[1] isa Float64
@test A[1] == 21.0
@test A[2] isa Float64
@test A[2] == 20.0
@test A[3] isa Float64
@test A[3] == 23.5
@test A[1, 1] isa Float64
@test A[1, 1] == 21.0
@test A[1, 2] isa Float64
@test A[1, 2] == 20.0
@test A[1, 3] isa Float64
@test A[1, 3] == 23.5
end
@testset "single colelem" begin
A = InteractionMatrix(Int[42, 40, 47], Int[2], 11)
@test A isa AbstractArray{Int, 2}
@test size(A) == (3, 1)
@test_throws BoundsError A[]
@test A[1] isa Int
@test A[1] == 11
@test A[2] isa Int
@test A[2] == 11
@test A[3] isa Int
@test A[3] == 11
@test A[1, 1] isa Int
@test A[1, 1] == 11
@test A[2, 1] isa Int
@test A[2, 1] == 11
@test A[3, 1] isa Int
@test A[3, 1] == 11
@test_throws BoundsError A[4]
@test_throws BoundsError A[4, 1]
@test_throws BoundsError A[1, 2]
A = InteractionMatrix{Int}(Int[42, 40, 47], Int[2], -)
@test A isa AbstractArray{Int, 2}
@test size(A) == (3, 1)
@test_throws BoundsError A[]
@test A[1] isa Int
@test A[1] == 40
@test A[2] isa Int
@test A[2] == 38
@test A[3] isa Int
@test A[3] == 45
@test A[1, 1] isa Int
@test A[1, 1] == 40
@test A[2, 1] isa Int
@test A[2, 1] == 38
@test A[3, 1] isa Int
@test A[3, 1] == 45
@test_throws BoundsError A[4]
@test_throws BoundsError A[4, 1]
@test_throws BoundsError A[1, 2]
A = InteractionMatrix{Int}(Int[42, 40, 47], Int[2], /)
@test_throws TypeError A[1]
@test_throws TypeError A[2]
@test_throws TypeError A[3]
@test_throws TypeError A[1, 1]
@test_throws TypeError A[2, 1]
@test_throws TypeError A[3, 1]
A = InteractionMatrix{Float64}(Int[42, 40,47], Int[2], /)
@test A[1] isa Float64
@test A[1] == 21.0
@test A[2] isa Float64
@test A[2] == 20.0
@test A[3] isa Float64
@test A[3] == 23.5
@test A[1, 1] isa Float64
@test A[1, 1] == 21.0
@test A[2, 1] isa Float64
@test A[2, 1] == 20.0
@test A[3, 1] isa Float64
@test A[3, 1] == 23.5
end
@testset "ordinary" begin
A = InteractionMatrix(Int[2, 5], Int[42, 40], 11)
@test A isa AbstractArray{Int, 2}
@test size(A) == (2, 2)
@test_throws BoundsError A[]
@test A[1] isa Int
@test A[1] == 11
@test A[2] isa Int
@test A[2] == 11
@test A[3] isa Int
@test A[3] == 11
@test A[4] isa Int
@test A[4] == 11
@test A[1, 1] isa Int
@test A[1, 1] == 11
@test A[2, 1] isa Int
@test A[2, 1] == 11
@test A[1, 2] isa Int
@test A[1, 2] == 11
@test A[2, 2] isa Int
@test A[2, 2] == 11
A = InteractionMatrix{Int}(Int[2, 5], Int[42, 40], -)
@test A isa AbstractArray{Int, 2}
@test size(A) == (2, 2)
@test_throws BoundsError A[]
@test A[1] isa Int
@test A[1] == -40
@test A[2] isa Int
@test A[2] == -37
@test A[3] isa Int
@test A[3] == -38
@test A[4] isa Int
@test A[4] == -35
@test A[1, 1] isa Int
@test A[1, 1] == -40
@test A[2, 1] isa Int
@test A[2, 1] == -37
@test A[1, 2] isa Int
@test A[1, 2] == -38
@test A[2, 2] isa Int
@test A[2, 2] == -35
A = InteractionMatrix{Int}(Int[42, 40], Int[2, 5], -)
@test A isa AbstractArray{Int, 2}
@test size(A) == (2, 2)
@test_throws BoundsError A[]
@test A[1] isa Int
@test A[1] == 40
@test A[2] isa Int
@test A[2] == 38
@test A[3] isa Int
@test A[3] == 37
@test A[4] isa Int
@test A[4] == 35
@test A[1, 1] isa Int
@test A[1, 1] == 40
@test A[2, 1] isa Int
@test A[2, 1] == 38
@test A[1, 2] isa Int
@test A[1, 2] == 37
@test A[2, 2] isa Int
@test A[2, 2] == 35
A = InteractionMatrix{Int}(Int[42, 40], Int[2, 5], /)
@test_throws TypeError A[1]
@test_throws TypeError A[2]
@test_throws TypeError A[3]
@test_throws TypeError A[4]
@test_throws TypeError A[1, 1]
@test_throws TypeError A[2, 1]
@test_throws TypeError A[1, 2]
@test_throws TypeError A[2, 2]
A = InteractionMatrix{Float64}(Int[42, 40], Int[2, 5], /)
@test A[1] isa Float64
@test A[1] == 21.0
@test A[2] isa Float64
@test A[2] == 20.0
@test A[3] isa Float64
@test A[3] == 8.4
@test A[4] isa Float64
@test A[4] == 8.0
@test A[1, 1] isa Float64
@test A[1, 1] == 21.0
@test A[2, 1] isa Float64
@test A[2, 1] == 20.0
@test A[1, 2] isa Float64
@test A[1, 2] == 8.4
@test A[2, 2] isa Float64
@test A[2, 2] == 8.0
end
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 8802 | @testitem "RowProjectionVector" begin
@testset "invalid row bounds" begin
v = [1, 2, 3]
@test_throws BoundsError RowProjectionVector(v, 0)
@test_throws BoundsError RowProjectionVector(v, 4)
end
@testset "empty projection" begin
v = [1, 2, 3]
u = RowProjectionVector(v, Int[])
@test u isa RowProjectionVector{Int}
@test size(u) == (0,)
@test length(u) == 0
@test_throws BoundsError u[]
@test_throws BoundsError u[] = 41
@test_throws BoundsError u[0]
@test_throws BoundsError u[0] = 41
@test_throws BoundsError u[1]
@test_throws BoundsError u[1] = 41
@test_throws BoundsError u[2]
@test_throws BoundsError u[2] = 41
u = RowProjectionVector(v)
@test u isa RowProjectionVector{Int}
@test size(u) == (0,)
@test length(u) == 0
@test_throws BoundsError u[]
@test_throws BoundsError u[] = 41
@test_throws BoundsError u[0]
@test_throws BoundsError u[0] = 41
@test_throws BoundsError u[1]
@test_throws BoundsError u[1] = 41
@test_throws BoundsError u[2]
@test_throws BoundsError u[2] = 41
end
@testset "single row" begin
v = [1, 2, 3]
for row ∈ eachindex(v)
u = RowProjectionVector(v, row)
@test u isa RowProjectionVector{Int}
@test size(u) == (1,)
@test length(u) == 1
@test_throws BoundsError u[0]
@test_throws BoundsError u[0] = 41
@test u[] == v[row]
@test u[1] == v[row]
u[] = 10 + row
@test u[] == 10 + row
u[1] = 100 + row
@test u[1] == 100 + row
@test_throws BoundsError u[length(u) + 1]
@test_throws BoundsError u[length(u) + 1] = 41
end
end
@testset "row subset" begin
v = [1, 2, 3]
u = RowProjectionVector(v, 3, 1)
@test u isa RowProjectionVector{Int}
@test size(u) == (2,)
@test length(u) == 2
@test_throws BoundsError u[0]
@test_throws BoundsError u[0] = 41
@test u[1] == v[3]
u[1] = 11
@test u[1] == v[3] == 11
@test u[2] == v[1]
u[2] = 12
@test u[2] == v[1] == 12
@test_throws BoundsError u[length(u) + 1]
@test_throws BoundsError u[length(u) + 1] = 41
end
@testset "row bag" begin
v = [1, 2, 3]
u = RowProjectionVector(v, 2, 2)
@test u isa RowProjectionVector{Int}
@test size(u) == (2,)
@test length(u) == 2
@test_throws BoundsError u[0]
@test_throws BoundsError u[0] = 41
@test u[1] == u[2] == v[2]
u[1] = 11
@test u[1] == u[2] == v[2] == 11
u[2] = 12
@test u[1] == u[2] == v[2] == 12
@test_throws BoundsError u[length(u) + 1]
@test_throws BoundsError u[length(u) + 1] = 41
end
@testset "full projection" begin
v = [1, 2, 3]
u = RowProjectionVector(v, 1, 2, 3)
@test u isa RowProjectionVector{Int}
@test size(u) == size(v)
@test length(u) == length(v)
@test_throws BoundsError u[0]
@test_throws BoundsError u[0] = 41
@test u == v
for row in eachindex(v)
u[row] = 10 + row
@test u[row] == 10 + row
@test v[row] == 10 + row
end
@test u == v
@test_throws BoundsError u[length(u) + 1]
@test_throws BoundsError u[length(u) + 1] = 41
end
end
@testitem "RowProjectionMatrix" begin
@testset "invalid row bounds" begin
M = [1 2 3; 4 5 6; 7 8 9]
@test_throws BoundsError RowProjectionMatrix(M, 0)
@test_throws BoundsError RowProjectionMatrix(M, 0, 1)
@test_throws BoundsError RowProjectionMatrix(M, 1, 0)
@test_throws BoundsError RowProjectionMatrix(M, 4)
@test_throws BoundsError RowProjectionMatrix(M, 1, 4)
@test_throws BoundsError RowProjectionMatrix(M, 4, 1)
end
@testset "empty projection" begin
M = [1 2 3; 4 5 6; 7 8 9]
A = RowProjectionMatrix(M, Int[])
@test A isa RowProjectionMatrix{Int}
@test size(A) == (0, size(M, 2))
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 41
@test_throws BoundsError A[0]
@test_throws BoundsError A[0] = 41
@test_throws BoundsError A[1]
@test_throws BoundsError A[1] = 41
@test_throws BoundsError A[1, 1]
@test_throws BoundsError A[1, 1] = 41
@test_throws BoundsError A[2]
@test_throws BoundsError A[2] = 41
A = RowProjectionMatrix(M)
@test A isa RowProjectionMatrix{Int}
@test size(A) == (0, size(M, 2))
@test length(A) == 0
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 41
@test_throws BoundsError A[0]
@test_throws BoundsError A[0] = 41
@test_throws BoundsError A[1]
@test_throws BoundsError A[1] = 41
@test_throws BoundsError A[1, 1]
@test_throws BoundsError A[1, 1] = 41
@test_throws BoundsError A[2]
@test_throws BoundsError A[2] = 41
end
@testset "single row" begin
M = [1 2 3; 4 5 6; 7 8 9]
for row ∈ axes(M, 1)
A = RowProjectionMatrix(M, row)
@test A isa RowProjectionMatrix{Int}
@test size(A) == (1, size(M, 2))
@test length(A) == size(M, 1)
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 41
@test_throws BoundsError A[0]
@test_throws BoundsError A[0] = 41
for col ∈ axes(M, 2)
@test A[col] == M[row, col]
@test A[1, col] == M[row, col]
A[col] = row + col
@test A[col] == row + col
@test A[1, col] == row + col
@test M[row, col] == row + col
A[1, col] = 10 + row + col
@test A[col] == 10 + row + col
@test A[1, col] == 10 + row + col
@test M[row, col] == 10 + row + col
M[row, col] = 100 + row + col
@test A[col] == 100 + row + col
@test A[1, col] == 100 + row + col
end
@test_throws BoundsError A[length(A) + 1]
@test_throws BoundsError A[length(A) + 1] = 41
end
end
@testset "row subset" begin
M = [1 2 3; 4 5 6; 7 8 9]
A = RowProjectionMatrix(M, 3, 1)
@test A isa RowProjectionMatrix{Int}
@test size(A) == (2, size(M, 2))
@test length(A) == 2 * size(M, 2)
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 41
@test_throws BoundsError A[0]
@test_throws BoundsError A[0] = 41
@test A[1, :] == M[3, :]
A[1, :] .= [11, 12, 13]
@test A[1, :] == M[3, :] == [11, 12, 13]
@test A[2, :] == M[1, :]
A[2, :] .= [21, 22, 23]
@test A[2, :] == M[1, :] == [21, 22, 23]
@test_throws BoundsError A[length(A) + 1]
@test_throws BoundsError A[length(A) + 1] = 41
end
@testset "row bag" begin
M = [1 2 3; 4 5 6; 7 8 9]
A = RowProjectionMatrix(M, 2, 2)
@test A isa RowProjectionMatrix{Int}
@test size(A) == (2, size(M, 2))
@test length(A) == 2 * size(M, 2)
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 41
@test_throws BoundsError A[0]
@test_throws BoundsError A[0] = 41
@test A[1, :] == A[2, :] == M[2, :]
A[1, :] .= [11, 12, 13]
@test A[1, :] == A[2, :] == M[2, :] == [11, 12, 13]
A[2, :] .= [21, 22, 23]
@test A[1, :] == A[2, :] == M[2, :] == [21, 22, 23]
@test_throws BoundsError A[length(A) + 1]
@test_throws BoundsError A[length(A) + 1] = 41
end
@testset "full projection" begin
M = [1 2 3; 4 5 6; 7 8 9]
A = RowProjectionMatrix(M, 1, 2, 3)
@test A isa RowProjectionMatrix{Int}
@test size(A) == size(M)
@test length(A) == length(M)
@test_throws BoundsError A[]
@test_throws BoundsError A[] = 41
@test_throws BoundsError A[0]
@test_throws BoundsError A[0] = 41
@test A == M
for row ∈ axes(M, 1)
for col ∈ axes(M, 2)
@test A[row, col] == M[row, col]
A[row, col] = 10 + row + col
@test A[row, col] == 10 + row + col
@test M[row, col] == 10 + row + col
end
end
@test_throws BoundsError A[length(A) + 1]
@test_throws BoundsError A[length(A) + 1] = 41
end
end
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | code | 54 | using TestItemRunner
@run_package_tests verbose=true
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | docs | 1766 | # Implicit arrays for Julia
[](https://github.com/tkemmer/ImplicitArrays.jl/actions/workflows/CI.yml)
[](https://github.com/tkemmer/ImplicitArrays.jl/blob/master/LICENSE)
[](https://tkemmer.github.io/ImplicitArrays.jl/stable)
[](https://tkemmer.github.io/ImplicitArrays.jl/dev)
The `ImplicitArrays.jl` package provides multiple implicit array types for the [Julia](https://julialang.org) programming language.
## Implicit array types
A full list of implicit array types provided by this package (along with code examples) is available in the [documentation](https://tkemmer.github.io/ImplicitArrays.jl/dev).
## Installation
This package version requires Julia 1.6 or above. In the Julia shell, switch to the
`Pkg` shell by pressing `]` and enter the following command:
```sh
pkg> add ImplicitArrays
```
## Testing
`ImplicitArrays.jl` provides tests for most of its functions. You can run the test suite with the
following command in the `Pkg` shell:
```sh
pkg> test ImplicitArrays
```
## Citing
If you use `ImplicitArrays.jl` in your research, please cite the following publication:
> Kemmer, T (2021). Space-efficient and exact system representations for the nonlocal protein
> electrostatics problem. Ph. D. thesis, Johannes Gutenberg University Mainz. Mainz, Germany.
Citation items for BibTeX can be found in [CITATION.bib](https://github.com/tkemmer/ImplicitArrays.jl/blob/master/CITATION.bib).
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 0.2.3 | a9e896d663c5a02d019fd95ac786bf14920175b5 | docs | 1842 | ```@meta
CurrentModule = ImplicitArrays
```
# ImplicitArrays.jl
The `ImplicitArrays.jl` package provides multiple implicit array types for the [Julia](https://julialang.org) programming language. In many situations, the implicit array types can be used as drop-in replacements for regular Julia arrays, while carrying a smaller memory footprints as their explicit counterparts.
## Block matrices
This section presents a [block matrix](https://en.wikipedia.org/wiki/Block_matrix) type for equally-sized blocks (sharing a common element type). The `BlockMatrix` type can be used to encapsulate and mix different matrix blocks, e.g., regular matrices and implicit matrices at the same time.
```@docs
BlockMatrix
```
## Fixed-value arrays
Fixed-value arrays "replicate" a single value across arbitrary array dimensions. The resulting arrays have a constant memory footprint (i.e., the represented value and the array dimensions) and can only be read from.
```@docs
FixedValueArray
```
## Interaction matrices
An interaction matrix `M` of size `n × m` consist of a list of `n` elements `rᵢ ∈ R` (*row elements*), a list of `m` elements `cⱼ ∈ C` (*column elements*), and a *interaction function* `f: R × C → T`, such that each element `Mᵢⱼ` of the matrix can be computed as `f(rᵢ, cⱼ)`.
### Interaction functions
```@docs
InteractionFunction
ConstInteractionFunction
GenericInteractionFunction
```
### Interaction matrices
```@docs
InteractionMatrix
```
## Row-projection arrays
Row-projection arrays represent views on existing vectors or matrices, where the projections are created from a sequence of valid row indices corresponding to the vector or matrix. Row indices can occur multiple times and at arbitrary positions in the sequence.
```@docs
RowProjectionVector
RowProjectionMatrix
```
| ImplicitArrays | https://github.com/tkemmer/ImplicitArrays.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1111 | cd(@__DIR__)
using TimeseriesSurrogates, StatsAPI
pages = [
"Documentation" => "index.md",
"man/whatisasurrogate.md",
"Example applications" => [
"Shuffle-based" => "methods/randomshuffle.md",
"Fourier-based" => "methods/fourier_surrogates.md",
"Wavelet-based" => "methods/wls.md",
"Pseudo-periodic" => "methods/pps.md",
"Pseudo-periodic twin" => "methods/ppts.md",
"Multidimensional surrogates" => "methods/multidim.md",
"Surrogates for irregular timeseries" => "collections/irregular_surrogates.md",
"Surrogates for nonstationary timeseries" => "collections/nonstationary_surrogates.md"
],
"man/exampleprocesses.md",
"contributor_guide.md"
]
import Downloads
Downloads.download(
"https://raw.githubusercontent.com/JuliaDynamics/doctheme/master/build_docs_with_style.jl",
joinpath(@__DIR__, "build_docs_with_style.jl")
)
include("build_docs_with_style.jl")
build_docs_with_style(pages, TimeseriesSurrogates, StatsAPI;
expandfirst = ["index.md"],
authors = "Kristian Agasøster Haaga, George Datseris",
)
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 492 | module TimeseriesSurrogatesUncertainData
using TimeseriesSurrogates
import UncertainData: UncertainDataset, UncertainIndexDataset, UncertainValueDataset, resample
TimeseriesSurrogates.surrogate(x::UncertainDataset, method::Surrogate) = surrogate(resample(x), method)
TimeseriesSurrogates.surrogate(x::UncertainValueDataset, method::Surrogate) = surrogate(resample(x), method)
TimeseriesSurrogates.surrogate(x::UncertainIndexDataset, method::Surrogate) = surrogate(resample(x), method)
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1390 | module TimeseriesSurrogatesVisualizations
using TimeseriesSurrogates, Makie
function TimeseriesSurrogates.surroplot!(fig, x, a;
cx="#191E44", cs=("#7143E0", 0.9), nbins=50, kwargs...
)
t = 1:length(x)
# make surrogate timeseries (allow possibility for `a` to be a timeseries or method)
s = a isa Surrogate ? surrogate(x, a) : a
# Time series
ax1, _ = Makie.lines(fig[1, 1], t, x; color=cx, linewidth=2)
Makie.lines!(ax1, t, s; color=cs, linewidth=2)
# Binned multitaper periodograms
p, psurr = TimeseriesSurrogates.DSP.mt_pgram(x), TimeseriesSurrogates.DSP.mt_pgram(s)
ax3 = Makie.Axis(fig[2, 1]; yscale=log10)
Makie.lines!(ax3, p.freq, p.power; color=cx, linewidth=3)
Makie.lines!(ax3, psurr.freq, psurr.power; color=cs, linewidth=3)
# Histograms
ax4 = Makie.Axis(fig[3, 1])
Makie.hist!(ax4, x; label="original", bins=nbins, color=cx)
Makie.hist!(ax4, s; label="surrogate", bins=nbins, color=cs)
Makie.axislegend(ax4)
ax1.xlabel = "time step"
ax1.ylabel = "value"
ax3.xlabel = "frequency"
ax3.ylabel = "power"
ax4.xlabel = "binned value"
ax4.ylabel = "histogram"
return fig
end
function TimeseriesSurrogates.surroplot(x, s;
cx="#191E44", cs=("#7143E0", 0.9), nbins=50, kwargs...)
fig = Makie.Figure(size=(500, 500), kwargs...)
surroplot!(fig, x, s; cx, cs, nbins)
end
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 2701 | # Activate the current directory and load packages.
using Pkg;
Pkg.activate(@__DIR__)
Pkg.instantiate()
using DelimitedFiles, TimeseriesSurrogates, BenchmarkTools, Plots, Distributions,
DynamicalSystems, Random, StatsPlots;
# Use GR backend for plotting.
gr()
x = readdlm("$(@__DIR__)/timeseries.csv")[:, 1]
# Reproducibility (note: this is not possible using Lancaster et al.'s MATLAB code.)
rng = Random.MersenneTwister(1234);
# Pre-initialize all different surrogate types
# ------------------------------------------
# Shuffle based surrogates
rs = surrogenerator(x, RandomShuffle(), rng)
rp = surrogenerator(x, RandomFourier(true), rng)
aaft = surrogenerator(x, AAFT(), rng)
iaaft = surrogenerator(x, IAAFT(), rng)
# Pseudoperiodic surrogates (PPS). Here, as in "timings.m", we use a subset of 500 time
# series points.
x_pps = x[1:1000]
τ = estimate_delay(x_pps, "ac_min")
d = findmin(delay_fnn(x_pps, τ))[2]
ρ = noiseradius(x_pps, d, τ, 0.025:0.025:0.5)
pps = surrogenerator(x_pps, PseudoPeriodic(d, τ, ρ, true))
# Collect surrogate generators and run once to trigger precompilation
surrogens = [rs, rp, aaft, iaaft, pps];
surrogates = [s() for s in surrogens];
# Define labels for plot.
methods = ["RandomShuffle()", "RandomFourier(true)", "AAFT()", "IAAFT()", "PseudoPeriodic()"];
n_methods = length(methods)
function generate_surrs(surrogenerator, n)
for i = 1:n
surrogenerator()
end
end
"""
time_n(methods; n = 100)
Compute `n` surrogates using each pre-initialized `Surrogenerator` in `methods` and compute the
mean time to generate a surrogate.
"""
function time_n(methods; n = 100)
benchmarks = zeros(length(methods))
for (i, surrogen) in enumerate(methods)
benchmarks[i] = @belapsed generate_surrs($surrogen, $n)
end
return benchmarks ./ n
end
time_n(surrogens, n = 1);
# Like in `timings.m`, compute average time to generate surrogate over 500
# realizations of each surrogate type
timings = time_n(surrogens, n = 500);
# Import the timings we generated using the `timings.m` MATLAB script.
# The ordering in that file is [rp, ft, aaft, iaaft, pps];
matlab_timings = readdlm("$(@__DIR__)/matlab_timings.csv")[:, 1]
# Plot the results
x = repeat(methods, outer = 2)
gp = repeat(["TimeseriesSurrogates.jl", "MATLAB"], inner = 5)
c = repeat(["Black", "Red"], inner = 5)
groupedbar(
[timings matlab_timings],
group = gp,
c = c,
xrotation = 45,
ylabel = "Mean runtime (s)",
yaxis = :log10,
yticks = [10.0^(i) for i = -6:0.5:-1],
ylims = (10^-6, 10^-1),
xticks = (1:5, ["rp", "ft", "aaft", "iaaft", "pps"]),
legend = :topleft,
)
savefig("$(@__DIR__)/../../figs/timings.png") | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1216 | module TimeseriesSurrogates
# Use the README as the module docs
@doc let
path = joinpath(dirname(@__DIR__), "README.md")
include_dependency(path)
read(path, String)
end TimeseriesSurrogates
using Random
using Distributions
using Distances # Will be used by the LombScargle method
using AbstractFFTs
using DSP
using Interpolations
using Wavelets
using StateSpaceSets
export standardize
include("core/api.jl")
include("core/surrogate_test.jl")
include("utils/testsystems.jl")
include("plotting/surrogate_plot.jl")
# The different surrogate routines
include("methods/randomshuffle.jl")
include("methods/large_shuffle.jl")
include("methods/randomfourier.jl")
include("methods/aaft.jl")
include("methods/iaaft.jl")
include("methods/truncated_fourier.jl")
include("methods/partial_randomization.jl")
include("methods/relative_partial_randomization.jl")
include("methods/spectral_partial_randomization.jl")
include("methods/wavelet_based.jl")
include("methods/pseudoperiodic.jl")
include("methods/pseudoperiodic_twin.jl")
include("methods/multidimensional.jl")
include("methods/ar.jl")
include("methods/trend_based.jl")
# Methods for irregular time series
include("methods/lombscargle.jl")
end # module
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 2390 | export surrogate, surrogenerator, Surrogate
"""Supertype of all surrogate methods."""
abstract type Surrogate end
struct SurrogateGenerator{S<:Surrogate, X, Y, A, R<:AbstractRNG}
method::S # method with its input parameters
x::X # input timeseries
s::Y # surrogate (usually same type as `x`, but not always)
init::A # pre-initialized things that speed up process
rng::R # random number generator object
end
"""
surrogenerator(x, method::Surrogate [, rng]) → sgen::SurrogateGenerator
Initialize a generator that creates surrogates of `x` on demand, based on the given `method`.
This is more efficient than [`surrogate`](@ref),
because for most methods some things can be initialized and reused
for every surrogate. Optionally you can provide an `rng::AbstractRNG` object that will
control the random number generation and hence establish reproducibility of the
generated surrogates. By default `Random.default_rng()` is used.
The generated surrogates overwrite, in-place, a common vector container.
Use `copy` if you need to actually store multiple surrogates.
To generate a surrogate, call `sgen` as a function with no arguments, e.g.:
```julia
sgen = surrogenerator(x, method)
s = sgen()
```
You can use the generator syntax of Julia to map over surrogates
generated by `sg`. For example, let `q` be a function returning a discriminatory statistic.
To test some null hypothesis with TimeseriesSurrogates.jl you'd do
```julia
using TimeseriesSurrogates
q, x # inputs
method = RandomFourier() # some example method
sgen = surrogenerator(x, method)
siter = (sgen() for _ in 1:1000)
qx = q(x)
qs = map(q, siter)
# compare `qx` with quantiles
using Statistics: quantile
q01, q99 = quantile(qs, [0.01, 0.99])
q01 ≤ qx ≤ q99 # if false, hypothesis can be rejected!
```
"""
function surrogenerator end
function Base.show(io::IO, sg::SurrogateGenerator)
println(io, "Surrogate generator for input timeseries $(summary(sg.x)) with method:")
show(io, sg.method)
end
"""
surrogate(x, method::Surrogate [, rng]) → s
Create a single surrogate timeseries `s` from `x` based on the given `method`.
If you want to generate multiple surrogates from `x`, you should use [`surrogenerator`](@ref)
for better performance.
"""
function surrogate(x, method::Surrogate, rng = Random.default_rng())
sg = surrogenerator(x, method, rng)
sg()
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 4437 | using Random: AbstractRNG
import StatsAPI: HypothesisTest, pvalue
export SurrogateTest, pvalue, fill_surrogate_test!
using Base.Threads
"""
SurrogateTest(f::Function, x, method::Surrogate; kwargs...) → test
Initialize a surrogate test for input data `x`, which can be used in [`pvalue`](@ref).
The tests requires as input a function `f` that given a timeseries (like `x`) it
outputs a real number, and a method of how to generate surrogates.
`f` is the function that computes the discriminatory statistic.
Once called with [`pvalue`](@ref), the `test` estimates and then
stores the real value `rval` and surrogate
values `vals` of the discriminatory statistic in the fields `rval, vals` respectively.
Alternatively, you can use [`fill_surrogate_test!`](@ref) directly if you don't care about
the p-value.
`SurrogateTest` automates the process described in the documentation page
[Performing surrogate hypothesis tests](@ref).
`SurrogateTest` subtypes `HypothesisTest` and is part of the StatsAPI.jl interface.
## Keywords
- `rng = Random.default_rng()`: a random number generator.
- `n::Int = 10_000`: how many surrogates to generate and compute `f` on.
- `threaded = true`: Whether to parallelize looping over surrogate computations in
to the available threads (`Threads.nthreads()`).
"""
struct SurrogateTest{F<:Function, S<:SurrogateGenerator, X<:Real} <: HypothesisTest
f::F
sgens::Vector{S}
# fields that are filled whenever a function is called
# for pretty printing or for keeping track of results
rval::X
vals::Vector{X}
threaded::Bool
end
function SurrogateTest(f::F, x, s::Surrogate;
rng = Random.default_rng(), n = 10_000, threaded = true
) where {F<:Function}
if threaded
seeds = rand(rng, 1:typemax(Int), Threads.nthreads())
sgens = [surrogenerator(x, s, Random.Xoshiro(seed)) for seed in seeds]
else
sgens = [surrogenerator(x, s, rng)]
end
rval = f(x)
X = typeof(rval)
vals = zeros(X, n)
return SurrogateTest{F, typeof(first(sgens)), X}(f, sgens, rval, vals, threaded)
end
# Pretty printing
function Base.show(io::IO, ::MIME"text/plain", test::SurrogateTest)
descriptors = [
"discr. statistic" => nameof(test.f),
"surrogate method" => nameof(typeof(first(test.sgens).method)),
"input timeseries" => summary(test.sgens[1].x),
"# of surrogates" => length(test.vals),
]
padlen = maximum(length(d[1]) for d in descriptors) + 3
print(io, "SurrogateTest")
for (desc, val) in descriptors
print(io, '\n', rpad(" $(desc): ", padlen), val)
end
return
end
"""
fill_surrogate_test!(test::SurrgateTest) → rval, vals
Perform the computations foreseen by `test` and return
the value of the discriminatory statistic for the real data `rval`
and the distribution of values for the surrogates `vals`.
This function is called by `pvalue`.
"""
function fill_surrogate_test!(test::SurrogateTest)
if test.threaded
@inbounds Threads.@threads for i in eachindex(test.vals)
sgen = test.sgens[Threads.threadid()]
test.vals[i] = test.f(sgen())
end
else
sgen = first(sgens)
@inbounds for i in eachindex(test.vals)
test.vals[i] = test.f(sgen())
end
end
return test.rval, test.vals
end
"""
pvalue(test::SurrogateTest; tail = :left)
Return the [p-value](https://en.wikipedia.org/wiki/P-value) corresponding to the given
[`SurrogateTest`](@ref), optionally specifying what kind of tail test to do
(one of `:left, :right, :both`).
For [`SurrogateTest`](@ref), the p-value is simply the proportion of surrogate statistics
that exceed (for `tail = :right`) or subseed (`tail = :left`) the discriminatory
statistic computed from the input data.
The default value of `tail` assumes that the surrogate data are expected to have higher
discriminatory statistic values. This is the case for statistics that quantify entropy.
For statistics that quantify autocorrelation, use `tail = :right` instead.
"""
function pvalue(test::SurrogateTest; tail = :left)
rval, vals = fill_surrogate_test!(test)
if tail == :right
p = count(v -> v ≥ rval, vals)
elseif tail == :left
p = count(v -> v ≤ rval, vals)
else
pr = count(v -> v ≥ rval, vals)
pl = count(v -> v ≤ rval, vals)
p = 2min(pr, pl)
end
return p/length(vals)
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1700 | export AAFT
"""
AAFT()
An amplitude-adjusted-fourier-transform (AAFT) surrogate[^Theiler1991].
AAFT surrogates have the same linear correlation, or periodogram, and also
preserves the amplitude distribution of the original data.
AAFT surrogates can be used to test the null hypothesis that the data come from a
monotonic nonlinear transformation of a linear Gaussian process
(also called integrated white noise)[^Theiler1991].
[^Theiler1991]: J. Theiler, S. Eubank, A. Longtin, B. Galdrikian, J. Farmer, Testing for nonlinearity in time series: The method of surrogate data, Physica D 58 (1–4) (1992) 77–94.
"""
struct AAFT <: Surrogate end
function surrogenerator(x, method::AAFT, rng = Random.default_rng())
n = length(x)
m = mean(x)
forward = plan_rfft(x)
inverse = plan_irfft(forward * x, n)
𝓕 = forward * (x .- m)
init = (
x_sorted = sort(x),
ix = zeros(Int, n),
inverse = inverse,
m = m,
𝓕 = 𝓕,
r = abs.(𝓕),
ϕ = angle.(𝓕),
shuffled𝓕 = similar(𝓕),
coeffs = zero(𝓕),
n = n,
)
return SurrogateGenerator(method, x, similar(x), init, rng)
end
function (sg::SurrogateGenerator{<:AAFT})()
s, rng = sg.s, sg.rng
init_fields = (:x_sorted, :ix, :inverse, :m, :r, :ϕ, :shuffled𝓕, :coeffs, :n)
x_sorted, ix, inverse, m, r, ϕ, shuffled𝓕, coeffs, n =
getfield.(Ref(sg.init), init_fields)
coeffs .= rand(rng, Uniform(0, 2π), length(shuffled𝓕))
shuffled𝓕 .= r .* exp.(coeffs .* 1im)
s .= (inverse * shuffled𝓕) .+ m
# Rescale back to original values to obtain AAFT surrogate.
sortperm!(ix, s)
s[ix] .= x_sorted
return s
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1861 | using DSP, Random
export AutoRegressive
"""
AutoRegressive(n, method = LPCLevinson())
Autoregressive surrogates of order-`n`. The autoregressive coefficients `φ` are estimated
using `DSP.lpc(x, n, method)`, and thus see the documentation of DSP.jl for possible
`method`s.
While these surrogates are obviously suited to test the null hypothesis whether the data
are coming from a autoregressive process, the Fourier Transform-based surrogates are
probably a better option. The current method is more like an explicit way to
produce surrogates for the same hypothesis by fitting a model.
It can be used as a convenient way to estimate
autoregressive coefficients and automatically generate surrogates based on them.
The coefficients φ of the autoregressive fit can be found by doing
```julia
sg = surrogenerator(x, AutoRegressive(n))
φ = sg.init.φ
```
"""
struct AutoRegressive{M} <: Surrogate
n::Int
m::M
end
AutoRegressive(n::Int) = AutoRegressive(n, LPCLevinson())
function surrogenerator(x, method::AutoRegressive, rng = Random.default_rng())
φ, e = lpc(x, method.n, method.m)
N, f = length(x), length(φ)
d = Normal(0, std(x))
init = (
d = d,
φ = φ,
N = N,
)
# The surrogate
T = typeof(d).parameters[1]
s = zeros(T, N + f)
return SurrogateGenerator(method, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:AutoRegressive})()
N, φ, d = sg.init.N, sg.init.φ, sg.init.d
return autoregressive!(sg.s, d, N, φ, sg.rng)
end
function autoregressive!(s, d::Normal{T}, N, φ, rng) where {T}
f = length(φ)
@inbounds for i in 1:f; s[i] = rand(rng, d); end
@inbounds for i in f+1:length(s)
s̃ = zero(T)
for j in 1:f
s̃ += φ[j] * s[i - j]
end
s̃ += rand(rng, d)
s[i] = s̃
end
return view(s, f+1:N+f)
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 4271 | export IAAFT
include("../utils/powerspectrum.jl")
include("../utils/interpolation.jl")
export IAAFT
"""
IAAFT(M = 100, tol = 1e-6, W = 75)
An iteratively adjusted amplitude-adjusted-fourier-transform surrogate[^SchreiberSchmitz1996].
IAAFT surrogates have the same linear correlation, or periodogram, and also
preserves the amplitude distribution of the original data, but are improved relative
to AAFT through iterative adjustment (which runs for a maximum of `M` steps).
During the iterative adjustment, the periodograms of the original signal and the
surrogate are coarse-grained and the powers are averaged over `W` equal-width
frequency bins. The iteration procedure ends when the relative deviation
between the periodograms is less than `tol` (or when `M` is reached).
IAAFT, just as AAFT, can be used to test the null hypothesis that the data
come from a monotonic nonlinear transformation of a linear Gaussian process.
[^SchreiberSchmitz1996]: T. Schreiber; A. Schmitz (1996). "Improved Surrogate Data for Nonlinearity Tests". [Phys. Rev. Lett. 77 (4)](https://journals.aps.org/prl/abstract/10.1103/PhysRevLett.77.635)
"""
struct IAAFT <: Surrogate
M::Int
tol::Real
W::Int
function IAAFT(;M::Int = 100, tol::Real = 1e-6, W::Int = 75)
new(M, tol, W)
end
end
Base.show(io::IO, x::IAAFT) = print(io, "IAAFT(M = $(x.M), tol = $(x.tol), W = $(x.W))")
function interpolated_spectrum(spectrum, n)
intp_spectrum = zeros(n)
interpolated_spectrum!(intp_spectrum, spectrum, n)
end
function interpolated_spectrum!(intp_spectrum, spectrum, n)
t = 1:length(spectrum)
r = getrange(t, n)
iₓ = itp(spectrum)
intp_spectrum .= iₓ.(r)
return intp_spectrum
end
function surrogenerator(x, method::IAAFT, rng = Random.default_rng())
m = mean(x)
x_sorted = sort(x)
forward = plan_rfft(x)
inverse = plan_irfft(forward * x, length(x))
𝓕 = forward * x
r = abs.(𝓕)
ϕ = abs.(𝓕)
ix = zeros(Int, length(x))
# Periodograms
𝓕p = prepare_spectrum(x, forward)
xpower = similar(𝓕) .|> real; powerspectrum!(𝓕p, xpower, x, forward)
spower = copy(xpower)
# Binned periodograms
xpowerᵦ = interpolated_spectrum(xpower, method.W)
spowerᵦ = interpolated_spectrum(spower, method.W)
init = (
forward = forward,
inverse = inverse,
𝓕 = 𝓕,
𝓕p = 𝓕p,
r = r,
ϕ = ϕ,
m = m,
x_sorted = x_sorted,
xpower = xpower,
spower = spower,
xpowerᵦ = xpowerᵦ,
spowerᵦ = spowerᵦ,
ix = ix,
)
return SurrogateGenerator(method, x, similar(x), init, rng)
end
using LinearAlgebra
function (sg::SurrogateGenerator{<:IAAFT})()
init_fields = (:forward, :inverse, :𝓕, :𝓕p, :r, :ϕ, :m, :x_sorted, :xpower, :spower, :xpowerᵦ, :spowerᵦ, :ix)
forward, inverse, 𝓕, 𝓕p, r, ϕ, m, x_sorted, xpower, spower, xpowerᵦ, spowerᵦ, ix = getfield.(Ref(sg.init), init_fields)
x, s, rng = sg.x, sg.s, sg.rng
M, W = sg.method.M, sg.method.W
tol = sg.method.tol
# Surrogate starts out as a random permutation of `x`
n = length(x)
s .= x[sample(rng, 1:n, n)]
sum_old, sum_new = 0.0, 0.0
iter = 1
while iter <= M
mul!(𝓕, forward, s)
ϕ .= angle.(𝓕)
𝓕 .= r .* exp.(ϕ .* 1im)
# TODO: Unfortunately, we can't simply do ldiv! here to avoid allocations.
# But, although FFTW does not yet have irfft!, it will probably have.
# See https://github.com/JuliaMath/FFTW.jl/pull/222.
# Once that PR is merged, we should replace the following line with
# the in-place version.
######################################################################
s .= inverse * 𝓕
sortperm!(ix, s)
s[ix] .= x_sorted
powerspectrum!(𝓕p, spower, s, forward)
interpolated_spectrum!(spowerᵦ, spower, W)
if iter == 1
sum_old = sum((xpowerᵦ .- xpowerᵦ) .^ 2) / sum(xpowerᵦ .^ 2)
else
sum_new = sum((xpowerᵦ .- spowerᵦ) .^ 2) / sum(xpowerᵦ .^ 2)
if abs(sum_old - sum_new) < tol
iter = M + 1
else
sum_old = sum_new
end
end
iter += 1
end
return s
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 7265 | export BlockShuffle, CycleShuffle, CircShift
#########################################################################
# BlockSuffle
#########################################################################
function get_uniform_blocklengths(L::Int, n::Int)
# Compute block lengths
N = floor(Int, L/n)
R = L % n
blocklengths = [N for i = 1:n]
for i = 1:R
blocklengths[i] += 1
end
return blocklengths
end
"""
BlockShuffle(n::Int; shift = false)
A block shuffle surrogate constructed by dividing the time series
into `n` blocks of roughly equal width at random indices (end
blocks are wrapped around to the start of the time series).
If `shift` is `true`, then the input signal is circularly shifted by a
random number of steps prior to picking blocks.
Block shuffle surrogates roughly preserve short-range temporal properties
in the time series (e.g. correlations at lags less than the block length),
but break any long-term dynamical information (e.g. correlations beyond
the block length).
Hence, these surrogates can be used to test any null hypothesis aimed at
comparing short-range dynamical properties versus long-range dynamical
properties of the signal.
"""
struct BlockShuffle{I <: Integer, B <: Bool} <: Surrogate
n::I
shift::B
function BlockShuffle(n::I; shift::B = false) where {I <: Integer, B <: Bool}
return new{I, B}(n, shift)
end
# Split time series into 10 pieces by default. Shifting disabled by default.
function BlockShuffle()
return new{Int, Bool}(10, false)
end
end
function surrogenerator(x::AbstractVector, bs::BlockShuffle, rng = Random.default_rng())
bs.n < length(x) || error("The number of blocks exceeds number of available points")
# The lengths of the blocks (one block will have a differing length if length of
# time series in not a multiple of the number of blocks, so )
blocklengths = get_uniform_blocklengths(length(x), bs.n)
# The start index of each block.
startinds = vcat(1, cumsum(blocklengths) .+ 1)
# The data from which we will sample. This array may be circularly shifted.
x_rotated = copy(x)
# The order in which we will draw the blocks. Will be shuffled every time
# a new surrogate is generated.
draw_order = collect(1:bs.n)
init = (
blocklengths = blocklengths,
startinds = startinds,
x_rotated = x_rotated,
draw_order = draw_order,
)
# The surrogate.
s = similar(x)
return SurrogateGenerator(bs, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:BlockShuffle})()
init_fields = (:blocklengths, :startinds, :x_rotated, :draw_order)
blocklengths, startinds, x_rotated, draw_order = getfield.(Ref(sg.init), init_fields)
x, s, n = sg.x, sg.s, sg.method.n
# Circular shift, if desired
if sg.method.shift
circshift!(x_rotated, x, rand(sg.rng, 1:length(x)))
end
# Shuffle blocks
shuffle!(sg.rng, draw_order)
k = 1
npts_sampled = 0
for i in draw_order
# The index of the data point which this block starts (in `x_rotated`)
sᵢ = startinds[i]
# The length of this block.
l = blocklengths[i]
# Indices of the block which is sampled.
ix_from = sᵢ:(sᵢ + l - 1)
# Indices in `s` into which this block will be placed.
ix_into = (npts_sampled + 1):(npts_sampled + 1 + l - 1)
# Do the assignment in-place behind a code barrier. This about
# 3x as efficient as doing an elementwise assignment and
# doesn't allocate.
assign_block_to_surrogate!(s, x_rotated, ix_into, ix_from)
npts_sampled += l
end
#@assert all(sort(s) .== sort(x_rotated))
return s
end
function assign_block_to_surrogate!(s, x_rotated, ix_into, ix_from)
@assert length(ix_into) == length(ix_from)
n = length(ix_into)
@inbounds for k = 1:n
ito = ix_into[k]
ifr = ix_from[k]
s[ito] = x_rotated[ifr]
end
end
#########################################################################
# CycleShuffle
#########################################################################
"""
CycleShuffle(n::Int = 7, σ = 0.5)
Cycle shuffled surrogates[^Theiler1994] that identify successive local peaks in the data and shuffle the
cycles in-between the peaks. Similar to [`BlockShuffle`](@ref), but here
the "blocks" are defined as follows:
1. The timeseries is smoothened via convolution with a Gaussian (`DSP.gaussian(n, σ)`).
2. Local maxima of the smoothened signal define the peaks, and thus the blocks in between them.
3. The first and last index of timeseries can never be peaks and thus signals that
should have peaks very close to start or end of the timeseries may not perform well. In addition,
points before the first or after the last peak are never shuffled.
3. The defined blocks are randomly shuffled as in [`BlockShuffle`](@ref).
CSS are used to test the null hypothesis that the signal is generated by a periodic
oscillator with no dynamical correlation between cycles,
i.e. the evolution of cycles is not deterministic.
See also [`PseudoPeriodic`](@ref).
[^Theiler1994]: J. Theiler, On the evidence for low-dimensional chaos in an epileptic electroencephalogram, [Phys. Lett. A 196](https://doi.org/10.1016/0375-9601(94)00856-K)
"""
struct CycleShuffle{T <: AbstractFloat} <: Surrogate
n::Int
σ::T
end
CycleShuffle(n = 7, σ = 0.5) = CycleShuffle{typeof(σ)}(n, σ)
function surrogenerator(x::AbstractVector, cs::CycleShuffle, rng = Random.default_rng())
n, N = cs.n, length(x)
g = DSP.gaussian(n, cs.σ)
smooth = DSP.conv(x, g)
r = length(smooth) - N
smooth = iseven(r) ? smooth[r÷2+1:end-r÷2] : smooth[r÷2+1:end-r÷2-1]
peaks = findall(i -> smooth[i-1] < smooth[i] && smooth[i] > smooth[i+1], 2:N-1)
blocks = [collect(peaks[i]:peaks[i+1]-1) for i in 1:length(peaks)-1]
init = (blocks = blocks, peak1 = peaks[1])
s = copy(x)
SurrogateGenerator(cs, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:CycleShuffle})()
blocks, peak1 = sg.init
x = sg.x
s = sg.s
shuffle!(sg.rng, blocks)
i = peak1
for b in blocks
s[(0:length(b)-1) .+ i] .= @view x[b]
i += length(b)
end
return s
end
#########################################################################
# Timeshift
#########################################################################
random_shift(n::Integer, rng) = n
random_shift(n::AbstractVector{<:Integer}, rng) = rand(rng, n)
"""
CircShift(n)
Surrogates that are circularly shifted versions of the original timeseries.
`n` can be an integer (the surrogate is the original time series shifted
by `n` indices), or any vector of integers, which which means that each
surrogate is shifted by an integer selected randomly among the entries in `n`.
"""
struct CircShift{N} <: Surrogate
n::N
end
function surrogenerator(x, sd::CircShift, rng = Random.default_rng())
return SurrogateGenerator(sd, x, similar(x), nothing, rng)
end
function (sg::SurrogateGenerator{<:CircShift})()
x, s = sg.x, sg.s
shift = random_shift(sg.method.n, sg.rng)
circshift!(s, x, shift)
return s
end | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 4618 | using LombScargle, Distances
export IrregularLombScargle
"""
IrregularLombScargle(t; tol = 1, n_total = 100000, n_acc = 50000, q = 1)
[`IrregularLombScargle`](@ref) surrogates for unevenly sampled time series
with supporting time steps `t`, generated using the simulated annealing algorithm
described in [^SchreiberSchmitz1999].
[`IrregularLombScargle`](@ref) surrogates (given enough iterations and a low enough
tolerance) preserve the periodogram and the amplitude
distribution of the original signal. For time series with equidistant time steps,
surrogates generated by this method result in surrogates similar to those produced
by the [`IAAFT`](@ref) method.
This algorithm starts with a random permutation of the original data. Then it iteratively
approaches the power spectrum of the original data by swapping two randomly selected values
in the surrogate data if the Minkowski distance of order `q` between the power spectrum of
the surrogate data and the original data is less than before. The iteration procedure ends
when the relative deviation between the periodograms is less than `tol` or when `n_total`
number of tries or `n_acc` number of actual swaps is reached.
[^SchmitzSchreiber1999]: A.Schmitz T.Schreiber (1999). "Testing for nonlinearity in unevenly sampled time series" [Phys. Rev E](https://journaIrregularLombScargle.aps.org/pre/pdf/10.1103/PhysRevE.59.4044)
"""
struct IrregularLombScargle{T<:AbstractVector, S<:Real} <: Surrogate
t::T
tol::S
n_total::Int
n_acc::Int
q::Int
end
IrregularLombScargle(t; tol = 1.0, n_total = 100000, n_acc = 50000, q = 1) = IrregularLombScargle(t, tol, n_total, n_acc, q)
function surrogenerator(x, method::IrregularLombScargle, rng = Random.default_rng())
# Plan Lombscargle periodogram. Use default flags.
lsplan = LombScargle.plan(method.t, x, fit_mean = false)
# Compute initial periodogram.
x_ls = lombscargle(lsplan)
# We have to copy the power vector here, because we are reusing `lsplan` later on
xpower = copy(x_ls.power)
# Use Minkowski distance of order q
dist = Distances.Minkowski(method.q)
# When re-computing the Lomb-Scargle periodogram, we will use the
# `_periodogram!` method, which re-uses the lsplan with a shuffled
# time vector. This is the same as shuffling the signal, so the
# surrogate starts out as a shuffled version of `t`.
s = shuffle(rng, method.t)
# Initialize a candidate surrogate.
candidate = zero(s)
init = (
lsplan = lsplan,
xpower = xpower,
n = length(x),
dist = dist,
candidate = candidate,
)
return SurrogateGenerator(method, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:IrregularLombScargle})()
lsplan, xpower, n, dist, candidate = sg.init
t, tol = sg.method.t, sg.method.tol
x, s, rng = sg.x, sg.s, sg.rng
# Power spectrum for the randomly shuffled signal.
spower = LombScargle._periodogram!(lsplan.P, s, lsplan)
# Compare power spectra for original (`xpower`) and randomly shuffled signal (`spower`).
lossold = Distances.evaluate(dist, xpower, spower)
range = 1:n
i = j = 0
while i < sg.method.n_total && j < sg.method.n_acc
if mod(i, 2000) == 0
@info "iterations: $i, swaps: $j, loss: $lossold"
end
# Initially, the new surrogate is identical to the existing surrogate.
copy!(candidate, s)
# Swap two random points and re-compute power spectrum for the candidate.
swap_elements!(candidate, s, rng, range)
# This is the bottleneck.
spower = LombScargle._periodogram!(lsplan.P, candidate, lsplan)
# If spectra are more similar after the swap, accept the new
# surrogate. Otherwise, do a new swap.
lossnew = evaluate(dist, xpower, spower)
if lossnew < lossold
lossnew <= tol && break
s = copy(candidate)
lossold = lossnew
j += 1
end
i += 1
end
@info "Terminated simulated annealing process after $i iterations and $j swaps. Loss: $lossold"
# Use the permutation of the time vector to permute the signal vector
# This gives us the inverse permutation from t to perm
perm = sortperm(sortperm(s))
# Check if this worked as expected
@assert t[perm] == s
# Re-scale back to original time series values.
return x[perm]
end
function swap_elements!(candidate, s, rng, range)
k = sample(rng, range)
l = sample(rng, range)
candidate[k] = s[l]
candidate[l] = s[k]
end | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 935 | using StateSpaceSets, Random
export ShuffleDimensions
"""
ShuffleDimensions()
Multidimensional surrogates of input `StateSpaceSet`s from StateSpaceSets.jl.
Each point in the set is individually shuffled, but the points themselves are
not shuffled.
These surrogates destroy the state space structure of the dataset and are thus
suited to distinguish deterministic datasets from high dimensional noise.
"""
struct ShuffleDimensions <: Surrogate end
function surrogenerator(x, sd::ShuffleDimensions, rng = Random.default_rng())
if !(x isa AbstractStateSpaceSet)
error("input `x` must be `AbstractStateSpaceSet` for `ShuffleDimensions`")
end
s = copy(x)
return SurrogateGenerator(sd, x, s, nothing, rng)
end
function (sg::SurrogateGenerator{<:ShuffleDimensions})()
s = sg.s
for i in eachindex(s)
@inbounds s[i] = shuffle(sg.rng, s[i])
end
return s
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 3471 | export PartialRandomization, PartialRandomizationAAFT
"""
PartialRandomization(α = 0.5)
`PartialRandomization` surrogates[^Ortega1998] are similar to [`RandomFourier`](@ref)
phase surrogates, but during the phase randomization step, instead of drawing phases
from `[0, 2π]`, phases are drawn from `[0, 2π]*α`, where `α ∈ [0, 1]`. The authors refers to `α` as the "degree" of phase randomization, where `α = 0` means `0 %` randomization
and `α = 1` means `100 %` randomization.
See [`RelativePartialRandomization`](@ref) and [`SpectralPartialRandomization`](@ref) for
alternative partial-randomization algorithms
[^Ortega1998]: Ortega, Guillermo J.; Louis, Enrique (1998). Smoothness Implies Determinism in Time Series: A Measure Based Approach. Physical Review Letters, 81(20), 4345–4348. doi:10.1103/PhysRevLett.81.4345
"""
struct PartialRandomization{T} <: Surrogate
α::T
function PartialRandomization(α::T=0.5) where T <: Real
0 <= α <= 1 || throw(ArgumentError("α must be between 0 and 1"))
return new{T}(α)
end
end
function surrogenerator(x::AbstractVector, rf::PartialRandomization, rng = Random.default_rng())
forward = plan_rfft(x)
inverse = plan_irfft(forward*x, length(x))
m = mean(x)
𝓕 = forward*(x .- m)
shuffled𝓕 = zero(𝓕)
s = similar(x)
n = length(𝓕)
r = abs.(𝓕)
ϕ = angle.(𝓕)
coeffs = zero(r)
init = (inverse = inverse, m = m, coeffs = coeffs, n = n, r = r,
ϕ = ϕ, shuffled𝓕 = shuffled𝓕)
return SurrogateGenerator(rf, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:PartialRandomization})()
inverse, m, coeffs, n, r, ϕ, shuffled𝓕 =
getfield.(Ref(sg.init),
(:inverse, :m, :coeffs, :n, :r, :ϕ, :shuffled𝓕))
s, rng = sg.s, sg.rng
α = sg.method.α
coeffs .= rand(rng, Uniform(0, 2π), n)
shuffled𝓕 .= r .* exp.(coeffs .* 1im .* α)
s .= inverse * shuffled𝓕 .+ m
return s
end
"""
PartialRandomizationAAFT(α = 0.5)
`PartialRandomizationAAFF` surrogates are similar to [`PartialRandomization`](@ref)
surrogates[^Ortega1998], but adds a rescaling step, so that the surrogate has
the same values as the original time series (analogous to the rescaling done for
[`AAFT`](@ref) surrogates).
Partial randomization surrogates have, to the package authors' knowledge, not been
published in scientific literature.
[^Ortega1998]: Ortega, Guillermo J.; Louis, Enrique (1998). Smoothness Implies Determinism in Time Series: A Measure Based Approach. Physical Review Letters, 81(20), 4345–4348. doi:10.1103/PhysRevLett.81.4345
"""
struct PartialRandomizationAAFT{T} <: Surrogate
α::T
function PartialRandomizationAAFT(α::T=0.5) where T <: Real
0 <= α <= 1 || throw(ArgumentError("α must be between 0 and 1"))
return new{T}(α)
end
end
function surrogenerator(x::AbstractVector, rf::PartialRandomizationAAFT, rng = Random.default_rng())
init = (
gen = surrogenerator(x, PartialRandomization(rf.α), rng),
ix = zeros(Int, length(x)),
x_sorted = sort(x),
)
s = similar(x)
return SurrogateGenerator(rf, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:PartialRandomizationAAFT})()
gen, ix, x_sorted = sg.init.gen, sg.init.ix, sg.init.x_sorted
s = sg.s
# Surrogate starts out as a PartialRandomization surrogate
s .= gen()
# Rescale to obtain a AAFT-like surrogate
sortperm!(ix, s)
s[ix] .= x_sorted
return s
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 4508 | using DelayEmbeddings, LinearAlgebra
export PseudoPeriodic, noiseradius
"""
PseudoPeriodic(d, τ, ρ, shift = true)
Create surrogates suitable for pseudo-periodic signals. They retain the periodic structure
of the signal, while inter-cycle dynamics that are either deterministic or correlated
noise are destroyed (for appropriate `ρ` choice).
Therefore these surrogates are suitable to test the null hypothesis
that the signal is a periodic orbit with uncorrelated noise[^Small2001].
Arguments `d, τ, ρ` are as in the paper, the embedding dimension, delay time and
noise radius. The method works by performing a delay coordinates embedding
from DelayEmbeddings.jl (see that docs for choosing appropriate `d, τ`).
For `ρ`, we have implemented
the method proposed in the paper in the function [`noiseradius`](@ref).
The argument `shift` is not discussed in the paper. If `shift=false`
we adjust the algorithm so that there is little phase shift between the
periodic component of the original and surrogate data.
See also [`CycleShuffle`](@ref).
[^Small2001]:
Small et al., Surrogate test for pseudoperiodic time series data,
[Physical Review Letters, 87(18)](https://doi.org/10.1103/PhysRevLett.87.188101)
"""
struct PseudoPeriodic{T<:Real} <: Surrogate
d::Int
τ::Int
ρ::T
shift::Bool
end
PseudoPeriodic(d, t, r) = PseudoPeriodic(d, t, r, true)
function surrogenerator(x::AbstractVector, pp::PseudoPeriodic, rng = Random.default_rng())
# in the following symbol `y` stands for `s` of the paper
d, τ = getfield.(Ref(pp), (:d, :τ))
N = length(x)
z = embed(x, d, τ)
Ñ = length(z)
w = zeros(eltype(z), Ñ-1) # weights vector
y = StateSpaceSet([z[1] for i in 1:N])
s = similar(x)
init = (y = y, w = w, z = z)
return SurrogateGenerator(pp, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:PseudoPeriodic})()
y, z, w = getfield.(Ref(sg.init), (:y, :z, :w))
ρ, shift = getfield.(Ref(sg.method), (:ρ, :shift))
pseudoperiodic!(sg.s, y, sg.x, z, w, ρ, shift, sg.rng)
end
# Low-level method, also used in `noiseradius`
function pseudoperiodic!(s, y, x, z, w, ρ, shift, rng)
N, Ñ = length.((x, z))
y[1] = shift ? rand(rng, z.data) : z[1]
@inbounds for i in 1:N-1
w .= (exp(-norm(z[t] - y[i])/ρ) for t in 1:Ñ-1)
j = sample(rng, 1:Ñ-1, pweights(w))
y[i+1] = z[j+1]
end
for (i, p) in enumerate(y); s[i] = p[1]; end
return s
end
"""
noiseradius(x::AbstractVector, d::Int, τ, ρs, n = 1) → ρ
Use the proposed* algorithm of[^Small2001] to estimate optimal `ρ` value for
[`PseudoPeriodic`](@ref) surrogates, where `ρs` is a vector of possible `ρ` values.
*The paper is ambiguous about exactly what to calculate. Here we count how many times
we have pairs of length-2 that are identical in `x` and its surrogate, but **are not**
also part of pairs of length-3.
This function directly returns the arg-maximum of the evaluated distribution of these counts
versus `ρ`, use `TimeseriesSurrogates._noiseradius` with same arguments to get the actual
distribution. `n` means to repeat τhe evaluation `n` times, which increases accuracy.
[^Small2001]: Small et al., Surrogate test for pseudoperiodic time series data, [Physical Review Letters, 87(18)](https://doi.org/10.1103/PhysRevLett.87.188101)
"""
function noiseradius(x::AbstractVector, d::Int, τ, ρs, n = 1)
l2n = _noiseradius(x, d, τ, ρs, n)
return ρs[argmax(l2n)]
end
function _noiseradius(x::AbstractVector, d::Int, τ, ρs, n = 1)
l2n = noiseradius(surrogenerator(x, PseudoPeriodic(d, τ, ρs[1])), ρs, n)
end
function noiseradius(sg::SurrogateGenerator{<:PseudoPeriodic}, ρs, n = 1)
l2n = zero(ρs) # length-2 number of points existing in both timeseries
y, z, w = getfield.(Ref(sg.init), (:y, :z, :w))
x, s = sg.x, sg.s
N = length(sg.x)
@inbounds for _ in 1:n
for (ℓ, ρ) in enumerate(ρs)
s̄ = pseudoperiodic!(s, y, x, z, w, ρ, sg.method.shift, sg.rng)
for i in 1:N-1
# TODO: This can be optimized heavily: checking x[i+2] already tells us
# that we shouldn't check x[i+1] on the next iteration.
l2n[ℓ] += count(j -> s̄[j]==x[i] && s̄[j+1]==x[i+1] && s̄[j+2]!=x[i+2], 1:N-2)
end
end
end
# TODO: here we can directly find maximum and return it as a single number
return l2n
end | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 6455 | export PseudoPeriodicTwin
export embed
using StatsBase: sample, pweights
using Distances: Euclidean, PreMetric, pairwise
using DelayEmbeddings: embed
"""
PseudoPeriodicTwin(d::Int, τ::Int, δ = 0.2, ρ = 0.1, metric = Euclidean())
PseudoPeriodicTwin(δ = 0.2, ρ = 0.1, metric = Euclidean())
A pseudoperiodic twin surrogate[^Miralles2015], which is a fusion of the
twin surrogate[^Thiel2006] and the pseudo-periodic surrogate[^Small2001].
## Input parameters
A delay reconstruction of the input timeseries is constructed using embedding
dimension `d` and embedding delay `τ`. The threshold `δ ∈ (0, 1]` determines which
points are "close" (neighbors) or not, and is expressed as a fraction of the
attractor diameter, as determined by the input data. The authors of the original
twin surrogate paper recommend `0.05 ≤ δ ≤ 0.2`[^Thiel2006].
If you have pre-embedded your timeseries, and timeseries is already a `::StateSpaceSet`, use the
three-argument constructor (so that no delay reconstruction is performed).
If you want a surrogate for a scalar-valued timeseries, use the five-argument constructor
to also provide the embedding delay `τ` and embedding dimension `d`.
## Null hypothesis
Pseudo-periodic twin surrogates generate signals similar to the original data if the
original signal is (quasi-)periodic. If the original signal is not
(quasi-)periodic, then these surrogates will have different
recurrence plots than the original signal, but preserve the overall
shape of the attractor. Thus, `PseudoPeriodicTwin` surrogates can be used to test
null hypothesis that the observed timeseries (or orbit) is consistent
with a quasi-periodic orbit[^Miralles2015].
## Returns
A `d`-dimensional surrogate orbit (a `StateSpaceSet`) is returned. Sample the first
column of this dataset if a scalar-valued surrogate is desired.
[^Small2001]: Small et al., Surrogate test for pseudoperiodic timeseries data, [Physical Review Letters, 87(18)](https://doi.org/10.1103/PhysRevLett.87.188101)
[^Thiel2006]: Thiel, Marco, et al. "Twin surrogates to test for complex synchronisation." EPL (Europhysics Letters) 75.4 (2006): 535.
[^Miralles2015]: Miralles, R., et al. "Characterization of the complexity in short oscillating timeseries: An application to seismic airgun detonations." The Journal of the Acoustical Society of America 138.3 (2015): 1595-1603.
"""
struct PseudoPeriodicTwin{T<:Real, P<:Real, D<:PreMetric} <: Surrogate
d::Union{Nothing, Int}
τ::Union{Nothing, Int}
δ::T
ρ::P
metric::D
function PseudoPeriodicTwin(d::Int, τ::Int, δ::T = 0.2, ρ::P = 0.1, metric::D = Euclidean()) where {T, P, D}
new{T, P, D}(d, τ, δ, ρ, metric)
end
function PseudoPeriodicTwin(δ::T = 0.2, ρ::P = 0.1, metric::D = Euclidean()) where {T, P, D}
new{T, P, D}(nothing, nothing, δ, ρ, metric)
end
end
"""
_prepare_embed(x::AbstractVector, d, τ) → StateSpaceSet
_prepare_embed(x::StateSpaceSet, d, τ) → StateSpaceSet
Prepate input data for surrogate generation. If input is a vector, embed it using
the provided parameters. If input as a dataset, we assume it already represents an
orbit.
"""
function _prepare_embed end
_prepare_embed(x::AbstractVector, d, τ) = embed(x, d, τ)
_prepare_embed(x::StateSpaceSet, d, τ) = x
function surrogenerator(x::Union{AbstractVector, StateSpaceSet}, pp::PseudoPeriodicTwin, rng = Random.default_rng())
d, τ, δ, metric = getfield.(Ref(pp), (:d, :τ, :δ, :metric))
ρ = getfield.(Ref(pp), (:ρ))
pts = _prepare_embed(x, d, τ)
Nx = length(x)
Npts = length(pts)
dists = pairwise(metric, Matrix(pts), dims = 1)
normalisedδ = δ*maximum(dists)
T = eltype(pts)
R = zeros(T, Npts, Npts)
# Recurrence matrix
for j = 1:Npts
for i = 1:Npts
R[i, j] = normalisedδ - dists[i, j] >= 0 ? 1.0 : 0.0
end
end
# Identify twins
#println("R contains $(count(R .== 1)/length(R)*100)% black dots")
twins_i = Vector{Int}(undef, 0)
twins_j = Vector{Int}(undef, 0)
for j = 1:Npts
for i = 1:Npts
if i !== j && all(R[:, i] .≈ R[:, j])
push!(twins_i, i)
push!(twins_j, j)
end
end
end
#println("Found $(length(twins)) twins")
twins = Dict{Int,Vector{Int}}()
# For every point that has a twin, store the indices of all of its twins
for twi in unique(twins_i)
twins[twi] = twins_j[findall(twins_i .== twi)]
end
for twj in unique(twins_j)
twins[twj] = twins_i[findall(twins_j .== twj)]
end
# Sampling weights (exclude the point itself)
W = [pweights(exp.(-dists[setdiff(1:Npts, i), i] / ρ)) for i = 1:Npts]
# The surrogate will be a vector of vectors (if pts is a StateSpaceSet, then
# the eltype is SVector).
PT = eltype(pts.data)
s = Vector{PT}(undef, Nx)
init = (pts = pts, Nx = Nx, Npts = Npts, dists = dists, R = R, twins = twins, W = W)
return SurrogateGenerator(pp, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:PseudoPeriodicTwin})()
pts, Nx, Npts, twins, W = getfield.(Ref(sg.init), (:pts, :Nx, :Npts, :twins, :W))
ρ = getfield.(Ref(sg.method), (:ρ))
s = sg.s
# Randomly pick a point from the state space as the starting point for the surrogate.
n = 1
i = rand(sg.rng, 1:Npts)
s[n] = pts[i]
while n < Nx
# Look for possible twins of the point xᵢ. If any twin exists, jump to one of them
# with probability 1/nⱼ, where nⱼ are the number of twins for the point xᵢ.
if haskey(twins, i)
# sample uniformly (with probability 1/ntargettwins) over possible target twins
j = twins[i][rand(sg.rng, 1:length(twins[i]))]
s[n] = pts[j]
i = j
n += 1
end
# The orbit moves on from the current point xᵢ to a randomly selected point
# on the attractor. Closer points are more likely to be selected, and points
# further away are less likely to be selected. The sampling probability
# of the next point xⱼ decreases exponentially with increasing distance
# from the current point xᵢ. Probabilities for jumping from xᵢ to any other
# point have been pre-computed, and are stored in W[i].
j = sample(sg.rng, 1:Npts, W[i])
s[n] = pts[j]
i = j
n += 1
end
s[Nx] = pts[sample(1:Npts, W[i])[1]]
return StateSpaceSet(s)
end | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 2125 | using Random
using LinearAlgebra
export RandomFourier, FT
"""
RandomFourier(phases = true)
A surrogate that randomizes the Fourier components
of the signal in some manner. If `phases==true`, the phases are randomized,
otherwise the amplitudes are randomized. `FT` is an alias for `RandomFourier`.
Random Fourier phase surrogates[^Theiler1991] preserve the
autocorrelation function, or power spectrum, of the original signal.
Random Fourier amplitude surrogates preserve the mean and autocorrelation
function but do not preserve the variance of the original. Random
amplitude surrogates are not common in the literature, but are provided
for convenience.
Random phase surrogates can be used to test the null hypothesis that
the original signal was produced by a linear Gaussian process [^Theiler1991].
[^Theiler1991]: J. Theiler, S. Eubank, A. Longtin, B. Galdrikian, J. Farmer, Testing for nonlinearity in time series: The method of surrogate data, Physica D 58 (1–4) (1992) 77–94.
"""
struct RandomFourier <: Surrogate
phases::Bool
end
RandomFourier() = RandomFourier(true)
const FT = RandomFourier
function surrogenerator(x::AbstractVector, rf::RandomFourier, rng = Random.default_rng())
forward = plan_rfft(x)
inverse = plan_irfft(forward*x, length(x))
m = mean(x)
𝓕 = forward*(x .- m)
shuffled𝓕 = zero(𝓕)
s = similar(x)
n = length(𝓕)
r = abs.(𝓕)
ϕ = angle.(𝓕)
coeffs = zero(r)
init = (inverse = inverse, m = m, coeffs = coeffs, n = n, r = r,
ϕ = ϕ, shuffled𝓕 = shuffled𝓕)
return SurrogateGenerator(rf, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:RandomFourier})()
inverse, m, coeffs, n, r, ϕ, shuffled𝓕 =
getfield.(Ref(sg.init),
(:inverse, :m, :coeffs, :n, :r, :ϕ, :shuffled𝓕))
s, rng, phases = sg.s, sg.rng, sg.method.phases
if phases
rand!(rng, Uniform(0, 2π), coeffs)
shuffled𝓕 .= r .* exp.(coeffs .* 1im)
else
coeffs .= r .* rand(rng, Uniform(0, 2π), n)
shuffled𝓕 .= coeffs .* exp.(ϕ .* 1im)
end
mul!(s, inverse, shuffled𝓕)
s .+= m
return s
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1552 | using Random
export RandomShuffle
"""
RandomShuffle() <: Surrogate
A random constrained surrogate, generated by shifting values around.
Random shuffle surrogates preserve the mean, variance and amplitude
distribution of the original signal. Properties not preserved are *any
temporal information*, such as the power spectrum and hence linear
correlations.
The null hypothesis this method can test for is whether the data
are uncorrelated noise, possibly measured via a nonlinear function.
Specifically, random shuffle surrogate can test
the null hypothesis that the original signal is produced by independent and
identically distributed random variables[^Theiler1991, ^Lancaster2018].
*Beware: random shuffle surrogates do not cover the case of correlated noise*[^Lancaster2018].
[^Theiler1991]: J. Theiler, S. Eubank, A. Longtin, B. Galdrikian, J. Farmer, Testing for nonlinearity in time series: The method of surrogate data, Physica D 58 (1–4) (1992) 77–94.
"""
struct RandomShuffle <: Surrogate end
function surrogenerator(x::AbstractVector, rf::RandomShuffle, rng = Random.default_rng())
n = length(x)
idxs = collect(1:n)
init = (
permutation = zeros(Int, n),
idxs = idxs,
)
return SurrogateGenerator(rf, x, similar(x), init, rng)
end
function (sg::SurrogateGenerator{<:RandomShuffle})()
x, s, rng = sg.x, sg.s, sg.rng
permutation, idxs = getfield.(Ref(sg.init), (:permutation, :idxs))
sample!(rng, idxs, permutation; replace = false)
s .= x[permutation]
return s
end | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 2834 | export RelativePartialRandomization, RelativePartialRandomizationAAFT
"""
RelativePartialRandomization(α = 0.5)
`RelativePartialRandomization` surrogates are similar to [`PartialRandomization`](@ref)
phase surrogates, but instead of drawing phases uniformly from `[0, 2π]`, phases are drawn
from `ϕ + [0, 2π]*α`, where `α ∈ [0, 1]` and `ϕ` is the original Fourier phase.
See the documentation for a detailed comparison between partial randomization algorithms.
"""
struct RelativePartialRandomization{T} <: Surrogate
α::T
function RelativePartialRandomization(α::T=0.5) where T <: Real
0 <= α <= 1 || throw(ArgumentError("α must be between 0 and 1"))
return new{T}(α)
end
end
function surrogenerator(x::AbstractVector, rf::RelativePartialRandomization, rng = Random.default_rng())
forward = plan_rfft(x)
inverse = plan_irfft(forward*x, length(x))
m = mean(x)
𝓕 = forward*(x .- m)
shuffled𝓕 = zero(𝓕)
s = similar(x)
n = length(𝓕)
r = abs.(𝓕)
ϕ = angle.(𝓕)
coeffs = zero(r)
init = (; inverse, m, coeffs, n, r, ϕ, shuffled𝓕)
return SurrogateGenerator(rf, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:RelativePartialRandomization})()
inverse, m, coeffs, n, r, ϕ, shuffled𝓕 =
getfield.(Ref(sg.init),
(:inverse, :m, :coeffs, :n, :r, :ϕ, :shuffled𝓕))
s, rng = sg.s, sg.rng
α = sg.method.α
coeffs .= rand(rng, Uniform(0, 2π), n)
coeffs .= (ϕ .+ coeffs.*α)
shuffled𝓕 .= r .* cis.(coeffs)
s .= inverse * shuffled𝓕 .+ m
return s
end
"""
RelativePartialRandomizationAAFT(α = 0.5)
`RelativePartialRandomizationAAFT` surrogates are similar to
[`RelativePartialRandomization`](@ref) surrogates, but add a rescaling step, so that the
surrogate has the same values as the original time series (analogous to the rescaling done
for [`AAFT`](@ref) surrogates).
"""
struct RelativePartialRandomizationAAFT{T} <: Surrogate
α::T
function RelativePartialRandomizationAAFT(α::T=0.5) where T <: Real
0 <= α <= 1 || throw(ArgumentError("α must be between 0 and 1"))
return new{T}(α)
end
end
function surrogenerator(x::AbstractVector, rf::RelativePartialRandomizationAAFT, rng = Random.default_rng())
init = (
gen = surrogenerator(x, RelativePartialRandomization(rf.α), rng),
ix = zeros(Int, length(x)),
x_sorted = sort(x),
)
s = similar(x)
return SurrogateGenerator(rf, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:RelativePartialRandomizationAAFT})()
gen, ix, x_sorted = sg.init.gen, sg.init.ix, sg.init.x_sorted
s = sg.s
# Surrogate starts out as a RelativePartialRandomization surrogate
s .= gen()
# Rescale to obtain a AAFT-like surrogate
sortperm!(ix, s)
s[ix] .= x_sorted
return s
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 3075 | export SpectralPartialRandomization, SpectralPartialRandomizationAAFT
"""
SpectralSpectralPartialRandomization(α = 0.5)
`SpectralPartialRandomization` surrogates are similar to [`PartialRandomization`](@ref)
phase surrogates, but instead of drawing phases uniformly from `[0, 2π]`, phases of the
highest frequency components responsible for a proportion `α` of power are replaced by
random phases drawn from `[0, 2π]`
See the documentation for a detailed comparison between partial randomization algorithms.
"""
struct SpectralPartialRandomization{T} <: Surrogate
α::T
function SpectralPartialRandomization(α::T=0.5) where T <: Real
0 <= α <= 1 || throw(ArgumentError("α must be between 0 and 1"))
return new{T}(α)
end
end
function surrogenerator(x::AbstractVector, rf::SpectralPartialRandomization, rng = Random.default_rng())
forward = plan_rfft(x)
inverse = plan_irfft(forward*x, length(x))
m = mean(x)
𝓕 = forward*(x .- m)
shuffled𝓕 = zero(𝓕)
s = similar(x)
n = length(𝓕)
r = abs.(𝓕)
ϕ = angle.(𝓕)
coeffs = zero(r)
S = r.^2
S = S ./ sum(S[2:end]) # Ignore power due to the mean, S[1]
fthresh = findfirst(cumsum(S) .> 1 - rf.α)
isnothing(fthresh) && (fthresh = n+1)
init = (; inverse, m, coeffs, n, r, ϕ, shuffled𝓕, fthresh)
return SurrogateGenerator(rf, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:SpectralPartialRandomization})()
inverse, m, coeffs, n, r, ϕ, shuffled𝓕, fthresh =
getfield.(Ref(sg.init),
(:inverse, :m, :coeffs, :n, :r, :ϕ, :shuffled𝓕, :fthresh))
s, rng = sg.s, sg.rng
coeffs .= rand(rng, Uniform(0, 2π), n)
coeffs[1:fthresh-1] .= 0
coeffs .= (ϕ .+ coeffs)
shuffled𝓕 .= r .* cis.(coeffs)
s .= inverse * shuffled𝓕 .+ m
return s
end
"""
SpectralPartialRandomizationAAFT(α = 0.5)
`SpectralPartialRandomizationAAFT` surrogates are similar to
[`PartialRandomization`](@ref) surrogates, but add a rescaling step, so that the
surrogate has the same values as the original time series (analogous to the rescaling done
for [`AAFT`](@ref) surrogates).
"""
struct SpectralPartialRandomizationAAFT{T} <: Surrogate
α::T
function SpectralPartialRandomizationAAFT(α::T=0.5) where T <: Real
0 <= α <= 1 || throw(ArgumentError("α must be between 0 and 1"))
return new{T}(α)
end
end
function surrogenerator(x::AbstractVector, rf::SpectralPartialRandomizationAAFT, rng = Random.default_rng())
init = (
gen = surrogenerator(x, SpectralPartialRandomization(rf.α), rng),
ix = zeros(Int, length(x)),
x_sorted = sort(x),
)
s = similar(x)
return SurrogateGenerator(rf, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:SpectralPartialRandomizationAAFT})()
gen, ix, x_sorted = sg.init.gen, sg.init.ix, sg.init.x_sorted
s = sg.s
# Surrogate starts out as a SpectralPartialRandomization surrogate
s .= gen()
# Rescale to obtain a AAFT-like surrogate
sortperm!(ix, s)
s[ix] .= x_sorted
return s
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 9267 | using LinearAlgebra
export TFTDRandomFourier, TFTD, TFTDAAFT, TFTDIAAFT
# Efficient linear regression formula from dmbates julia discourse post (nov 2019)
# https://discourse.julialang.org/t/efficient-way-of-doing-linear-regression/31232/27?page=2
function linreg(x, y)
(N = length(x)) == length(y) || throw(DimensionMismatch())
ldiv!(cholesky!(Symmetric([float(N) sum(x); 0.0 sum(abs2, x)], :U)), [sum(y), dot(x, y)])
end
function linear_trend(x)
l = linreg(0.0:1.0:length(x)-1.0 |> Vector{eltype(x)}, x)
return [l[1] + l[2]*a for a in x]
end
"""
TFTD(phases::Bool = true, fϵ = 0.05)
The `TFTDRandomFourier` (or just `TFTD` for short) surrogate was proposed by Lucio et al. (2012)[^Lucio2012] as
a combination of truncated Fourier surrogates[^Nakamura2006] ([`TFTS`](@ref)) and
detrend-retrend surrogates.
The `TFTD` part of the name comes from the fact that it uses a combination of truncated
Fourier transforms (TFT) and de-trending and re-trending (D) the time series
before and after surrogate generation. Hence, it can be used to generate surrogates also from
(strongly) nonstationary time series.
## Implementation details
Here, a best-fit linear trend is removed/added from the signal prior to and after generating
the random Fourier signal. In principle, any trend can be removed, but so far, we only provide
the linear option.
See also: [`TFTDAAFT`](@ref), [`TFTDIAAFT`](@ref).
[^Nakamura2006]: Nakamura, Tomomichi, Michael Small, and Yoshito Hirata. "Testing for nonlinearity in irregular fluctuations with long-term trends." Physical Review E 74.2 (2006): 026205.
[^Lucio2012]: Lucio, J. H., Valdés, R., & Rodríguez, L. R. (2012). Improvements to surrogate data methods for nonstationary time series. Physical Review E, 85(5), 056202.
"""
struct TFTDRandomFourier <: Surrogate
phases::Bool
fϵ
function TFTDRandomFourier(phases::Bool, fϵ = 0.05)
if !(0 < fϵ ≤ 1)
throw(ArgumentError("`fϵ` must be on the interval (0, 1] (indicates fraction of lowest frequencies to be preserved)"))
end
new(phases, fϵ)
end
end
const TFTD = TFTDRandomFourier
TFTD() = TFTD(true)
TFTD(fϵ::Real) = TFTDRandomFourier(true, fϵ)
function surrogenerator(x::AbstractVector, rf::TFTD, rng = Random.default_rng())
# Detrended time series
m = mean(x)
trend = linear_trend(x)
x̂ = x .- m .- trend
# Pre-plan and allocate Fourier transform
forward = plan_rfft(x̂)
inverse = plan_irfft(forward * x̂, length(x̂))
𝓕 = forward * x̂
n = length(𝓕)
# Polar coordinate representation of the Fourier transform
rx = abs.(𝓕)
ϕx = angle.(𝓕)
ϕs = similar(ϕx)
permutation = zeros(Int, length(x))
idxs = collect(1:length(x))
# Initialize surrogate
s = similar(x)
init = (forward = forward, inverse = inverse,
rx = rx, ϕx = ϕx, n = n, m = m,
𝓕 = 𝓕, ϕs = ϕs,
trend = trend, x̂ = x̂,
permutation, idxs)
return SurrogateGenerator(rf, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:TFTD})()
fϵ = sg.method.fϵ
s = sg.s
init_fields = (:forward, :inverse,
:rx, :ϕx, :n, :m,
:𝓕, :ϕs, :trend, :x̂, :permutation, :idxs)
forward, inverse,
rx, ϕx, n, m,
𝓕, ϕs, trend, x̂,
permutation, idxs = getfield.(Ref(sg.init), init_fields)
# Surrogate starts out as a random permutation of x̂
sample!(sg.rng, idxs, permutation; replace = false)
s .= @view x̂[permutation]
mul!(𝓕, forward, s)
ϕs .= angle.(𝓕)
# Frequencies are ordered from lowest when taking the Fourier
# transform, so by keeping the 1:n_preserve first phases intact,
# we are only randomizing the high-frequency components of the
# signal.
n_preserve = ceil(Int, abs(fϵ * n))
ϕs[1:n_preserve] .= @view ϕx[1:n_preserve]
# Updated spectrum is the old amplitudes with the mixed phases.
𝓕 .= rx .* exp.(ϕs .* 1im)
# TODO: Unfortunately, we can't do inverse transform in-place yet, but
# this is an open PR in FFTW.
s .= inverse*𝓕 .+ m .+ trend
return s
end
"""
TFTDAAFT(fϵ = 0.05)
[`TFTDAAFT`](@ref)[^Lucio2012] are similar to [`TFTD`](@ref) surrogates, but also re-scales
back to the original values of the time series. `fϵ ∈ (0, 1]` is the fraction of the powerspectrum
corresponding to the lowermost frequencies to be preserved.
See also: [`TFTD`](@ref), [`TFTDIAAFT`](@ref).
[^Lucio2012]: Lucio, J. H., Valdés, R., & Rodríguez, L. R. (2012). Improvements to surrogate data methods for nonstationary time series. Physical Review E, 85(5), 056202.
"""
struct TFTDAAFT <: Surrogate
fϵ
function TFTDAAFT(fϵ = 0.05)
if !(0 < fϵ ≤ 1)
throw(ArgumentError("`fϵ` must be on the interval (0, 1] (indicates fraction of lowest frequencies to be preserved)"))
end
new(fϵ)
end
end
function surrogenerator(x::AbstractVector, method::TFTDAAFT, rng = Random.default_rng())
init = (
gen = surrogenerator(x, TFTS(method.fϵ), rng),
ix = zeros(Int, length(x)),
x_sorted = sort(x),
)
s = similar(x)
return SurrogateGenerator(method, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:TFTDAAFT})()
s = sg.s
tfts_gen, ix, x_sorted = sg.init.gen, sg.init.ix, sg.init.x_sorted
s .= tfts_gen()
sortperm!(ix, s)
s[ix] .= x_sorted
return s
end
"""
TFTDIAAFT(fϵ = 0.05; M::Int = 100, tol::Real = 1e-6, W::Int = 75)
[`TFTDIAAFT`](@ref)[^Lucio2012] are similar to [`TFTDAAFT`](@ref), but adds an iterative
procedure to better match the periodograms of the surrogate and the original time series,
analogously to how [`IAAFT`](@ref) improves upon [`AAFT`](@ref).
`fϵ ∈ (0, 1]` is the fraction of the powerspectrum corresponding to the lowermost
frequencies to be preserved. `M` is the maximum number of iterations. `tol` is the
desired maximum relative tolerance between power spectra. `W` is the number of
bins into which the periodograms are binned when comparing across iterations.
See also: [`TFTD`](@ref), [`TFTDAAFT`](@ref).
[^Lucio2012]: Lucio, J. H., Valdés, R., & Rodríguez, L. R. (2012). Improvements to surrogate data methods for nonstationary time series. Physical Review E, 85(5), 056202.
"""
struct TFTDIAAFT <: Surrogate
fϵ
M::Int
tol::Real
W::Int
function TFTDIAAFT(fϵ = 0.05; M::Int = 100, tol::Real = 1e-6, W::Int = 75)
if !(0 < fϵ ≤ 1)
throw(ArgumentError("`fϵ` must be on the interval (0, 1] (indicates fraction of lowest frequencies to be preserved)"))
end
new(fϵ, M, tol, W)
end
end
function surrogenerator(x::AbstractVector, method::TFTDIAAFT, rng = Random.default_rng())
# Surrogate starts out as a TFTDRandomFourier surrogate
gen = surrogenerator(x, TFTDRandomFourier(true, method.fϵ), rng)
# Pre-allocate forward transform for periodogram; can be re-used.
𝓕, x̂, forward = gen.init.𝓕, gen.init.x̂, gen.init.forward
𝓕p = prepare_spectrum(x̂, forward)
# Initial power spectra and their interpolated versions.
xpower = similar(𝓕) .|> real;
powerspectrum!(𝓕p, xpower, x̂, forward)
spower = copy(xpower)
xpowerᵦ = interpolated_spectrum(xpower, method.W)
spowerᵦ = interpolated_spectrum(spower, method.W)
init = (
gen = gen,
ix = zeros(Int, length(x)),
x_sorted = sort(x),
𝓕p = 𝓕p,
xpower = xpower,
spower = spower,
xpowerᵦ = xpowerᵦ,
spowerᵦ = spowerᵦ,
)
s = similar(x)
return SurrogateGenerator(method, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:TFTDIAAFT})()
x, s, rng = sg.x, sg.s, sg.rng
fϵ, M, W, tol = sg.method.fϵ, sg.method.M, sg.method.W, sg.method.tol
n_preserve = ceil(Int, abs(fϵ * length(x)))
tftd_gen = sg.init.gen
𝓕, forward, ϕs, ϕx, rx, trend, x̂ = getfield.(Ref(tftd_gen.init),
(:𝓕, :forward, :ϕx, :ϕs, :rx, :trend, :x̂)
)
x_sorted, ix, 𝓕p, xpower, spower, xpowerᵦ, spowerᵦ = getfield.(Ref(sg.init),
(:x_sorted, :ix, :𝓕p, :xpower, :spower, :xpowerᵦ, :spowerᵦ)
)
sum_old, sum_new = 0.0, 0.0
iter = 1
# Surrogate starts out as a TFTDRandomFourier realization of `x`.
s .= tftd_gen()
while iter <= M
# Detrend and take transform (steps (vii-viii) in Lucio et al.)
s .= s .- trend
mul!(𝓕, forward, s)
# Rescaling the power spectrum, keeping some percentage of lowermost
# frequencies, then re-trending (steps vii-x in Lucio et al.)
ϕs .= angle.(𝓕)
ϕs[1:n_preserve] .= @view ϕx[1:n_preserve]
𝓕 .= rx .* exp.(ϕs .* 1im)
s .= s .+ trend
# Adjusting amplitudes
sortperm!(ix, s)
s[ix] .= x_sorted
# Compare power spectra
powerspectrum!(𝓕p, spower, s, forward)
interpolated_spectrum!(spowerᵦ, spower, W)
if iter == 1
sum_old = sum((xpowerᵦ .- xpowerᵦ) .^ 2) / sum(xpowerᵦ .^ 2)
else
sum_new = sum((xpowerᵦ .- spowerᵦ) .^ 2) / sum(xpowerᵦ .^ 2)
if abs(sum_old - sum_new) < tol
iter = M + 1
else
sum_old = sum_new
end
end
iter += 1
end
return s
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 6746 | export TFTS, TAAFT
using StatsBase: sample, sample!
"""
TFTS(fϵ::Real)
A truncated Fourier transform surrogate[^Nakamura2006] (TFTS).
TFTS surrogates are generated by leaving some frequencies untouched when performing the
phase shuffling step (as opposed to randomizing all frequencies, like for
[`RandomFourier`](@ref) surrogates).
These surrogates were designed to deal with data with irregular fluctuations superimposed
over long term trends (by preserving low frequencies)[^Nakamura2006]. Hence, TFTS surrogates
can be used to test the null hypothesis that the signal is a stationary linear system
generated the irregular fluctuations part of the signal[^Nakamura2006].
## Controlling the truncation of the spectrum
The truncation parameter `fϵ ∈ [-1, 0) ∪ (0, 1]` controls which parts of the spectrum are preserved.
- If `fϵ > 0`, then `fϵ` indicates the ratio of high frequency domain to the entire frequency domain.
For example, `fϵ = 0.5` preserves 50% of the frequency domain (randomizing the higher
frequencies, leaving low frequencies intact).
- If `fϵ < 0`, then `fϵ` indicates ratio of low frequency domain to the entire frequency domain.
For example, `fϵ = -0.2` preserves 20% of the frequency domain (leaving higher frequencies intact,
randomizing the lower frequencies).
- If `fϵ ± 1`, then all frequencies are randomized. The method is then equivalent to
[`RandomFourier`](@ref).
The appropriate value of `fϵ` strongly depends on the data and time series length, and must be
manually determined[^Nakamura2006], for example by comparing periodograms for the time series and
the surrogates.
[^Nakamura2006]: Nakamura, Tomomichi, Michael Small, and Yoshito Hirata. "Testing for nonlinearity in irregular fluctuations with long-term trends." Physical Review E 74.2 (2006): 026205.
"""
struct TFTS <: Surrogate
fϵ::Real
function TFTS(fϵ::Real)
if !(0 < fϵ ≤ 1) && !(-1 ≤ fϵ < 0)
throw(ArgumentError("`fϵ` must be on the interval [-1, 0) ∪ (0, 1] (positive if preserving high frequencies, negative if preserving low frequencies)"))
end
new(fϵ)
end
end
function surrogenerator(x, method::TFTS, rng = Random.default_rng())
# Pre-plan Fourier transforms
forward = plan_rfft(x)
inverse = plan_irfft(forward*x, length(x))
# Pre-compute 𝓕
𝓕 = forward * x
# Polar coordinate representation of the Fourier transform
rx = abs.(𝓕)
ϕx = angle.(𝓕)
n = length(𝓕)
# These are updated during iteration procedure
𝓕new = Vector{Complex{Float64}}(undef, length(𝓕))
𝓕s = Vector{Complex{Float64}}(undef, length(𝓕))
ϕs = Vector{Complex{Float64}}(undef, length(𝓕))
init = (forward = forward, inverse = inverse,
rx = rx, ϕx = ϕx, n = n,
𝓕new = 𝓕new, 𝓕s = 𝓕s, ϕs = ϕs)
return SurrogateGenerator(method, x, similar(x), init, rng)
end
function (sg::SurrogateGenerator{<:TFTS})()
x, s = sg.x, sg.s
fϵ = sg.method.fϵ
L = length(x)
init_fields = (:forward, :inverse,
:rx, :ϕx, :n,
:𝓕new, :𝓕s, :ϕs)
forward, inverse,
rx, ϕx, n,
𝓕new, 𝓕s, ϕs = getfield.(Ref(sg.init), init_fields)
# Surrogate starts out as a random permutation of x
s .= x[sample(sg.rng, 1:L, L; replace = false)]
𝓕s .= forward * s
ϕs .= angle.(𝓕s)
# Updated spectrum is the old amplitudes with the mixed phases.
if fϵ > 0
# Frequencies are ordered from lowest when taking the Fourier
# transform, so by keeping the 1:n_ni first phases intact,
# we are only randomizing the high-frequency components of the
# signal.
n_preserve = ceil(Int, abs(fϵ * n))
ϕs[1:n_preserve] .= ϕx[1:n_preserve]
elseif fϵ < 0
# Do the exact opposite to preserve high-frequencies
n_preserve = ceil(Int, abs(fϵ * n))
ϕs[end-n_preserve+1:end] .= ϕx[end-n_preserve+1:end]
end
𝓕new .= rx .* exp.(ϕs .* 1im)
s .= inverse * 𝓕new
return s
end
"""
TAAFT(fϵ)
An truncated version of the amplitude-adjusted-fourier-transform surrogate[^Theiler1991][^Nakamura2006].
The truncation parameter and phase randomization procedure is identical to [`TFTS`](@ref), but here an
additional step of rescaling back to the original data is performed. This preserves the
amplitude distribution of the original data.
[^Theiler1991]: J. Theiler, S. Eubank, A. Longtin, B. Galdrikian, J. Farmer, Testing for nonlinearity in time series: The method of surrogate data, Physica D 58 (1–4) (1992) 77–94.
[^Nakamura2006]: Nakamura, Tomomichi, Michael Small, and Yoshito Hirata. "Testing for nonlinearity in irregular fluctuations with long-term trends." Physical Review E 74.2 (2006): 026205.
"""
struct TAAFT <: Surrogate
fϵ::Real
function TAAFT(fϵ::Real)
fϵ != 0 || throw(ArgumentError("`fϵ` must be on the interval [-1, 0) ∪ (0, 1] (positive if preserving high frequencies, negative if preserving low frequencies)"))
new(fϵ)
end
end
function surrogenerator(x, method::TAAFT, rng = Random.default_rng())
init = (
gen = surrogenerator(x, TFTS(method.fϵ), rng),
x_sorted = sort(x),
idxs = collect(1:length(x)),
perm = zeros(Int, length(x)),
)
s = similar(x)
return SurrogateGenerator(method, x, s, init, rng)
end
function (taaft::SurrogateGenerator{<:TAAFT})()
sg = taaft.init.gen
x_sorted, idxs, perm = taaft.init.x_sorted, taaft.init.idxs, taaft.init.perm
x, s = sg.x, sg.s
fϵ = sg.method.fϵ
L = length(x)
init_fields = (:forward, :inverse,
:rx, :ϕx, :n,
:𝓕new, :𝓕s, :ϕs)
forward, inverse,
rx, ϕx, n,
𝓕new, 𝓕s, ϕs = getfield.(Ref(sg.init), init_fields)
# Surrogate starts out as a random permutation of x
sample!(sg.rng, idxs, perm, replace = false)
permuted_x_into_s!(s, x, perm)
𝓕s .= forward * s
ϕs .= angle.(𝓕s)
# Updated spectrum is the old amplitudes with the mixed phases.
if fϵ > 0
# Frequencies are ordered from lowest when taking the Fourier
# transform, so by keeping the 1:n_ni first phases intact,
# we are only randomizing the high-frequency components of the
# signal.
n_preserve = ceil(Int, abs(fϵ * n))
ϕs[1:n_preserve] .= @view ϕx[1:n_preserve]
elseif fϵ < 0
# Do the exact opposite to preserve high-frequencies
n_preserve = ceil(Int, abs(fϵ * n))
ϕs[end-n_preserve+1:end] .= @view ϕx[end-n_preserve+1:end]
end
𝓕new .= rx .* exp.(ϕs .* 1im)
s .= inverse * 𝓕new
s[sortperm(s)] .= x_sorted
return s
end
function permuted_x_into_s!(s, x, perm)
k = 1
for i in perm
s[k] = x[i]
k += 1
end
end | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 13924 | export WLS, RandomCascade
using Wavelets, Statistics
"""
WLS(shufflemethod::Surrogate = IAAFT();
f::Union{Nothing, Function} = Statistics.cor,
rescale::Bool = true,
wt::Wavelets.WT.OrthoWaveletClass = Wavelets.WT.Daubechies{16}())
A wavelet surrogate generated by the following procedure:
1. Compute the wavelet transform of the signal. This results in a set of
detail coefficients over a set of dyadic scales. As in Keylock (2006),
we here use the maximal overlap discrete wavelet transform, or MODWT,
so that the number of coefficients at each scale are the same.
2. Shuffle the detail coefficients at each dyadic scale using the
provided `shufflemethod`. See "Shuffling methods" below for alternatives.
3. Apply the inverse wavelet transform to the shuffled detail coefficients
to obtain a surrogate time series.
## Shuffling methods
You may choose to use any surrogate from this package to perform the
randomization of the detail coefficients at each dyadic scale.
The following methods have been discussed in the literature (more may exist):
- Random permutations of wavelet coefficients within each scale (Breakspear et al., 2003). To get this behaviour, use `WLS(x, RandomShuffle(), rescale = false, f = nothing)`.
- Cyclic rotation of wavelet coefficients within each scale (Breakspear et al., 2003). To get this behaviour, use `WLS(x, Circshift(1:length(x)), rescale = false, f = nothing)`.
- Block resampling of wavelet coefficients within each scale (Breakspear et al., 2003). To get this behaviour, use `WLS(x, BlockShuffle(nblocks, randomize = true), rescale = false, f = nothing)`.
- IAAFT resampling of wavelet coefficients within each scale (Keylock, 2006). To get this behaviour, use `WLS(x, IAAFT(), rescale = true, f = Statistics.cor)`.
This method preserves the local mean and variance structure of the signal, but
randomises nonlinear properties of the signal (i.e. Hurst exponents)[^Keylock2006].
These surrogates can therefore be used to test for changes in nonlinear properties
of the original signal. In contrast to IAAFT surrogates, the IAAFT-wavelet surrogates
also preserves nonstationarity. Using other `shufflemethod`s does not necessarily
preserve nonstationarity. To deal with nonstationary signals, Keylock (2006) recommends
using a wavelet with a high number of vanishing moments. Thus, our default is to
use a Daubechies wavelet with 16 vanishing moments. *Note: The iterative procedure after
the rank ordering step (step [v] in [^Keylock2006]) is not performed in
this implementation.*
The default method and parameters replicate the behaviour of Keylock (2006)'s IAAFT
wavelet surrogates.
## Error minimization
For the [`IAAFT`](@ref) approach introduced in Keylock (2006), detail coefficients
at each level are circularly rotated to minimize an error function. The methods
introduced in Breakspear et al. (2003) do not apply this error minimization.
In our implementation, you can turn this option on/off using the `f` parameter of
the `WLS` constructor. If `f = nothing` turns off error minization. If `f` is set
to a two-argument function that computes some statistic, for example
`f = Statistics.cor`, then detail coefficients at each scale are circularly
rotated until that function is maximized (and hence the "error" minimized).
If you want to *minimize* some error function, then instead provide an appropriate
transform of your function. For example, if using the root mean squared deviation,
define `rmsd_inv(x, y) = 1 - StatsBase.rmsd(x, y)` and set `f = rmsd_inv`.
## Rescaling
If `rescale == true`, then surrogate values are mapped onto the
values of the original time series, as in the [`AAFT`](@ref) algorithm.
If `rescale == false`, surrogate values are not constrained to the
original time series values. If [`AAFT`](@ref) or [`IAAFT`](@ref) shuffling
is used, `rescale` should be set to `true`. For other methods, it does not
necessarily need to be.
[^Breakspear2003]: Breakspear, M., Brammer, M., & Robinson, P. A. (2003). Construction of multivariate surrogate sets from nonlinear data using the wavelet transform. Physica D: Nonlinear Phenomena, 182(1-2), 1-22.
[^Keylock2006]: C.J. Keylock (2006). "Constrained surrogate time series with preservation of the mean and variance structure". Phys. Rev. E. 73: 036707. doi:10.1103/PhysRevE.73.036707.
"""
struct WLS{WT <: Wavelets.WT.OrthoWaveletClass, S <: Surrogate, E <: Union{Nothing, Function}} <: Surrogate
shufflemethod::Surrogate # should preserve values of the original series
rescale::Bool
f::E
wt::WT
function WLS(method::S = IAAFT(); rescale::Bool = true, wt::WT = Wavelets.WT.Daubechies{16}(), f::E = Statistics.cor) where {S <: Surrogate, WT <: Wavelets.WT.OrthoWaveletClass, E <: Union{Nothing, Function}}
new{WT, S, E}(method, rescale, f, wt)
end
end
# Initialize without error minimization.
function get_init_noerrorminimize(x, method, rng = Random.default_rng())
wl = wavelet(method.wt)
L = length(x)
x_sorted = sort(x)
# Wavelet coefficients (step [i] in Keylock)
W = modwt(x, wl)
T = eltype(W)
R = zeros(size(W))
Nscales = ndyadicscales(L)
# Will contain surrogate realizations of the wavelet coefficients
# at each scale (step [ii] in Keylock).
sW = zeros(T, size(W))
# Surrogate generators for each set of coefficients
sgs = [surrogenerator(W[:, i], method.shufflemethod, rng) for i = 1:Nscales]
init = (
wl = wl,
W = W,
Nscales = Nscales,
sW = sW,
sgs = sgs,
x_sorted = x_sorted,
R = R,
)
return init
end
# Initialize error minimization, as in Keylock (2006).
function get_init_errorminimize(x, method::WLS, rng = Random.default_rng())
wl = wavelet(method.wt)
L = length(x)
x_sorted = sort(x)
# Wavelet coefficients (step [i] in Keylock)
W = modwt(x, wl)
T = eltype(W)
Nscales = ndyadicscales(L)
# Will contain surrogate realizations of the wavelet coefficients
# at each scale (step [ii] in Keylock).
sW = zeros(T, size(W))
# We will also need a matrix to store the mirror images of the
# surrogates (last part of step [ii])
sWmirr = zeros(T, size(W))
# Surrogate generators for each set of coefficients
sgs = [surrogenerator(W[:, i], method.shufflemethod, rng) for i = 1:Nscales]
# Temporary array for the circular shift error minimizing step
circshifted_s = zeros(T, size(W))
circshifted_smirr = zeros(T, size(W))
R = zeros(size(W))
s = similar(x)
init = (wl = wl, W = W, Nscales = Nscales, L = L,
sW = sW, sgs = sgs, sWmirr = sWmirr,
circshifted_s = circshifted_s,
circshifted_smirr = circshifted_smirr,
x_sorted = x_sorted, R = R,
)
return init
end
function surrogenerator(x::AbstractVector{T}, method::WLS, rng = Random.default_rng()) where T
init = isnothing(method.f) ?
get_init_noerrorminimize(x, method, rng) :
get_init_errorminimize(x, method, rng)
s = similar(x)
return SurrogateGenerator(method, x, s, init, rng)
end
function (sg::SurrogateGenerator{<:WLS})()
if isnothing(sg.method.f)
wls_noerrorminimize(sg)
else
wls_errorminimize(sg)
end
end
function wls_noerrorminimize(sg::SurrogateGenerator{<:WLS})
s = sg.s
fds = (:wl, :W, :Nscales, :sW, :sgs, :x_sorted, :R)
wl, W, Nscales, sW, sgs, x_sorted, R = getfield.(Ref(sg.init), fds)
for λ in 1:Nscales
sW[:, λ] .= sgs[λ]()
end
s .= imodwt(sW, wl)
if sg.method.rescale
s[sortperm(s)] .= x_sorted
end
return s
end
function wls_errorminimize(sg::SurrogateGenerator{<:WLS})
s = sg.s
# Error minimization function (if we reached this function,
# f is never `Nothing`), so we can use it safely.
f = sg.method.f
fds = (:wl, :W, :Nscales, :L, :sW, :sgs, :sWmirr,
:circshifted_s, :circshifted_smirr,
:x_sorted, :R)
wl, W, Nscales, L, sW, sgs, sWmirr,
circshifted_s, circshifted_smirr,
x_sorted, R = getfield.(Ref(sg.init), fds)
# Create surrogate versions of detail coefficients at each dyadic scale [first part of step (ii) in Keylock]
for λ in 1:Nscales
sW[:, λ] .= sgs[λ]()
end
# Mirror the surrogate coefficients [last part of step (ii) in Keylock]
sWmirr .= reverse(sW, dims = 1)
# In the original paper, surrogates and mirror images are matched to original
# detail coefficients in a circular manner until some error criterion is
# minimized. Then, the surrogate or its mirror image, depending on which provides
# the best fit to the original coefficients, is chosen as the representative
# for a particular dyadic scale. Here, we instead use maximal correlation as
# the criterion for matching.
optimal_shifts = zeros(Int, Nscales)
optimal_shifts_mirr = zeros(Int, Nscales)
maxcorrs = zeros(Nscales)
maxcorrs_mirr = zeros(Nscales)
for i in 0:L-1
circshift!(circshifted_s, sW, (i, 0))
circshift!(circshifted_smirr, sWmirr, (i, 0))
for λ in 1:Nscales
origW = W[:, λ]
c = f(origW, circshifted_s[:, λ])
if c > maxcorrs[λ]
maxcorrs[λ] = c
optimal_shifts[λ] = i
end
c_mirr = f(origW, circshifted_smirr[:, λ])
if c_mirr > maxcorrs_mirr[λ]
maxcorrs_mirr[λ] = c_mirr
optimal_shifts_mirr[λ] = i
end
end
end
# Decide which coefficients are retained (either surrogate or mirror surrogate coefficients)
for λ in 1:Nscales
if maxcorrs[λ] >= maxcorrs_mirr[λ]
R[:, λ] .= circshift(sW[:, λ], optimal_shifts[λ])
else
R[:, λ] .= circshift(sWmirr[:, λ], optimal_shifts_mirr[λ])
end
end
s .= imodwt(R, wl)
if sg.method.rescale
s[sortperm(s)] .= x_sorted
end
return s
end
"""
RandomCascade(paddingmode::String = "zeros")
A random cascade multifractal wavelet surrogate (Paluš, 2008)[^Paluš2008].
If the input signal length is not a power of 2, the signal must be
padded before the surrogate is constructed. `paddingmode` determines
how the signal is padded. Currently supported padding modes: `"zeros"`.
The final surrogate (constructed from the padded signal) is subset
to match the length of the original signal.
Random cascade surrogate preserve multifractal properties of the input
time series, that is, interactions among dyadic scales and nonlinear
dependencies[^Paluš2008].
[^Paluš2008]: Paluš, Milan (2008). Bootstrapping Multifractals: Surrogate Data from Random Cascades on Wavelet Dyadic Trees. Physical Review Letters, 101(13), 134101–. doi:10.1103/PhysRevLett.101.134101
"""
struct RandomCascade{WT <: Wavelets.WT.OrthoWaveletClass} <: Surrogate
wt::WT
paddingmode::String
function RandomCascade(; wt::WT = Wavelets.WT.Daubechies{16}(), paddingmode::String = "zeros") where {WT <: Wavelets.WT.OrthoWaveletClass}
new{WT}(wt, paddingmode)
end
end
function surrogenerator(x::AbstractVector{T}, method::RandomCascade, rng = Random.default_rng()) where T
nlevels = ndyadicscales(length(x))
mode = method.paddingmode
# Pad input so that input to discrete wavelet transform has length which is a power of 2
x̃ = zeros(2^(nlevels + 1))
pad!(x̃, x, mode)
wl = wavelet(method.wt)
# Wavelet coefficients (step [i] in Keylock)
c = dwt(x̃, wl, nlevels)
# Surrogate coefficients will be partly identical to original coefficients,
# so we simply copy them and replace the necessary coefficients later.
cₛ = copy(c)
# Multiplication factors and index vectors can be pre-allocated for
# levels 2:nlevels-1; they are overwritten for each new surrogate.
Ms = [zeros(dyadicdetailn(j-1)) for j = 2:nlevels-1]
ixs = [zeros(Int, dyadicdetailn(j-1)) for j = 2:nlevels-1]
init = (
wl = wl,
c = c,
cₛ = cₛ,
nlevels = nlevels,
s̃ = similar(x̃),
Ms = Ms,
ixs = ixs,
)
return SurrogateGenerator(method, x, similar(x), init, rng)
end
function (sg::SurrogateGenerator{<:RandomCascade})()
s, rng = sg.s, sg.rng
c, cₛ, s̃, wl, nlevels, Ms, ixs =
sg.init.c, sg.init.cₛ, sg.init.s̃, sg.init.wl, sg.init.nlevels, sg.init.Ms, sg.init.ixs
cₛ[dyadicdetailrange(0)] = @view c[dyadicdetailrange(0)]
cₛ[dyadicdetailrange(1)] = @view c[dyadicdetailrange(1)]
for (l, j) = enumerate(2:nlevels-1)
cⱼ₋₁ = @view c[dyadicdetailrange(j - 1)]
cⱼ = @view c[dyadicdetailrange(j)]
M = Ms[l]
ct = 1
@inbounds for k = 1:length(cⱼ₋₁)
if k % 2 == 0
M[ct] = cⱼ[2*k] / cⱼ₋₁[k]
else
M[ct] = cⱼ[2*(k+1)] / cⱼ₋₁[k+1]
end
ct += 1
end
shuffle!(rng, M)
new_coeffs!(M, cⱼ₋₁)
ix = ixs[l]
sortperm!(ix, M)
cₛ[dyadicdetailrange(j-1)] .= @view cⱼ₋₁[ix]
end
s̃ .= idwt(cₛ, wl, nlevels)
# Surrogate length must match length of original signal.
s .= @view s̃[1:length(s)]
return s
end
function pad!(x̃, x, mode)
if mode == "zeros"
copyto!(x̃, x)
elseif mode == "constant"
copyto!(x̃, x)
x̃[length(x)+1:end] .= x[end]
elseif mode == "linear"
copyto!(x̃, x)
for i = length(x)+1:length(x̃)
x̃[i] = 2*x̃[i-1] - x̃[i-2]
end
else
throw(ArgumentError("""`paddingmode` must be one of ["zeros", "constant", "linear"]"""))
end
end
function new_coeffs!(M, cⱼ₋₁)
@inbounds for k = 1:length(cⱼ₋₁)
M[k] = M[k] * cⱼ₋₁[k]
end
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 710 | """
surroplot(x, s; kwargs...) → fig
surroplot(x, method::Surrogate; kwargs...) → fig
surroplot!(fig_or_gridlayout, x, method::Surrogate)
Plot a timeseries `x` along with its surrogate realization `s`, and compare the
power spectrum and histogram of the two time series. If given a method to generate
surrogates, create a surrogate from `x` and plot it.
## Keyword arguments
- `cx` and `cs`: Colors of the original and the surrogate time series, respectively.
- `nbins`: The number of bins for the histograms.
- `kwargs...`: Propagated to `Makie.Figure`.
- `resolution`: A tuple giving the resolution of the figure.
"""
function surroplot end
function surroplot! end
export surroplot, surroplot!
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1011 |
getrange(t, n) = range(minimum(t); stop = maximum(t), length = n)
itp(x) = LinearInterpolation(1:length(x), x)
interp(itp, tᵢ) = itp()
"""
Linearly interpolates two vectors x and y on a linear grid consisting of `nsteps`.
"""
function interp(x::Vector, y::Vector, nsteps::Int)
# Interpolate
itp = interpolate((x,), y, Gridded(Linear()))
# Interpolate at the given resolution
x_fills = LinRange(minimum(x), maximum(x), nsteps)
y_fills = itp(x_fills)
return collect(x_fills), y_fills
end
"""
Linearly interpolates two vector x and y on a linear grid consisting of `nsteps`.
"""
function interp(x, y, range::LinRange)
itp = interpolate((x,), y, Gridded(Linear()))
# Interpolate at the given resolution
return itp(range)
end
"""
interp!(ȳ::Vector, itp)
Interpolate using the pre-computed interpolation instance `itp` into
the pre-allocated vector `ȳ`.
"""
function interp!(ȳ::Vector, itp)
y_fills .= itp(x_fills)
return collect(x_fills), y_fills
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 3602 | # This file consists of code that is simplified/modified/inspired by/from
# the DSP.jl package. The purpose of these functions is to speed up repeated
# power spectrum computations for real-valued 1D vectors, by utilizing fft-plans
# and in-place computations.
#
# The DSP module is distributed under the MIT license.
# Copyright 2012-2021 DSP.jl contributors
# Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software withspectrum restriction, including withspectrum limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
# The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
using DSP
using LinearAlgebra: mul!
"""
prepare_spectrum(s, plan) → y::Vector
Pre-allocate a vector that will hold the one-sided power spectrum for a signal `s`,
taking into account the number of points that will be used for the Fourier transform.
"""
function prepare_spectrum(s, plan)
return plan * s
end
"""
_powerspectrum_from_fft!(
spectrum::AbstractArray{T},
ℱ::AbstractVector{Complex{T}},
nfft::Int,
r::Real,
offset::Int = 0
) where T
Compute one-sided power spectrum from a pre-computed Fourier transform `ℱ` of a signal,
into a pre-allocated `spectrum vector``. `nfft` is the number of points used for
the Fourier transform. `n` is the length of the signal,
"""
function _powerspectrum_from_fft!(
spectrum::AbstractArray{T},
ℱ::AbstractVector{Complex{T}},
nfft::Int,
n::Real,
offset::Int = 0
) where T
l = length(ℱ)
m1, m2 = convert(T, 1 / n), convert(T, 2 / n)
for i = 2:l-1
@inbounds spectrum[offset + i] += abs2(ℱ[i]) * m2
end
@inbounds spectrum .+= abs2.(ℱ) .* m2
@inbounds spectrum[offset + l] += abs2(ℱ[end]) * ifelse(iseven(nfft), m1, m2)
return spectrum
end
"""
powerspectrum_onesided!(spectrum, signal, forward)
Let `n = DSP.nextfastfft(length(s))`. Modifies `spectrum` in-place, so `spectrum`
is reset to all zeros every time this function is called.
- `forward` is a forward fft-plan for the signal.
- `spectrum` is a pre-allocated `AbstractVector{<:Real}` that will hold the spectrum.
Has the length of the Fourier transform resulting from `forward * signal`.
- `signal` is the signal, a `AbstractVector{<:Real}` of length `n`.
"""
function powerspectrum!(ℱp, spectrum, signal, forward)
# Fourier transform of the signal, based on pre-computed plan `forward`.
mul!(ℱp, forward, signal) #ℱp = forward * signal
l = length(signal)
# Reset spectrum, since we're doing multiple in-place additions to it.
spectrum .= 0.0
# In-place computation of spectrum based on the transform `ℱ`
n = nextfastfft(l)
_powerspectrum_from_fft!(spectrum, ℱp, n, l)
return spectrum
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 4332 | export NLNS, NSAR2, AR1, randomwalk, SNLST, random_cycles, colored_noise
"""
AR1(; n_steps, x₀, k, rng)
Simple AR(1) model given by the following map:
```math
x(t+1) = k x(t) + a(t),
```
where ``a(t)`` is a draw from a normal distribution with zero mean and unit
variance. `x₀` sets the initial condition and `k` is the tunable parameter in
the map. `rng` is a random number generator
"""
function AR1(n_steps, x₀, k, rng)
a = rand(rng, Normal(), n_steps)
x = Vector{Float64}(undef, n_steps)
x[1] = x₀
for i = 2:n_steps
x[i] = k*x[i-1] + a[i]
end
x
end
AR1(;n_steps = 500, x₀ = rand(), k = rand(), rng = Random.default_rng()) = AR1(n_steps, x₀, k, rng)
"""
NSAR2(n_steps, x₀, x₁)
Cyclostationary AR(2) process[^1].
## References
[^1]: Lucio et al., Phys. Rev. E *85*, 056202 (2012). [https://journals.aps.org/pre/abstract/10.1103/PhysRevE.85.056202](https://journals.aps.org/pre/abstract/10.1103/PhysRevE.85.056202)
"""
function NSAR2(n_steps, x₀, x₁)
T₀ = 50.0
τ = 10.0
M = 5.5
Tmod = 250
σ₀ = 1.0
a_1_0 = 2*cos(2*π/T₀)*exp(-1/τ)
a₂ = -exp(-2 / τ)
a = rand(Normal(), n_steps)
x = Vector{Float64}(undef, n_steps)
x[1], x[2] = x₀, x₁
for i = 3:n_steps
T_t = T₀ + M*sin(2*π*i / Tmod)
a₁_t = 2*cos(2*π/T_t) * exp(-1 / τ)
σ = σ₀^2/(1 - a_1_0^2 - a₂^2 - (2*(a_1_0^2) * a₂)/(1 - a₂)) *
(1 - a₁_t - a₂^2 - (2*(a₁_t^2) * a₂)/(1 - a₂))
x[i] = a₁_t * x[i-1] + a₂*x[i-2] + rand(Normal(0, sqrt(σ)))
end
x
end
"""
randomwalk(n_steps, x₀)
Linear random walk (AR(1) process with a unit root)[^1].
This is an example of a nonstationary linear process.
# References
[^1]: Lucio et al., Phys. Rev. E *85*, 056202 (2012). [https://journals.aps.org/pre/abstract/10.1103/PhysRevE.85.056202](https://journals.aps.org/pre/abstract/10.1103/PhysRevE.85.056202)
"""
function randomwalk(n_steps, x₀)
a = rand(Normal(), n_steps)
x = Vector{Float64}(undef, n_steps)
x[1] = x₀
for i = 2:n_steps
x[i] = x[i-1] + a[i]
end
x
end
"""
SNLST(n_steps, x₀, k)
Dynamically linear process transformed by a strongly nonlinear static
transformation (SNLST)[^1].
## Equations
The system is by the following map:
```math
x(t) = k x(t-1) + a(t)
```
with the transformation ``s(t) = x(t)^3``.
# References
[^1]: Lucio et al., Phys. Rev. E *85*, 056202 (2012). [https://journals.aps.org/pre/abstract/10.1103/PhysRevE.85.056202](https://journals.aps.org/pre/abstract/10.1103/PhysRevE.85.056202)
"""
function SNLST(n_steps, x₀, k)
a = rand(Normal(), n_steps)
x = Vector{Float64}(undef, n_steps)
x[1] = x₀
for i = 2:n_steps
x[i] = k*x[i-1] + a[i]
end
x.^3
end
# Keyword versions of the functions
SNLST(;n_steps = 500, x₀ = rand(), k = rand()) = SNLST(n_steps, x₀, k)
randomwalk(;n_steps = 500, x₀ = rand()) = randomwalk(n_steps, x₀)
NSAR2(;n_steps = 500, x₀ = rand(), x₁ = rand()) = NSAR2(n_steps, x₀, x₁)
"""
random_cycles(; periods=10 dt=π/20, σ = 0.05, frange = (0.8, 2.0))
Make a timeseries that is composed of `period` full sine wave periods, each with a
random frequency in the range given by `frange`, and added noise with std `σ`.
The sampling time is `dt`.
"""
function random_cycles(rng = Random.default_rng(); periods=10, dt=π/20, σ = 0.05, frange = (1.0, 1.6))
dt = π/20
x = Float64[]
for i in 1:periods
f = (frange[1]-frange[2])*rand(rng) + frange[1]
T = 2π/f
t = 0:dt:T
append!(x, sin.(f .* t))
end
N = length(x)
x .+= randn(N)/20
return x
end
"""
colored_noise(rng = Random.default_rng(); n::Int = 500, ρ, σ = 0.1, transform = true)
Generate `n` points of colored noise. `ρ` is the desired correlation
between adjacent samples. The noise is drawn from a normal distribution
with zero mean and standard deviation `σ`. If `transform = true`, then
transform data using aquadratic nonlinear static distortion.
"""
function colored_noise(rng = Random.default_rng(); n::Int = 500, ρ = 0.8, σ = 0.1, transform = true)
𝒩 = Normal(0, σ)
x = zeros(n)
x[1] = rand(rng, 𝒩)
for i = 2:n
x[i] = ρ*x[i-1] + sqrt(1 - ρ^2)*rand(rng, 𝒩)
end
if transform
x .= x .* sqrt.(x .^ 2)
end
return x .- mean(x)
end | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 8037 | using Test
using TimeseriesSurrogates
using TimeseriesSurrogates.AbstractFFTs
using TimeseriesSurrogates.Statistics
using TimeseriesSurrogates.Random
N = 500
ts = cumsum(randn(N))
ts_nan = cumsum(randn(N))
ts_nan[1] = NaN
x = cos.(range(0, 20π, length = N)) .+ randn(N)*0.05
@testset "LombScargle" begin
t = sort((0:N-1) + rand(N))
tol = 10
ls = IrregularLombScargle(t, tol = 10, n_total = 20000, n_acc = 5000)
s = surrogate(x, ls)
@test all(sort(s) .== sort(x))
end
@testset "WLS" begin
wts_norescale = WLS(AAFT(), rescale = false)
wts_rescale = WLS(AAFT())
s_norescale = surrogate(x, wts_norescale)
s_rescale = surrogate(x, wts_rescale)
@test length(s_norescale) == length(x)
@test length(s_rescale) == length(x)
# If rescaling, the surrogate will have the same values as the original
@test sort(x) ≈ sort(s_rescale)
end
@testset "PartialRandomization" begin
Random.seed!(32)
# Absolute randomization, Ortega
pr = PartialRandomization(0.2)
s = surrogate(x, pr)
@test length(s) == length(x)
@test_throws ArgumentError PartialRandomization(-0.01)
@test_throws ArgumentError PartialRandomization(1.01)
pr = PartialRandomization(0.0)
s = surrogate(x, pr)
@test s |> rfft .|> angle |> std |> ≈(0, atol=1e-5)
end
@testset "RelativePartialRandomization" begin
Random.seed!(32)
pr = RelativePartialRandomization(1.0)
s = surrogate(x, pr)
@test s |> rfft .|> angle |> std |> ≈(π/sqrt(3), atol=1e-1)
# Relative randomization
pr = RelativePartialRandomization(0.2)
s = @test_nowarn surrogate(x, pr)
@test length(s) == length(x)
pr = RelativePartialRandomization(0.0)
s = @test_nowarn surrogate(x, pr)
@test s |> ≈(x, rtol=1e-2) # No randomization, so the surrogate should be close to the original
pr = RelativePartialRandomization(1.0)
s = surrogate(cos.(0:0.1:1000).^2, pr)
@test s |> rfft .|> angle |> std |> ≈(π/sqrt(3), atol=1e-1)
end
@testset "SpectralPartialRandomization" begin
Random.seed!(32)
# Randomization based on the spectrum
pr = SpectralPartialRandomization(0.2)
s = @test_nowarn surrogate(x, pr)
pr = SpectralPartialRandomization(0.0)
s = @test_nowarn surrogate(x, pr)
@test s |> ≈(x, rtol=1e-2)
pr = SpectralPartialRandomization(1.0)
s = surrogate(cos.(0:0.1:1000).^2, pr)
@test s |> rfft .|> angle |> std |> ≈(π/sqrt(3), atol=1e-1)
end
@testset "PartialRandomizationAAFT" begin
praaft = PartialRandomizationAAFT(0.5)
s = surrogate(x, praaft)
@test length(s) == length(x)
@test sort(x) ≈ sort(s)
@test_throws ArgumentError PartialRandomizationAAFT(-0.01)
@test_throws ArgumentError PartialRandomizationAAFT(1.01)
end
@testset "RelativePartialRandomization" begin
praaft = RelativePartialRandomizationAAFT(0.2)
s = @test_nowarn surrogate(x, praaft)
@test sort(x) ≈ sort(s)
end
@testset "SpectralPartialRandomization" begin
praaft = SpectralPartialRandomizationAAFT(0.2)
s = @test_nowarn surrogate(x, praaft)
@test sort(x) ≈ sort(s)
end
@testset "RandomCascade" begin
randomcascade = RandomCascade()
s = surrogate(x, randomcascade)
@test length(s) == length(x)
@testset "Padding modes" begin
x̃ = zeros(2^(TimeseriesSurrogates.ndyadicscales(length(x)) + 1))
TimeseriesSurrogates.pad!(x̃, x, "zeros")
@test all(x̃[length(x)+1:end] .== 0.0)
TimeseriesSurrogates.pad!(x̃, x, "constant")
@test all(x̃[length(x)+1:end] .== x[end])
TimeseriesSurrogates.pad!(x̃, x, "linear")
dx = x[end] - x[end-1]
for i = length(x)+1:length(x̃)
@test x̃[i] - x̃[i-1] ≈ dx
end
@test_throws ArgumentError surrogate(x, RandomCascade(; paddingmode="ones"))
end
end
@testset "Periodic" begin
pp = PseudoPeriodic(3, 25, 0.05)
s = surrogate(x, pp)
@test length(s) == length(ts)
@test all(s[i] ∈ x for i in 1:N)
# Perhaps a more advanced test, e.g. that both components have Fourier peak at
# the same frequency, should be considered.
#TODO: Test for noiseradius
end
@testset "PeriodicTwin" begin
# A better test based on recurrence plots should be considered.
d, τ = 2, 6
δ = 0.2
ρ = noiseradius(x, d, τ, 0.02:0.02:0.5)
method = PseudoPeriodicTwin(d, τ, δ, ρ)
sg = surrogenerator(x, method)
s = sg()[:, 1]
@test length(s) == length(ts)
@test all(s[i] ∈ x for i in 1:N)
end
@testset "BlockShuffle" begin
bs1 = BlockShuffle()
bs2 = BlockShuffle(4)
s1 = surrogate(x, bs1)
s2 = surrogate(x, bs2)
@test length(s1) == length(x)
@test length(s2) == length(x)
@test all([s1[i] ∈ x for i = 1:N])
@test all([s2[i] ∈ x for i = 1:N])
end
@testset "RandomShuffle" begin
rs = RandomShuffle()
s = surrogate(x, rs)
@test length(s) == length(x)
@test all([s[i] ∈ x for i = 1:N])
end
@testset "AutoRegressive" begin
y = TimeseriesSurrogates.AR1(; n_steps = 2000, x₀ = 0.1, k = 0.5)
sg = surrogenerator(y, AutoRegressive(1))
@test 0.4 ≤ abs(sg.init.φ[1]) ≤ 0.6
s = sg()
@test length(s) == length(y)
end
@testset "AAFT" begin
aaft = AAFT()
s = surrogate(x, aaft)
@test length(s) == length(x)
@test all([s[i] ∈ x for i = 1:N])
end
@testset "IAAFT" begin
iaaft = IAAFT()
s = surrogate(x, iaaft)
@test length(s) == length(x)
@test all([s[i] ∈ x for i = 1:N])
end
@testset "TFTS" begin
method_preserve_lofreq = TFTS(0.05)
method_preserve_hifreq = TFTS(-0.05)
s = surrogate(x, method_preserve_lofreq)
@test length(s) == length(x)
s = surrogate(x, method_preserve_hifreq)
@test length(s) == length(x)
@test_throws ArgumentError TFTS(0)
end
@testset "TFTDAAFT" begin
tftdaaft = TFTDAAFT(0.03)
s = surrogate(x, tftdaaft)
@test length(s) == length(x)
@test sort(x) ≈ sort(s)
@test_throws ArgumentError TFTD(0)
@test_throws ArgumentError TFTD(1.2)
end
@testset "TFTDIAAFT" begin
tftdiaaft = TFTDAAFT(0.05)
s = surrogate(x, tftdiaaft)
@test length(s) == length(x)
@test sort(x) ≈ sort(s)
@test_throws ArgumentError TFTD(0)
@test_throws ArgumentError TFTD(1.2)
end
@testset "TAAFT" begin
method_preserve_lofreq = TAAFT(0.05)
method_preserve_hifreq = TAAFT(-0.05)
s = surrogate(x, method_preserve_lofreq)
@test length(s) == length(x)
@test all([s[i] ∈ x for i = 1:N])
s = surrogate(x, method_preserve_hifreq)
@test length(s) == length(x)
@test all([s[i] ∈ x for i = 1:N])
@test_throws ArgumentError TAAFT(0)
end
@testset "RandomFourier" begin
@testset "random phases" begin
phases = true
rf = RandomFourier(phases)
s = surrogate(x, rf)
@test length(s) == length(x)
# test that power spectrum is conserved
psx = abs2.(rfft(x))
pss = abs2.(rfft(s))
# For some reason I don't understand the last element of the spectrum
# is way off what is should be.
@test all(isapprox.(psx[1:end-1], pss[1:end-1]; atol = 1e-8))
end
@testset "random amplitudes" begin
phases = false
rf = RandomFourier(phases)
s = surrogate(x, rf)
@test length(s) == length(x)
end
end
@testset "TFTDRandomFourier" begin
@testset "random phases" begin
phases = true
rf = TFTDRandomFourier(phases)
s = surrogate(x, rf)
@test length(s) == length(x)
end
@testset "random amplitudes" begin
phases = false
rf = TFTDRandomFourier(phases)
s = surrogate(x, rf)
@test length(s) == length(x)
end
end
@testset "Circ/Cycle shuffle" begin
x = random_cycles()
s = surrogate(x, CycleShuffle())
for a in s
@test a ∈ x
end
s = surrogate(x, CircShift(1:length(x)))
for a in s
@test a ∈ x
end
end
using DelayEmbeddings
@testset "ShufleDims" begin
X = StateSpaceSet(rand(100, 3))
Y = surrogate(X, ShuffleDimensions())
for i in 1:100
@test sort(X[i]) == sort(Y[i])
end
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1608 | using Random, Statistics
N = 500
ts = cumsum(randn(N))
ts_nan = cumsum(randn(N))
ts_nan[1] = NaN
x = cos.(range(0, 20π, length = N)) .+ randn(N)*0.05
xf = x .|> Float32
t = (0:N-1) + rand(N)
all_conceivable_methods = [
PartialRandomization(0.3)
PartialRandomization(0.8)
WLS(rescale = false)
WLS(AAFT(), rescale = true)
WLS(rescale = false)
WLS(CircShift(N), f = nothing)
WLS(BlockShuffle(10), f = Statistics.cor)
RandomCascade()
PseudoPeriodic(3, 25, 0.05)
BlockShuffle()
BlockShuffle(4)
RandomShuffle()
AutoRegressive(1)
AAFT()
IAAFT()
TFTS(0.05)
TFTS(-0.05)
TAAFT(0.05)
TAAFT(-0.05)
RandomFourier(true)
RandomFourier(false)
TFTD()
TFTD(0.05)
TFTDAAFT(0.03)
TFTDIAAFT(0.03)
CycleShuffle()
IrregularLombScargle(t; tol = 10, n_total = 20000, n_acc = 5000)
]
methodnames = [string(nameof(typeof(x))) for x in all_conceivable_methods]
@testset "Reproducibility (rng)" begin
@testset "$n" for (i, n) in enumerate(methodnames)
method = all_conceivable_methods[i]
rng = Random.MersenneTwister(1234)
y = surrogate(x, method, rng)
rng = Random.MersenneTwister(1234)
z = surrogate(x, method, rng)
@test y == z
end
end
@testset "Float32 handling" begin
@testset "$n" for (i, n) in enumerate(methodnames)
method = all_conceivable_methods[i]
rng = Random.MersenneTwister(1234)
y = surrogate(xf, method, rng)
rng = Random.MersenneTwister(1234)
z = surrogate(xf, method, rng)
@test y == z
end
end
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 123 | using Test
using TimeseriesSurrogates
include("all_method_tests.jl")
include("reproducibility.jl")
include("test_test.jl") | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 560 | using Test
using TimeseriesSurrogates
using Random
using StatsBase: autocor
n = 400 # timeseries length
rng = Xoshiro(1234567)
x = TimeseriesSurrogates.AR1(; n_steps = n, k = 0.25, rng)
q(x) = sum(autocor(x, 0:10))
test = SurrogateTest(q, x, RandomFourier(); n = 1000, rng)
# the AR1 process is much more correlated than its surrogates!
p = pvalue(test)
@test p > 0.9
p = pvalue(test; tail = :right)
@test p < 0.1
test = SurrogateTest(q, x, RandomFourier(); n = 1000, rng)
rval, vals = fill_surrogate_test!(test)
@test minimum(vals) ≤ rval ≤ maximum(vals) | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | code | 1655 | L = 50
D = UncertainDataset([UncertainValue(Normal, rand(), rand()) for i = 1:L])
V = UncertainValueDataset([UncertainValue(Normal, rand(), rand()) for i = 1:L])
I = UncertainIndexDataset([UncertainValue(Normal, rand(), rand()) for i = 1:L])
@test randomshuffle(D) isa Vector{Float64}
@test randomshuffle(V) isa Vector{Float64}
@test randomshuffle(I) isa Vector{Float64}
@test randomphases(D) isa Vector{Float64}
@test randomphases(V) isa Vector{Float64}
@test randomphases(I) isa Vector{Float64}
@test randomamplitudes(D) isa Vector{Float64}
@test randomamplitudes(V) isa Vector{Float64}
@test randomamplitudes(I) isa Vector{Float64}
@test aaft(D) isa Vector{Float64}
@test aaft(V) isa Vector{Float64}
@test aaft(I) isa Vector{Float64}
@test iaaft(D) isa Vector{Float64}
@test iaaft(V) isa Vector{Float64}
@test iaaft(I) isa Vector{Float64}
method_AAFT = AAFT()
method_IAAFT = IAAFT()
method_RandomShuffle = RandomShuffle()
method_RandomFourier = RandomFourier()
@test surrogate(D, method_AAFT) isa Vector{Float64}
@test surrogate(D, method_IAAFT) isa Vector{Float64}
@test surrogate(D, method_RandomShuffle) isa Vector{Float64}
@test surrogate(D, method_RandomFourier) isa Vector{Float64}
@test surrogate(V, method_AAFT) isa Vector{Float64}
@test surrogate(V, method_IAAFT) isa Vector{Float64}
@test surrogate(V, method_RandomShuffle) isa Vector{Float64}
@test surrogate(V, method_RandomFourier) isa Vector{Float64}
@test surrogate(I, method_AAFT) isa Vector{Float64}
@test surrogate(I, method_IAAFT) isa Vector{Float64}
@test surrogate(I, method_RandomShuffle) isa Vector{Float64}
@test surrogate(I, method_RandomFourier) isa Vector{Float64} | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 2279 | *Changelog is kept with respect to version 1.0. This software follows SymVer2.0*
# 2.7
The function `fill_surrogate_test!` that was already in the source code and used by `pvalue` is now exported, so that if the users just want a parallelized estimation of surrogate discriminatory statistic they can just use this function.
# 2.6
- Added surrogate methods: `RelativePartialRandomization`, `SpectralPartialRandomization`, `RelativePartialRandomizationAAFT`, and `SpectralPartialRandomizationAAFT`.
# 2.5
- Moved to Julia extensions (requiring julia v1.9).
# 2.4
- Calling `pvalue` with `SurrogateTest` is now parallelized over available threads.
# 2.3
- `pvalue` is now correctly overloaded from StatsAPI.jl.
# 2.2
- Implemented API for automating surrogate hypothesis tests using the new exported names
`SurrogateTest` and `pvalue`.
- New documentation section with an educative example of surrogate testing.
# 2.1
- Added more padding modes to `RandomCascade`
# 2.0
## API changes
- `SurrogateGenerator`s now have a field `s` into which surrogates are generated, avoiding
unnecessary memory allocations. The
- The wavelet (`WLS`) surrogate constructor now uses keywords arguments instead of
positional arguments for some parameters.
## New features
- New surrogate methods: `PartialRandomization`, `PartialRandomizationAAFT`, `TFTDAAFT`,
`TFTDIAAFT`, and `RandomCascade`.
- Using the `f` keyword, it is now possible to select whether circular shifting at each
wavelet coefficient level should be performed for `WLS` surrogates.
# 1.3
## New features
- The API now allows random number generator to be specified for all methods, enabling
reproducibility
- New surrogate methods: `PseudoPeriodicTwin`, `IrregularLombScargle` and
`TFTDRandomFourier`.
## Bug fixes
- Fixed error in `RandomFourier(true)` and `AAFT` surrogates, where phases were not
correctly computed, leading to surrogates whose power spectra didn't match the power
spectrum of the original signal as well as they should. No other Fourier-based surrogate
were affected by this bug.
# 1.2
- New surrogate methods: `AutoRegressive`
# 1.1
- New surrogate methods: `CycleShuffle`, `ShuffleDimensions`, `CircShift`
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 2054 | # TimeseriesSurrogates.jl
[](https://juliadynamics.github.io/DynamicalSystemsDocs.jl/timeseriessurrogates/dev/)
[](https://juliadynamics.github.io/DynamicalSystemsDocs.jl/timeseriessurrogates/stable/)
[](https://doi.org/10.21105/joss.04414)
[](https://github.com/JuliaDynamics/TimeseriesSurrogates.jl/actions?query=workflow%3ACI)
[](https://codecov.io/gh/JuliaDynamics/TimeseriesSurrogates.jl)
[](https://pkgs.genieframework.com?packages=TimeseriesSurrogates)
A Julia package for generating timeseries surrogates.
TimeseriesSurrogates.jl is the fastest and most featureful open source code for generating timeseries surrogates.
It can be used as a standalone package, or as part of other projects in JuliaDynamics such as DynamicalSystems.jl or CausalityTools.jl.
To install it, run `import Pkg; Pkg.add("TimeseriesSurrogates")`.
All further information is provided in the documentation, which you can either find online or build locally by running the `docs/make.jl` file.
## Citing
Please use the following BiBTeX entry, or DOI, to cite TimeseriesSurrogates.jl:
DOI: https://doi.org/10.21105/joss.04414
BiBTeX:
```latex
@article{TimeseriesSurrogates.jl,
doi = {10.21105/joss.04414},
url = {https://doi.org/10.21105/joss.04414},
year = {2022},
publisher = {The Open Journal},
volume = {7},
number = {77},
pages = {4414},
author = {Kristian Agasøster Haaga and George Datseris},
title = {TimeseriesSurrogates.jl: a Julia package for generating surrogate data},
journal = {Journal of Open Source Software}
}
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 422 | ---
name: Bug report
about: Create a report to help us improve
title: ''
labels: ''
assignees: ''
---
**Describe the bug**
A clear and concise description of what the bug is.
**Minimal Working Example**
Please provide a piece of code that leads to the bug you encounter.
If the code is **runnable**, it will help us identify the problem faster.
**TimeseriesSurrogates.jl version**
Please provide the version you use! | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 502 | ---
name: Feature request
about: Suggest an idea for this project
title: ''
labels: ''
assignees: ''
---
**Is your feature request related to a problem? Please describe.**
A clear and concise description of what the problem is. Ex. I'm always frustrated when [...]
**Describe the solution you'd like**
A clear and concise description of what you want to happen.
**Describe alternatives you've considered**
A clear and concise description of any alternative solutions or features you've considered.
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 1936 | # Contributing
## Reporting issues
If you are having issues with the code, find bugs or otherwise want to report something about the package,
please submit an issue at our [GitHub repository](https://github.com/JuliaDynamics/TimeseriesSurrogates.jl/issues).
## Feature requests
If you have requests for a new method but can't implement it yourself, you can also report it as an [issue](https://github.com/JuliaDynamics/TimeseriesSurrogates.jl/issues). The package developers or other volunteers might be able to help with the implementation.
Please mark method requests clearly as "Method request: my new method...", and provide a reference to a scientific publication that outlines the algorithm.
## Pull requests
Pull requests for new surrogate methods are very welcome. Ideally, your implementation should use the same API as the existing methods:
- Create a `struct` for your surrogate method, e.g. `struct MyNewSurrogateMethod <: Surrogate`, that contain the parameters for the method. The docstring for the method should contain a reference to scientific publications detailing the algorithm,
as well as the intended purpose of the method, and potential implementation details that differ from the original algorithm.
- Implement `surrogenerator(x, method::MyNewSurrogateMethod)`, where you pre-compute things for efficiency and return a `SurrogateGenerator` instance.
- Implement the `SurrogateGenerator{<:MyNewSurrogateMethod}` functor that produces surrogate time series on demand. This is where the precomputed things are used, and the actual algorithm is implemented.
- Then `surrogate(x, method::Surrogate)` will "just work".
If you find this approach difficult and already have a basic implementation of a new surrogate method, the package maintainers may be able to help structuring the code. Let us know in an [issue](https://github.com/JuliaDynamics/TimeseriesSurrogates.jl/issues) or in a pull request!
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 3142 | # TimeseriesSurrogates.jl

`TimeseriesSurrogates` is a Julia package for generating surrogate timeseries. It is part of [JuliaDynamics](https://juliadynamics.github.io/JuliaDynamics/), a GitHub organization dedicated to creating high quality scientific software.
If you are new to this method of surrogate timeseries, feel free to read the [Crash-course in timeseries surrogate testing](@ref) page.
Please note that timeseries surrogates should not be confused with [surrogate models](https://en.wikipedia.org/wiki/Surrogate_model), such as those provided by [Surrogates.jl](https://github.com/SciML/Surrogates.jl).
## Installation
TimeseriesSurrogates.jl is a registered Julia package. To install the latest version, run the following code:
```julia
import Pkg; Pkg.add("TimeseriesSurrogates")
```
## API
TimeseriesSurrogates.jl API is composed by four names: [`surrogate`](@ref), [`surrogenerator`](@ref), [`SurrogateTest`](@ref), and [`pvalue`](@ref). They dispatch on the method to generate surrogates, which is a subtype of [`Surrogate`](@ref).
It is recommended to standardize the signal before using these functions, i.e. subtract mean and divide by standard deviation. The function `standardize` does this.
### Generating surrogates
```@docs
surrogate
surrogenerator
```
### Hypothesis testing
```@docs
SurrogateTest
fill_surrogate_test!
pvalue(::SurrogateTest)
```
## Surrogate methods
```@docs
Surrogate
```
```@index
Order = [:type]
```
### Shuffle-based
```@docs
RandomShuffle
BlockShuffle
CycleShuffle
CircShift
```
### Fourier-based
```@docs
RandomFourier
TFTDRandomFourier
PartialRandomization
PartialRandomizationAAFT
RelativePartialRandomization
RelativePartialRandomizationAAFT
SpectralPartialRandomization
SpectralPartialRandomizationAAFT
AAFT
TAAFT
IAAFT
```
### Non-stationary
```@docs
TFTS
TFTD
TFTDAAFT
TFTDIAAFT
```
### Pseudo-periodic
```@docs
PseudoPeriodic
PseudoPeriodicTwin
```
### Wavelet-based
```@docs
WLS
RandomCascade
```
### Other
```@docs
AutoRegressive
ShuffleDimensions
IrregularLombScargle
```
### Utilities
```@docs
noiseradius
```
## Visualization
TimeseriesSurrogates.jl has defined a simple function `surroplot(x, s)`.
This comes into scope when `using Makie` (you also need a plotting backend).
This functionality requires you to be using Julia 1.9 or later versions.
Example:
```@example MAIN
using TimeseriesSurrogates
using CairoMakie
x = AR1() # create a realization of a random AR(1) process
fig = surroplot(x, AAFT())
save("surroplot.png", fig); # hide
```
## Citing
Please use the following BiBTeX entry, or DOI, to cite TimeseriesSurrogates.jl:
DOI: https://doi.org/10.21105/joss.04414
BiBTeX:
```latex
@article{TimeseriesSurrogates.jl,
doi = {10.21105/joss.04414},
url = {https://doi.org/10.21105/joss.04414},
year = {2022},
publisher = {The Open Journal},
volume = {7},
number = {77},
pages = {4414},
author = {Kristian Agasøster Haaga and George Datseris},
title = {TimeseriesSurrogates.jl: a Julia package for generating surrogate data},
journal = {Journal of Open Source Software}
}
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 1592 | # Surrogates for unevenly sampled time series
To derive a surrogate for unevenly sampled time series, we can use surrogate methods which which does not explicitly use the time axis like [`RandomShuffle`](@ref) or [`BlockShuffle`](@ref), or we need to use algorithms that take the irregularity of the time axis into account.
## Lomb-Scargle based surrogate
The [`IrregularLombScargle`](@ref) surrogate is a form of a constrained surrogate which takes the Lomb-Scargle periodogram, which works on irregularly spaced data, to derive surrogates with similar phase distribution as the original time series.
This function uses the simulated annealing algorithm[^SchmitzSchreiber1999] to minimize the Minkowski distance between the original periodogram and the surrogate periodogram.
```@example MAIN
using TimeseriesSurrogates, CairoMakie, Random
# Example data: random AR1 process with a time axis with unevenly
# spaced time steps
rng = Random.MersenneTwister(1234)
x = AR1(n_steps = 300)
N = length(x)
t = (1:N) - rand(N)
# Use simulated annealing based on convergence of Lomb-Scargle periodograms
# The time series is relatively long, so set tolerance a bit higher than default.
ls = IrregularLombScargle(t, n_total = 100000, n_acc = 50000, tol = 5.0)
s = surrogate(x, ls, rng)
fig, ax = lines(t, x; label = "original")
lines!(ax, t, s; label = "surrogate")
axislegend(ax)
fig
```
[^SchmitzSchreiber1999]: A.Schmitz T.Schreiber (1999). "Testing for nonlinearity in unevenly sampled time series" [Phys. Rev E](https://journaIrregularLombScargle.aps.org/pre/pdf/10.1103/PhysRevE.59.4044)
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 4692 | # Surrogates for nonstationary time series
Several of the methods provided by TimeseriesSurrogates.jl can be used to
construct surrogates for nonstationary time series, which the following examples illustrate.
## Truncated Fourier surrogates
### [`TFTS`](@ref)
By retaining the lowermost frequencies of the frequency spectrum,
([`TFTS`](@ref)) surrogates preserve long-term trends in the signals.
```@example
using TimeseriesSurrogates
n = 300; a = 0.7; A = 20; σ = 15
x = cumsum(randn(n)) .+ [(1 + a*i) .+ A*sin(2π/10*i) for i = 1:n] .+
[A^2*sin(2π/2*i + π) for i = 1:n] .+ σ .* rand(n).^2;
# Preserve 5 % lowermost frequencies.
surroplot(x, surrogate(x, TFTS(0.05)))
```
### [`TAAFT`](@ref)
Truncated AAFT surrogates ([`TAAFT`](@ref)) are similar to TFTS surrogates, but also rescales back to the original values of the signal, so that the original signal and the surrogates consists of the same values. This, however, may introduce some bias, as demonstrated below.
```@example
using TimeseriesSurrogates
# Example signal
n = 300; a = 0.7; A = 20; σ = 15
x = cumsum(randn(n)) .+ [(1 + a*i) .+ A*sin(2π/10*i) for i = 1:n] .+
[A^2*sin(2π/2*i + π) for i = 1:n] .+ σ .* rand(n).^2;
# Preserve 5% of the power spectrum corresponding to the lowest frequencies
s_taaft_lo = surrogate(x, TAAFT(0.05))
surroplot(x, s_taaft_lo)
```
```@example
using TimeseriesSurrogates
# Example signal
n = 300; a = 0.7; A = 20; σ = 15
x = cumsum(randn(n)) .+ [(1 + a*i) .+ A*sin(2π/10*i) for i = 1:n] .+
[A^2*sin(2π/2*i + π) for i = 1:n] .+ σ .* rand(n).^2;
# Preserve 20% of the power spectrum corresponding to the highest frequencies
s_taaft_hi = surrogate(x, TAAFT(-0.2))
surroplot(x, s_taaft_hi)
```
## Truncated FT surrogates with trend removal/addition
One solution is to combine truncated Fourier surrogates with detrending/retrending.
For time series with strong trends, Lucio et al. (2012)[^Lucio2012] proposes variants
of the truncated Fourier-based surrogates wherein the trend is removed prior to
surrogate generation, and then added to the surrogate again after it has been generated.
This yields surrogates quite similar to those obtained when using truncated Fourier
surrogates (e.g. [`TFTS`](@ref)), but reducing the effects of endpoint mismatch that
affects regular truncated Fourier transform based surrogates.
In principle, any trend could be removed/added to the signal. For now, the only
option is to remove a best-fit linear trend obtained by ordinary least squares
regression.
### [`TFTD`](@ref)
The [`TFTD`](@ref) surrogate is a random Fourier surrogate where
the lowest frequencies are preserved during surrogate generation, and a
linear trend is removed during preprosessing and added again after the
surrogate has been generated. The [`TFTD`](@ref) surrogates do a decent
job at preserving long term trends.
```@example
using TimeseriesSurrogates
# Example signal
n = 300; a = 0.7; A = 20; σ = 15
x = cumsum(randn(n)) .+ [(1 + a*i) .+ A*sin(2π/10*i) for i = 1:n] .+
[A^2*sin(2π/2*i + π) for i = 1:n] .+ σ .* rand(n).^2;
s = surrogate(x, TFTDRandomFourier(true, 0.02))
surroplot(x, s)
```
[^Lucio2012]: Lucio, J. H., Valdés, R., & Rodríguez, L. R. (2012). Improvements to surrogate data methods for nonstationary time series. Physical Review E, 85(5), 056202.
### [`TFTDAAFT`](@ref)
The detrend-retrend extension of [`TAAFT`](@ref) is the [`TFTDAAFT`](@ref) method. The [`TFTDAAFT`](@ref) method adds a rescaling step to the [`TFTD`](@ref) method, ensuring that the surrogate and the original time series consist of the same values. Long-term trends in the data are also decently preserved by [`TFTDAAFT`](@ref), but like [`TFTDAAFT`](@ref), there is some bias.
```@example
using TimeseriesSurrogates
# Example signal
n = 300; a = 0.7; A = 20; σ = 15
x = cumsum(randn(n)) .+ [(1 + a*i) .+ A*sin(2π/10*i) for i = 1:n] .+
[A^2*sin(2π/2*i + π) for i = 1:n] .+ σ .* rand(n).^2;
# Keep 2 % of lowermost frequencies.
s = surrogate(x, TFTDAAFT(0.02))
surroplot(x, s)
```
### [`TFTDIAAFT`](@ref)
[`TFTDIAAFT`](@ref)[^Lucio2012] surrogates are similar to [`TFTDAAFT`](@ref) surrogates, but the [`TFTDIAAFT`](@ref)[^Lucio2012] method also uses
an iterative process to better match the power spectra of the original signal and the surrogate (analogous to how the [`IAAFT`](@ref) method improves upon the [`AAFT`](@ref) method).
```@example
using TimeseriesSurrogates
# Example signal
n = 300; a = 0.7; A = 20; σ = 15
x = cumsum(randn(n)) .+ [(1 + a*i) .+ A*sin(2π/10*i) for i = 1:n] .+
[A^2*sin(2π/2*i + π) for i = 1:n] .+ σ .* rand(n).^2;
# Keep 5% of lowermost frequences
s = surrogate(x, TFTDIAAFT(0.05))
surroplot(x, s)
``` | TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 73 | # Utility systems
```@docs
SNLST
randomwalk
NSAR2
AR1
random_cycles
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 4621 | # Crash-course in timeseries surrogate testing
!!! note
The summary here follows Sect. 7.4 from [Nonlinear Dynamics](https://link.springer.com/book/10.1007/978-3-030-91032-7) by Datseris and Parlitz.
## What is a surrogate timeseries?
A surrogate of a timeseries `x` is another timeseries `s` of equal length to `x`. This surrogate `s` is generated from `x` so that it roughly preserves
one or many pre-defined properties of `x`, but is otherwise randomized.
The upper panel in the figure below shows an example of a timeseries and one
surrogate realization that preserves its both power spectrum and its amplitude distribution (histogram). Because of this preservation, the time series look similar.
```@example MAIN
using TimeseriesSurrogates, CairoMakie
x = LinRange(0, 20π, 300) .+ 0.05 .* rand(300)
ts = sin.(x./rand(20:30, 300) + cos.(x))
s = surrogate(ts, IAAFT())
surroplot(ts, s)
```
## Performing surrogate hypothesis tests
A surrogate test is a statistical test of whether a given timeseries satisfies or not a given hypothesis regarding its properties or origin.
For example, the first surrogate methods were created to test the hypothesis,
whether a given timeseries `x` that appears noisy may be the result of a linear
stochastic process or not. If not, it may be a nonlinear process contaminated with observational noise. For the suitable hypothesis to test for, see the documentation strings of provided `Surrogate` methods or, even better, the review from Lancaster et al. (2018)[^Lancaster2018].
To perform such a surrogate test, you need to:
1. Decide what hypothesis to test against
2. Pick a surrogate generating `method` that satisfies the chosen hypothesis
3. Pick a suitable discriminatory statistic `q` with `q(x) ∈ Real`. It must be a statistic that would obtain sufficiently different values for timeseries satisfying, or not, the chosen hypothesis.
4. Compute `q(s)` for thousands of surrogate realizations `s = surrogate(x, method)`
5. Compare `q(x)` with the distribution of `q(s)`. If `q(x)` is significantly outside the e.g., 5-95 confidence interval of the distribution, the hypothesis is rejected.
This whole process is automated by [`SurrogateTest`](@ref), see the example below.
[^Lancaster2018]: Lancaster, G., Iatsenko, D., Pidde, A., Ticcinelli, V., & Stefanovska, A. (2018). Surrogate data for hypothesis testing of physical systems. Physics Reports, 748, 1–60. doi:10.1016/j.physrep.2018.06.001
## An educative example
Let's put everything together now to showcase how one would use this package to e.g., distinguish deterministic chaos contaminated with noise from actual stochastic timeseries, using the permutation entropy as a discriminatory statistic.
First, let's visualize the timeseries
```@example MAIN
using TimeseriesSurrogates # for surrogate tests
using DynamicalSystemsBase # to simulate logistic map
using ComplexityMeasures # to compute permutation entropy
using Random: Xoshiro # for reproducibility
using CairoMakie # for plotting
# AR1
n = 400 # timeseries length
rng = Xoshiro(1234567)
x = TimeseriesSurrogates.AR1(; n_steps = n, k = 0.25, rng)
# Logistic
logistic_rule(x, p, n) = @inbounds SVector(p[1]*x[1]*(1 - x[1]))
ds = DeterministicIteratedMap(logistic_rule, [0.4], [4.0])
Y, t = trajectory(ds, n-1)
y = standardize(Y[:, 1]) .+ 0.5randn(rng, n) # 50% observational noise
# Plot
fig, ax1 = lines(y)
ax2, = lines(fig[2,1], x, color = Cycled(2))
ax1.title = "deterministic + 50%noise"
ax2.title = "stochastic AR1"
fig
```
Then, let's compute surrogate distributions for both timeseries using the permutation entropy as the discriminatory statistic and [`RandomFourier`](@ref) as the surrogate generation method
```@example MAIN
perment(x) = entropy_normalized(SymbolicPermutation(; m = 3), x)
method = RandomFourier()
fig = Figure()
axs = [Axis(fig[1, i]) for i in 1:2]
Nsurr = 1000
for (i, z) in enumerate((y, x))
sgen = surrogenerator(z, method)
qx = perment(z)
qs = map(perment, (sgen() for _ in 1:Nsurr))
hist!(axs[i], qs; label = "pdf of q(s)", color = Cycled(i))
vlines!(axs[i], qx; linewidth = 5, label = "q(x)", color = Cycled(3))
axislegend(axs[i])
end
fig
```
we clearly see that the discriminatory value for the deterministic signal is so far out of the distribution that the null hypothesis that the timeseries is stochastic can be discarded with ease.
This whole process can be easily automated with [`SurrogateTest`](@ref) as follows:
```@example MAIN
test = SurrogateTest(perment, y, method; n = 1000, rng)
p = pvalue(test)
p < 0.001 # 99.9-th quantile confidence
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 5967 | # Fourier-based
Fourier based surrogates are a form of constrained surrogates created by taking the Fourier
transform of a time series, then shuffling either the phase angles or the amplitudes of the resulting complex numbers. Then, we take the inverse Fourier transform, yielding a surrogate time series.
## Random phase
```@example MAIN
using TimeseriesSurrogates, CairoMakie
ts = AR1() # create a realization of a random AR(1) process
phases = true
s = surrogate(ts, RandomFourier(phases))
surroplot(ts, s)
```
## Random amplitude
```@example MAIN
using TimeseriesSurrogates, CairoMakie
ts = AR1() # create a realization of a random AR(1) process
phases = false
s = surrogate(ts, RandomFourier(phases))
surroplot(ts, s)
```
## Partial randomization
### Without rescaling
[`PartialRandomization`](@ref) surrogates are similar to random phase surrogates, but allow for tuning the "degree" of phase randomization.
[`PartialRandomization`](@ref) use an algorithm introduced by Ortega et al., which draws random phases as:
$$\phi \to \alpha \xi , \quad \xi \sim \mathcal{U}(0, 2\pi),$$
where $\phi$ is a Fourier phase and $\mathcal{U}(0, 2\pi)$ is a uniform distribution.
Tuning the randomization parameter, $\alpha$, produces a set of time series with varying degrees of randomness in their Fourier phases.
```@example MAIN
using TimeseriesSurrogates, CairoMakie
ts = AR1() # create a realization of a random AR(1) process
# 50 % randomization of the phases
s = surrogate(ts, PartialRandomization(0.5))
surroplot(ts, s)
```
In addition to [`PartialRandomization`](@ref), we provide two other algorithms for producing partially randomized surrogates, outlined below.
### Relative partial randomization
The [`PartialRandomization`](@ref) algorithm corresponds to assigning entirely new phases to the Fourier spectrum with some degree of randomness, regardless of any deterministic structure in the original phases. As such, even for $\alpha = 0$ the surrogate time series can differ drastically from the original time series.
By contrast, the [`RelativePartialRandomization`](@ref) procedure draws phases as:
$$\phi \to \phi + \alpha \xi, \quad \xi \sim \mathcal{U}(0, 2\pi).$$
With this algorithm, phases are progressively corrupted by higher values of $\alpha$: surrogates are identical to the original time series for $\alpha = 0$, equivalent to random noise for $\alpha = 1$, and retain some of the structure of the original time series when $0 < \alpha < 1$. This procedure is particularly useful for controlling the degree of chaoticity and non-linearity in surrogates of chaotic systems.
### Spectral partial randomization
Both of the algorithms above randomize phases at all frequency components to the same degree.
To assess the contribution of different frequency components to the structure of a time series, the [`SpectralPartialRandomization`](@ref) algorithm only randomizes phases above a frequency threshold.
The threshold is chosen as the lowest frequency at which the power spectrum of the original time series drops below a fraction $1-\alpha$ of its maximum value (such that the power contained above the frequency threshold is a proportion $\alpha$ of the total power, excluding the zero frequency).
See the figure below for a comparison of the three partial randomization algorithms:
```@example MAIN
using DynamicalSystemsBase # hide
function surrocompare(x, surr_types, params; color = ("#7143E0", 0.9), N=1000, linewidth=3, # hide
transient=0, kwargs...) # hide
fig = Makie.Figure(resolution = (1080, 480), fontsize=22, kwargs...) # hide
for (j, a) in enumerate(surr_types) # hide
for (i, p) in enumerate(params) # hide
ax = Makie.Axis(fig[i,j]) # hide
hidedecorations!(ax) # hide
ax.ylabelvisible = true # hide
lines!(ax, surrogate(x, a(p...))[transient+1:transient+N]; color, linewidth) # hide
j == 1 && (ax.ylabel = "α = $(p)"; ax.ylabelfont = :bold) # hide
i == 1 && (ax.title = string(a)) # hide
end # hide
end # hide
colgap!(fig.layout, 30) # hide
rowgap!(fig.layout, 30) # hide
return fig # hide
end # hide
@inbounds function lorenz_rule!(du, u, p, t) # hide
σ = p[1]; ρ = p[2]; β = p[3] # hide
du[1] = σ*(u[2]-u[1]) # hide
du[2] = u[1]*(ρ-u[3]) - u[2] # hide
du[3] = u[1]*u[2] - β*u[3] # hide
return nothing # hide
end # hide
u0 = [0, 10.0, 0] # hide
p0 = [10, 28, 8/3] # hide
diffeq = (; abstol = 1e-9, reltol = 1e-9) # hide
lorenz = CoupledODEs(lorenz_rule!, u0, p0; diffeq) # hide
x = trajectory(lorenz, 1000; Ttr=500, Δt=0.025)[1][:, 1] # hide
surr_types = [PartialRandomization, RelativePartialRandomization, SpectralPartialRandomization] # hide
params = [0.0, 0.1, 0.25] # hide
surrocompare(x, surr_types, params; transient=1000) # hide
```
### With rescaling
[`PartialRandomizationAAFT`](@ref) adds a rescaling step to the [`PartialRandomization`](@ref) surrogates to obtain surrogates that contain the same values as the original time series. AAFT versions of [`RelativePartialRandomization`](@ref) and [`SpectralPartialRandomization`](@ref) are also available.
```@example MAIN
using TimeseriesSurrogates, CairoMakie
ts = AR1() # create a realization of a random AR(1) process
# 50 % randomization of the phases
s = surrogate(ts, PartialRandomizationAAFT(0.7))
surroplot(ts, s)
```
## Amplitude adjusted Fourier transform (AAFT)
```@example MAIN
using TimeseriesSurrogates, CairoMakie
ts = AR1() # create a realization of a random AR(1) process
s = surrogate(ts, AAFT())
surroplot(ts, s)
```
## Iterative AAFT (IAAFT)
The IAAFT surrogates add an iterative step to the AAFT algorithm to improve similarity
of the power spectra of the original time series and the surrogates.
```@example MAIN
using TimeseriesSurrogates, CairoMakie
ts = AR1() # create a realization of a random AR(1) process
s = surrogate(ts, IAAFT())
surroplot(ts, s)
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 1275 | # Multidimensional surrogates
Multidimensional surrogates operate typically on input `StateSpaceSet`s and output the same type.
## Shuffle dimensions
This surrogate was made to distinguish multidimensional data with *structure in the state space* from multidimensional noise.
Here is a simple application that shows that the distinction is successful for a system that we know a-priori is deterministic and has structure in the state space (a chaotic attractor).
```@example MAIN
using TimeseriesSurrogates
using DynamicalSystemsBase
using FractalDimensions: correlationsum
using CairoMakie
# Create a trajectory from the towel map
function towel_rule(x, p, n)
@inbounds x1, x2, x3 = x[1], x[2], x[3]
SVector( 3.8*x1*(1-x1) - 0.05*(x2+0.35)*(1-2*x3),
0.1*( (x2+0.35)*(1-2*x3) - 1 )*(1 - 1.9*x1),
3.78*x3*(1-x3)+0.2*x2 )
end
to = DeterministicIteratedMap(towel_rule, [0.1, -0.1, 0.1])
X = trajectory(to, 10_000; Ttr = 100)[1]
e = 10.0 .^ range(-1, 0; length = 10)
CX = correlationsum(X, e; w = 5)
le = log10.(e)
fig, ax = lines(le, log10.(CX))
sg = surrogenerator(X, ShuffleDimensions())
for i in 1:10
Z = sg()
CZ = correlationsum(Z, e)
lines!(ax, le, log.(CZ); color = ("black", 0.8))
end
ax.xlabel = "log(e)"; ax.ylabel = "log(C)"
fig
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 341 | # Pseudo-periodic
```@example MAIN
using TimeseriesSurrogates
t = 0:0.05:20π
x = @. 4 + 7cos(t) + 2cos(2t + 5π/4)
x .+= randn(length(x))*0.2
# Optimal d, τ values deduced using DelayEmbeddings.jl
d, τ = 3, 31
# For ρ you can use `noiseradius`
ρ = 0.11
method = PseudoPeriodic(d, τ, ρ, false)
s = surrogate(x, method)
surroplot(x, s)
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 1173 | # Pseudo-periodic twin surrogates
```@example MAIN
using TimeseriesSurrogates, CairoMakie
# Example system from the original paper
n, Δt = 500, 0.05
f₁, f₂ = sqrt(3), sqrt(5)
x = [8*sin(2π*f₁*t) + 4*sin(2π*f₂*t) for t = 0:Δt:Δt*n]
# Embedding parameter, neighbor threshold and noise radius
d, τ = 2, 6
δ = 0.15
ρ = noiseradius(x, d, τ, 0.02:0.02:0.5)
method = PseudoPeriodicTwin(d, τ, δ, ρ)
# Generate the surrogate, which is a `d`-dimensional dataset.
surr_orbit = surrogate(x, method)
# Get scalar surrogate time series from first and second column.
s1, s2 = surr_orbit[:, 1], surr_orbit[:, 2]
# Scalar time series versus surrogate time series
fig = Figure()
ax_ts = Axis(fig[1,1:2]; xlabel = "time", ylabel = "value")
lines!(ax_ts, s1; color = :red)
lines!(ax_ts, x; color = :black)
# Embedding versus surrogate embedding
X = embed(x, d, τ)
ax2 = Axis(fig[2, 1]; xlabel = "x(t)", ylabel = "x(t-$τ)")
lines!(ax2, X[:, 1], X[:, 2]; color = :black)
scatter!(ax2, X[:, 1], X[:, 2]; color = :black, markersize = 4)
ps = Axis(fig[2,2]; xlabel= "s(t)", ylabel = "s(t-$τ)")
lines!(ps, s1, s2; color = :red)
scatter!(ps, s1, s2; color = :black, markersize = 4)
fig
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 1227 | # Shuffle-based
## Random shuffle (RS)
Randomly shuffled surrogates are simply permutations of the original time series.
Thus, they break any correlations in the signal.
```@example MAIN
using TimeseriesSurrogates, CairoMakie
x = AR1() # create a realization of a random AR(1) process
s = surrogate(x, RandomShuffle())
surroplot(x, s)
```
## Block shuffle (BS)
Randomly shuffled surrogates are generated by dividing the original signal into
blocks, then permuting those blocks. Block positions are randomized, and
blocks at the end of the signal gets wrapped around to the start of the time
series.
Thus, they keep short-term correlations within
blocks, but destroy any long-term dynamical information in the signal.
```@example MAIN
using TimeseriesSurrogates, CairoMakie
x = NSAR2(n_steps = 300)
# We want to divide the signal into 8 blocks.
s = surrogate(x, BlockShuffle(8))
p = surroplot(x, s)
```
## Cycle shuffle (CSS)
```@example MAIN
using TimeseriesSurrogates, CairoMakie
x = random_cycles()
s = surrogate(x, CycleShuffle())
p = surroplot(x, s)
```
## Circular shift
```@example MAIN
using TimeseriesSurrogates, CairoMakie
x = random_cycles()
s = surrogate(x, CircShift(1:length(x)))
p = surroplot(x, s)
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 4386 | # Wavelet surrogates
## `WLS`
[`WLS`](@ref) surrogates are constructed by taking the maximal overlap
discrete wavelet transform (MODWT) of the signal, shuffling detail
coefficients across dyadic scales, then inverting the transform to
obtain the surrogate.
### Wavelet-IAAFT (WIAAFT) surrogates
In [Keylock (2006)](https://journals.aps.org/pre/abstract/10.1103/PhysRevE.73.036707),
IAAFT shuffling is used, yielding surrogates that preserve the local mean and
variance of the original signal, but randomizes nonlinear properties of the signal.
This also preserves nonstationarities in the signal. To construct WIAAFT surrogates,
rescaling must be enabled.
*Note: the final iterative procedure of the WIAAFT surrogate method, after the rescaling step,
is not performed in our current implementation, so surrogates might differ a bit from results
in Keylock (2006). For now, you have to do the iterative rescaling manually if desired.*.
```@example MAIN
using TimeseriesSurrogates, Random
Random.seed!(5040)
n = 500
σ = 30
x = cumsum(randn(n)) .+
[20*sin(2π/30*i) for i = 1:n] .+
[20*cos(2π/90*i) for i = 1:n] .+
[50*sin(2π/2*i + π) for i = 1:n] .+
σ .* rand(n).^2 .+
[0.5*t for t = 1:n];
# Rescale surrogate back to original values
method = WLS(IAAFT(), rescale = true)
s = surrogate(x, method);
p = surroplot(x, s)
```
Even without rescaling, IAAFT shuffling also yields surrogates with local properties
very similar to the original signal.
```@example MAIN
using TimeseriesSurrogates, Random
Random.seed!(5040)
n = 500
σ = 30
x = cumsum(randn(n)) .+
[20*sin(2π/30*i) for i = 1:n] .+
[20*cos(2π/90*i) for i = 1:n] .+
[50*sin(2π/2*i + π) for i = 1:n] .+
σ .* rand(n).^2 .+
[0.5*t for t = 1:n];
# Don't rescale back to original time series.
method = WLS(IAAFT(), rescale = false)
s = surrogate(x, method);
p = surroplot(x, s)
```
### Other shuffling methods
The choice of coefficient shuffling method determines how well and
which properties of the original signal are retained by the surrogates.
There might be use cases where surrogates do not need to perfectly preserve the
autocorrelation of the original signal, so additional shuffling
methods are provided for convenience.
Using random shuffling of the detail coefficients does not preserve the
autocorrelation structure of the original signal.
```@example MAIN
using TimeseriesSurrogates, Random
Random.seed!(5040)
n = 500
σ = 30
x = cumsum(randn(n)) .+
[20*sin(2π/30*i) for i = 1:n] .+
[20*cos(2π/90*i) for i = 1:n] .+
[50*sin(2π/2*i + π) for i = 1:n] .+
σ .* rand(n).^2 .+
[0.5*t for t = 1:n];
method = WLS(RandomShuffle(), rescale = false)
s = surrogate(x, method);
p = surroplot(x, s)
```
Block shuffling the detail coefficients better preserve local properties
because the shuffling is not completely random, but still does not
preserve the autocorrelation of the original signal.
```@example MAIN
using TimeseriesSurrogates, Random
Random.seed!(5040)
n = 500
σ = 30
x = cumsum(randn(n)) .+
[20*sin(2π/30*i) for i = 1:n] .+
[20*cos(2π/90*i) for i = 1:n] .+
[50*sin(2π/2*i + π) for i = 1:n] .+
σ .* rand(n).^2 .+
[0.5*t for t = 1:n];
s = surrogate(x, WLS(BlockShuffle(10), rescale = false));
p = surroplot(x, s)
```
Random Fourier phase shuffling the detail coefficients does a decent job at preserving
the autocorrelation.
```@example MAIN
using TimeseriesSurrogates, Random
Random.seed!(5040)
n = 500
σ = 30
x = cumsum(randn(n)) .+
[20*sin(2π/30*i) for i = 1:n] .+
[20*cos(2π/90*i) for i = 1:n] .+
[50*sin(2π/2*i + π) for i = 1:n] .+
σ .* rand(n).^2 .+
[0.5*t for t = 1:n];
s = surrogate(x, WLS(RandomFourier(), rescale = false));
surroplot(x, s)
```
To generate surrogates that preserve linear properties of the original signal, AAFT or IAAFT shuffling is required.
## `RandomCascade`
[`RandomCascade`](@ref) surrogates is another wavelet-based method that uses the regular discrete wavelet transform to generate surrogates.
```@example MAIN
using TimeseriesSurrogates, Random
Random.seed!(5040)
n = 500
σ = 30
x = cumsum(randn(n)) .+
[20*sin(2π/30*i) for i = 1:n] .+
[20*cos(2π/90*i) for i = 1:n] .+
[50*sin(2π/2*i + π) for i = 1:n] .+
σ .* rand(n).^2 .+
[0.2*t for t = 1:n];
s = surrogate(x, RandomCascade());
surroplot(x, s)
```
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 9239 | ---
title: 'TimeseriesSurrogates.jl: a Julia package for generating surrogate data'
tags:
- Julia
- surrogate data
- time series
- nonlinear time series analysis
- hypothesis testing
authors:
- name: Kristian Agasøster Haaga
orcid: 0000-0001-6880-8725
affiliation: "1, 2, 3"
- name: George Datseris
orcid: 0000-0002-6427-2385
affiliation: "4"
affiliations:
- name: Department of Earth Science, University of Bergen, Bergen, Norway
index: 1
- name: K. G. Jebsen Centre for Deep Sea Research, Bergen, Norway
index: 2
- name: Bjerknes Centre for Climate Research, Bergen, Norway
index: 3
- name: Max Planck Institute for Meteorology, Hamburg, Germany
index: 4
date: 9 March 2020
bibliography: paper.bib
---
# Introduction
The method of surrogate data is a way to generate data that preserve one or more statistical or dynamical properties of a given timeseries, but are otherwise randomized. Surrogate time series methods have widespread use in null hypothesis testing in nonlinear dynamics, for null hypothesis testing in causal inference, or for the more general case of producing synthetic data with similar statistical properties as an original signal. Originally introduced by @Theiler:1992 to test for nonlinearity in time series, numerous surrogate methods aimed preserving different properties of the original signal have since emerged; for a review, see @Lancaster:2018.
A simple example of an application of surrogates would be to distinguish whether a given timeseries `x` can be represented via a linear noise process, or not. The latter case can be an indication that the timeseries may represent deterministic nonlinear dynamics with additional noise. A simple way to test for this hypothesis would be to generate new timeseries from `x` that conserve the power spectrum of `x` (which is a defining feature of linear stochastic processes). Then, a discriminatory statistic, such as the correlation dimension or the auto-mutual-information [@Lancaster:2018] is computed for `x`, but also for thousands of surrogates from `x`. The discriminatory statistic of the surrogates provides a distribution of possible values, and if the value for `x` is well within the distribution spread, then `x` satisfies the null hypothesis (here, that `x` can be approximated as a linear stochastic process).
# Statement of need
Surrogate data has been used in several thousand publications so far (the citation number of @Theiler:1992 is more than 4,000) and hence the community is in clear need of such methods. Existing software packages for surrogate generation provide much fewer methods than available in the literature, with less-than optimal performance (see Comparison section below), and without allowing reproducible generation of surrogates. TimeseriesSurrogates.jl provides more than double the amount of methods given by other packages, with runtimes similar to and up to an order of magnitude faster than existing surrogate packages in other languages. Equally importantly, TimeseriesSurrogates.jl provides a framework that is tested via continuous integration, and is easy to extend via open source contributions.
# Available surrogate methods
| Method | Description | Reference |
|---|---|---|
| `AutoRegressive` | Autoregressive model based surrogates. | |
| `RandomShuffling` | Random shuffling of individual data points. | @Theiler:1992 |
| `BlockShuffle` | Random shuffling of blocks of data points. | @Theiler:1992 |
| `CircShift` | Circularly shift the signal. | |
| `RandomFourier` | Randomization of phases of Fourier transform of the signal. | @Theiler:1992 |
| `PartialRandomization` | Fourier randomization, but tuning of the "degree" of randomization.| @Ortega:1998 |
| `PartialRandomizationAAFT` | Partial Fourier randomization, but rescaling back to original values. | This paper. |
| `CycleShuffle` | Randomization of phases of Fourier transform of the signal. | @Theiler:1994 |
| `ShuffleDimensions` | Circularly shift the signal. | This paper. |
| `AAFT` | Amplitude adjusted `RandomFourier`. | @Theiler:1992 |
| `IAAFT` | Iterative amplitude adjusted `RandomFourier`. | @SchreiberSchmitz:1996 |
| `TFTS` | Truncated Fourier transform surrogates. | @Miralles2015 |
| `TAAFT` | Truncated AAFT surrogates. | @Nakamura:2006 |
| `TFTDRandomFourier` | Detrended and retrended truncated Fourier surrogates. | @Lucio:2012 |
| `TFTDAAFT` | Detrended and retrended truncated AAFT surrogates. | @Lucio:2012 |
| `TFTDIAAFT` | Detrended and retrended truncated AAFT surrogates with iterative adjustment. | @Lucio:2012 |
| `WLS` | Flexible wavelet-based methods using maximal overlap discrete wavelet transforms. | @Keylock:2006 |
| `RandomCascade` | Random cascade multifractal surrogates. | @Palus:2008 |
| `WIAAFT` | Wavelet-based iterative amplitude adjusted transforms. | @Keylock:2006 |
| `PseudoPeriodic` | Randomization of phases of Fourier transform of the signal. | @Small:2001 |
| `PseudoPeriodicTwin` | Combination of pseudoperiodic and twin surrogates. | @Miralles2015 |
| `LS` | Lomb-Scargle periodogram based surrogates for irregular time grids | @Schmitz:1999
Documentation strings for the various methods describe the usage intended by the original authors of the methods.
Example applications are showcased in the [package documentation](https://juliadynamics.github.io/TimeseriesSurrogates.jl/dev/).
# Design of TimeseriesSurrogates.jl
TimeseriesSurrogates.jl has been designed to be as performant as possible and as simple to extend as possible.
At a first level, we offer a function
```julia
using TimeseriesSurrogates, Random
method = RandomShuffle() # can be any valid method
rng = MersenneTwister(1234) # optional random number generator
s = surrogate(x, method, rng)
```
which creates a surrogate `s` based on the input `x` and the given method (any of the methods mentioned in the above table).
This interface is easily extendable because it uses Julia's multiple dispatch on the given `method`.
Thus, any new contribution of a new method uses the exact same interface, but introduces a new method type, e.g.
```julia
m = NewContributedMethod(args...)
s = surrogate(x, method, rng)
```
The function `surrogate` is straight-forward to use, but it does not allow maximum performance.
The reason for this is that when trying to make a second surrogate from `x` and the same method, there are many structures and computations that could be pre-initialized and/or reused for all surrogates. This is especially relevant for real-world applications where one typically makes thousands of surrogates with a given method.
To address this, we provide a second level of interface, the `surrogenerator` function.
It works as follows: first the user initializes a "surrogate generator" structure:
```julia
method = RandomShuffle()
sg = surrogenerator(x, method, rng)
```
The structure `sg` can generate surrogates of `x` on demand in the most performant manner possible for the given inputs `x, method`.
It can be used like so:
```julia
for i in 1:100
s = sg() # generate a surrogate
# code...
end
```
# Comparison
The average time to generate surrogates in TimeseriesSurrogates.jl is in the best case about an order of magnitude faster than, and in the worst case roughly equivalent to, the MATLAB surrogate code provided by @Lancaster:2018, though comparisons are not exact, due to differing implementations and tuning options. Moreover, the code of @Lancaster:2018 is not an actual package, but rather scripts that have been written and circulated. As such, they lack a test suite tested via continuous integration.
Timings for commonly used surrogate methods that are common to both libraries are shown in Figure 1.
Additionally, because TimeseriesSurrogates.jl provides many more methods not implemented in other packages, a comprehensive comparison of runtimes is not possible, but due to our optimized surrogate generators, we expect good performance relative to future implementations in other languages.

# Acknowledgements
KAH acknowledges funding by the Trond Mohn Foundation (previously Bergen Research Foundation) (Bergen, Norway) and a fast-track initiative grant from Bjerknes Centre for Climate Research (Bergen, Norway).
GD acknowledges continuous support from Bjorn Stevens and the Max Planck Society.
We thank Felix Cremer for the initial pull-request for the simulated annealing based (Lomb-Scargle) surrogate method.
# References
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 2.7.2 | dbba9d7e04a28e3945f9194a6577bf816b34ed70 | docs | 679 | # Instructions
## 1. Run the `timings.m` script in MATLAB
This will:
- Generate a test time series.
- Benchmark the Lancaster et al.'s code on that time series using five different surrogate methods that also exist in TimeseriesSurrogates.jl.
- Export the results as `timeseries.csv` and `matlab_timings.csv`.
## 2. Run the `timings.jl` script in Julia
This will:
- Import the `timeseries.csv` file generated in step 1.
- Benchmark TimeseriesSurrogates.jl on that time series, using the same surrogate methods as for the MATLAB run.
- Generate a bar plot that compares the timings.
- Export the bar plots as a .png file in the "TimeseriesSurrogates.jl/paper/figs/" folder.
| TimeseriesSurrogates | https://github.com/JuliaDynamics/TimeseriesSurrogates.jl.git |
|
[
"MIT"
] | 0.1.1 | 98fea05b931563024ba7559a3d9e3cc498cf814a | code | 363 | using Documenter
using SQLDataFrameTools
using Dates
using Documenter, SQLDataFrameTools
makedocs(
modules = [SQLDataFrameTools],
sitename="SQLDataFrameTools.jl",
authors = "Matt Lawless",
format = Documenter.HTML(),
)
deploydocs(
repo = "github.com/lawless-m/SQLDataFrameTools.jl.git",
devbranch = "main",
push_preview = true,
)
| SQLDataFrameTools | https://github.com/lawless-m/SQLDataFrameTools.jl.git |
|
[
"MIT"
] | 0.1.1 | 98fea05b931563024ba7559a3d9e3cc498cf814a | code | 5836 | module SQLDataFrameTools
using DataFrameTools
using SHA
using DBInterface
using Dates
using DataFrames
using Distributed
export QueryCache, df_cached, select_fn, expired, fetch_and_combine, Dfetch_and_combine
"""
QueryCache(sql, select, dir, format; subformat=nothing, dictencode=true)
is the Data Structure used in this module.
# Arguments
- `sql` is the SQL Query
- `select` is the function used to retrieve the dataset (which can be created with [`select_fn`](@ref))
- `dir` is the directory in which to store the cache file
- `format` is one of the file formats supported. See DataFrameTools.df_formats() for the list.
- `subformat` and `dictencode` are optional parameters for DataFrameTools.df_write
# Examples
query = QueryCache("SELECT 1", select_fn(MySQL.Connection, SERVER, USER, PASSWORD), ".", :jdf)
"""
struct QueryCache
sql
select
cachepath
subformat::Union{Nothing,Symbol}
dictencode::Bool
QueryCache(sql, select, dir, format; subformat=nothing, dictencode=true) = new(sql, select, cachepath(dir, bytes2hex(sha256(sql)), format), subformat, dictencode)
end
cachepath(dir, hash, sformat) = joinpath(dir, hash * '.' * string(sformat))
"""
expired(q::QueryCache, expires::Dates.DateTime)
expired(q::QueryCache, ttl::Dates.Period)
Has the cache file expired?
If the file doesn't exist always return true, otherwise check the mtime against the given time.
# Arguments
- `q` a QueryCache struct
- `expires` a DateTime to check against the current time.
- `ttl` a time period to compare the current time to the mtime of the cache + ttl
# Examples
expired(query, Dates.Day(3)) # returns a bool of whether the cache is more than 3 days old
expired(query, Dates.Minute(30)) # returns a bool of whether the cache is more than 30 minutes old
expired(query, Dates.DateTime(2021, 1, 1, 1, 2, 3)) # returns a bool compared to the given time
"""
expired(q::QueryCache, expires::DateTime) = expires <= now() || stat(q.cachepath).device == 0
expired(q::QueryCache, ttl::Period) = expired(q, unix2datetime(mtime(q.cachepath)) + ttl)
"""
df_cached(q::QueryCache, ttl_e::Union{Dates.Period, Dates.DateTime}; noisy::Bool=false)
# Arguments
- `q` a QueryCache
- `ttl_e` is either a DataTime or Period specifying how long the cache should be live.
If the cached version of the DataFrame is still live, return it from disk.
If it has expired, call the Query's sql_function with the sql, write the DataFrame to disk
in the specified formats and return the DataFrame.
The noisy flag indicates whether to print to stderr where the data is coming from.
# Examples
Always retreive the SQL from the server
df = df_cached(query, now())
Get the cached version, if it exists, or is less than 7 days old
Print "From Server" or "From Cache" on stderr, depending where it came from, with the filename / sql snippet
df = df_cached(query, Dates.Day(7), noisy=true)
"""
function df_cached(q::QueryCache, ttl_e; noisy=false)
if expired(q, ttl_e)
if noisy
println(stderr, "($(Threads.threadid())) From Server - ", q.sql[1:(length(q.sql) < 40 ? end : 40)])
end
df = q.select(q.sql)
df_write(q.cachepath, df, subformat=q.subformat, dictencode=q.dictencode)
return df
else
if noisy
println(stderr, "($(Threads.threadid())) From Cache - ", splitpath(q.cachepath)[end])
end
df_read(q.cachepath)
end
end
"""
select_fn(connection, args...; kw...)
Return a function which will `execute` the Query's sql on the supplied connection
# Arguments
- `connection` the appropriate Connection data structure from some other module
- `args` splatted arguments to use in DBInterface.connect
- `kw` splatted kwarguments to use in DBInterface.connect
# Examples
sql_fn = select_fn(MySQL.Connection, SERVER, USER, PASSWORD)
"""
select_fn(connection, args...; kw...) = sql->DBInterface.execute(DBInterface.connect(connection, args...; kw...), sql) |> DataFrame
"""
fetch_and_combine(queries; ttl:Union{Dates.Period, Dates.DateTime}, noisy::Bool)
Given an iterable collection of queries, fetch them and combine them into a single DataFrame using as many threads as available.
# Arguments
- `queries` iterable collection of QueryCache
- `ttl` Time To Live, a Period or DateTime (default 7 days)
- `noisy` if so, report on stderr where the data is coming from (default false)
# Example
If we have a long_view that times out on a single connection then split it into 3 and re-combine them.
This is my actual use case for this Module. I'm querying from MySQL on AWS and only get 300 seconds.
If the network is busy, my queries risk being terminated, so I break them into chunks.
df = fetch_and_combine([
QueryCache("SELECT long_view WHERE created BETWEEN '2019-01-01' AND '2019-12-13'", sql_fn, ".", :arrow),
QueryCache("SELECT long_view WHERE created BETWEEN '2020-01-01' AND '2020-12-13'", sql_fn, ".", :arrow),
QueryCache("SELECT long_view WHERE created BETWEEN '2021-01-01' AND '2021-12-13'", sql_fn, ".", :arrow),
])
"""
function fetch_and_combine(queries; ttl=Day(7), noisy=false)
dfs = Vector{DataFrame}(undef, length(queries))
Threads.@threads for i in 1:length(queries)
dfs[i] = df_cached(queries[i], ttl, noisy=noisy)
end
reduce((adf, df)->append!(adf, df), dfs[2:end], init=dfs[1])
end
#fetch_and_combine(queries; ttl=Day(7), noisy=false) = reduce((adf, query)->append!(adf, df_cached(query, ttl, noisy=noisy)), queries, init=DataFrame())
"""
Dfetch_and_combine(queries; ttl:Union{Dates.Period, Dates.DateTime}, noisy::Bool)
The same as [fetch\\_and\\_combine][@ref] but use a different process for each Query, spawning at :any.
"""
Dfetch_and_combine(queries; ttl=Day(7), noisy=false) = reduce((adf, future)->append!(adf, fetch(future)), [@spawnat :any df_cached(query, ttl, noisy=noisy) for query in queries], init=DataFrame())
###
end
| SQLDataFrameTools | https://github.com/lawless-m/SQLDataFrameTools.jl.git |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.